2
0
Эх сурвалжийг харах

Migration of crypto modules to Crypto namespace.

woollybah 6 жил өмнө
parent
commit
9d53971193
100 өөрчлөгдсөн 22763 нэмэгдсэн , 0 устгасан
  1. 6 0
      .gitignore
  2. 38 0
      crc32.mod/common.bmx
  3. 109 0
      crc32.mod/crc32.bmx
  4. 44 0
      crc32.mod/glue.c
  5. 121 0
      crypto.mod/common.bmx
  6. 1475 0
      crypto.mod/crypto.bmx
  7. 8 0
      crypto.mod/doc/tcryptohash_keygen.bmx
  8. 140 0
      crypto.mod/doc/tcryptokeyexchange.bmx
  9. 177 0
      crypto.mod/doc/tcryptokeyexchange_1.bmx
  10. 197 0
      crypto.mod/doc/tcryptokeyexchange_2.bmx
  11. 37 0
      crypto.mod/doc/tcryptopasswordhash.bmx
  12. 12 0
      crypto.mod/doc/tcryptorandom_fillbuffer.bmx
  13. 8 0
      crypto.mod/doc/tcryptorandom_random.bmx
  14. 11 0
      crypto.mod/doc/tcryptorandom_ratchet.bmx
  15. 11 0
      crypto.mod/doc/tcryptorandom_reseed.bmx
  16. 8 0
      crypto.mod/doc/tcryptorandom_uniform.bmx
  17. 28 0
      crypto.mod/doc/tcryptosign.bmx
  18. 49 0
      crypto.mod/doc/tcryptosign_1.bmx
  19. 10 0
      crypto.mod/doc/tcryptosignkeypair.bmx
  20. 294 0
      crypto.mod/glue.c
  21. 34 0
      digest.mod/common.bmx
  22. 178 0
      digest.mod/digest.bmx
  23. 35 0
      digest.mod/glue.c
  24. 24 0
      digest.mod/source.bmx
  25. 121 0
      digest.mod/tests/test.bmx
  26. 34 0
      libhydrogen.mod/libhydrogen.bmx
  27. 95 0
      libhydrogen.mod/libhydrogen/.clang-format
  28. 32 0
      libhydrogen.mod/libhydrogen/.gitignore
  29. 22 0
      libhydrogen.mod/libhydrogen/.travis.yml
  30. 18 0
      libhydrogen.mod/libhydrogen/LICENSE
  31. 61 0
      libhydrogen.mod/libhydrogen/Makefile
  32. 51 0
      libhydrogen.mod/libhydrogen/Makefile.arduino
  33. 29 0
      libhydrogen.mod/libhydrogen/README.md
  34. 18 0
      libhydrogen.mod/libhydrogen/hydrogen.c
  35. 317 0
      libhydrogen.mod/libhydrogen/hydrogen.h
  36. 322 0
      libhydrogen.mod/libhydrogen/impl/common.h
  37. 224 0
      libhydrogen.mod/libhydrogen/impl/core.h
  38. 25 0
      libhydrogen.mod/libhydrogen/impl/gimli-core.h
  39. 39 0
      libhydrogen.mod/libhydrogen/impl/gimli-core/portable.h
  40. 97 0
      libhydrogen.mod/libhydrogen/impl/gimli-core/sse2.h
  41. 138 0
      libhydrogen.mod/libhydrogen/impl/hash.h
  42. 83 0
      libhydrogen.mod/libhydrogen/impl/hydrogen_p.h
  43. 20 0
      libhydrogen.mod/libhydrogen/impl/kdf.h
  44. 441 0
      libhydrogen.mod/libhydrogen/impl/kx.h
  45. 281 0
      libhydrogen.mod/libhydrogen/impl/pwhash.h
  46. 436 0
      libhydrogen.mod/libhydrogen/impl/random.h
  47. 236 0
      libhydrogen.mod/libhydrogen/impl/secretbox.h
  48. 207 0
      libhydrogen.mod/libhydrogen/impl/sign.h
  49. 383 0
      libhydrogen.mod/libhydrogen/impl/x25519.h
  50. 10 0
      libhydrogen.mod/libhydrogen/library.properties
  51. BIN
      libhydrogen.mod/libhydrogen/logo.png
  52. 439 0
      libhydrogen.mod/libhydrogen/tests/tests.c
  53. 19 0
      libhydrogen.mod/source.bmx
  54. 14 0
      libtomcrypt.mod/libtomcrypt.bmx
  55. 29 0
      libtomcrypt.mod/libtomcrypt/LICENSE
  56. 638 0
      libtomcrypt.mod/libtomcrypt/src/hashes/blake2b.c
  57. 613 0
      libtomcrypt.mod/libtomcrypt/src/hashes/blake2s.c
  58. 306 0
      libtomcrypt.mod/libtomcrypt/src/hashes/chc/chc.c
  59. 53 0
      libtomcrypt.mod/libtomcrypt/src/hashes/helper/hash_file.c
  60. 74 0
      libtomcrypt.mod/libtomcrypt/src/hashes/helper/hash_filehandle.c
  61. 69 0
      libtomcrypt.mod/libtomcrypt/src/hashes/helper/hash_memory.c
  62. 88 0
      libtomcrypt.mod/libtomcrypt/src/hashes/helper/hash_memory_multi.c
  63. 250 0
      libtomcrypt.mod/libtomcrypt/src/hashes/md2.c
  64. 306 0
      libtomcrypt.mod/libtomcrypt/src/hashes/md4.c
  65. 366 0
      libtomcrypt.mod/libtomcrypt/src/hashes/md5.c
  66. 406 0
      libtomcrypt.mod/libtomcrypt/src/hashes/rmd128.c
  67. 465 0
      libtomcrypt.mod/libtomcrypt/src/hashes/rmd160.c
  68. 430 0
      libtomcrypt.mod/libtomcrypt/src/hashes/rmd256.c
  69. 495 0
      libtomcrypt.mod/libtomcrypt/src/hashes/rmd320.c
  70. 286 0
      libtomcrypt.mod/libtomcrypt/src/hashes/sha1.c
  71. 129 0
      libtomcrypt.mod/libtomcrypt/src/hashes/sha2/sha224.c
  72. 334 0
      libtomcrypt.mod/libtomcrypt/src/hashes/sha2/sha256.c
  73. 134 0
      libtomcrypt.mod/libtomcrypt/src/hashes/sha2/sha384.c
  74. 313 0
      libtomcrypt.mod/libtomcrypt/src/hashes/sha2/sha512.c
  75. 130 0
      libtomcrypt.mod/libtomcrypt/src/hashes/sha2/sha512_224.c
  76. 130 0
      libtomcrypt.mod/libtomcrypt/src/hashes/sha2/sha512_256.c
  77. 388 0
      libtomcrypt.mod/libtomcrypt/src/hashes/sha3.c
  78. 729 0
      libtomcrypt.mod/libtomcrypt/src/hashes/sha3_test.c
  79. 812 0
      libtomcrypt.mod/libtomcrypt/src/hashes/tiger.c
  80. 306 0
      libtomcrypt.mod/libtomcrypt/src/hashes/whirl/whirl.c
  81. 596 0
      libtomcrypt.mod/libtomcrypt/src/hashes/whirl/whirltab.c
  82. 105 0
      libtomcrypt.mod/libtomcrypt/src/headers/tomcrypt.h
  83. 48 0
      libtomcrypt.mod/libtomcrypt/src/headers/tomcrypt_argchk.h
  84. 303 0
      libtomcrypt.mod/libtomcrypt/src/headers/tomcrypt_cfg.h
  85. 1151 0
      libtomcrypt.mod/libtomcrypt/src/headers/tomcrypt_cipher.h
  86. 715 0
      libtomcrypt.mod/libtomcrypt/src/headers/tomcrypt_custom.h
  87. 512 0
      libtomcrypt.mod/libtomcrypt/src/headers/tomcrypt_hash.h
  88. 564 0
      libtomcrypt.mod/libtomcrypt/src/headers/tomcrypt_mac.h
  89. 439 0
      libtomcrypt.mod/libtomcrypt/src/headers/tomcrypt_macros.h
  90. 529 0
      libtomcrypt.mod/libtomcrypt/src/headers/tomcrypt_math.h
  91. 178 0
      libtomcrypt.mod/libtomcrypt/src/headers/tomcrypt_misc.h
  92. 797 0
      libtomcrypt.mod/libtomcrypt/src/headers/tomcrypt_pk.h
  93. 109 0
      libtomcrypt.mod/libtomcrypt/src/headers/tomcrypt_pkcs.h
  94. 440 0
      libtomcrypt.mod/libtomcrypt/src/headers/tomcrypt_private.h
  95. 233 0
      libtomcrypt.mod/libtomcrypt/src/headers/tomcrypt_prng.h
  96. 133 0
      libtomcrypt.mod/libtomcrypt/src/misc/adler32.c
  97. 75 0
      libtomcrypt.mod/libtomcrypt/src/misc/base16/base16_decode.c
  98. 74 0
      libtomcrypt.mod/libtomcrypt/src/misc/base16/base16_encode.c
  99. 121 0
      libtomcrypt.mod/libtomcrypt/src/misc/base32/base32_decode.c
  100. 96 0
      libtomcrypt.mod/libtomcrypt/src/misc/base32/base32_encode.c

+ 6 - 0
.gitignore

@@ -0,0 +1,6 @@
+.bmx
+*.bak
+*.a
+*.i
+*.i2
+*.exe

+ 38 - 0
crc32.mod/common.bmx

@@ -0,0 +1,38 @@
+'
+'  Copyright (C) 2019 Bruce A Henderson
+'
+'  This software is provided 'as-is', without any express or implied
+'  warranty.  In no event will the authors be held liable for any damages
+'  arising from the use of this software.
+'
+'  Permission is granted to anyone to use this software for any purpose,
+'  including commercial applications, and to alter it and redistribute it
+'  freely, subject to the following restrictions:
+'
+'  1. The origin of this software must not be misrepresented; you must not
+'     claim that you wrote the original software. If you use this software
+'     in a product, an acknowledgment in the product documentation would be
+'     appreciated but is not required.
+'  2. Altered source versions must be plainly marked as such, and must not be
+'     misrepresented as being the original software.
+'  3. This notice may not be removed or altered from any source distribution.
+'
+SuperStrict
+
+Import Crypto.Digest
+
+
+Import "../libtomcrypt.mod/libtomcrypt/src/headers/*.h"
+Import "../libtomcrypt.mod/libtomcrypt/src/misc/crc32.c"
+
+Import "glue.c"
+
+
+Extern
+
+	Function bmx_digest_crc32_init:Byte Ptr()
+	Function bmx_digest_crc32_update(handle:Byte Ptr, buf:Byte Ptr, length:Int)
+	Function bmx_digest_crc32_finish(handle:Byte Ptr, out:Byte Ptr, size:Int)
+	Function bmx_digest_crc32_finish_int(handle:Byte Ptr, out:Int Var)
+
+End Extern

+ 109 - 0
crc32.mod/crc32.bmx

@@ -0,0 +1,109 @@
+'
+'  Copyright (C) 2019 Bruce A Henderson
+'
+'  This software is provided 'as-is', without any express or implied
+'  warranty.  In no event will the authors be held liable for any damages
+'  arising from the use of this software.
+'
+'  Permission is granted to anyone to use this software for any purpose,
+'  including commercial applications, and to alter it and redistribute it
+'  freely, subject to the following restrictions:
+'
+'  1. The origin of this software must not be misrepresented; you must not
+'     claim that you wrote the original software. If you use this software
+'     in a product, an acknowledgment in the product documentation would be
+'     appreciated but is not required.
+'  2. Altered source versions must be plainly marked as such, and must not be
+'     misrepresented as being the original software.
+'  3. This notice may not be removed or altered from any source distribution.
+'
+SuperStrict
+
+Rem
+bbdoc: CRC32 Redundency check
+End Rem
+Module Crypto.CRC32
+
+ModuleInfo "CC_OPTS: -DLTC_NO_TEST -DLTC_NO_FILE"
+
+Import "common.bmx"
+
+New TCRC32Register
+
+Rem
+bbdoc: A CRC32 function.
+End Rem
+Type TCRC32 Extends TMessageDigest
+
+	Method New()
+		digestPtr = bmx_digest_crc32_init()
+	End Method
+
+	Method OutBytes:Int()
+		Return 4
+	End Method
+	
+	Rem
+	bbdoc: Updates the calculation with @dataLen bytes of data.
+	End Rem
+	Method Update:Int(data:Byte Ptr, dataLen:Int)
+		bmx_digest_crc32_update(digestPtr, data, dataLen)
+	End Method
+
+	Rem
+	bbdoc: Calculates the CRC for the given #String, setting the value in @result.
+	End Rem
+	Method Digest(txt:String, result:Int Var)
+		Local buf:Byte Ptr = txt.ToUTF8String()
+		Update(buf, Int(strlen_(buf)))
+		MemFree(buf)
+		Finish(result)
+	End Method
+
+	Rem
+	bbdoc: Calculates the CRC for the given #TStream, setting the value in @result.
+	End Rem
+	Method Digest(stream:TStream, result:Int Var)
+		Local buf:Byte[8192]
+		
+		Local bytesRead:Long
+		Repeat
+			bytesRead = stream.Read(buf, buf.length)
+			If bytesRead Then
+				Update(buf, Int(bytesRead))
+			End If
+		Until bytesRead <= 0
+
+		If Not bytesRead Then
+			Finish(result)
+		End If
+	End Method
+
+	Rem
+	bbdoc: Finishes calculation and produces the result, filling @result with the calculated bytes.
+	about: The state is reset, ready to create a new calculation.
+	End Rem
+	Method Finish:Int(result:Byte[])
+		Assert result.length >= 4, "Byte array must be at least 4 bytes."
+		bmx_digest_crc32_finish(digestPtr, result, 4)
+	End Method
+	
+	Rem
+	bbdoc: Finishes calculation and produces the result, setting @result with the result.
+	about: The state is reset, ready to create a new calculation.
+	End Rem
+	Method Finish:Int(result:Int Var)
+		bmx_digest_crc32_finish_int(digestPtr, result)
+	End Method
+
+End Type
+
+Type TCRC32Register Extends TDigestRegister
+
+	Method GetDigest:TMessageDigest( name:String ) Override
+		If name.ToUpper() = "CRC32" Then
+			Return New TCRC32
+		End If
+	End Method
+
+End Type

+ 44 - 0
crc32.mod/glue.c

@@ -0,0 +1,44 @@
+/*
+  Copyright (C) 2019 Bruce A Henderson
+
+  This software is provided 'as-is', without any express or implied
+  warranty.  In no event will the authors be held liable for any damages
+  arising from the use of this software.
+
+  Permission is granted to anyone to use this software for any purpose,
+  including commercial applications, and to alter it and redistribute it
+  freely, subject to the following restrictions:
+
+  1. The origin of this software must not be misrepresented; you must not
+     claim that you wrote the original software. If you use this software
+     in a product, an acknowledgment in the product documentation would be
+     appreciated but is not required.
+  2. Altered source versions must be plainly marked as such, and must not be
+     misrepresented as being the original software.
+  3. This notice may not be removed or altered from any source distribution.
+*/
+#include "tomcrypt.h"
+#include "brl.mod/blitz.mod/blitz.h"
+
+crc32_state * bmx_digest_crc32_init() {
+	crc32_state * state = malloc(sizeof(crc32_state));
+	crc32_init(state);
+	return state;
+}
+
+void bmx_digest_crc32_update(crc32_state * state, char * buf, int length) {
+	crc32_update(state, buf, length);
+}
+
+void bmx_digest_crc32_finish(crc32_state * state, void * out, int size) {
+	crc32_finish(state, out, size);
+	crc32_init(state);
+}
+
+void bmx_digest_crc32_finish_int(crc32_state * state, int * out) {
+	int res = 0;
+	crc32_finish(state, &res, 4);
+	crc32_init(state);
+	res = ((res << 8) & 0xff00ff00 ) | ((res >> 8) & 0xff00ff ); 
+	*out = (res << 16) | (res >> 16) & 0xFFFF;
+}

+ 121 - 0
crypto.mod/common.bmx

@@ -0,0 +1,121 @@
+'
+' Copyright (c) 2019 Bruce A Henderson
+'
+' Permission to use, copy, modify, and/or distribute this software for any
+' purpose with or without fee is hereby granted, provided that the above
+' copyright notice and this permission notice appear in all copies.
+'
+' THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES
+' WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF
+' MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR
+' ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES
+' WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN
+' ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF
+' OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE.
+'
+SuperStrict
+
+Import Crypto.LibHydrogen
+Import brl.base64
+
+?win32
+Import "-ladvapi32"
+?
+
+Import "../libhydrogen.mod/libhydrogen/*.h"
+Import "glue.c"
+
+Extern
+
+	Function hydro_init:Int()
+	
+	Function hydro_random_u32:UInt()
+	Function hydro_random_uniform:UInt(upperBound:UInt)
+	Function hydro_random_buf(buf:Byte Ptr, outLen:Size_T)
+	Function hydro_random_ratchet()
+	Function hydro_random_reseed()
+
+	Function bmx_hydro_hash_keygen(key:Byte Ptr)
+	Function bmx_hydro_hash_hash:Int(out:Byte Ptr, outLen:Size_T, in:Byte Ptr, inLen:Size_T, context:String, key:Byte Ptr)
+	Function bmx_hydro_hash_init:Byte Ptr(context:String, key:Byte Ptr)
+	Function bmx_hydro_hash_state_free(handle:Byte Ptr)
+	Function bmx_hydro_hash_update:Int(handle:Byte Ptr, in:Byte Ptr, inLen:Size_T)
+	Function bmx_hydro_hash_final:Int(handle:Byte Ptr, out:Byte Ptr, outLen:Size_T)
+	
+	Function bmx_hydro_secretbox_keygen(key:Byte Ptr)
+	Function bmx_hydro_secretbox_encrypt:Int(c:Byte Ptr, m:Byte Ptr, mLen:Size_T, msgId:ULong, context:String, key:Byte Ptr)
+	Function bmx_hydro_secretbox_decrypt:Int(m:Byte Ptr, c:Byte Ptr, cLen:Size_T, msgId:ULong, context:String, key:Byte Ptr)
+	Function bmx_hydro_secretbox_probe_create(probe:Byte Ptr, c:Byte Ptr, cLen:Size_T, context:String, key:Byte Ptr)
+	Function bmx_hydro_secretbox_probe_verify:Int(probe:Byte Ptr, c:Byte Ptr, cLen:Size_T, context:String, key:Byte Ptr)
+
+	Function bmx_hydro_pwhash_keygen(key:Byte Ptr)
+	Function bmx_hydro_pwhash_create:Int(stored:Byte Ptr, password:String, masterKey:Byte Ptr, opsLimit:ULong, memLimit:Size_T, threads:Int)
+	Function bmx_hydro_pwhash_verify:Int(stored:Byte Ptr, password:String, masterKey:Byte Ptr, opsLimitMax:ULong, memLimitMax:Size_T, threadsMax:Int)
+	Function bmx_hydro_pwhash_derive_static_key:Int(staticKey:Byte Ptr, staticKeyLen:Size_T, stored:Byte Ptr, password:String, context:String, masterKey:Byte Ptr, opsLimit:ULong, memLimit:Size_T, threads:Int)
+	Function bmx_hydro_pwhash_reencrypt:Int(stored:Byte Ptr, masterKey:Byte Ptr, newMasterKey:Byte Ptr)
+	Function bmx_hydro_pwhash_upgrade:Int(stored:Byte Ptr, masterKey:Byte Ptr, opsLimit:ULong, memLimit:Size_T, threads:Int)
+	Function bmx_hydro_pwhash_deterministic:Int(h:Byte Ptr, hLen:Size_T, password:String, context:String, masterKey:Byte Ptr, opsLimit:ULong, memLimit:Size_T, threads:Int)
+
+	Function bmx_hydro_sign_keygen(secretKey:Byte Ptr, publicKey:Byte Ptr)
+	Function bmx_hydro_sign_create:Int(csig:Byte Ptr, m:Byte Ptr, mLen:Size_T, context:String, sk:Byte Ptr)
+	Function bmx_hydro_sign_verify:Int(csig:Byte Ptr, m:Byte Ptr, mLen:Size_T, context:String, pk:Byte Ptr)
+	Function bmx_hydro_sign_init:Byte Ptr(context:String)
+	Function bmx_hydro_sign_state_free(state:Byte Ptr)
+	Function bmx_hydro_sign_update:Int(state:Byte Ptr, m:Byte Ptr, mLen:Size_T)
+	Function bmx_hydro_sign_final_create:Int(state:Byte Ptr, csig:Byte Ptr, sk:Byte Ptr)
+	Function bmx_hydro_sign_final_verify:Int(state:Byte Ptr, csig:Byte Ptr, pk:Byte Ptr)
+
+	Function bmx_hydro_kx_keygen(secretKey:Byte Ptr, publicKey:Byte Ptr)
+	Function bmx_hydro_kx_n_1:Int(rx:Byte Ptr, tx:Byte Ptr, packet1:Byte Ptr, preSharedKey:Byte Ptr, publicKey:Byte Ptr)
+	Function bmx_hydro_kx_n_2:Int(rx:Byte Ptr, tx:Byte Ptr, packet1:Byte Ptr, preSharedKey:Byte Ptr, secretKey:Byte Ptr, publicKey:Byte Ptr)
+
+	Function bmx_hydro_kx_state_new:Byte Ptr()
+	Function bmx_hydro_kx_state_free(state:Byte Ptr)
+
+	Function bmx_hydro_kx_kk_1:Int(state:Byte Ptr, packet1:Byte Ptr, peerPublicKey:Byte Ptr, secretKey:Byte Ptr, publicKey:Byte Ptr)
+	Function bmx_hydro_kx_kk_2:Int(rx:Byte Ptr, tx:Byte Ptr, packet2:Byte Ptr, packet1:Byte Ptr, peerPublicKey:Byte Ptr, secretKey:Byte Ptr, publicKey:Byte Ptr)
+	Function bmx_hydro_kx_kk_3:Int(state:Byte Ptr, rx:Byte Ptr, tx:Byte Ptr, packet2:Byte Ptr, secretKey:Byte Ptr, publicKey:Byte Ptr)
+
+	Function bmx_hydro_kx_xx_1:Int(state:Byte Ptr, packet1:Byte Ptr, preSharedKey:Byte Ptr)
+	Function bmx_hydro_kx_xx_2:Int(state:Byte Ptr, packet2:Byte Ptr, packet1:Byte Ptr, preSharedKey:Byte Ptr, secretKey:Byte Ptr, publicKey:Byte Ptr)
+	Function bmx_hydro_kx_xx_3:Int(state:Byte Ptr, rx:Byte Ptr, tx:Byte Ptr, packet3:Byte Ptr, peerPublicKey:Byte Ptr, packet2:Byte Ptr, preSharedKey:Byte Ptr, secretKey:Byte Ptr, publicKey:Byte Ptr)
+	Function bmx_hydro_kx_xx_4:Int(state:Byte Ptr, rx:Byte Ptr, tx:Byte Ptr, peerPublicKey:Byte Ptr, packet3:Byte Ptr, preSharedKey:Byte Ptr)
+
+End Extern
+
+
+Const CRYPTO_HASH_BYTES:Int = 32
+Const CRYPTO_HASH_BYTES_MAX:Int = 65535
+Const CRYPTO_HASH_BYTES_MIN:Int = 16
+Const CRYPTO_HASH_CONTEXTBYTES:Int = 8
+Const CRYPTO_HASH_KEYBYTES:Int = 32
+
+Const CRYPTO_SECRETBOX_CONTEXTBYTES:Int = 8
+Const CRYPTO_SECRETBOX_HEADERBYTES:Int = 20 + 16
+Const CRYPTO_SECRETBOX_KEYBYTES:Int = 32
+Const CRYPTO_SECRETBOX_PROBEBYTES:Int = 16
+
+Const CRYPTO_PWHASH_CONTEXTBYTES:Int = 8
+Const CRYPTO_PWHASH_MASTERKEYBYTES:Int = 32
+Const CRYPTO_PWHASH_STOREDBYTES:Int = 128
+
+Const CRYPTO_SIGN_BYTES:Int = 64
+Const CRYPTO_SIGN_CONTEXTBYTES:Int = 8
+Const CRYPTO_SIGN_PUBLICKEYBYTES:Int = 32
+Const CRYPTO_SIGN_SECRETKEYBYTES:Int = 64
+Const CRYPTO_SIGN_SEEDBYTES:Int = 32
+
+Const CRYPTO_KX_SESSIONKEYBYTES:Int = 32
+Const CRYPTO_KX_PUBLICKEYBYTES:Int = 32
+Const CRYPTO_KX_SECRETKEYBYTES:Int = 32
+Const CRYPTO_KX_PSKBYTES:Int = 32
+Const CRYPTO_KX_SEEDBYTES:Int = 32
+
+Const CRYPTO_KX_N_PACKET1BYTES:Int = 32
+
+Const CRYPTO_KX_KK_PACKET1BYTES:Int = 32
+Const CRYPTO_KX_KK_PACKET2BYTES:Int = 32
+
+Const CRYPTO_KX_XX_PACKET1BYTES:Int = 32
+Const CRYPTO_KX_XX_PACKET2BYTES:Int = 80
+Const CRYPTO_KX_XX_PACKET3BYTES:Int = 48

+ 1475 - 0
crypto.mod/crypto.bmx

@@ -0,0 +1,1475 @@
+'
+' Copyright (c) 2019 Bruce A Henderson
+'
+' Permission to use, copy, modify, and/or distribute this software for any
+' purpose with or without fee is hereby granted, provided that the above
+' copyright notice and this permission notice appear in all copies.
+'
+' THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES
+' WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF
+' MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR
+' ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES
+' WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN
+' ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF
+' OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE.
+'
+SuperStrict
+
+Rem
+bbdoc: Cryptographic Utils
+End Rem
+Module Crypto.Crypto
+
+ModuleInfo "Version: 1.00"
+ModuleInfo "Author: Bruce A Henderson."
+ModuleInfo "License: ISC"
+
+ModuleInfo "History: 1.00"
+ModuleInfo "History: Initial Release."
+
+Import "common.bmx"
+
+
+hydro_init()
+
+Rem
+bbdoc: Generate unpredictable data, suitable for creating secret keys.
+about:
+> If this is used in an application inside a VM, and the VM is snapshotted and restored, then the above functions will produce the same output.
+End Rem
+Type TCryptoRandom
+
+	Rem
+	bbdoc: Returns an unpredictable value between 0 and $ffffffff (inclusive).
+	End Rem
+	Function Random:UInt()
+		Return hydro_random_u32()
+	End Function
+	
+	Rem
+	bbdoc: Returns an unpredictable value between 0 and @upperBound (excluded).
+	about: Unlike `Random() Mod upperBound`, it does its best to guarantee a uniform distribution of the possible
+	output values even when @upperBound is not a power of 2.
+	End Rem
+	Function Uniform:UInt(upperBound:UInt)
+		Return hydro_random_uniform(upperBound)
+	End Function
+	
+	Rem
+	bbdoc: Fills @size bytes starting at @buf with an unpredictable sequence of bytes, derived from a secret seed.
+	End Rem
+	Function FillBuffer(buf:Byte Ptr, size:Size_T)
+		hydro_random_buf(buf, size)
+	End Function
+
+	Rem
+	bbdoc: Fills an array of bytes with an unpredictable sequence of bytes, derived from a secret seed.
+	End Rem
+	Function FillBuffer(buf:Byte[])
+		hydro_random_buf(buf, Size_T(buf.length))
+	End Function
+	
+	Rem
+	bbdoc: Fills a key with an unpredictable sequence of @bytes in length, derived from a secret seed.
+	End Rem
+	Function FillKey(key:TCryptoKey Var, bytes:Size_T = 32)
+		If key = Null Then
+			key = New TCryptoKey
+		End If
+		
+		If Not key.key Or key.key.length <> bytes Then
+			key.key = New Byte[bytes]
+		End If
+		
+		FillBuffer(key.key)
+	End Function
+	
+	Rem
+	bbdoc: Erases part of the state and replaces the secret key, making it impossible to recover the previous states in case the current one ever gets exposed due to a vulnerability.
+	End Rem
+	Function Ratchet()
+		hydro_random_ratchet()
+	End Function
+	
+	Rem
+	bbdoc: Reseeds the random number generator.
+	about: Must be called after a `fork()` call.
+	End Rem
+	Function Reseed()
+		hydro_random_reseed()
+	End Function
+
+End Type
+
+Rem
+bbdoc: A base for key implementations.
+End Rem
+Type TCryptoKey
+
+	Field key:Byte[]
+
+	Rem
+	bbdoc: Returns a String representation of the key.
+	End Rem
+	Method ToString:String()
+		Return TBase64.Encode(key)
+	End Method
+	
+	Rem
+	bbdoc: Retrieves a key from its String representation.
+	End Rem
+	Function FromString:TCryptoKey(k:String)
+		Local key:TCryptoKey = New TCryptoKey
+		key.key = TBase64.Decode(k)
+		Return key
+	End Function
+	
+End Type
+
+Rem
+bbdoc: A secret key suitable for use with the #TCryptoHash functions.
+End Rem
+Type TCryptoHashKey Extends TCryptoKey
+
+	Method New()
+		key = New Byte[CRYPTO_HASH_KEYBYTES]
+	End Method
+	
+	Rem
+	bbdoc: Retrieves a key from its String representation.
+	End Rem
+	Function FromString:TCryptoHashKey(key:String)
+		Local hashKey:TCryptoHashKey = New TCryptoHashKey
+		hashKey.key = TBase64.Decode(key)
+
+		If hashKey.key.length <> CRYPTO_HASH_KEYBYTES Then
+			Throw "Unexpected key size of " + hashKey.key.length + " bytes. Expected " + CRYPTO_HASH_KEYBYTES + " bytes"
+		End If
+
+		Return hashKey
+	End Function
+	
+End Type
+
+Rem
+bbdoc: Transforms an arbitrary-long input into a fixed length fingerprint
+about: This API requires a context.
+Similar to a type, a context is a 8 characters string describing what the function is going to be used for.
+
+Its purpose is to mitigate accidental bugs by separating domains. The same function used with the same key but
+in two distinct contexts is likely to generate two different outputs.
+
+Therefore, a key designed to encrypt data used in a specific context will not be able to decrypt data if
+accidentally used in another context.
+
+Contexts don't have to be secret and can have a low entropy. Examples of contexts include `UserName`, `__auth__`, `pictures` and `userdata`.
+
+If more convenient, it is also fine to use a single global context for a whole application. This will still prevent
+the same key from being mistakenly used by another application.
+End Rem
+Type TCryptoHash
+
+	Field statePtr:Byte Ptr
+	
+	Rem
+	bbdoc: Creates a secret key suitable for use with the #TCryptoHash functions.
+	End Rem
+	Function KeyGen:TCryptoHashKey()
+		Local key:TCryptoHashKey = New TCryptoHashKey
+		bmx_hydro_hash_keygen(key.key)
+		Return key
+	End Function
+
+	Rem
+	bbdoc: Puts a fingerprint of the message @in whose length is @inLen bytes into @out.
+	about: The output size can be chosen by the application.
+	The minimum recommended output size is #CRYPTO_HASH_BYTES. This size makes it practically impossible for
+	two messages to produce the same fingerprint.
+
+	But for specific use cases, the size can be any value between #CRYPTO_HASH_BYTES_MIN (included) and #CRYPTO_HASH_BYTES_MAX (included).
+
+	@key can be NULL. In this case, a message will always have the same fingerprint, similar to the MD5 or SHA-1 functions for which
+	#Hash() is a faster and more secure alternative.
+
+	But a key can also be specified. A message will always have the same fingerprint for a given key, but different keys used
+	to hash the same message are very likely to produce distinct fingerprints.
+
+	In particular, the key can be used to make sure that different applications generate different fingerprints even if they process the same data.
+
+	The key size is #CRYPTO_HASH_KEYBYTES bytes.
+	End Rem
+	Function Hash:Int(out:Byte Ptr, outLen:Size_T, in:Byte Ptr, inLen:Size_T, context:String, key:TCryptoHashKey)
+		If key Then
+			Return bmx_hydro_hash_hash(out, outLen, in, inLen, context, key.key)
+		Else
+			Return bmx_hydro_hash_hash(out, outLen, in, inLen, context, Null)
+		End If
+	End Function
+
+	Rem
+	Rem
+	bbdoc: Puts a fingerprint of the message @in into @out.
+	about: The output size can be chosen by the application.
+	The minimum recommended output size is #CRYPTO_HASH_BYTES. This size makes it practically impossible for
+	two messages to produce the same fingerprint.
+
+	But for specific use cases, the size can be any value between #CRYPTO_HASH_BYTES_MIN (included) and #CRYPTO_HASH_BYTES_MAX (included).
+
+	@key can be NULL. In this case, a message will always have the same fingerprint, similar to the MD5 or SHA-1 functions for which
+	#Hash() is a faster and more secure alternative.
+
+	But a key can also be specified. A message will always have the same fingerprint for a given key, but different keys used
+	to hash the same message are very likely to produce distinct fingerprints.
+
+	In particular, the key can be used to make sure that different applications generate different fingerprints even if they process the same data.
+
+	The key size is #CRYPTO_HASH_KEYBYTES bytes.
+	End Rem
+	Function Hash:Int(out:Byte[], in:Byte[], context:String, key:TCryptoHashKey)
+		If key Then
+			Return bmx_hydro_hash_hash(out, Size_T(out.length), in, Size_T(in.length), context, key.key)
+		Else
+			Return bmx_hydro_hash_hash(out, Size_T(out.length), in, Size_T(in.length), context, Null)
+		End If
+	End Function
+	
+	Rem
+	bbdoc: Initializes a state state with a key @key (that can be NULL), in order to eventually produce output.
+	End Rem
+	Method Create:TCryptoHash(context:String, key:TCryptoHashKey)
+		If key Then
+			statePtr = bmx_hydro_hash_init(context, key.key)
+		Else
+			statePtr = bmx_hydro_hash_init(context, Null)
+		End If
+		Return Self
+	End Method
+	
+	Rem
+	bbdoc: Sequentially processes a chunk @in of @inLen bytes in length.
+	End Rem
+	Method Update:Int(in:Byte Ptr, inLen:Size_T)
+		Return bmx_hydro_hash_update(statePtr, in, inLen)
+	End Method
+
+	Rem
+	bbdoc: Sequentially processes a chunk @in.
+	End Rem
+	Method Update:Int(in:Byte[])
+		Return bmx_hydro_hash_update(statePtr, in, Size_T(in.length))
+	End Method
+	
+	Rem
+	bbdoc: Completes the operation and puts the final fingerprint into @out as @outlen bytes.
+	End Rem
+	Method Finish(out:Byte Ptr, outLen:Size_T)
+		bmx_hydro_hash_final(statePtr, out, outLen)
+	End Method
+
+	Rem
+	bbdoc: Completes the operation and puts the final fingerprint into @out.
+	End Rem
+	Method Finish(out:Byte[])
+		bmx_hydro_hash_final(statePtr, out, Size_T(out.length))
+	End Method
+	
+	Method Free()
+		If statePtr Then
+			bmx_hydro_hash_state_free(statePtr)
+			statePtr = Null
+		End If
+	End Method
+	
+	Method Delete()
+		Free()
+	End Method
+
+End Type
+
+Rem
+bbdoc: A secret key suitable for use with #TCryptoSecretBox.
+End Rem
+Type TCryptoSecretBoxKey Extends TCryptoKey
+
+	Method New()
+		key = New Byte[CRYPTO_SECRETBOX_KEYBYTES]
+	End Method
+
+	Rem
+	bbdoc: Retrieves a key from its String representation.
+	End Rem
+	Function FromString:TCryptoSecretBoxKey(key:String)
+		Local sbKey:TCryptoSecretBoxKey = New TCryptoSecretBoxKey
+		sbKey.key = TBase64.Decode(key)
+
+		If sbKey.key.length <> CRYPTO_SECRETBOX_KEYBYTES Then
+			Throw "Unexpected key size of " + sbKey.key.length + " bytes. Expected " + CRYPTO_SECRETBOX_KEYBYTES + " bytes"
+		End If
+
+		Return sbKey
+	End Function
+	
+End Type
+
+Rem
+bbdoc: Encrypts a message with a secret key to keep it confidential.
+about: Computes a nonce and an authentication tag. This tag is used to make sure that the message hasn't been tampered with before decrypting it.
+
+A single key is used both to encrypt/sign and verify/decrypt messages. For this reason, it is critical to keep the key confidential.
+End Rem
+Type TCryptoSecretBox
+
+	Rem
+	bbdoc: Generates a secret key suitable for use with #TCryptoSecretBox.
+	End Rem
+	Function KeyGen:TCryptoSecretBoxKey()
+		Local key:TCryptoSecretBoxKey = New TCryptoSecretBoxKey
+		bmx_hydro_secretbox_keygen(key.key)
+		Return key
+	End Function
+	
+	Rem
+	bbdoc: Encrypts a message @m of length @mLen bytes using a @context, a secret @key and a message counter @msgId.
+	about: It puts the ciphertext whose length is #CRYPTO_SECRETBOX_HEADERBYTES + mlen into @c.
+
+	The header includes an automatically-generated 160-bit nonce as well as a 128-bit authentication tag.
+
+	A nonce doesn't have to be provided: it is automatically computed using the output of the PRNG and a keyed hash of the message
+	and its metadata. This prevents catastrophic failures even if the PRNG cannot be trusted.
+
+	@msgId is an optional message tag. For example, if 3 messages are sent to the same recipient using the same key, these messages
+	can sequentially use 0, 1 and 2 as identifiers.
+
+	If the recipient expects message 2, but receives a message with a different identifier, it will not decrypt it even if it was
+	encrypted with the correct key.
+
+	This can be used to discard duplicate or old messages.
+
+	A @msgId doesn't have to be secret and it doesn't have to be sequential either. Some applications might prefer a coarse timestamp instead.
+	Any value up to 2^64-1 is acceptable.
+
+	If this mechanism is not required by an application, using a constant @msgId such as 0 is also totally fine. Message identifiers are
+	optional and do not have to be unique.
+	End Rem
+	Function Encrypt:Int(c:Byte Ptr, cLen:Size_T, m:Byte Ptr, mLen:Size_T, msgId:ULong, context:String, key:TCryptoKey)
+		If cLen <> (mLen + CRYPTO_SECRETBOX_HEADERBYTES) Then
+			Throw "'c' must be " + mLen + " + " + CRYPTO_SECRETBOX_HEADERBYTES + " bytes"
+		End If
+		Return bmx_hydro_secretbox_encrypt(c, m, mLen, msgId, context, key.key)
+	End Function
+	
+	Rem
+	Rem
+	bbdoc: Encrypts a message @m using a @context, a secret @key and a message counter @msgId.
+	about: It puts the ciphertext whose length is @CRYPTO_SECRETBOX_HEADERBYTES + m.length into c.
+
+	The header includes an automatically-generated 160-bit nonce as well as a 128-bit authentication tag.
+
+	A nonce doesn't have to be provided: it is automatically computed using the output of the PRNG and a keyed hash of the message
+	and its metadata. This prevents catastrophic failures even if the PRNG cannot be trusted.
+
+	@msgId is an optional message tag. For example, if 3 messages are sent to the same recipient using the same key, these messages
+	can sequentially use 0, 1 and 2 as identifiers.
+
+	If the recipient expects message 2, but receives a message with a different identifier, it will not decrypt it even if it was
+	encrypted with the correct key.
+
+	This can be used to discard duplicate or old messages.
+
+	A @msgId doesn't have to be secret and it doesn't have to be sequential either. Some applications might prefer a coarse timestamp instead.
+	Any value up to 2^64-1 is acceptable.
+
+	If this mechanism is not required by an application, using a constant @msgId such as 0 is also totally fine. Message identifiers are
+	optional and do not have to be unique.
+	End Rem
+	Function Encrypt:Int(c:Byte[], m:Byte[], msgId:ULong, context:String, key:TCryptoKey)
+		If c.length <> m.length + CRYPTO_SECRETBOX_HEADERBYTES Then
+			Throw "'c' must be " + m.length + " + " + CRYPTO_SECRETBOX_HEADERBYTES + " bytes"
+		End If
+		Return bmx_hydro_secretbox_encrypt(c, m, Size_T(m.length), msgId, context, key.key)
+	End Function
+
+	Rem
+	bbdoc: Decrypts the ciphertext @c of length @cLen (which includes the @CRYPTO_SECRETBOX_HEADERBYTES bytes header) using the secret key @key, the @context and the message identifier @msgId.
+	about: If the authentication tag can be verified using these parameters, the function stores the decrypted message into @m.
+	The length of this decrypted message is cLen - CRYPTO_SECRETBOX_KEYBYTES. It then returns #True.
+
+	If the authentication tag doesn't appear to be valid for these parameters, the function returns #False.
+	End Rem
+	Function Decrypt:Int(m:Byte Ptr, mLen:Size_T, c:Byte Ptr, cLen:Size_T, msgId:ULong, context:String, key:TCryptoKey)
+		If mLen <> (cLen - CRYPTO_SECRETBOX_HEADERBYTES) Then
+			Throw "'m' must be " + cLen + " - " + CRYPTO_SECRETBOX_HEADERBYTES + " bytes"
+		End If
+		Return bmx_hydro_secretbox_decrypt(m, c, cLen, msgId, context, key.key)
+	End Function
+
+	Rem
+	bbdoc: Decrypts the ciphertext @c (which includes the #CRYPTO_SECRETBOX_HEADERBYTES bytes header) using the secret key @key, the @context and the message identifier @msgId.
+	about: If the authentication tag can be verified using these parameters, the function stores the decrypted message into @m.
+	The length of this decrypted message is c.length - CRYPTO_SECRETBOX_KEYBYTES. It then returns #True.
+
+	If the authentication tag doesn't appear to be valid for these parameters, the function returns #False.
+	End Rem
+	Function Decrypt:Int(m:Byte[], c:Byte[], msgId:ULong, context:String, key:TCryptoKey)
+		If m.length <> (c.length - CRYPTO_SECRETBOX_HEADERBYTES) Then
+			Throw "'m' must be " + c.length + " - " + CRYPTO_SECRETBOX_HEADERBYTES + " bytes"
+		End If
+		Return bmx_hydro_secretbox_decrypt(m, c, Size_T(c.length), msgId, context, key.key)
+	End Function
+
+	Rem
+	bbdoc: Computes a probe for the ciphertext @c whose length is @cLen, using the @context and a shared secret key @key.
+	about:  The probe is put into probe whose size is #CRYPTO_SECRETBOX_PROBEBYTES bytes.
+	End Rem
+	Function ProbeCreate(probe:Byte Ptr, probeLen:Size_T, c:Byte Ptr, cLen:Size_T, context:String, key:TCryptoKey)
+		If probeLen <> CRYPTO_SECRETBOX_PROBEBYTES Then
+			Throw "'probe' must be " + CRYPTO_SECRETBOX_PROBEBYTES + " bytes"
+		End If
+		bmx_hydro_secretbox_probe_create(probe, c, cLen, context, key.key)
+	End Function
+
+	Rem
+	bbdoc: Computes a probe for the ciphertext @c, using the @context and a shared secret key @key.
+	about:  The probe is put into @probe whose size is #CRYPTO_SECRETBOX_PROBEBYTES bytes.
+	End Rem
+	Function ProbeCreate(probe:Byte[], c:Byte[], context:String, key:TCryptoKey)
+		If probe.length <> CRYPTO_SECRETBOX_PROBEBYTES Then
+			Throw "'probe' must be " + CRYPTO_SECRETBOX_PROBEBYTES + " bytes"
+		End If
+		bmx_hydro_secretbox_probe_create(probe, c, Size_T(c.length), context, key.key)
+	End Function
+	
+	Rem
+	bbdoc: Verifies that a received probe @probe is valid for the ciphertext @c whose length is @cLen, using the @context and the shared secret key @key that was initially used to compute the probe.
+	about: It returns #True on success, and #False if the probe didn't pass verification.
+	End Rem
+	Function ProbeVerify:Int(probe:Byte Ptr, probeLen:Size_T, c:Byte Ptr, cLen:Size_T, context:String, key:TCryptoKey)
+		If probeLen <> CRYPTO_SECRETBOX_PROBEBYTES Then
+			Throw "'probe' must be " + CRYPTO_SECRETBOX_PROBEBYTES + " bytes"
+		End If
+		Return bmx_hydro_secretbox_probe_verify(probe, c, cLen, context, key.key)
+	End Function
+
+	Rem
+	bbdoc: Verifies that a received probe @probe is valid for the ciphertext @c, using the @context and the shared secret key @key that was initially used to compute the probe.
+	about: It returns #True on success, and #False if the probe didn't pass verification.
+	End Rem
+	Function ProbeVerify:Int(probe:Byte[], c:Byte[], context:String, key:TCryptoKey)
+		If probe.length <> CRYPTO_SECRETBOX_PROBEBYTES Then
+			Throw "'probe' must be " + CRYPTO_SECRETBOX_PROBEBYTES + " bytes"
+		End If
+		Return bmx_hydro_secretbox_probe_verify(probe, c, Size_T(c.length), context, key.key)
+	End Function
+	
+End Type
+
+Rem
+bbdoc: A secret key and a corresponding public key.
+End Rem
+Type TCryptoSignKeyPair
+
+	Rem
+	bbdoc: A secret key, that will be used to sign any number of messages
+	End Rem
+	Field secretKey:Byte[CRYPTO_SIGN_SECRETKEYBYTES]
+
+	Rem
+	bbdoc: A public key, that anybody can use to verify that the signature for a message was actually issued by the creator of the public key.
+	End Rem
+	Field publicKey:Byte[CRYPTO_SIGN_PUBLICKEYBYTES]
+	
+	Rem
+	bbdoc: Returns a String representation of the key pair.
+	End Rem
+	Method ToString:String()
+		Return PublicKeyToString() + "." + SecretKeyToString()
+	End Method
+	
+	Rem
+	bbdoc: Returns a String representation of the public key.
+	End Rem
+	Method PublicKeyToString:String()
+		Return TBase64.Encode(publicKey, 0, EBase64Options.DontBreakLines)
+	End Method
+	
+	Rem
+	bbdoc: Returns a String representation of the secret key.
+	End Rem
+	Method SecretKeyToString:String()
+		Return TBase64.Encode(secretKey, 0, EBase64Options.DontBreakLines)
+	End Method
+	
+	Rem
+	bbdoc: Retrieves the key pair from its String representation.
+	End Rem
+	Function FromString:TCryptoSignKeyPair(keys:String)
+		Local parts:String[] = keys.Split(".")
+		If parts.length <> 2 Then
+			Throw "Expected 2 key parts, but was " + parts.length
+		End If
+		
+		Local kp:TCryptoSignKeyPair = New TCryptoSignKeyPair
+		kp.publicKey = TBase64.Decode(parts[0])
+		kp.secretKey = TBase64.Decode(parts[1])
+		
+		If kp.publicKey.length <> CRYPTO_SIGN_PUBLICKEYBYTES Then
+			Throw "Unexpected public key size of " + kp.publicKey.length + " bytes. Expected " + CRYPTO_SIGN_PUBLICKEYBYTES + " bytes"
+		End If
+
+		If kp.secretKey.length <> CRYPTO_SIGN_SECRETKEYBYTES Then
+			Throw "Unexpected secret key size of " + kp.secretKey.length + " bytes. Expected " + CRYPTO_SIGN_SECRETKEYBYTES + " bytes"
+		End If
+		
+		Return kp
+	End Function
+	
+	Rem
+	bbdoc: Retrieves the secret key from its String representation.
+	End Rem
+	Function FromSecretKey:TCryptoSignKeyPair(sk:String)
+		Local kp:TCryptoSignKeyPair = New TCryptoSignKeyPair
+		kp.secretKey = TBase64.Decode(sk)
+
+		If kp.secretKey.length <> CRYPTO_SIGN_SECRETKEYBYTES Then
+			Throw "Unexpected secret key size of " + kp.secretKey.length + " bytes. Expected " + CRYPTO_SIGN_SECRETKEYBYTES + " bytes"
+		End If
+
+		Return kp
+	End Function
+	
+	Rem
+	bbdoc: Retrieves the public key from its String representation.
+	End Rem
+	Function FromPublicKey:TCryptoSignKeyPair(pk:String)
+		Local kp:TCryptoSignKeyPair = New TCryptoSignKeyPair
+		kp.publicKey = TBase64.Decode(pk)
+
+		If kp.publicKey.length <> CRYPTO_SIGN_PUBLICKEYBYTES Then
+			Throw "Unexpected public key size of " + kp.publicKey.length + " bytes. Expected " + CRYPTO_SIGN_PUBLICKEYBYTES + " bytes"
+		End If
+
+		Return kp
+	End Function
+End Type
+
+Rem
+bbdoc: The signature for a message signed by a #TCryptoSignKeyPair.secretKey.
+End Rem
+Type TCryptoSignature
+
+	Field signature:Byte[CRYPTO_SIGN_BYTES]
+	
+	Rem
+	bbdoc: Returns a String representation of the signature.
+	End Rem
+	Method ToString:String()
+		Return TBase64.Encode(signature, 0, EBase64Options.DontBreakLines)
+	End Method
+	
+	Rem
+	bbdoc: Retrieves the signature from its String representation.
+	End Rem
+	Function FromString:TCryptoSignature(signature:String)
+		Local sig:TCryptoSignature = New TCryptoSignature
+		sig.signature = TBase64.Decode(signature)
+
+		If sig.signature.length <> CRYPTO_SIGN_BYTES Then
+			Throw "Unexpected signature size of " + sig.signature.length + " bytes. Expected " + CRYPTO_SIGN_BYTES + " bytes"
+		End If
+
+		Return sig
+	End Function
+
+End Type
+
+Rem
+bbdoc: Message signing.
+about: The nonces are non-deterministic. They are computed using the output of the CSPRNG as well as a hash of the
+message to be signed. As a result, signing the same message multiple times can produce different, all valid signatures.
+However, only the owner of the secret key can compute a valid signature.
+End Rem
+Type TCryptoSign
+
+	Field statePtr:Byte Ptr
+
+	Rem
+	bbdoc: Generates a secret key and a corresponding public key.
+	End Rem
+	Function KeyGen:TCryptoSignKeyPair()
+		Local kp:TCryptoSignKeyPair = New TCryptoSignKeyPair
+		bmx_hydro_sign_keygen(kp.secretKey, kp.publicKey)
+		Return kp
+	End Function
+
+	Rem
+	bbdoc: Computes a signature for a message @m whose length is @mLen bytes, using the secret key from @kp and a @context.
+	End Rem
+	Function Sign:Int(csig:TCryptoSignature Var, m:Byte Ptr, mLen:Size_T, context:String, kp:TCryptoSignKeyPair)
+		If Not csig Then
+			csig = New TCryptoSignature
+		End If
+		Return bmx_hydro_sign_create(csig.signature, m, mLen, context, kp.secretKey)
+	End Function
+
+	Rem
+	bbdoc: Computes a signature for a message @m, using the secret key from @kp and a @context.
+	End Rem
+	Function Sign:Int(csig:TCryptoSignature Var, m:Byte[], context:String, kp:TCryptoSignKeyPair)
+		If Not csig Then
+			csig = New TCryptoSignature
+		End If
+		Return bmx_hydro_sign_create(csig.signature, m, Size_T(m.length), context, kp.secretKey)
+	End Function
+	
+	Rem
+	bbdoc: Checks that the signed message @m whose length is @mLen bytes has a valid signature for the public key @pk and the @context.
+	about: If the signature is doesn't appear to be valid, the function returns #False. On success, it returns #True.
+	End Rem
+	Function Verify:Int(csig:TCryptoSignature, m:Byte Ptr, mLen:Size_T, context:String, kp:TCryptoSignKeyPair)
+		Return bmx_hydro_sign_verify(csig.signature, m, mLen, context, kp.publicKey)
+	End Function
+
+	Rem
+	bbdoc: Checks that the signed message @m has a valid signature for the public key @pk and the @context.
+	about: If the signature is doesn't appear to be valid, the function returns #False. On success, it returns #True.
+	End Rem
+	Function Verify:Int(csig:TCryptoSignature, m:Byte[], context:String, kp:TCryptoSignKeyPair)
+		Return bmx_hydro_sign_verify(csig.signature, m, Size_T(m.length), context, kp.publicKey)
+	End Function
+
+	Rem
+	bbdoc: Initializes a state state using the @context.
+	End Rem
+	Method Create:TCryptoSign(context:String)
+		statePtr = bmx_hydro_sign_init(context)
+		Return Self
+	End Method
+	
+	Rem
+	bbdoc: Hashes chunk @m of @mLen bytes.
+	End Rem
+	Method Update:Int(m:Byte Ptr, mLen:Size_T)
+		Return bmx_hydro_sign_update(statePtr, m, mLen)
+	End Method
+
+	Rem
+	bbdoc: Hashes chunk @m.
+	End Rem
+	Method Update:Int(m:Byte[])
+		Return bmx_hydro_sign_update(statePtr, m, Size_T(m.length))
+	End Method
+	
+	Rem
+	bbdoc: Computes the signature into @csig using the secret key from @kp.
+	End Rem
+	Method FinishCreate:Int(csig:TCryptoSignature Var, kp:TCryptoSignKeyPair)
+		If Not csig Then
+			csig = New TCryptoSignature
+		End If
+		Return bmx_hydro_sign_final_create(statePtr, csig.signature, kp.secretKey)
+	End Method
+	
+	Rem
+	bbdoc: Verifies the signature into @csig using the public key from @kp.
+	about: Returns #False if the signature doesn't appear to be valid for the given message, context and public key, or #True if it could be successfully verified.
+	End Rem
+	Method FinishVerify:Int(csig:TCryptoSignature, kp:TCryptoSignKeyPair)
+		Return bmx_hydro_sign_final_verify(statePtr, csig.signature, kp.publicKey)
+	End Method
+
+	Method Free()
+		If statePtr Then
+			bmx_hydro_sign_state_free(statePtr)
+			statePtr = Null
+		End If
+	End Method
+	
+	Method Delete()
+		Free()
+	End Method
+
+End Type
+
+Rem
+bbdoc: A long-term key pair.
+about: These long-term keys can be reused indefinitely, even though rotating them from time to time is highly recommended in case
+the secret key ever gets leaked.
+End Rem
+Type TCryptoExchangeKeyPair
+
+	Field secretKey:Byte[CRYPTO_KX_SECRETKEYBYTES]
+	Field publicKey:Byte[CRYPTO_KX_PUBLICKEYBYTES]
+
+	Rem
+	bbdoc: Returns a String representation of the key pair.
+	End Rem
+	Method ToString:String()
+		Return PublicKeyToString() + "." + SecretKeyToString()
+	End Method
+	
+	Rem
+	bbdoc: Returns a String representation of the public key.
+	End Rem
+	Method PublicKeyToString:String()
+		Return TBase64.Encode(publicKey)
+	End Method
+	
+	Rem
+	bbdoc: Returns a String representation of the secret key.
+	End Rem
+	Method SecretKeyToString:String()
+		Return TBase64.Encode(secretKey, 0, EBase64Options.DontBreakLines)
+	End Method
+	
+	Rem
+	bbdoc: Retrieves the key pair from its String representation.
+	End Rem
+	Function FromString:TCryptoExchangeKeyPair(keys:String)
+		Local parts:String[] = keys.Split(".")
+		If parts.length <> 2 Then
+			Throw "Expected 2 key parts, but was " + parts.length
+		End If
+		
+		Local kp:TCryptoExchangeKeyPair = New TCryptoExchangeKeyPair
+		kp.publicKey = TBase64.Decode(parts[0])
+		kp.secretKey = TBase64.Decode(parts[1])
+		
+		If kp.publicKey.length <> CRYPTO_KX_PUBLICKEYBYTES Then
+			Throw "Unexpected public key size of " + kp.publicKey.length + " bytes. Expected " + CRYPTO_KX_PUBLICKEYBYTES + " bytes"
+		End If
+
+		If kp.secretKey.length <> CRYPTO_KX_SECRETKEYBYTES Then
+			Throw "Unexpected secret key size of " + kp.secretKey.length + " bytes. Expected " + CRYPTO_KX_SECRETKEYBYTES + " bytes"
+		End If
+		
+		Return kp
+	End Function
+	
+	Rem
+	bbdoc: Retrieves the public key from its String representation.
+	End Rem
+	Function PublicKeyFromString:TCryptoExchangeKeyPair(key:String)
+		Local kp:TCryptoExchangeKeyPair = New TCryptoExchangeKeyPair
+		kp.publicKey = TBase64.Decode(key)
+
+		If kp.publicKey.length <> CRYPTO_KX_PUBLICKEYBYTES Then
+			Throw "Unexpected public key size of " + kp.publicKey.length + " bytes. Expected " + CRYPTO_KX_PUBLICKEYBYTES + " bytes"
+		End If
+
+		Return kp
+	End Function
+	
+	Rem
+	bbdoc: Retrieves the secret key from its String representation.
+	End Rem
+	Function SecretKeyFromString:TCryptoExchangeKeyPair(key:String)
+		Local kp:TCryptoExchangeKeyPair = New TCryptoExchangeKeyPair
+		kp.secretKey = TBase64.Decode(key)
+
+		If kp.secretKey.length <> CRYPTO_KX_SECRETKEYBYTES Then
+			Throw "Unexpected secret key size of " + kp.secretKey.length + " bytes. Expected " + CRYPTO_KX_SECRETKEYBYTES + " bytes"
+		End If
+
+		Return kp
+	End Function
+
+End Type
+
+Rem
+bbdoc: A session key pair.
+about: The #tx key is used to encrypt outgoing messages.
+The #rx key is used to decrypt incoming messages.
+End Rem
+Type TCryptoSessionKeyPair
+
+	Field rx:TCryptoKey
+	Field tx:TCryptoKey
+	
+	Method New(initKeys:Int = True)
+		If initKeys Then
+			rx = New TCryptoKey
+			rx.key = New Byte[CRYPTO_KX_SESSIONKEYBYTES]
+			tx = New TCryptoKey
+			tx.key = New Byte[CRYPTO_KX_SESSIONKEYBYTES]
+		End If
+	End Method
+	
+	Rem
+	bbdoc: Returns a String representation of the key pair.
+	End Rem
+	Method ToString:String()
+		Return RxToString() + "." + TxToString()
+	End Method
+	
+	Rem
+	bbdoc: Returns a String representation of the #rx key.
+	End Rem
+	Method RxToString:String()
+		Return rx.ToString()
+	End Method
+	
+	Rem
+	bbdoc: Returns a String representation of the #tx key.
+	End Rem
+	Method TxToString:String()
+		Return tx.ToString()
+	End Method
+
+	Rem
+	bbdoc: Retrieves the key pair from its String representation.
+	End Rem
+	Function FromString:TCryptoSessionKeyPair(keys:String)
+		Local parts:String[] = keys.Split(".")
+		If parts.length <> 2 Then
+			Throw "Expected 2 key parts, but was " + parts.length
+		End If
+		
+		Local kp:TCryptoSessionKeyPair = New TCryptoSessionKeyPair(False)
+		kp.rx = TCryptoKey.FromString(parts[0])
+		kp.tx = TCryptoKey.FromString(parts[1])
+		
+		If kp.rx.key.length <> CRYPTO_KX_SESSIONKEYBYTES Then
+			Throw "Unexpected rx key size of " + kp.rx.key.length + " bytes. Expected " + CRYPTO_KX_SESSIONKEYBYTES + " bytes"
+		End If
+
+		If kp.tx.key.length <> CRYPTO_KX_SESSIONKEYBYTES Then
+			Throw "Unexpected tx key size of " + kp.tx.key.length + " bytes. Expected " + CRYPTO_KX_SESSIONKEYBYTES + " bytes"
+		End If
+		
+		Return kp
+	End Function
+	
+	Rem
+	bbdoc: Retrieves the #rx key from its String representation.
+	End Rem
+	Function RxFromString:TCryptoSessionKeyPair(key:String)
+		Local kp:TCryptoSessionKeyPair = New TCryptoSessionKeyPair(False)
+		kp.rx = TCryptoKey.FromString(key)
+
+		If kp.rx.key.length <> CRYPTO_KX_SESSIONKEYBYTES Then
+			Throw "Unexpected rx key size of " + kp.rx.key.length + " bytes. Expected " + CRYPTO_KX_SESSIONKEYBYTES + " bytes"
+		End If
+
+		Return kp
+	End Function
+
+	Rem
+	bbdoc: Retrieves the #tx key from its String representation.
+	End Rem
+	Function TxFromString:TCryptoSessionKeyPair(key:String)
+		Local kp:TCryptoSessionKeyPair = New TCryptoSessionKeyPair(False)
+		kp.tx = TCryptoKey.FromString(key)
+
+		If kp.tx.key.length <> CRYPTO_KX_SESSIONKEYBYTES Then
+			Throw "Unexpected tx key size of " + kp.tx.key.length + " bytes. Expected " + CRYPTO_KX_SESSIONKEYBYTES + " bytes"
+		End If
+
+		Return kp
+	End Function
+	
+End Type
+
+Rem
+bbdoc: Packet in N variant key exchange.
+End Rem
+Type TCryptoNPacket
+
+	Field packet:Byte[CRYPTO_KX_N_PACKET1BYTES]
+
+	Rem
+	bbdoc: Returns a string representation of the packet.
+	End Rem
+	Method ToString:String()
+		Return TBase64.Encode(packet)
+	End Method
+	
+	Rem
+	bbdoc: Retrieves the packet from its String representation.
+	End Rem
+	Function FromString:TCryptoNPacket(packet:String)
+		Local pack:TCryptoNPacket = New TCryptoNPacket
+		pack.packet = TBase64.Decode(packet)
+
+		If pack.packet.length <> CRYPTO_KX_N_PACKET1BYTES Then
+			Throw "Unexpected packet size of " + pack.packet.length + " bytes. Expected " + CRYPTO_KX_N_PACKET1BYTES + " bytes"
+		End If
+
+		Return pack
+	End Function
+	
+End Type
+
+Rem
+bbdoc: Packet 1 in KK variant key exchange.
+End Rem
+Type TCryptoKK1Packet
+
+	Field packet:Byte[CRYPTO_KX_KK_PACKET1BYTES]
+
+	Rem
+	bbdoc: Returns a string representation of the packet.
+	End Rem
+	Method ToString:String()
+		Return TBase64.Encode(packet)
+	End Method
+	
+	Rem
+	bbdoc: Retrieves the packet from its String representation.
+	End Rem
+	Function FromString:TCryptoKK1Packet(packet:String)
+		Local pack:TCryptoKK1Packet = New TCryptoKK1Packet
+		pack.packet = TBase64.Decode(packet)
+
+		If pack.packet.length <> CRYPTO_KX_KK_PACKET1BYTES Then
+			Throw "Unexpected packet size of " + pack.packet.length + " bytes. Expected " + CRYPTO_KX_KK_PACKET1BYTES + " bytes"
+		End If
+
+		Return pack
+	End Function
+	
+End Type
+
+Rem
+bbdoc: Packet 2 in KK variant key exchange.
+End Rem
+Type TCryptoKK2Packet
+
+	Field packet:Byte[CRYPTO_KX_KK_PACKET2BYTES]
+
+	Rem
+	bbdoc: Returns a string representation of the packet.
+	End Rem
+	Method ToString:String()
+		Return TBase64.Encode(packet)
+	End Method
+	
+	Rem
+	bbdoc: Retrieves the packet from its String representation.
+	End Rem
+	Function FromString:TCryptoKK2Packet(packet:String)
+		Local pack:TCryptoKK2Packet = New TCryptoKK2Packet
+		pack.packet = TBase64.Decode(packet)
+
+		If pack.packet.length <> CRYPTO_KX_KK_PACKET2BYTES Then
+			Throw "Unexpected packet size of " + pack.packet.length + " bytes. Expected " + CRYPTO_KX_KK_PACKET2BYTES + " bytes"
+		End If
+
+		Return pack
+	End Function
+	
+End Type
+
+Rem
+bbdoc: Packet 1 in XX variant key exchange.
+End Rem
+Type TCryptoXX1Packet
+
+	Field packet:Byte[CRYPTO_KX_XX_PACKET1BYTES]
+
+	Rem
+	bbdoc: Returns a string representation of the packet.
+	End Rem
+	Method ToString:String()
+		Return TBase64.Encode(packet)
+	End Method
+	
+	Rem
+	bbdoc: Retrieves the packet from its String representation.
+	End Rem
+	Function FromString:TCryptoXX1Packet(packet:String)
+		Local pack:TCryptoXX1Packet = New TCryptoXX1Packet
+		pack.packet = TBase64.Decode(packet)
+
+		If pack.packet.length <> CRYPTO_KX_XX_PACKET1BYTES Then
+			Throw "Unexpected packet size of " + pack.packet.length + " bytes. Expected " + CRYPTO_KX_XX_PACKET1BYTES + " bytes"
+		End If
+
+		Return pack
+	End Function
+	
+End Type
+
+Rem
+bbdoc: Packet 2 in XX variant key exchange.
+End Rem
+Type TCryptoXX2Packet
+
+	Field packet:Byte[CRYPTO_KX_XX_PACKET2BYTES]
+
+	Rem
+	bbdoc: Returns a string representation of the packet.
+	End Rem
+	Method ToString:String()
+		Return TBase64.Encode(packet)
+	End Method
+	
+	Rem
+	bbdoc: Retrieves the packet from its String representation.
+	End Rem
+	Function FromString:TCryptoXX2Packet(packet:String)
+		Local pack:TCryptoXX2Packet = New TCryptoXX2Packet
+		pack.packet = TBase64.Decode(packet)
+
+		If pack.packet.length <> CRYPTO_KX_XX_PACKET2BYTES Then
+			Throw "Unexpected packet size of " + pack.packet.length + " bytes. Expected " + CRYPTO_KX_XX_PACKET2BYTES + " bytes"
+		End If
+
+		Return pack
+	End Function
+	
+End Type
+
+Rem
+bbdoc: Packet 3 in XX variant key exchange.
+End Rem
+Type TCryptoXX3Packet
+
+	Field packet:Byte[CRYPTO_KX_XX_PACKET3BYTES]
+
+	Rem
+	bbdoc: Returns a string representation of the packet.
+	End Rem
+	Method ToString:String()
+		Return TBase64.Encode(packet)
+	End Method
+	
+	Rem
+	bbdoc: Retrieves the packet from its String representation.
+	End Rem
+	Function FromString:TCryptoXX3Packet(packet:String)
+		Local pack:TCryptoXX3Packet = New TCryptoXX3Packet
+		pack.packet = TBase64.Decode(packet)
+
+		If pack.packet.length <> CRYPTO_KX_XX_PACKET3BYTES Then
+			Throw "Unexpected packet size of " + pack.packet.length + " bytes. Expected " + CRYPTO_KX_XX_PACKET3BYTES + " bytes"
+		End If
+
+		Return pack
+	End Function
+	
+End Type
+
+Rem
+bbdoc: Key exchange state.
+End Rem
+Type TCryptoExchangeState
+
+	Field statePtr:Byte Ptr
+	
+	Method New()
+		statePtr = bmx_hydro_kx_state_new()
+	End Method
+	
+	Method Free()
+		If statePtr Then
+			bmx_hydro_kx_state_free(statePtr)
+			statePtr = Null
+		End If
+	End Method
+	
+	Method Delete()
+		Free()
+	End Method
+	
+End Type
+
+Rem
+bbdoc: Secure message exchange
+about: Using key exchange, two parties can securely compute a set of ephemeral, shared secret keys, that can be used to securely exchange messages.
+
+The general pattern two build a secure channel is:
+
+* Pick the variant that fits your application needs
+* Use the functions from that variant to build and parse packets to be exchanged between parties
+* Eventually, both parties will compute a shared secret, that can be used with #TCryptoSecretbox.
+End Rem
+Type TCryptoKeyExchange
+
+	Rem
+	bbdoc: Generates a long-term key pair.
+	about: These long-term keys can be reused indefinitely, even though rotating them from time to time is highly recommended
+	in case the secret key ever gets leaked.
+	End Rem
+	Function KeyGen:TCryptoExchangeKeyPair()
+		Local kp:TCryptoExchangeKeyPair = New TCryptoExchangeKeyPair
+		bmx_hydro_kx_keygen(kp.secretKey, kp.publicKey)
+		Return kp
+	End Function
+
+	Rem
+	bbdoc: Computes a session key pair @sessionKeyPair using the server's public key @publicKey, and builds a packet @packet1 that has to be sent to the server.
+	returns: #True on success, and #False on error.
+	about: This variant is designed to anonymously send messages to a recipient using its public key.
+	* What the client needs to know about the server: <b>the server's public key</b>
+	* What the server needs to know about the client: <b>nothing</b>
+	End Rem
+	Function N1:Int(sessionKeyPair:TCryptoSessionKeyPair Var, packet:TCryptoNPacket Var, preSharedKey:TCryptoKey, serverKeyPair:TCryptoExchangeKeyPair)
+		If Not sessionKeyPair Then
+			sessionKeyPair = New TCryptoSessionKeyPair
+		End If
+		If Not packet Then
+			packet = New TCryptoNPacket
+		End If
+		If preSharedKey Then
+			Return bmx_hydro_kx_n_1(sessionKeyPair.rx.key, sessionKeyPair.tx.key, packet.packet, preSharedKey.key, serverKeyPair.publicKey)
+		Else
+			Return bmx_hydro_kx_n_1(sessionKeyPair.rx.key, sessionKeyPair.tx.key, packet.packet, Null, serverKeyPair.publicKey)
+		End If
+	End Function
+
+	Rem
+	bbdoc: Computes a session key pair @sessionKeyPair using the packet @packet1 received from the client.
+	returns: #True on success, and #False on error.
+	End Rem
+	Function N2:Int(sessionKeyPair:TCryptoSessionKeyPair Var, packet:TCryptoNPacket, preSharedKey:TCryptoKey, keyPair:TCryptoExchangeKeyPair)
+		If Not sessionKeyPair Then
+			sessionKeyPair = New TCryptoSessionKeyPair
+		End If
+		If preSharedKey Then
+			Return bmx_hydro_kx_n_2(sessionKeyPair.rx.key, sessionKeyPair.tx.key, packet.packet, preSharedKey.key, keyPair.secretKey, keyPair.publicKey)
+		Else
+			Return bmx_hydro_kx_n_2(sessionKeyPair.rx.key, sessionKeyPair.tx.key, packet.packet, Null, keyPair.secretKey, keyPair.publicKey)
+		End If
+	End Function
+
+	Rem
+	bbdoc: Initializes the local state @state, computes an ephemeral key pair, and puts the first packet to send to the server into @packet1.
+	returns: #True on success, and #False on error.
+	End Rem
+	Function KK1:Int(state:TCryptoExchangeState Var, packet1:TCryptoKK1Packet Var, peerKeyPair:TCryptoExchangeKeyPair, keyPair:TCryptoExchangeKeyPair)
+		If Not state Then
+			state = New TCryptoExchangeState
+		End If
+		If Not packet1 Then
+			packet1 = New TCryptoKK1Packet
+		End If
+		Return bmx_hydro_kx_kk_1(state.statePtr, packet1.packet, peerKeyPair.publicKey, keyPair.secretKey, keyPair.publicKey)
+	End Function
+	
+	Rem
+	bbdoc: Validates the request, computes an ephemeral key pair, puts it into @sessionKeyPair, and stores the packet to send to the client into @packet2.
+	returns: #True on success, and #False on error.
+	End Rem
+	Function KK2:Int(sessionKeyPair:TCryptoSessionKeyPair Var, packet2:TCryptoKK2Packet Var, packet1:TCryptoKK1Packet, peerKeyPair:TCryptoExchangeKeyPair, keyPair:TCryptoExchangeKeyPair)
+		If Not sessionKeyPair Then
+			sessionKeyPair = New TCryptoSessionKeyPair
+		End If
+		If Not packet2 Then
+			packet2 = New TCryptoKK2Packet
+		End If
+		Return bmx_hydro_kx_kk_2(sessionKeyPair.rx.key, sessionKeyPair.tx.key, packet2.packet, packet1.packet, peerKeyPair.publicKey, keyPair.secretKey, keyPair.publicKey)
+	End Function
+	
+	Rem
+	bbdoc: Validates the packet, computes the shared session key and puts it into @sessionKeyPair.
+	returns: #True on success, and #False on error.
+	End Rem
+	Function KK3:Int(state:TCryptoExchangeState, sessionKeyPair:TCryptoSessionKeyPair Var, packet2:TCryptoKK2Packet, keyPair:TCryptoExchangeKeyPair)
+		If Not sessionKeyPair Then
+			sessionKeyPair = New TCryptoSessionKeyPair
+		End If
+		Return bmx_hydro_kx_kk_3(state.statePtr, sessionKeyPair.rx.key, sessionKeyPair.tx.key, packet2.packet, keyPair.secretKey, keyPair.publicKey)
+	End Function
+
+	Rem
+	bbdoc: Initializes the local state @state, computes an ephemeral key pair, and puts the first packet to send to the server into @packet1.
+	returns: #True on success, and #False on error.
+	about: Using this API, a client and a server can securely generate and exchange session keys.
+
+	This API is designed for online protocols, and requires two round trips:
+
+	* The initiator (client) sends a key exchange request.
+	* The listener (server) receives the request, validates it, and sends a packet to the client.
+	* The client validates the packet, compute the session keys, and sends a last packet to the server. The client learns the server public key as well, and can drop the connection if it doesn't match an expected public key.
+	* The server use this packet and previous data in order to compute the same session keys. The server learns the client public key as well.
+	
+	Two sessions keys are eventually computed. The former can be used to encrypt data sent from the client to the server, the later can be used
+	in the other direction.
+	
+	If the the pre-shared secret @preSharedKey is set, the server can detect a suspicious request after the first packet is received.
+	Without a pre-shared secret, an additional round trip is required.
+	End Rem
+	Function XX1:Int(state:TCryptoExchangeState Var, packet1:TCryptoXX1Packet Var, preSharedKey:TCryptoKey)
+		If Not state Then
+			state = New TCryptoExchangeState
+		End If
+		If Not packet1 Then
+			packet1 = New TCryptoXX1Packet
+		End If
+		If preSharedKey Then
+			Return bmx_hydro_kx_xx_1(state.statePtr, packet1.packet, preSharedKey.key)
+		Else
+			Return bmx_hydro_kx_xx_1(state.statePtr, packet1.packet, Null)
+		End If
+	End Function
+
+	Rem
+	bbdoc: Validates the request, computes an ephemeral key pair, and puts the packet to send to the client into @packet2.
+	returns: #True on success, and #False if the received packet doesn't appear to be valid.
+	End Rem
+	Function XX2:Int(state:TCryptoExchangeState Var, packet2:TCryptoXX2Packet Var, packet1:TCryptoXX1Packet, preSharedKey:TCryptoKey, keyPair:TCryptoExchangeKeyPair)
+		If Not state Then
+			state = New TCryptoExchangeState
+		End If
+		If Not packet2 Then
+			packet2 = New TCryptoXX2Packet
+		End If
+		If preSharedKey Then
+			Return bmx_hydro_kx_xx_2(state.statePtr, packet2.packet, packet1.packet, preSharedKey.key, keyPair.secretKey, keyPair.publicKey)
+		Else
+			Return bmx_hydro_kx_xx_2(state.statePtr, packet2.packet, packet1.packet, Null, keyPair.secretKey, keyPair.publicKey)
+		End If
+	End Function
+
+	Rem
+	bbdoc: Validates the packet, computes a session key and puts it into @sessionKeyPair.
+	returns: #True on success, and #False if the received packet doesn't appear to be valid.
+	about: @sessionKeyPair contains the final session key at this point.
+	A payload can already be sent by the client without waiting for the server to compute the session keys on its end.
+	End Rem
+	Function XX3:Int(state:TCryptoExchangeState, sessionKeyPair:TCryptoSessionKeyPair Var, packet3:TCryptoXX3Packet Var, peerKeyPair:TCryptoExchangeKeyPair Var, packet2:TCryptoXX2Packet, preSharedKey:TCryptoKey, keyPair:TCryptoExchangeKeyPair)
+		If Not sessionKeyPair Then
+			sessionKeyPair = New TCryptoSessionKeyPair
+		End If
+		If Not packet3 Then
+			packet3 = New TCryptoXX3Packet
+		End If
+		If Not peerKeyPair Then
+			peerKeyPair = New TCryptoExchangeKeyPair
+		End If
+		If preSharedKey Then
+			Return bmx_hydro_kx_xx_3(state.statePtr, sessionKeyPair.rx.key, sessionKeyPair.tx.key, packet3.packet, peerKeyPair.publicKey, packet2.packet, preSharedKey.key, keyPair.secretKey, keyPair.publicKey)
+		Else
+			Return bmx_hydro_kx_xx_3(state.statePtr, sessionKeyPair.rx.key, sessionKeyPair.tx.key, packet3.packet, peerKeyPair.publicKey, packet2.packet, Null, keyPair.secretKey, keyPair.publicKey)
+		End If
+	End Function
+
+	Rem
+	bbdoc: Validates the packet, computes the session key (identical to the one computed by the client) and puts it into @sessionKeyPair.
+	returns: #True on success, and #False if the received packet doesn't appear to be valid.
+	End Rem
+	Function XX4:Int(state:TCryptoExchangeState, sessionKeyPair:TCryptoSessionKeyPair Var, peerKeyPair:TCryptoExchangeKeyPair Var, packet3:TCryptoXX3Packet, preSharedKey:TCryptoKey)
+		If Not sessionKeyPair Then
+			sessionKeyPair = New TCryptoSessionKeyPair
+		End If
+		If Not peerKeyPair Then
+			peerKeyPair = New TCryptoExchangeKeyPair
+		End If
+		If preSharedKey Then
+			Return bmx_hydro_kx_xx_4(state.statePtr, sessionKeyPair.rx.key, sessionKeyPair.tx.key, peerKeyPair.publicKey, packet3.packet, preSharedKey.key)
+		Else
+			Return bmx_hydro_kx_xx_4(state.statePtr, sessionKeyPair.rx.key, sessionKeyPair.tx.key, peerKeyPair.publicKey, packet3.packet, Null)
+		End If
+	End Function
+
+End Type
+
+Rem
+bbdoc: A secret key suitable for use with the #TCryptoHash functions.
+End Rem
+Type TCryptoPWHashMasterKey
+
+	Field key:Byte[CRYPTO_PWHASH_MASTERKEYBYTES]
+
+	Rem
+	bbdoc: Returns a String representation of the key.
+	End Rem
+	Method ToString:String()
+		Return TBase64.Encode(key)
+	End Method
+	
+	Rem
+	bbdoc: Retrieves a key from its String representation.
+	End Rem
+	Function FromString:TCryptoPWHashMasterKey(key:String)
+		Local hashKey:TCryptoPWHashMasterKey = New TCryptoPWHashMasterKey
+		hashKey.key = TBase64.Decode(key)
+
+		If hashKey.key.length <> CRYPTO_PWHASH_MASTERKEYBYTES Then
+			Throw "Unexpected key size of " + hashKey.key.length + " bytes. Expected " + CRYPTO_PWHASH_MASTERKEYBYTES + " bytes"
+		End If
+
+		Return hashKey
+	End Function
+	
+End Type
+
+
+Rem
+bbdoc: A fixed-length, hashed, encrypted, authenticated representative of a password, that can be safely stored in a database.
+about: This representative can be used to later check if a user provided password is likely to be the original one, without ever
+storing the password in the database.
+End Rem
+Type TCryptoPWHashStoredKey
+
+	Field key:Byte[CRYPTO_PWHASH_STOREDBYTES]
+
+	Rem
+	bbdoc: Returns a String representation of the key.
+	End Rem
+	Method ToString:String()
+		Return TBase64.Encode(key, 0, EBase64Options.DontBreakLines)
+	End Method
+	
+	Rem
+	bbdoc: Retrieves a key from its String representation.
+	End Rem
+	Function FromString:TCryptoPWHashStoredKey(key:String)
+		Local storedKey:TCryptoPWHashStoredKey = New TCryptoPWHashStoredKey
+		storedKey.key = TBase64.Decode(key)
+
+		If storedKey.key.length <> CRYPTO_PWHASH_STOREDBYTES Then
+			Throw "Unexpected key size of " + storedKey.key.length + " bytes. Expected " + CRYPTO_PWHASH_STOREDBYTES + " bytes"
+		End If
+
+		Return storedKey
+	End Function
+
+End Type
+
+Rem
+bbdoc: Password Hashing
+about: Secret keys used to encrypt or sign confidential data have to be chosen from a very large keyspace.
+
+However, passwords are usually short, human-generated strings, making dictionary attacks practical.
+
+Password hashing functions derive a high-entropy secret key of any size from a password.
+
+The generated key will have the size defined by the application, no matter what the password length is.
+* The same password hashed with same parameters will always produce the same output.
+* The function deriving a key from a password is CPU intensive, to mitigate brute-force attacks by requiring a significant effort to verify each password.
+
+Common use cases:
+* Password storage, or rather: storing what it takes to verify a password without having to store the actual password.
+* Deriving a secret key from a password, for example for disk encryption
+End Rem
+Type TCryptoPasswordHash
+
+	Rem
+	bbdoc: Generates a key used to encrypt all hashed passwords, along with their parameters.
+	about: Hashed passwords and master keys should be stored in different places: hashed passwords are typically
+	stored in a database, whereas the master key can be statically loaded or hardcoded in the application.
+	
+	If the database ever gets breached, the list of hashed passwords will be completely useless without the master password.
+
+	The storage format supports reencryption and algorithm upgrades.
+	End Rem
+	Function KeyGen:TCryptoPWHashMasterKey()
+		Local key:TCryptoPWHashMasterKey = New TCryptoPWHashMasterKey
+		bmx_hydro_pwhash_keygen(key.key)
+		Return key
+	End Function
+
+	Rem
+	bbdoc: Derives a deterministic high-entropy key of any length (@hLen bytes) from a @password, a @context, a master key @masterKey and a set of parameters for the hash function.
+	about: The resulting key is put into @h.
+* @opslimit is the number of iterations. The higher the number, the slower the function will be, and the more secure the end result will be against brute-force attacks. This should be adjusted according to the hardware, and to application constraints.
+* @memlimit is the maximum amount of memory to use. The current function use a fixed amount of memory, and ignores this parameter. It can be unconditionally set to 0.
+* @threads is the number of threads. The current function ignores this parameter. It can be unconditionally set to 1.
+
+	This function can be used to derive a key from a password if no other information has been stored. For example, it can be used to
+	encrypt/decrypt a file using nothing but a password.
+	End Rem
+	Function Deterministic:Int(h:Byte Ptr, hLen:Size_T, password:String, context:String, masterKey:TCryptoPWHashMasterKey, opsLimit:ULong, memLimit:Size_T, threads:Int = 1)
+		Return bmx_hydro_pwhash_deterministic(h, hLen, password, context, masterKey.key, opsLimit, memLimit, threads)
+	End Function
+
+	Rem
+	bbdoc: Derives a deterministic high-entropy key of any length from a @password, a @context, a master key @masterKey and a set of parameters for the hash function.
+	about: The resulting key is put into @h.
+* @opslimit is the number of iterations. The higher the number, the slower the function will be, and the more secure the end result will be against brute-force attacks. This should be adjusted according to the hardware, and to application constraints.
+* @memlimit is the maximum amount of memory to use. The current function use a fixed amount of memory, and ignores this parameter. It can be unconditionally set to 0.
+* @threads is the number of threads. The current function ignores this parameter. It can be unconditionally set to 1.
+
+	This function can be used to derive a key from a password if no other information has been stored. For example, it can be used to
+	encrypt/decrypt a file using nothing but a password.
+	End Rem
+	Function Deterministic:Int(h:Byte[], password:String, context:String, masterKey:TCryptoPWHashMasterKey, opsLimit:ULong, memLimit:Size_T, threads:Int = 1)
+		Return bmx_hydro_pwhash_deterministic(h, Size_T(h.length), password, context, masterKey.key, opsLimit, memLimit, threads)
+	End Function
+
+	Rem
+	bbdoc: Computes a fixed-length (#CRYPTO_PWHASH_STOREDBYTES bytes), hashed, encrypted, authenticated representative of the @password, that can be safely stored in a database.
+	about: This representative can be used to later check if a user provided password is likely to be the original one,
+	without ever storing the password in the database.
+
+	The function encrypts and authenticates the representative and the parameters using the master key @masterKey. All passwords can safely
+	be encrypted using the same, long-term master key. Applications can also choose to derive @masterKey from a master-master key, and a
+	unique user identifier.
+
+	The representative includes @opsLimit, @memLimit and @threads: these do not have to be stored separately.
+
+	Note that the representative is not a string: this is binary data, that must be stored as a blob in a database, or encoded
+	as a string (for example as a hex value or using a safe base64 variant).
+	End Rem
+	Function Create:Int(stored:TCryptoPWHashStoredKey Var, password:String, masterKey:TCryptoPWHashMasterKey, opsLimit:ULong, memLimit:Size_T, threads:Int = 1)
+		If Not stored Then
+			stored = New TCryptoPWHashStoredKey
+		End If
+		Return bmx_hydro_pwhash_create(stored.key, password, masterKey.key, opsLimit, memLimit, threads)
+	End Function
+
+	Rem
+	bbdoc: Verifies that the @password is valid for the stored representative stored, decrypted using @masterKey.
+	about: @opslimitMax, @memlimitMax and @threadsMax are maximum values, designed to prevent DoS attacks against applications if the input
+	is untrusted. They should be set to the maximum values ever used in the #Create() function.
+
+	If the encoded parameters in the representative exceed these values, the function returns #False.
+
+	If the representative cannot be decrypted, the function returns #False without even trying to hash the password.
+
+	If the password doesn't appear to be valid for the stored representative, the function returns #False.
+	If the password passes all the checks, the function returns #True.
+	End Rem
+	Function Verify:Int(stored:TCryptoPWHashStoredKey, password:String, masterKey:TCryptoPWHashMasterKey, opsLimitMax:ULong, memLimitMax:Size_T, threadsMax:Int = 1)
+		Return bmx_hydro_pwhash_verify(stored.key, password, masterKey.key, opsLimitMax, memLimitMax, threadsMax)
+	End Function
+	
+	Rem
+	bbdoc: Fills @staticKey with @staticKeyLen bytes derived from the representative for @password.
+	about: Verifies that @password is valid for the representative. If this is the case, it fills @staticKey with @staticKeyLen bytes derived
+	from that representative, and returns #True.
+
+	If the password doesn't appear to be valid for what was stored, the function returns #False.
+
+	This function can be used to derive a deterministic, high-entropy key from a password and user-specific data stored in a database.
+	End Rem
+	Function DeriveStaticKey:Int(staticKey:Byte Ptr, staticKeyLen:Size_T, stored:TCryptoPWHashStoredKey, password:String, context:String, masterKey:TCryptoPWHashMasterKey, opsLimit:ULong, memLimit:Size_T, threads:Int = 1)
+		Return bmx_hydro_pwhash_derive_static_key(staticKey, staticKeyLen, stored.key, password, context, masterKey.key, opsLimit, memLimit, threads)
+	End Function
+
+	Rem
+	bbdoc: Fills @staticKey with bytes derived from the representative for @password.
+	about: Verifies that @password is valid for the representative. If this is the case, it fills @staticKey with bytes derived
+	from that representative, and returns #True.
+
+	If the password doesn't appear to be valid for what was stored, the function returns #False.
+
+	This function can be used to derive a deterministic, high-entropy key from a password and user-specific data stored in a database.
+	End Rem
+	Function DeriveStaticKey:Int(staticKey:Byte[], stored:TCryptoPWHashStoredKey, password:String, context:String, masterKey:TCryptoPWHashMasterKey, opsLimit:ULong, memLimit:Size_T, threads:Int = 1)
+		Return bmx_hydro_pwhash_derive_static_key(staticKey, Size_T(staticKey.length), stored.key, password, context, masterKey.key, opsLimit, memLimit, threads)
+	End Function
+	
+	Rem
+	bbdoc: Reencrypts a representative stored using the current master key @masterKey and a new master key @newMasterKey.
+	about: It updates stored in-place and returns #True on success. If the representative couldn't be decrypted using @masterKey, the function returns #False.
+	End Rem
+	Function Reencrypt:Int(stored:TCryptoPWHashStoredKey, masterKey:TCryptoPWHashMasterKey, newMasterKey:TCryptoPWHashMasterKey)
+		Return bmx_hydro_pwhash_reencrypt(stored.key, masterKey.key, newMasterKey.key)
+	End Function
+	
+	Rem
+	bbdoc: Upgrades in-place a previously computed representative stored encrypted using the master key @masterKey, to the new parameters @opslimit, @memlimit and @threads.
+	returns: #True on success, or #False if the data couldn't be decrypted using the provided master password.
+	about: If previously passwords become too fast to verify after a hardware upgrade, stored representatives can be upgraded with new
+	parameters without requiring the original passwords.
+	
+	Note that parameters can only be increased. Trying to reduce the value of an existing parameter will not change the original value.
+	End Rem
+	Function Upgrade:Int(stored:TCryptoPWHashStoredKey, masterKey:TCryptoPWHashMasterKey, opsLimit:ULong, memLimit:Size_T, threads:Int = 1)
+		Return bmx_hydro_pwhash_upgrade(stored.key, masterKey.key, opsLimit, memLimit, threads)
+	End Function
+	
+End Type
+

+ 8 - 0
crypto.mod/doc/tcryptohash_keygen.bmx

@@ -0,0 +1,8 @@
+SuperStrict
+
+Framework brl.standardio
+Import Crypto.Crypto
+
+Local key:TCryptoHashKey = TCryptoHash.KeyGen()
+
+Print key.ToString()

+ 140 - 0
crypto.mod/doc/tcryptokeyexchange.bmx

@@ -0,0 +1,140 @@
+'
+' Example of N variant key exchange
+'
+' What the client needs to know about the server: the server's public key
+' What the server needs to know about the client: nothing
+'
+SuperStrict
+
+Framework brl.standardio
+Import Crypto.Crypto
+
+Local server:TServer = New TServer
+Local client:TClient = New TClient
+
+Print "SHARE PUBLIC KEY"
+' Server: generate a long-term key pair
+Print "Server: Generate a long-term key pair~n"
+server.keyPair = TCryptoKeyExchange.KeyGen()
+
+' Server: send public key to client
+server.SendPublicKeyToClient(client)
+
+Print "KEY EXCHANGE"
+
+' Client: generate session keys and a packet with an ephemeral public key to send to the server
+client.BuildKeys()
+
+' Client: send packet to server
+client.SendPacketToServer(server)
+
+' Server: process the initial request from the client, and compute the session keys
+server.ComputeSessionKeys()
+
+Print "BEGIN MESSAGING"
+'
+' Client and Server can now securely send data to each other using their session keys
+'
+client.EncryptAndSendMessage(server, "Hello Server!")
+
+server.EncryptAndSendMessage(client, "Hello Client!")
+
+Type TBase
+
+	Field sessionKeyPair:TCryptoSessionKeyPair
+
+	Method Name:String() Abstract
+
+	Method EncryptAndSendMessage(base:TBase, message:String)
+		
+		Local msg:Byte Ptr = message.ToUTF8String()
+		
+		Print Name() + ": Message to send : " + message + "~n"
+		
+		Local c:Byte[message.length + CRYPTO_SECRETBOX_HEADERBYTES]
+		TCryptoSecretBox.Encrypt(c, Size_T(c.length), msg, Size_T(message.length), 0, "example", sessionKeyPair.tx)
+		
+		MemFree(msg)
+		
+		Local encoded:String = TBase64.Encode(c)
+
+		Print Name() + ": Sending encrypted message : " + encoded + "~n"
+		
+		base.ReceiveMessage(encoded)
+	End Method
+
+	Method ReceiveMessage(encoded:String)
+		Print Name() + ": Received encoded message~n"
+		Local m:Byte[] = TBase64.Decode(encoded)
+		
+		Local msg:Byte[m.length - CRYPTO_SECRETBOX_HEADERBYTES]
+		
+		If Not TCryptoSecretBox.Decrypt(msg, Size_T(msg.length), m, Size_T(m.length), 0, "example", sessionKeyPair.rx) Then
+			Throw Name() + ": Unable to decrypt message"
+		End If
+		
+		Local message:String = String.FromUTF8String(msg)
+		
+		Print Name() + ": Decrypted message : " + message + "~n"
+	End Method
+
+End Type
+
+Type TServer Extends TBase
+
+	Field keyPair:TCryptoExchangeKeyPair
+
+	Field clientPacket:TCryptoNPacket
+
+	Method Name:String()
+		Return "Server"
+	End Method
+	
+	Method SendPublicKeyToClient(client:TClient)
+		Print "Server: Sending public key to client~n"
+		client.ReceiveServerPublicKey(keyPair.PublicKeyToString())
+	End Method
+	
+	Method ReceivePacketFromClient(packet:String)
+		clientPacket = TCryptoNPacket.FromString(packet)
+		Print "Server: Received packet from client~n"
+	End Method
+	
+	Method ComputeSessionKeys()
+		Print "Server: Computing session keys~n"
+		If Not TCryptoKeyExchange.N2(sessionKeyPair, clientPacket, Null, keyPair) Then
+			Throw "Couldn't calculate server session keys~n"
+		End If
+	End Method
+	
+End Type
+
+
+Type TClient Extends TBase
+
+	Field serverPublicKey:TCryptoExchangeKeyPair
+
+	Field packet:TCryptoNPacket
+
+	Method Name:String()
+		Return "Client"
+	End Method
+
+	Method ReceiveServerPublicKey(key:String)
+		Print "Client: Received server public key~n"
+		serverPublicKey = TCryptoExchangeKeyPair.PublicKeyFromString(key)
+	End Method
+	
+	Method BuildKeys()
+		Print "Client: Creating packet~n"
+		If Not TCryptoKeyExchange.N1(sessionKeyPair, packet, Null, serverPublicKey) Then
+			Throw "Couldn't calculate client session keys~n"
+		End If
+	End Method
+	
+	Method SendPacketToServer(server:TServer)
+		Print "Client: Sending packet to server~n"
+		server.ReceivePacketFromClient(packet.ToString())
+	End Method
+	
+End Type

+ 177 - 0
crypto.mod/doc/tcryptokeyexchange_1.bmx

@@ -0,0 +1,177 @@
+'
+' Example of KK variant key exchange
+'
+' What the client needs to know about the server: the server's public key
+' What the server needs to know about the client: the client's public key
+'
+' This variant is designed to exchange messages between two parties that already know each other's public key.
+'
+SuperStrict
+
+Framework brl.standardio
+Import Crypto.Crypto
+
+Local server:TServer = New TServer
+Local client:TClient = New TClient
+
+Print "SHARE PUBLIC KEYS"
+
+' Client: generate a long-term key pair
+Print "Client: Generate a long-term key pair~n"
+client.keyPair = TCryptoKeyExchange.KeyGen()
+
+' Server: generate a long-term key pair
+Print "Server: Generate a long-term key pair~n"
+server.keyPair = TCryptoKeyExchange.KeyGen()
+
+' Client: send public key to server
+client.SendPublicKey(server)
+
+' Server: send public key to client
+server.SendPublicKey(client)
+
+' KEY EXCHANGE
+Print "KEY EXCHANGE"
+
+' Client: initiate a key exchange
+client.InitSession()
+
+' Client: send packet to server
+client.SendPacketToServer(server)
+
+' Server: process the initial request from the client, and compute the session keys
+server.ComputeSessionKeys()
+
+' Server: send packet to client
+server.SendPacketToClient(client)
+
+' Client: process the server packet and compute the session keys
+client.ComputeSessionKeys()
+
+Print "BEGIN MESSAGING"
+
+'
+' Client and Server can now securely send data to each other using their session keys
+'
+client.EncryptAndSendMessage(server, "Hello Server!")
+
+server.EncryptAndSendMessage(client, "Hello Client!")
+
+Type TBase
+
+	Field keyPair:TCryptoExchangeKeyPair
+	Field otherPublicKey:TCryptoExchangeKeyPair
+
+	Field sessionKeyPair:TCryptoSessionKeyPair
+
+	Method Name:String() Abstract
+
+	Method SendPublicKey(rec:TBase)
+		Print Name() + ": Sending my public key~n"
+		rec.ReceivePublicKey(keyPair.PublicKeyToString())
+	End Method
+	
+	Method ReceivePublicKey(key:String)
+		Print Name() + ": Received other public key~n"
+		otherPublicKey = TCryptoExchangeKeyPair.PublicKeyFromString(key)
+	End Method
+
+	Method EncryptAndSendMessage(base:TBase, message:String)
+		
+		Local msg:Byte Ptr = message.ToUTF8String()
+		
+		Print Name() + ": Message to send : " + message + "~n"
+		
+		Local c:Byte[message.length + CRYPTO_SECRETBOX_HEADERBYTES]
+		TCryptoSecretBox.Encrypt(c, Size_T(c.length), msg, Size_T(message.length), 0, "example", sessionKeyPair.tx)
+		
+		MemFree(msg)
+		
+		Local encoded:String = TBase64.Encode(c)
+
+		Print Name() + ": Sending encrypted message : " + encoded + "~n"
+		
+		base.ReceiveMessage(encoded)
+	End Method
+
+	Method ReceiveMessage(encoded:String)
+		Print Name() + ": Received encoded message~n"
+		Local m:Byte[] = TBase64.Decode(encoded)
+		
+		Local msg:Byte[m.length - CRYPTO_SECRETBOX_HEADERBYTES]
+		
+		If Not TCryptoSecretBox.Decrypt(msg, Size_T(msg.length), m, Size_T(m.length), 0, "example", sessionKeyPair.rx) Then
+			Throw Name() + ": Unable to decrypt message"
+		End If
+		
+		Local message:String = String.FromUTF8String(msg)
+		
+		Print Name() + ": Decrypted message : " + message + "~n"
+	End Method
+
+End Type
+
+Type TServer Extends TBase
+
+	Field clientPacket:TCryptoKK1Packet
+	Field packet2:TCryptoKK2Packet
+
+	Method Name:String()
+		Return "Server"
+	End Method
+	
+	Method ReceivePacketFromClient(packet:String)
+		clientPacket = TCryptoKK1Packet.FromString(packet)
+		Print "Server: Received packet1 from client~n"
+	End Method
+	
+	Method ComputeSessionKeys()
+		Print "Server: Computing session keys~n"
+		If Not TCryptoKeyExchange.KK2(sessionKeyPair, packet2, clientPacket, otherPublicKey, keyPair) Then
+			Throw "Couldn't calculate server session keys~n"
+		End If
+	End Method
+
+	Method SendPacketToClient(client:TClient)
+		Print "Server: Sending packet to client~n"
+		client.ReceivePacketFromServer(packet2.ToString())
+	End Method
+	
+End Type
+
+
+Type TClient Extends TBase
+
+	Field state:TCryptoExchangeState
+	Field packet1:TCryptoKK1Packet
+	Field serverPacket:TCryptoKK2Packet
+	
+	Method Name:String()
+		Return "Client"
+	End Method
+
+	Method InitSession()
+		Print "Client: Initial packet creation~n"
+		If Not TCryptoKeyExchange.KK1(state, packet1, otherPublicKey, keyPair ) Then
+			Throw "Couldn't create initial client packet/state~n"
+		End If
+	End Method
+	
+	Method SendPacketToServer(server:TServer)
+		Print "Client: Sending packet to server~n"
+		server.ReceivePacketFromClient(packet1.ToString())
+	End Method
+	
+	Method ReceivePacketFromServer(packet:String)
+		serverPacket = TCryptoKK2Packet.FromString(packet)
+		Print "Client: Received packet2 from server~n"
+	End Method
+
+	Method ComputeSessionKeys()
+		Print "Client: Computing session keys~n"
+		If Not TCryptoKeyExchange.KK3(state, sessionKeyPair, serverPacket, keyPair) Then
+			Throw "Couldn't calculate client session keys~n"
+		End If
+	End Method
+
+End Type

+ 197 - 0
crypto.mod/doc/tcryptokeyexchange_2.bmx

@@ -0,0 +1,197 @@
+'
+' Example of XX variant key exchange
+'
+' What the client needs to know about the server: nothing
+' What the server needs to know about the client: nothing
+'
+' This is the most versatile variant, but it requires two round trips.
+' In this variant, the client and the server don't need to share any prior data. However, the peers public keys will be exchanged. .
+'
+SuperStrict
+
+Framework brl.standardio
+Import Crypto.Crypto
+
+Local server:TServer = New TServer
+Local client:TClient = New TClient
+
+Print "GENERATE PUBLIC KEYS"
+
+' Client: generate a long-term key pair
+Print "Client: Generate a long-term key pair~n"
+client.keyPair = TCryptoKeyExchange.KeyGen()
+
+' Server: generate a long-term key pair
+Print "Server: Generate a long-term key pair~n"
+server.keyPair = TCryptoKeyExchange.KeyGen()
+
+' KEY EXCHANGE
+Print "KEY EXCHANGE"
+
+' Client: initiate a key exchange
+client.InitSession()
+
+' Client: send packet to server
+client.SendPacket1ToServer(server)
+
+' Server: process the initial request from the client
+server.ProcessInitialRequest()
+
+' Server: send packet to client
+server.SendPacketToClient(client)
+
+' Client: process the server packet and compute the session keys
+client.ComputeSessionKeys()
+
+' Client: send packet to server
+client.SendPacket3ToServer(server)
+
+' Server: process the client packet and compute the session keys
+server.ComputeSessionKeys()
+
+
+Print "BEGIN MESSAGING"
+
+'
+' Client and Server can now securely send data to each other using their session keys
+'
+client.EncryptAndSendMessage(server, "Hello Server!")
+
+server.EncryptAndSendMessage(client, "Hello Client!")
+
+Type TBase
+
+	Field state:TCryptoExchangeState
+	Field keyPair:TCryptoExchangeKeyPair
+	Field otherPublicKey:TCryptoExchangeKeyPair
+
+	Field sessionKeyPair:TCryptoSessionKeyPair
+
+	Method Name:String() Abstract
+
+	Method SendPublicKey(rec:TBase)
+		Print Name() + ": Sending my public key~n"
+		rec.ReceivePublicKey(keyPair.PublicKeyToString())
+	End Method
+	
+	Method ReceivePublicKey(key:String)
+		Print Name() + ": Received other public key~n"
+		otherPublicKey = TCryptoExchangeKeyPair.PublicKeyFromString(key)
+	End Method
+
+	Method EncryptAndSendMessage(base:TBase, message:String)
+		
+		Local msg:Byte Ptr = message.ToUTF8String()
+		
+		Print Name() + ": Message to send : " + message + "~n"
+		
+		Local c:Byte[message.length + CRYPTO_SECRETBOX_HEADERBYTES]
+		TCryptoSecretBox.Encrypt(c, Size_T(c.length), msg, Size_T(message.length), 0, "example", sessionKeyPair.tx)
+		
+		MemFree(msg)
+		
+		Local encoded:String = TBase64.Encode(c)
+
+		Print Name() + ": Sending encrypted message : " + encoded + "~n"
+		
+		base.ReceiveMessage(encoded)
+	End Method
+
+	Method ReceiveMessage(encoded:String)
+		Print Name() + ": Received encoded message~n"
+		Local m:Byte[] = TBase64.Decode(encoded)
+		
+		Local msg:Byte[m.length - CRYPTO_SECRETBOX_HEADERBYTES]
+		
+		If Not TCryptoSecretBox.Decrypt(msg, Size_T(msg.length), m, Size_T(m.length), 0, "example", sessionKeyPair.rx) Then
+			Throw Name() + ": Unable to decrypt message"
+		End If
+		
+		Local message:String = String.FromUTF8String(msg)
+		
+		Print Name() + ": Decrypted message : " + message + "~n"
+	End Method
+
+End Type
+
+Type TServer Extends TBase
+
+	Field clientPacket1:TCryptoXX1Packet
+	Field clientPacket3:TCryptoXX3Packet
+	Field packet2:TCryptoXX2Packet
+
+	Method Name:String()
+		Return "Server"
+	End Method
+	
+	Method ReceivePacket1FromClient(packet:String)
+		clientPacket1 = TCryptoXX1Packet.FromString(packet)
+		Print "Server: Received packet1 from client~n"
+	End Method
+	
+	Method ProcessInitialRequest()
+		Print "Server: Processing initial request~n"
+		If Not TCryptoKeyExchange.XX2(state, packet2, clientPacket1, Null, keyPair) Then
+			Throw "Couldn't initiate state~n"
+		End If
+	End Method
+
+	Method SendPacketToClient(client:TClient)
+		Print "Server: Sending packet to client~n"
+		client.ReceivePacketFromServer(packet2.ToString())
+	End Method
+
+	Method ReceivePacket3FromClient(packet:String)
+		clientPacket3 = TCryptoXX3Packet.FromString(packet)
+		Print "Server: Received packet3 from client~n"
+	End Method
+
+	Method ComputeSessionKeys()
+		Print "Server: Computing session keys~n"
+		If Not TCryptoKeyExchange.XX4(state, sessionKeyPair, otherPublicKey, clientPacket3, Null) Then
+			Throw "Couldn't calculate server session keys~n"
+		End If
+	End Method
+	
+End Type
+
+Type TClient Extends TBase
+	
+	Field packet1:TCryptoXX1Packet
+	Field packet3:TCryptoXX3Packet
+	Field serverPacket:TCryptoXX2Packet
+	
+	Method Name:String()
+		Return "Client"
+	End Method
+
+	Method InitSession()
+		Print "Client: Initial packet creation~n"
+		If Not TCryptoKeyExchange.XX1(state, packet1, Null ) Then
+			Throw "Couldn't create initial client packet/state~n"
+		End If
+	End Method
+	
+	Method SendPacket1ToServer(server:TServer)
+		Print "Client: Sending packet1 to server~n"
+		server.ReceivePacket1FromClient(packet1.ToString())
+	End Method
+	
+	Method ReceivePacketFromServer(packet:String)
+		serverPacket = TCryptoXX2Packet.FromString(packet)
+		Print "Client: Received packet2 from server~n"
+	End Method
+
+	Method ComputeSessionKeys()
+		Print "Client: Computing session keys~n"
+		If Not TCryptoKeyExchange.XX3(state, sessionKeyPair, packet3, otherPublicKey, serverPacket, Null, keyPair) Then
+			Throw "Couldn't calculate client session keys~n"
+		End If
+	End Method
+
+	Method SendPacket3ToServer(server:TServer)
+		Print "Client: Sending packet3 to server~n"
+		server.ReceivePacket3FromClient(packet3.ToString())
+	End Method
+
+End Type

+ 37 - 0
crypto.mod/doc/tcryptopasswordhash.bmx

@@ -0,0 +1,37 @@
+SuperStrict
+
+Framework brl.standardio
+Import Crypto.Crypto
+
+Const OPS_LIMIT:Int = 10000
+
+Local password:String = "Password123"
+
+' generate a master key
+Local masterKey:TCryptoPWHashMasterKey = TCryptoPasswordHash.KeyGen()
+
+Print "Master key : " + masterKey.ToString()
+
+Local storedKey:TCryptoPWHashStoredKey
+
+' calculate stored key based on password, master key and parameters
+TCryptoPasswordHash.Create(storedKey, password, masterKey, OPS_LIMIT, 0)
+
+Print "Password Hash : " + storedKey.ToString()
+
+' verify the password against the stored key
+Verify(storedKey, password, masterKey)
+
+Local wrongPass:String = "password123"
+
+' try to verify the wrong password against the stored key
+Verify(storedKey, wrongPass, masterKey)
+
+
+Function Verify(storedKey:TCryptoPWHashStoredKey, password:String, masterKey:TCryptoPWHashMasterKey)
+	If TCryptoPasswordHash.Verify(storedKey, password, masterKey, 50000, 0) Then
+		Print "Verified"
+	Else
+		Print "Invalid"
+	End If
+End Function

+ 12 - 0
crypto.mod/doc/tcryptorandom_fillbuffer.bmx

@@ -0,0 +1,12 @@
+SuperStrict
+
+Framework brl.standardio
+Import Crypto.Crypto
+
+Local buf:Byte[32]
+
+TCryptoRandom.FillBuffer(buf)
+
+For Local i:Int = 0 Until buf.length
+	Print buf[i]
+Next

+ 8 - 0
crypto.mod/doc/tcryptorandom_random.bmx

@@ -0,0 +1,8 @@
+SuperStrict
+
+Framework brl.standardio
+Import Crypto.Crypto
+
+For Local i:Int = 0 Until 10
+	Print TCryptoRandom.Random()
+Next

+ 11 - 0
crypto.mod/doc/tcryptorandom_ratchet.bmx

@@ -0,0 +1,11 @@
+SuperStrict
+
+Framework brl.standardio
+Import Crypto.Crypto
+
+For Local i:Int = 0 Until 10
+	Print TCryptoRandom.Random()
+Next
+
+TCryptoRandom.Ratchet()
+

+ 11 - 0
crypto.mod/doc/tcryptorandom_reseed.bmx

@@ -0,0 +1,11 @@
+SuperStrict
+
+Framework brl.standardio
+Import Crypto.Crypto
+
+For Local i:Int = 0 Until 10
+	Print TCryptoRandom.Random()
+Next
+
+TCryptoRandom.Reseed()
+

+ 8 - 0
crypto.mod/doc/tcryptorandom_uniform.bmx

@@ -0,0 +1,8 @@
+SuperStrict
+
+Framework brl.standardio
+Import Crypto.Crypto
+
+For Local i:Int = 0 Until 10
+	Print TCryptoRandom.Uniform(1000)
+Next

+ 28 - 0
crypto.mod/doc/tcryptosign.bmx

@@ -0,0 +1,28 @@
+SuperStrict
+
+Framework brl.standardio
+Import Crypto.Crypto
+
+' generate a key pair
+Local keyPair:TCryptoSignKeyPair = TCryptoSign.KeyGen()
+
+Print "keypair : " + keyPair.ToString()
+
+Local signature:TCryptoSignature
+
+Local message:String = "Just a castaway, an island lost at sea. Another lonely day with no one here but me. More loneliness than any man could bear. Rescue me before I fall into despair."
+Local mb:Byte Ptr = message.ToUTF8String()
+
+' sign the message with the secret key
+TCryptoSign.Sign(signature, mb, Size_T(message.length), "example", keyPair)
+
+Print "signature : " + signature.ToString()
+
+' verify the message with public key
+If TCryptoSign.Verify(signature, mb, Size_T(message.length), "example", keyPair) Then
+	Print "Verified !"
+Else
+	Print "Invalid"
+End If
+
+MemFree(mb)

+ 49 - 0
crypto.mod/doc/tcryptosign_1.bmx

@@ -0,0 +1,49 @@
+SuperStrict
+
+Framework brl.standardio
+Import Crypto.Crypto
+
+' generate a key pair
+Local keyPair:TCryptoSignKeyPair = TCryptoSign.KeyGen()
+
+Print "keypair : " + keyPair.ToString()
+
+Local signature:TCryptoSignature
+
+Local message:String[] = ["Just a castaway, an island lost at sea. " , ..
+	"Another lonely day with no one here but me. " , ..
+	"More loneliness than any man could bear. " , ..
+	"Rescue me before I fall into despair."]
+
+' create a signer with context
+Local signer:TCryptoSign = New TCryptoSign.Create("example")
+
+' update all the parts
+Update(signer, message)
+
+' create the signature
+signer.FinishCreate(signature, keyPair)
+
+Print "signature : " + signature.ToString()
+
+' create a verifier with context
+Local verifier:TCryptoSign = New TCryptoSign.Create("example")
+
+' update all the parts
+Update(verifier, message)
+
+' verify the public key against the signature
+If verifier.FinishVerify(signature, keyPair) Then
+	Print "Verified !"
+Else
+	Print "Invalid"
+End If
+
+
+Function Update(signer:TCryptoSign, message:String[])
+	For Local i:Int = 0 Until message.length
+		Local mb:Byte Ptr = message[i].ToUTF8String()
+		signer.Update(mb, Size_T(message[i].length))
+		MemFree(mb)
+	Next
+End Function

+ 10 - 0
crypto.mod/doc/tcryptosignkeypair.bmx

@@ -0,0 +1,10 @@
+SuperStrict
+
+Framework brl.standardio
+Import Crypto.Crypto
+
+Local keyPair:TCryptoSignKeyPair = TCryptoSign.KeyGen()
+
+Local s:String = keyPair.ToString()
+
+Print s

+ 294 - 0
crypto.mod/glue.c

@@ -0,0 +1,294 @@
+/*
+ * Copyright (c) 2019 Bruce A Henderson
+ *
+ * Permission to use, copy, modify, and/or distribute this software for any
+ * purpose with or without fee is hereby granted, provided that the above
+ * copyright notice and this permission notice appear in all copies.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES
+ * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF
+ * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR
+ * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES
+ * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN
+ * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF
+ * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE.
+ */
+#include "hydrogen.h"
+#include "brl.mod/blitz.mod/blitz.h"
+
+void bmx_hydro_hash_keygen(uint8_t * key) {
+	hydro_hash_keygen(key);
+}
+
+hydro_hash_state * bmx_hydro_hash_init(BBString * context, uint8_t * key) {
+	char * c = bbStringToUTF8String(context);
+	hydro_hash_state * state = malloc(sizeof(hydro_hash_state));
+	int res = hydro_hash_init(state, c, key);
+	bbMemFree(c);
+	return state;
+}
+
+int bmx_hydro_hash_update(hydro_hash_state * state, void * in, size_t inLen) {
+	return hydro_hash_update(state, in, inLen);
+}
+
+int bmx_hydro_hash_final(hydro_hash_state * state, uint8_t * out, size_t outLen) {
+	return hydro_hash_final(state, out, outLen);
+}
+
+void bmx_hydro_hash_state_free(hydro_hash_state * state) {
+	free(state);
+}
+
+int bmx_hydro_hash_hash(uint8_t * out, size_t outLen, uint8_t * in, size_t inLen, BBString * context, uint8_t * key) {
+	char * c = bbStringToUTF8String(context);
+	int res = hydro_hash_hash(out, outLen, in, inLen, c, key);
+	bbMemFree(c);
+	return res;
+}
+
+// --------------------------------------------------------
+
+void bmx_hydro_secretbox_keygen(uint8_t * key) {
+	hydro_secretbox_keygen(key);
+}
+
+int bmx_hydro_secretbox_encrypt(uint8_t * c, const void * m, size_t mLen, uint64_t msgId, BBString * context, uint8_t * key) {
+	char * ctx = bbStringToUTF8String(context);
+	int res = hydro_secretbox_encrypt(c, m, mLen, msgId, ctx, key);
+	bbMemFree(ctx);
+	return res == 0;
+}
+
+int bmx_hydro_secretbox_decrypt(void * m, const uint8_t * c, size_t cLen, uint64_t msgId, BBString * context, uint8_t * key) {
+	char * ctx = bbStringToUTF8String(context);
+	int res = hydro_secretbox_decrypt(m, c, cLen, msgId, ctx, key);
+	bbMemFree(ctx);
+	return res == 0;
+}
+
+void bmx_hydro_secretbox_probe_create(uint8_t * probe, uint8_t * c, size_t cLen, BBString * context, uint8_t * key) {
+	char * ctx = bbStringToUTF8String(context);
+	hydro_secretbox_probe_create(probe, c, cLen, ctx, key);
+	bbMemFree(ctx);
+}
+
+int bmx_hydro_secretbox_probe_verify(uint8_t * probe, const uint8_t * c, size_t cLen, BBString * context, uint8_t * key) {
+	char * ctx = bbStringToUTF8String(context);
+	int res = hydro_secretbox_probe_verify(probe, c, cLen, ctx, key);
+	bbMemFree(ctx);
+	return res == 0;	
+}
+
+// --------------------------------------------------------
+
+void bmx_hydro_pwhash_keygen(uint8_t * key) {
+	hydro_pwhash_keygen(key);
+}
+
+int bmx_hydro_pwhash_create(uint8_t * stored, BBString * password, uint8_t * masterKey, uint64_t opsLimit, size_t memLimit, int threads) {
+	char * p = bbStringToUTF8String(password);
+	int res = hydro_pwhash_create(stored, p, strlen(p), masterKey, opsLimit, memLimit, threads);
+	hydro_memzero(p, strlen(p));
+	bbMemFree(p);
+	return res == 0;
+}
+
+int bmx_hydro_pwhash_verify(uint8_t * stored, BBString * password, uint8_t * masterKey, uint64_t opsLimitMax, size_t memLimitMax, int threadsMax) {
+	char * p = bbStringToUTF8String(password);
+	int res = hydro_pwhash_verify(stored, p, strlen(p), masterKey, opsLimitMax, memLimitMax, threadsMax);
+	hydro_memzero(p, strlen(p));
+	bbMemFree(p);
+	return res == 0;
+}
+
+int bmx_hydro_pwhash_derive_static_key(uint8_t * staticKey, size_t staticKeyLen, uint8_t * stored, BBString * password, BBString * context, uint8_t * masterKey, uint64_t opsLimit, size_t memLimit, int threads) {
+	char * p = bbStringToUTF8String(password);
+	char * c = bbStringToUTF8String(context);
+	int res = hydro_pwhash_derive_static_key(staticKey, staticKeyLen, stored, p, strlen(p), c, masterKey, opsLimit, memLimit, threads);
+	hydro_memzero(p, strlen(p));
+	bbMemFree(p);
+	bbMemFree(c);
+	return res == 0;
+}
+
+int bmx_hydro_pwhash_reencrypt(uint8_t * stored, uint8_t * masterKey, uint8_t * newMasterKey) {
+	return hydro_pwhash_reencrypt(stored, masterKey, newMasterKey) == 0;
+}
+
+int bmx_hydro_pwhash_upgrade(uint8_t * stored, uint8_t * masterKey, uint64_t opsLimit, size_t memLimit, int threads) {
+	return hydro_pwhash_upgrade(stored, masterKey, opsLimit, memLimit, threads) == 0;
+}
+
+int bmx_hydro_pwhash_deterministic(uint8_t * h, size_t hLen, BBString * password, BBString * context, uint8_t * masterKey, uint64_t opsLimit, size_t memLimit, int threads) {
+	char * p = bbStringToUTF8String(password);
+	char * c = bbStringToUTF8String(context);
+	int res = hydro_pwhash_deterministic(h, hLen, p, strlen(p), c, masterKey, opsLimit, memLimit, threads);
+	hydro_memzero(p, strlen(p));
+	bbMemFree(p);
+	bbMemFree(c);
+	return res == 0;
+}
+
+// --------------------------------------------------------
+
+void bmx_hydro_sign_keygen(uint8_t * secretKey, uint8_t * publicKey) {
+	hydro_sign_keypair key_pair;
+	hydro_sign_keygen(&key_pair);
+	memcpy(secretKey, key_pair.sk, hydro_sign_SECRETKEYBYTES);
+	memcpy(publicKey, key_pair.pk, hydro_sign_PUBLICKEYBYTES);
+}
+
+int bmx_hydro_sign_create(uint8_t * csig, void * m, size_t mLen, BBString * context, uint8_t * sk) {
+	char * c = bbStringToUTF8String(context);
+	int res = hydro_sign_create(csig, m, mLen, c, sk);
+	bbMemFree(c);
+	return res == 0;
+}
+
+int bmx_hydro_sign_verify(uint8_t * csig, void * m, size_t mLen, BBString * context, uint8_t * pk) {
+	char * c = bbStringToUTF8String(context);
+	int res = hydro_sign_verify(csig, m, mLen, c, pk);
+	bbMemFree(c);
+	return res == 0;
+}
+
+hydro_sign_state * bmx_hydro_sign_init(BBString * context) {
+	char * c = bbStringToUTF8String(context);
+	hydro_sign_state * state = malloc(sizeof(hydro_sign_state));
+	int res = hydro_sign_init(state, c);
+	bbMemFree(c);
+	return state;
+}
+
+void bmx_hydro_sign_state_free(hydro_sign_state * state) {
+	free(state);
+}
+
+int bmx_hydro_sign_update(hydro_sign_state * state, const void * m, size_t mLen) {
+	return hydro_sign_update(state, m, mLen) == 0;
+}
+
+int bmx_hydro_sign_final_create(hydro_sign_state * state, uint8_t * csig, uint8_t * sk) {
+	return hydro_sign_final_create(state, csig, sk) == 0;
+}
+
+int bmx_hydro_sign_final_verify(hydro_sign_state * state, uint8_t * csig, uint8_t * pk) {
+	return hydro_sign_final_verify(state, csig, pk) == 0;
+}
+
+// --------------------------------------------------------
+
+void bmx_hydro_kx_keygen(uint8_t * secretKey, uint8_t * publicKey) {
+	hydro_kx_keypair key_pair;
+	hydro_kx_keygen(&key_pair);
+	memcpy(secretKey, key_pair.sk, hydro_kx_SECRETKEYBYTES);
+	memcpy(publicKey, key_pair.pk, hydro_kx_PUBLICKEYBYTES);
+}
+
+int bmx_hydro_kx_n_1(uint8_t * rx, uint8_t * tx, uint8_t * packet1, uint8_t * preSharedKey, uint8_t * publicKey) {
+	hydro_kx_session_keypair session;
+	
+	int res = hydro_kx_n_1(&session, packet1, preSharedKey, publicKey);
+	memcpy(rx, session.rx, hydro_kx_SESSIONKEYBYTES);
+	memcpy(tx, session.tx, hydro_kx_SESSIONKEYBYTES);
+	
+	return res == 0;
+}
+
+int bmx_hydro_kx_n_2(uint8_t * rx, uint8_t * tx, uint8_t * packet1, uint8_t * preSharedKey, uint8_t * secretKey, uint8_t * publicKey) {
+	hydro_kx_session_keypair session;
+
+	hydro_kx_keypair kp;
+	memcpy(kp.pk, publicKey, hydro_kx_PUBLICKEYBYTES);
+	memcpy(kp.sk, secretKey, hydro_kx_SECRETKEYBYTES);
+	
+	int res = hydro_kx_n_2(&session, packet1, preSharedKey, &kp);
+	memcpy(rx, session.rx, hydro_kx_SESSIONKEYBYTES);
+	memcpy(tx, session.tx, hydro_kx_SESSIONKEYBYTES);
+	
+	return res == 0;
+}
+
+hydro_kx_state * bmx_hydro_kx_state_new() {
+	hydro_kx_state * state = calloc(1, sizeof(hydro_kx_state));
+	return state;
+}
+
+void bmx_hydro_kx_state_free(hydro_kx_state * state) {
+	free(state);
+}
+
+int bmx_hydro_kx_kk_1(hydro_kx_state * state, uint8_t * packet1, uint8_t * peerPublicKey, uint8_t * secretKey, uint8_t * publicKey) {
+	hydro_kx_keypair kp;
+	memcpy(kp.pk, publicKey, hydro_kx_PUBLICKEYBYTES);
+	memcpy(kp.sk, secretKey, hydro_kx_SECRETKEYBYTES);
+
+	return hydro_kx_kk_1(state, packet1, peerPublicKey, &kp) == 0;
+}
+
+int bmx_hydro_kx_kk_2(uint8_t * rx, uint8_t * tx, uint8_t * packet2, uint8_t * packet1, uint8_t * peerPublicKey, uint8_t * secretKey, uint8_t * publicKey) {
+	hydro_kx_session_keypair session;
+
+	hydro_kx_keypair kp;
+	memcpy(kp.pk, publicKey, hydro_kx_PUBLICKEYBYTES);
+	memcpy(kp.sk, secretKey, hydro_kx_SECRETKEYBYTES);
+
+	int res = hydro_kx_kk_2(&session, packet2, packet1, peerPublicKey, &kp);
+	memcpy(rx, session.rx, hydro_kx_SESSIONKEYBYTES);
+	memcpy(tx, session.tx, hydro_kx_SESSIONKEYBYTES);
+
+	return res == 0;
+}
+
+int bmx_hydro_kx_kk_3(hydro_kx_state * state, uint8_t * rx, uint8_t * tx, uint8_t * packet2, uint8_t * secretKey, uint8_t * publicKey) {
+	hydro_kx_session_keypair session;
+
+	hydro_kx_keypair kp;
+	memcpy(kp.pk, publicKey, hydro_kx_PUBLICKEYBYTES);
+	memcpy(kp.sk, secretKey, hydro_kx_SECRETKEYBYTES);
+
+	int res = hydro_kx_kk_3(state, &session, packet2, &kp);
+	memcpy(rx, session.rx, hydro_kx_SESSIONKEYBYTES);
+	memcpy(tx, session.tx, hydro_kx_SESSIONKEYBYTES);
+
+	return res == 0;
+}
+
+int bmx_hydro_kx_xx_1(hydro_kx_state * state, uint8_t * packet1, uint8_t * preSharedKey) {
+	return hydro_kx_xx_1(state, packet1, preSharedKey) == 0;
+}
+
+int bmx_hydro_kx_xx_2(hydro_kx_state * state, uint8_t * packet2, uint8_t * packet1, uint8_t * preSharedKey, uint8_t * secretKey, uint8_t * publicKey) {
+	hydro_kx_keypair kp;
+	memcpy(kp.pk, publicKey, hydro_kx_PUBLICKEYBYTES);
+	memcpy(kp.sk, secretKey, hydro_kx_SECRETKEYBYTES);
+
+	return hydro_kx_xx_2(state, packet2, packet1, preSharedKey, &kp) == 0;
+}
+
+int bmx_hydro_kx_xx_3(hydro_kx_state * state, uint8_t * rx, uint8_t * tx, uint8_t * packet3, uint8_t * peerPublicKey, uint8_t * packet2, uint8_t * preSharedKey, uint8_t * secretKey, uint8_t * publicKey) {
+	hydro_kx_session_keypair session;
+
+	hydro_kx_keypair kp;
+	memcpy(kp.pk, publicKey, hydro_kx_PUBLICKEYBYTES);
+	memcpy(kp.sk, secretKey, hydro_kx_SECRETKEYBYTES);
+
+	int res = hydro_kx_xx_3(state, &session, packet3, peerPublicKey, packet2, preSharedKey, &kp);
+	
+	memcpy(rx, session.rx, hydro_kx_SESSIONKEYBYTES);
+	memcpy(tx, session.tx, hydro_kx_SESSIONKEYBYTES);
+
+	return res == 0;
+}
+
+int bmx_hydro_kx_xx_4(hydro_kx_state * state, uint8_t * rx, uint8_t * tx, uint8_t * peerPublicKey, uint8_t * packet3, uint8_t * preSharedKey) {
+	hydro_kx_session_keypair session;
+
+	int res = hydro_kx_xx_4(state, &session, peerPublicKey, packet3, preSharedKey);
+	
+	memcpy(rx, session.rx, hydro_kx_SESSIONKEYBYTES);
+	memcpy(tx, session.tx, hydro_kx_SESSIONKEYBYTES);
+
+	return res == 0;
+}

+ 34 - 0
digest.mod/common.bmx

@@ -0,0 +1,34 @@
+'
+'  Copyright (C) 2019 Bruce A Henderson
+'
+'  This software is provided 'as-is', without any express or implied
+'  warranty.  In no event will the authors be held liable for any damages
+'  arising from the use of this software.
+'
+'  Permission is granted to anyone to use this software for any purpose,
+'  including commercial applications, and to alter it and redistribute it
+'  freely, subject to the following restrictions:
+'
+'  1. The origin of this software must not be misrepresented; you must not
+'     claim that you wrote the original software. If you use this software
+'     in a product, an acknowledgment in the product documentation would be
+'     appreciated but is not required.
+'  2. Altered source versions must be plainly marked as such, and must not be
+'     misrepresented as being the original software.
+'  3. This notice may not be removed or altered from any source distribution.
+'
+SuperStrict
+
+Import Crypto.libtomcrypt
+Import pub.stdc
+Import brl.stream
+
+Import "source.bmx"
+
+Extern
+
+	Function bmx_digest_free(handle:Byte Ptr)
+
+	Function bmx_digest_bytes_to_hex:String(bytes:Byte Ptr, length:Int, uppercase:Int)
+	
+End Extern

+ 178 - 0
digest.mod/digest.bmx

@@ -0,0 +1,178 @@
+'
+'  Copyright (C) 2019 Bruce A Henderson
+'
+'  This software is provided 'as-is', without any express or implied
+'  warranty.  In no event will the authors be held liable for any damages
+'  arising from the use of this software.
+'
+'  Permission is granted to anyone to use this software for any purpose,
+'  including commercial applications, and to alter it and redistribute it
+'  freely, subject to the following restrictions:
+'
+'  1. The origin of this software must not be misrepresented; you must not
+'     claim that you wrote the original software. If you use this software
+'     in a product, an acknowledgment in the product documentation would be
+'     appreciated but is not required.
+'  2. Altered source versions must be plainly marked as such, and must not be
+'     misrepresented as being the original software.
+'  3. This notice may not be removed or altered from any source distribution.
+'
+SuperStrict
+
+Rem
+bbdoc: Message Digests and hashes.
+End Rem
+Module Crypto.Digest
+
+Import "common.bmx"
+
+Rem
+bbdoc: Gets a digest of the specified @name.
+about: A #TNoSuchAlgorithmException is thrown if the requested digest is not available.
+End Rem
+Function GeTMessageDigest:TMessageDigest(name:String)
+	Local d:TMessageDigest
+	Local register:TDigestRegister=digest_registry
+
+	While register
+		d=register.GetDigest(name)
+		If d Exit
+		register = register._succ
+	Wend
+
+	If Not d Then
+		Throw New TNoSuchAlgorithmException("Digest not available : " + name)
+	End If
+	Return d
+End Function
+
+Rem
+bbdoc: This exception is thrown when a particular cryptographic algorithm is requested but is not available in the environment.
+End Rem
+Type TNoSuchAlgorithmException Extends TBlitzException
+
+	Field message:String
+
+	Method New(message:String)
+		Self.message = message
+	End Method
+
+	Method ToString:String()
+		Return message
+	End Method
+
+End Type
+
+Rem
+bbdoc: An abstract base type for message digest implementations.
+End Rem
+Type TMessageDigest
+
+	Field digestPtr:Byte Ptr
+	
+	Method Update:Int(data:Byte Ptr, dataLen:Int) Abstract
+	Method Finish:Int(digest:Byte[]) Abstract
+	Method OutBytes:Int() Abstract
+
+	Rem
+	bbdoc: Calculates a digest for the given #String input @data.
+	returns: A #String representation of the digest.
+	End Rem
+	Method Digest:String(data:String)
+		Return BytesToHex(DigestBytes(data))
+	End Method
+
+	Rem
+	bbdoc: Calculates a digest for the given #TStream input @stream.
+	returns: A #String representation of the digest.
+	End Rem
+	Method Digest:String(stream:TStream)
+		Return BytesToHex(DigestBytes(stream))
+	End Method
+	
+	Rem
+	bbdoc: Calculates a digest for the given #String input @data.
+	returns: A byte array representation of the digest.
+	End Rem
+	Method DigestBytes:Byte[](data:String)
+		Local buf:Byte Ptr = data.ToUTF8String()
+		Update(buf, Int(strlen_(buf)))
+		Local res:Byte[OutBytes()]
+		Finish(res)
+		MemFree(buf)
+		Return res
+	End Method
+
+	Rem
+	bbdoc: Calculates a digest for the given #TStream input @stream.
+	returns: A bytes array representation of the digest.
+	End Rem
+	Method DigestBytes:Byte[](stream:TStream)
+		Local buf:Byte[8192]
+		
+		Local bytesRead:Long
+		Repeat
+			bytesRead = stream.Read(buf, buf.length)
+			If bytesRead Then
+				Update(buf, Int(bytesRead))
+			End If
+		Until bytesRead <= 0
+
+		If Not bytesRead Then
+			Local res:Byte[OutBytes()]
+			Finish(res)
+			Return res
+		End If
+		
+		Return Null
+	End Method
+
+	Method Delete()
+		If digestPtr Then
+			bmx_digest_free(digestPtr)
+			digestPtr = Null
+		End If
+	End Method
+
+End Type
+
+Rem
+bbdoc: Returns a hex representation of #Byte array @bytes.
+End Rem
+Function BytesToHex:String(bytes:Byte[], uppercase:Int = False)
+	Return bmx_digest_bytes_to_hex(bytes, bytes.length, uppercase)
+End Function
+
+Rem
+bbdoc: Returns a hex representation of @size @bytes.
+End Rem
+Function BytesToHex:String(bytes:Byte Ptr, size:Int, uppercase:Int = False)
+	Return bmx_digest_bytes_to_hex(bytes, size, uppercase)
+End Function
+
+Private
+
+Global digest_registry:TDigestRegister
+
+Public
+
+Rem
+bbdoc: A register of available message digests and cryptographic functions.
+about: This can be extended to add new digests to the register.
+End Rem
+Type TDigestRegister
+	Field _succ:TDigestRegister
+	
+	Method New()
+		_succ=digest_registry
+		digest_registry=Self
+	End Method
+	
+	Rem
+	bbdoc: Gets an instance of a messages digest.
+	returns: The message digest or #Null if one of the given name does not exist.
+	about: This method must be implemented by extending types.
+	End Rem
+	Method GeTDigest:TMessageDigest( name:String ) Abstract
+	
+End Type

+ 35 - 0
digest.mod/glue.c

@@ -0,0 +1,35 @@
+/*
+  Copyright (C) 2019 Bruce A Henderson
+
+  This software is provided 'as-is', without any express or implied
+  warranty.  In no event will the authors be held liable for any damages
+  arising from the use of this software.
+
+  Permission is granted to anyone to use this software for any purpose,
+  including commercial applications, and to alter it and redistribute it
+  freely, subject to the following restrictions:
+
+  1. The origin of this software must not be misrepresented; you must not
+     claim that you wrote the original software. If you use this software
+     in a product, an acknowledgment in the product documentation would be
+     appreciated but is not required.
+  2. Altered source versions must be plainly marked as such, and must not be
+     misrepresented as being the original software.
+  3. This notice may not be removed or altered from any source distribution.
+*/
+#include "tomcrypt.h"
+#include "brl.mod/blitz.mod/blitz.h"
+
+void bmx_digest_free(void * handle) {
+	free(handle);
+}
+
+// ++++++++++++++++++++++++++++++++++++++++++++++++++++++++
+
+BBString * bmx_digest_bytes_to_hex(char * bytes, int length, int uppercase) {
+	char hex[2048];
+	unsigned long outlen = sizeof(hex);
+	base16_encode(bytes, length, hex, &outlen, uppercase);
+	
+	return bbStringFromBytes(hex, outlen);
+}

+ 24 - 0
digest.mod/source.bmx

@@ -0,0 +1,24 @@
+'
+'  Copyright (C) 2019 Bruce A Henderson
+'
+'  This software is provided 'as-is', without any express or implied
+'  warranty.  In no event will the authors be held liable for any damages
+'  arising from the use of this software.
+'
+'  Permission is granted to anyone to use this software for any purpose,
+'  including commercial applications, and to alter it and redistribute it
+'  freely, subject to the following restrictions:
+'
+'  1. The origin of this software must not be misrepresented; you must not
+'     claim that you wrote the original software. If you use this software
+'     in a product, an acknowledgment in the product documentation would be
+'     appreciated but is not required.
+'  2. Altered source versions must be plainly marked as such, and must not be
+'     misrepresented as being the original software.
+'  3. This notice may not be removed or altered from any source distribution.
+'
+SuperStrict
+
+Import "../libtomcrypt.mod/libtomcrypt/src/headers/*.h"
+
+Import "glue.c"

+ 121 - 0
digest.mod/tests/test.bmx

@@ -0,0 +1,121 @@
+SuperStrict
+
+Framework brl.standardio
+Import Crypto.md5digest
+Import Crypto.sha1digest
+Import Crypto.sha256digest
+Import Crypto.sha512digest
+Import Crypto.crc32
+Import BRL.MaxUnit
+
+New TTestSuite.run()
+
+Type TDigestTest Extends TTest
+
+	Const TEST_PHRASE:String = "The quick brown fox jumps over the lazy dog"
+
+	Const MD5_HASH_STRING:String = "9e107d9d372bb6826bd81d3542a419d6"
+	Global MD5_HASH_ARRAY:Byte[] = [158, 16, 125, 157, 55, 43, 182, 130, 107, 216, 29, 53, 66, 164, 25, 214]
+
+	Const SHA1_HASH_STRING:String = "2fd4e1c67a2d28fced849ee1bb76e7391b93eb12"
+	Global SHA1_HASH_ARRAY:Byte[] = [47, 212, 225, 198, 122, 45, 40, 252, 237, 132, 158, 225, 187, 118, 231, 57, 27, 147, 235, 18]
+	
+	Const SHA256_HASH_STRING:String = "d7a8fbb307d7809469ca9abcb0082e4f8d5651e46d3cdb762d02d0bf37c9e592"
+	Global SHA256_HASH_ARRAY:Byte[] = [215, 168, 251, 179, 7, 215, 128, 148, 105, 202, 154, 188, 176, 8, 46, 79, 141, 86, 81, 228, 109, 60, 219, 118, 45, 2, 208, 191, 55, 201, 229, 146]
+	
+	Const SHA512_HASH_STRING:String = "07e547d9586f6a73f73fbac0435ed76951218fb7d0c8d788a309d785436bbb642e93a252a954f23912547d1e8a3b5ed6e1bfd7097821233fa0538f3db854fee6"
+	Global SHA512_HASH_ARRAY:Byte[] = [7, 229, 71, 217, 88, 111, 106, 115, 247, 63, 186, 192, 67, 94, 215, 105, 81, 33, 143, 183, 208, 200, 215, ..
+									136, 163, 9, 215, 133, 67, 107, 187, 100, 46, 147, 162, 82, 169, 84, 242, 57, 18, 84, 125, 30, 138, 59, 94, ..
+									214, 225, 191, 215, 9, 120, 33, 35, 63, 160, 83, 143, 61, 184, 84, 254, 230]
+
+	Const CRC32_HASH_STRING:String = "414fa339"
+	Global CRC32_HASH_ARRAY:Byte[] = [65, 79, 163, 57]
+	Const CRC32_INT:Int = 1095738169
+	
+	Method testMD5() { test }
+	
+		Local digest:TMessageDigest = GetMessageDigest("MD5")
+	
+		assertEquals(MD5_HASH_STRING, digest.Digest(TEST_PHRASE))
+	
+		Local bytes:Byte[] = digest.DigestBytes(TEST_PHRASE)
+
+		assertEquals(MD5_HASH_ARRAY.length, bytes.length)
+		
+		For Local i:Int = 0 Until MD5_HASH_ARRAY.length
+			assertEquals(MD5_HASH_ARRAY[i], bytes[i])
+		Next
+	
+	End Method
+
+	Method testSHA1() { test }
+	
+		Local digest:TMessageDigest = GetMessageDigest("SHA1")
+	
+		assertEquals(SHA1_HASH_STRING, digest.Digest(TEST_PHRASE))
+	
+		Local bytes:Byte[] = digest.DigestBytes(TEST_PHRASE)
+
+		assertEquals(SHA1_HASH_ARRAY.length, bytes.length)
+		
+		For Local i:Int = 0 Until SHA1_HASH_ARRAY.length
+			assertEquals(SHA1_HASH_ARRAY[i], bytes[i])
+		Next
+	
+	End Method
+
+	Method testSHA256() { test }
+	
+		Local digest:TMessageDigest = GetMessageDigest("SHA256")
+	
+		assertEquals(SHA256_HASH_STRING, digest.Digest(TEST_PHRASE))
+	
+		Local bytes:Byte[] = digest.DigestBytes(TEST_PHRASE)
+
+		assertEquals(SHA256_HASH_ARRAY.length, bytes.length)
+		
+		For Local i:Int = 0 Until SHA256_HASH_ARRAY.length
+			assertEquals(SHA256_HASH_ARRAY[i], bytes[i])
+		Next
+	
+	End Method
+
+	Method testSHA512() { test }
+	
+		Local digest:TMessageDigest = GetMessageDigest("SHA512")
+	
+		assertEquals(SHA512_HASH_STRING, digest.Digest(TEST_PHRASE))
+	
+		Local bytes:Byte[] = digest.DigestBytes(TEST_PHRASE)
+
+		assertEquals(SHA512_HASH_ARRAY.length, bytes.length)
+		
+		For Local i:Int = 0 Until SHA512_HASH_ARRAY.length
+			assertEquals(SHA512_HASH_ARRAY[i], bytes[i])
+		Next
+	
+	End Method
+
+	Method testCRC32() { test }
+	
+		Local digest:TMessageDigest = GetMessageDigest("CRC32")
+	
+		assertEquals(CRC32_HASH_STRING, digest.Digest(TEST_PHRASE))
+	
+		Local bytes:Byte[] = digest.DigestBytes(TEST_PHRASE)
+
+		assertEquals(CRC32_HASH_ARRAY.length, bytes.length)
+		
+		For Local i:Int = 0 Until CRC32_HASH_ARRAY.length
+			assertEquals(CRC32_HASH_ARRAY[i], bytes[i])
+		Next
+		
+		Local crc32:TCRC32 = TCRC32(digest)
+		Local result:Int
+		crc32.Digest(TEST_PHRASE, result)
+		
+		assertEquals(CRC32_INT, result)
+	
+	End Method
+
+End Type

+ 34 - 0
libhydrogen.mod/libhydrogen.bmx

@@ -0,0 +1,34 @@
+'
+' Copyright (c) 2019 Bruce A Henderson
+'
+' Permission to use, copy, modify, and/or distribute this software for any
+' purpose with or without fee is hereby granted, provided that the above
+' copyright notice and this permission notice appear in all copies.
+'
+' THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES
+' WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF
+' MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR
+' ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES
+' WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN
+' ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF
+' OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE.
+'
+SuperStrict
+
+
+Module Crypto.LibHydrogen
+
+
+ModuleInfo "Version: 1.01"
+ModuleInfo "Author: Frank Denis."
+ModuleInfo "License: ISC"
+ModuleInfo "Credit: Adapted for BlitzMax by Bruce A Henderson"
+
+ModuleInfo "History: 1.01"
+ModuleInfo "History: Disabled for NX."
+ModuleInfo "History: 1.00"
+ModuleInfo "History: Initial Release."
+
+?Not nx
+Import "source.bmx"
+?

+ 95 - 0
libhydrogen.mod/libhydrogen/.clang-format

@@ -0,0 +1,95 @@
+---
+Language:        Cpp
+AccessModifierOffset: -4
+AlignAfterOpenBracket: Align
+AlignConsecutiveAssignments: true
+AlignConsecutiveDeclarations: true
+AlignEscapedNewlinesLeft: true
+AlignOperands:   true
+AlignTrailingComments: true
+AllowAllParametersOfDeclarationOnNextLine: true
+AllowShortBlocksOnASingleLine: false
+AllowShortCaseLabelsOnASingleLine: false
+AllowShortFunctionsOnASingleLine: Inline
+AllowShortIfStatementsOnASingleLine: false
+AllowShortLoopsOnASingleLine: false
+AlwaysBreakAfterDefinitionReturnType: None
+AlwaysBreakAfterReturnType: TopLevelDefinitions
+AlwaysBreakBeforeMultilineStrings: true
+AlwaysBreakTemplateDeclarations: true
+BinPackArguments: true
+BinPackParameters: true
+BraceWrapping:   
+  AfterClass:      false
+  AfterControlStatement: false
+  AfterEnum:       false
+  AfterFunction:   true
+  AfterNamespace:  false
+  AfterObjCDeclaration: false
+  AfterStruct:     false
+  AfterUnion:      false
+  BeforeCatch:     false
+  BeforeElse:      false
+  IndentBraces:    false
+BreakBeforeBinaryOperators: None
+BreakBeforeBraces: WebKit
+BreakBeforeTernaryOperators: true
+BreakConstructorInitializersBeforeComma: true
+BreakAfterJavaFieldAnnotations: false
+BreakStringLiterals: true
+ColumnLimit:     100
+CommentPragmas:  '^ IWYU pragma:'
+ConstructorInitializerAllOnOneLineOrOnePerLine: false
+ConstructorInitializerIndentWidth: 4
+ContinuationIndentWidth: 4
+Cpp11BracedListStyle: false
+DerivePointerAlignment: true
+DisableFormat:   false
+ExperimentalAutoDetectBinPacking: false
+ForEachMacros:   [ foreach, Q_FOREACH, BOOST_FOREACH ]
+IncludeCategories: 
+  - Regex:           '^"(llvm|llvm-c|clang|clang-c)/'
+    Priority:        2
+  - Regex:           '^(<|"(gtest|isl|json)/)'
+    Priority:        3
+  - Regex:           '.*'
+    Priority:        1
+IncludeIsMainRegex: '$'
+IndentCaseLabels: false
+IndentWidth:     4
+IndentWrappedFunctionNames: false
+JavaScriptQuotes: Leave
+JavaScriptWrapImports: true
+KeepEmptyLinesAtTheStartOfBlocks: false
+MacroBlockBegin: ''
+MacroBlockEnd:   ''
+MaxEmptyLinesToKeep: 1
+NamespaceIndentation: Inner
+ObjCBlockIndentWidth: 4
+ObjCSpaceAfterProperty: true
+ObjCSpaceBeforeProtocolList: true
+PenaltyBreakBeforeFirstCallParameter: 19
+PenaltyBreakComment: 300
+PenaltyBreakFirstLessLess: 120
+PenaltyBreakString: 1000
+PenaltyExcessCharacter: 1000000
+PenaltyReturnTypeOnItsOwnLine: 60
+PointerAlignment: Right
+ReflowComments:  true
+SortIncludes:    true
+SpaceAfterCStyleCast: true
+SpaceAfterTemplateKeyword: true
+SpaceBeforeAssignmentOperators: true
+SpaceBeforeParens: ControlStatements
+SpaceInEmptyParentheses: false
+SpacesBeforeTrailingComments: 1
+SpacesInAngles:  false
+SpacesInContainerLiterals: true
+SpacesInCStyleCastParentheses: false
+SpacesInParentheses: false
+SpacesInSquareBrackets: false
+Standard:        Cpp11
+TabWidth:        8
+UseTab:          Never
+...
+

+ 32 - 0
libhydrogen.mod/libhydrogen/.gitignore

@@ -0,0 +1,32 @@
+*.bc
+*.cmake
+*.dSYM
+*.done
+*.final
+*.gcda
+*.gcno
+*.i
+*.la
+*.lo
+*.log
+*.mem
+*.nexe
+*.o
+*.plist
+*.scan
+*.sdf
+*.status
+*.su
+*.tar.*
+*~
+.DS_Store
+.deps
+.dirstamp
+.done
+.libs
+build.options.json
+coverage.info
+depcomp
+hydrogen-crypto.zip
+libhydrogen.a
+tests/tests

+ 22 - 0
libhydrogen.mod/libhydrogen/.travis.yml

@@ -0,0 +1,22 @@
+sudo: false
+
+language: c
+
+os:
+ - linux
+
+compiler:
+ - clang
+ - gcc
+ - g++
+
+addons:
+  apt:
+    packages:
+      - p7zip-full
+
+script:
+ - make
+ - make test
+ - make clean
+ - make -f Makefile.arduino package

+ 18 - 0
libhydrogen.mod/libhydrogen/LICENSE

@@ -0,0 +1,18 @@
+/*
+ * ISC License
+ *
+ * Copyright (c) 2017-2019
+ * Frank Denis <j at pureftpd dot org>
+ *
+ * Permission to use, copy, modify, and/or distribute this software for any
+ * purpose with or without fee is hereby granted, provided that the above
+ * copyright notice and this permission notice appear in all copies.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES
+ * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF
+ * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR
+ * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES
+ * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN
+ * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF
+ * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE.
+ */

+ 61 - 0
libhydrogen.mod/libhydrogen/Makefile

@@ -0,0 +1,61 @@
+PREFIX ?= /usr/local
+WFLAGS ?= -Wall -Wextra -Wmissing-prototypes -Wdiv-by-zero -Wbad-function-cast -Wcast-align -Wcast-qual -Wfloat-equal -Wmissing-declarations -Wnested-externs -Wno-unknown-pragmas -Wpointer-arith -Wredundant-decls -Wstrict-prototypes -Wswitch-enum -Wno-type-limits
+CFLAGS ?= -Os -march=native -fno-exceptions $(WFLAGS)
+CFLAGS += -I.
+OBJ = hydrogen.o
+AR ?= ar
+RANLIB ?= ranlib
+
+SRC = \
+	hydrogen.c \
+	hydrogen.h \
+	impl/common.h \
+	impl/core.h \
+	impl/gimli-core.h \
+	impl/hash.h \
+	impl/hydrogen_p.h \
+	impl/kdf.h \
+	impl/kx.h \
+	impl/pwhash.h \
+	impl/random.h \
+	impl/secretbox.h \
+	impl/sign.h \
+	impl/x25519.h
+
+all: lib test
+
+lib: libhydrogen.a
+
+install: lib
+	mkdir -p $(PREFIX)/lib
+	install -o 0 -g 0 -m 0755 libhydrogen.a $(PREFIX)/lib 2> /dev/null || install -m 0755 libhydrogen.a $(PREFIX)/lib
+	mkdir -p $(PREFIX)/include
+	install -o 0 -g 0 -m 0644 hydrogen.h $(PREFIX)/include 2> /dev/null || install -m 0644 hydrogen.h $(PREFIX)/include
+	ldconfig 2> /dev/null || true
+
+uninstall:
+	rm -f $(PREFIX)/lib/libhydrogen.a
+	rm -f $(PREFIX)/include/hydrogen.h
+
+test: tests/tests
+	rm -f tests/tests.done
+	tests/tests && touch tests/tests.done
+
+tests/tests: $(SRC) tests/tests.c
+	$(CC) $(CFLAGS) -O3 -o tests/tests hydrogen.c tests/tests.c
+
+$(OBJ): $(SRC)
+
+libhydrogen.a: $(OBJ)
+	$(AR) -r $@ $^
+	$(RANLIB) $@
+
+.PHONY: clean
+
+clean:
+	rm -f libhydrogen.a $(OBJ)
+	rm -f tests/tests tests/*.done
+
+check: test
+
+distclean: clean

+ 51 - 0
libhydrogen.mod/libhydrogen/Makefile.arduino

@@ -0,0 +1,51 @@
+TARGET_DEVICE ?= atmega328p
+HWTYPE ?= HYDRO_TARGET_DEVICE_ATMEGA328
+ARDUINO_HOME ?= /Applications/Arduino.app/Contents/Java
+ARDUINO_TOOLS ?= $(ARDUINO_HOME)/hardware/tools/avr/bin
+AR = $(ARDUINO_TOOLS)/avr-gcc-ar
+CC = $(ARDUINO_TOOLS)/avr-gcc
+RANLIB = $(ARDUINO_TOOLS)/avr-gcc-ranlib
+WFLAGS ?= -Wall -Wextra -Wmissing-prototypes -Wdiv-by-zero -Wbad-function-cast -Wcast-align -Wcast-qual -Wfloat-equal -Wmissing-declarations -Wnested-externs -Wno-unknown-pragmas -Wpointer-arith -Wredundant-decls -Wstrict-prototypes -Wswitch-enum -Wno-type-limits
+CFLAGS ?= -mmcu=$(TARGET_DEVICE) -Os -mcall-prologues -fno-exceptions -ffunction-sections -fdata-sections -flto $(WFLAGS)
+CFLAGS += -I. -I$(ARDUINO_HOME)/hardware/arduino/avr/cores/arduino -I$(ARDUINO_HOME)/hardware/arduino/avr/variants/standard
+CFLAGS += -DHYDRO_HWTYPE=$(HYDRO_HWTYPE)
+OBJ = hydrogen.o
+ARDUINO_PACKAGE ?= hydrogen-crypto.zip
+SRC = \
+	hydrogen.c \
+	hydrogen.h \
+	impl/common.h \
+	impl/core.h \
+	impl/gimli-core.h \
+	impl/hash.h \
+	impl/hydrogen_p.h \
+	impl/kdf.h \
+	impl/kx.h \
+	impl/pwhash.h \
+	impl/random.h \
+	impl/secretbox.h \
+	impl/sign.h \
+	impl/x25519.h \
+	impl/gimli-core/portable.h
+
+all: lib package
+
+package: $(ARDUINO_PACKAGE)
+
+$(ARDUINO_PACKAGE):
+	7z a -tzip -mx=9 -r $(ARDUINO_PACKAGE) $(SRC) library.properties
+
+lib: libhydrogen.a
+
+$(OBJ): $(SRC)
+
+libhydrogen.a: $(OBJ)
+	$(AR) -ar cr $@ $^
+	$(RANLIB) $@
+
+.PHONY: clean
+
+clean:
+	rm -f libhydrogen.a $(OBJ)
+	rm -f tests/tests
+	rm -f $(ARDUINO_PACKAGE)

+ 29 - 0
libhydrogen.mod/libhydrogen/README.md

@@ -0,0 +1,29 @@
+[![Build Status](https://travis-ci.org/jedisct1/libhydrogen.svg?branch=master)](https://travis-ci.org/jedisct1/libhydrogen?branch=master)
+[![Coverity Scan Build Status](https://scan.coverity.com/projects/13315/badge.svg)](https://scan.coverity.com/projects/13315)
+
+![libhydrogen](https://raw.github.com/jedisct1/libhydrogen/master/logo.png)
+==============
+
+The Hydrogen library is a small, easy-to-use, hard-to-misuse cryptographic library.
+
+Features:
+- Consistent high-level API, inspired by libsodium. Instead of low-level primitives, it exposes simple functions to solve common problems that cryptography can solve.
+- 100% built using just two cryptographic building blocks: the [Curve25519](https://cr.yp.to/ecdh.html) elliptic curve, and the [Gimli](https://gimli.cr.yp.to/) permutation.
+- Small and easy to audit. Implemented as one tiny file for every set of operation, and adding a single `.c` file to your project is all it takes to use libhydrogen in your project.
+- The whole code is released under a single, very liberal license (ISC).
+- Zero dynamic memory allocations and low stack requirements (median: 32 bytes, max: 128 bytes). This makes it usable in constrained environments such as microcontrollers.
+- Portable: written in standard C99. Supports Linux, *BSD, MacOS, Windows, and the Arduino IDE out of the box.
+- Can generate cryptographically-secure random numbers, even on Arduino boards.
+- Attempts to mitigate the implications of accidental misuse, even on systems with an unreliable PRG and/or no clock.
+
+Non-goals:
+- Having multiple primitives serving the same purpose, even to provide compatibility with other libraries.
+- Networking -- but a simple key exchange API based on the Noise protocol is available, and a STROBE-based transport API will be implemented.
+- Interoperability with other libraries.
+- Replacing libsodium. Libhydrogen tries to keep the number of APIs and the code size down to a minimum.
+
+# [Libhydrogen documentation](https://github.com/jedisct1/libhydrogen/wiki)
+
+The documentation is maintained in the [libhydrogen wiki](https://github.com/jedisct1/libhydrogen/wiki).
+
+The legacy libhydrogen code (leveraging XChaCha20, SipHashX, BLAKE2SX, Curve25519) remains available in the [v0 branch](https://github.com/jedisct1/libhydrogen/tree/v0).

+ 18 - 0
libhydrogen.mod/libhydrogen/hydrogen.c

@@ -0,0 +1,18 @@
+#include "hydrogen.h"
+
+#include "impl/common.h"
+#include "impl/hydrogen_p.h"
+
+#include "impl/core.h"
+#include "impl/gimli-core.h"
+#include "impl/random.h"
+
+#include "impl/hash.h"
+#include "impl/kdf.h"
+#include "impl/secretbox.h"
+
+#include "impl/x25519.h"
+
+#include "impl/kx.h"
+#include "impl/pwhash.h"
+#include "impl/sign.h"

+ 317 - 0
libhydrogen.mod/libhydrogen/hydrogen.h

@@ -0,0 +1,317 @@
+#ifndef hydrogen_H
+#define hydrogen_H
+
+#include <stdbool.h>
+#include <stdint.h>
+#include <stdlib.h>
+
+#ifdef __cplusplus
+# ifdef __GNUC__
+#  pragma GCC diagnostic ignored "-Wlong-long"
+# endif
+extern "C" {
+#endif
+
+#if defined(__clang__) || defined(__GNUC__)
+# define _hydro_attr_(X) __attribute__(X)
+#else
+# define _hydro_attr_(X)
+#endif
+#define _hydro_attr_deprecated_         _hydro_attr_((deprecated))
+#define _hydro_attr_malloc_             _hydro_attr_((malloc))
+#define _hydro_attr_noinline_           _hydro_attr_((noinline))
+#define _hydro_attr_noreturn_           _hydro_attr_((noreturn))
+#define _hydro_attr_warn_unused_result_ _hydro_attr_((warn_unused_result))
+#define _hydro_attr_weak_               _hydro_attr_((weak))
+
+#if defined(__INTEL_COMPILER) || defined(_MSC_VER)
+# define _hydro_attr_aligned_(X)        __declspec(align(X))
+#elif defined(__clang__) || defined(__GNUC__)
+# define _hydro_attr_aligned_(X)        _hydro_attr_((aligned(X)))
+#else
+# define _hydro_attr_aligned_(X)
+#endif
+
+#define HYDRO_VERSION_MAJOR 1
+#define HYDRO_VERSION_MINOR 0
+
+int hydro_init(void);
+
+/* ---------------- */
+
+#define hydro_random_SEEDBYTES 32
+
+uint32_t hydro_random_u32(void);
+
+uint32_t hydro_random_uniform(const uint32_t upper_bound);
+
+void hydro_random_buf(void *out, size_t out_len);
+
+void hydro_random_buf_deterministic(void *out, size_t out_len,
+                                    const uint8_t seed[hydro_random_SEEDBYTES]);
+
+void hydro_random_ratchet(void);
+
+void hydro_random_reseed(void);
+
+/* ---------------- */
+
+#define hydro_hash_BYTES 32
+#define hydro_hash_BYTES_MAX 65535
+#define hydro_hash_BYTES_MIN 16
+#define hydro_hash_CONTEXTBYTES 8
+#define hydro_hash_KEYBYTES 32
+
+typedef struct hydro_hash_state {
+    uint32_t state[12];
+    uint8_t  buf_off;
+    uint8_t  align[3];
+} hydro_hash_state;
+
+void hydro_hash_keygen(uint8_t key[hydro_hash_KEYBYTES]);
+
+int hydro_hash_init(hydro_hash_state *state, const char ctx[hydro_hash_CONTEXTBYTES],
+                    const uint8_t key[hydro_hash_KEYBYTES]);
+
+int hydro_hash_update(hydro_hash_state *state, const void *in_, size_t in_len);
+
+int hydro_hash_final(hydro_hash_state *state, uint8_t *out, size_t out_len);
+
+int hydro_hash_hash(uint8_t *out, size_t out_len, const void *in_, size_t in_len,
+                    const char    ctx[hydro_hash_CONTEXTBYTES],
+                    const uint8_t key[hydro_hash_KEYBYTES]);
+
+/* ---------------- */
+
+#define hydro_secretbox_CONTEXTBYTES 8
+#define hydro_secretbox_HEADERBYTES (20 + 16)
+#define hydro_secretbox_KEYBYTES 32
+#define hydro_secretbox_PROBEBYTES 16
+
+void hydro_secretbox_keygen(uint8_t key[hydro_secretbox_KEYBYTES]);
+
+int hydro_secretbox_encrypt(uint8_t *c, const void *m_, size_t mlen, uint64_t msg_id,
+                            const char    ctx[hydro_secretbox_CONTEXTBYTES],
+                            const uint8_t key[hydro_secretbox_KEYBYTES]);
+
+int hydro_secretbox_decrypt(void *m_, const uint8_t *c, size_t clen, uint64_t msg_id,
+                            const char    ctx[hydro_secretbox_CONTEXTBYTES],
+                            const uint8_t key[hydro_secretbox_KEYBYTES])
+    _hydro_attr_warn_unused_result_;
+
+void hydro_secretbox_probe_create(uint8_t probe[hydro_secretbox_PROBEBYTES], const uint8_t *c,
+                                  size_t c_len, const char ctx[hydro_secretbox_CONTEXTBYTES],
+                                  const uint8_t key[hydro_secretbox_KEYBYTES]);
+
+int hydro_secretbox_probe_verify(const uint8_t probe[hydro_secretbox_PROBEBYTES], const uint8_t *c,
+                                 size_t c_len, const char ctx[hydro_secretbox_CONTEXTBYTES],
+                                 const uint8_t key[hydro_secretbox_KEYBYTES])
+    _hydro_attr_warn_unused_result_;
+
+/* ---------------- */
+
+#define hydro_kdf_CONTEXTBYTES 8
+#define hydro_kdf_KEYBYTES 32
+#define hydro_kdf_BYTES_MAX 65535
+#define hydro_kdf_BYTES_MIN 16
+
+void hydro_kdf_keygen(uint8_t key[hydro_kdf_KEYBYTES]);
+
+int hydro_kdf_derive_from_key(uint8_t *subkey, size_t subkey_len, uint64_t subkey_id,
+                              const char    ctx[hydro_kdf_CONTEXTBYTES],
+                              const uint8_t key[hydro_kdf_KEYBYTES]);
+
+/* ---------------- */
+
+#define hydro_sign_BYTES 64
+#define hydro_sign_CONTEXTBYTES 8
+#define hydro_sign_PUBLICKEYBYTES 32
+#define hydro_sign_SECRETKEYBYTES 64
+#define hydro_sign_SEEDBYTES 32
+
+typedef struct hydro_sign_state {
+    hydro_hash_state hash_st;
+} hydro_sign_state;
+
+typedef struct hydro_sign_keypair {
+    uint8_t pk[hydro_sign_PUBLICKEYBYTES];
+    uint8_t sk[hydro_sign_SECRETKEYBYTES];
+} hydro_sign_keypair;
+
+void hydro_sign_keygen(hydro_sign_keypair *kp);
+
+void hydro_sign_keygen_deterministic(hydro_sign_keypair *kp,
+                                     const uint8_t       seed[hydro_sign_SEEDBYTES]);
+
+int hydro_sign_init(hydro_sign_state *state, const char ctx[hydro_sign_CONTEXTBYTES]);
+
+int hydro_sign_update(hydro_sign_state *state, const void *m_, size_t mlen);
+
+int hydro_sign_final_create(hydro_sign_state *state, uint8_t csig[hydro_sign_BYTES],
+                            const uint8_t sk[hydro_sign_SECRETKEYBYTES]);
+
+int hydro_sign_final_verify(hydro_sign_state *state, const uint8_t csig[hydro_sign_BYTES],
+                            const uint8_t pk[hydro_sign_PUBLICKEYBYTES])
+    _hydro_attr_warn_unused_result_;
+
+int hydro_sign_create(uint8_t csig[hydro_sign_BYTES], const void *m_, size_t mlen,
+                      const char    ctx[hydro_sign_CONTEXTBYTES],
+                      const uint8_t sk[hydro_sign_SECRETKEYBYTES]);
+
+int hydro_sign_verify(const uint8_t csig[hydro_sign_BYTES], const void *m_, size_t mlen,
+                      const char    ctx[hydro_sign_CONTEXTBYTES],
+                      const uint8_t pk[hydro_sign_PUBLICKEYBYTES]) _hydro_attr_warn_unused_result_;
+
+/* ---------------- */
+
+#define hydro_kx_SESSIONKEYBYTES 32
+#define hydro_kx_PUBLICKEYBYTES 32
+#define hydro_kx_SECRETKEYBYTES 32
+#define hydro_kx_PSKBYTES 32
+#define hydro_kx_SEEDBYTES 32
+
+typedef struct hydro_kx_keypair {
+    uint8_t pk[hydro_kx_PUBLICKEYBYTES];
+    uint8_t sk[hydro_kx_SECRETKEYBYTES];
+} hydro_kx_keypair;
+
+typedef struct hydro_kx_session_keypair {
+    uint8_t rx[hydro_kx_SESSIONKEYBYTES];
+    uint8_t tx[hydro_kx_SESSIONKEYBYTES];
+} hydro_kx_session_keypair;
+
+typedef struct hydro_kx_state {
+    hydro_kx_keypair eph_kp;
+    uint8_t          h[32];
+    uint8_t          ck[32];
+    uint8_t          k[32];
+} hydro_kx_state;
+
+void hydro_kx_keygen(hydro_kx_keypair *static_kp);
+
+void hydro_kx_keygen_deterministic(hydro_kx_keypair *static_kp,
+                                   const uint8_t     seed[hydro_kx_SEEDBYTES]);
+
+/* NOISE_N */
+
+#define hydro_kx_N_PACKET1BYTES 32
+
+int hydro_kx_n_1(hydro_kx_session_keypair *kp, uint8_t packet1[hydro_kx_N_PACKET1BYTES],
+                 const uint8_t psk[hydro_kx_PSKBYTES],
+                 const uint8_t peer_static_pk[hydro_kx_PUBLICKEYBYTES]);
+
+int hydro_kx_n_2(hydro_kx_session_keypair *kp, const uint8_t packet1[hydro_kx_N_PACKET1BYTES],
+                 const uint8_t psk[hydro_kx_PSKBYTES], const hydro_kx_keypair *static_kp);
+
+/* NOISE_KK */
+
+#define hydro_kx_KK_PACKET1BYTES 32
+#define hydro_kx_KK_PACKET2BYTES 32
+
+int hydro_kx_kk_1(hydro_kx_state *state, uint8_t packet1[hydro_kx_KK_PACKET1BYTES],
+                  const uint8_t           peer_static_pk[hydro_kx_PUBLICKEYBYTES],
+                  const hydro_kx_keypair *static_kp);
+
+int hydro_kx_kk_2(hydro_kx_session_keypair *kp, uint8_t packet2[hydro_kx_KK_PACKET2BYTES],
+                  const uint8_t           packet1[hydro_kx_KK_PACKET1BYTES],
+                  const uint8_t           peer_static_pk[hydro_kx_PUBLICKEYBYTES],
+                  const hydro_kx_keypair *static_kp);
+
+int hydro_kx_kk_3(hydro_kx_state *state, hydro_kx_session_keypair *kp,
+                  const uint8_t packet2[hydro_kx_KK_PACKET2BYTES],
+                  const hydro_kx_keypair *static_kp);
+
+/* NOISE_XX */
+
+#define hydro_kx_XX_PACKET1BYTES 32
+#define hydro_kx_XX_PACKET2BYTES 80
+#define hydro_kx_XX_PACKET3BYTES 48
+
+int hydro_kx_xx_1(hydro_kx_state *state, uint8_t packet1[hydro_kx_XX_PACKET1BYTES],
+                  const uint8_t psk[hydro_kx_PSKBYTES]);
+
+int hydro_kx_xx_2(hydro_kx_state *state, uint8_t packet2[hydro_kx_XX_PACKET2BYTES],
+                  const uint8_t packet1[hydro_kx_XX_PACKET1BYTES],
+                  const uint8_t psk[hydro_kx_PSKBYTES], const hydro_kx_keypair *static_kp);
+
+int hydro_kx_xx_3(hydro_kx_state *state, hydro_kx_session_keypair *kp,
+                  uint8_t       packet3[hydro_kx_XX_PACKET3BYTES],
+                  uint8_t       peer_static_pk[hydro_kx_PUBLICKEYBYTES],
+                  const uint8_t packet2[hydro_kx_XX_PACKET2BYTES],
+                  const uint8_t psk[hydro_kx_PSKBYTES], const hydro_kx_keypair *static_kp);
+
+int hydro_kx_xx_4(hydro_kx_state *state, hydro_kx_session_keypair *kp,
+                  uint8_t       peer_static_pk[hydro_kx_PUBLICKEYBYTES],
+                  const uint8_t packet3[hydro_kx_XX_PACKET3BYTES],
+                  const uint8_t psk[hydro_kx_PSKBYTES]);
+
+/* ---------------- */
+
+#define hydro_pwhash_CONTEXTBYTES 8
+#define hydro_pwhash_MASTERKEYBYTES 32
+#define hydro_pwhash_STOREDBYTES 128
+
+void hydro_pwhash_keygen(uint8_t master_key[hydro_pwhash_MASTERKEYBYTES]);
+
+int hydro_pwhash_deterministic(uint8_t *h, size_t h_len, const char *passwd, size_t passwd_len,
+                               const char    ctx[hydro_pwhash_CONTEXTBYTES],
+                               const uint8_t master_key[hydro_pwhash_MASTERKEYBYTES],
+                               uint64_t opslimit, size_t memlimit, uint8_t threads);
+
+int hydro_pwhash_create(uint8_t stored[hydro_pwhash_STOREDBYTES], const char *passwd,
+                        size_t passwd_len, const uint8_t master_key[hydro_pwhash_MASTERKEYBYTES],
+                        uint64_t opslimit, size_t memlimit, uint8_t threads);
+
+int hydro_pwhash_verify(const uint8_t stored[hydro_pwhash_STOREDBYTES], const char *passwd,
+                        size_t passwd_len, const uint8_t master_key[hydro_pwhash_MASTERKEYBYTES],
+                        uint64_t opslimit_max, size_t memlimit_max, uint8_t threads_max);
+
+int hydro_pwhash_derive_static_key(uint8_t *static_key, size_t static_key_len,
+                                   const uint8_t stored[hydro_pwhash_STOREDBYTES],
+                                   const char *passwd, size_t passwd_len,
+                                   const char    ctx[hydro_pwhash_CONTEXTBYTES],
+                                   const uint8_t master_key[hydro_pwhash_MASTERKEYBYTES],
+                                   uint64_t opslimit_max, size_t memlimit_max, uint8_t threads_max);
+
+int hydro_pwhash_reencrypt(uint8_t       stored[hydro_pwhash_STOREDBYTES],
+                           const uint8_t master_key[hydro_pwhash_MASTERKEYBYTES],
+                           const uint8_t new_master_key[hydro_pwhash_MASTERKEYBYTES]);
+
+int hydro_pwhash_upgrade(uint8_t       stored[hydro_pwhash_STOREDBYTES],
+                         const uint8_t master_key[hydro_pwhash_MASTERKEYBYTES], uint64_t opslimit,
+                         size_t memlimit, uint8_t threads);
+
+/* ---------------- */
+
+void hydro_memzero(void *pnt, size_t len);
+
+void hydro_increment(uint8_t *n, size_t len);
+
+bool hydro_equal(const void *b1_, const void *b2_, size_t len);
+
+int hydro_compare(const uint8_t *b1_, const uint8_t *b2_, size_t len);
+
+char *hydro_bin2hex(char *hex, size_t hex_maxlen, const uint8_t *bin, size_t bin_len);
+
+int hydro_hex2bin(uint8_t *bin, size_t bin_maxlen, const char *hex, size_t hex_len,
+                  const char *ignore, const char **hex_end_p);
+
+int hydro_pad(unsigned char *buf, size_t unpadded_buflen, size_t blocksize, size_t max_buflen);
+
+int hydro_unpad(const unsigned char *buf, size_t padded_buflen, size_t blocksize);
+
+/* ---------------- */
+
+#define HYDRO_HWTYPE_ATMEGA328 1
+
+#ifndef HYDRO_HWTYPE
+# ifdef __AVR__
+#  define HYDRO_HWTYPE HYDRO_HWTYPE_ATMEGA328
+# endif
+#endif
+
+#ifdef __cplusplus
+}
+#endif
+
+#endif

+ 322 - 0
libhydrogen.mod/libhydrogen/impl/common.h

@@ -0,0 +1,322 @@
+#include <assert.h>
+#include <errno.h>
+#include <limits.h>
+#include <stdbool.h>
+#include <stdint.h>
+#include <stdlib.h>
+#include <string.h>
+
+#if !defined(__unix__) && (defined(__APPLE__) || defined(__linux__))
+# define __unix__ 1
+#endif
+#ifndef __GNUC__
+# define __restrict__
+#endif
+
+#if defined(__BYTE_ORDER__) && defined(__ORDER_BIG_ENDIAN__) && \
+    __BYTE_ORDER__ == __ORDER_BIG_ENDIAN__
+# define NATIVE_BIG_ENDIAN
+#endif
+#ifndef NATIVE_BIG_ENDIAN
+# ifndef NATIVE_LITTLE_ENDIAN
+#  define NATIVE_LITTLE_ENDIAN
+# endif
+#endif
+
+#ifndef TLS
+# if defined(_WIN32) && !defined(__GNUC__)
+#  define TLS __declspec(thread)
+# elif (defined(__clang__) || defined(__GNUC__)) && defined(__unix__)
+#  define TLS __thread
+# else
+#  define TLS
+# endif
+#endif
+
+#ifndef SIZE_MAX
+# define SIZE_MAX ((size_t) -1)
+#endif
+
+#ifdef __OpenBSD__
+# define HAVE_EXPLICIT_BZERO 1
+#elif defined(__GLIBC__) && defined(__GLIBC_PREREQ) && defined(_GNU_SOURCE)
+# if __GLIBC_PREREQ(2, 25)
+#  define HAVE_EXPLICIT_BZERO 1
+# endif
+#endif
+
+#define COMPILER_ASSERT(X) (void) sizeof(char[(X) ? 1 : -1])
+
+#define ROTL32(x, b) (uint32_t)(((x) << (b)) | ((x) >> (32 - (b))))
+#define ROTL64(x, b) (uint64_t)(((x) << (b)) | ((x) >> (64 - (b))))
+#define ROTR32(x, b) (uint32_t)(((x) >> (b)) | ((x) << (32 - (b))))
+#define ROTR64(x, b) (uint64_t)(((x) >> (b)) | ((x) << (64 - (b))))
+
+#define LOAD64_LE(SRC) load64_le(SRC)
+static inline uint64_t
+load64_le(const uint8_t src[8])
+{
+#ifdef NATIVE_LITTLE_ENDIAN
+    uint64_t w;
+    memcpy(&w, src, sizeof w);
+    return w;
+#else
+    uint64_t w = (uint64_t) src[0];
+    w |= (uint64_t) src[1] << 8;
+    w |= (uint64_t) src[2] << 16;
+    w |= (uint64_t) src[3] << 24;
+    w |= (uint64_t) src[4] << 32;
+    w |= (uint64_t) src[5] << 40;
+    w |= (uint64_t) src[6] << 48;
+    w |= (uint64_t) src[7] << 56;
+    return w;
+#endif
+}
+
+#define STORE64_LE(DST, W) store64_le((DST), (W))
+static inline void
+store64_le(uint8_t dst[8], uint64_t w)
+{
+#ifdef NATIVE_LITTLE_ENDIAN
+    memcpy(dst, &w, sizeof w);
+#else
+    dst[0] = (uint8_t) w;
+    w >>= 8;
+    dst[1] = (uint8_t) w;
+    w >>= 8;
+    dst[2] = (uint8_t) w;
+    w >>= 8;
+    dst[3] = (uint8_t) w;
+    w >>= 8;
+    dst[4] = (uint8_t) w;
+    w >>= 8;
+    dst[5] = (uint8_t) w;
+    w >>= 8;
+    dst[6] = (uint8_t) w;
+    w >>= 8;
+    dst[7] = (uint8_t) w;
+#endif
+}
+
+#define LOAD32_LE(SRC) load32_le(SRC)
+static inline uint32_t
+load32_le(const uint8_t src[4])
+{
+#ifdef NATIVE_LITTLE_ENDIAN
+    uint32_t w;
+    memcpy(&w, src, sizeof w);
+    return w;
+#else
+    uint32_t w = (uint32_t) src[0];
+    w |= (uint32_t) src[1] << 8;
+    w |= (uint32_t) src[2] << 16;
+    w |= (uint32_t) src[3] << 24;
+    return w;
+#endif
+}
+
+#define STORE32_LE(DST, W) store32_le((DST), (W))
+static inline void
+store32_le(uint8_t dst[4], uint32_t w)
+{
+#ifdef NATIVE_LITTLE_ENDIAN
+    memcpy(dst, &w, sizeof w);
+#else
+    dst[0] = (uint8_t) w;
+    w >>= 8;
+    dst[1] = (uint8_t) w;
+    w >>= 8;
+    dst[2] = (uint8_t) w;
+    w >>= 8;
+    dst[3] = (uint8_t) w;
+#endif
+}
+
+#define LOAD16_LE(SRC) load16_le(SRC)
+static inline uint16_t
+load16_le(const uint8_t src[2])
+{
+#ifdef NATIVE_LITTLE_ENDIAN
+    uint16_t w;
+    memcpy(&w, src, sizeof w);
+    return w;
+#else
+    uint16_t w = (uint16_t) src[0];
+    w |= (uint16_t) src[1] << 8;
+    return w;
+#endif
+}
+
+#define STORE16_LE(DST, W) store16_le((DST), (W))
+static inline void
+store16_le(uint8_t dst[2], uint16_t w)
+{
+#ifdef NATIVE_LITTLE_ENDIAN
+    memcpy(dst, &w, sizeof w);
+#else
+    dst[0] = (uint8_t) w;
+    w >>= 8;
+    dst[1] = (uint8_t) w;
+#endif
+}
+
+/* ----- */
+
+#define LOAD64_BE(SRC) load64_be(SRC)
+static inline uint64_t
+load64_be(const uint8_t src[8])
+{
+#ifdef NATIVE_BIG_ENDIAN
+    uint64_t w;
+    memcpy(&w, src, sizeof w);
+    return w;
+#else
+    uint64_t w = (uint64_t) src[7];
+    w |= (uint64_t) src[6] << 8;
+    w |= (uint64_t) src[5] << 16;
+    w |= (uint64_t) src[4] << 24;
+    w |= (uint64_t) src[3] << 32;
+    w |= (uint64_t) src[2] << 40;
+    w |= (uint64_t) src[1] << 48;
+    w |= (uint64_t) src[0] << 56;
+    return w;
+#endif
+}
+
+#define STORE64_BE(DST, W) store64_be((DST), (W))
+static inline void
+store64_be(uint8_t dst[8], uint64_t w)
+{
+#ifdef NATIVE_BIG_ENDIAN
+    memcpy(dst, &w, sizeof w);
+#else
+    dst[7] = (uint8_t) w;
+    w >>= 8;
+    dst[6] = (uint8_t) w;
+    w >>= 8;
+    dst[5] = (uint8_t) w;
+    w >>= 8;
+    dst[4] = (uint8_t) w;
+    w >>= 8;
+    dst[3] = (uint8_t) w;
+    w >>= 8;
+    dst[2] = (uint8_t) w;
+    w >>= 8;
+    dst[1] = (uint8_t) w;
+    w >>= 8;
+    dst[0] = (uint8_t) w;
+#endif
+}
+
+#define LOAD32_BE(SRC) load32_be(SRC)
+static inline uint32_t
+load32_be(const uint8_t src[4])
+{
+#ifdef NATIVE_BIG_ENDIAN
+    uint32_t w;
+    memcpy(&w, src, sizeof w);
+    return w;
+#else
+    uint32_t w = (uint32_t) src[3];
+    w |= (uint32_t) src[2] << 8;
+    w |= (uint32_t) src[1] << 16;
+    w |= (uint32_t) src[0] << 24;
+    return w;
+#endif
+}
+
+#define STORE32_BE(DST, W) store32_be((DST), (W))
+static inline void
+store32_be(uint8_t dst[4], uint32_t w)
+{
+#ifdef NATIVE_BIG_ENDIAN
+    memcpy(dst, &w, sizeof w);
+#else
+    dst[3] = (uint8_t) w;
+    w >>= 8;
+    dst[2] = (uint8_t) w;
+    w >>= 8;
+    dst[1] = (uint8_t) w;
+    w >>= 8;
+    dst[0] = (uint8_t) w;
+#endif
+}
+
+#define LOAD16_BE(SRC) load16_be(SRC)
+static inline uint16_t
+load16_be(const uint8_t src[2])
+{
+#ifdef NATIVE_BIG_ENDIAN
+    uint16_t w;
+    memcpy(&w, src, sizeof w);
+    return w;
+#else
+    uint16_t w = (uint16_t) src[1];
+    w |= (uint16_t) src[0] << 8;
+    return w;
+#endif
+}
+
+#define STORE16_BE(DST, W) store16_be((DST), (W))
+static inline void
+store16_be(uint8_t dst[2], uint16_t w)
+{
+#ifdef NATIVE_BIG_ENDIAN
+    memcpy(dst, &w, sizeof w);
+#else
+    dst[1] = (uint8_t) w;
+    w >>= 8;
+    dst[0] = (uint8_t) w;
+#endif
+}
+
+static inline void
+mem_cpy(void *__restrict__ dst_, const void *__restrict__ src_, size_t n)
+{
+    unsigned char *      dst = (unsigned char *) dst_;
+    const unsigned char *src = (const unsigned char *) src_;
+    size_t               i;
+
+    for (i = 0; i < n; i++) {
+        dst[i] = src[i];
+    }
+}
+
+static inline void
+mem_zero(void *dst_, size_t n)
+{
+    unsigned char *dst = (unsigned char *) dst_;
+    size_t         i;
+
+    for (i = 0; i < n; i++) {
+        dst[i] = 0;
+    }
+}
+
+static inline void
+mem_xor(void *__restrict__ dst_, const void *__restrict__ src_, size_t n)
+{
+    unsigned char *      dst = (unsigned char *) dst_;
+    const unsigned char *src = (const unsigned char *) src_;
+    size_t               i;
+
+    for (i = 0; i < n; i++) {
+        dst[i] ^= src[i];
+    }
+}
+
+static inline void
+mem_xor2(void *__restrict__ dst_, const void *__restrict__ src1_, const void *__restrict__ src2_,
+         size_t n)
+{
+    unsigned char *      dst  = (unsigned char *) dst_;
+    const unsigned char *src1 = (const unsigned char *) src1_;
+    const unsigned char *src2 = (const unsigned char *) src2_;
+    size_t               i;
+
+    for (i = 0; i < n; i++) {
+        dst[i] = src1[i] ^ src2[i];
+    }
+}
+
+static const uint8_t zero[64] = { 0 };

+ 224 - 0
libhydrogen.mod/libhydrogen/impl/core.h

@@ -0,0 +1,224 @@
+int
+hydro_init(void)
+{
+    if (hydro_random_init() != 0) {
+        abort();
+    }
+    return 0;
+}
+
+void
+hydro_memzero(void *pnt, size_t len)
+{
+#ifdef HAVE_EXPLICIT_BZERO
+    explicit_bzero(pnt, len);
+#else
+    volatile unsigned char *volatile pnt_ = (volatile unsigned char *volatile) pnt;
+    size_t i                              = (size_t) 0U;
+
+    while (i < len) {
+        pnt_[i++] = 0U;
+    }
+#endif
+}
+
+void
+hydro_increment(uint8_t *n, size_t len)
+{
+    size_t        i;
+    uint_fast16_t c = 1U;
+
+    for (i = 0; i < len; i++) {
+        c += (uint_fast16_t) n[i];
+        n[i] = (uint8_t) c;
+        c >>= 8;
+    }
+}
+
+char *
+hydro_bin2hex(char *hex, size_t hex_maxlen, const uint8_t *bin, size_t bin_len)
+{
+    size_t       i = (size_t) 0U;
+    unsigned int x;
+    int          b;
+    int          c;
+
+    if (bin_len >= SIZE_MAX / 2 || hex_maxlen <= bin_len * 2U) {
+        abort();
+    }
+    while (i < bin_len) {
+        c = bin[i] & 0xf;
+        b = bin[i] >> 4;
+        x = (unsigned char) (87U + c + (((c - 10U) >> 8) & ~38U)) << 8 |
+            (unsigned char) (87U + b + (((b - 10U) >> 8) & ~38U));
+        hex[i * 2U] = (char) x;
+        x >>= 8;
+        hex[i * 2U + 1U] = (char) x;
+        i++;
+    }
+    hex[i * 2U] = 0U;
+
+    return hex;
+}
+
+int
+hydro_hex2bin(uint8_t *bin, size_t bin_maxlen, const char *hex, size_t hex_len, const char *ignore,
+              const char **hex_end_p)
+{
+    size_t        bin_pos = (size_t) 0U;
+    size_t        hex_pos = (size_t) 0U;
+    int           ret     = 0;
+    unsigned char c;
+    unsigned char c_alpha0, c_alpha;
+    unsigned char c_num0, c_num;
+    uint8_t       c_acc = 0U;
+    uint8_t       c_val;
+    unsigned char state = 0U;
+
+    while (hex_pos < hex_len) {
+        c        = (unsigned char) hex[hex_pos];
+        c_num    = c ^ 48U;
+        c_num0   = (c_num - 10U) >> 8;
+        c_alpha  = (c & ~32U) - 55U;
+        c_alpha0 = ((c_alpha - 10U) ^ (c_alpha - 16U)) >> 8;
+        if ((c_num0 | c_alpha0) == 0U) {
+            if (ignore != NULL && state == 0U && strchr(ignore, c) != NULL) {
+                hex_pos++;
+                continue;
+            }
+            break;
+        }
+        c_val = (uint8_t)((c_num0 & c_num) | (c_alpha0 & c_alpha));
+        if (bin_pos >= bin_maxlen) {
+            ret   = -1;
+            errno = ERANGE;
+            break;
+        }
+        if (state == 0U) {
+            c_acc = c_val * 16U;
+        } else {
+            bin[bin_pos++] = c_acc | c_val;
+        }
+        state = ~state;
+        hex_pos++;
+    }
+    if (state != 0U) {
+        hex_pos--;
+        errno = EINVAL;
+        ret   = -1;
+    }
+    if (ret != 0) {
+        bin_pos = (size_t) 0U;
+    }
+    if (hex_end_p != NULL) {
+        *hex_end_p = &hex[hex_pos];
+    } else if (hex_pos != hex_len) {
+        errno = EINVAL;
+        ret   = -1;
+    }
+    if (ret != 0) {
+        return ret;
+    }
+    return (int) bin_pos;
+}
+
+bool
+hydro_equal(const void *b1_, const void *b2_, size_t len)
+{
+    const volatile uint8_t *volatile b1 = (const volatile uint8_t *volatile) b1_;
+    const uint8_t *b2                   = (const uint8_t *) b2_;
+    size_t         i;
+    uint8_t        d = (uint8_t) 0U;
+
+    if (b1 == b2) {
+        d = ~d;
+    }
+    for (i = 0U; i < len; i++) {
+        d |= b1[i] ^ b2[i];
+    }
+    return (bool) (1 & ((d - 1) >> 8));
+}
+
+int
+hydro_compare(const uint8_t *b1_, const uint8_t *b2_, size_t len)
+{
+    const volatile uint8_t *volatile b1 = (const volatile uint8_t *volatile) b1_;
+    const uint8_t *b2                   = (const uint8_t *) b2_;
+    uint8_t        gt                   = 0U;
+    uint8_t        eq                   = 1U;
+    size_t         i;
+
+    i = len;
+    while (i != 0U) {
+        i--;
+        gt |= ((b2[i] - b1[i]) >> 8) & eq;
+        eq &= ((b2[i] ^ b1[i]) - 1) >> 8;
+    }
+    return (int) (gt + gt + eq) - 1;
+}
+
+int
+hydro_pad(unsigned char *buf, size_t unpadded_buflen, size_t blocksize, size_t max_buflen)
+{
+    unsigned char *        tail;
+    size_t                 i;
+    size_t                 xpadlen;
+    size_t                 xpadded_len;
+    volatile unsigned char mask;
+    unsigned char          barrier_mask;
+
+    if (blocksize <= 0U || max_buflen > INT_MAX) {
+        return -1;
+    }
+    xpadlen = blocksize - 1U;
+    if ((blocksize & (blocksize - 1U)) == 0U) {
+        xpadlen -= unpadded_buflen & (blocksize - 1U);
+    } else {
+        xpadlen -= unpadded_buflen % blocksize;
+    }
+    if (SIZE_MAX - unpadded_buflen <= xpadlen) {
+        return -1;
+    }
+    xpadded_len = unpadded_buflen + xpadlen;
+    if (xpadded_len >= max_buflen) {
+        return -1;
+    }
+    tail = &buf[xpadded_len];
+    mask = 0U;
+    for (i = 0; i < blocksize; i++) {
+        barrier_mask = (unsigned char)
+	 (((i ^ xpadlen) - 1U) >> ((sizeof(size_t) - 1U) * CHAR_BIT));
+        tail[-i]     = (tail[-i] & mask) | (0x80 & barrier_mask);
+        mask |= barrier_mask;
+    }
+    return (int) (xpadded_len + 1);
+}
+
+int
+hydro_unpad(const unsigned char *buf, size_t padded_buflen, size_t blocksize)
+{
+    const unsigned char *tail;
+    unsigned char        acc = 0U;
+    unsigned char        c;
+    unsigned char        valid   = 0U;
+    volatile size_t      pad_len = 0U;
+    size_t               i;
+    size_t               is_barrier;
+
+    if (padded_buflen < blocksize || blocksize <= 0U) {
+        return -1;
+    }
+    tail = &buf[padded_buflen - 1U];
+
+    for (i = 0U; i < blocksize; i++) {
+        c          = tail[-i];
+        is_barrier = (((acc - 1U) & (pad_len - 1U) & ((c ^ 0x80) - 1U)) >> 8) & 1U;
+        acc |= c;
+        pad_len |= (i & -is_barrier);
+        valid |= (unsigned char) is_barrier;
+    }
+    if (valid == 0) {
+        return -1;
+    }
+    return (int) (padded_buflen - 1 - pad_len);
+}

+ 25 - 0
libhydrogen.mod/libhydrogen/impl/gimli-core.h

@@ -0,0 +1,25 @@
+#ifdef __SSE2__
+# include "gimli-core/sse2.h"
+#else
+# include "gimli-core/portable.h"
+#endif
+
+static void
+gimli_core_u8(uint8_t state_u8[gimli_BLOCKBYTES], uint8_t tag)
+{
+    state_u8[gimli_BLOCKBYTES - 1] ^= tag;
+#ifndef NATIVE_LITTLE_ENDIAN
+    uint32_t state_u32[12];
+    int      i;
+
+    for (i = 0; i < 12; i++) {
+        state_u32[i] = LOAD32_LE(&state_u8[i * 4]);
+    }
+    gimli_core(state_u32);
+    for (i = 0; i < 12; i++) {
+        STORE32_LE(&state_u8[i * 4], state_u32[i]);
+    }
+#else
+    gimli_core((uint32_t *) (void *) state_u8); /* state_u8 must be properly aligned */
+#endif
+}

+ 39 - 0
libhydrogen.mod/libhydrogen/impl/gimli-core/portable.h

@@ -0,0 +1,39 @@
+static void
+gimli_core(uint32_t state[gimli_BLOCKBYTES / 4])
+{
+    unsigned int round;
+    unsigned int column;
+    uint32_t     x;
+    uint32_t     y;
+    uint32_t     z;
+
+    for (round = 24; round > 0; round--) {
+        for (column = 0; column < 4; column++) {
+            x = ROTL32(state[column], 24);
+            y = ROTL32(state[4 + column], 9);
+            z = state[8 + column];
+
+            state[8 + column] = x ^ (z << 1) ^ ((y & z) << 2);
+            state[4 + column] = y ^ x ^ ((x | z) << 1);
+            state[column]     = z ^ y ^ ((x & y) << 3);
+        }
+        switch (round & 3) {
+        case 0:
+            x        = state[0];
+            state[0] = state[1];
+            state[1] = x;
+            x        = state[2];
+            state[2] = state[3];
+            state[3] = x;
+            state[0] ^= ((uint32_t) 0x9e377900 | round);
+            break;
+        case 2:
+            x        = state[0];
+            state[0] = state[2];
+            state[2] = x;
+            x        = state[1];
+            state[1] = state[3];
+            state[3] = x;
+        }
+    }
+}

+ 97 - 0
libhydrogen.mod/libhydrogen/impl/gimli-core/sse2.h

@@ -0,0 +1,97 @@
+#include <tmmintrin.h>
+
+#define S 9
+
+static inline __m128i
+shift(__m128i x, int bits)
+{
+    return _mm_slli_epi32(x, bits);
+}
+
+static inline __m128i
+rotate(__m128i x, int bits)
+{
+    return _mm_slli_epi32(x, bits) | _mm_srli_epi32(x, 32 - bits);
+}
+
+#ifdef __SSSE3__
+static inline __m128i
+rotate24(__m128i x)
+{
+    return _mm_shuffle_epi8(x, _mm_set_epi8(12, 15, 14, 13, 8, 11, 10, 9, 4, 7, 6, 5, 0, 3, 2, 1));
+}
+#else
+static inline __m128i
+rotate24(__m128i x)
+{
+    uint8_t _hydro_attr_aligned_(16) x8[16], y8[16];
+
+    _mm_storeu_si128((__m128i *) (void *) x8, x);
+
+    y8[ 0] = x8[ 1]; y8[ 1] = x8[ 2]; y8[ 2] = x8[ 3]; y8[ 3] = x8[ 0];
+    y8[ 4] = x8[ 5]; y8[ 5] = x8[ 6]; y8[ 6] = x8[ 7]; y8[ 7] = x8[ 4];
+    y8[ 8] = x8[ 9]; y8[ 9] = x8[10]; y8[10] = x8[11]; y8[11] = x8[ 8];
+    y8[12] = x8[13]; y8[13] = x8[14]; y8[14] = x8[15]; y8[15] = x8[12];
+
+    return _mm_loadu_si128((const __m128i *) (const void *) y8);
+}
+#endif
+
+static const uint32_t coeffs[24] _hydro_attr_aligned_(16) = {
+    0x9e377904, 0, 0, 0, 0x9e377908, 0, 0, 0, 0x9e37790c, 0, 0, 0,
+    0x9e377910, 0, 0, 0, 0x9e377914, 0, 0, 0, 0x9e377918, 0, 0, 0,
+};
+
+static void
+gimli_core(uint32_t state[gimli_BLOCKBYTES / 4])
+{
+    __m128i x = _mm_loadu_si128((const __m128i *) (const void *) &state[0]);
+    __m128i y = _mm_loadu_si128((const __m128i *) (const void *) &state[4]);
+    __m128i z = _mm_loadu_si128((const __m128i *) (const void *) &state[8]);
+    __m128i newy;
+    __m128i newz;
+    int     round;
+
+    for (round = 5; round >= 0; round--) {
+        x    = rotate24(x);
+        y    = rotate(y, S);
+        newz = x ^ shift(z, 1) ^ shift(y & z, 2);
+        newy = y ^ x ^ shift(x | z, 1);
+        x    = z ^ y ^ shift(x & y, 3);
+        y    = newy;
+        z    = newz;
+
+        x = _mm_shuffle_epi32(x, _MM_SHUFFLE(2, 3, 0, 1));
+        x ^= ((const __m128i *) (const void *) coeffs)[round];
+
+        x    = rotate24(x);
+        y    = rotate(y, S);
+        newz = x ^ shift(z, 1) ^ shift(y & z, 2);
+        newy = y ^ x ^ shift(x | z, 1);
+        x    = z ^ y ^ shift(x & y, 3);
+        y    = newy;
+        z    = newz;
+
+        x    = rotate24(x);
+        y    = rotate(y, S);
+        newz = x ^ shift(z, 1) ^ shift(y & z, 2);
+        newy = y ^ x ^ shift(x | z, 1);
+        x    = z ^ y ^ shift(x & y, 3);
+        y    = newy;
+        z    = newz;
+
+        x = _mm_shuffle_epi32(x, _MM_SHUFFLE(1, 0, 3, 2));
+
+        x    = rotate24(x);
+        y    = rotate(y, S);
+        newz = x ^ shift(z, 1) ^ shift(y & z, 2);
+        newy = y ^ x ^ shift(x | z, 1);
+        x    = z ^ y ^ shift(x & y, 3);
+        y    = newy;
+        z    = newz;
+    }
+
+    _mm_storeu_si128((__m128i *) (void *) &state[0], x);
+    _mm_storeu_si128((__m128i *) (void *) &state[4], y);
+    _mm_storeu_si128((__m128i *) (void *) &state[8], z);
+}

+ 138 - 0
libhydrogen.mod/libhydrogen/impl/hash.h

@@ -0,0 +1,138 @@
+int
+hydro_hash_update(hydro_hash_state *state, const void *in_, size_t in_len)
+{
+    const uint8_t *in  = (const uint8_t *) in_;
+    uint8_t *      buf = (uint8_t *) (void *) state->state;
+    size_t         left;
+    size_t         ps;
+    size_t         i;
+
+    while (in_len > 0) {
+        if ((left = gimli_RATE - state->buf_off) == 0) {
+            gimli_core_u8(buf, 0);
+            state->buf_off = 0;
+            left           = gimli_RATE;
+        }
+        if ((ps = in_len) > left) {
+            ps = left;
+        }
+        for (i = 0; i < ps; i++) {
+            buf[state->buf_off + i] ^= in[i];
+        }
+        state->buf_off += (uint8_t) ps;
+        in += ps;
+        in_len -= ps;
+    }
+    return 0;
+}
+
+/* pad(str_enc("kmac") || str_enc(context)) || pad(str_enc(k)) ||
+   msg || right_enc(msg_len) || 0x00 */
+
+int
+hydro_hash_init(hydro_hash_state *state, const char ctx[hydro_hash_CONTEXTBYTES],
+                const uint8_t key[hydro_hash_KEYBYTES])
+{
+    uint8_t block[64] = { 4, 'k', 'm', 'a', 'c', 8 };
+    size_t  p;
+
+    COMPILER_ASSERT(hydro_hash_KEYBYTES <= sizeof block - gimli_RATE - 1);
+    COMPILER_ASSERT(hydro_hash_CONTEXTBYTES == 8);
+    mem_zero(block + 14, sizeof block - 14);
+    memcpy(block + 6, ctx, 8);
+    if (key != NULL) {
+        block[gimli_RATE] = (uint8_t) hydro_hash_KEYBYTES;
+        memcpy(block + gimli_RATE + 1, key, hydro_hash_KEYBYTES);
+        p = (gimli_RATE + 1 + hydro_hash_KEYBYTES + (gimli_RATE - 1)) & ~(size_t)(gimli_RATE - 1);
+    } else {
+        block[gimli_RATE] = (uint8_t) 0;
+        p                 = (gimli_RATE + 1 + 0 + (gimli_RATE - 1)) & ~(size_t)(gimli_RATE - 1);
+    }
+    mem_zero(state, sizeof *state);
+    hydro_hash_update(state, block, p);
+
+    return 0;
+}
+
+/* pad(str_enc("tmac") || str_enc(context)) || pad(str_enc(k)) ||
+   pad(right_enc(tweak)) || msg || right_enc(msg_len) || 0x00 */
+
+static int
+hydro_hash_init_with_tweak(hydro_hash_state *state, const char ctx[hydro_hash_CONTEXTBYTES],
+                           uint64_t tweak, const uint8_t key[hydro_hash_KEYBYTES])
+{
+    uint8_t block[80] = { 4, 't', 'm', 'a', 'c', 8 };
+    size_t  p;
+
+    COMPILER_ASSERT(hydro_hash_KEYBYTES <= sizeof block - 2 * gimli_RATE - 1);
+    COMPILER_ASSERT(hydro_hash_CONTEXTBYTES == 8);
+    mem_zero(block + 14, sizeof block - 14);
+    memcpy(block + 6, ctx, 8);
+    if (key != NULL) {
+        block[gimli_RATE] = (uint8_t) hydro_hash_KEYBYTES;
+        memcpy(block + gimli_RATE + 1, key, hydro_hash_KEYBYTES);
+        p = (gimli_RATE + 1 + hydro_hash_KEYBYTES + (gimli_RATE - 1)) & ~(size_t)(gimli_RATE - 1);
+    } else {
+        block[gimli_RATE] = (uint8_t) 0;
+        p                 = (gimli_RATE + 1 + 0 + (gimli_RATE - 1)) & ~(size_t)(gimli_RATE - 1);
+    }
+    block[p] = (uint8_t) sizeof tweak;
+    STORE64_LE(&block[p + 1], tweak);
+    p += gimli_RATE;
+    mem_zero(state, sizeof *state);
+    hydro_hash_update(state, block, p);
+
+    return 0;
+}
+
+int
+hydro_hash_final(hydro_hash_state *state, uint8_t *out, size_t out_len)
+{
+    uint8_t  lc[4];
+    uint8_t *buf = (uint8_t *) (void *) state->state;
+    size_t   i;
+    size_t   lc_len;
+    size_t   leftover;
+
+    if (out_len < hydro_hash_BYTES_MIN || out_len > hydro_hash_BYTES_MAX) {
+        return -1;
+    }
+    COMPILER_ASSERT(hydro_hash_BYTES_MAX <= 0xffff);
+    lc[1]  = (uint8_t) out_len;
+    lc[2]  = (uint8_t)(out_len >> 8);
+    lc[3]  = 0;
+    lc_len = (size_t)(1 + (lc[2] != 0));
+    lc[0]  = (uint8_t) lc_len;
+    hydro_hash_update(state, lc, 1 + lc_len + 1);
+    gimli_pad_u8(buf, state->buf_off, gimli_DOMAIN_XOF);
+    for (i = 0; i < out_len / gimli_RATE; i++) {
+        gimli_core_u8(buf, 0);
+        memcpy(out + i * gimli_RATE, buf, gimli_RATE);
+    }
+    leftover = out_len % gimli_RATE;
+    if (leftover != 0) {
+        gimli_core_u8(buf, 0);
+        mem_cpy(out + i * gimli_RATE, buf, leftover);
+    }
+    return 0;
+}
+
+int
+hydro_hash_hash(uint8_t *out, size_t out_len, const void *in_, size_t in_len,
+                const char ctx[hydro_hash_CONTEXTBYTES], const uint8_t key[hydro_hash_KEYBYTES])
+{
+    hydro_hash_state st;
+    const uint8_t *  in = (const uint8_t *) in_;
+
+    if (hydro_hash_init(&st, ctx, key) != 0 || hydro_hash_update(&st, in, in_len) != 0 ||
+        hydro_hash_final(&st, out, out_len) != 0) {
+        return -1;
+    }
+    return 0;
+}
+
+void
+hydro_hash_keygen(uint8_t key[hydro_hash_KEYBYTES])
+{
+    hydro_random_buf(key, hydro_hash_KEYBYTES);
+}

+ 83 - 0
libhydrogen.mod/libhydrogen/impl/hydrogen_p.h

@@ -0,0 +1,83 @@
+static int hydro_random_init(void);
+
+/* ---------------- */
+
+#define gimli_BLOCKBYTES 48
+#define gimli_CAPACITY   32
+#define gimli_RATE       16
+
+#define gimli_TAG_HEADER  0x01
+#define gimli_TAG_PAYLOAD 0x02
+#define gimli_TAG_FINAL   0x08
+#define gimli_TAG_FINAL0  0xf8
+#define gimli_TAG_KEY0    0xfe
+#define gimli_TAG_KEY     0xff
+
+#define gimli_DOMAIN_AEAD 0x0
+#define gimli_DOMAIN_XOF  0xf
+
+static void gimli_core_u8(uint8_t state_u8[gimli_BLOCKBYTES], uint8_t tag);
+
+static inline void
+gimli_pad_u8(uint8_t buf[gimli_BLOCKBYTES], size_t pos, uint8_t domain)
+{
+    buf[pos] ^= (domain << 1) | 1;
+    buf[gimli_RATE - 1] ^= 0x80;
+}
+
+static inline void
+hydro_mem_ct_zero_u32(uint32_t *dst_, size_t n)
+{
+    volatile uint32_t *volatile dst = (volatile uint32_t * volatile)(void *) dst_;
+    size_t i;
+
+    for (i = 0; i < n; i++) {
+        dst[i] = 0;
+    }
+}
+
+static inline uint32_t hydro_mem_ct_cmp_u32(const uint32_t *b1_, const uint32_t *b2,
+                                            size_t n) _hydro_attr_warn_unused_result_;
+
+static inline uint32_t
+hydro_mem_ct_cmp_u32(const uint32_t *b1_, const uint32_t *b2, size_t n)
+{
+    const volatile uint32_t *volatile b1 = (const volatile uint32_t *volatile)(const void *) b1_;
+    size_t   i;
+    uint32_t cv = 0;
+
+    for (i = 0; i < n; i++) {
+        cv |= b1[i] ^ b2[i];
+    }
+    return cv;
+}
+
+/* ---------------- */
+
+static int hydro_hash_init_with_tweak(hydro_hash_state *state,
+                                      const char ctx[hydro_hash_CONTEXTBYTES], uint64_t tweak,
+                                      const uint8_t key[hydro_hash_KEYBYTES]);
+
+/* ---------------- */
+
+#define hydro_secretbox_NONCEBYTES 20
+#define hydro_secretbox_MACBYTES 16
+
+/* ---------------- */
+
+#define hydro_x25519_BYTES 32
+#define hydro_x25519_PUBLICKEYBYTES 32
+#define hydro_x25519_SECRETKEYBYTES 32
+
+static int hydro_x25519_scalarmult(uint8_t       out[hydro_x25519_BYTES],
+                                   const uint8_t scalar[hydro_x25519_BYTES],
+                                   const uint8_t x1[hydro_x25519_BYTES],
+                                   bool          clamp) _hydro_attr_warn_unused_result_;
+
+static inline int hydro_x25519_scalarmult_base(uint8_t       pk[hydro_x25519_PUBLICKEYBYTES],
+                                               const uint8_t sk[hydro_x25519_SECRETKEYBYTES])
+    _hydro_attr_warn_unused_result_;
+
+static inline void
+hydro_x25519_scalarmult_base_uniform(uint8_t       pk[hydro_x25519_PUBLICKEYBYTES],
+                                     const uint8_t sk[hydro_x25519_SECRETKEYBYTES]);

+ 20 - 0
libhydrogen.mod/libhydrogen/impl/kdf.h

@@ -0,0 +1,20 @@
+int
+hydro_kdf_derive_from_key(uint8_t *subkey, size_t subkey_len, uint64_t subkey_id,
+                          const char    ctx[hydro_kdf_CONTEXTBYTES],
+                          const uint8_t key[hydro_kdf_KEYBYTES])
+{
+    hydro_hash_state st;
+
+    COMPILER_ASSERT(hydro_kdf_CONTEXTBYTES >= hydro_hash_CONTEXTBYTES);
+    COMPILER_ASSERT(hydro_kdf_KEYBYTES >= hydro_hash_KEYBYTES);
+    if (hydro_hash_init_with_tweak(&st, ctx, subkey_id, key) != 0) {
+        return -1;
+    }
+    return hydro_hash_final(&st, subkey, subkey_len);
+}
+
+void
+hydro_kdf_keygen(uint8_t key[hydro_kdf_KEYBYTES])
+{
+    hydro_random_buf(key, hydro_kdf_KEYBYTES);
+}

+ 441 - 0
libhydrogen.mod/libhydrogen/impl/kx.h

@@ -0,0 +1,441 @@
+#define hydro_kx_AEAD_KEYBYTES hydro_hash_KEYBYTES
+#define hydro_kx_AEAD_MACBYTES 16
+#define hydro_kx_AEAD_HEADERBYTES hydro_kx_AEAD_MACBYTES
+
+#define hydro_kx_CONTEXT "hydro_kx"
+#define hydro_kx_CONTEXT_CK_K "kdf_ck_k"
+
+void
+hydro_kx_keygen(hydro_kx_keypair *static_kp)
+{
+    hydro_random_buf(static_kp->sk, hydro_kx_SECRETKEYBYTES);
+    if (hydro_x25519_scalarmult_base(static_kp->pk, static_kp->sk) != 0) {
+        abort();
+    }
+}
+
+void
+hydro_kx_keygen_deterministic(hydro_kx_keypair *static_kp, const uint8_t seed[hydro_kx_SEEDBYTES])
+{
+    COMPILER_ASSERT(hydro_kx_SEEDBYTES >= hydro_random_SEEDBYTES);
+    hydro_random_buf_deterministic(static_kp->sk, hydro_kx_SECRETKEYBYTES, seed);
+    if (hydro_x25519_scalarmult_base(static_kp->pk, static_kp->sk) != 0) {
+        abort();
+    }
+}
+
+static void
+hydro_kx_aead_setup(uint8_t buf[gimli_BLOCKBYTES], const hydro_kx_state *state,
+                    const uint8_t psk[hydro_kx_PSKBYTES])
+{
+    static const uint8_t prefix[] = { 6, 'k', 'x', 'x', '2', '5', '6', 0 };
+
+    mem_zero(buf + sizeof prefix, gimli_BLOCKBYTES - sizeof prefix);
+    memcpy(buf, prefix, sizeof prefix);
+    gimli_core_u8(buf, gimli_TAG_HEADER);
+
+    COMPILER_ASSERT(hydro_kx_AEAD_KEYBYTES == 2 * gimli_RATE);
+    mem_xor(buf, state->k, gimli_RATE);
+    gimli_core_u8(buf, gimli_TAG_KEY);
+    mem_xor(buf, state->k + gimli_RATE, gimli_RATE);
+    gimli_core_u8(buf, gimli_TAG_KEY);
+
+    COMPILER_ASSERT(sizeof state->h == 2 * gimli_RATE);
+    mem_xor(buf, state->h, gimli_RATE);
+    gimli_core_u8(buf, gimli_TAG_HEADER);
+    mem_xor(buf, state->h + gimli_RATE, gimli_RATE);
+    gimli_core_u8(buf, gimli_TAG_HEADER);
+
+    if (psk != NULL) {
+        COMPILER_ASSERT(hydro_kx_PSKBYTES == 2 * gimli_RATE);
+        mem_xor(buf, psk, gimli_RATE);
+        gimli_core_u8(buf, gimli_TAG_HEADER);
+        mem_xor(buf, psk + gimli_RATE, gimli_RATE);
+        gimli_core_u8(buf, gimli_TAG_HEADER);
+    }
+}
+
+static void
+hydro_kx_finalize(uint8_t *buf, const uint8_t key[hydro_kx_AEAD_KEYBYTES])
+{
+    COMPILER_ASSERT(hydro_kx_AEAD_KEYBYTES == gimli_CAPACITY);
+    mem_xor(buf + gimli_RATE, key, hydro_kx_AEAD_KEYBYTES);
+    gimli_core_u8(buf, gimli_TAG_FINAL);
+    mem_xor(buf + gimli_RATE, key, hydro_kx_AEAD_KEYBYTES);
+    gimli_core_u8(buf, gimli_TAG_FINAL);
+}
+
+static void
+hydro_kx_aead_xor_enc(uint8_t buf[gimli_BLOCKBYTES], uint8_t *out, const uint8_t *in, size_t inlen)
+{
+    size_t i;
+    size_t leftover;
+
+    for (i = 0; i < inlen / gimli_RATE; i++) {
+        mem_xor2(&out[i * gimli_RATE], &in[i * gimli_RATE], buf, gimli_RATE);
+        memcpy(buf, &out[i * gimli_RATE], gimli_RATE);
+        gimli_core_u8(buf, gimli_TAG_PAYLOAD);
+    }
+    leftover = inlen % gimli_RATE;
+    if (leftover != 0) {
+        mem_xor2(&out[i * gimli_RATE], &in[i * gimli_RATE], buf, leftover);
+        mem_cpy(buf, &out[i * gimli_RATE], leftover);
+    }
+    gimli_pad_u8(buf, leftover, gimli_DOMAIN_AEAD);
+    gimli_core_u8(buf, gimli_TAG_PAYLOAD);
+}
+
+static void
+hydro_kx_aead_xor_dec(uint8_t buf[gimli_BLOCKBYTES], uint8_t *out, const uint8_t *in, size_t inlen)
+{
+    size_t i;
+    size_t leftover;
+
+    for (i = 0; i < inlen / gimli_RATE; i++) {
+        mem_xor2(&out[i * gimli_RATE], &in[i * gimli_RATE], buf, gimli_RATE);
+        memcpy(buf, &in[i * gimli_RATE], gimli_RATE);
+        gimli_core_u8(buf, gimli_TAG_PAYLOAD);
+    }
+    leftover = inlen % gimli_RATE;
+    if (leftover != 0) {
+        mem_xor2(&out[i * gimli_RATE], &in[i * gimli_RATE], buf, leftover);
+        mem_cpy(buf, &in[i * gimli_RATE], leftover);
+    }
+    gimli_pad_u8(buf, leftover, gimli_DOMAIN_AEAD);
+    gimli_core_u8(buf, gimli_TAG_PAYLOAD);
+}
+
+static void
+hydro_kx_encrypt(const hydro_kx_state *state, uint8_t *c, const uint8_t *m, size_t mlen,
+                 const uint8_t psk[hydro_kx_PSKBYTES])
+{
+    _hydro_attr_aligned_(16) uint8_t buf[gimli_BLOCKBYTES];
+    uint8_t *                        mac = &c[0];
+    uint8_t *                        ct  = &c[hydro_kx_AEAD_MACBYTES];
+
+    hydro_kx_aead_setup(buf, state, psk);
+    hydro_kx_aead_xor_enc(buf, ct, m, mlen);
+
+    hydro_kx_finalize(buf, state->k);
+    COMPILER_ASSERT(hydro_kx_AEAD_MACBYTES <= gimli_CAPACITY);
+    memcpy(mac, buf + gimli_RATE, hydro_kx_AEAD_MACBYTES);
+}
+
+static int hydro_kx_decrypt(hydro_kx_state *state, uint8_t *m, const uint8_t *c, size_t clen,
+                            const uint8_t psk[hydro_kx_PSKBYTES]) _hydro_attr_warn_unused_result_;
+
+static int
+hydro_kx_decrypt(hydro_kx_state *state, uint8_t *m, const uint8_t *c, size_t clen,
+                 const uint8_t psk[hydro_kx_PSKBYTES])
+{
+    _hydro_attr_aligned_(16) uint32_t int_state[gimli_BLOCKBYTES / 4];
+    uint32_t                          pub_mac[hydro_kx_AEAD_MACBYTES / 4];
+    uint8_t *                         buf = (uint8_t *) (void *) int_state;
+    const uint8_t *                   mac;
+    const uint8_t *                   ct;
+    size_t                            mlen;
+    uint32_t                          cv;
+
+    if (clen < hydro_kx_AEAD_HEADERBYTES) {
+        return -1;
+    }
+    mac  = &c[0];
+    ct   = &c[hydro_kx_AEAD_MACBYTES];
+    mlen = clen - hydro_kx_AEAD_HEADERBYTES;
+    memcpy(pub_mac, mac, sizeof pub_mac);
+    hydro_kx_aead_setup(buf, state, psk);
+    hydro_kx_aead_xor_dec(buf, m, ct, mlen);
+
+    hydro_kx_finalize(buf, state->k);
+    COMPILER_ASSERT(hydro_kx_AEAD_MACBYTES <= gimli_CAPACITY);
+    COMPILER_ASSERT(gimli_RATE % 4 == 0);
+    cv = hydro_mem_ct_cmp_u32(int_state + gimli_RATE / 4, pub_mac, hydro_kx_AEAD_MACBYTES / 4);
+    hydro_mem_ct_zero_u32(int_state, gimli_BLOCKBYTES / 4);
+    if (cv != 0) {
+        mem_zero(m, mlen);
+        return -1;
+    }
+    return 0;
+}
+
+static int
+hydro_kx_scalarmult(hydro_kx_state *state, uint8_t dh_res[hydro_x25519_BYTES],
+                    const uint8_t scalar[hydro_x25519_BYTES], const uint8_t x1[hydro_x25519_BYTES])
+{
+    uint8_t ck_k[hydro_hash_BYTES + hydro_hash_KEYBYTES];
+
+    if (hydro_x25519_scalarmult(dh_res, scalar, x1, 1) != 0) {
+        return -1;
+    }
+    COMPILER_ASSERT(sizeof state->ck >= hydro_hash_KEYBYTES);
+    hydro_hash_hash(ck_k, sizeof ck_k, dh_res, hydro_x25519_BYTES, hydro_kx_CONTEXT_CK_K,
+                    state->ck);
+    memcpy(state->ck, ck_k, sizeof state->ck);
+    memcpy(state->k, ck_k + sizeof state->ck, sizeof state->k);
+
+    return 0;
+}
+
+static void
+hydro_kx_final(hydro_kx_state *state, uint8_t rx[hydro_kx_SESSIONKEYBYTES],
+               uint8_t tx[hydro_kx_SESSIONKEYBYTES])
+{
+    COMPILER_ASSERT(hydro_kx_SESSIONKEYBYTES == hydro_kx_AEAD_KEYBYTES);
+    COMPILER_ASSERT(hydro_kx_PUBLICKEYBYTES == hydro_x25519_BYTES);
+    COMPILER_ASSERT(hydro_kx_SECRETKEYBYTES == hydro_x25519_BYTES);
+    COMPILER_ASSERT(hydro_kx_PSKBYTES == hydro_hash_KEYBYTES);
+    COMPILER_ASSERT(sizeof(state->h) == hydro_hash_BYTES);
+    COMPILER_ASSERT(sizeof(state->ck) == hydro_hash_KEYBYTES);
+    COMPILER_ASSERT(sizeof(state->k) == hydro_kx_AEAD_KEYBYTES);
+    COMPILER_ASSERT(hydro_kx_XX_PACKET1BYTES == hydro_kx_PUBLICKEYBYTES);
+    COMPILER_ASSERT(hydro_kx_XX_PACKET2BYTES ==
+                    hydro_kx_PUBLICKEYBYTES + hydro_kx_AEAD_HEADERBYTES + hydro_kx_PUBLICKEYBYTES);
+    COMPILER_ASSERT(hydro_kx_XX_PACKET3BYTES ==
+                    hydro_kx_AEAD_HEADERBYTES + hydro_kx_PUBLICKEYBYTES);
+
+    COMPILER_ASSERT(hydro_kdf_KEYBYTES == hydro_hash_BYTES);
+    hydro_kdf_derive_from_key(rx, hydro_kx_SESSIONKEYBYTES, 0, hydro_kx_CONTEXT, state->ck);
+    hydro_kdf_derive_from_key(tx, hydro_kx_SESSIONKEYBYTES, 1, hydro_kx_CONTEXT, state->ck);
+    hydro_memzero(state, sizeof *state);
+}
+
+/* NOISE_N */
+
+int
+hydro_kx_n_1(hydro_kx_session_keypair *kp, uint8_t packet1[hydro_kx_N_PACKET1BYTES],
+             const uint8_t psk[hydro_kx_PSKBYTES],
+             const uint8_t peer_static_pk[hydro_kx_PUBLICKEYBYTES])
+{
+    hydro_kx_state state;
+    uint8_t        dh_res[hydro_x25519_BYTES];
+
+    mem_zero(&state, sizeof state);
+
+    hydro_kx_keygen(&state.eph_kp);
+    COMPILER_ASSERT(hydro_kx_PSKBYTES >= hydro_hash_KEYBYTES);
+    hydro_hash_hash(state.h, sizeof state.h, peer_static_pk, hydro_kx_PUBLICKEYBYTES,
+                    hydro_kx_CONTEXT, psk);
+    memcpy(packet1, state.eph_kp.pk, hydro_kx_PUBLICKEYBYTES);
+
+    COMPILER_ASSERT(sizeof state.h >= hydro_hash_KEYBYTES);
+    hydro_hash_hash(state.h, sizeof state.h, state.eph_kp.pk, sizeof state.eph_kp.pk,
+                    hydro_kx_CONTEXT, state.h);
+
+    if (hydro_kx_scalarmult(&state, dh_res, state.eph_kp.sk, peer_static_pk) != 0) {
+        return -1;
+    }
+    hydro_kx_final(&state, kp->rx, kp->tx);
+
+    return 0;
+}
+
+int
+hydro_kx_n_2(hydro_kx_session_keypair *kp, const uint8_t packet1[hydro_kx_N_PACKET1BYTES],
+             const uint8_t psk[hydro_kx_PSKBYTES], const hydro_kx_keypair *static_kp)
+{
+    hydro_kx_state state;
+    uint8_t        dh_res[hydro_x25519_BYTES];
+    const uint8_t *peer_eph_pk = packet1;
+
+    mem_zero(&state, sizeof state);
+
+    COMPILER_ASSERT(hydro_kx_PSKBYTES >= hydro_hash_KEYBYTES);
+    hydro_hash_hash(state.h, sizeof state.h, static_kp->pk, sizeof static_kp->pk, hydro_kx_CONTEXT,
+                    psk);
+
+    COMPILER_ASSERT(sizeof state.h >= hydro_hash_KEYBYTES);
+    hydro_hash_hash(state.h, sizeof state.h, peer_eph_pk, hydro_kx_PUBLICKEYBYTES, hydro_kx_CONTEXT,
+                    state.h);
+
+    if (hydro_kx_scalarmult(&state, dh_res, static_kp->sk, peer_eph_pk) != 0) {
+        return -1;
+    }
+    hydro_kx_final(&state, kp->tx, kp->rx);
+
+    return 0;
+}
+
+/* NOISE_KK */
+
+int
+hydro_kx_kk_1(hydro_kx_state *state, uint8_t packet1[hydro_kx_KK_PACKET1BYTES],
+              const uint8_t           peer_static_pk[hydro_kx_PUBLICKEYBYTES],
+              const hydro_kx_keypair *static_kp)
+{
+    uint8_t dh_res[hydro_x25519_BYTES];
+    mem_zero(state, sizeof *state);
+
+    hydro_kx_keygen(&state->eph_kp);
+    hydro_hash_hash(state->h, sizeof state->h, state->eph_kp.pk, sizeof state->eph_kp.pk,
+                    hydro_kx_CONTEXT, NULL);
+    memcpy(packet1, state->eph_kp.pk, sizeof state->eph_kp.pk);
+
+    if (hydro_kx_scalarmult(state, dh_res, state->eph_kp.sk, peer_static_pk) != 0) {
+        return -1;
+    }
+    if (hydro_kx_scalarmult(state, dh_res, static_kp->sk, peer_static_pk) != 0) {
+        return -1;
+    }
+    return 0;
+}
+
+int
+hydro_kx_kk_2(hydro_kx_session_keypair *kp, uint8_t packet2[hydro_kx_KK_PACKET2BYTES],
+              const uint8_t           packet1[hydro_kx_KK_PACKET1BYTES],
+              const uint8_t           peer_static_pk[hydro_kx_PUBLICKEYBYTES],
+              const hydro_kx_keypair *static_kp)
+{
+    hydro_kx_state state;
+    uint8_t        dh_res[hydro_x25519_BYTES];
+    const uint8_t *peer_eph_pk = packet1;
+
+    mem_zero(&state, sizeof state);
+
+    hydro_kx_keygen(&state.eph_kp);
+    hydro_hash_hash(state.h, sizeof state.h, state.eph_kp.pk, sizeof state.eph_kp.pk,
+                    hydro_kx_CONTEXT, NULL);
+    memcpy(packet2, state.eph_kp.pk, sizeof state.eph_kp.pk);
+
+    if (hydro_kx_scalarmult(&state, dh_res, static_kp->sk, peer_eph_pk) != 0) {
+        return -1;
+    }
+    if (hydro_kx_scalarmult(&state, dh_res, static_kp->sk, peer_static_pk) != 0) {
+        return -1;
+    }
+
+    if (hydro_kx_scalarmult(&state, dh_res, state.eph_kp.sk, peer_eph_pk) != 0) {
+        return -1;
+    }
+    if (hydro_kx_scalarmult(&state, dh_res, state.eph_kp.sk, peer_static_pk) != 0) {
+        return -1;
+    }
+    hydro_kx_final(&state, kp->rx, kp->tx);
+
+    return 0;
+}
+
+int
+hydro_kx_kk_3(hydro_kx_state *state, hydro_kx_session_keypair *kp,
+              const uint8_t packet2[hydro_kx_KK_PACKET2BYTES],
+              const hydro_kx_keypair *static_kp)
+{
+    uint8_t        dh_res[hydro_x25519_BYTES];
+    const uint8_t *peer_eph_pk = packet2;
+
+    if (hydro_kx_scalarmult(state, dh_res, state->eph_kp.sk, peer_eph_pk) != 0) {
+        return -1;
+    }
+    if (hydro_kx_scalarmult(state, dh_res, static_kp->sk, peer_eph_pk) != 0) {
+        return -1;
+    }
+    hydro_kx_final(state, kp->tx, kp->rx);
+
+    return 0;
+}
+
+/* NOISE_XX */
+
+int
+hydro_kx_xx_1(hydro_kx_state *state, uint8_t packet1[hydro_kx_XX_PACKET1BYTES],
+              const uint8_t psk[hydro_kx_PSKBYTES])
+{
+    mem_zero(state, sizeof *state);
+
+    hydro_kx_keygen(&state->eph_kp);
+    COMPILER_ASSERT(hydro_kx_PSKBYTES >= hydro_hash_KEYBYTES);
+    hydro_hash_hash(state->h, sizeof state->h, state->eph_kp.pk, sizeof state->eph_kp.pk,
+                    hydro_kx_CONTEXT, psk);
+    memcpy(packet1, state->eph_kp.pk, hydro_kx_PUBLICKEYBYTES);
+
+    return 0;
+}
+
+int
+hydro_kx_xx_2(hydro_kx_state *state, uint8_t packet2[hydro_kx_XX_PACKET2BYTES],
+              const uint8_t packet1[hydro_kx_XX_PACKET1BYTES], const uint8_t psk[hydro_kx_PSKBYTES],
+              const hydro_kx_keypair *static_kp)
+{
+    uint8_t        dh_res[hydro_x25519_BYTES];
+    const uint8_t *peer_eph_pk = packet1;
+
+    mem_zero(state, sizeof *state);
+
+    hydro_hash_hash(state->h, sizeof state->h, peer_eph_pk, hydro_kx_PUBLICKEYBYTES,
+                    hydro_kx_CONTEXT, psk);
+    hydro_kx_keygen(&state->eph_kp);
+    memcpy(packet2, state->eph_kp.pk, sizeof state->eph_kp.pk);
+    COMPILER_ASSERT(sizeof state->h >= hydro_hash_KEYBYTES);
+    hydro_hash_hash(state->h, sizeof state->h, state->eph_kp.pk, sizeof state->eph_kp.pk,
+                    hydro_kx_CONTEXT, state->h);
+
+    if (hydro_kx_scalarmult(state, dh_res, state->eph_kp.sk, peer_eph_pk) != 0) {
+        return -1;
+    }
+    hydro_kx_encrypt(state, packet2 + sizeof state->eph_kp.pk, static_kp->pk, sizeof static_kp->pk,
+                     psk);
+    if (hydro_kx_scalarmult(state, dh_res, static_kp->sk, peer_eph_pk) != 0) {
+        return -1;
+    }
+    return 0;
+}
+
+int
+hydro_kx_xx_3(hydro_kx_state *state, hydro_kx_session_keypair *kp,
+              uint8_t       packet3[hydro_kx_XX_PACKET3BYTES],
+              uint8_t       peer_static_pk[hydro_kx_PUBLICKEYBYTES],
+              const uint8_t packet2[hydro_kx_XX_PACKET2BYTES], const uint8_t psk[hydro_kx_PSKBYTES],
+              const hydro_kx_keypair *static_kp)
+{
+    uint8_t        dh_res[hydro_x25519_BYTES];
+    uint8_t        peer_static_pk_[hydro_kx_PUBLICKEYBYTES];
+    const uint8_t *peer_eph_pk              = packet2;
+    const uint8_t *peer_encrypted_static_pk = packet2 + hydro_kx_PUBLICKEYBYTES;
+
+    hydro_hash_hash(state->h, sizeof state->h, peer_eph_pk, hydro_kx_PUBLICKEYBYTES,
+                    hydro_kx_CONTEXT, state->h);
+
+    if (hydro_kx_scalarmult(state, dh_res, state->eph_kp.sk, peer_eph_pk) != 0) {
+        return -1;
+    }
+    if (peer_static_pk == NULL) {
+        peer_static_pk = peer_static_pk_;
+    }
+    if (hydro_kx_decrypt(state, peer_static_pk, peer_encrypted_static_pk,
+                         hydro_kx_AEAD_HEADERBYTES + hydro_kx_PUBLICKEYBYTES, psk) != 0) {
+        return -1;
+    }
+    if (hydro_kx_scalarmult(state, dh_res, state->eph_kp.sk, peer_static_pk) != 0) {
+        return -1;
+    }
+    hydro_kx_encrypt(state, packet3, static_kp->pk, sizeof static_kp->pk, psk);
+    if (hydro_kx_scalarmult(state, dh_res, static_kp->sk, peer_eph_pk) != 0) {
+        return -1;
+    }
+    hydro_kx_final(state, kp->rx, kp->tx);
+
+    return 0;
+}
+
+int
+hydro_kx_xx_4(hydro_kx_state *state, hydro_kx_session_keypair *kp,
+              uint8_t       peer_static_pk[hydro_kx_PUBLICKEYBYTES],
+              const uint8_t packet3[hydro_kx_XX_PACKET3BYTES], const uint8_t psk[hydro_kx_PSKBYTES])
+{
+    uint8_t        dh_res[hydro_x25519_BYTES];
+    uint8_t        peer_static_pk_[hydro_kx_PUBLICKEYBYTES];
+    const uint8_t *peer_encrypted_static_pk = packet3;
+
+    if (peer_static_pk == NULL) {
+        peer_static_pk = peer_static_pk_;
+    }
+    if (hydro_kx_decrypt(state, peer_static_pk, peer_encrypted_static_pk,
+                         hydro_kx_AEAD_HEADERBYTES + hydro_kx_PUBLICKEYBYTES, psk) != 0) {
+        return -1;
+    }
+    if (hydro_kx_scalarmult(state, dh_res, state->eph_kp.sk, peer_static_pk) != 0) {
+        return -1;
+    }
+    hydro_kx_final(state, kp->tx, kp->rx);
+
+    return 0;
+}

+ 281 - 0
libhydrogen.mod/libhydrogen/impl/pwhash.h

@@ -0,0 +1,281 @@
+#define hydro_pwhash_ENC_ALGBYTES 1
+#define hydro_pwhash_HASH_ALGBYTES 1
+#define hydro_pwhash_THREADSBYTES 1
+#define hydro_pwhash_OPSLIMITBYTES 8
+#define hydro_pwhash_MEMLIMITBYTES 8
+#define hydro_pwhash_HASHBYTES 32
+#define hydro_pwhash_SALTBYTES 16
+#define hydro_pwhash_PARAMSBYTES                                                           \
+    (hydro_pwhash_HASH_ALGBYTES + hydro_pwhash_THREADSBYTES + hydro_pwhash_OPSLIMITBYTES + \
+     hydro_pwhash_MEMLIMITBYTES + hydro_pwhash_SALTBYTES + hydro_pwhash_HASHBYTES)
+#define hydro_pwhash_ENC_ALG 0x01
+#define hydro_pwhash_HASH_ALG 0x01
+#define hydro_pwhash_CONTEXT "hydro_pw"
+
+static int
+_hydro_pwhash_hash(uint8_t out[hydro_random_SEEDBYTES], size_t h_len,
+                   const uint8_t salt[hydro_pwhash_SALTBYTES], const char *passwd,
+                   size_t passwd_len, const char ctx[hydro_pwhash_CONTEXTBYTES],
+                   const uint8_t master_key[hydro_pwhash_MASTERKEYBYTES], uint64_t opslimit,
+                   size_t memlimit, uint8_t threads)
+{
+    _hydro_attr_aligned_(16) uint8_t state[gimli_BLOCKBYTES];
+    hydro_hash_state                 h_st;
+    uint8_t                          tmp64_u8[8];
+    uint64_t                         i;
+    uint8_t                          tmp8;
+
+    COMPILER_ASSERT(hydro_pwhash_MASTERKEYBYTES >= hydro_hash_KEYBYTES);
+    hydro_hash_init(&h_st, ctx, master_key);
+
+    STORE64_LE(tmp64_u8, (uint64_t) passwd_len);
+    hydro_hash_update(&h_st, tmp64_u8, sizeof tmp64_u8);
+    hydro_hash_update(&h_st, passwd, passwd_len);
+
+    hydro_hash_update(&h_st, salt, hydro_pwhash_SALTBYTES);
+
+    tmp8 = hydro_pwhash_HASH_ALG;
+    hydro_hash_update(&h_st, &tmp8, 1);
+
+    hydro_hash_update(&h_st, &threads, 1);
+
+    STORE64_LE(tmp64_u8, (uint64_t) memlimit);
+    hydro_hash_update(&h_st, tmp64_u8, sizeof tmp64_u8);
+
+    STORE64_LE(tmp64_u8, (uint64_t) h_len);
+    hydro_hash_update(&h_st, tmp64_u8, sizeof tmp64_u8);
+
+    hydro_hash_final(&h_st, (uint8_t *) (void *) &state, sizeof state);
+
+    gimli_core_u8(state, 1);
+    COMPILER_ASSERT(gimli_RATE >= 8);
+    for (i = 0; i < opslimit; i++) {
+        mem_zero(state, gimli_RATE);
+        STORE64_LE(state, i);
+        gimli_core_u8(state, 0);
+    }
+    mem_zero(state, gimli_RATE);
+
+    COMPILER_ASSERT(hydro_random_SEEDBYTES == gimli_CAPACITY);
+    memcpy(out, state + gimli_RATE, hydro_random_SEEDBYTES);
+    hydro_memzero(state, sizeof state);
+
+    return 0;
+}
+
+void
+hydro_pwhash_keygen(uint8_t master_key[hydro_pwhash_MASTERKEYBYTES])
+{
+    hydro_random_buf(master_key, hydro_pwhash_MASTERKEYBYTES);
+}
+
+int
+hydro_pwhash_deterministic(uint8_t *h, size_t h_len, const char *passwd, size_t passwd_len,
+                           const char    ctx[hydro_pwhash_CONTEXTBYTES],
+                           const uint8_t master_key[hydro_pwhash_MASTERKEYBYTES], uint64_t opslimit,
+                           size_t memlimit, uint8_t threads)
+{
+    uint8_t seed[hydro_random_SEEDBYTES];
+
+    COMPILER_ASSERT(sizeof zero >= hydro_pwhash_SALTBYTES);
+    COMPILER_ASSERT(sizeof zero >= hydro_pwhash_MASTERKEYBYTES);
+
+    (void) memlimit;
+    if (_hydro_pwhash_hash(seed, h_len, zero, passwd, passwd_len, ctx, master_key, opslimit,
+                           memlimit, threads) != 0) {
+        return -1;
+    }
+    hydro_random_buf_deterministic(h, h_len, seed);
+    hydro_memzero(seed, sizeof seed);
+
+    return 0;
+}
+
+int
+hydro_pwhash_create(uint8_t stored[hydro_pwhash_STOREDBYTES], const char *passwd, size_t passwd_len,
+                    const uint8_t master_key[hydro_pwhash_MASTERKEYBYTES], uint64_t opslimit,
+                    size_t memlimit, uint8_t threads)
+{
+    uint8_t *const enc_alg     = &stored[0];
+    uint8_t *const secretbox   = &enc_alg[hydro_pwhash_ENC_ALGBYTES];
+    uint8_t *const hash_alg    = &secretbox[hydro_secretbox_HEADERBYTES];
+    uint8_t *const threads_u8  = &hash_alg[hydro_pwhash_HASH_ALGBYTES];
+    uint8_t *const opslimit_u8 = &threads_u8[hydro_pwhash_THREADSBYTES];
+    uint8_t *const memlimit_u8 = &opslimit_u8[hydro_pwhash_OPSLIMITBYTES];
+    uint8_t *const salt        = &memlimit_u8[hydro_pwhash_MEMLIMITBYTES];
+    uint8_t *const h           = &salt[hydro_pwhash_SALTBYTES];
+
+    COMPILER_ASSERT(hydro_pwhash_STOREDBYTES >= hydro_pwhash_ENC_ALGBYTES +
+                                                    hydro_secretbox_HEADERBYTES +
+                                                    hydro_pwhash_PARAMSBYTES);
+    (void) memlimit;
+    mem_zero(stored, hydro_pwhash_STOREDBYTES);
+    *enc_alg    = hydro_pwhash_ENC_ALG;
+    *hash_alg   = hydro_pwhash_HASH_ALG;
+    *threads_u8 = threads;
+    STORE64_LE(opslimit_u8, opslimit);
+    STORE64_LE(memlimit_u8, (uint64_t) memlimit);
+    hydro_random_buf(salt, hydro_pwhash_SALTBYTES);
+
+    COMPILER_ASSERT(sizeof zero >= hydro_pwhash_MASTERKEYBYTES);
+    if (_hydro_pwhash_hash(h, hydro_pwhash_HASHBYTES, salt, passwd, passwd_len,
+                           hydro_pwhash_CONTEXT, zero, opslimit, memlimit, threads) != 0) {
+        return -1;
+    }
+    COMPILER_ASSERT(hydro_pwhash_MASTERKEYBYTES == hydro_secretbox_KEYBYTES);
+
+    return hydro_secretbox_encrypt(secretbox, hash_alg, hydro_pwhash_PARAMSBYTES,
+                                   (uint64_t) *enc_alg, hydro_pwhash_CONTEXT, master_key);
+}
+
+static int
+_hydro_pwhash_verify(uint8_t       computed_h[hydro_pwhash_HASHBYTES],
+                     const uint8_t stored[hydro_pwhash_STOREDBYTES], const char *passwd,
+                     size_t passwd_len, const uint8_t master_key[hydro_pwhash_MASTERKEYBYTES],
+                     uint64_t opslimit_max, size_t memlimit_max, uint8_t threads_max)
+{
+    const uint8_t *const enc_alg   = &stored[0];
+    const uint8_t *const secretbox = &enc_alg[hydro_pwhash_ENC_ALGBYTES];
+
+    uint8_t        params[hydro_pwhash_PARAMSBYTES];
+    uint8_t *const hash_alg    = &params[0];
+    uint8_t *const threads_u8  = &hash_alg[hydro_pwhash_HASH_ALGBYTES];
+    uint8_t *const opslimit_u8 = &threads_u8[hydro_pwhash_THREADSBYTES];
+    uint8_t *const memlimit_u8 = &opslimit_u8[hydro_pwhash_OPSLIMITBYTES];
+    uint8_t *const salt        = &memlimit_u8[hydro_pwhash_MEMLIMITBYTES];
+    uint8_t *const h           = &salt[hydro_pwhash_SALTBYTES];
+
+    uint64_t opslimit;
+    size_t   memlimit;
+    uint8_t  threads;
+
+    (void) memlimit;
+    if (*enc_alg != hydro_pwhash_ENC_ALG) {
+        return -1;
+    }
+    if (hydro_secretbox_decrypt(params, secretbox,
+                                hydro_secretbox_HEADERBYTES + hydro_pwhash_PARAMSBYTES,
+                                (uint64_t) *enc_alg, hydro_pwhash_CONTEXT, master_key) != 0) {
+        return -1;
+    }
+    if (*hash_alg != hydro_pwhash_HASH_ALG || (opslimit = LOAD64_LE(opslimit_u8)) > opslimit_max ||
+        (memlimit = (size_t) LOAD64_LE(memlimit_u8)) > memlimit_max ||
+        (threads = *threads_u8) > threads_max) {
+        return -1;
+    }
+    if (_hydro_pwhash_hash(computed_h, hydro_pwhash_HASHBYTES, salt, passwd, passwd_len,
+                           hydro_pwhash_CONTEXT, zero, opslimit, memlimit, threads) == 0 &&
+        hydro_equal(computed_h, h, hydro_pwhash_HASHBYTES) == 1) {
+        return 0;
+    }
+    return -1;
+}
+
+int
+hydro_pwhash_verify(const uint8_t stored[hydro_pwhash_STOREDBYTES], const char *passwd,
+                    size_t passwd_len, const uint8_t master_key[hydro_pwhash_MASTERKEYBYTES],
+                    uint64_t opslimit_max, size_t memlimit_max, uint8_t threads_max)
+{
+    uint8_t computed_h[hydro_pwhash_HASHBYTES];
+    int     ret;
+
+    ret = _hydro_pwhash_verify(computed_h, stored, passwd, passwd_len, master_key, opslimit_max,
+                               memlimit_max, threads_max);
+    hydro_memzero(computed_h, sizeof computed_h);
+
+    return ret;
+}
+
+int
+hydro_pwhash_derive_static_key(uint8_t *static_key, size_t static_key_len,
+                               const uint8_t stored[hydro_pwhash_STOREDBYTES], const char *passwd,
+                               size_t passwd_len, const char ctx[hydro_pwhash_CONTEXTBYTES],
+                               const uint8_t master_key[hydro_pwhash_MASTERKEYBYTES],
+                               uint64_t opslimit_max, size_t memlimit_max, uint8_t threads_max)
+{
+    uint8_t computed_h[hydro_pwhash_HASHBYTES];
+
+    if (_hydro_pwhash_verify(computed_h, stored, passwd, passwd_len, master_key, opslimit_max,
+                             memlimit_max, threads_max) != 0) {
+        hydro_memzero(computed_h, sizeof computed_h);
+        return -1;
+    }
+    COMPILER_ASSERT(hydro_kdf_CONTEXTBYTES <= hydro_pwhash_CONTEXTBYTES);
+    COMPILER_ASSERT(hydro_kdf_KEYBYTES <= hydro_pwhash_HASHBYTES);
+    hydro_kdf_derive_from_key(static_key, static_key_len, 0, ctx, computed_h);
+    hydro_memzero(computed_h, sizeof computed_h);
+
+    return 0;
+}
+
+int
+hydro_pwhash_reencrypt(uint8_t       stored[hydro_pwhash_STOREDBYTES],
+                       const uint8_t master_key[hydro_pwhash_MASTERKEYBYTES],
+                       const uint8_t new_master_key[hydro_pwhash_MASTERKEYBYTES])
+{
+    uint8_t *const enc_alg   = &stored[0];
+    uint8_t *const secretbox = &enc_alg[hydro_pwhash_ENC_ALGBYTES];
+    uint8_t *const params    = &secretbox[hydro_secretbox_HEADERBYTES];
+
+    if (*enc_alg != hydro_pwhash_ENC_ALG) {
+        return -1;
+    }
+    if (hydro_secretbox_decrypt(secretbox, secretbox,
+                                hydro_secretbox_HEADERBYTES + hydro_pwhash_PARAMSBYTES,
+                                (uint64_t) *enc_alg, hydro_pwhash_CONTEXT, master_key) != 0) {
+        return -1;
+    }
+    memmove(params, secretbox, hydro_pwhash_PARAMSBYTES);
+    return hydro_secretbox_encrypt(secretbox, params, hydro_pwhash_PARAMSBYTES, (uint64_t) *enc_alg,
+                                   hydro_pwhash_CONTEXT, new_master_key);
+}
+
+int
+hydro_pwhash_upgrade(uint8_t       stored[hydro_pwhash_STOREDBYTES],
+                     const uint8_t master_key[hydro_pwhash_MASTERKEYBYTES], uint64_t opslimit,
+                     size_t memlimit, uint8_t threads)
+{
+    uint8_t *const enc_alg     = &stored[0];
+    uint8_t *const secretbox   = &enc_alg[hydro_pwhash_ENC_ALGBYTES];
+    uint8_t *const params      = &secretbox[hydro_secretbox_HEADERBYTES];
+    uint8_t *const hash_alg    = &params[0];
+    uint8_t *const threads_u8  = &hash_alg[hydro_pwhash_HASH_ALGBYTES];
+    uint8_t *const opslimit_u8 = &threads_u8[hydro_pwhash_THREADSBYTES];
+    uint8_t *const memlimit_u8 = &opslimit_u8[hydro_pwhash_OPSLIMITBYTES];
+    uint8_t *const salt        = &memlimit_u8[hydro_pwhash_MEMLIMITBYTES];
+    uint8_t *const h           = &salt[hydro_pwhash_SALTBYTES];
+
+    _hydro_attr_aligned_(16) uint8_t state[gimli_BLOCKBYTES];
+    uint64_t                         i;
+    uint64_t                         opslimit_prev;
+
+    if (*enc_alg != hydro_pwhash_ENC_ALG) {
+        return -1;
+    }
+    if (hydro_secretbox_decrypt(secretbox, secretbox,
+                                hydro_secretbox_HEADERBYTES + hydro_pwhash_PARAMSBYTES,
+                                (uint64_t) *enc_alg, hydro_pwhash_CONTEXT, master_key) != 0) {
+        return -1;
+    }
+    memmove(params, secretbox, hydro_pwhash_PARAMSBYTES);
+    opslimit_prev = LOAD64_LE(opslimit_u8);
+    if (*hash_alg != hydro_pwhash_HASH_ALG) {
+        mem_zero(stored, hydro_pwhash_STOREDBYTES);
+        return -1;
+    }
+    COMPILER_ASSERT(hydro_random_SEEDBYTES == gimli_CAPACITY);
+    memcpy(state + gimli_RATE, h, hydro_random_SEEDBYTES);
+    for (i = opslimit_prev; i < opslimit; i++) {
+        mem_zero(state, gimli_RATE);
+        STORE64_LE(state, i);
+        gimli_core_u8(state, 0);
+    }
+    mem_zero(state, gimli_RATE);
+    memcpy(h, state + gimli_RATE, hydro_random_SEEDBYTES);
+    *threads_u8 = threads;
+    STORE64_LE(opslimit_u8, opslimit);
+    STORE64_LE(memlimit_u8, (uint64_t) memlimit);
+
+    return hydro_secretbox_encrypt(secretbox, params, hydro_pwhash_PARAMSBYTES, (uint64_t) *enc_alg,
+                                   hydro_pwhash_CONTEXT, master_key);
+}

+ 436 - 0
libhydrogen.mod/libhydrogen/impl/random.h

@@ -0,0 +1,436 @@
+static TLS struct {
+    _hydro_attr_aligned_(16) uint8_t state[gimli_BLOCKBYTES];
+    uint64_t counter;
+    uint8_t  initialized;
+    uint8_t  available;
+} hydro_random_context;
+
+#if defined(AVR) && !defined(__unix__)
+#include <Arduino.h>
+
+static bool
+hydro_random_rbit(unsigned int x)
+{
+    size_t i;
+    bool   res = 0;
+
+    for (i = 0; i < sizeof x; i++) {
+        res ^= ((x >> i) & 1);
+    }
+    return res;
+}
+
+static int
+hydro_random_init(void)
+{
+    const char       ctx[hydro_hash_CONTEXTBYTES] = { 'h', 'y', 'd', 'r', 'o', 'P', 'R', 'G' };
+    hydro_hash_state st;
+    uint16_t         ebits = 0;
+    uint16_t         tc;
+    bool             a, b;
+
+    cli();
+    MCUSR = 0;
+    WDTCSR |= _BV(WDCE) | _BV(WDE);
+    WDTCSR = _BV(WDIE);
+    sei();
+
+    hydro_hash_init(&st, ctx, NULL);
+
+    while (ebits < 256) {
+        delay(1);
+        tc = TCNT1;
+        hydro_hash_update(&st, (const uint8_t *) &tc, sizeof tc);
+        a = hydro_random_rbit(tc);
+        delay(1);
+        tc = TCNT1;
+        b  = hydro_random_rbit(tc);
+        hydro_hash_update(&st, (const uint8_t *) &tc, sizeof tc);
+        if (a == b) {
+            continue;
+        }
+        hydro_hash_update(&st, (const uint8_t *) &b, sizeof b);
+        ebits++;
+    }
+
+    cli();
+    MCUSR = 0;
+    WDTCSR |= _BV(WDCE) | _BV(WDE);
+    WDTCSR = 0;
+    sei();
+
+    hydro_hash_final(&st, hydro_random_context.state, sizeof hydro_random_context.state);
+    hydro_random_context.counter = ~LOAD64_LE(hydro_random_context.state);
+
+    return 0;
+}
+
+ISR(WDT_vect) {}
+
+#elif (defined(ESP32) || defined(ESP8266)) && !defined(__unix__)
+
+// Important: RF *must* be activated on ESP board
+// https://techtutorialsx.com/2017/12/22/esp32-arduino-random-number-generation/
+
+#include <esp_system.h>
+
+static int
+hydro_random_init(void)
+{
+    const char       ctx[hydro_hash_CONTEXTBYTES] = { 'h', 'y', 'd', 'r', 'o', 'P', 'R', 'G' };
+    hydro_hash_state st;
+    uint16_t         ebits = 0;
+
+    hydro_hash_init(&st, ctx, NULL);
+
+    while (ebits < 256) {
+        uint32_t r = esp_random();
+
+        delay(10);
+        hydro_hash_update(&st, (const uint32_t *) &r, sizeof r);
+        ebits += 32;
+    }
+
+    hydro_hash_final(&st, hydro_random_context.state, sizeof hydro_random_context.state);
+    hydro_random_context.counter = ~LOAD64_LE(hydro_random_context.state);
+
+    return 0;
+}
+
+#elif (defined(NRF52832_XXAA) || defined(NRF52832_XXAB)) && !defined(__unix__)
+
+// Important: The SoftDevice *must* be activated to enable reading from the RNG
+// http://infocenter.nordicsemi.com/index.jsp?topic=%2Fcom.nordic.infocenter.nrf52832.ps.v1.1%2Frng.html
+
+#include <nrf_soc.h>
+
+static int
+hydro_random_init(void)
+{
+    const char       ctx[hydro_hash_CONTEXTBYTES] = { 'h', 'y', 'd', 'r', 'o', 'P', 'R', 'G' };
+    hydro_hash_state st;
+    const uint8_t    total_bytes = 32;
+    uint8_t          remaining_bytes = total_bytes;
+    uint8_t          available_bytes;
+    uint8_t          rand_buffer[32];
+
+    hydro_hash_init(&st, ctx, NULL);
+
+    for (;;) {
+        if (sd_rand_application_bytes_available_get(&available_bytes) != NRF_SUCCESS) {
+            return -1;
+        }
+        if (available_bytes > 0) {
+            if (available_bytes > remaining_bytes) {
+                available_bytes = remaining_bytes;
+            }
+            if (sd_rand_application_vector_get(rand_buffer, available_bytes) != NRF_SUCCESS) {
+                return -1;
+            }
+            hydro_hash_update(&st, rand_buffer, total_bytes);
+            remaining_bytes -= available_bytes;
+        }
+        if (remaining_bytes <= 0) {
+            break;
+        }
+        delay(10);
+    }
+    hydro_hash_final(&st, hydro_random_context.state, sizeof hydro_random_context.state);
+    hydro_random_context.counter = ~LOAD64_LE(hydro_random_context.state);
+
+    return 0;
+}
+
+#elif defined(_WIN32)
+
+#include <windows.h>
+#define RtlGenRandom SystemFunction036
+#if defined(__cplusplus)
+extern "C"
+#endif
+    BOOLEAN NTAPI
+            RtlGenRandom(PVOID RandomBuffer, ULONG RandomBufferLength);
+#pragma comment(lib, "advapi32.lib")
+
+static int
+hydro_random_init(void)
+{
+    if (!RtlGenRandom((PVOID) hydro_random_context.state,
+                      (ULONG) sizeof hydro_random_context.state)) {
+        return -1;
+    }
+    hydro_random_context.counter = ~LOAD64_LE(hydro_random_context.state);
+
+    return 0;
+}
+
+#elif defined(__wasi__)
+
+#include <unistd.h>
+
+static int
+hydro_random_init(void)
+{
+    if (getentropy(hydro_random_context.state,
+                   sizeof hydro_random_context.state) != 0) {
+        return -1;
+    }
+    hydro_random_context.counter = ~LOAD64_LE(hydro_random_context.state);
+
+    return 0;
+}
+
+#elif defined(__unix__)
+
+#include <errno.h>
+#include <fcntl.h>
+#ifdef __linux__
+# include <poll.h>
+#endif
+#include <sys/types.h>
+#include <unistd.h>
+
+#ifdef __linux__
+static int
+hydro_random_block_on_dev_random(void)
+{
+    struct pollfd pfd;
+    int           fd;
+    int           pret;
+
+    fd = open("/dev/random", O_RDONLY);
+    if (fd == -1) {
+        return 0;
+    }
+    pfd.fd      = fd;
+    pfd.events  = POLLIN;
+    pfd.revents = 0;
+    do {
+        pret = poll(&pfd, 1, -1);
+    } while (pret < 0 && (errno == EINTR || errno == EAGAIN));
+    if (pret != 1) {
+        (void) close(fd);
+        errno = EIO;
+        return -1;
+    }
+    return close(fd);
+}
+#endif
+
+static ssize_t
+hydro_random_safe_read(const int fd, void *const buf_, size_t len)
+{
+    unsigned char *buf = (unsigned char *) buf_;
+    ssize_t        readnb;
+
+    do {
+        while ((readnb = read(fd, buf, len)) < (ssize_t) 0 && (errno == EINTR || errno == EAGAIN))
+            ;
+        if (readnb < (ssize_t) 0) {
+            return readnb;
+        }
+        if (readnb == (ssize_t) 0) {
+            break;
+        }
+        len -= (size_t) readnb;
+        buf += readnb;
+    } while (len > (ssize_t) 0);
+
+    return (ssize_t)(buf - (unsigned char *) buf_);
+}
+
+static int
+hydro_random_init(void)
+{
+    uint8_t tmp[gimli_BLOCKBYTES + 8];
+    int     fd;
+    int     ret = -1;
+
+#ifdef __linux__
+    if (hydro_random_block_on_dev_random() != 0) {
+        return -1;
+    }
+#endif
+    do {
+        fd = open("/dev/urandom", O_RDONLY);
+        if (fd == -1 && errno != EINTR) {
+            return -1;
+        }
+    } while (fd == -1);
+    if (hydro_random_safe_read(fd, tmp, sizeof tmp) == (ssize_t) sizeof tmp) {
+        memcpy(hydro_random_context.state, tmp, gimli_BLOCKBYTES);
+        memcpy(&hydro_random_context.counter, tmp + gimli_BLOCKBYTES, 8);
+        hydro_memzero(tmp, sizeof tmp);
+        ret = 0;
+    }
+    ret |= close(fd);
+
+    return ret;
+}
+
+#elif defined(TARGET_LIKE_MBED)
+
+#include <mbedtls/ctr_drbg.h>
+#include <mbedtls/entropy.h>
+
+#if defined(MBEDTLS_ENTROPY_C)
+
+static int
+hydro_random_init(void)
+{
+    mbedtls_entropy_context entropy;
+    uint16_t                pos = 0;
+
+    mbedtls_entropy_init(&entropy);
+
+    // Pull data directly out of the entropy pool for the state, as it's small enough.
+    if (mbedtls_entropy_func(&entropy, (uint8_t *) &hydro_random_context.counter,
+                             sizeof hydro_random_context.counter) != 0) {
+        return -1;
+    }
+    // mbedtls_entropy_func can't provide more than MBEDTLS_ENTROPY_BLOCK_SIZE in one go.
+    // This constant depends of mbedTLS configuration (whether the PRNG is backed by SHA256/SHA512
+    // at this time) Therefore, if necessary, we get entropy multiple times.
+
+    do {
+        const uint8_t dataLeftToConsume = gimli_BLOCKBYTES - pos;
+        const uint8_t currentChunkSize  = (dataLeftToConsume > MBEDTLS_ENTROPY_BLOCK_SIZE)
+                                             ? MBEDTLS_ENTROPY_BLOCK_SIZE
+                                             : dataLeftToConsume;
+
+        // Forces mbedTLS to fetch fresh entropy, then get some to feed libhydrogen.
+        if (mbedtls_entropy_gather(&entropy) != 0 ||
+            mbedtls_entropy_func(&entropy, &hydro_random_context.state[pos], currentChunkSize) != 0) {
+            return -1;
+        }
+        pos += MBEDTLS_ENTROPY_BLOCK_SIZE;
+    } while (pos < gimli_BLOCKBYTES);
+
+    mbedtls_entropy_free(&entropy);
+
+    return 0;
+}
+
+#else
+# error Need an entropy source
+#endif
+
+#else
+# error Unsupported platform
+#endif
+
+static void
+hydro_random_check_initialized(void)
+{
+    if (hydro_random_context.initialized == 0) {
+        if (hydro_random_init() != 0) {
+            abort();
+        }
+        gimli_core_u8(hydro_random_context.state, 0);
+        hydro_random_ratchet();
+        hydro_random_context.initialized = 1;
+    }
+}
+
+void
+hydro_random_ratchet(void)
+{
+    mem_zero(hydro_random_context.state, gimli_RATE);
+    STORE64_LE(hydro_random_context.state, hydro_random_context.counter);
+    hydro_random_context.counter++;
+    gimli_core_u8(hydro_random_context.state, 0);
+    hydro_random_context.available = gimli_RATE;
+}
+
+uint32_t
+hydro_random_u32(void)
+{
+    uint32_t v;
+
+    hydro_random_check_initialized();
+    if (hydro_random_context.available < 4) {
+        hydro_random_ratchet();
+    }
+    memcpy(&v, &hydro_random_context.state[gimli_RATE - hydro_random_context.available], 4);
+    hydro_random_context.available -= 4;
+
+    return v;
+}
+
+uint32_t
+hydro_random_uniform(const uint32_t upper_bound)
+{
+    uint32_t min;
+    uint32_t r;
+
+    if (upper_bound < 2U) {
+        return 0;
+    }
+    min = (1U + ~upper_bound) % upper_bound; /* = 2**32 mod upper_bound */
+    do {
+        r = hydro_random_u32();
+    } while (r < min);
+    /* r is now clamped to a set whose size mod upper_bound == 0
+     * the worst case (2**31+1) requires 2 attempts on average */
+
+    return r % upper_bound;
+}
+
+void
+hydro_random_buf(void *out, size_t out_len)
+{
+    uint8_t *p = (uint8_t *) out;
+    size_t   i;
+    size_t   leftover;
+
+    hydro_random_check_initialized();
+    for (i = 0; i < out_len / gimli_RATE; i++) {
+        gimli_core_u8(hydro_random_context.state, 0);
+        memcpy(p + i * gimli_RATE, hydro_random_context.state, gimli_RATE);
+    }
+    leftover = out_len % gimli_RATE;
+    if (leftover != 0) {
+        gimli_core_u8(hydro_random_context.state, 0);
+        mem_cpy(p + i * gimli_RATE, hydro_random_context.state, leftover);
+    }
+    hydro_random_ratchet();
+}
+
+void
+hydro_random_buf_deterministic(void *out, size_t out_len,
+                               const uint8_t seed[hydro_random_SEEDBYTES])
+{
+    static const uint8_t             prefix[] = { 7, 'd', 'r', 'b', 'g', '2', '5', '6' };
+    _hydro_attr_aligned_(16) uint8_t state[gimli_BLOCKBYTES];
+    uint8_t *                        p = (uint8_t *) out;
+    size_t                           i;
+    size_t                           leftover;
+
+    mem_zero(state, gimli_BLOCKBYTES);
+    COMPILER_ASSERT(sizeof prefix + 8 <= gimli_RATE);
+    memcpy(state, prefix, sizeof prefix);
+    STORE64_LE(state + sizeof prefix, (uint64_t) out_len);
+    gimli_core_u8(state, 1);
+    COMPILER_ASSERT(hydro_random_SEEDBYTES == gimli_RATE * 2);
+    mem_xor(state, seed, gimli_RATE);
+    gimli_core_u8(state, 2);
+    mem_xor(state, seed + gimli_RATE, gimli_RATE);
+    gimli_core_u8(state, 2);
+    for (i = 0; i < out_len / gimli_RATE; i++) {
+        gimli_core_u8(state, 0);
+        memcpy(p + i * gimli_RATE, state, gimli_RATE);
+    }
+    leftover = out_len % gimli_RATE;
+    if (leftover != 0) {
+        gimli_core_u8(state, 0);
+        mem_cpy(p + i * gimli_RATE, state, leftover);
+    }
+    hydro_random_ratchet();
+}
+
+void
+hydro_random_reseed(void)
+{
+    hydro_random_context.initialized = 0;
+    hydro_random_check_initialized();
+}

+ 236 - 0
libhydrogen.mod/libhydrogen/impl/secretbox.h

@@ -0,0 +1,236 @@
+#define hydro_secretbox_IVBYTES 20
+#define hydro_secretbox_SIVBYTES 20
+#define hydro_secretbox_MACBYTES 16
+
+void
+hydro_secretbox_keygen(uint8_t key[hydro_secretbox_KEYBYTES])
+{
+    hydro_random_buf(key, hydro_secretbox_KEYBYTES);
+}
+
+static void
+hydro_secretbox_xor_enc(uint8_t buf[gimli_BLOCKBYTES], uint8_t *out, const uint8_t *in,
+                        size_t inlen)
+{
+    size_t i;
+    size_t leftover;
+
+    for (i = 0; i < inlen / gimli_RATE; i++) {
+        mem_xor2(&out[i * gimli_RATE], &in[i * gimli_RATE], buf, gimli_RATE);
+        memcpy(buf, &out[i * gimli_RATE], gimli_RATE);
+        gimli_core_u8(buf, gimli_TAG_PAYLOAD);
+    }
+    leftover = inlen % gimli_RATE;
+    if (leftover != 0) {
+        mem_xor2(&out[i * gimli_RATE], &in[i * gimli_RATE], buf, leftover);
+        mem_cpy(buf, &out[i * gimli_RATE], leftover);
+    }
+    gimli_pad_u8(buf, leftover, gimli_DOMAIN_AEAD);
+    gimli_core_u8(buf, gimli_TAG_PAYLOAD);
+}
+
+static void
+hydro_secretbox_xor_dec(uint8_t buf[gimli_BLOCKBYTES], uint8_t *out, const uint8_t *in,
+                        size_t inlen)
+{
+    size_t i;
+    size_t leftover;
+
+    for (i = 0; i < inlen / gimli_RATE; i++) {
+        mem_xor2(&out[i * gimli_RATE], &in[i * gimli_RATE], buf, gimli_RATE);
+        memcpy(buf, &in[i * gimli_RATE], gimli_RATE);
+        gimli_core_u8(buf, gimli_TAG_PAYLOAD);
+    }
+    leftover = inlen % gimli_RATE;
+    if (leftover != 0) {
+        mem_xor2(&out[i * gimli_RATE], &in[i * gimli_RATE], buf, leftover);
+        mem_cpy(buf, &in[i * gimli_RATE], leftover);
+    }
+    gimli_pad_u8(buf, leftover, gimli_DOMAIN_AEAD);
+    gimli_core_u8(buf, gimli_TAG_PAYLOAD);
+}
+
+static void
+hydro_secretbox_setup(uint8_t buf[gimli_BLOCKBYTES], uint64_t msg_id,
+                      const char    ctx[hydro_secretbox_CONTEXTBYTES],
+                      const uint8_t key[hydro_secretbox_KEYBYTES],
+                      const uint8_t iv[hydro_secretbox_IVBYTES], uint8_t key_tag)
+{
+    static const uint8_t prefix[] = { 6, 's', 'b', 'x', '2', '5', '6', 8 };
+    uint8_t              msg_id_le[8];
+
+    mem_zero(buf, gimli_BLOCKBYTES);
+    COMPILER_ASSERT(hydro_secretbox_CONTEXTBYTES == 8);
+    COMPILER_ASSERT(sizeof prefix + hydro_secretbox_CONTEXTBYTES <= gimli_RATE);
+    memcpy(buf, prefix, sizeof prefix);
+    memcpy(buf + sizeof prefix, ctx, hydro_secretbox_CONTEXTBYTES);
+    COMPILER_ASSERT(sizeof prefix + hydro_secretbox_CONTEXTBYTES == gimli_RATE);
+    gimli_core_u8(buf, gimli_TAG_HEADER);
+
+    COMPILER_ASSERT(hydro_secretbox_KEYBYTES == 2 * gimli_RATE);
+    mem_xor(buf, key, gimli_RATE);
+    gimli_core_u8(buf, key_tag);
+    mem_xor(buf, key + gimli_RATE, gimli_RATE);
+    gimli_core_u8(buf, key_tag);
+
+    COMPILER_ASSERT(hydro_secretbox_IVBYTES < gimli_RATE * 2);
+    buf[0] ^= hydro_secretbox_IVBYTES;
+    mem_xor(&buf[1], iv, gimli_RATE - 1);
+    gimli_core_u8(buf, gimli_TAG_HEADER);
+    mem_xor(buf, iv + gimli_RATE - 1, hydro_secretbox_IVBYTES - (gimli_RATE - 1));
+    STORE64_LE(msg_id_le, msg_id);
+    COMPILER_ASSERT(hydro_secretbox_IVBYTES - gimli_RATE + 8 <= gimli_RATE);
+    mem_xor(buf + hydro_secretbox_IVBYTES - gimli_RATE, msg_id_le, 8);
+    gimli_core_u8(buf, gimli_TAG_HEADER);
+}
+
+static void
+hydro_secretbox_finalize(uint8_t *buf, const uint8_t key[hydro_secretbox_KEYBYTES], uint8_t tag)
+{
+    COMPILER_ASSERT(hydro_secretbox_KEYBYTES == gimli_CAPACITY);
+    mem_xor(buf + gimli_RATE, key, hydro_secretbox_KEYBYTES);
+    gimli_core_u8(buf, tag);
+    mem_xor(buf + gimli_RATE, key, hydro_secretbox_KEYBYTES);
+    gimli_core_u8(buf, tag);
+}
+
+static int
+hydro_secretbox_encrypt_iv(uint8_t *c, const void *m_, size_t mlen, uint64_t msg_id,
+                           const char    ctx[hydro_secretbox_CONTEXTBYTES],
+                           const uint8_t key[hydro_secretbox_KEYBYTES],
+                           const uint8_t iv[hydro_secretbox_IVBYTES])
+{
+    _hydro_attr_aligned_(16) uint32_t state[gimli_BLOCKBYTES / 4];
+    uint8_t *                         buf = (uint8_t *) (void *) state;
+    const uint8_t *                   m   = (const uint8_t *) m_;
+    uint8_t *                         siv = &c[0];
+    uint8_t *                         mac = &c[hydro_secretbox_SIVBYTES];
+    uint8_t *                         ct  = &c[hydro_secretbox_SIVBYTES + hydro_secretbox_MACBYTES];
+    size_t                            i;
+    size_t                            leftover;
+
+    if (c == m) {
+        memmove(c + hydro_secretbox_HEADERBYTES, m, mlen);
+        m = c + hydro_secretbox_HEADERBYTES;
+    }
+
+    /* first pass: compute the SIV */
+
+    hydro_secretbox_setup(buf, msg_id, ctx, key, iv, gimli_TAG_KEY0);
+    for (i = 0; i < mlen / gimli_RATE; i++) {
+        mem_xor(buf, &m[i * gimli_RATE], gimli_RATE);
+        gimli_core_u8(buf, gimli_TAG_PAYLOAD);
+    }
+    leftover = mlen % gimli_RATE;
+    if (leftover != 0) {
+        mem_xor(buf, &m[i * gimli_RATE], leftover);
+    }
+    gimli_pad_u8(buf, leftover, gimli_DOMAIN_XOF);
+    gimli_core_u8(buf, gimli_TAG_PAYLOAD);
+
+    hydro_secretbox_finalize(buf, key, gimli_TAG_FINAL0);
+    COMPILER_ASSERT(hydro_secretbox_SIVBYTES <= gimli_CAPACITY);
+    memcpy(siv, buf + gimli_RATE, hydro_secretbox_SIVBYTES);
+
+    /* second pass: encrypt the message, mix the key, squeeze an extra block for
+     * the MAC */
+
+    COMPILER_ASSERT(hydro_secretbox_SIVBYTES == hydro_secretbox_IVBYTES);
+    hydro_secretbox_setup(buf, msg_id, ctx, key, siv, gimli_TAG_KEY);
+    hydro_secretbox_xor_enc(buf, ct, m, mlen);
+
+    hydro_secretbox_finalize(buf, key, gimli_TAG_FINAL);
+    COMPILER_ASSERT(hydro_secretbox_MACBYTES <= gimli_CAPACITY);
+    memcpy(mac, buf + gimli_RATE, hydro_secretbox_MACBYTES);
+
+    return 0;
+}
+
+void
+hydro_secretbox_probe_create(uint8_t probe[hydro_secretbox_PROBEBYTES], const uint8_t *c,
+                             size_t c_len, const char ctx[hydro_secretbox_CONTEXTBYTES],
+                             const uint8_t key[hydro_secretbox_KEYBYTES])
+{
+    const uint8_t *mac;
+
+    if (c_len < hydro_secretbox_HEADERBYTES) {
+        abort();
+    }
+    mac = &c[hydro_secretbox_SIVBYTES];
+    COMPILER_ASSERT(hydro_secretbox_CONTEXTBYTES >= hydro_hash_CONTEXTBYTES);
+    COMPILER_ASSERT(hydro_secretbox_KEYBYTES >= hydro_hash_KEYBYTES);
+    hydro_hash_hash(probe, hydro_secretbox_PROBEBYTES, mac, hydro_secretbox_MACBYTES, ctx, key);
+}
+
+int
+hydro_secretbox_probe_verify(const uint8_t probe[hydro_secretbox_PROBEBYTES], const uint8_t *c,
+                             size_t c_len, const char ctx[hydro_secretbox_CONTEXTBYTES],
+                             const uint8_t key[hydro_secretbox_KEYBYTES])
+{
+    uint8_t        computed_probe[hydro_secretbox_PROBEBYTES];
+    const uint8_t *mac;
+
+    if (c_len < hydro_secretbox_HEADERBYTES) {
+        return -1;
+    }
+    mac = &c[hydro_secretbox_SIVBYTES];
+    hydro_hash_hash(computed_probe, hydro_secretbox_PROBEBYTES, mac, hydro_secretbox_MACBYTES, ctx,
+                    key);
+    if (hydro_equal(computed_probe, probe, hydro_secretbox_PROBEBYTES) == 1) {
+        return 0;
+    }
+    hydro_memzero(computed_probe, hydro_secretbox_PROBEBYTES);
+    return -1;
+}
+
+int
+hydro_secretbox_encrypt(uint8_t *c, const void *m_, size_t mlen, uint64_t msg_id,
+                        const char    ctx[hydro_secretbox_CONTEXTBYTES],
+                        const uint8_t key[hydro_secretbox_KEYBYTES])
+{
+    uint8_t iv[hydro_secretbox_IVBYTES];
+
+    hydro_random_buf(iv, sizeof iv);
+
+    return hydro_secretbox_encrypt_iv(c, m_, mlen, msg_id, ctx, key, iv);
+}
+
+int
+hydro_secretbox_decrypt(void *m_, const uint8_t *c, size_t clen, uint64_t msg_id,
+                        const char    ctx[hydro_secretbox_CONTEXTBYTES],
+                        const uint8_t key[hydro_secretbox_KEYBYTES])
+{
+    _hydro_attr_aligned_(16) uint32_t state[gimli_BLOCKBYTES / 4];
+    uint32_t                          pub_mac[hydro_secretbox_MACBYTES / 4];
+    uint8_t *                         buf = (uint8_t *) (void *) state;
+    const uint8_t *                   siv;
+    const uint8_t *                   mac;
+    const uint8_t *                   ct;
+    uint8_t *                         m = (uint8_t *) m_;
+    size_t                            mlen;
+    uint32_t                          cv;
+
+    if (clen < hydro_secretbox_HEADERBYTES) {
+        return -1;
+    }
+    siv = &c[0];
+    mac = &c[hydro_secretbox_SIVBYTES];
+    ct  = &c[hydro_secretbox_SIVBYTES + hydro_secretbox_MACBYTES];
+
+    mlen = clen - hydro_secretbox_HEADERBYTES;
+    memcpy(pub_mac, mac, sizeof pub_mac);
+    COMPILER_ASSERT(hydro_secretbox_SIVBYTES == hydro_secretbox_IVBYTES);
+    hydro_secretbox_setup(buf, msg_id, ctx, key, siv, gimli_TAG_KEY);
+    hydro_secretbox_xor_dec(buf, m, ct, mlen);
+
+    hydro_secretbox_finalize(buf, key, gimli_TAG_FINAL);
+    COMPILER_ASSERT(hydro_secretbox_MACBYTES <= gimli_CAPACITY);
+    COMPILER_ASSERT(gimli_RATE % 4 == 0);
+    cv = hydro_mem_ct_cmp_u32(state + gimli_RATE / 4, pub_mac, hydro_secretbox_MACBYTES / 4);
+    hydro_mem_ct_zero_u32(state, gimli_BLOCKBYTES / 4);
+    if (cv != 0) {
+        mem_zero(m, mlen);
+        return -1;
+    }
+    return 0;
+}

+ 207 - 0
libhydrogen.mod/libhydrogen/impl/sign.h

@@ -0,0 +1,207 @@
+#define hydro_sign_CHALLENGEBYTES 32
+#define hydro_sign_NONCEBYTES 32
+#define hydro_sign_PREHASHBYTES 64
+
+static void
+hydro_sign_p2(uint8_t sig[hydro_x25519_BYTES], const uint8_t challenge[hydro_sign_CHALLENGEBYTES],
+              const uint8_t eph_sk[hydro_x25519_BYTES], const uint8_t sk[hydro_x25519_BYTES])
+{
+    hydro_x25519_scalar_t scalar1, scalar2, scalar3;
+
+    COMPILER_ASSERT(hydro_sign_CHALLENGEBYTES == hydro_x25519_BYTES);
+    hydro_x25519_swapin(scalar1, eph_sk);
+    hydro_x25519_swapin(scalar2, sk);
+    hydro_x25519_swapin(scalar3, challenge);
+    hydro_x25519_sc_montmul(scalar1, scalar2, scalar3);
+    mem_zero(scalar2, sizeof scalar2);
+    hydro_x25519_sc_montmul(scalar2, scalar1, hydro_x25519_sc_r2);
+    hydro_x25519_swapout(sig, scalar2);
+}
+
+static void
+hydro_sign_challenge(uint8_t       challenge[hydro_sign_CHALLENGEBYTES],
+                     const uint8_t nonce[hydro_sign_NONCEBYTES],
+                     const uint8_t pk[hydro_sign_PUBLICKEYBYTES],
+                     const uint8_t prehash[hydro_sign_PREHASHBYTES])
+{
+    hydro_hash_state st;
+
+    hydro_hash_init(&st, (const char *) zero, NULL);
+    hydro_hash_update(&st, nonce, hydro_sign_NONCEBYTES);
+    hydro_hash_update(&st, pk, hydro_sign_PUBLICKEYBYTES);
+    hydro_hash_update(&st, prehash, hydro_sign_PREHASHBYTES);
+    hydro_hash_final(&st, challenge, hydro_sign_CHALLENGEBYTES);
+}
+
+static int
+hydro_sign_prehash(uint8_t csig[hydro_sign_BYTES], const uint8_t prehash[hydro_sign_PREHASHBYTES],
+                   const uint8_t sk[hydro_sign_SECRETKEYBYTES])
+{
+    hydro_hash_state st;
+    uint8_t          challenge[hydro_sign_CHALLENGEBYTES];
+    const uint8_t *  pk     = &sk[hydro_x25519_SECRETKEYBYTES];
+    uint8_t *        nonce  = &csig[0];
+    uint8_t *        sig    = &csig[hydro_sign_NONCEBYTES];
+    uint8_t *        eph_sk = sig;
+
+    hydro_random_buf(eph_sk, hydro_x25519_SECRETKEYBYTES);
+    COMPILER_ASSERT(hydro_x25519_SECRETKEYBYTES == hydro_hash_KEYBYTES);
+    hydro_hash_init(&st, (const char *) zero, sk);
+    hydro_hash_update(&st, eph_sk, hydro_x25519_SECRETKEYBYTES);
+    hydro_hash_update(&st, prehash, hydro_sign_CHALLENGEBYTES);
+    hydro_hash_final(&st, eph_sk, hydro_x25519_SECRETKEYBYTES);
+
+    hydro_x25519_scalarmult_base_uniform(nonce, eph_sk);
+    hydro_sign_challenge(challenge, nonce, pk, prehash);
+
+    COMPILER_ASSERT(hydro_sign_BYTES == hydro_sign_NONCEBYTES + hydro_x25519_SECRETKEYBYTES);
+    COMPILER_ASSERT(hydro_x25519_SECRETKEYBYTES <= hydro_sign_CHALLENGEBYTES);
+    hydro_sign_p2(sig, challenge, eph_sk, sk);
+
+    return 0;
+}
+
+static int
+hydro_sign_verify_core(hydro_x25519_fe xs[5], const hydro_x25519_limb_t *other1,
+                       const uint8_t other2[hydro_x25519_BYTES])
+{
+    hydro_x25519_limb_t *     z2 = xs[1], *x3 = xs[2], *z3 = xs[3];
+    hydro_x25519_fe           xo2;
+    const hydro_x25519_limb_t sixteen = 16;
+
+    hydro_x25519_swapin(xo2, other2);
+    memcpy(x3, other1, 2 * sizeof(hydro_x25519_fe));
+    hydro_x25519_ladder_part1(xs);
+
+    /* Here z2 = t2^2 */
+    hydro_x25519_mul1(z2, other1);
+    hydro_x25519_mul1(z2, other1 + hydro_x25519_NLIMBS);
+    hydro_x25519_mul1(z2, xo2);
+
+    hydro_x25519_mul(z2, z2, &sixteen, 1);
+
+    hydro_x25519_mul1(z3, xo2);
+    hydro_x25519_sub(z3, z3, x3);
+    hydro_x25519_sqr1(z3);
+
+    /* check equality */
+    hydro_x25519_sub(z3, z3, z2);
+
+    /* canon(z2): both sides are zero. canon(z3): the two sides are equal. */
+    /* Reject sigs where both sides are zero. */
+    return hydro_x25519_canon(z2) | ~hydro_x25519_canon(z3);
+}
+
+static int
+hydro_sign_verify_p2(const uint8_t sig[hydro_x25519_BYTES],
+                     const uint8_t challenge[hydro_sign_CHALLENGEBYTES],
+                     const uint8_t nonce[hydro_sign_NONCEBYTES],
+                     const uint8_t pk[hydro_x25519_BYTES])
+{
+    hydro_x25519_fe xs[7];
+
+    hydro_x25519_core(&xs[0], challenge, pk, 0);
+    hydro_x25519_core(&xs[2], sig, hydro_x25519_BASE_POINT, 0);
+
+    return hydro_sign_verify_core(&xs[2], xs[0], nonce);
+}
+
+static int
+hydro_sign_verify_challenge(const uint8_t csig[hydro_sign_BYTES],
+                            const uint8_t challenge[hydro_sign_CHALLENGEBYTES],
+                            const uint8_t pk[hydro_sign_PUBLICKEYBYTES])
+{
+    const uint8_t *nonce = &csig[0];
+    const uint8_t *sig   = &csig[hydro_sign_NONCEBYTES];
+
+    return hydro_sign_verify_p2(sig, challenge, nonce, pk);
+}
+
+void
+hydro_sign_keygen(hydro_sign_keypair *kp)
+{
+    uint8_t *pk_copy = &kp->sk[hydro_x25519_SECRETKEYBYTES];
+
+    COMPILER_ASSERT(hydro_sign_SECRETKEYBYTES ==
+                    hydro_x25519_SECRETKEYBYTES + hydro_x25519_PUBLICKEYBYTES);
+    COMPILER_ASSERT(hydro_sign_PUBLICKEYBYTES == hydro_x25519_PUBLICKEYBYTES);
+    hydro_random_buf(kp->sk, hydro_x25519_SECRETKEYBYTES);
+    hydro_x25519_scalarmult_base_uniform(kp->pk, kp->sk);
+    memcpy(pk_copy, kp->pk, hydro_x25519_PUBLICKEYBYTES);
+}
+
+void
+hydro_sign_keygen_deterministic(hydro_sign_keypair *kp, const uint8_t seed[hydro_sign_SEEDBYTES])
+{
+    uint8_t *pk_copy = &kp->sk[hydro_x25519_SECRETKEYBYTES];
+
+    COMPILER_ASSERT(hydro_sign_SEEDBYTES >= hydro_random_SEEDBYTES);
+    hydro_random_buf_deterministic(kp->sk, hydro_x25519_SECRETKEYBYTES, seed);
+    hydro_x25519_scalarmult_base_uniform(kp->pk, kp->sk);
+    memcpy(pk_copy, kp->pk, hydro_x25519_PUBLICKEYBYTES);
+}
+
+int
+hydro_sign_init(hydro_sign_state *state, const char ctx[hydro_sign_CONTEXTBYTES])
+{
+    return hydro_hash_init(&state->hash_st, ctx, NULL);
+}
+
+int
+hydro_sign_update(hydro_sign_state *state, const void *m_, size_t mlen)
+{
+    return hydro_hash_update(&state->hash_st, m_, mlen);
+}
+
+int
+hydro_sign_final_create(hydro_sign_state *state, uint8_t csig[hydro_sign_BYTES],
+                        const uint8_t sk[hydro_sign_SECRETKEYBYTES])
+{
+    uint8_t prehash[hydro_sign_PREHASHBYTES];
+
+    hydro_hash_final(&state->hash_st, prehash, sizeof prehash);
+
+    return hydro_sign_prehash(csig, prehash, sk);
+}
+
+int
+hydro_sign_final_verify(hydro_sign_state *state, const uint8_t csig[hydro_sign_BYTES],
+                        const uint8_t pk[hydro_sign_PUBLICKEYBYTES])
+{
+    uint8_t        challenge[hydro_sign_CHALLENGEBYTES];
+    uint8_t        prehash[hydro_sign_PREHASHBYTES];
+    const uint8_t *nonce = &csig[0];
+
+    hydro_hash_final(&state->hash_st, prehash, sizeof prehash);
+    hydro_sign_challenge(challenge, nonce, pk, prehash);
+
+    return hydro_sign_verify_challenge(csig, challenge, pk);
+}
+
+int
+hydro_sign_create(uint8_t csig[hydro_sign_BYTES], const void *m_, size_t mlen,
+                  const char    ctx[hydro_sign_CONTEXTBYTES],
+                  const uint8_t sk[hydro_sign_SECRETKEYBYTES])
+{
+    hydro_sign_state st;
+
+    if (hydro_sign_init(&st, ctx) != 0 || hydro_sign_update(&st, m_, mlen) != 0 ||
+        hydro_sign_final_create(&st, csig, sk) != 0) {
+        return -1;
+    }
+    return 0;
+}
+
+int
+hydro_sign_verify(const uint8_t csig[hydro_sign_BYTES], const void *m_, size_t mlen,
+                  const char    ctx[hydro_sign_CONTEXTBYTES],
+                  const uint8_t pk[hydro_sign_PUBLICKEYBYTES])
+{
+    hydro_sign_state st;
+
+    if (hydro_sign_init(&st, ctx) != 0 || hydro_sign_update(&st, m_, mlen) != 0 ||
+        hydro_sign_final_verify(&st, csig, pk) != 0) {
+        return -1;
+    }
+    return 0;
+}

+ 383 - 0
libhydrogen.mod/libhydrogen/impl/x25519.h

@@ -0,0 +1,383 @@
+/*
+ * Based on Michael Hamburg's STROBE reference implementation.
+ * Copyright (c) 2015-2016 Cryptography Research, Inc.
+ * MIT License (MIT)
+ */
+
+#if defined(__GNUC__) && defined(__SIZEOF_INT128__)
+# define hydro_x25519_WBITS 64
+#else
+# define hydro_x25519_WBITS 32
+#endif
+
+#if hydro_x25519_WBITS == 64
+typedef uint64_t    hydro_x25519_limb_t;
+typedef __uint128_t hydro_x25519_dlimb_t;
+typedef __int128_t  hydro_x25519_sdlimb_t;
+# define hydro_x25519_eswap_limb(X) LOAD64_LE((const uint8_t *) &(X))
+# define hydro_x25519_LIMB(x) x##ull
+#elif hydro_x25519_WBITS == 32
+typedef uint32_t hydro_x25519_limb_t;
+typedef uint64_t hydro_x25519_dlimb_t;
+typedef int64_t  hydro_x25519_sdlimb_t;
+# define hydro_x25519_eswap_limb(X) LOAD32_LE((const uint8_t *) &(X))
+# define hydro_x25519_LIMB(x) (uint32_t)(x##ull), (uint32_t)((x##ull) >> 32)
+#else
+# error "Need to know hydro_x25519_WBITS"
+#endif
+
+#define hydro_x25519_NLIMBS (256 / hydro_x25519_WBITS)
+typedef hydro_x25519_limb_t hydro_x25519_fe[hydro_x25519_NLIMBS];
+
+typedef hydro_x25519_limb_t hydro_x25519_scalar_t[hydro_x25519_NLIMBS];
+
+static const hydro_x25519_limb_t hydro_x25519_MONTGOMERY_FACTOR =
+    (hydro_x25519_limb_t) 0xd2b51da312547e1bull;
+
+static const hydro_x25519_scalar_t hydro_x25519_sc_p = { hydro_x25519_LIMB(0x5812631a5cf5d3ed),
+                                                         hydro_x25519_LIMB(0x14def9dea2f79cd6),
+                                                         hydro_x25519_LIMB(0x0000000000000000),
+                                                         hydro_x25519_LIMB(0x1000000000000000) };
+
+static const hydro_x25519_scalar_t hydro_x25519_sc_r2 = { hydro_x25519_LIMB(0xa40611e3449c0f01),
+                                                          hydro_x25519_LIMB(0xd00e1ba768859347),
+                                                          hydro_x25519_LIMB(0xceec73d217f5be65),
+                                                          hydro_x25519_LIMB(0x0399411b7c309a3d) };
+
+static const uint8_t hydro_x25519_BASE_POINT[hydro_x25519_BYTES] = { 9 };
+
+static const hydro_x25519_limb_t hydro_x25519_a24[1] = { 121665 };
+
+static inline hydro_x25519_limb_t
+hydro_x25519_umaal(hydro_x25519_limb_t *carry, hydro_x25519_limb_t acc, hydro_x25519_limb_t mand,
+                   hydro_x25519_limb_t mier)
+{
+    hydro_x25519_dlimb_t tmp = (hydro_x25519_dlimb_t) mand * mier + acc + *carry;
+
+    *carry = tmp >> hydro_x25519_WBITS;
+    return (hydro_x25519_limb_t) tmp;
+}
+
+static inline hydro_x25519_limb_t
+hydro_x25519_adc(hydro_x25519_limb_t *carry, hydro_x25519_limb_t acc, hydro_x25519_limb_t mand)
+{
+    hydro_x25519_dlimb_t total = (hydro_x25519_dlimb_t) *carry + acc + mand;
+
+    *carry = total >> hydro_x25519_WBITS;
+    return (hydro_x25519_limb_t) total;
+}
+
+static inline hydro_x25519_limb_t
+hydro_x25519_adc0(hydro_x25519_limb_t *carry, hydro_x25519_limb_t acc)
+{
+    hydro_x25519_dlimb_t total = (hydro_x25519_dlimb_t) *carry + acc;
+
+    *carry = total >> hydro_x25519_WBITS;
+    return (hydro_x25519_limb_t) total;
+}
+
+static void
+hydro_x25519_propagate(hydro_x25519_fe x, hydro_x25519_limb_t over)
+{
+    hydro_x25519_limb_t carry;
+    int                 i;
+
+    over = x[hydro_x25519_NLIMBS - 1] >> (hydro_x25519_WBITS - 1) | over << 1;
+    x[hydro_x25519_NLIMBS - 1] &= ~((hydro_x25519_limb_t) 1 << (hydro_x25519_WBITS - 1));
+    carry = over * 19;
+    for (i = 0; i < hydro_x25519_NLIMBS; i++) {
+        x[i] = hydro_x25519_adc0(&carry, x[i]);
+    }
+}
+
+static void
+hydro_x25519_add(hydro_x25519_fe out, const hydro_x25519_fe a, const hydro_x25519_fe b)
+{
+    hydro_x25519_limb_t carry = 0;
+    int                 i;
+
+    for (i = 0; i < hydro_x25519_NLIMBS; i++) {
+        out[i] = hydro_x25519_adc(&carry, a[i], b[i]);
+    }
+    hydro_x25519_propagate(out, carry);
+}
+
+static void
+hydro_x25519_sub(hydro_x25519_fe out, const hydro_x25519_fe a, const hydro_x25519_fe b)
+{
+    hydro_x25519_sdlimb_t carry = -38;
+    int                   i;
+
+    for (i = 0; i < hydro_x25519_NLIMBS; i++) {
+        out[i] = (hydro_x25519_limb_t) (carry = carry + a[i] - b[i]);
+        carry >>= hydro_x25519_WBITS;
+    }
+    hydro_x25519_propagate(out, (hydro_x25519_limb_t) (1 + carry));
+}
+
+static void
+hydro_x25519_swapin(hydro_x25519_limb_t *x, const uint8_t *in)
+{
+    int i;
+
+    memcpy(x, in, sizeof(hydro_x25519_fe));
+    for (i = 0; i < hydro_x25519_NLIMBS; i++) {
+        x[i] = hydro_x25519_eswap_limb(x[i]);
+    }
+}
+
+static void
+hydro_x25519_swapout(uint8_t *out, hydro_x25519_limb_t *x)
+{
+    int i;
+
+    for (i = 0; i < hydro_x25519_NLIMBS; i++) {
+        x[i] = hydro_x25519_eswap_limb(x[i]);
+    }
+    memcpy(out, x, sizeof(hydro_x25519_fe));
+}
+
+static void
+hydro_x25519_mul(hydro_x25519_fe out, const hydro_x25519_fe a, const hydro_x25519_fe b, int nb)
+{
+    hydro_x25519_limb_t accum[2 * hydro_x25519_NLIMBS] = { 0 };
+    hydro_x25519_limb_t carry2;
+    int                 i, j;
+
+    for (i = 0; i < nb; i++) {
+        carry2                   = 0;
+        hydro_x25519_limb_t mand = b[i];
+        for (j = 0; j < hydro_x25519_NLIMBS; j++) {
+            accum[i + j] = hydro_x25519_umaal(&carry2, accum[i + j], mand, a[j]);
+        }
+        accum[i + j] = carry2;
+    }
+    carry2 = 0;
+    for (j = 0; j < hydro_x25519_NLIMBS; j++) {
+        const hydro_x25519_limb_t mand = 38;
+
+        out[j] = hydro_x25519_umaal(&carry2, accum[j], mand, accum[j + hydro_x25519_NLIMBS]);
+    }
+    hydro_x25519_propagate(out, carry2);
+}
+
+static void
+hydro_x25519_sqr(hydro_x25519_fe out, const hydro_x25519_fe a)
+{
+    hydro_x25519_mul(out, a, a, hydro_x25519_NLIMBS);
+}
+
+static void
+hydro_x25519_mul1(hydro_x25519_fe out, const hydro_x25519_fe a)
+{
+    hydro_x25519_mul(out, a, out, hydro_x25519_NLIMBS);
+}
+
+static void
+hydro_x25519_sqr1(hydro_x25519_fe a)
+{
+    hydro_x25519_mul1(a, a);
+}
+
+static void
+hydro_x25519_condswap(hydro_x25519_limb_t a[2 * hydro_x25519_NLIMBS],
+                      hydro_x25519_limb_t b[2 * hydro_x25519_NLIMBS], hydro_x25519_limb_t doswap)
+{
+    int i;
+
+    for (i = 0; i < 2 * hydro_x25519_NLIMBS; i++) {
+        hydro_x25519_limb_t xorv = (a[i] ^ b[i]) & doswap;
+        a[i] ^= xorv;
+        b[i] ^= xorv;
+    }
+}
+
+static int
+hydro_x25519_canon(hydro_x25519_fe x)
+{
+    hydro_x25519_sdlimb_t carry;
+    hydro_x25519_limb_t   carry0 = 19;
+    hydro_x25519_limb_t   res;
+    int                   i;
+
+    for (i = 0; i < hydro_x25519_NLIMBS; i++) {
+        x[i] = hydro_x25519_adc0(&carry0, x[i]);
+    }
+    hydro_x25519_propagate(x, carry0);
+    carry = -19;
+    res   = 0;
+    for (i = 0; i < hydro_x25519_NLIMBS; i++) {
+        res |= x[i] = (hydro_x25519_limb_t) (carry += x[i]);
+        carry >>= hydro_x25519_WBITS;
+    }
+    return ((hydro_x25519_dlimb_t) res - 1) >> hydro_x25519_WBITS;
+}
+
+static void
+hydro_x25519_ladder_part1(hydro_x25519_fe xs[5])
+{
+    hydro_x25519_limb_t *x2 = xs[0], *z2 = xs[1], *x3 = xs[2], *z3 = xs[3], *t1 = xs[4];
+
+    hydro_x25519_add(t1, x2, z2);              // t1 = A
+    hydro_x25519_sub(z2, x2, z2);              // z2 = B
+    hydro_x25519_add(x2, x3, z3);              // x2 = C
+    hydro_x25519_sub(z3, x3, z3);              // z3 = D
+    hydro_x25519_mul1(z3, t1);                 // z3 = DA
+    hydro_x25519_mul1(x2, z2);                 // x3 = BC
+    hydro_x25519_add(x3, z3, x2);              // x3 = DA+CB
+    hydro_x25519_sub(z3, z3, x2);              // z3 = DA-CB
+    hydro_x25519_sqr1(t1);                     // t1 = AA
+    hydro_x25519_sqr1(z2);                     // z2 = BB
+    hydro_x25519_sub(x2, t1, z2);              // x2 = E = AA-BB
+    hydro_x25519_mul(z2, x2, hydro_x25519_a24, // z2 = E*a24
+                     sizeof(hydro_x25519_a24) / sizeof(hydro_x25519_a24[0]));
+    hydro_x25519_add(z2, z2, t1); // z2 = E*a24 + AA
+}
+
+static void
+hydro_x25519_ladder_part2(hydro_x25519_fe xs[5], const hydro_x25519_fe x1)
+{
+    hydro_x25519_limb_t *x2 = xs[0], *z2 = xs[1], *x3 = xs[2], *z3 = xs[3], *t1 = xs[4];
+
+    hydro_x25519_sqr1(z3);        // z3 = (DA-CB)^2
+    hydro_x25519_mul1(z3, x1);    // z3 = x1 * (DA-CB)^2
+    hydro_x25519_sqr1(x3);        // x3 = (DA+CB)^2
+    hydro_x25519_mul1(z2, x2);    // z2 = AA*(E*a24+AA)
+    hydro_x25519_sub(x2, t1, x2); // x2 = BB again
+    hydro_x25519_mul1(x2, t1);    // x2 = AA*BB
+}
+
+static void
+hydro_x25519_core(hydro_x25519_fe xs[5], const uint8_t scalar[hydro_x25519_BYTES],
+                  const uint8_t *x1, bool clamp)
+{
+    hydro_x25519_limb_t  swap;
+    hydro_x25519_limb_t *x2 = xs[0], *x3 = xs[2], *z3 = xs[3];
+    hydro_x25519_fe      x1i;
+    int                  i;
+
+    hydro_x25519_swapin(x1i, x1);
+    x1   = (const uint8_t *) x1i;
+    swap = 0;
+    mem_zero(xs, 4 * sizeof(hydro_x25519_fe));
+    x2[0] = z3[0] = 1;
+    memcpy(x3, x1, sizeof(hydro_x25519_fe));
+    for (i = 255; i >= 0; i--) {
+        uint8_t             bytei = scalar[i / 8];
+        hydro_x25519_limb_t doswap;
+        hydro_x25519_fe     x1_dup;
+
+        if (clamp) {
+            if (i / 8 == 0) {
+                bytei &= ~7;
+            } else if (i / 8 == hydro_x25519_BYTES - 1) {
+                bytei &= 0x7F;
+                bytei |= 0x40;
+            }
+        }
+        doswap = 1U + ~(hydro_x25519_limb_t)((bytei >> (i % 8)) & 1);
+        hydro_x25519_condswap(x2, x3, swap ^ doswap);
+        swap = doswap;
+        hydro_x25519_ladder_part1(xs);
+        memcpy(x1_dup, x1, sizeof x1_dup);
+        hydro_x25519_ladder_part2(xs, x1_dup);
+    }
+    hydro_x25519_condswap(x2, x3, swap);
+}
+
+static int
+hydro_x25519_scalarmult(uint8_t out[hydro_x25519_BYTES], const uint8_t scalar[hydro_x25519_BYTES],
+                        const uint8_t x1[hydro_x25519_BYTES], bool clamp)
+{
+    hydro_x25519_fe      xs[5];
+    hydro_x25519_limb_t *x2, *z2, *z3;
+    hydro_x25519_limb_t *prev;
+    int                  i;
+    int                  ret;
+
+    hydro_x25519_core(xs, scalar, x1, clamp);
+
+    /* Precomputed inversion chain */
+    x2   = xs[0];
+    z2   = xs[1];
+    z3   = xs[3];
+    prev = z2;
+
+    /* Raise to the p-2 = 0x7f..ffeb */
+    for (i = 253; i >= 0; i--) {
+        hydro_x25519_sqr(z3, prev);
+        prev = z3;
+        if (i >= 8 || (0xeb >> i & 1)) {
+            hydro_x25519_mul1(z3, z2);
+        }
+    }
+
+    /* Here prev = z3 */
+    /* x2 /= z2 */
+    hydro_x25519_mul1(x2, z3);
+    ret = hydro_x25519_canon(x2);
+    hydro_x25519_swapout(out, x2);
+
+    if (clamp == 0) {
+        return 0;
+    }
+    return ret;
+}
+
+static inline int
+hydro_x25519_scalarmult_base(uint8_t       pk[hydro_x25519_PUBLICKEYBYTES],
+                             const uint8_t sk[hydro_x25519_SECRETKEYBYTES])
+{
+    return hydro_x25519_scalarmult(pk, sk, hydro_x25519_BASE_POINT, 1);
+}
+
+static inline void
+hydro_x25519_scalarmult_base_uniform(uint8_t       pk[hydro_x25519_PUBLICKEYBYTES],
+                                     const uint8_t sk[hydro_x25519_SECRETKEYBYTES])
+{
+    if (hydro_x25519_scalarmult(pk, sk, hydro_x25519_BASE_POINT, 0) != 0) {
+        abort();
+    }
+}
+
+static void
+hydro_x25519_sc_montmul(hydro_x25519_scalar_t out, const hydro_x25519_scalar_t a,
+                        const hydro_x25519_scalar_t b)
+{
+    hydro_x25519_limb_t hic = 0;
+    int                 i, j;
+
+    for (i = 0; i < hydro_x25519_NLIMBS; i++) {
+        hydro_x25519_limb_t carry = 0, carry2 = 0, mand = a[i],
+                            mand2 = hydro_x25519_MONTGOMERY_FACTOR;
+
+        for (j = 0; j < hydro_x25519_NLIMBS; j++) {
+            hydro_x25519_limb_t acc = out[j];
+
+            acc = hydro_x25519_umaal(&carry, acc, mand, b[j]);
+            if (j == 0) {
+                mand2 *= acc;
+            }
+            acc = hydro_x25519_umaal(&carry2, acc, mand2, hydro_x25519_sc_p[j]);
+            if (j > 0) {
+                out[j - 1] = acc;
+            }
+        }
+
+        /* Add two carry registers and high carry */
+        out[hydro_x25519_NLIMBS - 1] = hydro_x25519_adc(&hic, carry, carry2);
+    }
+
+    /* Reduce */
+    hydro_x25519_sdlimb_t scarry = 0;
+    for (i = 0; i < hydro_x25519_NLIMBS; i++) {
+        out[i] = (hydro_x25519_limb_t) (scarry = scarry + out[i] - hydro_x25519_sc_p[i]);
+        scarry >>= hydro_x25519_WBITS;
+    }
+    hydro_x25519_limb_t need_add = (hydro_x25519_limb_t) -(scarry + hic);
+
+    hydro_x25519_limb_t carry = 0;
+    for (i = 0; i < hydro_x25519_NLIMBS; i++) {
+        out[i] = hydro_x25519_umaal(&carry, out[i], need_add, hydro_x25519_sc_p[i]);
+    }
+}

+ 10 - 0
libhydrogen.mod/libhydrogen/library.properties

@@ -0,0 +1,10 @@
+architectures=avr,nrf52
+author=Frank Denis <[email protected]>
+category=Other
+includes=hydrogen.h
+maintainer=Frank Denis <[email protected]>
+name=hydrogen-crypto
+paragraph=Consistent high-level API, inspired by libsodium. Instead of low-level primitives, it exposes simple functions to solve common problems that cryptography can solve.
+sentence=An easy-to-use, hard-to-misuse cryptographic library
+url=https://github.com/jedisct1/libhydrogen
+version=0.1

BIN
libhydrogen.mod/libhydrogen/logo.png


+ 439 - 0
libhydrogen.mod/libhydrogen/tests/tests.c

@@ -0,0 +1,439 @@
+#include <assert.h>
+#include <stdio.h>
+#include <string.h>
+
+#include "hydrogen.h"
+
+static const char *ctx = "libtests";
+
+static int
+streq(const char *expected, const char *found)
+{
+    if (strcmp(expected, found) != 0) {
+        fprintf(stderr, "Found: [%s]\n", found);
+        return 0;
+    }
+    return 1;
+}
+#define assert_streq(EXPECTED, FOUND) assert(streq((EXPECTED), (FOUND)))
+
+static void
+test_randombytes(void)
+{
+    uint8_t       dk[hydro_random_SEEDBYTES];
+    uint8_t       tmp[10000];
+    unsigned long b = 0U;
+    unsigned long bp;
+    uint32_t      x;
+    size_t        i, j;
+
+    for (i = 0; i < 10000; i++) {
+        x = hydro_random_u32();
+        for (j = 0; j < sizeof x; j++) {
+            b += (x >> j) & 1;
+        }
+    }
+    assert(b > 18000 && b < 22000);
+
+    b = 0;
+    hydro_random_buf(tmp, sizeof tmp);
+    for (i = 0; i < 10000; i++) {
+        for (j = 0; j < sizeof tmp[0]; j++) {
+            b += (tmp[i] >> j) & 1;
+        }
+    }
+    assert(b > 4500 && b < 5500);
+
+    memcpy(dk, tmp, sizeof dk);
+    b = 0;
+    hydro_random_buf_deterministic(tmp, 10000, dk);
+    for (i = 0; i < 10000; i++) {
+        for (j = 0; j < sizeof tmp[0]; j++) {
+            b += (tmp[i] >> j) & 1;
+        }
+    }
+    assert(b > 4500 && b < 5500);
+    bp = b;
+    b  = 0;
+    hydro_random_buf_deterministic(tmp, 10000, dk);
+    for (i = 0; i < 10000; i++) {
+        for (j = 0; j < sizeof tmp[0]; j++) {
+            b += (tmp[i] >> j) & 1;
+        }
+    }
+    assert(b == bp);
+
+    for (i = 0; i < 1000; i++) {
+        for (j = 1; j < 100; j++) {
+            x = hydro_random_uniform((uint32_t) j);
+            assert(x < j);
+        }
+    }
+}
+
+static void
+test_hash(void)
+{
+    hydro_hash_state st;
+    uint8_t          dk[hydro_random_SEEDBYTES];
+    uint8_t          h[100];
+    uint8_t          key[hydro_hash_KEYBYTES];
+    uint8_t          msg[1000];
+    char             hex[100 * 2 + 1];
+    size_t           i;
+
+    memset(dk, 0, sizeof dk);
+    hydro_random_buf_deterministic(key, sizeof key, dk);
+    hydro_increment(dk, sizeof dk);
+    hydro_hash_init(&st, ctx, key);
+    for (i = 0; i <= sizeof msg; i++) {
+        hydro_random_buf_deterministic(msg, i, dk);
+        hydro_increment(dk, sizeof dk);
+        hydro_hash_update(&st, msg, i);
+    }
+    hydro_hash_final(&st, h, sizeof h);
+    hydro_bin2hex(hex, sizeof hex, h, sizeof h);
+    assert_streq(
+        "e5d2beb77a039965850ee76327e06b2fa6cb5121db8038b11bce4641a9c4bd843658104bdf07342570bb5fd1d7"
+        "2c0d31a8981b47c718fddaffbd4171605c873cbaf921bb57988dd814f3a3fbef9799ff7c762705c4bf37ab2981"
+        "5981bf0d8833d60afe14",
+        hex);
+    hydro_hash_hash(h, sizeof h, msg, sizeof msg, ctx, key);
+    hydro_bin2hex(hex, sizeof hex, h, sizeof h);
+    assert_streq(
+        "724bd8883df73320ffd70923cb997f9a99bc670c4d78887be4975add0099fbf489b266a85d1f56743062d60a05"
+        "590cbce47e45108367879bf4641cbaefe584e8618cbeb8c230ae956da22c7c5c4f11a8804ca576ec20fa5da239"
+        "dde3d03a6018383c21f5",
+        hex);
+    hydro_hash_hash(h, hydro_hash_BYTES, msg, sizeof msg, ctx, key);
+    hydro_bin2hex(hex, sizeof hex, h, hydro_hash_BYTES);
+    assert_streq("7dfa45ce18210e2422fd658bf7beccb6e534e44f99ae359f4af3ba41af8ca463", hex);
+}
+
+static void
+test_core(void)
+{
+    uint8_t     x[100];
+    uint8_t     y[100];
+    uint8_t     a[5] = { 1, 2, 3, 4, 5 };
+    uint8_t     b[5] = { 1, 2, 3, 4, 5 };
+    char        hex[201];
+    const char *hexf;
+
+    memset(x, 0xd0, sizeof x);
+    hydro_memzero(x, sizeof x);
+    assert(x[0] == 0);
+    assert(x[sizeof x - 1] == 0);
+    hydro_increment(x, sizeof x);
+    assert(x[0] == 1);
+    assert(x[sizeof x - 1] == 0);
+    x[0] = 0xff;
+    hydro_increment(x, sizeof x);
+    assert(x[0] == 0);
+    assert(x[1] == 1);
+    assert(x[sizeof x - 1] == 0);
+    assert(hydro_equal(a, b, sizeof a));
+    assert(!hydro_equal(a, a, sizeof a));
+    assert(hydro_compare(a, b, sizeof a) == 0);
+    assert(hydro_compare(a, a, sizeof a) == 0);
+    a[0]++;
+    assert(hydro_compare(a, b, sizeof a) == 1);
+    assert(hydro_compare(b, a, sizeof a) == -1);
+    hydro_random_buf(x, sizeof x);
+    assert(hydro_bin2hex(hex, sizeof hex, x, sizeof x) != NULL);
+    assert(hydro_hex2bin(y, 1, hex, sizeof hex, NULL, NULL) == -1);
+    assert(hydro_hex2bin(y, sizeof y, hex, sizeof hex, NULL, NULL) == -1);
+    assert(hydro_hex2bin(y, sizeof y, hex, sizeof hex - 1, NULL, NULL) == sizeof x);
+    assert(hydro_equal(x, y, sizeof x));
+    assert(hydro_hex2bin(x, sizeof x, "452a", 4, NULL, NULL) == 2);
+    assert(hydro_hex2bin(y, sizeof y, "#452a#", 6, "#", NULL) == 2);
+    assert(hydro_equal(x, y, sizeof x));
+    memcpy(hex, "#452a", sizeof "#452a");
+    assert(hydro_hex2bin(x, sizeof x, hex, 0, NULL, &hexf) == 0);
+    assert(hexf == hex);
+    assert(hydro_hex2bin(x, sizeof x, hex, sizeof "#452a", NULL, &hexf) == 0);
+    assert(hexf == hex);
+    assert(hydro_hex2bin(x, sizeof x, hex, sizeof "#452a", "#", &hexf) == 2);
+    assert(hexf == hex + 6);
+}
+
+static void
+test_secretbox(void)
+{
+    uint8_t key[hydro_secretbox_KEYBYTES];
+    uint8_t m[25];
+    uint8_t m2[25];
+    uint8_t c[hydro_secretbox_HEADERBYTES + 25];
+    uint8_t dk[hydro_random_SEEDBYTES];
+    uint8_t probe[hydro_secretbox_PROBEBYTES];
+
+    memset(dk, 0, sizeof dk);
+    hydro_random_buf_deterministic(m, sizeof m, dk);
+    hydro_increment(dk, sizeof dk);
+    hydro_random_buf_deterministic(key, sizeof key, dk);
+    hydro_increment(dk, sizeof dk);
+    hydro_secretbox_encrypt(c, m, sizeof m, 0, ctx, key);
+    assert(hydro_secretbox_decrypt(m2, c, sizeof c, 0, ctx, key) == 0);
+    assert(hydro_equal(m, m2, sizeof m));
+
+    hydro_secretbox_probe_create(probe, c, sizeof c, ctx, key);
+    assert(hydro_secretbox_probe_verify(probe, c, sizeof c, ctx, key) == 0);
+    probe[0]++;
+    assert(hydro_secretbox_probe_verify(probe, c, sizeof c, ctx, key) == -1);
+    probe[0]--;
+    key[0]++;
+    assert(hydro_secretbox_probe_verify(probe, c, sizeof c, ctx, key) == -1);
+    key[0]--;
+
+    assert(hydro_secretbox_decrypt(m2, c, 0, 0, ctx, key) == -1);
+    assert(hydro_secretbox_decrypt(m2, c, 1, 0, ctx, key) == -1);
+    assert(hydro_secretbox_decrypt(m2, c, hydro_secretbox_HEADERBYTES, 0, ctx, key) == -1);
+    assert(hydro_secretbox_decrypt(m2, c, sizeof c, 1, ctx, key) == -1);
+    assert(!hydro_equal(m, m2, sizeof m));
+    key[0]++;
+    assert(hydro_secretbox_decrypt(m2, c, sizeof c, 0, ctx, key) == -1);
+    key[0]--;
+    c[hydro_random_uniform(sizeof c)]++;
+    assert(hydro_secretbox_decrypt(m2, c, sizeof c, 0, ctx, key) == -1);
+}
+
+static void
+test_kdf(void)
+{
+    uint8_t key[hydro_kdf_KEYBYTES];
+    uint8_t dk[hydro_random_SEEDBYTES];
+    uint8_t subkey1[16];
+    uint8_t subkey2[16];
+    uint8_t subkey3[32];
+    uint8_t subkey4[50];
+    char    subkey1_hex[16 * 2 + 1];
+    char    subkey2_hex[16 * 2 + 1];
+    char    subkey3_hex[32 * 2 + 1];
+    char    subkey4_hex[50 * 2 + 1];
+
+    memset(dk, 0, sizeof dk);
+    hydro_random_buf_deterministic(key, sizeof key, dk);
+    hydro_kdf_derive_from_key(subkey1, sizeof subkey1, 1, ctx, key);
+    hydro_kdf_derive_from_key(subkey2, sizeof subkey2, 2, ctx, key);
+    hydro_kdf_derive_from_key(subkey3, sizeof subkey3, 0, ctx, key);
+    hydro_kdf_derive_from_key(subkey4, sizeof subkey4, 0, ctx, key);
+    hydro_bin2hex(subkey1_hex, sizeof subkey1_hex, subkey1, sizeof subkey1);
+    hydro_bin2hex(subkey2_hex, sizeof subkey2_hex, subkey2, sizeof subkey2);
+    hydro_bin2hex(subkey3_hex, sizeof subkey3_hex, subkey3, sizeof subkey3);
+    hydro_bin2hex(subkey4_hex, sizeof subkey4_hex, subkey4, sizeof subkey4);
+    assert_streq("af8019d3516d4ba6c80a7ea5a87e4d77", subkey1_hex);
+    assert_streq("af8c4cba4e1f36c293631cc7001717dd", subkey2_hex);
+    assert_streq("ff9345489dea1e4fe59194cea8794c9b0af9380c2d18c3ab38eeef2af95c1e26", subkey3_hex);
+    assert_streq(
+        "a8dd79ca19d604d1487b82d76b8d4ad4138a29dfaeeb207b99b2e5904e7855555bb94a76070fa71871df6ed911"
+        "661d99efec",
+        subkey4_hex);
+}
+
+static void
+test_sign(void)
+{
+    uint8_t            msg[500];
+    uint8_t            sig[hydro_sign_BYTES];
+    hydro_sign_state   st;
+    hydro_sign_keypair kp;
+
+    hydro_random_buf(msg, sizeof msg);
+    hydro_sign_keygen(&kp);
+    hydro_sign_create(sig, msg, sizeof msg, ctx, kp.sk);
+    assert(hydro_sign_verify(sig, msg, sizeof msg, ctx, kp.pk) == 0);
+    sig[0]++;
+    assert(hydro_sign_verify(sig, msg, sizeof msg, ctx, kp.pk) == -1);
+    sig[0]--;
+    sig[hydro_sign_BYTES - 1]++;
+    assert(hydro_sign_verify(sig, msg, sizeof msg, ctx, kp.pk) == -1);
+    sig[hydro_sign_BYTES - 1]--;
+    msg[0]++;
+    assert(hydro_sign_verify(sig, msg, sizeof msg, ctx, kp.pk) == -1);
+    msg[0]++;
+    hydro_sign_create(sig, msg, sizeof msg, ctx, kp.sk);
+
+    hydro_sign_init(&st, ctx);
+    hydro_sign_update(&st, msg, (sizeof msg) / 3);
+    hydro_sign_update(&st, msg + (sizeof msg) / 3, (sizeof msg) - (sizeof msg) / 3);
+    assert(hydro_sign_final_verify(&st, sig, kp.pk) == 0);
+
+    hydro_sign_init(&st, ctx);
+    hydro_sign_update(&st, msg, (sizeof msg) / 3);
+    hydro_sign_update(&st, msg + (sizeof msg) / 3, (sizeof msg) - (sizeof msg) / 3);
+    hydro_sign_final_create(&st, sig, kp.sk);
+
+    hydro_sign_init(&st, ctx);
+    hydro_sign_update(&st, msg, (sizeof msg) / 3);
+    hydro_sign_update(&st, msg + (sizeof msg) / 3, (sizeof msg) - (sizeof msg) / 3);
+    assert(hydro_sign_final_verify(&st, sig, kp.pk) == 0);
+
+    hydro_sign_init(&st, ctx);
+    hydro_sign_update(&st, msg, (sizeof msg) / 3);
+    hydro_sign_update(&st, msg + (sizeof msg) / 3, (sizeof msg) - (sizeof msg) / 3);
+    sig[0]++;
+    assert(hydro_sign_final_verify(&st, sig, kp.pk) == -1);
+
+    hydro_sign_create(sig, msg, 0, ctx, kp.sk);
+    assert(hydro_sign_verify(sig, msg, sizeof msg, ctx, kp.pk) == -1);
+    assert(hydro_sign_verify(sig, msg, 0, ctx, kp.pk) == 0);
+}
+
+static void
+test_kx_n(void)
+{
+    hydro_kx_keypair         server_static_kp;
+    uint8_t                  psk[hydro_kx_PSKBYTES];
+    uint8_t                  packet1[hydro_kx_N_PACKET1BYTES];
+    hydro_kx_session_keypair kp_client;
+    hydro_kx_session_keypair kp_server;
+
+    hydro_kx_keygen(&server_static_kp);
+    hydro_random_buf(psk, sizeof psk);
+
+    hydro_kx_n_1(&kp_client, packet1, psk, server_static_kp.pk);
+    hydro_kx_n_2(&kp_server, packet1, psk, &server_static_kp);
+
+    assert(hydro_equal(kp_client.tx, kp_server.rx, hydro_kx_SESSIONKEYBYTES));
+    assert(hydro_equal(kp_client.rx, kp_server.tx, hydro_kx_SESSIONKEYBYTES));
+}
+
+static void
+test_kx_kk(void)
+{
+    hydro_kx_state           st_client;
+    hydro_kx_keypair         client_static_kp;
+    hydro_kx_keypair         server_static_kp;
+    uint8_t                  packet1[hydro_kx_KK_PACKET1BYTES];
+    uint8_t                  packet2[hydro_kx_KK_PACKET2BYTES];
+    hydro_kx_session_keypair kp_client;
+    hydro_kx_session_keypair kp_server;
+
+    hydro_kx_keygen(&client_static_kp);
+    hydro_kx_keygen(&server_static_kp);
+
+    hydro_kx_kk_1(&st_client, packet1, server_static_kp.pk, &client_static_kp);
+    hydro_kx_kk_2(&kp_server, packet2, packet1, client_static_kp.pk, &server_static_kp);
+    hydro_kx_kk_3(&st_client, &kp_client, packet2, &client_static_kp);
+
+    assert(hydro_equal(kp_client.tx, kp_server.rx, hydro_kx_SESSIONKEYBYTES));
+    assert(hydro_equal(kp_client.rx, kp_server.tx, hydro_kx_SESSIONKEYBYTES));
+}
+
+static void
+test_kx_xx(void)
+{
+    hydro_kx_state           st_client;
+    hydro_kx_state           st_server;
+    hydro_kx_keypair         client_static_kp;
+    hydro_kx_keypair         server_static_kp;
+    uint8_t                  psk[hydro_kx_PSKBYTES];
+    uint8_t                  client_peer_pk[hydro_kx_PUBLICKEYBYTES];
+    uint8_t                  server_peer_pk[hydro_kx_PUBLICKEYBYTES];
+    uint8_t                  packet1[hydro_kx_XX_PACKET1BYTES];
+    uint8_t                  packet2[hydro_kx_XX_PACKET2BYTES];
+    uint8_t                  packet3[hydro_kx_XX_PACKET3BYTES];
+    hydro_kx_session_keypair kp_client;
+    hydro_kx_session_keypair kp_server;
+
+    hydro_kx_keygen(&client_static_kp);
+    hydro_kx_keygen(&server_static_kp);
+
+    hydro_kx_xx_1(&st_client, packet1, NULL);
+    hydro_kx_xx_2(&st_server, packet2, packet1, NULL, &server_static_kp);
+    hydro_kx_xx_3(&st_client, &kp_client, packet3, NULL, packet2, NULL, &client_static_kp);
+    hydro_kx_xx_4(&st_server, &kp_server, NULL, packet3, NULL);
+
+    assert(hydro_equal(kp_client.tx, kp_server.rx, hydro_kx_SESSIONKEYBYTES));
+    assert(hydro_equal(kp_client.rx, kp_server.tx, hydro_kx_SESSIONKEYBYTES));
+
+    hydro_random_buf(psk, sizeof psk);
+    hydro_kx_xx_1(&st_client, packet1, psk);
+    hydro_kx_xx_2(&st_server, packet2, packet1, psk, &server_static_kp);
+    hydro_kx_xx_3(&st_client, &kp_client, packet3, client_peer_pk, packet2, psk, &client_static_kp);
+    hydro_kx_xx_4(&st_server, &kp_server, server_peer_pk, packet3, psk);
+
+    assert(hydro_equal(kp_client.tx, kp_server.rx, hydro_kx_SESSIONKEYBYTES));
+    assert(hydro_equal(kp_client.rx, kp_server.tx, hydro_kx_SESSIONKEYBYTES));
+    assert(hydro_equal(client_peer_pk, server_static_kp.pk, hydro_kx_PUBLICKEYBYTES));
+    assert(hydro_equal(server_peer_pk, client_static_kp.pk, hydro_kx_PUBLICKEYBYTES));
+}
+
+static void
+test_pwhash(void)
+{
+    uint8_t            master_key[hydro_pwhash_MASTERKEYBYTES];
+    uint8_t            new_master_key[hydro_pwhash_MASTERKEYBYTES];
+    uint8_t            stored[hydro_pwhash_STOREDBYTES];
+    uint8_t            h[64];
+    uint8_t            static_key[64];
+    char               h_hex[2 * 64 + 1];
+    unsigned long long ops = 1000;
+
+    memset(master_key, 'x', sizeof master_key);
+    hydro_pwhash_deterministic(h, sizeof h, "test", sizeof "test" - 1, ctx, master_key, ops, 0, 1);
+    hydro_bin2hex(h_hex, sizeof h_hex, h, sizeof h);
+    if (ops == 1000) {
+        assert_streq(
+            "2f1a804a02f25066fd0688bf8b8e03dff3a3866958a9cf5883c459e602e232d38e3e488723f0b4a2bc61d2"
+            "0cb36a04a4d2eb18be99bc61870d72d7de5d67f237",
+            h_hex);
+    }
+
+    hydro_pwhash_keygen(master_key);
+    assert(hydro_pwhash_create(stored, "test", sizeof "test" - 1, master_key, ops, 0, 1) == 0);
+    assert(hydro_pwhash_verify(stored, "test", sizeof "test" - 1, master_key, ops, 0, 1) == 0);
+    assert(hydro_pwhash_verify(stored, "test", sizeof "test" - 1, master_key, ops * 2, 10, 10) ==
+           0);
+    assert(hydro_pwhash_verify(stored, "test", sizeof "test" - 1, master_key, ops / 2, 10, 10) ==
+           -1);
+    assert(hydro_pwhash_verify(stored, "Test", sizeof "Test" - 1, master_key, ops, 0, 1) == -1);
+    assert(hydro_pwhash_verify(stored, "test", sizeof "tes" - 1, master_key, ops, 0, 1) == -1);
+
+    assert(hydro_pwhash_derive_static_key(static_key, sizeof static_key, stored, "test",
+                                          sizeof "test" - 1, ctx, master_key, ops, 0, 1) == 0);
+    assert(hydro_pwhash_derive_static_key(static_key, sizeof static_key, stored, "Test",
+                                          sizeof "Test" - 1, ctx, master_key, ops, 0, 1) == -1);
+
+    assert(hydro_pwhash_reencrypt(stored, master_key, master_key) == 0);
+    assert(hydro_pwhash_verify(stored, "test", sizeof "test" - 1, master_key, ops, 0, 1) == 0);
+    hydro_pwhash_keygen(new_master_key);
+    assert(hydro_pwhash_reencrypt(stored, master_key, new_master_key) == 0);
+    assert(hydro_pwhash_verify(stored, "test", sizeof "test" - 1, master_key, ops, 0, 1) == -1);
+    assert(hydro_pwhash_verify(stored, "test", sizeof "test" - 1, new_master_key, ops, 0, 1) == 0);
+
+    assert(hydro_pwhash_upgrade(stored, new_master_key, ops * 2, 0, 1) == 0);
+    assert(hydro_pwhash_verify(stored, "test", sizeof "test" - 1, new_master_key, ops, 0, 1) == -1);
+    assert(hydro_pwhash_verify(stored, "test", sizeof "test" - 1, new_master_key, ops * 2, 0, 1) ==
+           0);
+}
+
+int
+main(void)
+{
+#if defined(_WIN32)
+    /*
+     * On Windows, disable the "Abort - Retry - Ignore" GUI dialog that otherwise pops up on
+     * assertion failure.
+     */
+    _set_abort_behavior(0, _WRITE_ABORT_MSG | _CALL_REPORTFAULT);
+#endif
+
+    int ret;
+
+    ret = hydro_init();
+    assert(ret == 0);
+
+    test_core();
+    test_hash();
+    test_kdf();
+    test_kx_n();
+    test_kx_kk();
+    test_kx_xx();
+    test_pwhash();
+    test_randombytes();
+    test_secretbox();
+    test_sign();
+
+    return 0;
+}

+ 19 - 0
libhydrogen.mod/source.bmx

@@ -0,0 +1,19 @@
+'
+' Copyright (c) 2019 Bruce A Henderson
+'
+' Permission to use, copy, modify, and/or distribute this software for any
+' purpose with or without fee is hereby granted, provided that the above
+' copyright notice and this permission notice appear in all copies.
+'
+' THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES
+' WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF
+' MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR
+' ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES
+' WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN
+' ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF
+' OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE.
+'
+SuperStrict
+
+Import "libhydrogen/*.h"
+Import "libhydrogen/hydrogen.c"

+ 14 - 0
libtomcrypt.mod/libtomcrypt.bmx

@@ -0,0 +1,14 @@
+SuperStrict
+
+
+Module Crypto.libtomcrypt
+
+ModuleInfo "CC_OPTS: -DLTC_NO_TEST -DLTC_NO_FILE"
+
+Import "libtomcrypt/src/headers/*.h"
+
+Import "libtomcrypt/src/misc/base16/base16_decode.c"
+Import "libtomcrypt/src/misc/base16/base16_encode.c"
+
+Import "libtomcrypt/src/misc/compare_testvector.c"
+Import "libtomcrypt/src/misc/crypt/crypt_argchk.c"

+ 29 - 0
libtomcrypt.mod/libtomcrypt/LICENSE

@@ -0,0 +1,29 @@
+LibTomCrypt is licensed under DUAL licensing terms.
+
+Choose and use the license of your needs.
+
+[LICENSE #1]
+
+LibTomCrypt is public domain.  As should all quality software be.
+
+Tom St Denis
+
+[/LICENSE #1]
+
+[LICENSE #2]
+
+            DO WHAT THE FUCK YOU WANT TO PUBLIC LICENSE
+                    Version 2, December 2004
+
+ Copyright (C) 2004 Sam Hocevar <[email protected]>
+
+ Everyone is permitted to copy and distribute verbatim or modified
+ copies of this license document, and changing it is allowed as long
+ as the name is changed.
+
+            DO WHAT THE FUCK YOU WANT TO PUBLIC LICENSE
+   TERMS AND CONDITIONS FOR COPYING, DISTRIBUTION AND MODIFICATION
+
+  0. You just DO WHAT THE FUCK YOU WANT TO. 
+
+[/LICENSE #2]

+ 638 - 0
libtomcrypt.mod/libtomcrypt/src/hashes/blake2b.c

@@ -0,0 +1,638 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ */
+
+/*
+   BLAKE2 reference source code package - reference C implementations
+
+   Copyright 2012, Samuel Neves <[email protected]>.  You may use this under the
+   terms of the CC0, the OpenSSL Licence, or the Apache Public License 2.0, at
+   your option.  The terms of these licenses can be found at:
+
+   - CC0 1.0 Universal : http://creativecommons.org/publicdomain/zero/1.0
+   - OpenSSL license   : https://www.openssl.org/source/license.html
+   - Apache 2.0        : http://www.apache.org/licenses/LICENSE-2.0
+
+   More information about the BLAKE2 hash function can be found at
+   https://blake2.net.
+*/
+/* see also https://www.ietf.org/rfc/rfc7693.txt */
+
+#include "tomcrypt_private.h"
+
+#ifdef LTC_BLAKE2B
+
+enum blake2b_constant {
+   BLAKE2B_BLOCKBYTES = 128,
+   BLAKE2B_OUTBYTES = 64,
+   BLAKE2B_KEYBYTES = 64,
+   BLAKE2B_SALTBYTES = 16,
+   BLAKE2B_PERSONALBYTES = 16,
+   BLAKE2B_PARAM_SIZE = 64
+};
+
+/* param offsets */
+enum {
+   O_DIGEST_LENGTH = 0,
+   O_KEY_LENGTH = 1,
+   O_FANOUT = 2,
+   O_DEPTH = 3,
+   O_LEAF_LENGTH = 4,
+   O_NODE_OFFSET = 8,
+   O_XOF_LENGTH = 12,
+   O_NODE_DEPTH = 16,
+   O_INNER_LENGTH = 17,
+   O_RESERVED = 18,
+   O_SALT = 32,
+   O_PERSONAL = 48
+};
+
+/*
+struct blake2b_param {
+   unsigned char digest_length;
+   unsigned char key_length;
+   unsigned char fanout;
+   unsigned char depth;
+   ulong32 leaf_length;
+   ulong32 node_offset;
+   ulong32 xof_length;
+   unsigned char node_depth;
+   unsigned char inner_length;
+   unsigned char reserved[14];
+   unsigned char salt[BLAKE2B_SALTBYTES];
+   unsigned char personal[BLAKE2B_PERSONALBYTES];
+};
+*/
+
+const struct ltc_hash_descriptor blake2b_160_desc =
+{
+    "blake2b-160",
+    25,
+    20,
+    128,
+    { 1, 3, 6, 1, 4, 1, 1722, 12, 2, 1, 5 },
+    11,
+    &blake2b_160_init,
+    &blake2b_process,
+    &blake2b_done,
+    &blake2b_160_test,
+    NULL
+};
+
+const struct ltc_hash_descriptor blake2b_256_desc =
+{
+    "blake2b-256",
+    26,
+    32,
+    128,
+    { 1, 3, 6, 1, 4, 1, 1722, 12, 2, 1, 8 },
+    11,
+    &blake2b_256_init,
+    &blake2b_process,
+    &blake2b_done,
+    &blake2b_256_test,
+    NULL
+};
+
+const struct ltc_hash_descriptor blake2b_384_desc =
+{
+    "blake2b-384",
+    27,
+    48,
+    128,
+    { 1, 3, 6, 1, 4, 1, 1722, 12, 2, 1, 12 },
+    11,
+    &blake2b_384_init,
+    &blake2b_process,
+    &blake2b_done,
+    &blake2b_384_test,
+    NULL
+};
+
+const struct ltc_hash_descriptor blake2b_512_desc =
+{
+    "blake2b-512",
+    28,
+    64,
+    128,
+    { 1, 3, 6, 1, 4, 1, 1722, 12, 2, 1, 16 },
+    11,
+    &blake2b_512_init,
+    &blake2b_process,
+    &blake2b_done,
+    &blake2b_512_test,
+    NULL
+};
+
+static const ulong64 blake2b_IV[8] =
+{
+  CONST64(0x6a09e667f3bcc908), CONST64(0xbb67ae8584caa73b),
+  CONST64(0x3c6ef372fe94f82b), CONST64(0xa54ff53a5f1d36f1),
+  CONST64(0x510e527fade682d1), CONST64(0x9b05688c2b3e6c1f),
+  CONST64(0x1f83d9abfb41bd6b), CONST64(0x5be0cd19137e2179)
+};
+
+static const unsigned char blake2b_sigma[12][16] =
+{
+  {  0,  1,  2,  3,  4,  5,  6,  7,  8,  9, 10, 11, 12, 13, 14, 15 } ,
+  { 14, 10,  4,  8,  9, 15, 13,  6,  1, 12,  0,  2, 11,  7,  5,  3 } ,
+  { 11,  8, 12,  0,  5,  2, 15, 13, 10, 14,  3,  6,  7,  1,  9,  4 } ,
+  {  7,  9,  3,  1, 13, 12, 11, 14,  2,  6,  5, 10,  4,  0, 15,  8 } ,
+  {  9,  0,  5,  7,  2,  4, 10, 15, 14,  1, 11, 12,  6,  8,  3, 13 } ,
+  {  2, 12,  6, 10,  0, 11,  8,  3,  4, 13,  7,  5, 15, 14,  1,  9 } ,
+  { 12,  5,  1, 15, 14, 13,  4, 10,  0,  7,  6,  3,  9,  2,  8, 11 } ,
+  { 13, 11,  7, 14, 12,  1,  3,  9,  5,  0, 15,  4,  8,  6,  2, 10 } ,
+  {  6, 15, 14,  9, 11,  3,  0,  8, 12,  2, 13,  7,  1,  4, 10,  5 } ,
+  { 10,  2,  8,  4,  7,  6,  1,  5, 15, 11,  9, 14,  3, 12, 13 , 0 } ,
+  {  0,  1,  2,  3,  4,  5,  6,  7,  8,  9, 10, 11, 12, 13, 14, 15 } ,
+  { 14, 10,  4,  8,  9, 15, 13,  6,  1, 12,  0,  2, 11,  7,  5,  3 }
+};
+
+static void blake2b_set_lastnode(hash_state *md) { md->blake2b.f[1] = CONST64(0xffffffffffffffff); }
+
+/* Some helper functions, not necessarily useful */
+static int blake2b_is_lastblock(const hash_state *md) { return md->blake2b.f[0] != 0; }
+
+static void blake2b_set_lastblock(hash_state *md)
+{
+   if (md->blake2b.last_node) {
+      blake2b_set_lastnode(md);
+   }
+   md->blake2b.f[0] = CONST64(0xffffffffffffffff);
+}
+
+static void blake2b_increment_counter(hash_state *md, ulong64 inc)
+{
+   md->blake2b.t[0] += inc;
+   if (md->blake2b.t[0] < inc) md->blake2b.t[1]++;
+}
+
+static void blake2b_init0(hash_state *md)
+{
+   unsigned long i;
+   XMEMSET(&md->blake2b, 0, sizeof(md->blake2b));
+
+   for (i = 0; i < 8; ++i) {
+      md->blake2b.h[i] = blake2b_IV[i];
+   }
+}
+
+/* init xors IV with input parameter block */
+static int blake2b_init_param(hash_state *md, const unsigned char *P)
+{
+   unsigned long i;
+
+   blake2b_init0(md);
+
+   /* IV XOR ParamBlock */
+   for (i = 0; i < 8; ++i) {
+      ulong64 tmp;
+      LOAD64L(tmp, P + i * 8);
+      md->blake2b.h[i] ^= tmp;
+   }
+
+   md->blake2b.outlen = P[O_DIGEST_LENGTH];
+   return CRYPT_OK;
+}
+
+/**
+   Initialize the hash/MAC state
+
+      Use this function to init for arbitrary sizes.
+
+      Give a key and keylen to init for MAC mode.
+
+   @param md      The hash state you wish to initialize
+   @param outlen  The desired output-length
+   @param key     The key of the MAC
+   @param keylen  The length of the key
+   @return CRYPT_OK if successful
+*/
+int blake2b_init(hash_state *md, unsigned long outlen, const unsigned char *key, unsigned long keylen)
+{
+   unsigned char P[BLAKE2B_PARAM_SIZE];
+   int err;
+
+   LTC_ARGCHK(md != NULL);
+
+   if ((!outlen) || (outlen > BLAKE2B_OUTBYTES)) {
+      return CRYPT_INVALID_ARG;
+   }
+   if ((key && !keylen) || (keylen && !key) || (keylen > BLAKE2B_KEYBYTES)) {
+      return CRYPT_INVALID_ARG;
+   }
+
+   XMEMSET(P, 0, sizeof(P));
+
+   P[O_DIGEST_LENGTH] = (unsigned char)outlen;
+   P[O_KEY_LENGTH] = (unsigned char)keylen;
+   P[O_FANOUT] = 1;
+   P[O_DEPTH] = 1;
+
+   err = blake2b_init_param(md, P);
+   if (err != CRYPT_OK) return err;
+
+   if (key) {
+      unsigned char block[BLAKE2B_BLOCKBYTES];
+
+      XMEMSET(block, 0, BLAKE2B_BLOCKBYTES);
+      XMEMCPY(block, key, keylen);
+      blake2b_process(md, block, BLAKE2B_BLOCKBYTES);
+
+#ifdef LTC_CLEAN_STACK
+      zeromem(block, sizeof(block));
+#endif
+   }
+
+   return CRYPT_OK;
+}
+
+/**
+   Initialize the hash state
+   @param md   The hash state you wish to initialize
+   @return CRYPT_OK if successful
+*/
+int blake2b_160_init(hash_state *md) { return blake2b_init(md, 20, NULL, 0); }
+
+/**
+   Initialize the hash state
+   @param md   The hash state you wish to initialize
+   @return CRYPT_OK if successful
+*/
+int blake2b_256_init(hash_state *md) { return blake2b_init(md, 32, NULL, 0); }
+
+/**
+   Initialize the hash state
+   @param md   The hash state you wish to initialize
+   @return CRYPT_OK if successful
+*/
+int blake2b_384_init(hash_state *md) { return blake2b_init(md, 48, NULL, 0); }
+
+/**
+   Initialize the hash state
+   @param md   The hash state you wish to initialize
+   @return CRYPT_OK if successful
+*/
+int blake2b_512_init(hash_state *md) { return blake2b_init(md, 64, NULL, 0); }
+
+#define G(r, i, a, b, c, d)                                                                                            \
+   do {                                                                                                                \
+      a = a + b + m[blake2b_sigma[r][2 * i + 0]];                                                                      \
+      d = ROR64(d ^ a, 32);                                                                                            \
+      c = c + d;                                                                                                       \
+      b = ROR64(b ^ c, 24);                                                                                            \
+      a = a + b + m[blake2b_sigma[r][2 * i + 1]];                                                                      \
+      d = ROR64(d ^ a, 16);                                                                                            \
+      c = c + d;                                                                                                       \
+      b = ROR64(b ^ c, 63);                                                                                            \
+   } while (0)
+
+#define ROUND(r)                                                                                                       \
+   do {                                                                                                                \
+      G(r, 0, v[0], v[4], v[8], v[12]);                                                                                \
+      G(r, 1, v[1], v[5], v[9], v[13]);                                                                                \
+      G(r, 2, v[2], v[6], v[10], v[14]);                                                                               \
+      G(r, 3, v[3], v[7], v[11], v[15]);                                                                               \
+      G(r, 4, v[0], v[5], v[10], v[15]);                                                                               \
+      G(r, 5, v[1], v[6], v[11], v[12]);                                                                               \
+      G(r, 6, v[2], v[7], v[8], v[13]);                                                                                \
+      G(r, 7, v[3], v[4], v[9], v[14]);                                                                                \
+   } while (0)
+
+#ifdef LTC_CLEAN_STACK
+static int _blake2b_compress(hash_state *md, const unsigned char *buf)
+#else
+static int blake2b_compress(hash_state *md, const unsigned char *buf)
+#endif
+{
+   ulong64 m[16];
+   ulong64 v[16];
+   unsigned long i;
+
+   for (i = 0; i < 16; ++i) {
+      LOAD64L(m[i], buf + i * sizeof(m[i]));
+   }
+
+   for (i = 0; i < 8; ++i) {
+      v[i] = md->blake2b.h[i];
+   }
+
+   v[8] = blake2b_IV[0];
+   v[9] = blake2b_IV[1];
+   v[10] = blake2b_IV[2];
+   v[11] = blake2b_IV[3];
+   v[12] = blake2b_IV[4] ^ md->blake2b.t[0];
+   v[13] = blake2b_IV[5] ^ md->blake2b.t[1];
+   v[14] = blake2b_IV[6] ^ md->blake2b.f[0];
+   v[15] = blake2b_IV[7] ^ md->blake2b.f[1];
+
+   ROUND(0);
+   ROUND(1);
+   ROUND(2);
+   ROUND(3);
+   ROUND(4);
+   ROUND(5);
+   ROUND(6);
+   ROUND(7);
+   ROUND(8);
+   ROUND(9);
+   ROUND(10);
+   ROUND(11);
+
+   for (i = 0; i < 8; ++i) {
+      md->blake2b.h[i] = md->blake2b.h[i] ^ v[i] ^ v[i + 8];
+   }
+   return CRYPT_OK;
+}
+
+#undef G
+#undef ROUND
+
+#ifdef LTC_CLEAN_STACK
+static int blake2b_compress(hash_state *md, const unsigned char *buf)
+{
+   int err;
+   err = _blake2b_compress(md, buf);
+   burn_stack(sizeof(ulong64) * 32 + sizeof(unsigned long));
+   return err;
+}
+#endif
+
+/**
+   Process a block of memory through the hash
+   @param md     The hash state
+   @param in     The data to hash
+   @param inlen  The length of the data (octets)
+   @return CRYPT_OK if successful
+*/
+int blake2b_process(hash_state *md, const unsigned char *in, unsigned long inlen)
+{
+   LTC_ARGCHK(md != NULL);
+   LTC_ARGCHK(in != NULL);
+
+   if (md->blake2b.curlen > sizeof(md->blake2b.buf)) {
+      return CRYPT_INVALID_ARG;
+   }
+
+   if (inlen > 0) {
+      unsigned long left = md->blake2b.curlen;
+      unsigned long fill = BLAKE2B_BLOCKBYTES - left;
+      if (inlen > fill) {
+         md->blake2b.curlen = 0;
+         XMEMCPY(md->blake2b.buf + (left % sizeof(md->blake2b.buf)), in, fill); /* Fill buffer */
+         blake2b_increment_counter(md, BLAKE2B_BLOCKBYTES);
+         blake2b_compress(md, md->blake2b.buf); /* Compress */
+         in += fill;
+         inlen -= fill;
+         while (inlen > BLAKE2B_BLOCKBYTES) {
+            blake2b_increment_counter(md, BLAKE2B_BLOCKBYTES);
+            blake2b_compress(md, in);
+            in += BLAKE2B_BLOCKBYTES;
+            inlen -= BLAKE2B_BLOCKBYTES;
+         }
+      }
+      XMEMCPY(md->blake2b.buf + md->blake2b.curlen, in, inlen);
+      md->blake2b.curlen += inlen;
+   }
+   return CRYPT_OK;
+}
+
+/**
+   Terminate the hash to get the digest
+   @param md  The hash state
+   @param out [out] The destination of the hash (size depending on the length used on init)
+   @return CRYPT_OK if successful
+*/
+int blake2b_done(hash_state *md, unsigned char *out)
+{
+   unsigned char buffer[BLAKE2B_OUTBYTES] = { 0 };
+   unsigned long i;
+
+   LTC_ARGCHK(md != NULL);
+   LTC_ARGCHK(out != NULL);
+
+   /* if(md->blakebs.outlen != outlen) return CRYPT_INVALID_ARG; */
+
+   if (blake2b_is_lastblock(md)) {
+      return CRYPT_ERROR;
+   }
+
+   blake2b_increment_counter(md, md->blake2b.curlen);
+   blake2b_set_lastblock(md);
+   XMEMSET(md->blake2b.buf + md->blake2b.curlen, 0, BLAKE2B_BLOCKBYTES - md->blake2b.curlen); /* Padding */
+   blake2b_compress(md, md->blake2b.buf);
+
+   for (i = 0; i < 8; ++i) { /* Output full hash to temp buffer */
+      STORE64L(md->blake2b.h[i], buffer + i * 8);
+   }
+
+   XMEMCPY(out, buffer, md->blake2b.outlen);
+   zeromem(md, sizeof(hash_state));
+#ifdef LTC_CLEAN_STACK
+   zeromem(buffer, sizeof(buffer));
+#endif
+   return CRYPT_OK;
+}
+
+/**
+  Self-test the hash
+  @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled
+*/
+int blake2b_512_test(void)
+{
+#ifndef LTC_TEST
+   return CRYPT_NOP;
+#else
+   static const struct {
+      const char *msg;
+      unsigned char hash[64];
+  } tests[] = {
+    { "",
+      { 0x78, 0x6a, 0x02, 0xf7, 0x42, 0x01, 0x59, 0x03,
+        0xc6, 0xc6, 0xfd, 0x85, 0x25, 0x52, 0xd2, 0x72,
+        0x91, 0x2f, 0x47, 0x40, 0xe1, 0x58, 0x47, 0x61,
+        0x8a, 0x86, 0xe2, 0x17, 0xf7, 0x1f, 0x54, 0x19,
+        0xd2, 0x5e, 0x10, 0x31, 0xaf, 0xee, 0x58, 0x53,
+        0x13, 0x89, 0x64, 0x44, 0x93, 0x4e, 0xb0, 0x4b,
+        0x90, 0x3a, 0x68, 0x5b, 0x14, 0x48, 0xb7, 0x55,
+        0xd5, 0x6f, 0x70, 0x1a, 0xfe, 0x9b, 0xe2, 0xce } },
+    { "abc",
+      { 0xba, 0x80, 0xa5, 0x3f, 0x98, 0x1c, 0x4d, 0x0d,
+        0x6a, 0x27, 0x97, 0xb6, 0x9f, 0x12, 0xf6, 0xe9,
+        0x4c, 0x21, 0x2f, 0x14, 0x68, 0x5a, 0xc4, 0xb7,
+        0x4b, 0x12, 0xbb, 0x6f, 0xdb, 0xff, 0xa2, 0xd1,
+        0x7d, 0x87, 0xc5, 0x39, 0x2a, 0xab, 0x79, 0x2d,
+        0xc2, 0x52, 0xd5, 0xde, 0x45, 0x33, 0xcc, 0x95,
+        0x18, 0xd3, 0x8a, 0xa8, 0xdb, 0xf1, 0x92, 0x5a,
+        0xb9, 0x23, 0x86, 0xed, 0xd4, 0x00, 0x99, 0x23 } },
+
+    { NULL, { 0 } }
+  };
+
+   int i;
+   unsigned char tmp[64];
+   hash_state md;
+
+   for (i = 0; tests[i].msg != NULL; i++) {
+      blake2b_512_init(&md);
+      blake2b_process(&md, (unsigned char *)tests[i].msg, (unsigned long)strlen(tests[i].msg));
+      blake2b_done(&md, tmp);
+      if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "BLAKE2B_512", i)) {
+         return CRYPT_FAIL_TESTVECTOR;
+      }
+   }
+   return CRYPT_OK;
+#endif
+}
+
+/**
+  Self-test the hash
+  @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled
+*/
+int blake2b_384_test(void)
+{
+#ifndef LTC_TEST
+   return CRYPT_NOP;
+#else
+   static const struct {
+      const char *msg;
+      unsigned char hash[48];
+  } tests[] = {
+    { "",
+      { 0xb3, 0x28, 0x11, 0x42, 0x33, 0x77, 0xf5, 0x2d,
+        0x78, 0x62, 0x28, 0x6e, 0xe1, 0xa7, 0x2e, 0xe5,
+        0x40, 0x52, 0x43, 0x80, 0xfd, 0xa1, 0x72, 0x4a,
+        0x6f, 0x25, 0xd7, 0x97, 0x8c, 0x6f, 0xd3, 0x24,
+        0x4a, 0x6c, 0xaf, 0x04, 0x98, 0x81, 0x26, 0x73,
+        0xc5, 0xe0, 0x5e, 0xf5, 0x83, 0x82, 0x51, 0x00 } },
+    { "abc",
+      { 0x6f, 0x56, 0xa8, 0x2c, 0x8e, 0x7e, 0xf5, 0x26,
+        0xdf, 0xe1, 0x82, 0xeb, 0x52, 0x12, 0xf7, 0xdb,
+        0x9d, 0xf1, 0x31, 0x7e, 0x57, 0x81, 0x5d, 0xbd,
+        0xa4, 0x60, 0x83, 0xfc, 0x30, 0xf5, 0x4e, 0xe6,
+        0xc6, 0x6b, 0xa8, 0x3b, 0xe6, 0x4b, 0x30, 0x2d,
+        0x7c, 0xba, 0x6c, 0xe1, 0x5b, 0xb5, 0x56, 0xf4 } },
+
+    { NULL, { 0 } }
+  };
+
+   int i;
+   unsigned char tmp[48];
+   hash_state md;
+
+   for (i = 0; tests[i].msg != NULL; i++) {
+      blake2b_384_init(&md);
+      blake2b_process(&md, (unsigned char *)tests[i].msg, (unsigned long)strlen(tests[i].msg));
+      blake2b_done(&md, tmp);
+      if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "BLAKE2B_384", i)) {
+         return CRYPT_FAIL_TESTVECTOR;
+      }
+   }
+   return CRYPT_OK;
+#endif
+}
+
+/**
+  Self-test the hash
+  @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled
+*/
+int blake2b_256_test(void)
+{
+#ifndef LTC_TEST
+   return CRYPT_NOP;
+#else
+   static const struct {
+      const char *msg;
+      unsigned char hash[32];
+  } tests[] = {
+    { "",
+      { 0x0e, 0x57, 0x51, 0xc0, 0x26, 0xe5, 0x43, 0xb2,
+        0xe8, 0xab, 0x2e, 0xb0, 0x60, 0x99, 0xda, 0xa1,
+        0xd1, 0xe5, 0xdf, 0x47, 0x77, 0x8f, 0x77, 0x87,
+        0xfa, 0xab, 0x45, 0xcd, 0xf1, 0x2f, 0xe3, 0xa8 } },
+    { "abc",
+      { 0xbd, 0xdd, 0x81, 0x3c, 0x63, 0x42, 0x39, 0x72,
+        0x31, 0x71, 0xef, 0x3f, 0xee, 0x98, 0x57, 0x9b,
+        0x94, 0x96, 0x4e, 0x3b, 0xb1, 0xcb, 0x3e, 0x42,
+        0x72, 0x62, 0xc8, 0xc0, 0x68, 0xd5, 0x23, 0x19 } },
+    { "12345678901234567890123456789012345678901234567890"
+      "12345678901234567890123456789012345678901234567890"
+      "12345678901234567890123456789012345678901234567890"
+      "12345678901234567890123456789012345678901234567890"
+      "12345678901234567890123456789012345678901234567890"
+      "12345678901234567890123456789012345678901234567890",
+      { 0x0f, 0x6e, 0x01, 0x8d, 0x38, 0xd6, 0x3f, 0x08,
+        0x4d, 0x58, 0xe3, 0x0c, 0x90, 0xfb, 0xa2, 0x41,
+        0x5f, 0xca, 0x17, 0xfa, 0x66, 0x26, 0x49, 0xf3,
+        0x8a, 0x30, 0x41, 0x7c, 0x57, 0xcd, 0xa8, 0x14 } },
+
+    { NULL, { 0 } }
+  };
+
+   int i;
+   unsigned char tmp[32];
+   hash_state md;
+
+   for (i = 0; tests[i].msg != NULL; i++) {
+      blake2b_256_init(&md);
+      blake2b_process(&md, (unsigned char *)tests[i].msg, (unsigned long)strlen(tests[i].msg));
+      blake2b_done(&md, tmp);
+      if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "BLAKE2B_256", i)) {
+         return CRYPT_FAIL_TESTVECTOR;
+      }
+   }
+   return CRYPT_OK;
+#endif
+}
+
+/**
+  Self-test the hash
+  @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled
+*/
+int blake2b_160_test(void)
+{
+#ifndef LTC_TEST
+   return CRYPT_NOP;
+#else
+   static const struct {
+      const char *msg;
+      unsigned char hash[20];
+  } tests[] = {
+    { "",
+      { 0x33, 0x45, 0x52, 0x4a, 0xbf, 0x6b, 0xbe, 0x18,
+        0x09, 0x44, 0x92, 0x24, 0xb5, 0x97, 0x2c, 0x41,
+        0x79, 0x0b, 0x6c, 0xf2 } },
+    { "abc",
+      { 0x38, 0x42, 0x64, 0xf6, 0x76, 0xf3, 0x95, 0x36,
+        0x84, 0x05, 0x23, 0xf2, 0x84, 0x92, 0x1c, 0xdc,
+        0x68, 0xb6, 0x84, 0x6b } },
+
+    { NULL, { 0 } }
+  };
+
+   int i;
+   unsigned char tmp[20];
+   hash_state md;
+
+   for (i = 0; tests[i].msg != NULL; i++) {
+      blake2b_160_init(&md);
+      blake2b_process(&md, (unsigned char *)tests[i].msg, (unsigned long)strlen(tests[i].msg));
+      blake2b_done(&md, tmp);
+      if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "BLAKE2B_160", i)) {
+         return CRYPT_FAIL_TESTVECTOR;
+      }
+   }
+   return CRYPT_OK;
+#endif
+}
+
+#endif
+
+/* ref:         HEAD -> develop */
+/* git commit:  a1f6312416ef6cd183ee62db58b640dc2d7ec1f4 */
+/* commit time: 2019-09-04 13:44:47 +0200 */

+ 613 - 0
libtomcrypt.mod/libtomcrypt/src/hashes/blake2s.c

@@ -0,0 +1,613 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ */
+
+/*
+   BLAKE2 reference source code package - reference C implementations
+
+   Copyright 2012, Samuel Neves <[email protected]>.  You may use this under the
+   terms of the CC0, the OpenSSL Licence, or the Apache Public License 2.0, at
+   your option.  The terms of these licenses can be found at:
+
+   - CC0 1.0 Universal : http://creativecommons.org/publicdomain/zero/1.0
+   - OpenSSL license   : https://www.openssl.org/source/license.html
+   - Apache 2.0        : http://www.apache.org/licenses/LICENSE-2.0
+
+   More information about the BLAKE2 hash function can be found at
+   https://blake2.net.
+*/
+/* see also https://www.ietf.org/rfc/rfc7693.txt */
+
+#include "tomcrypt_private.h"
+
+#ifdef LTC_BLAKE2S
+
+enum blake2s_constant {
+   BLAKE2S_BLOCKBYTES = 64,
+   BLAKE2S_OUTBYTES = 32,
+   BLAKE2S_KEYBYTES = 32,
+   BLAKE2S_SALTBYTES = 8,
+   BLAKE2S_PERSONALBYTES = 8,
+   BLAKE2S_PARAM_SIZE = 32
+};
+
+/* param offsets */
+enum {
+   O_DIGEST_LENGTH = 0,
+   O_KEY_LENGTH = 1,
+   O_FANOUT = 2,
+   O_DEPTH = 3,
+   O_LEAF_LENGTH = 4,
+   O_NODE_OFFSET = 8,
+   O_XOF_LENGTH = 12,
+   O_NODE_DEPTH = 14,
+   O_INNER_LENGTH = 15,
+   O_SALT = 16,
+   O_PERSONAL = 24
+};
+
+/*
+struct blake2s_param {
+   unsigned char digest_length;
+   unsigned char key_length;
+   unsigned char fanout;
+   unsigned char depth;
+   ulong32 leaf_length;
+   ulong32 node_offset;
+   ushort16 xof_length;
+   unsigned char node_depth;
+   unsigned char inner_length;
+   unsigned char salt[BLAKE2S_SALTBYTES];
+   unsigned char personal[BLAKE2S_PERSONALBYTES];
+};
+*/
+
+const struct ltc_hash_descriptor blake2s_128_desc =
+{
+    "blake2s-128",
+    21,
+    16,
+    64,
+    { 1, 3, 6, 1, 4, 1, 1722, 12, 2, 2, 4 },
+    11,
+    &blake2s_128_init,
+    &blake2s_process,
+    &blake2s_done,
+    &blake2s_128_test,
+    NULL
+};
+
+const struct ltc_hash_descriptor blake2s_160_desc =
+{
+    "blake2s-160",
+    22,
+    20,
+    64,
+    { 1, 3, 6, 1, 4, 1, 1722, 12, 2, 2, 5 },
+    11,
+    &blake2s_160_init,
+    &blake2s_process,
+    &blake2s_done,
+    &blake2s_160_test,
+    NULL
+};
+
+const struct ltc_hash_descriptor blake2s_224_desc =
+{
+    "blake2s-224",
+    23,
+    28,
+    64,
+    { 1, 3, 6, 1, 4, 1, 1722, 12, 2, 2, 7 },
+    11,
+    &blake2s_224_init,
+    &blake2s_process,
+    &blake2s_done,
+    &blake2s_224_test,
+    NULL
+};
+
+const struct ltc_hash_descriptor blake2s_256_desc =
+{
+    "blake2s-256",
+    24,
+    32,
+    64,
+    { 1, 3, 6, 1, 4, 1, 1722, 12, 2, 2, 8 },
+    11,
+    &blake2s_256_init,
+    &blake2s_process,
+    &blake2s_done,
+    &blake2s_256_test,
+    NULL
+};
+
+static const ulong32 blake2s_IV[8] = {
+    0x6A09E667UL, 0xBB67AE85UL, 0x3C6EF372UL, 0xA54FF53AUL,
+    0x510E527FUL, 0x9B05688CUL, 0x1F83D9ABUL, 0x5BE0CD19UL
+};
+
+static const unsigned char blake2s_sigma[10][16] = {
+    { 0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15 },
+    { 14, 10, 4, 8, 9, 15, 13, 6, 1, 12, 0, 2, 11, 7, 5, 3 },
+    { 11, 8, 12, 0, 5, 2, 15, 13, 10, 14, 3, 6, 7, 1, 9, 4 },
+    { 7, 9, 3, 1, 13, 12, 11, 14, 2, 6, 5, 10, 4, 0, 15, 8 },
+    { 9, 0, 5, 7, 2, 4, 10, 15, 14, 1, 11, 12, 6, 8, 3, 13 },
+    { 2, 12, 6, 10, 0, 11, 8, 3, 4, 13, 7, 5, 15, 14, 1, 9 },
+    { 12, 5, 1, 15, 14, 13, 4, 10, 0, 7, 6, 3, 9, 2, 8, 11 },
+    { 13, 11, 7, 14, 12, 1, 3, 9, 5, 0, 15, 4, 8, 6, 2, 10 },
+    { 6, 15, 14, 9, 11, 3, 0, 8, 12, 2, 13, 7, 1, 4, 10, 5 },
+    { 10, 2, 8, 4, 7, 6, 1, 5, 15, 11, 9, 14, 3, 12, 13, 0 },
+};
+
+static void blake2s_set_lastnode(hash_state *md) { md->blake2s.f[1] = 0xffffffffUL; }
+
+/* Some helper functions, not necessarily useful */
+static int blake2s_is_lastblock(const hash_state *md) { return md->blake2s.f[0] != 0; }
+
+static void blake2s_set_lastblock(hash_state *md)
+{
+   if (md->blake2s.last_node) {
+      blake2s_set_lastnode(md);
+   }
+   md->blake2s.f[0] = 0xffffffffUL;
+}
+
+static void blake2s_increment_counter(hash_state *md, const ulong32 inc)
+{
+   md->blake2s.t[0] += inc;
+   if (md->blake2s.t[0] < inc) md->blake2s.t[1]++;
+}
+
+static int blake2s_init0(hash_state *md)
+{
+   int i;
+   XMEMSET(&md->blake2s, 0, sizeof(struct blake2s_state));
+
+   for (i = 0; i < 8; ++i) {
+      md->blake2s.h[i] = blake2s_IV[i];
+   }
+
+   return CRYPT_OK;
+}
+
+/* init2 xors IV with input parameter block */
+static int blake2s_init_param(hash_state *md, const unsigned char *P)
+{
+   unsigned long i;
+
+   blake2s_init0(md);
+
+   /* IV XOR ParamBlock */
+   for (i = 0; i < 8; ++i) {
+      ulong32 tmp;
+      LOAD32L(tmp, P + i * 4);
+      md->blake2s.h[i] ^= tmp;
+   }
+
+   md->blake2s.outlen = P[O_DIGEST_LENGTH];
+   return CRYPT_OK;
+}
+
+/**
+   Initialize the hash/MAC state
+
+      Use this function to init for arbitrary sizes.
+
+      Give a key and keylen to init for MAC mode.
+
+   @param md      The hash state you wish to initialize
+   @param outlen  The desired output-length
+   @param key     The key of the MAC
+   @param keylen  The length of the key
+   @return CRYPT_OK if successful
+*/
+int blake2s_init(hash_state *md, unsigned long outlen, const unsigned char *key, unsigned long keylen)
+{
+   unsigned char P[BLAKE2S_PARAM_SIZE];
+   int err;
+
+   LTC_ARGCHK(md != NULL);
+
+   if ((!outlen) || (outlen > BLAKE2S_OUTBYTES)) {
+      return CRYPT_INVALID_ARG;
+   }
+   if ((key && !keylen) || (keylen && !key) || (keylen > BLAKE2S_KEYBYTES)) {
+      return CRYPT_INVALID_ARG;
+   }
+
+   XMEMSET(P, 0, sizeof(P));
+
+   P[O_DIGEST_LENGTH] = (unsigned char)outlen;
+   P[O_KEY_LENGTH] = (unsigned char)keylen;
+   P[O_FANOUT] = 1;
+   P[O_DEPTH] = 1;
+
+   err = blake2s_init_param(md, P);
+   if (err != CRYPT_OK) return err;
+
+   if (key) {
+      unsigned char block[BLAKE2S_BLOCKBYTES];
+
+      XMEMSET(block, 0, BLAKE2S_BLOCKBYTES);
+      XMEMCPY(block, key, keylen);
+      blake2s_process(md, block, BLAKE2S_BLOCKBYTES);
+
+#ifdef LTC_CLEAN_STACK
+      zeromem(block, sizeof(block));
+#endif
+   }
+   return CRYPT_OK;
+}
+
+/**
+   Initialize the hash state
+   @param md   The hash state you wish to initialize
+   @return CRYPT_OK if successful
+*/
+int blake2s_128_init(hash_state *md) { return blake2s_init(md, 16, NULL, 0); }
+
+/**
+   Initialize the hash state
+   @param md   The hash state you wish to initialize
+   @return CRYPT_OK if successful
+*/
+int blake2s_160_init(hash_state *md) { return blake2s_init(md, 20, NULL, 0); }
+
+/**
+   Initialize the hash state
+   @param md   The hash state you wish to initialize
+   @return CRYPT_OK if successful
+*/
+int blake2s_224_init(hash_state *md) { return blake2s_init(md, 28, NULL, 0); }
+
+/**
+   Initialize the hash state
+   @param md   The hash state you wish to initialize
+   @return CRYPT_OK if successful
+*/
+int blake2s_256_init(hash_state *md) { return blake2s_init(md, 32, NULL, 0); }
+
+#define G(r, i, a, b, c, d)                                                                                            \
+   do {                                                                                                                \
+      a = a + b + m[blake2s_sigma[r][2 * i + 0]];                                                                      \
+      d = ROR(d ^ a, 16);                                                                                              \
+      c = c + d;                                                                                                       \
+      b = ROR(b ^ c, 12);                                                                                              \
+      a = a + b + m[blake2s_sigma[r][2 * i + 1]];                                                                      \
+      d = ROR(d ^ a, 8);                                                                                               \
+      c = c + d;                                                                                                       \
+      b = ROR(b ^ c, 7);                                                                                               \
+   } while (0)
+#define ROUND(r)                                                                                                       \
+   do {                                                                                                                \
+      G(r, 0, v[0], v[4], v[8], v[12]);                                                                                \
+      G(r, 1, v[1], v[5], v[9], v[13]);                                                                                \
+      G(r, 2, v[2], v[6], v[10], v[14]);                                                                               \
+      G(r, 3, v[3], v[7], v[11], v[15]);                                                                               \
+      G(r, 4, v[0], v[5], v[10], v[15]);                                                                               \
+      G(r, 5, v[1], v[6], v[11], v[12]);                                                                               \
+      G(r, 6, v[2], v[7], v[8], v[13]);                                                                                \
+      G(r, 7, v[3], v[4], v[9], v[14]);                                                                                \
+   } while (0)
+
+#ifdef LTC_CLEAN_STACK
+static int _blake2s_compress(hash_state *md, const unsigned char *buf)
+#else
+static int blake2s_compress(hash_state *md, const unsigned char *buf)
+#endif
+{
+   unsigned long i;
+   ulong32 m[16];
+   ulong32 v[16];
+
+   for (i = 0; i < 16; ++i) {
+      LOAD32L(m[i], buf + i * sizeof(m[i]));
+   }
+
+   for (i = 0; i < 8; ++i) {
+      v[i] = md->blake2s.h[i];
+   }
+
+   v[8] = blake2s_IV[0];
+   v[9] = blake2s_IV[1];
+   v[10] = blake2s_IV[2];
+   v[11] = blake2s_IV[3];
+   v[12] = md->blake2s.t[0] ^ blake2s_IV[4];
+   v[13] = md->blake2s.t[1] ^ blake2s_IV[5];
+   v[14] = md->blake2s.f[0] ^ blake2s_IV[6];
+   v[15] = md->blake2s.f[1] ^ blake2s_IV[7];
+
+   ROUND(0);
+   ROUND(1);
+   ROUND(2);
+   ROUND(3);
+   ROUND(4);
+   ROUND(5);
+   ROUND(6);
+   ROUND(7);
+   ROUND(8);
+   ROUND(9);
+
+   for (i = 0; i < 8; ++i) {
+      md->blake2s.h[i] = md->blake2s.h[i] ^ v[i] ^ v[i + 8];
+   }
+   return CRYPT_OK;
+}
+#undef G
+#undef ROUND
+
+#ifdef LTC_CLEAN_STACK
+static int blake2s_compress(hash_state *md, const unsigned char *buf)
+{
+   int err;
+   err = _blake2s_compress(md, buf);
+   burn_stack(sizeof(ulong32) * (32) + sizeof(unsigned long));
+   return err;
+}
+#endif
+
+/**
+   Process a block of memory through the hash
+   @param md     The hash state
+   @param in     The data to hash
+   @param inlen  The length of the data (octets)
+   @return CRYPT_OK if successful
+*/
+int blake2s_process(hash_state *md, const unsigned char *in, unsigned long inlen)
+{
+   LTC_ARGCHK(md != NULL);
+   LTC_ARGCHK(in != NULL);
+
+   if (md->blake2s.curlen > sizeof(md->blake2s.buf)) {
+      return CRYPT_INVALID_ARG;
+   }
+
+   if (inlen > 0) {
+      unsigned long left = md->blake2s.curlen;
+      unsigned long fill = BLAKE2S_BLOCKBYTES - left;
+      if (inlen > fill) {
+         md->blake2s.curlen = 0;
+         XMEMCPY(md->blake2s.buf + (left % sizeof(md->blake2s.buf)), in, fill); /* Fill buffer */
+         blake2s_increment_counter(md, BLAKE2S_BLOCKBYTES);
+         blake2s_compress(md, md->blake2s.buf); /* Compress */
+         in += fill;
+         inlen -= fill;
+         while (inlen > BLAKE2S_BLOCKBYTES) {
+            blake2s_increment_counter(md, BLAKE2S_BLOCKBYTES);
+            blake2s_compress(md, in);
+            in += BLAKE2S_BLOCKBYTES;
+            inlen -= BLAKE2S_BLOCKBYTES;
+         }
+      }
+      XMEMCPY(md->blake2s.buf + md->blake2s.curlen, in, inlen);
+      md->blake2s.curlen += inlen;
+   }
+   return CRYPT_OK;
+}
+
+/**
+   Terminate the hash to get the digest
+   @param md  The hash state
+   @param out [out] The destination of the hash (size depending on the length used on init)
+   @return CRYPT_OK if successful
+*/
+int blake2s_done(hash_state *md, unsigned char *out)
+{
+   unsigned char buffer[BLAKE2S_OUTBYTES] = { 0 };
+   unsigned long i;
+
+   LTC_ARGCHK(md != NULL);
+   LTC_ARGCHK(out != NULL);
+
+   /* if(md->blake2s.outlen != outlen) return CRYPT_INVALID_ARG; */
+
+   if (blake2s_is_lastblock(md)) {
+      return CRYPT_ERROR;
+   }
+   blake2s_increment_counter(md, md->blake2s.curlen);
+   blake2s_set_lastblock(md);
+   XMEMSET(md->blake2s.buf + md->blake2s.curlen, 0, BLAKE2S_BLOCKBYTES - md->blake2s.curlen); /* Padding */
+   blake2s_compress(md, md->blake2s.buf);
+
+   for (i = 0; i < 8; ++i) { /* Output full hash to temp buffer */
+      STORE32L(md->blake2s.h[i], buffer + i * 4);
+   }
+
+   XMEMCPY(out, buffer, md->blake2s.outlen);
+   zeromem(md, sizeof(hash_state));
+#ifdef LTC_CLEAN_STACK
+   zeromem(buffer, sizeof(buffer));
+#endif
+   return CRYPT_OK;
+}
+
+/**
+  Self-test the hash
+  @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled
+*/
+int blake2s_256_test(void)
+{
+#ifndef LTC_TEST
+   return CRYPT_NOP;
+#else
+   static const struct {
+      const char *msg;
+      unsigned char hash[32];
+  } tests[] = {
+    { "",
+      { 0x69, 0x21, 0x7a, 0x30, 0x79, 0x90, 0x80, 0x94,
+        0xe1, 0x11, 0x21, 0xd0, 0x42, 0x35, 0x4a, 0x7c,
+        0x1f, 0x55, 0xb6, 0x48, 0x2c, 0xa1, 0xa5, 0x1e,
+        0x1b, 0x25, 0x0d, 0xfd, 0x1e, 0xd0, 0xee, 0xf9 } },
+    { "abc",
+      { 0x50, 0x8c, 0x5e, 0x8c, 0x32, 0x7c, 0x14, 0xe2,
+        0xe1, 0xa7, 0x2b, 0xa3, 0x4e, 0xeb, 0x45, 0x2f,
+        0x37, 0x45, 0x8b, 0x20, 0x9e, 0xd6, 0x3a, 0x29,
+        0x4d, 0x99, 0x9b, 0x4c, 0x86, 0x67, 0x59, 0x82 } },
+    { "12345678901234567890123456789012345678901234567890"
+      "12345678901234567890123456789012345678901234567890"
+      "12345678901234567890123456789012345678901234567890"
+      "12345678901234567890123456789012345678901234567890"
+      "12345678901234567890123456789012345678901234567890"
+      "12345678901234567890123456789012345678901234567890",
+      { 0xa3, 0x78, 0x8b, 0x5b, 0x59, 0xee, 0xe4, 0x41,
+        0x95, 0x23, 0x58, 0x00, 0xa4, 0xf9, 0xfa, 0x41,
+        0x86, 0x0c, 0x7b, 0x1c, 0x35, 0xa2, 0x42, 0x70,
+        0x50, 0x80, 0x79, 0x56, 0xe3, 0xbe, 0x31, 0x74 } },
+
+    { NULL, { 0 } }
+  };
+
+   int i;
+   unsigned char tmp[32];
+   hash_state md;
+
+   for (i = 0; tests[i].msg != NULL; i++) {
+      blake2s_256_init(&md);
+      blake2s_process(&md, (unsigned char *)tests[i].msg, (unsigned long)strlen(tests[i].msg));
+      blake2s_done(&md, tmp);
+      if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "BLAKE2S_256", i)) {
+         return CRYPT_FAIL_TESTVECTOR;
+      }
+
+   }
+   return CRYPT_OK;
+#endif
+}
+
+/**
+  Self-test the hash
+  @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled
+*/
+int blake2s_224_test(void)
+{
+#ifndef LTC_TEST
+   return CRYPT_NOP;
+#else
+   static const struct {
+      const char *msg;
+      unsigned char hash[28];
+  } tests[] = {
+    { "",
+      { 0x1f, 0xa1, 0x29, 0x1e, 0x65, 0x24, 0x8b, 0x37,
+        0xb3, 0x43, 0x34, 0x75, 0xb2, 0xa0, 0xdd, 0x63,
+        0xd5, 0x4a, 0x11, 0xec, 0xc4, 0xe3, 0xe0, 0x34,
+        0xe7, 0xbc, 0x1e, 0xf4 } },
+    { "abc",
+      { 0x0b, 0x03, 0x3f, 0xc2, 0x26, 0xdf, 0x7a, 0xbd,
+        0xe2, 0x9f, 0x67, 0xa0, 0x5d, 0x3d, 0xc6, 0x2c,
+        0xf2, 0x71, 0xef, 0x3d, 0xfe, 0xa4, 0xd3, 0x87,
+        0x40, 0x7f, 0xbd, 0x55 } },
+
+    { NULL, { 0 } }
+  };
+
+   int i;
+   unsigned char tmp[28];
+   hash_state md;
+
+   for (i = 0; tests[i].msg != NULL; i++) {
+      blake2s_224_init(&md);
+      blake2s_process(&md, (unsigned char *)tests[i].msg, (unsigned long)strlen(tests[i].msg));
+      blake2s_done(&md, tmp);
+      if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "BLAKE2S_224", i)) {
+         return CRYPT_FAIL_TESTVECTOR;
+      }
+
+   }
+   return CRYPT_OK;
+#endif
+}
+
+/**
+  Self-test the hash
+  @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled
+*/
+int blake2s_160_test(void)
+{
+#ifndef LTC_TEST
+   return CRYPT_NOP;
+#else
+   static const struct {
+      const char *msg;
+      unsigned char hash[20];
+  } tests[] = {
+    { "",
+      { 0x35, 0x4c, 0x9c, 0x33, 0xf7, 0x35, 0x96, 0x24,
+        0x18, 0xbd, 0xac, 0xb9, 0x47, 0x98, 0x73, 0x42,
+        0x9c, 0x34, 0x91, 0x6f} },
+    { "abc",
+      { 0x5a, 0xe3, 0xb9, 0x9b, 0xe2, 0x9b, 0x01, 0x83,
+        0x4c, 0x3b, 0x50, 0x85, 0x21, 0xed, 0xe6, 0x04,
+        0x38, 0xf8, 0xde, 0x17 } },
+
+    { NULL, { 0 } }
+  };
+
+   int i;
+   unsigned char tmp[20];
+   hash_state md;
+
+   for (i = 0; tests[i].msg != NULL; i++) {
+      blake2s_160_init(&md);
+      blake2s_process(&md, (unsigned char *)tests[i].msg, (unsigned long)strlen(tests[i].msg));
+      blake2s_done(&md, tmp);
+      if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "BLAKE2S_160", i)) {
+         return CRYPT_FAIL_TESTVECTOR;
+      }
+
+   }
+   return CRYPT_OK;
+#endif
+}
+
+/**
+  Self-test the hash
+  @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled
+*/
+int blake2s_128_test(void)
+{
+#ifndef LTC_TEST
+   return CRYPT_NOP;
+#else
+   static const struct {
+      const char *msg;
+      unsigned char hash[16];
+  } tests[] = {
+    { "",
+      { 0x64, 0x55, 0x0d, 0x6f, 0xfe, 0x2c, 0x0a, 0x01,
+        0xa1, 0x4a, 0xba, 0x1e, 0xad, 0xe0, 0x20, 0x0c } },
+    { "abc",
+      { 0xaa, 0x49, 0x38, 0x11, 0x9b, 0x1d, 0xc7, 0xb8,
+        0x7c, 0xba, 0xd0, 0xff, 0xd2, 0x00, 0xd0, 0xae } },
+
+    { NULL, { 0 } }
+  };
+
+   int i;
+   unsigned char tmp[16];
+   hash_state md;
+
+   for (i = 0; tests[i].msg != NULL; i++) {
+      blake2s_128_init(&md);
+      blake2s_process(&md, (unsigned char *)tests[i].msg, (unsigned long)strlen(tests[i].msg));
+      blake2s_done(&md, tmp);
+      if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "BLAKE2S_128", i)) {
+         return CRYPT_FAIL_TESTVECTOR;
+      }
+   }
+   return CRYPT_OK;
+#endif
+}
+
+#endif
+
+/* ref:         HEAD -> develop */
+/* git commit:  a1f6312416ef6cd183ee62db58b640dc2d7ec1f4 */
+/* commit time: 2019-09-04 13:44:47 +0200 */

+ 306 - 0
libtomcrypt.mod/libtomcrypt/src/hashes/chc/chc.c

@@ -0,0 +1,306 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ */
+
+#include "tomcrypt_private.h"
+
+/**
+  @file chc.c
+  CHC support. (Tom St Denis)
+*/
+
+#ifdef LTC_CHC_HASH
+
+#define UNDEFED_HASH  -17
+
+/* chc settings */
+static int            cipher_idx=UNDEFED_HASH,        /* which cipher */
+                      cipher_blocksize;               /* blocksize of cipher */
+
+
+const struct ltc_hash_descriptor chc_desc = {
+   "chc_hash", 12, 0, 0, { 0 }, 0,
+   &chc_init,
+   &chc_process,
+   &chc_done,
+   &chc_test,
+   NULL
+};
+
+/**
+  Initialize the CHC state with a given cipher
+  @param cipher  The index of the cipher you wish to bind
+  @return CRYPT_OK if successful
+*/
+int chc_register(int cipher)
+{
+   int err, kl, idx;
+
+   if ((err = cipher_is_valid(cipher)) != CRYPT_OK) {
+      return err;
+   }
+
+   /* will it be valid? */
+   kl = cipher_descriptor[cipher].block_length;
+
+   /* must be >64 bit block */
+   if (kl <= 8) {
+      return CRYPT_INVALID_CIPHER;
+   }
+
+   /* can we use the ideal keysize? */
+   if ((err = cipher_descriptor[cipher].keysize(&kl)) != CRYPT_OK) {
+      return err;
+   }
+   /* we require that key size == block size be a valid choice */
+   if (kl != cipher_descriptor[cipher].block_length) {
+      return CRYPT_INVALID_CIPHER;
+   }
+
+   /* determine if chc_hash has been register_hash'ed already */
+   if ((err = hash_is_valid(idx = find_hash("chc_hash"))) != CRYPT_OK) {
+      return err;
+   }
+
+   /* store into descriptor */
+   hash_descriptor[idx].hashsize  =
+   hash_descriptor[idx].blocksize = cipher_descriptor[cipher].block_length;
+
+   /* store the idx and block size */
+   cipher_idx       = cipher;
+   cipher_blocksize = cipher_descriptor[cipher].block_length;
+   return CRYPT_OK;
+}
+
+/**
+   Initialize the hash state
+   @param md   The hash state you wish to initialize
+   @return CRYPT_OK if successful
+*/
+int chc_init(hash_state *md)
+{
+   symmetric_key *key;
+   unsigned char  buf[MAXBLOCKSIZE];
+   int            err;
+
+   LTC_ARGCHK(md != NULL);
+
+   /* is the cipher valid? */
+   if ((err = cipher_is_valid(cipher_idx)) != CRYPT_OK) {
+      return err;
+   }
+
+   if (cipher_blocksize != cipher_descriptor[cipher_idx].block_length) {
+      return CRYPT_INVALID_CIPHER;
+   }
+
+   if ((key = XMALLOC(sizeof(*key))) == NULL) {
+      return CRYPT_MEM;
+   }
+
+   /* zero key and what not */
+   zeromem(buf, cipher_blocksize);
+   if ((err = cipher_descriptor[cipher_idx].setup(buf, cipher_blocksize, 0, key)) != CRYPT_OK) {
+      XFREE(key);
+      return err;
+   }
+
+   /* encrypt zero block */
+   cipher_descriptor[cipher_idx].ecb_encrypt(buf, md->chc.state, key);
+
+   /* zero other members */
+   md->chc.length = 0;
+   md->chc.curlen = 0;
+   zeromem(md->chc.buf, sizeof(md->chc.buf));
+   XFREE(key);
+   return CRYPT_OK;
+}
+
+/*
+   key    <= state
+   T0,T1  <= block
+   T0     <= encrypt T0
+   state  <= state xor T0 xor T1
+*/
+static int chc_compress(hash_state *md, const unsigned char *buf)
+{
+   unsigned char  T[2][MAXBLOCKSIZE];
+   symmetric_key *key;
+   int            err, x;
+
+   if ((key = XMALLOC(sizeof(*key))) == NULL) {
+      return CRYPT_MEM;
+   }
+   if ((err = cipher_descriptor[cipher_idx].setup(md->chc.state, cipher_blocksize, 0, key)) != CRYPT_OK) {
+      XFREE(key);
+      return err;
+   }
+   XMEMCPY(T[1], buf, cipher_blocksize);
+   cipher_descriptor[cipher_idx].ecb_encrypt(buf, T[0], key);
+   for (x = 0; x < cipher_blocksize; x++) {
+       md->chc.state[x] ^= T[0][x] ^ T[1][x];
+   }
+#ifdef LTC_CLEAN_STACK
+   zeromem(T, sizeof(T));
+   zeromem(key, sizeof(*key));
+#endif
+   XFREE(key);
+   return CRYPT_OK;
+}
+
+/**
+   Function for processing blocks
+   @param md   The hash state
+   @param buf  The data to hash
+   @param len  The length of the data (octets)
+   @return CRYPT_OK if successful
+*/
+static int _chc_process(hash_state * md, const unsigned char *in, unsigned long inlen);
+static HASH_PROCESS(_chc_process, chc_compress, chc, (unsigned long)cipher_blocksize)
+
+/**
+   Process a block of memory though the hash
+   @param md   The hash state
+   @param in   The data to hash
+   @param inlen  The length of the data (octets)
+   @return CRYPT_OK if successful
+*/
+int chc_process(hash_state * md, const unsigned char *in, unsigned long inlen)
+{
+   int err;
+
+   LTC_ARGCHK(md   != NULL);
+   LTC_ARGCHK(in  != NULL);
+
+   /* is the cipher valid? */
+   if ((err = cipher_is_valid(cipher_idx)) != CRYPT_OK) {
+      return err;
+   }
+   if (cipher_blocksize != cipher_descriptor[cipher_idx].block_length) {
+      return CRYPT_INVALID_CIPHER;
+   }
+
+   return _chc_process(md, in, inlen);
+}
+
+/**
+   Terminate the hash to get the digest
+   @param md   The hash state
+   @param out [out] The destination of the hash (length of the block size of the block cipher)
+   @return CRYPT_OK if successful
+*/
+int chc_done(hash_state *md, unsigned char *out)
+{
+    int err;
+
+    LTC_ARGCHK(md   != NULL);
+    LTC_ARGCHK(out  != NULL);
+
+    /* is the cipher valid? */
+    if ((err = cipher_is_valid(cipher_idx)) != CRYPT_OK) {
+       return err;
+    }
+    if (cipher_blocksize != cipher_descriptor[cipher_idx].block_length) {
+       return CRYPT_INVALID_CIPHER;
+    }
+
+    if (md->chc.curlen >= sizeof(md->chc.buf)) {
+       return CRYPT_INVALID_ARG;
+    }
+
+    /* increase the length of the message */
+    md->chc.length += md->chc.curlen * 8;
+
+    /* append the '1' bit */
+    md->chc.buf[md->chc.curlen++] = (unsigned char)0x80;
+
+    /* if the length is currently above l-8 bytes we append zeros
+     * then compress.  Then we can fall back to padding zeros and length
+     * encoding like normal.
+     */
+    if (md->chc.curlen > (unsigned long)(cipher_blocksize - 8)) {
+        while (md->chc.curlen < (unsigned long)cipher_blocksize) {
+            md->chc.buf[md->chc.curlen++] = (unsigned char)0;
+        }
+        chc_compress(md, md->chc.buf);
+        md->chc.curlen = 0;
+    }
+
+    /* pad upto l-8 bytes of zeroes */
+    while (md->chc.curlen < (unsigned long)(cipher_blocksize - 8)) {
+        md->chc.buf[md->chc.curlen++] = (unsigned char)0;
+    }
+
+    /* store length */
+    STORE64L(md->chc.length, md->chc.buf+(cipher_blocksize-8));
+    chc_compress(md, md->chc.buf);
+
+    /* copy output */
+    XMEMCPY(out, md->chc.state, cipher_blocksize);
+
+#ifdef LTC_CLEAN_STACK
+    zeromem(md, sizeof(hash_state));
+#endif
+    return CRYPT_OK;
+}
+
+/**
+  Self-test the hash
+  @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled
+*/
+int chc_test(void)
+{
+#ifndef LTC_TEST
+   return CRYPT_NOP;
+#else
+   static const struct {
+      unsigned char *msg,
+                     hash[MAXBLOCKSIZE];
+      int            len;
+   } tests[] = {
+{
+   (unsigned char *)"hello world",
+   { 0xcf, 0x57, 0x9d, 0xc3, 0x0a, 0x0e, 0xea, 0x61,
+     0x0d, 0x54, 0x47, 0xc4, 0x3c, 0x06, 0xf5, 0x4e },
+   16
+}
+};
+   int i, oldhashidx, idx;
+   unsigned char tmp[MAXBLOCKSIZE];
+   hash_state md;
+
+   /* AES can be under rijndael or aes... try to find it */
+   if ((idx = find_cipher("aes")) == -1) {
+      if ((idx = find_cipher("rijndael")) == -1) {
+         return CRYPT_NOP;
+      }
+   }
+   oldhashidx = cipher_idx;
+   chc_register(idx);
+
+   for (i = 0; i < (int)(sizeof(tests)/sizeof(tests[0])); i++) {
+       chc_init(&md);
+       chc_process(&md, tests[i].msg, strlen((char *)tests[i].msg));
+       chc_done(&md, tmp);
+       if (compare_testvector(tmp, tests[i].len, tests[i].hash, tests[i].len, "CHC", i)) {
+          return CRYPT_FAIL_TESTVECTOR;
+       }
+   }
+   if (oldhashidx != UNDEFED_HASH) {
+      chc_register(oldhashidx);
+   }
+
+   return CRYPT_OK;
+#endif
+}
+
+#endif
+
+/* ref:         HEAD -> develop */
+/* git commit:  a1f6312416ef6cd183ee62db58b640dc2d7ec1f4 */
+/* commit time: 2019-09-04 13:44:47 +0200 */

+ 53 - 0
libtomcrypt.mod/libtomcrypt/src/hashes/helper/hash_file.c

@@ -0,0 +1,53 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ */
+#include "tomcrypt_private.h"
+
+#ifndef LTC_NO_FILE
+/**
+  @file hash_file.c
+  Hash a file, Tom St Denis
+*/
+
+/**
+  @param hash   The index of the hash desired
+  @param fname  The name of the file you wish to hash
+  @param out    [out] The destination of the digest
+  @param outlen [in/out] The max size and resulting size of the message digest
+  @result CRYPT_OK if successful
+*/
+int hash_file(int hash, const char *fname, unsigned char *out, unsigned long *outlen)
+{
+    FILE *in;
+    int err;
+    LTC_ARGCHK(fname  != NULL);
+    LTC_ARGCHK(out    != NULL);
+    LTC_ARGCHK(outlen != NULL);
+
+    if ((err = hash_is_valid(hash)) != CRYPT_OK) {
+        return err;
+    }
+
+    in = fopen(fname, "rb");
+    if (in == NULL) {
+       return CRYPT_FILE_NOTFOUND;
+    }
+
+    err = hash_filehandle(hash, in, out, outlen);
+    if (fclose(in) != 0) {
+       return CRYPT_ERROR;
+    }
+
+    return err;
+}
+#endif /* #ifndef LTC_NO_FILE */
+
+
+/* ref:         HEAD -> develop */
+/* git commit:  a1f6312416ef6cd183ee62db58b640dc2d7ec1f4 */
+/* commit time: 2019-09-04 13:44:47 +0200 */

+ 74 - 0
libtomcrypt.mod/libtomcrypt/src/hashes/helper/hash_filehandle.c

@@ -0,0 +1,74 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ */
+#include "tomcrypt_private.h"
+
+#ifndef LTC_NO_FILE
+/**
+   @file hash_filehandle.c
+   Hash open files, Tom St Denis
+*/
+
+/**
+  Hash data from an open file handle.
+  @param hash   The index of the hash you want to use
+  @param in     The FILE* handle of the file you want to hash
+  @param out    [out] The destination of the digest
+  @param outlen [in/out] The max size and resulting size of the digest
+  @result CRYPT_OK if successful
+*/
+int hash_filehandle(int hash, FILE *in, unsigned char *out, unsigned long *outlen)
+{
+    hash_state md;
+    unsigned char *buf;
+    size_t x;
+    int err;
+
+    LTC_ARGCHK(out    != NULL);
+    LTC_ARGCHK(outlen != NULL);
+    LTC_ARGCHK(in     != NULL);
+
+    if ((buf = XMALLOC(LTC_FILE_READ_BUFSIZE)) == NULL) {
+        return CRYPT_MEM;
+    }
+
+    if ((err = hash_is_valid(hash)) != CRYPT_OK) {
+        goto LBL_ERR;
+    }
+
+    if (*outlen < hash_descriptor[hash].hashsize) {
+       *outlen = hash_descriptor[hash].hashsize;
+       err = CRYPT_BUFFER_OVERFLOW;
+       goto LBL_ERR;
+    }
+    if ((err = hash_descriptor[hash].init(&md)) != CRYPT_OK) {
+       goto LBL_ERR;
+    }
+
+    do {
+        x = fread(buf, 1, LTC_FILE_READ_BUFSIZE, in);
+        if ((err = hash_descriptor[hash].process(&md, buf, (unsigned long)x)) != CRYPT_OK) {
+           goto LBL_CLEANBUF;
+        }
+    } while (x == LTC_FILE_READ_BUFSIZE);
+    if ((err = hash_descriptor[hash].done(&md, out)) == CRYPT_OK) {
+       *outlen = hash_descriptor[hash].hashsize;
+    }
+
+LBL_CLEANBUF:
+    zeromem(buf, LTC_FILE_READ_BUFSIZE);
+LBL_ERR:
+    XFREE(buf);
+    return err;
+}
+#endif /* #ifndef LTC_NO_FILE */
+
+
+/* ref:         HEAD -> develop */
+/* git commit:  a1f6312416ef6cd183ee62db58b640dc2d7ec1f4 */
+/* commit time: 2019-09-04 13:44:47 +0200 */

+ 69 - 0
libtomcrypt.mod/libtomcrypt/src/hashes/helper/hash_memory.c

@@ -0,0 +1,69 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ */
+#include "tomcrypt_private.h"
+
+#ifdef LTC_HASH_HELPERS
+/**
+  @file hash_memory.c
+  Hash memory helper, Tom St Denis
+*/
+
+/**
+  Hash a block of memory and store the digest.
+  @param hash   The index of the hash you wish to use
+  @param in     The data you wish to hash
+  @param inlen  The length of the data to hash (octets)
+  @param out    [out] Where to store the digest
+  @param outlen [in/out] Max size and resulting size of the digest
+  @return CRYPT_OK if successful
+*/
+int hash_memory(int hash, const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen)
+{
+    hash_state *md;
+    int err;
+
+    LTC_ARGCHK(in     != NULL);
+    LTC_ARGCHK(out    != NULL);
+    LTC_ARGCHK(outlen != NULL);
+
+    if ((err = hash_is_valid(hash)) != CRYPT_OK) {
+        return err;
+    }
+
+    if (*outlen < hash_descriptor[hash].hashsize) {
+       *outlen = hash_descriptor[hash].hashsize;
+       return CRYPT_BUFFER_OVERFLOW;
+    }
+
+    md = XMALLOC(sizeof(hash_state));
+    if (md == NULL) {
+       return CRYPT_MEM;
+    }
+
+    if ((err = hash_descriptor[hash].init(md)) != CRYPT_OK) {
+       goto LBL_ERR;
+    }
+    if ((err = hash_descriptor[hash].process(md, in, inlen)) != CRYPT_OK) {
+       goto LBL_ERR;
+    }
+    err = hash_descriptor[hash].done(md, out);
+    *outlen = hash_descriptor[hash].hashsize;
+LBL_ERR:
+#ifdef LTC_CLEAN_STACK
+    zeromem(md, sizeof(hash_state));
+#endif
+    XFREE(md);
+
+    return err;
+}
+#endif /* #ifdef LTC_HASH_HELPERS */
+
+/* ref:         HEAD -> develop */
+/* git commit:  a1f6312416ef6cd183ee62db58b640dc2d7ec1f4 */
+/* commit time: 2019-09-04 13:44:47 +0200 */

+ 88 - 0
libtomcrypt.mod/libtomcrypt/src/hashes/helper/hash_memory_multi.c

@@ -0,0 +1,88 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ */
+#include "tomcrypt_private.h"
+#include <stdarg.h>
+
+#ifdef LTC_HASH_HELPERS
+/**
+  @file hash_memory_multi.c
+  Hash (multiple buffers) memory helper, Tom St Denis
+*/
+
+/**
+  Hash multiple (non-adjacent) blocks of memory at once.
+  @param hash   The index of the hash you wish to use
+  @param out    [out] Where to store the digest
+  @param outlen [in/out] Max size and resulting size of the digest
+  @param in     The data you wish to hash
+  @param inlen  The length of the data to hash (octets)
+  @param ...    tuples of (data,len) pairs to hash, terminated with a (NULL,x) (x=don't care)
+  @return CRYPT_OK if successful
+*/
+int hash_memory_multi(int hash, unsigned char *out, unsigned long *outlen,
+                      const unsigned char *in, unsigned long inlen, ...)
+{
+    hash_state          *md;
+    int                  err;
+    va_list              args;
+    const unsigned char *curptr;
+    unsigned long        curlen;
+
+    LTC_ARGCHK(in     != NULL);
+    LTC_ARGCHK(out    != NULL);
+    LTC_ARGCHK(outlen != NULL);
+
+    if ((err = hash_is_valid(hash)) != CRYPT_OK) {
+        return err;
+    }
+
+    if (*outlen < hash_descriptor[hash].hashsize) {
+       *outlen = hash_descriptor[hash].hashsize;
+       return CRYPT_BUFFER_OVERFLOW;
+    }
+
+    md = XMALLOC(sizeof(hash_state));
+    if (md == NULL) {
+       return CRYPT_MEM;
+    }
+
+    if ((err = hash_descriptor[hash].init(md)) != CRYPT_OK) {
+       goto LBL_ERR;
+    }
+
+    va_start(args, inlen);
+    curptr = in;
+    curlen = inlen;
+    for (;;) {
+       /* process buf */
+       if ((err = hash_descriptor[hash].process(md, curptr, curlen)) != CRYPT_OK) {
+          goto LBL_ERR;
+       }
+       /* step to next */
+       curptr = va_arg(args, const unsigned char*);
+       if (curptr == NULL) {
+          break;
+       }
+       curlen = va_arg(args, unsigned long);
+    }
+    err = hash_descriptor[hash].done(md, out);
+    *outlen = hash_descriptor[hash].hashsize;
+LBL_ERR:
+#ifdef LTC_CLEAN_STACK
+    zeromem(md, sizeof(hash_state));
+#endif
+    XFREE(md);
+    va_end(args);
+    return err;
+}
+#endif /* #ifdef LTC_HASH_HELPERS */
+
+/* ref:         HEAD -> develop */
+/* git commit:  a1f6312416ef6cd183ee62db58b640dc2d7ec1f4 */
+/* commit time: 2019-09-04 13:44:47 +0200 */

+ 250 - 0
libtomcrypt.mod/libtomcrypt/src/hashes/md2.c

@@ -0,0 +1,250 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ */
+#include "tomcrypt_private.h"
+
+/**
+   @param md2.c
+   LTC_MD2 (RFC 1319) hash function implementation by Tom St Denis
+*/
+
+#ifdef LTC_MD2
+
+const struct ltc_hash_descriptor md2_desc =
+{
+    "md2",
+    7,
+    16,
+    16,
+
+    /* OID */
+   { 1, 2, 840, 113549, 2, 2,  },
+   6,
+
+    &md2_init,
+    &md2_process,
+    &md2_done,
+    &md2_test,
+    NULL
+};
+
+static const unsigned char PI_SUBST[256] = {
+  41, 46, 67, 201, 162, 216, 124, 1, 61, 54, 84, 161, 236, 240, 6,
+  19, 98, 167, 5, 243, 192, 199, 115, 140, 152, 147, 43, 217, 188,
+  76, 130, 202, 30, 155, 87, 60, 253, 212, 224, 22, 103, 66, 111, 24,
+  138, 23, 229, 18, 190, 78, 196, 214, 218, 158, 222, 73, 160, 251,
+  245, 142, 187, 47, 238, 122, 169, 104, 121, 145, 21, 178, 7, 63,
+  148, 194, 16, 137, 11, 34, 95, 33, 128, 127, 93, 154, 90, 144, 50,
+  39, 53, 62, 204, 231, 191, 247, 151, 3, 255, 25, 48, 179, 72, 165,
+  181, 209, 215, 94, 146, 42, 172, 86, 170, 198, 79, 184, 56, 210,
+  150, 164, 125, 182, 118, 252, 107, 226, 156, 116, 4, 241, 69, 157,
+  112, 89, 100, 113, 135, 32, 134, 91, 207, 101, 230, 45, 168, 2, 27,
+  96, 37, 173, 174, 176, 185, 246, 28, 70, 97, 105, 52, 64, 126, 15,
+  85, 71, 163, 35, 221, 81, 175, 58, 195, 92, 249, 206, 186, 197,
+  234, 38, 44, 83, 13, 110, 133, 40, 132, 9, 211, 223, 205, 244, 65,
+  129, 77, 82, 106, 220, 55, 200, 108, 193, 171, 250, 36, 225, 123,
+  8, 12, 189, 177, 74, 120, 136, 149, 139, 227, 99, 232, 109, 233,
+  203, 213, 254, 59, 0, 29, 57, 242, 239, 183, 14, 102, 88, 208, 228,
+  166, 119, 114, 248, 235, 117, 75, 10, 49, 68, 80, 180, 143, 237,
+  31, 26, 219, 153, 141, 51, 159, 17, 131, 20
+};
+
+/* adds 16 bytes to the checksum */
+static void md2_update_chksum(hash_state *md)
+{
+   int j;
+   unsigned char L;
+   L = md->md2.chksum[15];
+   for (j = 0; j < 16; j++) {
+
+/* caution, the RFC says its "C[j] = S[M[i*16+j] xor L]" but the reference source code [and test vectors] say
+   otherwise.
+*/
+       L = (md->md2.chksum[j] ^= PI_SUBST[(int)(md->md2.buf[j] ^ L)] & 255);
+   }
+}
+
+static void md2_compress(hash_state *md)
+{
+   int j, k;
+   unsigned char t;
+
+   /* copy block */
+   for (j = 0; j < 16; j++) {
+       md->md2.X[16+j] = md->md2.buf[j];
+       md->md2.X[32+j] = md->md2.X[j] ^ md->md2.X[16+j];
+   }
+
+   t = (unsigned char)0;
+
+   /* do 18 rounds */
+   for (j = 0; j < 18; j++) {
+       for (k = 0; k < 48; k++) {
+           t = (md->md2.X[k] ^= PI_SUBST[(int)(t & 255)]);
+       }
+       t = (t + (unsigned char)j) & 255;
+   }
+}
+
+/**
+   Initialize the hash state
+   @param md   The hash state you wish to initialize
+   @return CRYPT_OK if successful
+*/
+int md2_init(hash_state *md)
+{
+   LTC_ARGCHK(md != NULL);
+
+   /* LTC_MD2 uses a zero'ed state... */
+   zeromem(md->md2.X, sizeof(md->md2.X));
+   zeromem(md->md2.chksum, sizeof(md->md2.chksum));
+   zeromem(md->md2.buf, sizeof(md->md2.buf));
+   md->md2.curlen = 0;
+   return CRYPT_OK;
+}
+
+/**
+   Process a block of memory though the hash
+   @param md     The hash state
+   @param in     The data to hash
+   @param inlen  The length of the data (octets)
+   @return CRYPT_OK if successful
+*/
+int md2_process(hash_state *md, const unsigned char *in, unsigned long inlen)
+{
+    unsigned long n;
+    LTC_ARGCHK(md != NULL);
+    LTC_ARGCHK(in != NULL);
+    if (md-> md2 .curlen > sizeof(md-> md2 .buf)) {
+       return CRYPT_INVALID_ARG;
+    }
+    while (inlen > 0) {
+        n = MIN(inlen, (16 - md->md2.curlen));
+        XMEMCPY(md->md2.buf + md->md2.curlen, in, (size_t)n);
+        md->md2.curlen += n;
+        in             += n;
+        inlen          -= n;
+
+        /* is 16 bytes full? */
+        if (md->md2.curlen == 16) {
+            md2_compress(md);
+            md2_update_chksum(md);
+            md->md2.curlen = 0;
+        }
+    }
+    return CRYPT_OK;
+}
+
+/**
+   Terminate the hash to get the digest
+   @param md  The hash state
+   @param out [out] The destination of the hash (16 bytes)
+   @return CRYPT_OK if successful
+*/
+int md2_done(hash_state * md, unsigned char *out)
+{
+    unsigned long i, k;
+
+    LTC_ARGCHK(md  != NULL);
+    LTC_ARGCHK(out != NULL);
+
+    if (md->md2.curlen >= sizeof(md->md2.buf)) {
+       return CRYPT_INVALID_ARG;
+    }
+
+
+    /* pad the message */
+    k = 16 - md->md2.curlen;
+    for (i = md->md2.curlen; i < 16; i++) {
+        md->md2.buf[i] = (unsigned char)k;
+    }
+
+    /* hash and update */
+    md2_compress(md);
+    md2_update_chksum(md);
+
+    /* hash checksum */
+    XMEMCPY(md->md2.buf, md->md2.chksum, 16);
+    md2_compress(md);
+
+    /* output is lower 16 bytes of X */
+    XMEMCPY(out, md->md2.X, 16);
+
+#ifdef LTC_CLEAN_STACK
+    zeromem(md, sizeof(hash_state));
+#endif
+    return CRYPT_OK;
+}
+
+/**
+  Self-test the hash
+  @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled
+*/
+int md2_test(void)
+{
+ #ifndef LTC_TEST
+    return CRYPT_NOP;
+ #else
+   static const struct {
+        const char *msg;
+        unsigned char hash[16];
+   } tests[] = {
+      { "",
+        {0x83,0x50,0xe5,0xa3,0xe2,0x4c,0x15,0x3d,
+         0xf2,0x27,0x5c,0x9f,0x80,0x69,0x27,0x73
+        }
+      },
+      { "a",
+        {0x32,0xec,0x01,0xec,0x4a,0x6d,0xac,0x72,
+         0xc0,0xab,0x96,0xfb,0x34,0xc0,0xb5,0xd1
+        }
+      },
+      { "message digest",
+        {0xab,0x4f,0x49,0x6b,0xfb,0x2a,0x53,0x0b,
+         0x21,0x9f,0xf3,0x30,0x31,0xfe,0x06,0xb0
+        }
+      },
+      { "abcdefghijklmnopqrstuvwxyz",
+        {0x4e,0x8d,0xdf,0xf3,0x65,0x02,0x92,0xab,
+         0x5a,0x41,0x08,0xc3,0xaa,0x47,0x94,0x0b
+        }
+      },
+      { "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789",
+        {0xda,0x33,0xde,0xf2,0xa4,0x2d,0xf1,0x39,
+         0x75,0x35,0x28,0x46,0xc3,0x03,0x38,0xcd
+        }
+      },
+      { "12345678901234567890123456789012345678901234567890123456789012345678901234567890",
+        {0xd5,0x97,0x6f,0x79,0xd8,0x3d,0x3a,0x0d,
+         0xc9,0x80,0x6c,0x3c,0x66,0xf3,0xef,0xd8
+        }
+      }
+   };
+
+   int i;
+   unsigned char tmp[16];
+   hash_state md;
+
+   for (i = 0; i < (int)(sizeof(tests) / sizeof(tests[0])); i++) {
+       md2_init(&md);
+       md2_process(&md, (unsigned char*)tests[i].msg, (unsigned long)strlen(tests[i].msg));
+       md2_done(&md, tmp);
+       if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "MD2", i)) {
+          return CRYPT_FAIL_TESTVECTOR;
+       }
+   }
+   return CRYPT_OK;
+  #endif
+}
+
+#endif
+
+
+/* ref:         HEAD -> develop */
+/* git commit:  a1f6312416ef6cd183ee62db58b640dc2d7ec1f4 */
+/* commit time: 2019-09-04 13:44:47 +0200 */

+ 306 - 0
libtomcrypt.mod/libtomcrypt/src/hashes/md4.c

@@ -0,0 +1,306 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ */
+#include "tomcrypt_private.h"
+
+/**
+   @param md4.c
+   Submitted by Dobes Vandermeer  ([email protected])
+*/
+
+#ifdef LTC_MD4
+
+const struct ltc_hash_descriptor md4_desc =
+{
+    "md4",
+    6,
+    16,
+    64,
+
+    /* OID */
+   { 1, 2, 840, 113549, 2, 4,  },
+   6,
+
+    &md4_init,
+    &md4_process,
+    &md4_done,
+    &md4_test,
+    NULL
+};
+
+#define S11 3
+#define S12 7
+#define S13 11
+#define S14 19
+#define S21 3
+#define S22 5
+#define S23 9
+#define S24 13
+#define S31 3
+#define S32 9
+#define S33 11
+#define S34 15
+
+/* F, G and H are basic LTC_MD4 functions. */
+#define F(x, y, z) (z ^ (x & (y ^ z)))
+#define G(x, y, z) ((x & y) | (z & (x | y)))
+#define H(x, y, z) ((x) ^ (y) ^ (z))
+
+/* ROTATE_LEFT rotates x left n bits. */
+#define ROTATE_LEFT(x, n) ROLc(x, n)
+
+/* FF, GG and HH are transformations for rounds 1, 2 and 3 */
+/* Rotation is separate from addition to prevent recomputation */
+
+#define FF(a, b, c, d, x, s) { \
+    (a) += F ((b), (c), (d)) + (x); \
+    (a) = ROTATE_LEFT ((a), (s)); \
+  }
+#define GG(a, b, c, d, x, s) { \
+    (a) += G ((b), (c), (d)) + (x) + 0x5a827999UL; \
+    (a) = ROTATE_LEFT ((a), (s)); \
+  }
+#define HH(a, b, c, d, x, s) { \
+    (a) += H ((b), (c), (d)) + (x) + 0x6ed9eba1UL; \
+    (a) = ROTATE_LEFT ((a), (s)); \
+  }
+
+#ifdef LTC_CLEAN_STACK
+static int _md4_compress(hash_state *md, const unsigned char *buf)
+#else
+static int  md4_compress(hash_state *md, const unsigned char *buf)
+#endif
+{
+    ulong32 x[16], a, b, c, d;
+    int i;
+
+    /* copy state */
+    a = md->md4.state[0];
+    b = md->md4.state[1];
+    c = md->md4.state[2];
+    d = md->md4.state[3];
+
+    /* copy the state into 512-bits into W[0..15] */
+    for (i = 0; i < 16; i++) {
+        LOAD32L(x[i], buf + (4*i));
+    }
+
+    /* Round 1 */
+    FF (a, b, c, d, x[ 0], S11); /* 1 */
+    FF (d, a, b, c, x[ 1], S12); /* 2 */
+    FF (c, d, a, b, x[ 2], S13); /* 3 */
+    FF (b, c, d, a, x[ 3], S14); /* 4 */
+    FF (a, b, c, d, x[ 4], S11); /* 5 */
+    FF (d, a, b, c, x[ 5], S12); /* 6 */
+    FF (c, d, a, b, x[ 6], S13); /* 7 */
+    FF (b, c, d, a, x[ 7], S14); /* 8 */
+    FF (a, b, c, d, x[ 8], S11); /* 9 */
+    FF (d, a, b, c, x[ 9], S12); /* 10 */
+    FF (c, d, a, b, x[10], S13); /* 11 */
+    FF (b, c, d, a, x[11], S14); /* 12 */
+    FF (a, b, c, d, x[12], S11); /* 13 */
+    FF (d, a, b, c, x[13], S12); /* 14 */
+    FF (c, d, a, b, x[14], S13); /* 15 */
+    FF (b, c, d, a, x[15], S14); /* 16 */
+
+    /* Round 2 */
+    GG (a, b, c, d, x[ 0], S21); /* 17 */
+    GG (d, a, b, c, x[ 4], S22); /* 18 */
+    GG (c, d, a, b, x[ 8], S23); /* 19 */
+    GG (b, c, d, a, x[12], S24); /* 20 */
+    GG (a, b, c, d, x[ 1], S21); /* 21 */
+    GG (d, a, b, c, x[ 5], S22); /* 22 */
+    GG (c, d, a, b, x[ 9], S23); /* 23 */
+    GG (b, c, d, a, x[13], S24); /* 24 */
+    GG (a, b, c, d, x[ 2], S21); /* 25 */
+    GG (d, a, b, c, x[ 6], S22); /* 26 */
+    GG (c, d, a, b, x[10], S23); /* 27 */
+    GG (b, c, d, a, x[14], S24); /* 28 */
+    GG (a, b, c, d, x[ 3], S21); /* 29 */
+    GG (d, a, b, c, x[ 7], S22); /* 30 */
+    GG (c, d, a, b, x[11], S23); /* 31 */
+    GG (b, c, d, a, x[15], S24); /* 32 */
+
+    /* Round 3 */
+    HH (a, b, c, d, x[ 0], S31); /* 33 */
+    HH (d, a, b, c, x[ 8], S32); /* 34 */
+    HH (c, d, a, b, x[ 4], S33); /* 35 */
+    HH (b, c, d, a, x[12], S34); /* 36 */
+    HH (a, b, c, d, x[ 2], S31); /* 37 */
+    HH (d, a, b, c, x[10], S32); /* 38 */
+    HH (c, d, a, b, x[ 6], S33); /* 39 */
+    HH (b, c, d, a, x[14], S34); /* 40 */
+    HH (a, b, c, d, x[ 1], S31); /* 41 */
+    HH (d, a, b, c, x[ 9], S32); /* 42 */
+    HH (c, d, a, b, x[ 5], S33); /* 43 */
+    HH (b, c, d, a, x[13], S34); /* 44 */
+    HH (a, b, c, d, x[ 3], S31); /* 45 */
+    HH (d, a, b, c, x[11], S32); /* 46 */
+    HH (c, d, a, b, x[ 7], S33); /* 47 */
+    HH (b, c, d, a, x[15], S34); /* 48 */
+
+
+    /* Update our state */
+    md->md4.state[0] = md->md4.state[0] + a;
+    md->md4.state[1] = md->md4.state[1] + b;
+    md->md4.state[2] = md->md4.state[2] + c;
+    md->md4.state[3] = md->md4.state[3] + d;
+
+    return CRYPT_OK;
+}
+
+#ifdef LTC_CLEAN_STACK
+static int md4_compress(hash_state *md, const unsigned char *buf)
+{
+   int err;
+   err = _md4_compress(md, buf);
+   burn_stack(sizeof(ulong32) * 20 + sizeof(int));
+   return err;
+}
+#endif
+
+/**
+   Initialize the hash state
+   @param md   The hash state you wish to initialize
+   @return CRYPT_OK if successful
+*/
+int md4_init(hash_state * md)
+{
+   LTC_ARGCHK(md != NULL);
+   md->md4.state[0] = 0x67452301UL;
+   md->md4.state[1] = 0xefcdab89UL;
+   md->md4.state[2] = 0x98badcfeUL;
+   md->md4.state[3] = 0x10325476UL;
+   md->md4.length  = 0;
+   md->md4.curlen  = 0;
+   return CRYPT_OK;
+}
+
+/**
+   Process a block of memory though the hash
+   @param md     The hash state
+   @param in     The data to hash
+   @param inlen  The length of the data (octets)
+   @return CRYPT_OK if successful
+*/
+HASH_PROCESS(md4_process, md4_compress, md4, 64)
+
+/**
+   Terminate the hash to get the digest
+   @param md  The hash state
+   @param out [out] The destination of the hash (16 bytes)
+   @return CRYPT_OK if successful
+*/
+int md4_done(hash_state * md, unsigned char *out)
+{
+    int i;
+
+    LTC_ARGCHK(md  != NULL);
+    LTC_ARGCHK(out != NULL);
+
+    if (md->md4.curlen >= sizeof(md->md4.buf)) {
+       return CRYPT_INVALID_ARG;
+    }
+
+    /* increase the length of the message */
+    md->md4.length += md->md4.curlen * 8;
+
+    /* append the '1' bit */
+    md->md4.buf[md->md4.curlen++] = (unsigned char)0x80;
+
+    /* if the length is currently above 56 bytes we append zeros
+     * then compress.  Then we can fall back to padding zeros and length
+     * encoding like normal.
+     */
+    if (md->md4.curlen > 56) {
+        while (md->md4.curlen < 64) {
+            md->md4.buf[md->md4.curlen++] = (unsigned char)0;
+        }
+        md4_compress(md, md->md4.buf);
+        md->md4.curlen = 0;
+    }
+
+    /* pad upto 56 bytes of zeroes */
+    while (md->md4.curlen < 56) {
+        md->md4.buf[md->md4.curlen++] = (unsigned char)0;
+    }
+
+    /* store length */
+    STORE64L(md->md4.length, md->md4.buf+56);
+    md4_compress(md, md->md4.buf);
+
+    /* copy output */
+    for (i = 0; i < 4; i++) {
+        STORE32L(md->md4.state[i], out+(4*i));
+    }
+#ifdef LTC_CLEAN_STACK
+    zeromem(md, sizeof(hash_state));
+#endif
+    return CRYPT_OK;
+}
+
+/**
+  Self-test the hash
+  @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled
+*/
+int md4_test(void)
+{
+ #ifndef LTC_TEST
+    return CRYPT_NOP;
+ #else
+    static const struct md4_test_case {
+        const char *input;
+        unsigned char hash[16];
+    } tests[] = {
+        { "",
+          {0x31, 0xd6, 0xcf, 0xe0, 0xd1, 0x6a, 0xe9, 0x31,
+           0xb7, 0x3c, 0x59, 0xd7, 0xe0, 0xc0, 0x89, 0xc0} },
+        { "a",
+          {0xbd, 0xe5, 0x2c, 0xb3, 0x1d, 0xe3, 0x3e, 0x46,
+           0x24, 0x5e, 0x05, 0xfb, 0xdb, 0xd6, 0xfb, 0x24} },
+        { "abc",
+          {0xa4, 0x48, 0x01, 0x7a, 0xaf, 0x21, 0xd8, 0x52,
+           0x5f, 0xc1, 0x0a, 0xe8, 0x7a, 0xa6, 0x72, 0x9d} },
+        { "message digest",
+          {0xd9, 0x13, 0x0a, 0x81, 0x64, 0x54, 0x9f, 0xe8,
+           0x18, 0x87, 0x48, 0x06, 0xe1, 0xc7, 0x01, 0x4b} },
+        { "abcdefghijklmnopqrstuvwxyz",
+          {0xd7, 0x9e, 0x1c, 0x30, 0x8a, 0xa5, 0xbb, 0xcd,
+           0xee, 0xa8, 0xed, 0x63, 0xdf, 0x41, 0x2d, 0xa9} },
+        { "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789",
+          {0x04, 0x3f, 0x85, 0x82, 0xf2, 0x41, 0xdb, 0x35,
+           0x1c, 0xe6, 0x27, 0xe1, 0x53, 0xe7, 0xf0, 0xe4} },
+        { "12345678901234567890123456789012345678901234567890123456789012345678901234567890",
+          {0xe3, 0x3b, 0x4d, 0xdc, 0x9c, 0x38, 0xf2, 0x19,
+           0x9c, 0x3e, 0x7b, 0x16, 0x4f, 0xcc, 0x05, 0x36} },
+    };
+
+    int i;
+    unsigned char tmp[16];
+    hash_state md;
+
+    for(i = 0; i < (int)(sizeof(tests) / sizeof(tests[0])); i++) {
+        md4_init(&md);
+        md4_process(&md, (unsigned char *)tests[i].input, (unsigned long)strlen(tests[i].input));
+        md4_done(&md, tmp);
+        if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "MD4", i)) {
+           return CRYPT_FAIL_TESTVECTOR;
+        }
+
+    }
+    return CRYPT_OK;
+  #endif
+}
+
+#endif
+
+
+
+/* ref:         HEAD -> develop */
+/* git commit:  a1f6312416ef6cd183ee62db58b640dc2d7ec1f4 */
+/* commit time: 2019-09-04 13:44:47 +0200 */

+ 366 - 0
libtomcrypt.mod/libtomcrypt/src/hashes/md5.c

@@ -0,0 +1,366 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ */
+#include "tomcrypt_private.h"
+
+
+/**
+  @file md5.c
+  LTC_MD5 hash function by Tom St Denis
+*/
+
+#ifdef LTC_MD5
+
+const struct ltc_hash_descriptor md5_desc =
+{
+    "md5",
+    3,
+    16,
+    64,
+
+    /* OID */
+   { 1, 2, 840, 113549, 2, 5,  },
+   6,
+
+    &md5_init,
+    &md5_process,
+    &md5_done,
+    &md5_test,
+    NULL
+};
+
+#define F(x,y,z)  (z ^ (x & (y ^ z)))
+#define G(x,y,z)  (y ^ (z & (y ^ x)))
+#define H(x,y,z)  (x^y^z)
+#define I(x,y,z)  (y^(x|(~z)))
+
+#ifdef LTC_SMALL_CODE
+
+#define FF(a,b,c,d,M,s,t) \
+    a = (a + F(b,c,d) + M + t); a = ROL(a, s) + b;
+
+#define GG(a,b,c,d,M,s,t) \
+    a = (a + G(b,c,d) + M + t); a = ROL(a, s) + b;
+
+#define HH(a,b,c,d,M,s,t) \
+    a = (a + H(b,c,d) + M + t); a = ROL(a, s) + b;
+
+#define II(a,b,c,d,M,s,t) \
+    a = (a + I(b,c,d) + M + t); a = ROL(a, s) + b;
+
+static const unsigned char Worder[64] = {
+   0,1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,
+   1,6,11,0,5,10,15,4,9,14,3,8,13,2,7,12,
+   5,8,11,14,1,4,7,10,13,0,3,6,9,12,15,2,
+   0,7,14,5,12,3,10,1,8,15,6,13,4,11,2,9
+};
+
+static const unsigned char Rorder[64] = {
+   7,12,17,22,7,12,17,22,7,12,17,22,7,12,17,22,
+   5,9,14,20,5,9,14,20,5,9,14,20,5,9,14,20,
+   4,11,16,23,4,11,16,23,4,11,16,23,4,11,16,23,
+   6,10,15,21,6,10,15,21,6,10,15,21,6,10,15,21
+};
+
+static const ulong32 Korder[64] = {
+0xd76aa478UL, 0xe8c7b756UL, 0x242070dbUL, 0xc1bdceeeUL, 0xf57c0fafUL, 0x4787c62aUL, 0xa8304613UL, 0xfd469501UL,
+0x698098d8UL, 0x8b44f7afUL, 0xffff5bb1UL, 0x895cd7beUL, 0x6b901122UL, 0xfd987193UL, 0xa679438eUL, 0x49b40821UL,
+0xf61e2562UL, 0xc040b340UL, 0x265e5a51UL, 0xe9b6c7aaUL, 0xd62f105dUL, 0x02441453UL, 0xd8a1e681UL, 0xe7d3fbc8UL,
+0x21e1cde6UL, 0xc33707d6UL, 0xf4d50d87UL, 0x455a14edUL, 0xa9e3e905UL, 0xfcefa3f8UL, 0x676f02d9UL, 0x8d2a4c8aUL,
+0xfffa3942UL, 0x8771f681UL, 0x6d9d6122UL, 0xfde5380cUL, 0xa4beea44UL, 0x4bdecfa9UL, 0xf6bb4b60UL, 0xbebfbc70UL,
+0x289b7ec6UL, 0xeaa127faUL, 0xd4ef3085UL, 0x04881d05UL, 0xd9d4d039UL, 0xe6db99e5UL, 0x1fa27cf8UL, 0xc4ac5665UL,
+0xf4292244UL, 0x432aff97UL, 0xab9423a7UL, 0xfc93a039UL, 0x655b59c3UL, 0x8f0ccc92UL, 0xffeff47dUL, 0x85845dd1UL,
+0x6fa87e4fUL, 0xfe2ce6e0UL, 0xa3014314UL, 0x4e0811a1UL, 0xf7537e82UL, 0xbd3af235UL, 0x2ad7d2bbUL, 0xeb86d391UL
+};
+
+#else
+
+#define FF(a,b,c,d,M,s,t) \
+    a = (a + F(b,c,d) + M + t); a = ROLc(a, s) + b;
+
+#define GG(a,b,c,d,M,s,t) \
+    a = (a + G(b,c,d) + M + t); a = ROLc(a, s) + b;
+
+#define HH(a,b,c,d,M,s,t) \
+    a = (a + H(b,c,d) + M + t); a = ROLc(a, s) + b;
+
+#define II(a,b,c,d,M,s,t) \
+    a = (a + I(b,c,d) + M + t); a = ROLc(a, s) + b;
+
+
+#endif
+
+#ifdef LTC_CLEAN_STACK
+static int _md5_compress(hash_state *md, const unsigned char *buf)
+#else
+static int  md5_compress(hash_state *md, const unsigned char *buf)
+#endif
+{
+    ulong32 i, W[16], a, b, c, d;
+#ifdef LTC_SMALL_CODE
+    ulong32 t;
+#endif
+
+    /* copy the state into 512-bits into W[0..15] */
+    for (i = 0; i < 16; i++) {
+        LOAD32L(W[i], buf + (4*i));
+    }
+
+    /* copy state */
+    a = md->md5.state[0];
+    b = md->md5.state[1];
+    c = md->md5.state[2];
+    d = md->md5.state[3];
+
+#ifdef LTC_SMALL_CODE
+    for (i = 0; i < 16; ++i) {
+        FF(a,b,c,d,W[Worder[i]],Rorder[i],Korder[i]);
+        t = d; d = c; c = b; b = a; a = t;
+    }
+
+    for (; i < 32; ++i) {
+        GG(a,b,c,d,W[Worder[i]],Rorder[i],Korder[i]);
+        t = d; d = c; c = b; b = a; a = t;
+    }
+
+    for (; i < 48; ++i) {
+        HH(a,b,c,d,W[Worder[i]],Rorder[i],Korder[i]);
+        t = d; d = c; c = b; b = a; a = t;
+    }
+
+    for (; i < 64; ++i) {
+        II(a,b,c,d,W[Worder[i]],Rorder[i],Korder[i]);
+        t = d; d = c; c = b; b = a; a = t;
+    }
+
+#else
+    FF(a,b,c,d,W[0],7,0xd76aa478UL)
+    FF(d,a,b,c,W[1],12,0xe8c7b756UL)
+    FF(c,d,a,b,W[2],17,0x242070dbUL)
+    FF(b,c,d,a,W[3],22,0xc1bdceeeUL)
+    FF(a,b,c,d,W[4],7,0xf57c0fafUL)
+    FF(d,a,b,c,W[5],12,0x4787c62aUL)
+    FF(c,d,a,b,W[6],17,0xa8304613UL)
+    FF(b,c,d,a,W[7],22,0xfd469501UL)
+    FF(a,b,c,d,W[8],7,0x698098d8UL)
+    FF(d,a,b,c,W[9],12,0x8b44f7afUL)
+    FF(c,d,a,b,W[10],17,0xffff5bb1UL)
+    FF(b,c,d,a,W[11],22,0x895cd7beUL)
+    FF(a,b,c,d,W[12],7,0x6b901122UL)
+    FF(d,a,b,c,W[13],12,0xfd987193UL)
+    FF(c,d,a,b,W[14],17,0xa679438eUL)
+    FF(b,c,d,a,W[15],22,0x49b40821UL)
+    GG(a,b,c,d,W[1],5,0xf61e2562UL)
+    GG(d,a,b,c,W[6],9,0xc040b340UL)
+    GG(c,d,a,b,W[11],14,0x265e5a51UL)
+    GG(b,c,d,a,W[0],20,0xe9b6c7aaUL)
+    GG(a,b,c,d,W[5],5,0xd62f105dUL)
+    GG(d,a,b,c,W[10],9,0x02441453UL)
+    GG(c,d,a,b,W[15],14,0xd8a1e681UL)
+    GG(b,c,d,a,W[4],20,0xe7d3fbc8UL)
+    GG(a,b,c,d,W[9],5,0x21e1cde6UL)
+    GG(d,a,b,c,W[14],9,0xc33707d6UL)
+    GG(c,d,a,b,W[3],14,0xf4d50d87UL)
+    GG(b,c,d,a,W[8],20,0x455a14edUL)
+    GG(a,b,c,d,W[13],5,0xa9e3e905UL)
+    GG(d,a,b,c,W[2],9,0xfcefa3f8UL)
+    GG(c,d,a,b,W[7],14,0x676f02d9UL)
+    GG(b,c,d,a,W[12],20,0x8d2a4c8aUL)
+    HH(a,b,c,d,W[5],4,0xfffa3942UL)
+    HH(d,a,b,c,W[8],11,0x8771f681UL)
+    HH(c,d,a,b,W[11],16,0x6d9d6122UL)
+    HH(b,c,d,a,W[14],23,0xfde5380cUL)
+    HH(a,b,c,d,W[1],4,0xa4beea44UL)
+    HH(d,a,b,c,W[4],11,0x4bdecfa9UL)
+    HH(c,d,a,b,W[7],16,0xf6bb4b60UL)
+    HH(b,c,d,a,W[10],23,0xbebfbc70UL)
+    HH(a,b,c,d,W[13],4,0x289b7ec6UL)
+    HH(d,a,b,c,W[0],11,0xeaa127faUL)
+    HH(c,d,a,b,W[3],16,0xd4ef3085UL)
+    HH(b,c,d,a,W[6],23,0x04881d05UL)
+    HH(a,b,c,d,W[9],4,0xd9d4d039UL)
+    HH(d,a,b,c,W[12],11,0xe6db99e5UL)
+    HH(c,d,a,b,W[15],16,0x1fa27cf8UL)
+    HH(b,c,d,a,W[2],23,0xc4ac5665UL)
+    II(a,b,c,d,W[0],6,0xf4292244UL)
+    II(d,a,b,c,W[7],10,0x432aff97UL)
+    II(c,d,a,b,W[14],15,0xab9423a7UL)
+    II(b,c,d,a,W[5],21,0xfc93a039UL)
+    II(a,b,c,d,W[12],6,0x655b59c3UL)
+    II(d,a,b,c,W[3],10,0x8f0ccc92UL)
+    II(c,d,a,b,W[10],15,0xffeff47dUL)
+    II(b,c,d,a,W[1],21,0x85845dd1UL)
+    II(a,b,c,d,W[8],6,0x6fa87e4fUL)
+    II(d,a,b,c,W[15],10,0xfe2ce6e0UL)
+    II(c,d,a,b,W[6],15,0xa3014314UL)
+    II(b,c,d,a,W[13],21,0x4e0811a1UL)
+    II(a,b,c,d,W[4],6,0xf7537e82UL)
+    II(d,a,b,c,W[11],10,0xbd3af235UL)
+    II(c,d,a,b,W[2],15,0x2ad7d2bbUL)
+    II(b,c,d,a,W[9],21,0xeb86d391UL)
+#endif
+
+    md->md5.state[0] = md->md5.state[0] + a;
+    md->md5.state[1] = md->md5.state[1] + b;
+    md->md5.state[2] = md->md5.state[2] + c;
+    md->md5.state[3] = md->md5.state[3] + d;
+
+    return CRYPT_OK;
+}
+
+#ifdef LTC_CLEAN_STACK
+static int md5_compress(hash_state *md, const unsigned char *buf)
+{
+   int err;
+   err = _md5_compress(md, buf);
+   burn_stack(sizeof(ulong32) * 21);
+   return err;
+}
+#endif
+
+/**
+   Initialize the hash state
+   @param md   The hash state you wish to initialize
+   @return CRYPT_OK if successful
+*/
+int md5_init(hash_state * md)
+{
+   LTC_ARGCHK(md != NULL);
+   md->md5.state[0] = 0x67452301UL;
+   md->md5.state[1] = 0xefcdab89UL;
+   md->md5.state[2] = 0x98badcfeUL;
+   md->md5.state[3] = 0x10325476UL;
+   md->md5.curlen = 0;
+   md->md5.length = 0;
+   return CRYPT_OK;
+}
+
+/**
+   Process a block of memory though the hash
+   @param md     The hash state
+   @param in     The data to hash
+   @param inlen  The length of the data (octets)
+   @return CRYPT_OK if successful
+*/
+HASH_PROCESS(md5_process, md5_compress, md5, 64)
+
+/**
+   Terminate the hash to get the digest
+   @param md  The hash state
+   @param out [out] The destination of the hash (16 bytes)
+   @return CRYPT_OK if successful
+*/
+int md5_done(hash_state * md, unsigned char *out)
+{
+    int i;
+
+    LTC_ARGCHK(md  != NULL);
+    LTC_ARGCHK(out != NULL);
+
+    if (md->md5.curlen >= sizeof(md->md5.buf)) {
+       return CRYPT_INVALID_ARG;
+    }
+
+
+    /* increase the length of the message */
+    md->md5.length += md->md5.curlen * 8;
+
+    /* append the '1' bit */
+    md->md5.buf[md->md5.curlen++] = (unsigned char)0x80;
+
+    /* if the length is currently above 56 bytes we append zeros
+     * then compress.  Then we can fall back to padding zeros and length
+     * encoding like normal.
+     */
+    if (md->md5.curlen > 56) {
+        while (md->md5.curlen < 64) {
+            md->md5.buf[md->md5.curlen++] = (unsigned char)0;
+        }
+        md5_compress(md, md->md5.buf);
+        md->md5.curlen = 0;
+    }
+
+    /* pad upto 56 bytes of zeroes */
+    while (md->md5.curlen < 56) {
+        md->md5.buf[md->md5.curlen++] = (unsigned char)0;
+    }
+
+    /* store length */
+    STORE64L(md->md5.length, md->md5.buf+56);
+    md5_compress(md, md->md5.buf);
+
+    /* copy output */
+    for (i = 0; i < 4; i++) {
+        STORE32L(md->md5.state[i], out+(4*i));
+    }
+#ifdef LTC_CLEAN_STACK
+    zeromem(md, sizeof(hash_state));
+#endif
+    return CRYPT_OK;
+}
+
+/**
+  Self-test the hash
+  @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled
+*/
+int  md5_test(void)
+{
+ #ifndef LTC_TEST
+    return CRYPT_NOP;
+ #else
+  static const struct {
+      const char *msg;
+      unsigned char hash[16];
+  } tests[] = {
+    { "",
+      { 0xd4, 0x1d, 0x8c, 0xd9, 0x8f, 0x00, 0xb2, 0x04,
+        0xe9, 0x80, 0x09, 0x98, 0xec, 0xf8, 0x42, 0x7e } },
+    { "a",
+      {0x0c, 0xc1, 0x75, 0xb9, 0xc0, 0xf1, 0xb6, 0xa8,
+       0x31, 0xc3, 0x99, 0xe2, 0x69, 0x77, 0x26, 0x61 } },
+    { "abc",
+      { 0x90, 0x01, 0x50, 0x98, 0x3c, 0xd2, 0x4f, 0xb0,
+        0xd6, 0x96, 0x3f, 0x7d, 0x28, 0xe1, 0x7f, 0x72 } },
+    { "message digest",
+      { 0xf9, 0x6b, 0x69, 0x7d, 0x7c, 0xb7, 0x93, 0x8d,
+        0x52, 0x5a, 0x2f, 0x31, 0xaa, 0xf1, 0x61, 0xd0 } },
+    { "abcdefghijklmnopqrstuvwxyz",
+      { 0xc3, 0xfc, 0xd3, 0xd7, 0x61, 0x92, 0xe4, 0x00,
+        0x7d, 0xfb, 0x49, 0x6c, 0xca, 0x67, 0xe1, 0x3b } },
+    { "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789",
+      { 0xd1, 0x74, 0xab, 0x98, 0xd2, 0x77, 0xd9, 0xf5,
+        0xa5, 0x61, 0x1c, 0x2c, 0x9f, 0x41, 0x9d, 0x9f } },
+    { "12345678901234567890123456789012345678901234567890123456789012345678901234567890",
+      { 0x57, 0xed, 0xf4, 0xa2, 0x2b, 0xe3, 0xc9, 0x55,
+        0xac, 0x49, 0xda, 0x2e, 0x21, 0x07, 0xb6, 0x7a } },
+    { NULL, { 0 } }
+  };
+
+  int i;
+  unsigned char tmp[16];
+  hash_state md;
+
+  for (i = 0; tests[i].msg != NULL; i++) {
+      md5_init(&md);
+      md5_process(&md, (unsigned char *)tests[i].msg, (unsigned long)strlen(tests[i].msg));
+      md5_done(&md, tmp);
+      if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "MD5", i)) {
+         return CRYPT_FAIL_TESTVECTOR;
+      }
+  }
+  return CRYPT_OK;
+ #endif
+}
+
+#endif
+
+
+
+/* ref:         HEAD -> develop */
+/* git commit:  a1f6312416ef6cd183ee62db58b640dc2d7ec1f4 */
+/* commit time: 2019-09-04 13:44:47 +0200 */

+ 406 - 0
libtomcrypt.mod/libtomcrypt/src/hashes/rmd128.c

@@ -0,0 +1,406 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ */
+#include "tomcrypt_private.h"
+
+/**
+   @param rmd128.c
+   RMD128 Hash function
+*/
+
+/* Implementation of LTC_RIPEMD-128 based on the source by Antoon Bosselaers, ESAT-COSIC
+ *
+ * This source has been radically overhauled to be portable and work within
+ * the LibTomCrypt API by Tom St Denis
+ */
+
+#ifdef LTC_RIPEMD128
+
+const struct ltc_hash_descriptor rmd128_desc =
+{
+    "rmd128",
+    8,
+    16,
+    64,
+
+    /* OID */
+   { 1, 0, 10118, 3, 0, 50 },
+   6,
+
+    &rmd128_init,
+    &rmd128_process,
+    &rmd128_done,
+    &rmd128_test,
+    NULL
+};
+
+/* the four basic functions F(), G() and H() */
+#define F(x, y, z)        ((x) ^ (y) ^ (z))
+#define G(x, y, z)        (((x) & (y)) | (~(x) & (z)))
+#define H(x, y, z)        (((x) | ~(y)) ^ (z))
+#define I(x, y, z)        (((x) & (z)) | ((y) & ~(z)))
+
+/* the eight basic operations FF() through III() */
+#define FF(a, b, c, d, x, s)        \
+      (a) += F((b), (c), (d)) + (x);\
+      (a) = ROLc((a), (s));
+
+#define GG(a, b, c, d, x, s)        \
+      (a) += G((b), (c), (d)) + (x) + 0x5a827999UL;\
+      (a) = ROLc((a), (s));
+
+#define HH(a, b, c, d, x, s)        \
+      (a) += H((b), (c), (d)) + (x) + 0x6ed9eba1UL;\
+      (a) = ROLc((a), (s));
+
+#define II(a, b, c, d, x, s)        \
+      (a) += I((b), (c), (d)) + (x) + 0x8f1bbcdcUL;\
+      (a) = ROLc((a), (s));
+
+#define FFF(a, b, c, d, x, s)        \
+      (a) += F((b), (c), (d)) + (x);\
+      (a) = ROLc((a), (s));
+
+#define GGG(a, b, c, d, x, s)        \
+      (a) += G((b), (c), (d)) + (x) + 0x6d703ef3UL;\
+      (a) = ROLc((a), (s));
+
+#define HHH(a, b, c, d, x, s)        \
+      (a) += H((b), (c), (d)) + (x) + 0x5c4dd124UL;\
+      (a) = ROLc((a), (s));
+
+#define III(a, b, c, d, x, s)        \
+      (a) += I((b), (c), (d)) + (x) + 0x50a28be6UL;\
+      (a) = ROLc((a), (s));
+
+#ifdef LTC_CLEAN_STACK
+static int _rmd128_compress(hash_state *md, const unsigned char *buf)
+#else
+static int  rmd128_compress(hash_state *md, const unsigned char *buf)
+#endif
+{
+   ulong32 aa,bb,cc,dd,aaa,bbb,ccc,ddd,X[16];
+   int i;
+
+   /* load words X */
+   for (i = 0; i < 16; i++){
+      LOAD32L(X[i], buf + (4 * i));
+   }
+
+   /* load state */
+   aa = aaa = md->rmd128.state[0];
+   bb = bbb = md->rmd128.state[1];
+   cc = ccc = md->rmd128.state[2];
+   dd = ddd = md->rmd128.state[3];
+
+   /* round 1 */
+   FF(aa, bb, cc, dd, X[ 0], 11);
+   FF(dd, aa, bb, cc, X[ 1], 14);
+   FF(cc, dd, aa, bb, X[ 2], 15);
+   FF(bb, cc, dd, aa, X[ 3], 12);
+   FF(aa, bb, cc, dd, X[ 4],  5);
+   FF(dd, aa, bb, cc, X[ 5],  8);
+   FF(cc, dd, aa, bb, X[ 6],  7);
+   FF(bb, cc, dd, aa, X[ 7],  9);
+   FF(aa, bb, cc, dd, X[ 8], 11);
+   FF(dd, aa, bb, cc, X[ 9], 13);
+   FF(cc, dd, aa, bb, X[10], 14);
+   FF(bb, cc, dd, aa, X[11], 15);
+   FF(aa, bb, cc, dd, X[12],  6);
+   FF(dd, aa, bb, cc, X[13],  7);
+   FF(cc, dd, aa, bb, X[14],  9);
+   FF(bb, cc, dd, aa, X[15],  8);
+
+   /* round 2 */
+   GG(aa, bb, cc, dd, X[ 7],  7);
+   GG(dd, aa, bb, cc, X[ 4],  6);
+   GG(cc, dd, aa, bb, X[13],  8);
+   GG(bb, cc, dd, aa, X[ 1], 13);
+   GG(aa, bb, cc, dd, X[10], 11);
+   GG(dd, aa, bb, cc, X[ 6],  9);
+   GG(cc, dd, aa, bb, X[15],  7);
+   GG(bb, cc, dd, aa, X[ 3], 15);
+   GG(aa, bb, cc, dd, X[12],  7);
+   GG(dd, aa, bb, cc, X[ 0], 12);
+   GG(cc, dd, aa, bb, X[ 9], 15);
+   GG(bb, cc, dd, aa, X[ 5],  9);
+   GG(aa, bb, cc, dd, X[ 2], 11);
+   GG(dd, aa, bb, cc, X[14],  7);
+   GG(cc, dd, aa, bb, X[11], 13);
+   GG(bb, cc, dd, aa, X[ 8], 12);
+
+   /* round 3 */
+   HH(aa, bb, cc, dd, X[ 3], 11);
+   HH(dd, aa, bb, cc, X[10], 13);
+   HH(cc, dd, aa, bb, X[14],  6);
+   HH(bb, cc, dd, aa, X[ 4],  7);
+   HH(aa, bb, cc, dd, X[ 9], 14);
+   HH(dd, aa, bb, cc, X[15],  9);
+   HH(cc, dd, aa, bb, X[ 8], 13);
+   HH(bb, cc, dd, aa, X[ 1], 15);
+   HH(aa, bb, cc, dd, X[ 2], 14);
+   HH(dd, aa, bb, cc, X[ 7],  8);
+   HH(cc, dd, aa, bb, X[ 0], 13);
+   HH(bb, cc, dd, aa, X[ 6],  6);
+   HH(aa, bb, cc, dd, X[13],  5);
+   HH(dd, aa, bb, cc, X[11], 12);
+   HH(cc, dd, aa, bb, X[ 5],  7);
+   HH(bb, cc, dd, aa, X[12],  5);
+
+   /* round 4 */
+   II(aa, bb, cc, dd, X[ 1], 11);
+   II(dd, aa, bb, cc, X[ 9], 12);
+   II(cc, dd, aa, bb, X[11], 14);
+   II(bb, cc, dd, aa, X[10], 15);
+   II(aa, bb, cc, dd, X[ 0], 14);
+   II(dd, aa, bb, cc, X[ 8], 15);
+   II(cc, dd, aa, bb, X[12],  9);
+   II(bb, cc, dd, aa, X[ 4],  8);
+   II(aa, bb, cc, dd, X[13],  9);
+   II(dd, aa, bb, cc, X[ 3], 14);
+   II(cc, dd, aa, bb, X[ 7],  5);
+   II(bb, cc, dd, aa, X[15],  6);
+   II(aa, bb, cc, dd, X[14],  8);
+   II(dd, aa, bb, cc, X[ 5],  6);
+   II(cc, dd, aa, bb, X[ 6],  5);
+   II(bb, cc, dd, aa, X[ 2], 12);
+
+   /* parallel round 1 */
+   III(aaa, bbb, ccc, ddd, X[ 5],  8);
+   III(ddd, aaa, bbb, ccc, X[14],  9);
+   III(ccc, ddd, aaa, bbb, X[ 7],  9);
+   III(bbb, ccc, ddd, aaa, X[ 0], 11);
+   III(aaa, bbb, ccc, ddd, X[ 9], 13);
+   III(ddd, aaa, bbb, ccc, X[ 2], 15);
+   III(ccc, ddd, aaa, bbb, X[11], 15);
+   III(bbb, ccc, ddd, aaa, X[ 4],  5);
+   III(aaa, bbb, ccc, ddd, X[13],  7);
+   III(ddd, aaa, bbb, ccc, X[ 6],  7);
+   III(ccc, ddd, aaa, bbb, X[15],  8);
+   III(bbb, ccc, ddd, aaa, X[ 8], 11);
+   III(aaa, bbb, ccc, ddd, X[ 1], 14);
+   III(ddd, aaa, bbb, ccc, X[10], 14);
+   III(ccc, ddd, aaa, bbb, X[ 3], 12);
+   III(bbb, ccc, ddd, aaa, X[12],  6);
+
+   /* parallel round 2 */
+   HHH(aaa, bbb, ccc, ddd, X[ 6],  9);
+   HHH(ddd, aaa, bbb, ccc, X[11], 13);
+   HHH(ccc, ddd, aaa, bbb, X[ 3], 15);
+   HHH(bbb, ccc, ddd, aaa, X[ 7],  7);
+   HHH(aaa, bbb, ccc, ddd, X[ 0], 12);
+   HHH(ddd, aaa, bbb, ccc, X[13],  8);
+   HHH(ccc, ddd, aaa, bbb, X[ 5],  9);
+   HHH(bbb, ccc, ddd, aaa, X[10], 11);
+   HHH(aaa, bbb, ccc, ddd, X[14],  7);
+   HHH(ddd, aaa, bbb, ccc, X[15],  7);
+   HHH(ccc, ddd, aaa, bbb, X[ 8], 12);
+   HHH(bbb, ccc, ddd, aaa, X[12],  7);
+   HHH(aaa, bbb, ccc, ddd, X[ 4],  6);
+   HHH(ddd, aaa, bbb, ccc, X[ 9], 15);
+   HHH(ccc, ddd, aaa, bbb, X[ 1], 13);
+   HHH(bbb, ccc, ddd, aaa, X[ 2], 11);
+
+   /* parallel round 3 */
+   GGG(aaa, bbb, ccc, ddd, X[15],  9);
+   GGG(ddd, aaa, bbb, ccc, X[ 5],  7);
+   GGG(ccc, ddd, aaa, bbb, X[ 1], 15);
+   GGG(bbb, ccc, ddd, aaa, X[ 3], 11);
+   GGG(aaa, bbb, ccc, ddd, X[ 7],  8);
+   GGG(ddd, aaa, bbb, ccc, X[14],  6);
+   GGG(ccc, ddd, aaa, bbb, X[ 6],  6);
+   GGG(bbb, ccc, ddd, aaa, X[ 9], 14);
+   GGG(aaa, bbb, ccc, ddd, X[11], 12);
+   GGG(ddd, aaa, bbb, ccc, X[ 8], 13);
+   GGG(ccc, ddd, aaa, bbb, X[12],  5);
+   GGG(bbb, ccc, ddd, aaa, X[ 2], 14);
+   GGG(aaa, bbb, ccc, ddd, X[10], 13);
+   GGG(ddd, aaa, bbb, ccc, X[ 0], 13);
+   GGG(ccc, ddd, aaa, bbb, X[ 4],  7);
+   GGG(bbb, ccc, ddd, aaa, X[13],  5);
+
+   /* parallel round 4 */
+   FFF(aaa, bbb, ccc, ddd, X[ 8], 15);
+   FFF(ddd, aaa, bbb, ccc, X[ 6],  5);
+   FFF(ccc, ddd, aaa, bbb, X[ 4],  8);
+   FFF(bbb, ccc, ddd, aaa, X[ 1], 11);
+   FFF(aaa, bbb, ccc, ddd, X[ 3], 14);
+   FFF(ddd, aaa, bbb, ccc, X[11], 14);
+   FFF(ccc, ddd, aaa, bbb, X[15],  6);
+   FFF(bbb, ccc, ddd, aaa, X[ 0], 14);
+   FFF(aaa, bbb, ccc, ddd, X[ 5],  6);
+   FFF(ddd, aaa, bbb, ccc, X[12],  9);
+   FFF(ccc, ddd, aaa, bbb, X[ 2], 12);
+   FFF(bbb, ccc, ddd, aaa, X[13],  9);
+   FFF(aaa, bbb, ccc, ddd, X[ 9], 12);
+   FFF(ddd, aaa, bbb, ccc, X[ 7],  5);
+   FFF(ccc, ddd, aaa, bbb, X[10], 15);
+   FFF(bbb, ccc, ddd, aaa, X[14],  8);
+
+   /* combine results */
+   ddd += cc + md->rmd128.state[1];               /* final result for MDbuf[0] */
+   md->rmd128.state[1] = md->rmd128.state[2] + dd + aaa;
+   md->rmd128.state[2] = md->rmd128.state[3] + aa + bbb;
+   md->rmd128.state[3] = md->rmd128.state[0] + bb + ccc;
+   md->rmd128.state[0] = ddd;
+
+   return CRYPT_OK;
+}
+
+#ifdef LTC_CLEAN_STACK
+static int rmd128_compress(hash_state *md, const unsigned char *buf)
+{
+   int err;
+   err = _rmd128_compress(md, buf);
+   burn_stack(sizeof(ulong32) * 24 + sizeof(int));
+   return err;
+}
+#endif
+
+/**
+   Initialize the hash state
+   @param md   The hash state you wish to initialize
+   @return CRYPT_OK if successful
+*/
+int rmd128_init(hash_state * md)
+{
+   LTC_ARGCHK(md != NULL);
+   md->rmd128.state[0] = 0x67452301UL;
+   md->rmd128.state[1] = 0xefcdab89UL;
+   md->rmd128.state[2] = 0x98badcfeUL;
+   md->rmd128.state[3] = 0x10325476UL;
+   md->rmd128.curlen   = 0;
+   md->rmd128.length   = 0;
+   return CRYPT_OK;
+}
+
+/**
+   Process a block of memory though the hash
+   @param md     The hash state
+   @param in     The data to hash
+   @param inlen  The length of the data (octets)
+   @return CRYPT_OK if successful
+*/
+HASH_PROCESS(rmd128_process, rmd128_compress, rmd128, 64)
+
+/**
+   Terminate the hash to get the digest
+   @param md  The hash state
+   @param out [out] The destination of the hash (16 bytes)
+   @return CRYPT_OK if successful
+*/
+int rmd128_done(hash_state * md, unsigned char *out)
+{
+    int i;
+
+    LTC_ARGCHK(md  != NULL);
+    LTC_ARGCHK(out != NULL);
+
+    if (md->rmd128.curlen >= sizeof(md->rmd128.buf)) {
+       return CRYPT_INVALID_ARG;
+    }
+
+
+    /* increase the length of the message */
+    md->rmd128.length += md->rmd128.curlen * 8;
+
+    /* append the '1' bit */
+    md->rmd128.buf[md->rmd128.curlen++] = (unsigned char)0x80;
+
+    /* if the length is currently above 56 bytes we append zeros
+     * then compress.  Then we can fall back to padding zeros and length
+     * encoding like normal.
+     */
+    if (md->rmd128.curlen > 56) {
+        while (md->rmd128.curlen < 64) {
+            md->rmd128.buf[md->rmd128.curlen++] = (unsigned char)0;
+        }
+        rmd128_compress(md, md->rmd128.buf);
+        md->rmd128.curlen = 0;
+    }
+
+    /* pad upto 56 bytes of zeroes */
+    while (md->rmd128.curlen < 56) {
+        md->rmd128.buf[md->rmd128.curlen++] = (unsigned char)0;
+    }
+
+    /* store length */
+    STORE64L(md->rmd128.length, md->rmd128.buf+56);
+    rmd128_compress(md, md->rmd128.buf);
+
+    /* copy output */
+    for (i = 0; i < 4; i++) {
+        STORE32L(md->rmd128.state[i], out+(4*i));
+    }
+#ifdef LTC_CLEAN_STACK
+    zeromem(md, sizeof(hash_state));
+#endif
+   return CRYPT_OK;
+}
+
+/**
+  Self-test the hash
+  @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled
+*/
+int rmd128_test(void)
+{
+#ifndef LTC_TEST
+   return CRYPT_NOP;
+#else
+   static const struct {
+        const char *msg;
+        unsigned char hash[16];
+   } tests[] = {
+   { "",
+     { 0xcd, 0xf2, 0x62, 0x13, 0xa1, 0x50, 0xdc, 0x3e,
+       0xcb, 0x61, 0x0f, 0x18, 0xf6, 0xb3, 0x8b, 0x46 }
+   },
+   { "a",
+     { 0x86, 0xbe, 0x7a, 0xfa, 0x33, 0x9d, 0x0f, 0xc7,
+       0xcf, 0xc7, 0x85, 0xe7, 0x2f, 0x57, 0x8d, 0x33 }
+   },
+   { "abc",
+     { 0xc1, 0x4a, 0x12, 0x19, 0x9c, 0x66, 0xe4, 0xba,
+       0x84, 0x63, 0x6b, 0x0f, 0x69, 0x14, 0x4c, 0x77 }
+   },
+   { "message digest",
+     { 0x9e, 0x32, 0x7b, 0x3d, 0x6e, 0x52, 0x30, 0x62,
+       0xaf, 0xc1, 0x13, 0x2d, 0x7d, 0xf9, 0xd1, 0xb8 }
+   },
+   { "abcdefghijklmnopqrstuvwxyz",
+     { 0xfd, 0x2a, 0xa6, 0x07, 0xf7, 0x1d, 0xc8, 0xf5,
+       0x10, 0x71, 0x49, 0x22, 0xb3, 0x71, 0x83, 0x4e }
+   },
+   { "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789",
+     { 0xd1, 0xe9, 0x59, 0xeb, 0x17, 0x9c, 0x91, 0x1f,
+       0xae, 0xa4, 0x62, 0x4c, 0x60, 0xc5, 0xc7, 0x02 }
+   }
+   };
+
+   int i;
+   unsigned char tmp[16];
+   hash_state md;
+
+   for (i = 0; i < (int)(sizeof(tests)/sizeof(tests[0])); i++) {
+       rmd128_init(&md);
+       rmd128_process(&md, (unsigned char *)tests[i].msg, strlen(tests[i].msg));
+       rmd128_done(&md, tmp);
+       if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "RIPEMD128", i)) {
+          return CRYPT_FAIL_TESTVECTOR;
+       }
+   }
+   return CRYPT_OK;
+#endif
+}
+
+#endif
+
+
+/* ref:         HEAD -> develop */
+/* git commit:  a1f6312416ef6cd183ee62db58b640dc2d7ec1f4 */
+/* commit time: 2019-09-04 13:44:47 +0200 */

+ 465 - 0
libtomcrypt.mod/libtomcrypt/src/hashes/rmd160.c

@@ -0,0 +1,465 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ */
+#include "tomcrypt_private.h"
+
+/**
+   @file rmd160.c
+   RMD160 hash function
+*/
+
+/* Implementation of LTC_RIPEMD-160 based on the source by Antoon Bosselaers, ESAT-COSIC
+ *
+ * This source has been radically overhauled to be portable and work within
+ * the LibTomCrypt API by Tom St Denis
+ */
+
+#ifdef LTC_RIPEMD160
+
+const struct ltc_hash_descriptor rmd160_desc =
+{
+    "rmd160",
+    9,
+    20,
+    64,
+
+    /* OID */
+   { 1, 3, 36, 3, 2, 1,  },
+   6,
+
+    &rmd160_init,
+    &rmd160_process,
+    &rmd160_done,
+    &rmd160_test,
+    NULL
+};
+
+/* the five basic functions F(), G() and H() */
+#define F(x, y, z)        ((x) ^ (y) ^ (z))
+#define G(x, y, z)        (((x) & (y)) | (~(x) & (z)))
+#define H(x, y, z)        (((x) | ~(y)) ^ (z))
+#define I(x, y, z)        (((x) & (z)) | ((y) & ~(z)))
+#define J(x, y, z)        ((x) ^ ((y) | ~(z)))
+
+/* the ten basic operations FF() through III() */
+#define FF(a, b, c, d, e, x, s)        \
+      (a) += F((b), (c), (d)) + (x);\
+      (a) = ROLc((a), (s)) + (e);\
+      (c) = ROLc((c), 10);
+
+#define GG(a, b, c, d, e, x, s)        \
+      (a) += G((b), (c), (d)) + (x) + 0x5a827999UL;\
+      (a) = ROLc((a), (s)) + (e);\
+      (c) = ROLc((c), 10);
+
+#define HH(a, b, c, d, e, x, s)        \
+      (a) += H((b), (c), (d)) + (x) + 0x6ed9eba1UL;\
+      (a) = ROLc((a), (s)) + (e);\
+      (c) = ROLc((c), 10);
+
+#define II(a, b, c, d, e, x, s)        \
+      (a) += I((b), (c), (d)) + (x) + 0x8f1bbcdcUL;\
+      (a) = ROLc((a), (s)) + (e);\
+      (c) = ROLc((c), 10);
+
+#define JJ(a, b, c, d, e, x, s)        \
+      (a) += J((b), (c), (d)) + (x) + 0xa953fd4eUL;\
+      (a) = ROLc((a), (s)) + (e);\
+      (c) = ROLc((c), 10);
+
+#define FFF(a, b, c, d, e, x, s)        \
+      (a) += F((b), (c), (d)) + (x);\
+      (a) = ROLc((a), (s)) + (e);\
+      (c) = ROLc((c), 10);
+
+#define GGG(a, b, c, d, e, x, s)        \
+      (a) += G((b), (c), (d)) + (x) + 0x7a6d76e9UL;\
+      (a) = ROLc((a), (s)) + (e);\
+      (c) = ROLc((c), 10);
+
+#define HHH(a, b, c, d, e, x, s)        \
+      (a) += H((b), (c), (d)) + (x) + 0x6d703ef3UL;\
+      (a) = ROLc((a), (s)) + (e);\
+      (c) = ROLc((c), 10);
+
+#define III(a, b, c, d, e, x, s)        \
+      (a) += I((b), (c), (d)) + (x) + 0x5c4dd124UL;\
+      (a) = ROLc((a), (s)) + (e);\
+      (c) = ROLc((c), 10);
+
+#define JJJ(a, b, c, d, e, x, s)        \
+      (a) += J((b), (c), (d)) + (x) + 0x50a28be6UL;\
+      (a) = ROLc((a), (s)) + (e);\
+      (c) = ROLc((c), 10);
+
+
+#ifdef LTC_CLEAN_STACK
+static int _rmd160_compress(hash_state *md, const unsigned char *buf)
+#else
+static int  rmd160_compress(hash_state *md, const unsigned char *buf)
+#endif
+{
+   ulong32 aa,bb,cc,dd,ee,aaa,bbb,ccc,ddd,eee,X[16];
+   int i;
+
+   /* load words X */
+   for (i = 0; i < 16; i++){
+      LOAD32L(X[i], buf + (4 * i));
+   }
+
+   /* load state */
+   aa = aaa = md->rmd160.state[0];
+   bb = bbb = md->rmd160.state[1];
+   cc = ccc = md->rmd160.state[2];
+   dd = ddd = md->rmd160.state[3];
+   ee = eee = md->rmd160.state[4];
+
+   /* round 1 */
+   FF(aa, bb, cc, dd, ee, X[ 0], 11);
+   FF(ee, aa, bb, cc, dd, X[ 1], 14);
+   FF(dd, ee, aa, bb, cc, X[ 2], 15);
+   FF(cc, dd, ee, aa, bb, X[ 3], 12);
+   FF(bb, cc, dd, ee, aa, X[ 4],  5);
+   FF(aa, bb, cc, dd, ee, X[ 5],  8);
+   FF(ee, aa, bb, cc, dd, X[ 6],  7);
+   FF(dd, ee, aa, bb, cc, X[ 7],  9);
+   FF(cc, dd, ee, aa, bb, X[ 8], 11);
+   FF(bb, cc, dd, ee, aa, X[ 9], 13);
+   FF(aa, bb, cc, dd, ee, X[10], 14);
+   FF(ee, aa, bb, cc, dd, X[11], 15);
+   FF(dd, ee, aa, bb, cc, X[12],  6);
+   FF(cc, dd, ee, aa, bb, X[13],  7);
+   FF(bb, cc, dd, ee, aa, X[14],  9);
+   FF(aa, bb, cc, dd, ee, X[15],  8);
+
+   /* round 2 */
+   GG(ee, aa, bb, cc, dd, X[ 7],  7);
+   GG(dd, ee, aa, bb, cc, X[ 4],  6);
+   GG(cc, dd, ee, aa, bb, X[13],  8);
+   GG(bb, cc, dd, ee, aa, X[ 1], 13);
+   GG(aa, bb, cc, dd, ee, X[10], 11);
+   GG(ee, aa, bb, cc, dd, X[ 6],  9);
+   GG(dd, ee, aa, bb, cc, X[15],  7);
+   GG(cc, dd, ee, aa, bb, X[ 3], 15);
+   GG(bb, cc, dd, ee, aa, X[12],  7);
+   GG(aa, bb, cc, dd, ee, X[ 0], 12);
+   GG(ee, aa, bb, cc, dd, X[ 9], 15);
+   GG(dd, ee, aa, bb, cc, X[ 5],  9);
+   GG(cc, dd, ee, aa, bb, X[ 2], 11);
+   GG(bb, cc, dd, ee, aa, X[14],  7);
+   GG(aa, bb, cc, dd, ee, X[11], 13);
+   GG(ee, aa, bb, cc, dd, X[ 8], 12);
+
+   /* round 3 */
+   HH(dd, ee, aa, bb, cc, X[ 3], 11);
+   HH(cc, dd, ee, aa, bb, X[10], 13);
+   HH(bb, cc, dd, ee, aa, X[14],  6);
+   HH(aa, bb, cc, dd, ee, X[ 4],  7);
+   HH(ee, aa, bb, cc, dd, X[ 9], 14);
+   HH(dd, ee, aa, bb, cc, X[15],  9);
+   HH(cc, dd, ee, aa, bb, X[ 8], 13);
+   HH(bb, cc, dd, ee, aa, X[ 1], 15);
+   HH(aa, bb, cc, dd, ee, X[ 2], 14);
+   HH(ee, aa, bb, cc, dd, X[ 7],  8);
+   HH(dd, ee, aa, bb, cc, X[ 0], 13);
+   HH(cc, dd, ee, aa, bb, X[ 6],  6);
+   HH(bb, cc, dd, ee, aa, X[13],  5);
+   HH(aa, bb, cc, dd, ee, X[11], 12);
+   HH(ee, aa, bb, cc, dd, X[ 5],  7);
+   HH(dd, ee, aa, bb, cc, X[12],  5);
+
+   /* round 4 */
+   II(cc, dd, ee, aa, bb, X[ 1], 11);
+   II(bb, cc, dd, ee, aa, X[ 9], 12);
+   II(aa, bb, cc, dd, ee, X[11], 14);
+   II(ee, aa, bb, cc, dd, X[10], 15);
+   II(dd, ee, aa, bb, cc, X[ 0], 14);
+   II(cc, dd, ee, aa, bb, X[ 8], 15);
+   II(bb, cc, dd, ee, aa, X[12],  9);
+   II(aa, bb, cc, dd, ee, X[ 4],  8);
+   II(ee, aa, bb, cc, dd, X[13],  9);
+   II(dd, ee, aa, bb, cc, X[ 3], 14);
+   II(cc, dd, ee, aa, bb, X[ 7],  5);
+   II(bb, cc, dd, ee, aa, X[15],  6);
+   II(aa, bb, cc, dd, ee, X[14],  8);
+   II(ee, aa, bb, cc, dd, X[ 5],  6);
+   II(dd, ee, aa, bb, cc, X[ 6],  5);
+   II(cc, dd, ee, aa, bb, X[ 2], 12);
+
+   /* round 5 */
+   JJ(bb, cc, dd, ee, aa, X[ 4],  9);
+   JJ(aa, bb, cc, dd, ee, X[ 0], 15);
+   JJ(ee, aa, bb, cc, dd, X[ 5],  5);
+   JJ(dd, ee, aa, bb, cc, X[ 9], 11);
+   JJ(cc, dd, ee, aa, bb, X[ 7],  6);
+   JJ(bb, cc, dd, ee, aa, X[12],  8);
+   JJ(aa, bb, cc, dd, ee, X[ 2], 13);
+   JJ(ee, aa, bb, cc, dd, X[10], 12);
+   JJ(dd, ee, aa, bb, cc, X[14],  5);
+   JJ(cc, dd, ee, aa, bb, X[ 1], 12);
+   JJ(bb, cc, dd, ee, aa, X[ 3], 13);
+   JJ(aa, bb, cc, dd, ee, X[ 8], 14);
+   JJ(ee, aa, bb, cc, dd, X[11], 11);
+   JJ(dd, ee, aa, bb, cc, X[ 6],  8);
+   JJ(cc, dd, ee, aa, bb, X[15],  5);
+   JJ(bb, cc, dd, ee, aa, X[13],  6);
+
+   /* parallel round 1 */
+   JJJ(aaa, bbb, ccc, ddd, eee, X[ 5],  8);
+   JJJ(eee, aaa, bbb, ccc, ddd, X[14],  9);
+   JJJ(ddd, eee, aaa, bbb, ccc, X[ 7],  9);
+   JJJ(ccc, ddd, eee, aaa, bbb, X[ 0], 11);
+   JJJ(bbb, ccc, ddd, eee, aaa, X[ 9], 13);
+   JJJ(aaa, bbb, ccc, ddd, eee, X[ 2], 15);
+   JJJ(eee, aaa, bbb, ccc, ddd, X[11], 15);
+   JJJ(ddd, eee, aaa, bbb, ccc, X[ 4],  5);
+   JJJ(ccc, ddd, eee, aaa, bbb, X[13],  7);
+   JJJ(bbb, ccc, ddd, eee, aaa, X[ 6],  7);
+   JJJ(aaa, bbb, ccc, ddd, eee, X[15],  8);
+   JJJ(eee, aaa, bbb, ccc, ddd, X[ 8], 11);
+   JJJ(ddd, eee, aaa, bbb, ccc, X[ 1], 14);
+   JJJ(ccc, ddd, eee, aaa, bbb, X[10], 14);
+   JJJ(bbb, ccc, ddd, eee, aaa, X[ 3], 12);
+   JJJ(aaa, bbb, ccc, ddd, eee, X[12],  6);
+
+   /* parallel round 2 */
+   III(eee, aaa, bbb, ccc, ddd, X[ 6],  9);
+   III(ddd, eee, aaa, bbb, ccc, X[11], 13);
+   III(ccc, ddd, eee, aaa, bbb, X[ 3], 15);
+   III(bbb, ccc, ddd, eee, aaa, X[ 7],  7);
+   III(aaa, bbb, ccc, ddd, eee, X[ 0], 12);
+   III(eee, aaa, bbb, ccc, ddd, X[13],  8);
+   III(ddd, eee, aaa, bbb, ccc, X[ 5],  9);
+   III(ccc, ddd, eee, aaa, bbb, X[10], 11);
+   III(bbb, ccc, ddd, eee, aaa, X[14],  7);
+   III(aaa, bbb, ccc, ddd, eee, X[15],  7);
+   III(eee, aaa, bbb, ccc, ddd, X[ 8], 12);
+   III(ddd, eee, aaa, bbb, ccc, X[12],  7);
+   III(ccc, ddd, eee, aaa, bbb, X[ 4],  6);
+   III(bbb, ccc, ddd, eee, aaa, X[ 9], 15);
+   III(aaa, bbb, ccc, ddd, eee, X[ 1], 13);
+   III(eee, aaa, bbb, ccc, ddd, X[ 2], 11);
+
+   /* parallel round 3 */
+   HHH(ddd, eee, aaa, bbb, ccc, X[15],  9);
+   HHH(ccc, ddd, eee, aaa, bbb, X[ 5],  7);
+   HHH(bbb, ccc, ddd, eee, aaa, X[ 1], 15);
+   HHH(aaa, bbb, ccc, ddd, eee, X[ 3], 11);
+   HHH(eee, aaa, bbb, ccc, ddd, X[ 7],  8);
+   HHH(ddd, eee, aaa, bbb, ccc, X[14],  6);
+   HHH(ccc, ddd, eee, aaa, bbb, X[ 6],  6);
+   HHH(bbb, ccc, ddd, eee, aaa, X[ 9], 14);
+   HHH(aaa, bbb, ccc, ddd, eee, X[11], 12);
+   HHH(eee, aaa, bbb, ccc, ddd, X[ 8], 13);
+   HHH(ddd, eee, aaa, bbb, ccc, X[12],  5);
+   HHH(ccc, ddd, eee, aaa, bbb, X[ 2], 14);
+   HHH(bbb, ccc, ddd, eee, aaa, X[10], 13);
+   HHH(aaa, bbb, ccc, ddd, eee, X[ 0], 13);
+   HHH(eee, aaa, bbb, ccc, ddd, X[ 4],  7);
+   HHH(ddd, eee, aaa, bbb, ccc, X[13],  5);
+
+   /* parallel round 4 */
+   GGG(ccc, ddd, eee, aaa, bbb, X[ 8], 15);
+   GGG(bbb, ccc, ddd, eee, aaa, X[ 6],  5);
+   GGG(aaa, bbb, ccc, ddd, eee, X[ 4],  8);
+   GGG(eee, aaa, bbb, ccc, ddd, X[ 1], 11);
+   GGG(ddd, eee, aaa, bbb, ccc, X[ 3], 14);
+   GGG(ccc, ddd, eee, aaa, bbb, X[11], 14);
+   GGG(bbb, ccc, ddd, eee, aaa, X[15],  6);
+   GGG(aaa, bbb, ccc, ddd, eee, X[ 0], 14);
+   GGG(eee, aaa, bbb, ccc, ddd, X[ 5],  6);
+   GGG(ddd, eee, aaa, bbb, ccc, X[12],  9);
+   GGG(ccc, ddd, eee, aaa, bbb, X[ 2], 12);
+   GGG(bbb, ccc, ddd, eee, aaa, X[13],  9);
+   GGG(aaa, bbb, ccc, ddd, eee, X[ 9], 12);
+   GGG(eee, aaa, bbb, ccc, ddd, X[ 7],  5);
+   GGG(ddd, eee, aaa, bbb, ccc, X[10], 15);
+   GGG(ccc, ddd, eee, aaa, bbb, X[14],  8);
+
+   /* parallel round 5 */
+   FFF(bbb, ccc, ddd, eee, aaa, X[12] ,  8);
+   FFF(aaa, bbb, ccc, ddd, eee, X[15] ,  5);
+   FFF(eee, aaa, bbb, ccc, ddd, X[10] , 12);
+   FFF(ddd, eee, aaa, bbb, ccc, X[ 4] ,  9);
+   FFF(ccc, ddd, eee, aaa, bbb, X[ 1] , 12);
+   FFF(bbb, ccc, ddd, eee, aaa, X[ 5] ,  5);
+   FFF(aaa, bbb, ccc, ddd, eee, X[ 8] , 14);
+   FFF(eee, aaa, bbb, ccc, ddd, X[ 7] ,  6);
+   FFF(ddd, eee, aaa, bbb, ccc, X[ 6] ,  8);
+   FFF(ccc, ddd, eee, aaa, bbb, X[ 2] , 13);
+   FFF(bbb, ccc, ddd, eee, aaa, X[13] ,  6);
+   FFF(aaa, bbb, ccc, ddd, eee, X[14] ,  5);
+   FFF(eee, aaa, bbb, ccc, ddd, X[ 0] , 15);
+   FFF(ddd, eee, aaa, bbb, ccc, X[ 3] , 13);
+   FFF(ccc, ddd, eee, aaa, bbb, X[ 9] , 11);
+   FFF(bbb, ccc, ddd, eee, aaa, X[11] , 11);
+
+   /* combine results */
+   ddd += cc + md->rmd160.state[1];               /* final result for md->rmd160.state[0] */
+   md->rmd160.state[1] = md->rmd160.state[2] + dd + eee;
+   md->rmd160.state[2] = md->rmd160.state[3] + ee + aaa;
+   md->rmd160.state[3] = md->rmd160.state[4] + aa + bbb;
+   md->rmd160.state[4] = md->rmd160.state[0] + bb + ccc;
+   md->rmd160.state[0] = ddd;
+
+   return CRYPT_OK;
+}
+
+#ifdef LTC_CLEAN_STACK
+static int rmd160_compress(hash_state *md, const unsigned char *buf)
+{
+   int err;
+   err = _rmd160_compress(md, buf);
+   burn_stack(sizeof(ulong32) * 26 + sizeof(int));
+   return err;
+}
+#endif
+
+/**
+   Initialize the hash state
+   @param md   The hash state you wish to initialize
+   @return CRYPT_OK if successful
+*/
+int rmd160_init(hash_state * md)
+{
+   LTC_ARGCHK(md != NULL);
+   md->rmd160.state[0] = 0x67452301UL;
+   md->rmd160.state[1] = 0xefcdab89UL;
+   md->rmd160.state[2] = 0x98badcfeUL;
+   md->rmd160.state[3] = 0x10325476UL;
+   md->rmd160.state[4] = 0xc3d2e1f0UL;
+   md->rmd160.curlen   = 0;
+   md->rmd160.length   = 0;
+   return CRYPT_OK;
+}
+
+/**
+   Process a block of memory though the hash
+   @param md     The hash state
+   @param in     The data to hash
+   @param inlen  The length of the data (octets)
+   @return CRYPT_OK if successful
+*/
+HASH_PROCESS(rmd160_process, rmd160_compress, rmd160, 64)
+
+/**
+   Terminate the hash to get the digest
+   @param md  The hash state
+   @param out [out] The destination of the hash (20 bytes)
+   @return CRYPT_OK if successful
+*/
+int rmd160_done(hash_state * md, unsigned char *out)
+{
+    int i;
+
+    LTC_ARGCHK(md  != NULL);
+    LTC_ARGCHK(out != NULL);
+
+    if (md->rmd160.curlen >= sizeof(md->rmd160.buf)) {
+       return CRYPT_INVALID_ARG;
+    }
+
+
+    /* increase the length of the message */
+    md->rmd160.length += md->rmd160.curlen * 8;
+
+    /* append the '1' bit */
+    md->rmd160.buf[md->rmd160.curlen++] = (unsigned char)0x80;
+
+    /* if the length is currently above 56 bytes we append zeros
+     * then compress.  Then we can fall back to padding zeros and length
+     * encoding like normal.
+     */
+    if (md->rmd160.curlen > 56) {
+        while (md->rmd160.curlen < 64) {
+            md->rmd160.buf[md->rmd160.curlen++] = (unsigned char)0;
+        }
+        rmd160_compress(md, md->rmd160.buf);
+        md->rmd160.curlen = 0;
+    }
+
+    /* pad upto 56 bytes of zeroes */
+    while (md->rmd160.curlen < 56) {
+        md->rmd160.buf[md->rmd160.curlen++] = (unsigned char)0;
+    }
+
+    /* store length */
+    STORE64L(md->rmd160.length, md->rmd160.buf+56);
+    rmd160_compress(md, md->rmd160.buf);
+
+    /* copy output */
+    for (i = 0; i < 5; i++) {
+        STORE32L(md->rmd160.state[i], out+(4*i));
+    }
+#ifdef LTC_CLEAN_STACK
+    zeromem(md, sizeof(hash_state));
+#endif
+    return CRYPT_OK;
+}
+
+/**
+  Self-test the hash
+  @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled
+*/
+int rmd160_test(void)
+{
+#ifndef LTC_TEST
+   return CRYPT_NOP;
+#else
+   static const struct {
+        const char *msg;
+        unsigned char hash[20];
+   } tests[] = {
+   { "",
+     { 0x9c, 0x11, 0x85, 0xa5, 0xc5, 0xe9, 0xfc, 0x54, 0x61, 0x28,
+       0x08, 0x97, 0x7e, 0xe8, 0xf5, 0x48, 0xb2, 0x25, 0x8d, 0x31 }
+   },
+   { "a",
+     { 0x0b, 0xdc, 0x9d, 0x2d, 0x25, 0x6b, 0x3e, 0xe9, 0xda, 0xae,
+       0x34, 0x7b, 0xe6, 0xf4, 0xdc, 0x83, 0x5a, 0x46, 0x7f, 0xfe }
+   },
+   { "abc",
+     { 0x8e, 0xb2, 0x08, 0xf7, 0xe0, 0x5d, 0x98, 0x7a, 0x9b, 0x04,
+       0x4a, 0x8e, 0x98, 0xc6, 0xb0, 0x87, 0xf1, 0x5a, 0x0b, 0xfc }
+   },
+   { "message digest",
+     { 0x5d, 0x06, 0x89, 0xef, 0x49, 0xd2, 0xfa, 0xe5, 0x72, 0xb8,
+       0x81, 0xb1, 0x23, 0xa8, 0x5f, 0xfa, 0x21, 0x59, 0x5f, 0x36 }
+   },
+   { "abcdefghijklmnopqrstuvwxyz",
+     { 0xf7, 0x1c, 0x27, 0x10, 0x9c, 0x69, 0x2c, 0x1b, 0x56, 0xbb,
+       0xdc, 0xeb, 0x5b, 0x9d, 0x28, 0x65, 0xb3, 0x70, 0x8d, 0xbc }
+   },
+   { "abcdbcdecdefdefgefghfghighijhijkijkljklmklmnlmnomnopnopq",
+     { 0x12, 0xa0, 0x53, 0x38, 0x4a, 0x9c, 0x0c, 0x88, 0xe4, 0x05,
+       0xa0, 0x6c, 0x27, 0xdc, 0xf4, 0x9a, 0xda, 0x62, 0xeb, 0x2b }
+   }
+   };
+
+   int i;
+   unsigned char tmp[20];
+   hash_state md;
+
+   for (i = 0; i < (int)(sizeof(tests)/sizeof(tests[0])); i++) {
+       rmd160_init(&md);
+       rmd160_process(&md, (unsigned char *)tests[i].msg, strlen(tests[i].msg));
+       rmd160_done(&md, tmp);
+       if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "RIPEMD160", i)) {
+          return CRYPT_FAIL_TESTVECTOR;
+       }
+   }
+   return CRYPT_OK;
+#endif
+}
+
+#endif
+
+
+/* ref:         HEAD -> develop */
+/* git commit:  a1f6312416ef6cd183ee62db58b640dc2d7ec1f4 */
+/* commit time: 2019-09-04 13:44:47 +0200 */

+ 430 - 0
libtomcrypt.mod/libtomcrypt/src/hashes/rmd256.c

@@ -0,0 +1,430 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ */
+#include "tomcrypt_private.h"
+
+/**
+   @param rmd256.c
+   RLTC_MD256 Hash function
+*/
+
+#ifdef LTC_RIPEMD256
+
+const struct ltc_hash_descriptor rmd256_desc =
+{
+    "rmd256",
+    13,
+    32,
+    64,
+
+    /* OID */
+   { 1, 3, 36, 3, 2, 3 },
+   6,
+
+    &rmd256_init,
+    &rmd256_process,
+    &rmd256_done,
+    &rmd256_test,
+    NULL
+};
+
+/* the four basic functions F(), G() and H() */
+#define F(x, y, z)        ((x) ^ (y) ^ (z))
+#define G(x, y, z)        (((x) & (y)) | (~(x) & (z)))
+#define H(x, y, z)        (((x) | ~(y)) ^ (z))
+#define I(x, y, z)        (((x) & (z)) | ((y) & ~(z)))
+
+/* the eight basic operations FF() through III() */
+#define FF(a, b, c, d, x, s)        \
+      (a) += F((b), (c), (d)) + (x);\
+      (a) = ROLc((a), (s));
+
+#define GG(a, b, c, d, x, s)        \
+      (a) += G((b), (c), (d)) + (x) + 0x5a827999UL;\
+      (a) = ROLc((a), (s));
+
+#define HH(a, b, c, d, x, s)        \
+      (a) += H((b), (c), (d)) + (x) + 0x6ed9eba1UL;\
+      (a) = ROLc((a), (s));
+
+#define II(a, b, c, d, x, s)        \
+      (a) += I((b), (c), (d)) + (x) + 0x8f1bbcdcUL;\
+      (a) = ROLc((a), (s));
+
+#define FFF(a, b, c, d, x, s)        \
+      (a) += F((b), (c), (d)) + (x);\
+      (a) = ROLc((a), (s));
+
+#define GGG(a, b, c, d, x, s)        \
+      (a) += G((b), (c), (d)) + (x) + 0x6d703ef3UL;\
+      (a) = ROLc((a), (s));
+
+#define HHH(a, b, c, d, x, s)        \
+      (a) += H((b), (c), (d)) + (x) + 0x5c4dd124UL;\
+      (a) = ROLc((a), (s));
+
+#define III(a, b, c, d, x, s)        \
+      (a) += I((b), (c), (d)) + (x) + 0x50a28be6UL;\
+      (a) = ROLc((a), (s));
+
+#ifdef LTC_CLEAN_STACK
+static int _rmd256_compress(hash_state *md, const unsigned char *buf)
+#else
+static int  rmd256_compress(hash_state *md, const unsigned char *buf)
+#endif
+{
+   ulong32 aa,bb,cc,dd,aaa,bbb,ccc,ddd,tmp,X[16];
+   int i;
+
+   /* load words X */
+   for (i = 0; i < 16; i++){
+      LOAD32L(X[i], buf + (4 * i));
+   }
+
+   /* load state */
+   aa = md->rmd256.state[0];
+   bb = md->rmd256.state[1];
+   cc = md->rmd256.state[2];
+   dd = md->rmd256.state[3];
+   aaa = md->rmd256.state[4];
+   bbb = md->rmd256.state[5];
+   ccc = md->rmd256.state[6];
+   ddd = md->rmd256.state[7];
+
+   /* round 1 */
+   FF(aa, bb, cc, dd, X[ 0], 11);
+   FF(dd, aa, bb, cc, X[ 1], 14);
+   FF(cc, dd, aa, bb, X[ 2], 15);
+   FF(bb, cc, dd, aa, X[ 3], 12);
+   FF(aa, bb, cc, dd, X[ 4],  5);
+   FF(dd, aa, bb, cc, X[ 5],  8);
+   FF(cc, dd, aa, bb, X[ 6],  7);
+   FF(bb, cc, dd, aa, X[ 7],  9);
+   FF(aa, bb, cc, dd, X[ 8], 11);
+   FF(dd, aa, bb, cc, X[ 9], 13);
+   FF(cc, dd, aa, bb, X[10], 14);
+   FF(bb, cc, dd, aa, X[11], 15);
+   FF(aa, bb, cc, dd, X[12],  6);
+   FF(dd, aa, bb, cc, X[13],  7);
+   FF(cc, dd, aa, bb, X[14],  9);
+   FF(bb, cc, dd, aa, X[15],  8);
+
+   /* parallel round 1 */
+   III(aaa, bbb, ccc, ddd, X[ 5],  8);
+   III(ddd, aaa, bbb, ccc, X[14],  9);
+   III(ccc, ddd, aaa, bbb, X[ 7],  9);
+   III(bbb, ccc, ddd, aaa, X[ 0], 11);
+   III(aaa, bbb, ccc, ddd, X[ 9], 13);
+   III(ddd, aaa, bbb, ccc, X[ 2], 15);
+   III(ccc, ddd, aaa, bbb, X[11], 15);
+   III(bbb, ccc, ddd, aaa, X[ 4],  5);
+   III(aaa, bbb, ccc, ddd, X[13],  7);
+   III(ddd, aaa, bbb, ccc, X[ 6],  7);
+   III(ccc, ddd, aaa, bbb, X[15],  8);
+   III(bbb, ccc, ddd, aaa, X[ 8], 11);
+   III(aaa, bbb, ccc, ddd, X[ 1], 14);
+   III(ddd, aaa, bbb, ccc, X[10], 14);
+   III(ccc, ddd, aaa, bbb, X[ 3], 12);
+   III(bbb, ccc, ddd, aaa, X[12],  6);
+
+   tmp = aa; aa = aaa; aaa = tmp;
+
+   /* round 2 */
+   GG(aa, bb, cc, dd, X[ 7],  7);
+   GG(dd, aa, bb, cc, X[ 4],  6);
+   GG(cc, dd, aa, bb, X[13],  8);
+   GG(bb, cc, dd, aa, X[ 1], 13);
+   GG(aa, bb, cc, dd, X[10], 11);
+   GG(dd, aa, bb, cc, X[ 6],  9);
+   GG(cc, dd, aa, bb, X[15],  7);
+   GG(bb, cc, dd, aa, X[ 3], 15);
+   GG(aa, bb, cc, dd, X[12],  7);
+   GG(dd, aa, bb, cc, X[ 0], 12);
+   GG(cc, dd, aa, bb, X[ 9], 15);
+   GG(bb, cc, dd, aa, X[ 5],  9);
+   GG(aa, bb, cc, dd, X[ 2], 11);
+   GG(dd, aa, bb, cc, X[14],  7);
+   GG(cc, dd, aa, bb, X[11], 13);
+   GG(bb, cc, dd, aa, X[ 8], 12);
+
+   /* parallel round 2 */
+   HHH(aaa, bbb, ccc, ddd, X[ 6],  9);
+   HHH(ddd, aaa, bbb, ccc, X[11], 13);
+   HHH(ccc, ddd, aaa, bbb, X[ 3], 15);
+   HHH(bbb, ccc, ddd, aaa, X[ 7],  7);
+   HHH(aaa, bbb, ccc, ddd, X[ 0], 12);
+   HHH(ddd, aaa, bbb, ccc, X[13],  8);
+   HHH(ccc, ddd, aaa, bbb, X[ 5],  9);
+   HHH(bbb, ccc, ddd, aaa, X[10], 11);
+   HHH(aaa, bbb, ccc, ddd, X[14],  7);
+   HHH(ddd, aaa, bbb, ccc, X[15],  7);
+   HHH(ccc, ddd, aaa, bbb, X[ 8], 12);
+   HHH(bbb, ccc, ddd, aaa, X[12],  7);
+   HHH(aaa, bbb, ccc, ddd, X[ 4],  6);
+   HHH(ddd, aaa, bbb, ccc, X[ 9], 15);
+   HHH(ccc, ddd, aaa, bbb, X[ 1], 13);
+   HHH(bbb, ccc, ddd, aaa, X[ 2], 11);
+
+   tmp = bb; bb = bbb; bbb = tmp;
+
+   /* round 3 */
+   HH(aa, bb, cc, dd, X[ 3], 11);
+   HH(dd, aa, bb, cc, X[10], 13);
+   HH(cc, dd, aa, bb, X[14],  6);
+   HH(bb, cc, dd, aa, X[ 4],  7);
+   HH(aa, bb, cc, dd, X[ 9], 14);
+   HH(dd, aa, bb, cc, X[15],  9);
+   HH(cc, dd, aa, bb, X[ 8], 13);
+   HH(bb, cc, dd, aa, X[ 1], 15);
+   HH(aa, bb, cc, dd, X[ 2], 14);
+   HH(dd, aa, bb, cc, X[ 7],  8);
+   HH(cc, dd, aa, bb, X[ 0], 13);
+   HH(bb, cc, dd, aa, X[ 6],  6);
+   HH(aa, bb, cc, dd, X[13],  5);
+   HH(dd, aa, bb, cc, X[11], 12);
+   HH(cc, dd, aa, bb, X[ 5],  7);
+   HH(bb, cc, dd, aa, X[12],  5);
+
+   /* parallel round 3 */
+   GGG(aaa, bbb, ccc, ddd, X[15],  9);
+   GGG(ddd, aaa, bbb, ccc, X[ 5],  7);
+   GGG(ccc, ddd, aaa, bbb, X[ 1], 15);
+   GGG(bbb, ccc, ddd, aaa, X[ 3], 11);
+   GGG(aaa, bbb, ccc, ddd, X[ 7],  8);
+   GGG(ddd, aaa, bbb, ccc, X[14],  6);
+   GGG(ccc, ddd, aaa, bbb, X[ 6],  6);
+   GGG(bbb, ccc, ddd, aaa, X[ 9], 14);
+   GGG(aaa, bbb, ccc, ddd, X[11], 12);
+   GGG(ddd, aaa, bbb, ccc, X[ 8], 13);
+   GGG(ccc, ddd, aaa, bbb, X[12],  5);
+   GGG(bbb, ccc, ddd, aaa, X[ 2], 14);
+   GGG(aaa, bbb, ccc, ddd, X[10], 13);
+   GGG(ddd, aaa, bbb, ccc, X[ 0], 13);
+   GGG(ccc, ddd, aaa, bbb, X[ 4],  7);
+   GGG(bbb, ccc, ddd, aaa, X[13],  5);
+
+   tmp = cc; cc = ccc; ccc = tmp;
+
+   /* round 4 */
+   II(aa, bb, cc, dd, X[ 1], 11);
+   II(dd, aa, bb, cc, X[ 9], 12);
+   II(cc, dd, aa, bb, X[11], 14);
+   II(bb, cc, dd, aa, X[10], 15);
+   II(aa, bb, cc, dd, X[ 0], 14);
+   II(dd, aa, bb, cc, X[ 8], 15);
+   II(cc, dd, aa, bb, X[12],  9);
+   II(bb, cc, dd, aa, X[ 4],  8);
+   II(aa, bb, cc, dd, X[13],  9);
+   II(dd, aa, bb, cc, X[ 3], 14);
+   II(cc, dd, aa, bb, X[ 7],  5);
+   II(bb, cc, dd, aa, X[15],  6);
+   II(aa, bb, cc, dd, X[14],  8);
+   II(dd, aa, bb, cc, X[ 5],  6);
+   II(cc, dd, aa, bb, X[ 6],  5);
+   II(bb, cc, dd, aa, X[ 2], 12);
+
+   /* parallel round 4 */
+   FFF(aaa, bbb, ccc, ddd, X[ 8], 15);
+   FFF(ddd, aaa, bbb, ccc, X[ 6],  5);
+   FFF(ccc, ddd, aaa, bbb, X[ 4],  8);
+   FFF(bbb, ccc, ddd, aaa, X[ 1], 11);
+   FFF(aaa, bbb, ccc, ddd, X[ 3], 14);
+   FFF(ddd, aaa, bbb, ccc, X[11], 14);
+   FFF(ccc, ddd, aaa, bbb, X[15],  6);
+   FFF(bbb, ccc, ddd, aaa, X[ 0], 14);
+   FFF(aaa, bbb, ccc, ddd, X[ 5],  6);
+   FFF(ddd, aaa, bbb, ccc, X[12],  9);
+   FFF(ccc, ddd, aaa, bbb, X[ 2], 12);
+   FFF(bbb, ccc, ddd, aaa, X[13],  9);
+   FFF(aaa, bbb, ccc, ddd, X[ 9], 12);
+   FFF(ddd, aaa, bbb, ccc, X[ 7],  5);
+   FFF(ccc, ddd, aaa, bbb, X[10], 15);
+   FFF(bbb, ccc, ddd, aaa, X[14],  8);
+
+   tmp = dd; dd = ddd; ddd = tmp;
+
+   /* combine results */
+   md->rmd256.state[0] += aa;
+   md->rmd256.state[1] += bb;
+   md->rmd256.state[2] += cc;
+   md->rmd256.state[3] += dd;
+   md->rmd256.state[4] += aaa;
+   md->rmd256.state[5] += bbb;
+   md->rmd256.state[6] += ccc;
+   md->rmd256.state[7] += ddd;
+
+   return CRYPT_OK;
+}
+
+#ifdef LTC_CLEAN_STACK
+static int rmd256_compress(hash_state *md, const unsigned char *buf)
+{
+   int err;
+   err = _rmd256_compress(md, buf);
+   burn_stack(sizeof(ulong32) * 25 + sizeof(int));
+   return err;
+}
+#endif
+
+/**
+   Initialize the hash state
+   @param md   The hash state you wish to initialize
+   @return CRYPT_OK if successful
+*/
+int rmd256_init(hash_state * md)
+{
+   LTC_ARGCHK(md != NULL);
+   md->rmd256.state[0] = 0x67452301UL;
+   md->rmd256.state[1] = 0xefcdab89UL;
+   md->rmd256.state[2] = 0x98badcfeUL;
+   md->rmd256.state[3] = 0x10325476UL;
+   md->rmd256.state[4] = 0x76543210UL;
+   md->rmd256.state[5] = 0xfedcba98UL;
+   md->rmd256.state[6] = 0x89abcdefUL;
+   md->rmd256.state[7] = 0x01234567UL;
+   md->rmd256.curlen   = 0;
+   md->rmd256.length   = 0;
+   return CRYPT_OK;
+}
+
+/**
+   Process a block of memory though the hash
+   @param md     The hash state
+   @param in     The data to hash
+   @param inlen  The length of the data (octets)
+   @return CRYPT_OK if successful
+*/
+HASH_PROCESS(rmd256_process, rmd256_compress, rmd256, 64)
+
+/**
+   Terminate the hash to get the digest
+   @param md  The hash state
+   @param out [out] The destination of the hash (16 bytes)
+   @return CRYPT_OK if successful
+*/
+int rmd256_done(hash_state * md, unsigned char *out)
+{
+    int i;
+
+    LTC_ARGCHK(md  != NULL);
+    LTC_ARGCHK(out != NULL);
+
+    if (md->rmd256.curlen >= sizeof(md->rmd256.buf)) {
+       return CRYPT_INVALID_ARG;
+    }
+
+
+    /* increase the length of the message */
+    md->rmd256.length += md->rmd256.curlen * 8;
+
+    /* append the '1' bit */
+    md->rmd256.buf[md->rmd256.curlen++] = (unsigned char)0x80;
+
+    /* if the length is currently above 56 bytes we append zeros
+     * then compress.  Then we can fall back to padding zeros and length
+     * encoding like normal.
+     */
+    if (md->rmd256.curlen > 56) {
+        while (md->rmd256.curlen < 64) {
+            md->rmd256.buf[md->rmd256.curlen++] = (unsigned char)0;
+        }
+        rmd256_compress(md, md->rmd256.buf);
+        md->rmd256.curlen = 0;
+    }
+
+    /* pad upto 56 bytes of zeroes */
+    while (md->rmd256.curlen < 56) {
+        md->rmd256.buf[md->rmd256.curlen++] = (unsigned char)0;
+    }
+
+    /* store length */
+    STORE64L(md->rmd256.length, md->rmd256.buf+56);
+    rmd256_compress(md, md->rmd256.buf);
+
+    /* copy output */
+    for (i = 0; i < 8; i++) {
+        STORE32L(md->rmd256.state[i], out+(4*i));
+    }
+#ifdef LTC_CLEAN_STACK
+    zeromem(md, sizeof(hash_state));
+#endif
+   return CRYPT_OK;
+}
+
+/**
+  Self-test the hash
+  @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled
+*/
+int rmd256_test(void)
+{
+#ifndef LTC_TEST
+   return CRYPT_NOP;
+#else
+   static const struct {
+        const char *msg;
+        unsigned char hash[32];
+   } tests[] = {
+   { "",
+     { 0x02, 0xba, 0x4c, 0x4e, 0x5f, 0x8e, 0xcd, 0x18,
+       0x77, 0xfc, 0x52, 0xd6, 0x4d, 0x30, 0xe3, 0x7a,
+       0x2d, 0x97, 0x74, 0xfb, 0x1e, 0x5d, 0x02, 0x63,
+       0x80, 0xae, 0x01, 0x68, 0xe3, 0xc5, 0x52, 0x2d }
+   },
+   { "a",
+     { 0xf9, 0x33, 0x3e, 0x45, 0xd8, 0x57, 0xf5, 0xd9,
+       0x0a, 0x91, 0xba, 0xb7, 0x0a, 0x1e, 0xba, 0x0c,
+       0xfb, 0x1b, 0xe4, 0xb0, 0x78, 0x3c, 0x9a, 0xcf,
+       0xcd, 0x88, 0x3a, 0x91, 0x34, 0x69, 0x29, 0x25 }
+   },
+   { "abc",
+     { 0xaf, 0xbd, 0x6e, 0x22, 0x8b, 0x9d, 0x8c, 0xbb,
+       0xce, 0xf5, 0xca, 0x2d, 0x03, 0xe6, 0xdb, 0xa1,
+       0x0a, 0xc0, 0xbc, 0x7d, 0xcb, 0xe4, 0x68, 0x0e,
+       0x1e, 0x42, 0xd2, 0xe9, 0x75, 0x45, 0x9b, 0x65 }
+   },
+   { "message digest",
+     { 0x87, 0xe9, 0x71, 0x75, 0x9a, 0x1c, 0xe4, 0x7a,
+       0x51, 0x4d, 0x5c, 0x91, 0x4c, 0x39, 0x2c, 0x90,
+       0x18, 0xc7, 0xc4, 0x6b, 0xc1, 0x44, 0x65, 0x55,
+       0x4a, 0xfc, 0xdf, 0x54, 0xa5, 0x07, 0x0c, 0x0e }
+   },
+   { "abcdefghijklmnopqrstuvwxyz",
+     { 0x64, 0x9d, 0x30, 0x34, 0x75, 0x1e, 0xa2, 0x16,
+       0x77, 0x6b, 0xf9, 0xa1, 0x8a, 0xcc, 0x81, 0xbc,
+       0x78, 0x96, 0x11, 0x8a, 0x51, 0x97, 0x96, 0x87,
+       0x82, 0xdd, 0x1f, 0xd9, 0x7d, 0x8d, 0x51, 0x33 }
+   },
+   { "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789",
+     { 0x57, 0x40, 0xa4, 0x08, 0xac, 0x16, 0xb7, 0x20,
+       0xb8, 0x44, 0x24, 0xae, 0x93, 0x1c, 0xbb, 0x1f,
+       0xe3, 0x63, 0xd1, 0xd0, 0xbf, 0x40, 0x17, 0xf1,
+       0xa8, 0x9f, 0x7e, 0xa6, 0xde, 0x77, 0xa0, 0xb8 }
+   }
+   };
+
+   int i;
+   unsigned char tmp[32];
+   hash_state md;
+
+   for (i = 0; i < (int)(sizeof(tests)/sizeof(tests[0])); i++) {
+       rmd256_init(&md);
+       rmd256_process(&md, (unsigned char *)tests[i].msg, strlen(tests[i].msg));
+       rmd256_done(&md, tmp);
+       if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "RIPEMD256", i)) {
+          return CRYPT_FAIL_TESTVECTOR;
+       }
+   }
+   return CRYPT_OK;
+#endif
+}
+
+#endif
+
+/* ref:         HEAD -> develop */
+/* git commit:  a1f6312416ef6cd183ee62db58b640dc2d7ec1f4 */
+/* commit time: 2019-09-04 13:44:47 +0200 */

+ 495 - 0
libtomcrypt.mod/libtomcrypt/src/hashes/rmd320.c

@@ -0,0 +1,495 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ */
+#include "tomcrypt_private.h"
+
+/**
+   @file rmd320.c
+   RMD320 hash function
+*/
+
+#ifdef LTC_RIPEMD320
+
+const struct ltc_hash_descriptor rmd320_desc =
+{
+    "rmd320",
+    14,
+    40,
+    64,
+
+    /* OID ... does not exist
+     * http://oid-info.com/get/1.3.36.3.2 */
+   { 0 },
+   0,
+
+    &rmd320_init,
+    &rmd320_process,
+    &rmd320_done,
+    &rmd320_test,
+    NULL
+};
+
+/* the five basic functions F(), G() and H() */
+#define F(x, y, z)        ((x) ^ (y) ^ (z))
+#define G(x, y, z)        (((x) & (y)) | (~(x) & (z)))
+#define H(x, y, z)        (((x) | ~(y)) ^ (z))
+#define I(x, y, z)        (((x) & (z)) | ((y) & ~(z)))
+#define J(x, y, z)        ((x) ^ ((y) | ~(z)))
+
+/* the ten basic operations FF() through III() */
+#define FF(a, b, c, d, e, x, s)        \
+      (a) += F((b), (c), (d)) + (x);\
+      (a) = ROLc((a), (s)) + (e);\
+      (c) = ROLc((c), 10);
+
+#define GG(a, b, c, d, e, x, s)        \
+      (a) += G((b), (c), (d)) + (x) + 0x5a827999UL;\
+      (a) = ROLc((a), (s)) + (e);\
+      (c) = ROLc((c), 10);
+
+#define HH(a, b, c, d, e, x, s)        \
+      (a) += H((b), (c), (d)) + (x) + 0x6ed9eba1UL;\
+      (a) = ROLc((a), (s)) + (e);\
+      (c) = ROLc((c), 10);
+
+#define II(a, b, c, d, e, x, s)        \
+      (a) += I((b), (c), (d)) + (x) + 0x8f1bbcdcUL;\
+      (a) = ROLc((a), (s)) + (e);\
+      (c) = ROLc((c), 10);
+
+#define JJ(a, b, c, d, e, x, s)        \
+      (a) += J((b), (c), (d)) + (x) + 0xa953fd4eUL;\
+      (a) = ROLc((a), (s)) + (e);\
+      (c) = ROLc((c), 10);
+
+#define FFF(a, b, c, d, e, x, s)        \
+      (a) += F((b), (c), (d)) + (x);\
+      (a) = ROLc((a), (s)) + (e);\
+      (c) = ROLc((c), 10);
+
+#define GGG(a, b, c, d, e, x, s)        \
+      (a) += G((b), (c), (d)) + (x) + 0x7a6d76e9UL;\
+      (a) = ROLc((a), (s)) + (e);\
+      (c) = ROLc((c), 10);
+
+#define HHH(a, b, c, d, e, x, s)        \
+      (a) += H((b), (c), (d)) + (x) + 0x6d703ef3UL;\
+      (a) = ROLc((a), (s)) + (e);\
+      (c) = ROLc((c), 10);
+
+#define III(a, b, c, d, e, x, s)        \
+      (a) += I((b), (c), (d)) + (x) + 0x5c4dd124UL;\
+      (a) = ROLc((a), (s)) + (e);\
+      (c) = ROLc((c), 10);
+
+#define JJJ(a, b, c, d, e, x, s)        \
+      (a) += J((b), (c), (d)) + (x) + 0x50a28be6UL;\
+      (a) = ROLc((a), (s)) + (e);\
+      (c) = ROLc((c), 10);
+
+
+#ifdef LTC_CLEAN_STACK
+static int _rmd320_compress(hash_state *md, const unsigned char *buf)
+#else
+static int  rmd320_compress(hash_state *md, const unsigned char *buf)
+#endif
+{
+   ulong32 aa,bb,cc,dd,ee,aaa,bbb,ccc,ddd,eee,tmp,X[16];
+   int i;
+
+   /* load words X */
+   for (i = 0; i < 16; i++){
+      LOAD32L(X[i], buf + (4 * i));
+   }
+
+   /* load state */
+   aa = md->rmd320.state[0];
+   bb = md->rmd320.state[1];
+   cc = md->rmd320.state[2];
+   dd = md->rmd320.state[3];
+   ee = md->rmd320.state[4];
+   aaa = md->rmd320.state[5];
+   bbb = md->rmd320.state[6];
+   ccc = md->rmd320.state[7];
+   ddd = md->rmd320.state[8];
+   eee = md->rmd320.state[9];
+
+   /* round 1 */
+   FF(aa, bb, cc, dd, ee, X[ 0], 11);
+   FF(ee, aa, bb, cc, dd, X[ 1], 14);
+   FF(dd, ee, aa, bb, cc, X[ 2], 15);
+   FF(cc, dd, ee, aa, bb, X[ 3], 12);
+   FF(bb, cc, dd, ee, aa, X[ 4],  5);
+   FF(aa, bb, cc, dd, ee, X[ 5],  8);
+   FF(ee, aa, bb, cc, dd, X[ 6],  7);
+   FF(dd, ee, aa, bb, cc, X[ 7],  9);
+   FF(cc, dd, ee, aa, bb, X[ 8], 11);
+   FF(bb, cc, dd, ee, aa, X[ 9], 13);
+   FF(aa, bb, cc, dd, ee, X[10], 14);
+   FF(ee, aa, bb, cc, dd, X[11], 15);
+   FF(dd, ee, aa, bb, cc, X[12],  6);
+   FF(cc, dd, ee, aa, bb, X[13],  7);
+   FF(bb, cc, dd, ee, aa, X[14],  9);
+   FF(aa, bb, cc, dd, ee, X[15],  8);
+
+   /* parallel round 1 */
+   JJJ(aaa, bbb, ccc, ddd, eee, X[ 5],  8);
+   JJJ(eee, aaa, bbb, ccc, ddd, X[14],  9);
+   JJJ(ddd, eee, aaa, bbb, ccc, X[ 7],  9);
+   JJJ(ccc, ddd, eee, aaa, bbb, X[ 0], 11);
+   JJJ(bbb, ccc, ddd, eee, aaa, X[ 9], 13);
+   JJJ(aaa, bbb, ccc, ddd, eee, X[ 2], 15);
+   JJJ(eee, aaa, bbb, ccc, ddd, X[11], 15);
+   JJJ(ddd, eee, aaa, bbb, ccc, X[ 4],  5);
+   JJJ(ccc, ddd, eee, aaa, bbb, X[13],  7);
+   JJJ(bbb, ccc, ddd, eee, aaa, X[ 6],  7);
+   JJJ(aaa, bbb, ccc, ddd, eee, X[15],  8);
+   JJJ(eee, aaa, bbb, ccc, ddd, X[ 8], 11);
+   JJJ(ddd, eee, aaa, bbb, ccc, X[ 1], 14);
+   JJJ(ccc, ddd, eee, aaa, bbb, X[10], 14);
+   JJJ(bbb, ccc, ddd, eee, aaa, X[ 3], 12);
+   JJJ(aaa, bbb, ccc, ddd, eee, X[12],  6);
+
+   tmp = aa; aa = aaa; aaa = tmp;
+
+   /* round 2 */
+   GG(ee, aa, bb, cc, dd, X[ 7],  7);
+   GG(dd, ee, aa, bb, cc, X[ 4],  6);
+   GG(cc, dd, ee, aa, bb, X[13],  8);
+   GG(bb, cc, dd, ee, aa, X[ 1], 13);
+   GG(aa, bb, cc, dd, ee, X[10], 11);
+   GG(ee, aa, bb, cc, dd, X[ 6],  9);
+   GG(dd, ee, aa, bb, cc, X[15],  7);
+   GG(cc, dd, ee, aa, bb, X[ 3], 15);
+   GG(bb, cc, dd, ee, aa, X[12],  7);
+   GG(aa, bb, cc, dd, ee, X[ 0], 12);
+   GG(ee, aa, bb, cc, dd, X[ 9], 15);
+   GG(dd, ee, aa, bb, cc, X[ 5],  9);
+   GG(cc, dd, ee, aa, bb, X[ 2], 11);
+   GG(bb, cc, dd, ee, aa, X[14],  7);
+   GG(aa, bb, cc, dd, ee, X[11], 13);
+   GG(ee, aa, bb, cc, dd, X[ 8], 12);
+
+   /* parallel round 2 */
+   III(eee, aaa, bbb, ccc, ddd, X[ 6],  9);
+   III(ddd, eee, aaa, bbb, ccc, X[11], 13);
+   III(ccc, ddd, eee, aaa, bbb, X[ 3], 15);
+   III(bbb, ccc, ddd, eee, aaa, X[ 7],  7);
+   III(aaa, bbb, ccc, ddd, eee, X[ 0], 12);
+   III(eee, aaa, bbb, ccc, ddd, X[13],  8);
+   III(ddd, eee, aaa, bbb, ccc, X[ 5],  9);
+   III(ccc, ddd, eee, aaa, bbb, X[10], 11);
+   III(bbb, ccc, ddd, eee, aaa, X[14],  7);
+   III(aaa, bbb, ccc, ddd, eee, X[15],  7);
+   III(eee, aaa, bbb, ccc, ddd, X[ 8], 12);
+   III(ddd, eee, aaa, bbb, ccc, X[12],  7);
+   III(ccc, ddd, eee, aaa, bbb, X[ 4],  6);
+   III(bbb, ccc, ddd, eee, aaa, X[ 9], 15);
+   III(aaa, bbb, ccc, ddd, eee, X[ 1], 13);
+   III(eee, aaa, bbb, ccc, ddd, X[ 2], 11);
+
+   tmp = bb; bb = bbb; bbb = tmp;
+
+   /* round 3 */
+   HH(dd, ee, aa, bb, cc, X[ 3], 11);
+   HH(cc, dd, ee, aa, bb, X[10], 13);
+   HH(bb, cc, dd, ee, aa, X[14],  6);
+   HH(aa, bb, cc, dd, ee, X[ 4],  7);
+   HH(ee, aa, bb, cc, dd, X[ 9], 14);
+   HH(dd, ee, aa, bb, cc, X[15],  9);
+   HH(cc, dd, ee, aa, bb, X[ 8], 13);
+   HH(bb, cc, dd, ee, aa, X[ 1], 15);
+   HH(aa, bb, cc, dd, ee, X[ 2], 14);
+   HH(ee, aa, bb, cc, dd, X[ 7],  8);
+   HH(dd, ee, aa, bb, cc, X[ 0], 13);
+   HH(cc, dd, ee, aa, bb, X[ 6],  6);
+   HH(bb, cc, dd, ee, aa, X[13],  5);
+   HH(aa, bb, cc, dd, ee, X[11], 12);
+   HH(ee, aa, bb, cc, dd, X[ 5],  7);
+   HH(dd, ee, aa, bb, cc, X[12],  5);
+
+   /* parallel round 3 */
+   HHH(ddd, eee, aaa, bbb, ccc, X[15],  9);
+   HHH(ccc, ddd, eee, aaa, bbb, X[ 5],  7);
+   HHH(bbb, ccc, ddd, eee, aaa, X[ 1], 15);
+   HHH(aaa, bbb, ccc, ddd, eee, X[ 3], 11);
+   HHH(eee, aaa, bbb, ccc, ddd, X[ 7],  8);
+   HHH(ddd, eee, aaa, bbb, ccc, X[14],  6);
+   HHH(ccc, ddd, eee, aaa, bbb, X[ 6],  6);
+   HHH(bbb, ccc, ddd, eee, aaa, X[ 9], 14);
+   HHH(aaa, bbb, ccc, ddd, eee, X[11], 12);
+   HHH(eee, aaa, bbb, ccc, ddd, X[ 8], 13);
+   HHH(ddd, eee, aaa, bbb, ccc, X[12],  5);
+   HHH(ccc, ddd, eee, aaa, bbb, X[ 2], 14);
+   HHH(bbb, ccc, ddd, eee, aaa, X[10], 13);
+   HHH(aaa, bbb, ccc, ddd, eee, X[ 0], 13);
+   HHH(eee, aaa, bbb, ccc, ddd, X[ 4],  7);
+   HHH(ddd, eee, aaa, bbb, ccc, X[13],  5);
+
+   tmp = cc; cc = ccc; ccc = tmp;
+
+   /* round 4 */
+   II(cc, dd, ee, aa, bb, X[ 1], 11);
+   II(bb, cc, dd, ee, aa, X[ 9], 12);
+   II(aa, bb, cc, dd, ee, X[11], 14);
+   II(ee, aa, bb, cc, dd, X[10], 15);
+   II(dd, ee, aa, bb, cc, X[ 0], 14);
+   II(cc, dd, ee, aa, bb, X[ 8], 15);
+   II(bb, cc, dd, ee, aa, X[12],  9);
+   II(aa, bb, cc, dd, ee, X[ 4],  8);
+   II(ee, aa, bb, cc, dd, X[13],  9);
+   II(dd, ee, aa, bb, cc, X[ 3], 14);
+   II(cc, dd, ee, aa, bb, X[ 7],  5);
+   II(bb, cc, dd, ee, aa, X[15],  6);
+   II(aa, bb, cc, dd, ee, X[14],  8);
+   II(ee, aa, bb, cc, dd, X[ 5],  6);
+   II(dd, ee, aa, bb, cc, X[ 6],  5);
+   II(cc, dd, ee, aa, bb, X[ 2], 12);
+
+   /* parallel round 4 */
+   GGG(ccc, ddd, eee, aaa, bbb, X[ 8], 15);
+   GGG(bbb, ccc, ddd, eee, aaa, X[ 6],  5);
+   GGG(aaa, bbb, ccc, ddd, eee, X[ 4],  8);
+   GGG(eee, aaa, bbb, ccc, ddd, X[ 1], 11);
+   GGG(ddd, eee, aaa, bbb, ccc, X[ 3], 14);
+   GGG(ccc, ddd, eee, aaa, bbb, X[11], 14);
+   GGG(bbb, ccc, ddd, eee, aaa, X[15],  6);
+   GGG(aaa, bbb, ccc, ddd, eee, X[ 0], 14);
+   GGG(eee, aaa, bbb, ccc, ddd, X[ 5],  6);
+   GGG(ddd, eee, aaa, bbb, ccc, X[12],  9);
+   GGG(ccc, ddd, eee, aaa, bbb, X[ 2], 12);
+   GGG(bbb, ccc, ddd, eee, aaa, X[13],  9);
+   GGG(aaa, bbb, ccc, ddd, eee, X[ 9], 12);
+   GGG(eee, aaa, bbb, ccc, ddd, X[ 7],  5);
+   GGG(ddd, eee, aaa, bbb, ccc, X[10], 15);
+   GGG(ccc, ddd, eee, aaa, bbb, X[14],  8);
+
+   tmp = dd; dd = ddd; ddd = tmp;
+
+   /* round 5 */
+   JJ(bb, cc, dd, ee, aa, X[ 4],  9);
+   JJ(aa, bb, cc, dd, ee, X[ 0], 15);
+   JJ(ee, aa, bb, cc, dd, X[ 5],  5);
+   JJ(dd, ee, aa, bb, cc, X[ 9], 11);
+   JJ(cc, dd, ee, aa, bb, X[ 7],  6);
+   JJ(bb, cc, dd, ee, aa, X[12],  8);
+   JJ(aa, bb, cc, dd, ee, X[ 2], 13);
+   JJ(ee, aa, bb, cc, dd, X[10], 12);
+   JJ(dd, ee, aa, bb, cc, X[14],  5);
+   JJ(cc, dd, ee, aa, bb, X[ 1], 12);
+   JJ(bb, cc, dd, ee, aa, X[ 3], 13);
+   JJ(aa, bb, cc, dd, ee, X[ 8], 14);
+   JJ(ee, aa, bb, cc, dd, X[11], 11);
+   JJ(dd, ee, aa, bb, cc, X[ 6],  8);
+   JJ(cc, dd, ee, aa, bb, X[15],  5);
+   JJ(bb, cc, dd, ee, aa, X[13],  6);
+
+   /* parallel round 5 */
+   FFF(bbb, ccc, ddd, eee, aaa, X[12] ,  8);
+   FFF(aaa, bbb, ccc, ddd, eee, X[15] ,  5);
+   FFF(eee, aaa, bbb, ccc, ddd, X[10] , 12);
+   FFF(ddd, eee, aaa, bbb, ccc, X[ 4] ,  9);
+   FFF(ccc, ddd, eee, aaa, bbb, X[ 1] , 12);
+   FFF(bbb, ccc, ddd, eee, aaa, X[ 5] ,  5);
+   FFF(aaa, bbb, ccc, ddd, eee, X[ 8] , 14);
+   FFF(eee, aaa, bbb, ccc, ddd, X[ 7] ,  6);
+   FFF(ddd, eee, aaa, bbb, ccc, X[ 6] ,  8);
+   FFF(ccc, ddd, eee, aaa, bbb, X[ 2] , 13);
+   FFF(bbb, ccc, ddd, eee, aaa, X[13] ,  6);
+   FFF(aaa, bbb, ccc, ddd, eee, X[14] ,  5);
+   FFF(eee, aaa, bbb, ccc, ddd, X[ 0] , 15);
+   FFF(ddd, eee, aaa, bbb, ccc, X[ 3] , 13);
+   FFF(ccc, ddd, eee, aaa, bbb, X[ 9] , 11);
+   FFF(bbb, ccc, ddd, eee, aaa, X[11] , 11);
+
+   tmp = ee; ee = eee; eee = tmp;
+
+   /* combine results */
+   md->rmd320.state[0] += aa;
+   md->rmd320.state[1] += bb;
+   md->rmd320.state[2] += cc;
+   md->rmd320.state[3] += dd;
+   md->rmd320.state[4] += ee;
+   md->rmd320.state[5] += aaa;
+   md->rmd320.state[6] += bbb;
+   md->rmd320.state[7] += ccc;
+   md->rmd320.state[8] += ddd;
+   md->rmd320.state[9] += eee;
+
+   return CRYPT_OK;
+}
+
+#ifdef LTC_CLEAN_STACK
+static int rmd320_compress(hash_state *md, const unsigned char *buf)
+{
+   int err;
+   err = _rmd320_compress(md, buf);
+   burn_stack(sizeof(ulong32) * 27 + sizeof(int));
+   return err;
+}
+#endif
+
+/**
+   Initialize the hash state
+   @param md   The hash state you wish to initialize
+   @return CRYPT_OK if successful
+*/
+int rmd320_init(hash_state * md)
+{
+   LTC_ARGCHK(md != NULL);
+   md->rmd320.state[0] = 0x67452301UL;
+   md->rmd320.state[1] = 0xefcdab89UL;
+   md->rmd320.state[2] = 0x98badcfeUL;
+   md->rmd320.state[3] = 0x10325476UL;
+   md->rmd320.state[4] = 0xc3d2e1f0UL;
+   md->rmd320.state[5] = 0x76543210UL;
+   md->rmd320.state[6] = 0xfedcba98UL;
+   md->rmd320.state[7] = 0x89abcdefUL;
+   md->rmd320.state[8] = 0x01234567UL;
+   md->rmd320.state[9] = 0x3c2d1e0fUL;
+   md->rmd320.curlen   = 0;
+   md->rmd320.length   = 0;
+   return CRYPT_OK;
+}
+
+/**
+   Process a block of memory though the hash
+   @param md     The hash state
+   @param in     The data to hash
+   @param inlen  The length of the data (octets)
+   @return CRYPT_OK if successful
+*/
+HASH_PROCESS(rmd320_process, rmd320_compress, rmd320, 64)
+
+/**
+   Terminate the hash to get the digest
+   @param md  The hash state
+   @param out [out] The destination of the hash (20 bytes)
+   @return CRYPT_OK if successful
+*/
+int rmd320_done(hash_state * md, unsigned char *out)
+{
+    int i;
+
+    LTC_ARGCHK(md  != NULL);
+    LTC_ARGCHK(out != NULL);
+
+    if (md->rmd320.curlen >= sizeof(md->rmd320.buf)) {
+       return CRYPT_INVALID_ARG;
+    }
+
+
+    /* increase the length of the message */
+    md->rmd320.length += md->rmd320.curlen * 8;
+
+    /* append the '1' bit */
+    md->rmd320.buf[md->rmd320.curlen++] = (unsigned char)0x80;
+
+    /* if the length is currently above 56 bytes we append zeros
+     * then compress.  Then we can fall back to padding zeros and length
+     * encoding like normal.
+     */
+    if (md->rmd320.curlen > 56) {
+        while (md->rmd320.curlen < 64) {
+            md->rmd320.buf[md->rmd320.curlen++] = (unsigned char)0;
+        }
+        rmd320_compress(md, md->rmd320.buf);
+        md->rmd320.curlen = 0;
+    }
+
+    /* pad upto 56 bytes of zeroes */
+    while (md->rmd320.curlen < 56) {
+        md->rmd320.buf[md->rmd320.curlen++] = (unsigned char)0;
+    }
+
+    /* store length */
+    STORE64L(md->rmd320.length, md->rmd320.buf+56);
+    rmd320_compress(md, md->rmd320.buf);
+
+    /* copy output */
+    for (i = 0; i < 10; i++) {
+        STORE32L(md->rmd320.state[i], out+(4*i));
+    }
+#ifdef LTC_CLEAN_STACK
+    zeromem(md, sizeof(hash_state));
+#endif
+    return CRYPT_OK;
+}
+
+/**
+  Self-test the hash
+  @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled
+*/
+int rmd320_test(void)
+{
+#ifndef LTC_TEST
+   return CRYPT_NOP;
+#else
+   static const struct {
+        const char *msg;
+        unsigned char hash[40];
+   } tests[] = {
+   { "",
+     { 0x22, 0xd6, 0x5d, 0x56, 0x61, 0x53, 0x6c, 0xdc, 0x75, 0xc1,
+       0xfd, 0xf5, 0xc6, 0xde, 0x7b, 0x41, 0xb9, 0xf2, 0x73, 0x25,
+       0xeb, 0xc6, 0x1e, 0x85, 0x57, 0x17, 0x7d, 0x70, 0x5a, 0x0e,
+       0xc8, 0x80, 0x15, 0x1c, 0x3a, 0x32, 0xa0, 0x08, 0x99, 0xb8 }
+   },
+   { "a",
+     { 0xce, 0x78, 0x85, 0x06, 0x38, 0xf9, 0x26, 0x58, 0xa5, 0xa5,
+       0x85, 0x09, 0x75, 0x79, 0x92, 0x6d, 0xda, 0x66, 0x7a, 0x57,
+       0x16, 0x56, 0x2c, 0xfc, 0xf6, 0xfb, 0xe7, 0x7f, 0x63, 0x54,
+       0x2f, 0x99, 0xb0, 0x47, 0x05, 0xd6, 0x97, 0x0d, 0xff, 0x5d }
+   },
+   { "abc",
+     { 0xde, 0x4c, 0x01, 0xb3, 0x05, 0x4f, 0x89, 0x30, 0xa7, 0x9d,
+       0x09, 0xae, 0x73, 0x8e, 0x92, 0x30, 0x1e, 0x5a, 0x17, 0x08,
+       0x5b, 0xef, 0xfd, 0xc1, 0xb8, 0xd1, 0x16, 0x71, 0x3e, 0x74,
+       0xf8, 0x2f, 0xa9, 0x42, 0xd6, 0x4c, 0xdb, 0xc4, 0x68, 0x2d }
+   },
+   { "message digest",
+     { 0x3a, 0x8e, 0x28, 0x50, 0x2e, 0xd4, 0x5d, 0x42, 0x2f, 0x68,
+       0x84, 0x4f, 0x9d, 0xd3, 0x16, 0xe7, 0xb9, 0x85, 0x33, 0xfa,
+       0x3f, 0x2a, 0x91, 0xd2, 0x9f, 0x84, 0xd4, 0x25, 0xc8, 0x8d,
+       0x6b, 0x4e, 0xff, 0x72, 0x7d, 0xf6, 0x6a, 0x7c, 0x01, 0x97 }
+   },
+   { "abcdefghijklmnopqrstuvwxyz",
+     { 0xca, 0xbd, 0xb1, 0x81, 0x0b, 0x92, 0x47, 0x0a, 0x20, 0x93,
+       0xaa, 0x6b, 0xce, 0x05, 0x95, 0x2c, 0x28, 0x34, 0x8c, 0xf4,
+       0x3f, 0xf6, 0x08, 0x41, 0x97, 0x51, 0x66, 0xbb, 0x40, 0xed,
+       0x23, 0x40, 0x04, 0xb8, 0x82, 0x44, 0x63, 0xe6, 0xb0, 0x09 }
+   },
+   { "abcdbcdecdefdefgefghfghighijhijkijkljklmklmnlmnomnopnopq",
+     { 0xd0, 0x34, 0xa7, 0x95, 0x0c, 0xf7, 0x22, 0x02, 0x1b, 0xa4,
+       0xb8, 0x4d, 0xf7, 0x69, 0xa5, 0xde, 0x20, 0x60, 0xe2, 0x59,
+       0xdf, 0x4c, 0x9b, 0xb4, 0xa4, 0x26, 0x8c, 0x0e, 0x93, 0x5b,
+       0xbc, 0x74, 0x70, 0xa9, 0x69, 0xc9, 0xd0, 0x72, 0xa1, 0xac }
+   }
+   };
+
+   int i;
+   unsigned char tmp[40];
+   hash_state md;
+
+   for (i = 0; i < (int)(sizeof(tests)/sizeof(tests[0])); i++) {
+       rmd320_init(&md);
+       rmd320_process(&md, (unsigned char *)tests[i].msg, strlen(tests[i].msg));
+       rmd320_done(&md, tmp);
+       if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "RIPEMD320", i)) {
+          return CRYPT_FAIL_TESTVECTOR;
+       }
+   }
+   return CRYPT_OK;
+#endif
+}
+
+#endif
+
+/* ref:         HEAD -> develop */
+/* git commit:  a1f6312416ef6cd183ee62db58b640dc2d7ec1f4 */
+/* commit time: 2019-09-04 13:44:47 +0200 */

+ 286 - 0
libtomcrypt.mod/libtomcrypt/src/hashes/sha1.c

@@ -0,0 +1,286 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ */
+#include "tomcrypt_private.h"
+
+/**
+  @file sha1.c
+  LTC_SHA1 code by Tom St Denis
+*/
+
+
+#ifdef LTC_SHA1
+
+const struct ltc_hash_descriptor sha1_desc =
+{
+    "sha1",
+    2,
+    20,
+    64,
+
+    /* OID */
+   { 1, 3, 14, 3, 2, 26,  },
+   6,
+
+    &sha1_init,
+    &sha1_process,
+    &sha1_done,
+    &sha1_test,
+    NULL
+};
+
+#define F0(x,y,z)  (z ^ (x & (y ^ z)))
+#define F1(x,y,z)  (x ^ y ^ z)
+#define F2(x,y,z)  ((x & y) | (z & (x | y)))
+#define F3(x,y,z)  (x ^ y ^ z)
+
+#ifdef LTC_CLEAN_STACK
+static int _sha1_compress(hash_state *md, const unsigned char *buf)
+#else
+static int  sha1_compress(hash_state *md, const unsigned char *buf)
+#endif
+{
+    ulong32 a,b,c,d,e,W[80],i;
+#ifdef LTC_SMALL_CODE
+    ulong32 t;
+#endif
+
+    /* copy the state into 512-bits into W[0..15] */
+    for (i = 0; i < 16; i++) {
+        LOAD32H(W[i], buf + (4*i));
+    }
+
+    /* copy state */
+    a = md->sha1.state[0];
+    b = md->sha1.state[1];
+    c = md->sha1.state[2];
+    d = md->sha1.state[3];
+    e = md->sha1.state[4];
+
+    /* expand it */
+    for (i = 16; i < 80; i++) {
+        W[i] = ROL(W[i-3] ^ W[i-8] ^ W[i-14] ^ W[i-16], 1);
+    }
+
+    /* compress */
+    /* round one */
+    #define FF0(a,b,c,d,e,i) e = (ROLc(a, 5) + F0(b,c,d) + e + W[i] + 0x5a827999UL); b = ROLc(b, 30);
+    #define FF1(a,b,c,d,e,i) e = (ROLc(a, 5) + F1(b,c,d) + e + W[i] + 0x6ed9eba1UL); b = ROLc(b, 30);
+    #define FF2(a,b,c,d,e,i) e = (ROLc(a, 5) + F2(b,c,d) + e + W[i] + 0x8f1bbcdcUL); b = ROLc(b, 30);
+    #define FF3(a,b,c,d,e,i) e = (ROLc(a, 5) + F3(b,c,d) + e + W[i] + 0xca62c1d6UL); b = ROLc(b, 30);
+
+#ifdef LTC_SMALL_CODE
+
+    for (i = 0; i < 20; ) {
+       FF0(a,b,c,d,e,i++); t = e; e = d; d = c; c = b; b = a; a = t;
+    }
+
+    for (; i < 40; ) {
+       FF1(a,b,c,d,e,i++); t = e; e = d; d = c; c = b; b = a; a = t;
+    }
+
+    for (; i < 60; ) {
+       FF2(a,b,c,d,e,i++); t = e; e = d; d = c; c = b; b = a; a = t;
+    }
+
+    for (; i < 80; ) {
+       FF3(a,b,c,d,e,i++); t = e; e = d; d = c; c = b; b = a; a = t;
+    }
+
+#else
+
+    for (i = 0; i < 20; ) {
+       FF0(a,b,c,d,e,i++);
+       FF0(e,a,b,c,d,i++);
+       FF0(d,e,a,b,c,i++);
+       FF0(c,d,e,a,b,i++);
+       FF0(b,c,d,e,a,i++);
+    }
+
+    /* round two */
+    for (; i < 40; )  {
+       FF1(a,b,c,d,e,i++);
+       FF1(e,a,b,c,d,i++);
+       FF1(d,e,a,b,c,i++);
+       FF1(c,d,e,a,b,i++);
+       FF1(b,c,d,e,a,i++);
+    }
+
+    /* round three */
+    for (; i < 60; )  {
+       FF2(a,b,c,d,e,i++);
+       FF2(e,a,b,c,d,i++);
+       FF2(d,e,a,b,c,i++);
+       FF2(c,d,e,a,b,i++);
+       FF2(b,c,d,e,a,i++);
+    }
+
+    /* round four */
+    for (; i < 80; )  {
+       FF3(a,b,c,d,e,i++);
+       FF3(e,a,b,c,d,i++);
+       FF3(d,e,a,b,c,i++);
+       FF3(c,d,e,a,b,i++);
+       FF3(b,c,d,e,a,i++);
+    }
+#endif
+
+    #undef FF0
+    #undef FF1
+    #undef FF2
+    #undef FF3
+
+    /* store */
+    md->sha1.state[0] = md->sha1.state[0] + a;
+    md->sha1.state[1] = md->sha1.state[1] + b;
+    md->sha1.state[2] = md->sha1.state[2] + c;
+    md->sha1.state[3] = md->sha1.state[3] + d;
+    md->sha1.state[4] = md->sha1.state[4] + e;
+
+    return CRYPT_OK;
+}
+
+#ifdef LTC_CLEAN_STACK
+static int sha1_compress(hash_state *md, const unsigned char *buf)
+{
+   int err;
+   err = _sha1_compress(md, buf);
+   burn_stack(sizeof(ulong32) * 87);
+   return err;
+}
+#endif
+
+/**
+   Initialize the hash state
+   @param md   The hash state you wish to initialize
+   @return CRYPT_OK if successful
+*/
+int sha1_init(hash_state * md)
+{
+   LTC_ARGCHK(md != NULL);
+   md->sha1.state[0] = 0x67452301UL;
+   md->sha1.state[1] = 0xefcdab89UL;
+   md->sha1.state[2] = 0x98badcfeUL;
+   md->sha1.state[3] = 0x10325476UL;
+   md->sha1.state[4] = 0xc3d2e1f0UL;
+   md->sha1.curlen = 0;
+   md->sha1.length = 0;
+   return CRYPT_OK;
+}
+
+/**
+   Process a block of memory though the hash
+   @param md     The hash state
+   @param in     The data to hash
+   @param inlen  The length of the data (octets)
+   @return CRYPT_OK if successful
+*/
+HASH_PROCESS(sha1_process, sha1_compress, sha1, 64)
+
+/**
+   Terminate the hash to get the digest
+   @param md  The hash state
+   @param out [out] The destination of the hash (20 bytes)
+   @return CRYPT_OK if successful
+*/
+int sha1_done(hash_state * md, unsigned char *out)
+{
+    int i;
+
+    LTC_ARGCHK(md  != NULL);
+    LTC_ARGCHK(out != NULL);
+
+    if (md->sha1.curlen >= sizeof(md->sha1.buf)) {
+       return CRYPT_INVALID_ARG;
+    }
+
+    /* increase the length of the message */
+    md->sha1.length += md->sha1.curlen * 8;
+
+    /* append the '1' bit */
+    md->sha1.buf[md->sha1.curlen++] = (unsigned char)0x80;
+
+    /* if the length is currently above 56 bytes we append zeros
+     * then compress.  Then we can fall back to padding zeros and length
+     * encoding like normal.
+     */
+    if (md->sha1.curlen > 56) {
+        while (md->sha1.curlen < 64) {
+            md->sha1.buf[md->sha1.curlen++] = (unsigned char)0;
+        }
+        sha1_compress(md, md->sha1.buf);
+        md->sha1.curlen = 0;
+    }
+
+    /* pad upto 56 bytes of zeroes */
+    while (md->sha1.curlen < 56) {
+        md->sha1.buf[md->sha1.curlen++] = (unsigned char)0;
+    }
+
+    /* store length */
+    STORE64H(md->sha1.length, md->sha1.buf+56);
+    sha1_compress(md, md->sha1.buf);
+
+    /* copy output */
+    for (i = 0; i < 5; i++) {
+        STORE32H(md->sha1.state[i], out+(4*i));
+    }
+#ifdef LTC_CLEAN_STACK
+    zeromem(md, sizeof(hash_state));
+#endif
+    return CRYPT_OK;
+}
+
+/**
+  Self-test the hash
+  @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled
+*/
+int  sha1_test(void)
+{
+ #ifndef LTC_TEST
+    return CRYPT_NOP;
+ #else
+  static const struct {
+      const char *msg;
+      unsigned char hash[20];
+  } tests[] = {
+    { "abc",
+      { 0xa9, 0x99, 0x3e, 0x36, 0x47, 0x06, 0x81, 0x6a,
+        0xba, 0x3e, 0x25, 0x71, 0x78, 0x50, 0xc2, 0x6c,
+        0x9c, 0xd0, 0xd8, 0x9d }
+    },
+    { "abcdbcdecdefdefgefghfghighijhijkijkljklmklmnlmnomnopnopq",
+      { 0x84, 0x98, 0x3E, 0x44, 0x1C, 0x3B, 0xD2, 0x6E,
+        0xBA, 0xAE, 0x4A, 0xA1, 0xF9, 0x51, 0x29, 0xE5,
+        0xE5, 0x46, 0x70, 0xF1 }
+    }
+  };
+
+  int i;
+  unsigned char tmp[20];
+  hash_state md;
+
+  for (i = 0; i < (int)(sizeof(tests) / sizeof(tests[0]));  i++) {
+      sha1_init(&md);
+      sha1_process(&md, (unsigned char*)tests[i].msg, (unsigned long)strlen(tests[i].msg));
+      sha1_done(&md, tmp);
+      if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "SHA1", i)) {
+         return CRYPT_FAIL_TESTVECTOR;
+      }
+  }
+  return CRYPT_OK;
+  #endif
+}
+
+#endif
+
+
+
+/* ref:         HEAD -> develop */
+/* git commit:  a1f6312416ef6cd183ee62db58b640dc2d7ec1f4 */
+/* commit time: 2019-09-04 13:44:47 +0200 */

+ 129 - 0
libtomcrypt.mod/libtomcrypt/src/hashes/sha2/sha224.c

@@ -0,0 +1,129 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ */
+/**
+   @param sha224.c
+   LTC_SHA-224 new NIST standard based off of LTC_SHA-256 truncated to 224 bits (Tom St Denis)
+*/
+
+#include "tomcrypt_private.h"
+
+#if defined(LTC_SHA224) && defined(LTC_SHA256)
+
+const struct ltc_hash_descriptor sha224_desc =
+{
+    "sha224",
+    10,
+    28,
+    64,
+
+    /* OID */
+   { 2, 16, 840, 1, 101, 3, 4, 2, 4,  },
+   9,
+
+    &sha224_init,
+    &sha256_process,
+    &sha224_done,
+    &sha224_test,
+    NULL
+};
+
+/* init the sha256 er... sha224 state ;-) */
+/**
+   Initialize the hash state
+   @param md   The hash state you wish to initialize
+   @return CRYPT_OK if successful
+*/
+int sha224_init(hash_state * md)
+{
+    LTC_ARGCHK(md != NULL);
+
+    md->sha256.curlen = 0;
+    md->sha256.length = 0;
+    md->sha256.state[0] = 0xc1059ed8UL;
+    md->sha256.state[1] = 0x367cd507UL;
+    md->sha256.state[2] = 0x3070dd17UL;
+    md->sha256.state[3] = 0xf70e5939UL;
+    md->sha256.state[4] = 0xffc00b31UL;
+    md->sha256.state[5] = 0x68581511UL;
+    md->sha256.state[6] = 0x64f98fa7UL;
+    md->sha256.state[7] = 0xbefa4fa4UL;
+    return CRYPT_OK;
+}
+
+/**
+   Terminate the hash to get the digest
+   @param md  The hash state
+   @param out [out] The destination of the hash (28 bytes)
+   @return CRYPT_OK if successful
+*/
+int sha224_done(hash_state * md, unsigned char *out)
+{
+    unsigned char buf[32];
+    int err;
+
+    LTC_ARGCHK(md  != NULL);
+    LTC_ARGCHK(out != NULL);
+
+    err = sha256_done(md, buf);
+    XMEMCPY(out, buf, 28);
+#ifdef LTC_CLEAN_STACK
+    zeromem(buf, sizeof(buf));
+#endif
+    return err;
+}
+
+/**
+  Self-test the hash
+  @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled
+*/
+int  sha224_test(void)
+{
+ #ifndef LTC_TEST
+    return CRYPT_NOP;
+ #else
+  static const struct {
+      const char *msg;
+      unsigned char hash[28];
+  } tests[] = {
+    { "abc",
+      { 0x23, 0x09, 0x7d, 0x22, 0x34, 0x05, 0xd8,
+        0x22, 0x86, 0x42, 0xa4, 0x77, 0xbd, 0xa2,
+        0x55, 0xb3, 0x2a, 0xad, 0xbc, 0xe4, 0xbd,
+        0xa0, 0xb3, 0xf7, 0xe3, 0x6c, 0x9d, 0xa7 }
+    },
+    { "abcdbcdecdefdefgefghfghighijhijkijkljklmklmnlmnomnopnopq",
+      { 0x75, 0x38, 0x8b, 0x16, 0x51, 0x27, 0x76,
+        0xcc, 0x5d, 0xba, 0x5d, 0xa1, 0xfd, 0x89,
+        0x01, 0x50, 0xb0, 0xc6, 0x45, 0x5c, 0xb4,
+        0xf5, 0x8b, 0x19, 0x52, 0x52, 0x25, 0x25 }
+    },
+  };
+
+  int i;
+  unsigned char tmp[28];
+  hash_state md;
+
+  for (i = 0; i < (int)(sizeof(tests) / sizeof(tests[0])); i++) {
+      sha224_init(&md);
+      sha224_process(&md, (unsigned char*)tests[i].msg, (unsigned long)strlen(tests[i].msg));
+      sha224_done(&md, tmp);
+      if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "SHA224", i)) {
+         return CRYPT_FAIL_TESTVECTOR;
+      }
+  }
+  return CRYPT_OK;
+ #endif
+}
+
+#endif /* defined(LTC_SHA224) && defined(LTC_SHA256) */
+
+
+/* ref:         HEAD -> develop */
+/* git commit:  a1f6312416ef6cd183ee62db58b640dc2d7ec1f4 */
+/* commit time: 2019-09-04 13:44:47 +0200 */

+ 334 - 0
libtomcrypt.mod/libtomcrypt/src/hashes/sha2/sha256.c

@@ -0,0 +1,334 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ */
+#include "tomcrypt_private.h"
+
+/**
+  @file sha256.c
+  LTC_SHA256 by Tom St Denis
+*/
+
+#ifdef LTC_SHA256
+
+const struct ltc_hash_descriptor sha256_desc =
+{
+    "sha256",
+    0,
+    32,
+    64,
+
+    /* OID */
+   { 2, 16, 840, 1, 101, 3, 4, 2, 1,  },
+   9,
+
+    &sha256_init,
+    &sha256_process,
+    &sha256_done,
+    &sha256_test,
+    NULL
+};
+
+#ifdef LTC_SMALL_CODE
+/* the K array */
+static const ulong32 K[64] = {
+    0x428a2f98UL, 0x71374491UL, 0xb5c0fbcfUL, 0xe9b5dba5UL, 0x3956c25bUL,
+    0x59f111f1UL, 0x923f82a4UL, 0xab1c5ed5UL, 0xd807aa98UL, 0x12835b01UL,
+    0x243185beUL, 0x550c7dc3UL, 0x72be5d74UL, 0x80deb1feUL, 0x9bdc06a7UL,
+    0xc19bf174UL, 0xe49b69c1UL, 0xefbe4786UL, 0x0fc19dc6UL, 0x240ca1ccUL,
+    0x2de92c6fUL, 0x4a7484aaUL, 0x5cb0a9dcUL, 0x76f988daUL, 0x983e5152UL,
+    0xa831c66dUL, 0xb00327c8UL, 0xbf597fc7UL, 0xc6e00bf3UL, 0xd5a79147UL,
+    0x06ca6351UL, 0x14292967UL, 0x27b70a85UL, 0x2e1b2138UL, 0x4d2c6dfcUL,
+    0x53380d13UL, 0x650a7354UL, 0x766a0abbUL, 0x81c2c92eUL, 0x92722c85UL,
+    0xa2bfe8a1UL, 0xa81a664bUL, 0xc24b8b70UL, 0xc76c51a3UL, 0xd192e819UL,
+    0xd6990624UL, 0xf40e3585UL, 0x106aa070UL, 0x19a4c116UL, 0x1e376c08UL,
+    0x2748774cUL, 0x34b0bcb5UL, 0x391c0cb3UL, 0x4ed8aa4aUL, 0x5b9cca4fUL,
+    0x682e6ff3UL, 0x748f82eeUL, 0x78a5636fUL, 0x84c87814UL, 0x8cc70208UL,
+    0x90befffaUL, 0xa4506cebUL, 0xbef9a3f7UL, 0xc67178f2UL
+};
+#endif
+
+/* Various logical functions */
+#define Ch(x,y,z)       (z ^ (x & (y ^ z)))
+#define Maj(x,y,z)      (((x | y) & z) | (x & y))
+#define S(x, n)         RORc((x),(n))
+#define R(x, n)         (((x)&0xFFFFFFFFUL)>>(n))
+#define Sigma0(x)       (S(x, 2) ^ S(x, 13) ^ S(x, 22))
+#define Sigma1(x)       (S(x, 6) ^ S(x, 11) ^ S(x, 25))
+#define Gamma0(x)       (S(x, 7) ^ S(x, 18) ^ R(x, 3))
+#define Gamma1(x)       (S(x, 17) ^ S(x, 19) ^ R(x, 10))
+
+/* compress 512-bits */
+#ifdef LTC_CLEAN_STACK
+static int _sha256_compress(hash_state * md, const unsigned char *buf)
+#else
+static int  sha256_compress(hash_state * md, const unsigned char *buf)
+#endif
+{
+    ulong32 S[8], W[64], t0, t1;
+#ifdef LTC_SMALL_CODE
+    ulong32 t;
+#endif
+    int i;
+
+    /* copy state into S */
+    for (i = 0; i < 8; i++) {
+        S[i] = md->sha256.state[i];
+    }
+
+    /* copy the state into 512-bits into W[0..15] */
+    for (i = 0; i < 16; i++) {
+        LOAD32H(W[i], buf + (4*i));
+    }
+
+    /* fill W[16..63] */
+    for (i = 16; i < 64; i++) {
+        W[i] = Gamma1(W[i - 2]) + W[i - 7] + Gamma0(W[i - 15]) + W[i - 16];
+    }
+
+    /* Compress */
+#ifdef LTC_SMALL_CODE
+#define RND(a,b,c,d,e,f,g,h,i)                         \
+     t0 = h + Sigma1(e) + Ch(e, f, g) + K[i] + W[i];   \
+     t1 = Sigma0(a) + Maj(a, b, c);                    \
+     d += t0;                                          \
+     h  = t0 + t1;
+
+     for (i = 0; i < 64; ++i) {
+         RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],i);
+         t = S[7]; S[7] = S[6]; S[6] = S[5]; S[5] = S[4];
+         S[4] = S[3]; S[3] = S[2]; S[2] = S[1]; S[1] = S[0]; S[0] = t;
+     }
+#else
+#define RND(a,b,c,d,e,f,g,h,i,ki)                    \
+     t0 = h + Sigma1(e) + Ch(e, f, g) + ki + W[i];   \
+     t1 = Sigma0(a) + Maj(a, b, c);                  \
+     d += t0;                                        \
+     h  = t0 + t1;
+
+    RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],0,0x428a2f98);
+    RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],1,0x71374491);
+    RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],2,0xb5c0fbcf);
+    RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],3,0xe9b5dba5);
+    RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],4,0x3956c25b);
+    RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],5,0x59f111f1);
+    RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],6,0x923f82a4);
+    RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],7,0xab1c5ed5);
+    RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],8,0xd807aa98);
+    RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],9,0x12835b01);
+    RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],10,0x243185be);
+    RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],11,0x550c7dc3);
+    RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],12,0x72be5d74);
+    RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],13,0x80deb1fe);
+    RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],14,0x9bdc06a7);
+    RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],15,0xc19bf174);
+    RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],16,0xe49b69c1);
+    RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],17,0xefbe4786);
+    RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],18,0x0fc19dc6);
+    RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],19,0x240ca1cc);
+    RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],20,0x2de92c6f);
+    RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],21,0x4a7484aa);
+    RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],22,0x5cb0a9dc);
+    RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],23,0x76f988da);
+    RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],24,0x983e5152);
+    RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],25,0xa831c66d);
+    RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],26,0xb00327c8);
+    RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],27,0xbf597fc7);
+    RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],28,0xc6e00bf3);
+    RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],29,0xd5a79147);
+    RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],30,0x06ca6351);
+    RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],31,0x14292967);
+    RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],32,0x27b70a85);
+    RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],33,0x2e1b2138);
+    RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],34,0x4d2c6dfc);
+    RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],35,0x53380d13);
+    RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],36,0x650a7354);
+    RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],37,0x766a0abb);
+    RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],38,0x81c2c92e);
+    RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],39,0x92722c85);
+    RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],40,0xa2bfe8a1);
+    RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],41,0xa81a664b);
+    RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],42,0xc24b8b70);
+    RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],43,0xc76c51a3);
+    RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],44,0xd192e819);
+    RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],45,0xd6990624);
+    RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],46,0xf40e3585);
+    RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],47,0x106aa070);
+    RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],48,0x19a4c116);
+    RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],49,0x1e376c08);
+    RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],50,0x2748774c);
+    RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],51,0x34b0bcb5);
+    RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],52,0x391c0cb3);
+    RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],53,0x4ed8aa4a);
+    RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],54,0x5b9cca4f);
+    RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],55,0x682e6ff3);
+    RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],56,0x748f82ee);
+    RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],57,0x78a5636f);
+    RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],58,0x84c87814);
+    RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],59,0x8cc70208);
+    RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],60,0x90befffa);
+    RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],61,0xa4506ceb);
+    RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],62,0xbef9a3f7);
+    RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],63,0xc67178f2);
+
+#undef RND
+
+#endif
+
+    /* feedback */
+    for (i = 0; i < 8; i++) {
+        md->sha256.state[i] = md->sha256.state[i] + S[i];
+    }
+    return CRYPT_OK;
+}
+
+#ifdef LTC_CLEAN_STACK
+static int sha256_compress(hash_state * md, const unsigned char *buf)
+{
+    int err;
+    err = _sha256_compress(md, buf);
+    burn_stack(sizeof(ulong32) * 74);
+    return err;
+}
+#endif
+
+/**
+   Initialize the hash state
+   @param md   The hash state you wish to initialize
+   @return CRYPT_OK if successful
+*/
+int sha256_init(hash_state * md)
+{
+    LTC_ARGCHK(md != NULL);
+
+    md->sha256.curlen = 0;
+    md->sha256.length = 0;
+    md->sha256.state[0] = 0x6A09E667UL;
+    md->sha256.state[1] = 0xBB67AE85UL;
+    md->sha256.state[2] = 0x3C6EF372UL;
+    md->sha256.state[3] = 0xA54FF53AUL;
+    md->sha256.state[4] = 0x510E527FUL;
+    md->sha256.state[5] = 0x9B05688CUL;
+    md->sha256.state[6] = 0x1F83D9ABUL;
+    md->sha256.state[7] = 0x5BE0CD19UL;
+    return CRYPT_OK;
+}
+
+/**
+   Process a block of memory though the hash
+   @param md     The hash state
+   @param in     The data to hash
+   @param inlen  The length of the data (octets)
+   @return CRYPT_OK if successful
+*/
+HASH_PROCESS(sha256_process, sha256_compress, sha256, 64)
+
+/**
+   Terminate the hash to get the digest
+   @param md  The hash state
+   @param out [out] The destination of the hash (32 bytes)
+   @return CRYPT_OK if successful
+*/
+int sha256_done(hash_state * md, unsigned char *out)
+{
+    int i;
+
+    LTC_ARGCHK(md  != NULL);
+    LTC_ARGCHK(out != NULL);
+
+    if (md->sha256.curlen >= sizeof(md->sha256.buf)) {
+       return CRYPT_INVALID_ARG;
+    }
+
+
+    /* increase the length of the message */
+    md->sha256.length += md->sha256.curlen * 8;
+
+    /* append the '1' bit */
+    md->sha256.buf[md->sha256.curlen++] = (unsigned char)0x80;
+
+    /* if the length is currently above 56 bytes we append zeros
+     * then compress.  Then we can fall back to padding zeros and length
+     * encoding like normal.
+     */
+    if (md->sha256.curlen > 56) {
+        while (md->sha256.curlen < 64) {
+            md->sha256.buf[md->sha256.curlen++] = (unsigned char)0;
+        }
+        sha256_compress(md, md->sha256.buf);
+        md->sha256.curlen = 0;
+    }
+
+    /* pad upto 56 bytes of zeroes */
+    while (md->sha256.curlen < 56) {
+        md->sha256.buf[md->sha256.curlen++] = (unsigned char)0;
+    }
+
+    /* store length */
+    STORE64H(md->sha256.length, md->sha256.buf+56);
+    sha256_compress(md, md->sha256.buf);
+
+    /* copy output */
+    for (i = 0; i < 8; i++) {
+        STORE32H(md->sha256.state[i], out+(4*i));
+    }
+#ifdef LTC_CLEAN_STACK
+    zeromem(md, sizeof(hash_state));
+#endif
+    return CRYPT_OK;
+}
+
+/**
+  Self-test the hash
+  @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled
+*/
+int  sha256_test(void)
+{
+ #ifndef LTC_TEST
+    return CRYPT_NOP;
+ #else
+  static const struct {
+      const char *msg;
+      unsigned char hash[32];
+  } tests[] = {
+    { "abc",
+      { 0xba, 0x78, 0x16, 0xbf, 0x8f, 0x01, 0xcf, 0xea,
+        0x41, 0x41, 0x40, 0xde, 0x5d, 0xae, 0x22, 0x23,
+        0xb0, 0x03, 0x61, 0xa3, 0x96, 0x17, 0x7a, 0x9c,
+        0xb4, 0x10, 0xff, 0x61, 0xf2, 0x00, 0x15, 0xad }
+    },
+    { "abcdbcdecdefdefgefghfghighijhijkijkljklmklmnlmnomnopnopq",
+      { 0x24, 0x8d, 0x6a, 0x61, 0xd2, 0x06, 0x38, 0xb8,
+        0xe5, 0xc0, 0x26, 0x93, 0x0c, 0x3e, 0x60, 0x39,
+        0xa3, 0x3c, 0xe4, 0x59, 0x64, 0xff, 0x21, 0x67,
+        0xf6, 0xec, 0xed, 0xd4, 0x19, 0xdb, 0x06, 0xc1 }
+    },
+  };
+
+  int i;
+  unsigned char tmp[32];
+  hash_state md;
+
+  for (i = 0; i < (int)(sizeof(tests) / sizeof(tests[0])); i++) {
+      sha256_init(&md);
+      sha256_process(&md, (unsigned char*)tests[i].msg, (unsigned long)strlen(tests[i].msg));
+      sha256_done(&md, tmp);
+      if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "SHA256", i)) {
+         return CRYPT_FAIL_TESTVECTOR;
+      }
+  }
+  return CRYPT_OK;
+ #endif
+}
+
+#endif
+
+
+
+/* ref:         HEAD -> develop */
+/* git commit:  a1f6312416ef6cd183ee62db58b640dc2d7ec1f4 */
+/* commit time: 2019-09-04 13:44:47 +0200 */

+ 134 - 0
libtomcrypt.mod/libtomcrypt/src/hashes/sha2/sha384.c

@@ -0,0 +1,134 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ */
+/**
+   @param sha384.c
+   LTC_SHA384 hash included in sha512.c, Tom St Denis
+*/
+
+#include "tomcrypt_private.h"
+
+#if defined(LTC_SHA384) && defined(LTC_SHA512)
+
+const struct ltc_hash_descriptor sha384_desc =
+{
+    "sha384",
+    4,
+    48,
+    128,
+
+    /* OID */
+   { 2, 16, 840, 1, 101, 3, 4, 2, 2,  },
+   9,
+
+    &sha384_init,
+    &sha512_process,
+    &sha384_done,
+    &sha384_test,
+    NULL
+};
+
+/**
+   Initialize the hash state
+   @param md   The hash state you wish to initialize
+   @return CRYPT_OK if successful
+*/
+int sha384_init(hash_state * md)
+{
+    LTC_ARGCHK(md != NULL);
+
+    md->sha512.curlen = 0;
+    md->sha512.length = 0;
+    md->sha512.state[0] = CONST64(0xcbbb9d5dc1059ed8);
+    md->sha512.state[1] = CONST64(0x629a292a367cd507);
+    md->sha512.state[2] = CONST64(0x9159015a3070dd17);
+    md->sha512.state[3] = CONST64(0x152fecd8f70e5939);
+    md->sha512.state[4] = CONST64(0x67332667ffc00b31);
+    md->sha512.state[5] = CONST64(0x8eb44a8768581511);
+    md->sha512.state[6] = CONST64(0xdb0c2e0d64f98fa7);
+    md->sha512.state[7] = CONST64(0x47b5481dbefa4fa4);
+    return CRYPT_OK;
+}
+
+/**
+   Terminate the hash to get the digest
+   @param md  The hash state
+   @param out [out] The destination of the hash (48 bytes)
+   @return CRYPT_OK if successful
+*/
+int sha384_done(hash_state * md, unsigned char *out)
+{
+   unsigned char buf[64];
+
+   LTC_ARGCHK(md  != NULL);
+   LTC_ARGCHK(out != NULL);
+
+    if (md->sha512.curlen >= sizeof(md->sha512.buf)) {
+       return CRYPT_INVALID_ARG;
+    }
+
+   sha512_done(md, buf);
+   XMEMCPY(out, buf, 48);
+#ifdef LTC_CLEAN_STACK
+   zeromem(buf, sizeof(buf));
+#endif
+   return CRYPT_OK;
+}
+
+/**
+  Self-test the hash
+  @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled
+*/
+int  sha384_test(void)
+{
+ #ifndef LTC_TEST
+    return CRYPT_NOP;
+ #else
+  static const struct {
+      const char *msg;
+      unsigned char hash[48];
+  } tests[] = {
+    { "abc",
+      { 0xcb, 0x00, 0x75, 0x3f, 0x45, 0xa3, 0x5e, 0x8b,
+        0xb5, 0xa0, 0x3d, 0x69, 0x9a, 0xc6, 0x50, 0x07,
+        0x27, 0x2c, 0x32, 0xab, 0x0e, 0xde, 0xd1, 0x63,
+        0x1a, 0x8b, 0x60, 0x5a, 0x43, 0xff, 0x5b, 0xed,
+        0x80, 0x86, 0x07, 0x2b, 0xa1, 0xe7, 0xcc, 0x23,
+        0x58, 0xba, 0xec, 0xa1, 0x34, 0xc8, 0x25, 0xa7 }
+    },
+    { "abcdefghbcdefghicdefghijdefghijkefghijklfghijklmghijklmnhijklmnoijklmnopjklmnopqklmnopqrlmnopqrsmnopqrstnopqrstu",
+      { 0x09, 0x33, 0x0c, 0x33, 0xf7, 0x11, 0x47, 0xe8,
+        0x3d, 0x19, 0x2f, 0xc7, 0x82, 0xcd, 0x1b, 0x47,
+        0x53, 0x11, 0x1b, 0x17, 0x3b, 0x3b, 0x05, 0xd2,
+        0x2f, 0xa0, 0x80, 0x86, 0xe3, 0xb0, 0xf7, 0x12,
+        0xfc, 0xc7, 0xc7, 0x1a, 0x55, 0x7e, 0x2d, 0xb9,
+        0x66, 0xc3, 0xe9, 0xfa, 0x91, 0x74, 0x60, 0x39 }
+    },
+  };
+
+  int i;
+  unsigned char tmp[48];
+  hash_state md;
+
+  for (i = 0; i < (int)(sizeof(tests) / sizeof(tests[0])); i++) {
+      sha384_init(&md);
+      sha384_process(&md, (unsigned char*)tests[i].msg, (unsigned long)strlen(tests[i].msg));
+      sha384_done(&md, tmp);
+      if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "SHA384", i)) {
+         return CRYPT_FAIL_TESTVECTOR;
+      }
+  }
+  return CRYPT_OK;
+ #endif
+}
+
+#endif /* defined(LTC_SHA384) && defined(LTC_SHA512) */
+
+/* ref:         HEAD -> develop */
+/* git commit:  a1f6312416ef6cd183ee62db58b640dc2d7ec1f4 */
+/* commit time: 2019-09-04 13:44:47 +0200 */

+ 313 - 0
libtomcrypt.mod/libtomcrypt/src/hashes/sha2/sha512.c

@@ -0,0 +1,313 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ */
+#include "tomcrypt_private.h"
+
+/**
+   @param sha512.c
+   LTC_SHA512 by Tom St Denis
+*/
+
+#ifdef LTC_SHA512
+
+const struct ltc_hash_descriptor sha512_desc =
+{
+    "sha512",
+    5,
+    64,
+    128,
+
+    /* OID */
+   { 2, 16, 840, 1, 101, 3, 4, 2, 3,  },
+   9,
+
+    &sha512_init,
+    &sha512_process,
+    &sha512_done,
+    &sha512_test,
+    NULL
+};
+
+/* the K array */
+static const ulong64 K[80] = {
+CONST64(0x428a2f98d728ae22), CONST64(0x7137449123ef65cd),
+CONST64(0xb5c0fbcfec4d3b2f), CONST64(0xe9b5dba58189dbbc),
+CONST64(0x3956c25bf348b538), CONST64(0x59f111f1b605d019),
+CONST64(0x923f82a4af194f9b), CONST64(0xab1c5ed5da6d8118),
+CONST64(0xd807aa98a3030242), CONST64(0x12835b0145706fbe),
+CONST64(0x243185be4ee4b28c), CONST64(0x550c7dc3d5ffb4e2),
+CONST64(0x72be5d74f27b896f), CONST64(0x80deb1fe3b1696b1),
+CONST64(0x9bdc06a725c71235), CONST64(0xc19bf174cf692694),
+CONST64(0xe49b69c19ef14ad2), CONST64(0xefbe4786384f25e3),
+CONST64(0x0fc19dc68b8cd5b5), CONST64(0x240ca1cc77ac9c65),
+CONST64(0x2de92c6f592b0275), CONST64(0x4a7484aa6ea6e483),
+CONST64(0x5cb0a9dcbd41fbd4), CONST64(0x76f988da831153b5),
+CONST64(0x983e5152ee66dfab), CONST64(0xa831c66d2db43210),
+CONST64(0xb00327c898fb213f), CONST64(0xbf597fc7beef0ee4),
+CONST64(0xc6e00bf33da88fc2), CONST64(0xd5a79147930aa725),
+CONST64(0x06ca6351e003826f), CONST64(0x142929670a0e6e70),
+CONST64(0x27b70a8546d22ffc), CONST64(0x2e1b21385c26c926),
+CONST64(0x4d2c6dfc5ac42aed), CONST64(0x53380d139d95b3df),
+CONST64(0x650a73548baf63de), CONST64(0x766a0abb3c77b2a8),
+CONST64(0x81c2c92e47edaee6), CONST64(0x92722c851482353b),
+CONST64(0xa2bfe8a14cf10364), CONST64(0xa81a664bbc423001),
+CONST64(0xc24b8b70d0f89791), CONST64(0xc76c51a30654be30),
+CONST64(0xd192e819d6ef5218), CONST64(0xd69906245565a910),
+CONST64(0xf40e35855771202a), CONST64(0x106aa07032bbd1b8),
+CONST64(0x19a4c116b8d2d0c8), CONST64(0x1e376c085141ab53),
+CONST64(0x2748774cdf8eeb99), CONST64(0x34b0bcb5e19b48a8),
+CONST64(0x391c0cb3c5c95a63), CONST64(0x4ed8aa4ae3418acb),
+CONST64(0x5b9cca4f7763e373), CONST64(0x682e6ff3d6b2b8a3),
+CONST64(0x748f82ee5defb2fc), CONST64(0x78a5636f43172f60),
+CONST64(0x84c87814a1f0ab72), CONST64(0x8cc702081a6439ec),
+CONST64(0x90befffa23631e28), CONST64(0xa4506cebde82bde9),
+CONST64(0xbef9a3f7b2c67915), CONST64(0xc67178f2e372532b),
+CONST64(0xca273eceea26619c), CONST64(0xd186b8c721c0c207),
+CONST64(0xeada7dd6cde0eb1e), CONST64(0xf57d4f7fee6ed178),
+CONST64(0x06f067aa72176fba), CONST64(0x0a637dc5a2c898a6),
+CONST64(0x113f9804bef90dae), CONST64(0x1b710b35131c471b),
+CONST64(0x28db77f523047d84), CONST64(0x32caab7b40c72493),
+CONST64(0x3c9ebe0a15c9bebc), CONST64(0x431d67c49c100d4c),
+CONST64(0x4cc5d4becb3e42b6), CONST64(0x597f299cfc657e2a),
+CONST64(0x5fcb6fab3ad6faec), CONST64(0x6c44198c4a475817)
+};
+
+/* Various logical functions */
+#define Ch(x,y,z)       (z ^ (x & (y ^ z)))
+#define Maj(x,y,z)      (((x | y) & z) | (x & y))
+#define S(x, n)         ROR64c(x, n)
+#define R(x, n)         (((x)&CONST64(0xFFFFFFFFFFFFFFFF))>>((ulong64)n))
+#define Sigma0(x)       (S(x, 28) ^ S(x, 34) ^ S(x, 39))
+#define Sigma1(x)       (S(x, 14) ^ S(x, 18) ^ S(x, 41))
+#define Gamma0(x)       (S(x, 1) ^ S(x, 8) ^ R(x, 7))
+#define Gamma1(x)       (S(x, 19) ^ S(x, 61) ^ R(x, 6))
+
+/* compress 1024-bits */
+#ifdef LTC_CLEAN_STACK
+static int _sha512_compress(hash_state * md, const unsigned char *buf)
+#else
+static int  sha512_compress(hash_state * md, const unsigned char *buf)
+#endif
+{
+    ulong64 S[8], W[80], t0, t1;
+    int i;
+
+    /* copy state into S */
+    for (i = 0; i < 8; i++) {
+        S[i] = md->sha512.state[i];
+    }
+
+    /* copy the state into 1024-bits into W[0..15] */
+    for (i = 0; i < 16; i++) {
+        LOAD64H(W[i], buf + (8*i));
+    }
+
+    /* fill W[16..79] */
+    for (i = 16; i < 80; i++) {
+        W[i] = Gamma1(W[i - 2]) + W[i - 7] + Gamma0(W[i - 15]) + W[i - 16];
+    }
+
+    /* Compress */
+#ifdef LTC_SMALL_CODE
+    for (i = 0; i < 80; i++) {
+        t0 = S[7] + Sigma1(S[4]) + Ch(S[4], S[5], S[6]) + K[i] + W[i];
+        t1 = Sigma0(S[0]) + Maj(S[0], S[1], S[2]);
+        S[7] = S[6];
+        S[6] = S[5];
+        S[5] = S[4];
+        S[4] = S[3] + t0;
+        S[3] = S[2];
+        S[2] = S[1];
+        S[1] = S[0];
+        S[0] = t0 + t1;
+    }
+#else
+#define RND(a,b,c,d,e,f,g,h,i)                    \
+     t0 = h + Sigma1(e) + Ch(e, f, g) + K[i] + W[i];   \
+     t1 = Sigma0(a) + Maj(a, b, c);                  \
+     d += t0;                                        \
+     h  = t0 + t1;
+
+    for (i = 0; i < 80; i += 8) {
+        RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],i+0);
+        RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],i+1);
+        RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],i+2);
+        RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],i+3);
+        RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],i+4);
+        RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],i+5);
+        RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],i+6);
+        RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],i+7);
+    }
+#endif
+
+
+    /* feedback */
+    for (i = 0; i < 8; i++) {
+        md->sha512.state[i] = md->sha512.state[i] + S[i];
+    }
+
+    return CRYPT_OK;
+}
+
+/* compress 1024-bits */
+#ifdef LTC_CLEAN_STACK
+static int sha512_compress(hash_state * md, const unsigned char *buf)
+{
+    int err;
+    err = _sha512_compress(md, buf);
+    burn_stack(sizeof(ulong64) * 90 + sizeof(int));
+    return err;
+}
+#endif
+
+/**
+   Initialize the hash state
+   @param md   The hash state you wish to initialize
+   @return CRYPT_OK if successful
+*/
+int sha512_init(hash_state * md)
+{
+    LTC_ARGCHK(md != NULL);
+    md->sha512.curlen = 0;
+    md->sha512.length = 0;
+    md->sha512.state[0] = CONST64(0x6a09e667f3bcc908);
+    md->sha512.state[1] = CONST64(0xbb67ae8584caa73b);
+    md->sha512.state[2] = CONST64(0x3c6ef372fe94f82b);
+    md->sha512.state[3] = CONST64(0xa54ff53a5f1d36f1);
+    md->sha512.state[4] = CONST64(0x510e527fade682d1);
+    md->sha512.state[5] = CONST64(0x9b05688c2b3e6c1f);
+    md->sha512.state[6] = CONST64(0x1f83d9abfb41bd6b);
+    md->sha512.state[7] = CONST64(0x5be0cd19137e2179);
+    return CRYPT_OK;
+}
+
+/**
+   Process a block of memory though the hash
+   @param md     The hash state
+   @param in     The data to hash
+   @param inlen  The length of the data (octets)
+   @return CRYPT_OK if successful
+*/
+HASH_PROCESS(sha512_process, sha512_compress, sha512, 128)
+
+/**
+   Terminate the hash to get the digest
+   @param md  The hash state
+   @param out [out] The destination of the hash (64 bytes)
+   @return CRYPT_OK if successful
+*/
+int sha512_done(hash_state * md, unsigned char *out)
+{
+    int i;
+
+    LTC_ARGCHK(md  != NULL);
+    LTC_ARGCHK(out != NULL);
+
+    if (md->sha512.curlen >= sizeof(md->sha512.buf)) {
+       return CRYPT_INVALID_ARG;
+    }
+
+    /* increase the length of the message */
+    md->sha512.length += md->sha512.curlen * CONST64(8);
+
+    /* append the '1' bit */
+    md->sha512.buf[md->sha512.curlen++] = (unsigned char)0x80;
+
+    /* if the length is currently above 112 bytes we append zeros
+     * then compress.  Then we can fall back to padding zeros and length
+     * encoding like normal.
+     */
+    if (md->sha512.curlen > 112) {
+        while (md->sha512.curlen < 128) {
+            md->sha512.buf[md->sha512.curlen++] = (unsigned char)0;
+        }
+        sha512_compress(md, md->sha512.buf);
+        md->sha512.curlen = 0;
+    }
+
+    /* pad upto 120 bytes of zeroes
+     * note: that from 112 to 120 is the 64 MSB of the length.  We assume that you won't hash
+     * > 2^64 bits of data... :-)
+     */
+    while (md->sha512.curlen < 120) {
+        md->sha512.buf[md->sha512.curlen++] = (unsigned char)0;
+    }
+
+    /* store length */
+    STORE64H(md->sha512.length, md->sha512.buf+120);
+    sha512_compress(md, md->sha512.buf);
+
+    /* copy output */
+    for (i = 0; i < 8; i++) {
+        STORE64H(md->sha512.state[i], out+(8*i));
+    }
+#ifdef LTC_CLEAN_STACK
+    zeromem(md, sizeof(hash_state));
+#endif
+    return CRYPT_OK;
+}
+
+/**
+  Self-test the hash
+  @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled
+*/
+int  sha512_test(void)
+{
+ #ifndef LTC_TEST
+    return CRYPT_NOP;
+ #else
+  static const struct {
+      const char *msg;
+      unsigned char hash[64];
+  } tests[] = {
+    { "abc",
+     { 0xdd, 0xaf, 0x35, 0xa1, 0x93, 0x61, 0x7a, 0xba,
+       0xcc, 0x41, 0x73, 0x49, 0xae, 0x20, 0x41, 0x31,
+       0x12, 0xe6, 0xfa, 0x4e, 0x89, 0xa9, 0x7e, 0xa2,
+       0x0a, 0x9e, 0xee, 0xe6, 0x4b, 0x55, 0xd3, 0x9a,
+       0x21, 0x92, 0x99, 0x2a, 0x27, 0x4f, 0xc1, 0xa8,
+       0x36, 0xba, 0x3c, 0x23, 0xa3, 0xfe, 0xeb, 0xbd,
+       0x45, 0x4d, 0x44, 0x23, 0x64, 0x3c, 0xe8, 0x0e,
+       0x2a, 0x9a, 0xc9, 0x4f, 0xa5, 0x4c, 0xa4, 0x9f }
+    },
+    { "abcdefghbcdefghicdefghijdefghijkefghijklfghijklmghijklmnhijklmnoijklmnopjklmnopqklmnopqrlmnopqrsmnopqrstnopqrstu",
+     { 0x8e, 0x95, 0x9b, 0x75, 0xda, 0xe3, 0x13, 0xda,
+       0x8c, 0xf4, 0xf7, 0x28, 0x14, 0xfc, 0x14, 0x3f,
+       0x8f, 0x77, 0x79, 0xc6, 0xeb, 0x9f, 0x7f, 0xa1,
+       0x72, 0x99, 0xae, 0xad, 0xb6, 0x88, 0x90, 0x18,
+       0x50, 0x1d, 0x28, 0x9e, 0x49, 0x00, 0xf7, 0xe4,
+       0x33, 0x1b, 0x99, 0xde, 0xc4, 0xb5, 0x43, 0x3a,
+       0xc7, 0xd3, 0x29, 0xee, 0xb6, 0xdd, 0x26, 0x54,
+       0x5e, 0x96, 0xe5, 0x5b, 0x87, 0x4b, 0xe9, 0x09 }
+    },
+  };
+
+  int i;
+  unsigned char tmp[64];
+  hash_state md;
+
+  for (i = 0; i < (int)(sizeof(tests) / sizeof(tests[0])); i++) {
+      sha512_init(&md);
+      sha512_process(&md, (unsigned char *)tests[i].msg, (unsigned long)strlen(tests[i].msg));
+      sha512_done(&md, tmp);
+      if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "SHA512", i)) {
+         return CRYPT_FAIL_TESTVECTOR;
+      }
+  }
+  return CRYPT_OK;
+  #endif
+}
+
+#endif
+
+
+
+
+/* ref:         HEAD -> develop */
+/* git commit:  a1f6312416ef6cd183ee62db58b640dc2d7ec1f4 */
+/* commit time: 2019-09-04 13:44:47 +0200 */

+ 130 - 0
libtomcrypt.mod/libtomcrypt/src/hashes/sha2/sha512_224.c

@@ -0,0 +1,130 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ */
+/**
+   @param sha512_224.c
+   SHA512/224 hash included in sha512.c
+*/
+
+#include "tomcrypt_private.h"
+
+#if defined(LTC_SHA512_224) && defined(LTC_SHA512)
+
+const struct ltc_hash_descriptor sha512_224_desc =
+{
+    "sha512-224",
+    15,
+    28,
+    128,
+
+    /* OID */
+   { 2, 16, 840, 1, 101, 3, 4, 2, 5,  },
+   9,
+
+    &sha512_224_init,
+    &sha512_process,
+    &sha512_224_done,
+    &sha512_224_test,
+    NULL
+};
+
+/**
+   Initialize the hash state
+   @param md   The hash state you wish to initialize
+   @return CRYPT_OK if successful
+*/
+int sha512_224_init(hash_state * md)
+{
+    LTC_ARGCHK(md != NULL);
+
+    md->sha512.curlen = 0;
+    md->sha512.length = 0;
+    md->sha512.state[0] = CONST64(0x8C3D37C819544DA2);
+    md->sha512.state[1] = CONST64(0x73E1996689DCD4D6);
+    md->sha512.state[2] = CONST64(0x1DFAB7AE32FF9C82);
+    md->sha512.state[3] = CONST64(0x679DD514582F9FCF);
+    md->sha512.state[4] = CONST64(0x0F6D2B697BD44DA8);
+    md->sha512.state[5] = CONST64(0x77E36F7304C48942);
+    md->sha512.state[6] = CONST64(0x3F9D85A86A1D36C8);
+    md->sha512.state[7] = CONST64(0x1112E6AD91D692A1);
+    return CRYPT_OK;
+}
+
+/**
+   Terminate the hash to get the digest
+   @param md  The hash state
+   @param out [out] The destination of the hash (48 bytes)
+   @return CRYPT_OK if successful
+*/
+int sha512_224_done(hash_state * md, unsigned char *out)
+{
+   unsigned char buf[64];
+
+   LTC_ARGCHK(md  != NULL);
+   LTC_ARGCHK(out != NULL);
+
+    if (md->sha512.curlen >= sizeof(md->sha512.buf)) {
+       return CRYPT_INVALID_ARG;
+    }
+
+   sha512_done(md, buf);
+   XMEMCPY(out, buf, 28);
+#ifdef LTC_CLEAN_STACK
+   zeromem(buf, sizeof(buf));
+#endif
+   return CRYPT_OK;
+}
+
+/**
+  Self-test the hash
+  @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled
+*/
+int  sha512_224_test(void)
+{
+ #ifndef LTC_TEST
+    return CRYPT_NOP;
+ #else
+  static const struct {
+      const char *msg;
+      unsigned char hash[28];
+  } tests[] = {
+    { "abc",
+      { 0x46, 0x34, 0x27, 0x0F, 0x70, 0x7B, 0x6A, 0x54,
+        0xDA, 0xAE, 0x75, 0x30, 0x46, 0x08, 0x42, 0xE2,
+        0x0E, 0x37, 0xED, 0x26, 0x5C, 0xEE, 0xE9, 0xA4,
+        0x3E, 0x89, 0x24, 0xAA }
+    },
+    { "abcdefghbcdefghicdefghijdefghijkefghijklfghijklmghijklmnhijklmnoijklmnopjklmnopqklmnopqrlmnopqrsmnopqrstnopqrstu",
+      { 0x23, 0xFE, 0xC5, 0xBB, 0x94, 0xD6, 0x0B, 0x23,
+        0x30, 0x81, 0x92, 0x64, 0x0B, 0x0C, 0x45, 0x33,
+        0x35, 0xD6, 0x64, 0x73, 0x4F, 0xE4, 0x0E, 0x72,
+        0x68, 0x67, 0x4A, 0xF9 }
+    },
+  };
+
+  int i;
+  unsigned char tmp[28];
+  hash_state md;
+
+  for (i = 0; i < (int)(sizeof(tests) / sizeof(tests[0])); i++) {
+      sha512_224_init(&md);
+      sha512_224_process(&md, (unsigned char*)tests[i].msg, (unsigned long)strlen(tests[i].msg));
+      sha512_224_done(&md, tmp);
+      if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "SHA512-224", i)) {
+         return CRYPT_FAIL_TESTVECTOR;
+      }
+  }
+  return CRYPT_OK;
+ #endif
+}
+
+#endif /* defined(LTC_SHA384) && defined(LTC_SHA512) */
+
+/* ref:         HEAD -> develop */
+/* git commit:  a1f6312416ef6cd183ee62db58b640dc2d7ec1f4 */
+/* commit time: 2019-09-04 13:44:47 +0200 */

+ 130 - 0
libtomcrypt.mod/libtomcrypt/src/hashes/sha2/sha512_256.c

@@ -0,0 +1,130 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ */
+/**
+   @param sha512_256.c
+   SHA512/256 hash included in sha512.c
+*/
+
+#include "tomcrypt_private.h"
+
+#if defined(LTC_SHA512_256) && defined(LTC_SHA512)
+
+const struct ltc_hash_descriptor sha512_256_desc =
+{
+    "sha512-256",
+    16,
+    32,
+    128,
+
+    /* OID */
+   { 2, 16, 840, 1, 101, 3, 4, 2, 6,  },
+   9,
+
+    &sha512_256_init,
+    &sha512_process,
+    &sha512_256_done,
+    &sha512_256_test,
+    NULL
+};
+
+/**
+   Initialize the hash state
+   @param md   The hash state you wish to initialize
+   @return CRYPT_OK if successful
+*/
+int sha512_256_init(hash_state * md)
+{
+    LTC_ARGCHK(md != NULL);
+
+    md->sha512.curlen = 0;
+    md->sha512.length = 0;
+    md->sha512.state[0] = CONST64(0x22312194FC2BF72C);
+    md->sha512.state[1] = CONST64(0x9F555FA3C84C64C2);
+    md->sha512.state[2] = CONST64(0x2393B86B6F53B151);
+    md->sha512.state[3] = CONST64(0x963877195940EABD);
+    md->sha512.state[4] = CONST64(0x96283EE2A88EFFE3);
+    md->sha512.state[5] = CONST64(0xBE5E1E2553863992);
+    md->sha512.state[6] = CONST64(0x2B0199FC2C85B8AA);
+    md->sha512.state[7] = CONST64(0x0EB72DDC81C52CA2);
+    return CRYPT_OK;
+}
+
+/**
+   Terminate the hash to get the digest
+   @param md  The hash state
+   @param out [out] The destination of the hash (48 bytes)
+   @return CRYPT_OK if successful
+*/
+int sha512_256_done(hash_state * md, unsigned char *out)
+{
+   unsigned char buf[64];
+
+   LTC_ARGCHK(md  != NULL);
+   LTC_ARGCHK(out != NULL);
+
+    if (md->sha512.curlen >= sizeof(md->sha512.buf)) {
+       return CRYPT_INVALID_ARG;
+    }
+
+   sha512_done(md, buf);
+   XMEMCPY(out, buf, 32);
+#ifdef LTC_CLEAN_STACK
+   zeromem(buf, sizeof(buf));
+#endif
+   return CRYPT_OK;
+}
+
+/**
+  Self-test the hash
+  @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled
+*/
+int  sha512_256_test(void)
+{
+ #ifndef LTC_TEST
+    return CRYPT_NOP;
+ #else
+  static const struct {
+      const char *msg;
+      unsigned char hash[32];
+  } tests[] = {
+    { "abc",
+      { 0x53, 0x04, 0x8E, 0x26, 0x81, 0x94, 0x1E, 0xF9,
+        0x9B, 0x2E, 0x29, 0xB7, 0x6B, 0x4C, 0x7D, 0xAB,
+        0xE4, 0xC2, 0xD0, 0xC6, 0x34, 0xFC, 0x6D, 0x46,
+        0xE0, 0xE2, 0xF1, 0x31, 0x07, 0xE7, 0xAF, 0x23 }
+    },
+    { "abcdefghbcdefghicdefghijdefghijkefghijklfghijklmghijklmnhijklmnoijklmnopjklmnopqklmnopqrlmnopqrsmnopqrstnopqrstu",
+      { 0x39, 0x28, 0xE1, 0x84, 0xFB, 0x86, 0x90, 0xF8,
+        0x40, 0xDA, 0x39, 0x88, 0x12, 0x1D, 0x31, 0xBE,
+        0x65, 0xCB, 0x9D, 0x3E, 0xF8, 0x3E, 0xE6, 0x14,
+        0x6F, 0xEA, 0xC8, 0x61, 0xE1, 0x9B, 0x56, 0x3A }
+    },
+  };
+
+  int i;
+  unsigned char tmp[32];
+  hash_state md;
+
+  for (i = 0; i < (int)(sizeof(tests) / sizeof(tests[0])); i++) {
+      sha512_256_init(&md);
+      sha512_256_process(&md, (unsigned char*)tests[i].msg, (unsigned long)strlen(tests[i].msg));
+      sha512_256_done(&md, tmp);
+      if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "SHA512-265", i)) {
+         return CRYPT_FAIL_TESTVECTOR;
+      }
+  }
+  return CRYPT_OK;
+ #endif
+}
+
+#endif /* defined(LTC_SHA384) && defined(LTC_SHA512) */
+
+/* ref:         HEAD -> develop */
+/* git commit:  a1f6312416ef6cd183ee62db58b640dc2d7ec1f4 */
+/* commit time: 2019-09-04 13:44:47 +0200 */

+ 388 - 0
libtomcrypt.mod/libtomcrypt/src/hashes/sha3.c

@@ -0,0 +1,388 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ */
+
+/* based on https://github.com/brainhub/SHA3IUF (public domain) */
+
+#include "tomcrypt_private.h"
+
+#ifdef LTC_SHA3
+
+const struct ltc_hash_descriptor sha3_224_desc =
+{
+   "sha3-224",                  /* name of hash */
+   17,                          /* internal ID */
+   28,                          /* Size of digest in octets */
+   144,                         /* Input block size in octets */
+   { 2,16,840,1,101,3,4,2,7 },  /* ASN.1 OID */
+   9,                           /* Length OID */
+   &sha3_224_init,
+   &sha3_process,
+   &sha3_done,
+   &sha3_224_test,
+   NULL
+};
+
+const struct ltc_hash_descriptor sha3_256_desc =
+{
+   "sha3-256",                  /* name of hash */
+   18,                          /* internal ID */
+   32,                          /* Size of digest in octets */
+   136,                         /* Input block size in octets */
+   { 2,16,840,1,101,3,4,2,8 },  /* ASN.1 OID */
+   9,                           /* Length OID */
+   &sha3_256_init,
+   &sha3_process,
+   &sha3_done,
+   &sha3_256_test,
+   NULL
+};
+
+const struct ltc_hash_descriptor sha3_384_desc =
+{
+   "sha3-384",                  /* name of hash */
+   19,                          /* internal ID */
+   48,                          /* Size of digest in octets */
+   104,                         /* Input block size in octets */
+   { 2,16,840,1,101,3,4,2,9 },  /* ASN.1 OID */
+   9,                           /* Length OID */
+   &sha3_384_init,
+   &sha3_process,
+   &sha3_done,
+   &sha3_384_test,
+   NULL
+};
+
+const struct ltc_hash_descriptor sha3_512_desc =
+{
+   "sha3-512",                  /* name of hash */
+   20,                          /* internal ID */
+   64,                          /* Size of digest in octets */
+   72,                          /* Input block size in octets */
+   { 2,16,840,1,101,3,4,2,10 }, /* ASN.1 OID */
+   9,                           /* Length OID */
+   &sha3_512_init,
+   &sha3_process,
+   &sha3_done,
+   &sha3_512_test,
+   NULL
+};
+#endif
+
+#ifdef LTC_KECCAK
+const struct ltc_hash_descriptor keccak_224_desc =
+{
+   "keccak224",                 /* name of hash */
+   29,                          /* internal ID */
+   28,                          /* Size of digest in octets */
+   144,                         /* Input block size in octets */
+   { 0 }, 0,                    /* no ASN.1 OID */
+   &sha3_224_init,
+   &sha3_process,
+   &keccak_done,
+   &keccak_224_test,
+   NULL
+};
+
+const struct ltc_hash_descriptor keccak_256_desc =
+{
+   "keccak256",                 /* name of hash */
+   30,                          /* internal ID */
+   32,                          /* Size of digest in octets */
+   136,                         /* Input block size in octets */
+   { 0 }, 0,                    /* no ASN.1 OID */
+   &sha3_256_init,
+   &sha3_process,
+   &keccak_done,
+   &keccak_256_test,
+   NULL
+};
+
+const struct ltc_hash_descriptor keccak_384_desc =
+{
+   "keccak384",                 /* name of hash */
+   31,                          /* internal ID */
+   48,                          /* Size of digest in octets */
+   104,                         /* Input block size in octets */
+   { 0 }, 0,                    /* no ASN.1 OID */
+   &sha3_384_init,
+   &sha3_process,
+   &keccak_done,
+   &keccak_384_test,
+   NULL
+};
+
+const struct ltc_hash_descriptor keccak_512_desc =
+{
+   "keccak512",                 /* name of hash */
+   32,                          /* internal ID */
+   64,                          /* Size of digest in octets */
+   72,                          /* Input block size in octets */
+   { 0 }, 0,                    /* no ASN.1 OID */
+   &sha3_512_init,
+   &sha3_process,
+   &keccak_done,
+   &keccak_512_test,
+   NULL
+};
+#endif
+
+#if defined(LTC_SHA3) || defined(LTC_KECCAK)
+
+#define SHA3_KECCAK_SPONGE_WORDS 25 /* 1600 bits > 200 bytes > 25 x ulong64 */
+#define SHA3_KECCAK_ROUNDS 24
+
+static const ulong64 keccakf_rndc[24] = {
+   CONST64(0x0000000000000001), CONST64(0x0000000000008082),
+   CONST64(0x800000000000808a), CONST64(0x8000000080008000),
+   CONST64(0x000000000000808b), CONST64(0x0000000080000001),
+   CONST64(0x8000000080008081), CONST64(0x8000000000008009),
+   CONST64(0x000000000000008a), CONST64(0x0000000000000088),
+   CONST64(0x0000000080008009), CONST64(0x000000008000000a),
+   CONST64(0x000000008000808b), CONST64(0x800000000000008b),
+   CONST64(0x8000000000008089), CONST64(0x8000000000008003),
+   CONST64(0x8000000000008002), CONST64(0x8000000000000080),
+   CONST64(0x000000000000800a), CONST64(0x800000008000000a),
+   CONST64(0x8000000080008081), CONST64(0x8000000000008080),
+   CONST64(0x0000000080000001), CONST64(0x8000000080008008)
+};
+
+static const unsigned keccakf_rotc[24] = {
+   1, 3, 6, 10, 15, 21, 28, 36, 45, 55, 2, 14, 27, 41, 56, 8, 25, 43, 62, 18, 39, 61, 20, 44
+};
+
+static const unsigned keccakf_piln[24] = {
+   10, 7, 11, 17, 18, 3, 5, 16, 8, 21, 24, 4, 15, 23, 19, 13, 12, 2, 20, 14, 22, 9, 6, 1
+};
+
+static void keccakf(ulong64 s[25])
+{
+   int i, j, round;
+   ulong64 t, bc[5];
+
+   for(round = 0; round < SHA3_KECCAK_ROUNDS; round++) {
+      /* Theta */
+      for(i = 0; i < 5; i++) {
+         bc[i] = s[i] ^ s[i + 5] ^ s[i + 10] ^ s[i + 15] ^ s[i + 20];
+      }
+      for(i = 0; i < 5; i++) {
+         t = bc[(i + 4) % 5] ^ ROL64(bc[(i + 1) % 5], 1);
+         for(j = 0; j < 25; j += 5) {
+            s[j + i] ^= t;
+         }
+      }
+      /* Rho Pi */
+      t = s[1];
+      for(i = 0; i < 24; i++) {
+         j = keccakf_piln[i];
+         bc[0] = s[j];
+         s[j] = ROL64(t, keccakf_rotc[i]);
+         t = bc[0];
+      }
+      /* Chi */
+      for(j = 0; j < 25; j += 5) {
+         for(i = 0; i < 5; i++) {
+            bc[i] = s[j + i];
+         }
+         for(i = 0; i < 5; i++) {
+            s[j + i] ^= (~bc[(i + 1) % 5]) & bc[(i + 2) % 5];
+         }
+      }
+      /* Iota */
+      s[0] ^= keccakf_rndc[round];
+   }
+}
+
+static LTC_INLINE int _done(hash_state *md, unsigned char *hash, ulong64 pad)
+{
+   unsigned i;
+
+   LTC_ARGCHK(md   != NULL);
+   LTC_ARGCHK(hash != NULL);
+
+   md->sha3.s[md->sha3.word_index] ^= (md->sha3.saved ^ (pad << (md->sha3.byte_index * 8)));
+   md->sha3.s[SHA3_KECCAK_SPONGE_WORDS - md->sha3.capacity_words - 1] ^= CONST64(0x8000000000000000);
+   keccakf(md->sha3.s);
+
+   /* store sha3.s[] as little-endian bytes into sha3.sb */
+   for(i = 0; i < SHA3_KECCAK_SPONGE_WORDS; i++) {
+      STORE64L(md->sha3.s[i], md->sha3.sb + i * 8);
+   }
+
+   XMEMCPY(hash, md->sha3.sb, md->sha3.capacity_words * 4);
+   return CRYPT_OK;
+}
+
+/* Public Inteface */
+
+int sha3_224_init(hash_state *md)
+{
+   LTC_ARGCHK(md != NULL);
+   XMEMSET(&md->sha3, 0, sizeof(md->sha3));
+   md->sha3.capacity_words = 2 * 224 / (8 * sizeof(ulong64));
+   return CRYPT_OK;
+}
+
+int sha3_256_init(hash_state *md)
+{
+   LTC_ARGCHK(md != NULL);
+   XMEMSET(&md->sha3, 0, sizeof(md->sha3));
+   md->sha3.capacity_words = 2 * 256 / (8 * sizeof(ulong64));
+   return CRYPT_OK;
+}
+
+int sha3_384_init(hash_state *md)
+{
+   LTC_ARGCHK(md != NULL);
+   XMEMSET(&md->sha3, 0, sizeof(md->sha3));
+   md->sha3.capacity_words = 2 * 384 / (8 * sizeof(ulong64));
+   return CRYPT_OK;
+}
+
+int sha3_512_init(hash_state *md)
+{
+   LTC_ARGCHK(md != NULL);
+   XMEMSET(&md->sha3, 0, sizeof(md->sha3));
+   md->sha3.capacity_words = 2 * 512 / (8 * sizeof(ulong64));
+   return CRYPT_OK;
+}
+
+#ifdef LTC_SHA3
+int sha3_shake_init(hash_state *md, int num)
+{
+   LTC_ARGCHK(md != NULL);
+   if (num != 128 && num != 256) return CRYPT_INVALID_ARG;
+   XMEMSET(&md->sha3, 0, sizeof(md->sha3));
+   md->sha3.capacity_words = (unsigned short)(2 * num / (8 * sizeof(ulong64)));
+   return CRYPT_OK;
+}
+#endif
+
+int sha3_process(hash_state *md, const unsigned char *in, unsigned long inlen)
+{
+   /* 0...7 -- how much is needed to have a word */
+   unsigned old_tail = (8 - md->sha3.byte_index) & 7;
+
+   unsigned long words;
+   unsigned tail;
+   unsigned long i;
+
+   if (inlen == 0) return CRYPT_OK; /* nothing to do */
+   LTC_ARGCHK(md != NULL);
+   LTC_ARGCHK(in != NULL);
+
+   if(inlen < old_tail) {       /* have no complete word or haven't started the word yet */
+      while (inlen--) md->sha3.saved |= (ulong64) (*(in++)) << ((md->sha3.byte_index++) * 8);
+      return CRYPT_OK;
+   }
+
+   if(old_tail) {               /* will have one word to process */
+      inlen -= old_tail;
+      while (old_tail--) md->sha3.saved |= (ulong64) (*(in++)) << ((md->sha3.byte_index++) * 8);
+      /* now ready to add saved to the sponge */
+      md->sha3.s[md->sha3.word_index] ^= md->sha3.saved;
+      md->sha3.byte_index = 0;
+      md->sha3.saved = 0;
+      if(++md->sha3.word_index == (SHA3_KECCAK_SPONGE_WORDS - md->sha3.capacity_words)) {
+         keccakf(md->sha3.s);
+         md->sha3.word_index = 0;
+      }
+   }
+
+   /* now work in full words directly from input */
+   words = inlen / sizeof(ulong64);
+   tail = inlen - words * sizeof(ulong64);
+
+   for(i = 0; i < words; i++, in += sizeof(ulong64)) {
+      ulong64 t;
+      LOAD64L(t, in);
+      md->sha3.s[md->sha3.word_index] ^= t;
+      if(++md->sha3.word_index == (SHA3_KECCAK_SPONGE_WORDS - md->sha3.capacity_words)) {
+         keccakf(md->sha3.s);
+         md->sha3.word_index = 0;
+      }
+   }
+
+   /* finally, save the partial word */
+   while (tail--) {
+      md->sha3.saved |= (ulong64) (*(in++)) << ((md->sha3.byte_index++) * 8);
+   }
+   return CRYPT_OK;
+}
+
+#ifdef LTC_SHA3
+int sha3_done(hash_state *md, unsigned char *out)
+{
+   return _done(md, out, CONST64(0x06));
+}
+#endif
+
+#ifdef LTC_KECCAK
+int keccak_done(hash_state *md, unsigned char *out)
+{
+   return _done(md, out, CONST64(0x01));
+}
+#endif
+
+#ifdef LTC_SHA3
+int sha3_shake_done(hash_state *md, unsigned char *out, unsigned long outlen)
+{
+   /* IMPORTANT NOTE: sha3_shake_done can be called many times */
+   unsigned long idx;
+   unsigned i;
+
+   if (outlen == 0) return CRYPT_OK; /* nothing to do */
+   LTC_ARGCHK(md  != NULL);
+   LTC_ARGCHK(out != NULL);
+
+   if (!md->sha3.xof_flag) {
+      /* shake_xof operation must be done only once */
+      md->sha3.s[md->sha3.word_index] ^= (md->sha3.saved ^ (CONST64(0x1F) << (md->sha3.byte_index * 8)));
+      md->sha3.s[SHA3_KECCAK_SPONGE_WORDS - md->sha3.capacity_words - 1] ^= CONST64(0x8000000000000000);
+      keccakf(md->sha3.s);
+      /* store sha3.s[] as little-endian bytes into sha3.sb */
+      for(i = 0; i < SHA3_KECCAK_SPONGE_WORDS; i++) {
+         STORE64L(md->sha3.s[i], md->sha3.sb + i * 8);
+      }
+      md->sha3.byte_index = 0;
+      md->sha3.xof_flag = 1;
+   }
+
+   for (idx = 0; idx < outlen; idx++) {
+      if(md->sha3.byte_index >= (SHA3_KECCAK_SPONGE_WORDS - md->sha3.capacity_words) * 8) {
+         keccakf(md->sha3.s);
+         /* store sha3.s[] as little-endian bytes into sha3.sb */
+         for(i = 0; i < SHA3_KECCAK_SPONGE_WORDS; i++) {
+            STORE64L(md->sha3.s[i], md->sha3.sb + i * 8);
+         }
+         md->sha3.byte_index = 0;
+      }
+      out[idx] = md->sha3.sb[md->sha3.byte_index++];
+   }
+   return CRYPT_OK;
+}
+
+int sha3_shake_memory(int num, const unsigned char *in, unsigned long inlen, unsigned char *out, const unsigned long *outlen)
+{
+   hash_state md;
+   int err;
+   LTC_ARGCHK(in  != NULL);
+   LTC_ARGCHK(out != NULL);
+   LTC_ARGCHK(outlen != NULL);
+   if ((err = sha3_shake_init(&md, num))          != CRYPT_OK) return err;
+   if ((err = sha3_shake_process(&md, in, inlen)) != CRYPT_OK) return err;
+   if ((err = sha3_shake_done(&md, out, *outlen)) != CRYPT_OK) return err;
+   return CRYPT_OK;
+}
+#endif
+
+#endif
+
+/* ref:         HEAD -> develop */
+/* git commit:  a1f6312416ef6cd183ee62db58b640dc2d7ec1f4 */
+/* commit time: 2019-09-04 13:44:47 +0200 */

+ 729 - 0
libtomcrypt.mod/libtomcrypt/src/hashes/sha3_test.c

@@ -0,0 +1,729 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ */
+
+/* based on https://github.com/brainhub/SHA3IUF (public domain) */
+
+#include "tomcrypt_private.h"
+
+#ifdef LTC_SHA3
+
+int sha3_224_test(void)
+{
+#ifndef LTC_TEST
+   return CRYPT_NOP;
+#else
+   unsigned char buf[200], hash[224 / 8];
+   int i;
+   hash_state c;
+   const unsigned char c1 = 0xa3;
+
+   const unsigned char sha3_224_empty[224 / 8] = {
+      0x6b, 0x4e, 0x03, 0x42, 0x36, 0x67, 0xdb, 0xb7,
+      0x3b, 0x6e, 0x15, 0x45, 0x4f, 0x0e, 0xb1, 0xab,
+      0xd4, 0x59, 0x7f, 0x9a, 0x1b, 0x07, 0x8e, 0x3f,
+      0x5b, 0x5a, 0x6b, 0xc7
+   };
+
+   const unsigned char sha3_224_0xa3_200_times[224 / 8] = {
+      0x93, 0x76, 0x81, 0x6a, 0xba, 0x50, 0x3f, 0x72,
+      0xf9, 0x6c, 0xe7, 0xeb, 0x65, 0xac, 0x09, 0x5d,
+      0xee, 0xe3, 0xbe, 0x4b, 0xf9, 0xbb, 0xc2, 0xa1,
+      0xcb, 0x7e, 0x11, 0xe0
+   };
+
+   XMEMSET(buf, c1, sizeof(buf));
+
+   /* SHA3-224 on an empty buffer */
+   sha3_224_init(&c);
+   sha3_done(&c, hash);
+   if (compare_testvector(hash, sizeof(hash), sha3_224_empty, sizeof(sha3_224_empty), "SHA3-224", 0)) {
+      return CRYPT_FAIL_TESTVECTOR;
+   }
+
+   /* SHA3-224 in two steps. [FIPS 202] */
+   sha3_224_init(&c);
+   sha3_process(&c, buf, sizeof(buf) / 2);
+   sha3_process(&c, buf + sizeof(buf) / 2, sizeof(buf) / 2);
+   sha3_done(&c, hash);
+   if (compare_testvector(hash, sizeof(hash), sha3_224_0xa3_200_times, sizeof(sha3_224_0xa3_200_times), "SHA3-224", 1)) {
+      return CRYPT_FAIL_TESTVECTOR;
+   }
+
+   /* SHA3-224 byte-by-byte: 200 steps. [FIPS 202] */
+   i = 200;
+   sha3_224_init(&c);
+   while (i--) {
+       sha3_process(&c, &c1, 1);
+   }
+   sha3_done(&c, hash);
+   if (compare_testvector(hash, sizeof(hash), sha3_224_0xa3_200_times, sizeof(sha3_224_0xa3_200_times), "SHA3-224", 2)) {
+      return CRYPT_FAIL_TESTVECTOR;
+   }
+
+   return CRYPT_OK;
+#endif
+}
+
+int sha3_256_test(void)
+{
+#ifndef LTC_TEST
+   return CRYPT_NOP;
+#else
+   unsigned char buf[200], hash[256 / 8];
+   int i;
+   hash_state c;
+   const unsigned char c1 = 0xa3;
+
+   const unsigned char sha3_256_empty[256 / 8] = {
+      0xa7, 0xff, 0xc6, 0xf8, 0xbf, 0x1e, 0xd7, 0x66,
+      0x51, 0xc1, 0x47, 0x56, 0xa0, 0x61, 0xd6, 0x62,
+      0xf5, 0x80, 0xff, 0x4d, 0xe4, 0x3b, 0x49, 0xfa,
+      0x82, 0xd8, 0x0a, 0x4b, 0x80, 0xf8, 0x43, 0x4a
+   };
+   const unsigned char sha3_256_0xa3_200_times[256 / 8] = {
+      0x79, 0xf3, 0x8a, 0xde, 0xc5, 0xc2, 0x03, 0x07,
+      0xa9, 0x8e, 0xf7, 0x6e, 0x83, 0x24, 0xaf, 0xbf,
+      0xd4, 0x6c, 0xfd, 0x81, 0xb2, 0x2e, 0x39, 0x73,
+      0xc6, 0x5f, 0xa1, 0xbd, 0x9d, 0xe3, 0x17, 0x87
+   };
+
+   XMEMSET(buf, c1, sizeof(buf));
+
+   /* SHA3-256 on an empty buffer */
+   sha3_256_init(&c);
+   sha3_done(&c, hash);
+   if (compare_testvector(hash, sizeof(hash), sha3_256_empty, sizeof(sha3_256_empty), "SHA3-256", 0)) {
+      return CRYPT_FAIL_TESTVECTOR;
+   }
+
+   /* SHA3-256 as a single buffer. [FIPS 202] */
+   sha3_256_init(&c);
+   sha3_process(&c, buf, sizeof(buf));
+   sha3_done(&c, hash);
+   if (compare_testvector(hash, sizeof(hash), sha3_256_0xa3_200_times, sizeof(sha3_256_0xa3_200_times), "SHA3-256", 1)) {
+      return CRYPT_FAIL_TESTVECTOR;
+   }
+
+   /* SHA3-256 in two steps. [FIPS 202] */
+   sha3_256_init(&c);
+   sha3_process(&c, buf, sizeof(buf) / 2);
+   sha3_process(&c, buf + sizeof(buf) / 2, sizeof(buf) / 2);
+   sha3_done(&c, hash);
+   if (compare_testvector(hash, sizeof(hash), sha3_256_0xa3_200_times, sizeof(sha3_256_0xa3_200_times), "SHA3-256", 2)) {
+      return CRYPT_FAIL_TESTVECTOR;
+   }
+
+   /* SHA3-256 byte-by-byte: 200 steps. [FIPS 202] */
+   i = 200;
+   sha3_256_init(&c);
+   while (i--) {
+       sha3_process(&c, &c1, 1);
+   }
+   sha3_done(&c, hash);
+   if (compare_testvector(hash, sizeof(hash), sha3_256_0xa3_200_times, sizeof(sha3_256_0xa3_200_times), "SHA3-256", 3)) {
+      return CRYPT_FAIL_TESTVECTOR;
+   }
+
+   /* SHA3-256 byte-by-byte: 135 bytes. Input from [Keccak]. Output
+    * matched with sha3sum. */
+   sha3_256_init(&c);
+   sha3_process(&c, (unsigned char*)
+           "\xb7\x71\xd5\xce\xf5\xd1\xa4\x1a"
+           "\x93\xd1\x56\x43\xd7\x18\x1d\x2a"
+           "\x2e\xf0\xa8\xe8\x4d\x91\x81\x2f"
+           "\x20\xed\x21\xf1\x47\xbe\xf7\x32"
+           "\xbf\x3a\x60\xef\x40\x67\xc3\x73"
+           "\x4b\x85\xbc\x8c\xd4\x71\x78\x0f"
+           "\x10\xdc\x9e\x82\x91\xb5\x83\x39"
+           "\xa6\x77\xb9\x60\x21\x8f\x71\xe7"
+           "\x93\xf2\x79\x7a\xea\x34\x94\x06"
+           "\x51\x28\x29\x06\x5d\x37\xbb\x55"
+           "\xea\x79\x6f\xa4\xf5\x6f\xd8\x89"
+           "\x6b\x49\xb2\xcd\x19\xb4\x32\x15"
+           "\xad\x96\x7c\x71\x2b\x24\xe5\x03"
+           "\x2d\x06\x52\x32\xe0\x2c\x12\x74"
+           "\x09\xd2\xed\x41\x46\xb9\xd7\x5d"
+           "\x76\x3d\x52\xdb\x98\xd9\x49\xd3"
+           "\xb0\xfe\xd6\xa8\x05\x2f\xbb", 1080 / 8);
+   sha3_done(&c, hash);
+   if(compare_testvector(hash, sizeof(hash),
+           "\xa1\x9e\xee\x92\xbb\x20\x97\xb6"
+           "\x4e\x82\x3d\x59\x77\x98\xaa\x18"
+           "\xbe\x9b\x7c\x73\x6b\x80\x59\xab"
+           "\xfd\x67\x79\xac\x35\xac\x81\xb5", 256 / 8, "SHA3-256", 4)) {
+      return CRYPT_FAIL_TESTVECTOR;
+   }
+
+   return CRYPT_OK;
+#endif
+}
+
+int sha3_384_test(void)
+{
+#ifndef LTC_TEST
+   return CRYPT_NOP;
+#else
+   unsigned char buf[200], hash[384 / 8];
+   int i;
+   hash_state c;
+   const unsigned char c1 = 0xa3;
+
+   const unsigned char sha3_384_0xa3_200_times[384 / 8] = {
+      0x18, 0x81, 0xde, 0x2c, 0xa7, 0xe4, 0x1e, 0xf9,
+      0x5d, 0xc4, 0x73, 0x2b, 0x8f, 0x5f, 0x00, 0x2b,
+      0x18, 0x9c, 0xc1, 0xe4, 0x2b, 0x74, 0x16, 0x8e,
+      0xd1, 0x73, 0x26, 0x49, 0xce, 0x1d, 0xbc, 0xdd,
+      0x76, 0x19, 0x7a, 0x31, 0xfd, 0x55, 0xee, 0x98,
+      0x9f, 0x2d, 0x70, 0x50, 0xdd, 0x47, 0x3e, 0x8f
+   };
+
+   XMEMSET(buf, c1, sizeof(buf));
+
+   /* SHA3-384 as a single buffer. [FIPS 202] */
+   sha3_384_init(&c);
+   sha3_process(&c, buf, sizeof(buf));
+   sha3_done(&c, hash);
+   if (compare_testvector(hash, sizeof(hash), sha3_384_0xa3_200_times, sizeof(sha3_384_0xa3_200_times), "SHA3-384", 0)) {
+      return CRYPT_FAIL_TESTVECTOR;
+   }
+
+   /* SHA3-384 in two steps. [FIPS 202] */
+   sha3_384_init(&c);
+   sha3_process(&c, buf, sizeof(buf) / 2);
+   sha3_process(&c, buf + sizeof(buf) / 2, sizeof(buf) / 2);
+   sha3_done(&c, hash);
+   if (compare_testvector(hash, sizeof(hash), sha3_384_0xa3_200_times, sizeof(sha3_384_0xa3_200_times), "SHA3-384", 1)) {
+      return CRYPT_FAIL_TESTVECTOR;
+   }
+
+   /* SHA3-384 byte-by-byte: 200 steps. [FIPS 202] */
+   i = 200;
+   sha3_384_init(&c);
+   while (i--) {
+       sha3_process(&c, &c1, 1);
+   }
+   sha3_done(&c, hash);
+   if (compare_testvector(hash, sizeof(hash), sha3_384_0xa3_200_times, sizeof(sha3_384_0xa3_200_times), "SHA3-384", 2)) {
+      return CRYPT_FAIL_TESTVECTOR;
+   }
+
+   return CRYPT_OK;
+#endif
+}
+
+int sha3_512_test(void)
+{
+#ifndef LTC_TEST
+   return CRYPT_NOP;
+#else
+   unsigned char buf[200], hash[512 / 8];
+   int i;
+   hash_state c;
+   const unsigned char c1 = 0xa3;
+
+   const unsigned char sha3_512_0xa3_200_times[512 / 8] = {
+      0xe7, 0x6d, 0xfa, 0xd2, 0x20, 0x84, 0xa8, 0xb1,
+      0x46, 0x7f, 0xcf, 0x2f, 0xfa, 0x58, 0x36, 0x1b,
+      0xec, 0x76, 0x28, 0xed, 0xf5, 0xf3, 0xfd, 0xc0,
+      0xe4, 0x80, 0x5d, 0xc4, 0x8c, 0xae, 0xec, 0xa8,
+      0x1b, 0x7c, 0x13, 0xc3, 0x0a, 0xdf, 0x52, 0xa3,
+      0x65, 0x95, 0x84, 0x73, 0x9a, 0x2d, 0xf4, 0x6b,
+      0xe5, 0x89, 0xc5, 0x1c, 0xa1, 0xa4, 0xa8, 0x41,
+      0x6d, 0xf6, 0x54, 0x5a, 0x1c, 0xe8, 0xba, 0x00
+   };
+
+   XMEMSET(buf, c1, sizeof(buf));
+
+   /* SHA3-512 as a single buffer. [FIPS 202] */
+   sha3_512_init(&c);
+   sha3_process(&c, buf, sizeof(buf));
+   sha3_done(&c, hash);
+   if (compare_testvector(hash, sizeof(hash), sha3_512_0xa3_200_times, sizeof(sha3_512_0xa3_200_times), "SHA3-512", 0)) {
+      return CRYPT_FAIL_TESTVECTOR;
+   }
+
+   /* SHA3-512 in two steps. [FIPS 202] */
+   sha3_512_init(&c);
+   sha3_process(&c, buf, sizeof(buf) / 2);
+   sha3_process(&c, buf + sizeof(buf) / 2, sizeof(buf) / 2);
+   sha3_done(&c, hash);
+   if (compare_testvector(hash, sizeof(hash), sha3_512_0xa3_200_times, sizeof(sha3_512_0xa3_200_times), "SHA3-512", 1)) {
+      return CRYPT_FAIL_TESTVECTOR;
+   }
+
+   /* SHA3-512 byte-by-byte: 200 steps. [FIPS 202] */
+   i = 200;
+   sha3_512_init(&c);
+   while (i--) {
+       sha3_process(&c, &c1, 1);
+   }
+   sha3_done(&c, hash);
+   if (compare_testvector(hash, sizeof(hash), sha3_512_0xa3_200_times, sizeof(sha3_512_0xa3_200_times), "SHA3-512", 2)) {
+      return CRYPT_FAIL_TESTVECTOR;
+   }
+
+   return CRYPT_OK;
+#endif
+}
+
+int sha3_shake_test(void)
+{
+#ifndef LTC_TEST
+   return CRYPT_NOP;
+#else
+   unsigned char buf[200], hash[512];
+   int i;
+   hash_state c;
+   const unsigned char c1 = 0xa3;
+   unsigned long len;
+
+   const unsigned char shake256_empty[32] = {
+      0xab, 0x0b, 0xae, 0x31, 0x63, 0x39, 0x89, 0x43,
+      0x04, 0xe3, 0x58, 0x77, 0xb0, 0xc2, 0x8a, 0x9b,
+      0x1f, 0xd1, 0x66, 0xc7, 0x96, 0xb9, 0xcc, 0x25,
+      0x8a, 0x06, 0x4a, 0x8f, 0x57, 0xe2, 0x7f, 0x2a
+   };
+   const unsigned char shake256_0xa3_200_times[32] = {
+      0x6a, 0x1a, 0x9d, 0x78, 0x46, 0x43, 0x6e, 0x4d,
+      0xca, 0x57, 0x28, 0xb6, 0xf7, 0x60, 0xee, 0xf0,
+      0xca, 0x92, 0xbf, 0x0b, 0xe5, 0x61, 0x5e, 0x96,
+      0x95, 0x9d, 0x76, 0x71, 0x97, 0xa0, 0xbe, 0xeb
+   };
+   const unsigned char shake128_empty[32] = {
+      0x43, 0xe4, 0x1b, 0x45, 0xa6, 0x53, 0xf2, 0xa5,
+      0xc4, 0x49, 0x2c, 0x1a, 0xdd, 0x54, 0x45, 0x12,
+      0xdd, 0xa2, 0x52, 0x98, 0x33, 0x46, 0x2b, 0x71,
+      0xa4, 0x1a, 0x45, 0xbe, 0x97, 0x29, 0x0b, 0x6f
+   };
+   const unsigned char shake128_0xa3_200_times[32] = {
+      0x44, 0xc9, 0xfb, 0x35, 0x9f, 0xd5, 0x6a, 0xc0,
+      0xa9, 0xa7, 0x5a, 0x74, 0x3c, 0xff, 0x68, 0x62,
+      0xf1, 0x7d, 0x72, 0x59, 0xab, 0x07, 0x52, 0x16,
+      0xc0, 0x69, 0x95, 0x11, 0x64, 0x3b, 0x64, 0x39
+   };
+
+   XMEMSET(buf, c1, sizeof(buf));
+
+   /* SHAKE256 on an empty buffer */
+   sha3_shake_init(&c, 256);
+   for (i = 0; i < 16; i++) sha3_shake_done(&c, hash, 32); /* get 512 bytes, keep in hash the last 32 */
+   if (compare_testvector(hash, sizeof(shake256_empty), shake256_empty, sizeof(shake256_empty), "SHAKE256", 0)) {
+      return CRYPT_FAIL_TESTVECTOR;
+   }
+
+   /* SHAKE256 via sha3_shake_memory [FIPS 202] */
+   len = 512;
+   sha3_shake_memory(256, buf, sizeof(buf), hash, &len);
+   if (compare_testvector(hash + 480, sizeof(shake256_0xa3_200_times), shake256_0xa3_200_times, sizeof(shake256_0xa3_200_times), "SHAKE256", 1)) {
+      return CRYPT_FAIL_TESTVECTOR;
+   }
+
+   /* SHAKE256 as a single buffer. [FIPS 202] */
+   sha3_shake_init(&c, 256);
+   sha3_shake_process(&c, buf, sizeof(buf));
+   for (i = 0; i < 16; i++) sha3_shake_done(&c, hash, 32); /* get 512 bytes, keep in hash the last 32 */
+   if (compare_testvector(hash, sizeof(shake256_0xa3_200_times), shake256_0xa3_200_times, sizeof(shake256_0xa3_200_times), "SHAKE256", 2)) {
+      return CRYPT_FAIL_TESTVECTOR;
+   }
+
+   /* SHAKE256 in two steps. [FIPS 202] */
+   sha3_shake_init(&c, 256);
+   sha3_shake_process(&c, buf, sizeof(buf) / 2);
+   sha3_shake_process(&c, buf + sizeof(buf) / 2, sizeof(buf) / 2);
+   for (i = 0; i < 16; i++) sha3_shake_done(&c, hash, 32); /* get 512 bytes, keep in hash the last 32 */
+   if (compare_testvector(hash, sizeof(shake256_0xa3_200_times), shake256_0xa3_200_times, sizeof(shake256_0xa3_200_times), "SHAKE256", 3)) {
+      return CRYPT_FAIL_TESTVECTOR;
+   }
+
+   /* SHAKE256 byte-by-byte: 200 steps. [FIPS 202] */
+   i = 200;
+   sha3_shake_init(&c, 256);
+   while (i--) sha3_shake_process(&c, &c1, 1);
+   for (i = 0; i < 16; i++) sha3_shake_done(&c, hash, 32); /* get 512 bytes, keep in hash the last 32 */
+   if (compare_testvector(hash, sizeof(shake256_0xa3_200_times), shake256_0xa3_200_times, sizeof(shake256_0xa3_200_times), "SHAKE256", 4)) {
+      return CRYPT_FAIL_TESTVECTOR;
+   }
+
+   /* SHAKE128 on an empty buffer */
+   sha3_shake_init(&c, 128);
+   for (i = 0; i < 16; i++) sha3_shake_done(&c, hash, 32); /* get 512 bytes, keep in hash the last 32 */
+   if (compare_testvector(hash, sizeof(shake128_empty), shake128_empty, sizeof(shake128_empty), "SHAKE128", 0)) {
+      return CRYPT_FAIL_TESTVECTOR;
+   }
+
+   /* SHAKE128 via sha3_shake_memory [FIPS 202] */
+   len = 512;
+   sha3_shake_memory(128, buf, sizeof(buf), hash, &len);
+   if (compare_testvector(hash + 480, sizeof(shake128_0xa3_200_times), shake128_0xa3_200_times, sizeof(shake128_0xa3_200_times), "SHAKE128", 1)) {
+      return CRYPT_FAIL_TESTVECTOR;
+   }
+
+   /* SHAKE128 as a single buffer. [FIPS 202] */
+   sha3_shake_init(&c, 128);
+   sha3_shake_process(&c, buf, sizeof(buf));
+   for (i = 0; i < 16; i++) sha3_shake_done(&c, hash, 32); /* get 512 bytes, keep in hash the last 32 */
+   if (compare_testvector(hash, sizeof(shake128_0xa3_200_times), shake128_0xa3_200_times, sizeof(shake128_0xa3_200_times), "SHAKE128", 2)) {
+      return CRYPT_FAIL_TESTVECTOR;
+   }
+
+   /* SHAKE128 in two steps. [FIPS 202] */
+   sha3_shake_init(&c, 128);
+   sha3_shake_process(&c, buf, sizeof(buf) / 2);
+   sha3_shake_process(&c, buf + sizeof(buf) / 2, sizeof(buf) / 2);
+   for (i = 0; i < 16; i++) sha3_shake_done(&c, hash, 32); /* get 512 bytes, keep in hash the last 32 */
+   if (compare_testvector(hash, sizeof(shake128_0xa3_200_times), shake128_0xa3_200_times, sizeof(shake128_0xa3_200_times), "SHAKE128", 3)) {
+      return CRYPT_FAIL_TESTVECTOR;
+   }
+
+   /* SHAKE128 byte-by-byte: 200 steps. [FIPS 202] */
+   i = 200;
+   sha3_shake_init(&c, 128);
+   while (i--) sha3_shake_process(&c, &c1, 1);
+   for (i = 0; i < 16; i++) sha3_shake_done(&c, hash, 32); /* get 512 bytes, keep in hash the last 32 */
+   if (compare_testvector(hash, sizeof(shake128_0xa3_200_times), shake128_0xa3_200_times, sizeof(shake128_0xa3_200_times), "SHAKE128", 4)) {
+      return CRYPT_FAIL_TESTVECTOR;
+   }
+
+   return CRYPT_OK;
+#endif
+}
+
+#endif
+
+#ifdef LTC_KECCAK
+
+int keccak_224_test(void)
+{
+#ifndef LTC_TEST
+   return CRYPT_NOP;
+#else
+   hash_state c;
+   unsigned char hash[MAXBLOCKSIZE];
+
+   keccak_224_init(&c);
+   keccak_process(&c, (unsigned char*) "\xcc", 1);
+   keccak_done(&c, hash);
+   if(compare_testvector(hash, 28,
+                         "\xa9\xca\xb5\x9e\xb4\x0a\x10\xb2"
+                         "\x46\x29\x0f\x2d\x60\x86\xe3\x2e"
+                         "\x36\x89\xfa\xf1\xd2\x6b\x47\x0c"
+                         "\x89\x9f\x28\x02", 28,
+                         "KECCAK-224", 0) != 0) {
+       return CRYPT_FAIL_TESTVECTOR;
+   }
+
+   keccak_224_init(&c);
+   keccak_process(&c, (unsigned char*)"\x41\xfb", 2);
+   keccak_done(&c, hash);
+   if(compare_testvector(hash, 28,
+                         "\x61\x5b\xa3\x67\xaf\xdc\x35\xaa"
+                         "\xc3\x97\xbc\x7e\xb5\xd5\x8d\x10"
+                         "\x6a\x73\x4b\x24\x98\x6d\x5d\x97"
+                         "\x8f\xef\xd6\x2c", 28,
+                         "KECCAK-224", 1) != 0) {
+       return CRYPT_FAIL_TESTVECTOR;
+   }
+
+   keccak_224_init(&c);
+   keccak_process(&c, (unsigned char*)
+                    "\x52\xa6\x08\xab\x21\xcc\xdd\x8a"
+                    "\x44\x57\xa5\x7e\xde\x78\x21\x76", 16);
+   keccak_done(&c, hash);
+   if(compare_testvector(hash, 28,
+                         "\x56\x79\xcd\x50\x9c\x51\x20\xaf"
+                         "\x54\x79\x5c\xf4\x77\x14\x96\x41"
+                         "\xcf\x27\xb2\xeb\xb6\xa5\xf9\x03"
+                         "\x40\x70\x4e\x57", 28,
+                         "KECCAK-224", 2) != 0) {
+       return CRYPT_FAIL_TESTVECTOR;
+   }
+
+   keccak_224_init(&c);
+   keccak_process(&c, (unsigned char*)
+                    "\x43\x3c\x53\x03\x13\x16\x24\xc0"
+                    "\x02\x1d\x86\x8a\x30\x82\x54\x75"
+                    "\xe8\xd0\xbd\x30\x52\xa0\x22\x18"
+                    "\x03\x98\xf4\xca\x44\x23\xb9\x82"
+                    "\x14\xb6\xbe\xaa\xc2\x1c\x88\x07"
+                    "\xa2\xc3\x3f\x8c\x93\xbd\x42\xb0"
+                    "\x92\xcc\x1b\x06\xce\xdf\x32\x24"
+                    "\xd5\xed\x1e\xc2\x97\x84\x44\x4f"
+                    "\x22\xe0\x8a\x55\xaa\x58\x54\x2b"
+                    "\x52\x4b\x02\xcd\x3d\x5d\x5f\x69"
+                    "\x07\xaf\xe7\x1c\x5d\x74\x62\x22"
+                    "\x4a\x3f\x9d\x9e\x53\xe7\xe0\x84"
+                    "\x6d\xcb\xb4\xce", 100);
+   keccak_done(&c, hash);
+   if(compare_testvector(hash, 28,
+                         "\x62\xb1\x0f\x1b\x62\x36\xeb\xc2"
+                         "\xda\x72\x95\x77\x42\xa8\xd4\xe4"
+                         "\x8e\x21\x3b\x5f\x89\x34\x60\x4b"
+                         "\xfd\x4d\x2c\x3a", 28,
+                         "KECCAK-224", 3) != 0) {
+       return CRYPT_FAIL_TESTVECTOR;
+   }
+
+   return CRYPT_OK;
+#endif
+}
+
+int keccak_256_test(void)
+{
+#ifndef LTC_TEST
+   return CRYPT_NOP;
+#else
+   hash_state c;
+   unsigned char hash[MAXBLOCKSIZE];
+
+   keccak_256_init(&c);
+   keccak_process(&c, (unsigned char*) "\xcc", 1);
+   keccak_done(&c, hash);
+   if(compare_testvector(hash, 32,
+                         "\xee\xad\x6d\xbf\xc7\x34\x0a\x56"
+                         "\xca\xed\xc0\x44\x69\x6a\x16\x88"
+                         "\x70\x54\x9a\x6a\x7f\x6f\x56\x96"
+                         "\x1e\x84\xa5\x4b\xd9\x97\x0b\x8a", 32,
+                         "KECCAK-256", 0) != 0) {
+       return CRYPT_FAIL_TESTVECTOR;
+   }
+
+   keccak_256_init(&c);
+   keccak_process(&c, (unsigned char*)"\x41\xfb", 2);
+   keccak_done(&c, hash);
+   if(compare_testvector(hash, 32,
+                         "\xa8\xea\xce\xda\x4d\x47\xb3\x28"
+                         "\x1a\x79\x5a\xd9\xe1\xea\x21\x22"
+                         "\xb4\x07\xba\xf9\xaa\xbc\xb9\xe1"
+                         "\x8b\x57\x17\xb7\x87\x35\x37\xd2", 32,
+                         "KECCAK-256", 1) != 0) {
+       return CRYPT_FAIL_TESTVECTOR;
+   }
+
+   keccak_256_init(&c);
+   keccak_process(&c, (unsigned char*)
+                    "\x52\xa6\x08\xab\x21\xcc\xdd\x8a"
+                    "\x44\x57\xa5\x7e\xde\x78\x21\x76", 16);
+   keccak_done(&c, hash);
+   if(compare_testvector(hash, 32,
+                         "\x0e\x32\xde\xfa\x20\x71\xf0\xb5"
+                         "\xac\x0e\x6a\x10\x8b\x84\x2e\xd0"
+                         "\xf1\xd3\x24\x97\x12\xf5\x8e\xe0"
+                         "\xdd\xf9\x56\xfe\x33\x2a\x5f\x95", 32,
+                         "KECCAK-256", 2) != 0) {
+       return CRYPT_FAIL_TESTVECTOR;
+   }
+
+   keccak_256_init(&c);
+   keccak_process(&c, (unsigned char*)
+                    "\x43\x3c\x53\x03\x13\x16\x24\xc0"
+                    "\x02\x1d\x86\x8a\x30\x82\x54\x75"
+                    "\xe8\xd0\xbd\x30\x52\xa0\x22\x18"
+                    "\x03\x98\xf4\xca\x44\x23\xb9\x82"
+                    "\x14\xb6\xbe\xaa\xc2\x1c\x88\x07"
+                    "\xa2\xc3\x3f\x8c\x93\xbd\x42\xb0"
+                    "\x92\xcc\x1b\x06\xce\xdf\x32\x24"
+                    "\xd5\xed\x1e\xc2\x97\x84\x44\x4f"
+                    "\x22\xe0\x8a\x55\xaa\x58\x54\x2b"
+                    "\x52\x4b\x02\xcd\x3d\x5d\x5f\x69"
+                    "\x07\xaf\xe7\x1c\x5d\x74\x62\x22"
+                    "\x4a\x3f\x9d\x9e\x53\xe7\xe0\x84"
+                    "\x6d\xcb\xb4\xce", 100);
+   keccak_done(&c, hash);
+   if(compare_testvector(hash, 32,
+                         "\xce\x87\xa5\x17\x3b\xff\xd9\x23"
+                         "\x99\x22\x16\x58\xf8\x01\xd4\x5c"
+                         "\x29\x4d\x90\x06\xee\x9f\x3f\x9d"
+                         "\x41\x9c\x8d\x42\x77\x48\xdc\x41", 32,
+                         "KECCAK-256", 3) != 0) {
+       return CRYPT_FAIL_TESTVECTOR;
+   }
+
+   return CRYPT_OK;
+#endif
+}
+
+int keccak_384_test(void)
+{
+#ifndef LTC_TEST
+   return CRYPT_NOP;
+#else
+   hash_state c;
+   unsigned char hash[MAXBLOCKSIZE];
+
+   keccak_384_init(&c);
+   keccak_process(&c, (unsigned char*) "\xcc", 1);
+   keccak_done(&c, hash);
+   if(compare_testvector(hash, 48,
+                         "\x1b\x84\xe6\x2a\x46\xe5\xa2\x01"
+                         "\x86\x17\x54\xaf\x5d\xc9\x5c\x4a"
+                         "\x1a\x69\xca\xf4\xa7\x96\xae\x40"
+                         "\x56\x80\x16\x1e\x29\x57\x26\x41"
+                         "\xf5\xfa\x1e\x86\x41\xd7\x95\x83"
+                         "\x36\xee\x7b\x11\xc5\x8f\x73\xe9", 48,
+                         "KECCAK-384", 0) != 0) {
+       return CRYPT_FAIL_TESTVECTOR;
+   }
+
+   keccak_384_init(&c);
+   keccak_process(&c, (unsigned char*)"\x41\xfb", 2);
+   keccak_done(&c, hash);
+   if(compare_testvector(hash, 48,
+                         "\x49\x5c\xce\x27\x14\xcd\x72\xc8"
+                         "\xc5\x3c\x33\x63\xd2\x2c\x58\xb5"
+                         "\x59\x60\xfe\x26\xbe\x0b\xf3\xbb"
+                         "\xc7\xa3\x31\x6d\xd5\x63\xad\x1d"
+                         "\xb8\x41\x0e\x75\xee\xfe\xa6\x55"
+                         "\xe3\x9d\x46\x70\xec\x0b\x17\x92", 48,
+                         "KECCAK-384", 1) != 0) {
+       return CRYPT_FAIL_TESTVECTOR;
+   }
+
+   keccak_384_init(&c);
+   keccak_process(&c, (unsigned char*)
+                    "\x52\xa6\x08\xab\x21\xcc\xdd\x8a"
+                    "\x44\x57\xa5\x7e\xde\x78\x21\x76", 16);
+   keccak_done(&c, hash);
+   if(compare_testvector(hash, 48,
+                         "\x18\x42\x2a\xc1\xd3\xa1\xe5\x4b"
+                         "\xad\x87\x68\x83\xd2\xd6\xdd\x65"
+                         "\xf6\x5c\x1d\x5f\x33\xa7\x12\x5c"
+                         "\xc4\xc1\x86\x40\x5a\x12\xed\x64"
+                         "\xba\x96\x67\x2e\xed\xda\x8c\x5a"
+                         "\x63\x31\xd2\x86\x83\xf4\x88\xeb", 48,
+                         "KECCAK-384", 2) != 0) {
+       return CRYPT_FAIL_TESTVECTOR;
+   }
+
+   keccak_384_init(&c);
+   keccak_process(&c, (unsigned char*)
+                    "\x43\x3c\x53\x03\x13\x16\x24\xc0"
+                    "\x02\x1d\x86\x8a\x30\x82\x54\x75"
+                    "\xe8\xd0\xbd\x30\x52\xa0\x22\x18"
+                    "\x03\x98\xf4\xca\x44\x23\xb9\x82"
+                    "\x14\xb6\xbe\xaa\xc2\x1c\x88\x07"
+                    "\xa2\xc3\x3f\x8c\x93\xbd\x42\xb0"
+                    "\x92\xcc\x1b\x06\xce\xdf\x32\x24"
+                    "\xd5\xed\x1e\xc2\x97\x84\x44\x4f"
+                    "\x22\xe0\x8a\x55\xaa\x58\x54\x2b"
+                    "\x52\x4b\x02\xcd\x3d\x5d\x5f\x69"
+                    "\x07\xaf\xe7\x1c\x5d\x74\x62\x22"
+                    "\x4a\x3f\x9d\x9e\x53\xe7\xe0\x84"
+                    "\x6d\xcb\xb4\xce", 100);
+   keccak_done(&c, hash);
+   if(compare_testvector(hash, 48,
+                         "\x13\x51\x14\x50\x8d\xd6\x3e\x27"
+                         "\x9e\x70\x9c\x26\xf7\x81\x7c\x04"
+                         "\x82\x76\x6c\xde\x49\x13\x2e\x3e"
+                         "\xdf\x2e\xed\xd8\x99\x6f\x4e\x35"
+                         "\x96\xd1\x84\x10\x0b\x38\x48\x68"
+                         "\x24\x9f\x1d\x8b\x8f\xda\xa2\xc9", 48,
+                         "KECCAK-384", 3) != 0) {
+       return CRYPT_FAIL_TESTVECTOR;
+   }
+
+   return CRYPT_OK;
+#endif
+}
+
+int keccak_512_test(void)
+{
+#ifndef LTC_TEST
+   return CRYPT_NOP;
+#else
+   hash_state c;
+   unsigned char hash[MAXBLOCKSIZE];
+
+   keccak_512_init(&c);
+   keccak_process(&c, (unsigned char*) "\xcc", 1);
+   keccak_done(&c, hash);
+   if(compare_testvector(hash, 64,
+                         "\x86\x30\xc1\x3c\xbd\x06\x6e\xa7"
+                         "\x4b\xbe\x7f\xe4\x68\xfe\xc1\xde"
+                         "\xe1\x0e\xdc\x12\x54\xfb\x4c\x1b"
+                         "\x7c\x5f\xd6\x9b\x64\x6e\x44\x16"
+                         "\x0b\x8c\xe0\x1d\x05\xa0\x90\x8c"
+                         "\xa7\x90\xdf\xb0\x80\xf4\xb5\x13"
+                         "\xbc\x3b\x62\x25\xec\xe7\xa8\x10"
+                         "\x37\x14\x41\xa5\xac\x66\x6e\xb9", 64,
+                         "KECCAK-512", 0) != 0) {
+       return CRYPT_FAIL_TESTVECTOR;
+   }
+
+   keccak_512_init(&c);
+   keccak_process(&c, (unsigned char*)"\x41\xfb", 2);
+   keccak_done(&c, hash);
+   if(compare_testvector(hash, 64,
+                         "\x55\x1d\xa6\x23\x6f\x8b\x96\xfc"
+                         "\xe9\xf9\x7f\x11\x90\xe9\x01\x32"
+                         "\x4f\x0b\x45\xe0\x6d\xbb\xb5\xcd"
+                         "\xb8\x35\x5d\x6e\xd1\xdc\x34\xb3"
+                         "\xf0\xea\xe7\xdc\xb6\x86\x22\xff"
+                         "\x23\x2f\xa3\xce\xce\x0d\x46\x16"
+                         "\xcd\xeb\x39\x31\xf9\x38\x03\x66"
+                         "\x2a\x28\xdf\x1c\xd5\x35\xb7\x31", 64,
+                         "KECCAK-512", 1) != 0) {
+       return CRYPT_FAIL_TESTVECTOR;
+   }
+
+   keccak_512_init(&c);
+   keccak_process(&c, (unsigned char*)
+                    "\x52\xa6\x08\xab\x21\xcc\xdd\x8a"
+                    "\x44\x57\xa5\x7e\xde\x78\x21\x76", 16);
+   keccak_done(&c, hash);
+   if(compare_testvector(hash, 64,
+                         "\x4b\x39\xd3\xda\x5b\xcd\xf4\xd9"
+                         "\xb7\x69\x01\x59\x95\x64\x43\x11"
+                         "\xc1\x4c\x43\x5b\xf7\x2b\x10\x09"
+                         "\xd6\xdd\x71\xb0\x1a\x63\xb9\x7c"
+                         "\xfb\x59\x64\x18\xe8\xe4\x23\x42"
+                         "\xd1\x17\xe0\x74\x71\xa8\x91\x43"
+                         "\x14\xba\x7b\x0e\x26\x4d\xad\xf0"
+                         "\xce\xa3\x81\x86\x8c\xbd\x43\xd1", 64,
+                         "KECCAK-512", 2) != 0) {
+       return CRYPT_FAIL_TESTVECTOR;
+   }
+
+   keccak_512_init(&c);
+   keccak_process(&c, (unsigned char*)
+                    "\x43\x3c\x53\x03\x13\x16\x24\xc0"
+                    "\x02\x1d\x86\x8a\x30\x82\x54\x75"
+                    "\xe8\xd0\xbd\x30\x52\xa0\x22\x18"
+                    "\x03\x98\xf4\xca\x44\x23\xb9\x82"
+                    "\x14\xb6\xbe\xaa\xc2\x1c\x88\x07"
+                    "\xa2\xc3\x3f\x8c\x93\xbd\x42\xb0"
+                    "\x92\xcc\x1b\x06\xce\xdf\x32\x24"
+                    "\xd5\xed\x1e\xc2\x97\x84\x44\x4f"
+                    "\x22\xe0\x8a\x55\xaa\x58\x54\x2b"
+                    "\x52\x4b\x02\xcd\x3d\x5d\x5f\x69"
+                    "\x07\xaf\xe7\x1c\x5d\x74\x62\x22"
+                    "\x4a\x3f\x9d\x9e\x53\xe7\xe0\x84"
+                    "\x6d\xcb\xb4\xce", 100);
+   keccak_done(&c, hash);
+   if(compare_testvector(hash, 64,
+                         "\x52\x7d\x28\xe3\x41\xe6\xb1\x4f"
+                         "\x46\x84\xad\xb4\xb8\x24\xc4\x96"
+                         "\xc6\x48\x2e\x51\x14\x95\x65\xd3"
+                         "\xd1\x72\x26\x82\x88\x84\x30\x6b"
+                         "\x51\xd6\x14\x8a\x72\x62\x2c\x2b"
+                         "\x75\xf5\xd3\x51\x0b\x79\x9d\x8b"
+                         "\xdc\x03\xea\xed\xe4\x53\x67\x6a"
+                         "\x6e\xc8\xfe\x03\xa1\xad\x0e\xab", 64,
+                         "KECCAK-512", 3) != 0) {
+       return CRYPT_FAIL_TESTVECTOR;
+   }
+
+   return CRYPT_OK;
+#endif
+}
+
+#endif
+
+/* ref:         HEAD -> develop */
+/* git commit:  a1f6312416ef6cd183ee62db58b640dc2d7ec1f4 */
+/* commit time: 2019-09-04 13:44:47 +0200 */

+ 812 - 0
libtomcrypt.mod/libtomcrypt/src/hashes/tiger.c

@@ -0,0 +1,812 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ */
+
+#include "tomcrypt_private.h"
+
+/**
+   @file tiger.c
+   Tiger hash function, Tom St Denis
+*/
+
+#ifdef LTC_TIGER
+
+const struct ltc_hash_descriptor tiger_desc =
+{
+    "tiger",
+    1,
+    24,
+    64,
+
+    /* OID */
+   { 1, 3, 6, 1, 4, 1, 11591, 12, 2,  },
+   9,
+
+    &tiger_init,
+    &tiger_process,
+    &tiger_done,
+    &tiger_test,
+    NULL
+};
+
+#define t1 (table)
+#define t2 (table+256)
+#define t3 (table+256*2)
+#define t4 (table+256*3)
+
+static const ulong64 table[4*256] = {
+    CONST64(0x02AAB17CF7E90C5E) /*    0 */, CONST64(0xAC424B03E243A8EC) /*    1 */,
+    CONST64(0x72CD5BE30DD5FCD3) /*    2 */, CONST64(0x6D019B93F6F97F3A) /*    3 */,
+    CONST64(0xCD9978FFD21F9193) /*    4 */, CONST64(0x7573A1C9708029E2) /*    5 */,
+    CONST64(0xB164326B922A83C3) /*    6 */, CONST64(0x46883EEE04915870) /*    7 */,
+    CONST64(0xEAACE3057103ECE6) /*    8 */, CONST64(0xC54169B808A3535C) /*    9 */,
+    CONST64(0x4CE754918DDEC47C) /*   10 */, CONST64(0x0AA2F4DFDC0DF40C) /*   11 */,
+    CONST64(0x10B76F18A74DBEFA) /*   12 */, CONST64(0xC6CCB6235AD1AB6A) /*   13 */,
+    CONST64(0x13726121572FE2FF) /*   14 */, CONST64(0x1A488C6F199D921E) /*   15 */,
+    CONST64(0x4BC9F9F4DA0007CA) /*   16 */, CONST64(0x26F5E6F6E85241C7) /*   17 */,
+    CONST64(0x859079DBEA5947B6) /*   18 */, CONST64(0x4F1885C5C99E8C92) /*   19 */,
+    CONST64(0xD78E761EA96F864B) /*   20 */, CONST64(0x8E36428C52B5C17D) /*   21 */,
+    CONST64(0x69CF6827373063C1) /*   22 */, CONST64(0xB607C93D9BB4C56E) /*   23 */,
+    CONST64(0x7D820E760E76B5EA) /*   24 */, CONST64(0x645C9CC6F07FDC42) /*   25 */,
+    CONST64(0xBF38A078243342E0) /*   26 */, CONST64(0x5F6B343C9D2E7D04) /*   27 */,
+    CONST64(0xF2C28AEB600B0EC6) /*   28 */, CONST64(0x6C0ED85F7254BCAC) /*   29 */,
+    CONST64(0x71592281A4DB4FE5) /*   30 */, CONST64(0x1967FA69CE0FED9F) /*   31 */,
+    CONST64(0xFD5293F8B96545DB) /*   32 */, CONST64(0xC879E9D7F2A7600B) /*   33 */,
+    CONST64(0x860248920193194E) /*   34 */, CONST64(0xA4F9533B2D9CC0B3) /*   35 */,
+    CONST64(0x9053836C15957613) /*   36 */, CONST64(0xDB6DCF8AFC357BF1) /*   37 */,
+    CONST64(0x18BEEA7A7A370F57) /*   38 */, CONST64(0x037117CA50B99066) /*   39 */,
+    CONST64(0x6AB30A9774424A35) /*   40 */, CONST64(0xF4E92F02E325249B) /*   41 */,
+    CONST64(0x7739DB07061CCAE1) /*   42 */, CONST64(0xD8F3B49CECA42A05) /*   43 */,
+    CONST64(0xBD56BE3F51382F73) /*   44 */, CONST64(0x45FAED5843B0BB28) /*   45 */,
+    CONST64(0x1C813D5C11BF1F83) /*   46 */, CONST64(0x8AF0E4B6D75FA169) /*   47 */,
+    CONST64(0x33EE18A487AD9999) /*   48 */, CONST64(0x3C26E8EAB1C94410) /*   49 */,
+    CONST64(0xB510102BC0A822F9) /*   50 */, CONST64(0x141EEF310CE6123B) /*   51 */,
+    CONST64(0xFC65B90059DDB154) /*   52 */, CONST64(0xE0158640C5E0E607) /*   53 */,
+    CONST64(0x884E079826C3A3CF) /*   54 */, CONST64(0x930D0D9523C535FD) /*   55 */,
+    CONST64(0x35638D754E9A2B00) /*   56 */, CONST64(0x4085FCCF40469DD5) /*   57 */,
+    CONST64(0xC4B17AD28BE23A4C) /*   58 */, CONST64(0xCAB2F0FC6A3E6A2E) /*   59 */,
+    CONST64(0x2860971A6B943FCD) /*   60 */, CONST64(0x3DDE6EE212E30446) /*   61 */,
+    CONST64(0x6222F32AE01765AE) /*   62 */, CONST64(0x5D550BB5478308FE) /*   63 */,
+    CONST64(0xA9EFA98DA0EDA22A) /*   64 */, CONST64(0xC351A71686C40DA7) /*   65 */,
+    CONST64(0x1105586D9C867C84) /*   66 */, CONST64(0xDCFFEE85FDA22853) /*   67 */,
+    CONST64(0xCCFBD0262C5EEF76) /*   68 */, CONST64(0xBAF294CB8990D201) /*   69 */,
+    CONST64(0xE69464F52AFAD975) /*   70 */, CONST64(0x94B013AFDF133E14) /*   71 */,
+    CONST64(0x06A7D1A32823C958) /*   72 */, CONST64(0x6F95FE5130F61119) /*   73 */,
+    CONST64(0xD92AB34E462C06C0) /*   74 */, CONST64(0xED7BDE33887C71D2) /*   75 */,
+    CONST64(0x79746D6E6518393E) /*   76 */, CONST64(0x5BA419385D713329) /*   77 */,
+    CONST64(0x7C1BA6B948A97564) /*   78 */, CONST64(0x31987C197BFDAC67) /*   79 */,
+    CONST64(0xDE6C23C44B053D02) /*   80 */, CONST64(0x581C49FED002D64D) /*   81 */,
+    CONST64(0xDD474D6338261571) /*   82 */, CONST64(0xAA4546C3E473D062) /*   83 */,
+    CONST64(0x928FCE349455F860) /*   84 */, CONST64(0x48161BBACAAB94D9) /*   85 */,
+    CONST64(0x63912430770E6F68) /*   86 */, CONST64(0x6EC8A5E602C6641C) /*   87 */,
+    CONST64(0x87282515337DDD2B) /*   88 */, CONST64(0x2CDA6B42034B701B) /*   89 */,
+    CONST64(0xB03D37C181CB096D) /*   90 */, CONST64(0xE108438266C71C6F) /*   91 */,
+    CONST64(0x2B3180C7EB51B255) /*   92 */, CONST64(0xDF92B82F96C08BBC) /*   93 */,
+    CONST64(0x5C68C8C0A632F3BA) /*   94 */, CONST64(0x5504CC861C3D0556) /*   95 */,
+    CONST64(0xABBFA4E55FB26B8F) /*   96 */, CONST64(0x41848B0AB3BACEB4) /*   97 */,
+    CONST64(0xB334A273AA445D32) /*   98 */, CONST64(0xBCA696F0A85AD881) /*   99 */,
+    CONST64(0x24F6EC65B528D56C) /*  100 */, CONST64(0x0CE1512E90F4524A) /*  101 */,
+    CONST64(0x4E9DD79D5506D35A) /*  102 */, CONST64(0x258905FAC6CE9779) /*  103 */,
+    CONST64(0x2019295B3E109B33) /*  104 */, CONST64(0xF8A9478B73A054CC) /*  105 */,
+    CONST64(0x2924F2F934417EB0) /*  106 */, CONST64(0x3993357D536D1BC4) /*  107 */,
+    CONST64(0x38A81AC21DB6FF8B) /*  108 */, CONST64(0x47C4FBF17D6016BF) /*  109 */,
+    CONST64(0x1E0FAADD7667E3F5) /*  110 */, CONST64(0x7ABCFF62938BEB96) /*  111 */,
+    CONST64(0xA78DAD948FC179C9) /*  112 */, CONST64(0x8F1F98B72911E50D) /*  113 */,
+    CONST64(0x61E48EAE27121A91) /*  114 */, CONST64(0x4D62F7AD31859808) /*  115 */,
+    CONST64(0xECEBA345EF5CEAEB) /*  116 */, CONST64(0xF5CEB25EBC9684CE) /*  117 */,
+    CONST64(0xF633E20CB7F76221) /*  118 */, CONST64(0xA32CDF06AB8293E4) /*  119 */,
+    CONST64(0x985A202CA5EE2CA4) /*  120 */, CONST64(0xCF0B8447CC8A8FB1) /*  121 */,
+    CONST64(0x9F765244979859A3) /*  122 */, CONST64(0xA8D516B1A1240017) /*  123 */,
+    CONST64(0x0BD7BA3EBB5DC726) /*  124 */, CONST64(0xE54BCA55B86ADB39) /*  125 */,
+    CONST64(0x1D7A3AFD6C478063) /*  126 */, CONST64(0x519EC608E7669EDD) /*  127 */,
+    CONST64(0x0E5715A2D149AA23) /*  128 */, CONST64(0x177D4571848FF194) /*  129 */,
+    CONST64(0xEEB55F3241014C22) /*  130 */, CONST64(0x0F5E5CA13A6E2EC2) /*  131 */,
+    CONST64(0x8029927B75F5C361) /*  132 */, CONST64(0xAD139FABC3D6E436) /*  133 */,
+    CONST64(0x0D5DF1A94CCF402F) /*  134 */, CONST64(0x3E8BD948BEA5DFC8) /*  135 */,
+    CONST64(0xA5A0D357BD3FF77E) /*  136 */, CONST64(0xA2D12E251F74F645) /*  137 */,
+    CONST64(0x66FD9E525E81A082) /*  138 */, CONST64(0x2E0C90CE7F687A49) /*  139 */,
+    CONST64(0xC2E8BCBEBA973BC5) /*  140 */, CONST64(0x000001BCE509745F) /*  141 */,
+    CONST64(0x423777BBE6DAB3D6) /*  142 */, CONST64(0xD1661C7EAEF06EB5) /*  143 */,
+    CONST64(0xA1781F354DAACFD8) /*  144 */, CONST64(0x2D11284A2B16AFFC) /*  145 */,
+    CONST64(0xF1FC4F67FA891D1F) /*  146 */, CONST64(0x73ECC25DCB920ADA) /*  147 */,
+    CONST64(0xAE610C22C2A12651) /*  148 */, CONST64(0x96E0A810D356B78A) /*  149 */,
+    CONST64(0x5A9A381F2FE7870F) /*  150 */, CONST64(0xD5AD62EDE94E5530) /*  151 */,
+    CONST64(0xD225E5E8368D1427) /*  152 */, CONST64(0x65977B70C7AF4631) /*  153 */,
+    CONST64(0x99F889B2DE39D74F) /*  154 */, CONST64(0x233F30BF54E1D143) /*  155 */,
+    CONST64(0x9A9675D3D9A63C97) /*  156 */, CONST64(0x5470554FF334F9A8) /*  157 */,
+    CONST64(0x166ACB744A4F5688) /*  158 */, CONST64(0x70C74CAAB2E4AEAD) /*  159 */,
+    CONST64(0xF0D091646F294D12) /*  160 */, CONST64(0x57B82A89684031D1) /*  161 */,
+    CONST64(0xEFD95A5A61BE0B6B) /*  162 */, CONST64(0x2FBD12E969F2F29A) /*  163 */,
+    CONST64(0x9BD37013FEFF9FE8) /*  164 */, CONST64(0x3F9B0404D6085A06) /*  165 */,
+    CONST64(0x4940C1F3166CFE15) /*  166 */, CONST64(0x09542C4DCDF3DEFB) /*  167 */,
+    CONST64(0xB4C5218385CD5CE3) /*  168 */, CONST64(0xC935B7DC4462A641) /*  169 */,
+    CONST64(0x3417F8A68ED3B63F) /*  170 */, CONST64(0xB80959295B215B40) /*  171 */,
+    CONST64(0xF99CDAEF3B8C8572) /*  172 */, CONST64(0x018C0614F8FCB95D) /*  173 */,
+    CONST64(0x1B14ACCD1A3ACDF3) /*  174 */, CONST64(0x84D471F200BB732D) /*  175 */,
+    CONST64(0xC1A3110E95E8DA16) /*  176 */, CONST64(0x430A7220BF1A82B8) /*  177 */,
+    CONST64(0xB77E090D39DF210E) /*  178 */, CONST64(0x5EF4BD9F3CD05E9D) /*  179 */,
+    CONST64(0x9D4FF6DA7E57A444) /*  180 */, CONST64(0xDA1D60E183D4A5F8) /*  181 */,
+    CONST64(0xB287C38417998E47) /*  182 */, CONST64(0xFE3EDC121BB31886) /*  183 */,
+    CONST64(0xC7FE3CCC980CCBEF) /*  184 */, CONST64(0xE46FB590189BFD03) /*  185 */,
+    CONST64(0x3732FD469A4C57DC) /*  186 */, CONST64(0x7EF700A07CF1AD65) /*  187 */,
+    CONST64(0x59C64468A31D8859) /*  188 */, CONST64(0x762FB0B4D45B61F6) /*  189 */,
+    CONST64(0x155BAED099047718) /*  190 */, CONST64(0x68755E4C3D50BAA6) /*  191 */,
+    CONST64(0xE9214E7F22D8B4DF) /*  192 */, CONST64(0x2ADDBF532EAC95F4) /*  193 */,
+    CONST64(0x32AE3909B4BD0109) /*  194 */, CONST64(0x834DF537B08E3450) /*  195 */,
+    CONST64(0xFA209DA84220728D) /*  196 */, CONST64(0x9E691D9B9EFE23F7) /*  197 */,
+    CONST64(0x0446D288C4AE8D7F) /*  198 */, CONST64(0x7B4CC524E169785B) /*  199 */,
+    CONST64(0x21D87F0135CA1385) /*  200 */, CONST64(0xCEBB400F137B8AA5) /*  201 */,
+    CONST64(0x272E2B66580796BE) /*  202 */, CONST64(0x3612264125C2B0DE) /*  203 */,
+    CONST64(0x057702BDAD1EFBB2) /*  204 */, CONST64(0xD4BABB8EACF84BE9) /*  205 */,
+    CONST64(0x91583139641BC67B) /*  206 */, CONST64(0x8BDC2DE08036E024) /*  207 */,
+    CONST64(0x603C8156F49F68ED) /*  208 */, CONST64(0xF7D236F7DBEF5111) /*  209 */,
+    CONST64(0x9727C4598AD21E80) /*  210 */, CONST64(0xA08A0896670A5FD7) /*  211 */,
+    CONST64(0xCB4A8F4309EBA9CB) /*  212 */, CONST64(0x81AF564B0F7036A1) /*  213 */,
+    CONST64(0xC0B99AA778199ABD) /*  214 */, CONST64(0x959F1EC83FC8E952) /*  215 */,
+    CONST64(0x8C505077794A81B9) /*  216 */, CONST64(0x3ACAAF8F056338F0) /*  217 */,
+    CONST64(0x07B43F50627A6778) /*  218 */, CONST64(0x4A44AB49F5ECCC77) /*  219 */,
+    CONST64(0x3BC3D6E4B679EE98) /*  220 */, CONST64(0x9CC0D4D1CF14108C) /*  221 */,
+    CONST64(0x4406C00B206BC8A0) /*  222 */, CONST64(0x82A18854C8D72D89) /*  223 */,
+    CONST64(0x67E366B35C3C432C) /*  224 */, CONST64(0xB923DD61102B37F2) /*  225 */,
+    CONST64(0x56AB2779D884271D) /*  226 */, CONST64(0xBE83E1B0FF1525AF) /*  227 */,
+    CONST64(0xFB7C65D4217E49A9) /*  228 */, CONST64(0x6BDBE0E76D48E7D4) /*  229 */,
+    CONST64(0x08DF828745D9179E) /*  230 */, CONST64(0x22EA6A9ADD53BD34) /*  231 */,
+    CONST64(0xE36E141C5622200A) /*  232 */, CONST64(0x7F805D1B8CB750EE) /*  233 */,
+    CONST64(0xAFE5C7A59F58E837) /*  234 */, CONST64(0xE27F996A4FB1C23C) /*  235 */,
+    CONST64(0xD3867DFB0775F0D0) /*  236 */, CONST64(0xD0E673DE6E88891A) /*  237 */,
+    CONST64(0x123AEB9EAFB86C25) /*  238 */, CONST64(0x30F1D5D5C145B895) /*  239 */,
+    CONST64(0xBB434A2DEE7269E7) /*  240 */, CONST64(0x78CB67ECF931FA38) /*  241 */,
+    CONST64(0xF33B0372323BBF9C) /*  242 */, CONST64(0x52D66336FB279C74) /*  243 */,
+    CONST64(0x505F33AC0AFB4EAA) /*  244 */, CONST64(0xE8A5CD99A2CCE187) /*  245 */,
+    CONST64(0x534974801E2D30BB) /*  246 */, CONST64(0x8D2D5711D5876D90) /*  247 */,
+    CONST64(0x1F1A412891BC038E) /*  248 */, CONST64(0xD6E2E71D82E56648) /*  249 */,
+    CONST64(0x74036C3A497732B7) /*  250 */, CONST64(0x89B67ED96361F5AB) /*  251 */,
+    CONST64(0xFFED95D8F1EA02A2) /*  252 */, CONST64(0xE72B3BD61464D43D) /*  253 */,
+    CONST64(0xA6300F170BDC4820) /*  254 */, CONST64(0xEBC18760ED78A77A) /*  255 */,
+    CONST64(0xE6A6BE5A05A12138) /*  256 */, CONST64(0xB5A122A5B4F87C98) /*  257 */,
+    CONST64(0x563C6089140B6990) /*  258 */, CONST64(0x4C46CB2E391F5DD5) /*  259 */,
+    CONST64(0xD932ADDBC9B79434) /*  260 */, CONST64(0x08EA70E42015AFF5) /*  261 */,
+    CONST64(0xD765A6673E478CF1) /*  262 */, CONST64(0xC4FB757EAB278D99) /*  263 */,
+    CONST64(0xDF11C6862D6E0692) /*  264 */, CONST64(0xDDEB84F10D7F3B16) /*  265 */,
+    CONST64(0x6F2EF604A665EA04) /*  266 */, CONST64(0x4A8E0F0FF0E0DFB3) /*  267 */,
+    CONST64(0xA5EDEEF83DBCBA51) /*  268 */, CONST64(0xFC4F0A2A0EA4371E) /*  269 */,
+    CONST64(0xE83E1DA85CB38429) /*  270 */, CONST64(0xDC8FF882BA1B1CE2) /*  271 */,
+    CONST64(0xCD45505E8353E80D) /*  272 */, CONST64(0x18D19A00D4DB0717) /*  273 */,
+    CONST64(0x34A0CFEDA5F38101) /*  274 */, CONST64(0x0BE77E518887CAF2) /*  275 */,
+    CONST64(0x1E341438B3C45136) /*  276 */, CONST64(0xE05797F49089CCF9) /*  277 */,
+    CONST64(0xFFD23F9DF2591D14) /*  278 */, CONST64(0x543DDA228595C5CD) /*  279 */,
+    CONST64(0x661F81FD99052A33) /*  280 */, CONST64(0x8736E641DB0F7B76) /*  281 */,
+    CONST64(0x15227725418E5307) /*  282 */, CONST64(0xE25F7F46162EB2FA) /*  283 */,
+    CONST64(0x48A8B2126C13D9FE) /*  284 */, CONST64(0xAFDC541792E76EEA) /*  285 */,
+    CONST64(0x03D912BFC6D1898F) /*  286 */, CONST64(0x31B1AAFA1B83F51B) /*  287 */,
+    CONST64(0xF1AC2796E42AB7D9) /*  288 */, CONST64(0x40A3A7D7FCD2EBAC) /*  289 */,
+    CONST64(0x1056136D0AFBBCC5) /*  290 */, CONST64(0x7889E1DD9A6D0C85) /*  291 */,
+    CONST64(0xD33525782A7974AA) /*  292 */, CONST64(0xA7E25D09078AC09B) /*  293 */,
+    CONST64(0xBD4138B3EAC6EDD0) /*  294 */, CONST64(0x920ABFBE71EB9E70) /*  295 */,
+    CONST64(0xA2A5D0F54FC2625C) /*  296 */, CONST64(0xC054E36B0B1290A3) /*  297 */,
+    CONST64(0xF6DD59FF62FE932B) /*  298 */, CONST64(0x3537354511A8AC7D) /*  299 */,
+    CONST64(0xCA845E9172FADCD4) /*  300 */, CONST64(0x84F82B60329D20DC) /*  301 */,
+    CONST64(0x79C62CE1CD672F18) /*  302 */, CONST64(0x8B09A2ADD124642C) /*  303 */,
+    CONST64(0xD0C1E96A19D9E726) /*  304 */, CONST64(0x5A786A9B4BA9500C) /*  305 */,
+    CONST64(0x0E020336634C43F3) /*  306 */, CONST64(0xC17B474AEB66D822) /*  307 */,
+    CONST64(0x6A731AE3EC9BAAC2) /*  308 */, CONST64(0x8226667AE0840258) /*  309 */,
+    CONST64(0x67D4567691CAECA5) /*  310 */, CONST64(0x1D94155C4875ADB5) /*  311 */,
+    CONST64(0x6D00FD985B813FDF) /*  312 */, CONST64(0x51286EFCB774CD06) /*  313 */,
+    CONST64(0x5E8834471FA744AF) /*  314 */, CONST64(0xF72CA0AEE761AE2E) /*  315 */,
+    CONST64(0xBE40E4CDAEE8E09A) /*  316 */, CONST64(0xE9970BBB5118F665) /*  317 */,
+    CONST64(0x726E4BEB33DF1964) /*  318 */, CONST64(0x703B000729199762) /*  319 */,
+    CONST64(0x4631D816F5EF30A7) /*  320 */, CONST64(0xB880B5B51504A6BE) /*  321 */,
+    CONST64(0x641793C37ED84B6C) /*  322 */, CONST64(0x7B21ED77F6E97D96) /*  323 */,
+    CONST64(0x776306312EF96B73) /*  324 */, CONST64(0xAE528948E86FF3F4) /*  325 */,
+    CONST64(0x53DBD7F286A3F8F8) /*  326 */, CONST64(0x16CADCE74CFC1063) /*  327 */,
+    CONST64(0x005C19BDFA52C6DD) /*  328 */, CONST64(0x68868F5D64D46AD3) /*  329 */,
+    CONST64(0x3A9D512CCF1E186A) /*  330 */, CONST64(0x367E62C2385660AE) /*  331 */,
+    CONST64(0xE359E7EA77DCB1D7) /*  332 */, CONST64(0x526C0773749ABE6E) /*  333 */,
+    CONST64(0x735AE5F9D09F734B) /*  334 */, CONST64(0x493FC7CC8A558BA8) /*  335 */,
+    CONST64(0xB0B9C1533041AB45) /*  336 */, CONST64(0x321958BA470A59BD) /*  337 */,
+    CONST64(0x852DB00B5F46C393) /*  338 */, CONST64(0x91209B2BD336B0E5) /*  339 */,
+    CONST64(0x6E604F7D659EF19F) /*  340 */, CONST64(0xB99A8AE2782CCB24) /*  341 */,
+    CONST64(0xCCF52AB6C814C4C7) /*  342 */, CONST64(0x4727D9AFBE11727B) /*  343 */,
+    CONST64(0x7E950D0C0121B34D) /*  344 */, CONST64(0x756F435670AD471F) /*  345 */,
+    CONST64(0xF5ADD442615A6849) /*  346 */, CONST64(0x4E87E09980B9957A) /*  347 */,
+    CONST64(0x2ACFA1DF50AEE355) /*  348 */, CONST64(0xD898263AFD2FD556) /*  349 */,
+    CONST64(0xC8F4924DD80C8FD6) /*  350 */, CONST64(0xCF99CA3D754A173A) /*  351 */,
+    CONST64(0xFE477BACAF91BF3C) /*  352 */, CONST64(0xED5371F6D690C12D) /*  353 */,
+    CONST64(0x831A5C285E687094) /*  354 */, CONST64(0xC5D3C90A3708A0A4) /*  355 */,
+    CONST64(0x0F7F903717D06580) /*  356 */, CONST64(0x19F9BB13B8FDF27F) /*  357 */,
+    CONST64(0xB1BD6F1B4D502843) /*  358 */, CONST64(0x1C761BA38FFF4012) /*  359 */,
+    CONST64(0x0D1530C4E2E21F3B) /*  360 */, CONST64(0x8943CE69A7372C8A) /*  361 */,
+    CONST64(0xE5184E11FEB5CE66) /*  362 */, CONST64(0x618BDB80BD736621) /*  363 */,
+    CONST64(0x7D29BAD68B574D0B) /*  364 */, CONST64(0x81BB613E25E6FE5B) /*  365 */,
+    CONST64(0x071C9C10BC07913F) /*  366 */, CONST64(0xC7BEEB7909AC2D97) /*  367 */,
+    CONST64(0xC3E58D353BC5D757) /*  368 */, CONST64(0xEB017892F38F61E8) /*  369 */,
+    CONST64(0xD4EFFB9C9B1CC21A) /*  370 */, CONST64(0x99727D26F494F7AB) /*  371 */,
+    CONST64(0xA3E063A2956B3E03) /*  372 */, CONST64(0x9D4A8B9A4AA09C30) /*  373 */,
+    CONST64(0x3F6AB7D500090FB4) /*  374 */, CONST64(0x9CC0F2A057268AC0) /*  375 */,
+    CONST64(0x3DEE9D2DEDBF42D1) /*  376 */, CONST64(0x330F49C87960A972) /*  377 */,
+    CONST64(0xC6B2720287421B41) /*  378 */, CONST64(0x0AC59EC07C00369C) /*  379 */,
+    CONST64(0xEF4EAC49CB353425) /*  380 */, CONST64(0xF450244EEF0129D8) /*  381 */,
+    CONST64(0x8ACC46E5CAF4DEB6) /*  382 */, CONST64(0x2FFEAB63989263F7) /*  383 */,
+    CONST64(0x8F7CB9FE5D7A4578) /*  384 */, CONST64(0x5BD8F7644E634635) /*  385 */,
+    CONST64(0x427A7315BF2DC900) /*  386 */, CONST64(0x17D0C4AA2125261C) /*  387 */,
+    CONST64(0x3992486C93518E50) /*  388 */, CONST64(0xB4CBFEE0A2D7D4C3) /*  389 */,
+    CONST64(0x7C75D6202C5DDD8D) /*  390 */, CONST64(0xDBC295D8E35B6C61) /*  391 */,
+    CONST64(0x60B369D302032B19) /*  392 */, CONST64(0xCE42685FDCE44132) /*  393 */,
+    CONST64(0x06F3DDB9DDF65610) /*  394 */, CONST64(0x8EA4D21DB5E148F0) /*  395 */,
+    CONST64(0x20B0FCE62FCD496F) /*  396 */, CONST64(0x2C1B912358B0EE31) /*  397 */,
+    CONST64(0xB28317B818F5A308) /*  398 */, CONST64(0xA89C1E189CA6D2CF) /*  399 */,
+    CONST64(0x0C6B18576AAADBC8) /*  400 */, CONST64(0xB65DEAA91299FAE3) /*  401 */,
+    CONST64(0xFB2B794B7F1027E7) /*  402 */, CONST64(0x04E4317F443B5BEB) /*  403 */,
+    CONST64(0x4B852D325939D0A6) /*  404 */, CONST64(0xD5AE6BEEFB207FFC) /*  405 */,
+    CONST64(0x309682B281C7D374) /*  406 */, CONST64(0xBAE309A194C3B475) /*  407 */,
+    CONST64(0x8CC3F97B13B49F05) /*  408 */, CONST64(0x98A9422FF8293967) /*  409 */,
+    CONST64(0x244B16B01076FF7C) /*  410 */, CONST64(0xF8BF571C663D67EE) /*  411 */,
+    CONST64(0x1F0D6758EEE30DA1) /*  412 */, CONST64(0xC9B611D97ADEB9B7) /*  413 */,
+    CONST64(0xB7AFD5887B6C57A2) /*  414 */, CONST64(0x6290AE846B984FE1) /*  415 */,
+    CONST64(0x94DF4CDEACC1A5FD) /*  416 */, CONST64(0x058A5BD1C5483AFF) /*  417 */,
+    CONST64(0x63166CC142BA3C37) /*  418 */, CONST64(0x8DB8526EB2F76F40) /*  419 */,
+    CONST64(0xE10880036F0D6D4E) /*  420 */, CONST64(0x9E0523C9971D311D) /*  421 */,
+    CONST64(0x45EC2824CC7CD691) /*  422 */, CONST64(0x575B8359E62382C9) /*  423 */,
+    CONST64(0xFA9E400DC4889995) /*  424 */, CONST64(0xD1823ECB45721568) /*  425 */,
+    CONST64(0xDAFD983B8206082F) /*  426 */, CONST64(0xAA7D29082386A8CB) /*  427 */,
+    CONST64(0x269FCD4403B87588) /*  428 */, CONST64(0x1B91F5F728BDD1E0) /*  429 */,
+    CONST64(0xE4669F39040201F6) /*  430 */, CONST64(0x7A1D7C218CF04ADE) /*  431 */,
+    CONST64(0x65623C29D79CE5CE) /*  432 */, CONST64(0x2368449096C00BB1) /*  433 */,
+    CONST64(0xAB9BF1879DA503BA) /*  434 */, CONST64(0xBC23ECB1A458058E) /*  435 */,
+    CONST64(0x9A58DF01BB401ECC) /*  436 */, CONST64(0xA070E868A85F143D) /*  437 */,
+    CONST64(0x4FF188307DF2239E) /*  438 */, CONST64(0x14D565B41A641183) /*  439 */,
+    CONST64(0xEE13337452701602) /*  440 */, CONST64(0x950E3DCF3F285E09) /*  441 */,
+    CONST64(0x59930254B9C80953) /*  442 */, CONST64(0x3BF299408930DA6D) /*  443 */,
+    CONST64(0xA955943F53691387) /*  444 */, CONST64(0xA15EDECAA9CB8784) /*  445 */,
+    CONST64(0x29142127352BE9A0) /*  446 */, CONST64(0x76F0371FFF4E7AFB) /*  447 */,
+    CONST64(0x0239F450274F2228) /*  448 */, CONST64(0xBB073AF01D5E868B) /*  449 */,
+    CONST64(0xBFC80571C10E96C1) /*  450 */, CONST64(0xD267088568222E23) /*  451 */,
+    CONST64(0x9671A3D48E80B5B0) /*  452 */, CONST64(0x55B5D38AE193BB81) /*  453 */,
+    CONST64(0x693AE2D0A18B04B8) /*  454 */, CONST64(0x5C48B4ECADD5335F) /*  455 */,
+    CONST64(0xFD743B194916A1CA) /*  456 */, CONST64(0x2577018134BE98C4) /*  457 */,
+    CONST64(0xE77987E83C54A4AD) /*  458 */, CONST64(0x28E11014DA33E1B9) /*  459 */,
+    CONST64(0x270CC59E226AA213) /*  460 */, CONST64(0x71495F756D1A5F60) /*  461 */,
+    CONST64(0x9BE853FB60AFEF77) /*  462 */, CONST64(0xADC786A7F7443DBF) /*  463 */,
+    CONST64(0x0904456173B29A82) /*  464 */, CONST64(0x58BC7A66C232BD5E) /*  465 */,
+    CONST64(0xF306558C673AC8B2) /*  466 */, CONST64(0x41F639C6B6C9772A) /*  467 */,
+    CONST64(0x216DEFE99FDA35DA) /*  468 */, CONST64(0x11640CC71C7BE615) /*  469 */,
+    CONST64(0x93C43694565C5527) /*  470 */, CONST64(0xEA038E6246777839) /*  471 */,
+    CONST64(0xF9ABF3CE5A3E2469) /*  472 */, CONST64(0x741E768D0FD312D2) /*  473 */,
+    CONST64(0x0144B883CED652C6) /*  474 */, CONST64(0xC20B5A5BA33F8552) /*  475 */,
+    CONST64(0x1AE69633C3435A9D) /*  476 */, CONST64(0x97A28CA4088CFDEC) /*  477 */,
+    CONST64(0x8824A43C1E96F420) /*  478 */, CONST64(0x37612FA66EEEA746) /*  479 */,
+    CONST64(0x6B4CB165F9CF0E5A) /*  480 */, CONST64(0x43AA1C06A0ABFB4A) /*  481 */,
+    CONST64(0x7F4DC26FF162796B) /*  482 */, CONST64(0x6CBACC8E54ED9B0F) /*  483 */,
+    CONST64(0xA6B7FFEFD2BB253E) /*  484 */, CONST64(0x2E25BC95B0A29D4F) /*  485 */,
+    CONST64(0x86D6A58BDEF1388C) /*  486 */, CONST64(0xDED74AC576B6F054) /*  487 */,
+    CONST64(0x8030BDBC2B45805D) /*  488 */, CONST64(0x3C81AF70E94D9289) /*  489 */,
+    CONST64(0x3EFF6DDA9E3100DB) /*  490 */, CONST64(0xB38DC39FDFCC8847) /*  491 */,
+    CONST64(0x123885528D17B87E) /*  492 */, CONST64(0xF2DA0ED240B1B642) /*  493 */,
+    CONST64(0x44CEFADCD54BF9A9) /*  494 */, CONST64(0x1312200E433C7EE6) /*  495 */,
+    CONST64(0x9FFCC84F3A78C748) /*  496 */, CONST64(0xF0CD1F72248576BB) /*  497 */,
+    CONST64(0xEC6974053638CFE4) /*  498 */, CONST64(0x2BA7B67C0CEC4E4C) /*  499 */,
+    CONST64(0xAC2F4DF3E5CE32ED) /*  500 */, CONST64(0xCB33D14326EA4C11) /*  501 */,
+    CONST64(0xA4E9044CC77E58BC) /*  502 */, CONST64(0x5F513293D934FCEF) /*  503 */,
+    CONST64(0x5DC9645506E55444) /*  504 */, CONST64(0x50DE418F317DE40A) /*  505 */,
+    CONST64(0x388CB31A69DDE259) /*  506 */, CONST64(0x2DB4A83455820A86) /*  507 */,
+    CONST64(0x9010A91E84711AE9) /*  508 */, CONST64(0x4DF7F0B7B1498371) /*  509 */,
+    CONST64(0xD62A2EABC0977179) /*  510 */, CONST64(0x22FAC097AA8D5C0E) /*  511 */,
+    CONST64(0xF49FCC2FF1DAF39B) /*  512 */, CONST64(0x487FD5C66FF29281) /*  513 */,
+    CONST64(0xE8A30667FCDCA83F) /*  514 */, CONST64(0x2C9B4BE3D2FCCE63) /*  515 */,
+    CONST64(0xDA3FF74B93FBBBC2) /*  516 */, CONST64(0x2FA165D2FE70BA66) /*  517 */,
+    CONST64(0xA103E279970E93D4) /*  518 */, CONST64(0xBECDEC77B0E45E71) /*  519 */,
+    CONST64(0xCFB41E723985E497) /*  520 */, CONST64(0xB70AAA025EF75017) /*  521 */,
+    CONST64(0xD42309F03840B8E0) /*  522 */, CONST64(0x8EFC1AD035898579) /*  523 */,
+    CONST64(0x96C6920BE2B2ABC5) /*  524 */, CONST64(0x66AF4163375A9172) /*  525 */,
+    CONST64(0x2174ABDCCA7127FB) /*  526 */, CONST64(0xB33CCEA64A72FF41) /*  527 */,
+    CONST64(0xF04A4933083066A5) /*  528 */, CONST64(0x8D970ACDD7289AF5) /*  529 */,
+    CONST64(0x8F96E8E031C8C25E) /*  530 */, CONST64(0xF3FEC02276875D47) /*  531 */,
+    CONST64(0xEC7BF310056190DD) /*  532 */, CONST64(0xF5ADB0AEBB0F1491) /*  533 */,
+    CONST64(0x9B50F8850FD58892) /*  534 */, CONST64(0x4975488358B74DE8) /*  535 */,
+    CONST64(0xA3354FF691531C61) /*  536 */, CONST64(0x0702BBE481D2C6EE) /*  537 */,
+    CONST64(0x89FB24057DEDED98) /*  538 */, CONST64(0xAC3075138596E902) /*  539 */,
+    CONST64(0x1D2D3580172772ED) /*  540 */, CONST64(0xEB738FC28E6BC30D) /*  541 */,
+    CONST64(0x5854EF8F63044326) /*  542 */, CONST64(0x9E5C52325ADD3BBE) /*  543 */,
+    CONST64(0x90AA53CF325C4623) /*  544 */, CONST64(0xC1D24D51349DD067) /*  545 */,
+    CONST64(0x2051CFEEA69EA624) /*  546 */, CONST64(0x13220F0A862E7E4F) /*  547 */,
+    CONST64(0xCE39399404E04864) /*  548 */, CONST64(0xD9C42CA47086FCB7) /*  549 */,
+    CONST64(0x685AD2238A03E7CC) /*  550 */, CONST64(0x066484B2AB2FF1DB) /*  551 */,
+    CONST64(0xFE9D5D70EFBF79EC) /*  552 */, CONST64(0x5B13B9DD9C481854) /*  553 */,
+    CONST64(0x15F0D475ED1509AD) /*  554 */, CONST64(0x0BEBCD060EC79851) /*  555 */,
+    CONST64(0xD58C6791183AB7F8) /*  556 */, CONST64(0xD1187C5052F3EEE4) /*  557 */,
+    CONST64(0xC95D1192E54E82FF) /*  558 */, CONST64(0x86EEA14CB9AC6CA2) /*  559 */,
+    CONST64(0x3485BEB153677D5D) /*  560 */, CONST64(0xDD191D781F8C492A) /*  561 */,
+    CONST64(0xF60866BAA784EBF9) /*  562 */, CONST64(0x518F643BA2D08C74) /*  563 */,
+    CONST64(0x8852E956E1087C22) /*  564 */, CONST64(0xA768CB8DC410AE8D) /*  565 */,
+    CONST64(0x38047726BFEC8E1A) /*  566 */, CONST64(0xA67738B4CD3B45AA) /*  567 */,
+    CONST64(0xAD16691CEC0DDE19) /*  568 */, CONST64(0xC6D4319380462E07) /*  569 */,
+    CONST64(0xC5A5876D0BA61938) /*  570 */, CONST64(0x16B9FA1FA58FD840) /*  571 */,
+    CONST64(0x188AB1173CA74F18) /*  572 */, CONST64(0xABDA2F98C99C021F) /*  573 */,
+    CONST64(0x3E0580AB134AE816) /*  574 */, CONST64(0x5F3B05B773645ABB) /*  575 */,
+    CONST64(0x2501A2BE5575F2F6) /*  576 */, CONST64(0x1B2F74004E7E8BA9) /*  577 */,
+    CONST64(0x1CD7580371E8D953) /*  578 */, CONST64(0x7F6ED89562764E30) /*  579 */,
+    CONST64(0xB15926FF596F003D) /*  580 */, CONST64(0x9F65293DA8C5D6B9) /*  581 */,
+    CONST64(0x6ECEF04DD690F84C) /*  582 */, CONST64(0x4782275FFF33AF88) /*  583 */,
+    CONST64(0xE41433083F820801) /*  584 */, CONST64(0xFD0DFE409A1AF9B5) /*  585 */,
+    CONST64(0x4325A3342CDB396B) /*  586 */, CONST64(0x8AE77E62B301B252) /*  587 */,
+    CONST64(0xC36F9E9F6655615A) /*  588 */, CONST64(0x85455A2D92D32C09) /*  589 */,
+    CONST64(0xF2C7DEA949477485) /*  590 */, CONST64(0x63CFB4C133A39EBA) /*  591 */,
+    CONST64(0x83B040CC6EBC5462) /*  592 */, CONST64(0x3B9454C8FDB326B0) /*  593 */,
+    CONST64(0x56F56A9E87FFD78C) /*  594 */, CONST64(0x2DC2940D99F42BC6) /*  595 */,
+    CONST64(0x98F7DF096B096E2D) /*  596 */, CONST64(0x19A6E01E3AD852BF) /*  597 */,
+    CONST64(0x42A99CCBDBD4B40B) /*  598 */, CONST64(0xA59998AF45E9C559) /*  599 */,
+    CONST64(0x366295E807D93186) /*  600 */, CONST64(0x6B48181BFAA1F773) /*  601 */,
+    CONST64(0x1FEC57E2157A0A1D) /*  602 */, CONST64(0x4667446AF6201AD5) /*  603 */,
+    CONST64(0xE615EBCACFB0F075) /*  604 */, CONST64(0xB8F31F4F68290778) /*  605 */,
+    CONST64(0x22713ED6CE22D11E) /*  606 */, CONST64(0x3057C1A72EC3C93B) /*  607 */,
+    CONST64(0xCB46ACC37C3F1F2F) /*  608 */, CONST64(0xDBB893FD02AAF50E) /*  609 */,
+    CONST64(0x331FD92E600B9FCF) /*  610 */, CONST64(0xA498F96148EA3AD6) /*  611 */,
+    CONST64(0xA8D8426E8B6A83EA) /*  612 */, CONST64(0xA089B274B7735CDC) /*  613 */,
+    CONST64(0x87F6B3731E524A11) /*  614 */, CONST64(0x118808E5CBC96749) /*  615 */,
+    CONST64(0x9906E4C7B19BD394) /*  616 */, CONST64(0xAFED7F7E9B24A20C) /*  617 */,
+    CONST64(0x6509EADEEB3644A7) /*  618 */, CONST64(0x6C1EF1D3E8EF0EDE) /*  619 */,
+    CONST64(0xB9C97D43E9798FB4) /*  620 */, CONST64(0xA2F2D784740C28A3) /*  621 */,
+    CONST64(0x7B8496476197566F) /*  622 */, CONST64(0x7A5BE3E6B65F069D) /*  623 */,
+    CONST64(0xF96330ED78BE6F10) /*  624 */, CONST64(0xEEE60DE77A076A15) /*  625 */,
+    CONST64(0x2B4BEE4AA08B9BD0) /*  626 */, CONST64(0x6A56A63EC7B8894E) /*  627 */,
+    CONST64(0x02121359BA34FEF4) /*  628 */, CONST64(0x4CBF99F8283703FC) /*  629 */,
+    CONST64(0x398071350CAF30C8) /*  630 */, CONST64(0xD0A77A89F017687A) /*  631 */,
+    CONST64(0xF1C1A9EB9E423569) /*  632 */, CONST64(0x8C7976282DEE8199) /*  633 */,
+    CONST64(0x5D1737A5DD1F7ABD) /*  634 */, CONST64(0x4F53433C09A9FA80) /*  635 */,
+    CONST64(0xFA8B0C53DF7CA1D9) /*  636 */, CONST64(0x3FD9DCBC886CCB77) /*  637 */,
+    CONST64(0xC040917CA91B4720) /*  638 */, CONST64(0x7DD00142F9D1DCDF) /*  639 */,
+    CONST64(0x8476FC1D4F387B58) /*  640 */, CONST64(0x23F8E7C5F3316503) /*  641 */,
+    CONST64(0x032A2244E7E37339) /*  642 */, CONST64(0x5C87A5D750F5A74B) /*  643 */,
+    CONST64(0x082B4CC43698992E) /*  644 */, CONST64(0xDF917BECB858F63C) /*  645 */,
+    CONST64(0x3270B8FC5BF86DDA) /*  646 */, CONST64(0x10AE72BB29B5DD76) /*  647 */,
+    CONST64(0x576AC94E7700362B) /*  648 */, CONST64(0x1AD112DAC61EFB8F) /*  649 */,
+    CONST64(0x691BC30EC5FAA427) /*  650 */, CONST64(0xFF246311CC327143) /*  651 */,
+    CONST64(0x3142368E30E53206) /*  652 */, CONST64(0x71380E31E02CA396) /*  653 */,
+    CONST64(0x958D5C960AAD76F1) /*  654 */, CONST64(0xF8D6F430C16DA536) /*  655 */,
+    CONST64(0xC8FFD13F1BE7E1D2) /*  656 */, CONST64(0x7578AE66004DDBE1) /*  657 */,
+    CONST64(0x05833F01067BE646) /*  658 */, CONST64(0xBB34B5AD3BFE586D) /*  659 */,
+    CONST64(0x095F34C9A12B97F0) /*  660 */, CONST64(0x247AB64525D60CA8) /*  661 */,
+    CONST64(0xDCDBC6F3017477D1) /*  662 */, CONST64(0x4A2E14D4DECAD24D) /*  663 */,
+    CONST64(0xBDB5E6D9BE0A1EEB) /*  664 */, CONST64(0x2A7E70F7794301AB) /*  665 */,
+    CONST64(0xDEF42D8A270540FD) /*  666 */, CONST64(0x01078EC0A34C22C1) /*  667 */,
+    CONST64(0xE5DE511AF4C16387) /*  668 */, CONST64(0x7EBB3A52BD9A330A) /*  669 */,
+    CONST64(0x77697857AA7D6435) /*  670 */, CONST64(0x004E831603AE4C32) /*  671 */,
+    CONST64(0xE7A21020AD78E312) /*  672 */, CONST64(0x9D41A70C6AB420F2) /*  673 */,
+    CONST64(0x28E06C18EA1141E6) /*  674 */, CONST64(0xD2B28CBD984F6B28) /*  675 */,
+    CONST64(0x26B75F6C446E9D83) /*  676 */, CONST64(0xBA47568C4D418D7F) /*  677 */,
+    CONST64(0xD80BADBFE6183D8E) /*  678 */, CONST64(0x0E206D7F5F166044) /*  679 */,
+    CONST64(0xE258A43911CBCA3E) /*  680 */, CONST64(0x723A1746B21DC0BC) /*  681 */,
+    CONST64(0xC7CAA854F5D7CDD3) /*  682 */, CONST64(0x7CAC32883D261D9C) /*  683 */,
+    CONST64(0x7690C26423BA942C) /*  684 */, CONST64(0x17E55524478042B8) /*  685 */,
+    CONST64(0xE0BE477656A2389F) /*  686 */, CONST64(0x4D289B5E67AB2DA0) /*  687 */,
+    CONST64(0x44862B9C8FBBFD31) /*  688 */, CONST64(0xB47CC8049D141365) /*  689 */,
+    CONST64(0x822C1B362B91C793) /*  690 */, CONST64(0x4EB14655FB13DFD8) /*  691 */,
+    CONST64(0x1ECBBA0714E2A97B) /*  692 */, CONST64(0x6143459D5CDE5F14) /*  693 */,
+    CONST64(0x53A8FBF1D5F0AC89) /*  694 */, CONST64(0x97EA04D81C5E5B00) /*  695 */,
+    CONST64(0x622181A8D4FDB3F3) /*  696 */, CONST64(0xE9BCD341572A1208) /*  697 */,
+    CONST64(0x1411258643CCE58A) /*  698 */, CONST64(0x9144C5FEA4C6E0A4) /*  699 */,
+    CONST64(0x0D33D06565CF620F) /*  700 */, CONST64(0x54A48D489F219CA1) /*  701 */,
+    CONST64(0xC43E5EAC6D63C821) /*  702 */, CONST64(0xA9728B3A72770DAF) /*  703 */,
+    CONST64(0xD7934E7B20DF87EF) /*  704 */, CONST64(0xE35503B61A3E86E5) /*  705 */,
+    CONST64(0xCAE321FBC819D504) /*  706 */, CONST64(0x129A50B3AC60BFA6) /*  707 */,
+    CONST64(0xCD5E68EA7E9FB6C3) /*  708 */, CONST64(0xB01C90199483B1C7) /*  709 */,
+    CONST64(0x3DE93CD5C295376C) /*  710 */, CONST64(0xAED52EDF2AB9AD13) /*  711 */,
+    CONST64(0x2E60F512C0A07884) /*  712 */, CONST64(0xBC3D86A3E36210C9) /*  713 */,
+    CONST64(0x35269D9B163951CE) /*  714 */, CONST64(0x0C7D6E2AD0CDB5FA) /*  715 */,
+    CONST64(0x59E86297D87F5733) /*  716 */, CONST64(0x298EF221898DB0E7) /*  717 */,
+    CONST64(0x55000029D1A5AA7E) /*  718 */, CONST64(0x8BC08AE1B5061B45) /*  719 */,
+    CONST64(0xC2C31C2B6C92703A) /*  720 */, CONST64(0x94CC596BAF25EF42) /*  721 */,
+    CONST64(0x0A1D73DB22540456) /*  722 */, CONST64(0x04B6A0F9D9C4179A) /*  723 */,
+    CONST64(0xEFFDAFA2AE3D3C60) /*  724 */, CONST64(0xF7C8075BB49496C4) /*  725 */,
+    CONST64(0x9CC5C7141D1CD4E3) /*  726 */, CONST64(0x78BD1638218E5534) /*  727 */,
+    CONST64(0xB2F11568F850246A) /*  728 */, CONST64(0xEDFABCFA9502BC29) /*  729 */,
+    CONST64(0x796CE5F2DA23051B) /*  730 */, CONST64(0xAAE128B0DC93537C) /*  731 */,
+    CONST64(0x3A493DA0EE4B29AE) /*  732 */, CONST64(0xB5DF6B2C416895D7) /*  733 */,
+    CONST64(0xFCABBD25122D7F37) /*  734 */, CONST64(0x70810B58105DC4B1) /*  735 */,
+    CONST64(0xE10FDD37F7882A90) /*  736 */, CONST64(0x524DCAB5518A3F5C) /*  737 */,
+    CONST64(0x3C9E85878451255B) /*  738 */, CONST64(0x4029828119BD34E2) /*  739 */,
+    CONST64(0x74A05B6F5D3CECCB) /*  740 */, CONST64(0xB610021542E13ECA) /*  741 */,
+    CONST64(0x0FF979D12F59E2AC) /*  742 */, CONST64(0x6037DA27E4F9CC50) /*  743 */,
+    CONST64(0x5E92975A0DF1847D) /*  744 */, CONST64(0xD66DE190D3E623FE) /*  745 */,
+    CONST64(0x5032D6B87B568048) /*  746 */, CONST64(0x9A36B7CE8235216E) /*  747 */,
+    CONST64(0x80272A7A24F64B4A) /*  748 */, CONST64(0x93EFED8B8C6916F7) /*  749 */,
+    CONST64(0x37DDBFF44CCE1555) /*  750 */, CONST64(0x4B95DB5D4B99BD25) /*  751 */,
+    CONST64(0x92D3FDA169812FC0) /*  752 */, CONST64(0xFB1A4A9A90660BB6) /*  753 */,
+    CONST64(0x730C196946A4B9B2) /*  754 */, CONST64(0x81E289AA7F49DA68) /*  755 */,
+    CONST64(0x64669A0F83B1A05F) /*  756 */, CONST64(0x27B3FF7D9644F48B) /*  757 */,
+    CONST64(0xCC6B615C8DB675B3) /*  758 */, CONST64(0x674F20B9BCEBBE95) /*  759 */,
+    CONST64(0x6F31238275655982) /*  760 */, CONST64(0x5AE488713E45CF05) /*  761 */,
+    CONST64(0xBF619F9954C21157) /*  762 */, CONST64(0xEABAC46040A8EAE9) /*  763 */,
+    CONST64(0x454C6FE9F2C0C1CD) /*  764 */, CONST64(0x419CF6496412691C) /*  765 */,
+    CONST64(0xD3DC3BEF265B0F70) /*  766 */, CONST64(0x6D0E60F5C3578A9E) /*  767 */,
+    CONST64(0x5B0E608526323C55) /*  768 */, CONST64(0x1A46C1A9FA1B59F5) /*  769 */,
+    CONST64(0xA9E245A17C4C8FFA) /*  770 */, CONST64(0x65CA5159DB2955D7) /*  771 */,
+    CONST64(0x05DB0A76CE35AFC2) /*  772 */, CONST64(0x81EAC77EA9113D45) /*  773 */,
+    CONST64(0x528EF88AB6AC0A0D) /*  774 */, CONST64(0xA09EA253597BE3FF) /*  775 */,
+    CONST64(0x430DDFB3AC48CD56) /*  776 */, CONST64(0xC4B3A67AF45CE46F) /*  777 */,
+    CONST64(0x4ECECFD8FBE2D05E) /*  778 */, CONST64(0x3EF56F10B39935F0) /*  779 */,
+    CONST64(0x0B22D6829CD619C6) /*  780 */, CONST64(0x17FD460A74DF2069) /*  781 */,
+    CONST64(0x6CF8CC8E8510ED40) /*  782 */, CONST64(0xD6C824BF3A6ECAA7) /*  783 */,
+    CONST64(0x61243D581A817049) /*  784 */, CONST64(0x048BACB6BBC163A2) /*  785 */,
+    CONST64(0xD9A38AC27D44CC32) /*  786 */, CONST64(0x7FDDFF5BAAF410AB) /*  787 */,
+    CONST64(0xAD6D495AA804824B) /*  788 */, CONST64(0xE1A6A74F2D8C9F94) /*  789 */,
+    CONST64(0xD4F7851235DEE8E3) /*  790 */, CONST64(0xFD4B7F886540D893) /*  791 */,
+    CONST64(0x247C20042AA4BFDA) /*  792 */, CONST64(0x096EA1C517D1327C) /*  793 */,
+    CONST64(0xD56966B4361A6685) /*  794 */, CONST64(0x277DA5C31221057D) /*  795 */,
+    CONST64(0x94D59893A43ACFF7) /*  796 */, CONST64(0x64F0C51CCDC02281) /*  797 */,
+    CONST64(0x3D33BCC4FF6189DB) /*  798 */, CONST64(0xE005CB184CE66AF1) /*  799 */,
+    CONST64(0xFF5CCD1D1DB99BEA) /*  800 */, CONST64(0xB0B854A7FE42980F) /*  801 */,
+    CONST64(0x7BD46A6A718D4B9F) /*  802 */, CONST64(0xD10FA8CC22A5FD8C) /*  803 */,
+    CONST64(0xD31484952BE4BD31) /*  804 */, CONST64(0xC7FA975FCB243847) /*  805 */,
+    CONST64(0x4886ED1E5846C407) /*  806 */, CONST64(0x28CDDB791EB70B04) /*  807 */,
+    CONST64(0xC2B00BE2F573417F) /*  808 */, CONST64(0x5C9590452180F877) /*  809 */,
+    CONST64(0x7A6BDDFFF370EB00) /*  810 */, CONST64(0xCE509E38D6D9D6A4) /*  811 */,
+    CONST64(0xEBEB0F00647FA702) /*  812 */, CONST64(0x1DCC06CF76606F06) /*  813 */,
+    CONST64(0xE4D9F28BA286FF0A) /*  814 */, CONST64(0xD85A305DC918C262) /*  815 */,
+    CONST64(0x475B1D8732225F54) /*  816 */, CONST64(0x2D4FB51668CCB5FE) /*  817 */,
+    CONST64(0xA679B9D9D72BBA20) /*  818 */, CONST64(0x53841C0D912D43A5) /*  819 */,
+    CONST64(0x3B7EAA48BF12A4E8) /*  820 */, CONST64(0x781E0E47F22F1DDF) /*  821 */,
+    CONST64(0xEFF20CE60AB50973) /*  822 */, CONST64(0x20D261D19DFFB742) /*  823 */,
+    CONST64(0x16A12B03062A2E39) /*  824 */, CONST64(0x1960EB2239650495) /*  825 */,
+    CONST64(0x251C16FED50EB8B8) /*  826 */, CONST64(0x9AC0C330F826016E) /*  827 */,
+    CONST64(0xED152665953E7671) /*  828 */, CONST64(0x02D63194A6369570) /*  829 */,
+    CONST64(0x5074F08394B1C987) /*  830 */, CONST64(0x70BA598C90B25CE1) /*  831 */,
+    CONST64(0x794A15810B9742F6) /*  832 */, CONST64(0x0D5925E9FCAF8C6C) /*  833 */,
+    CONST64(0x3067716CD868744E) /*  834 */, CONST64(0x910AB077E8D7731B) /*  835 */,
+    CONST64(0x6A61BBDB5AC42F61) /*  836 */, CONST64(0x93513EFBF0851567) /*  837 */,
+    CONST64(0xF494724B9E83E9D5) /*  838 */, CONST64(0xE887E1985C09648D) /*  839 */,
+    CONST64(0x34B1D3C675370CFD) /*  840 */, CONST64(0xDC35E433BC0D255D) /*  841 */,
+    CONST64(0xD0AAB84234131BE0) /*  842 */, CONST64(0x08042A50B48B7EAF) /*  843 */,
+    CONST64(0x9997C4EE44A3AB35) /*  844 */, CONST64(0x829A7B49201799D0) /*  845 */,
+    CONST64(0x263B8307B7C54441) /*  846 */, CONST64(0x752F95F4FD6A6CA6) /*  847 */,
+    CONST64(0x927217402C08C6E5) /*  848 */, CONST64(0x2A8AB754A795D9EE) /*  849 */,
+    CONST64(0xA442F7552F72943D) /*  850 */, CONST64(0x2C31334E19781208) /*  851 */,
+    CONST64(0x4FA98D7CEAEE6291) /*  852 */, CONST64(0x55C3862F665DB309) /*  853 */,
+    CONST64(0xBD0610175D53B1F3) /*  854 */, CONST64(0x46FE6CB840413F27) /*  855 */,
+    CONST64(0x3FE03792DF0CFA59) /*  856 */, CONST64(0xCFE700372EB85E8F) /*  857 */,
+    CONST64(0xA7BE29E7ADBCE118) /*  858 */, CONST64(0xE544EE5CDE8431DD) /*  859 */,
+    CONST64(0x8A781B1B41F1873E) /*  860 */, CONST64(0xA5C94C78A0D2F0E7) /*  861 */,
+    CONST64(0x39412E2877B60728) /*  862 */, CONST64(0xA1265EF3AFC9A62C) /*  863 */,
+    CONST64(0xBCC2770C6A2506C5) /*  864 */, CONST64(0x3AB66DD5DCE1CE12) /*  865 */,
+    CONST64(0xE65499D04A675B37) /*  866 */, CONST64(0x7D8F523481BFD216) /*  867 */,
+    CONST64(0x0F6F64FCEC15F389) /*  868 */, CONST64(0x74EFBE618B5B13C8) /*  869 */,
+    CONST64(0xACDC82B714273E1D) /*  870 */, CONST64(0xDD40BFE003199D17) /*  871 */,
+    CONST64(0x37E99257E7E061F8) /*  872 */, CONST64(0xFA52626904775AAA) /*  873 */,
+    CONST64(0x8BBBF63A463D56F9) /*  874 */, CONST64(0xF0013F1543A26E64) /*  875 */,
+    CONST64(0xA8307E9F879EC898) /*  876 */, CONST64(0xCC4C27A4150177CC) /*  877 */,
+    CONST64(0x1B432F2CCA1D3348) /*  878 */, CONST64(0xDE1D1F8F9F6FA013) /*  879 */,
+    CONST64(0x606602A047A7DDD6) /*  880 */, CONST64(0xD237AB64CC1CB2C7) /*  881 */,
+    CONST64(0x9B938E7225FCD1D3) /*  882 */, CONST64(0xEC4E03708E0FF476) /*  883 */,
+    CONST64(0xFEB2FBDA3D03C12D) /*  884 */, CONST64(0xAE0BCED2EE43889A) /*  885 */,
+    CONST64(0x22CB8923EBFB4F43) /*  886 */, CONST64(0x69360D013CF7396D) /*  887 */,
+    CONST64(0x855E3602D2D4E022) /*  888 */, CONST64(0x073805BAD01F784C) /*  889 */,
+    CONST64(0x33E17A133852F546) /*  890 */, CONST64(0xDF4874058AC7B638) /*  891 */,
+    CONST64(0xBA92B29C678AA14A) /*  892 */, CONST64(0x0CE89FC76CFAADCD) /*  893 */,
+    CONST64(0x5F9D4E0908339E34) /*  894 */, CONST64(0xF1AFE9291F5923B9) /*  895 */,
+    CONST64(0x6E3480F60F4A265F) /*  896 */, CONST64(0xEEBF3A2AB29B841C) /*  897 */,
+    CONST64(0xE21938A88F91B4AD) /*  898 */, CONST64(0x57DFEFF845C6D3C3) /*  899 */,
+    CONST64(0x2F006B0BF62CAAF2) /*  900 */, CONST64(0x62F479EF6F75EE78) /*  901 */,
+    CONST64(0x11A55AD41C8916A9) /*  902 */, CONST64(0xF229D29084FED453) /*  903 */,
+    CONST64(0x42F1C27B16B000E6) /*  904 */, CONST64(0x2B1F76749823C074) /*  905 */,
+    CONST64(0x4B76ECA3C2745360) /*  906 */, CONST64(0x8C98F463B91691BD) /*  907 */,
+    CONST64(0x14BCC93CF1ADE66A) /*  908 */, CONST64(0x8885213E6D458397) /*  909 */,
+    CONST64(0x8E177DF0274D4711) /*  910 */, CONST64(0xB49B73B5503F2951) /*  911 */,
+    CONST64(0x10168168C3F96B6B) /*  912 */, CONST64(0x0E3D963B63CAB0AE) /*  913 */,
+    CONST64(0x8DFC4B5655A1DB14) /*  914 */, CONST64(0xF789F1356E14DE5C) /*  915 */,
+    CONST64(0x683E68AF4E51DAC1) /*  916 */, CONST64(0xC9A84F9D8D4B0FD9) /*  917 */,
+    CONST64(0x3691E03F52A0F9D1) /*  918 */, CONST64(0x5ED86E46E1878E80) /*  919 */,
+    CONST64(0x3C711A0E99D07150) /*  920 */, CONST64(0x5A0865B20C4E9310) /*  921 */,
+    CONST64(0x56FBFC1FE4F0682E) /*  922 */, CONST64(0xEA8D5DE3105EDF9B) /*  923 */,
+    CONST64(0x71ABFDB12379187A) /*  924 */, CONST64(0x2EB99DE1BEE77B9C) /*  925 */,
+    CONST64(0x21ECC0EA33CF4523) /*  926 */, CONST64(0x59A4D7521805C7A1) /*  927 */,
+    CONST64(0x3896F5EB56AE7C72) /*  928 */, CONST64(0xAA638F3DB18F75DC) /*  929 */,
+    CONST64(0x9F39358DABE9808E) /*  930 */, CONST64(0xB7DEFA91C00B72AC) /*  931 */,
+    CONST64(0x6B5541FD62492D92) /*  932 */, CONST64(0x6DC6DEE8F92E4D5B) /*  933 */,
+    CONST64(0x353F57ABC4BEEA7E) /*  934 */, CONST64(0x735769D6DA5690CE) /*  935 */,
+    CONST64(0x0A234AA642391484) /*  936 */, CONST64(0xF6F9508028F80D9D) /*  937 */,
+    CONST64(0xB8E319A27AB3F215) /*  938 */, CONST64(0x31AD9C1151341A4D) /*  939 */,
+    CONST64(0x773C22A57BEF5805) /*  940 */, CONST64(0x45C7561A07968633) /*  941 */,
+    CONST64(0xF913DA9E249DBE36) /*  942 */, CONST64(0xDA652D9B78A64C68) /*  943 */,
+    CONST64(0x4C27A97F3BC334EF) /*  944 */, CONST64(0x76621220E66B17F4) /*  945 */,
+    CONST64(0x967743899ACD7D0B) /*  946 */, CONST64(0xF3EE5BCAE0ED6782) /*  947 */,
+    CONST64(0x409F753600C879FC) /*  948 */, CONST64(0x06D09A39B5926DB6) /*  949 */,
+    CONST64(0x6F83AEB0317AC588) /*  950 */, CONST64(0x01E6CA4A86381F21) /*  951 */,
+    CONST64(0x66FF3462D19F3025) /*  952 */, CONST64(0x72207C24DDFD3BFB) /*  953 */,
+    CONST64(0x4AF6B6D3E2ECE2EB) /*  954 */, CONST64(0x9C994DBEC7EA08DE) /*  955 */,
+    CONST64(0x49ACE597B09A8BC4) /*  956 */, CONST64(0xB38C4766CF0797BA) /*  957 */,
+    CONST64(0x131B9373C57C2A75) /*  958 */, CONST64(0xB1822CCE61931E58) /*  959 */,
+    CONST64(0x9D7555B909BA1C0C) /*  960 */, CONST64(0x127FAFDD937D11D2) /*  961 */,
+    CONST64(0x29DA3BADC66D92E4) /*  962 */, CONST64(0xA2C1D57154C2ECBC) /*  963 */,
+    CONST64(0x58C5134D82F6FE24) /*  964 */, CONST64(0x1C3AE3515B62274F) /*  965 */,
+    CONST64(0xE907C82E01CB8126) /*  966 */, CONST64(0xF8ED091913E37FCB) /*  967 */,
+    CONST64(0x3249D8F9C80046C9) /*  968 */, CONST64(0x80CF9BEDE388FB63) /*  969 */,
+    CONST64(0x1881539A116CF19E) /*  970 */, CONST64(0x5103F3F76BD52457) /*  971 */,
+    CONST64(0x15B7E6F5AE47F7A8) /*  972 */, CONST64(0xDBD7C6DED47E9CCF) /*  973 */,
+    CONST64(0x44E55C410228BB1A) /*  974 */, CONST64(0xB647D4255EDB4E99) /*  975 */,
+    CONST64(0x5D11882BB8AAFC30) /*  976 */, CONST64(0xF5098BBB29D3212A) /*  977 */,
+    CONST64(0x8FB5EA14E90296B3) /*  978 */, CONST64(0x677B942157DD025A) /*  979 */,
+    CONST64(0xFB58E7C0A390ACB5) /*  980 */, CONST64(0x89D3674C83BD4A01) /*  981 */,
+    CONST64(0x9E2DA4DF4BF3B93B) /*  982 */, CONST64(0xFCC41E328CAB4829) /*  983 */,
+    CONST64(0x03F38C96BA582C52) /*  984 */, CONST64(0xCAD1BDBD7FD85DB2) /*  985 */,
+    CONST64(0xBBB442C16082AE83) /*  986 */, CONST64(0xB95FE86BA5DA9AB0) /*  987 */,
+    CONST64(0xB22E04673771A93F) /*  988 */, CONST64(0x845358C9493152D8) /*  989 */,
+    CONST64(0xBE2A488697B4541E) /*  990 */, CONST64(0x95A2DC2DD38E6966) /*  991 */,
+    CONST64(0xC02C11AC923C852B) /*  992 */, CONST64(0x2388B1990DF2A87B) /*  993 */,
+    CONST64(0x7C8008FA1B4F37BE) /*  994 */, CONST64(0x1F70D0C84D54E503) /*  995 */,
+    CONST64(0x5490ADEC7ECE57D4) /*  996 */, CONST64(0x002B3C27D9063A3A) /*  997 */,
+    CONST64(0x7EAEA3848030A2BF) /*  998 */, CONST64(0xC602326DED2003C0) /*  999 */,
+    CONST64(0x83A7287D69A94086) /* 1000 */, CONST64(0xC57A5FCB30F57A8A) /* 1001 */,
+    CONST64(0xB56844E479EBE779) /* 1002 */, CONST64(0xA373B40F05DCBCE9) /* 1003 */,
+    CONST64(0xD71A786E88570EE2) /* 1004 */, CONST64(0x879CBACDBDE8F6A0) /* 1005 */,
+    CONST64(0x976AD1BCC164A32F) /* 1006 */, CONST64(0xAB21E25E9666D78B) /* 1007 */,
+    CONST64(0x901063AAE5E5C33C) /* 1008 */, CONST64(0x9818B34448698D90) /* 1009 */,
+    CONST64(0xE36487AE3E1E8ABB) /* 1010 */, CONST64(0xAFBDF931893BDCB4) /* 1011 */,
+    CONST64(0x6345A0DC5FBBD519) /* 1012 */, CONST64(0x8628FE269B9465CA) /* 1013 */,
+    CONST64(0x1E5D01603F9C51EC) /* 1014 */, CONST64(0x4DE44006A15049B7) /* 1015 */,
+    CONST64(0xBF6C70E5F776CBB1) /* 1016 */, CONST64(0x411218F2EF552BED) /* 1017 */,
+    CONST64(0xCB0C0708705A36A3) /* 1018 */, CONST64(0xE74D14754F986044) /* 1019 */,
+    CONST64(0xCD56D9430EA8280E) /* 1020 */, CONST64(0xC12591D7535F5065) /* 1021 */,
+    CONST64(0xC83223F1720AEF96) /* 1022 */, CONST64(0xC3A0396F7363A51F) /* 1023 */};
+
+#ifdef _MSC_VER
+   #define INLINE __inline
+#else
+   #define INLINE
+#endif
+
+/* one round of the hash function */
+INLINE static void tiger_round(ulong64 *a, ulong64 *b, ulong64 *c, ulong64 x, int mul)
+{
+    ulong64 tmp;
+    tmp = (*c ^= x);
+           *a -= t1[LTC_BYTE(tmp, 0)] ^ t2[LTC_BYTE(tmp, 2)] ^ t3[LTC_BYTE(tmp, 4)] ^ t4[LTC_BYTE(tmp, 6)];
+    tmp = (*b += t4[LTC_BYTE(tmp, 1)] ^ t3[LTC_BYTE(tmp, 3)] ^ t2[LTC_BYTE(tmp,5)] ^ t1[LTC_BYTE(tmp,7)]);
+    switch (mul) {
+        case 5:  *b = (tmp << 2) + tmp; break;
+        case 7:  *b = (tmp << 3) - tmp; break;
+        case 9:  *b = (tmp << 3) + tmp; break;
+    }
+}
+
+/* one complete pass */
+static void pass(ulong64 *a, ulong64 *b, ulong64 *c, const ulong64 *x, int mul)
+{
+   tiger_round(a,b,c,x[0],mul);
+   tiger_round(b,c,a,x[1],mul);
+   tiger_round(c,a,b,x[2],mul);
+   tiger_round(a,b,c,x[3],mul);
+   tiger_round(b,c,a,x[4],mul);
+   tiger_round(c,a,b,x[5],mul);
+   tiger_round(a,b,c,x[6],mul);
+   tiger_round(b,c,a,x[7],mul);
+}
+
+/* The key mixing schedule */
+static void key_schedule(ulong64 *x)
+{
+    x[0] -= x[7] ^ CONST64(0xA5A5A5A5A5A5A5A5);
+    x[1] ^= x[0];
+    x[2] += x[1];
+    x[3] -= x[2] ^ ((~x[1])<<19);
+    x[4] ^= x[3];
+    x[5] += x[4];
+    x[6] -= x[5] ^ ((~x[4])>>23);
+    x[7] ^= x[6];
+    x[0] += x[7];
+    x[1] -= x[0] ^ ((~x[7])<<19);
+    x[2] ^= x[1];
+    x[3] += x[2];
+    x[4] -= x[3] ^ ((~x[2])>>23);
+    x[5] ^= x[4];
+    x[6] += x[5];
+    x[7] -= x[6] ^ CONST64(0x0123456789ABCDEF);
+}
+
+#ifdef LTC_CLEAN_STACK
+static int _tiger_compress(hash_state *md, const unsigned char *buf)
+#else
+static int  tiger_compress(hash_state *md, const unsigned char *buf)
+#endif
+{
+    ulong64 a, b, c, x[8];
+    unsigned long i;
+
+    /* load words */
+    for (i = 0; i < 8; i++) {
+        LOAD64L(x[i],&buf[8*i]);
+    }
+    a = md->tiger.state[0];
+    b = md->tiger.state[1];
+    c = md->tiger.state[2];
+
+    pass(&a,&b,&c,x,5);
+    key_schedule(x);
+    pass(&c,&a,&b,x,7);
+    key_schedule(x);
+    pass(&b,&c,&a,x,9);
+
+    /* store state */
+    md->tiger.state[0] = a ^ md->tiger.state[0];
+    md->tiger.state[1] = b - md->tiger.state[1];
+    md->tiger.state[2] = c + md->tiger.state[2];
+
+    return CRYPT_OK;
+}
+
+#ifdef LTC_CLEAN_STACK
+static int tiger_compress(hash_state *md, const unsigned char *buf)
+{
+   int err;
+   err = _tiger_compress(md, buf);
+   burn_stack(sizeof(ulong64) * 11 + sizeof(unsigned long));
+   return err;
+}
+#endif
+
+/**
+   Initialize the hash state
+   @param md   The hash state you wish to initialize
+   @return CRYPT_OK if successful
+*/
+int tiger_init(hash_state *md)
+{
+    LTC_ARGCHK(md != NULL);
+    md->tiger.state[0] = CONST64(0x0123456789ABCDEF);
+    md->tiger.state[1] = CONST64(0xFEDCBA9876543210);
+    md->tiger.state[2] = CONST64(0xF096A5B4C3B2E187);
+    md->tiger.curlen = 0;
+    md->tiger.length = 0;
+    return CRYPT_OK;
+}
+
+/**
+   Process a block of memory though the hash
+   @param md     The hash state
+   @param in     The data to hash
+   @param inlen  The length of the data (octets)
+   @return CRYPT_OK if successful
+*/
+HASH_PROCESS(tiger_process, tiger_compress, tiger, 64)
+
+/**
+   Terminate the hash to get the digest
+   @param md  The hash state
+   @param out [out] The destination of the hash (24 bytes)
+   @return CRYPT_OK if successful
+*/
+int tiger_done(hash_state * md, unsigned char *out)
+{
+    LTC_ARGCHK(md  != NULL);
+    LTC_ARGCHK(out != NULL);
+
+    if (md->tiger.curlen >= sizeof(md->tiger.buf)) {
+       return CRYPT_INVALID_ARG;
+    }
+
+    /* increase the length of the message */
+    md->tiger.length += md->tiger.curlen * 8;
+
+    /* append the '1' bit */
+    md->tiger.buf[md->tiger.curlen++] = (unsigned char)0x01;
+
+    /* if the length is currently above 56 bytes we append zeros
+     * then compress.  Then we can fall back to padding zeros and length
+     * encoding like normal. */
+    if (md->tiger.curlen > 56) {
+        while (md->tiger.curlen < 64) {
+            md->tiger.buf[md->tiger.curlen++] = (unsigned char)0;
+        }
+        tiger_compress(md, md->tiger.buf);
+        md->tiger.curlen = 0;
+    }
+
+    /* pad upto 56 bytes of zeroes */
+    while (md->tiger.curlen < 56) {
+        md->tiger.buf[md->tiger.curlen++] = (unsigned char)0;
+    }
+
+    /* store length */
+    STORE64L(md->tiger.length, md->tiger.buf+56);
+    tiger_compress(md, md->tiger.buf);
+
+    /* copy output */
+    STORE64L(md->tiger.state[0], &out[0]);
+    STORE64L(md->tiger.state[1], &out[8]);
+    STORE64L(md->tiger.state[2], &out[16]);
+#ifdef LTC_CLEAN_STACK
+    zeromem(md, sizeof(hash_state));
+#endif
+
+    return CRYPT_OK;
+}
+
+/**
+  Self-test the hash
+  @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled
+*/
+int  tiger_test(void)
+{
+ #ifndef LTC_TEST
+    return CRYPT_NOP;
+ #else
+  static const struct {
+      const char *msg;
+      unsigned char hash[24];
+  } tests[] = {
+    { "",
+     { 0x32, 0x93, 0xac, 0x63, 0x0c, 0x13, 0xf0, 0x24,
+       0x5f, 0x92, 0xbb, 0xb1, 0x76, 0x6e, 0x16, 0x16,
+       0x7a, 0x4e, 0x58, 0x49, 0x2d, 0xde, 0x73, 0xf3 }
+    },
+    { "abc",
+     { 0x2a, 0xab, 0x14, 0x84, 0xe8, 0xc1, 0x58, 0xf2,
+       0xbf, 0xb8, 0xc5, 0xff, 0x41, 0xb5, 0x7a, 0x52,
+       0x51, 0x29, 0x13, 0x1c, 0x95, 0x7b, 0x5f, 0x93 }
+    },
+    { "Tiger",
+     { 0xdd, 0x00, 0x23, 0x07, 0x99, 0xf5, 0x00, 0x9f,
+       0xec, 0x6d, 0xeb, 0xc8, 0x38, 0xbb, 0x6a, 0x27,
+       0xdf, 0x2b, 0x9d, 0x6f, 0x11, 0x0c, 0x79, 0x37 }
+    },
+    { "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+-",
+     { 0xf7, 0x1c, 0x85, 0x83, 0x90, 0x2a, 0xfb, 0x87,
+       0x9e, 0xdf, 0xe6, 0x10, 0xf8, 0x2c, 0x0d, 0x47,
+       0x86, 0xa3, 0xa5, 0x34, 0x50, 0x44, 0x86, 0xb5 }
+    },
+    { "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+-ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+-",
+     { 0xc5, 0x40, 0x34, 0xe5, 0xb4, 0x3e, 0xb8, 0x00,
+       0x58, 0x48, 0xa7, 0xe0, 0xae, 0x6a, 0xac, 0x76,
+       0xe4, 0xff, 0x59, 0x0a, 0xe7, 0x15, 0xfd, 0x25 }
+    },
+  };
+
+  int i;
+  unsigned char tmp[24];
+  hash_state md;
+
+  for (i = 0; i < (int)(sizeof(tests) / sizeof(tests[0])); i++) {
+      tiger_init(&md);
+      tiger_process(&md, (unsigned char *)tests[i].msg, (unsigned long)strlen(tests[i].msg));
+      tiger_done(&md, tmp);
+      if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "TIGER", i)) {
+          return CRYPT_FAIL_TESTVECTOR;
+      }
+  }
+  return CRYPT_OK;
+  #endif
+}
+
+#endif
+
+/*
+Hash of "":
+        24F0130C63AC9332 16166E76B1BB925F F373DE2D49584E7A
+Hash of "abc":
+        F258C1E88414AB2A 527AB541FFC5B8BF 935F7B951C132951
+Hash of "Tiger":
+        9F00F599072300DD 276ABB38C8EB6DEC 37790C116F9D2BDF
+Hash of "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+-":
+        87FB2A9083851CF7 470D2CF810E6DF9E B586445034A5A386
+Hash of "ABCDEFGHIJKLMNOPQRSTUVWXYZ=abcdefghijklmnopqrstuvwxyz+0123456789":
+        467DB80863EBCE48 8DF1CD1261655DE9 57896565975F9197
+Hash of "Tiger - A Fast New Hash Function, by Ross Anderson and Eli Biham":
+        0C410A042968868A 1671DA5A3FD29A72 5EC1E457D3CDB303
+Hash of "Tiger - A Fast New Hash Function, by Ross Anderson and Eli Biham, proceedings of Fast Software Encryption 3, Cambridge.":
+        EBF591D5AFA655CE 7F22894FF87F54AC 89C811B6B0DA3193
+Hash of "Tiger - A Fast New Hash Function, by Ross Anderson and Eli Biham, proceedings of Fast Software Encryption 3, Cambridge, 1996.":
+        3D9AEB03D1BD1A63 57B2774DFD6D5B24 DD68151D503974FC
+Hash of "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+-ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+-":
+        00B83EB4E53440C5 76AC6AAEE0A74858 25FD15E70A59FFE4
+*/
+
+
+
+
+/* ref:         HEAD -> develop */
+/* git commit:  a1f6312416ef6cd183ee62db58b640dc2d7ec1f4 */
+/* commit time: 2019-09-04 13:44:47 +0200 */

+ 306 - 0
libtomcrypt.mod/libtomcrypt/src/hashes/whirl/whirl.c

@@ -0,0 +1,306 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ */
+
+/**
+   @file whirl.c
+   LTC_WHIRLPOOL (using their new sbox) hash function by Tom St Denis
+*/
+
+#include "tomcrypt_private.h"
+
+#ifdef LTC_WHIRLPOOL
+
+const struct ltc_hash_descriptor whirlpool_desc =
+{
+    "whirlpool",
+    11,
+    64,
+    64,
+
+   /* OID */
+   { 1, 0, 10118, 3, 0, 55 },
+   6,
+
+    &whirlpool_init,
+    &whirlpool_process,
+    &whirlpool_done,
+    &whirlpool_test,
+    NULL
+};
+
+/* the sboxes */
+#define __LTC_WHIRLTAB_C__
+#include "whirltab.c"
+
+/* get a_{i,j} */
+#define GB(a,i,j) ((a[(i) & 7] >> (8 * (j))) & 255)
+
+/* shortcut macro to perform three functions at once */
+#define theta_pi_gamma(a, i)             \
+   (SB0(GB(a, i-0, 7)) ^                 \
+    SB1(GB(a, i-1, 6)) ^                 \
+    SB2(GB(a, i-2, 5)) ^                 \
+    SB3(GB(a, i-3, 4)) ^                 \
+    SB4(GB(a, i-4, 3)) ^                 \
+    SB5(GB(a, i-5, 2)) ^                 \
+    SB6(GB(a, i-6, 1)) ^                 \
+    SB7(GB(a, i-7, 0)))
+
+#ifdef LTC_CLEAN_STACK
+static int _whirlpool_compress(hash_state *md, const unsigned char *buf)
+#else
+static int whirlpool_compress(hash_state *md, const unsigned char *buf)
+#endif
+{
+   ulong64 K[2][8], T[3][8];
+   int x, y;
+
+   /* load the block/state */
+   for (x = 0; x < 8; x++) {
+      K[0][x] = md->whirlpool.state[x];
+
+      LOAD64H(T[0][x], buf + (8 * x));
+      T[2][x]  = T[0][x];
+      T[0][x] ^= K[0][x];
+   }
+
+   /* do rounds 1..10 */
+   for (x = 0; x < 10; x += 2) {
+       /* odd round */
+       /* apply main transform to K[0] into K[1] */
+       for (y = 0; y < 8; y++) {
+           K[1][y] = theta_pi_gamma(K[0], y);
+       }
+       /* xor the constant */
+       K[1][0] ^= cont[x];
+
+       /* apply main transform to T[0] into T[1] */
+       for (y = 0; y < 8; y++) {
+           T[1][y] = theta_pi_gamma(T[0], y) ^ K[1][y];
+       }
+
+       /* even round */
+       /* apply main transform to K[1] into K[0] */
+       for (y = 0; y < 8; y++) {
+           K[0][y] = theta_pi_gamma(K[1], y);
+       }
+       /* xor the constant */
+       K[0][0] ^= cont[x+1];
+
+       /* apply main transform to T[1] into T[0] */
+       for (y = 0; y < 8; y++) {
+           T[0][y] = theta_pi_gamma(T[1], y) ^ K[0][y];
+       }
+   }
+
+   /* store state */
+   for (x = 0; x < 8; x++) {
+      md->whirlpool.state[x] ^= T[0][x] ^ T[2][x];
+   }
+
+   return CRYPT_OK;
+}
+
+
+#ifdef LTC_CLEAN_STACK
+static int whirlpool_compress(hash_state *md, const unsigned char *buf)
+{
+   int err;
+   err = _whirlpool_compress(md, buf);
+   burn_stack((5 * 8 * sizeof(ulong64)) + (2 * sizeof(int)));
+   return err;
+}
+#endif
+
+
+/**
+   Initialize the hash state
+   @param md   The hash state you wish to initialize
+   @return CRYPT_OK if successful
+*/
+int whirlpool_init(hash_state * md)
+{
+   LTC_ARGCHK(md != NULL);
+   zeromem(&md->whirlpool, sizeof(md->whirlpool));
+   return CRYPT_OK;
+}
+
+/**
+   Process a block of memory though the hash
+   @param md     The hash state
+   @param in     The data to hash
+   @param inlen  The length of the data (octets)
+   @return CRYPT_OK if successful
+*/
+HASH_PROCESS(whirlpool_process, whirlpool_compress, whirlpool, 64)
+
+/**
+   Terminate the hash to get the digest
+   @param md  The hash state
+   @param out [out] The destination of the hash (64 bytes)
+   @return CRYPT_OK if successful
+*/
+int whirlpool_done(hash_state * md, unsigned char *out)
+{
+    int i;
+
+    LTC_ARGCHK(md  != NULL);
+    LTC_ARGCHK(out != NULL);
+
+    if (md->whirlpool.curlen >= sizeof(md->whirlpool.buf)) {
+       return CRYPT_INVALID_ARG;
+    }
+
+    /* increase the length of the message */
+    md->whirlpool.length += md->whirlpool.curlen * 8;
+
+    /* append the '1' bit */
+    md->whirlpool.buf[md->whirlpool.curlen++] = (unsigned char)0x80;
+
+    /* if the length is currently above 32 bytes we append zeros
+     * then compress.  Then we can fall back to padding zeros and length
+     * encoding like normal.
+     */
+    if (md->whirlpool.curlen > 32) {
+        while (md->whirlpool.curlen < 64) {
+            md->whirlpool.buf[md->whirlpool.curlen++] = (unsigned char)0;
+        }
+        whirlpool_compress(md, md->whirlpool.buf);
+        md->whirlpool.curlen = 0;
+    }
+
+    /* pad upto 56 bytes of zeroes (should be 32 but we only support 64-bit lengths)  */
+    while (md->whirlpool.curlen < 56) {
+        md->whirlpool.buf[md->whirlpool.curlen++] = (unsigned char)0;
+    }
+
+    /* store length */
+    STORE64H(md->whirlpool.length, md->whirlpool.buf+56);
+    whirlpool_compress(md, md->whirlpool.buf);
+
+    /* copy output */
+    for (i = 0; i < 8; i++) {
+        STORE64H(md->whirlpool.state[i], out+(8*i));
+    }
+#ifdef LTC_CLEAN_STACK
+    zeromem(md, sizeof(*md));
+#endif
+    return CRYPT_OK;
+}
+
+/**
+  Self-test the hash
+  @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled
+*/
+int  whirlpool_test(void)
+{
+ #ifndef LTC_TEST
+    return CRYPT_NOP;
+ #else
+  static const struct {
+      int len;
+      unsigned char msg[128], hash[64];
+  } tests[] = {
+
+  /* NULL Message */
+{
+  0,
+  { 0x00 },
+  { 0x19, 0xFA, 0x61, 0xD7, 0x55, 0x22, 0xA4, 0x66, 0x9B, 0x44, 0xE3, 0x9C, 0x1D, 0x2E, 0x17, 0x26,
+    0xC5, 0x30, 0x23, 0x21, 0x30, 0xD4, 0x07, 0xF8, 0x9A, 0xFE, 0xE0, 0x96, 0x49, 0x97, 0xF7, 0xA7,
+    0x3E, 0x83, 0xBE, 0x69, 0x8B, 0x28, 0x8F, 0xEB, 0xCF, 0x88, 0xE3, 0xE0, 0x3C, 0x4F, 0x07, 0x57,
+    0xEA, 0x89, 0x64, 0xE5, 0x9B, 0x63, 0xD9, 0x37, 0x08, 0xB1, 0x38, 0xCC, 0x42, 0xA6, 0x6E, 0xB3 }
+},
+
+
+   /* 448-bits of 0 bits */
+{
+
+  56,
+  { 0x00 },
+  { 0x0B, 0x3F, 0x53, 0x78, 0xEB, 0xED, 0x2B, 0xF4, 0xD7, 0xBE, 0x3C, 0xFD, 0x81, 0x8C, 0x1B, 0x03,
+    0xB6, 0xBB, 0x03, 0xD3, 0x46, 0x94, 0x8B, 0x04, 0xF4, 0xF4, 0x0C, 0x72, 0x6F, 0x07, 0x58, 0x70,
+    0x2A, 0x0F, 0x1E, 0x22, 0x58, 0x80, 0xE3, 0x8D, 0xD5, 0xF6, 0xED, 0x6D, 0xE9, 0xB1, 0xE9, 0x61,
+    0xE4, 0x9F, 0xC1, 0x31, 0x8D, 0x7C, 0xB7, 0x48, 0x22, 0xF3, 0xD0, 0xE2, 0xE9, 0xA7, 0xE7, 0xB0 }
+},
+
+   /* 520-bits of 0 bits */
+{
+  65,
+  { 0x00 },
+  { 0x85, 0xE1, 0x24, 0xC4, 0x41, 0x5B, 0xCF, 0x43, 0x19, 0x54, 0x3E, 0x3A, 0x63, 0xFF, 0x57, 0x1D,
+    0x09, 0x35, 0x4C, 0xEE, 0xBE, 0xE1, 0xE3, 0x25, 0x30, 0x8C, 0x90, 0x69, 0xF4, 0x3E, 0x2A, 0xE4,
+    0xD0, 0xE5, 0x1D, 0x4E, 0xB1, 0xE8, 0x64, 0x28, 0x70, 0x19, 0x4E, 0x95, 0x30, 0xD8, 0xD8, 0xAF,
+    0x65, 0x89, 0xD1, 0xBF, 0x69, 0x49, 0xDD, 0xF9, 0x0A, 0x7F, 0x12, 0x08, 0x62, 0x37, 0x95, 0xB9 }
+},
+
+   /* 512-bits, leading set */
+{
+  64,
+  { 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+    0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+    0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+    0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
+  { 0x10, 0x3E, 0x00, 0x55, 0xA9, 0xB0, 0x90, 0xE1, 0x1C, 0x8F, 0xDD, 0xEB, 0xBA, 0x06, 0xC0, 0x5A,
+    0xCE, 0x8B, 0x64, 0xB8, 0x96, 0x12, 0x8F, 0x6E, 0xED, 0x30, 0x71, 0xFC, 0xF3, 0xDC, 0x16, 0x94,
+    0x67, 0x78, 0xE0, 0x72, 0x23, 0x23, 0x3F, 0xD1, 0x80, 0xFC, 0x40, 0xCC, 0xDB, 0x84, 0x30, 0xA6,
+    0x40, 0xE3, 0x76, 0x34, 0x27, 0x1E, 0x65, 0x5C, 0xA1, 0x67, 0x4E, 0xBF, 0xF5, 0x07, 0xF8, 0xCB }
+},
+
+   /* 512-bits, leading set of second byte */
+{
+  64,
+  { 0x00, 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+    0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+    0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+    0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
+  { 0x35, 0x7B, 0x42, 0xEA, 0x79, 0xBC, 0x97, 0x86, 0x97, 0x5A, 0x3C, 0x44, 0x70, 0xAA, 0xB2, 0x3E,
+    0x62, 0x29, 0x79, 0x7B, 0xAD, 0xBD, 0x54, 0x36, 0x5B, 0x54, 0x96, 0xE5, 0x5D, 0x9D, 0xD7, 0x9F,
+    0xE9, 0x62, 0x4F, 0xB4, 0x22, 0x66, 0x93, 0x0A, 0x62, 0x8E, 0xD4, 0xDB, 0x08, 0xF9, 0xDD, 0x35,
+    0xEF, 0x1B, 0xE1, 0x04, 0x53, 0xFC, 0x18, 0xF4, 0x2C, 0x7F, 0x5E, 0x1F, 0x9B, 0xAE, 0x55, 0xE0 }
+},
+
+   /* 512-bits, leading set of last byte */
+{
+  64,
+  { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+    0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+    0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+    0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80 },
+  { 0x8B, 0x39, 0x04, 0xDD, 0x19, 0x81, 0x41, 0x26, 0xFD, 0x02, 0x74, 0xAB, 0x49, 0xC5, 0x97, 0xF6,
+    0xD7, 0x75, 0x33, 0x52, 0xA2, 0xDD, 0x91, 0xFD, 0x8F, 0x9F, 0x54, 0x05, 0x4C, 0x54, 0xBF, 0x0F,
+    0x06, 0xDB, 0x4F, 0xF7, 0x08, 0xA3, 0xA2, 0x8B, 0xC3, 0x7A, 0x92, 0x1E, 0xEE, 0x11, 0xED, 0x7B,
+    0x6A, 0x53, 0x79, 0x32, 0xCC, 0x5E, 0x94, 0xEE, 0x1E, 0xA6, 0x57, 0x60, 0x7E, 0x36, 0xC9, 0xF7 }
+},
+
+};
+
+  int i;
+  unsigned char tmp[64];
+  hash_state md;
+
+  for (i = 0; i < (int)(sizeof(tests)/sizeof(tests[0])); i++) {
+      whirlpool_init(&md);
+      whirlpool_process(&md, (unsigned char *)tests[i].msg, tests[i].len);
+      whirlpool_done(&md, tmp);
+      if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "WHIRLPOOL", i)) {
+         return CRYPT_FAIL_TESTVECTOR;
+      }
+  }
+  return CRYPT_OK;
+ #endif
+}
+
+
+#endif
+
+
+/* ref:         HEAD -> develop */
+/* git commit:  a1f6312416ef6cd183ee62db58b640dc2d7ec1f4 */
+/* commit time: 2019-09-04 13:44:47 +0200 */

+ 596 - 0
libtomcrypt.mod/libtomcrypt/src/hashes/whirl/whirltab.c

@@ -0,0 +1,596 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ */
+
+/**
+   @file whirltab.c
+   LTC_WHIRLPOOL tables, Tom St Denis
+*/
+
+#ifdef __LTC_WHIRLTAB_C__
+
+static const ulong64 sbox0[] = {
+CONST64(0x18186018c07830d8), CONST64(0x23238c2305af4626), CONST64(0xc6c63fc67ef991b8), CONST64(0xe8e887e8136fcdfb),
+CONST64(0x878726874ca113cb), CONST64(0xb8b8dab8a9626d11), CONST64(0x0101040108050209), CONST64(0x4f4f214f426e9e0d),
+CONST64(0x3636d836adee6c9b), CONST64(0xa6a6a2a6590451ff), CONST64(0xd2d26fd2debdb90c), CONST64(0xf5f5f3f5fb06f70e),
+CONST64(0x7979f979ef80f296), CONST64(0x6f6fa16f5fcede30), CONST64(0x91917e91fcef3f6d), CONST64(0x52525552aa07a4f8),
+CONST64(0x60609d6027fdc047), CONST64(0xbcbccabc89766535), CONST64(0x9b9b569baccd2b37), CONST64(0x8e8e028e048c018a),
+CONST64(0xa3a3b6a371155bd2), CONST64(0x0c0c300c603c186c), CONST64(0x7b7bf17bff8af684), CONST64(0x3535d435b5e16a80),
+CONST64(0x1d1d741de8693af5), CONST64(0xe0e0a7e05347ddb3), CONST64(0xd7d77bd7f6acb321), CONST64(0xc2c22fc25eed999c),
+CONST64(0x2e2eb82e6d965c43), CONST64(0x4b4b314b627a9629), CONST64(0xfefedffea321e15d), CONST64(0x575741578216aed5),
+CONST64(0x15155415a8412abd), CONST64(0x7777c1779fb6eee8), CONST64(0x3737dc37a5eb6e92), CONST64(0xe5e5b3e57b56d79e),
+CONST64(0x9f9f469f8cd92313), CONST64(0xf0f0e7f0d317fd23), CONST64(0x4a4a354a6a7f9420), CONST64(0xdada4fda9e95a944),
+CONST64(0x58587d58fa25b0a2), CONST64(0xc9c903c906ca8fcf), CONST64(0x2929a429558d527c), CONST64(0x0a0a280a5022145a),
+CONST64(0xb1b1feb1e14f7f50), CONST64(0xa0a0baa0691a5dc9), CONST64(0x6b6bb16b7fdad614), CONST64(0x85852e855cab17d9),
+CONST64(0xbdbdcebd8173673c), CONST64(0x5d5d695dd234ba8f), CONST64(0x1010401080502090), CONST64(0xf4f4f7f4f303f507),
+CONST64(0xcbcb0bcb16c08bdd), CONST64(0x3e3ef83eedc67cd3), CONST64(0x0505140528110a2d), CONST64(0x676781671fe6ce78),
+CONST64(0xe4e4b7e47353d597), CONST64(0x27279c2725bb4e02), CONST64(0x4141194132588273), CONST64(0x8b8b168b2c9d0ba7),
+CONST64(0xa7a7a6a7510153f6), CONST64(0x7d7de97dcf94fab2), CONST64(0x95956e95dcfb3749), CONST64(0xd8d847d88e9fad56),
+CONST64(0xfbfbcbfb8b30eb70), CONST64(0xeeee9fee2371c1cd), CONST64(0x7c7ced7cc791f8bb), CONST64(0x6666856617e3cc71),
+CONST64(0xdddd53dda68ea77b), CONST64(0x17175c17b84b2eaf), CONST64(0x4747014702468e45), CONST64(0x9e9e429e84dc211a),
+CONST64(0xcaca0fca1ec589d4), CONST64(0x2d2db42d75995a58), CONST64(0xbfbfc6bf9179632e), CONST64(0x07071c07381b0e3f),
+CONST64(0xadad8ead012347ac), CONST64(0x5a5a755aea2fb4b0), CONST64(0x838336836cb51bef), CONST64(0x3333cc3385ff66b6),
+CONST64(0x636391633ff2c65c), CONST64(0x02020802100a0412), CONST64(0xaaaa92aa39384993), CONST64(0x7171d971afa8e2de),
+CONST64(0xc8c807c80ecf8dc6), CONST64(0x19196419c87d32d1), CONST64(0x494939497270923b), CONST64(0xd9d943d9869aaf5f),
+CONST64(0xf2f2eff2c31df931), CONST64(0xe3e3abe34b48dba8), CONST64(0x5b5b715be22ab6b9), CONST64(0x88881a8834920dbc),
+CONST64(0x9a9a529aa4c8293e), CONST64(0x262698262dbe4c0b), CONST64(0x3232c8328dfa64bf), CONST64(0xb0b0fab0e94a7d59),
+CONST64(0xe9e983e91b6acff2), CONST64(0x0f0f3c0f78331e77), CONST64(0xd5d573d5e6a6b733), CONST64(0x80803a8074ba1df4),
+CONST64(0xbebec2be997c6127), CONST64(0xcdcd13cd26de87eb), CONST64(0x3434d034bde46889), CONST64(0x48483d487a759032),
+CONST64(0xffffdbffab24e354), CONST64(0x7a7af57af78ff48d), CONST64(0x90907a90f4ea3d64), CONST64(0x5f5f615fc23ebe9d),
+CONST64(0x202080201da0403d), CONST64(0x6868bd6867d5d00f), CONST64(0x1a1a681ad07234ca), CONST64(0xaeae82ae192c41b7),
+CONST64(0xb4b4eab4c95e757d), CONST64(0x54544d549a19a8ce), CONST64(0x93937693ece53b7f), CONST64(0x222288220daa442f),
+CONST64(0x64648d6407e9c863), CONST64(0xf1f1e3f1db12ff2a), CONST64(0x7373d173bfa2e6cc), CONST64(0x12124812905a2482),
+CONST64(0x40401d403a5d807a), CONST64(0x0808200840281048), CONST64(0xc3c32bc356e89b95), CONST64(0xecec97ec337bc5df),
+CONST64(0xdbdb4bdb9690ab4d), CONST64(0xa1a1bea1611f5fc0), CONST64(0x8d8d0e8d1c830791), CONST64(0x3d3df43df5c97ac8),
+CONST64(0x97976697ccf1335b), CONST64(0x0000000000000000), CONST64(0xcfcf1bcf36d483f9), CONST64(0x2b2bac2b4587566e),
+CONST64(0x7676c57697b3ece1), CONST64(0x8282328264b019e6), CONST64(0xd6d67fd6fea9b128), CONST64(0x1b1b6c1bd87736c3),
+CONST64(0xb5b5eeb5c15b7774), CONST64(0xafaf86af112943be), CONST64(0x6a6ab56a77dfd41d), CONST64(0x50505d50ba0da0ea),
+CONST64(0x45450945124c8a57), CONST64(0xf3f3ebf3cb18fb38), CONST64(0x3030c0309df060ad), CONST64(0xefef9bef2b74c3c4),
+CONST64(0x3f3ffc3fe5c37eda), CONST64(0x55554955921caac7), CONST64(0xa2a2b2a2791059db), CONST64(0xeaea8fea0365c9e9),
+CONST64(0x656589650fecca6a), CONST64(0xbabad2bab9686903), CONST64(0x2f2fbc2f65935e4a), CONST64(0xc0c027c04ee79d8e),
+CONST64(0xdede5fdebe81a160), CONST64(0x1c1c701ce06c38fc), CONST64(0xfdfdd3fdbb2ee746), CONST64(0x4d4d294d52649a1f),
+CONST64(0x92927292e4e03976), CONST64(0x7575c9758fbceafa), CONST64(0x06061806301e0c36), CONST64(0x8a8a128a249809ae),
+CONST64(0xb2b2f2b2f940794b), CONST64(0xe6e6bfe66359d185), CONST64(0x0e0e380e70361c7e), CONST64(0x1f1f7c1ff8633ee7),
+CONST64(0x6262956237f7c455), CONST64(0xd4d477d4eea3b53a), CONST64(0xa8a89aa829324d81), CONST64(0x96966296c4f43152),
+CONST64(0xf9f9c3f99b3aef62), CONST64(0xc5c533c566f697a3), CONST64(0x2525942535b14a10), CONST64(0x59597959f220b2ab),
+CONST64(0x84842a8454ae15d0), CONST64(0x7272d572b7a7e4c5), CONST64(0x3939e439d5dd72ec), CONST64(0x4c4c2d4c5a619816),
+CONST64(0x5e5e655eca3bbc94), CONST64(0x7878fd78e785f09f), CONST64(0x3838e038ddd870e5), CONST64(0x8c8c0a8c14860598),
+CONST64(0xd1d163d1c6b2bf17), CONST64(0xa5a5aea5410b57e4), CONST64(0xe2e2afe2434dd9a1), CONST64(0x616199612ff8c24e),
+CONST64(0xb3b3f6b3f1457b42), CONST64(0x2121842115a54234), CONST64(0x9c9c4a9c94d62508), CONST64(0x1e1e781ef0663cee),
+CONST64(0x4343114322528661), CONST64(0xc7c73bc776fc93b1), CONST64(0xfcfcd7fcb32be54f), CONST64(0x0404100420140824),
+CONST64(0x51515951b208a2e3), CONST64(0x99995e99bcc72f25), CONST64(0x6d6da96d4fc4da22), CONST64(0x0d0d340d68391a65),
+CONST64(0xfafacffa8335e979), CONST64(0xdfdf5bdfb684a369), CONST64(0x7e7ee57ed79bfca9), CONST64(0x242490243db44819),
+CONST64(0x3b3bec3bc5d776fe), CONST64(0xabab96ab313d4b9a), CONST64(0xcece1fce3ed181f0), CONST64(0x1111441188552299),
+CONST64(0x8f8f068f0c890383), CONST64(0x4e4e254e4a6b9c04), CONST64(0xb7b7e6b7d1517366), CONST64(0xebeb8beb0b60cbe0),
+CONST64(0x3c3cf03cfdcc78c1), CONST64(0x81813e817cbf1ffd), CONST64(0x94946a94d4fe3540), CONST64(0xf7f7fbf7eb0cf31c),
+CONST64(0xb9b9deb9a1676f18), CONST64(0x13134c13985f268b), CONST64(0x2c2cb02c7d9c5851), CONST64(0xd3d36bd3d6b8bb05),
+CONST64(0xe7e7bbe76b5cd38c), CONST64(0x6e6ea56e57cbdc39), CONST64(0xc4c437c46ef395aa), CONST64(0x03030c03180f061b),
+CONST64(0x565645568a13acdc), CONST64(0x44440d441a49885e), CONST64(0x7f7fe17fdf9efea0), CONST64(0xa9a99ea921374f88),
+CONST64(0x2a2aa82a4d825467), CONST64(0xbbbbd6bbb16d6b0a), CONST64(0xc1c123c146e29f87), CONST64(0x53535153a202a6f1),
+CONST64(0xdcdc57dcae8ba572), CONST64(0x0b0b2c0b58271653), CONST64(0x9d9d4e9d9cd32701), CONST64(0x6c6cad6c47c1d82b),
+CONST64(0x3131c43195f562a4), CONST64(0x7474cd7487b9e8f3), CONST64(0xf6f6fff6e309f115), CONST64(0x464605460a438c4c),
+CONST64(0xacac8aac092645a5), CONST64(0x89891e893c970fb5), CONST64(0x14145014a04428b4), CONST64(0xe1e1a3e15b42dfba),
+CONST64(0x16165816b04e2ca6), CONST64(0x3a3ae83acdd274f7), CONST64(0x6969b9696fd0d206), CONST64(0x09092409482d1241),
+CONST64(0x7070dd70a7ade0d7), CONST64(0xb6b6e2b6d954716f), CONST64(0xd0d067d0ceb7bd1e), CONST64(0xeded93ed3b7ec7d6),
+CONST64(0xcccc17cc2edb85e2), CONST64(0x424215422a578468), CONST64(0x98985a98b4c22d2c), CONST64(0xa4a4aaa4490e55ed),
+CONST64(0x2828a0285d885075), CONST64(0x5c5c6d5cda31b886), CONST64(0xf8f8c7f8933fed6b), CONST64(0x8686228644a411c2)
+};
+
+#ifdef LTC_SMALL_CODE
+
+#define SB0(x) sbox0[x]
+#define SB1(x) ROR64c(sbox0[x], 8)
+#define SB2(x) ROR64c(sbox0[x], 16)
+#define SB3(x) ROR64c(sbox0[x], 24)
+#define SB4(x) ROR64c(sbox0[x], 32)
+#define SB5(x) ROR64c(sbox0[x], 40)
+#define SB6(x) ROR64c(sbox0[x], 48)
+#define SB7(x) ROR64c(sbox0[x], 56)
+
+#else
+
+#define SB0(x) sbox0[x]
+#define SB1(x) sbox1[x]
+#define SB2(x) sbox2[x]
+#define SB3(x) sbox3[x]
+#define SB4(x) sbox4[x]
+#define SB5(x) sbox5[x]
+#define SB6(x) sbox6[x]
+#define SB7(x) sbox7[x]
+
+
+static const ulong64 sbox1[] = {
+CONST64(0xd818186018c07830), CONST64(0x2623238c2305af46), CONST64(0xb8c6c63fc67ef991), CONST64(0xfbe8e887e8136fcd),
+CONST64(0xcb878726874ca113), CONST64(0x11b8b8dab8a9626d), CONST64(0x0901010401080502), CONST64(0x0d4f4f214f426e9e),
+CONST64(0x9b3636d836adee6c), CONST64(0xffa6a6a2a6590451), CONST64(0x0cd2d26fd2debdb9), CONST64(0x0ef5f5f3f5fb06f7),
+CONST64(0x967979f979ef80f2), CONST64(0x306f6fa16f5fcede), CONST64(0x6d91917e91fcef3f), CONST64(0xf852525552aa07a4),
+CONST64(0x4760609d6027fdc0), CONST64(0x35bcbccabc897665), CONST64(0x379b9b569baccd2b), CONST64(0x8a8e8e028e048c01),
+CONST64(0xd2a3a3b6a371155b), CONST64(0x6c0c0c300c603c18), CONST64(0x847b7bf17bff8af6), CONST64(0x803535d435b5e16a),
+CONST64(0xf51d1d741de8693a), CONST64(0xb3e0e0a7e05347dd), CONST64(0x21d7d77bd7f6acb3), CONST64(0x9cc2c22fc25eed99),
+CONST64(0x432e2eb82e6d965c), CONST64(0x294b4b314b627a96), CONST64(0x5dfefedffea321e1), CONST64(0xd5575741578216ae),
+CONST64(0xbd15155415a8412a), CONST64(0xe87777c1779fb6ee), CONST64(0x923737dc37a5eb6e), CONST64(0x9ee5e5b3e57b56d7),
+CONST64(0x139f9f469f8cd923), CONST64(0x23f0f0e7f0d317fd), CONST64(0x204a4a354a6a7f94), CONST64(0x44dada4fda9e95a9),
+CONST64(0xa258587d58fa25b0), CONST64(0xcfc9c903c906ca8f), CONST64(0x7c2929a429558d52), CONST64(0x5a0a0a280a502214),
+CONST64(0x50b1b1feb1e14f7f), CONST64(0xc9a0a0baa0691a5d), CONST64(0x146b6bb16b7fdad6), CONST64(0xd985852e855cab17),
+CONST64(0x3cbdbdcebd817367), CONST64(0x8f5d5d695dd234ba), CONST64(0x9010104010805020), CONST64(0x07f4f4f7f4f303f5),
+CONST64(0xddcbcb0bcb16c08b), CONST64(0xd33e3ef83eedc67c), CONST64(0x2d0505140528110a), CONST64(0x78676781671fe6ce),
+CONST64(0x97e4e4b7e47353d5), CONST64(0x0227279c2725bb4e), CONST64(0x7341411941325882), CONST64(0xa78b8b168b2c9d0b),
+CONST64(0xf6a7a7a6a7510153), CONST64(0xb27d7de97dcf94fa), CONST64(0x4995956e95dcfb37), CONST64(0x56d8d847d88e9fad),
+CONST64(0x70fbfbcbfb8b30eb), CONST64(0xcdeeee9fee2371c1), CONST64(0xbb7c7ced7cc791f8), CONST64(0x716666856617e3cc),
+CONST64(0x7bdddd53dda68ea7), CONST64(0xaf17175c17b84b2e), CONST64(0x454747014702468e), CONST64(0x1a9e9e429e84dc21),
+CONST64(0xd4caca0fca1ec589), CONST64(0x582d2db42d75995a), CONST64(0x2ebfbfc6bf917963), CONST64(0x3f07071c07381b0e),
+CONST64(0xacadad8ead012347), CONST64(0xb05a5a755aea2fb4), CONST64(0xef838336836cb51b), CONST64(0xb63333cc3385ff66),
+CONST64(0x5c636391633ff2c6), CONST64(0x1202020802100a04), CONST64(0x93aaaa92aa393849), CONST64(0xde7171d971afa8e2),
+CONST64(0xc6c8c807c80ecf8d), CONST64(0xd119196419c87d32), CONST64(0x3b49493949727092), CONST64(0x5fd9d943d9869aaf),
+CONST64(0x31f2f2eff2c31df9), CONST64(0xa8e3e3abe34b48db), CONST64(0xb95b5b715be22ab6), CONST64(0xbc88881a8834920d),
+CONST64(0x3e9a9a529aa4c829), CONST64(0x0b262698262dbe4c), CONST64(0xbf3232c8328dfa64), CONST64(0x59b0b0fab0e94a7d),
+CONST64(0xf2e9e983e91b6acf), CONST64(0x770f0f3c0f78331e), CONST64(0x33d5d573d5e6a6b7), CONST64(0xf480803a8074ba1d),
+CONST64(0x27bebec2be997c61), CONST64(0xebcdcd13cd26de87), CONST64(0x893434d034bde468), CONST64(0x3248483d487a7590),
+CONST64(0x54ffffdbffab24e3), CONST64(0x8d7a7af57af78ff4), CONST64(0x6490907a90f4ea3d), CONST64(0x9d5f5f615fc23ebe),
+CONST64(0x3d202080201da040), CONST64(0x0f6868bd6867d5d0), CONST64(0xca1a1a681ad07234), CONST64(0xb7aeae82ae192c41),
+CONST64(0x7db4b4eab4c95e75), CONST64(0xce54544d549a19a8), CONST64(0x7f93937693ece53b), CONST64(0x2f222288220daa44),
+CONST64(0x6364648d6407e9c8), CONST64(0x2af1f1e3f1db12ff), CONST64(0xcc7373d173bfa2e6), CONST64(0x8212124812905a24),
+CONST64(0x7a40401d403a5d80), CONST64(0x4808082008402810), CONST64(0x95c3c32bc356e89b), CONST64(0xdfecec97ec337bc5),
+CONST64(0x4ddbdb4bdb9690ab), CONST64(0xc0a1a1bea1611f5f), CONST64(0x918d8d0e8d1c8307), CONST64(0xc83d3df43df5c97a),
+CONST64(0x5b97976697ccf133), CONST64(0x0000000000000000), CONST64(0xf9cfcf1bcf36d483), CONST64(0x6e2b2bac2b458756),
+CONST64(0xe17676c57697b3ec), CONST64(0xe68282328264b019), CONST64(0x28d6d67fd6fea9b1), CONST64(0xc31b1b6c1bd87736),
+CONST64(0x74b5b5eeb5c15b77), CONST64(0xbeafaf86af112943), CONST64(0x1d6a6ab56a77dfd4), CONST64(0xea50505d50ba0da0),
+CONST64(0x5745450945124c8a), CONST64(0x38f3f3ebf3cb18fb), CONST64(0xad3030c0309df060), CONST64(0xc4efef9bef2b74c3),
+CONST64(0xda3f3ffc3fe5c37e), CONST64(0xc755554955921caa), CONST64(0xdba2a2b2a2791059), CONST64(0xe9eaea8fea0365c9),
+CONST64(0x6a656589650fecca), CONST64(0x03babad2bab96869), CONST64(0x4a2f2fbc2f65935e), CONST64(0x8ec0c027c04ee79d),
+CONST64(0x60dede5fdebe81a1), CONST64(0xfc1c1c701ce06c38), CONST64(0x46fdfdd3fdbb2ee7), CONST64(0x1f4d4d294d52649a),
+CONST64(0x7692927292e4e039), CONST64(0xfa7575c9758fbcea), CONST64(0x3606061806301e0c), CONST64(0xae8a8a128a249809),
+CONST64(0x4bb2b2f2b2f94079), CONST64(0x85e6e6bfe66359d1), CONST64(0x7e0e0e380e70361c), CONST64(0xe71f1f7c1ff8633e),
+CONST64(0x556262956237f7c4), CONST64(0x3ad4d477d4eea3b5), CONST64(0x81a8a89aa829324d), CONST64(0x5296966296c4f431),
+CONST64(0x62f9f9c3f99b3aef), CONST64(0xa3c5c533c566f697), CONST64(0x102525942535b14a), CONST64(0xab59597959f220b2),
+CONST64(0xd084842a8454ae15), CONST64(0xc57272d572b7a7e4), CONST64(0xec3939e439d5dd72), CONST64(0x164c4c2d4c5a6198),
+CONST64(0x945e5e655eca3bbc), CONST64(0x9f7878fd78e785f0), CONST64(0xe53838e038ddd870), CONST64(0x988c8c0a8c148605),
+CONST64(0x17d1d163d1c6b2bf), CONST64(0xe4a5a5aea5410b57), CONST64(0xa1e2e2afe2434dd9), CONST64(0x4e616199612ff8c2),
+CONST64(0x42b3b3f6b3f1457b), CONST64(0x342121842115a542), CONST64(0x089c9c4a9c94d625), CONST64(0xee1e1e781ef0663c),
+CONST64(0x6143431143225286), CONST64(0xb1c7c73bc776fc93), CONST64(0x4ffcfcd7fcb32be5), CONST64(0x2404041004201408),
+CONST64(0xe351515951b208a2), CONST64(0x2599995e99bcc72f), CONST64(0x226d6da96d4fc4da), CONST64(0x650d0d340d68391a),
+CONST64(0x79fafacffa8335e9), CONST64(0x69dfdf5bdfb684a3), CONST64(0xa97e7ee57ed79bfc), CONST64(0x19242490243db448),
+CONST64(0xfe3b3bec3bc5d776), CONST64(0x9aabab96ab313d4b), CONST64(0xf0cece1fce3ed181), CONST64(0x9911114411885522),
+CONST64(0x838f8f068f0c8903), CONST64(0x044e4e254e4a6b9c), CONST64(0x66b7b7e6b7d15173), CONST64(0xe0ebeb8beb0b60cb),
+CONST64(0xc13c3cf03cfdcc78), CONST64(0xfd81813e817cbf1f), CONST64(0x4094946a94d4fe35), CONST64(0x1cf7f7fbf7eb0cf3),
+CONST64(0x18b9b9deb9a1676f), CONST64(0x8b13134c13985f26), CONST64(0x512c2cb02c7d9c58), CONST64(0x05d3d36bd3d6b8bb),
+CONST64(0x8ce7e7bbe76b5cd3), CONST64(0x396e6ea56e57cbdc), CONST64(0xaac4c437c46ef395), CONST64(0x1b03030c03180f06),
+CONST64(0xdc565645568a13ac), CONST64(0x5e44440d441a4988), CONST64(0xa07f7fe17fdf9efe), CONST64(0x88a9a99ea921374f),
+CONST64(0x672a2aa82a4d8254), CONST64(0x0abbbbd6bbb16d6b), CONST64(0x87c1c123c146e29f), CONST64(0xf153535153a202a6),
+CONST64(0x72dcdc57dcae8ba5), CONST64(0x530b0b2c0b582716), CONST64(0x019d9d4e9d9cd327), CONST64(0x2b6c6cad6c47c1d8),
+CONST64(0xa43131c43195f562), CONST64(0xf37474cd7487b9e8), CONST64(0x15f6f6fff6e309f1), CONST64(0x4c464605460a438c),
+CONST64(0xa5acac8aac092645), CONST64(0xb589891e893c970f), CONST64(0xb414145014a04428), CONST64(0xbae1e1a3e15b42df),
+CONST64(0xa616165816b04e2c), CONST64(0xf73a3ae83acdd274), CONST64(0x066969b9696fd0d2), CONST64(0x4109092409482d12),
+CONST64(0xd77070dd70a7ade0), CONST64(0x6fb6b6e2b6d95471), CONST64(0x1ed0d067d0ceb7bd), CONST64(0xd6eded93ed3b7ec7),
+CONST64(0xe2cccc17cc2edb85), CONST64(0x68424215422a5784), CONST64(0x2c98985a98b4c22d), CONST64(0xeda4a4aaa4490e55),
+CONST64(0x752828a0285d8850), CONST64(0x865c5c6d5cda31b8), CONST64(0x6bf8f8c7f8933fed), CONST64(0xc28686228644a411)
+};
+
+static const ulong64 sbox2[] = {
+CONST64(0x30d818186018c078), CONST64(0x462623238c2305af), CONST64(0x91b8c6c63fc67ef9), CONST64(0xcdfbe8e887e8136f),
+CONST64(0x13cb878726874ca1), CONST64(0x6d11b8b8dab8a962), CONST64(0x0209010104010805), CONST64(0x9e0d4f4f214f426e),
+CONST64(0x6c9b3636d836adee), CONST64(0x51ffa6a6a2a65904), CONST64(0xb90cd2d26fd2debd), CONST64(0xf70ef5f5f3f5fb06),
+CONST64(0xf2967979f979ef80), CONST64(0xde306f6fa16f5fce), CONST64(0x3f6d91917e91fcef), CONST64(0xa4f852525552aa07),
+CONST64(0xc04760609d6027fd), CONST64(0x6535bcbccabc8976), CONST64(0x2b379b9b569baccd), CONST64(0x018a8e8e028e048c),
+CONST64(0x5bd2a3a3b6a37115), CONST64(0x186c0c0c300c603c), CONST64(0xf6847b7bf17bff8a), CONST64(0x6a803535d435b5e1),
+CONST64(0x3af51d1d741de869), CONST64(0xddb3e0e0a7e05347), CONST64(0xb321d7d77bd7f6ac), CONST64(0x999cc2c22fc25eed),
+CONST64(0x5c432e2eb82e6d96), CONST64(0x96294b4b314b627a), CONST64(0xe15dfefedffea321), CONST64(0xaed5575741578216),
+CONST64(0x2abd15155415a841), CONST64(0xeee87777c1779fb6), CONST64(0x6e923737dc37a5eb), CONST64(0xd79ee5e5b3e57b56),
+CONST64(0x23139f9f469f8cd9), CONST64(0xfd23f0f0e7f0d317), CONST64(0x94204a4a354a6a7f), CONST64(0xa944dada4fda9e95),
+CONST64(0xb0a258587d58fa25), CONST64(0x8fcfc9c903c906ca), CONST64(0x527c2929a429558d), CONST64(0x145a0a0a280a5022),
+CONST64(0x7f50b1b1feb1e14f), CONST64(0x5dc9a0a0baa0691a), CONST64(0xd6146b6bb16b7fda), CONST64(0x17d985852e855cab),
+CONST64(0x673cbdbdcebd8173), CONST64(0xba8f5d5d695dd234), CONST64(0x2090101040108050), CONST64(0xf507f4f4f7f4f303),
+CONST64(0x8bddcbcb0bcb16c0), CONST64(0x7cd33e3ef83eedc6), CONST64(0x0a2d050514052811), CONST64(0xce78676781671fe6),
+CONST64(0xd597e4e4b7e47353), CONST64(0x4e0227279c2725bb), CONST64(0x8273414119413258), CONST64(0x0ba78b8b168b2c9d),
+CONST64(0x53f6a7a7a6a75101), CONST64(0xfab27d7de97dcf94), CONST64(0x374995956e95dcfb), CONST64(0xad56d8d847d88e9f),
+CONST64(0xeb70fbfbcbfb8b30), CONST64(0xc1cdeeee9fee2371), CONST64(0xf8bb7c7ced7cc791), CONST64(0xcc716666856617e3),
+CONST64(0xa77bdddd53dda68e), CONST64(0x2eaf17175c17b84b), CONST64(0x8e45474701470246), CONST64(0x211a9e9e429e84dc),
+CONST64(0x89d4caca0fca1ec5), CONST64(0x5a582d2db42d7599), CONST64(0x632ebfbfc6bf9179), CONST64(0x0e3f07071c07381b),
+CONST64(0x47acadad8ead0123), CONST64(0xb4b05a5a755aea2f), CONST64(0x1bef838336836cb5), CONST64(0x66b63333cc3385ff),
+CONST64(0xc65c636391633ff2), CONST64(0x041202020802100a), CONST64(0x4993aaaa92aa3938), CONST64(0xe2de7171d971afa8),
+CONST64(0x8dc6c8c807c80ecf), CONST64(0x32d119196419c87d), CONST64(0x923b494939497270), CONST64(0xaf5fd9d943d9869a),
+CONST64(0xf931f2f2eff2c31d), CONST64(0xdba8e3e3abe34b48), CONST64(0xb6b95b5b715be22a), CONST64(0x0dbc88881a883492),
+CONST64(0x293e9a9a529aa4c8), CONST64(0x4c0b262698262dbe), CONST64(0x64bf3232c8328dfa), CONST64(0x7d59b0b0fab0e94a),
+CONST64(0xcff2e9e983e91b6a), CONST64(0x1e770f0f3c0f7833), CONST64(0xb733d5d573d5e6a6), CONST64(0x1df480803a8074ba),
+CONST64(0x6127bebec2be997c), CONST64(0x87ebcdcd13cd26de), CONST64(0x68893434d034bde4), CONST64(0x903248483d487a75),
+CONST64(0xe354ffffdbffab24), CONST64(0xf48d7a7af57af78f), CONST64(0x3d6490907a90f4ea), CONST64(0xbe9d5f5f615fc23e),
+CONST64(0x403d202080201da0), CONST64(0xd00f6868bd6867d5), CONST64(0x34ca1a1a681ad072), CONST64(0x41b7aeae82ae192c),
+CONST64(0x757db4b4eab4c95e), CONST64(0xa8ce54544d549a19), CONST64(0x3b7f93937693ece5), CONST64(0x442f222288220daa),
+CONST64(0xc86364648d6407e9), CONST64(0xff2af1f1e3f1db12), CONST64(0xe6cc7373d173bfa2), CONST64(0x248212124812905a),
+CONST64(0x807a40401d403a5d), CONST64(0x1048080820084028), CONST64(0x9b95c3c32bc356e8), CONST64(0xc5dfecec97ec337b),
+CONST64(0xab4ddbdb4bdb9690), CONST64(0x5fc0a1a1bea1611f), CONST64(0x07918d8d0e8d1c83), CONST64(0x7ac83d3df43df5c9),
+CONST64(0x335b97976697ccf1), CONST64(0x0000000000000000), CONST64(0x83f9cfcf1bcf36d4), CONST64(0x566e2b2bac2b4587),
+CONST64(0xece17676c57697b3), CONST64(0x19e68282328264b0), CONST64(0xb128d6d67fd6fea9), CONST64(0x36c31b1b6c1bd877),
+CONST64(0x7774b5b5eeb5c15b), CONST64(0x43beafaf86af1129), CONST64(0xd41d6a6ab56a77df), CONST64(0xa0ea50505d50ba0d),
+CONST64(0x8a5745450945124c), CONST64(0xfb38f3f3ebf3cb18), CONST64(0x60ad3030c0309df0), CONST64(0xc3c4efef9bef2b74),
+CONST64(0x7eda3f3ffc3fe5c3), CONST64(0xaac755554955921c), CONST64(0x59dba2a2b2a27910), CONST64(0xc9e9eaea8fea0365),
+CONST64(0xca6a656589650fec), CONST64(0x6903babad2bab968), CONST64(0x5e4a2f2fbc2f6593), CONST64(0x9d8ec0c027c04ee7),
+CONST64(0xa160dede5fdebe81), CONST64(0x38fc1c1c701ce06c), CONST64(0xe746fdfdd3fdbb2e), CONST64(0x9a1f4d4d294d5264),
+CONST64(0x397692927292e4e0), CONST64(0xeafa7575c9758fbc), CONST64(0x0c3606061806301e), CONST64(0x09ae8a8a128a2498),
+CONST64(0x794bb2b2f2b2f940), CONST64(0xd185e6e6bfe66359), CONST64(0x1c7e0e0e380e7036), CONST64(0x3ee71f1f7c1ff863),
+CONST64(0xc4556262956237f7), CONST64(0xb53ad4d477d4eea3), CONST64(0x4d81a8a89aa82932), CONST64(0x315296966296c4f4),
+CONST64(0xef62f9f9c3f99b3a), CONST64(0x97a3c5c533c566f6), CONST64(0x4a102525942535b1), CONST64(0xb2ab59597959f220),
+CONST64(0x15d084842a8454ae), CONST64(0xe4c57272d572b7a7), CONST64(0x72ec3939e439d5dd), CONST64(0x98164c4c2d4c5a61),
+CONST64(0xbc945e5e655eca3b), CONST64(0xf09f7878fd78e785), CONST64(0x70e53838e038ddd8), CONST64(0x05988c8c0a8c1486),
+CONST64(0xbf17d1d163d1c6b2), CONST64(0x57e4a5a5aea5410b), CONST64(0xd9a1e2e2afe2434d), CONST64(0xc24e616199612ff8),
+CONST64(0x7b42b3b3f6b3f145), CONST64(0x42342121842115a5), CONST64(0x25089c9c4a9c94d6), CONST64(0x3cee1e1e781ef066),
+CONST64(0x8661434311432252), CONST64(0x93b1c7c73bc776fc), CONST64(0xe54ffcfcd7fcb32b), CONST64(0x0824040410042014),
+CONST64(0xa2e351515951b208), CONST64(0x2f2599995e99bcc7), CONST64(0xda226d6da96d4fc4), CONST64(0x1a650d0d340d6839),
+CONST64(0xe979fafacffa8335), CONST64(0xa369dfdf5bdfb684), CONST64(0xfca97e7ee57ed79b), CONST64(0x4819242490243db4),
+CONST64(0x76fe3b3bec3bc5d7), CONST64(0x4b9aabab96ab313d), CONST64(0x81f0cece1fce3ed1), CONST64(0x2299111144118855),
+CONST64(0x03838f8f068f0c89), CONST64(0x9c044e4e254e4a6b), CONST64(0x7366b7b7e6b7d151), CONST64(0xcbe0ebeb8beb0b60),
+CONST64(0x78c13c3cf03cfdcc), CONST64(0x1ffd81813e817cbf), CONST64(0x354094946a94d4fe), CONST64(0xf31cf7f7fbf7eb0c),
+CONST64(0x6f18b9b9deb9a167), CONST64(0x268b13134c13985f), CONST64(0x58512c2cb02c7d9c), CONST64(0xbb05d3d36bd3d6b8),
+CONST64(0xd38ce7e7bbe76b5c), CONST64(0xdc396e6ea56e57cb), CONST64(0x95aac4c437c46ef3), CONST64(0x061b03030c03180f),
+CONST64(0xacdc565645568a13), CONST64(0x885e44440d441a49), CONST64(0xfea07f7fe17fdf9e), CONST64(0x4f88a9a99ea92137),
+CONST64(0x54672a2aa82a4d82), CONST64(0x6b0abbbbd6bbb16d), CONST64(0x9f87c1c123c146e2), CONST64(0xa6f153535153a202),
+CONST64(0xa572dcdc57dcae8b), CONST64(0x16530b0b2c0b5827), CONST64(0x27019d9d4e9d9cd3), CONST64(0xd82b6c6cad6c47c1),
+CONST64(0x62a43131c43195f5), CONST64(0xe8f37474cd7487b9), CONST64(0xf115f6f6fff6e309), CONST64(0x8c4c464605460a43),
+CONST64(0x45a5acac8aac0926), CONST64(0x0fb589891e893c97), CONST64(0x28b414145014a044), CONST64(0xdfbae1e1a3e15b42),
+CONST64(0x2ca616165816b04e), CONST64(0x74f73a3ae83acdd2), CONST64(0xd2066969b9696fd0), CONST64(0x124109092409482d),
+CONST64(0xe0d77070dd70a7ad), CONST64(0x716fb6b6e2b6d954), CONST64(0xbd1ed0d067d0ceb7), CONST64(0xc7d6eded93ed3b7e),
+CONST64(0x85e2cccc17cc2edb), CONST64(0x8468424215422a57), CONST64(0x2d2c98985a98b4c2), CONST64(0x55eda4a4aaa4490e),
+CONST64(0x50752828a0285d88), CONST64(0xb8865c5c6d5cda31), CONST64(0xed6bf8f8c7f8933f), CONST64(0x11c28686228644a4)
+};
+
+static const ulong64 sbox3[] = {
+CONST64(0x7830d818186018c0), CONST64(0xaf462623238c2305), CONST64(0xf991b8c6c63fc67e), CONST64(0x6fcdfbe8e887e813),
+CONST64(0xa113cb878726874c), CONST64(0x626d11b8b8dab8a9), CONST64(0x0502090101040108), CONST64(0x6e9e0d4f4f214f42),
+CONST64(0xee6c9b3636d836ad), CONST64(0x0451ffa6a6a2a659), CONST64(0xbdb90cd2d26fd2de), CONST64(0x06f70ef5f5f3f5fb),
+CONST64(0x80f2967979f979ef), CONST64(0xcede306f6fa16f5f), CONST64(0xef3f6d91917e91fc), CONST64(0x07a4f852525552aa),
+CONST64(0xfdc04760609d6027), CONST64(0x766535bcbccabc89), CONST64(0xcd2b379b9b569bac), CONST64(0x8c018a8e8e028e04),
+CONST64(0x155bd2a3a3b6a371), CONST64(0x3c186c0c0c300c60), CONST64(0x8af6847b7bf17bff), CONST64(0xe16a803535d435b5),
+CONST64(0x693af51d1d741de8), CONST64(0x47ddb3e0e0a7e053), CONST64(0xacb321d7d77bd7f6), CONST64(0xed999cc2c22fc25e),
+CONST64(0x965c432e2eb82e6d), CONST64(0x7a96294b4b314b62), CONST64(0x21e15dfefedffea3), CONST64(0x16aed55757415782),
+CONST64(0x412abd15155415a8), CONST64(0xb6eee87777c1779f), CONST64(0xeb6e923737dc37a5), CONST64(0x56d79ee5e5b3e57b),
+CONST64(0xd923139f9f469f8c), CONST64(0x17fd23f0f0e7f0d3), CONST64(0x7f94204a4a354a6a), CONST64(0x95a944dada4fda9e),
+CONST64(0x25b0a258587d58fa), CONST64(0xca8fcfc9c903c906), CONST64(0x8d527c2929a42955), CONST64(0x22145a0a0a280a50),
+CONST64(0x4f7f50b1b1feb1e1), CONST64(0x1a5dc9a0a0baa069), CONST64(0xdad6146b6bb16b7f), CONST64(0xab17d985852e855c),
+CONST64(0x73673cbdbdcebd81), CONST64(0x34ba8f5d5d695dd2), CONST64(0x5020901010401080), CONST64(0x03f507f4f4f7f4f3),
+CONST64(0xc08bddcbcb0bcb16), CONST64(0xc67cd33e3ef83eed), CONST64(0x110a2d0505140528), CONST64(0xe6ce78676781671f),
+CONST64(0x53d597e4e4b7e473), CONST64(0xbb4e0227279c2725), CONST64(0x5882734141194132), CONST64(0x9d0ba78b8b168b2c),
+CONST64(0x0153f6a7a7a6a751), CONST64(0x94fab27d7de97dcf), CONST64(0xfb374995956e95dc), CONST64(0x9fad56d8d847d88e),
+CONST64(0x30eb70fbfbcbfb8b), CONST64(0x71c1cdeeee9fee23), CONST64(0x91f8bb7c7ced7cc7), CONST64(0xe3cc716666856617),
+CONST64(0x8ea77bdddd53dda6), CONST64(0x4b2eaf17175c17b8), CONST64(0x468e454747014702), CONST64(0xdc211a9e9e429e84),
+CONST64(0xc589d4caca0fca1e), CONST64(0x995a582d2db42d75), CONST64(0x79632ebfbfc6bf91), CONST64(0x1b0e3f07071c0738),
+CONST64(0x2347acadad8ead01), CONST64(0x2fb4b05a5a755aea), CONST64(0xb51bef838336836c), CONST64(0xff66b63333cc3385),
+CONST64(0xf2c65c636391633f), CONST64(0x0a04120202080210), CONST64(0x384993aaaa92aa39), CONST64(0xa8e2de7171d971af),
+CONST64(0xcf8dc6c8c807c80e), CONST64(0x7d32d119196419c8), CONST64(0x70923b4949394972), CONST64(0x9aaf5fd9d943d986),
+CONST64(0x1df931f2f2eff2c3), CONST64(0x48dba8e3e3abe34b), CONST64(0x2ab6b95b5b715be2), CONST64(0x920dbc88881a8834),
+CONST64(0xc8293e9a9a529aa4), CONST64(0xbe4c0b262698262d), CONST64(0xfa64bf3232c8328d), CONST64(0x4a7d59b0b0fab0e9),
+CONST64(0x6acff2e9e983e91b), CONST64(0x331e770f0f3c0f78), CONST64(0xa6b733d5d573d5e6), CONST64(0xba1df480803a8074),
+CONST64(0x7c6127bebec2be99), CONST64(0xde87ebcdcd13cd26), CONST64(0xe468893434d034bd), CONST64(0x75903248483d487a),
+CONST64(0x24e354ffffdbffab), CONST64(0x8ff48d7a7af57af7), CONST64(0xea3d6490907a90f4), CONST64(0x3ebe9d5f5f615fc2),
+CONST64(0xa0403d202080201d), CONST64(0xd5d00f6868bd6867), CONST64(0x7234ca1a1a681ad0), CONST64(0x2c41b7aeae82ae19),
+CONST64(0x5e757db4b4eab4c9), CONST64(0x19a8ce54544d549a), CONST64(0xe53b7f93937693ec), CONST64(0xaa442f222288220d),
+CONST64(0xe9c86364648d6407), CONST64(0x12ff2af1f1e3f1db), CONST64(0xa2e6cc7373d173bf), CONST64(0x5a24821212481290),
+CONST64(0x5d807a40401d403a), CONST64(0x2810480808200840), CONST64(0xe89b95c3c32bc356), CONST64(0x7bc5dfecec97ec33),
+CONST64(0x90ab4ddbdb4bdb96), CONST64(0x1f5fc0a1a1bea161), CONST64(0x8307918d8d0e8d1c), CONST64(0xc97ac83d3df43df5),
+CONST64(0xf1335b97976697cc), CONST64(0x0000000000000000), CONST64(0xd483f9cfcf1bcf36), CONST64(0x87566e2b2bac2b45),
+CONST64(0xb3ece17676c57697), CONST64(0xb019e68282328264), CONST64(0xa9b128d6d67fd6fe), CONST64(0x7736c31b1b6c1bd8),
+CONST64(0x5b7774b5b5eeb5c1), CONST64(0x2943beafaf86af11), CONST64(0xdfd41d6a6ab56a77), CONST64(0x0da0ea50505d50ba),
+CONST64(0x4c8a574545094512), CONST64(0x18fb38f3f3ebf3cb), CONST64(0xf060ad3030c0309d), CONST64(0x74c3c4efef9bef2b),
+CONST64(0xc37eda3f3ffc3fe5), CONST64(0x1caac75555495592), CONST64(0x1059dba2a2b2a279), CONST64(0x65c9e9eaea8fea03),
+CONST64(0xecca6a656589650f), CONST64(0x686903babad2bab9), CONST64(0x935e4a2f2fbc2f65), CONST64(0xe79d8ec0c027c04e),
+CONST64(0x81a160dede5fdebe), CONST64(0x6c38fc1c1c701ce0), CONST64(0x2ee746fdfdd3fdbb), CONST64(0x649a1f4d4d294d52),
+CONST64(0xe0397692927292e4), CONST64(0xbceafa7575c9758f), CONST64(0x1e0c360606180630), CONST64(0x9809ae8a8a128a24),
+CONST64(0x40794bb2b2f2b2f9), CONST64(0x59d185e6e6bfe663), CONST64(0x361c7e0e0e380e70), CONST64(0x633ee71f1f7c1ff8),
+CONST64(0xf7c4556262956237), CONST64(0xa3b53ad4d477d4ee), CONST64(0x324d81a8a89aa829), CONST64(0xf4315296966296c4),
+CONST64(0x3aef62f9f9c3f99b), CONST64(0xf697a3c5c533c566), CONST64(0xb14a102525942535), CONST64(0x20b2ab59597959f2),
+CONST64(0xae15d084842a8454), CONST64(0xa7e4c57272d572b7), CONST64(0xdd72ec3939e439d5), CONST64(0x6198164c4c2d4c5a),
+CONST64(0x3bbc945e5e655eca), CONST64(0x85f09f7878fd78e7), CONST64(0xd870e53838e038dd), CONST64(0x8605988c8c0a8c14),
+CONST64(0xb2bf17d1d163d1c6), CONST64(0x0b57e4a5a5aea541), CONST64(0x4dd9a1e2e2afe243), CONST64(0xf8c24e616199612f),
+CONST64(0x457b42b3b3f6b3f1), CONST64(0xa542342121842115), CONST64(0xd625089c9c4a9c94), CONST64(0x663cee1e1e781ef0),
+CONST64(0x5286614343114322), CONST64(0xfc93b1c7c73bc776), CONST64(0x2be54ffcfcd7fcb3), CONST64(0x1408240404100420),
+CONST64(0x08a2e351515951b2), CONST64(0xc72f2599995e99bc), CONST64(0xc4da226d6da96d4f), CONST64(0x391a650d0d340d68),
+CONST64(0x35e979fafacffa83), CONST64(0x84a369dfdf5bdfb6), CONST64(0x9bfca97e7ee57ed7), CONST64(0xb44819242490243d),
+CONST64(0xd776fe3b3bec3bc5), CONST64(0x3d4b9aabab96ab31), CONST64(0xd181f0cece1fce3e), CONST64(0x5522991111441188),
+CONST64(0x8903838f8f068f0c), CONST64(0x6b9c044e4e254e4a), CONST64(0x517366b7b7e6b7d1), CONST64(0x60cbe0ebeb8beb0b),
+CONST64(0xcc78c13c3cf03cfd), CONST64(0xbf1ffd81813e817c), CONST64(0xfe354094946a94d4), CONST64(0x0cf31cf7f7fbf7eb),
+CONST64(0x676f18b9b9deb9a1), CONST64(0x5f268b13134c1398), CONST64(0x9c58512c2cb02c7d), CONST64(0xb8bb05d3d36bd3d6),
+CONST64(0x5cd38ce7e7bbe76b), CONST64(0xcbdc396e6ea56e57), CONST64(0xf395aac4c437c46e), CONST64(0x0f061b03030c0318),
+CONST64(0x13acdc565645568a), CONST64(0x49885e44440d441a), CONST64(0x9efea07f7fe17fdf), CONST64(0x374f88a9a99ea921),
+CONST64(0x8254672a2aa82a4d), CONST64(0x6d6b0abbbbd6bbb1), CONST64(0xe29f87c1c123c146), CONST64(0x02a6f153535153a2),
+CONST64(0x8ba572dcdc57dcae), CONST64(0x2716530b0b2c0b58), CONST64(0xd327019d9d4e9d9c), CONST64(0xc1d82b6c6cad6c47),
+CONST64(0xf562a43131c43195), CONST64(0xb9e8f37474cd7487), CONST64(0x09f115f6f6fff6e3), CONST64(0x438c4c464605460a),
+CONST64(0x2645a5acac8aac09), CONST64(0x970fb589891e893c), CONST64(0x4428b414145014a0), CONST64(0x42dfbae1e1a3e15b),
+CONST64(0x4e2ca616165816b0), CONST64(0xd274f73a3ae83acd), CONST64(0xd0d2066969b9696f), CONST64(0x2d12410909240948),
+CONST64(0xade0d77070dd70a7), CONST64(0x54716fb6b6e2b6d9), CONST64(0xb7bd1ed0d067d0ce), CONST64(0x7ec7d6eded93ed3b),
+CONST64(0xdb85e2cccc17cc2e), CONST64(0x578468424215422a), CONST64(0xc22d2c98985a98b4), CONST64(0x0e55eda4a4aaa449),
+CONST64(0x8850752828a0285d), CONST64(0x31b8865c5c6d5cda), CONST64(0x3fed6bf8f8c7f893), CONST64(0xa411c28686228644)
+};
+
+static const ulong64 sbox4[] = {
+CONST64(0xc07830d818186018), CONST64(0x05af462623238c23), CONST64(0x7ef991b8c6c63fc6), CONST64(0x136fcdfbe8e887e8),
+CONST64(0x4ca113cb87872687), CONST64(0xa9626d11b8b8dab8), CONST64(0x0805020901010401), CONST64(0x426e9e0d4f4f214f),
+CONST64(0xadee6c9b3636d836), CONST64(0x590451ffa6a6a2a6), CONST64(0xdebdb90cd2d26fd2), CONST64(0xfb06f70ef5f5f3f5),
+CONST64(0xef80f2967979f979), CONST64(0x5fcede306f6fa16f), CONST64(0xfcef3f6d91917e91), CONST64(0xaa07a4f852525552),
+CONST64(0x27fdc04760609d60), CONST64(0x89766535bcbccabc), CONST64(0xaccd2b379b9b569b), CONST64(0x048c018a8e8e028e),
+CONST64(0x71155bd2a3a3b6a3), CONST64(0x603c186c0c0c300c), CONST64(0xff8af6847b7bf17b), CONST64(0xb5e16a803535d435),
+CONST64(0xe8693af51d1d741d), CONST64(0x5347ddb3e0e0a7e0), CONST64(0xf6acb321d7d77bd7), CONST64(0x5eed999cc2c22fc2),
+CONST64(0x6d965c432e2eb82e), CONST64(0x627a96294b4b314b), CONST64(0xa321e15dfefedffe), CONST64(0x8216aed557574157),
+CONST64(0xa8412abd15155415), CONST64(0x9fb6eee87777c177), CONST64(0xa5eb6e923737dc37), CONST64(0x7b56d79ee5e5b3e5),
+CONST64(0x8cd923139f9f469f), CONST64(0xd317fd23f0f0e7f0), CONST64(0x6a7f94204a4a354a), CONST64(0x9e95a944dada4fda),
+CONST64(0xfa25b0a258587d58), CONST64(0x06ca8fcfc9c903c9), CONST64(0x558d527c2929a429), CONST64(0x5022145a0a0a280a),
+CONST64(0xe14f7f50b1b1feb1), CONST64(0x691a5dc9a0a0baa0), CONST64(0x7fdad6146b6bb16b), CONST64(0x5cab17d985852e85),
+CONST64(0x8173673cbdbdcebd), CONST64(0xd234ba8f5d5d695d), CONST64(0x8050209010104010), CONST64(0xf303f507f4f4f7f4),
+CONST64(0x16c08bddcbcb0bcb), CONST64(0xedc67cd33e3ef83e), CONST64(0x28110a2d05051405), CONST64(0x1fe6ce7867678167),
+CONST64(0x7353d597e4e4b7e4), CONST64(0x25bb4e0227279c27), CONST64(0x3258827341411941), CONST64(0x2c9d0ba78b8b168b),
+CONST64(0x510153f6a7a7a6a7), CONST64(0xcf94fab27d7de97d), CONST64(0xdcfb374995956e95), CONST64(0x8e9fad56d8d847d8),
+CONST64(0x8b30eb70fbfbcbfb), CONST64(0x2371c1cdeeee9fee), CONST64(0xc791f8bb7c7ced7c), CONST64(0x17e3cc7166668566),
+CONST64(0xa68ea77bdddd53dd), CONST64(0xb84b2eaf17175c17), CONST64(0x02468e4547470147), CONST64(0x84dc211a9e9e429e),
+CONST64(0x1ec589d4caca0fca), CONST64(0x75995a582d2db42d), CONST64(0x9179632ebfbfc6bf), CONST64(0x381b0e3f07071c07),
+CONST64(0x012347acadad8ead), CONST64(0xea2fb4b05a5a755a), CONST64(0x6cb51bef83833683), CONST64(0x85ff66b63333cc33),
+CONST64(0x3ff2c65c63639163), CONST64(0x100a041202020802), CONST64(0x39384993aaaa92aa), CONST64(0xafa8e2de7171d971),
+CONST64(0x0ecf8dc6c8c807c8), CONST64(0xc87d32d119196419), CONST64(0x7270923b49493949), CONST64(0x869aaf5fd9d943d9),
+CONST64(0xc31df931f2f2eff2), CONST64(0x4b48dba8e3e3abe3), CONST64(0xe22ab6b95b5b715b), CONST64(0x34920dbc88881a88),
+CONST64(0xa4c8293e9a9a529a), CONST64(0x2dbe4c0b26269826), CONST64(0x8dfa64bf3232c832), CONST64(0xe94a7d59b0b0fab0),
+CONST64(0x1b6acff2e9e983e9), CONST64(0x78331e770f0f3c0f), CONST64(0xe6a6b733d5d573d5), CONST64(0x74ba1df480803a80),
+CONST64(0x997c6127bebec2be), CONST64(0x26de87ebcdcd13cd), CONST64(0xbde468893434d034), CONST64(0x7a75903248483d48),
+CONST64(0xab24e354ffffdbff), CONST64(0xf78ff48d7a7af57a), CONST64(0xf4ea3d6490907a90), CONST64(0xc23ebe9d5f5f615f),
+CONST64(0x1da0403d20208020), CONST64(0x67d5d00f6868bd68), CONST64(0xd07234ca1a1a681a), CONST64(0x192c41b7aeae82ae),
+CONST64(0xc95e757db4b4eab4), CONST64(0x9a19a8ce54544d54), CONST64(0xece53b7f93937693), CONST64(0x0daa442f22228822),
+CONST64(0x07e9c86364648d64), CONST64(0xdb12ff2af1f1e3f1), CONST64(0xbfa2e6cc7373d173), CONST64(0x905a248212124812),
+CONST64(0x3a5d807a40401d40), CONST64(0x4028104808082008), CONST64(0x56e89b95c3c32bc3), CONST64(0x337bc5dfecec97ec),
+CONST64(0x9690ab4ddbdb4bdb), CONST64(0x611f5fc0a1a1bea1), CONST64(0x1c8307918d8d0e8d), CONST64(0xf5c97ac83d3df43d),
+CONST64(0xccf1335b97976697), CONST64(0x0000000000000000), CONST64(0x36d483f9cfcf1bcf), CONST64(0x4587566e2b2bac2b),
+CONST64(0x97b3ece17676c576), CONST64(0x64b019e682823282), CONST64(0xfea9b128d6d67fd6), CONST64(0xd87736c31b1b6c1b),
+CONST64(0xc15b7774b5b5eeb5), CONST64(0x112943beafaf86af), CONST64(0x77dfd41d6a6ab56a), CONST64(0xba0da0ea50505d50),
+CONST64(0x124c8a5745450945), CONST64(0xcb18fb38f3f3ebf3), CONST64(0x9df060ad3030c030), CONST64(0x2b74c3c4efef9bef),
+CONST64(0xe5c37eda3f3ffc3f), CONST64(0x921caac755554955), CONST64(0x791059dba2a2b2a2), CONST64(0x0365c9e9eaea8fea),
+CONST64(0x0fecca6a65658965), CONST64(0xb9686903babad2ba), CONST64(0x65935e4a2f2fbc2f), CONST64(0x4ee79d8ec0c027c0),
+CONST64(0xbe81a160dede5fde), CONST64(0xe06c38fc1c1c701c), CONST64(0xbb2ee746fdfdd3fd), CONST64(0x52649a1f4d4d294d),
+CONST64(0xe4e0397692927292), CONST64(0x8fbceafa7575c975), CONST64(0x301e0c3606061806), CONST64(0x249809ae8a8a128a),
+CONST64(0xf940794bb2b2f2b2), CONST64(0x6359d185e6e6bfe6), CONST64(0x70361c7e0e0e380e), CONST64(0xf8633ee71f1f7c1f),
+CONST64(0x37f7c45562629562), CONST64(0xeea3b53ad4d477d4), CONST64(0x29324d81a8a89aa8), CONST64(0xc4f4315296966296),
+CONST64(0x9b3aef62f9f9c3f9), CONST64(0x66f697a3c5c533c5), CONST64(0x35b14a1025259425), CONST64(0xf220b2ab59597959),
+CONST64(0x54ae15d084842a84), CONST64(0xb7a7e4c57272d572), CONST64(0xd5dd72ec3939e439), CONST64(0x5a6198164c4c2d4c),
+CONST64(0xca3bbc945e5e655e), CONST64(0xe785f09f7878fd78), CONST64(0xddd870e53838e038), CONST64(0x148605988c8c0a8c),
+CONST64(0xc6b2bf17d1d163d1), CONST64(0x410b57e4a5a5aea5), CONST64(0x434dd9a1e2e2afe2), CONST64(0x2ff8c24e61619961),
+CONST64(0xf1457b42b3b3f6b3), CONST64(0x15a5423421218421), CONST64(0x94d625089c9c4a9c), CONST64(0xf0663cee1e1e781e),
+CONST64(0x2252866143431143), CONST64(0x76fc93b1c7c73bc7), CONST64(0xb32be54ffcfcd7fc), CONST64(0x2014082404041004),
+CONST64(0xb208a2e351515951), CONST64(0xbcc72f2599995e99), CONST64(0x4fc4da226d6da96d), CONST64(0x68391a650d0d340d),
+CONST64(0x8335e979fafacffa), CONST64(0xb684a369dfdf5bdf), CONST64(0xd79bfca97e7ee57e), CONST64(0x3db4481924249024),
+CONST64(0xc5d776fe3b3bec3b), CONST64(0x313d4b9aabab96ab), CONST64(0x3ed181f0cece1fce), CONST64(0x8855229911114411),
+CONST64(0x0c8903838f8f068f), CONST64(0x4a6b9c044e4e254e), CONST64(0xd1517366b7b7e6b7), CONST64(0x0b60cbe0ebeb8beb),
+CONST64(0xfdcc78c13c3cf03c), CONST64(0x7cbf1ffd81813e81), CONST64(0xd4fe354094946a94), CONST64(0xeb0cf31cf7f7fbf7),
+CONST64(0xa1676f18b9b9deb9), CONST64(0x985f268b13134c13), CONST64(0x7d9c58512c2cb02c), CONST64(0xd6b8bb05d3d36bd3),
+CONST64(0x6b5cd38ce7e7bbe7), CONST64(0x57cbdc396e6ea56e), CONST64(0x6ef395aac4c437c4), CONST64(0x180f061b03030c03),
+CONST64(0x8a13acdc56564556), CONST64(0x1a49885e44440d44), CONST64(0xdf9efea07f7fe17f), CONST64(0x21374f88a9a99ea9),
+CONST64(0x4d8254672a2aa82a), CONST64(0xb16d6b0abbbbd6bb), CONST64(0x46e29f87c1c123c1), CONST64(0xa202a6f153535153),
+CONST64(0xae8ba572dcdc57dc), CONST64(0x582716530b0b2c0b), CONST64(0x9cd327019d9d4e9d), CONST64(0x47c1d82b6c6cad6c),
+CONST64(0x95f562a43131c431), CONST64(0x87b9e8f37474cd74), CONST64(0xe309f115f6f6fff6), CONST64(0x0a438c4c46460546),
+CONST64(0x092645a5acac8aac), CONST64(0x3c970fb589891e89), CONST64(0xa04428b414145014), CONST64(0x5b42dfbae1e1a3e1),
+CONST64(0xb04e2ca616165816), CONST64(0xcdd274f73a3ae83a), CONST64(0x6fd0d2066969b969), CONST64(0x482d124109092409),
+CONST64(0xa7ade0d77070dd70), CONST64(0xd954716fb6b6e2b6), CONST64(0xceb7bd1ed0d067d0), CONST64(0x3b7ec7d6eded93ed),
+CONST64(0x2edb85e2cccc17cc), CONST64(0x2a57846842421542), CONST64(0xb4c22d2c98985a98), CONST64(0x490e55eda4a4aaa4),
+CONST64(0x5d8850752828a028), CONST64(0xda31b8865c5c6d5c), CONST64(0x933fed6bf8f8c7f8), CONST64(0x44a411c286862286)
+};
+
+static const ulong64 sbox5[] = {
+CONST64(0x18c07830d8181860), CONST64(0x2305af462623238c), CONST64(0xc67ef991b8c6c63f), CONST64(0xe8136fcdfbe8e887),
+CONST64(0x874ca113cb878726), CONST64(0xb8a9626d11b8b8da), CONST64(0x0108050209010104), CONST64(0x4f426e9e0d4f4f21),
+CONST64(0x36adee6c9b3636d8), CONST64(0xa6590451ffa6a6a2), CONST64(0xd2debdb90cd2d26f), CONST64(0xf5fb06f70ef5f5f3),
+CONST64(0x79ef80f2967979f9), CONST64(0x6f5fcede306f6fa1), CONST64(0x91fcef3f6d91917e), CONST64(0x52aa07a4f8525255),
+CONST64(0x6027fdc04760609d), CONST64(0xbc89766535bcbcca), CONST64(0x9baccd2b379b9b56), CONST64(0x8e048c018a8e8e02),
+CONST64(0xa371155bd2a3a3b6), CONST64(0x0c603c186c0c0c30), CONST64(0x7bff8af6847b7bf1), CONST64(0x35b5e16a803535d4),
+CONST64(0x1de8693af51d1d74), CONST64(0xe05347ddb3e0e0a7), CONST64(0xd7f6acb321d7d77b), CONST64(0xc25eed999cc2c22f),
+CONST64(0x2e6d965c432e2eb8), CONST64(0x4b627a96294b4b31), CONST64(0xfea321e15dfefedf), CONST64(0x578216aed5575741),
+CONST64(0x15a8412abd151554), CONST64(0x779fb6eee87777c1), CONST64(0x37a5eb6e923737dc), CONST64(0xe57b56d79ee5e5b3),
+CONST64(0x9f8cd923139f9f46), CONST64(0xf0d317fd23f0f0e7), CONST64(0x4a6a7f94204a4a35), CONST64(0xda9e95a944dada4f),
+CONST64(0x58fa25b0a258587d), CONST64(0xc906ca8fcfc9c903), CONST64(0x29558d527c2929a4), CONST64(0x0a5022145a0a0a28),
+CONST64(0xb1e14f7f50b1b1fe), CONST64(0xa0691a5dc9a0a0ba), CONST64(0x6b7fdad6146b6bb1), CONST64(0x855cab17d985852e),
+CONST64(0xbd8173673cbdbdce), CONST64(0x5dd234ba8f5d5d69), CONST64(0x1080502090101040), CONST64(0xf4f303f507f4f4f7),
+CONST64(0xcb16c08bddcbcb0b), CONST64(0x3eedc67cd33e3ef8), CONST64(0x0528110a2d050514), CONST64(0x671fe6ce78676781),
+CONST64(0xe47353d597e4e4b7), CONST64(0x2725bb4e0227279c), CONST64(0x4132588273414119), CONST64(0x8b2c9d0ba78b8b16),
+CONST64(0xa7510153f6a7a7a6), CONST64(0x7dcf94fab27d7de9), CONST64(0x95dcfb374995956e), CONST64(0xd88e9fad56d8d847),
+CONST64(0xfb8b30eb70fbfbcb), CONST64(0xee2371c1cdeeee9f), CONST64(0x7cc791f8bb7c7ced), CONST64(0x6617e3cc71666685),
+CONST64(0xdda68ea77bdddd53), CONST64(0x17b84b2eaf17175c), CONST64(0x4702468e45474701), CONST64(0x9e84dc211a9e9e42),
+CONST64(0xca1ec589d4caca0f), CONST64(0x2d75995a582d2db4), CONST64(0xbf9179632ebfbfc6), CONST64(0x07381b0e3f07071c),
+CONST64(0xad012347acadad8e), CONST64(0x5aea2fb4b05a5a75), CONST64(0x836cb51bef838336), CONST64(0x3385ff66b63333cc),
+CONST64(0x633ff2c65c636391), CONST64(0x02100a0412020208), CONST64(0xaa39384993aaaa92), CONST64(0x71afa8e2de7171d9),
+CONST64(0xc80ecf8dc6c8c807), CONST64(0x19c87d32d1191964), CONST64(0x497270923b494939), CONST64(0xd9869aaf5fd9d943),
+CONST64(0xf2c31df931f2f2ef), CONST64(0xe34b48dba8e3e3ab), CONST64(0x5be22ab6b95b5b71), CONST64(0x8834920dbc88881a),
+CONST64(0x9aa4c8293e9a9a52), CONST64(0x262dbe4c0b262698), CONST64(0x328dfa64bf3232c8), CONST64(0xb0e94a7d59b0b0fa),
+CONST64(0xe91b6acff2e9e983), CONST64(0x0f78331e770f0f3c), CONST64(0xd5e6a6b733d5d573), CONST64(0x8074ba1df480803a),
+CONST64(0xbe997c6127bebec2), CONST64(0xcd26de87ebcdcd13), CONST64(0x34bde468893434d0), CONST64(0x487a75903248483d),
+CONST64(0xffab24e354ffffdb), CONST64(0x7af78ff48d7a7af5), CONST64(0x90f4ea3d6490907a), CONST64(0x5fc23ebe9d5f5f61),
+CONST64(0x201da0403d202080), CONST64(0x6867d5d00f6868bd), CONST64(0x1ad07234ca1a1a68), CONST64(0xae192c41b7aeae82),
+CONST64(0xb4c95e757db4b4ea), CONST64(0x549a19a8ce54544d), CONST64(0x93ece53b7f939376), CONST64(0x220daa442f222288),
+CONST64(0x6407e9c86364648d), CONST64(0xf1db12ff2af1f1e3), CONST64(0x73bfa2e6cc7373d1), CONST64(0x12905a2482121248),
+CONST64(0x403a5d807a40401d), CONST64(0x0840281048080820), CONST64(0xc356e89b95c3c32b), CONST64(0xec337bc5dfecec97),
+CONST64(0xdb9690ab4ddbdb4b), CONST64(0xa1611f5fc0a1a1be), CONST64(0x8d1c8307918d8d0e), CONST64(0x3df5c97ac83d3df4),
+CONST64(0x97ccf1335b979766), CONST64(0x0000000000000000), CONST64(0xcf36d483f9cfcf1b), CONST64(0x2b4587566e2b2bac),
+CONST64(0x7697b3ece17676c5), CONST64(0x8264b019e6828232), CONST64(0xd6fea9b128d6d67f), CONST64(0x1bd87736c31b1b6c),
+CONST64(0xb5c15b7774b5b5ee), CONST64(0xaf112943beafaf86), CONST64(0x6a77dfd41d6a6ab5), CONST64(0x50ba0da0ea50505d),
+CONST64(0x45124c8a57454509), CONST64(0xf3cb18fb38f3f3eb), CONST64(0x309df060ad3030c0), CONST64(0xef2b74c3c4efef9b),
+CONST64(0x3fe5c37eda3f3ffc), CONST64(0x55921caac7555549), CONST64(0xa2791059dba2a2b2), CONST64(0xea0365c9e9eaea8f),
+CONST64(0x650fecca6a656589), CONST64(0xbab9686903babad2), CONST64(0x2f65935e4a2f2fbc), CONST64(0xc04ee79d8ec0c027),
+CONST64(0xdebe81a160dede5f), CONST64(0x1ce06c38fc1c1c70), CONST64(0xfdbb2ee746fdfdd3), CONST64(0x4d52649a1f4d4d29),
+CONST64(0x92e4e03976929272), CONST64(0x758fbceafa7575c9), CONST64(0x06301e0c36060618), CONST64(0x8a249809ae8a8a12),
+CONST64(0xb2f940794bb2b2f2), CONST64(0xe66359d185e6e6bf), CONST64(0x0e70361c7e0e0e38), CONST64(0x1ff8633ee71f1f7c),
+CONST64(0x6237f7c455626295), CONST64(0xd4eea3b53ad4d477), CONST64(0xa829324d81a8a89a), CONST64(0x96c4f43152969662),
+CONST64(0xf99b3aef62f9f9c3), CONST64(0xc566f697a3c5c533), CONST64(0x2535b14a10252594), CONST64(0x59f220b2ab595979),
+CONST64(0x8454ae15d084842a), CONST64(0x72b7a7e4c57272d5), CONST64(0x39d5dd72ec3939e4), CONST64(0x4c5a6198164c4c2d),
+CONST64(0x5eca3bbc945e5e65), CONST64(0x78e785f09f7878fd), CONST64(0x38ddd870e53838e0), CONST64(0x8c148605988c8c0a),
+CONST64(0xd1c6b2bf17d1d163), CONST64(0xa5410b57e4a5a5ae), CONST64(0xe2434dd9a1e2e2af), CONST64(0x612ff8c24e616199),
+CONST64(0xb3f1457b42b3b3f6), CONST64(0x2115a54234212184), CONST64(0x9c94d625089c9c4a), CONST64(0x1ef0663cee1e1e78),
+CONST64(0x4322528661434311), CONST64(0xc776fc93b1c7c73b), CONST64(0xfcb32be54ffcfcd7), CONST64(0x0420140824040410),
+CONST64(0x51b208a2e3515159), CONST64(0x99bcc72f2599995e), CONST64(0x6d4fc4da226d6da9), CONST64(0x0d68391a650d0d34),
+CONST64(0xfa8335e979fafacf), CONST64(0xdfb684a369dfdf5b), CONST64(0x7ed79bfca97e7ee5), CONST64(0x243db44819242490),
+CONST64(0x3bc5d776fe3b3bec), CONST64(0xab313d4b9aabab96), CONST64(0xce3ed181f0cece1f), CONST64(0x1188552299111144),
+CONST64(0x8f0c8903838f8f06), CONST64(0x4e4a6b9c044e4e25), CONST64(0xb7d1517366b7b7e6), CONST64(0xeb0b60cbe0ebeb8b),
+CONST64(0x3cfdcc78c13c3cf0), CONST64(0x817cbf1ffd81813e), CONST64(0x94d4fe354094946a), CONST64(0xf7eb0cf31cf7f7fb),
+CONST64(0xb9a1676f18b9b9de), CONST64(0x13985f268b13134c), CONST64(0x2c7d9c58512c2cb0), CONST64(0xd3d6b8bb05d3d36b),
+CONST64(0xe76b5cd38ce7e7bb), CONST64(0x6e57cbdc396e6ea5), CONST64(0xc46ef395aac4c437), CONST64(0x03180f061b03030c),
+CONST64(0x568a13acdc565645), CONST64(0x441a49885e44440d), CONST64(0x7fdf9efea07f7fe1), CONST64(0xa921374f88a9a99e),
+CONST64(0x2a4d8254672a2aa8), CONST64(0xbbb16d6b0abbbbd6), CONST64(0xc146e29f87c1c123), CONST64(0x53a202a6f1535351),
+CONST64(0xdcae8ba572dcdc57), CONST64(0x0b582716530b0b2c), CONST64(0x9d9cd327019d9d4e), CONST64(0x6c47c1d82b6c6cad),
+CONST64(0x3195f562a43131c4), CONST64(0x7487b9e8f37474cd), CONST64(0xf6e309f115f6f6ff), CONST64(0x460a438c4c464605),
+CONST64(0xac092645a5acac8a), CONST64(0x893c970fb589891e), CONST64(0x14a04428b4141450), CONST64(0xe15b42dfbae1e1a3),
+CONST64(0x16b04e2ca6161658), CONST64(0x3acdd274f73a3ae8), CONST64(0x696fd0d2066969b9), CONST64(0x09482d1241090924),
+CONST64(0x70a7ade0d77070dd), CONST64(0xb6d954716fb6b6e2), CONST64(0xd0ceb7bd1ed0d067), CONST64(0xed3b7ec7d6eded93),
+CONST64(0xcc2edb85e2cccc17), CONST64(0x422a578468424215), CONST64(0x98b4c22d2c98985a), CONST64(0xa4490e55eda4a4aa),
+CONST64(0x285d8850752828a0), CONST64(0x5cda31b8865c5c6d), CONST64(0xf8933fed6bf8f8c7), CONST64(0x8644a411c2868622)
+};
+
+static const ulong64 sbox6[] = {
+CONST64(0x6018c07830d81818), CONST64(0x8c2305af46262323), CONST64(0x3fc67ef991b8c6c6), CONST64(0x87e8136fcdfbe8e8),
+CONST64(0x26874ca113cb8787), CONST64(0xdab8a9626d11b8b8), CONST64(0x0401080502090101), CONST64(0x214f426e9e0d4f4f),
+CONST64(0xd836adee6c9b3636), CONST64(0xa2a6590451ffa6a6), CONST64(0x6fd2debdb90cd2d2), CONST64(0xf3f5fb06f70ef5f5),
+CONST64(0xf979ef80f2967979), CONST64(0xa16f5fcede306f6f), CONST64(0x7e91fcef3f6d9191), CONST64(0x5552aa07a4f85252),
+CONST64(0x9d6027fdc0476060), CONST64(0xcabc89766535bcbc), CONST64(0x569baccd2b379b9b), CONST64(0x028e048c018a8e8e),
+CONST64(0xb6a371155bd2a3a3), CONST64(0x300c603c186c0c0c), CONST64(0xf17bff8af6847b7b), CONST64(0xd435b5e16a803535),
+CONST64(0x741de8693af51d1d), CONST64(0xa7e05347ddb3e0e0), CONST64(0x7bd7f6acb321d7d7), CONST64(0x2fc25eed999cc2c2),
+CONST64(0xb82e6d965c432e2e), CONST64(0x314b627a96294b4b), CONST64(0xdffea321e15dfefe), CONST64(0x41578216aed55757),
+CONST64(0x5415a8412abd1515), CONST64(0xc1779fb6eee87777), CONST64(0xdc37a5eb6e923737), CONST64(0xb3e57b56d79ee5e5),
+CONST64(0x469f8cd923139f9f), CONST64(0xe7f0d317fd23f0f0), CONST64(0x354a6a7f94204a4a), CONST64(0x4fda9e95a944dada),
+CONST64(0x7d58fa25b0a25858), CONST64(0x03c906ca8fcfc9c9), CONST64(0xa429558d527c2929), CONST64(0x280a5022145a0a0a),
+CONST64(0xfeb1e14f7f50b1b1), CONST64(0xbaa0691a5dc9a0a0), CONST64(0xb16b7fdad6146b6b), CONST64(0x2e855cab17d98585),
+CONST64(0xcebd8173673cbdbd), CONST64(0x695dd234ba8f5d5d), CONST64(0x4010805020901010), CONST64(0xf7f4f303f507f4f4),
+CONST64(0x0bcb16c08bddcbcb), CONST64(0xf83eedc67cd33e3e), CONST64(0x140528110a2d0505), CONST64(0x81671fe6ce786767),
+CONST64(0xb7e47353d597e4e4), CONST64(0x9c2725bb4e022727), CONST64(0x1941325882734141), CONST64(0x168b2c9d0ba78b8b),
+CONST64(0xa6a7510153f6a7a7), CONST64(0xe97dcf94fab27d7d), CONST64(0x6e95dcfb37499595), CONST64(0x47d88e9fad56d8d8),
+CONST64(0xcbfb8b30eb70fbfb), CONST64(0x9fee2371c1cdeeee), CONST64(0xed7cc791f8bb7c7c), CONST64(0x856617e3cc716666),
+CONST64(0x53dda68ea77bdddd), CONST64(0x5c17b84b2eaf1717), CONST64(0x014702468e454747), CONST64(0x429e84dc211a9e9e),
+CONST64(0x0fca1ec589d4caca), CONST64(0xb42d75995a582d2d), CONST64(0xc6bf9179632ebfbf), CONST64(0x1c07381b0e3f0707),
+CONST64(0x8ead012347acadad), CONST64(0x755aea2fb4b05a5a), CONST64(0x36836cb51bef8383), CONST64(0xcc3385ff66b63333),
+CONST64(0x91633ff2c65c6363), CONST64(0x0802100a04120202), CONST64(0x92aa39384993aaaa), CONST64(0xd971afa8e2de7171),
+CONST64(0x07c80ecf8dc6c8c8), CONST64(0x6419c87d32d11919), CONST64(0x39497270923b4949), CONST64(0x43d9869aaf5fd9d9),
+CONST64(0xeff2c31df931f2f2), CONST64(0xabe34b48dba8e3e3), CONST64(0x715be22ab6b95b5b), CONST64(0x1a8834920dbc8888),
+CONST64(0x529aa4c8293e9a9a), CONST64(0x98262dbe4c0b2626), CONST64(0xc8328dfa64bf3232), CONST64(0xfab0e94a7d59b0b0),
+CONST64(0x83e91b6acff2e9e9), CONST64(0x3c0f78331e770f0f), CONST64(0x73d5e6a6b733d5d5), CONST64(0x3a8074ba1df48080),
+CONST64(0xc2be997c6127bebe), CONST64(0x13cd26de87ebcdcd), CONST64(0xd034bde468893434), CONST64(0x3d487a7590324848),
+CONST64(0xdbffab24e354ffff), CONST64(0xf57af78ff48d7a7a), CONST64(0x7a90f4ea3d649090), CONST64(0x615fc23ebe9d5f5f),
+CONST64(0x80201da0403d2020), CONST64(0xbd6867d5d00f6868), CONST64(0x681ad07234ca1a1a), CONST64(0x82ae192c41b7aeae),
+CONST64(0xeab4c95e757db4b4), CONST64(0x4d549a19a8ce5454), CONST64(0x7693ece53b7f9393), CONST64(0x88220daa442f2222),
+CONST64(0x8d6407e9c8636464), CONST64(0xe3f1db12ff2af1f1), CONST64(0xd173bfa2e6cc7373), CONST64(0x4812905a24821212),
+CONST64(0x1d403a5d807a4040), CONST64(0x2008402810480808), CONST64(0x2bc356e89b95c3c3), CONST64(0x97ec337bc5dfecec),
+CONST64(0x4bdb9690ab4ddbdb), CONST64(0xbea1611f5fc0a1a1), CONST64(0x0e8d1c8307918d8d), CONST64(0xf43df5c97ac83d3d),
+CONST64(0x6697ccf1335b9797), CONST64(0x0000000000000000), CONST64(0x1bcf36d483f9cfcf), CONST64(0xac2b4587566e2b2b),
+CONST64(0xc57697b3ece17676), CONST64(0x328264b019e68282), CONST64(0x7fd6fea9b128d6d6), CONST64(0x6c1bd87736c31b1b),
+CONST64(0xeeb5c15b7774b5b5), CONST64(0x86af112943beafaf), CONST64(0xb56a77dfd41d6a6a), CONST64(0x5d50ba0da0ea5050),
+CONST64(0x0945124c8a574545), CONST64(0xebf3cb18fb38f3f3), CONST64(0xc0309df060ad3030), CONST64(0x9bef2b74c3c4efef),
+CONST64(0xfc3fe5c37eda3f3f), CONST64(0x4955921caac75555), CONST64(0xb2a2791059dba2a2), CONST64(0x8fea0365c9e9eaea),
+CONST64(0x89650fecca6a6565), CONST64(0xd2bab9686903baba), CONST64(0xbc2f65935e4a2f2f), CONST64(0x27c04ee79d8ec0c0),
+CONST64(0x5fdebe81a160dede), CONST64(0x701ce06c38fc1c1c), CONST64(0xd3fdbb2ee746fdfd), CONST64(0x294d52649a1f4d4d),
+CONST64(0x7292e4e039769292), CONST64(0xc9758fbceafa7575), CONST64(0x1806301e0c360606), CONST64(0x128a249809ae8a8a),
+CONST64(0xf2b2f940794bb2b2), CONST64(0xbfe66359d185e6e6), CONST64(0x380e70361c7e0e0e), CONST64(0x7c1ff8633ee71f1f),
+CONST64(0x956237f7c4556262), CONST64(0x77d4eea3b53ad4d4), CONST64(0x9aa829324d81a8a8), CONST64(0x6296c4f431529696),
+CONST64(0xc3f99b3aef62f9f9), CONST64(0x33c566f697a3c5c5), CONST64(0x942535b14a102525), CONST64(0x7959f220b2ab5959),
+CONST64(0x2a8454ae15d08484), CONST64(0xd572b7a7e4c57272), CONST64(0xe439d5dd72ec3939), CONST64(0x2d4c5a6198164c4c),
+CONST64(0x655eca3bbc945e5e), CONST64(0xfd78e785f09f7878), CONST64(0xe038ddd870e53838), CONST64(0x0a8c148605988c8c),
+CONST64(0x63d1c6b2bf17d1d1), CONST64(0xaea5410b57e4a5a5), CONST64(0xafe2434dd9a1e2e2), CONST64(0x99612ff8c24e6161),
+CONST64(0xf6b3f1457b42b3b3), CONST64(0x842115a542342121), CONST64(0x4a9c94d625089c9c), CONST64(0x781ef0663cee1e1e),
+CONST64(0x1143225286614343), CONST64(0x3bc776fc93b1c7c7), CONST64(0xd7fcb32be54ffcfc), CONST64(0x1004201408240404),
+CONST64(0x5951b208a2e35151), CONST64(0x5e99bcc72f259999), CONST64(0xa96d4fc4da226d6d), CONST64(0x340d68391a650d0d),
+CONST64(0xcffa8335e979fafa), CONST64(0x5bdfb684a369dfdf), CONST64(0xe57ed79bfca97e7e), CONST64(0x90243db448192424),
+CONST64(0xec3bc5d776fe3b3b), CONST64(0x96ab313d4b9aabab), CONST64(0x1fce3ed181f0cece), CONST64(0x4411885522991111),
+CONST64(0x068f0c8903838f8f), CONST64(0x254e4a6b9c044e4e), CONST64(0xe6b7d1517366b7b7), CONST64(0x8beb0b60cbe0ebeb),
+CONST64(0xf03cfdcc78c13c3c), CONST64(0x3e817cbf1ffd8181), CONST64(0x6a94d4fe35409494), CONST64(0xfbf7eb0cf31cf7f7),
+CONST64(0xdeb9a1676f18b9b9), CONST64(0x4c13985f268b1313), CONST64(0xb02c7d9c58512c2c), CONST64(0x6bd3d6b8bb05d3d3),
+CONST64(0xbbe76b5cd38ce7e7), CONST64(0xa56e57cbdc396e6e), CONST64(0x37c46ef395aac4c4), CONST64(0x0c03180f061b0303),
+CONST64(0x45568a13acdc5656), CONST64(0x0d441a49885e4444), CONST64(0xe17fdf9efea07f7f), CONST64(0x9ea921374f88a9a9),
+CONST64(0xa82a4d8254672a2a), CONST64(0xd6bbb16d6b0abbbb), CONST64(0x23c146e29f87c1c1), CONST64(0x5153a202a6f15353),
+CONST64(0x57dcae8ba572dcdc), CONST64(0x2c0b582716530b0b), CONST64(0x4e9d9cd327019d9d), CONST64(0xad6c47c1d82b6c6c),
+CONST64(0xc43195f562a43131), CONST64(0xcd7487b9e8f37474), CONST64(0xfff6e309f115f6f6), CONST64(0x05460a438c4c4646),
+CONST64(0x8aac092645a5acac), CONST64(0x1e893c970fb58989), CONST64(0x5014a04428b41414), CONST64(0xa3e15b42dfbae1e1),
+CONST64(0x5816b04e2ca61616), CONST64(0xe83acdd274f73a3a), CONST64(0xb9696fd0d2066969), CONST64(0x2409482d12410909),
+CONST64(0xdd70a7ade0d77070), CONST64(0xe2b6d954716fb6b6), CONST64(0x67d0ceb7bd1ed0d0), CONST64(0x93ed3b7ec7d6eded),
+CONST64(0x17cc2edb85e2cccc), CONST64(0x15422a5784684242), CONST64(0x5a98b4c22d2c9898), CONST64(0xaaa4490e55eda4a4),
+CONST64(0xa0285d8850752828), CONST64(0x6d5cda31b8865c5c), CONST64(0xc7f8933fed6bf8f8), CONST64(0x228644a411c28686)
+};
+
+static const ulong64 sbox7[] = {
+CONST64(0x186018c07830d818), CONST64(0x238c2305af462623), CONST64(0xc63fc67ef991b8c6), CONST64(0xe887e8136fcdfbe8),
+CONST64(0x8726874ca113cb87), CONST64(0xb8dab8a9626d11b8), CONST64(0x0104010805020901), CONST64(0x4f214f426e9e0d4f),
+CONST64(0x36d836adee6c9b36), CONST64(0xa6a2a6590451ffa6), CONST64(0xd26fd2debdb90cd2), CONST64(0xf5f3f5fb06f70ef5),
+CONST64(0x79f979ef80f29679), CONST64(0x6fa16f5fcede306f), CONST64(0x917e91fcef3f6d91), CONST64(0x525552aa07a4f852),
+CONST64(0x609d6027fdc04760), CONST64(0xbccabc89766535bc), CONST64(0x9b569baccd2b379b), CONST64(0x8e028e048c018a8e),
+CONST64(0xa3b6a371155bd2a3), CONST64(0x0c300c603c186c0c), CONST64(0x7bf17bff8af6847b), CONST64(0x35d435b5e16a8035),
+CONST64(0x1d741de8693af51d), CONST64(0xe0a7e05347ddb3e0), CONST64(0xd77bd7f6acb321d7), CONST64(0xc22fc25eed999cc2),
+CONST64(0x2eb82e6d965c432e), CONST64(0x4b314b627a96294b), CONST64(0xfedffea321e15dfe), CONST64(0x5741578216aed557),
+CONST64(0x155415a8412abd15), CONST64(0x77c1779fb6eee877), CONST64(0x37dc37a5eb6e9237), CONST64(0xe5b3e57b56d79ee5),
+CONST64(0x9f469f8cd923139f), CONST64(0xf0e7f0d317fd23f0), CONST64(0x4a354a6a7f94204a), CONST64(0xda4fda9e95a944da),
+CONST64(0x587d58fa25b0a258), CONST64(0xc903c906ca8fcfc9), CONST64(0x29a429558d527c29), CONST64(0x0a280a5022145a0a),
+CONST64(0xb1feb1e14f7f50b1), CONST64(0xa0baa0691a5dc9a0), CONST64(0x6bb16b7fdad6146b), CONST64(0x852e855cab17d985),
+CONST64(0xbdcebd8173673cbd), CONST64(0x5d695dd234ba8f5d), CONST64(0x1040108050209010), CONST64(0xf4f7f4f303f507f4),
+CONST64(0xcb0bcb16c08bddcb), CONST64(0x3ef83eedc67cd33e), CONST64(0x05140528110a2d05), CONST64(0x6781671fe6ce7867),
+CONST64(0xe4b7e47353d597e4), CONST64(0x279c2725bb4e0227), CONST64(0x4119413258827341), CONST64(0x8b168b2c9d0ba78b),
+CONST64(0xa7a6a7510153f6a7), CONST64(0x7de97dcf94fab27d), CONST64(0x956e95dcfb374995), CONST64(0xd847d88e9fad56d8),
+CONST64(0xfbcbfb8b30eb70fb), CONST64(0xee9fee2371c1cdee), CONST64(0x7ced7cc791f8bb7c), CONST64(0x66856617e3cc7166),
+CONST64(0xdd53dda68ea77bdd), CONST64(0x175c17b84b2eaf17), CONST64(0x47014702468e4547), CONST64(0x9e429e84dc211a9e),
+CONST64(0xca0fca1ec589d4ca), CONST64(0x2db42d75995a582d), CONST64(0xbfc6bf9179632ebf), CONST64(0x071c07381b0e3f07),
+CONST64(0xad8ead012347acad), CONST64(0x5a755aea2fb4b05a), CONST64(0x8336836cb51bef83), CONST64(0x33cc3385ff66b633),
+CONST64(0x6391633ff2c65c63), CONST64(0x020802100a041202), CONST64(0xaa92aa39384993aa), CONST64(0x71d971afa8e2de71),
+CONST64(0xc807c80ecf8dc6c8), CONST64(0x196419c87d32d119), CONST64(0x4939497270923b49), CONST64(0xd943d9869aaf5fd9),
+CONST64(0xf2eff2c31df931f2), CONST64(0xe3abe34b48dba8e3), CONST64(0x5b715be22ab6b95b), CONST64(0x881a8834920dbc88),
+CONST64(0x9a529aa4c8293e9a), CONST64(0x2698262dbe4c0b26), CONST64(0x32c8328dfa64bf32), CONST64(0xb0fab0e94a7d59b0),
+CONST64(0xe983e91b6acff2e9), CONST64(0x0f3c0f78331e770f), CONST64(0xd573d5e6a6b733d5), CONST64(0x803a8074ba1df480),
+CONST64(0xbec2be997c6127be), CONST64(0xcd13cd26de87ebcd), CONST64(0x34d034bde4688934), CONST64(0x483d487a75903248),
+CONST64(0xffdbffab24e354ff), CONST64(0x7af57af78ff48d7a), CONST64(0x907a90f4ea3d6490), CONST64(0x5f615fc23ebe9d5f),
+CONST64(0x2080201da0403d20), CONST64(0x68bd6867d5d00f68), CONST64(0x1a681ad07234ca1a), CONST64(0xae82ae192c41b7ae),
+CONST64(0xb4eab4c95e757db4), CONST64(0x544d549a19a8ce54), CONST64(0x937693ece53b7f93), CONST64(0x2288220daa442f22),
+CONST64(0x648d6407e9c86364), CONST64(0xf1e3f1db12ff2af1), CONST64(0x73d173bfa2e6cc73), CONST64(0x124812905a248212),
+CONST64(0x401d403a5d807a40), CONST64(0x0820084028104808), CONST64(0xc32bc356e89b95c3), CONST64(0xec97ec337bc5dfec),
+CONST64(0xdb4bdb9690ab4ddb), CONST64(0xa1bea1611f5fc0a1), CONST64(0x8d0e8d1c8307918d), CONST64(0x3df43df5c97ac83d),
+CONST64(0x976697ccf1335b97), CONST64(0x0000000000000000), CONST64(0xcf1bcf36d483f9cf), CONST64(0x2bac2b4587566e2b),
+CONST64(0x76c57697b3ece176), CONST64(0x82328264b019e682), CONST64(0xd67fd6fea9b128d6), CONST64(0x1b6c1bd87736c31b),
+CONST64(0xb5eeb5c15b7774b5), CONST64(0xaf86af112943beaf), CONST64(0x6ab56a77dfd41d6a), CONST64(0x505d50ba0da0ea50),
+CONST64(0x450945124c8a5745), CONST64(0xf3ebf3cb18fb38f3), CONST64(0x30c0309df060ad30), CONST64(0xef9bef2b74c3c4ef),
+CONST64(0x3ffc3fe5c37eda3f), CONST64(0x554955921caac755), CONST64(0xa2b2a2791059dba2), CONST64(0xea8fea0365c9e9ea),
+CONST64(0x6589650fecca6a65), CONST64(0xbad2bab9686903ba), CONST64(0x2fbc2f65935e4a2f), CONST64(0xc027c04ee79d8ec0),
+CONST64(0xde5fdebe81a160de), CONST64(0x1c701ce06c38fc1c), CONST64(0xfdd3fdbb2ee746fd), CONST64(0x4d294d52649a1f4d),
+CONST64(0x927292e4e0397692), CONST64(0x75c9758fbceafa75), CONST64(0x061806301e0c3606), CONST64(0x8a128a249809ae8a),
+CONST64(0xb2f2b2f940794bb2), CONST64(0xe6bfe66359d185e6), CONST64(0x0e380e70361c7e0e), CONST64(0x1f7c1ff8633ee71f),
+CONST64(0x62956237f7c45562), CONST64(0xd477d4eea3b53ad4), CONST64(0xa89aa829324d81a8), CONST64(0x966296c4f4315296),
+CONST64(0xf9c3f99b3aef62f9), CONST64(0xc533c566f697a3c5), CONST64(0x25942535b14a1025), CONST64(0x597959f220b2ab59),
+CONST64(0x842a8454ae15d084), CONST64(0x72d572b7a7e4c572), CONST64(0x39e439d5dd72ec39), CONST64(0x4c2d4c5a6198164c),
+CONST64(0x5e655eca3bbc945e), CONST64(0x78fd78e785f09f78), CONST64(0x38e038ddd870e538), CONST64(0x8c0a8c148605988c),
+CONST64(0xd163d1c6b2bf17d1), CONST64(0xa5aea5410b57e4a5), CONST64(0xe2afe2434dd9a1e2), CONST64(0x6199612ff8c24e61),
+CONST64(0xb3f6b3f1457b42b3), CONST64(0x21842115a5423421), CONST64(0x9c4a9c94d625089c), CONST64(0x1e781ef0663cee1e),
+CONST64(0x4311432252866143), CONST64(0xc73bc776fc93b1c7), CONST64(0xfcd7fcb32be54ffc), CONST64(0x0410042014082404),
+CONST64(0x515951b208a2e351), CONST64(0x995e99bcc72f2599), CONST64(0x6da96d4fc4da226d), CONST64(0x0d340d68391a650d),
+CONST64(0xfacffa8335e979fa), CONST64(0xdf5bdfb684a369df), CONST64(0x7ee57ed79bfca97e), CONST64(0x2490243db4481924),
+CONST64(0x3bec3bc5d776fe3b), CONST64(0xab96ab313d4b9aab), CONST64(0xce1fce3ed181f0ce), CONST64(0x1144118855229911),
+CONST64(0x8f068f0c8903838f), CONST64(0x4e254e4a6b9c044e), CONST64(0xb7e6b7d1517366b7), CONST64(0xeb8beb0b60cbe0eb),
+CONST64(0x3cf03cfdcc78c13c), CONST64(0x813e817cbf1ffd81), CONST64(0x946a94d4fe354094), CONST64(0xf7fbf7eb0cf31cf7),
+CONST64(0xb9deb9a1676f18b9), CONST64(0x134c13985f268b13), CONST64(0x2cb02c7d9c58512c), CONST64(0xd36bd3d6b8bb05d3),
+CONST64(0xe7bbe76b5cd38ce7), CONST64(0x6ea56e57cbdc396e), CONST64(0xc437c46ef395aac4), CONST64(0x030c03180f061b03),
+CONST64(0x5645568a13acdc56), CONST64(0x440d441a49885e44), CONST64(0x7fe17fdf9efea07f), CONST64(0xa99ea921374f88a9),
+CONST64(0x2aa82a4d8254672a), CONST64(0xbbd6bbb16d6b0abb), CONST64(0xc123c146e29f87c1), CONST64(0x535153a202a6f153),
+CONST64(0xdc57dcae8ba572dc), CONST64(0x0b2c0b582716530b), CONST64(0x9d4e9d9cd327019d), CONST64(0x6cad6c47c1d82b6c),
+CONST64(0x31c43195f562a431), CONST64(0x74cd7487b9e8f374), CONST64(0xf6fff6e309f115f6), CONST64(0x4605460a438c4c46),
+CONST64(0xac8aac092645a5ac), CONST64(0x891e893c970fb589), CONST64(0x145014a04428b414), CONST64(0xe1a3e15b42dfbae1),
+CONST64(0x165816b04e2ca616), CONST64(0x3ae83acdd274f73a), CONST64(0x69b9696fd0d20669), CONST64(0x092409482d124109),
+CONST64(0x70dd70a7ade0d770), CONST64(0xb6e2b6d954716fb6), CONST64(0xd067d0ceb7bd1ed0), CONST64(0xed93ed3b7ec7d6ed),
+CONST64(0xcc17cc2edb85e2cc), CONST64(0x4215422a57846842), CONST64(0x985a98b4c22d2c98), CONST64(0xa4aaa4490e55eda4),
+CONST64(0x28a0285d88507528), CONST64(0x5c6d5cda31b8865c), CONST64(0xf8c7f8933fed6bf8), CONST64(0x86228644a411c286)
+};
+
+#endif
+
+static const ulong64 cont[] = {
+CONST64(0x1823c6e887b8014f),
+CONST64(0x36a6d2f5796f9152),
+CONST64(0x60bc9b8ea30c7b35),
+CONST64(0x1de0d7c22e4bfe57),
+CONST64(0x157737e59ff04ada),
+CONST64(0x58c9290ab1a06b85),
+CONST64(0xbd5d10f4cb3e0567),
+CONST64(0xe427418ba77d95d8),
+CONST64(0xfbee7c66dd17479e),
+CONST64(0xca2dbf07ad5a8333),
+CONST64(0x6302aa71c81949d9),
+};
+
+#endif /* __LTC_WHIRLTAB_C__ */
+
+/* ref:         HEAD -> develop */
+/* git commit:  a1f6312416ef6cd183ee62db58b640dc2d7ec1f4 */
+/* commit time: 2019-09-04 13:44:47 +0200 */

+ 105 - 0
libtomcrypt.mod/libtomcrypt/src/headers/tomcrypt.h

@@ -0,0 +1,105 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ */
+
+#ifndef TOMCRYPT_H_
+#define TOMCRYPT_H_
+#include <assert.h>
+#include <stdio.h>
+#include <string.h>
+#include <stdlib.h>
+#include <stddef.h>
+#include <time.h>
+#include <ctype.h>
+#include <limits.h>
+
+/* use configuration data */
+#include <tomcrypt_custom.h>
+
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+/* version */
+#define CRYPT   0x0118
+#define SCRYPT  "1.18.2-develop"
+
+/* max size of either a cipher/hash block or symmetric key [largest of the two] */
+#define MAXBLOCKSIZE  144
+
+#ifndef TAB_SIZE
+/* descriptor table size */
+#define TAB_SIZE      34
+#endif
+
+/* error codes [will be expanded in future releases] */
+enum {
+   CRYPT_OK=0,             /* Result OK */
+   CRYPT_ERROR,            /* Generic Error */
+   CRYPT_NOP,              /* Not a failure but no operation was performed */
+
+   CRYPT_INVALID_KEYSIZE,  /* Invalid key size given */
+   CRYPT_INVALID_ROUNDS,   /* Invalid number of rounds */
+   CRYPT_FAIL_TESTVECTOR,  /* Algorithm failed test vectors */
+
+   CRYPT_BUFFER_OVERFLOW,  /* Not enough space for output */
+   CRYPT_INVALID_PACKET,   /* Invalid input packet given */
+
+   CRYPT_INVALID_PRNGSIZE, /* Invalid number of bits for a PRNG */
+   CRYPT_ERROR_READPRNG,   /* Could not read enough from PRNG */
+
+   CRYPT_INVALID_CIPHER,   /* Invalid cipher specified */
+   CRYPT_INVALID_HASH,     /* Invalid hash specified */
+   CRYPT_INVALID_PRNG,     /* Invalid PRNG specified */
+
+   CRYPT_MEM,              /* Out of memory */
+
+   CRYPT_PK_TYPE_MISMATCH, /* Not equivalent types of PK keys */
+   CRYPT_PK_NOT_PRIVATE,   /* Requires a private PK key */
+
+   CRYPT_INVALID_ARG,      /* Generic invalid argument */
+   CRYPT_FILE_NOTFOUND,    /* File Not Found */
+
+   CRYPT_PK_INVALID_TYPE,  /* Invalid type of PK key */
+
+   CRYPT_OVERFLOW,         /* An overflow of a value was detected/prevented */
+
+   CRYPT_PK_ASN1_ERROR,    /* An error occurred while en- or decoding ASN.1 data */
+
+   CRYPT_INPUT_TOO_LONG,   /* The input was longer than expected. */
+
+   CRYPT_PK_INVALID_SIZE,  /* Invalid size input for PK parameters */
+
+   CRYPT_INVALID_PRIME_SIZE,/* Invalid size of prime requested */
+   CRYPT_PK_INVALID_PADDING, /* Invalid padding on input */
+
+   CRYPT_HASH_OVERFLOW      /* Hash applied to too many bits */
+};
+
+#include <tomcrypt_cfg.h>
+#include <tomcrypt_macros.h>
+#include <tomcrypt_cipher.h>
+#include <tomcrypt_hash.h>
+#include <tomcrypt_mac.h>
+#include <tomcrypt_prng.h>
+#include <tomcrypt_pk.h>
+#include <tomcrypt_math.h>
+#include <tomcrypt_misc.h>
+#include <tomcrypt_argchk.h>
+#include <tomcrypt_pkcs.h>
+
+#ifdef __cplusplus
+   }
+#endif
+
+#endif /* TOMCRYPT_H_ */
+
+
+/* ref:         HEAD -> develop */
+/* git commit:  a1f6312416ef6cd183ee62db58b640dc2d7ec1f4 */
+/* commit time: 2019-09-04 13:44:47 +0200 */

+ 48 - 0
libtomcrypt.mod/libtomcrypt/src/headers/tomcrypt_argchk.h

@@ -0,0 +1,48 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ */
+
+/* Defines the LTC_ARGCHK macro used within the library */
+/* ARGTYPE is defined in tomcrypt_cfg.h */
+
+/* ARGTYPE is per default defined to 0  */
+#if ARGTYPE == 0
+
+#include <signal.h>
+
+LTC_NORETURN void crypt_argchk(const char *v, const char *s, int d);
+#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0)
+#define LTC_ARGCHKVD(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0)
+
+#elif ARGTYPE == 1
+
+/* fatal type of error */
+#define LTC_ARGCHK(x) assert((x))
+#define LTC_ARGCHKVD(x) LTC_ARGCHK(x)
+
+#elif ARGTYPE == 2
+
+#define LTC_ARGCHK(x) if (!(x)) { fprintf(stderr, "\nwarning: ARGCHK failed at %s:%d\n", __FILE__, __LINE__); }
+#define LTC_ARGCHKVD(x) LTC_ARGCHK(x)
+
+#elif ARGTYPE == 3
+
+#define LTC_ARGCHK(x) LTC_UNUSED_PARAM(x)
+#define LTC_ARGCHKVD(x) LTC_ARGCHK(x)
+
+#elif ARGTYPE == 4
+
+#define LTC_ARGCHK(x)   if (!(x)) return CRYPT_INVALID_ARG;
+#define LTC_ARGCHKVD(x) if (!(x)) return;
+
+#endif
+
+
+/* ref:         HEAD -> develop */
+/* git commit:  a1f6312416ef6cd183ee62db58b640dc2d7ec1f4 */
+/* commit time: 2019-09-04 13:44:47 +0200 */

+ 303 - 0
libtomcrypt.mod/libtomcrypt/src/headers/tomcrypt_cfg.h

@@ -0,0 +1,303 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ */
+
+/* This is the build config file.
+ *
+ * With this you can setup what to inlcude/exclude automatically during any build.  Just comment
+ * out the line that #define's the word for the thing you want to remove.  phew!
+ */
+
+#ifndef TOMCRYPT_CFG_H
+#define TOMCRYPT_CFG_H
+
+#if defined(_WIN32) || defined(_MSC_VER)
+   #define LTC_CALL __cdecl
+#elif !defined(LTC_CALL)
+   #define LTC_CALL
+#endif
+
+#ifndef LTC_EXPORT
+   #define LTC_EXPORT
+#endif
+
+/* certain platforms use macros for these, making the prototypes broken */
+#ifndef LTC_NO_PROTOTYPES
+
+/* you can change how memory allocation works ... */
+LTC_EXPORT void * LTC_CALL XMALLOC(size_t n);
+LTC_EXPORT void * LTC_CALL XREALLOC(void *p, size_t n);
+LTC_EXPORT void * LTC_CALL XCALLOC(size_t n, size_t s);
+LTC_EXPORT void LTC_CALL XFREE(void *p);
+
+LTC_EXPORT void LTC_CALL XQSORT(void *base, size_t nmemb, size_t size, int(*compar)(const void *, const void *));
+
+
+/* change the clock function too */
+LTC_EXPORT clock_t LTC_CALL XCLOCK(void);
+
+/* various other functions */
+LTC_EXPORT void * LTC_CALL XMEMCPY(void *dest, const void *src, size_t n);
+LTC_EXPORT int   LTC_CALL XMEMCMP(const void *s1, const void *s2, size_t n);
+LTC_EXPORT void * LTC_CALL XMEMSET(void *s, int c, size_t n);
+
+LTC_EXPORT int   LTC_CALL XSTRCMP(const char *s1, const char *s2);
+
+#endif
+
+/* some compilers do not like "inline" (or maybe "static inline"), namely: HP cc, IBM xlc */
+#if defined(__GNUC__) || defined(__xlc__)
+   #define LTC_INLINE __inline__
+#elif defined(_MSC_VER) || defined(__HP_cc)
+   #define LTC_INLINE __inline
+#elif defined(__STDC_VERSION__) && __STDC_VERSION__ >= 199901L
+   #define LTC_INLINE inline
+#else
+   #define LTC_INLINE
+#endif
+
+#if defined(__clang__) || defined(__GNUC_MINOR__)
+#define LTC_NORETURN __attribute__ ((noreturn))
+#elif defined(_MSC_VER)
+#define LTC_NORETURN __declspec(noreturn)
+#else
+#define LTC_NORETURN
+#endif
+
+/* type of argument checking, 0=default, 1=fatal and 2=error+continue, 3=nothing */
+#ifndef ARGTYPE
+   #define ARGTYPE  0
+#endif
+
+#undef LTC_ENCRYPT
+#define LTC_ENCRYPT 0
+#undef LTC_DECRYPT
+#define LTC_DECRYPT 1
+
+/* Controls endianess and size of registers.  Leave uncommented to get platform neutral [slower] code
+ *
+ * Note: in order to use the optimized macros your platform must support unaligned 32 and 64 bit read/writes.
+ * The x86 platforms allow this but some others [ARM for instance] do not.  On those platforms you **MUST**
+ * use the portable [slower] macros.
+ */
+/* detect x86/i386 32bit */
+#if defined(__i386__) || defined(__i386) || defined(_M_IX86)
+   #define ENDIAN_LITTLE
+   #define ENDIAN_32BITWORD
+   #define LTC_FAST
+#endif
+
+/* detect amd64/x64 */
+#if defined(__x86_64__) || defined(_M_X64) || defined(_M_AMD64)
+   #define ENDIAN_LITTLE
+   #define ENDIAN_64BITWORD
+   #define LTC_FAST
+#endif
+
+/* detect PPC32 */
+#if defined(LTC_PPC32)
+   #define ENDIAN_BIG
+   #define ENDIAN_32BITWORD
+   #define LTC_FAST
+#endif
+
+/* detects MIPS R5900 processors (PS2) */
+#if (defined(__R5900) || defined(R5900) || defined(__R5900__)) && (defined(_mips) || defined(__mips__) || defined(mips))
+   #define ENDIAN_64BITWORD
+   #if defined(_MIPSEB) || defined(__MIPSEB) || defined(__MIPSEB__)
+     #define ENDIAN_BIG
+   #endif
+     #define ENDIAN_LITTLE
+   #endif
+#endif
+
+/* detect AIX */
+#if defined(_AIX) && defined(_BIG_ENDIAN)
+  #define ENDIAN_BIG
+  #if defined(__LP64__) || defined(_ARCH_PPC64)
+    #define ENDIAN_64BITWORD
+  #else
+    #define ENDIAN_32BITWORD
+  #endif
+#endif
+
+/* detect HP-UX */
+#if defined(__hpux) || defined(__hpux__)
+  #define ENDIAN_BIG
+  #if defined(__ia64) || defined(__ia64__) || defined(__LP64__)
+    #define ENDIAN_64BITWORD
+  #else
+    #define ENDIAN_32BITWORD
+  #endif
+#endif
+
+/* detect Apple OS X */
+#if defined(__APPLE__) && defined(__MACH__)
+  #if defined(__LITTLE_ENDIAN__) || defined(__x86_64__)
+    #define ENDIAN_LITTLE
+  #else
+    #define ENDIAN_BIG
+  #endif
+  #if defined(__LP64__) || defined(__x86_64__)
+    #define ENDIAN_64BITWORD
+  #else
+    #define ENDIAN_32BITWORD
+  #endif
+#endif
+
+/* detect SPARC and SPARC64 */
+#if defined(__sparc__) || defined(__sparc)
+  #define ENDIAN_BIG
+  #if defined(__arch64__) || defined(__sparcv9) || defined(__sparc_v9__)
+    #define ENDIAN_64BITWORD
+  #else
+    #define ENDIAN_32BITWORD
+  #endif
+#endif
+
+/* detect IBM S390(x) */
+#if defined(__s390x__) || defined(__s390__)
+  #define ENDIAN_BIG
+  #if defined(__s390x__)
+    #define ENDIAN_64BITWORD
+  #else
+    #define ENDIAN_32BITWORD
+  #endif
+#endif
+
+/* detect PPC64 */
+#if defined(__powerpc64__) || defined(__ppc64__) || defined(__PPC64__)
+   #define ENDIAN_64BITWORD
+   #if __BYTE_ORDER__ == __ORDER_BIG_ENDIAN__
+      #define ENDIAN_BIG
+   #elif  __BYTE_ORDER__ == __ORDER_LITTLE_ENDIAN__
+      #define ENDIAN_LITTLE
+   #endif
+   #define LTC_FAST
+#endif
+
+/* endianness fallback */
+#if !defined(ENDIAN_BIG) && !defined(ENDIAN_LITTLE)
+  #if defined(_BYTE_ORDER) && _BYTE_ORDER == _BIG_ENDIAN || \
+      defined(__BYTE_ORDER) && __BYTE_ORDER == __BIG_ENDIAN || \
+      defined(__BYTE_ORDER__) && __BYTE_ORDER__ == __ORDER_BIG_ENDIAN__ || \
+      defined(__BIG_ENDIAN__) || \
+      defined(__ARMEB__) || defined(__THUMBEB__) || defined(__AARCH64EB__) || \
+      defined(_MIPSEB) || defined(__MIPSEB) || defined(__MIPSEB__)
+    #define ENDIAN_BIG
+  #elif defined(_BYTE_ORDER) && _BYTE_ORDER == _LITTLE_ENDIAN || \
+      defined(__BYTE_ORDER) && __BYTE_ORDER == __LITTLE_ENDIAN || \
+      defined(__BYTE_ORDER__) && __BYTE_ORDER__ == __ORDER_LITTLE_ENDIAN__ || \
+      defined(__LITTLE_ENDIAN__) || \
+      defined(__ARMEL__) || defined(__THUMBEL__) || defined(__AARCH64EL__) || \
+      defined(_MIPSEL) || defined(__MIPSEL) || defined(__MIPSEL__)
+    #define ENDIAN_LITTLE
+  #else
+    #error Cannot detect endianness
+  #endif
+#endif
+
+/* ulong64: 64-bit data type */
+#ifdef _MSC_VER
+   #define CONST64(n) n ## ui64
+   typedef unsigned __int64 ulong64;
+   typedef __int64 long64;
+#else
+   #define CONST64(n) n ## ULL
+   typedef unsigned long long ulong64;
+   typedef long long long64;
+#endif
+
+/* ulong32: "32-bit at least" data type */
+#if defined(__x86_64__) || defined(_M_X64) || defined(_M_AMD64) || \
+    defined(__powerpc64__) || defined(__ppc64__) || defined(__PPC64__) || \
+    defined(__s390x__) || defined(__arch64__) || defined(__aarch64__) || \
+    defined(__sparcv9) || defined(__sparc_v9__) || defined(__sparc64__) || \
+    defined(__ia64) || defined(__ia64__) || defined(__itanium__) || defined(_M_IA64) || \
+    defined(__LP64__) || defined(_LP64) || defined(__64BIT__)
+   typedef unsigned ulong32;
+   #if !defined(ENDIAN_64BITWORD) && !defined(ENDIAN_32BITWORD)
+     #define ENDIAN_64BITWORD
+   #endif
+#else
+   typedef unsigned long ulong32;
+   #if !defined(ENDIAN_64BITWORD) && !defined(ENDIAN_32BITWORD)
+     #define ENDIAN_32BITWORD
+   #endif
+#endif
+
+#if defined(ENDIAN_64BITWORD) && !defined(_MSC_VER)
+typedef unsigned long long ltc_mp_digit;
+#else
+typedef unsigned long ltc_mp_digit;
+#endif
+
+/* No asm is a quick way to disable anything "not portable" */
+#ifdef LTC_NO_ASM
+   #define ENDIAN_NEUTRAL
+   #undef ENDIAN_32BITWORD
+   #undef ENDIAN_64BITWORD
+   #undef LTC_FAST
+   #define LTC_NO_ROLC
+   #define LTC_NO_BSWAP
+#endif
+
+/* No LTC_FAST if: explicitly disabled OR non-gcc/non-clang compiler OR old gcc OR using -ansi -std=c99 */
+#if defined(LTC_NO_FAST) || (__GNUC__ < 4) || defined(__STRICT_ANSI__)
+   #undef LTC_FAST
+#endif
+
+#ifdef LTC_FAST
+   #define LTC_FAST_TYPE_PTR_CAST(x) ((LTC_FAST_TYPE*)(void*)(x))
+   #ifdef ENDIAN_64BITWORD
+   typedef ulong64 __attribute__((__may_alias__)) LTC_FAST_TYPE;
+   #else
+   typedef ulong32 __attribute__((__may_alias__)) LTC_FAST_TYPE;
+   #endif
+#endif
+
+#if !defined(ENDIAN_NEUTRAL) && (defined(ENDIAN_BIG) || defined(ENDIAN_LITTLE)) && !(defined(ENDIAN_32BITWORD) || defined(ENDIAN_64BITWORD))
+   #error You must specify a word size as well as endianess in tomcrypt_cfg.h
+#endif
+
+#if !(defined(ENDIAN_BIG) || defined(ENDIAN_LITTLE))
+   #define ENDIAN_NEUTRAL
+#endif
+
+#if (defined(ENDIAN_32BITWORD) && defined(ENDIAN_64BITWORD))
+   #error Cannot be 32 and 64 bit words...
+#endif
+
+/* gcc 4.3 and up has a bswap builtin; detect it by gcc version.
+ * clang also supports the bswap builtin, and although clang pretends
+ * to be gcc (macro-wise, anyway), clang pretends to be a version
+ * prior to gcc 4.3, so we can't detect bswap that way.  Instead,
+ * clang has a __has_builtin mechanism that can be used to check
+ * for builtins:
+ * http://clang.llvm.org/docs/LanguageExtensions.html#feature_check */
+#ifndef __has_builtin
+   #define __has_builtin(x) 0
+#endif
+#if !defined(LTC_NO_BSWAP) && defined(__GNUC__) &&                      \
+   ((__GNUC__ * 100 + __GNUC_MINOR__ >= 403) ||                         \
+    (__has_builtin(__builtin_bswap32) && __has_builtin(__builtin_bswap64)))
+   #define LTC_HAVE_BSWAP_BUILTIN
+#endif
+
+#if defined(__GNUC__) && (__GNUC__ * 100 + __GNUC_MINOR__ >= 301)
+   #define LTC_DEPRECATED __attribute__((deprecated))
+#elif defined(_MSC_VER) && _MSC_VER >= 1500
+   /* supported since Visual Studio 2008 */
+   #define LTC_DEPRECATED __declspec(deprecated)
+#else
+   #define LTC_DEPRECATED
+#endif
+
+/* ref:         HEAD -> develop */
+/* git commit:  a1f6312416ef6cd183ee62db58b640dc2d7ec1f4 */
+/* commit time: 2019-09-04 13:44:47 +0200 */

+ 1151 - 0
libtomcrypt.mod/libtomcrypt/src/headers/tomcrypt_cipher.h

@@ -0,0 +1,1151 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ */
+
+/* ---- SYMMETRIC KEY STUFF -----
+ *
+ * We put each of the ciphers scheduled keys in their own structs then we put all of
+ * the key formats in one union.  This makes the function prototypes easier to use.
+ */
+#ifdef LTC_BLOWFISH
+struct blowfish_key {
+   ulong32 S[4][256];
+   ulong32 K[18];
+};
+#endif
+
+#ifdef LTC_RC5
+struct rc5_key {
+   int rounds;
+   ulong32 K[50];
+};
+#endif
+
+#ifdef LTC_RC6
+struct rc6_key {
+   ulong32 K[44];
+};
+#endif
+
+#ifdef LTC_SAFERP
+struct saferp_key {
+   unsigned char K[33][16];
+   long rounds;
+};
+#endif
+
+#ifdef LTC_RIJNDAEL
+struct rijndael_key {
+   ulong32 eK[60], dK[60];
+   int Nr;
+};
+#endif
+
+#ifdef LTC_KSEED
+struct kseed_key {
+    ulong32 K[32], dK[32];
+};
+#endif
+
+#ifdef LTC_KASUMI
+struct kasumi_key {
+    ulong32 KLi1[8], KLi2[8],
+            KOi1[8], KOi2[8], KOi3[8],
+            KIi1[8], KIi2[8], KIi3[8];
+};
+#endif
+
+#ifdef LTC_XTEA
+struct xtea_key {
+   unsigned long A[32], B[32];
+};
+#endif
+
+#ifdef LTC_TWOFISH
+#ifndef LTC_TWOFISH_SMALL
+   struct twofish_key {
+      ulong32 S[4][256], K[40];
+   };
+#else
+   struct twofish_key {
+      ulong32 K[40];
+      unsigned char S[32], start;
+   };
+#endif
+#endif
+
+#ifdef LTC_SAFER
+#define LTC_SAFER_K64_DEFAULT_NOF_ROUNDS     6
+#define LTC_SAFER_K128_DEFAULT_NOF_ROUNDS   10
+#define LTC_SAFER_SK64_DEFAULT_NOF_ROUNDS    8
+#define LTC_SAFER_SK128_DEFAULT_NOF_ROUNDS  10
+#define LTC_SAFER_MAX_NOF_ROUNDS            13
+#define LTC_SAFER_BLOCK_LEN                  8
+#define LTC_SAFER_KEY_LEN     (1 + LTC_SAFER_BLOCK_LEN * (1 + 2 * LTC_SAFER_MAX_NOF_ROUNDS))
+typedef unsigned char safer_block_t[LTC_SAFER_BLOCK_LEN];
+typedef unsigned char safer_key_t[LTC_SAFER_KEY_LEN];
+struct safer_key { safer_key_t key; };
+#endif
+
+#ifdef LTC_RC2
+struct rc2_key { unsigned xkey[64]; };
+#endif
+
+#ifdef LTC_DES
+struct des_key {
+    ulong32 ek[32], dk[32];
+};
+
+struct des3_key {
+    ulong32 ek[3][32], dk[3][32];
+};
+#endif
+
+#ifdef LTC_CAST5
+struct cast5_key {
+    ulong32 K[32], keylen;
+};
+#endif
+
+#ifdef LTC_NOEKEON
+struct noekeon_key {
+    ulong32 K[4], dK[4];
+};
+#endif
+
+#ifdef LTC_SKIPJACK
+struct skipjack_key {
+    unsigned char key[10];
+};
+#endif
+
+#ifdef LTC_KHAZAD
+struct khazad_key {
+   ulong64 roundKeyEnc[8 + 1];
+   ulong64 roundKeyDec[8 + 1];
+};
+#endif
+
+#ifdef LTC_ANUBIS
+struct anubis_key {
+   int keyBits;
+   int R;
+   ulong32 roundKeyEnc[18 + 1][4];
+   ulong32 roundKeyDec[18 + 1][4];
+};
+#endif
+
+#ifdef LTC_MULTI2
+struct multi2_key {
+    int N;
+    ulong32 uk[8];
+};
+#endif
+
+#ifdef LTC_CAMELLIA
+struct camellia_key {
+    int R;
+    ulong64 kw[4], k[24], kl[6];
+};
+#endif
+
+#ifdef LTC_IDEA
+/* rounds */
+#define LTC_IDEA_ROUNDS 8
+/* key schedule length in # of unsigned shorts */
+#define LTC_IDEA_KEYLEN 6*LTC_IDEA_ROUNDS+4
+struct idea_key {
+   unsigned short int ek[LTC_IDEA_KEYLEN]; /* enc key */
+   unsigned short int dk[LTC_IDEA_KEYLEN]; /* dec key */
+};
+#endif
+
+#ifdef LTC_SERPENT
+struct serpent_key {
+   ulong32 k[33*4];
+};
+#endif
+
+typedef union Symmetric_key {
+#ifdef LTC_DES
+   struct des_key des;
+   struct des3_key des3;
+#endif
+#ifdef LTC_RC2
+   struct rc2_key rc2;
+#endif
+#ifdef LTC_SAFER
+   struct safer_key safer;
+#endif
+#ifdef LTC_TWOFISH
+   struct twofish_key  twofish;
+#endif
+#ifdef LTC_BLOWFISH
+   struct blowfish_key blowfish;
+#endif
+#ifdef LTC_RC5
+   struct rc5_key      rc5;
+#endif
+#ifdef LTC_RC6
+   struct rc6_key      rc6;
+#endif
+#ifdef LTC_SAFERP
+   struct saferp_key   saferp;
+#endif
+#ifdef LTC_RIJNDAEL
+   struct rijndael_key rijndael;
+#endif
+#ifdef LTC_XTEA
+   struct xtea_key     xtea;
+#endif
+#ifdef LTC_CAST5
+   struct cast5_key    cast5;
+#endif
+#ifdef LTC_NOEKEON
+   struct noekeon_key  noekeon;
+#endif
+#ifdef LTC_SKIPJACK
+   struct skipjack_key skipjack;
+#endif
+#ifdef LTC_KHAZAD
+   struct khazad_key   khazad;
+#endif
+#ifdef LTC_ANUBIS
+   struct anubis_key   anubis;
+#endif
+#ifdef LTC_KSEED
+   struct kseed_key    kseed;
+#endif
+#ifdef LTC_KASUMI
+   struct kasumi_key   kasumi;
+#endif
+#ifdef LTC_MULTI2
+   struct multi2_key   multi2;
+#endif
+#ifdef LTC_CAMELLIA
+   struct camellia_key camellia;
+#endif
+#ifdef LTC_IDEA
+   struct idea_key     idea;
+#endif
+#ifdef LTC_SERPENT
+   struct serpent_key  serpent;
+#endif
+   void   *data;
+} symmetric_key;
+
+#ifdef LTC_ECB_MODE
+/** A block cipher ECB structure */
+typedef struct {
+   /** The index of the cipher chosen */
+   int                 cipher,
+   /** The block size of the given cipher */
+                       blocklen;
+   /** The scheduled key */
+   symmetric_key       key;
+} symmetric_ECB;
+#endif
+
+#ifdef LTC_CFB_MODE
+/** A block cipher CFB structure */
+typedef struct {
+   /** The index of the cipher chosen */
+   int                 cipher,
+   /** The block size of the given cipher */
+                       blocklen,
+   /** The padding offset */
+                       padlen;
+   /** The current IV */
+   unsigned char       IV[MAXBLOCKSIZE],
+   /** The pad used to encrypt/decrypt */
+                       pad[MAXBLOCKSIZE];
+   /** The scheduled key */
+   symmetric_key       key;
+} symmetric_CFB;
+#endif
+
+#ifdef LTC_OFB_MODE
+/** A block cipher OFB structure */
+typedef struct {
+   /** The index of the cipher chosen */
+   int                 cipher,
+   /** The block size of the given cipher */
+                       blocklen,
+   /** The padding offset */
+                       padlen;
+   /** The current IV */
+   unsigned char       IV[MAXBLOCKSIZE];
+   /** The scheduled key */
+   symmetric_key       key;
+} symmetric_OFB;
+#endif
+
+#ifdef LTC_CBC_MODE
+/** A block cipher CBC structure */
+typedef struct {
+   /** The index of the cipher chosen */
+   int                 cipher,
+   /** The block size of the given cipher */
+                       blocklen;
+   /** The current IV */
+   unsigned char       IV[MAXBLOCKSIZE];
+   /** The scheduled key */
+   symmetric_key       key;
+} symmetric_CBC;
+#endif
+
+
+#ifdef LTC_CTR_MODE
+/** A block cipher CTR structure */
+typedef struct {
+   /** The index of the cipher chosen */
+   int                 cipher,
+   /** The block size of the given cipher */
+                       blocklen,
+   /** The padding offset */
+                       padlen,
+   /** The mode (endianess) of the CTR, 0==little, 1==big */
+                       mode,
+   /** counter width */
+                       ctrlen;
+
+   /** The counter */
+   unsigned char       ctr[MAXBLOCKSIZE],
+   /** The pad used to encrypt/decrypt */
+                       pad[MAXBLOCKSIZE];
+   /** The scheduled key */
+   symmetric_key       key;
+} symmetric_CTR;
+#endif
+
+
+#ifdef LTC_LRW_MODE
+/** A LRW structure */
+typedef struct {
+    /** The index of the cipher chosen (must be a 128-bit block cipher) */
+    int               cipher;
+
+    /** The current IV */
+    unsigned char     IV[16],
+
+    /** the tweak key */
+                      tweak[16],
+
+    /** The current pad, it's the product of the first 15 bytes against the tweak key */
+                      pad[16];
+
+    /** The scheduled symmetric key */
+    symmetric_key     key;
+
+#ifdef LTC_LRW_TABLES
+    /** The pre-computed multiplication table */
+    unsigned char     PC[16][256][16];
+#endif
+} symmetric_LRW;
+#endif
+
+#ifdef LTC_F8_MODE
+/** A block cipher F8 structure */
+typedef struct {
+   /** The index of the cipher chosen */
+   int                 cipher,
+   /** The block size of the given cipher */
+                       blocklen,
+   /** The padding offset */
+                       padlen;
+   /** The current IV */
+   unsigned char       IV[MAXBLOCKSIZE],
+                       MIV[MAXBLOCKSIZE];
+   /** Current block count */
+   ulong32             blockcnt;
+   /** The scheduled key */
+   symmetric_key       key;
+} symmetric_F8;
+#endif
+
+
+/** cipher descriptor table, last entry has "name == NULL" to mark the end of table */
+extern struct ltc_cipher_descriptor {
+   /** name of cipher */
+   const char *name;
+   /** internal ID */
+   unsigned char ID;
+   /** min keysize (octets) */
+   int  min_key_length,
+   /** max keysize (octets) */
+        max_key_length,
+   /** block size (octets) */
+        block_length,
+   /** default number of rounds */
+        default_rounds;
+   /** Setup the cipher
+      @param key         The input symmetric key
+      @param keylen      The length of the input key (octets)
+      @param num_rounds  The requested number of rounds (0==default)
+      @param skey        [out] The destination of the scheduled key
+      @return CRYPT_OK if successful
+   */
+   int  (*setup)(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey);
+   /** Encrypt a block
+      @param pt      The plaintext
+      @param ct      [out] The ciphertext
+      @param skey    The scheduled key
+      @return CRYPT_OK if successful
+   */
+   int (*ecb_encrypt)(const unsigned char *pt, unsigned char *ct, const symmetric_key *skey);
+   /** Decrypt a block
+      @param ct      The ciphertext
+      @param pt      [out] The plaintext
+      @param skey    The scheduled key
+      @return CRYPT_OK if successful
+   */
+   int (*ecb_decrypt)(const unsigned char *ct, unsigned char *pt, const symmetric_key *skey);
+   /** Test the block cipher
+       @return CRYPT_OK if successful, CRYPT_NOP if self-testing has been disabled
+   */
+   int (*test)(void);
+
+   /** Terminate the context
+      @param skey    The scheduled key
+   */
+   void (*done)(symmetric_key *skey);
+
+   /** Determine a key size
+       @param keysize    [in/out] The size of the key desired and the suggested size
+       @return CRYPT_OK if successful
+   */
+   int  (*keysize)(int *keysize);
+
+/** Accelerators **/
+   /** Accelerated ECB encryption
+       @param pt      Plaintext
+       @param ct      Ciphertext
+       @param blocks  The number of complete blocks to process
+       @param skey    The scheduled key context
+       @return CRYPT_OK if successful
+   */
+   int (*accel_ecb_encrypt)(const unsigned char *pt, unsigned char *ct, unsigned long blocks, symmetric_key *skey);
+
+   /** Accelerated ECB decryption
+       @param pt      Plaintext
+       @param ct      Ciphertext
+       @param blocks  The number of complete blocks to process
+       @param skey    The scheduled key context
+       @return CRYPT_OK if successful
+   */
+   int (*accel_ecb_decrypt)(const unsigned char *ct, unsigned char *pt, unsigned long blocks, symmetric_key *skey);
+
+   /** Accelerated CBC encryption
+       @param pt      Plaintext
+       @param ct      Ciphertext
+       @param blocks  The number of complete blocks to process
+       @param IV      The initial value (input/output)
+       @param skey    The scheduled key context
+       @return CRYPT_OK if successful
+   */
+   int (*accel_cbc_encrypt)(const unsigned char *pt, unsigned char *ct, unsigned long blocks, unsigned char *IV, symmetric_key *skey);
+
+   /** Accelerated CBC decryption
+       @param pt      Plaintext
+       @param ct      Ciphertext
+       @param blocks  The number of complete blocks to process
+       @param IV      The initial value (input/output)
+       @param skey    The scheduled key context
+       @return CRYPT_OK if successful
+   */
+   int (*accel_cbc_decrypt)(const unsigned char *ct, unsigned char *pt, unsigned long blocks, unsigned char *IV, symmetric_key *skey);
+
+   /** Accelerated CTR encryption
+       @param pt      Plaintext
+       @param ct      Ciphertext
+       @param blocks  The number of complete blocks to process
+       @param IV      The initial value (input/output)
+       @param mode    little or big endian counter (mode=0 or mode=1)
+       @param skey    The scheduled key context
+       @return CRYPT_OK if successful
+   */
+   int (*accel_ctr_encrypt)(const unsigned char *pt, unsigned char *ct, unsigned long blocks, unsigned char *IV, int mode, symmetric_key *skey);
+
+   /** Accelerated LRW
+       @param pt      Plaintext
+       @param ct      Ciphertext
+       @param blocks  The number of complete blocks to process
+       @param IV      The initial value (input/output)
+       @param tweak   The LRW tweak
+       @param skey    The scheduled key context
+       @return CRYPT_OK if successful
+   */
+   int (*accel_lrw_encrypt)(const unsigned char *pt, unsigned char *ct, unsigned long blocks, unsigned char *IV, const unsigned char *tweak, symmetric_key *skey);
+
+   /** Accelerated LRW
+       @param ct      Ciphertext
+       @param pt      Plaintext
+       @param blocks  The number of complete blocks to process
+       @param IV      The initial value (input/output)
+       @param tweak   The LRW tweak
+       @param skey    The scheduled key context
+       @return CRYPT_OK if successful
+   */
+   int (*accel_lrw_decrypt)(const unsigned char *ct, unsigned char *pt, unsigned long blocks, unsigned char *IV, const unsigned char *tweak, symmetric_key *skey);
+
+   /** Accelerated CCM packet (one-shot)
+       @param key        The secret key to use
+       @param keylen     The length of the secret key (octets)
+       @param uskey      A previously scheduled key [optional can be NULL]
+       @param nonce      The session nonce [use once]
+       @param noncelen   The length of the nonce
+       @param header     The header for the session
+       @param headerlen  The length of the header (octets)
+       @param pt         [out] The plaintext
+       @param ptlen      The length of the plaintext (octets)
+       @param ct         [out] The ciphertext
+       @param tag        [out] The destination tag
+       @param taglen     [in/out] The max size and resulting size of the authentication tag
+       @param direction  Encrypt or Decrypt direction (0 or 1)
+       @return CRYPT_OK if successful
+   */
+   int (*accel_ccm_memory)(
+       const unsigned char *key,    unsigned long keylen,
+       symmetric_key       *uskey,
+       const unsigned char *nonce,  unsigned long noncelen,
+       const unsigned char *header, unsigned long headerlen,
+             unsigned char *pt,     unsigned long ptlen,
+             unsigned char *ct,
+             unsigned char *tag,    unsigned long *taglen,
+                       int  direction);
+
+   /** Accelerated GCM packet (one shot)
+       @param key        The secret key
+       @param keylen     The length of the secret key
+       @param IV         The initialization vector
+       @param IVlen      The length of the initialization vector
+       @param adata      The additional authentication data (header)
+       @param adatalen   The length of the adata
+       @param pt         The plaintext
+       @param ptlen      The length of the plaintext (ciphertext length is the same)
+       @param ct         The ciphertext
+       @param tag        [out] The MAC tag
+       @param taglen     [in/out] The MAC tag length
+       @param direction  Encrypt or Decrypt mode (GCM_ENCRYPT or GCM_DECRYPT)
+       @return CRYPT_OK on success
+   */
+   int (*accel_gcm_memory)(
+       const unsigned char *key,    unsigned long keylen,
+       const unsigned char *IV,     unsigned long IVlen,
+       const unsigned char *adata,  unsigned long adatalen,
+             unsigned char *pt,     unsigned long ptlen,
+             unsigned char *ct,
+             unsigned char *tag,    unsigned long *taglen,
+                       int direction);
+
+   /** Accelerated one shot LTC_OMAC
+       @param key            The secret key
+       @param keylen         The key length (octets)
+       @param in             The message
+       @param inlen          Length of message (octets)
+       @param out            [out] Destination for tag
+       @param outlen         [in/out] Initial and final size of out
+       @return CRYPT_OK on success
+   */
+   int (*omac_memory)(
+       const unsigned char *key, unsigned long keylen,
+       const unsigned char *in,  unsigned long inlen,
+             unsigned char *out, unsigned long *outlen);
+
+   /** Accelerated one shot XCBC
+       @param key            The secret key
+       @param keylen         The key length (octets)
+       @param in             The message
+       @param inlen          Length of message (octets)
+       @param out            [out] Destination for tag
+       @param outlen         [in/out] Initial and final size of out
+       @return CRYPT_OK on success
+   */
+   int (*xcbc_memory)(
+       const unsigned char *key, unsigned long keylen,
+       const unsigned char *in,  unsigned long inlen,
+             unsigned char *out, unsigned long *outlen);
+
+   /** Accelerated one shot F9
+       @param key            The secret key
+       @param keylen         The key length (octets)
+       @param in             The message
+       @param inlen          Length of message (octets)
+       @param out            [out] Destination for tag
+       @param outlen         [in/out] Initial and final size of out
+       @return CRYPT_OK on success
+       @remark Requires manual padding
+   */
+   int (*f9_memory)(
+       const unsigned char *key, unsigned long keylen,
+       const unsigned char *in,  unsigned long inlen,
+             unsigned char *out, unsigned long *outlen);
+
+   /** Accelerated XTS encryption
+       @param pt      Plaintext
+       @param ct      Ciphertext
+       @param blocks  The number of complete blocks to process
+       @param tweak   The 128-bit encryption tweak (input/output).
+                      The tweak should not be encrypted on input, but
+                      next tweak will be copied encrypted on output.
+       @param skey1   The first scheduled key context
+       @param skey2   The second scheduled key context
+       @return CRYPT_OK if successful
+    */
+    int (*accel_xts_encrypt)(const unsigned char *pt, unsigned char *ct,
+        unsigned long blocks, unsigned char *tweak,
+        const symmetric_key *skey1, const symmetric_key *skey2);
+
+    /** Accelerated XTS decryption
+        @param ct      Ciphertext
+        @param pt      Plaintext
+        @param blocks  The number of complete blocks to process
+        @param tweak   The 128-bit encryption tweak (input/output).
+                       The tweak should not be encrypted on input, but
+                       next tweak will be copied encrypted on output.
+        @param skey1   The first scheduled key context
+        @param skey2   The second scheduled key context
+        @return CRYPT_OK if successful
+     */
+     int (*accel_xts_decrypt)(const unsigned char *ct, unsigned char *pt,
+         unsigned long blocks, unsigned char *tweak,
+         const symmetric_key *skey1, const symmetric_key *skey2);
+} cipher_descriptor[];
+
+#ifdef LTC_BLOWFISH
+int blowfish_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey);
+int blowfish_ecb_encrypt(const unsigned char *pt, unsigned char *ct, const symmetric_key *skey);
+int blowfish_ecb_decrypt(const unsigned char *ct, unsigned char *pt, const symmetric_key *skey);
+int blowfish_test(void);
+void blowfish_done(symmetric_key *skey);
+int blowfish_keysize(int *keysize);
+extern const struct ltc_cipher_descriptor blowfish_desc;
+#endif
+
+#ifdef LTC_RC5
+int rc5_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey);
+int rc5_ecb_encrypt(const unsigned char *pt, unsigned char *ct, const symmetric_key *skey);
+int rc5_ecb_decrypt(const unsigned char *ct, unsigned char *pt, const symmetric_key *skey);
+int rc5_test(void);
+void rc5_done(symmetric_key *skey);
+int rc5_keysize(int *keysize);
+extern const struct ltc_cipher_descriptor rc5_desc;
+#endif
+
+#ifdef LTC_RC6
+int rc6_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey);
+int rc6_ecb_encrypt(const unsigned char *pt, unsigned char *ct, const symmetric_key *skey);
+int rc6_ecb_decrypt(const unsigned char *ct, unsigned char *pt, const symmetric_key *skey);
+int rc6_test(void);
+void rc6_done(symmetric_key *skey);
+int rc6_keysize(int *keysize);
+extern const struct ltc_cipher_descriptor rc6_desc;
+#endif
+
+#ifdef LTC_RC2
+int rc2_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey);
+int rc2_setup_ex(const unsigned char *key, int keylen, int bits, int num_rounds, symmetric_key *skey);
+int rc2_ecb_encrypt(const unsigned char *pt, unsigned char *ct, const symmetric_key *skey);
+int rc2_ecb_decrypt(const unsigned char *ct, unsigned char *pt, const symmetric_key *skey);
+int rc2_test(void);
+void rc2_done(symmetric_key *skey);
+int rc2_keysize(int *keysize);
+extern const struct ltc_cipher_descriptor rc2_desc;
+#endif
+
+#ifdef LTC_SAFERP
+int saferp_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey);
+int saferp_ecb_encrypt(const unsigned char *pt, unsigned char *ct, const symmetric_key *skey);
+int saferp_ecb_decrypt(const unsigned char *ct, unsigned char *pt, const symmetric_key *skey);
+int saferp_test(void);
+void saferp_done(symmetric_key *skey);
+int saferp_keysize(int *keysize);
+extern const struct ltc_cipher_descriptor saferp_desc;
+#endif
+
+#ifdef LTC_SAFER
+int safer_k64_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey);
+int safer_sk64_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey);
+int safer_k128_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey);
+int safer_sk128_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey);
+int safer_ecb_encrypt(const unsigned char *pt, unsigned char *ct, const symmetric_key *skey);
+int safer_ecb_decrypt(const unsigned char *ct, unsigned char *pt, const symmetric_key *skey);
+int safer_k64_test(void);
+int safer_sk64_test(void);
+int safer_sk128_test(void);
+void safer_done(symmetric_key *skey);
+int safer_64_keysize(int *keysize);
+int safer_128_keysize(int *keysize);
+extern const struct ltc_cipher_descriptor safer_k64_desc, safer_k128_desc, safer_sk64_desc, safer_sk128_desc;
+#endif
+
+#ifdef LTC_RIJNDAEL
+
+/* make aes an alias */
+#define aes_setup           rijndael_setup
+#define aes_ecb_encrypt     rijndael_ecb_encrypt
+#define aes_ecb_decrypt     rijndael_ecb_decrypt
+#define aes_test            rijndael_test
+#define aes_done            rijndael_done
+#define aes_keysize         rijndael_keysize
+
+#define aes_enc_setup           rijndael_enc_setup
+#define aes_enc_ecb_encrypt     rijndael_enc_ecb_encrypt
+#define aes_enc_keysize         rijndael_enc_keysize
+
+int rijndael_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey);
+int rijndael_ecb_encrypt(const unsigned char *pt, unsigned char *ct, const symmetric_key *skey);
+int rijndael_ecb_decrypt(const unsigned char *ct, unsigned char *pt, const symmetric_key *skey);
+int rijndael_test(void);
+void rijndael_done(symmetric_key *skey);
+int rijndael_keysize(int *keysize);
+int rijndael_enc_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey);
+int rijndael_enc_ecb_encrypt(const unsigned char *pt, unsigned char *ct, const symmetric_key *skey);
+void rijndael_enc_done(symmetric_key *skey);
+int rijndael_enc_keysize(int *keysize);
+extern const struct ltc_cipher_descriptor rijndael_desc, aes_desc;
+extern const struct ltc_cipher_descriptor rijndael_enc_desc, aes_enc_desc;
+#endif
+
+#ifdef LTC_XTEA
+int xtea_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey);
+int xtea_ecb_encrypt(const unsigned char *pt, unsigned char *ct, const symmetric_key *skey);
+int xtea_ecb_decrypt(const unsigned char *ct, unsigned char *pt, const symmetric_key *skey);
+int xtea_test(void);
+void xtea_done(symmetric_key *skey);
+int xtea_keysize(int *keysize);
+extern const struct ltc_cipher_descriptor xtea_desc;
+#endif
+
+#ifdef LTC_TWOFISH
+int twofish_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey);
+int twofish_ecb_encrypt(const unsigned char *pt, unsigned char *ct, const symmetric_key *skey);
+int twofish_ecb_decrypt(const unsigned char *ct, unsigned char *pt, const symmetric_key *skey);
+int twofish_test(void);
+void twofish_done(symmetric_key *skey);
+int twofish_keysize(int *keysize);
+extern const struct ltc_cipher_descriptor twofish_desc;
+#endif
+
+#ifdef LTC_DES
+int des_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey);
+int des_ecb_encrypt(const unsigned char *pt, unsigned char *ct, const symmetric_key *skey);
+int des_ecb_decrypt(const unsigned char *ct, unsigned char *pt, const symmetric_key *skey);
+int des_test(void);
+void des_done(symmetric_key *skey);
+int des_keysize(int *keysize);
+int des3_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey);
+int des3_ecb_encrypt(const unsigned char *pt, unsigned char *ct, const symmetric_key *skey);
+int des3_ecb_decrypt(const unsigned char *ct, unsigned char *pt, const symmetric_key *skey);
+int des3_test(void);
+void des3_done(symmetric_key *skey);
+int des3_keysize(int *keysize);
+extern const struct ltc_cipher_descriptor des_desc, des3_desc;
+#endif
+
+#ifdef LTC_CAST5
+int cast5_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey);
+int cast5_ecb_encrypt(const unsigned char *pt, unsigned char *ct, const symmetric_key *skey);
+int cast5_ecb_decrypt(const unsigned char *ct, unsigned char *pt, const symmetric_key *skey);
+int cast5_test(void);
+void cast5_done(symmetric_key *skey);
+int cast5_keysize(int *keysize);
+extern const struct ltc_cipher_descriptor cast5_desc;
+#endif
+
+#ifdef LTC_NOEKEON
+int noekeon_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey);
+int noekeon_ecb_encrypt(const unsigned char *pt, unsigned char *ct, const symmetric_key *skey);
+int noekeon_ecb_decrypt(const unsigned char *ct, unsigned char *pt, const symmetric_key *skey);
+int noekeon_test(void);
+void noekeon_done(symmetric_key *skey);
+int noekeon_keysize(int *keysize);
+extern const struct ltc_cipher_descriptor noekeon_desc;
+#endif
+
+#ifdef LTC_SKIPJACK
+int skipjack_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey);
+int skipjack_ecb_encrypt(const unsigned char *pt, unsigned char *ct, const symmetric_key *skey);
+int skipjack_ecb_decrypt(const unsigned char *ct, unsigned char *pt, const symmetric_key *skey);
+int skipjack_test(void);
+void skipjack_done(symmetric_key *skey);
+int skipjack_keysize(int *keysize);
+extern const struct ltc_cipher_descriptor skipjack_desc;
+#endif
+
+#ifdef LTC_KHAZAD
+int khazad_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey);
+int khazad_ecb_encrypt(const unsigned char *pt, unsigned char *ct, const symmetric_key *skey);
+int khazad_ecb_decrypt(const unsigned char *ct, unsigned char *pt, const symmetric_key *skey);
+int khazad_test(void);
+void khazad_done(symmetric_key *skey);
+int khazad_keysize(int *keysize);
+extern const struct ltc_cipher_descriptor khazad_desc;
+#endif
+
+#ifdef LTC_ANUBIS
+int anubis_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey);
+int anubis_ecb_encrypt(const unsigned char *pt, unsigned char *ct, const symmetric_key *skey);
+int anubis_ecb_decrypt(const unsigned char *ct, unsigned char *pt, const symmetric_key *skey);
+int anubis_test(void);
+void anubis_done(symmetric_key *skey);
+int anubis_keysize(int *keysize);
+extern const struct ltc_cipher_descriptor anubis_desc;
+#endif
+
+#ifdef LTC_KSEED
+int kseed_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey);
+int kseed_ecb_encrypt(const unsigned char *pt, unsigned char *ct, const symmetric_key *skey);
+int kseed_ecb_decrypt(const unsigned char *ct, unsigned char *pt, const symmetric_key *skey);
+int kseed_test(void);
+void kseed_done(symmetric_key *skey);
+int kseed_keysize(int *keysize);
+extern const struct ltc_cipher_descriptor kseed_desc;
+#endif
+
+#ifdef LTC_KASUMI
+int kasumi_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey);
+int kasumi_ecb_encrypt(const unsigned char *pt, unsigned char *ct, const symmetric_key *skey);
+int kasumi_ecb_decrypt(const unsigned char *ct, unsigned char *pt, const symmetric_key *skey);
+int kasumi_test(void);
+void kasumi_done(symmetric_key *skey);
+int kasumi_keysize(int *keysize);
+extern const struct ltc_cipher_descriptor kasumi_desc;
+#endif
+
+
+#ifdef LTC_MULTI2
+int multi2_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey);
+int multi2_ecb_encrypt(const unsigned char *pt, unsigned char *ct, const symmetric_key *skey);
+int multi2_ecb_decrypt(const unsigned char *ct, unsigned char *pt, const symmetric_key *skey);
+int multi2_test(void);
+void multi2_done(symmetric_key *skey);
+int multi2_keysize(int *keysize);
+extern const struct ltc_cipher_descriptor multi2_desc;
+#endif
+
+#ifdef LTC_CAMELLIA
+int camellia_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey);
+int camellia_ecb_encrypt(const unsigned char *pt, unsigned char *ct, const symmetric_key *skey);
+int camellia_ecb_decrypt(const unsigned char *ct, unsigned char *pt, const symmetric_key *skey);
+int camellia_test(void);
+void camellia_done(symmetric_key *skey);
+int camellia_keysize(int *keysize);
+extern const struct ltc_cipher_descriptor camellia_desc;
+#endif
+
+#ifdef LTC_IDEA
+int idea_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey);
+int idea_ecb_encrypt(const unsigned char *pt, unsigned char *ct, const symmetric_key *skey);
+int idea_ecb_decrypt(const unsigned char *ct, unsigned char *pt, const symmetric_key *skey);
+int idea_test(void);
+void idea_done(symmetric_key *skey);
+int idea_keysize(int *keysize);
+extern const struct ltc_cipher_descriptor idea_desc;
+#endif
+
+#ifdef LTC_SERPENT
+int serpent_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey);
+int serpent_ecb_encrypt(const unsigned char *pt, unsigned char *ct, const symmetric_key *skey);
+int serpent_ecb_decrypt(const unsigned char *ct, unsigned char *pt, const symmetric_key *skey);
+int serpent_test(void);
+void serpent_done(symmetric_key *skey);
+int serpent_keysize(int *keysize);
+extern const struct ltc_cipher_descriptor serpent_desc;
+#endif
+
+#ifdef LTC_ECB_MODE
+int ecb_start(int cipher, const unsigned char *key,
+              int keylen, int num_rounds, symmetric_ECB *ecb);
+int ecb_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, symmetric_ECB *ecb);
+int ecb_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, symmetric_ECB *ecb);
+int ecb_done(symmetric_ECB *ecb);
+#endif
+
+#ifdef LTC_CFB_MODE
+int cfb_start(int cipher, const unsigned char *IV, const unsigned char *key,
+              int keylen, int num_rounds, symmetric_CFB *cfb);
+int cfb_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, symmetric_CFB *cfb);
+int cfb_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, symmetric_CFB *cfb);
+int cfb_getiv(unsigned char *IV, unsigned long *len, const symmetric_CFB *cfb);
+int cfb_setiv(const unsigned char *IV, unsigned long len, symmetric_CFB *cfb);
+int cfb_done(symmetric_CFB *cfb);
+#endif
+
+#ifdef LTC_OFB_MODE
+int ofb_start(int cipher, const unsigned char *IV, const unsigned char *key,
+              int keylen, int num_rounds, symmetric_OFB *ofb);
+int ofb_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, symmetric_OFB *ofb);
+int ofb_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, symmetric_OFB *ofb);
+int ofb_getiv(unsigned char *IV, unsigned long *len, const symmetric_OFB *ofb);
+int ofb_setiv(const unsigned char *IV, unsigned long len, symmetric_OFB *ofb);
+int ofb_done(symmetric_OFB *ofb);
+#endif
+
+#ifdef LTC_CBC_MODE
+int cbc_start(int cipher, const unsigned char *IV, const unsigned char *key,
+               int keylen, int num_rounds, symmetric_CBC *cbc);
+int cbc_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, symmetric_CBC *cbc);
+int cbc_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, symmetric_CBC *cbc);
+int cbc_getiv(unsigned char *IV, unsigned long *len, const symmetric_CBC *cbc);
+int cbc_setiv(const unsigned char *IV, unsigned long len, symmetric_CBC *cbc);
+int cbc_done(symmetric_CBC *cbc);
+#endif
+
+#ifdef LTC_CTR_MODE
+
+#define CTR_COUNTER_LITTLE_ENDIAN    0x0000
+#define CTR_COUNTER_BIG_ENDIAN       0x1000
+#define LTC_CTR_RFC3686              0x2000
+
+int ctr_start(               int   cipher,
+              const unsigned char *IV,
+              const unsigned char *key,       int keylen,
+                             int  num_rounds, int ctr_mode,
+                   symmetric_CTR *ctr);
+int ctr_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, symmetric_CTR *ctr);
+int ctr_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, symmetric_CTR *ctr);
+int ctr_getiv(unsigned char *IV, unsigned long *len, const symmetric_CTR *ctr);
+int ctr_setiv(const unsigned char *IV, unsigned long len, symmetric_CTR *ctr);
+int ctr_done(symmetric_CTR *ctr);
+int ctr_test(void);
+#endif
+
+#ifdef LTC_LRW_MODE
+
+#define LRW_ENCRYPT LTC_ENCRYPT
+#define LRW_DECRYPT LTC_DECRYPT
+
+int lrw_start(               int   cipher,
+              const unsigned char *IV,
+              const unsigned char *key,       int keylen,
+              const unsigned char *tweak,
+                             int  num_rounds,
+                   symmetric_LRW *lrw);
+int lrw_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, symmetric_LRW *lrw);
+int lrw_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, symmetric_LRW *lrw);
+int lrw_getiv(unsigned char *IV, unsigned long *len, const symmetric_LRW *lrw);
+int lrw_setiv(const unsigned char *IV, unsigned long len, symmetric_LRW *lrw);
+int lrw_done(symmetric_LRW *lrw);
+int lrw_test(void);
+
+/* don't call */
+int lrw_process(const unsigned char *pt, unsigned char *ct, unsigned long len, int mode, symmetric_LRW *lrw);
+#endif
+
+#ifdef LTC_F8_MODE
+int f8_start(                int  cipher, const unsigned char *IV,
+             const unsigned char *key,                    int  keylen,
+             const unsigned char *salt_key,               int  skeylen,
+                             int  num_rounds,   symmetric_F8  *f8);
+int f8_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, symmetric_F8 *f8);
+int f8_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, symmetric_F8 *f8);
+int f8_getiv(unsigned char *IV, unsigned long *len, const symmetric_F8 *f8);
+int f8_setiv(const unsigned char *IV, unsigned long len, symmetric_F8 *f8);
+int f8_done(symmetric_F8 *f8);
+int f8_test_mode(void);
+#endif
+
+#ifdef LTC_XTS_MODE
+typedef struct {
+   symmetric_key  key1, key2;
+   int            cipher;
+} symmetric_xts;
+
+int xts_start(                int  cipher,
+              const unsigned char *key1,
+              const unsigned char *key2,
+                    unsigned long  keylen,
+                              int  num_rounds,
+                    symmetric_xts *xts);
+
+int xts_encrypt(
+   const unsigned char *pt, unsigned long ptlen,
+         unsigned char *ct,
+         unsigned char *tweak,
+   const symmetric_xts *xts);
+int xts_decrypt(
+   const unsigned char *ct, unsigned long ptlen,
+         unsigned char *pt,
+         unsigned char *tweak,
+   const symmetric_xts *xts);
+
+void xts_done(symmetric_xts *xts);
+int  xts_test(void);
+void xts_mult_x(unsigned char *I);
+#endif
+
+int find_cipher(const char *name);
+int find_cipher_any(const char *name, int blocklen, int keylen);
+int find_cipher_id(unsigned char ID);
+int register_cipher(const struct ltc_cipher_descriptor *cipher);
+int unregister_cipher(const struct ltc_cipher_descriptor *cipher);
+int register_all_ciphers(void);
+int cipher_is_valid(int idx);
+
+LTC_MUTEX_PROTO(ltc_cipher_mutex)
+
+/* ---- stream ciphers ---- */
+
+#ifdef LTC_CHACHA
+
+typedef struct {
+   ulong32 input[16];
+   unsigned char kstream[64];
+   unsigned long ksleft;
+   unsigned long ivlen;
+   int rounds;
+} chacha_state;
+
+int chacha_setup(chacha_state *st, const unsigned char *key, unsigned long keylen, int rounds);
+int chacha_ivctr32(chacha_state *st, const unsigned char *iv, unsigned long ivlen, ulong32 counter);
+int chacha_ivctr64(chacha_state *st, const unsigned char *iv, unsigned long ivlen, ulong64 counter);
+int chacha_crypt(chacha_state *st, const unsigned char *in, unsigned long inlen, unsigned char *out);
+int chacha_keystream(chacha_state *st, unsigned char *out, unsigned long outlen);
+int chacha_done(chacha_state *st);
+int chacha_test(void);
+int chacha_memory(const unsigned char *key,    unsigned long keylen,  unsigned long rounds,
+                  const unsigned char *iv,     unsigned long ivlen,   ulong64 counter,
+                  const unsigned char *datain, unsigned long datalen, unsigned char *dataout);
+
+#endif /* LTC_CHACHA */
+
+#ifdef LTC_SALSA20
+
+typedef struct {
+   ulong32 input[16];
+   unsigned char kstream[64];
+   unsigned long ksleft;
+   unsigned long ivlen;
+   int rounds;
+} salsa20_state;
+
+int salsa20_setup(salsa20_state *st, const unsigned char *key, unsigned long keylen, int rounds);
+int salsa20_ivctr64(salsa20_state *st, const unsigned char *iv, unsigned long ivlen, ulong64 counter);
+int salsa20_crypt(salsa20_state *st, const unsigned char *in, unsigned long inlen, unsigned char *out);
+int salsa20_keystream(salsa20_state *st, unsigned char *out, unsigned long outlen);
+int salsa20_done(salsa20_state *st);
+int salsa20_test(void);
+int salsa20_memory(const unsigned char *key,    unsigned long keylen,  unsigned long rounds,
+                   const unsigned char *iv,     unsigned long ivlen,   ulong64 counter,
+                   const unsigned char *datain, unsigned long datalen, unsigned char *dataout);
+
+#endif /* LTC_SALSA20 */
+
+#ifdef LTC_XSALSA20
+
+int xsalsa20_setup(salsa20_state *st, const unsigned char *key,   unsigned long keylen,
+                                      const unsigned char *nonce, unsigned long noncelen,
+                                      int rounds);
+int xsalsa20_test(void);
+int xsalsa20_memory(const unsigned char *key,    unsigned long keylen,   unsigned long rounds,
+                    const unsigned char *nonce,  unsigned long noncelen,
+                    const unsigned char *datain, unsigned long datalen,  unsigned char *dataout);
+
+#endif /* LTC_XSALSA20 */
+
+#ifdef LTC_SOSEMANUK
+
+typedef struct {
+    ulong32 kc[100];    /* key_context */
+    ulong32 s00, s01, s02, s03, s04, s05, s06, s07, s08, s09;
+    ulong32 r1, r2;
+    /*
+     * Buffering: the stream cipher produces output data by
+     * blocks of 640 bits. buf[] contains such a block, and
+     * "ptr" is the index of the next output byte.
+     */
+    unsigned char buf[80];
+    unsigned ptr;
+} sosemanuk_state;
+
+int sosemanuk_setup(sosemanuk_state *st, const unsigned char *key, unsigned long keylen);
+int sosemanuk_setiv(sosemanuk_state *st, const unsigned char *iv, unsigned long ivlen);
+int sosemanuk_crypt(sosemanuk_state *st, const unsigned char *in, unsigned long inlen, unsigned char *out);
+int sosemanuk_keystream(sosemanuk_state *st, unsigned char *out, unsigned long outlen);
+int sosemanuk_done(sosemanuk_state *st);
+int sosemanuk_test(void);
+int sosemanuk_memory(const unsigned char *key,    unsigned long keylen,
+                     const unsigned char *iv,     unsigned long ivlen,
+                     const unsigned char *datain, unsigned long datalen,
+                     unsigned char *dataout);
+
+#endif /* LTC_SOSEMANUK */
+
+#ifdef LTC_RABBIT
+
+typedef struct {
+   ulong32 x[8];
+   ulong32 c[8];
+   ulong32 carry;
+} rabbit_ctx;
+
+typedef struct {
+   rabbit_ctx master_ctx;
+   rabbit_ctx work_ctx;
+   unsigned char block[16];     /* last keystream block containing unused bytes */
+   ulong32       unused;        /* count fm right */
+} rabbit_state;
+
+int rabbit_setup(rabbit_state* st, const unsigned char *key, unsigned long keylen);
+int rabbit_setiv(rabbit_state* st, const unsigned char *iv, unsigned long ivlen);
+int rabbit_crypt(rabbit_state* st, const unsigned char *in, unsigned long inlen, unsigned char *out);
+int rabbit_keystream(rabbit_state* st, unsigned char *out, unsigned long outlen);
+int rabbit_done(rabbit_state *st);
+int rabbit_test(void);
+int rabbit_memory(const unsigned char *key,    unsigned long keylen,
+                  const unsigned char *iv,     unsigned long ivlen,
+                  const unsigned char *datain, unsigned long datalen,
+                  unsigned char *dataout);
+
+#endif /* LTC_RABBIT */
+
+#ifdef LTC_RC4_STREAM
+
+typedef struct {
+   unsigned int x, y;
+   unsigned char buf[256];
+} rc4_state;
+
+int rc4_stream_setup(rc4_state *st, const unsigned char *key, unsigned long keylen);
+int rc4_stream_crypt(rc4_state *st, const unsigned char *in, unsigned long inlen, unsigned char *out);
+int rc4_stream_keystream(rc4_state *st, unsigned char *out, unsigned long outlen);
+int rc4_stream_done(rc4_state *st);
+int rc4_stream_test(void);
+int rc4_stream_memory(const unsigned char *key,    unsigned long keylen,
+                      const unsigned char *datain, unsigned long datalen,
+                      unsigned char *dataout);
+
+#endif /* LTC_RC4_STREAM */
+
+#ifdef LTC_SOBER128_STREAM
+
+typedef struct {
+   ulong32 R[17],       /* Working storage for the shift register */
+           initR[17],   /* saved register contents */
+           konst,       /* key dependent constant */
+           sbuf;        /* partial word encryption buffer */
+   int     nbuf;        /* number of part-word stream bits buffered */
+} sober128_state;
+
+int sober128_stream_setup(sober128_state *st, const unsigned char *key, unsigned long keylen);
+int sober128_stream_setiv(sober128_state *st, const unsigned char *iv, unsigned long ivlen);
+int sober128_stream_crypt(sober128_state *st, const unsigned char *in, unsigned long inlen, unsigned char *out);
+int sober128_stream_keystream(sober128_state *st, unsigned char *out, unsigned long outlen);
+int sober128_stream_done(sober128_state *st);
+int sober128_stream_test(void);
+int sober128_stream_memory(const unsigned char *key,    unsigned long keylen,
+                           const unsigned char *iv,     unsigned long ivlen,
+                           const unsigned char *datain, unsigned long datalen,
+                           unsigned char *dataout);
+
+#endif /* LTC_SOBER128_STREAM */
+
+/* ref:         HEAD -> develop */
+/* git commit:  a1f6312416ef6cd183ee62db58b640dc2d7ec1f4 */
+/* commit time: 2019-09-04 13:44:47 +0200 */

+ 715 - 0
libtomcrypt.mod/libtomcrypt/src/headers/tomcrypt_custom.h

@@ -0,0 +1,715 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ */
+
+#ifndef TOMCRYPT_CUSTOM_H_
+#define TOMCRYPT_CUSTOM_H_
+
+/* macros for various libc functions you can change for embedded targets */
+#ifndef XMALLOC
+#define XMALLOC  malloc
+#endif
+#ifndef XREALLOC
+#define XREALLOC realloc
+#endif
+#ifndef XCALLOC
+#define XCALLOC  calloc
+#endif
+#ifndef XFREE
+#define XFREE    free
+#endif
+
+#ifndef XMEMSET
+#define XMEMSET  memset
+#endif
+#ifndef XMEMCPY
+#define XMEMCPY  memcpy
+#endif
+#ifndef XMEMMOVE
+#define XMEMMOVE memmove
+#endif
+#ifndef XMEMCMP
+#define XMEMCMP  memcmp
+#endif
+/* A memory compare function that has to run in constant time,
+ * c.f. mem_neq() API summary.
+ */
+#ifndef XMEM_NEQ
+#define XMEM_NEQ  mem_neq
+#endif
+#ifndef XSTRCMP
+#define XSTRCMP  strcmp
+#endif
+#ifndef XSTRNCPY
+#define XSTRNCPY strncpy
+#endif
+
+#ifndef XCLOCK
+#define XCLOCK   clock
+#endif
+
+#ifndef XQSORT
+#define XQSORT qsort
+#endif
+
+#if ( defined(malloc) || defined(realloc) || defined(calloc) || defined(free) || \
+      defined(memset) || defined(memcpy) || defined(memcmp) || defined(strcmp) || \
+      defined(strncpy) || defined(clock) || defined(qsort) ) && !defined(LTC_NO_PROTOTYPES)
+#define LTC_NO_PROTOTYPES
+#endif
+
+/* shortcut to disable automatic inclusion */
+#if defined LTC_NOTHING && !defined LTC_EASY
+  #define LTC_NO_CIPHERS
+  #define LTC_NO_MODES
+  #define LTC_NO_HASHES
+  #define LTC_NO_MACS
+  #define LTC_NO_PRNGS
+  #define LTC_NO_PK
+  #define LTC_NO_PKCS
+  #define LTC_NO_MISC
+#endif /* LTC_NOTHING */
+
+/* Easy button? */
+#ifdef LTC_EASY
+   #define LTC_NO_CIPHERS
+   #define LTC_RIJNDAEL
+   #define LTC_BLOWFISH
+   #define LTC_DES
+   #define LTC_CAST5
+
+   #define LTC_NO_MODES
+   #define LTC_ECB_MODE
+   #define LTC_CBC_MODE
+   #define LTC_CTR_MODE
+
+   #define LTC_NO_HASHES
+   #define LTC_SHA1
+   #define LTC_SHA3
+   #define LTC_SHA512
+   #define LTC_SHA384
+   #define LTC_SHA256
+   #define LTC_SHA224
+   #define LTC_HASH_HELPERS
+
+   #define LTC_NO_MACS
+   #define LTC_HMAC
+   #define LTC_OMAC
+   #define LTC_CCM_MODE
+
+   #define LTC_NO_PRNGS
+   #define LTC_SPRNG
+   #define LTC_YARROW
+   #define LTC_DEVRANDOM
+   #define LTC_TRY_URANDOM_FIRST
+   #define LTC_RNG_GET_BYTES
+   #define LTC_RNG_MAKE_PRNG
+
+   #define LTC_NO_PK
+   #define LTC_MRSA
+   #define LTC_MECC
+
+   #define LTC_NO_MISC
+   #define LTC_BASE64
+#endif
+
+/* The minimal set of functionality to run the tests */
+#ifdef LTC_MINIMAL
+   #define LTC_RIJNDAEL
+   #define LTC_SHA256
+   #define LTC_YARROW
+   #define LTC_CTR_MODE
+
+   #define LTC_RNG_MAKE_PRNG
+   #define LTC_RNG_GET_BYTES
+   #define LTC_DEVRANDOM
+   #define LTC_TRY_URANDOM_FIRST
+
+   #undef LTC_NO_FILE
+#endif
+
+/* Enable self-test test vector checking */
+#ifndef LTC_NO_TEST
+   #define LTC_TEST
+#endif
+/* Enable extended self-tests */
+/* #define LTC_TEST_EXT */
+
+/* Use small code where possible */
+/* #define LTC_SMALL_CODE */
+
+/* clean the stack of functions which put private information on stack */
+/* #define LTC_CLEAN_STACK */
+
+/* disable all file related functions */
+/* #define LTC_NO_FILE */
+
+/* disable all forms of ASM */
+/* #define LTC_NO_ASM */
+
+/* disable FAST mode */
+/* #define LTC_NO_FAST */
+
+/* disable BSWAP on x86 */
+/* #define LTC_NO_BSWAP */
+
+/* ---> math provider? <--- */
+#ifndef LTC_NO_MATH
+
+/* LibTomMath */
+/* #define LTM_DESC */
+
+/* TomsFastMath */
+/* #define TFM_DESC */
+
+/* GNU Multiple Precision Arithmetic Library */
+/* #define GMP_DESC */
+
+#endif /* LTC_NO_MATH */
+
+/* ---> Symmetric Block Ciphers <--- */
+#ifndef LTC_NO_CIPHERS
+
+#define LTC_BLOWFISH
+#define LTC_RC2
+#define LTC_RC5
+#define LTC_RC6
+#define LTC_SAFERP
+#define LTC_RIJNDAEL
+#define LTC_XTEA
+/* _TABLES tells it to use tables during setup, _SMALL means to use the smaller scheduled key format
+ * (saves 4KB of ram), _ALL_TABLES enables all tables during setup */
+#define LTC_TWOFISH
+#ifndef LTC_NO_TABLES
+   #define LTC_TWOFISH_TABLES
+   /* #define LTC_TWOFISH_ALL_TABLES */
+#else
+   #define LTC_TWOFISH_SMALL
+#endif
+/* #define LTC_TWOFISH_SMALL */
+/* LTC_DES includes EDE triple-DES */
+#define LTC_DES
+#define LTC_CAST5
+#define LTC_NOEKEON
+#define LTC_SKIPJACK
+#define LTC_SAFER
+#define LTC_KHAZAD
+#define LTC_ANUBIS
+#define LTC_ANUBIS_TWEAK
+#define LTC_KSEED
+#define LTC_KASUMI
+#define LTC_MULTI2
+#define LTC_CAMELLIA
+#define LTC_IDEA
+#define LTC_SERPENT
+
+/* stream ciphers */
+#define LTC_CHACHA
+#define LTC_SALSA20
+#define LTC_XSALSA20
+#define LTC_SOSEMANUK
+#define LTC_RABBIT
+#define LTC_RC4_STREAM
+#define LTC_SOBER128_STREAM
+
+#endif /* LTC_NO_CIPHERS */
+
+
+/* ---> Block Cipher Modes of Operation <--- */
+#ifndef LTC_NO_MODES
+
+#define LTC_CFB_MODE
+#define LTC_OFB_MODE
+#define LTC_ECB_MODE
+#define LTC_CBC_MODE
+#define LTC_CTR_MODE
+
+/* F8 chaining mode */
+#define LTC_F8_MODE
+
+/* LRW mode */
+#define LTC_LRW_MODE
+#ifndef LTC_NO_TABLES
+   /* like GCM mode this will enable 16 8x128 tables [64KB] that make
+    * seeking very fast.
+    */
+   #define LTC_LRW_TABLES
+#endif
+
+/* XTS mode */
+#define LTC_XTS_MODE
+
+#endif /* LTC_NO_MODES */
+
+/* ---> One-Way Hash Functions <--- */
+#ifndef LTC_NO_HASHES
+
+#define LTC_CHC_HASH
+#define LTC_WHIRLPOOL
+#define LTC_SHA3
+#define LTC_KECCAK
+#define LTC_SHA512
+#define LTC_SHA512_256
+#define LTC_SHA512_224
+#define LTC_SHA384
+#define LTC_SHA256
+#define LTC_SHA224
+#define LTC_TIGER
+#define LTC_SHA1
+#define LTC_MD5
+#define LTC_MD4
+#define LTC_MD2
+#define LTC_RIPEMD128
+#define LTC_RIPEMD160
+#define LTC_RIPEMD256
+#define LTC_RIPEMD320
+#define LTC_BLAKE2S
+#define LTC_BLAKE2B
+
+#define LTC_HASH_HELPERS
+
+#endif /* LTC_NO_HASHES */
+
+
+/* ---> MAC functions <--- */
+#ifndef LTC_NO_MACS
+
+#define LTC_HMAC
+#define LTC_OMAC
+#define LTC_PMAC
+#define LTC_XCBC
+#define LTC_F9_MODE
+#define LTC_PELICAN
+#define LTC_POLY1305
+#define LTC_BLAKE2SMAC
+#define LTC_BLAKE2BMAC
+
+/* ---> Encrypt + Authenticate Modes <--- */
+
+#define LTC_EAX_MODE
+
+#define LTC_OCB_MODE
+#define LTC_OCB3_MODE
+#define LTC_CCM_MODE
+#define LTC_GCM_MODE
+#define LTC_CHACHA20POLY1305_MODE
+
+/* Use 64KiB tables */
+#ifndef LTC_NO_TABLES
+   #define LTC_GCM_TABLES
+#endif
+
+/* USE SSE2? requires GCC works on x86_32 and x86_64*/
+#ifdef LTC_GCM_TABLES
+/* #define LTC_GCM_TABLES_SSE2 */
+#endif
+
+#endif /* LTC_NO_MACS */
+
+
+/* --> Pseudo Random Number Generators <--- */
+#ifndef LTC_NO_PRNGS
+
+/* Yarrow */
+#define LTC_YARROW
+
+/* a PRNG that simply reads from an available system source */
+#define LTC_SPRNG
+
+/* The RC4 stream cipher based PRNG */
+#define LTC_RC4
+
+/* The ChaCha20 stream cipher based PRNG */
+#define LTC_CHACHA20_PRNG
+
+/* Fortuna PRNG */
+#define LTC_FORTUNA
+
+/* Greg's SOBER128 stream cipher based PRNG */
+#define LTC_SOBER128
+
+/* the *nix style /dev/random device */
+#define LTC_DEVRANDOM
+/* try /dev/urandom before trying /dev/random
+ * are you sure you want to disable this? http://www.2uo.de/myths-about-urandom/ */
+#define LTC_TRY_URANDOM_FIRST
+/* rng_get_bytes() */
+#define LTC_RNG_GET_BYTES
+/* rng_make_prng() */
+#define LTC_RNG_MAKE_PRNG
+
+/* enable the ltc_rng hook to integrate e.g. embedded hardware RNG's easily */
+/* #define LTC_PRNG_ENABLE_LTC_RNG */
+
+#endif /* LTC_NO_PRNGS */
+
+#ifdef LTC_YARROW
+
+/* which descriptor of AES to use?  */
+/* 0 = rijndael_enc 1 = aes_enc, 2 = rijndael [full], 3 = aes [full] */
+#ifdef ENCRYPT_ONLY
+  #define LTC_YARROW_AES 0
+#else
+  #define LTC_YARROW_AES 2
+#endif
+
+#endif
+
+#ifdef LTC_FORTUNA
+
+#if !defined(LTC_FORTUNA_RESEED_RATELIMIT_STATIC) && \
+      ((defined(_POSIX_C_SOURCE) && _POSIX_C_SOURCE >= 200112L) || defined(_WIN32))
+
+/* time-based rate limit of the reseeding */
+#define LTC_FORTUNA_RESEED_RATELIMIT_TIMED
+
+/* with non-glibc or glibc 2.17+ prefer clock_gettime over gettimeofday */
+#if defined(__GLIBC__) && defined(__GLIBC_PREREQ)
+#if __GLIBC_PREREQ(2, 17)
+  #define LTC_CLOCK_GETTIME
+#endif
+#elif defined(_POSIX_C_SOURCE) && _POSIX_C_SOURCE >= 200112L
+  #define LTC_CLOCK_GETTIME
+#endif
+
+#else
+
+#ifndef LTC_FORTUNA_WD
+/* reseed every N calls to the read function */
+#define LTC_FORTUNA_WD    10
+#endif
+
+#ifdef LTC_FORTUNA_RESEED_RATELIMIT_TIMED
+/* make sure only one of
+ *   LTC_FORTUNA_RESEED_RATELIMIT_STATIC
+ * and
+ *   LTC_FORTUNA_RESEED_RATELIMIT_TIMED
+ * is defined.
+ */
+#undef LTC_FORTUNA_RESEED_RATELIMIT_TIMED
+#warning "undef'ed LTC_FORTUNA_RESEED_RATELIMIT_TIMED, looks like your architecture doesn't support it"
+#endif
+
+#endif
+
+#ifndef LTC_FORTUNA_POOLS
+/* number of pools (4..32) can save a bit of ram by lowering the count */
+#define LTC_FORTUNA_POOLS 32
+#endif
+
+#endif /* LTC_FORTUNA */
+
+
+/* ---> Public Key Crypto <--- */
+#ifndef LTC_NO_PK
+
+/* Include RSA support */
+#define LTC_MRSA
+
+/* Include Diffie-Hellman support */
+/* is_prime fails for GMP */
+#define LTC_MDH
+/* Supported Key Sizes */
+#define LTC_DH768
+#define LTC_DH1024
+#define LTC_DH1536
+#define LTC_DH2048
+
+#if defined(LTM_DESC) || defined(GMP_DESC)
+/* tfm has a problem in fp_isprime for larger key sizes */
+#define LTC_DH3072
+#define LTC_DH4096
+#define LTC_DH6144
+#define LTC_DH8192
+#endif
+
+/* Digital Signature Algorithm */
+#define LTC_MDSA
+
+/* Ed25519 & X25519 */
+#define LTC_CURVE25519
+
+/* ECC */
+#define LTC_MECC
+
+/* use Shamir's trick for point mul (speeds up signature verification) */
+#define LTC_ECC_SHAMIR
+
+#if defined(TFM_DESC) && defined(LTC_MECC)
+   #define LTC_MECC_ACCEL
+#endif
+
+/* do we want fixed point ECC */
+/* #define LTC_MECC_FP */
+
+#endif /* LTC_NO_PK */
+
+#if defined(LTC_MRSA) && !defined(LTC_NO_RSA_BLINDING)
+/* Enable RSA blinding when doing private key operations by default */
+#define LTC_RSA_BLINDING
+#endif  /* LTC_NO_RSA_BLINDING */
+
+#if defined(LTC_MRSA) && !defined(LTC_NO_RSA_CRT_HARDENING)
+/* Enable RSA CRT hardening when doing private key operations by default */
+#define LTC_RSA_CRT_HARDENING
+#endif  /* LTC_NO_RSA_CRT_HARDENING */
+
+#if defined(LTC_MECC) && !defined(LTC_NO_ECC_TIMING_RESISTANT)
+/* Enable ECC timing resistant version by default */
+#define LTC_ECC_TIMING_RESISTANT
+#endif
+
+/* PKCS #1 (RSA) and #5 (Password Handling) stuff */
+#ifndef LTC_NO_PKCS
+
+#define LTC_PKCS_1
+#define LTC_PKCS_5
+#define LTC_PKCS_8
+#define LTC_PKCS_12
+
+/* Include ASN.1 DER (required by DSA/RSA) */
+#define LTC_DER
+
+#endif /* LTC_NO_PKCS */
+
+/* misc stuff */
+#ifndef LTC_NO_MISC
+
+/* Various tidbits of modern neatoness */
+#define LTC_BASE64
+/* ... and it's URL safe version */
+#define LTC_BASE64_URL
+/* Base32 encoding/decoding */
+#define LTC_BASE32
+/* Base16/hex encoding/decoding */
+#define LTC_BASE16
+
+/* Keep LTC_NO_HKDF for compatibility reasons
+ * superseeded by LTC_NO_MISC*/
+#ifndef LTC_NO_HKDF
+/* HKDF Key Derivation/Expansion stuff */
+#define LTC_HKDF
+#endif /* LTC_NO_HKDF */
+
+#define LTC_ADLER32
+
+#define LTC_CRC32
+
+#define LTC_SSH
+
+#define LTC_PADDING
+
+#define LTC_PBES
+
+#endif /* LTC_NO_MISC */
+
+/* cleanup */
+
+#ifdef LTC_MECC
+/* Supported ECC Key Sizes */
+#ifndef LTC_NO_CURVES
+   #define LTC_ECC_BRAINPOOLP160R1
+   #define LTC_ECC_BRAINPOOLP160T1
+   #define LTC_ECC_BRAINPOOLP192R1
+   #define LTC_ECC_BRAINPOOLP192T1
+   #define LTC_ECC_BRAINPOOLP224R1
+   #define LTC_ECC_BRAINPOOLP224T1
+   #define LTC_ECC_BRAINPOOLP256R1
+   #define LTC_ECC_BRAINPOOLP256T1
+   #define LTC_ECC_BRAINPOOLP320R1
+   #define LTC_ECC_BRAINPOOLP320T1
+   #define LTC_ECC_BRAINPOOLP384R1
+   #define LTC_ECC_BRAINPOOLP384T1
+   #define LTC_ECC_BRAINPOOLP512R1
+   #define LTC_ECC_BRAINPOOLP512T1
+   #define LTC_ECC_PRIME192V2
+   #define LTC_ECC_PRIME192V3
+   #define LTC_ECC_PRIME239V1
+   #define LTC_ECC_PRIME239V2
+   #define LTC_ECC_PRIME239V3
+   #define LTC_ECC_SECP112R1
+   #define LTC_ECC_SECP112R2
+   #define LTC_ECC_SECP128R1
+   #define LTC_ECC_SECP128R2
+   #define LTC_ECC_SECP160K1
+   #define LTC_ECC_SECP160R1
+   #define LTC_ECC_SECP160R2
+   #define LTC_ECC_SECP192K1
+   #define LTC_ECC_SECP192R1
+   #define LTC_ECC_SECP224K1
+   #define LTC_ECC_SECP224R1
+   #define LTC_ECC_SECP256K1
+   #define LTC_ECC_SECP256R1
+   #define LTC_ECC_SECP384R1
+   #define LTC_ECC_SECP521R1
+#endif
+#endif
+
+#if defined(LTC_DER)
+   #ifndef LTC_DER_MAX_RECURSION
+      /* Maximum recursion limit when processing nested ASN.1 types. */
+      #define LTC_DER_MAX_RECURSION 30
+   #endif
+#endif
+
+#if defined(LTC_MECC) || defined(LTC_MRSA) || defined(LTC_MDSA) || defined(LTC_SSH)
+   /* Include the MPI functionality?  (required by the PK algorithms) */
+   #define LTC_MPI
+
+   #ifndef LTC_PK_MAX_RETRIES
+      /* iterations limit for retry-loops */
+      #define LTC_PK_MAX_RETRIES  20
+   #endif
+#endif
+
+#ifdef LTC_MRSA
+   #define LTC_PKCS_1
+#endif
+
+#if defined(LTC_MRSA) || defined(LTC_MECC)
+   #define LTC_PKCS_8
+#endif
+
+#ifdef LTC_PKCS_8
+   #define LTC_PADDING
+   #define LTC_PBES
+#endif
+
+#if defined(LTC_PELICAN) && !defined(LTC_RIJNDAEL)
+   #error Pelican-MAC requires LTC_RIJNDAEL
+#endif
+
+#if defined(LTC_EAX_MODE) && !(defined(LTC_CTR_MODE) && defined(LTC_OMAC))
+   #error LTC_EAX_MODE requires CTR and LTC_OMAC mode
+#endif
+
+#if defined(LTC_YARROW) && !defined(LTC_CTR_MODE)
+   #error LTC_YARROW requires LTC_CTR_MODE chaining mode to be defined!
+#endif
+
+#if defined(LTC_DER) && !defined(LTC_MPI)
+   #error ASN.1 DER requires MPI functionality
+#endif
+
+#if (defined(LTC_MDSA) || defined(LTC_MRSA) || defined(LTC_MECC)) && !defined(LTC_DER)
+   #error PK requires ASN.1 DER functionality, make sure LTC_DER is enabled
+#endif
+
+#if defined(LTC_CHACHA20POLY1305_MODE) && (!defined(LTC_CHACHA) || !defined(LTC_POLY1305))
+   #error LTC_CHACHA20POLY1305_MODE requires LTC_CHACHA + LTC_POLY1305
+#endif
+
+#if defined(LTC_CHACHA20_PRNG) && !defined(LTC_CHACHA)
+   #error LTC_CHACHA20_PRNG requires LTC_CHACHA
+#endif
+
+#if defined(LTC_XSALSA20) && !defined(LTC_SALSA20)
+   #error LTC_XSALSA20 requires LTC_SALSA20
+#endif
+
+#if defined(LTC_RC4) && !defined(LTC_RC4_STREAM)
+   #error LTC_RC4 requires LTC_RC4_STREAM
+#endif
+
+#if defined(LTC_SOBER128) && !defined(LTC_SOBER128_STREAM)
+   #error LTC_SOBER128 requires LTC_SOBER128_STREAM
+#endif
+
+#if defined(LTC_BLAKE2SMAC) && !defined(LTC_BLAKE2S)
+   #error LTC_BLAKE2SMAC requires LTC_BLAKE2S
+#endif
+
+#if defined(LTC_BLAKE2BMAC) && !defined(LTC_BLAKE2B)
+   #error LTC_BLAKE2BMAC requires LTC_BLAKE2B
+#endif
+
+#if defined(LTC_SPRNG) && !defined(LTC_RNG_GET_BYTES)
+   #error LTC_SPRNG requires LTC_RNG_GET_BYTES
+#endif
+
+#if defined(LTC_NO_MATH) && (defined(LTM_DESC) || defined(TFM_DESC) || defined(GMP_DESC))
+   #error LTC_NO_MATH defined, but also a math descriptor
+#endif
+
+/* THREAD management */
+#ifdef LTC_PTHREAD
+
+#include <pthread.h>
+
+#define LTC_MUTEX_GLOBAL(x)   pthread_mutex_t x = PTHREAD_MUTEX_INITIALIZER;
+#define LTC_MUTEX_PROTO(x)    extern pthread_mutex_t x;
+#define LTC_MUTEX_TYPE(x)     pthread_mutex_t x;
+#define LTC_MUTEX_INIT(x)     LTC_ARGCHK(pthread_mutex_init(x, NULL) == 0);
+#define LTC_MUTEX_LOCK(x)     LTC_ARGCHK(pthread_mutex_lock(x) == 0);
+#define LTC_MUTEX_UNLOCK(x)   LTC_ARGCHK(pthread_mutex_unlock(x) == 0);
+#define LTC_MUTEX_DESTROY(x)  LTC_ARGCHK(pthread_mutex_destroy(x) == 0);
+
+#else
+
+/* default no functions */
+#define LTC_MUTEX_GLOBAL(x)
+#define LTC_MUTEX_PROTO(x)
+#define LTC_MUTEX_TYPE(x)
+#define LTC_MUTEX_INIT(x)
+#define LTC_MUTEX_LOCK(x)
+#define LTC_MUTEX_UNLOCK(x)
+#define LTC_MUTEX_DESTROY(x)
+
+#endif
+
+/* Debuggers */
+
+/* define this if you use Valgrind, note: it CHANGES the way SOBER-128 and RC4 work (see the code) */
+/* #define LTC_VALGRIND */
+
+#endif
+
+#ifndef LTC_NO_FILE
+   /* buffer size for reading from a file via fread(..) */
+   #ifndef LTC_FILE_READ_BUFSIZE
+   #define LTC_FILE_READ_BUFSIZE 8192
+   #endif
+#endif
+
+/* ECC backwards compatibility */
+#if !defined(LTC_ECC_SECP112R1) && defined(LTC_ECC112)
+#define LTC_ECC_SECP112R1
+#undef LTC_ECC112
+#endif
+#if !defined(LTC_ECC_SECP128R1) && defined(LTC_ECC128)
+#define LTC_ECC_SECP128R1
+#undef LTC_ECC128
+#endif
+#if !defined(LTC_ECC_SECP160R1) && defined(LTC_ECC160)
+#define LTC_ECC_SECP160R1
+#undef LTC_ECC160
+#endif
+#if !defined(LTC_ECC_SECP192R1) && defined(LTC_ECC192)
+#define LTC_ECC_SECP192R1
+#undef LTC_ECC192
+#endif
+#if !defined(LTC_ECC_SECP224R1) && defined(LTC_ECC224)
+#define LTC_ECC_SECP224R1
+#undef LTC_ECC224
+#endif
+#if !defined(LTC_ECC_SECP256R1) && defined(LTC_ECC256)
+#define LTC_ECC_SECP256R1
+#undef LTC_ECC256
+#endif
+#if !defined(LTC_ECC_SECP384R1) && defined(LTC_ECC384)
+#define LTC_ECC_SECP384R1
+#undef LTC_ECC384
+#endif
+#if !defined(LTC_ECC_SECP512R1) && defined(LTC_ECC521)
+#define LTC_ECC_SECP521R1
+#undef LTC_ECC521
+#endif
+
+/* ref:         HEAD -> develop */
+/* git commit:  a1f6312416ef6cd183ee62db58b640dc2d7ec1f4 */
+/* commit time: 2019-09-04 13:44:47 +0200 */

+ 512 - 0
libtomcrypt.mod/libtomcrypt/src/headers/tomcrypt_hash.h

@@ -0,0 +1,512 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ */
+
+/* ---- HASH FUNCTIONS ---- */
+#if defined(LTC_SHA3) || defined(LTC_KECCAK)
+struct sha3_state {
+    ulong64 saved;                  /* the portion of the input message that we didn't consume yet */
+    ulong64 s[25];
+    unsigned char sb[25 * 8];       /* used for storing `ulong64 s[25]` as little-endian bytes */
+    unsigned short byte_index;      /* 0..7--the next byte after the set one (starts from 0; 0--none are buffered) */
+    unsigned short word_index;      /* 0..24--the next word to integrate input (starts from 0) */
+    unsigned short capacity_words;  /* the double size of the hash output in words (e.g. 16 for Keccak 512) */
+    unsigned short xof_flag;
+};
+#endif
+
+#ifdef LTC_SHA512
+struct sha512_state {
+    ulong64  length, state[8];
+    unsigned long curlen;
+    unsigned char buf[128];
+};
+#endif
+
+#ifdef LTC_SHA256
+struct sha256_state {
+    ulong64 length;
+    ulong32 state[8], curlen;
+    unsigned char buf[64];
+};
+#endif
+
+#ifdef LTC_SHA1
+struct sha1_state {
+    ulong64 length;
+    ulong32 state[5], curlen;
+    unsigned char buf[64];
+};
+#endif
+
+#ifdef LTC_MD5
+struct md5_state {
+    ulong64 length;
+    ulong32 state[4], curlen;
+    unsigned char buf[64];
+};
+#endif
+
+#ifdef LTC_MD4
+struct md4_state {
+    ulong64 length;
+    ulong32 state[4], curlen;
+    unsigned char buf[64];
+};
+#endif
+
+#ifdef LTC_TIGER
+struct tiger_state {
+    ulong64 state[3], length;
+    unsigned long curlen;
+    unsigned char buf[64];
+};
+#endif
+
+#ifdef LTC_MD2
+struct md2_state {
+    unsigned char chksum[16], X[48], buf[16];
+    unsigned long curlen;
+};
+#endif
+
+#ifdef LTC_RIPEMD128
+struct rmd128_state {
+    ulong64 length;
+    unsigned char buf[64];
+    ulong32 curlen, state[4];
+};
+#endif
+
+#ifdef LTC_RIPEMD160
+struct rmd160_state {
+    ulong64 length;
+    unsigned char buf[64];
+    ulong32 curlen, state[5];
+};
+#endif
+
+#ifdef LTC_RIPEMD256
+struct rmd256_state {
+    ulong64 length;
+    unsigned char buf[64];
+    ulong32 curlen, state[8];
+};
+#endif
+
+#ifdef LTC_RIPEMD320
+struct rmd320_state {
+    ulong64 length;
+    unsigned char buf[64];
+    ulong32 curlen, state[10];
+};
+#endif
+
+#ifdef LTC_WHIRLPOOL
+struct whirlpool_state {
+    ulong64 length, state[8];
+    unsigned char buf[64];
+    ulong32 curlen;
+};
+#endif
+
+#ifdef LTC_CHC_HASH
+struct chc_state {
+    ulong64 length;
+    unsigned char state[MAXBLOCKSIZE], buf[MAXBLOCKSIZE];
+    ulong32 curlen;
+};
+#endif
+
+#ifdef LTC_BLAKE2S
+struct blake2s_state {
+    ulong32 h[8];
+    ulong32 t[2];
+    ulong32 f[2];
+    unsigned char buf[64];
+    unsigned long curlen;
+    unsigned long outlen;
+    unsigned char last_node;
+};
+#endif
+
+#ifdef LTC_BLAKE2B
+struct blake2b_state {
+    ulong64 h[8];
+    ulong64 t[2];
+    ulong64 f[2];
+    unsigned char buf[128];
+    unsigned long curlen;
+    unsigned long outlen;
+    unsigned char last_node;
+};
+#endif
+
+typedef union Hash_state {
+    char dummy[1];
+#ifdef LTC_CHC_HASH
+    struct chc_state chc;
+#endif
+#ifdef LTC_WHIRLPOOL
+    struct whirlpool_state whirlpool;
+#endif
+#if defined(LTC_SHA3) || defined(LTC_KECCAK)
+    struct sha3_state sha3;
+#endif
+#ifdef LTC_SHA512
+    struct sha512_state sha512;
+#endif
+#ifdef LTC_SHA256
+    struct sha256_state sha256;
+#endif
+#ifdef LTC_SHA1
+    struct sha1_state   sha1;
+#endif
+#ifdef LTC_MD5
+    struct md5_state    md5;
+#endif
+#ifdef LTC_MD4
+    struct md4_state    md4;
+#endif
+#ifdef LTC_MD2
+    struct md2_state    md2;
+#endif
+#ifdef LTC_TIGER
+    struct tiger_state  tiger;
+#endif
+#ifdef LTC_RIPEMD128
+    struct rmd128_state rmd128;
+#endif
+#ifdef LTC_RIPEMD160
+    struct rmd160_state rmd160;
+#endif
+#ifdef LTC_RIPEMD256
+    struct rmd256_state rmd256;
+#endif
+#ifdef LTC_RIPEMD320
+    struct rmd320_state rmd320;
+#endif
+#ifdef LTC_BLAKE2S
+    struct blake2s_state blake2s;
+#endif
+#ifdef LTC_BLAKE2B
+    struct blake2b_state blake2b;
+#endif
+
+    void *data;
+} hash_state;
+
+/** hash descriptor */
+extern  struct ltc_hash_descriptor {
+    /** name of hash */
+    const char *name;
+    /** internal ID */
+    unsigned char ID;
+    /** Size of digest in octets */
+    unsigned long hashsize;
+    /** Input block size in octets */
+    unsigned long blocksize;
+    /** ASN.1 OID */
+    unsigned long OID[16];
+    /** Length of DER encoding */
+    unsigned long OIDlen;
+
+    /** Init a hash state
+      @param hash   The hash to initialize
+      @return CRYPT_OK if successful
+    */
+    int (*init)(hash_state *hash);
+    /** Process a block of data
+      @param hash   The hash state
+      @param in     The data to hash
+      @param inlen  The length of the data (octets)
+      @return CRYPT_OK if successful
+    */
+    int (*process)(hash_state *hash, const unsigned char *in, unsigned long inlen);
+    /** Produce the digest and store it
+      @param hash   The hash state
+      @param out    [out] The destination of the digest
+      @return CRYPT_OK if successful
+    */
+    int (*done)(hash_state *hash, unsigned char *out);
+    /** Self-test
+      @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled
+    */
+    int (*test)(void);
+
+    /* accelerated hmac callback: if you need to-do multiple packets just use the generic hmac_memory and provide a hash callback */
+    int  (*hmac_block)(const unsigned char *key, unsigned long  keylen,
+                       const unsigned char *in,  unsigned long  inlen,
+                             unsigned char *out, unsigned long *outlen);
+
+} hash_descriptor[];
+
+#ifdef LTC_CHC_HASH
+int chc_register(int cipher);
+int chc_init(hash_state * md);
+int chc_process(hash_state * md, const unsigned char *in, unsigned long inlen);
+int chc_done(hash_state * md, unsigned char *out);
+int chc_test(void);
+extern const struct ltc_hash_descriptor chc_desc;
+#endif
+
+#ifdef LTC_WHIRLPOOL
+int whirlpool_init(hash_state * md);
+int whirlpool_process(hash_state * md, const unsigned char *in, unsigned long inlen);
+int whirlpool_done(hash_state * md, unsigned char *out);
+int whirlpool_test(void);
+extern const struct ltc_hash_descriptor whirlpool_desc;
+#endif
+
+#if defined(LTC_SHA3) || defined(LTC_KECCAK)
+/* sha3_NNN_init are shared by SHA3 and KECCAK */
+int sha3_512_init(hash_state * md);
+int sha3_384_init(hash_state * md);
+int sha3_256_init(hash_state * md);
+int sha3_224_init(hash_state * md);
+/* sha3_process is the same for all variants of SHA3 + KECCAK */
+int sha3_process(hash_state * md, const unsigned char *in, unsigned long inlen);
+#endif
+
+#ifdef LTC_SHA3
+int sha3_512_test(void);
+extern const struct ltc_hash_descriptor sha3_512_desc;
+int sha3_384_test(void);
+extern const struct ltc_hash_descriptor sha3_384_desc;
+int sha3_256_test(void);
+extern const struct ltc_hash_descriptor sha3_256_desc;
+int sha3_224_test(void);
+extern const struct ltc_hash_descriptor sha3_224_desc;
+int sha3_done(hash_state *md, unsigned char *out);
+/* SHAKE128 + SHAKE256 */
+int sha3_shake_init(hash_state *md, int num);
+#define sha3_shake_process(a,b,c) sha3_process(a,b,c)
+int sha3_shake_done(hash_state *md, unsigned char *out, unsigned long outlen);
+int sha3_shake_test(void);
+int sha3_shake_memory(int num, const unsigned char *in, unsigned long inlen, unsigned char *out, const unsigned long *outlen);
+#endif
+
+#ifdef LTC_KECCAK
+#define keccak_512_init(a)    sha3_512_init(a)
+#define keccak_384_init(a)    sha3_384_init(a)
+#define keccak_256_init(a)    sha3_256_init(a)
+#define keccak_224_init(a)    sha3_224_init(a)
+#define keccak_process(a,b,c) sha3_process(a,b,c)
+extern const struct ltc_hash_descriptor keccak_512_desc;
+int keccak_512_test(void);
+extern const struct ltc_hash_descriptor keccak_384_desc;
+int keccak_384_test(void);
+extern const struct ltc_hash_descriptor keccak_256_desc;
+int keccak_256_test(void);
+extern const struct ltc_hash_descriptor keccak_224_desc;
+int keccak_224_test(void);
+int keccak_done(hash_state *md, unsigned char *out);
+#endif
+
+#ifdef LTC_SHA512
+int sha512_init(hash_state * md);
+int sha512_process(hash_state * md, const unsigned char *in, unsigned long inlen);
+int sha512_done(hash_state * md, unsigned char *out);
+int sha512_test(void);
+extern const struct ltc_hash_descriptor sha512_desc;
+#endif
+
+#ifdef LTC_SHA384
+#ifndef LTC_SHA512
+   #error LTC_SHA512 is required for LTC_SHA384
+#endif
+int sha384_init(hash_state * md);
+#define sha384_process sha512_process
+int sha384_done(hash_state * md, unsigned char *out);
+int sha384_test(void);
+extern const struct ltc_hash_descriptor sha384_desc;
+#endif
+
+#ifdef LTC_SHA512_256
+#ifndef LTC_SHA512
+   #error LTC_SHA512 is required for LTC_SHA512_256
+#endif
+int sha512_256_init(hash_state * md);
+#define sha512_256_process sha512_process
+int sha512_256_done(hash_state * md, unsigned char *out);
+int sha512_256_test(void);
+extern const struct ltc_hash_descriptor sha512_256_desc;
+#endif
+
+#ifdef LTC_SHA512_224
+#ifndef LTC_SHA512
+   #error LTC_SHA512 is required for LTC_SHA512_224
+#endif
+int sha512_224_init(hash_state * md);
+#define sha512_224_process sha512_process
+int sha512_224_done(hash_state * md, unsigned char *out);
+int sha512_224_test(void);
+extern  const struct ltc_hash_descriptor sha512_224_desc;
+#endif
+
+#ifdef LTC_SHA256
+int sha256_init(hash_state * md);
+int sha256_process(hash_state * md, const unsigned char *in, unsigned long inlen);
+int sha256_done(hash_state * md, unsigned char *out);
+int sha256_test(void);
+extern const struct ltc_hash_descriptor sha256_desc;
+
+#ifdef LTC_SHA224
+#ifndef LTC_SHA256
+   #error LTC_SHA256 is required for LTC_SHA224
+#endif
+int sha224_init(hash_state * md);
+#define sha224_process sha256_process
+int sha224_done(hash_state * md, unsigned char *out);
+int sha224_test(void);
+extern const struct ltc_hash_descriptor sha224_desc;
+#endif
+#endif
+
+#ifdef LTC_SHA1
+int sha1_init(hash_state * md);
+int sha1_process(hash_state * md, const unsigned char *in, unsigned long inlen);
+int sha1_done(hash_state * md, unsigned char *out);
+int sha1_test(void);
+extern const struct ltc_hash_descriptor sha1_desc;
+#endif
+
+#ifdef LTC_BLAKE2S
+extern const struct ltc_hash_descriptor blake2s_256_desc;
+int blake2s_256_init(hash_state * md);
+int blake2s_256_test(void);
+
+extern const struct ltc_hash_descriptor blake2s_224_desc;
+int blake2s_224_init(hash_state * md);
+int blake2s_224_test(void);
+
+extern const struct ltc_hash_descriptor blake2s_160_desc;
+int blake2s_160_init(hash_state * md);
+int blake2s_160_test(void);
+
+extern const struct ltc_hash_descriptor blake2s_128_desc;
+int blake2s_128_init(hash_state * md);
+int blake2s_128_test(void);
+
+int blake2s_init(hash_state * md, unsigned long outlen, const unsigned char *key, unsigned long keylen);
+int blake2s_process(hash_state * md, const unsigned char *in, unsigned long inlen);
+int blake2s_done(hash_state * md, unsigned char *out);
+#endif
+
+#ifdef LTC_BLAKE2B
+extern const struct ltc_hash_descriptor blake2b_512_desc;
+int blake2b_512_init(hash_state * md);
+int blake2b_512_test(void);
+
+extern const struct ltc_hash_descriptor blake2b_384_desc;
+int blake2b_384_init(hash_state * md);
+int blake2b_384_test(void);
+
+extern const struct ltc_hash_descriptor blake2b_256_desc;
+int blake2b_256_init(hash_state * md);
+int blake2b_256_test(void);
+
+extern const struct ltc_hash_descriptor blake2b_160_desc;
+int blake2b_160_init(hash_state * md);
+int blake2b_160_test(void);
+
+int blake2b_init(hash_state * md, unsigned long outlen, const unsigned char *key, unsigned long keylen);
+int blake2b_process(hash_state * md, const unsigned char *in, unsigned long inlen);
+int blake2b_done(hash_state * md, unsigned char *out);
+#endif
+
+#ifdef LTC_MD5
+int md5_init(hash_state * md);
+int md5_process(hash_state * md, const unsigned char *in, unsigned long inlen);
+int md5_done(hash_state * md, unsigned char *out);
+int md5_test(void);
+extern const struct ltc_hash_descriptor md5_desc;
+#endif
+
+#ifdef LTC_MD4
+int md4_init(hash_state * md);
+int md4_process(hash_state * md, const unsigned char *in, unsigned long inlen);
+int md4_done(hash_state * md, unsigned char *out);
+int md4_test(void);
+extern const struct ltc_hash_descriptor md4_desc;
+#endif
+
+#ifdef LTC_MD2
+int md2_init(hash_state * md);
+int md2_process(hash_state * md, const unsigned char *in, unsigned long inlen);
+int md2_done(hash_state * md, unsigned char *out);
+int md2_test(void);
+extern const struct ltc_hash_descriptor md2_desc;
+#endif
+
+#ifdef LTC_TIGER
+int tiger_init(hash_state * md);
+int tiger_process(hash_state * md, const unsigned char *in, unsigned long inlen);
+int tiger_done(hash_state * md, unsigned char *out);
+int tiger_test(void);
+extern const struct ltc_hash_descriptor tiger_desc;
+#endif
+
+#ifdef LTC_RIPEMD128
+int rmd128_init(hash_state * md);
+int rmd128_process(hash_state * md, const unsigned char *in, unsigned long inlen);
+int rmd128_done(hash_state * md, unsigned char *out);
+int rmd128_test(void);
+extern const struct ltc_hash_descriptor rmd128_desc;
+#endif
+
+#ifdef LTC_RIPEMD160
+int rmd160_init(hash_state * md);
+int rmd160_process(hash_state * md, const unsigned char *in, unsigned long inlen);
+int rmd160_done(hash_state * md, unsigned char *out);
+int rmd160_test(void);
+extern const struct ltc_hash_descriptor rmd160_desc;
+#endif
+
+#ifdef LTC_RIPEMD256
+int rmd256_init(hash_state * md);
+int rmd256_process(hash_state * md, const unsigned char *in, unsigned long inlen);
+int rmd256_done(hash_state * md, unsigned char *out);
+int rmd256_test(void);
+extern const struct ltc_hash_descriptor rmd256_desc;
+#endif
+
+#ifdef LTC_RIPEMD320
+int rmd320_init(hash_state * md);
+int rmd320_process(hash_state * md, const unsigned char *in, unsigned long inlen);
+int rmd320_done(hash_state * md, unsigned char *out);
+int rmd320_test(void);
+extern const struct ltc_hash_descriptor rmd320_desc;
+#endif
+
+
+int find_hash(const char *name);
+int find_hash_id(unsigned char ID);
+int find_hash_oid(const unsigned long *ID, unsigned long IDlen);
+int find_hash_any(const char *name, int digestlen);
+int register_hash(const struct ltc_hash_descriptor *hash);
+int unregister_hash(const struct ltc_hash_descriptor *hash);
+int register_all_hashes(void);
+int hash_is_valid(int idx);
+
+LTC_MUTEX_PROTO(ltc_hash_mutex)
+
+int hash_memory(int hash,
+                const unsigned char *in,  unsigned long inlen,
+                      unsigned char *out, unsigned long *outlen);
+int hash_memory_multi(int hash, unsigned char *out, unsigned long *outlen,
+                      const unsigned char *in, unsigned long inlen, ...);
+
+#ifndef LTC_NO_FILE
+int hash_filehandle(int hash, FILE *in, unsigned char *out, unsigned long *outlen);
+int hash_file(int hash, const char *fname, unsigned char *out, unsigned long *outlen);
+#endif
+
+/* ref:         HEAD -> develop */
+/* git commit:  a1f6312416ef6cd183ee62db58b640dc2d7ec1f4 */
+/* commit time: 2019-09-04 13:44:47 +0200 */

+ 564 - 0
libtomcrypt.mod/libtomcrypt/src/headers/tomcrypt_mac.h

@@ -0,0 +1,564 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ */
+
+#ifdef LTC_HMAC
+typedef struct Hmac_state {
+     hash_state     md;
+     int            hash;
+     hash_state     hashstate;
+     unsigned char  key[MAXBLOCKSIZE];
+} hmac_state;
+
+int hmac_init(hmac_state *hmac, int hash, const unsigned char *key, unsigned long keylen);
+int hmac_process(hmac_state *hmac, const unsigned char *in, unsigned long inlen);
+int hmac_done(hmac_state *hmac, unsigned char *out, unsigned long *outlen);
+int hmac_test(void);
+int hmac_memory(int hash,
+                const unsigned char *key, unsigned long keylen,
+                const unsigned char *in,  unsigned long inlen,
+                      unsigned char *out, unsigned long *outlen);
+int hmac_memory_multi(int hash,
+                const unsigned char *key,  unsigned long keylen,
+                      unsigned char *out,  unsigned long *outlen,
+                const unsigned char *in,   unsigned long inlen, ...);
+int hmac_file(int hash, const char *fname, const unsigned char *key,
+              unsigned long keylen,
+              unsigned char *out, unsigned long *outlen);
+#endif
+
+#ifdef LTC_OMAC
+
+typedef struct {
+   int             cipher_idx,
+                   buflen,
+                   blklen;
+   unsigned char   block[MAXBLOCKSIZE],
+                   prev[MAXBLOCKSIZE],
+                   Lu[2][MAXBLOCKSIZE];
+   symmetric_key   key;
+} omac_state;
+
+int omac_init(omac_state *omac, int cipher, const unsigned char *key, unsigned long keylen);
+int omac_process(omac_state *omac, const unsigned char *in, unsigned long inlen);
+int omac_done(omac_state *omac, unsigned char *out, unsigned long *outlen);
+int omac_memory(int cipher,
+               const unsigned char *key, unsigned long keylen,
+               const unsigned char *in,  unsigned long inlen,
+                     unsigned char *out, unsigned long *outlen);
+int omac_memory_multi(int cipher,
+                const unsigned char *key, unsigned long keylen,
+                      unsigned char *out, unsigned long *outlen,
+                const unsigned char *in,  unsigned long inlen, ...);
+int omac_file(int cipher,
+              const unsigned char *key, unsigned long keylen,
+              const          char *filename,
+                    unsigned char *out, unsigned long *outlen);
+int omac_test(void);
+#endif /* LTC_OMAC */
+
+#ifdef LTC_PMAC
+
+typedef struct {
+   unsigned char     Ls[32][MAXBLOCKSIZE],    /* L shifted by i bits to the left */
+                     Li[MAXBLOCKSIZE],        /* value of Li [current value, we calc from previous recall] */
+                     Lr[MAXBLOCKSIZE],        /* L * x^-1 */
+                     block[MAXBLOCKSIZE],     /* currently accumulated block */
+                     checksum[MAXBLOCKSIZE];  /* current checksum */
+
+   symmetric_key     key;                     /* scheduled key for cipher */
+   unsigned long     block_index;             /* index # for current block */
+   int               cipher_idx,              /* cipher idx */
+                     block_len,               /* length of block */
+                     buflen;                  /* number of bytes in the buffer */
+} pmac_state;
+
+int pmac_init(pmac_state *pmac, int cipher, const unsigned char *key, unsigned long keylen);
+int pmac_process(pmac_state *pmac, const unsigned char *in, unsigned long inlen);
+int pmac_done(pmac_state *pmac, unsigned char *out, unsigned long *outlen);
+
+int pmac_memory(int cipher,
+               const unsigned char *key, unsigned long keylen,
+               const unsigned char *in, unsigned long inlen,
+                     unsigned char *out, unsigned long *outlen);
+
+int pmac_memory_multi(int cipher,
+                const unsigned char *key, unsigned long keylen,
+                      unsigned char *out, unsigned long *outlen,
+                const unsigned char *in, unsigned long inlen, ...);
+
+int pmac_file(int cipher,
+             const unsigned char *key, unsigned long keylen,
+             const          char *filename,
+                   unsigned char *out, unsigned long *outlen);
+
+int pmac_test(void);
+
+/* internal functions */
+int pmac_ntz(unsigned long x);
+void pmac_shift_xor(pmac_state *pmac);
+
+#endif /* PMAC */
+
+#ifdef LTC_POLY1305
+typedef struct {
+   ulong32 r[5];
+   ulong32 h[5];
+   ulong32 pad[4];
+   unsigned long leftover;
+   unsigned char buffer[16];
+   int final;
+} poly1305_state;
+
+int poly1305_init(poly1305_state *st, const unsigned char *key, unsigned long keylen);
+int poly1305_process(poly1305_state *st, const unsigned char *in, unsigned long inlen);
+int poly1305_done(poly1305_state *st, unsigned char *mac, unsigned long *maclen);
+int poly1305_memory(const unsigned char *key, unsigned long keylen, const unsigned char *in, unsigned long inlen, unsigned char *mac, unsigned long *maclen);
+int poly1305_memory_multi(const unsigned char *key, unsigned long keylen, unsigned char *mac, unsigned long *maclen, const unsigned char *in,  unsigned long inlen, ...);
+int poly1305_file(const char *fname, const unsigned char *key, unsigned long keylen, unsigned char *mac, unsigned long *maclen);
+int poly1305_test(void);
+#endif /* LTC_POLY1305 */
+
+#ifdef LTC_BLAKE2SMAC
+typedef hash_state blake2smac_state;
+int blake2smac_init(blake2smac_state *st, unsigned long outlen, const unsigned char *key, unsigned long keylen);
+int blake2smac_process(blake2smac_state *st, const unsigned char *in, unsigned long inlen);
+int blake2smac_done(blake2smac_state *st, unsigned char *mac, unsigned long *maclen);
+int blake2smac_memory(const unsigned char *key, unsigned long keylen, const unsigned char *in, unsigned long inlen, unsigned char *mac, unsigned long *maclen);
+int blake2smac_memory_multi(const unsigned char *key, unsigned long keylen, unsigned char *mac, unsigned long *maclen, const unsigned char *in,  unsigned long inlen, ...);
+int blake2smac_file(const char *fname, const unsigned char *key, unsigned long keylen, unsigned char *mac, unsigned long *maclen);
+int blake2smac_test(void);
+#endif /* LTC_BLAKE2SMAC */
+
+#ifdef LTC_BLAKE2BMAC
+typedef hash_state blake2bmac_state;
+int blake2bmac_init(blake2bmac_state *st, unsigned long outlen, const unsigned char *key, unsigned long keylen);
+int blake2bmac_process(blake2bmac_state *st, const unsigned char *in, unsigned long inlen);
+int blake2bmac_done(blake2bmac_state *st, unsigned char *mac, unsigned long *maclen);
+int blake2bmac_memory(const unsigned char *key, unsigned long keylen, const unsigned char *in, unsigned long inlen, unsigned char *mac, unsigned long *maclen);
+int blake2bmac_memory_multi(const unsigned char *key, unsigned long keylen, unsigned char *mac, unsigned long *maclen, const unsigned char *in,  unsigned long inlen, ...);
+int blake2bmac_file(const char *fname, const unsigned char *key, unsigned long keylen, unsigned char *mac, unsigned long *maclen);
+int blake2bmac_test(void);
+#endif /* LTC_BLAKE2BMAC */
+
+
+#ifdef LTC_PELICAN
+
+typedef struct pelican_state
+{
+    symmetric_key K;
+    unsigned char state[16];
+    int           buflen;
+} pelican_state;
+
+int pelican_init(pelican_state *pelmac, const unsigned char *key, unsigned long keylen);
+int pelican_process(pelican_state *pelmac, const unsigned char *in, unsigned long inlen);
+int pelican_done(pelican_state *pelmac, unsigned char *out);
+int pelican_test(void);
+
+int pelican_memory(const unsigned char *key, unsigned long keylen,
+                   const unsigned char *in, unsigned long inlen,
+                         unsigned char *out);
+
+#endif
+
+#ifdef LTC_XCBC
+
+/* add this to "keylen" to xcbc_init to use a pure three-key XCBC MAC */
+#define LTC_XCBC_PURE  0x8000UL
+
+typedef struct {
+   unsigned char K[3][MAXBLOCKSIZE],
+                 IV[MAXBLOCKSIZE];
+
+   symmetric_key key;
+
+             int cipher,
+                 buflen,
+                 blocksize;
+} xcbc_state;
+
+int xcbc_init(xcbc_state *xcbc, int cipher, const unsigned char *key, unsigned long keylen);
+int xcbc_process(xcbc_state *xcbc, const unsigned char *in, unsigned long inlen);
+int xcbc_done(xcbc_state *xcbc, unsigned char *out, unsigned long *outlen);
+int xcbc_memory(int cipher,
+               const unsigned char *key, unsigned long keylen,
+               const unsigned char *in,  unsigned long inlen,
+                     unsigned char *out, unsigned long *outlen);
+int xcbc_memory_multi(int cipher,
+                const unsigned char *key, unsigned long keylen,
+                      unsigned char *out, unsigned long *outlen,
+                const unsigned char *in,  unsigned long inlen, ...);
+int xcbc_file(int cipher,
+              const unsigned char *key, unsigned long keylen,
+              const          char *filename,
+                    unsigned char *out, unsigned long *outlen);
+int xcbc_test(void);
+
+#endif
+
+#ifdef LTC_F9_MODE
+
+typedef struct {
+   unsigned char akey[MAXBLOCKSIZE],
+                 ACC[MAXBLOCKSIZE],
+                 IV[MAXBLOCKSIZE];
+
+   symmetric_key key;
+
+             int cipher,
+                 buflen,
+                 keylen,
+                 blocksize;
+} f9_state;
+
+int f9_init(f9_state *f9, int cipher, const unsigned char *key, unsigned long keylen);
+int f9_process(f9_state *f9, const unsigned char *in, unsigned long inlen);
+int f9_done(f9_state *f9, unsigned char *out, unsigned long *outlen);
+int f9_memory(int cipher,
+               const unsigned char *key, unsigned long keylen,
+               const unsigned char *in,  unsigned long inlen,
+                     unsigned char *out, unsigned long *outlen);
+int f9_memory_multi(int cipher,
+                const unsigned char *key, unsigned long keylen,
+                      unsigned char *out, unsigned long *outlen,
+                const unsigned char *in,  unsigned long inlen, ...);
+int f9_file(int cipher,
+              const unsigned char *key, unsigned long keylen,
+              const          char *fname,
+                    unsigned char *out, unsigned long *outlen);
+int f9_test(void);
+
+#endif
+
+/*
+ * ENC+AUTH modes
+ */
+
+#ifdef LTC_EAX_MODE
+
+#if !(defined(LTC_OMAC) && defined(LTC_CTR_MODE))
+   #error LTC_EAX_MODE requires LTC_OMAC and CTR
+#endif
+
+typedef struct {
+   unsigned char N[MAXBLOCKSIZE];
+   symmetric_CTR ctr;
+   omac_state    headeromac, ctomac;
+} eax_state;
+
+int eax_init(eax_state *eax, int cipher, const unsigned char *key, unsigned long keylen,
+             const unsigned char *nonce, unsigned long noncelen,
+             const unsigned char *header, unsigned long headerlen);
+
+int eax_encrypt(eax_state *eax, const unsigned char *pt, unsigned char *ct, unsigned long length);
+int eax_decrypt(eax_state *eax, const unsigned char *ct, unsigned char *pt, unsigned long length);
+int eax_addheader(eax_state *eax, const unsigned char *header, unsigned long length);
+int eax_done(eax_state *eax, unsigned char *tag, unsigned long *taglen);
+
+int eax_encrypt_authenticate_memory(int cipher,
+    const unsigned char *key,    unsigned long keylen,
+    const unsigned char *nonce,  unsigned long noncelen,
+    const unsigned char *header, unsigned long headerlen,
+    const unsigned char *pt,     unsigned long ptlen,
+          unsigned char *ct,
+          unsigned char *tag,    unsigned long *taglen);
+
+int eax_decrypt_verify_memory(int cipher,
+    const unsigned char *key,    unsigned long keylen,
+    const unsigned char *nonce,  unsigned long noncelen,
+    const unsigned char *header, unsigned long headerlen,
+    const unsigned char *ct,     unsigned long ctlen,
+          unsigned char *pt,
+    const unsigned char *tag,    unsigned long taglen,
+          int           *stat);
+
+ int eax_test(void);
+#endif /* EAX MODE */
+
+#ifdef LTC_OCB_MODE
+typedef struct {
+   unsigned char     L[MAXBLOCKSIZE],         /* L value */
+                     Ls[32][MAXBLOCKSIZE],    /* L shifted by i bits to the left */
+                     Li[MAXBLOCKSIZE],        /* value of Li [current value, we calc from previous recall] */
+                     Lr[MAXBLOCKSIZE],        /* L * x^-1 */
+                     R[MAXBLOCKSIZE],         /* R value */
+                     checksum[MAXBLOCKSIZE];  /* current checksum */
+
+   symmetric_key     key;                     /* scheduled key for cipher */
+   unsigned long     block_index;             /* index # for current block */
+   int               cipher,                  /* cipher idx */
+                     block_len;               /* length of block */
+} ocb_state;
+
+int ocb_init(ocb_state *ocb, int cipher,
+             const unsigned char *key, unsigned long keylen, const unsigned char *nonce);
+
+int ocb_encrypt(ocb_state *ocb, const unsigned char *pt, unsigned char *ct);
+int ocb_decrypt(ocb_state *ocb, const unsigned char *ct, unsigned char *pt);
+
+int ocb_done_encrypt(ocb_state *ocb,
+                     const unsigned char *pt,  unsigned long ptlen,
+                           unsigned char *ct,
+                           unsigned char *tag, unsigned long *taglen);
+
+int ocb_done_decrypt(ocb_state *ocb,
+                     const unsigned char *ct,  unsigned long ctlen,
+                           unsigned char *pt,
+                     const unsigned char *tag, unsigned long taglen, int *stat);
+
+int ocb_encrypt_authenticate_memory(int cipher,
+    const unsigned char *key,    unsigned long keylen,
+    const unsigned char *nonce,
+    const unsigned char *pt,     unsigned long ptlen,
+          unsigned char *ct,
+          unsigned char *tag,    unsigned long *taglen);
+
+int ocb_decrypt_verify_memory(int cipher,
+    const unsigned char *key,    unsigned long keylen,
+    const unsigned char *nonce,
+    const unsigned char *ct,     unsigned long ctlen,
+          unsigned char *pt,
+    const unsigned char *tag,    unsigned long taglen,
+          int           *stat);
+
+int ocb_test(void);
+
+/* internal functions */
+void ocb_shift_xor(ocb_state *ocb, unsigned char *Z);
+int ocb_ntz(unsigned long x);
+int s_ocb_done(ocb_state *ocb, const unsigned char *pt, unsigned long ptlen,
+               unsigned char *ct, unsigned char *tag, unsigned long *taglen, int mode);
+
+#endif /* LTC_OCB_MODE */
+
+#ifdef LTC_OCB3_MODE
+typedef struct {
+   unsigned char     Offset_0[MAXBLOCKSIZE],       /* Offset_0 value */
+                     Offset_current[MAXBLOCKSIZE], /* Offset_{current_block_index} value */
+                     L_dollar[MAXBLOCKSIZE],       /* L_$ value */
+                     L_star[MAXBLOCKSIZE],         /* L_* value */
+                     L_[32][MAXBLOCKSIZE],         /* L_{i} values */
+                     tag_part[MAXBLOCKSIZE],       /* intermediate result of tag calculation */
+                     checksum[MAXBLOCKSIZE];       /* current checksum */
+
+   /* AAD related members */
+   unsigned char     aSum_current[MAXBLOCKSIZE],    /* AAD related helper variable */
+                     aOffset_current[MAXBLOCKSIZE], /* AAD related helper variable */
+                     adata_buffer[MAXBLOCKSIZE];    /* AAD buffer */
+   int               adata_buffer_bytes;            /* bytes in AAD buffer */
+   unsigned long     ablock_index;                  /* index # for current adata (AAD) block */
+
+   symmetric_key     key;                     /* scheduled key for cipher */
+   unsigned long     block_index;             /* index # for current data block */
+   int               cipher,                  /* cipher idx */
+                     tag_len,                 /* length of tag */
+                     block_len;               /* length of block */
+} ocb3_state;
+
+int ocb3_init(ocb3_state *ocb, int cipher,
+             const unsigned char *key, unsigned long keylen,
+             const unsigned char *nonce, unsigned long noncelen,
+             unsigned long taglen);
+
+int ocb3_encrypt(ocb3_state *ocb, const unsigned char *pt, unsigned long ptlen, unsigned char *ct);
+int ocb3_decrypt(ocb3_state *ocb, const unsigned char *ct, unsigned long ctlen, unsigned char *pt);
+int ocb3_encrypt_last(ocb3_state *ocb, const unsigned char *pt, unsigned long ptlen, unsigned char *ct);
+int ocb3_decrypt_last(ocb3_state *ocb, const unsigned char *ct, unsigned long ctlen, unsigned char *pt);
+int ocb3_add_aad(ocb3_state *ocb, const unsigned char *aad, unsigned long aadlen);
+int ocb3_done(ocb3_state *ocb, unsigned char *tag, unsigned long *taglen);
+
+int ocb3_encrypt_authenticate_memory(int cipher,
+    const unsigned char *key,    unsigned long keylen,
+    const unsigned char *nonce,  unsigned long noncelen,
+    const unsigned char *adata,  unsigned long adatalen,
+    const unsigned char *pt,     unsigned long ptlen,
+          unsigned char *ct,
+          unsigned char *tag,    unsigned long *taglen);
+
+int ocb3_decrypt_verify_memory(int cipher,
+    const unsigned char *key,    unsigned long keylen,
+    const unsigned char *nonce,  unsigned long noncelen,
+    const unsigned char *adata,  unsigned long adatalen,
+    const unsigned char *ct,     unsigned long ctlen,
+          unsigned char *pt,
+    const unsigned char *tag,    unsigned long taglen,
+          int           *stat);
+
+int ocb3_test(void);
+
+#endif /* LTC_OCB3_MODE */
+
+#ifdef LTC_CCM_MODE
+
+#define CCM_ENCRYPT LTC_ENCRYPT
+#define CCM_DECRYPT LTC_DECRYPT
+
+typedef struct {
+   symmetric_key       K;
+   int                 cipher,               /* which cipher */
+                       taglen,               /* length of the tag */
+                       x;                    /* index in PAD */
+
+   unsigned long       L,                    /* L value */
+                       ptlen,                /* length that will be enc / dec */
+                       current_ptlen,        /* current processed length */
+                       aadlen,               /* length of the aad */
+                       current_aadlen,       /* length of the currently provided add */
+                       noncelen;             /* length of the nonce */
+
+   unsigned char       PAD[16],
+                       ctr[16],
+                       CTRPAD[16],
+                       CTRlen;
+} ccm_state;
+
+int ccm_init(ccm_state *ccm, int cipher,
+             const unsigned char *key, int keylen, int ptlen, int taglen, int aadlen);
+
+int ccm_reset(ccm_state *ccm);
+
+int ccm_add_nonce(ccm_state *ccm,
+                  const unsigned char *nonce,     unsigned long noncelen);
+
+int ccm_add_aad(ccm_state *ccm,
+                const unsigned char *adata,  unsigned long adatalen);
+
+int ccm_process(ccm_state *ccm,
+                unsigned char *pt,     unsigned long ptlen,
+                unsigned char *ct,
+                int direction);
+
+int ccm_done(ccm_state *ccm,
+             unsigned char *tag,    unsigned long *taglen);
+
+int ccm_memory(int cipher,
+    const unsigned char *key,    unsigned long keylen,
+    symmetric_key       *uskey,
+    const unsigned char *nonce,  unsigned long noncelen,
+    const unsigned char *header, unsigned long headerlen,
+          unsigned char *pt,     unsigned long ptlen,
+          unsigned char *ct,
+          unsigned char *tag,    unsigned long *taglen,
+                    int  direction);
+
+int ccm_test(void);
+
+#endif /* LTC_CCM_MODE */
+
+#if defined(LRW_MODE) || defined(LTC_GCM_MODE)
+void gcm_gf_mult(const unsigned char *a, const unsigned char *b, unsigned char *c);
+#endif
+
+
+/* table shared between GCM and LRW */
+#if defined(LTC_GCM_TABLES) || defined(LTC_LRW_TABLES) || ((defined(LTC_GCM_MODE) || defined(LTC_GCM_MODE)) && defined(LTC_FAST))
+extern const unsigned char gcm_shift_table[];
+#endif
+
+#ifdef LTC_GCM_MODE
+
+#define GCM_ENCRYPT LTC_ENCRYPT
+#define GCM_DECRYPT LTC_DECRYPT
+
+#define LTC_GCM_MODE_IV    0
+#define LTC_GCM_MODE_AAD   1
+#define LTC_GCM_MODE_TEXT  2
+
+typedef struct {
+   symmetric_key       K;
+   unsigned char       H[16],        /* multiplier */
+                       X[16],        /* accumulator */
+                       Y[16],        /* counter */
+                       Y_0[16],      /* initial counter */
+                       buf[16];      /* buffer for stuff */
+
+   int                 cipher,       /* which cipher */
+                       ivmode,       /* Which mode is the IV in? */
+                       mode,         /* mode the GCM code is in */
+                       buflen;       /* length of data in buf */
+
+   ulong64             totlen,       /* 64-bit counter used for IV and AAD */
+                       pttotlen;     /* 64-bit counter for the PT */
+
+#ifdef LTC_GCM_TABLES
+   unsigned char       PC[16][256][16]  /* 16 tables of 8x128 */
+#ifdef LTC_GCM_TABLES_SSE2
+__attribute__ ((aligned (16)))
+#endif
+;
+#endif
+} gcm_state;
+
+void gcm_mult_h(const gcm_state *gcm, unsigned char *I);
+
+int gcm_init(gcm_state *gcm, int cipher,
+             const unsigned char *key, int keylen);
+
+int gcm_reset(gcm_state *gcm);
+
+int gcm_add_iv(gcm_state *gcm,
+               const unsigned char *IV,     unsigned long IVlen);
+
+int gcm_add_aad(gcm_state *gcm,
+               const unsigned char *adata,  unsigned long adatalen);
+
+int gcm_process(gcm_state *gcm,
+                     unsigned char *pt,     unsigned long ptlen,
+                     unsigned char *ct,
+                     int direction);
+
+int gcm_done(gcm_state *gcm,
+                     unsigned char *tag,    unsigned long *taglen);
+
+int gcm_memory(      int           cipher,
+               const unsigned char *key,    unsigned long keylen,
+               const unsigned char *IV,     unsigned long IVlen,
+               const unsigned char *adata,  unsigned long adatalen,
+                     unsigned char *pt,     unsigned long ptlen,
+                     unsigned char *ct,
+                     unsigned char *tag,    unsigned long *taglen,
+                               int direction);
+int gcm_test(void);
+
+#endif /* LTC_GCM_MODE */
+
+#ifdef LTC_CHACHA20POLY1305_MODE
+
+typedef struct {
+   poly1305_state poly;
+   chacha_state chacha;
+   ulong64 aadlen;
+   ulong64 ctlen;
+   int aadflg;
+} chacha20poly1305_state;
+
+#define CHACHA20POLY1305_ENCRYPT LTC_ENCRYPT
+#define CHACHA20POLY1305_DECRYPT LTC_DECRYPT
+
+int chacha20poly1305_init(chacha20poly1305_state *st, const unsigned char *key, unsigned long keylen);
+int chacha20poly1305_setiv(chacha20poly1305_state *st, const unsigned char *iv, unsigned long ivlen);
+int chacha20poly1305_setiv_rfc7905(chacha20poly1305_state *st, const unsigned char *iv, unsigned long ivlen, ulong64 sequence_number);
+int chacha20poly1305_add_aad(chacha20poly1305_state *st, const unsigned char *in, unsigned long inlen);
+int chacha20poly1305_encrypt(chacha20poly1305_state *st, const unsigned char *in, unsigned long inlen, unsigned char *out);
+int chacha20poly1305_decrypt(chacha20poly1305_state *st, const unsigned char *in, unsigned long inlen, unsigned char *out);
+int chacha20poly1305_done(chacha20poly1305_state *st, unsigned char *tag, unsigned long *taglen);
+int chacha20poly1305_memory(const unsigned char *key, unsigned long keylen,
+                            const unsigned char *iv,  unsigned long ivlen,
+                            const unsigned char *aad, unsigned long aadlen,
+                            const unsigned char *in,  unsigned long inlen,
+                                  unsigned char *out,
+                                  unsigned char *tag, unsigned long *taglen,
+                            int direction);
+int chacha20poly1305_test(void);
+
+#endif /* LTC_CHACHA20POLY1305_MODE */
+
+/* ref:         HEAD -> develop */
+/* git commit:  a1f6312416ef6cd183ee62db58b640dc2d7ec1f4 */
+/* commit time: 2019-09-04 13:44:47 +0200 */

+ 439 - 0
libtomcrypt.mod/libtomcrypt/src/headers/tomcrypt_macros.h

@@ -0,0 +1,439 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ */
+
+/* ---- HELPER MACROS ---- */
+#ifdef ENDIAN_NEUTRAL
+
+#define STORE32L(x, y)                                                                     \
+  do { (y)[3] = (unsigned char)(((x)>>24)&255); (y)[2] = (unsigned char)(((x)>>16)&255);   \
+       (y)[1] = (unsigned char)(((x)>>8)&255); (y)[0] = (unsigned char)((x)&255); } while(0)
+
+#define LOAD32L(x, y)                            \
+  do { x = ((ulong32)((y)[3] & 255)<<24) | \
+           ((ulong32)((y)[2] & 255)<<16) | \
+           ((ulong32)((y)[1] & 255)<<8)  | \
+           ((ulong32)((y)[0] & 255)); } while(0)
+
+#define STORE64L(x, y)                                                                     \
+  do { (y)[7] = (unsigned char)(((x)>>56)&255); (y)[6] = (unsigned char)(((x)>>48)&255);   \
+       (y)[5] = (unsigned char)(((x)>>40)&255); (y)[4] = (unsigned char)(((x)>>32)&255);   \
+       (y)[3] = (unsigned char)(((x)>>24)&255); (y)[2] = (unsigned char)(((x)>>16)&255);   \
+       (y)[1] = (unsigned char)(((x)>>8)&255); (y)[0] = (unsigned char)((x)&255); } while(0)
+
+#define LOAD64L(x, y)                                                       \
+  do { x = (((ulong64)((y)[7] & 255))<<56)|(((ulong64)((y)[6] & 255))<<48)| \
+           (((ulong64)((y)[5] & 255))<<40)|(((ulong64)((y)[4] & 255))<<32)| \
+           (((ulong64)((y)[3] & 255))<<24)|(((ulong64)((y)[2] & 255))<<16)| \
+           (((ulong64)((y)[1] & 255))<<8)|(((ulong64)((y)[0] & 255))); } while(0)
+
+#define STORE32H(x, y)                                                                     \
+  do { (y)[0] = (unsigned char)(((x)>>24)&255); (y)[1] = (unsigned char)(((x)>>16)&255);   \
+       (y)[2] = (unsigned char)(((x)>>8)&255); (y)[3] = (unsigned char)((x)&255); } while(0)
+
+#define LOAD32H(x, y)                            \
+  do { x = ((ulong32)((y)[0] & 255)<<24) | \
+           ((ulong32)((y)[1] & 255)<<16) | \
+           ((ulong32)((y)[2] & 255)<<8)  | \
+           ((ulong32)((y)[3] & 255)); } while(0)
+
+#define STORE64H(x, y)                                                                     \
+do { (y)[0] = (unsigned char)(((x)>>56)&255); (y)[1] = (unsigned char)(((x)>>48)&255);     \
+     (y)[2] = (unsigned char)(((x)>>40)&255); (y)[3] = (unsigned char)(((x)>>32)&255);     \
+     (y)[4] = (unsigned char)(((x)>>24)&255); (y)[5] = (unsigned char)(((x)>>16)&255);     \
+     (y)[6] = (unsigned char)(((x)>>8)&255); (y)[7] = (unsigned char)((x)&255); } while(0)
+
+#define LOAD64H(x, y)                                                      \
+do { x = (((ulong64)((y)[0] & 255))<<56)|(((ulong64)((y)[1] & 255))<<48) | \
+         (((ulong64)((y)[2] & 255))<<40)|(((ulong64)((y)[3] & 255))<<32) | \
+         (((ulong64)((y)[4] & 255))<<24)|(((ulong64)((y)[5] & 255))<<16) | \
+         (((ulong64)((y)[6] & 255))<<8)|(((ulong64)((y)[7] & 255))); } while(0)
+
+
+#elif defined(ENDIAN_LITTLE)
+
+#ifdef LTC_HAVE_BSWAP_BUILTIN
+
+#define STORE32H(x, y)                          \
+do { ulong32 __t = __builtin_bswap32 ((x));     \
+      XMEMCPY ((y), &__t, 4); } while(0)
+
+#define LOAD32H(x, y)                           \
+do { XMEMCPY (&(x), (y), 4);                    \
+      (x) = __builtin_bswap32 ((x)); } while(0)
+
+#elif !defined(LTC_NO_BSWAP) && (defined(INTEL_CC) || (defined(__GNUC__) && (defined(__DJGPP__) || defined(__CYGWIN__) || defined(__MINGW32__) || defined(__i386__) || defined(__x86_64__))))
+
+#define STORE32H(x, y)           \
+asm __volatile__ (               \
+   "bswapl %0     \n\t"          \
+   "movl   %0,(%1)\n\t"          \
+   "bswapl %0     \n\t"          \
+      ::"r"(x), "r"(y));
+
+#define LOAD32H(x, y)          \
+asm __volatile__ (             \
+   "movl (%1),%0\n\t"          \
+   "bswapl %0\n\t"             \
+   :"=r"(x): "r"(y));
+
+#else
+
+#define STORE32H(x, y)                                                                     \
+  do { (y)[0] = (unsigned char)(((x)>>24)&255); (y)[1] = (unsigned char)(((x)>>16)&255);   \
+       (y)[2] = (unsigned char)(((x)>>8)&255); (y)[3] = (unsigned char)((x)&255); } while(0)
+
+#define LOAD32H(x, y)                            \
+  do { x = ((ulong32)((y)[0] & 255)<<24) | \
+           ((ulong32)((y)[1] & 255)<<16) | \
+           ((ulong32)((y)[2] & 255)<<8)  | \
+           ((ulong32)((y)[3] & 255)); } while(0)
+
+#endif
+
+#ifdef LTC_HAVE_BSWAP_BUILTIN
+
+#define STORE64H(x, y)                          \
+do { ulong64 __t = __builtin_bswap64 ((x));     \
+      XMEMCPY ((y), &__t, 8); } while(0)
+
+#define LOAD64H(x, y)                           \
+do { XMEMCPY (&(x), (y), 8);                    \
+      (x) = __builtin_bswap64 ((x)); } while(0)
+
+/* x86_64 processor */
+#elif !defined(LTC_NO_BSWAP) && (defined(__GNUC__) && defined(__x86_64__))
+
+#define STORE64H(x, y)           \
+asm __volatile__ (               \
+   "bswapq %0     \n\t"          \
+   "movq   %0,(%1)\n\t"          \
+   "bswapq %0     \n\t"          \
+   ::"r"(x), "r"(y): "memory");
+
+#define LOAD64H(x, y)          \
+asm __volatile__ (             \
+   "movq (%1),%0\n\t"          \
+   "bswapq %0\n\t"             \
+   :"=r"(x): "r"(y): "memory");
+
+#else
+
+#define STORE64H(x, y)                                                                     \
+do { (y)[0] = (unsigned char)(((x)>>56)&255); (y)[1] = (unsigned char)(((x)>>48)&255);     \
+     (y)[2] = (unsigned char)(((x)>>40)&255); (y)[3] = (unsigned char)(((x)>>32)&255);     \
+     (y)[4] = (unsigned char)(((x)>>24)&255); (y)[5] = (unsigned char)(((x)>>16)&255);     \
+     (y)[6] = (unsigned char)(((x)>>8)&255); (y)[7] = (unsigned char)((x)&255); } while(0)
+
+#define LOAD64H(x, y)                                                      \
+do { x = (((ulong64)((y)[0] & 255))<<56)|(((ulong64)((y)[1] & 255))<<48) | \
+         (((ulong64)((y)[2] & 255))<<40)|(((ulong64)((y)[3] & 255))<<32) | \
+         (((ulong64)((y)[4] & 255))<<24)|(((ulong64)((y)[5] & 255))<<16) | \
+         (((ulong64)((y)[6] & 255))<<8)|(((ulong64)((y)[7] & 255))); } while(0)
+
+#endif
+
+#ifdef ENDIAN_32BITWORD
+
+#define STORE32L(x, y)        \
+  do { ulong32  __t = (x); XMEMCPY(y, &__t, 4); } while(0)
+
+#define LOAD32L(x, y)         \
+  do { XMEMCPY(&(x), y, 4); } while(0)
+
+#define STORE64L(x, y)                                                                     \
+  do { (y)[7] = (unsigned char)(((x)>>56)&255); (y)[6] = (unsigned char)(((x)>>48)&255);   \
+       (y)[5] = (unsigned char)(((x)>>40)&255); (y)[4] = (unsigned char)(((x)>>32)&255);   \
+       (y)[3] = (unsigned char)(((x)>>24)&255); (y)[2] = (unsigned char)(((x)>>16)&255);   \
+       (y)[1] = (unsigned char)(((x)>>8)&255); (y)[0] = (unsigned char)((x)&255); } while(0)
+
+#define LOAD64L(x, y)                                                       \
+  do { x = (((ulong64)((y)[7] & 255))<<56)|(((ulong64)((y)[6] & 255))<<48)| \
+           (((ulong64)((y)[5] & 255))<<40)|(((ulong64)((y)[4] & 255))<<32)| \
+           (((ulong64)((y)[3] & 255))<<24)|(((ulong64)((y)[2] & 255))<<16)| \
+           (((ulong64)((y)[1] & 255))<<8)|(((ulong64)((y)[0] & 255))); } while(0)
+
+#else /* 64-bit words then  */
+
+#define STORE32L(x, y)        \
+  do { ulong32 __t = (x); XMEMCPY(y, &__t, 4); } while(0)
+
+#define LOAD32L(x, y)         \
+  do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0)
+
+#define STORE64L(x, y)        \
+  do { ulong64 __t = (x); XMEMCPY(y, &__t, 8); } while(0)
+
+#define LOAD64L(x, y)         \
+  do { XMEMCPY(&(x), y, 8); } while(0)
+
+#endif /* ENDIAN_64BITWORD */
+
+#elif defined(ENDIAN_BIG)
+
+#define STORE32L(x, y)                                                                     \
+  do { (y)[3] = (unsigned char)(((x)>>24)&255); (y)[2] = (unsigned char)(((x)>>16)&255);   \
+       (y)[1] = (unsigned char)(((x)>>8)&255); (y)[0] = (unsigned char)((x)&255); } while(0)
+
+#define LOAD32L(x, y)                            \
+  do { x = ((ulong32)((y)[3] & 255)<<24) | \
+           ((ulong32)((y)[2] & 255)<<16) | \
+           ((ulong32)((y)[1] & 255)<<8)  | \
+           ((ulong32)((y)[0] & 255)); } while(0)
+
+#define STORE64L(x, y)                                                                     \
+do { (y)[7] = (unsigned char)(((x)>>56)&255); (y)[6] = (unsigned char)(((x)>>48)&255);     \
+     (y)[5] = (unsigned char)(((x)>>40)&255); (y)[4] = (unsigned char)(((x)>>32)&255);     \
+     (y)[3] = (unsigned char)(((x)>>24)&255); (y)[2] = (unsigned char)(((x)>>16)&255);     \
+     (y)[1] = (unsigned char)(((x)>>8)&255); (y)[0] = (unsigned char)((x)&255); } while(0)
+
+#define LOAD64L(x, y)                                                      \
+do { x = (((ulong64)((y)[7] & 255))<<56)|(((ulong64)((y)[6] & 255))<<48) | \
+         (((ulong64)((y)[5] & 255))<<40)|(((ulong64)((y)[4] & 255))<<32) | \
+         (((ulong64)((y)[3] & 255))<<24)|(((ulong64)((y)[2] & 255))<<16) | \
+         (((ulong64)((y)[1] & 255))<<8)|(((ulong64)((y)[0] & 255))); } while(0)
+
+#ifdef ENDIAN_32BITWORD
+
+#define STORE32H(x, y)        \
+  do { ulong32 __t = (x); XMEMCPY(y, &__t, 4); } while(0)
+
+#define LOAD32H(x, y)         \
+  do { XMEMCPY(&(x), y, 4); } while(0)
+
+#define STORE64H(x, y)                                                                     \
+  do { (y)[0] = (unsigned char)(((x)>>56)&255); (y)[1] = (unsigned char)(((x)>>48)&255);   \
+       (y)[2] = (unsigned char)(((x)>>40)&255); (y)[3] = (unsigned char)(((x)>>32)&255);   \
+       (y)[4] = (unsigned char)(((x)>>24)&255); (y)[5] = (unsigned char)(((x)>>16)&255);   \
+       (y)[6] = (unsigned char)(((x)>>8)&255);  (y)[7] = (unsigned char)((x)&255); } while(0)
+
+#define LOAD64H(x, y)                                                       \
+  do { x = (((ulong64)((y)[0] & 255))<<56)|(((ulong64)((y)[1] & 255))<<48)| \
+           (((ulong64)((y)[2] & 255))<<40)|(((ulong64)((y)[3] & 255))<<32)| \
+           (((ulong64)((y)[4] & 255))<<24)|(((ulong64)((y)[5] & 255))<<16)| \
+           (((ulong64)((y)[6] & 255))<<8)| (((ulong64)((y)[7] & 255))); } while(0)
+
+#else /* 64-bit words then  */
+
+#define STORE32H(x, y)        \
+  do { ulong32 __t = (x); XMEMCPY(y, &__t, 4); } while(0)
+
+#define LOAD32H(x, y)         \
+  do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0)
+
+#define STORE64H(x, y)        \
+  do { ulong64 __t = (x); XMEMCPY(y, &__t, 8); } while(0)
+
+#define LOAD64H(x, y)         \
+  do { XMEMCPY(&(x), y, 8); } while(0)
+
+#endif /* ENDIAN_64BITWORD */
+#endif /* ENDIAN_BIG */
+
+#define BSWAP(x)  ( ((x>>24)&0x000000FFUL) | ((x<<24)&0xFF000000UL)  | \
+                    ((x>>8)&0x0000FF00UL)  | ((x<<8)&0x00FF0000UL) )
+
+
+/* 32-bit Rotates */
+#if defined(_MSC_VER)
+#define LTC_ROx_ASM
+
+/* instrinsic rotate */
+#include <stdlib.h>
+#pragma intrinsic(_lrotr,_lrotl)
+#define ROR(x,n) _lrotr(x,n)
+#define ROL(x,n) _lrotl(x,n)
+#define RORc(x,n) _lrotr(x,n)
+#define ROLc(x,n) _lrotl(x,n)
+
+#elif !defined(__STRICT_ANSI__) && defined(__GNUC__) && (defined(__i386__) || defined(__x86_64__)) && !defined(INTEL_CC) && !defined(LTC_NO_ASM)
+#define LTC_ROx_ASM
+
+static inline ulong32 ROL(ulong32 word, int i)
+{
+   asm ("roll %%cl,%0"
+      :"=r" (word)
+      :"0" (word),"c" (i));
+   return word;
+}
+
+static inline ulong32 ROR(ulong32 word, int i)
+{
+   asm ("rorl %%cl,%0"
+      :"=r" (word)
+      :"0" (word),"c" (i));
+   return word;
+}
+
+#ifndef LTC_NO_ROLC
+
+#define ROLc(word,i) ({ \
+   ulong32 __ROLc_tmp = (word); \
+   __asm__ ("roll %2, %0" : \
+            "=r" (__ROLc_tmp) : \
+            "0" (__ROLc_tmp), \
+            "I" (i)); \
+            __ROLc_tmp; \
+   })
+#define RORc(word,i) ({ \
+   ulong32 __RORc_tmp = (word); \
+   __asm__ ("rorl %2, %0" : \
+            "=r" (__RORc_tmp) : \
+            "0" (__RORc_tmp), \
+            "I" (i)); \
+            __RORc_tmp; \
+   })
+
+#else
+
+#define ROLc ROL
+#define RORc ROR
+
+#endif
+
+#elif !defined(__STRICT_ANSI__) && defined(LTC_PPC32)
+#define LTC_ROx_ASM
+
+static inline ulong32 ROL(ulong32 word, int i)
+{
+   asm ("rotlw %0,%0,%2"
+      :"=r" (word)
+      :"0" (word),"r" (i));
+   return word;
+}
+
+static inline ulong32 ROR(ulong32 word, int i)
+{
+   asm ("rotlw %0,%0,%2"
+      :"=r" (word)
+      :"0" (word),"r" (32-i));
+   return word;
+}
+
+#ifndef LTC_NO_ROLC
+
+static inline ulong32 ROLc(ulong32 word, const int i)
+{
+   asm ("rotlwi %0,%0,%2"
+      :"=r" (word)
+      :"0" (word),"I" (i));
+   return word;
+}
+
+static inline ulong32 RORc(ulong32 word, const int i)
+{
+   asm ("rotrwi %0,%0,%2"
+      :"=r" (word)
+      :"0" (word),"I" (i));
+   return word;
+}
+
+#else
+
+#define ROLc ROL
+#define RORc ROR
+
+#endif
+
+
+#else
+
+/* rotates the hard way */
+#define ROL(x, y) ( (((ulong32)(x)<<(ulong32)((y)&31)) | (((ulong32)(x)&0xFFFFFFFFUL)>>(ulong32)((32-((y)&31))&31))) & 0xFFFFFFFFUL)
+#define ROR(x, y) ( ((((ulong32)(x)&0xFFFFFFFFUL)>>(ulong32)((y)&31)) | ((ulong32)(x)<<(ulong32)((32-((y)&31))&31))) & 0xFFFFFFFFUL)
+#define ROLc(x, y) ( (((ulong32)(x)<<(ulong32)((y)&31)) | (((ulong32)(x)&0xFFFFFFFFUL)>>(ulong32)((32-((y)&31))&31))) & 0xFFFFFFFFUL)
+#define RORc(x, y) ( ((((ulong32)(x)&0xFFFFFFFFUL)>>(ulong32)((y)&31)) | ((ulong32)(x)<<(ulong32)((32-((y)&31))&31))) & 0xFFFFFFFFUL)
+
+#endif
+
+
+/* 64-bit Rotates */
+#if !defined(__STRICT_ANSI__) && defined(__GNUC__) && defined(__x86_64__) && !defined(_WIN64) && !defined(LTC_NO_ASM)
+
+static inline ulong64 ROL64(ulong64 word, int i)
+{
+   asm("rolq %%cl,%0"
+      :"=r" (word)
+      :"0" (word),"c" (i));
+   return word;
+}
+
+static inline ulong64 ROR64(ulong64 word, int i)
+{
+   asm("rorq %%cl,%0"
+      :"=r" (word)
+      :"0" (word),"c" (i));
+   return word;
+}
+
+#ifndef LTC_NO_ROLC
+
+#define ROL64c(word,i) ({ \
+   ulong64 __ROL64c_tmp = word; \
+   __asm__ ("rolq %2, %0" : \
+            "=r" (__ROL64c_tmp) : \
+            "0" (__ROL64c_tmp), \
+            "J" (i)); \
+            __ROL64c_tmp; \
+   })
+#define ROR64c(word,i) ({ \
+   ulong64 __ROR64c_tmp = word; \
+   __asm__ ("rorq %2, %0" : \
+            "=r" (__ROR64c_tmp) : \
+            "0" (__ROR64c_tmp), \
+            "J" (i)); \
+            __ROR64c_tmp; \
+   })
+
+#else /* LTC_NO_ROLC */
+
+#define ROL64c ROL64
+#define ROR64c ROR64
+
+#endif
+
+#else /* Not x86_64  */
+
+#define ROL64(x, y) \
+    ( (((x)<<((ulong64)(y)&63)) | \
+      (((x)&CONST64(0xFFFFFFFFFFFFFFFF))>>(((ulong64)64-((y)&63))&63))) & CONST64(0xFFFFFFFFFFFFFFFF))
+
+#define ROR64(x, y) \
+    ( ((((x)&CONST64(0xFFFFFFFFFFFFFFFF))>>((ulong64)(y)&CONST64(63))) | \
+      ((x)<<(((ulong64)64-((y)&63))&63))) & CONST64(0xFFFFFFFFFFFFFFFF))
+
+#define ROL64c(x, y) \
+    ( (((x)<<((ulong64)(y)&63)) | \
+      (((x)&CONST64(0xFFFFFFFFFFFFFFFF))>>(((ulong64)64-((y)&63))&63))) & CONST64(0xFFFFFFFFFFFFFFFF))
+
+#define ROR64c(x, y) \
+    ( ((((x)&CONST64(0xFFFFFFFFFFFFFFFF))>>((ulong64)(y)&CONST64(63))) | \
+      ((x)<<(((ulong64)64-((y)&63))&63))) & CONST64(0xFFFFFFFFFFFFFFFF))
+
+#endif
+
+#ifndef MAX
+   #define MAX(x, y) ( ((x)>(y))?(x):(y) )
+#endif
+
+#ifndef MIN
+   #define MIN(x, y) ( ((x)<(y))?(x):(y) )
+#endif
+
+#ifndef LTC_UNUSED_PARAM
+   #define LTC_UNUSED_PARAM(x) (void)(x)
+#endif
+
+/* there is no snprintf before Visual C++ 2015 */
+#if defined(_MSC_VER) && _MSC_VER < 1900
+#define snprintf _snprintf
+#endif
+
+/* ref:         HEAD -> develop */
+/* git commit:  a1f6312416ef6cd183ee62db58b640dc2d7ec1f4 */
+/* commit time: 2019-09-04 13:44:47 +0200 */

+ 529 - 0
libtomcrypt.mod/libtomcrypt/src/headers/tomcrypt_math.h

@@ -0,0 +1,529 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ */
+
+/** math functions **/
+
+#define LTC_MP_LT   -1
+#define LTC_MP_EQ    0
+#define LTC_MP_GT    1
+
+#define LTC_MP_NO    0
+#define LTC_MP_YES   1
+
+#ifndef LTC_MECC
+   typedef void ecc_point;
+#endif
+
+#ifndef LTC_MRSA
+   typedef void rsa_key;
+#endif
+
+#ifndef LTC_MILLER_RABIN_REPS
+   /* Number of rounds of the Miller-Rabin test
+    * "Reasonable values of reps are between 15 and 50." c.f. gmp doc of mpz_probab_prime_p()
+    * As of https://security.stackexchange.com/a/4546 we should use 40 rounds */
+   #define LTC_MILLER_RABIN_REPS    40
+#endif
+
+int radix_to_bin(const void *in, int radix, void *out, unsigned long *len);
+
+/** math descriptor */
+typedef struct {
+   /** Name of the math provider */
+   const char *name;
+
+   /** Bits per digit, amount of bits must fit in an unsigned long */
+   int  bits_per_digit;
+
+/* ---- init/deinit functions ---- */
+
+   /** initialize a bignum
+     @param   a     The number to initialize
+     @return  CRYPT_OK on success
+   */
+   int (*init)(void **a);
+
+   /** init copy
+     @param  dst    The number to initialize and write to
+     @param  src    The number to copy from
+     @return CRYPT_OK on success
+   */
+   int (*init_copy)(void **dst, void *src);
+
+   /** deinit
+      @param   a    The number to free
+      @return CRYPT_OK on success
+   */
+   void (*deinit)(void *a);
+
+/* ---- data movement ---- */
+
+   /** negate
+      @param   src   The number to negate
+      @param   dst   The destination
+      @return CRYPT_OK on success
+   */
+   int (*neg)(void *src, void *dst);
+
+   /** copy
+      @param   src   The number to copy from
+      @param   dst   The number to write to
+      @return CRYPT_OK on success
+   */
+   int (*copy)(void *src, void *dst);
+
+/* ---- trivial low level functions ---- */
+
+   /** set small constant
+      @param a    Number to write to
+      @param n    Source upto bits_per_digit (actually meant for very small constants)
+      @return CRYPT_OK on success
+   */
+   int (*set_int)(void *a, ltc_mp_digit n);
+
+   /** get small constant
+      @param a  Small number to read,
+                only fetches up to bits_per_digit from the number
+      @return   The lower bits_per_digit of the integer (unsigned)
+   */
+   unsigned long (*get_int)(void *a);
+
+   /** get digit n
+     @param a  The number to read from
+     @param n  The number of the digit to fetch
+     @return  The bits_per_digit  sized n'th digit of a
+   */
+   ltc_mp_digit (*get_digit)(void *a, int n);
+
+   /** Get the number of digits that represent the number
+     @param a   The number to count
+     @return The number of digits used to represent the number
+   */
+   int (*get_digit_count)(void *a);
+
+   /** compare two integers
+     @param a   The left side integer
+     @param b   The right side integer
+     @return LTC_MP_LT if a < b,
+             LTC_MP_GT if a > b and
+             LTC_MP_EQ otherwise.  (signed comparison)
+   */
+   int (*compare)(void *a, void *b);
+
+   /** compare against int
+     @param a   The left side integer
+     @param b   The right side integer (upto bits_per_digit)
+     @return LTC_MP_LT if a < b,
+             LTC_MP_GT if a > b and
+             LTC_MP_EQ otherwise.  (signed comparison)
+   */
+   int (*compare_d)(void *a, ltc_mp_digit n);
+
+   /** Count the number of bits used to represent the integer
+     @param a   The integer to count
+     @return The number of bits required to represent the integer
+   */
+   int (*count_bits)(void * a);
+
+   /** Count the number of LSB bits which are zero
+     @param a   The integer to count
+     @return The number of contiguous zero LSB bits
+   */
+   int (*count_lsb_bits)(void *a);
+
+   /** Compute a power of two
+     @param a  The integer to store the power in
+     @param n  The power of two you want to store (a = 2^n)
+     @return CRYPT_OK on success
+   */
+   int (*twoexpt)(void *a , int n);
+
+/* ---- radix conversions ---- */
+
+   /** read ascii string
+     @param a     The integer to store into
+     @param str   The string to read
+     @param radix The radix the integer has been represented in (2-64)
+     @return CRYPT_OK on success
+   */
+   int (*read_radix)(void *a, const char *str, int radix);
+
+   /** write number to string
+     @param a     The integer to store
+     @param str   The destination for the string
+     @param radix The radix the integer is to be represented in (2-64)
+     @return CRYPT_OK on success
+   */
+   int (*write_radix)(void *a, char *str, int radix);
+
+   /** get size as unsigned char string
+     @param a  The integer to get the size (when stored in array of octets)
+     @return   The length of the integer in octets
+   */
+   unsigned long (*unsigned_size)(void *a);
+
+   /** store an integer as an array of octets
+     @param src   The integer to store
+     @param dst   The buffer to store the integer in
+     @return CRYPT_OK on success
+   */
+   int (*unsigned_write)(void *src, unsigned char *dst);
+
+   /** read an array of octets and store as integer
+     @param dst   The integer to load
+     @param src   The array of octets
+     @param len   The number of octets
+     @return CRYPT_OK on success
+   */
+   int (*unsigned_read)(         void *dst,
+                        unsigned char *src,
+                        unsigned long  len);
+
+/* ---- basic math ---- */
+
+   /** add two integers
+     @param a   The first source integer
+     @param b   The second source integer
+     @param c   The destination of "a + b"
+     @return CRYPT_OK on success
+   */
+   int (*add)(void *a, void *b, void *c);
+
+   /** add two integers
+     @param a   The first source integer
+     @param b   The second source integer
+                (single digit of upto bits_per_digit in length)
+     @param c   The destination of "a + b"
+     @return CRYPT_OK on success
+   */
+   int (*addi)(void *a, ltc_mp_digit b, void *c);
+
+   /** subtract two integers
+     @param a   The first source integer
+     @param b   The second source integer
+     @param c   The destination of "a - b"
+     @return CRYPT_OK on success
+   */
+   int (*sub)(void *a, void *b, void *c);
+
+   /** subtract two integers
+     @param a   The first source integer
+     @param b   The second source integer
+                (single digit of upto bits_per_digit in length)
+     @param c   The destination of "a - b"
+     @return CRYPT_OK on success
+   */
+   int (*subi)(void *a, ltc_mp_digit b, void *c);
+
+   /** multiply two integers
+     @param a   The first source integer
+     @param b   The second source integer
+                (single digit of upto bits_per_digit in length)
+     @param c   The destination of "a * b"
+     @return CRYPT_OK on success
+   */
+   int (*mul)(void *a, void *b, void *c);
+
+   /** multiply two integers
+     @param a   The first source integer
+     @param b   The second source integer
+                (single digit of upto bits_per_digit in length)
+     @param c   The destination of "a * b"
+     @return CRYPT_OK on success
+   */
+   int (*muli)(void *a, ltc_mp_digit b, void *c);
+
+   /** Square an integer
+     @param a    The integer to square
+     @param b    The destination
+     @return CRYPT_OK on success
+   */
+   int (*sqr)(void *a, void *b);
+
+   /** Square root (mod prime)
+     @param a    The integer to compute square root mod prime from
+     @param b    The prime
+     @param c    The destination
+     @return CRYPT_OK on success
+   */
+   int (*sqrtmod_prime)(void *a, void *b, void *c);
+
+   /** Divide an integer
+     @param a    The dividend
+     @param b    The divisor
+     @param c    The quotient (can be NULL to signify don't care)
+     @param d    The remainder (can be NULL to signify don't care)
+     @return CRYPT_OK on success
+   */
+   int (*mpdiv)(void *a, void *b, void *c, void *d);
+
+   /** divide by two
+      @param  a   The integer to divide (shift right)
+      @param  b   The destination
+      @return CRYPT_OK on success
+   */
+   int (*div_2)(void *a, void *b);
+
+   /** Get remainder (small value)
+      @param  a    The integer to reduce
+      @param  b    The modulus (upto bits_per_digit in length)
+      @param  c    The destination for the residue
+      @return CRYPT_OK on success
+   */
+   int (*modi)(void *a, ltc_mp_digit b, ltc_mp_digit *c);
+
+   /** gcd
+      @param  a     The first integer
+      @param  b     The second integer
+      @param  c     The destination for (a, b)
+      @return CRYPT_OK on success
+   */
+   int (*gcd)(void *a, void *b, void *c);
+
+   /** lcm
+      @param  a     The first integer
+      @param  b     The second integer
+      @param  c     The destination for [a, b]
+      @return CRYPT_OK on success
+   */
+   int (*lcm)(void *a, void *b, void *c);
+
+   /** Modular multiplication
+      @param  a     The first source
+      @param  b     The second source
+      @param  c     The modulus
+      @param  d     The destination (a*b mod c)
+      @return CRYPT_OK on success
+   */
+   int (*mulmod)(void *a, void *b, void *c, void *d);
+
+   /** Modular squaring
+      @param  a     The first source
+      @param  b     The modulus
+      @param  c     The destination (a*a mod b)
+      @return CRYPT_OK on success
+   */
+   int (*sqrmod)(void *a, void *b, void *c);
+
+   /** Modular inversion
+      @param  a     The value to invert
+      @param  b     The modulus
+      @param  c     The destination (1/a mod b)
+      @return CRYPT_OK on success
+   */
+   int (*invmod)(void *, void *, void *);
+
+/* ---- reduction ---- */
+
+   /** setup Montgomery
+       @param a  The modulus
+       @param b  The destination for the reduction digit
+       @return CRYPT_OK on success
+   */
+   int (*montgomery_setup)(void *a, void **b);
+
+   /** get normalization value
+       @param a   The destination for the normalization value
+       @param b   The modulus
+       @return  CRYPT_OK on success
+   */
+   int (*montgomery_normalization)(void *a, void *b);
+
+   /** reduce a number
+       @param a   The number [and dest] to reduce
+       @param b   The modulus
+       @param c   The value "b" from montgomery_setup()
+       @return CRYPT_OK on success
+   */
+   int (*montgomery_reduce)(void *a, void *b, void *c);
+
+   /** clean up  (frees memory)
+       @param a   The value "b" from montgomery_setup()
+       @return CRYPT_OK on success
+   */
+   void (*montgomery_deinit)(void *a);
+
+/* ---- exponentiation ---- */
+
+   /** Modular exponentiation
+       @param a    The base integer
+       @param b    The power (can be negative) integer
+       @param c    The modulus integer
+       @param d    The destination
+       @return CRYPT_OK on success
+   */
+   int (*exptmod)(void *a, void *b, void *c, void *d);
+
+   /** Primality testing
+       @param a     The integer to test
+       @param b     The number of Miller-Rabin tests that shall be executed
+       @param c     The destination of the result (FP_YES if prime)
+       @return CRYPT_OK on success
+   */
+   int (*isprime)(void *a, int b, int *c);
+
+/* ----  (optional) ecc point math ---- */
+
+   /** ECC GF(p) point multiplication (from the NIST curves)
+       @param k   The integer to multiply the point by
+       @param G   The point to multiply
+       @param R   The destination for kG
+       @param a   ECC curve parameter a
+       @param modulus  The modulus for the field
+       @param map Boolean indicated whether to map back to affine or not
+                  (can be ignored if you work in affine only)
+       @return CRYPT_OK on success
+   */
+   int (*ecc_ptmul)(     void *k,
+                    const ecc_point *G,
+                          ecc_point *R,
+                               void *a,
+                               void *modulus,
+                                int  map);
+
+   /** ECC GF(p) point addition
+       @param P    The first point
+       @param Q    The second point
+       @param R    The destination of P + Q
+       @param ma   The curve parameter "a" in montgomery form
+       @param modulus  The modulus
+       @param mp   The "b" value from montgomery_setup()
+       @return CRYPT_OK on success
+   */
+   int (*ecc_ptadd)(const ecc_point *P,
+                    const ecc_point *Q,
+                          ecc_point *R,
+                               void *ma,
+                               void *modulus,
+                               void *mp);
+
+   /** ECC GF(p) point double
+       @param P    The first point
+       @param R    The destination of 2P
+       @param ma   The curve parameter "a" in montgomery form
+       @param modulus  The modulus
+       @param mp   The "b" value from montgomery_setup()
+       @return CRYPT_OK on success
+   */
+   int (*ecc_ptdbl)(const ecc_point *P,
+                          ecc_point *R,
+                               void *ma,
+                               void *modulus,
+                               void *mp);
+
+   /** ECC mapping from projective to affine,
+       currently uses (x,y,z) => (x/z^2, y/z^3, 1)
+       @param P     The point to map
+       @param modulus The modulus
+       @param mp    The "b" value from montgomery_setup()
+       @return CRYPT_OK on success
+       @remark The mapping can be different but keep in mind a
+               ecc_point only has three integers (x,y,z) so if
+               you use a different mapping you have to make it fit.
+   */
+   int (*ecc_map)(ecc_point *P, void *modulus, void *mp);
+
+   /** Computes kA*A + kB*B = C using Shamir's Trick
+       @param A        First point to multiply
+       @param kA       What to multiple A by
+       @param B        Second point to multiply
+       @param kB       What to multiple B by
+       @param C        [out] Destination point (can overlap with A or B)
+       @param ma       The curve parameter "a" in montgomery form
+       @param modulus  Modulus for curve
+       @return CRYPT_OK on success
+   */
+   int (*ecc_mul2add)(const ecc_point *A, void *kA,
+                      const ecc_point *B, void *kB,
+                            ecc_point *C,
+                                 void *ma,
+                                 void *modulus);
+
+/* ---- (optional) rsa optimized math (for internal CRT) ---- */
+
+   /** RSA Key Generation
+       @param prng     An active PRNG state
+       @param wprng    The index of the PRNG desired
+       @param size     The size of the key in octets
+       @param e        The "e" value (public key).
+                       e==65537 is a good choice
+       @param key      [out] Destination of a newly created private key pair
+       @return CRYPT_OK if successful, upon error all allocated ram is freed
+    */
+    int (*rsa_keygen)(prng_state *prng,
+                             int  wprng,
+                             int  size,
+                            long  e,
+                         rsa_key *key);
+
+   /** RSA exponentiation
+      @param in       The octet array representing the base
+      @param inlen    The length of the input
+      @param out      The destination (to be stored in an octet array format)
+      @param outlen   The length of the output buffer and the resulting size
+                      (zero padded to the size of the modulus)
+      @param which    PK_PUBLIC for public RSA and PK_PRIVATE for private RSA
+      @param key      The RSA key to use
+      @return CRYPT_OK on success
+   */
+   int (*rsa_me)(const unsigned char *in,   unsigned long inlen,
+                       unsigned char *out,  unsigned long *outlen, int which,
+                 const rsa_key *key);
+
+/* ---- basic math continued ---- */
+
+   /** Modular addition
+      @param  a     The first source
+      @param  b     The second source
+      @param  c     The modulus
+      @param  d     The destination (a + b mod c)
+      @return CRYPT_OK on success
+   */
+   int (*addmod)(void *a, void *b, void *c, void *d);
+
+   /** Modular substraction
+      @param  a     The first source
+      @param  b     The second source
+      @param  c     The modulus
+      @param  d     The destination (a - b mod c)
+      @return CRYPT_OK on success
+   */
+   int (*submod)(void *a, void *b, void *c, void *d);
+
+/* ---- misc stuff ---- */
+
+   /** Make a pseudo-random mpi
+      @param  a     The mpi to make random
+      @param  size  The desired length
+      @return CRYPT_OK on success
+   */
+   int (*rand)(void *a, int size);
+} ltc_math_descriptor;
+
+extern ltc_math_descriptor ltc_mp;
+
+int ltc_init_multi(void **a, ...);
+void ltc_deinit_multi(void *a, ...);
+void ltc_cleanup_multi(void **a, ...);
+
+#ifdef LTM_DESC
+extern const ltc_math_descriptor ltm_desc;
+#endif
+
+#ifdef TFM_DESC
+extern const ltc_math_descriptor tfm_desc;
+#endif
+
+#ifdef GMP_DESC
+extern const ltc_math_descriptor gmp_desc;
+#endif
+
+/* ref:         HEAD -> develop */
+/* git commit:  a1f6312416ef6cd183ee62db58b640dc2d7ec1f4 */
+/* commit time: 2019-09-04 13:44:47 +0200 */

+ 178 - 0
libtomcrypt.mod/libtomcrypt/src/headers/tomcrypt_misc.h

@@ -0,0 +1,178 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ */
+
+/* ---- LTC_BASE64 Routines ---- */
+#ifdef LTC_BASE64
+int base64_encode(const unsigned char *in,  unsigned long inlen,
+                                 char *out, unsigned long *outlen);
+
+int base64_decode(const char *in,  unsigned long inlen,
+                        unsigned char *out, unsigned long *outlen);
+int base64_strict_decode(const char *in,  unsigned long inlen,
+                        unsigned char *out, unsigned long *outlen);
+int base64_sane_decode(const char *in,  unsigned long inlen,
+                        unsigned char *out, unsigned long *outlen);
+#endif
+
+#ifdef LTC_BASE64_URL
+int base64url_encode(const unsigned char *in,  unsigned long inlen,
+                                    char *out, unsigned long *outlen);
+int base64url_strict_encode(const unsigned char *in,  unsigned long inlen,
+                                           char *out, unsigned long *outlen);
+
+int base64url_decode(const char *in,  unsigned long inlen,
+                        unsigned char *out, unsigned long *outlen);
+int base64url_strict_decode(const char *in,  unsigned long inlen,
+                        unsigned char *out, unsigned long *outlen);
+int base64url_sane_decode(const char *in,  unsigned long inlen,
+                        unsigned char *out, unsigned long *outlen);
+#endif
+
+/* ---- BASE32 Routines ---- */
+#ifdef LTC_BASE32
+typedef enum {
+   BASE32_RFC4648   = 0,
+   BASE32_BASE32HEX = 1,
+   BASE32_ZBASE32   = 2,
+   BASE32_CROCKFORD = 3
+} base32_alphabet;
+int base32_encode(const unsigned char *in,  unsigned long inlen,
+                                 char *out, unsigned long *outlen,
+                        base32_alphabet id);
+int base32_decode(const          char *in,  unsigned long inlen,
+                        unsigned char *out, unsigned long *outlen,
+                        base32_alphabet id);
+#endif
+
+/* ---- BASE16 Routines ---- */
+#ifdef LTC_BASE16
+int base16_encode(const unsigned char *in,  unsigned long  inlen,
+                                 char *out, unsigned long *outlen,
+                        unsigned int   options);
+int base16_decode(const          char *in,  unsigned long  inlen,
+                        unsigned char *out, unsigned long *outlen);
+#endif
+
+/* ===> LTC_HKDF -- RFC5869 HMAC-based Key Derivation Function <=== */
+#ifdef LTC_HKDF
+
+int hkdf_test(void);
+
+int hkdf_extract(int hash_idx,
+                 const unsigned char *salt, unsigned long saltlen,
+                 const unsigned char *in,   unsigned long inlen,
+                       unsigned char *out,  unsigned long *outlen);
+
+int hkdf_expand(int hash_idx,
+                const unsigned char *info, unsigned long infolen,
+                const unsigned char *in,   unsigned long inlen,
+                      unsigned char *out,  unsigned long outlen);
+
+int hkdf(int hash_idx,
+         const unsigned char *salt, unsigned long saltlen,
+         const unsigned char *info, unsigned long infolen,
+         const unsigned char *in,   unsigned long inlen,
+               unsigned char *out,  unsigned long outlen);
+
+#endif  /* LTC_HKDF */
+
+/* ---- MEM routines ---- */
+int mem_neq(const void *a, const void *b, size_t len);
+void zeromem(volatile void *out, size_t outlen);
+void burn_stack(unsigned long len);
+
+const char *error_to_string(int err);
+
+extern const char *crypt_build_settings;
+
+/* ---- HMM ---- */
+int crypt_fsa(void *mp, ...);
+
+/* ---- Dynamic language support ---- */
+int crypt_get_constant(const char* namein, int *valueout);
+int crypt_list_all_constants(char *names_list, unsigned int *names_list_size);
+
+int crypt_get_size(const char* namein, unsigned int *sizeout);
+int crypt_list_all_sizes(char *names_list, unsigned int *names_list_size);
+
+#ifdef LTM_DESC
+LTC_DEPRECATED void init_LTM(void);
+#endif
+#ifdef TFM_DESC
+LTC_DEPRECATED void init_TFM(void);
+#endif
+#ifdef GMP_DESC
+LTC_DEPRECATED void init_GMP(void);
+#endif
+int crypt_mp_init(const char* mpi);
+
+#ifdef LTC_ADLER32
+typedef struct adler32_state_s
+{
+   unsigned short s[2];
+} adler32_state;
+
+void adler32_init(adler32_state *ctx);
+void adler32_update(adler32_state *ctx, const unsigned char *input, unsigned long length);
+void adler32_finish(const adler32_state *ctx, void *hash, unsigned long size);
+int adler32_test(void);
+#endif
+
+#ifdef LTC_CRC32
+typedef struct crc32_state_s
+{
+   ulong32 crc;
+} crc32_state;
+
+void crc32_init(crc32_state *ctx);
+void crc32_update(crc32_state *ctx, const unsigned char *input, unsigned long length);
+void crc32_finish(const crc32_state *ctx, void *hash, unsigned long size);
+int crc32_test(void);
+#endif
+
+
+#ifdef LTC_PADDING
+
+enum padding_type {
+   LTC_PAD_PKCS7        = 0x0000U,
+#ifdef LTC_RNG_GET_BYTES
+   LTC_PAD_ISO_10126    = 0x1000U,
+#endif
+   LTC_PAD_ANSI_X923    = 0x2000U,
+   LTC_PAD_ONE_AND_ZERO = 0x8000U,
+   LTC_PAD_ZERO         = 0x9000U,
+   LTC_PAD_ZERO_ALWAYS  = 0xA000U,
+};
+
+int padding_pad(unsigned char *data, unsigned long length, unsigned long* padded_length, unsigned long mode);
+int padding_depad(const unsigned char *data, unsigned long *length, unsigned long mode);
+#endif  /* LTC_PADDING */
+
+#ifdef LTC_SSH
+typedef enum ssh_data_type_ {
+   LTC_SSHDATA_BYTE,
+   LTC_SSHDATA_BOOLEAN,
+   LTC_SSHDATA_UINT32,
+   LTC_SSHDATA_UINT64,
+   LTC_SSHDATA_STRING,
+   LTC_SSHDATA_MPINT,
+   LTC_SSHDATA_NAMELIST,
+   LTC_SSHDATA_EOL
+} ssh_data_type;
+
+/* VA list handy helpers with tuples of <type, data> */
+int ssh_encode_sequence_multi(unsigned char *out, unsigned long *outlen, ...);
+int ssh_decode_sequence_multi(const unsigned char *in, unsigned long inlen, ...);
+#endif /* LTC_SSH */
+
+int compare_testvector(const void* is, const unsigned long is_len, const void* should, const unsigned long should_len, const char* what, int which);
+
+/* ref:         HEAD -> develop */
+/* git commit:  a1f6312416ef6cd183ee62db58b640dc2d7ec1f4 */
+/* commit time: 2019-09-04 13:44:47 +0200 */

+ 797 - 0
libtomcrypt.mod/libtomcrypt/src/headers/tomcrypt_pk.h

@@ -0,0 +1,797 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ */
+
+/* ---- NUMBER THEORY ---- */
+
+enum public_key_type {
+   /* Refers to the public key */
+   PK_PUBLIC      = 0x0000,
+   /* Refers to the private key */
+   PK_PRIVATE     = 0x0001,
+
+   /* Indicates standard output formats that can be read e.g. by OpenSSL or GnuTLS */
+   PK_STD         = 0x1000,
+   /* Indicates compressed public ECC key */
+   PK_COMPRESSED  = 0x2000,
+   /* Indicates ECC key with the curve specified by OID */
+   PK_CURVEOID    = 0x4000
+};
+
+int rand_prime(void *N, long len, prng_state *prng, int wprng);
+
+/* ---- RSA ---- */
+#ifdef LTC_MRSA
+
+/** RSA PKCS style key */
+typedef struct Rsa_key {
+    /** Type of key, PK_PRIVATE or PK_PUBLIC */
+    int type;
+    /** The public exponent */
+    void *e;
+    /** The private exponent */
+    void *d;
+    /** The modulus */
+    void *N;
+    /** The p factor of N */
+    void *p;
+    /** The q factor of N */
+    void *q;
+    /** The 1/q mod p CRT param */
+    void *qP;
+    /** The d mod (p - 1) CRT param */
+    void *dP;
+    /** The d mod (q - 1) CRT param */
+    void *dQ;
+} rsa_key;
+
+int rsa_make_key(prng_state *prng, int wprng, int size, long e, rsa_key *key);
+
+int rsa_get_size(const rsa_key *key);
+
+int rsa_exptmod(const unsigned char *in,   unsigned long inlen,
+                      unsigned char *out,  unsigned long *outlen, int which,
+                const rsa_key *key);
+
+void rsa_free(rsa_key *key);
+
+/* These use PKCS #1 v2.0 padding */
+#define rsa_encrypt_key(_in, _inlen, _out, _outlen, _lparam, _lparamlen, _prng, _prng_idx, _hash_idx, _key) \
+  rsa_encrypt_key_ex(_in, _inlen, _out, _outlen, _lparam, _lparamlen, _prng, _prng_idx, _hash_idx, LTC_PKCS_1_OAEP, _key)
+
+#define rsa_decrypt_key(_in, _inlen, _out, _outlen, _lparam, _lparamlen, _hash_idx, _stat, _key) \
+  rsa_decrypt_key_ex(_in, _inlen, _out, _outlen, _lparam, _lparamlen, _hash_idx, LTC_PKCS_1_OAEP, _stat, _key)
+
+#define rsa_sign_hash(_in, _inlen, _out, _outlen, _prng, _prng_idx, _hash_idx, _saltlen, _key) \
+  rsa_sign_hash_ex(_in, _inlen, _out, _outlen, LTC_PKCS_1_PSS, _prng, _prng_idx, _hash_idx, _saltlen, _key)
+
+#define rsa_verify_hash(_sig, _siglen, _hash, _hashlen, _hash_idx, _saltlen, _stat, _key) \
+  rsa_verify_hash_ex(_sig, _siglen, _hash, _hashlen, LTC_PKCS_1_PSS, _hash_idx, _saltlen, _stat, _key)
+
+#define rsa_sign_saltlen_get_max(_hash_idx, _key) \
+  rsa_sign_saltlen_get_max_ex(LTC_PKCS_1_PSS, _hash_idx, _key)
+
+/* These can be switched between PKCS #1 v2.x and PKCS #1 v1.5 paddings */
+int rsa_encrypt_key_ex(const unsigned char *in,       unsigned long  inlen,
+                             unsigned char *out,      unsigned long *outlen,
+                       const unsigned char *lparam,   unsigned long  lparamlen,
+                             prng_state    *prng,     int            prng_idx,
+                             int            hash_idx, int            padding,
+                       const rsa_key       *key);
+
+int rsa_decrypt_key_ex(const unsigned char *in,             unsigned long  inlen,
+                             unsigned char *out,            unsigned long *outlen,
+                       const unsigned char *lparam,         unsigned long  lparamlen,
+                             int            hash_idx,       int            padding,
+                             int           *stat,     const rsa_key       *key);
+
+int rsa_sign_hash_ex(const unsigned char *in,       unsigned long  inlen,
+                           unsigned char *out,      unsigned long *outlen,
+                           int            padding,
+                           prng_state    *prng,     int            prng_idx,
+                           int            hash_idx, unsigned long  saltlen,
+                     const rsa_key       *key);
+
+int rsa_verify_hash_ex(const unsigned char *sig,            unsigned long  siglen,
+                       const unsigned char *hash,           unsigned long  hashlen,
+                             int            padding,
+                             int            hash_idx,       unsigned long  saltlen,
+                             int           *stat,     const rsa_key       *key);
+
+int rsa_sign_saltlen_get_max_ex(int padding, int hash_idx, const rsa_key *key);
+
+/* PKCS #1 import/export */
+int rsa_export(unsigned char *out, unsigned long *outlen, int type, const rsa_key *key);
+int rsa_import(const unsigned char *in, unsigned long inlen, rsa_key *key);
+
+int rsa_import_x509(const unsigned char *in, unsigned long inlen, rsa_key *key);
+int rsa_import_pkcs8(const unsigned char *in, unsigned long inlen,
+                     const void *passwd, unsigned long passwdlen, rsa_key *key);
+
+int rsa_set_key(const unsigned char *N,  unsigned long Nlen,
+                const unsigned char *e,  unsigned long elen,
+                const unsigned char *d,  unsigned long dlen,
+                rsa_key *key);
+int rsa_set_factors(const unsigned char *p,  unsigned long plen,
+                    const unsigned char *q,  unsigned long qlen,
+                    rsa_key *key);
+int rsa_set_crt_params(const unsigned char *dP, unsigned long dPlen,
+                       const unsigned char *dQ, unsigned long dQlen,
+                       const unsigned char *qP, unsigned long qPlen,
+                       rsa_key *key);
+#endif
+
+/* ---- DH Routines ---- */
+#ifdef LTC_MDH
+
+typedef struct {
+    int type;
+    void *x;
+    void *y;
+    void *base;
+    void *prime;
+} dh_key;
+
+int dh_get_groupsize(const dh_key *key);
+
+int dh_export(unsigned char *out, unsigned long *outlen, int type, const dh_key *key);
+int dh_import(const unsigned char *in, unsigned long inlen, dh_key *key);
+
+int dh_set_pg(const unsigned char *p, unsigned long plen,
+              const unsigned char *g, unsigned long glen,
+              dh_key *key);
+int dh_set_pg_dhparam(const unsigned char *dhparam, unsigned long dhparamlen, dh_key *key);
+int dh_set_pg_groupsize(int groupsize, dh_key *key);
+
+int dh_set_key(const unsigned char *in, unsigned long inlen, int type, dh_key *key);
+int dh_generate_key(prng_state *prng, int wprng, dh_key *key);
+
+int dh_shared_secret(const dh_key  *private_key, const dh_key  *public_key,
+                     unsigned char *out,         unsigned long *outlen);
+
+void dh_free(dh_key *key);
+
+int dh_export_key(void *out, unsigned long *outlen, int type, const dh_key *key);
+#endif /* LTC_MDH */
+
+
+/* ---- ECC Routines ---- */
+#ifdef LTC_MECC
+
+/* size of our temp buffers for exported keys */
+#define ECC_BUF_SIZE 256
+
+/* max private key size */
+#define ECC_MAXSIZE  66
+
+/** Structure defines a GF(p) curve */
+typedef struct {
+   /** The prime that defines the field the curve is in (encoded in hex) */
+   const char *prime;
+
+   /** The fields A param (hex) */
+   const char *A;
+
+   /** The fields B param (hex) */
+   const char *B;
+
+   /** The order of the curve (hex) */
+   const char *order;
+
+   /** The x co-ordinate of the base point on the curve (hex) */
+   const char *Gx;
+
+   /** The y co-ordinate of the base point on the curve (hex) */
+   const char *Gy;
+
+   /** The co-factor */
+   unsigned long cofactor;
+
+   /** The OID */
+   const char *OID;
+} ltc_ecc_curve;
+
+/** A point on a ECC curve, stored in Jacbobian format such that (x,y,z) => (x/z^2, y/z^3, 1) when interpretted as affine */
+typedef struct {
+    /** The x co-ordinate */
+    void *x;
+
+    /** The y co-ordinate */
+    void *y;
+
+    /** The z co-ordinate */
+    void *z;
+} ecc_point;
+
+/** ECC key's domain parameters */
+typedef struct {
+   /** The size of the curve in octets */
+   int size;
+   /** The prime that defines the field the curve is in */
+   void *prime;
+   /** The fields A param */
+   void *A;
+   /** The fields B param */
+   void *B;
+   /** The order of the curve */
+   void *order;
+   /** The base point G on the curve */
+   ecc_point base;
+   /** The co-factor */
+   unsigned long cofactor;
+   /** The OID */
+   unsigned long oid[16];
+   unsigned long oidlen;
+} ltc_ecc_dp;
+
+/** An ECC key */
+typedef struct {
+    /** Type of key, PK_PRIVATE or PK_PUBLIC */
+    int type;
+
+    /** Structure with domain parameters */
+    ltc_ecc_dp dp;
+
+    /** Structure with the public key */
+    ecc_point pubkey;
+
+    /** The private key */
+    void *k;
+} ecc_key;
+
+/** Formats of ECC signatures */
+typedef enum ecc_signature_type_ {
+   /* ASN.1 encoded, ANSI X9.62 */
+   LTC_ECCSIG_ANSIX962   = 0x0,
+   /* raw R, S values */
+   LTC_ECCSIG_RFC7518    = 0x1,
+   /* raw R, S, V (+27) values */
+   LTC_ECCSIG_ETH27      = 0x2,
+   /* SSH + ECDSA signature format defined by RFC5656 */
+   LTC_ECCSIG_RFC5656    = 0x3,
+} ecc_signature_type;
+
+/** the ECC params provided */
+extern const ltc_ecc_curve ltc_ecc_curves[];
+
+void ecc_sizes(int *low, int *high);
+int  ecc_get_size(const ecc_key *key);
+
+int  ecc_find_curve(const char* name_or_oid, const ltc_ecc_curve** cu);
+int  ecc_set_curve(const ltc_ecc_curve *cu, ecc_key *key);
+int  ecc_generate_key(prng_state *prng, int wprng, ecc_key *key);
+int  ecc_set_key(const unsigned char *in, unsigned long inlen, int type, ecc_key *key);
+int  ecc_get_key(unsigned char *out, unsigned long *outlen, int type, const ecc_key *key);
+int  ecc_get_oid_str(char *out, unsigned long *outlen, const ecc_key *key);
+
+int  ecc_make_key(prng_state *prng, int wprng, int keysize, ecc_key *key);
+int  ecc_make_key_ex(prng_state *prng, int wprng, ecc_key *key, const ltc_ecc_curve *cu);
+void ecc_free(ecc_key *key);
+
+int  ecc_export(unsigned char *out, unsigned long *outlen, int type, const ecc_key *key);
+int  ecc_import(const unsigned char *in, unsigned long inlen, ecc_key *key);
+int  ecc_import_ex(const unsigned char *in, unsigned long inlen, ecc_key *key, const ltc_ecc_curve *cu);
+
+int ecc_ansi_x963_export(const ecc_key *key, unsigned char *out, unsigned long *outlen);
+int ecc_ansi_x963_import(const unsigned char *in, unsigned long inlen, ecc_key *key);
+int ecc_ansi_x963_import_ex(const unsigned char *in, unsigned long inlen, ecc_key *key, const ltc_ecc_curve *cu);
+
+int ecc_export_openssl(unsigned char *out, unsigned long *outlen, int type, const ecc_key *key);
+int ecc_import_openssl(const unsigned char *in, unsigned long inlen, ecc_key *key);
+int ecc_import_pkcs8(const unsigned char *in, unsigned long inlen, const void *pwd, unsigned long pwdlen, ecc_key *key);
+int ecc_import_x509(const unsigned char *in, unsigned long inlen, ecc_key *key);
+
+int  ecc_shared_secret(const ecc_key *private_key, const ecc_key *public_key,
+                       unsigned char *out, unsigned long *outlen);
+
+int  ecc_encrypt_key(const unsigned char *in,   unsigned long inlen,
+                           unsigned char *out,  unsigned long *outlen,
+                           prng_state *prng, int wprng, int hash,
+                           const ecc_key *key);
+
+int  ecc_decrypt_key(const unsigned char *in,  unsigned long  inlen,
+                           unsigned char *out, unsigned long *outlen,
+                           const ecc_key *key);
+
+#define ecc_sign_hash_rfc7518(in_, inlen_, out_, outlen_, prng_, wprng_, key_) \
+   ecc_sign_hash_ex(in_, inlen_, out_, outlen_, prng_, wprng_, LTC_ECCSIG_RFC7518, NULL, key_)
+
+#define ecc_sign_hash(in_, inlen_, out_, outlen_, prng_, wprng_, key_) \
+   ecc_sign_hash_ex(in_, inlen_, out_, outlen_, prng_, wprng_, LTC_ECCSIG_ANSIX962, NULL, key_)
+
+#define ecc_verify_hash_rfc7518(sig_, siglen_, hash_, hashlen_, stat_, key_) \
+   ecc_verify_hash_ex(sig_, siglen_, hash_, hashlen_, LTC_ECCSIG_RFC7518, stat_, key_)
+
+#define ecc_verify_hash(sig_, siglen_, hash_, hashlen_, stat_, key_) \
+   ecc_verify_hash_ex(sig_, siglen_, hash_, hashlen_, LTC_ECCSIG_ANSIX962, stat_, key_)
+
+int  ecc_sign_hash_ex(const unsigned char *in,  unsigned long inlen,
+                            unsigned char *out, unsigned long *outlen,
+                            prng_state *prng, int wprng, ecc_signature_type sigformat,
+                            int *recid, const ecc_key *key);
+
+int  ecc_verify_hash_ex(const unsigned char *sig,  unsigned long siglen,
+                        const unsigned char *hash, unsigned long hashlen,
+                        ecc_signature_type sigformat, int *stat, const ecc_key *key);
+
+int  ecc_recover_key(const unsigned char *sig,  unsigned long siglen,
+                     const unsigned char *hash, unsigned long hashlen,
+                     int recid, ecc_signature_type sigformat, ecc_key *key);
+
+#endif
+
+#ifdef LTC_CURVE25519
+
+typedef struct {
+   /** The key type, PK_PRIVATE or PK_PUBLIC */
+   enum public_key_type type;
+
+   /** The PK-algorithm, PKA_ED25519 or PKA_X25519 */
+   /** This was supposed to be:
+    * enum public_key_algorithms algo;
+    * but that enum is now in tomcrypt_private.h
+    */
+   int algo;
+
+   /** The private key */
+   unsigned char priv[32];
+
+   /** The public key */
+   unsigned char pub[32];
+} curve25519_key;
+
+
+/** Ed25519 Signature API */
+int ed25519_make_key(prng_state *prng, int wprng, curve25519_key *key);
+
+int ed25519_set_key(const unsigned char *sk, unsigned long sklen,
+                    const unsigned char *pk, unsigned long pklen,
+                         curve25519_key *key);
+
+int ed25519_export(       unsigned char *out, unsigned long *outlen,
+                                    int  which,
+                   const curve25519_key *key);
+
+int ed25519_import(const unsigned char *in, unsigned long inlen, curve25519_key *key);
+int ed25519_import_x509(const unsigned char *in, unsigned long inlen, curve25519_key *key);
+int ed25519_import_pkcs8(const unsigned char *in, unsigned long inlen,
+                                  const void *pwd, unsigned long pwdlen,
+                              curve25519_key *key);
+
+int ed25519_sign(const unsigned char  *msg, unsigned long msglen,
+                       unsigned char  *sig, unsigned long *siglen,
+                 const curve25519_key *private_key);
+
+int ed25519_verify(const  unsigned char *msg, unsigned long msglen,
+                   const  unsigned char *sig, unsigned long siglen,
+                   int *stat, const curve25519_key *public_key);
+
+/** X25519 Key-Exchange API */
+int x25519_make_key(prng_state *prng, int wprng, curve25519_key *key);
+
+int x25519_set_key(const unsigned char *k,  unsigned long klen,
+                   const unsigned char *u,  unsigned long ulen,
+                        curve25519_key *key);
+
+int x25519_export(       unsigned char *out, unsigned long *outlen,
+                                   int  which,
+                  const curve25519_key *key);
+
+int x25519_import(const unsigned char *in, unsigned long inlen, curve25519_key *key);
+int x25519_import_x509(const unsigned char *in, unsigned long inlen, curve25519_key *key);
+int x25519_import_pkcs8(const unsigned char *in, unsigned long inlen,
+                                 const void *pwd, unsigned long pwdlen,
+                             curve25519_key *key);
+
+int x25519_shared_secret(const curve25519_key *private_key,
+                         const curve25519_key *public_key,
+                                unsigned char *out, unsigned long *outlen);
+
+#endif /* LTC_CURVE25519 */
+
+#ifdef LTC_MDSA
+
+/* Max diff between group and modulus size in bytes */
+#define LTC_MDSA_DELTA     512
+
+/* Max DSA group size in bytes (default allows 4k-bit groups) */
+#define LTC_MDSA_MAX_GROUP 512
+
+/** DSA key structure */
+typedef struct {
+   /** The key type, PK_PRIVATE or PK_PUBLIC */
+   int type;
+
+   /** The order of the sub-group used in octets */
+   int qord;
+
+   /** The generator  */
+   void *g;
+
+   /** The prime used to generate the sub-group */
+   void *q;
+
+   /** The large prime that generats the field the contains the sub-group */
+   void *p;
+
+   /** The private key */
+   void *x;
+
+   /** The public key */
+   void *y;
+} dsa_key;
+
+int dsa_make_key(prng_state *prng, int wprng, int group_size, int modulus_size, dsa_key *key);
+
+int dsa_set_pqg(const unsigned char *p,  unsigned long plen,
+                const unsigned char *q,  unsigned long qlen,
+                const unsigned char *g,  unsigned long glen,
+                dsa_key *key);
+int dsa_set_pqg_dsaparam(const unsigned char *dsaparam, unsigned long dsaparamlen, dsa_key *key);
+int dsa_generate_pqg(prng_state *prng, int wprng, int group_size, int modulus_size, dsa_key *key);
+
+int dsa_set_key(const unsigned char *in, unsigned long inlen, int type, dsa_key *key);
+int dsa_generate_key(prng_state *prng, int wprng, dsa_key *key);
+
+void dsa_free(dsa_key *key);
+
+int dsa_sign_hash_raw(const unsigned char *in,  unsigned long inlen,
+                                   void *r,   void *s,
+                               prng_state *prng, int wprng, const dsa_key *key);
+
+int dsa_sign_hash(const unsigned char *in,  unsigned long inlen,
+                        unsigned char *out, unsigned long *outlen,
+                        prng_state *prng, int wprng, const dsa_key *key);
+
+int dsa_verify_hash_raw(         void *r,          void *s,
+                    const unsigned char *hash, unsigned long hashlen,
+                                    int *stat, const dsa_key *key);
+
+int dsa_verify_hash(const unsigned char *sig,        unsigned long  siglen,
+                    const unsigned char *hash,       unsigned long  hashlen,
+                          int           *stat, const dsa_key       *key);
+
+int dsa_encrypt_key(const unsigned char *in,   unsigned long inlen,
+                          unsigned char *out,  unsigned long *outlen,
+                          prng_state    *prng, int wprng, int hash,
+                    const dsa_key       *key);
+
+int dsa_decrypt_key(const unsigned char *in,  unsigned long  inlen,
+                          unsigned char *out, unsigned long *outlen,
+                    const dsa_key       *key);
+
+int dsa_import(const unsigned char *in, unsigned long inlen, dsa_key *key);
+int dsa_export(unsigned char *out, unsigned long *outlen, int type, const dsa_key *key);
+int dsa_verify_key(const dsa_key *key, int *stat);
+int dsa_shared_secret(void          *private_key, void *base,
+                      const dsa_key *public_key,
+                      unsigned char *out,         unsigned long *outlen);
+#endif /* LTC_MDSA */
+
+#ifdef LTC_DER
+/* DER handling */
+
+typedef enum ltc_asn1_type_ {
+ /*  0 */
+ LTC_ASN1_EOL,
+ LTC_ASN1_BOOLEAN,
+ LTC_ASN1_INTEGER,
+ LTC_ASN1_SHORT_INTEGER,
+ LTC_ASN1_BIT_STRING,
+ /*  5 */
+ LTC_ASN1_OCTET_STRING,
+ LTC_ASN1_NULL,
+ LTC_ASN1_OBJECT_IDENTIFIER,
+ LTC_ASN1_IA5_STRING,
+ LTC_ASN1_PRINTABLE_STRING,
+ /* 10 */
+ LTC_ASN1_UTF8_STRING,
+ LTC_ASN1_UTCTIME,
+ LTC_ASN1_CHOICE,
+ LTC_ASN1_SEQUENCE,
+ LTC_ASN1_SET,
+ /* 15 */
+ LTC_ASN1_SETOF,
+ LTC_ASN1_RAW_BIT_STRING,
+ LTC_ASN1_TELETEX_STRING,
+ LTC_ASN1_GENERALIZEDTIME,
+ LTC_ASN1_CUSTOM_TYPE,
+} ltc_asn1_type;
+
+typedef enum {
+   LTC_ASN1_CL_UNIVERSAL = 0x0,
+   LTC_ASN1_CL_APPLICATION = 0x1,
+   LTC_ASN1_CL_CONTEXT_SPECIFIC = 0x2,
+   LTC_ASN1_CL_PRIVATE = 0x3,
+} ltc_asn1_class;
+
+typedef enum {
+   LTC_ASN1_PC_PRIMITIVE = 0x0,
+   LTC_ASN1_PC_CONSTRUCTED = 0x1,
+} ltc_asn1_pc;
+
+/** A LTC ASN.1 list type */
+typedef struct ltc_asn1_list_ {
+   /** The LTC ASN.1 enumerated type identifier */
+   ltc_asn1_type type;
+   /** The data to encode or place for decoding */
+   void         *data;
+   /** The size of the input or resulting output */
+   unsigned long size;
+   /** The used flag
+    * 1. This is used by the CHOICE ASN.1 type to indicate which choice was made
+    * 2. This is used by the ASN.1 decoder to indicate if an element is used
+    * 3. This is used by the flexi-decoder to indicate the first byte of the identifier */
+   int           used;
+   /** Flag used to indicate optional items in ASN.1 sequences */
+   int           optional;
+   /** ASN.1 identifier */
+   ltc_asn1_class klass;
+   ltc_asn1_pc    pc;
+   ulong64        tag;
+   /** prev/next entry in the list */
+   struct ltc_asn1_list_ *prev, *next, *child, *parent;
+} ltc_asn1_list;
+
+#define LTC_SET_ASN1(list, index, Type, Data, Size)  \
+   do {                                              \
+      int LTC_MACRO_temp            = (index);       \
+      ltc_asn1_list *LTC_MACRO_list = (list);        \
+      LTC_MACRO_list[LTC_MACRO_temp].type = (Type);  \
+      LTC_MACRO_list[LTC_MACRO_temp].data = (void*)(Data);  \
+      LTC_MACRO_list[LTC_MACRO_temp].size = (Size);  \
+      LTC_MACRO_list[LTC_MACRO_temp].used = 0;       \
+      LTC_MACRO_list[LTC_MACRO_temp].optional = 0;   \
+      LTC_MACRO_list[LTC_MACRO_temp].klass = 0;      \
+      LTC_MACRO_list[LTC_MACRO_temp].pc = 0;         \
+      LTC_MACRO_list[LTC_MACRO_temp].tag = 0;        \
+   } while (0)
+
+#define __LTC_SET_ASN1_IDENTIFIER(list, index, Class, Pc, Tag)      \
+   do {                                                           \
+      int LTC_MACRO_temp            = (index);                    \
+      ltc_asn1_list *LTC_MACRO_list = (list);                     \
+      LTC_MACRO_list[LTC_MACRO_temp].type = LTC_ASN1_CUSTOM_TYPE; \
+      LTC_MACRO_list[LTC_MACRO_temp].klass = (Class);             \
+      LTC_MACRO_list[LTC_MACRO_temp].pc = (Pc);                   \
+      LTC_MACRO_list[LTC_MACRO_temp].tag = (Tag);                 \
+   } while (0)
+
+#define LTC_SET_ASN1_CUSTOM_CONSTRUCTED(list, index, Class, Tag, Data)    \
+   do {                                                           \
+      int LTC_MACRO_temp##__LINE__ = (index);                     \
+      LTC_SET_ASN1(list, LTC_MACRO_temp##__LINE__, LTC_ASN1_CUSTOM_TYPE, Data, 1);   \
+      __LTC_SET_ASN1_IDENTIFIER(list, LTC_MACRO_temp##__LINE__, Class, LTC_ASN1_PC_CONSTRUCTED, Tag);       \
+   } while (0)
+
+#define LTC_SET_ASN1_CUSTOM_PRIMITIVE(list, index, Class, Tag, Type, Data, Size)    \
+   do {                                                           \
+      int LTC_MACRO_temp##__LINE__ = (index);                     \
+      LTC_SET_ASN1(list, LTC_MACRO_temp##__LINE__, LTC_ASN1_CUSTOM_TYPE, Data, Size);   \
+      __LTC_SET_ASN1_IDENTIFIER(list, LTC_MACRO_temp##__LINE__, Class, LTC_ASN1_PC_PRIMITIVE, Tag);       \
+      list[LTC_MACRO_temp##__LINE__].used = (int)(Type);       \
+   } while (0)
+
+extern const char*          der_asn1_class_to_string_map[];
+extern const unsigned long  der_asn1_class_to_string_map_sz;
+
+extern const char*          der_asn1_pc_to_string_map[];
+extern const unsigned long  der_asn1_pc_to_string_map_sz;
+
+extern const char*          der_asn1_tag_to_string_map[];
+extern const unsigned long  der_asn1_tag_to_string_map_sz;
+
+/* SEQUENCE */
+int der_encode_sequence_ex(const ltc_asn1_list *list, unsigned long inlen,
+                           unsigned char *out,        unsigned long *outlen, int type_of);
+
+#define der_encode_sequence(list, inlen, out, outlen) der_encode_sequence_ex(list, inlen, out, outlen, LTC_ASN1_SEQUENCE)
+
+/** The supported bitmap for all the
+ * decoders with a `flags` argument.
+ */
+enum ltc_der_seq {
+   LTC_DER_SEQ_ZERO = 0x0u,
+
+   /** Bit0  - [0]=Unordered (SET or SETOF)
+    *          [1]=Ordered (SEQUENCE) */
+   LTC_DER_SEQ_UNORDERED = LTC_DER_SEQ_ZERO,
+   LTC_DER_SEQ_ORDERED = 0x1u,
+
+   /** Bit1  - [0]=Relaxed
+    *          [1]=Strict */
+   LTC_DER_SEQ_RELAXED = LTC_DER_SEQ_ZERO,
+   LTC_DER_SEQ_STRICT = 0x2u,
+
+   /** Alternative naming */
+   LTC_DER_SEQ_SET = LTC_DER_SEQ_UNORDERED,
+   LTC_DER_SEQ_SEQUENCE = LTC_DER_SEQ_ORDERED,
+};
+
+int der_decode_sequence_ex(const unsigned char *in, unsigned long  inlen,
+                           ltc_asn1_list *list,     unsigned long  outlen, unsigned int flags);
+
+#define der_decode_sequence(in, inlen, list, outlen) der_decode_sequence_ex(in, inlen, list, outlen, LTC_DER_SEQ_SEQUENCE | LTC_DER_SEQ_RELAXED)
+#define der_decode_sequence_strict(in, inlen, list, outlen) der_decode_sequence_ex(in, inlen, list, outlen, LTC_DER_SEQ_SEQUENCE | LTC_DER_SEQ_STRICT)
+
+int der_length_sequence(const ltc_asn1_list *list, unsigned long inlen,
+                        unsigned long *outlen);
+
+
+/* Custom-types */
+int der_encode_custom_type(const ltc_asn1_list *root,
+                                 unsigned char *out, unsigned long *outlen);
+
+int der_decode_custom_type(const unsigned char *in, unsigned long inlen,
+                                 ltc_asn1_list *root);
+
+int der_length_custom_type(const ltc_asn1_list *root,
+                                 unsigned long *outlen,
+                                 unsigned long *payloadlen);
+
+/* SET */
+#define der_decode_set(in, inlen, list, outlen) der_decode_sequence_ex(in, inlen, list, outlen, LTC_DER_SEQ_SET)
+#define der_length_set der_length_sequence
+int der_encode_set(const ltc_asn1_list *list, unsigned long inlen,
+                   unsigned char *out,        unsigned long *outlen);
+
+int der_encode_setof(const ltc_asn1_list *list, unsigned long inlen,
+                     unsigned char *out,        unsigned long *outlen);
+
+/* VA list handy helpers with triplets of <type, size, data> */
+int der_encode_sequence_multi(unsigned char *out, unsigned long *outlen, ...);
+int der_decode_sequence_multi(const unsigned char *in, unsigned long inlen, ...);
+
+/* FLEXI DECODER handle unknown list decoder */
+int  der_decode_sequence_flexi(const unsigned char *in, unsigned long *inlen, ltc_asn1_list **out);
+#define der_free_sequence_flexi         der_sequence_free
+void der_sequence_free(ltc_asn1_list *in);
+void der_sequence_shrink(ltc_asn1_list *in);
+
+/* BOOLEAN */
+int der_length_boolean(unsigned long *outlen);
+int der_encode_boolean(int in,
+                       unsigned char *out, unsigned long *outlen);
+int der_decode_boolean(const unsigned char *in, unsigned long inlen,
+                                       int *out);
+/* INTEGER */
+int der_encode_integer(void *num, unsigned char *out, unsigned long *outlen);
+int der_decode_integer(const unsigned char *in, unsigned long inlen, void *num);
+int der_length_integer(void *num, unsigned long *outlen);
+
+/* INTEGER -- handy for 0..2^32-1 values */
+int der_decode_short_integer(const unsigned char *in, unsigned long inlen, unsigned long *num);
+int der_encode_short_integer(unsigned long num, unsigned char *out, unsigned long *outlen);
+int der_length_short_integer(unsigned long num, unsigned long *outlen);
+
+/* BIT STRING */
+int der_encode_bit_string(const unsigned char *in, unsigned long inlen,
+                                unsigned char *out, unsigned long *outlen);
+int der_decode_bit_string(const unsigned char *in, unsigned long inlen,
+                                unsigned char *out, unsigned long *outlen);
+int der_encode_raw_bit_string(const unsigned char *in, unsigned long inlen,
+                                unsigned char *out, unsigned long *outlen);
+int der_decode_raw_bit_string(const unsigned char *in, unsigned long inlen,
+                                unsigned char *out, unsigned long *outlen);
+int der_length_bit_string(unsigned long nbits, unsigned long *outlen);
+
+/* OCTET STRING */
+int der_encode_octet_string(const unsigned char *in, unsigned long inlen,
+                                  unsigned char *out, unsigned long *outlen);
+int der_decode_octet_string(const unsigned char *in, unsigned long inlen,
+                                  unsigned char *out, unsigned long *outlen);
+int der_length_octet_string(unsigned long noctets, unsigned long *outlen);
+
+/* OBJECT IDENTIFIER */
+int der_encode_object_identifier(const unsigned long *words, unsigned long  nwords,
+                                       unsigned char *out,   unsigned long *outlen);
+int der_decode_object_identifier(const unsigned char *in,    unsigned long  inlen,
+                                       unsigned long *words, unsigned long *outlen);
+int der_length_object_identifier(const unsigned long *words, unsigned long nwords, unsigned long *outlen);
+unsigned long der_object_identifier_bits(unsigned long x);
+
+/* IA5 STRING */
+int der_encode_ia5_string(const unsigned char *in, unsigned long inlen,
+                                unsigned char *out, unsigned long *outlen);
+int der_decode_ia5_string(const unsigned char *in, unsigned long inlen,
+                                unsigned char *out, unsigned long *outlen);
+int der_length_ia5_string(const unsigned char *octets, unsigned long noctets, unsigned long *outlen);
+
+int der_ia5_char_encode(int c);
+int der_ia5_value_decode(int v);
+
+/* TELETEX STRING */
+int der_decode_teletex_string(const unsigned char *in, unsigned long inlen,
+                                unsigned char *out, unsigned long *outlen);
+int der_length_teletex_string(const unsigned char *octets, unsigned long noctets, unsigned long *outlen);
+
+/* PRINTABLE STRING */
+int der_encode_printable_string(const unsigned char *in, unsigned long inlen,
+                                unsigned char *out, unsigned long *outlen);
+int der_decode_printable_string(const unsigned char *in, unsigned long inlen,
+                                unsigned char *out, unsigned long *outlen);
+int der_length_printable_string(const unsigned char *octets, unsigned long noctets, unsigned long *outlen);
+
+int der_printable_char_encode(int c);
+int der_printable_value_decode(int v);
+
+/* UTF-8 */
+#if (defined(SIZE_MAX) || __STDC_VERSION__ >= 199901L || defined(WCHAR_MAX) || defined(__WCHAR_MAX__) || defined(_WCHAR_T) || defined(_WCHAR_T_DEFINED) || defined (__WCHAR_TYPE__)) && !defined(LTC_NO_WCHAR)
+   #if defined(__WCHAR_MAX__)
+      #define LTC_WCHAR_MAX __WCHAR_MAX__
+   #else
+      #include <wchar.h>
+      #define LTC_WCHAR_MAX WCHAR_MAX
+   #endif
+/* please note that it might happen that LTC_WCHAR_MAX is undefined */
+#else
+   typedef ulong32 wchar_t;
+   #define LTC_WCHAR_MAX 0xFFFFFFFF
+#endif
+
+int der_encode_utf8_string(const wchar_t *in,  unsigned long inlen,
+                           unsigned char *out, unsigned long *outlen);
+
+int der_decode_utf8_string(const unsigned char *in,  unsigned long inlen,
+                                       wchar_t *out, unsigned long *outlen);
+unsigned long der_utf8_charsize(const wchar_t c);
+int der_length_utf8_string(const wchar_t *in, unsigned long noctets, unsigned long *outlen);
+
+
+/* CHOICE */
+int der_decode_choice(const unsigned char *in,   unsigned long *inlen,
+                            ltc_asn1_list *list, unsigned long  outlen);
+
+/* UTCTime */
+typedef struct {
+   unsigned YY, /* year */
+            MM, /* month */
+            DD, /* day */
+            hh, /* hour */
+            mm, /* minute */
+            ss, /* second */
+            off_dir, /* timezone offset direction 0 == +, 1 == - */
+            off_hh, /* timezone offset hours */
+            off_mm; /* timezone offset minutes */
+} ltc_utctime;
+
+int der_encode_utctime(const ltc_utctime   *utctime,
+                             unsigned char *out,   unsigned long *outlen);
+
+int der_decode_utctime(const unsigned char *in, unsigned long *inlen,
+                             ltc_utctime   *out);
+
+int der_length_utctime(const ltc_utctime *utctime, unsigned long *outlen);
+
+/* GeneralizedTime */
+typedef struct {
+   unsigned YYYY, /* year */
+            MM, /* month */
+            DD, /* day */
+            hh, /* hour */
+            mm, /* minute */
+            ss, /* second */
+            fs, /* fractional seconds */
+            off_dir, /* timezone offset direction 0 == +, 1 == - */
+            off_hh, /* timezone offset hours */
+            off_mm; /* timezone offset minutes */
+} ltc_generalizedtime;
+
+int der_encode_generalizedtime(const ltc_generalizedtime *gtime,
+                                     unsigned char       *out, unsigned long *outlen);
+
+int der_decode_generalizedtime(const unsigned char *in, unsigned long *inlen,
+                               ltc_generalizedtime *out);
+
+int der_length_generalizedtime(const ltc_generalizedtime *gtime, unsigned long *outlen);
+
+#endif
+
+/* ref:         HEAD -> develop */
+/* git commit:  a1f6312416ef6cd183ee62db58b640dc2d7ec1f4 */
+/* commit time: 2019-09-04 13:44:47 +0200 */

+ 109 - 0
libtomcrypt.mod/libtomcrypt/src/headers/tomcrypt_pkcs.h

@@ -0,0 +1,109 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ */
+
+/* PKCS Header Info */
+
+/* ===> PKCS #1 -- RSA Cryptography <=== */
+#ifdef LTC_PKCS_1
+
+enum ltc_pkcs_1_v1_5_blocks
+{
+  LTC_PKCS_1_EMSA   = 1,        /* Block type 1 (PKCS #1 v1.5 signature padding) */
+  LTC_PKCS_1_EME    = 2         /* Block type 2 (PKCS #1 v1.5 encryption padding) */
+};
+
+enum ltc_pkcs_1_paddings
+{
+  LTC_PKCS_1_V1_5     = 1,        /* PKCS #1 v1.5 padding (\sa ltc_pkcs_1_v1_5_blocks) */
+  LTC_PKCS_1_OAEP     = 2,        /* PKCS #1 v2.0 encryption padding */
+  LTC_PKCS_1_PSS      = 3,        /* PKCS #1 v2.1 signature padding */
+  LTC_PKCS_1_V1_5_NA1 = 4         /* PKCS #1 v1.5 padding - No ASN.1 (\sa ltc_pkcs_1_v1_5_blocks) */
+};
+
+int pkcs_1_mgf1(      int            hash_idx,
+                const unsigned char *seed, unsigned long seedlen,
+                      unsigned char *mask, unsigned long masklen);
+
+int pkcs_1_i2osp(void *n, unsigned long modulus_len, unsigned char *out);
+int pkcs_1_os2ip(void *n, unsigned char *in, unsigned long inlen);
+
+/* *** v1.5 padding */
+int pkcs_1_v1_5_encode(const unsigned char *msg,
+                             unsigned long  msglen,
+                             int            block_type,
+                             unsigned long  modulus_bitlen,
+                                prng_state *prng,
+                                       int  prng_idx,
+                             unsigned char *out,
+                             unsigned long *outlen);
+
+int pkcs_1_v1_5_decode(const unsigned char *msg,
+                             unsigned long  msglen,
+                                       int  block_type,
+                             unsigned long  modulus_bitlen,
+                             unsigned char *out,
+                             unsigned long *outlen,
+                                       int *is_valid);
+
+/* *** v2.1 padding */
+int pkcs_1_oaep_encode(const unsigned char *msg,    unsigned long msglen,
+                       const unsigned char *lparam, unsigned long lparamlen,
+                             unsigned long modulus_bitlen, prng_state *prng,
+                             int           prng_idx,         int  hash_idx,
+                             unsigned char *out,    unsigned long *outlen);
+
+int pkcs_1_oaep_decode(const unsigned char *msg,    unsigned long msglen,
+                       const unsigned char *lparam, unsigned long lparamlen,
+                             unsigned long modulus_bitlen, int hash_idx,
+                             unsigned char *out,    unsigned long *outlen,
+                             int           *res);
+
+int pkcs_1_pss_encode(const unsigned char *msghash, unsigned long msghashlen,
+                            unsigned long saltlen,  prng_state   *prng,
+                            int           prng_idx, int           hash_idx,
+                            unsigned long modulus_bitlen,
+                            unsigned char *out,     unsigned long *outlen);
+
+int pkcs_1_pss_decode(const unsigned char *msghash, unsigned long msghashlen,
+                      const unsigned char *sig,     unsigned long siglen,
+                            unsigned long saltlen,  int           hash_idx,
+                            unsigned long modulus_bitlen, int    *res);
+
+#endif /* LTC_PKCS_1 */
+
+/* ===> PKCS #5 -- Password Based Cryptography <=== */
+#ifdef LTC_PKCS_5
+
+/* Algorithm #1 (PBKDF1) */
+int pkcs_5_alg1(const unsigned char *password, unsigned long password_len,
+                const unsigned char *salt,
+                int iteration_count,  int hash_idx,
+                unsigned char *out,   unsigned long *outlen);
+
+/* Algorithm #1 (PBKDF1) - OpenSSL-compatible variant for arbitrarily-long keys.
+   Compatible with EVP_BytesToKey() */
+int pkcs_5_alg1_openssl(const unsigned char *password,
+                        unsigned long password_len,
+                        const unsigned char *salt,
+                        int iteration_count,  int hash_idx,
+                        unsigned char *out,   unsigned long *outlen);
+
+/* Algorithm #2 (PBKDF2) */
+int pkcs_5_alg2(const unsigned char *password, unsigned long password_len,
+                const unsigned char *salt,     unsigned long salt_len,
+                int iteration_count,           int hash_idx,
+                unsigned char *out,            unsigned long *outlen);
+
+int pkcs_5_test (void);
+#endif  /* LTC_PKCS_5 */
+
+
+/* ref:         HEAD -> develop */
+/* git commit:  a1f6312416ef6cd183ee62db58b640dc2d7ec1f4 */
+/* commit time: 2019-09-04 13:44:47 +0200 */

+ 440 - 0
libtomcrypt.mod/libtomcrypt/src/headers/tomcrypt_private.h

@@ -0,0 +1,440 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ */
+
+#include "tomcrypt.h"
+
+/*
+ * Internal Macros
+ */
+
+#define LTC_PAD_MASK       (0xF000U)
+
+/*
+ * Internal Enums
+ */
+
+enum ltc_oid_id {
+   PKA_RSA,
+   PKA_DSA,
+   PKA_EC,
+   PKA_EC_PRIMEF,
+   PKA_X25519,
+   PKA_ED25519,
+};
+
+/*
+ * Internal Types
+ */
+
+typedef struct {
+  int size;
+  const char *name, *base, *prime;
+} ltc_dh_set_type;
+
+
+typedef int (*fn_kdf_t)(const unsigned char *password, unsigned long password_len,
+                              const unsigned char *salt,     unsigned long salt_len,
+                              int iteration_count,  int hash_idx,
+                              unsigned char *out,   unsigned long *outlen);
+
+typedef struct {
+   /* KDF */
+   fn_kdf_t kdf;
+   /* Hash or HMAC */
+   const char* h;
+   /* cipher */
+   const char* c;
+   unsigned long keylen;
+   /* not used for pbkdf2 */
+   unsigned long blocklen;
+} pbes_properties;
+
+typedef struct
+{
+   pbes_properties type;
+   const void *pwd;
+   unsigned long pwdlen;
+   ltc_asn1_list *enc_data;
+   ltc_asn1_list *salt;
+   ltc_asn1_list *iv;
+   unsigned long iterations;
+   /* only used for RC2 */
+   unsigned long key_bits;
+} pbes_arg;
+
+/*
+ * Internal functions
+ */
+
+/* tomcrypt_hash.h */
+
+/* a simple macro for making hash "process" functions */
+#define HASH_PROCESS(func_name, compress_name, state_var, block_size)                       \
+int func_name (hash_state * md, const unsigned char *in, unsigned long inlen)               \
+{                                                                                           \
+    unsigned long n;                                                                        \
+    int           err;                                                                      \
+    LTC_ARGCHK(md != NULL);                                                                 \
+    LTC_ARGCHK(in != NULL);                                                                 \
+    if (md-> state_var .curlen > sizeof(md-> state_var .buf)) {                             \
+       return CRYPT_INVALID_ARG;                                                            \
+    }                                                                                       \
+    if ((md-> state_var .length + inlen) < md-> state_var .length) {                        \
+      return CRYPT_HASH_OVERFLOW;                                                           \
+    }                                                                                       \
+    while (inlen > 0) {                                                                     \
+        if (md-> state_var .curlen == 0 && inlen >= block_size) {                           \
+           if ((err = compress_name (md, in)) != CRYPT_OK) {                                \
+              return err;                                                                   \
+           }                                                                                \
+           md-> state_var .length += block_size * 8;                                        \
+           in             += block_size;                                                    \
+           inlen          -= block_size;                                                    \
+        } else {                                                                            \
+           n = MIN(inlen, (block_size - md-> state_var .curlen));                           \
+           XMEMCPY(md-> state_var .buf + md-> state_var.curlen, in, (size_t)n);             \
+           md-> state_var .curlen += n;                                                     \
+           in             += n;                                                             \
+           inlen          -= n;                                                             \
+           if (md-> state_var .curlen == block_size) {                                      \
+              if ((err = compress_name (md, md-> state_var .buf)) != CRYPT_OK) {            \
+                 return err;                                                                \
+              }                                                                             \
+              md-> state_var .length += 8*block_size;                                       \
+              md-> state_var .curlen = 0;                                                   \
+           }                                                                                \
+       }                                                                                    \
+    }                                                                                       \
+    return CRYPT_OK;                                                                        \
+}
+
+
+/* tomcrypt_mac.h */
+
+int ocb3_int_ntz(unsigned long x);
+void ocb3_int_xor_blocks(unsigned char *out, const unsigned char *block_a, const unsigned char *block_b, unsigned long block_len);
+
+
+/* tomcrypt_math.h */
+
+#if !defined(DESC_DEF_ONLY)
+
+#define MP_DIGIT_BIT                 ltc_mp.bits_per_digit
+
+/* some handy macros */
+#define mp_init(a)                   ltc_mp.init(a)
+#define mp_init_multi                ltc_init_multi
+#define mp_clear(a)                  ltc_mp.deinit(a)
+#define mp_clear_multi               ltc_deinit_multi
+#define mp_cleanup_multi             ltc_cleanup_multi
+#define mp_init_copy(a, b)           ltc_mp.init_copy(a, b)
+
+#define mp_neg(a, b)                 ltc_mp.neg(a, b)
+#define mp_copy(a, b)                ltc_mp.copy(a, b)
+
+#define mp_set(a, b)                 ltc_mp.set_int(a, b)
+#define mp_set_int(a, b)             ltc_mp.set_int(a, b)
+#define mp_get_int(a)                ltc_mp.get_int(a)
+#define mp_get_digit(a, n)           ltc_mp.get_digit(a, n)
+#define mp_get_digit_count(a)        ltc_mp.get_digit_count(a)
+#define mp_cmp(a, b)                 ltc_mp.compare(a, b)
+#define mp_cmp_d(a, b)               ltc_mp.compare_d(a, b)
+#define mp_count_bits(a)             ltc_mp.count_bits(a)
+#define mp_cnt_lsb(a)                ltc_mp.count_lsb_bits(a)
+#define mp_2expt(a, b)               ltc_mp.twoexpt(a, b)
+
+#define mp_read_radix(a, b, c)       ltc_mp.read_radix(a, b, c)
+#define mp_toradix(a, b, c)          ltc_mp.write_radix(a, b, c)
+#define mp_unsigned_bin_size(a)      ltc_mp.unsigned_size(a)
+#define mp_to_unsigned_bin(a, b)     ltc_mp.unsigned_write(a, b)
+#define mp_read_unsigned_bin(a, b, c) ltc_mp.unsigned_read(a, b, c)
+
+#define mp_add(a, b, c)              ltc_mp.add(a, b, c)
+#define mp_add_d(a, b, c)            ltc_mp.addi(a, b, c)
+#define mp_sub(a, b, c)              ltc_mp.sub(a, b, c)
+#define mp_sub_d(a, b, c)            ltc_mp.subi(a, b, c)
+#define mp_mul(a, b, c)              ltc_mp.mul(a, b, c)
+#define mp_mul_d(a, b, c)            ltc_mp.muli(a, b, c)
+#define mp_sqr(a, b)                 ltc_mp.sqr(a, b)
+#define mp_sqrtmod_prime(a, b, c)    ltc_mp.sqrtmod_prime(a, b, c)
+#define mp_div(a, b, c, d)           ltc_mp.mpdiv(a, b, c, d)
+#define mp_div_2(a, b)               ltc_mp.div_2(a, b)
+#define mp_mod(a, b, c)              ltc_mp.mpdiv(a, b, NULL, c)
+#define mp_mod_d(a, b, c)            ltc_mp.modi(a, b, c)
+#define mp_gcd(a, b, c)              ltc_mp.gcd(a, b, c)
+#define mp_lcm(a, b, c)              ltc_mp.lcm(a, b, c)
+
+#define mp_addmod(a, b, c, d)        ltc_mp.addmod(a, b, c, d)
+#define mp_submod(a, b, c, d)        ltc_mp.submod(a, b, c, d)
+#define mp_mulmod(a, b, c, d)        ltc_mp.mulmod(a, b, c, d)
+#define mp_sqrmod(a, b, c)           ltc_mp.sqrmod(a, b, c)
+#define mp_invmod(a, b, c)           ltc_mp.invmod(a, b, c)
+
+#define mp_montgomery_setup(a, b)    ltc_mp.montgomery_setup(a, b)
+#define mp_montgomery_normalization(a, b) ltc_mp.montgomery_normalization(a, b)
+#define mp_montgomery_reduce(a, b, c)   ltc_mp.montgomery_reduce(a, b, c)
+#define mp_montgomery_free(a)        ltc_mp.montgomery_deinit(a)
+
+#define mp_exptmod(a,b,c,d)          ltc_mp.exptmod(a,b,c,d)
+#define mp_prime_is_prime(a, b, c)   ltc_mp.isprime(a, b, c)
+
+#define mp_iszero(a)                 (mp_cmp_d(a, 0) == LTC_MP_EQ ? LTC_MP_YES : LTC_MP_NO)
+#define mp_isodd(a)                  (mp_get_digit_count(a) > 0 ? (mp_get_digit(a, 0) & 1 ? LTC_MP_YES : LTC_MP_NO) : LTC_MP_NO)
+#define mp_exch(a, b)                do { void *ABC__tmp = a; a = b; b = ABC__tmp; } while(0)
+
+#define mp_tohex(a, b)               mp_toradix(a, b, 16)
+
+#define mp_rand(a, b)                ltc_mp.rand(a, b)
+
+#endif
+
+
+/* tomcrypt_misc.h */
+
+void copy_or_zeromem(const unsigned char* src, unsigned char* dest, unsigned long len, int coz);
+
+int pbes_decrypt(const pbes_arg  *arg, unsigned char *dec_data, unsigned long *dec_size);
+
+int pbes1_extract(const ltc_asn1_list *s, pbes_arg *res);
+int pbes2_extract(const ltc_asn1_list *s, pbes_arg *res);
+
+
+/* tomcrypt_pk.h */
+
+int rand_bn_bits(void *N, int bits, prng_state *prng, int wprng);
+int rand_bn_upto(void *N, void *limit, prng_state *prng, int wprng);
+
+int pk_get_oid(enum ltc_oid_id id, const char **st);
+int pk_oid_str_to_num(const char *OID, unsigned long *oid, unsigned long *oidlen);
+int pk_oid_num_to_str(const unsigned long *oid, unsigned long oidlen, char *OID, unsigned long *outlen);
+
+/* ---- DH Routines ---- */
+#ifdef LTC_MDH
+extern const ltc_dh_set_type ltc_dh_sets[];
+
+int dh_check_pubkey(const dh_key *key);
+#endif /* LTC_MDH */
+
+/* ---- ECC Routines ---- */
+#ifdef LTC_MECC
+int ecc_set_curve_from_mpis(void *a, void *b, void *prime, void *order, void *gx, void *gy, unsigned long cofactor, ecc_key *key);
+int ecc_copy_curve(const ecc_key *srckey, ecc_key *key);
+int ecc_set_curve_by_size(int size, ecc_key *key);
+int ecc_import_subject_public_key_info(const unsigned char *in, unsigned long inlen, ecc_key *key);
+
+#ifdef LTC_SSH
+int ecc_ssh_ecdsa_encode_name(char *buffer, unsigned long *buflen, const ecc_key *key);
+#endif
+
+/* low level functions */
+ecc_point *ltc_ecc_new_point(void);
+void       ltc_ecc_del_point(ecc_point *p);
+int        ltc_ecc_set_point_xyz(ltc_mp_digit x, ltc_mp_digit y, ltc_mp_digit z, ecc_point *p);
+int        ltc_ecc_copy_point(const ecc_point *src, ecc_point *dst);
+int        ltc_ecc_is_point(const ltc_ecc_dp *dp, void *x, void *y);
+int        ltc_ecc_is_point_at_infinity(const ecc_point *P, void *modulus, int *retval);
+int        ltc_ecc_import_point(const unsigned char *in, unsigned long inlen, void *prime, void *a, void *b, void *x, void *y);
+int        ltc_ecc_export_point(unsigned char *out, unsigned long *outlen, void *x, void *y, unsigned long size, int compressed);
+int        ltc_ecc_verify_key(const ecc_key *key);
+
+/* point ops (mp == montgomery digit) */
+#if !defined(LTC_MECC_ACCEL) || defined(LTM_DESC) || defined(GMP_DESC)
+/* R = 2P */
+int ltc_ecc_projective_dbl_point(const ecc_point *P, ecc_point *R, void *ma, void *modulus, void *mp);
+
+/* R = P + Q */
+int ltc_ecc_projective_add_point(const ecc_point *P, const ecc_point *Q, ecc_point *R, void *ma, void *modulus, void *mp);
+#endif
+
+#if defined(LTC_MECC_FP)
+/* optimized point multiplication using fixed point cache (HAC algorithm 14.117) */
+int ltc_ecc_fp_mulmod(void *k, ecc_point *G, ecc_point *R, void *a, void *modulus, int map);
+
+/* functions for saving/loading/freeing/adding to fixed point cache */
+int ltc_ecc_fp_save_state(unsigned char **out, unsigned long *outlen);
+int ltc_ecc_fp_restore_state(unsigned char *in, unsigned long inlen);
+void ltc_ecc_fp_free(void);
+int ltc_ecc_fp_add_point(ecc_point *g, void *modulus, int lock);
+
+/* lock/unlock all points currently in fixed point cache */
+void ltc_ecc_fp_tablelock(int lock);
+#endif
+
+/* R = kG */
+int ltc_ecc_mulmod(void *k, const ecc_point *G, ecc_point *R, void *a, void *modulus, int map);
+
+#ifdef LTC_ECC_SHAMIR
+/* kA*A + kB*B = C */
+int ltc_ecc_mul2add(const ecc_point *A, void *kA,
+                    const ecc_point *B, void *kB,
+                          ecc_point *C,
+                               void *ma,
+                               void *modulus);
+
+#ifdef LTC_MECC_FP
+/* Shamir's trick with optimized point multiplication using fixed point cache */
+int ltc_ecc_fp_mul2add(const ecc_point *A, void *kA,
+                       const ecc_point *B, void *kB,
+                             ecc_point *C,
+                                  void *ma,
+                                  void *modulus);
+#endif
+
+#endif
+
+
+/* map P to affine from projective */
+int ltc_ecc_map(ecc_point *P, void *modulus, void *mp);
+#endif /* LTC_MECC */
+
+#ifdef LTC_MDSA
+int dsa_int_validate_xy(const dsa_key *key, int *stat);
+int dsa_int_validate_pqg(const dsa_key *key, int *stat);
+int dsa_int_validate_primes(const dsa_key *key, int *stat);
+#endif /* LTC_MDSA */
+
+
+#ifdef LTC_CURVE25519
+
+int tweetnacl_crypto_sign(
+  unsigned char *sm,unsigned long long *smlen,
+  const unsigned char *m,unsigned long long mlen,
+  const unsigned char *sk, const unsigned char *pk);
+int tweetnacl_crypto_sign_open(
+  int *stat,
+  unsigned char *m,unsigned long long *mlen,
+  const unsigned char *sm,unsigned long long smlen,
+  const unsigned char *pk);
+int tweetnacl_crypto_sign_keypair(prng_state *prng, int wprng, unsigned char *pk,unsigned char *sk);
+int tweetnacl_crypto_sk_to_pk(unsigned char *pk, const unsigned char *sk);
+int tweetnacl_crypto_scalarmult(unsigned char *q, const unsigned char *n, const unsigned char *p);
+int tweetnacl_crypto_scalarmult_base(unsigned char *q,const unsigned char *n);
+
+typedef int (*sk_to_pk)(unsigned char *pk ,const unsigned char *sk);
+int ec25519_import_pkcs8(const unsigned char *in, unsigned long inlen,
+                       const void *pwd, unsigned long pwdlen,
+                       enum ltc_oid_id id, sk_to_pk fp,
+                       curve25519_key *key);
+int ec25519_export(       unsigned char *out, unsigned long *outlen,
+                                    int  which,
+                   const curve25519_key *key);
+#endif /* LTC_CURVE25519 */
+
+#ifdef LTC_DER
+
+#define LTC_ASN1_IS_TYPE(e, t) (((e) != NULL) && ((e)->type == (t)))
+
+/* DER handling */
+int der_decode_custom_type_ex(const unsigned char *in, unsigned long  inlen,
+                           ltc_asn1_list *root,
+                           ltc_asn1_list *list,     unsigned long  outlen, unsigned int flags);
+
+int der_encode_asn1_identifier(const ltc_asn1_list *id, unsigned char *out, unsigned long *outlen);
+int der_decode_asn1_identifier(const unsigned char *in, unsigned long *inlen, ltc_asn1_list *id);
+int der_length_asn1_identifier(const ltc_asn1_list *id, unsigned long *idlen);
+
+int der_encode_asn1_length(unsigned long len, unsigned char* out, unsigned long* outlen);
+int der_decode_asn1_length(const unsigned char *in, unsigned long *inlen, unsigned long *outlen);
+int der_length_asn1_length(unsigned long len, unsigned long *outlen);
+
+int der_length_sequence_ex(const ltc_asn1_list *list, unsigned long inlen,
+                           unsigned long *outlen, unsigned long *payloadlen);
+
+extern const ltc_asn1_type  der_asn1_tag_to_type_map[];
+extern const unsigned long  der_asn1_tag_to_type_map_sz;
+
+extern const int der_asn1_type_to_identifier_map[];
+extern const unsigned long der_asn1_type_to_identifier_map_sz;
+
+int der_decode_sequence_multi_ex(const unsigned char *in, unsigned long inlen, unsigned int flags, ...);
+
+int der_teletex_char_encode(int c);
+int der_teletex_value_decode(int v);
+
+int der_utf8_valid_char(const wchar_t c);
+
+typedef int (*public_key_decode_cb)(const unsigned char *in, unsigned long inlen, void *ctx);
+
+int x509_decode_public_key_from_certificate(const unsigned char *in, unsigned long inlen,
+                                            enum ltc_oid_id algorithm, ltc_asn1_type param_type,
+                                            ltc_asn1_list* parameters, unsigned long *parameters_len,
+                                            public_key_decode_cb callback, void *ctx);
+
+/* SUBJECT PUBLIC KEY INFO */
+int x509_encode_subject_public_key_info(unsigned char *out, unsigned long *outlen,
+        unsigned int algorithm, const void* public_key, unsigned long public_key_len,
+        ltc_asn1_type parameters_type, ltc_asn1_list* parameters, unsigned long parameters_len);
+
+int x509_decode_subject_public_key_info(const unsigned char *in, unsigned long inlen,
+        unsigned int algorithm, void* public_key, unsigned long* public_key_len,
+        ltc_asn1_type parameters_type, ltc_asn1_list* parameters, unsigned long *parameters_len);
+
+int pk_oid_cmp_with_ulong(const char *o1, const unsigned long *o2, unsigned long o2size);
+int pk_oid_cmp_with_asn1(const char *o1, const ltc_asn1_list *o2);
+
+#endif /* LTC_DER */
+
+/* tomcrypt_pkcs.h */
+
+#ifdef LTC_PKCS_8
+
+int pkcs8_decode_flexi(const unsigned char  *in,  unsigned long inlen,
+                                    const void  *pwd, unsigned long pwdlen,
+                                 ltc_asn1_list **decoded_list);
+
+#endif  /* LTC_PKCS_8 */
+
+
+#ifdef LTC_PKCS_12
+
+int pkcs12_utf8_to_utf16(const unsigned char *in,  unsigned long  inlen,
+                               unsigned char *out, unsigned long *outlen);
+
+int pkcs12_kdf(               int   hash_id,
+               const unsigned char *pw,         unsigned long pwlen,
+               const unsigned char *salt,       unsigned long saltlen,
+                     unsigned int   iterations, unsigned char purpose,
+                     unsigned char *out,        unsigned long outlen);
+
+#endif  /* LTC_PKCS_12 */
+
+/* tomcrypt_prng.h */
+
+#define _LTC_PRNG_EXPORT(which) \
+int which ## _export(unsigned char *out, unsigned long *outlen, prng_state *prng)      \
+{                                                                                      \
+   unsigned long len = which ## _desc.export_size;                                     \
+                                                                                       \
+   LTC_ARGCHK(prng   != NULL);                                                         \
+   LTC_ARGCHK(out    != NULL);                                                         \
+   LTC_ARGCHK(outlen != NULL);                                                         \
+                                                                                       \
+   if (*outlen < len) {                                                                \
+      *outlen = len;                                                                   \
+      return CRYPT_BUFFER_OVERFLOW;                                                    \
+   }                                                                                   \
+                                                                                       \
+   if (which ## _read(out, len, prng) != len) {                                        \
+      return CRYPT_ERROR_READPRNG;                                                     \
+   }                                                                                   \
+                                                                                       \
+   *outlen = len;                                                                      \
+   return CRYPT_OK;                                                                    \
+}
+
+/* extract a byte portably */
+#ifdef _MSC_VER
+   #define LTC_BYTE(x, n) ((unsigned char)((x) >> (8 * (n))))
+#else
+   #define LTC_BYTE(x, n) (((x) >> (8 * (n))) & 255)
+#endif
+
+/* ref:         HEAD -> develop */
+/* git commit:  a1f6312416ef6cd183ee62db58b640dc2d7ec1f4 */
+/* commit time: 2019-09-04 13:44:47 +0200 */

+ 233 - 0
libtomcrypt.mod/libtomcrypt/src/headers/tomcrypt_prng.h

@@ -0,0 +1,233 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ */
+
+/* ---- PRNG Stuff ---- */
+#ifdef LTC_YARROW
+struct yarrow_prng {
+    int                   cipher, hash;
+    unsigned char         pool[MAXBLOCKSIZE];
+    symmetric_CTR         ctr;
+};
+#endif
+
+#ifdef LTC_RC4
+struct rc4_prng {
+    rc4_state s;
+};
+#endif
+
+#ifdef LTC_CHACHA20_PRNG
+struct chacha20_prng {
+    chacha_state s;        /* chacha state */
+    unsigned char ent[40]; /* entropy buffer */
+    unsigned long idx;     /* entropy counter */
+};
+#endif
+
+#ifdef LTC_FORTUNA
+struct fortuna_prng {
+    hash_state pool[LTC_FORTUNA_POOLS];     /* the  pools */
+
+    symmetric_key skey;
+
+    unsigned char K[32],      /* the current key */
+                  IV[16];     /* IV for CTR mode */
+
+    unsigned long pool_idx,   /* current pool we will add to */
+                  pool0_len;  /* length of 0'th pool */
+    ulong64       wd;
+    ulong64       reset_cnt;  /* number of times we have reseeded */
+};
+#endif
+
+#ifdef LTC_SOBER128
+struct sober128_prng {
+    sober128_state s;      /* sober128 state */
+    unsigned char ent[40]; /* entropy buffer */
+    unsigned long idx;     /* entropy counter */
+};
+#endif
+
+typedef struct {
+   union {
+      char dummy[1];
+#ifdef LTC_YARROW
+      struct yarrow_prng    yarrow;
+#endif
+#ifdef LTC_RC4
+      struct rc4_prng       rc4;
+#endif
+#ifdef LTC_CHACHA20_PRNG
+      struct chacha20_prng  chacha;
+#endif
+#ifdef LTC_FORTUNA
+      struct fortuna_prng   fortuna;
+#endif
+#ifdef LTC_SOBER128
+      struct sober128_prng  sober128;
+#endif
+   } u;
+   short ready;            /* ready flag 0-1 */
+   LTC_MUTEX_TYPE(lock)    /* lock */
+} prng_state;
+
+/** PRNG descriptor */
+extern struct ltc_prng_descriptor {
+    /** Name of the PRNG */
+    const char *name;
+    /** size in bytes of exported state */
+    int  export_size;
+    /** Start a PRNG state
+        @param prng   [out] The state to initialize
+        @return CRYPT_OK if successful
+    */
+    int (*start)(prng_state *prng);
+    /** Add entropy to the PRNG
+        @param in         The entropy
+        @param inlen      Length of the entropy (octets)\
+        @param prng       The PRNG state
+        @return CRYPT_OK if successful
+    */
+    int (*add_entropy)(const unsigned char *in, unsigned long inlen, prng_state *prng);
+    /** Ready a PRNG state to read from
+        @param prng       The PRNG state to ready
+        @return CRYPT_OK if successful
+    */
+    int (*ready)(prng_state *prng);
+    /** Read from the PRNG
+        @param out     [out] Where to store the data
+        @param outlen  Length of data desired (octets)
+        @param prng    The PRNG state to read from
+        @return Number of octets read
+    */
+    unsigned long (*read)(unsigned char *out, unsigned long outlen, prng_state *prng);
+    /** Terminate a PRNG state
+        @param prng   The PRNG state to terminate
+        @return CRYPT_OK if successful
+    */
+    int (*done)(prng_state *prng);
+    /** Export a PRNG state
+        @param out     [out] The destination for the state
+        @param outlen  [in/out] The max size and resulting size of the PRNG state
+        @param prng    The PRNG to export
+        @return CRYPT_OK if successful
+    */
+    int (*pexport)(unsigned char *out, unsigned long *outlen, prng_state *prng);
+    /** Import a PRNG state
+        @param in      The data to import
+        @param inlen   The length of the data to import (octets)
+        @param prng    The PRNG to initialize/import
+        @return CRYPT_OK if successful
+    */
+    int (*pimport)(const unsigned char *in, unsigned long inlen, prng_state *prng);
+    /** Self-test the PRNG
+        @return CRYPT_OK if successful, CRYPT_NOP if self-testing has been disabled
+    */
+    int (*test)(void);
+} prng_descriptor[];
+
+#ifdef LTC_YARROW
+int yarrow_start(prng_state *prng);
+int yarrow_add_entropy(const unsigned char *in, unsigned long inlen, prng_state *prng);
+int yarrow_ready(prng_state *prng);
+unsigned long yarrow_read(unsigned char *out, unsigned long outlen, prng_state *prng);
+int yarrow_done(prng_state *prng);
+int  yarrow_export(unsigned char *out, unsigned long *outlen, prng_state *prng);
+int  yarrow_import(const unsigned char *in, unsigned long inlen, prng_state *prng);
+int  yarrow_test(void);
+extern const struct ltc_prng_descriptor yarrow_desc;
+#endif
+
+#ifdef LTC_FORTUNA
+int fortuna_start(prng_state *prng);
+int fortuna_add_entropy(const unsigned char *in, unsigned long inlen, prng_state *prng);
+int fortuna_add_random_event(unsigned long source, unsigned long pool, const unsigned char *in, unsigned long inlen, prng_state *prng);
+int fortuna_ready(prng_state *prng);
+unsigned long fortuna_read(unsigned char *out, unsigned long outlen, prng_state *prng);
+int fortuna_done(prng_state *prng);
+int fortuna_export(unsigned char *out, unsigned long *outlen, prng_state *prng);
+int fortuna_import(const unsigned char *in, unsigned long inlen, prng_state *prng);
+int fortuna_update_seed(const unsigned char *in, unsigned long inlen, prng_state *prng);
+int fortuna_test(void);
+extern const struct ltc_prng_descriptor fortuna_desc;
+#endif
+
+#ifdef LTC_RC4
+int rc4_start(prng_state *prng);
+int rc4_add_entropy(const unsigned char *in, unsigned long inlen, prng_state *prng);
+int rc4_ready(prng_state *prng);
+unsigned long rc4_read(unsigned char *out, unsigned long outlen, prng_state *prng);
+int  rc4_done(prng_state *prng);
+int  rc4_export(unsigned char *out, unsigned long *outlen, prng_state *prng);
+int  rc4_import(const unsigned char *in, unsigned long inlen, prng_state *prng);
+int  rc4_test(void);
+extern const struct ltc_prng_descriptor rc4_desc;
+#endif
+
+#ifdef LTC_CHACHA20_PRNG
+int chacha20_prng_start(prng_state *prng);
+int chacha20_prng_add_entropy(const unsigned char *in, unsigned long inlen, prng_state *prng);
+int chacha20_prng_ready(prng_state *prng);
+unsigned long chacha20_prng_read(unsigned char *out, unsigned long outlen, prng_state *prng);
+int  chacha20_prng_done(prng_state *prng);
+int  chacha20_prng_export(unsigned char *out, unsigned long *outlen, prng_state *prng);
+int  chacha20_prng_import(const unsigned char *in, unsigned long inlen, prng_state *prng);
+int  chacha20_prng_test(void);
+extern const struct ltc_prng_descriptor chacha20_prng_desc;
+#endif
+
+#ifdef LTC_SPRNG
+int sprng_start(prng_state *prng);
+int sprng_add_entropy(const unsigned char *in, unsigned long inlen, prng_state *prng);
+int sprng_ready(prng_state *prng);
+unsigned long sprng_read(unsigned char *out, unsigned long outlen, prng_state *prng);
+int sprng_done(prng_state *prng);
+int  sprng_export(unsigned char *out, unsigned long *outlen, prng_state *prng);
+int  sprng_import(const unsigned char *in, unsigned long inlen, prng_state *prng);
+int  sprng_test(void);
+extern const struct ltc_prng_descriptor sprng_desc;
+#endif
+
+#ifdef LTC_SOBER128
+int sober128_start(prng_state *prng);
+int sober128_add_entropy(const unsigned char *in, unsigned long inlen, prng_state *prng);
+int sober128_ready(prng_state *prng);
+unsigned long sober128_read(unsigned char *out, unsigned long outlen, prng_state *prng);
+int sober128_done(prng_state *prng);
+int  sober128_export(unsigned char *out, unsigned long *outlen, prng_state *prng);
+int  sober128_import(const unsigned char *in, unsigned long inlen, prng_state *prng);
+int  sober128_test(void);
+extern const struct ltc_prng_descriptor sober128_desc;
+#endif
+
+int find_prng(const char *name);
+int register_prng(const struct ltc_prng_descriptor *prng);
+int unregister_prng(const struct ltc_prng_descriptor *prng);
+int register_all_prngs(void);
+int prng_is_valid(int idx);
+LTC_MUTEX_PROTO(ltc_prng_mutex)
+
+/* Slow RNG you **might** be able to use to seed a PRNG with.  Be careful as this
+ * might not work on all platforms as planned
+ */
+unsigned long rng_get_bytes(unsigned char *out,
+                            unsigned long outlen,
+                            void (*callback)(void));
+
+int rng_make_prng(int bits, int wprng, prng_state *prng, void (*callback)(void));
+
+#ifdef LTC_PRNG_ENABLE_LTC_RNG
+extern unsigned long (*ltc_rng)(unsigned char *out, unsigned long outlen,
+      void (*callback)(void));
+#endif
+
+
+/* ref:         HEAD -> develop */
+/* git commit:  a1f6312416ef6cd183ee62db58b640dc2d7ec1f4 */
+/* commit time: 2019-09-04 13:44:47 +0200 */

+ 133 - 0
libtomcrypt.mod/libtomcrypt/src/misc/adler32.c

@@ -0,0 +1,133 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ */
+#include "tomcrypt_private.h"
+
+/**
+   @file adler32.c
+   Adler-32 checksum algorithm
+   Written and placed in the public domain by Wei Dai
+   Adapted for libtomcrypt by Steffen Jaeckel
+*/
+#ifdef LTC_ADLER32
+
+static const unsigned long _adler32_base = 65521;
+
+void adler32_init(adler32_state *ctx)
+{
+   LTC_ARGCHKVD(ctx != NULL);
+   ctx->s[0] = 1;
+   ctx->s[1] = 0;
+}
+
+void adler32_update(adler32_state *ctx, const unsigned char *input, unsigned long length)
+{
+   unsigned long s1, s2;
+
+   LTC_ARGCHKVD(ctx != NULL);
+   LTC_ARGCHKVD(input != NULL);
+   s1 = ctx->s[0];
+   s2 = ctx->s[1];
+
+   if (length % 8 != 0) {
+      do {
+         s1 += *input++;
+         s2 += s1;
+         length--;
+      } while (length % 8 != 0);
+
+      if (s1 >= _adler32_base) {
+         s1 -= _adler32_base;
+      }
+      s2 %= _adler32_base;
+   }
+
+   while (length > 0) {
+      s1 += input[0];
+      s2 += s1;
+      s1 += input[1];
+      s2 += s1;
+      s1 += input[2];
+      s2 += s1;
+      s1 += input[3];
+      s2 += s1;
+      s1 += input[4];
+      s2 += s1;
+      s1 += input[5];
+      s2 += s1;
+      s1 += input[6];
+      s2 += s1;
+      s1 += input[7];
+      s2 += s1;
+
+      length -= 8;
+      input += 8;
+
+      if (s1 >= _adler32_base) {
+         s1 -= _adler32_base;
+      }
+      s2 %= _adler32_base;
+   }
+
+   LTC_ARGCHKVD(s1 < _adler32_base);
+   LTC_ARGCHKVD(s2 < _adler32_base);
+
+   ctx->s[0] = (unsigned short)s1;
+   ctx->s[1] = (unsigned short)s2;
+}
+
+void adler32_finish(const adler32_state *ctx, void *hash, unsigned long size)
+{
+   unsigned char* h;
+
+   LTC_ARGCHKVD(ctx != NULL);
+   LTC_ARGCHKVD(hash != NULL);
+
+   h = hash;
+
+   switch (size) {
+      default:
+         h[3] = ctx->s[0] & 0x0ff;
+         /* FALLTHROUGH */
+      case 3:
+         h[2] = (ctx->s[0] >> 8) & 0x0ff;
+         /* FALLTHROUGH */
+      case 2:
+         h[1] = ctx->s[1] & 0x0ff;
+         /* FALLTHROUGH */
+      case 1:
+         h[0] = (ctx->s[1] >> 8) & 0x0ff;
+         /* FALLTHROUGH */
+      case 0:
+         ;
+   }
+}
+
+int adler32_test(void)
+{
+#ifndef LTC_TEST
+   return CRYPT_NOP;
+#else
+   const void* in = "libtomcrypt";
+   const unsigned char adler32[] = { 0x1b, 0xe8, 0x04, 0xba };
+   unsigned char out[4];
+   adler32_state ctx;
+   adler32_init(&ctx);
+   adler32_update(&ctx, in, strlen(in));
+   adler32_finish(&ctx, out, 4);
+   if (compare_testvector(adler32, 4, out, 4, "adler32", 0)) {
+      return CRYPT_FAIL_TESTVECTOR;
+   }
+   return CRYPT_OK;
+#endif
+}
+#endif
+
+/* ref:         HEAD -> develop */
+/* git commit:  a1f6312416ef6cd183ee62db58b640dc2d7ec1f4 */
+/* commit time: 2019-09-04 13:44:47 +0200 */

+ 75 - 0
libtomcrypt.mod/libtomcrypt/src/misc/base16/base16_decode.c

@@ -0,0 +1,75 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ */
+
+#include "tomcrypt_private.h"
+
+/**
+   @file base16_decode.c
+   Base16/Hex decode a string.
+   Based on https://stackoverflow.com/a/23898449
+   Adapted for libtomcrypt by Steffen Jaeckel
+*/
+
+#ifdef LTC_BASE16
+
+/**
+   Base16 decode a string
+   @param in       The Base16 string to decode
+   @param inlen    The length of the Base16 data
+   @param out      [out] The destination of the binary decoded data
+   @param outlen   [in/out] The max size and resulting size of the decoded data
+   @return CRYPT_OK if successful
+*/
+int base16_decode(const          char *in,  unsigned long  inlen,
+                        unsigned char *out, unsigned long *outlen)
+{
+   unsigned long pos, out_len;
+   unsigned char idx0, idx1;
+   char in0, in1;
+
+   const unsigned char hashmap[] = {
+         0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, /* 01234567 */
+         0x08, 0x09, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, /* 89:;<=>? */
+         0xff, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f, 0xff, /* @ABCDEFG */
+         0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, /* HIJKLMNO */
+         0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, /* PQRSTUVW */
+         0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, /* XYZ[\]^_ */
+         0xff, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f, 0xff, /* `abcdefg */
+   };
+
+   LTC_ARGCHK(in     != NULL);
+   LTC_ARGCHK(out    != NULL);
+   LTC_ARGCHK(outlen != NULL);
+
+   if ((inlen % 2) == 1) return CRYPT_INVALID_PACKET;
+   out_len = *outlen * 2;
+   for (pos = 0; ((pos + 1 < out_len) && (pos + 1 < inlen)); pos += 2) {
+      in0 = in[pos + 0];
+      in1 = in[pos + 1];
+
+      if ((in0 < '0') || (in0 > 'g')) return CRYPT_INVALID_PACKET;
+      if ((in1 < '0') || (in1 > 'g')) return CRYPT_INVALID_PACKET;
+
+      idx0 = (unsigned char) (in0 & 0x1F) ^ 0x10;
+      idx1 = (unsigned char) (in1 & 0x1F) ^ 0x10;
+
+      if (hashmap[idx0] == 0xff) return CRYPT_INVALID_PACKET;
+      if (hashmap[idx1] == 0xff) return CRYPT_INVALID_PACKET;
+
+      out[pos / 2] = (unsigned char) (hashmap[idx0] << 4) | hashmap[idx1];
+   }
+   *outlen = pos / 2;
+   return CRYPT_OK;
+}
+
+#endif
+
+/* ref:         HEAD -> develop */
+/* git commit:  a1f6312416ef6cd183ee62db58b640dc2d7ec1f4 */
+/* commit time: 2019-09-04 13:44:47 +0200 */

+ 74 - 0
libtomcrypt.mod/libtomcrypt/src/misc/base16/base16_encode.c

@@ -0,0 +1,74 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ */
+
+#include "tomcrypt_private.h"
+
+/**
+   @file base16_encode.c
+   Base16/Hex encode a string, Steffen Jaeckel
+*/
+
+#ifdef LTC_BASE16
+
+/**
+   Base16 encode a buffer
+   @param in       The input buffer to encode
+   @param inlen    The length of the input buffer
+   @param out      [out] The destination of the Base16 encoded data
+   @param outlen   [in/out] The max size and resulting size of the encoded data
+   @param options  Output 'a-f' on 0 and 'A-F' otherwise.
+   @return CRYPT_OK if successful
+*/
+int base16_encode(const unsigned char *in,  unsigned long  inlen,
+                                 char *out, unsigned long *outlen,
+                        unsigned int   options)
+{
+   unsigned long i, x;
+   const char *alphabet;
+   const char *alphabets[2] = {
+      "0123456789abcdef",
+      "0123456789ABCDEF",
+   };
+
+   LTC_ARGCHK(in     != NULL);
+   LTC_ARGCHK(out    != NULL);
+   LTC_ARGCHK(outlen != NULL);
+
+   /* check the sizes */
+   x = inlen * 2 + 1;
+
+   if (x < inlen) return CRYPT_OVERFLOW;
+
+   if (*outlen < x) {
+      *outlen = x;
+      return CRYPT_BUFFER_OVERFLOW;
+   }
+   x--;
+   *outlen = x; /* returning the length without terminating NUL */
+
+   if (options == 0) {
+      alphabet = alphabets[0];
+   } else {
+      alphabet = alphabets[1];
+   }
+
+   for (i = 0; i < x; i += 2) {
+      out[i]   = alphabet[(in[i/2] >> 4) & 0x0f];
+      out[i+1] = alphabet[in[i/2] & 0x0f];
+   }
+   out[x] = '\0';
+
+   return CRYPT_OK;
+}
+
+#endif
+
+/* ref:         HEAD -> develop */
+/* git commit:  a1f6312416ef6cd183ee62db58b640dc2d7ec1f4 */
+/* commit time: 2019-09-04 13:44:47 +0200 */

+ 121 - 0
libtomcrypt.mod/libtomcrypt/src/misc/base32/base32_decode.c

@@ -0,0 +1,121 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ */
+
+#include "tomcrypt_private.h"
+
+#ifdef LTC_BASE32
+
+/**
+   Base32 decode a buffer
+   @param in       The Base32 data to decode
+   @param inlen    The length of the Base32 data
+   @param out      [out] The destination of the binary decoded data
+   @param outlen   [in/out] The max size and resulting size of the decoded data
+   @param id       Alphabet to use BASE32_RFC4648, BASE32_BASE32HEX, BASE32_ZBASE32 or BASE32_CROCKFORD
+   @return CRYPT_OK if successful
+*/
+int base32_decode(const          char *in,  unsigned long inlen,
+                        unsigned char *out, unsigned long *outlen,
+                        base32_alphabet id)
+{
+   unsigned long x;
+   int y = 0;
+   ulong64 t = 0;
+   char c;
+   const unsigned char *map;
+   const unsigned char tables[4][43] = {
+      {  /* id = BASE32_RFC4648 : ABCDEFGHIJKLMNOPQRSTUVWXYZ234567 */
+         99/*0*/,99/*1*/,26/*2*/,27/*3*/,28/*4*/,29/*5*/,30/*6*/,31/*7*/,99/*8*/,99/*9*/,
+         99/*:*/,99/*;*/,99/*<*/,99/*=*/,99/*>*/,99/*?*/,99/*@*/,
+          0/*A*/, 1/*B*/, 2/*C*/, 3/*D*/, 4/*E*/, 5/*F*/, 6/*G*/, 7/*H*/, 8/*I*/, 9/*J*/,10/*K*/,11/*L*/,12/*M*/,
+         13/*N*/,14/*O*/,15/*P*/,16/*Q*/,17/*R*/,18/*S*/,19/*T*/,20/*U*/,21/*V*/,22/*W*/,23/*X*/,24/*Y*/,25/*Z*/
+      },
+      {  /* id = BASE32_BASE32HEX : 0123456789ABCDEFGHIJKLMNOPQRSTUV */
+           0/*0*/, 1/*1*/, 2/*2*/, 3/*3*/, 4/*4*/, 5/*5*/, 6/*6*/, 7/*7*/, 8/*8*/, 9/*9*/,
+          99/*:*/,99/*;*/,99/*<*/,99/*=*/,99/*>*/,99/*?*/,99/*@*/,
+          10/*A*/,11/*B*/,12/*C*/,13/*D*/,14/*E*/,15/*F*/,16/*G*/,17/*H*/,18/*I*/,19/*J*/,20/*K*/,21/*L*/,22/*M*/,
+          23/*N*/,24/*O*/,25/*P*/,26/*Q*/,27/*R*/,28/*S*/,29/*T*/,30/*U*/,31/*V*/,99/*W*/,99/*X*/,99/*Y*/,99/*Z*/
+      },
+      {  /* id = BASE32_ZBASE32 : YBNDRFG8EJKMCPQXOT1UWISZA345H769 */
+         99/*0*/,18/*1*/,99/*2*/,25/*3*/,26/*4*/,27/*5*/,30/*6*/,29/*7*/, 7/*8*/,31/*9*/,
+         99/*:*/,99/*;*/,99/*<*/,99/*=*/,99/*>*/,99/*?*/,99/*@*/,
+         24/*A*/, 1/*B*/,12/*C*/, 3/*D*/, 8/*E*/, 5/*F*/, 6/*G*/,28/*H*/,21/*I*/, 9/*J*/,10/*K*/,99/*L*/,11/*M*/,
+          2/*N*/,16/*O*/,13/*P*/,14/*Q*/, 4/*R*/,22/*S*/,17/*T*/,19/*U*/,99/*V*/,20/*W*/,15/*X*/, 0/*Y*/,23/*Z*/
+      },
+      {  /* id = BASE32_CROCKFORD : 0123456789ABCDEFGHJKMNPQRSTVWXYZ + O=>0 + IL=>1 */
+          0/*0*/, 1/*1*/, 2/*2*/, 3/*3*/, 4/*4*/, 5/*5*/, 6/*6*/, 7/*7*/, 8/*8*/, 9/*9*/,
+         99/*:*/,99/*;*/,99/*<*/,99/*=*/,99/*>*/,99/*?*/,99/*@*/,
+         10/*A*/,11/*B*/,12/*C*/,13/*D*/,14/*E*/,15/*F*/,16/*G*/,17/*H*/, 1/*I*/,18/*J*/,19/*K*/, 1/*L*/,20/*M*/,
+         21/*N*/, 0/*O*/,22/*P*/,23/*Q*/,24/*R*/,25/*S*/,26/*T*/,99/*U*/,27/*V*/,28/*W*/,29/*X*/,30/*Y*/,31/*Z*/
+      }
+   };
+
+   LTC_ARGCHK(in     != NULL);
+   LTC_ARGCHK(out    != NULL);
+   LTC_ARGCHK(outlen != NULL);
+   LTC_ARGCHK(id >= BASE32_RFC4648);
+   LTC_ARGCHK(id <= BASE32_CROCKFORD);
+
+   /* ignore all trailing = */
+   while (inlen > 0 && in[inlen-1] == '=') inlen--;
+
+   /* no input, nothing to do */
+   if (inlen == 0) {
+      *outlen = 0;
+      return CRYPT_OK;
+   }
+
+   /* check the size of output buffer */
+   x = (inlen * 5) / 8;
+   if (*outlen < x) {
+      *outlen = x;
+      return CRYPT_BUFFER_OVERFLOW;
+   }
+   *outlen = x;
+
+   /* check input data length */
+   x = inlen % 8;
+   if (x == 1 || x == 3 || x == 6) {
+      return CRYPT_INVALID_PACKET;
+   }
+
+   map = tables[id];
+   for (x = 0; x < inlen; x++) {
+      c = in[x];
+      /* convert to upper case */
+      if ((c >= 'a') && (c <= 'z')) c -= 32;
+      if (c < '0' || c > 'Z' || map[c-'0'] > 31) {
+         return CRYPT_INVALID_PACKET;
+      }
+      t = (t<<5) | map[c-'0'];
+      if (++y == 8) {
+         *out++ = (unsigned char)((t>>32) & 255);
+         *out++ = (unsigned char)((t>>24) & 255);
+         *out++ = (unsigned char)((t>>16) & 255);
+         *out++ = (unsigned char)((t>> 8) & 255);
+         *out++ = (unsigned char)( t      & 255);
+         y = 0;
+         t = 0;
+      }
+   }
+   if (y > 0) {
+      t = t << (5 * (8 - y));
+      if (y >= 2) *out++ = (unsigned char)((t>>32) & 255);
+      if (y >= 4) *out++ = (unsigned char)((t>>24) & 255);
+      if (y >= 5) *out++ = (unsigned char)((t>>16) & 255);
+      if (y >= 7) *out++ = (unsigned char)((t>> 8) & 255);
+   }
+   return CRYPT_OK;
+}
+
+#endif
+
+/* ref:         HEAD -> develop */
+/* git commit:  a1f6312416ef6cd183ee62db58b640dc2d7ec1f4 */
+/* commit time: 2019-09-04 13:44:47 +0200 */

+ 96 - 0
libtomcrypt.mod/libtomcrypt/src/misc/base32/base32_encode.c

@@ -0,0 +1,96 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ */
+
+#include "tomcrypt_private.h"
+
+#ifdef LTC_BASE32
+
+/**
+   Base32 encode a buffer
+   @param in       The input buffer to encode
+   @param inlen    The length of the input buffer
+   @param out      [out] The destination of the Base32 encoded data
+   @param outlen   [in/out] The max size and resulting size of the encoded data
+   @param id       Alphabet to use BASE32_RFC4648, BASE32_BASE32HEX, BASE32_ZBASE32 or BASE32_CROCKFORD
+   @return CRYPT_OK if successful
+*/
+int base32_encode(const unsigned char *in,  unsigned long inlen,
+                                 char *out, unsigned long *outlen,
+                        base32_alphabet id)
+{
+   unsigned long i, x;
+   const char *codes;
+   const char *alphabet[4] = {
+      "ABCDEFGHIJKLMNOPQRSTUVWXYZ234567",     /* id = BASE32_RFC4648   */
+      "0123456789ABCDEFGHIJKLMNOPQRSTUV",     /* id = BASE32_BASE32HEX */
+      "ybndrfg8ejkmcpqxot1uwisza345h769",     /* id = BASE32_ZBASE32   */
+      "0123456789ABCDEFGHJKMNPQRSTVWXYZ"      /* id = BASE32_CROCKFORD */
+   };
+
+   LTC_ARGCHK(in     != NULL);
+   LTC_ARGCHK(out    != NULL);
+   LTC_ARGCHK(outlen != NULL);
+   LTC_ARGCHK(id >= BASE32_RFC4648);
+   LTC_ARGCHK(id <= BASE32_CROCKFORD);
+
+   /* check the size of output buffer +1 byte for terminating NUL */
+   x = (8 * inlen + 4) / 5 + 1;
+   if (*outlen < x) {
+      *outlen = x;
+      return CRYPT_BUFFER_OVERFLOW;
+   }
+   *outlen = x - 1; /* returning the length without terminating NUL */
+
+   /* no input, nothing to do */
+   if (inlen == 0) {
+      *out = '\0';
+      return CRYPT_OK;
+   }
+
+   codes = alphabet[id];
+   x = 5 * (inlen / 5);
+   for (i = 0; i < x; i += 5) {
+      *out++ = codes[(in[0] >> 3) & 0x1F];
+      *out++ = codes[(((in[0] & 0x7) << 2) + (in[1] >> 6)) & 0x1F];
+      *out++ = codes[(in[1] >> 1) & 0x1F];
+      *out++ = codes[(((in[1] & 0x1) << 4) + (in[2] >> 4)) & 0x1F];
+      *out++ = codes[(((in[2] & 0xF) << 1) + (in[3] >> 7)) & 0x1F];
+      *out++ = codes[(in[3] >> 2) & 0x1F];
+      *out++ = codes[(((in[3] & 0x3) << 3) + (in[4] >> 5)) & 0x1F];
+      *out++ = codes[in[4] & 0x1F];
+      in += 5;
+   }
+   if (i < inlen) {
+      unsigned a = in[0];
+      unsigned b = (i+1 < inlen) ? in[1] : 0;
+      unsigned c = (i+2 < inlen) ? in[2] : 0;
+      unsigned d = (i+3 < inlen) ? in[3] : 0;
+      *out++ = codes[(a >> 3) & 0x1F];
+      *out++ = codes[(((a & 0x7) << 2) + (b >> 6)) & 0x1F];
+      if (i+1 < inlen) {
+         *out++ = codes[(b >> 1) & 0x1F];
+         *out++ = codes[(((b & 0x1) << 4) + (c >> 4)) & 0x1F];
+      }
+      if (i+2 < inlen) {
+         *out++ = codes[(((c & 0xF) << 1) + (d >> 7)) & 0x1F];
+      }
+      if (i+3 < inlen) {
+         *out++ = codes[(d >> 2) & 0x1F];
+         *out++ = codes[((d & 0x3) << 3) & 0x1F];
+      }
+   }
+   *out = '\0';
+   return CRYPT_OK;
+}
+
+#endif
+
+/* ref:         HEAD -> develop */
+/* git commit:  a1f6312416ef6cd183ee62db58b640dc2d7ec1f4 */
+/* commit time: 2019-09-04 13:44:47 +0200 */

Энэ ялгаанд хэт олон файл өөрчлөгдсөн тул зарим файлыг харуулаагүй болно