raysan5.raylib/docs/examples/web/text/text_raylib_fonts.js

var Module;

if (typeof Module === 'undefined') Module = {};

if (!Module.expectedDataFileDownloads) {
  Module.expectedDataFileDownloads = 0;
  Module.finishedDataFileDownloads = 0;
}
Module.expectedDataFileDownloads++;
(function() {
 var loadPackage = function(metadata) {

    var PACKAGE_PATH;
    if (typeof window === 'object') {
      PACKAGE_PATH = window['encodeURIComponent'](window.location.pathname.toString().substring(0, window.location.pathname.toString().lastIndexOf('/')) + '/');
    } else if (typeof location !== 'undefined') {
      // worker
      PACKAGE_PATH = encodeURIComponent(location.pathname.toString().substring(0, location.pathname.toString().lastIndexOf('/')) + '/');
    } else {
      throw 'using preloaded data can only be done on a web page or in a web worker';
    }
    var PACKAGE_NAME = 'text/text_raylib_fonts.data';
    var REMOTE_PACKAGE_BASE = 'text_raylib_fonts.data';
    if (typeof Module['locateFilePackage'] === 'function' && !Module['locateFile']) {
      Module['locateFile'] = Module['locateFilePackage'];
      Module.printErr('warning: you defined Module.locateFilePackage, that has been renamed to Module.locateFile (using your locateFilePackage for now)');
    }
    var REMOTE_PACKAGE_NAME = typeof Module['locateFile'] === 'function' ?
                              Module['locateFile'](REMOTE_PACKAGE_BASE) :
                              ((Module['filePackagePrefixURL'] || '') + REMOTE_PACKAGE_BASE);
  
    var REMOTE_PACKAGE_SIZE = metadata.remote_package_size;
    var PACKAGE_UUID = metadata.package_uuid;
  
    function fetchRemotePackage(packageName, packageSize, callback, errback) {
      var xhr = new XMLHttpRequest();
      xhr.open('GET', packageName, true);
      xhr.responseType = 'arraybuffer';
      xhr.onprogress = function(event) {
        var url = packageName;
        var size = packageSize;
        if (event.total) size = event.total;
        if (event.loaded) {
          if (!xhr.addedTotal) {
            xhr.addedTotal = true;
            if (!Module.dataFileDownloads) Module.dataFileDownloads = {};
            Module.dataFileDownloads[url] = {
              loaded: event.loaded,
              total: size
            };
          } else {
            Module.dataFileDownloads[url].loaded = event.loaded;
          }
          var total = 0;
          var loaded = 0;
          var num = 0;
          for (var download in Module.dataFileDownloads) {
          var data = Module.dataFileDownloads[download];
            total += data.total;
            loaded += data.loaded;
            num++;
          }
          total = Math.ceil(total * Module.expectedDataFileDownloads/num);
          if (Module['setStatus']) Module['setStatus']('Downloading data... (' + loaded + '/' + total + ')');
        } else if (!Module.dataFileDownloads) {
          if (Module['setStatus']) Module['setStatus']('Downloading data...');
        }
      };
      xhr.onerror = function(event) {
        throw new Error("NetworkError for: " + packageName);
      }
      xhr.onload = function(event) {
        if (xhr.status == 200 || xhr.status == 304 || xhr.status == 206 || (xhr.status == 0 && xhr.response)) { // file URLs can return 0
          var packageData = xhr.response;
          callback(packageData);
        } else {
          throw new Error(xhr.statusText + " : " + xhr.responseURL);
        }
      };
      xhr.send(null);
    };

    function handleError(error) {
      console.error('package error:', error);
    };
  
      var fetchedCallback = null;
      var fetched = Module['getPreloadedPackage'] ? Module['getPreloadedPackage'](REMOTE_PACKAGE_NAME, REMOTE_PACKAGE_SIZE) : null;

      if (!fetched) fetchRemotePackage(REMOTE_PACKAGE_NAME, REMOTE_PACKAGE_SIZE, function(data) {
        if (fetchedCallback) {
          fetchedCallback(data);
          fetchedCallback = null;
        } else {
          fetched = data;
        }
      }, handleError);
    
  function runWithFS() {

    function assert(check, msg) {
      if (!check) throw msg + new Error().stack;
    }
Module['FS_createPath']('/', 'resources', true, true);
Module['FS_createPath']('/resources', 'fonts', true, true);

    function DataRequest(start, end, crunched, audio) {
      this.start = start;
      this.end = end;
      this.crunched = crunched;
      this.audio = audio;
    }
    DataRequest.prototype = {
      requests: {},
      open: function(mode, name) {
        this.name = name;
        this.requests[name] = this;
        Module['addRunDependency']('fp ' + this.name);
      },
      send: function() {},
      onload: function() {
        var byteArray = this.byteArray.subarray(this.start, this.end);

          this.finish(byteArray);

      },
      finish: function(byteArray) {
        var that = this;

        Module['FS_createDataFile'](this.name, null, byteArray, true, true, true); // canOwn this data in the filesystem, it is a slide into the heap that will never change
        Module['removeRunDependency']('fp ' + that.name);

        this.requests[this.name] = null;
      }
    };

        var files = metadata.files;
        for (i = 0; i < files.length; ++i) {
          new DataRequest(files[i].start, files[i].end, files[i].crunched, files[i].audio).open('GET', files[i].filename);
        }

  
    function processPackageData(arrayBuffer) {
      Module.finishedDataFileDownloads++;
      assert(arrayBuffer, 'Loading data file failed.');
      assert(arrayBuffer instanceof ArrayBuffer, 'bad input to processPackageData');
      var byteArray = new Uint8Array(arrayBuffer);
      var curr;
      
        // copy the entire loaded file into a spot in the heap. Files will refer to slices in that. They cannot be freed though
        // (we may be allocating before malloc is ready, during startup).
        if (Module['SPLIT_MEMORY']) Module.printErr('warning: you should run the file packager with --no-heap-copy when SPLIT_MEMORY is used, otherwise copying into the heap may fail due to the splitting');
        var ptr = Module['getMemory'](byteArray.length);
        Module['HEAPU8'].set(byteArray, ptr);
        DataRequest.prototype.byteArray = Module['HEAPU8'].subarray(ptr, ptr+byteArray.length);
  
          var files = metadata.files;
          for (i = 0; i < files.length; ++i) {
            DataRequest.prototype.requests[files[i].filename].onload();
          }
              Module['removeRunDependency']('datafile_text/text_raylib_fonts.data');

    };
    Module['addRunDependency']('datafile_text/text_raylib_fonts.data');
  
    if (!Module.preloadResults) Module.preloadResults = {};
  
      Module.preloadResults[PACKAGE_NAME] = {fromCache: false};
      if (fetched) {
        processPackageData(fetched);
        fetched = null;
      } else {
        fetchedCallback = processPackageData;
      }
    
  }
  if (Module['calledRun']) {
    runWithFS();
  } else {
    if (!Module['preRun']) Module['preRun'] = [];
    Module["preRun"].push(runWithFS); // FS is not initialized yet, wait for it
  }

 }
 loadPackage({"files": [{"audio": 0, "start": 0, "crunched": 0, "end": 4424, "filename": "/resources/fonts/alagard.png"}, {"audio": 0, "start": 4424, "crunched": 0, "end": 7336, "filename": "/resources/fonts/pixelplay.png"}, {"audio": 0, "start": 7336, "crunched": 0, "end": 9735, "filename": "/resources/fonts/mecha.png"}, {"audio": 0, "start": 9735, "crunched": 0, "end": 12274, "filename": "/resources/fonts/setback.png"}, {"audio": 0, "start": 12274, "crunched": 0, "end": 15206, "filename": "/resources/fonts/romulus.png"}, {"audio": 0, "start": 15206, "crunched": 0, "end": 18209, "filename": "/resources/fonts/pixantiqua.png"}, {"audio": 0, "start": 18209, "crunched": 0, "end": 20651, "filename": "/resources/fonts/alpha_beta.png"}, {"audio": 0, "start": 20651, "crunched": 0, "end": 24129, "filename": "/resources/fonts/jupiter_crash.png"}], "remote_package_size": 24129, "package_uuid": "6678b3d2-e5b4-4a4d-a0c0-734e1f82c6c7"});

})();

// The Module object: Our interface to the outside world. We import
// and export values on it, and do the work to get that through
// closure compiler if necessary. There are various ways Module can be used:
// 1. Not defined. We create it here
// 2. A function parameter, function(Module) { ..generated code.. }
// 3. pre-run appended it, var Module = {}; ..generated code..
// 4. External script tag defines var Module.
// We need to do an eval in order to handle the closure compiler
// case, where this code here is minified but Module was defined
// elsewhere (e.g. case 4 above). We also need to check if Module
// already exists (e.g. case 3 above).
// Note that if you want to run closure, and also to use Module
// after the generated code, you will need to define   var Module = {};
// before the code. Then that object will be used in the code, and you
// can continue to use Module afterwards as well.
var Module;
if (!Module) Module = (typeof Module !== 'undefined' ? Module : null) || {};

// Sometimes an existing Module object exists with properties
// meant to overwrite the default module functionality. Here
// we collect those properties and reapply _after_ we configure
// the current environment's defaults to avoid having to be so
// defensive during initialization.
var moduleOverrides = {};
for (var key in Module) {
  if (Module.hasOwnProperty(key)) {
    moduleOverrides[key] = Module[key];
  }
}

// The environment setup code below is customized to use Module.
// *** Environment setup code ***
var ENVIRONMENT_IS_WEB = false;
var ENVIRONMENT_IS_WORKER = false;
var ENVIRONMENT_IS_NODE = false;
var ENVIRONMENT_IS_SHELL = false;

// Three configurations we can be running in:
// 1) We could be the application main() thread running in the main JS UI thread. (ENVIRONMENT_IS_WORKER == false and ENVIRONMENT_IS_PTHREAD == false)
// 2) We could be the application main() thread proxied to worker. (with Emscripten -s PROXY_TO_WORKER=1) (ENVIRONMENT_IS_WORKER == true, ENVIRONMENT_IS_PTHREAD == false)
// 3) We could be an application pthread running in a worker. (ENVIRONMENT_IS_WORKER == true and ENVIRONMENT_IS_PTHREAD == true)

if (Module['ENVIRONMENT']) {
  if (Module['ENVIRONMENT'] === 'WEB') {
    ENVIRONMENT_IS_WEB = true;
  } else if (Module['ENVIRONMENT'] === 'WORKER') {
    ENVIRONMENT_IS_WORKER = true;
  } else if (Module['ENVIRONMENT'] === 'NODE') {
    ENVIRONMENT_IS_NODE = true;
  } else if (Module['ENVIRONMENT'] === 'SHELL') {
    ENVIRONMENT_IS_SHELL = true;
  } else {
    throw new Error('The provided Module[\'ENVIRONMENT\'] value is not valid. It must be one of: WEB|WORKER|NODE|SHELL.');
  }
} else {
  ENVIRONMENT_IS_WEB = typeof window === 'object';
  ENVIRONMENT_IS_WORKER = typeof importScripts === 'function';
  ENVIRONMENT_IS_NODE = typeof process === 'object' && typeof require === 'function' && !ENVIRONMENT_IS_WEB && !ENVIRONMENT_IS_WORKER;
  ENVIRONMENT_IS_SHELL = !ENVIRONMENT_IS_WEB && !ENVIRONMENT_IS_NODE && !ENVIRONMENT_IS_WORKER;
}


if (ENVIRONMENT_IS_NODE) {
  // Expose functionality in the same simple way that the shells work
  // Note that we pollute the global namespace here, otherwise we break in node
  if (!Module['print']) Module['print'] = console.log;
  if (!Module['printErr']) Module['printErr'] = console.warn;

  var nodeFS;
  var nodePath;

  Module['read'] = function read(filename, binary) {
    if (!nodeFS) nodeFS = require('fs');
    if (!nodePath) nodePath = require('path');
    filename = nodePath['normalize'](filename);
    var ret = nodeFS['readFileSync'](filename);
    return binary ? ret : ret.toString();
  };

  Module['readBinary'] = function readBinary(filename) {
    var ret = Module['read'](filename, true);
    if (!ret.buffer) {
      ret = new Uint8Array(ret);
    }
    assert(ret.buffer);
    return ret;
  };

  Module['load'] = function load(f) {
    globalEval(read(f));
  };

  if (!Module['thisProgram']) {
    if (process['argv'].length > 1) {
      Module['thisProgram'] = process['argv'][1].replace(/\\/g, '/');
    } else {
      Module['thisProgram'] = 'unknown-program';
    }
  }

  Module['arguments'] = process['argv'].slice(2);

  if (typeof module !== 'undefined') {
    module['exports'] = Module;
  }

  process['on']('uncaughtException', function(ex) {
    // suppress ExitStatus exceptions from showing an error
    if (!(ex instanceof ExitStatus)) {
      throw ex;
    }
  });

  Module['inspect'] = function () { return '[Emscripten Module object]'; };
}
else if (ENVIRONMENT_IS_SHELL) {
  if (!Module['print']) Module['print'] = print;
  if (typeof printErr != 'undefined') Module['printErr'] = printErr; // not present in v8 or older sm

  if (typeof read != 'undefined') {
    Module['read'] = read;
  } else {
    Module['read'] = function read() { throw 'no read() available' };
  }

  Module['readBinary'] = function readBinary(f) {
    if (typeof readbuffer === 'function') {
      return new Uint8Array(readbuffer(f));
    }
    var data = read(f, 'binary');
    assert(typeof data === 'object');
    return data;
  };

  if (typeof scriptArgs != 'undefined') {
    Module['arguments'] = scriptArgs;
  } else if (typeof arguments != 'undefined') {
    Module['arguments'] = arguments;
  }

  if (typeof quit === 'function') {
    Module['quit'] = function(status, toThrow) {
      quit(status);
    }
  }

}
else if (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) {
  Module['read'] = function read(url) {
    var xhr = new XMLHttpRequest();
    xhr.open('GET', url, false);
    xhr.send(null);
    return xhr.responseText;
  };

  if (ENVIRONMENT_IS_WORKER) {
    Module['readBinary'] = function read(url) {
      var xhr = new XMLHttpRequest();
      xhr.open('GET', url, false);
      xhr.responseType = 'arraybuffer';
      xhr.send(null);
      return xhr.response;
    };
  }

  Module['readAsync'] = function readAsync(url, onload, onerror) {
    var xhr = new XMLHttpRequest();
    xhr.open('GET', url, true);
    xhr.responseType = 'arraybuffer';
    xhr.onload = function xhr_onload() {
      if (xhr.status == 200 || (xhr.status == 0 && xhr.response)) { // file URLs can return 0
        onload(xhr.response);
      } else {
        onerror();
      }
    };
    xhr.onerror = onerror;
    xhr.send(null);
  };

  if (typeof arguments != 'undefined') {
    Module['arguments'] = arguments;
  }

  if (typeof console !== 'undefined') {
    if (!Module['print']) Module['print'] = function print(x) {
      console.log(x);
    };
    if (!Module['printErr']) Module['printErr'] = function printErr(x) {
      console.warn(x);
    };
  } else {
    // Probably a worker, and without console.log. We can do very little here...
    var TRY_USE_DUMP = false;
    if (!Module['print']) Module['print'] = (TRY_USE_DUMP && (typeof(dump) !== "undefined") ? (function(x) {
      dump(x);
    }) : (function(x) {
      // self.postMessage(x); // enable this if you want stdout to be sent as messages
    }));
  }

  if (ENVIRONMENT_IS_WORKER) {
    Module['load'] = importScripts;
  }

  if (typeof Module['setWindowTitle'] === 'undefined') {
    Module['setWindowTitle'] = function(title) { document.title = title };
  }
}
else {
  // Unreachable because SHELL is dependant on the others
  throw 'Unknown runtime environment. Where are we?';
}

function globalEval(x) {
  eval.call(null, x);
}
if (!Module['load'] && Module['read']) {
  Module['load'] = function load(f) {
    globalEval(Module['read'](f));
  };
}
if (!Module['print']) {
  Module['print'] = function(){};
}
if (!Module['printErr']) {
  Module['printErr'] = Module['print'];
}
if (!Module['arguments']) {
  Module['arguments'] = [];
}
if (!Module['thisProgram']) {
  Module['thisProgram'] = './this.program';
}
if (!Module['quit']) {
  Module['quit'] = function(status, toThrow) {
    throw toThrow;
  }
}

// *** Environment setup code ***

// Closure helpers
Module.print = Module['print'];
Module.printErr = Module['printErr'];

// Callbacks
Module['preRun'] = [];
Module['postRun'] = [];

// Merge back in the overrides
for (var key in moduleOverrides) {
  if (moduleOverrides.hasOwnProperty(key)) {
    Module[key] = moduleOverrides[key];
  }
}
// Free the object hierarchy contained in the overrides, this lets the GC
// reclaim data used e.g. in memoryInitializerRequest, which is a large typed array.
moduleOverrides = undefined;



// {{PREAMBLE_ADDITIONS}}

// === Preamble library stuff ===

// Documentation for the public APIs defined in this file must be updated in:
//    site/source/docs/api_reference/preamble.js.rst
// A prebuilt local version of the documentation is available at:
//    site/build/text/docs/api_reference/preamble.js.txt
// You can also build docs locally as HTML or other formats in site/
// An online HTML version (which may be of a different version of Emscripten)
//    is up at http://kripken.github.io/emscripten-site/docs/api_reference/preamble.js.html

//========================================
// Runtime code shared with compiler
//========================================

var Runtime = {
  setTempRet0: function (value) {
    tempRet0 = value;
    return value;
  },
  getTempRet0: function () {
    return tempRet0;
  },
  stackSave: function () {
    return STACKTOP;
  },
  stackRestore: function (stackTop) {
    STACKTOP = stackTop;
  },
  getNativeTypeSize: function (type) {
    switch (type) {
      case 'i1': case 'i8': return 1;
      case 'i16': return 2;
      case 'i32': return 4;
      case 'i64': return 8;
      case 'float': return 4;
      case 'double': return 8;
      default: {
        if (type[type.length-1] === '*') {
          return Runtime.QUANTUM_SIZE; // A pointer
        } else if (type[0] === 'i') {
          var bits = parseInt(type.substr(1));
          assert(bits % 8 === 0);
          return bits/8;
        } else {
          return 0;
        }
      }
    }
  },
  getNativeFieldSize: function (type) {
    return Math.max(Runtime.getNativeTypeSize(type), Runtime.QUANTUM_SIZE);
  },
  STACK_ALIGN: 16,
  prepVararg: function (ptr, type) {
    if (type === 'double' || type === 'i64') {
      // move so the load is aligned
      if (ptr & 7) {
        assert((ptr & 7) === 4);
        ptr += 4;
      }
    } else {
      assert((ptr & 3) === 0);
    }
    return ptr;
  },
  getAlignSize: function (type, size, vararg) {
    // we align i64s and doubles on 64-bit boundaries, unlike x86
    if (!vararg && (type == 'i64' || type == 'double')) return 8;
    if (!type) return Math.min(size, 8); // align structures internally to 64 bits
    return Math.min(size || (type ? Runtime.getNativeFieldSize(type) : 0), Runtime.QUANTUM_SIZE);
  },
  dynCall: function (sig, ptr, args) {
    if (args && args.length) {
      assert(args.length == sig.length-1);
      assert(('dynCall_' + sig) in Module, 'bad function pointer type - no table for sig \'' + sig + '\'');
      return Module['dynCall_' + sig].apply(null, [ptr].concat(args));
    } else {
      assert(sig.length == 1);
      assert(('dynCall_' + sig) in Module, 'bad function pointer type - no table for sig \'' + sig + '\'');
      return Module['dynCall_' + sig].call(null, ptr);
    }
  },
  functionPointers: [],
  addFunction: function (func) {
    for (var i = 0; i < Runtime.functionPointers.length; i++) {
      if (!Runtime.functionPointers[i]) {
        Runtime.functionPointers[i] = func;
        return 2*(1 + i);
      }
    }
    throw 'Finished up all reserved function pointers. Use a higher value for RESERVED_FUNCTION_POINTERS.';
  },
  removeFunction: function (index) {
    Runtime.functionPointers[(index-2)/2] = null;
  },
  warnOnce: function (text) {
    if (!Runtime.warnOnce.shown) Runtime.warnOnce.shown = {};
    if (!Runtime.warnOnce.shown[text]) {
      Runtime.warnOnce.shown[text] = 1;
      Module.printErr(text);
    }
  },
  funcWrappers: {},
  getFuncWrapper: function (func, sig) {
    assert(sig);
    if (!Runtime.funcWrappers[sig]) {
      Runtime.funcWrappers[sig] = {};
    }
    var sigCache = Runtime.funcWrappers[sig];
    if (!sigCache[func]) {
      // optimize away arguments usage in common cases
      if (sig.length === 1) {
        sigCache[func] = function dynCall_wrapper() {
          return Runtime.dynCall(sig, func);
        };
      } else if (sig.length === 2) {
        sigCache[func] = function dynCall_wrapper(arg) {
          return Runtime.dynCall(sig, func, [arg]);
        };
      } else {
        // general case
        sigCache[func] = function dynCall_wrapper() {
          return Runtime.dynCall(sig, func, Array.prototype.slice.call(arguments));
        };
      }
    }
    return sigCache[func];
  },
  getCompilerSetting: function (name) {
    throw 'You must build with -s RETAIN_COMPILER_SETTINGS=1 for Runtime.getCompilerSetting or emscripten_get_compiler_setting to work';
  },
  stackAlloc: function (size) { var ret = STACKTOP;STACKTOP = (STACKTOP + size)|0;STACKTOP = (((STACKTOP)+15)&-16);(assert((((STACKTOP|0) < (STACK_MAX|0))|0))|0); return ret; },
  staticAlloc: function (size) { var ret = STATICTOP;STATICTOP = (STATICTOP + (assert(!staticSealed),size))|0;STATICTOP = (((STATICTOP)+15)&-16); return ret; },
  dynamicAlloc: function (size) { assert(DYNAMICTOP_PTR);var ret = HEAP32[DYNAMICTOP_PTR>>2];var end = (((ret + size + 15)|0) & -16);HEAP32[DYNAMICTOP_PTR>>2] = end;if (end >= TOTAL_MEMORY) {var success = enlargeMemory();if (!success) {HEAP32[DYNAMICTOP_PTR>>2] = ret;return 0;}}return ret;},
  alignMemory: function (size,quantum) { var ret = size = Math.ceil((size)/(quantum ? quantum : 16))*(quantum ? quantum : 16); return ret; },
  makeBigInt: function (low,high,unsigned) { var ret = (unsigned ? ((+((low>>>0)))+((+((high>>>0)))*4294967296.0)) : ((+((low>>>0)))+((+((high|0)))*4294967296.0))); return ret; },
  GLOBAL_BASE: 8,
  QUANTUM_SIZE: 4,
  __dummy__: 0
}



Module["Runtime"] = Runtime;



//========================================
// Runtime essentials
//========================================

var ABORT = 0; // whether we are quitting the application. no code should run after this. set in exit() and abort()
var EXITSTATUS = 0;

function assert(condition, text) {
  if (!condition) {
    abort('Assertion failed: ' + text);
  }
}

var globalScope = this;

// Returns the C function with a specified identifier (for C++, you need to do manual name mangling)
function getCFunc(ident) {
  var func = Module['_' + ident]; // closure exported function
  if (!func) {
    try { func = eval('_' + ident); } catch(e) {}
  }
  assert(func, 'Cannot call unknown function ' + ident + ' (perhaps LLVM optimizations or closure removed it?)');
  return func;
}

var cwrap, ccall;
(function(){
  var JSfuncs = {
    // Helpers for cwrap -- it can't refer to Runtime directly because it might
    // be renamed by closure, instead it calls JSfuncs['stackSave'].body to find
    // out what the minified function name is.
    'stackSave': function() {
      Runtime.stackSave()
    },
    'stackRestore': function() {
      Runtime.stackRestore()
    },
    // type conversion from js to c
    'arrayToC' : function(arr) {
      var ret = Runtime.stackAlloc(arr.length);
      writeArrayToMemory(arr, ret);
      return ret;
    },
    'stringToC' : function(str) {
      var ret = 0;
      if (str !== null && str !== undefined && str !== 0) { // null string
        // at most 4 bytes per UTF-8 code point, +1 for the trailing '\0'
        var len = (str.length << 2) + 1;
        ret = Runtime.stackAlloc(len);
        stringToUTF8(str, ret, len);
      }
      return ret;
    }
  };
  // For fast lookup of conversion functions
  var toC = {'string' : JSfuncs['stringToC'], 'array' : JSfuncs['arrayToC']};

  // C calling interface.
  ccall = function ccallFunc(ident, returnType, argTypes, args, opts) {
    var func = getCFunc(ident);
    var cArgs = [];
    var stack = 0;
    assert(returnType !== 'array', 'Return type should not be "array".');
    if (args) {
      for (var i = 0; i < args.length; i++) {
        var converter = toC[argTypes[i]];
        if (converter) {
          if (stack === 0) stack = Runtime.stackSave();
          cArgs[i] = converter(args[i]);
        } else {
          cArgs[i] = args[i];
        }
      }
    }
    var ret = func.apply(null, cArgs);
    if ((!opts || !opts.async) && typeof EmterpreterAsync === 'object') {
      assert(!EmterpreterAsync.state, 'cannot start async op with normal JS calling ccall');
    }
    if (opts && opts.async) assert(!returnType, 'async ccalls cannot return values');
    if (returnType === 'string') ret = Pointer_stringify(ret);
    if (stack !== 0) {
      if (opts && opts.async) {
        EmterpreterAsync.asyncFinalizers.push(function() {
          Runtime.stackRestore(stack);
        });
        return;
      }
      Runtime.stackRestore(stack);
    }
    return ret;
  }

  var sourceRegex = /^function\s*[a-zA-Z$_0-9]*\s*\(([^)]*)\)\s*{\s*([^*]*?)[\s;]*(?:return\s*(.*?)[;\s]*)?}$/;
  function parseJSFunc(jsfunc) {
    // Match the body and the return value of a javascript function source
    var parsed = jsfunc.toString().match(sourceRegex).slice(1);
    return {arguments : parsed[0], body : parsed[1], returnValue: parsed[2]}
  }

  // sources of useful functions. we create this lazily as it can trigger a source decompression on this entire file
  var JSsource = null;
  function ensureJSsource() {
    if (!JSsource) {
      JSsource = {};
      for (var fun in JSfuncs) {
        if (JSfuncs.hasOwnProperty(fun)) {
          // Elements of toCsource are arrays of three items:
          // the code, and the return value
          JSsource[fun] = parseJSFunc(JSfuncs[fun]);
        }
      }
    }
  }

  cwrap = function cwrap(ident, returnType, argTypes) {
    argTypes = argTypes || [];
    var cfunc = getCFunc(ident);
    // When the function takes numbers and returns a number, we can just return
    // the original function
    var numericArgs = argTypes.every(function(type){ return type === 'number'});
    var numericRet = (returnType !== 'string');
    if ( numericRet && numericArgs) {
      return cfunc;
    }
    // Creation of the arguments list (["$1","$2",...,"$nargs"])
    var argNames = argTypes.map(function(x,i){return '$'+i});
    var funcstr = "(function(" + argNames.join(',') + ") {";
    var nargs = argTypes.length;
    if (!numericArgs) {
      // Generate the code needed to convert the arguments from javascript
      // values to pointers
      ensureJSsource();
      funcstr += 'var stack = ' + JSsource['stackSave'].body + ';';
      for (var i = 0; i < nargs; i++) {
        var arg = argNames[i], type = argTypes[i];
        if (type === 'number') continue;
        var convertCode = JSsource[type + 'ToC']; // [code, return]
        funcstr += 'var ' + convertCode.arguments + ' = ' + arg + ';';
        funcstr += convertCode.body + ';';
        funcstr += arg + '=(' + convertCode.returnValue + ');';
      }
    }

    // When the code is compressed, the name of cfunc is not literally 'cfunc' anymore
    var cfuncname = parseJSFunc(function(){return cfunc}).returnValue;
    // Call the function
    funcstr += 'var ret = ' + cfuncname + '(' + argNames.join(',') + ');';
    if (!numericRet) { // Return type can only by 'string' or 'number'
      // Convert the result to a string
      var strgfy = parseJSFunc(function(){return Pointer_stringify}).returnValue;
      funcstr += 'ret = ' + strgfy + '(ret);';
    }
    funcstr += "if (typeof EmterpreterAsync === 'object') { assert(!EmterpreterAsync.state, 'cannot start async op with normal JS calling cwrap') }";
    if (!numericArgs) {
      // If we had a stack, restore it
      ensureJSsource();
      funcstr += JSsource['stackRestore'].body.replace('()', '(stack)') + ';';
    }
    funcstr += 'return ret})';
    return eval(funcstr);
  };
})();
Module["ccall"] = ccall;
Module["cwrap"] = cwrap;

function setValue(ptr, value, type, noSafe) {
  type = type || 'i8';
  if (type.charAt(type.length-1) === '*') type = 'i32'; // pointers are 32-bit
    switch(type) {
      case 'i1': HEAP8[((ptr)>>0)]=value; break;
      case 'i8': HEAP8[((ptr)>>0)]=value; break;
      case 'i16': HEAP16[((ptr)>>1)]=value; break;
      case 'i32': HEAP32[((ptr)>>2)]=value; break;
      case 'i64': (tempI64 = [value>>>0,(tempDouble=value,(+(Math_abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math_min((+(Math_floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math_ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[((ptr)>>2)]=tempI64[0],HEAP32[(((ptr)+(4))>>2)]=tempI64[1]); break;
      case 'float': HEAPF32[((ptr)>>2)]=value; break;
      case 'double': HEAPF64[((ptr)>>3)]=value; break;
      default: abort('invalid type for setValue: ' + type);
    }
}
Module["setValue"] = setValue;


function getValue(ptr, type, noSafe) {
  type = type || 'i8';
  if (type.charAt(type.length-1) === '*') type = 'i32'; // pointers are 32-bit
    switch(type) {
      case 'i1': return HEAP8[((ptr)>>0)];
      case 'i8': return HEAP8[((ptr)>>0)];
      case 'i16': return HEAP16[((ptr)>>1)];
      case 'i32': return HEAP32[((ptr)>>2)];
      case 'i64': return HEAP32[((ptr)>>2)];
      case 'float': return HEAPF32[((ptr)>>2)];
      case 'double': return HEAPF64[((ptr)>>3)];
      default: abort('invalid type for setValue: ' + type);
    }
  return null;
}
Module["getValue"] = getValue;

var ALLOC_NORMAL = 0; // Tries to use _malloc()
var ALLOC_STACK = 1; // Lives for the duration of the current function call
var ALLOC_STATIC = 2; // Cannot be freed
var ALLOC_DYNAMIC = 3; // Cannot be freed except through sbrk
var ALLOC_NONE = 4; // Do not allocate
Module["ALLOC_NORMAL"] = ALLOC_NORMAL;
Module["ALLOC_STACK"] = ALLOC_STACK;
Module["ALLOC_STATIC"] = ALLOC_STATIC;
Module["ALLOC_DYNAMIC"] = ALLOC_DYNAMIC;
Module["ALLOC_NONE"] = ALLOC_NONE;

// allocate(): This is for internal use. You can use it yourself as well, but the interface
//             is a little tricky (see docs right below). The reason is that it is optimized
//             for multiple syntaxes to save space in generated code. So you should
//             normally not use allocate(), and instead allocate memory using _malloc(),
//             initialize it with setValue(), and so forth.
// @slab: An array of data, or a number. If a number, then the size of the block to allocate,
//        in *bytes* (note that this is sometimes confusing: the next parameter does not
//        affect this!)
// @types: Either an array of types, one for each byte (or 0 if no type at that position),
//         or a single type which is used for the entire block. This only matters if there
//         is initial data - if @slab is a number, then this does not matter at all and is
//         ignored.
// @allocator: How to allocate memory, see ALLOC_*
function allocate(slab, types, allocator, ptr) {
  var zeroinit, size;
  if (typeof slab === 'number') {
    zeroinit = true;
    size = slab;
  } else {
    zeroinit = false;
    size = slab.length;
  }

  var singleType = typeof types === 'string' ? types : null;

  var ret;
  if (allocator == ALLOC_NONE) {
    ret = ptr;
  } else {
    ret = [typeof _malloc === 'function' ? _malloc : Runtime.staticAlloc, Runtime.stackAlloc, Runtime.staticAlloc, Runtime.dynamicAlloc][allocator === undefined ? ALLOC_STATIC : allocator](Math.max(size, singleType ? 1 : types.length));
  }

  if (zeroinit) {
    var ptr = ret, stop;
    assert((ret & 3) == 0);
    stop = ret + (size & ~3);
    for (; ptr < stop; ptr += 4) {
      HEAP32[((ptr)>>2)]=0;
    }
    stop = ret + size;
    while (ptr < stop) {
      HEAP8[((ptr++)>>0)]=0;
    }
    return ret;
  }

  if (singleType === 'i8') {
    if (slab.subarray || slab.slice) {
      HEAPU8.set(slab, ret);
    } else {
      HEAPU8.set(new Uint8Array(slab), ret);
    }
    return ret;
  }

  var i = 0, type, typeSize, previousType;
  while (i < size) {
    var curr = slab[i];

    if (typeof curr === 'function') {
      curr = Runtime.getFunctionIndex(curr);
    }

    type = singleType || types[i];
    if (type === 0) {
      i++;
      continue;
    }
    assert(type, 'Must know what type to store in allocate!');

    if (type == 'i64') type = 'i32'; // special case: we have one i32 here, and one i32 later

    setValue(ret+i, curr, type);

    // no need to look up size unless type changes, so cache it
    if (previousType !== type) {
      typeSize = Runtime.getNativeTypeSize(type);
      previousType = type;
    }
    i += typeSize;
  }

  return ret;
}
Module["allocate"] = allocate;

// Allocate memory during any stage of startup - static memory early on, dynamic memory later, malloc when ready
function getMemory(size) {
  if (!staticSealed) return Runtime.staticAlloc(size);
  if (!runtimeInitialized) return Runtime.dynamicAlloc(size);
  return _malloc(size);
}
Module["getMemory"] = getMemory;

function Pointer_stringify(ptr, /* optional */ length) {
  if (length === 0 || !ptr) return '';
  // TODO: use TextDecoder
  // Find the length, and check for UTF while doing so
  var hasUtf = 0;
  var t;
  var i = 0;
  while (1) {
    assert(ptr + i < TOTAL_MEMORY);
    t = HEAPU8[(((ptr)+(i))>>0)];
    hasUtf |= t;
    if (t == 0 && !length) break;
    i++;
    if (length && i == length) break;
  }
  if (!length) length = i;

  var ret = '';

  if (hasUtf < 128) {
    var MAX_CHUNK = 1024; // split up into chunks, because .apply on a huge string can overflow the stack
    var curr;
    while (length > 0) {
      curr = String.fromCharCode.apply(String, HEAPU8.subarray(ptr, ptr + Math.min(length, MAX_CHUNK)));
      ret = ret ? ret + curr : curr;
      ptr += MAX_CHUNK;
      length -= MAX_CHUNK;
    }
    return ret;
  }
  return Module['UTF8ToString'](ptr);
}
Module["Pointer_stringify"] = Pointer_stringify;

// Given a pointer 'ptr' to a null-terminated ASCII-encoded string in the emscripten HEAP, returns
// a copy of that string as a Javascript String object.

function AsciiToString(ptr) {
  var str = '';
  while (1) {
    var ch = HEAP8[((ptr++)>>0)];
    if (!ch) return str;
    str += String.fromCharCode(ch);
  }
}
Module["AsciiToString"] = AsciiToString;

// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr',
// null-terminated and encoded in ASCII form. The copy will require at most str.length+1 bytes of space in the HEAP.

function stringToAscii(str, outPtr) {
  return writeAsciiToMemory(str, outPtr, false);
}
Module["stringToAscii"] = stringToAscii;

// Given a pointer 'ptr' to a null-terminated UTF8-encoded string in the given array that contains uint8 values, returns
// a copy of that string as a Javascript String object.

var UTF8Decoder = typeof TextDecoder !== 'undefined' ? new TextDecoder('utf8') : undefined;
function UTF8ArrayToString(u8Array, idx) {
  var endPtr = idx;
  // TextDecoder needs to know the byte length in advance, it doesn't stop on null terminator by itself.
  // Also, use the length info to avoid running tiny strings through TextDecoder, since .subarray() allocates garbage.
  while (u8Array[endPtr]) ++endPtr;

  if (endPtr - idx > 16 && u8Array.subarray && UTF8Decoder) {
    return UTF8Decoder.decode(u8Array.subarray(idx, endPtr));
  } else {
    var u0, u1, u2, u3, u4, u5;

    var str = '';
    while (1) {
      // For UTF8 byte structure, see http://en.wikipedia.org/wiki/UTF-8#Description and https://www.ietf.org/rfc/rfc2279.txt and https://tools.ietf.org/html/rfc3629
      u0 = u8Array[idx++];
      if (!u0) return str;
      if (!(u0 & 0x80)) { str += String.fromCharCode(u0); continue; }
      u1 = u8Array[idx++] & 63;
      if ((u0 & 0xE0) == 0xC0) { str += String.fromCharCode(((u0 & 31) << 6) | u1); continue; }
      u2 = u8Array[idx++] & 63;
      if ((u0 & 0xF0) == 0xE0) {
        u0 = ((u0 & 15) << 12) | (u1 << 6) | u2;
      } else {
        u3 = u8Array[idx++] & 63;
        if ((u0 & 0xF8) == 0xF0) {
          u0 = ((u0 & 7) << 18) | (u1 << 12) | (u2 << 6) | u3;
        } else {
          u4 = u8Array[idx++] & 63;
          if ((u0 & 0xFC) == 0xF8) {
            u0 = ((u0 & 3) << 24) | (u1 << 18) | (u2 << 12) | (u3 << 6) | u4;
          } else {
            u5 = u8Array[idx++] & 63;
            u0 = ((u0 & 1) << 30) | (u1 << 24) | (u2 << 18) | (u3 << 12) | (u4 << 6) | u5;
          }
        }
      }
      if (u0 < 0x10000) {
        str += String.fromCharCode(u0);
      } else {
        var ch = u0 - 0x10000;
        str += String.fromCharCode(0xD800 | (ch >> 10), 0xDC00 | (ch & 0x3FF));
      }
    }
  }
}
Module["UTF8ArrayToString"] = UTF8ArrayToString;

// Given a pointer 'ptr' to a null-terminated UTF8-encoded string in the emscripten HEAP, returns
// a copy of that string as a Javascript String object.

function UTF8ToString(ptr) {
  return UTF8ArrayToString(HEAPU8,ptr);
}
Module["UTF8ToString"] = UTF8ToString;

// Copies the given Javascript String object 'str' to the given byte array at address 'outIdx',
// encoded in UTF8 form and null-terminated. The copy will require at most str.length*4+1 bytes of space in the HEAP.
// Use the function lengthBytesUTF8 to compute the exact number of bytes (excluding null terminator) that this function will write.
// Parameters:
//   str: the Javascript string to copy.
//   outU8Array: the array to copy to. Each index in this array is assumed to be one 8-byte element.
//   outIdx: The starting offset in the array to begin the copying.
//   maxBytesToWrite: The maximum number of bytes this function can write to the array. This count should include the null
//                    terminator, i.e. if maxBytesToWrite=1, only the null terminator will be written and nothing else.
//                    maxBytesToWrite=0 does not write any bytes to the output, not even the null terminator.
// Returns the number of bytes written, EXCLUDING the null terminator.

function stringToUTF8Array(str, outU8Array, outIdx, maxBytesToWrite) {
  if (!(maxBytesToWrite > 0)) // Parameter maxBytesToWrite is not optional. Negative values, 0, null, undefined and false each don't write out any bytes.
    return 0;

  var startIdx = outIdx;
  var endIdx = outIdx + maxBytesToWrite - 1; // -1 for string null terminator.
  for (var i = 0; i < str.length; ++i) {
    // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! So decode UTF16->UTF32->UTF8.
    // See http://unicode.org/faq/utf_bom.html#utf16-3
    // For UTF8 byte structure, see http://en.wikipedia.org/wiki/UTF-8#Description and https://www.ietf.org/rfc/rfc2279.txt and https://tools.ietf.org/html/rfc3629
    var u = str.charCodeAt(i); // possibly a lead surrogate
    if (u >= 0xD800 && u <= 0xDFFF) u = 0x10000 + ((u & 0x3FF) << 10) | (str.charCodeAt(++i) & 0x3FF);
    if (u <= 0x7F) {
      if (outIdx >= endIdx) break;
      outU8Array[outIdx++] = u;
    } else if (u <= 0x7FF) {
      if (outIdx + 1 >= endIdx) break;
      outU8Array[outIdx++] = 0xC0 | (u >> 6);
      outU8Array[outIdx++] = 0x80 | (u & 63);
    } else if (u <= 0xFFFF) {
      if (outIdx + 2 >= endIdx) break;
      outU8Array[outIdx++] = 0xE0 | (u >> 12);
      outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63);
      outU8Array[outIdx++] = 0x80 | (u & 63);
    } else if (u <= 0x1FFFFF) {
      if (outIdx + 3 >= endIdx) break;
      outU8Array[outIdx++] = 0xF0 | (u >> 18);
      outU8Array[outIdx++] = 0x80 | ((u >> 12) & 63);
      outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63);
      outU8Array[outIdx++] = 0x80 | (u & 63);
    } else if (u <= 0x3FFFFFF) {
      if (outIdx + 4 >= endIdx) break;
      outU8Array[outIdx++] = 0xF8 | (u >> 24);
      outU8Array[outIdx++] = 0x80 | ((u >> 18) & 63);
      outU8Array[outIdx++] = 0x80 | ((u >> 12) & 63);
      outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63);
      outU8Array[outIdx++] = 0x80 | (u & 63);
    } else {
      if (outIdx + 5 >= endIdx) break;
      outU8Array[outIdx++] = 0xFC | (u >> 30);
      outU8Array[outIdx++] = 0x80 | ((u >> 24) & 63);
      outU8Array[outIdx++] = 0x80 | ((u >> 18) & 63);
      outU8Array[outIdx++] = 0x80 | ((u >> 12) & 63);
      outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63);
      outU8Array[outIdx++] = 0x80 | (u & 63);
    }
  }
  // Null-terminate the pointer to the buffer.
  outU8Array[outIdx] = 0;
  return outIdx - startIdx;
}
Module["stringToUTF8Array"] = stringToUTF8Array;

// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr',
// null-terminated and encoded in UTF8 form. The copy will require at most str.length*4+1 bytes of space in the HEAP.
// Use the function lengthBytesUTF8 to compute the exact number of bytes (excluding null terminator) that this function will write.
// Returns the number of bytes written, EXCLUDING the null terminator.

function stringToUTF8(str, outPtr, maxBytesToWrite) {
  assert(typeof maxBytesToWrite == 'number', 'stringToUTF8(str, outPtr, maxBytesToWrite) is missing the third parameter that specifies the length of the output buffer!');
  return stringToUTF8Array(str, HEAPU8,outPtr, maxBytesToWrite);
}
Module["stringToUTF8"] = stringToUTF8;

// Returns the number of bytes the given Javascript string takes if encoded as a UTF8 byte array, EXCLUDING the null terminator byte.

function lengthBytesUTF8(str) {
  var len = 0;
  for (var i = 0; i < str.length; ++i) {
    // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! So decode UTF16->UTF32->UTF8.
    // See http://unicode.org/faq/utf_bom.html#utf16-3
    var u = str.charCodeAt(i); // possibly a lead surrogate
    if (u >= 0xD800 && u <= 0xDFFF) u = 0x10000 + ((u & 0x3FF) << 10) | (str.charCodeAt(++i) & 0x3FF);
    if (u <= 0x7F) {
      ++len;
    } else if (u <= 0x7FF) {
      len += 2;
    } else if (u <= 0xFFFF) {
      len += 3;
    } else if (u <= 0x1FFFFF) {
      len += 4;
    } else if (u <= 0x3FFFFFF) {
      len += 5;
    } else {
      len += 6;
    }
  }
  return len;
}
Module["lengthBytesUTF8"] = lengthBytesUTF8;

// Given a pointer 'ptr' to a null-terminated UTF16LE-encoded string in the emscripten HEAP, returns
// a copy of that string as a Javascript String object.

var UTF16Decoder = typeof TextDecoder !== 'undefined' ? new TextDecoder('utf-16le') : undefined;
function UTF16ToString(ptr) {
  assert(ptr % 2 == 0, 'Pointer passed to UTF16ToString must be aligned to two bytes!');
  var endPtr = ptr;
  // TextDecoder needs to know the byte length in advance, it doesn't stop on null terminator by itself.
  // Also, use the length info to avoid running tiny strings through TextDecoder, since .subarray() allocates garbage.
  var idx = endPtr >> 1;
  while (HEAP16[idx]) ++idx;
  endPtr = idx << 1;

  if (endPtr - ptr > 32 && UTF16Decoder) {
    return UTF16Decoder.decode(HEAPU8.subarray(ptr, endPtr));
  } else {
    var i = 0;

    var str = '';
    while (1) {
      var codeUnit = HEAP16[(((ptr)+(i*2))>>1)];
      if (codeUnit == 0) return str;
      ++i;
      // fromCharCode constructs a character from a UTF-16 code unit, so we can pass the UTF16 string right through.
      str += String.fromCharCode(codeUnit);
    }
  }
}


// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr',
// null-terminated and encoded in UTF16 form. The copy will require at most str.length*4+2 bytes of space in the HEAP.
// Use the function lengthBytesUTF16() to compute the exact number of bytes (excluding null terminator) that this function will write.
// Parameters:
//   str: the Javascript string to copy.
//   outPtr: Byte address in Emscripten HEAP where to write the string to.
//   maxBytesToWrite: The maximum number of bytes this function can write to the array. This count should include the null
//                    terminator, i.e. if maxBytesToWrite=2, only the null terminator will be written and nothing else.
//                    maxBytesToWrite<2 does not write any bytes to the output, not even the null terminator.
// Returns the number of bytes written, EXCLUDING the null terminator.

function stringToUTF16(str, outPtr, maxBytesToWrite) {
  assert(outPtr % 2 == 0, 'Pointer passed to stringToUTF16 must be aligned to two bytes!');
  assert(typeof maxBytesToWrite == 'number', 'stringToUTF16(str, outPtr, maxBytesToWrite) is missing the third parameter that specifies the length of the output buffer!');
  // Backwards compatibility: if max bytes is not specified, assume unsafe unbounded write is allowed.
  if (maxBytesToWrite === undefined) {
    maxBytesToWrite = 0x7FFFFFFF;
  }
  if (maxBytesToWrite < 2) return 0;
  maxBytesToWrite -= 2; // Null terminator.
  var startPtr = outPtr;
  var numCharsToWrite = (maxBytesToWrite < str.length*2) ? (maxBytesToWrite / 2) : str.length;
  for (var i = 0; i < numCharsToWrite; ++i) {
    // charCodeAt returns a UTF-16 encoded code unit, so it can be directly written to the HEAP.
    var codeUnit = str.charCodeAt(i); // possibly a lead surrogate
    HEAP16[((outPtr)>>1)]=codeUnit;
    outPtr += 2;
  }
  // Null-terminate the pointer to the HEAP.
  HEAP16[((outPtr)>>1)]=0;
  return outPtr - startPtr;
}


// Returns the number of bytes the given Javascript string takes if encoded as a UTF16 byte array, EXCLUDING the null terminator byte.

function lengthBytesUTF16(str) {
  return str.length*2;
}


function UTF32ToString(ptr) {
  assert(ptr % 4 == 0, 'Pointer passed to UTF32ToString must be aligned to four bytes!');
  var i = 0;

  var str = '';
  while (1) {
    var utf32 = HEAP32[(((ptr)+(i*4))>>2)];
    if (utf32 == 0)
      return str;
    ++i;
    // Gotcha: fromCharCode constructs a character from a UTF-16 encoded code (pair), not from a Unicode code point! So encode the code point to UTF-16 for constructing.
    // See http://unicode.org/faq/utf_bom.html#utf16-3
    if (utf32 >= 0x10000) {
      var ch = utf32 - 0x10000;
      str += String.fromCharCode(0xD800 | (ch >> 10), 0xDC00 | (ch & 0x3FF));
    } else {
      str += String.fromCharCode(utf32);
    }
  }
}


// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr',
// null-terminated and encoded in UTF32 form. The copy will require at most str.length*4+4 bytes of space in the HEAP.
// Use the function lengthBytesUTF32() to compute the exact number of bytes (excluding null terminator) that this function will write.
// Parameters:
//   str: the Javascript string to copy.
//   outPtr: Byte address in Emscripten HEAP where to write the string to.
//   maxBytesToWrite: The maximum number of bytes this function can write to the array. This count should include the null
//                    terminator, i.e. if maxBytesToWrite=4, only the null terminator will be written and nothing else.
//                    maxBytesToWrite<4 does not write any bytes to the output, not even the null terminator.
// Returns the number of bytes written, EXCLUDING the null terminator.

function stringToUTF32(str, outPtr, maxBytesToWrite) {
  assert(outPtr % 4 == 0, 'Pointer passed to stringToUTF32 must be aligned to four bytes!');
  assert(typeof maxBytesToWrite == 'number', 'stringToUTF32(str, outPtr, maxBytesToWrite) is missing the third parameter that specifies the length of the output buffer!');
  // Backwards compatibility: if max bytes is not specified, assume unsafe unbounded write is allowed.
  if (maxBytesToWrite === undefined) {
    maxBytesToWrite = 0x7FFFFFFF;
  }
  if (maxBytesToWrite < 4) return 0;
  var startPtr = outPtr;
  var endPtr = startPtr + maxBytesToWrite - 4;
  for (var i = 0; i < str.length; ++i) {
    // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! We must decode the string to UTF-32 to the heap.
    // See http://unicode.org/faq/utf_bom.html#utf16-3
    var codeUnit = str.charCodeAt(i); // possibly a lead surrogate
    if (codeUnit >= 0xD800 && codeUnit <= 0xDFFF) {
      var trailSurrogate = str.charCodeAt(++i);
      codeUnit = 0x10000 + ((codeUnit & 0x3FF) << 10) | (trailSurrogate & 0x3FF);
    }
    HEAP32[((outPtr)>>2)]=codeUnit;
    outPtr += 4;
    if (outPtr + 4 > endPtr) break;
  }
  // Null-terminate the pointer to the HEAP.
  HEAP32[((outPtr)>>2)]=0;
  return outPtr - startPtr;
}


// Returns the number of bytes the given Javascript string takes if encoded as a UTF16 byte array, EXCLUDING the null terminator byte.

function lengthBytesUTF32(str) {
  var len = 0;
  for (var i = 0; i < str.length; ++i) {
    // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! We must decode the string to UTF-32 to the heap.
    // See http://unicode.org/faq/utf_bom.html#utf16-3
    var codeUnit = str.charCodeAt(i);
    if (codeUnit >= 0xD800 && codeUnit <= 0xDFFF) ++i; // possibly a lead surrogate, so skip over the tail surrogate.
    len += 4;
  }

  return len;
}


function demangle(func) {
  var __cxa_demangle_func = Module['___cxa_demangle'] || Module['__cxa_demangle'];
  if (__cxa_demangle_func) {
    try {
      var s =
        func.substr(1);
      var len = lengthBytesUTF8(s)+1;
      var buf = _malloc(len);
      stringToUTF8(s, buf, len);
      var status = _malloc(4);
      var ret = __cxa_demangle_func(buf, 0, 0, status);
      if (getValue(status, 'i32') === 0 && ret) {
        return Pointer_stringify(ret);
      }
      // otherwise, libcxxabi failed
    } catch(e) {
      // ignore problems here
    } finally {
      if (buf) _free(buf);
      if (status) _free(status);
      if (ret) _free(ret);
    }
    // failure when using libcxxabi, don't demangle
    return func;
  }
  Runtime.warnOnce('warning: build with  -s DEMANGLE_SUPPORT=1  to link in libcxxabi demangling');
  return func;
}

function demangleAll(text) {
  var regex =
    /__Z[\w\d_]+/g;
  return text.replace(regex,
    function(x) {
      var y = demangle(x);
      return x === y ? x : (x + ' [' + y + ']');
    });
}

function jsStackTrace() {
  var err = new Error();
  if (!err.stack) {
    // IE10+ special cases: It does have callstack info, but it is only populated if an Error object is thrown,
    // so try that as a special-case.
    try {
      throw new Error(0);
    } catch(e) {
      err = e;
    }
    if (!err.stack) {
      return '(no stack trace available)';
    }
  }
  return err.stack.toString();
}

function stackTrace() {
  var js = jsStackTrace();
  if (Module['extraStackTrace']) js += '\n' + Module['extraStackTrace']();
  return demangleAll(js);
}
Module["stackTrace"] = stackTrace;

// Memory management

var PAGE_SIZE = 16384;
var WASM_PAGE_SIZE = 65536;
var ASMJS_PAGE_SIZE = 16777216;
var MIN_TOTAL_MEMORY = 16777216;

function alignUp(x, multiple) {
  if (x % multiple > 0) {
    x += multiple - (x % multiple);
  }
  return x;
}

var HEAP;
var buffer;
var HEAP8, HEAPU8, HEAP16, HEAPU16, HEAP32, HEAPU32, HEAPF32, HEAPF64;

function updateGlobalBuffer(buf) {
  Module['buffer'] = buffer = buf;
}

function updateGlobalBufferViews() {
  Module['HEAP8'] = HEAP8 = new Int8Array(buffer);
  Module['HEAP16'] = HEAP16 = new Int16Array(buffer);
  Module['HEAP32'] = HEAP32 = new Int32Array(buffer);
  Module['HEAPU8'] = HEAPU8 = new Uint8Array(buffer);
  Module['HEAPU16'] = HEAPU16 = new Uint16Array(buffer);
  Module['HEAPU32'] = HEAPU32 = new Uint32Array(buffer);
  Module['HEAPF32'] = HEAPF32 = new Float32Array(buffer);
  Module['HEAPF64'] = HEAPF64 = new Float64Array(buffer);
}

var STATIC_BASE, STATICTOP, staticSealed; // static area
var STACK_BASE, STACKTOP, STACK_MAX; // stack area
var DYNAMIC_BASE, DYNAMICTOP_PTR; // dynamic area handled by sbrk

  STATIC_BASE = STATICTOP = STACK_BASE = STACKTOP = STACK_MAX = DYNAMIC_BASE = DYNAMICTOP_PTR = 0;
  staticSealed = false;


// Initializes the stack cookie. Called at the startup of main and at the startup of each thread in pthreads mode.
function writeStackCookie() {
  assert((STACK_MAX & 3) == 0);
  HEAPU32[(STACK_MAX >> 2)-1] = 0x02135467;
  HEAPU32[(STACK_MAX >> 2)-2] = 0x89BACDFE;
}

function checkStackCookie() {
  if (HEAPU32[(STACK_MAX >> 2)-1] != 0x02135467 || HEAPU32[(STACK_MAX >> 2)-2] != 0x89BACDFE) {
    abort('Stack overflow! Stack cookie has been overwritten, expected hex dwords 0x89BACDFE and 0x02135467, but received 0x' + HEAPU32[(STACK_MAX >> 2)-2].toString(16) + ' ' + HEAPU32[(STACK_MAX >> 2)-1].toString(16));
  }
  // Also test the global address 0 for integrity. This check is not compatible with SAFE_SPLIT_MEMORY though, since that mode already tests all address 0 accesses on its own.
  if (HEAP32[0] !== 0x63736d65 /* 'emsc' */) throw 'Runtime error: The application has corrupted its heap memory area (address zero)!';
}

function abortStackOverflow(allocSize) {
  abort('Stack overflow! Attempted to allocate ' + allocSize + ' bytes on the stack, but stack has only ' + (STACK_MAX - asm.stackSave() + allocSize) + ' bytes available!');
}

function abortOnCannotGrowMemory() {
  abort('Cannot enlarge memory arrays. Either (1) compile with  -s TOTAL_MEMORY=X  with X higher than the current value ' + TOTAL_MEMORY + ', (2) compile with  -s ALLOW_MEMORY_GROWTH=1  which adjusts the size at runtime but prevents some optimizations, (3) set Module.TOTAL_MEMORY to a higher value before the program runs, or if you want malloc to return NULL (0) instead of this abort, compile with  -s ABORTING_MALLOC=0 ');
}


function enlargeMemory() {
  abortOnCannotGrowMemory();
}


var TOTAL_STACK = Module['TOTAL_STACK'] || 5242880;
var TOTAL_MEMORY = Module['TOTAL_MEMORY'] || 16777216;
if (TOTAL_MEMORY < TOTAL_STACK) Module.printErr('TOTAL_MEMORY should be larger than TOTAL_STACK, was ' + TOTAL_MEMORY + '! (TOTAL_STACK=' + TOTAL_STACK + ')');

// Initialize the runtime's memory
// check for full engine support (use string 'subarray' to avoid closure compiler confusion)
assert(typeof Int32Array !== 'undefined' && typeof Float64Array !== 'undefined' && !!(new Int32Array(1)['subarray']) && !!(new Int32Array(1)['set']),
       'JS engine does not provide full typed array support');



// Use a provided buffer, if there is one, or else allocate a new one
if (Module['buffer']) {
  buffer = Module['buffer'];
  assert(buffer.byteLength === TOTAL_MEMORY, 'provided buffer should be ' + TOTAL_MEMORY + ' bytes, but it is ' + buffer.byteLength);
} else {
  // Use a WebAssembly memory where available
  {
    buffer = new ArrayBuffer(TOTAL_MEMORY);
  }
  assert(buffer.byteLength === TOTAL_MEMORY);
}
updateGlobalBufferViews();


function getTotalMemory() {
  return TOTAL_MEMORY;
}

// Endianness check (note: assumes compiler arch was little-endian)
  HEAP32[0] = 0x63736d65; /* 'emsc' */
HEAP16[1] = 0x6373;
if (HEAPU8[2] !== 0x73 || HEAPU8[3] !== 0x63) throw 'Runtime error: expected the system to be little-endian!';

Module['HEAP'] = HEAP;
Module['buffer'] = buffer;
Module['HEAP8'] = HEAP8;
Module['HEAP16'] = HEAP16;
Module['HEAP32'] = HEAP32;
Module['HEAPU8'] = HEAPU8;
Module['HEAPU16'] = HEAPU16;
Module['HEAPU32'] = HEAPU32;
Module['HEAPF32'] = HEAPF32;
Module['HEAPF64'] = HEAPF64;

function callRuntimeCallbacks(callbacks) {
  while(callbacks.length > 0) {
    var callback = callbacks.shift();
    if (typeof callback == 'function') {
      callback();
      continue;
    }
    var func = callback.func;
    if (typeof func === 'number') {
      if (callback.arg === undefined) {
        Module['dynCall_v'](func);
      } else {
        Module['dynCall_vi'](func, callback.arg);
      }
    } else {
      func(callback.arg === undefined ? null : callback.arg);
    }
  }
}

var __ATPRERUN__  = []; // functions called before the runtime is initialized
var __ATINIT__    = []; // functions called during startup
var __ATMAIN__    = []; // functions called when main() is to be run
var __ATEXIT__    = []; // functions called during shutdown
var __ATPOSTRUN__ = []; // functions called after the runtime has exited

var runtimeInitialized = false;
var runtimeExited = false;


function preRun() {
  // compatibility - merge in anything from Module['preRun'] at this time
  if (Module['preRun']) {
    if (typeof Module['preRun'] == 'function') Module['preRun'] = [Module['preRun']];
    while (Module['preRun'].length) {
      addOnPreRun(Module['preRun'].shift());
    }
  }
  callRuntimeCallbacks(__ATPRERUN__);
}

function ensureInitRuntime() {
  checkStackCookie();
  if (runtimeInitialized) return;
  runtimeInitialized = true;
  callRuntimeCallbacks(__ATINIT__);
}

function preMain() {
  checkStackCookie();
  callRuntimeCallbacks(__ATMAIN__);
}

function exitRuntime() {
  checkStackCookie();
  callRuntimeCallbacks(__ATEXIT__);
  runtimeExited = true;
}

function postRun() {
  checkStackCookie();
  // compatibility - merge in anything from Module['postRun'] at this time
  if (Module['postRun']) {
    if (typeof Module['postRun'] == 'function') Module['postRun'] = [Module['postRun']];
    while (Module['postRun'].length) {
      addOnPostRun(Module['postRun'].shift());
    }
  }
  callRuntimeCallbacks(__ATPOSTRUN__);
}

function addOnPreRun(cb) {
  __ATPRERUN__.unshift(cb);
}
Module["addOnPreRun"] = addOnPreRun;

function addOnInit(cb) {
  __ATINIT__.unshift(cb);
}
Module["addOnInit"] = addOnInit;

function addOnPreMain(cb) {
  __ATMAIN__.unshift(cb);
}
Module["addOnPreMain"] = addOnPreMain;

function addOnExit(cb) {
  __ATEXIT__.unshift(cb);
}
Module["addOnExit"] = addOnExit;

function addOnPostRun(cb) {
  __ATPOSTRUN__.unshift(cb);
}
Module["addOnPostRun"] = addOnPostRun;

// Tools


function intArrayFromString(stringy, dontAddNull, length /* optional */) {
  var len = length > 0 ? length : lengthBytesUTF8(stringy)+1;
  var u8array = new Array(len);
  var numBytesWritten = stringToUTF8Array(stringy, u8array, 0, u8array.length);
  if (dontAddNull) u8array.length = numBytesWritten;
  return u8array;
}
Module["intArrayFromString"] = intArrayFromString;

function intArrayToString(array) {
  var ret = [];
  for (var i = 0; i < array.length; i++) {
    var chr = array[i];
    if (chr > 0xFF) {
      assert(false, 'Character code ' + chr + ' (' + String.fromCharCode(chr) + ')  at offset ' + i + ' not in 0x00-0xFF.');
      chr &= 0xFF;
    }
    ret.push(String.fromCharCode(chr));
  }
  return ret.join('');
}
Module["intArrayToString"] = intArrayToString;

// Deprecated: This function should not be called because it is unsafe and does not provide
// a maximum length limit of how many bytes it is allowed to write. Prefer calling the
// function stringToUTF8Array() instead, which takes in a maximum length that can be used
// to be secure from out of bounds writes.
function writeStringToMemory(string, buffer, dontAddNull) {
  Runtime.warnOnce('writeStringToMemory is deprecated and should not be called! Use stringToUTF8() instead!');

  var lastChar, end;
  if (dontAddNull) {
    // stringToUTF8Array always appends null. If we don't want to do that, remember the
    // character that existed at the location where the null will be placed, and restore
    // that after the write (below).
    end = buffer + lengthBytesUTF8(string);
    lastChar = HEAP8[end];
  }
  stringToUTF8(string, buffer, Infinity);
  if (dontAddNull) HEAP8[end] = lastChar; // Restore the value under the null character.
}
Module["writeStringToMemory"] = writeStringToMemory;

function writeArrayToMemory(array, buffer) {
  assert(array.length >= 0, 'writeArrayToMemory array must have a length (should be an array or typed array)')
  HEAP8.set(array, buffer);
}
Module["writeArrayToMemory"] = writeArrayToMemory;

function writeAsciiToMemory(str, buffer, dontAddNull) {
  for (var i = 0; i < str.length; ++i) {
    assert(str.charCodeAt(i) === str.charCodeAt(i)&0xff);
    HEAP8[((buffer++)>>0)]=str.charCodeAt(i);
  }
  // Null-terminate the pointer to the HEAP.
  if (!dontAddNull) HEAP8[((buffer)>>0)]=0;
}
Module["writeAsciiToMemory"] = writeAsciiToMemory;

function unSign(value, bits, ignore) {
  if (value >= 0) {
    return value;
  }
  return bits <= 32 ? 2*Math.abs(1 << (bits-1)) + value // Need some trickery, since if bits == 32, we are right at the limit of the bits JS uses in bitshifts
                    : Math.pow(2, bits)         + value;
}
function reSign(value, bits, ignore) {
  if (value <= 0) {
    return value;
  }
  var half = bits <= 32 ? Math.abs(1 << (bits-1)) // abs is needed if bits == 32
                        : Math.pow(2, bits-1);
  if (value >= half && (bits <= 32 || value > half)) { // for huge values, we can hit the precision limit and always get true here. so don't do that
                                                       // but, in general there is no perfect solution here. With 64-bit ints, we get rounding and errors
                                                       // TODO: In i64 mode 1, resign the two parts separately and safely
    value = -2*half + value; // Cannot bitshift half, as it may be at the limit of the bits JS uses in bitshifts
  }
  return value;
}


// check for imul support, and also for correctness ( https://bugs.webkit.org/show_bug.cgi?id=126345 )
if (!Math['imul'] || Math['imul'](0xffffffff, 5) !== -5) Math['imul'] = function imul(a, b) {
  var ah  = a >>> 16;
  var al = a & 0xffff;
  var bh  = b >>> 16;
  var bl = b & 0xffff;
  return (al*bl + ((ah*bl + al*bh) << 16))|0;
};
Math.imul = Math['imul'];


if (!Math['clz32']) Math['clz32'] = function(x) {
  x = x >>> 0;
  for (var i = 0; i < 32; i++) {
    if (x & (1 << (31 - i))) return i;
  }
  return 32;
};
Math.clz32 = Math['clz32']

if (!Math['trunc']) Math['trunc'] = function(x) {
  return x < 0 ? Math.ceil(x) : Math.floor(x);
};
Math.trunc = Math['trunc'];

var Math_abs = Math.abs;
var Math_cos = Math.cos;
var Math_sin = Math.sin;
var Math_tan = Math.tan;
var Math_acos = Math.acos;
var Math_asin = Math.asin;
var Math_atan = Math.atan;
var Math_atan2 = Math.atan2;
var Math_exp = Math.exp;
var Math_log = Math.log;
var Math_sqrt = Math.sqrt;
var Math_ceil = Math.ceil;
var Math_floor = Math.floor;
var Math_pow = Math.pow;
var Math_imul = Math.imul;
var Math_fround = Math.fround;
var Math_round = Math.round;
var Math_min = Math.min;
var Math_clz32 = Math.clz32;
var Math_trunc = Math.trunc;

// A counter of dependencies for calling run(). If we need to
// do asynchronous work before running, increment this and
// decrement it. Incrementing must happen in a place like
// PRE_RUN_ADDITIONS (used by emcc to add file preloading).
// Note that you can add dependencies in preRun, even though
// it happens right before run - run will be postponed until
// the dependencies are met.
var runDependencies = 0;
var runDependencyWatcher = null;
var dependenciesFulfilled = null; // overridden to take different actions when all run dependencies are fulfilled
var runDependencyTracking = {};

function getUniqueRunDependency(id) {
  var orig = id;
  while (1) {
    if (!runDependencyTracking[id]) return id;
    id = orig + Math.random();
  }
  return id;
}

function addRunDependency(id) {
  runDependencies++;
  if (Module['monitorRunDependencies']) {
    Module['monitorRunDependencies'](runDependencies);
  }
  if (id) {
    assert(!runDependencyTracking[id]);
    runDependencyTracking[id] = 1;
    if (runDependencyWatcher === null && typeof setInterval !== 'undefined') {
      // Check for missing dependencies every few seconds
      runDependencyWatcher = setInterval(function() {
        if (ABORT) {
          clearInterval(runDependencyWatcher);
          runDependencyWatcher = null;
          return;
        }
        var shown = false;
        for (var dep in runDependencyTracking) {
          if (!shown) {
            shown = true;
            Module.printErr('still waiting on run dependencies:');
          }
          Module.printErr('dependency: ' + dep);
        }
        if (shown) {
          Module.printErr('(end of list)');
        }
      }, 10000);
    }
  } else {
    Module.printErr('warning: run dependency added without ID');
  }
}
Module["addRunDependency"] = addRunDependency;

function removeRunDependency(id) {
  runDependencies--;
  if (Module['monitorRunDependencies']) {
    Module['monitorRunDependencies'](runDependencies);
  }
  if (id) {
    assert(runDependencyTracking[id]);
    delete runDependencyTracking[id];
  } else {
    Module.printErr('warning: run dependency removed without ID');
  }
  if (runDependencies == 0) {
    if (runDependencyWatcher !== null) {
      clearInterval(runDependencyWatcher);
      runDependencyWatcher = null;
    }
    if (dependenciesFulfilled) {
      var callback = dependenciesFulfilled;
      dependenciesFulfilled = null;
      callback(); // can add another dependenciesFulfilled
    }
  }
}
Module["removeRunDependency"] = removeRunDependency;

Module["preloadedImages"] = {}; // maps url to image data
Module["preloadedAudios"] = {}; // maps url to audio data



var memoryInitializer = null;






// === Body ===

var ASM_CONSTS = [function($0, $1) { { Module.printErr('bad name in getProcAddress: ' + [Pointer_stringify($0), Pointer_stringify($1)]); } }];

function _emscripten_asm_const_iii(code, a0, a1) {
 return ASM_CONSTS[code](a0, a1);
}



STATIC_BASE = 8;

STATICTOP = STATIC_BASE + 25584;
  /* global initializers */  __ATINIT__.push();
  

/* memory initializer */ allocate([32,3,0,0,194,1,0,0,2,0,0,0,4,0,0,0,8,0,0,0,4,0,0,0,3,0,0,0,4,0,0,0,4,0,0,0,1,0,0,0,255,255,255,255,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,32,0,32,0,0,176,1,0,0,0,0,0,0,0,0,0,32,37,249,142,0,10,2,0,0,128,190,125,95,244,125,31,160,242,43,74,30,9,82,8,0,64,34,65,80,20,4,16,32,32,41,46,18,8,34,8,0,32,34,65,80,20,4,16,32,32,249,16,76,8,250,62,60,16,34,125,222,247,125,16,32,32,161,232,50,8,34,8,0,8,34,5,16,4,69,16,0,240,163,164,50,8,82,8,0,4,34,5,16,4,69,16,32,32,249,226,94,8,2,0,129,2,62,125,31,244,125,16,0,0,32,0,0,176,1,128,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,190,15,0,192,15,224,247,251,125,126,191,95,232,190,80,0,162,8,8,68,232,47,20,10,133,2,129,80,72,160,80,0,162,40,228,73,40,40,20,10,132,2,129,64,72,160,72,0,190,15,2,16,175,235,247,9,132,62,159,216,79,160,71,0,34,136,228,9,161,42,20,10,132,2,129,80,72,160,72,0,34,40,8,4,160,47,20,10,133,2,129,80,72,162,80,0,190,143,0,0,33,32,244,251,125,126,129,95,232,156,208,7,0,128,0,0,224,15,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,128,1,12,0,130,66,191,223,239,247,251,11,5,5,133,66,191,4,72,0,198,66,161,80,40,20,64,8,5,37,133,66,160,8,168,0,170,70,161,80,40,20,64,8,5,37,133,66,144,16,8,0,146,74,161,95,232,247,67,8,5,37,121,126,136,32,8,0,130,82,161,64,40,1,66,8,137,36,133,64,132,64,8,0,130,98,161,64,42,2,66,8,81,36,133,64,130,128,8,0,130,66,191,192,47,244,67,248,33,252,133,126,191,0,9,62,0,0,0,0,4,0,0,0,0,0,0,0,128,1,12,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,4,0,4,0,32,72,65,0,0,0,0,0,8,0,0,4,4,0,4,60,32,0,65,0,0,0,0,0,8,0,0,240,125,223,247,133,239,75,81,190,239,251,190,239,59,81,4,0,69,65,20,133,40,74,73,170,40,138,162,32,8,81,4,240,69,65,244,157,40,74,71,170,40,138,162,224,11,81,4,16,69,65,20,132,40,74,73,170,40,138,162,0,10,145,2,240,125,223,247,133,47,74,209,170,232,251,190,224,123,31,1,0,0,0,0,4,8,64,0,0,0,8,32,0,0,0,0,0,0,0,0,132,15,96,0,0,0,8,32,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,172,1,15,0,0,0,0,0,0,0,0,0,0,0,0,0,36,1,9,0,0,0,0,0,0,0,0,0,6,0,0,0,36,1,9,0,0,0,0,0,0,0,128,16,9,162,40,250,36,1,9,0,0,0,0,0,0,0,0,62,1,42,37,66,34,82,9,0,0,0,0,0,0,0,128,138,3,42,34,34,36,41,9,0,0,0,0,0,0,0,128,10,1,42,37,18,36,1,9,0,0,0,0,0,0,0,128,10,1,190,232,251,36,1,9,0,0,0,0,0,0,0,128,190,14,0,0,2,172,1,15,0,0,0,0,0,0,0,128,4,0,0,224,3,0,0,0,0,0,0,0,0,0,0,128,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,56,0,0,0,14,184,67,132,3,58,32,0,128,160,190,2,32,0,0,240,138,32,82,196,2,43,32,4,34,145,2,248,59,0,240,7,142,56,75,228,2,58,32,2,28,138,30,8,42,233,17,4,224,11,66,244,2,130,36,1,20,4,20,232,186,4,209,5,128,184,195,231,10,58,137,0,28,14,60,40,2,9,80,4,128,0,64,196,2,128,68,0,34,132,32,232,2,0,80,4,0,0,64,128,2,0,32,5,0,142,62,8,2,0,16,4,224,3,64,128,66,0,0,7,0,132,0,248,3,0,240,7,0,0,64,128,34,0,0,4,0,0,0,0,0,0,0,0,0,0,64,128,2,0,0,4,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,7,128,0,194,160,72,24,0,0,1,132,33,9,146,2,66,38,4,1,33,81,0,0,127,63,2,66,2,16,41,0,34,20,192,239,247,251,253,126,9,161,223,239,247,187,187,3,18,15,68,40,20,10,133,66,9,129,64,32,16,16,17,1,8,4,68,40,20,10,133,66,127,129,64,32,16,16,17,1,4,130,199,239,247,251,253,126,9,129,207,231,243,17,17,1,50,169,80,40,20,10,133,66,9,161,64,32,16,16,17,1,64,184,80,40,20,10,133,66,121,191,223,239,247,187,187,3,32,160,31,0,0,0,0,0,0,16,0,0,0,0,0,0,112,32,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,40,2,8,131,34,1,0,2,8,67,2,1,0,1,1,124,20,4,132,68,1,0,32,4,132,4,128,8,63,130,0,132,66,191,223,239,247,3,126,161,80,40,20,10,33,0,0,132,70,161,80,40,20,138,82,161,80,40,20,122,161,239,3,158,74,161,80,40,20,82,82,161,80,40,20,74,31,8,2,132,82,161,80,40,20,34,74,161,80,40,244,75,161,239,3,132,98,161,80,40,20,82,74,161,80,40,4,122,161,40,2,124,66,191,223,239,247,139,126,191,223,239,247,11,189,239,3,0,0,0,0,0,0,0,4,0,0,0,0,8,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,8,5,32,0,0,4,132,0,34,129,69,17,16,66,1,0,148,66,81,0,0,8,66,81,148,42,162,32,8,165,80,0,0,0,32,0,0,0,0,0,0,0,5,0,0,0,0,8,190,239,251,254,251,190,239,251,20,145,235,251,190,239,251,0,32,8,130,32,10,162,40,138,20,145,40,138,162,40,138,62,190,239,251,254,11,190,239,251,20,145,40,138,162,40,138,0,162,40,138,34,8,130,32,8,20,145,40,138,162,40,138,8,190,239,251,254,251,190,239,251,20,145,47,250,190,239,251,0,0,0,0,0,64,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,32,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,33,0,4,0,0,0,0,0,0,0,0,0,0,0,0,130,80,20,2,20,0,0,0,0,0,0,0,0,0,0,16,0,0,0,32,0,0,0,0,0,0,0,0,0,0,0,190,40,138,162,40,34,0,0,0,0,0,0,0,0,0,0,170,40,138,162,232,34,0,0,0,0,0,0,0,0,0,0,170,40,138,162,168,34,0,0,0,0,0,0,0,0,0,0,170,40,138,162,232,34,0,0,0,0,0,0,0,0,0,0,190,239,251,190,47,62,0,0,0,0,0,0,0,0,0,0,4,0,0,0,40,32,0,0,0,0,0,0,0,0,0,0,0,0,0,128,15,62,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,3,0,0,0,1,0,0,0,4,0,0,0,6,0,0,0,5,0,0,0,7,0,0,0,6,0,0,0,2,0,0,0,3,0,0,0,3,0,0,0,5,0,0,0,5,0,0,0,2,0,0,0,4,0,0,0,1,0,0,0,7,0,0,0,5,0,0,0,2,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,1,0,0,0,1,0,0,0,3,0,0,0,4,0,0,0,3,0,0,0,6,0,0,0,7,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,3,0,0,0,5,0,0,0,6,0,0,0,5,0,0,0,7,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,7,0,0,0,6,0,0,0,7,0,0,0,7,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,2,0,0,0,7,0,0,0,2,0,0,0,3,0,0,0,5,0,0,0,2,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,4,0,0,0,5,0,0,0,5,0,0,0,1,0,0,0,2,0,0,0,5,0,0,0,2,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,4,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,3,0,0,0,1,0,0,0,3,0,0,0,4,0,0,0,4,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,7,0,0,0,1,0,0,0,5,0,0,0,3,0,0,0,7,0,0,0,3,0,0,0,5,0,0,0,4,0,0,0,1,0,0,0,7,0,0,0,4,0,0,0,3,0,0,0,5,0,0,0,3,0,0,0,3,0,0,0,2,0,0,0,5,0,0,0,6,0,0,0,1,0,0,0,2,0,0,0,2,0,0,0,3,0,0,0,5,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,7,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,3,0,0,0,3,0,0,0,3,0,0,0,3,0,0,0,7,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,5,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,4,0,0,0,6,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,9,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,2,0,0,0,2,0,0,0,3,0,0,0,3,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,3,0,0,0,5,0,0,0,255,255,255,255,0,1,0,0,255,255,255,255,0,0,128,191,0,0,0,0,4,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,8,0,0,0,8,0,0,0,4,0,0,0,4,0,0,0,2,0,0,0,2,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,4,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,1,0,0,0,8,0,0,0,8,0,0,0,8,0,0,0,4,0,0,0,4,0,0,0,2,0,0,0,2,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,1,0,0,1,0,0,0,4,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,2,0,0,0,2,0,0,0,2,0,0,0,2,0,0,0,3,0,0,0,3,0,0,0,3,0,0,0,3,0,0,0,4,0,0,0,4,0,0,0,4,0,0,0,4,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,3,0,0,0,4,0,0,0,5,0,0,0,6,0,0,0,7,0,0,0,8,0,0,0,9,0,0,0,10,0,0,0,11,0,0,0,13,0,0,0,15,0,0,0,17,0,0,0,19,0,0,0,23,0,0,0,27,0,0,0,31,0,0,0,35,0,0,0,43,0,0,0,51,0,0,0,59,0,0,0,67,0,0,0,83,0,0,0,99,0,0,0,115,0,0,0,131,0,0,0,163,0,0,0,195,0,0,0,227,0,0,0,2,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,1,0,0,0,2,0,0,0,2,0,0,0,3,0,0,0,3,0,0,0,4,0,0,0,4,0,0,0,5,0,0,0,5,0,0,0,6,0,0,0,6,0,0,0,7,0,0,0,7,0,0,0,8,0,0,0,8,0,0,0,9,0,0,0,9,0,0,0,10,0,0,0,10,0,0,0,11,0,0,0,11,0,0,0,12,0,0,0,12,0,0,0,13,0,0,0,13,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,2,0,0,0,3,0,0,0,4,0,0,0,5,0,0,0,7,0,0,0,9,0,0,0,13,0,0,0,17,0,0,0,25,0,0,0,33,0,0,0,49,0,0,0,65,0,0,0,97,0,0,0,129,0,0,0,193,0,0,0,1,1,0,0,129,1,0,0,1,2,0,0,1,3,0,0,1,4,0,0,1,6,0,0,1,8,0,0,1,12,0,0,1,16,0,0,1,24,0,0,1,32,0,0,1,48,0,0,1,64,0,0,1,96,0,0,0,0,0,0,0,0,0,0,2,0,0,192,3,0,0,192,4,0,0,192,5,0,0,192,6,0,0,192,7,0,0,192,8,0,0,192,9,0,0,192,10,0,0,192,11,0,0,192,12,0,0,192,13,0,0,192,14,0,0,192,15,0,0,192,16,0,0,192,17,0,0,192,18,0,0,192,19,0,0,192,20,0,0,192,21,0,0,192,22,0,0,192,23,0,0,192,24,0,0,192,25,0,0,192,26,0,0,192,27,0,0,192,28,0,0,192,29,0,0,192,30,0,0,192,31,0,0,192,0,0,0,179,1,0,0,195,2,0,0,195,3,0,0,195,4,0,0,195,5,0,0,195,6,0,0,195,7,0,0,195,8,0,0,195,9,0,0,195,10,0,0,195,11,0,0,195,12,0,0,195,13,0,0,211,14,0,0,195,15,0,0,195,0,0,12,187,1,0,12,195,2,0,12,195,3,0,12,195,4,0,12,211,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,196,88,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,8,16,0,0,5,0,0,0,0,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,0,0,0,3,0,0,0,239,95,0,0,0,4,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,10,255,255,255,255,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,8,16,0,0,10,0,0,0,100,0,0,0,232,3,0,0,16,39,0,0,160,134,1,0,64,66,15,0,128,150,152,0,0,225,245,5,95,112,137,0,255,9,47,15,114,97,121,108,105,98,32,91,116,101,120,116,93,32,101,120,97,109,112,108,101,32,45,32,114,97,121,108,105,98,32,102,111,110,116,115,0,190,33,55,255,255,161,0,255,0,117,44,255,0,82,172,255,112,31,126,255,0,158,47,255,255,203,0,255,230,41,55,255,65,76,65,71,65,82,68,32,70,79,78,84,32,100,101,115,105,103,110,101,100,32,98,121,32,72,101,119,101,116,116,32,84,115,111,105,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,80,73,88,69,76,80,76,65,89,32,70,79,78,84,32,100,101,115,105,103,110,101,100,32,98,121,32,65,108,101,107,115,97,110,100,101,114,32,83,104,101,118,99,104,117,107,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,77,69,67,72,65,32,70,79,78,84,32,100,101,115,105,103,110,101,100,32,98,121,32,67,97,112,116,97,105,110,32,70,97,108,99,111,110,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,83,69,84,66,65,67,75,32,70,79,78,84,32,100,101,115,105,103,110,101,100,32,98,121,32,66,114,105,97,110,32,75,101,110,116,32,40,65,69,110,105,103,109,97,41,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,82,79,77,85,76,85,83,32,70,79,78,84,32,100,101,115,105,103,110,101,100,32,98,121,32,72,101,119,101,116,116,32,84,115,111,105,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,80,73,88,65,78,84,73,81,85,65,32,70,79,78,84,32,100,101,115,105,103,110,101,100,32,98,121,32,71,101,114,104,97,114,100,32,71,114,111,115,115,109,97,110,110,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,65,76,80,72,65,95,66,69,84,65,32,70,79,78,84,32,100,101,115,105,103,110,101,100,32,98,121,32,66,114,105,97,110,32,75,101,110,116,32,40,65,69,110,105,103,109,97,41,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,74,85,80,73,84,69,82,95,67,82,65,83,72,32,70,79,78,84,32,100,101,115,105,103,110,101,100,32,98,121,32,66,114,105,97,110,32,75,101,110,116,32,40,65,69,110,105,103,109,97,41,0,0,0,0,0,0,0,0,0,0,0,0,0,114,101,115,111,117,114,99,101,115,47,102,111,110,116,115,47,97,108,97,103,97,114,100,46,112,110,103,0,114,101,115,111,117,114,99,101,115,47,102,111,110,116,115,47,112,105,120,101,108,112,108,97,121,46,112,110,103,0,114,101,115,111,117,114,99,101,115,47,102,111,110,116,115,47,109,101,99,104,97,46,112,110,103,0,114,101,115,111,117,114,99,101,115,47,102,111,110,116,115,47,115,101,116,98,97,99,107,46,112,110,103,0,114,101,115,111,117,114,99,101,115,47,102,111,110,116,115,47,114,111,109,117,108,117,115,46,112,110,103,0,114,101,115,111,117,114,99,101,115,47,102,111,110,116,115,47,112,105,120,97,110,116,105,113,117,97,46,112,110,103,0,114,101,115,111,117,114,99,101,115,47,102,111,110,116,115,47,97,108,112,104,97,95,98,101,116,97,46,112,110,103,0,114,101,115,111,117,114,99,101,115,47,102,111,110,116,115,47,106,117,112,105,116,101,114,95,99,114,97,115,104,46,112,110,103,0,102,114,101,101,32,102,111,110,116,115,32,105,110,99,108,117,100,101,100,32,119,105,116,104,32,114,97,121,108,105,98,0,73,110,105,116,105,97,108,105,122,105,110,103,32,114,97,121,108,105,98,32,40,118,49,46,55,46,48,41,0,35,99,97,110,118,97,115,0,84,97,114,103,101,116,32,116,105,109,101,32,112,101,114,32,102,114,97,109,101,58,32,37,48,50,46,48,51,102,32,109,105,108,108,105,115,101,99,111,110,100,115,0,69,115,99,97,112,101,0,67,97,110,118,97,115,32,115,99,97,108,101,100,32,116,111,32,102,117,108,108,115,99,114,101,101,110,46,32,69,108,101,109,101,110,116,83,105,122,101,58,32,40,37,105,120,37,105,41,44,32,83,99,114,101,101,110,83,105,122,101,40,37,105,120,37,105,41,0,67,97,110,118,97,115,32,115,99,97,108,101,100,32,116,111,32,119,105,110,100,111,119,101,100,46,32,69,108,101,109,101,110,116,83,105,122,101,58,32,40,37,105,120,37,105,41,44,32,83,99,114,101,101,110,83,105,122,101,40,37,105,120,37,105,41,0,91,84,69,88,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,102,111,110,116,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,68,88,84,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,32,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,69,84,67,49,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,32,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,69,84,67,50,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,32,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,80,86,82,84,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,32,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,65,83,84,67,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,32,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,84,101,120,116,117,114,101,32,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,91,84,69,88,32,73,68,32,37,105,93,32,84,101,120,116,117,114,101,32,99,114,101,97,116,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,37,105,120,37,105,41,0,84,101,120,116,117,114,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,99,114,101,97,116,101,100,0,73,109,97,103,101,32,100,97,116,97,32,102,111,114,109,97,116,32,105,115,32,99,111,109,112,114,101,115,115,101,100,44,32,99,97,110,32,110,111,116,32,98,101,32,99,111,110,118,101,114,116,101,100,0,70,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,32,102,111,114,32,112,105,120,101,108,32,100,97,116,97,32,114,101,116,114,105,101,118,97,108,0,70,97,105,108,101,100,32,116,111,32,105,110,105,116,105,97,108,105,122,101,32,71,76,70,87,0,84,114,121,105,110,103,32,116,111,32,101,110,97,98,108,101,32,77,83,65,65,32,120,52,0,67,108,111,115,101,115,116,32,102,117,108,108,115,99,114,101,101,110,32,118,105,100,101,111,109,111,100,101,58,32,37,105,32,120,32,37,105,0,71,76,70,87,32,70,97,105,108,101,100,32,116,111,32,105,110,105,116,105,97,108,105,122,101,32,87,105,110,100,111,119,0,68,105,115,112,108,97,121,32,100,101,118,105,99,101,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,82,101,110,100,101,114,32,115,105,122,101,58,32,37,105,32,120,32,37,105,0,83,99,114,101,101,110,32,115,105,122,101,58,32,37,105,32,120,32,37,105,0,86,105,101,119,112,111,114,116,32,111,102,102,115,101,116,115,58,32,37,105,44,32,37,105,0,84,114,121,105,110,103,32,116,111,32,101,110,97,98,108,101,32,86,83,89,78,67,0,71,80,85,58,32,86,101,110,100,111,114,58,32,32,32,37,115,0,71,80,85,58,32,82,101,110,100,101,114,101,114,58,32,37,115,0,71,80,85,58,32,86,101,114,115,105,111,110,58,32,32,37,115,0,71,80,85,58,32,71,76,83,76,58,32,32,32,32,32,37,115,0,32,0,78,117,109,98,101,114,32,111,102,32,115,117,112,112,111,114,116,101,100,32,101,120,116,101,110,115,105,111,110,115,58,32,37,105,0,71,76,95,79,69,83,95,118,101,114,116,101,120,95,97,114,114,97,121,95,111,98,106,101,99,116,0,103,108,71,101,110,86,101,114,116,101,120,65,114,114,97,121,115,79,69,83,0,103,108,66,105,110,100,86,101,114,116,101,120,65,114,114,97,121,79,69,83,0,103,108,68,101,108,101,116,101,86,101,114,116,101,120,65,114,114,97,121,115,79,69,83,0,71,76,95,79,69,83,95,116,101,120,116,117,114,101,95,110,112,111,116,0,71,76,95,69,88,84,95,116,101,120,116,117,114,101,95,99,111,109,112,114,101,115,115,105,111,110,95,115,51,116,99,0,71,76,95,87,69,66,71,76,95,99,111,109,112,114,101,115,115,101,100,95,116,101,120,116,117,114,101,95,115,51,116,99,0,71,76,95,87,69,66,75,73,84,95,87,69,66,71,76,95,99,111,109,112,114,101,115,115,101,100,95,116,101,120,116,117,114,101,95,115,51,116,99,0,71,76,95,79,69,83,95,99,111,109,112,114,101,115,115,101,100,95,69,84,67,49,95,82,71,66,56,95,116,101,120,116,117,114,101,0,71,76,95,87,69,66,71,76,95,99,111,109,112,114,101,115,115,101,100,95,116,101,120,116,117,114,101,95,101,116,99,49,0,71,76,95,65,82,66,95,69,83,51,95,99,111,109,112,97,116,105,98,105,108,105,116,121,0,71,76,95,73,77,71,95,116,101,120,116,117,114,101,95,99,111,109,112,114,101,115,115,105,111,110,95,112,118,114,116,99,0,71,76,95,75,72,82,95,116,101,120,116,117,114,101,95,99,111,109,112,114,101,115,115,105,111,110,95,97,115,116,99,95,104,100,114,0,71,76,95,69,88,84,95,116,101,120,116,117,114,101,95,102,105,108,116,101,114,95,97,110,105,115,111,116,114,111,112,105,99,0,71,76,95,69,88,84,95,116,101,120,116,117,114,101,95,109,105,114,114,111,114,95,99,108,97,109,112,0,91,69,88,84,69,78,83,73,79,78,93,32,86,65,79,32,101,120,116,101,110,115,105,111,110,32,100,101,116,101,99,116,101,100,44,32,86,65,79,32,102,117,110,99,116,105,111,110,115,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,69,88,84,69,78,83,73,79,78,93,32,86,65,79,32,101,120,116,101,110,115,105,111,110,32,110,111,116,32,102,111,117,110,100,44,32,86,65,79,32,117,115,97,103,101,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,91,69,88,84,69,78,83,73,79,78,93,32,78,80,79,84,32,116,101,120,116,117,114,101,115,32,101,120,116,101,110,115,105,111,110,32,100,101,116,101,99,116,101,100,44,32,102,117,108,108,32,78,80,79,84,32,116,101,120,116,117,114,101,115,32,115,117,112,112,111,114,116,101,100,0,91,69,88,84,69,78,83,73,79,78,93,32,78,80,79,84,32,116,101,120,116,117,114,101,115,32,101,120,116,101,110,115,105,111,110,32,110,111,116,32,102,111,117,110,100,44,32,108,105,109,105,116,101,100,32,78,80,79,84,32,115,117,112,112,111,114,116,32,40,110,111,45,109,105,112,109,97,112,115,44,32,110,111,45,114,101,112,101,97,116,41,0,91,69,88,84,69,78,83,73,79,78,93,32,68,88,84,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,115,32,115,117,112,112,111,114,116,101,100,0,91,69,88,84,69,78,83,73,79,78,93,32,69,84,67,49,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,115,32,115,117,112,112,111,114,116,101,100,0,91,69,88,84,69,78,83,73,79,78,93,32,69,84,67,50,47,69,65,67,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,115,32,115,117,112,112,111,114,116,101,100,0,91,69,88,84,69,78,83,73,79,78,93,32,80,86,82,84,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,115,32,115,117,112,112,111,114,116,101,100,0,91,69,88,84,69,78,83,73,79,78,93,32,65,83,84,67,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,115,32,115,117,112,112,111,114,116,101,100,0,91,69,88,84,69,78,83,73,79,78,93,32,65,110,105,115,111,116,114,111,112,105,99,32,116,101,120,116,117,114,101,115,32,102,105,108,116,101,114,105,110,103,32,115,117,112,112,111,114,116,101,100,32,40,109,97,120,58,32,37,46,48,102,88,41,0,91,69,88,84,69,78,83,73,79,78,93,32,67,108,97,109,112,32,109,105,114,114,111,114,32,119,114,97,112,32,116,101,120,116,117,114,101,32,109,111,100,101,32,115,117,112,112,111,114,116,101,100,0,91,84,69,88,32,73,68,32,37,105,93,32,66,97,115,101,32,119,104,105,116,101,32,116,101,120,116,117,114,101,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,66,97,115,101,32,119,104,105,116,101,32,116,101,120,116,117,114,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,108,111,97,100,101,100,0,79,112,101,110,71,76,32,100,101,102,97,117,108,116,32,115,116,97,116,101,115,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,67,80,85,93,32,68,101,102,97,117,108,116,32,98,117,102,102,101,114,115,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,108,105,110,101,115,44,32,116,114,105,97,110,103,108,101,115,44,32,113,117,97,100,115,41,0,91,86,65,79,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,98,117,102,102,101,114,115,32,86,65,79,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,108,105,110,101,115,41,0,91,86,66,79,32,73,68,32,37,105,93,91,86,66,79,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,98,117,102,102,101,114,115,32,86,66,79,115,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,108,105,110,101,115,41,0,91,86,65,79,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,98,117,102,102,101,114,115,32,86,65,79,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,116,114,105,97,110,103,108,101,115,41,0,91,86,66,79,32,73,68,32,37,105,93,91,86,66,79,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,98,117,102,102,101,114,115,32,86,66,79,115,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,116,114,105,97,110,103,108,101,115,41,0,91,86,65,79,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,98,117,102,102,101,114,115,32,86,65,79,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,113,117,97,100,115,41,0,91,86,66,79,32,73,68,32,37,105,93,91,86,66,79,32,73,68,32,37,105,93,91,86,66,79,32,73,68,32,37,105,93,91,86,66,79,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,98,117,102,102,101,114,115,32,86,66,79,115,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,113,117,97,100,115,41,0,35,118,101,114,115,105,111,110,32,49,48,48,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,97,116,116,114,105,98,117,116,101,32,118,101,99,51,32,118,101,114,116,101,120,80,111,115,105,116,105,111,110,59,32,32,32,32,32,10,97,116,116,114,105,98,117,116,101,32,118,101,99,50,32,118,101,114,116,101,120,84,101,120,67,111,111,114,100,59,32,32,32,32,32,10,97,116,116,114,105,98,117,116,101,32,118,101,99,52,32,118,101,114,116,101,120,67,111,108,111,114,59,32,32,32,32,32,32,32,32,10,118,97,114,121,105,110,103,32,118,101,99,50,32,102,114,97,103,84,101,120,67,111,111,114,100,59,32,32,32,32,32,32,32,32,32,10,118,97,114,121,105,110,103,32,118,101,99,52,32,102,114,97,103,67,111,108,111,114,59,32,32,32,32,32,32,32,32,32,32,32,32,10,117,110,105,102,111,114,109,32,109,97,116,52,32,109,118,112,77,97,116,114,105,120,59,32,32,32,32,32,32,32,32,32,32,32,32,10,118,111,105,100,32,109,97,105,110,40,41,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,123,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,32,32,32,32,102,114,97,103,84,101,120,67,111,111,114,100,32,61,32,118,101,114,116,101,120,84,101,120,67,111,111,114,100,59,32,10,32,32,32,32,102,114,97,103,67,111,108,111,114,32,61,32,118,101,114,116,101,120,67,111,108,111,114,59,32,32,32,32,32,32,32,10,32,32,32,32,103,108,95,80,111,115,105,116,105,111,110,32,61,32,109,118,112,77,97,116,114,105,120,42,118,101,99,52,40,118,101,114,116,101,120,80,111,115,105,116,105,111,110,44,32,49,46,48,41,59,32,10,125,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,0,35,118,101,114,115,105,111,110,32,49,48,48,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,112,114,101,99,105,115,105,111,110,32,109,101,100,105,117,109,112,32,102,108,111,97,116,59,32,32,32,32,32,32,32,32,32,32,32,10,118,97,114,121,105,110,103,32,118,101,99,50,32,102,114,97,103,84,101,120,67,111,111,114,100,59,32,32,32,32,32,32,32,32,32,10,118,97,114,121,105,110,103,32,118,101,99,52,32,102,114,97,103,67,111,108,111,114,59,32,32,32,32,32,32,32,32,32,32,32,32,10,117,110,105,102,111,114,109,32,115,97,109,112,108,101,114,50,68,32,116,101,120,116,117,114,101,48,59,32,32,32,32,32,32,32,32,10,117,110,105,102,111,114,109,32,118,101,99,52,32,99,111,108,68,105,102,102,117,115,101,59,32,32,32,32,32,32,32,32,32,32,32,10,118,111,105,100,32,109,97,105,110,40,41,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,123,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,32,32,32,32,118,101,99,52,32,116,101,120,101,108,67,111,108,111,114,32,61,32,116,101,120,116,117,114,101,50,68,40,116,101,120,116,117,114,101,48,44,32,102,114,97,103,84,101,120,67,111,111,114,100,41,59,32,10,32,32,32,32,103,108,95,70,114,97,103,67,111,108,111,114,32,61,32,116,101,120,101,108,67,111,108,111,114,42,99,111,108,68,105,102,102,117,115,101,42,102,114,97,103,67,111,108,111,114,59,32,32,32,32,32,32,10,125,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,0,91,83,72,68,82,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,115,104,97,100,101,114,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,83,72,68,82,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,115,104,97,100,101,114,32,99,111,117,108,100,32,110,111,116,32,98,101,32,108,111,97,100,101,100,0,118,101,114,116,101,120,80,111,115,105,116,105,111,110,0,118,101,114,116,101,120,84,101,120,67,111,111,114,100,0,118,101,114,116,101,120,84,101,120,67,111,111,114,100,50,0,118,101,114,116,101,120,78,111,114,109,97,108,0,118,101,114,116,101,120,84,97,110,103,101,110,116,0,118,101,114,116,101,120,67,111,108,111,114,0,109,118,112,77,97,116,114,105,120,0,99,111,108,68,105,102,102,117,115,101,0,99,111,108,65,109,98,105,101,110,116,0,99,111,108,83,112,101,99,117,108,97,114,0,116,101,120,116,117,114,101,48,0,116,101,120,116,117,114,101,49,0,116,101,120,116,117,114,101,50,0,91,86,83,72,68,82,32,73,68,32,37,105,93,32,70,97,105,108,101,100,32,116,111,32,99,111,109,112,105,108,101,32,118,101,114,116,101,120,32,115,104,97,100,101,114,46,46,46,0,37,115,0,91,86,83,72,68,82,32,73,68,32,37,105,93,32,86,101,114,116,101,120,32,115,104,97,100,101,114,32,99,111,109,112,105,108,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,70,83,72,68,82,32,73,68,32,37,105,93,32,70,97,105,108,101,100,32,116,111,32,99,111,109,112,105,108,101,32,102,114,97,103,109,101,110,116,32,115,104,97,100,101,114,46,46,46,0,91,70,83,72,68,82,32,73,68,32,37,105,93,32,70,114,97,103,109,101,110,116,32,115,104,97,100,101,114,32,99,111,109,112,105,108,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,83,72,68,82,32,73,68,32,37,105,93,32,70,97,105,108,101,100,32,116,111,32,108,105,110,107,32,115,104,97,100,101,114,32,112,114,111,103,114,97,109,46,46,46,0,91,83,72,68,82,32,73,68,32,37,105,93,32,83,104,97,100,101,114,32,112,114,111,103,114,97,109,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,68,79,87,78,83,67,65,76,73,78,71,58,32,82,101,113,117,105,114,101,100,32,115,99,114,101,101,110,32,115,105,122,101,32,40,37,105,120,37,105,41,32,105,115,32,98,105,103,103,101,114,32,116,104,97,110,32,100,105,115,112,108,97,121,32,115,105,122,101,32,40,37,105,120,37,105,41,0,68,111,119,110,115,99,97,108,101,32,109,97,116,114,105,120,32,103,101,110,101,114,97,116,101,100,44,32,99,111,110,116,101,110,116,32,119,105,108,108,32,98,101,32,114,101,110,100,101,114,101,100,32,97,116,58,32,37,105,32,120,32,37,105,0,85,80,83,67,65,76,73,78,71,58,32,82,101,113,117,105,114,101,100,32,115,99,114,101,101,110,32,115,105,122,101,58,32,37,105,32,120,32,37,105,32,45,62,32,68,105,115,112,108,97,121,32,115,105,122,101,58,32,37,105,32,120,32,37,105,0,91,71,76,70,87,51,32,69,114,114,111,114,93,32,67,111,100,101,58,32,37,105,32,68,101,99,114,105,112,116,105,111,110,58,32,37,115,0,73,78,70,79,58,32,0,87,65,82,78,73,78,71,58,32,0,87,105,110,100,111,119,32,99,108,111,115,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,84,69,88,32,73,68,32,37,105,93,32,85,110,108,111,97,100,101,100,32,116,101,120,116,117,114,101,32,100,97,116,97,32,40,98,97,115,101,32,119,104,105,116,101,32,116,101,120,116,117,114,101,41,32,102,114,111,109,32,86,82,65,77,0,91,84,69,88,32,73,68,32,37,105,93,32,85,110,108,111,97,100,101,100,32,116,101,120,116,117,114,101,32,100,97,116,97,32,102,114,111,109,32,86,82,65,77,32,40,71,80,85,41,0,83,116,97,99,107,32,66,117,102,102,101,114,32,79,118,101,114,102,108,111,119,32,40,77,65,88,32,37,105,32,77,97,116,114,105,120,41,0,77,65,88,95,76,73,78,69,83,95,66,65,84,67,72,32,111,118,101,114,102,108,111,119,0,77,65,88,95,84,82,73,65,78,71,76,69,83,95,66,65,84,67,72,32,111,118,101,114,102,108,111,119,0,77,65,88,95,81,85,65,68,83,95,66,65,84,67,72,32,111,118,101,114,102,108,111,119,0,67,108,97,109,112,32,109,105,114,114,111,114,32,119,114,97,112,32,109,111,100,101,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,91,84,69,88,32,73,68,32,37,105,93,32,77,97,120,105,109,117,109,32,97,110,105,115,111,116,114,111,112,105,99,32,102,105,108,116,101,114,32,108,101,118,101,108,32,115,117,112,112,111,114,116,101,100,32,105,115,32,37,105,88,0,65,110,105,115,111,116,114,111,112,105,99,32,102,105,108,116,101,114,105,110,103,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,114,105,46,98,105,116,115,95,112,101,114,95,99,104,97,110,110,101,108,32,61,61,32,49,54,0,46,47,101,120,116,101,114,110,97,108,47,115,116,98,95,105,109,97,103,101,46,104,0,115,116,98,105,95,95,108,111,97,100,95,97,110,100,95,112,111,115,116,112,114,111,99,101,115,115,95,56,98,105,116,0,111,117,116,111,102,109,101,109,0,117,110,107,110,111,119,110,32,105,109,97,103,101,32,116,121,112,101,0,98,97,100,32,114,101,113,95,99,111,109,112,0,114,101,113,95,99,111,109,112,32,62,61,32,49,32,38,38,32,114,101,113,95,99,111,109,112,32,60,61,32,52,0,115,116,98,105,95], "i8", ALLOC_NONE, Runtime.GLOBAL_BASE);
/* memory initializer */ allocate([95,99,111,110,118,101,114,116,95,102,111,114,109,97,116,49,54,0,115,116,98,105,95,95,99,111,110,118,101,114,116,95,102,111,114,109,97,116,0,109,117,108,116,105,112,108,101,32,73,72,68,82,0,98,97,100,32,73,72,68,82,32,108,101,110,0,116,111,111,32,108,97,114,103,101,0,49,47,50,47,52,47,56,47,49,54,45,98,105,116,32,111,110,108,121,0,98,97,100,32,99,116,121,112,101,0,98,97,100,32,99,111,109,112,32,109,101,116,104,111,100,0,98,97,100,32,102,105,108,116,101,114,32,109,101,116,104,111,100,0,98,97,100,32,105,110,116,101,114,108,97,99,101,32,109,101,116,104,111,100,0,48,45,112,105,120,101,108,32,105,109,97,103,101,0,102,105,114,115,116,32,110,111,116,32,73,72,68,82,0,105,110,118,97,108,105,100,32,80,76,84,69,0,116,82,78,83,32,97,102,116,101,114,32,73,68,65,84,0,116,82,78,83,32,98,101,102,111,114,101,32,80,76,84,69,0,98,97,100,32,116,82,78,83,32,108,101,110,0,116,82,78,83,32,119,105,116,104,32,97,108,112,104,97,0,0,255,85,0,17,0,0,0,1,110,111,32,80,76,84,69,0,111,117,116,111,102,100,97,116,97,0,110,111,32,73,68,65,84,0,88,88,88,88,32,80,78,71,32,99,104,117,110,107,32,110,111,116,32,107,110,111,119,110,0,115,45,62,105,109,103,95,111,117,116,95,110,32,61,61,32,52,0,115,116,98,105,95,95,100,101,95,105,112,104,111,110,101,0,111,117,116,95,110,32,61,61,32,50,32,124,124,32,111,117,116,95,110,32,61,61,32,52,0,115,116,98,105,95,95,99,111,109,112,117,116,101,95,116,114,97,110,115,112,97,114,101,110,99,121,0,115,116,98,105,95,95,99,111,109,112,117,116,101,95,116,114,97,110,115,112,97,114,101,110,99,121,49,54,0,111,117,116,95,110,32,61,61,32,115,45,62,105,109,103,95,110,32,124,124,32,111,117,116,95,110,32,61,61,32,115,45,62,105,109,103,95,110,43,49,0,115,116,98,105,95,95,99,114,101,97,116,101,95,112,110,103,95,105,109,97,103,101,95,114,97,119,0,110,111,116,32,101,110,111,117,103,104,32,112,105,120,101,108,115,0,105,109,103,95,119,105,100,116,104,95,98,121,116,101,115,32,60,61,32,120,0,0,1,0,5,6,105,109,103,95,110,43,49,32,61,61,32,111,117,116,95,110,0,105,110,118,97,108,105,100,32,102,105,108,116,101,114,0,105,109,103,95,110,32,61,61,32,51,0,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,7,7,7,7,7,7,7,7,7,7,7,7,7,7,7,7,7,7,7,7,7,7,7,7,8,8,8,8,8,8,8,8,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,98,97,100,32,104,117,102,102,109,97,110,32,99,111,100,101,0,98,97,100,32,100,105,115,116,0,111,117,116,112,117,116,32,98,117,102,102,101,114,32,108,105,109,105,116,0,122,45,62,115,105,122,101,91,98,93,32,61,61,32,115,0,115,116,98,105,95,95,122,104,117,102,102,109,97,110,95,100,101,99,111,100,101,95,115,108,111,119,112,97,116,104,0,98,105,116,115,32,60,61,32,49,54,0,115,116,98,105,95,95,98,105,116,95,114,101,118,101,114,115,101,0,122,45,62,99,111,100,101,95,98,117,102,102,101,114,32,60,32,40,49,85,32,60,60,32,122,45,62,110,117,109,95,98,105,116,115,41,0,115,116,98,105,95,95,102,105,108,108,95,98,105,116,115,0,98,97,100,32,99,111,100,101,108,101,110,103,116,104,115,0,99,32,61,61,32,49,56,0,115,116,98,105,95,95,99,111,109,112,117,116,101,95,104,117,102,102,109,97,110,95,99,111,100,101,115,0,98,97,100,32,115,105,122,101,115,0,97,45,62,110,117,109,95,98,105,116,115,32,61,61,32,48,0,115,116,98,105,95,95,112,97,114,115,101,95,117,110,99,111,109,112,114,101,115,115,101,100,95,98,108,111,99,107,0,122,108,105,98,32,99,111,114,114,117,112,116,0,114,101,97,100,32,112,97,115,116,32,98,117,102,102,101,114,0,98,97,100,32,122,108,105,98,32,104,101,97,100,101,114,0,110,111,32,112,114,101,115,101,116,32,100,105,99,116,0,98,97,100,32,99,111,109,112,114,101,115,115,105,111,110,0,98,97,100,32,112,110,103,32,115,105,103,0,91,37,115,93,32,82,101,115,111,117,114,99,101,32,102,105,108,101,32,100,111,101,115,32,110,111,116,32,99,111,110,116,97,105,110,32,105,109,97,103,101,32,100,97,116,97,0,46,112,110,103,0,91,37,115,93,32,73,109,97,103,101,32,102,105,108,101,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,91,37,115,93,32,73,109,97,103,101,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,37,105,120,37,105,41,0,91,37,115,93,32,73,109,97,103,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,108,111,97,100,101,100,0,73,109,97,103,101,32,102,111,114,109,97,116,32,110,111,116,32,114,101,99,111,103,110,105,122,101,100,0,91,37,115,93,32,114,82,69,83,32,114,97,121,108,105,98,32,114,101,115,111,117,114,99,101,32,102,105,108,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,111,112,101,110,101,100,0,91,37,115,93,32,84,104,105,115,32,105,115,32,110,111,116,32,97,32,118,97,108,105,100,32,114,97,121,108,105,98,32,114,101,115,111,117,114,99,101,32,102,105,108,101,0,91,37,115,93,91,73,68,32,37,105,93,32,82,101,115,111,117,114,99,101,32,100,97,116,97,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,37,115,93,91,73,68,32,37,105,93,32,82,101,113,117,101,115,116,101,100,32,114,101,115,111,117,114,99,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,102,111,117,110,100,0,79,117,116,32,111,102,32,109,101,109,111,114,121,32,119,104,105,108,101,32,100,101,99,111,109,112,114,101,115,115,105,110,103,32,100,97,116,97,0,68,97,116,97,32,100,101,99,111,109,112,114,101,115,115,105,111,110,32,102,97,105,108,101,100,0,69,120,112,101,99,116,101,100,32,117,110,99,111,109,112,114,101,115,115,101,100,32,115,105,122,101,32,100,111,32,110,111,116,32,109,97,116,99,104,44,32,100,97,116,97,32,109,97,121,32,98,101,32,99,111,114,114,117,112,116,101,100,0,32,45,45,32,69,120,112,101,99,116,101,100,32,117,110,99,111,109,112,114,101,115,115,101,100,32,115,105,122,101,58,32,37,105,0,32,45,45,32,82,101,116,117,114,110,101,100,32,117,110,99,111,109,112,114,101,115,115,101,100,32,115,105,122,101,58,32,37,105,0,68,97,116,97,32,100,101,99,111,109,112,114,101,115,115,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,102,114,111,109,32,37,117,32,98,121,116,101,115,32,116,111,32,37,117,32,98,121,116,101,115,0,5,5,4,0,16,17,18,0,8,7,9,6,10,5,11,4,12,3,13,2,14,1,15,2,3,7,0,3,3,11,0,65,108,112,104,97,32,109,97,115,107,32,109,117,115,116,32,98,101,32,115,97,109,101,32,115,105,122,101,32,97,115,32,105,109,97,103,101,0,65,108,112,104,97,32,109,97,115,107,32,99,97,110,32,110,111,116,32,98,101,32,97,112,112,108,105,101,100,32,116,111,32,99,111,109,112,114,101,115,115,101,100,32,100,97,116,97,32,102,111,114,109,97,116,115,0,91,84,69,88,32,73,68,32,37,105,93,32,78,111,32,109,105,112,109,97,112,115,32,97,118,97,105,108,97,98,108,101,32,102,111,114,32,84,82,73,76,73,78,69,65,82,32,116,101,120,116,117,114,101,32,102,105,108,116,101,114,105,110,103,0,46,114,114,101,115,0,46,116,116,102,0,46,102,110,116,0,91,37,115,93,32,83,112,114,105,116,101,70,111,110,116,32,99,111,117,108,100,32,110,111,116,32,98,101,32,108,111,97,100,101,100,44,32,117,115,105,110,103,32,100,101,102,97,117,108,116,32,102,111,110,116,0,83,112,114,105,116,101,70,111,110,116,32,100,97,116,97,32,112,97,114,115,101,100,32,99,111,114,114,101,99,116,108,121,32,102,114,111,109,32,105,109,97,103,101,0,73,109,97,103,101,32,102,105,108,101,32,108,111,97,100,101,100,32,99,111,114,114,101,99,116,108,121,32,97,115,32,83,112,114,105,116,101,70,111,110,116,0,114,116,0,91,37,115,93,32,70,78,84,32,102,105,108,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,111,112,101,110,101,100,0,108,105,110,101,72,101,105,103,104,116,0,108,105,110,101,72,101,105,103,104,116,61,37,105,32,98,97,115,101,61,37,105,32,115,99,97,108,101,87,61,37,105,32,115,99,97,108,101,72,61,37,105,0,91,37,115,93,32,70,111,110,116,32,115,105,122,101,58,32,37,105,0,91,37,115,93,32,70,111,110,116,32,116,101,120,116,117,114,101,32,115,99,97,108,101,58,32,37,105,120,37,105,0,102,105,108,101,0,102,105,108,101,61,34,37,49,50,56,91,94,34,93,34,0,91,37,115,93,32,70,111,110,116,32,116,101,120,116,117,114,101,32,102,105,108,101,110,97,109,101,58,32,37,115,0,99,111,117,110,116,0,99,111,117,110,116,61,37,105,0,91,37,115,93,32,70,111,110,116,32,110,117,109,32,99,104,97,114,115,58,32,37,105,0,91,37,115,93,32,70,111,110,116,32,116,101,120,116,117,114,101,32,108,111,97,100,105,110,103,32,112,97,116,104,58,32,37,115,0,99,104,97,114,32,105,100,61,37,105,32,120,61,37,105,32,121,61,37,105,32,119,105,100,116,104,61,37,105,32,104,101,105,103,104,116,61,37,105,32,120,111,102,102,115,101,116,61,37,105,32,121,111,102,102,115,101,116,61,37,105,32,120,97,100,118,97,110,99,101,61,37,105,0,91,37,115,93,32,83,112,114,105,116,101,70,111,110,116,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,85,110,108,111,97,100,101,100,32,115,112,114,105,116,101,32,102,111,110,116,32,100,97,116,97,0,91,37,115,93,32,83,112,114,105,116,101,70,111,110,116,32,99,111,117,108,100,32,110,111,116,32,98,101,32,103,101,110,101,114,97,116,101,100,44,32,117,115,105,110,103,32,100,101,102,97,117,108,116,32,102,111,110,116,0,84,84,70,32,115,112,114,105,116,101,102,111,110,116,32,108,111,97,100,105,110,103,58,32,80,114,101,100,105,99,116,101,100,32,116,101,120,116,117,114,101,32,115,105,122,101,58,32,37,105,120,37,105,0,114,98,0,91,37,115,93,32,84,84,70,32,102,105,108,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,111,112,101,110,101,100,0,84,84,70,32,115,112,114,105,116,101,102,111,110,116,32,108,111,97,100,105,110,103,58,32,102,105,114,115,116,32,99,104,97,114,97,99,116,101,114,32,105,115,32,110,111,116,32,83,80,65,67,69,40,51,50,41,32,99,104,97,114,97,99,116,101,114,0,84,84,70,32,115,112,114,105,116,101,102,111,110,116,32,108,111,97,100,105,110,103,58,32,78,111,116,32,97,108,108,32,116,104,101,32,99,104,97,114,97,99,116,101,114,115,32,102,105,116,32,105,110,32,116,104,101,32,102,111,110,116,0,120,43,103,119,32,60,32,112,119,0,46,47,101,120,116,101,114,110,97,108,47,115,116,98,95,116,114,117,101,116,121,112,101,46,104,0,115,116,98,116,116,95,66,97,107,101,70,111,110,116,66,105,116,109,97,112,95,105,110,116,101,114,110,97,108,0,122,45,62,100,105,114,101,99,116,105,111,110,0,115,116,98,116,116,95,95,114,97,115,116,101,114,105,122,101,95,115,111,114,116,101,100,95,101,100,103,101,115,0,122,45,62,101,121,32,62,61,32,115,99,97,110,95,121,95,116,111,112,0,101,45,62,101,121,32,62,61,32,121,95,116,111,112,0,115,116,98,116,116,95,95,102,105,108,108,95,97,99,116,105,118,101,95,101,100,103,101,115,95,110,101,119,0,101,45,62,115,121,32,60,61,32,121,95,98,111,116,116,111,109,32,38,38,32,101,45,62,101,121,32,62,61,32,121,95,116,111,112,0,120,32,62,61,32,48,32,38,38,32,120,32,60,32,108,101,110,0,102,97,98,115,40,97,114,101,97,41,32,60,61,32,49,46,48,49,102,0,121,48,32,60,32,121,49,0,115,116,98,116,116,95,95,104,97,110,100,108,101,95,99,108,105,112,112,101,100,95,101,100,103,101,0,101,45,62,115,121,32,60,61,32,101,45,62,101,121,0,120,49,32,60,61,32,120,43,49,0,120,49,32,62,61,32,120,0,120,49,32,60,61,32,120,0,120,49,32,62,61,32,120,43,49,0,120,49,32,62,61,32,120,32,38,38,32,120,49,32,60,61,32,120,43,49,0,120,48,32,62,61,32,120,32,38,38,32,120,48,32,60,61,32,120,43,49,32,38,38,32,120,49,32,62,61,32,120,32,38,38,32,120,49,32,60,61,32,120,43,49,0,122,32,33,61,32,40,40,118,111,105,100,42,41,48,41,0,115,116,98,116,116,95,95,110,101,119,95,97,99,116,105,118,101,0,33,105,110,102,111,45,62,99,102,102,46,115,105,122,101,0,115,116,98,116,116,95,95,71,101,116,71,108,121,102,79,102,102,115,101,116,0,48,0,115,116,98,116,116,95,95,99,102,102,95,105,110,116,0,110,32,62,61,32,49,32,38,38,32,110,32,60,61,32,52,0,115,116,98,116,116,95,95,98,117,102,95,103,101,116,0,115,105,122,101,32,60,32,48,120,52,48,48,48,48,48,48,48,0,115,116,98,116,116,95,95,110,101,119,95,98,117,102,0,33,40,111,32,62,32,98,45,62,115,105,122,101,32,124,124,32,111,32,60,32,48,41,0,115,116,98,116,116,95,95,98,117,102,95,115,101,101,107,0,111,102,102,115,105,122,101,32,62,61,32,49,32,38,38,32,111,102,102,115,105,122,101,32,60,61,32,52,0,115,116,98,116,116,95,95,99,102,102,95,103,101,116,95,105,110,100,101,120,0,98,48,32,62,61,32,50,56,0,115,116,98,116,116,95,95,99,102,102,95,115,107,105,112,95,111,112,101,114,97,110,100,0,105,32,62,61,32,48,32,38,38,32,105,32,60,32,99,111,117,110,116,0,115,116,98,116,116,95,95,99,102,102,95,105,110,100,101,120,95,103,101,116,0,111,117,116,112,117,116,95,99,116,120,46,110,117,109,95,118,101,114,116,105,99,101,115,32,61,61,32,99,111,117,110,116,95,99,116,120,46,110,117,109,95,118,101,114,116,105,99,101,115,0,115,116,98,116,116,95,95,71,101,116,71,108,121,112,104,83,104,97,112,101,84,50,0,115,116,98,116,116,95,95,71,101,116,71,108,121,112,104,83,104,97,112,101,84,84,0,115,116,98,116,116,95,70,105,110,100,71,108,121,112,104,73,110,100,101,120,0,117,110,105,99,111,100,101,95,99,111,100,101,112,111,105,110,116,32,60,61,32,116,116,85,83,72,79,82,84,40,100,97,116,97,32,43,32,101,110,100,67,111,117,110,116,32,43,32,50,42,105,116,101,109,41,0,99,109,97,112,0,108,111,99,97,0,104,101,97,100,0,103,108,121,102,0,104,104,101,97,0,104,109,116,120,0,107,101,114,110,0,67,70,70,32,0,109,97,120,112,0,69,88,84,0,65,82,66,0,79,69,83,0,65,78,71,76,69,0,103,108,67,114,101,97,116,101,80,114,111,103,114,97,109,79,98,106,101,99,116,0,103,108,67,114,101,97,116,101,80,114,111,103,114,97,109,0,103,108,85,115,101,80,114,111,103,114,97,109,79,98,106,101,99,116,0,103,108,85,115,101,80,114,111,103,114,97,109,0,103,108,67,114,101,97,116,101,83,104,97,100,101,114,79,98,106,101,99,116,0,103,108,67,114,101,97,116,101,83,104,97,100,101,114,0,103,108,65,116,116,97,99,104,79,98,106,101,99,116,0,103,108,65,116,116,97,99,104,83,104,97,100,101,114,0,103,108,68,101,116,97,99,104,79,98,106,101,99,116,0,103,108,68,101,116,97,99,104,83,104,97,100,101,114,0,103,108,80,105,120,101,108,83,116,111,114,101,105,0,103,108,71,101,116,83,116,114,105,110,103,0,103,108,71,101,116,73,110,116,101,103,101,114,118,0,103,108,71,101,116,70,108,111,97,116,118,0,103,108,71,101,116,66,111,111,108,101,97,110,118,0,103,108,71,101,110,84,101,120,116,117,114,101,115,0,103,108,68,101,108,101,116,101,84,101,120,116,117,114,101,115,0,103,108,67,111,109,112,114,101,115,115,101,100,84,101,120,73,109,97,103,101,50,68,0,103,108,67,111,109,112,114,101,115,115,101,100,84,101,120,83,117,98,73,109,97,103,101,50,68,0,103,108,84,101,120,73,109,97,103,101,50,68,0,103,108,84,101,120,83,117,98,73,109,97,103,101,50,68,0,103,108,82,101,97,100,80,105,120,101,108,115,0,103,108,66,105,110,100,84,101,120,116,117,114,101,0,103,108,71,101,116,84,101,120,80,97,114,97,109,101,116,101,114,102,118,0,103,108,71,101,116,84,101,120,80,97,114,97,109,101,116,101,114,105,118,0,103,108,84,101,120,80,97,114,97,109,101,116,101,114,102,118,0,103,108,84,101,120,80,97,114,97,109,101,116,101,114,105,118,0,103,108,73,115,84,101,120,116,117,114,101,0,103,108,71,101,110,66,117,102,102,101,114,115,0,103,108,68,101,108,101,116,101,66,117,102,102,101,114,115,0,103,108,71,101,116,66,117,102,102,101,114,80,97,114,97,109,101,116,101,114,105,118,0,103,108,66,117,102,102,101,114,68,97,116,97,0,103,108,66,117,102,102,101,114,83,117,98,68,97,116,97,0,103,108,73,115,66,117,102,102,101,114,0,103,108,71,101,110,82,101,110,100,101,114,98,117,102,102,101,114,115,0,103,108,68,101,108,101,116,101,82,101,110,100,101,114,98,117,102,102,101,114,115,0,103,108,66,105,110,100,82,101,110,100,101,114,98,117,102,102,101,114,0,103,108,71,101,116,82,101,110,100,101,114,98,117,102,102,101,114,80,97,114,97,109,101,116,101,114,105,118,0,103,108,73,115,82,101,110,100,101,114,98,117,102,102,101,114,0,103,108,71,101,116,85,110,105,102,111,114,109,102,118,0,103,108,71,101,116,85,110,105,102,111,114,109,105,118,0,103,108,71,101,116,85,110,105,102,111,114,109,76,111,99,97,116,105,111,110,0,103,108,71,101,116,86,101,114,116,101,120,65,116,116,114,105,98,102,118,0,103,108,71,101,116,86,101,114,116,101,120,65,116,116,114,105,98,105,118,0,103,108,71,101,116,86,101,114,116,101,120,65,116,116,114,105,98,80,111,105,110,116,101,114,118,0,103,108,71,101,116,65,99,116,105,118,101,85,110,105,102,111,114,109,0,103,108,85,110,105,102,111,114,109,49,102,0,103,108,85,110,105,102,111,114,109,50,102,0,103,108,85,110,105,102,111,114,109,51,102,0,103,108,85,110,105,102,111,114,109,52,102,0,103,108,85,110,105,102,111,114,109,49,105,0,103,108,85,110,105,102,111,114,109,50,105,0,103,108,85,110,105,102,111,114,109,51,105,0,103,108,85,110,105,102,111,114,109,52,105,0,103,108,85,110,105,102,111,114,109,49,105,118,0,103,108,85,110,105,102,111,114,109,50,105,118,0,103,108,85,110,105,102,111,114,109,51,105,118,0,103,108,85,110,105,102,111,114,109,52,105,118,0,103,108,85,110,105,102,111,114,109,49,102,118,0,103,108,85,110,105,102,111,114,109,50,102,118,0,103,108,85,110,105,102,111,114,109,51,102,118,0,103,108,85,110,105,102,111,114,109,52,102,118,0,103,108,85,110,105,102,111,114,109,77,97,116,114,105,120,50,102,118,0,103,108,85,110,105,102,111,114,109,77,97,116,114,105,120,51,102,118,0,103,108,85,110,105,102,111,114,109,77,97,116,114,105,120,52,102,118,0,103,108,66,105,110,100,66,117,102,102,101,114,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,49,102,118,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,50,102,118,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,51,102,118,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,52,102,118,0,103,108,71,101,116,65,116,116,114,105,98,76,111,99,97,116,105,111,110,0,103,108,71,101,116,65,99,116,105,118,101,65,116,116,114,105,98,0,103,108,68,101,108,101,116,101,83,104,97,100,101,114,0,103,108,71,101,116,65,116,116,97,99,104,101,100,83,104,97,100,101,114,115,0,103,108,83,104,97,100,101,114,83,111,117,114,99,101,0,103,108,71,101,116,83,104,97,100,101,114,83,111,117,114,99,101,0,103,108,67,111,109,112,105,108,101,83,104,97,100,101,114,0,103,108,71,101,116,83,104,97,100,101,114,73,110,102,111,76,111,103,0,103,108,71,101,116,83,104,97,100,101,114,105,118,0,103,108,71,101,116,80,114,111,103,114,97,109,105,118,0,103,108,73,115,83,104,97,100,101,114,0,103,108,68,101,108,101,116,101,80,114,111,103,114,97,109,0,103,108,71,101,116,83,104,97,100,101,114,80,114,101,99,105,115,105,111,110,70,111,114,109,97,116,0,103,108,76,105,110,107,80,114,111,103,114,97,109,0,103,108,71,101,116,80,114,111,103,114,97,109,73,110,102,111,76,111,103,0,103,108,86,97,108,105,100,97,116,101,80,114,111,103,114,97,109,0,103,108,73,115,80,114,111,103,114,97,109,0,103,108,66,105,110,100,65,116,116,114,105,98,76,111,99,97,116,105,111,110,0,103,108,66,105,110,100,70,114,97,109,101,98,117,102,102,101,114,0,103,108,71,101,110,70,114,97,109,101,98,117,102,102,101,114,115,0,103,108,68,101,108,101,116,101,70,114,97,109,101,98,117,102,102,101,114,115,0,103,108,70,114,97,109,101,98,117,102,102,101,114,82,101,110,100,101,114,98,117,102,102,101,114,0,103,108,70,114,97,109,101,98,117,102,102,101,114,84,101,120,116,117,114,101,50,68,0,103,108,71,101,116,70,114,97,109,101,98,117,102,102,101,114,65,116,116,97,99,104,109,101,110,116,80,97,114,97,109,101,116,101,114,105,118,0,103,108,73,115,70,114,97,109,101,98,117,102,102,101,114,0,103,108,68,101,108,101,116,101,79,98,106,101,99,116,0,103,108,71,101,116,79,98,106,101,99,116,80,97,114,97,109,101,116,101,114,105,118,0,103,108,71,101,116,73,110,102,111,76,111,103,0,103,108,66,105,110,100,80,114,111,103,114,97,109,0,103,108,71,101,116,80,111,105,110,116,101,114,118,0,103,108,68,114,97,119,82,97,110,103,101,69,108,101,109,101,110,116,115,0,103,108,69,110,97,98,108,101,67,108,105,101,110,116,83,116,97,116,101,0,103,108,86,101,114,116,101,120,80,111,105,110,116,101,114,0,103,108,84,101,120,67,111,111,114,100,80,111,105,110,116,101,114,0,103,108,78,111,114,109,97,108,80,111,105,110,116,101,114,0,103,108,67,111,108,111,114,80,111,105,110,116,101,114,0,103,108,67,108,105,101,110,116,65,99,116,105,118,101,84,101,120,116,117,114,101,0,103,108,71,101,110,86,101,114,116,101,120,65,114,114,97,121,115,0,103,108,68,101,108,101,116,101,86,101,114,116,101,120,65,114,114,97,121,115,0,103,108,66,105,110,100,86,101,114,116,101,120,65,114,114,97,121,0,103,108,77,97,116,114,105,120,77,111,100,101,0,103,108,76,111,97,100,73,100,101,110,116,105,116,121,0,103,108,76,111,97,100,77,97,116,114,105,120,102,0,103,108,70,114,117,115,116,117,109,0,103,108,82,111,116,97,116,101,102,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,80,111,105,110,116,101,114,0,103,108,69,110,97,98,108,101,86,101,114,116,101,120,65,116,116,114,105,98,65,114,114,97,121,0,103,108,68,105,115,97,98,108,101,86,101,114,116,101,120,65,116,116,114,105,98,65,114,114,97,121,0,103,108,68,114,97,119,65,114,114,97,121,115,0,103,108,68,114,97,119,69,108,101,109,101,110,116,115,0,103,108,83,104,97,100,101,114,66,105,110,97,114,121,0,103,108,82,101,108,101,97,115,101,83,104,97,100,101,114,67,111,109,112,105,108,101,114,0,103,108,71,101,116,69,114,114,111,114,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,68,105,118,105,115,111,114,0,103,108,68,114,97,119,65,114,114,97,121,115,73,110,115,116,97,110,99,101,100,0,103,108,68,114,97,119,69,108,101,109,101,110,116,115,73,110,115,116,97,110,99,101,100,0,103,108,70,105,110,105,115,104,0,103,108,70,108,117,115,104,0,103,108,67,108,101,97,114,68,101,112,116,104,0,103,108,67,108,101,97,114,68,101,112,116,104,102,0,103,108,68,101,112,116,104,70,117,110,99,0,103,108,69,110,97,98,108,101,0,103,108,68,105,115,97,98,108,101,0,103,108,70,114,111,110,116,70,97,99,101,0,103,108,67,117,108,108,70,97,99,101,0,103,108,67,108,101,97,114,0,103,108,76,105,110,101,87,105,100,116,104,0,103,108,67,108,101,97,114,83,116,101,110,99,105,108,0,103,108,68,101,112,116,104,77,97,115,107,0,103,108,83,116,101,110,99,105,108,77,97,115,107,0,103,108,67,104,101,99,107,70,114,97,109,101,98,117,102,102,101,114,83,116,97,116,117,115,0,103,108,71,101,110,101,114,97,116,101,77,105,112,109,97,112,0,103,108,65,99,116,105,118,101,84,101,120,116,117,114,101,0,103,108,66,108,101,110,100,69,113,117,97,116,105,111,110,0,103,108,73,115,69,110,97,98,108,101,100,0,103,108,66,108,101,110,100,70,117,110,99,0,103,108,66,108,101,110,100,69,113,117,97,116,105,111,110,83,101,112,97,114,97,116,101,0,103,108,68,101,112,116,104,82,97,110,103,101,0,103,108,68,101,112,116,104,82,97,110,103,101,102,0,103,108,83,116,101,110,99,105,108,77,97,115,107,83,101,112,97,114,97,116,101,0,103,108,72,105,110,116,0,103,108,80,111,108,121,103,111,110,79,102,102,115,101,116,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,49,102,0,103,108,83,97,109,112,108,101,67,111,118,101,114,97,103,101,0,103,108,84,101,120,80,97,114,97,109,101,116,101,114,105,0,103,108,84,101,120,80,97,114,97,109,101,116,101,114,102,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,50,102,0,103,108,83,116,101,110,99,105,108,70,117,110,99,0,103,108,83,116,101,110,99,105,108,79,112,0,103,108,86,105,101,119,112,111,114,116,0,103,108,67,108,101,97,114,67,111,108,111,114,0,103,108,83,99,105,115,115,111,114,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,51,102,0,103,108,67,111,108,111,114,77,97,115,107,0,103,108,82,101,110,100,101,114,98,117,102,102,101,114,83,116,111,114,97,103,101,0,103,108,66,108,101,110,100,70,117,110,99,83,101,112,97,114,97,116,101,0,103,108,66,108,101,110,100,67,111,108,111,114,0,103,108,83,116,101,110,99,105,108,70,117,110,99,83,101,112,97,114,97,116,101,0,103,108,83,116,101,110,99,105,108,79,112,83,101,112,97,114,97,116,101,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,52,102,0,103,108,67,111,112,121,84,101,120,73,109,97,103,101,50,68,0,103,108,67,111,112,121,84,101,120,83,117,98,73,109,97,103,101,50,68,0,103,108,68,114,97,119,66,117,102,102,101,114,115,0,123,32,77,111,100,117,108,101,46,112,114,105,110,116,69,114,114,40,39,98,97,100,32,110,97,109,101,32,105,110,32,103,101,116,80,114,111,99,65,100,100,114,101,115,115,58,32,39,32,43,32,91,80,111,105,110,116,101,114,95,115,116,114,105,110,103,105,102,121,40,36,48,41,44,32,80,111,105,110,116,101,114,95,115,116,114,105,110,103,105,102,121,40,36,49,41,93,41,59,32,125,0,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,0,1,2,3,4,5,6,7,8,9,255,255,255,255,255,255,255,10,11,12,13,14,15,16,17,18,19,20,21,22,23,24,25,26,27,28,29,30,31,32,33,34,35,255,255,255,255,255,255,10,11,12,13,14,15,16,17,18,19,20,21,22,23,24,25,26,27,28,29,30,31,32,33,34,35,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,0,1,2,4,7,3,6,5,0,17,0,10,0,17,17,17,0,0,0,0,5,0,0,0,0,0,0,9,0,0,0,0,11,0,0,0,0,0,0,0,0,17,0,15,10,17,17,17,3,10,7,0,1,19,9,11,11,0,0,9,6,11,0,0,11,0,6,17,0,0,0,17,17,17,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,11,0,0,0,0,0,0,0,0,17,0,10,10,17,17,17,0,10,0,0,2,0,9,11,0,0,0,9,0,11,0,0,11,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,12,0,0,0,0,0,0,0,0,0,0,0,12,0,0,0,0,12,0,0,0,0,9,12,0,0,0,0,0,12,0,0,12,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,14,0,0,0,0,0,0,0,0,0,0,0,13,0,0,0,4,13,0,0,0,0,9,14,0,0,0,0,0,14,0,0,14,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,16,0,0,0,0,0,0,0,0,0,0,0,15,0,0,0,0,15,0,0,0,0,9,16,0,0,0,0,0,16,0,0,16,0,0,18,0,0,0,18,18,18,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,18,0,0,0,18,18,18,0,0,0,0,0,0,9,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,11,0,0,0,0,0,0,0,0,0,0,0,10,0,0,0,0,10,0,0,0,0,9,11,0,0,0,0,0,11,0,0,11,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,12,0,0,0,0,0,0,0,0,0,0,0,12,0,0,0,0,12,0,0,0,0,9,12,0,0,0,0,0,12,0,0,12,0,0,45,43,32,32,32,48,88,48,120,0,40,110,117,108,108,41,0,45,48,88,43,48,88,32,48,88,45,48,120,43,48,120,32,48,120,0,105,110,102,0,73,78,70,0,78,65,78,0,48,49,50,51,52,53,54,55,56,57,65,66,67,68,69,70,46,0,84,33,34,25,13,1,2,3,17,75,28,12,16,4,11,29,18,30,39,104,110,111,112,113,98,32,5,6,15,19,20,21,26,8,22,7,40,36,23,24,9,10,14,27,31,37,35,131,130,125,38,42,43,60,61,62,63,67,71,74,77,88,89,90,91,92,93,94,95,96,97,99,100,101,102,103,105,106,107,108,114,115,116,121,122,123,124,0,73,108,108,101,103,97,108,32,98,121,116,101,32,115,101,113,117,101,110,99,101,0,68,111,109,97,105,110,32,101,114,114,111,114,0,82,101,115,117,108,116,32,110,111,116,32,114,101,112,114,101,115,101,110,116,97,98,108,101,0,78,111,116,32,97,32,116,116,121,0,80,101,114,109,105,115,115,105,111,110,32,100,101,110,105,101,100,0,79,112,101,114,97,116,105,111,110,32,110,111,116,32,112,101,114,109,105,116,116,101,100,0,78,111,32,115,117,99,104,32,102,105,108,101,32,111,114,32,100,105,114,101,99,116,111,114,121,0,78,111,32,115,117,99,104,32,112,114,111,99,101,115,115,0,70,105,108,101,32,101,120,105,115,116,115,0,86,97,108,117,101,32,116,111,111,32,108,97,114,103,101,32,102,111,114,32,100,97,116,97,32,116,121,112,101,0,78,111,32,115,112,97,99,101,32,108,101,102,116,32,111,110,32,100,101,118,105,99,101,0,79,117,116,32,111,102,32,109,101,109,111,114,121,0,82,101,115,111,117,114,99,101,32,98,117,115,121,0,73,110,116,101,114,114,117,112,116,101,100,32,115,121,115,116,101,109,32,99,97,108,108,0,82,101,115,111,117,114,99,101,32,116,101,109,112,111,114,97,114,105,108,121,32,117,110,97,118,97,105,108,97,98,108,101,0,73,110,118,97,108,105,100,32,115,101,101,107,0,67,114,111,115,115,45,100,101,118,105,99,101,32,108,105,110,107,0,82,101,97,100,45,111,110,108,121,32,102,105,108,101,32,115,121,115,116,101,109,0,68,105,114,101,99,116,111,114,121,32,110,111,116,32,101,109,112,116,121,0,67,111,110,110,101,99,116,105,111,110,32,114,101,115,101,116,32,98,121,32,112,101,101,114,0,79,112,101,114,97,116,105,111,110,32,116,105,109,101,100,32,111,117,116,0,67,111,110,110,101,99,116,105,111,110,32,114,101,102,117,115,101,100,0,72,111,115,116,32,105,115,32,100,111,119,110,0,72,111,115,116,32,105,115,32,117,110,114,101,97,99,104,97,98,108,101,0,65,100,100,114,101,115,115,32,105,110,32,117,115,101,0,66,114,111,107,101,110,32,112,105,112,101,0,73,47,79,32,101,114,114,111,114,0,78,111,32,115,117,99,104,32,100,101,118,105,99,101,32,111,114,32,97,100,100,114,101,115,115,0,66,108,111,99,107,32,100,101,118,105,99,101,32,114,101,113,117,105,114,101,100,0,78,111,32,115,117,99,104,32,100,101,118,105,99,101,0,78,111,116,32,97,32,100,105,114,101,99,116,111,114,121,0,73,115,32,97,32,100,105,114,101,99,116,111,114,121,0,84,101,120,116,32,102,105,108,101,32,98,117,115,121,0,69,120,101,99,32,102,111,114,109,97,116,32,101,114,114,111,114,0,73,110,118,97,108,105,100,32,97,114,103,117,109,101,110,116,0,65,114,103,117,109,101,110,116,32,108,105,115,116,32,116,111,111,32,108,111,110,103,0,83,121,109,98,111,108,105,99,32,108,105,110,107,32,108,111,111,112,0,70,105,108,101,110,97,109,101,32,116,111,111,32,108,111,110,103,0,84,111,111,32,109,97,110,121,32,111,112,101,110,32,102,105,108,101,115,32,105,110,32,115,121,115,116,101,109,0,78,111,32,102,105,108,101,32,100,101,115,99,114,105,112,116,111,114,115,32,97,118,97,105,108,97,98,108,101,0,66,97,100,32,102,105,108,101,32,100,101,115,99,114,105,112,116,111,114,0,78,111,32,99,104,105,108,100,32,112,114,111,99,101,115,115,0,66,97,100,32,97,100,100,114,101,115,115,0,70,105,108,101,32,116,111,111,32,108,97,114,103,101,0,84,111,111,32,109,97,110,121,32,108,105,110,107,115,0,78,111,32,108,111,99,107,115,32,97,118,97,105,108,97,98,108,101,0,82,101,115,111,117,114,99,101,32,100,101,97,100,108,111,99,107,32,119,111,117,108,100,32,111,99,99,117,114,0,83,116,97,116,101,32,110,111,116,32,114,101,99,111,118,101,114,97,98,108,101,0,80,114,101,118,105,111,117,115,32,111,119,110,101,114,32,100,105,101,100,0,79,112,101,114,97,116,105,111,110,32,99,97,110,99,101,108,101,100,0,70,117,110,99,116,105,111,110,32,110,111,116,32,105,109,112,108,101,109,101,110,116,101,100,0,78,111,32,109,101,115,115,97,103,101,32,111,102,32,100,101,115,105,114,101,100,32,116,121,112,101,0,73,100,101,110,116,105,102,105,101,114,32,114,101,109,111,118,101,100,0,68,101,118,105,99,101,32,110,111,116,32,97,32,115,116,114,101,97,109,0,78,111,32,100,97,116,97,32,97,118,97,105,108,97,98,108,101,0,68,101,118,105,99,101,32,116,105,109,101,111,117,116,0,79,117,116,32,111,102,32,115,116,114,101,97,109,115,32,114,101,115,111,117,114,99,101,115,0,76,105,110,107,32,104,97,115,32,98,101,101,110,32,115,101,118,101,114,101,100,0,80,114,111,116,111,99,111,108,32,101,114,114,111,114,0,66,97,100,32,109,101,115,115,97,103,101,0,70,105,108,101,32,100,101,115,99,114,105,112,116,111,114,32,105,110,32,98,97,100,32,115,116,97,116,101,0,78,111,116,32,97,32,115,111,99,107,101,116,0,68,101,115,116,105,110,97,116,105,111,110,32,97,100,100,114,101,115,115,32,114,101,113,117,105,114,101,100,0,77,101,115,115,97,103,101,32,116,111,111,32,108,97,114,103,101,0,80,114,111,116,111,99,111,108,32,119,114,111,110,103,32,116,121,112,101,32,102,111,114,32,115,111,99,107,101,116,0,80,114,111,116,111,99,111,108,32,110,111,116,32,97,118,97,105,108,97,98,108,101,0,80,114,111,116,111,99,111,108,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,83,111,99,107,101,116,32,116,121,112,101,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,78,111,116,32,115,117,112,112,111,114,116,101,100,0,80,114,111,116,111,99,111,108,32,102,97,109,105,108,121,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,65,100,100,114,101,115,115,32,102,97,109,105,108,121,32,110,111,116,32,115,117,112,112,111,114,116,101,100,32,98,121,32,112,114,111,116,111,99,111,108,0,65,100,100,114,101,115,115,32,110,111,116,32,97,118,97,105,108,97,98,108,101,0,78,101,116,119,111,114,107,32,105,115,32,100,111,119,110,0,78,101,116,119,111,114,107,32,117,110,114,101,97,99,104,97,98,108,101,0,67,111,110,110,101,99,116,105,111,110,32,114,101,115,101,116,32,98,121,32,110,101,116,119,111,114,107,0,67,111,110,110,101,99,116,105,111,110,32,97,98,111,114,116,101,100,0,78,111,32,98,117,102,102,101,114,32,115,112,97,99,101,32,97,118,97,105,108,97,98,108,101,0,83,111,99,107,101,116,32,105,115,32,99,111,110,110,101,99,116,101,100,0,83,111,99,107,101,116,32,110,111,116,32,99,111,110,110,101,99,116,101,100,0,67,97,110,110,111,116,32,115,101,110,100,32,97,102,116,101,114,32,115,111,99,107,101,116,32,115,104,117,116,100,111,119,110,0,79,112,101,114,97,116,105,111,110,32,97,108,114,101,97,100,121,32,105,110,32,112,114,111,103,114,101,115,115,0,79,112,101,114,97,116,105,111,110,32,105,110,32,112,114,111,103,114,101,115,115,0,83,116,97,108,101,32,102,105,108,101,32,104,97,110,100,108,101,0,82,101,109,111,116,101,32,73,47,79,32,101,114,114,111,114,0,81,117,111,116,97,32,101,120,99,101,101,100,101,100,0,78,111,32,109,101,100,105,117,109,32,102,111,117,110,100,0,87,114,111,110,103,32,109,101,100,105,117,109,32,116,121,112,101,0,78,111,32,101,114,114,111,114,32,105,110,102,111,114,109,97,116,105,111,110,0,0,105,110,102,105,110,105,116,121,0,110,97,110,0,114,119,97,0], "i8", ALLOC_NONE, Runtime.GLOBAL_BASE+10240);





/* no memory initializer */
var tempDoublePtr = STATICTOP; STATICTOP += 16;

assert(tempDoublePtr % 8 == 0);

function copyTempFloat(ptr) { // functions, because inlining this code increases code size too much

  HEAP8[tempDoublePtr] = HEAP8[ptr];

  HEAP8[tempDoublePtr+1] = HEAP8[ptr+1];

  HEAP8[tempDoublePtr+2] = HEAP8[ptr+2];

  HEAP8[tempDoublePtr+3] = HEAP8[ptr+3];

}

function copyTempDouble(ptr) {

  HEAP8[tempDoublePtr] = HEAP8[ptr];

  HEAP8[tempDoublePtr+1] = HEAP8[ptr+1];

  HEAP8[tempDoublePtr+2] = HEAP8[ptr+2];

  HEAP8[tempDoublePtr+3] = HEAP8[ptr+3];

  HEAP8[tempDoublePtr+4] = HEAP8[ptr+4];

  HEAP8[tempDoublePtr+5] = HEAP8[ptr+5];

  HEAP8[tempDoublePtr+6] = HEAP8[ptr+6];

  HEAP8[tempDoublePtr+7] = HEAP8[ptr+7];

}

// {{PRE_LIBRARY}}


  
  var GL={counter:1,lastError:0,buffers:[],mappedBuffers:{},programs:[],framebuffers:[],renderbuffers:[],textures:[],uniforms:[],shaders:[],vaos:[],contexts:[],currentContext:null,offscreenCanvases:{},timerQueriesEXT:[],byteSizeByTypeRoot:5120,byteSizeByType:[1,1,2,2,4,4,4,2,3,4,8],programInfos:{},stringCache:{},tempFixedLengthArray:[],packAlignment:4,unpackAlignment:4,init:function () {
        GL.miniTempBuffer = new Float32Array(GL.MINI_TEMP_BUFFER_SIZE);
        for (var i = 0; i < GL.MINI_TEMP_BUFFER_SIZE; i++) {
          GL.miniTempBufferViews[i] = GL.miniTempBuffer.subarray(0, i+1);
        }
  
        // For functions such as glDrawBuffers, glInvalidateFramebuffer and glInvalidateSubFramebuffer that need to pass a short array to the WebGL API,
        // create a set of short fixed-length arrays to avoid having to generate any garbage when calling those functions.
        for (var i = 0; i < 32; i++) {
          GL.tempFixedLengthArray.push(new Array(i));
        }
      },recordError:function recordError(errorCode) {
        if (!GL.lastError) {
          GL.lastError = errorCode;
        }
      },getNewId:function (table) {
        var ret = GL.counter++;
        for (var i = table.length; i < ret; i++) {
          table[i] = null;
        }
        return ret;
      },MINI_TEMP_BUFFER_SIZE:256,miniTempBuffer:null,miniTempBufferViews:[0],getSource:function (shader, count, string, length) {
        var source = '';
        for (var i = 0; i < count; ++i) {
          var frag;
          if (length) {
            var len = HEAP32[(((length)+(i*4))>>2)];
            if (len < 0) {
              frag = Pointer_stringify(HEAP32[(((string)+(i*4))>>2)]);
            } else {
              frag = Pointer_stringify(HEAP32[(((string)+(i*4))>>2)], len);
            }
          } else {
            frag = Pointer_stringify(HEAP32[(((string)+(i*4))>>2)]);
          }
          source += frag;
        }
        return source;
      },createContext:function (canvas, webGLContextAttributes) {
        if (typeof webGLContextAttributes['majorVersion'] === 'undefined' && typeof webGLContextAttributes['minorVersion'] === 'undefined') {
          webGLContextAttributes['majorVersion'] = 1;
          webGLContextAttributes['minorVersion'] = 0;
        }
        var ctx;
        var errorInfo = '?';
        function onContextCreationError(event) {
          errorInfo = event.statusMessage || errorInfo;
        }
        try {
          canvas.addEventListener('webglcontextcreationerror', onContextCreationError, false);
          try {
            if (webGLContextAttributes['majorVersion'] == 1 && webGLContextAttributes['minorVersion'] == 0) {
              ctx = canvas.getContext("webgl", webGLContextAttributes) || canvas.getContext("experimental-webgl", webGLContextAttributes);
            } else if (webGLContextAttributes['majorVersion'] == 2 && webGLContextAttributes['minorVersion'] == 0) {
              ctx = canvas.getContext("webgl2", webGLContextAttributes) || canvas.getContext("experimental-webgl2", webGLContextAttributes);
            } else {
              throw 'Unsupported WebGL context version ' + majorVersion + '.' + minorVersion + '!'
            }
          } finally {
            canvas.removeEventListener('webglcontextcreationerror', onContextCreationError, false);
          }
          if (!ctx) throw ':(';
        } catch (e) {
          Module.print('Could not create canvas: ' + [errorInfo, e, JSON.stringify(webGLContextAttributes)]);
          return 0;
        }
        // possible GL_DEBUG entry point: ctx = wrapDebugGL(ctx);
  
        if (!ctx) return 0;
        return GL.registerContext(ctx, webGLContextAttributes);
      },registerContext:function (ctx, webGLContextAttributes) {
        var handle = GL.getNewId(GL.contexts);
        var context = {
          handle: handle,
          attributes: webGLContextAttributes,
          version: webGLContextAttributes['majorVersion'],
          GLctx: ctx
        };
  
  
        // Store the created context object so that we can access the context given a canvas without having to pass the parameters again.
        if (ctx.canvas) ctx.canvas.GLctxObject = context;
        GL.contexts[handle] = context;
        if (typeof webGLContextAttributes['enableExtensionsByDefault'] === 'undefined' || webGLContextAttributes['enableExtensionsByDefault']) {
          GL.initExtensions(context);
        }
        return handle;
      },makeContextCurrent:function (contextHandle) {
        var context = GL.contexts[contextHandle];
        if (!context) return false;
        GLctx = Module.ctx = context.GLctx; // Active WebGL context object.
        GL.currentContext = context; // Active Emscripten GL layer context object.
        return true;
      },getContext:function (contextHandle) {
        return GL.contexts[contextHandle];
      },deleteContext:function (contextHandle) {
        if (GL.currentContext === GL.contexts[contextHandle]) GL.currentContext = null;
        if (typeof JSEvents === 'object') JSEvents.removeAllHandlersOnTarget(GL.contexts[contextHandle].GLctx.canvas); // Release all JS event handlers on the DOM element that the GL context is associated with since the context is now deleted.
        if (GL.contexts[contextHandle] && GL.contexts[contextHandle].GLctx.canvas) GL.contexts[contextHandle].GLctx.canvas.GLctxObject = undefined; // Make sure the canvas object no longer refers to the context object so there are no GC surprises.
        GL.contexts[contextHandle] = null;
      },initExtensions:function (context) {
        // If this function is called without a specific context object, init the extensions of the currently active context.
        if (!context) context = GL.currentContext;
  
        if (context.initExtensionsDone) return;
        context.initExtensionsDone = true;
  
        var GLctx = context.GLctx;
  
        context.maxVertexAttribs = GLctx.getParameter(GLctx.MAX_VERTEX_ATTRIBS);
  
        // Detect the presence of a few extensions manually, this GL interop layer itself will need to know if they exist. 
  
        if (context.version < 2) {
          // Extension available from Firefox 26 and Google Chrome 30
          var instancedArraysExt = GLctx.getExtension('ANGLE_instanced_arrays');
          if (instancedArraysExt) {
            GLctx['vertexAttribDivisor'] = function(index, divisor) { instancedArraysExt['vertexAttribDivisorANGLE'](index, divisor); };
            GLctx['drawArraysInstanced'] = function(mode, first, count, primcount) { instancedArraysExt['drawArraysInstancedANGLE'](mode, first, count, primcount); };
            GLctx['drawElementsInstanced'] = function(mode, count, type, indices, primcount) { instancedArraysExt['drawElementsInstancedANGLE'](mode, count, type, indices, primcount); };
          }
  
          // Extension available from Firefox 25 and WebKit
          var vaoExt = GLctx.getExtension('OES_vertex_array_object');
          if (vaoExt) {
            GLctx['createVertexArray'] = function() { return vaoExt['createVertexArrayOES'](); };
            GLctx['deleteVertexArray'] = function(vao) { vaoExt['deleteVertexArrayOES'](vao); };
            GLctx['bindVertexArray'] = function(vao) { vaoExt['bindVertexArrayOES'](vao); };
            GLctx['isVertexArray'] = function(vao) { return vaoExt['isVertexArrayOES'](vao); };
          }
  
          var drawBuffersExt = GLctx.getExtension('WEBGL_draw_buffers');
          if (drawBuffersExt) {
            GLctx['drawBuffers'] = function(n, bufs) { drawBuffersExt['drawBuffersWEBGL'](n, bufs); };
          }
        }
  
        GLctx.disjointTimerQueryExt = GLctx.getExtension("EXT_disjoint_timer_query");
  
        // These are the 'safe' feature-enabling extensions that don't add any performance impact related to e.g. debugging, and
        // should be enabled by default so that client GLES2/GL code will not need to go through extra hoops to get its stuff working.
        // As new extensions are ratified at http://www.khronos.org/registry/webgl/extensions/ , feel free to add your new extensions
        // here, as long as they don't produce a performance impact for users that might not be using those extensions.
        // E.g. debugging-related extensions should probably be off by default.
        var automaticallyEnabledExtensions = [ "OES_texture_float", "OES_texture_half_float", "OES_standard_derivatives",
                                               "OES_vertex_array_object", "WEBGL_compressed_texture_s3tc", "WEBGL_depth_texture",
                                               "OES_element_index_uint", "EXT_texture_filter_anisotropic", "ANGLE_instanced_arrays",
                                               "OES_texture_float_linear", "OES_texture_half_float_linear", "WEBGL_compressed_texture_atc",
                                               "WEBGL_compressed_texture_pvrtc", "EXT_color_buffer_half_float", "WEBGL_color_buffer_float",
                                               "EXT_frag_depth", "EXT_sRGB", "WEBGL_draw_buffers", "WEBGL_shared_resources",
                                               "EXT_shader_texture_lod", "EXT_color_buffer_float"];
  
        function shouldEnableAutomatically(extension) {
          var ret = false;
          automaticallyEnabledExtensions.forEach(function(include) {
            if (ext.indexOf(include) != -1) {
              ret = true;
            }
          });
          return ret;
        }
  
        var exts = GLctx.getSupportedExtensions();
        if (exts && exts.length > 0) {
          GLctx.getSupportedExtensions().forEach(function(ext) {
            if (automaticallyEnabledExtensions.indexOf(ext) != -1) {
              GLctx.getExtension(ext); // Calling .getExtension enables that extension permanently, no need to store the return value to be enabled.
            }
          });
        }
      },populateUniformTable:function (program) {
        var p = GL.programs[program];
        GL.programInfos[program] = {
          uniforms: {},
          maxUniformLength: 0, // This is eagerly computed below, since we already enumerate all uniforms anyway.
          maxAttributeLength: -1, // This is lazily computed and cached, computed when/if first asked, "-1" meaning not computed yet.
          maxUniformBlockNameLength: -1 // Lazily computed as well
        };
  
        var ptable = GL.programInfos[program];
        var utable = ptable.uniforms;
        // A program's uniform table maps the string name of an uniform to an integer location of that uniform.
        // The global GL.uniforms map maps integer locations to WebGLUniformLocations.
        var numUniforms = GLctx.getProgramParameter(p, GLctx.ACTIVE_UNIFORMS);
        for (var i = 0; i < numUniforms; ++i) {
          var u = GLctx.getActiveUniform(p, i);
  
          var name = u.name;
          ptable.maxUniformLength = Math.max(ptable.maxUniformLength, name.length+1);
  
          // Strip off any trailing array specifier we might have got, e.g. "[0]".
          if (name.indexOf(']', name.length-1) !== -1) {
            var ls = name.lastIndexOf('[');
            name = name.slice(0, ls);
          }
  
          // Optimize memory usage slightly: If we have an array of uniforms, e.g. 'vec3 colors[3];', then 
          // only store the string 'colors' in utable, and 'colors[0]', 'colors[1]' and 'colors[2]' will be parsed as 'colors'+i.
          // Note that for the GL.uniforms table, we still need to fetch the all WebGLUniformLocations for all the indices.
          var loc = GLctx.getUniformLocation(p, name);
          if (loc != null)
          {
            var id = GL.getNewId(GL.uniforms);
            utable[name] = [u.size, id];
            GL.uniforms[id] = loc;
  
            for (var j = 1; j < u.size; ++j) {
              var n = name + '['+j+']';
              loc = GLctx.getUniformLocation(p, n);
              id = GL.getNewId(GL.uniforms);
  
              GL.uniforms[id] = loc;
            }
          }
        }
      }};function _emscripten_glIsRenderbuffer(renderbuffer) {
      var rb = GL.renderbuffers[renderbuffer];
      if (!rb) return 0;
      return GLctx.isRenderbuffer(rb);
    }

  function _emscripten_glStencilMaskSeparate(x0, x1) { GLctx['stencilMaskSeparate'](x0, x1) }

  
  
  function _emscripten_get_now() { abort() }
  
  
  
  function _emscripten_set_main_loop_timing(mode, value) {
      Browser.mainLoop.timingMode = mode;
      Browser.mainLoop.timingValue = value;
  
      if (!Browser.mainLoop.func) {
        console.error('emscripten_set_main_loop_timing: Cannot set timing mode for main loop since a main loop does not exist! Call emscripten_set_main_loop first to set one up.');
        return 1; // Return non-zero on failure, can't set timing mode when there is no main loop.
      }
  
      if (mode == 0 /*EM_TIMING_SETTIMEOUT*/) {
        Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_setTimeout() {
          var timeUntilNextTick = Math.max(0, Browser.mainLoop.tickStartTime + value - _emscripten_get_now())|0;
          setTimeout(Browser.mainLoop.runner, timeUntilNextTick); // doing this each time means that on exception, we stop
        };
        Browser.mainLoop.method = 'timeout';
      } else if (mode == 1 /*EM_TIMING_RAF*/) {
        Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_rAF() {
          Browser.requestAnimationFrame(Browser.mainLoop.runner);
        };
        Browser.mainLoop.method = 'rAF';
      } else if (mode == 2 /*EM_TIMING_SETIMMEDIATE*/) {
        if (!window['setImmediate']) {
          // Emulate setImmediate. (note: not a complete polyfill, we don't emulate clearImmediate() to keep code size to minimum, since not needed)
          var setImmediates = [];
          var emscriptenMainLoopMessageId = 'setimmediate';
          function Browser_setImmediate_messageHandler(event) {
            if (event.source === window && event.data === emscriptenMainLoopMessageId) {
              event.stopPropagation();
              setImmediates.shift()();
            }
          }
          window.addEventListener("message", Browser_setImmediate_messageHandler, true);
          window['setImmediate'] = function Browser_emulated_setImmediate(func) {
            setImmediates.push(func);
            if (ENVIRONMENT_IS_WORKER) {
              if (Module['setImmediates'] === undefined) Module['setImmediates'] = [];
              Module['setImmediates'].push(func);
              window.postMessage({target: emscriptenMainLoopMessageId}); // In --proxy-to-worker, route the message via proxyClient.js
            } else window.postMessage(emscriptenMainLoopMessageId, "*"); // On the main thread, can just send the message to itself.
          }
        }
        Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_setImmediate() {
          window['setImmediate'](Browser.mainLoop.runner);
        };
        Browser.mainLoop.method = 'immediate';
      }
      return 0;
    }function _emscripten_set_main_loop(func, fps, simulateInfiniteLoop, arg, noSetTiming) {
      Module['noExitRuntime'] = true;
  
      assert(!Browser.mainLoop.func, 'emscripten_set_main_loop: there can only be one main loop function at once: call emscripten_cancel_main_loop to cancel the previous one before setting a new one with different parameters.');
  
      Browser.mainLoop.func = func;
      Browser.mainLoop.arg = arg;
  
      var browserIterationFunc;
      if (typeof arg !== 'undefined') {
        browserIterationFunc = function() {
          Module['dynCall_vi'](func, arg);
        };
      } else {
        browserIterationFunc = function() {
          Module['dynCall_v'](func);
        };
      }
  
      var thisMainLoopId = Browser.mainLoop.currentlyRunningMainloop;
  
      Browser.mainLoop.runner = function Browser_mainLoop_runner() {
        if (ABORT) return;
        if (Browser.mainLoop.queue.length > 0) {
          var start = Date.now();
          var blocker = Browser.mainLoop.queue.shift();
          blocker.func(blocker.arg);
          if (Browser.mainLoop.remainingBlockers) {
            var remaining = Browser.mainLoop.remainingBlockers;
            var next = remaining%1 == 0 ? remaining-1 : Math.floor(remaining);
            if (blocker.counted) {
              Browser.mainLoop.remainingBlockers = next;
            } else {
              // not counted, but move the progress along a tiny bit
              next = next + 0.5; // do not steal all the next one's progress
              Browser.mainLoop.remainingBlockers = (8*remaining + next)/9;
            }
          }
          console.log('main loop blocker "' + blocker.name + '" took ' + (Date.now() - start) + ' ms'); //, left: ' + Browser.mainLoop.remainingBlockers);
          Browser.mainLoop.updateStatus();
          
          // catches pause/resume main loop from blocker execution
          if (thisMainLoopId < Browser.mainLoop.currentlyRunningMainloop) return;
          
          setTimeout(Browser.mainLoop.runner, 0);
          return;
        }
  
        // catch pauses from non-main loop sources
        if (thisMainLoopId < Browser.mainLoop.currentlyRunningMainloop) return;
  
        // Implement very basic swap interval control
        Browser.mainLoop.currentFrameNumber = Browser.mainLoop.currentFrameNumber + 1 | 0;
        if (Browser.mainLoop.timingMode == 1/*EM_TIMING_RAF*/ && Browser.mainLoop.timingValue > 1 && Browser.mainLoop.currentFrameNumber % Browser.mainLoop.timingValue != 0) {
          // Not the scheduled time to render this frame - skip.
          Browser.mainLoop.scheduler();
          return;
        } else if (Browser.mainLoop.timingMode == 0/*EM_TIMING_SETTIMEOUT*/) {
          Browser.mainLoop.tickStartTime = _emscripten_get_now();
        }
  
        // Signal GL rendering layer that processing of a new frame is about to start. This helps it optimize
        // VBO double-buffering and reduce GPU stalls.
  
  
        if (Browser.mainLoop.method === 'timeout' && Module.ctx) {
          Module.printErr('Looks like you are rendering without using requestAnimationFrame for the main loop. You should use 0 for the frame rate in emscripten_set_main_loop in order to use requestAnimationFrame, as that can greatly improve your frame rates!');
          Browser.mainLoop.method = ''; // just warn once per call to set main loop
        }
  
        Browser.mainLoop.runIter(browserIterationFunc);
  
        checkStackCookie();
  
        // catch pauses from the main loop itself
        if (thisMainLoopId < Browser.mainLoop.currentlyRunningMainloop) return;
  
        // Queue new audio data. This is important to be right after the main loop invocation, so that we will immediately be able
        // to queue the newest produced audio samples.
        // TODO: Consider adding pre- and post- rAF callbacks so that GL.newRenderingFrameStarted() and SDL.audio.queueNewAudioData()
        //       do not need to be hardcoded into this function, but can be more generic.
        if (typeof SDL === 'object' && SDL.audio && SDL.audio.queueNewAudioData) SDL.audio.queueNewAudioData();
  
        Browser.mainLoop.scheduler();
      }
  
      if (!noSetTiming) {
        if (fps && fps > 0) _emscripten_set_main_loop_timing(0/*EM_TIMING_SETTIMEOUT*/, 1000.0 / fps);
        else _emscripten_set_main_loop_timing(1/*EM_TIMING_RAF*/, 1); // Do rAF by rendering each frame (no decimating)
  
        Browser.mainLoop.scheduler();
      }
  
      if (simulateInfiniteLoop) {
        throw 'SimulateInfiniteLoop';
      }
    }var Browser={mainLoop:{scheduler:null,method:"",currentlyRunningMainloop:0,func:null,arg:0,timingMode:0,timingValue:0,currentFrameNumber:0,queue:[],pause:function () {
          Browser.mainLoop.scheduler = null;
          Browser.mainLoop.currentlyRunningMainloop++; // Incrementing this signals the previous main loop that it's now become old, and it must return.
        },resume:function () {
          Browser.mainLoop.currentlyRunningMainloop++;
          var timingMode = Browser.mainLoop.timingMode;
          var timingValue = Browser.mainLoop.timingValue;
          var func = Browser.mainLoop.func;
          Browser.mainLoop.func = null;
          _emscripten_set_main_loop(func, 0, false, Browser.mainLoop.arg, true /* do not set timing and call scheduler, we will do it on the next lines */);
          _emscripten_set_main_loop_timing(timingMode, timingValue);
          Browser.mainLoop.scheduler();
        },updateStatus:function () {
          if (Module['setStatus']) {
            var message = Module['statusMessage'] || 'Please wait...';
            var remaining = Browser.mainLoop.remainingBlockers;
            var expected = Browser.mainLoop.expectedBlockers;
            if (remaining) {
              if (remaining < expected) {
                Module['setStatus'](message + ' (' + (expected - remaining) + '/' + expected + ')');
              } else {
                Module['setStatus'](message);
              }
            } else {
              Module['setStatus']('');
            }
          }
        },runIter:function (func) {
          if (ABORT) return;
          if (Module['preMainLoop']) {
            var preRet = Module['preMainLoop']();
            if (preRet === false) {
              return; // |return false| skips a frame
            }
          }
          try {
            func();
          } catch (e) {
            if (e instanceof ExitStatus) {
              return;
            } else {
              if (e && typeof e === 'object' && e.stack) Module.printErr('exception thrown: ' + [e, e.stack]);
              throw e;
            }
          }
          if (Module['postMainLoop']) Module['postMainLoop']();
        }},isFullscreen:false,pointerLock:false,moduleContextCreatedCallbacks:[],workers:[],init:function () {
        if (!Module["preloadPlugins"]) Module["preloadPlugins"] = []; // needs to exist even in workers
  
        if (Browser.initted) return;
        Browser.initted = true;
  
        try {
          new Blob();
          Browser.hasBlobConstructor = true;
        } catch(e) {
          Browser.hasBlobConstructor = false;
          console.log("warning: no blob constructor, cannot create blobs with mimetypes");
        }
        Browser.BlobBuilder = typeof MozBlobBuilder != "undefined" ? MozBlobBuilder : (typeof WebKitBlobBuilder != "undefined" ? WebKitBlobBuilder : (!Browser.hasBlobConstructor ? console.log("warning: no BlobBuilder") : null));
        Browser.URLObject = typeof window != "undefined" ? (window.URL ? window.URL : window.webkitURL) : undefined;
        if (!Module.noImageDecoding && typeof Browser.URLObject === 'undefined') {
          console.log("warning: Browser does not support creating object URLs. Built-in browser image decoding will not be available.");
          Module.noImageDecoding = true;
        }
  
        // Support for plugins that can process preloaded files. You can add more of these to
        // your app by creating and appending to Module.preloadPlugins.
        //
        // Each plugin is asked if it can handle a file based on the file's name. If it can,
        // it is given the file's raw data. When it is done, it calls a callback with the file's
        // (possibly modified) data. For example, a plugin might decompress a file, or it
        // might create some side data structure for use later (like an Image element, etc.).
  
        var imagePlugin = {};
        imagePlugin['canHandle'] = function imagePlugin_canHandle(name) {
          return !Module.noImageDecoding && /\.(jpg|jpeg|png|bmp)$/i.test(name);
        };
        imagePlugin['handle'] = function imagePlugin_handle(byteArray, name, onload, onerror) {
          var b = null;
          if (Browser.hasBlobConstructor) {
            try {
              b = new Blob([byteArray], { type: Browser.getMimetype(name) });
              if (b.size !== byteArray.length) { // Safari bug #118630
                // Safari's Blob can only take an ArrayBuffer
                b = new Blob([(new Uint8Array(byteArray)).buffer], { type: Browser.getMimetype(name) });
              }
            } catch(e) {
              Runtime.warnOnce('Blob constructor present but fails: ' + e + '; falling back to blob builder');
            }
          }
          if (!b) {
            var bb = new Browser.BlobBuilder();
            bb.append((new Uint8Array(byteArray)).buffer); // we need to pass a buffer, and must copy the array to get the right data range
            b = bb.getBlob();
          }
          var url = Browser.URLObject.createObjectURL(b);
          assert(typeof url == 'string', 'createObjectURL must return a url as a string');
          var img = new Image();
          img.onload = function img_onload() {
            assert(img.complete, 'Image ' + name + ' could not be decoded');
            var canvas = document.createElement('canvas');
            canvas.width = img.width;
            canvas.height = img.height;
            var ctx = canvas.getContext('2d');
            ctx.drawImage(img, 0, 0);
            Module["preloadedImages"][name] = canvas;
            Browser.URLObject.revokeObjectURL(url);
            if (onload) onload(byteArray);
          };
          img.onerror = function img_onerror(event) {
            console.log('Image ' + url + ' could not be decoded');
            if (onerror) onerror();
          };
          img.src = url;
        };
        Module['preloadPlugins'].push(imagePlugin);
  
        var audioPlugin = {};
        audioPlugin['canHandle'] = function audioPlugin_canHandle(name) {
          return !Module.noAudioDecoding && name.substr(-4) in { '.ogg': 1, '.wav': 1, '.mp3': 1 };
        };
        audioPlugin['handle'] = function audioPlugin_handle(byteArray, name, onload, onerror) {
          var done = false;
          function finish(audio) {
            if (done) return;
            done = true;
            Module["preloadedAudios"][name] = audio;
            if (onload) onload(byteArray);
          }
          function fail() {
            if (done) return;
            done = true;
            Module["preloadedAudios"][name] = new Audio(); // empty shim
            if (onerror) onerror();
          }
          if (Browser.hasBlobConstructor) {
            try {
              var b = new Blob([byteArray], { type: Browser.getMimetype(name) });
            } catch(e) {
              return fail();
            }
            var url = Browser.URLObject.createObjectURL(b); // XXX we never revoke this!
            assert(typeof url == 'string', 'createObjectURL must return a url as a string');
            var audio = new Audio();
            audio.addEventListener('canplaythrough', function() { finish(audio) }, false); // use addEventListener due to chromium bug 124926
            audio.onerror = function audio_onerror(event) {
              if (done) return;
              console.log('warning: browser could not fully decode audio ' + name + ', trying slower base64 approach');
              function encode64(data) {
                var BASE = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/';
                var PAD = '=';
                var ret = '';
                var leftchar = 0;
                var leftbits = 0;
                for (var i = 0; i < data.length; i++) {
                  leftchar = (leftchar << 8) | data[i];
                  leftbits += 8;
                  while (leftbits >= 6) {
                    var curr = (leftchar >> (leftbits-6)) & 0x3f;
                    leftbits -= 6;
                    ret += BASE[curr];
                  }
                }
                if (leftbits == 2) {
                  ret += BASE[(leftchar&3) << 4];
                  ret += PAD + PAD;
                } else if (leftbits == 4) {
                  ret += BASE[(leftchar&0xf) << 2];
                  ret += PAD;
                }
                return ret;
              }
              audio.src = 'data:audio/x-' + name.substr(-3) + ';base64,' + encode64(byteArray);
              finish(audio); // we don't wait for confirmation this worked - but it's worth trying
            };
            audio.src = url;
            // workaround for chrome bug 124926 - we do not always get oncanplaythrough or onerror
            Browser.safeSetTimeout(function() {
              finish(audio); // try to use it even though it is not necessarily ready to play
            }, 10000);
          } else {
            return fail();
          }
        };
        Module['preloadPlugins'].push(audioPlugin);
  
        // Canvas event setup
  
        function pointerLockChange() {
          Browser.pointerLock = document['pointerLockElement'] === Module['canvas'] ||
                                document['mozPointerLockElement'] === Module['canvas'] ||
                                document['webkitPointerLockElement'] === Module['canvas'] ||
                                document['msPointerLockElement'] === Module['canvas'];
        }
        var canvas = Module['canvas'];
        if (canvas) {
          // forced aspect ratio can be enabled by defining 'forcedAspectRatio' on Module
          // Module['forcedAspectRatio'] = 4 / 3;
          
          canvas.requestPointerLock = canvas['requestPointerLock'] ||
                                      canvas['mozRequestPointerLock'] ||
                                      canvas['webkitRequestPointerLock'] ||
                                      canvas['msRequestPointerLock'] ||
                                      function(){};
          canvas.exitPointerLock = document['exitPointerLock'] ||
                                   document['mozExitPointerLock'] ||
                                   document['webkitExitPointerLock'] ||
                                   document['msExitPointerLock'] ||
                                   function(){}; // no-op if function does not exist
          canvas.exitPointerLock = canvas.exitPointerLock.bind(document);
  
          document.addEventListener('pointerlockchange', pointerLockChange, false);
          document.addEventListener('mozpointerlockchange', pointerLockChange, false);
          document.addEventListener('webkitpointerlockchange', pointerLockChange, false);
          document.addEventListener('mspointerlockchange', pointerLockChange, false);
  
          if (Module['elementPointerLock']) {
            canvas.addEventListener("click", function(ev) {
              if (!Browser.pointerLock && Module['canvas'].requestPointerLock) {
                Module['canvas'].requestPointerLock();
                ev.preventDefault();
              }
            }, false);
          }
        }
      },createContext:function (canvas, useWebGL, setInModule, webGLContextAttributes) {
        if (useWebGL && Module.ctx && canvas == Module.canvas) return Module.ctx; // no need to recreate GL context if it's already been created for this canvas.
  
        var ctx;
        var contextHandle;
        if (useWebGL) {
          // For GLES2/desktop GL compatibility, adjust a few defaults to be different to WebGL defaults, so that they align better with the desktop defaults.
          var contextAttributes = {
            antialias: false,
            alpha: false
          };
  
          if (webGLContextAttributes) {
            for (var attribute in webGLContextAttributes) {
              contextAttributes[attribute] = webGLContextAttributes[attribute];
            }
          }
  
          contextHandle = GL.createContext(canvas, contextAttributes);
          if (contextHandle) {
            ctx = GL.getContext(contextHandle).GLctx;
          }
        } else {
          ctx = canvas.getContext('2d');
        }
  
        if (!ctx) return null;
  
        if (setInModule) {
          if (!useWebGL) assert(typeof GLctx === 'undefined', 'cannot set in module if GLctx is used, but we are a non-GL context that would replace it');
  
          Module.ctx = ctx;
          if (useWebGL) GL.makeContextCurrent(contextHandle);
          Module.useWebGL = useWebGL;
          Browser.moduleContextCreatedCallbacks.forEach(function(callback) { callback() });
          Browser.init();
        }
        return ctx;
      },destroyContext:function (canvas, useWebGL, setInModule) {},fullscreenHandlersInstalled:false,lockPointer:undefined,resizeCanvas:undefined,requestFullscreen:function (lockPointer, resizeCanvas, vrDevice) {
        Browser.lockPointer = lockPointer;
        Browser.resizeCanvas = resizeCanvas;
        Browser.vrDevice = vrDevice;
        if (typeof Browser.lockPointer === 'undefined') Browser.lockPointer = true;
        if (typeof Browser.resizeCanvas === 'undefined') Browser.resizeCanvas = false;
        if (typeof Browser.vrDevice === 'undefined') Browser.vrDevice = null;
  
        var canvas = Module['canvas'];
        function fullscreenChange() {
          Browser.isFullscreen = false;
          var canvasContainer = canvas.parentNode;
          if ((document['fullscreenElement'] || document['mozFullScreenElement'] ||
               document['msFullscreenElement'] || document['webkitFullscreenElement'] ||
               document['webkitCurrentFullScreenElement']) === canvasContainer) {
            canvas.exitFullscreen = document['exitFullscreen'] ||
                                    document['cancelFullScreen'] ||
                                    document['mozCancelFullScreen'] ||
                                    document['msExitFullscreen'] ||
                                    document['webkitCancelFullScreen'] ||
                                    function() {};
            canvas.exitFullscreen = canvas.exitFullscreen.bind(document);
            if (Browser.lockPointer) canvas.requestPointerLock();
            Browser.isFullscreen = true;
            if (Browser.resizeCanvas) Browser.setFullscreenCanvasSize();
          } else {
            
            // remove the full screen specific parent of the canvas again to restore the HTML structure from before going full screen
            canvasContainer.parentNode.insertBefore(canvas, canvasContainer);
            canvasContainer.parentNode.removeChild(canvasContainer);
            
            if (Browser.resizeCanvas) Browser.setWindowedCanvasSize();
          }
          if (Module['onFullScreen']) Module['onFullScreen'](Browser.isFullscreen);
          if (Module['onFullscreen']) Module['onFullscreen'](Browser.isFullscreen);
          Browser.updateCanvasDimensions(canvas);
        }
  
        if (!Browser.fullscreenHandlersInstalled) {
          Browser.fullscreenHandlersInstalled = true;
          document.addEventListener('fullscreenchange', fullscreenChange, false);
          document.addEventListener('mozfullscreenchange', fullscreenChange, false);
          document.addEventListener('webkitfullscreenchange', fullscreenChange, false);
          document.addEventListener('MSFullscreenChange', fullscreenChange, false);
        }
  
        // create a new parent to ensure the canvas has no siblings. this allows browsers to optimize full screen performance when its parent is the full screen root
        var canvasContainer = document.createElement("div");
        canvas.parentNode.insertBefore(canvasContainer, canvas);
        canvasContainer.appendChild(canvas);
  
        // use parent of canvas as full screen root to allow aspect ratio correction (Firefox stretches the root to screen size)
        canvasContainer.requestFullscreen = canvasContainer['requestFullscreen'] ||
                                            canvasContainer['mozRequestFullScreen'] ||
                                            canvasContainer['msRequestFullscreen'] ||
                                           (canvasContainer['webkitRequestFullscreen'] ? function() { canvasContainer['webkitRequestFullscreen'](Element['ALLOW_KEYBOARD_INPUT']) } : null) ||
                                           (canvasContainer['webkitRequestFullScreen'] ? function() { canvasContainer['webkitRequestFullScreen'](Element['ALLOW_KEYBOARD_INPUT']) } : null);
  
        if (vrDevice) {
          canvasContainer.requestFullscreen({ vrDisplay: vrDevice });
        } else {
          canvasContainer.requestFullscreen();
        }
      },requestFullScreen:function (lockPointer, resizeCanvas, vrDevice) {
          Module.printErr('Browser.requestFullScreen() is deprecated. Please call Browser.requestFullscreen instead.');
          Browser.requestFullScreen = function(lockPointer, resizeCanvas, vrDevice) {
            return Browser.requestFullscreen(lockPointer, resizeCanvas, vrDevice);
          }
          return Browser.requestFullscreen(lockPointer, resizeCanvas, vrDevice);
      },nextRAF:0,fakeRequestAnimationFrame:function (func) {
        // try to keep 60fps between calls to here
        var now = Date.now();
        if (Browser.nextRAF === 0) {
          Browser.nextRAF = now + 1000/60;
        } else {
          while (now + 2 >= Browser.nextRAF) { // fudge a little, to avoid timer jitter causing us to do lots of delay:0
            Browser.nextRAF += 1000/60;
          }
        }
        var delay = Math.max(Browser.nextRAF - now, 0);
        setTimeout(func, delay);
      },requestAnimationFrame:function requestAnimationFrame(func) {
        if (typeof window === 'undefined') { // Provide fallback to setTimeout if window is undefined (e.g. in Node.js)
          Browser.fakeRequestAnimationFrame(func);
        } else {
          if (!window.requestAnimationFrame) {
            window.requestAnimationFrame = window['requestAnimationFrame'] ||
                                           window['mozRequestAnimationFrame'] ||
                                           window['webkitRequestAnimationFrame'] ||
                                           window['msRequestAnimationFrame'] ||
                                           window['oRequestAnimationFrame'] ||
                                           Browser.fakeRequestAnimationFrame;
          }
          window.requestAnimationFrame(func);
        }
      },safeCallback:function (func) {
        return function() {
          if (!ABORT) return func.apply(null, arguments);
        };
      },allowAsyncCallbacks:true,queuedAsyncCallbacks:[],pauseAsyncCallbacks:function () {
        Browser.allowAsyncCallbacks = false;
      },resumeAsyncCallbacks:function () { // marks future callbacks as ok to execute, and synchronously runs any remaining ones right now
        Browser.allowAsyncCallbacks = true;
        if (Browser.queuedAsyncCallbacks.length > 0) {
          var callbacks = Browser.queuedAsyncCallbacks;
          Browser.queuedAsyncCallbacks = [];
          callbacks.forEach(function(func) {
            func();
          });
        }
      },safeRequestAnimationFrame:function (func) {
        return Browser.requestAnimationFrame(function() {
          if (ABORT) return;
          if (Browser.allowAsyncCallbacks) {
            func();
          } else {
            Browser.queuedAsyncCallbacks.push(func);
          }
        });
      },safeSetTimeout:function (func, timeout) {
        Module['noExitRuntime'] = true;
        return setTimeout(function() {
          if (ABORT) return;
          if (Browser.allowAsyncCallbacks) {
            func();
          } else {
            Browser.queuedAsyncCallbacks.push(func);
          }
        }, timeout);
      },safeSetInterval:function (func, timeout) {
        Module['noExitRuntime'] = true;
        return setInterval(function() {
          if (ABORT) return;
          if (Browser.allowAsyncCallbacks) {
            func();
          } // drop it on the floor otherwise, next interval will kick in
        }, timeout);
      },getMimetype:function (name) {
        return {
          'jpg': 'image/jpeg',
          'jpeg': 'image/jpeg',
          'png': 'image/png',
          'bmp': 'image/bmp',
          'ogg': 'audio/ogg',
          'wav': 'audio/wav',
          'mp3': 'audio/mpeg'
        }[name.substr(name.lastIndexOf('.')+1)];
      },getUserMedia:function (func) {
        if(!window.getUserMedia) {
          window.getUserMedia = navigator['getUserMedia'] ||
                                navigator['mozGetUserMedia'];
        }
        window.getUserMedia(func);
      },getMovementX:function (event) {
        return event['movementX'] ||
               event['mozMovementX'] ||
               event['webkitMovementX'] ||
               0;
      },getMovementY:function (event) {
        return event['movementY'] ||
               event['mozMovementY'] ||
               event['webkitMovementY'] ||
               0;
      },getMouseWheelDelta:function (event) {
        var delta = 0;
        switch (event.type) {
          case 'DOMMouseScroll': 
            delta = event.detail;
            break;
          case 'mousewheel': 
            delta = event.wheelDelta;
            break;
          case 'wheel': 
            delta = event['deltaY'];
            break;
          default:
            throw 'unrecognized mouse wheel event: ' + event.type;
        }
        return delta;
      },mouseX:0,mouseY:0,mouseMovementX:0,mouseMovementY:0,touches:{},lastTouches:{},calculateMouseEvent:function (event) { // event should be mousemove, mousedown or mouseup
        if (Browser.pointerLock) {
          // When the pointer is locked, calculate the coordinates
          // based on the movement of the mouse.
          // Workaround for Firefox bug 764498
          if (event.type != 'mousemove' &&
              ('mozMovementX' in event)) {
            Browser.mouseMovementX = Browser.mouseMovementY = 0;
          } else {
            Browser.mouseMovementX = Browser.getMovementX(event);
            Browser.mouseMovementY = Browser.getMovementY(event);
          }
          
          // check if SDL is available
          if (typeof SDL != "undefined") {
          	Browser.mouseX = SDL.mouseX + Browser.mouseMovementX;
          	Browser.mouseY = SDL.mouseY + Browser.mouseMovementY;
          } else {
          	// just add the mouse delta to the current absolut mouse position
          	// FIXME: ideally this should be clamped against the canvas size and zero
          	Browser.mouseX += Browser.mouseMovementX;
          	Browser.mouseY += Browser.mouseMovementY;
          }        
        } else {
          // Otherwise, calculate the movement based on the changes
          // in the coordinates.
          var rect = Module["canvas"].getBoundingClientRect();
          var cw = Module["canvas"].width;
          var ch = Module["canvas"].height;
  
          // Neither .scrollX or .pageXOffset are defined in a spec, but
          // we prefer .scrollX because it is currently in a spec draft.
          // (see: http://www.w3.org/TR/2013/WD-cssom-view-20131217/)
          var scrollX = ((typeof window.scrollX !== 'undefined') ? window.scrollX : window.pageXOffset);
          var scrollY = ((typeof window.scrollY !== 'undefined') ? window.scrollY : window.pageYOffset);
          // If this assert lands, it's likely because the browser doesn't support scrollX or pageXOffset
          // and we have no viable fallback.
          assert((typeof scrollX !== 'undefined') && (typeof scrollY !== 'undefined'), 'Unable to retrieve scroll position, mouse positions likely broken.');
  
          if (event.type === 'touchstart' || event.type === 'touchend' || event.type === 'touchmove') {
            var touch = event.touch;
            if (touch === undefined) {
              return; // the "touch" property is only defined in SDL
  
            }
            var adjustedX = touch.pageX - (scrollX + rect.left);
            var adjustedY = touch.pageY - (scrollY + rect.top);
  
            adjustedX = adjustedX * (cw / rect.width);
            adjustedY = adjustedY * (ch / rect.height);
  
            var coords = { x: adjustedX, y: adjustedY };
            
            if (event.type === 'touchstart') {
              Browser.lastTouches[touch.identifier] = coords;
              Browser.touches[touch.identifier] = coords;
            } else if (event.type === 'touchend' || event.type === 'touchmove') {
              var last = Browser.touches[touch.identifier];
              if (!last) last = coords;
              Browser.lastTouches[touch.identifier] = last;
              Browser.touches[touch.identifier] = coords;
            } 
            return;
          }
  
          var x = event.pageX - (scrollX + rect.left);
          var y = event.pageY - (scrollY + rect.top);
  
          // the canvas might be CSS-scaled compared to its backbuffer;
          // SDL-using content will want mouse coordinates in terms
          // of backbuffer units.
          x = x * (cw / rect.width);
          y = y * (ch / rect.height);
  
          Browser.mouseMovementX = x - Browser.mouseX;
          Browser.mouseMovementY = y - Browser.mouseY;
          Browser.mouseX = x;
          Browser.mouseY = y;
        }
      },asyncLoad:function (url, onload, onerror, noRunDep) {
        var dep = !noRunDep ? getUniqueRunDependency('al ' + url) : '';
        Module['readAsync'](url, function(arrayBuffer) {
          assert(arrayBuffer, 'Loading data file "' + url + '" failed (no arrayBuffer).');
          onload(new Uint8Array(arrayBuffer));
          if (dep) removeRunDependency(dep);
        }, function(event) {
          if (onerror) {
            onerror();
          } else {
            throw 'Loading data file "' + url + '" failed.';
          }
        });
        if (dep) addRunDependency(dep);
      },resizeListeners:[],updateResizeListeners:function () {
        var canvas = Module['canvas'];
        Browser.resizeListeners.forEach(function(listener) {
          listener(canvas.width, canvas.height);
        });
      },setCanvasSize:function (width, height, noUpdates) {
        var canvas = Module['canvas'];
        Browser.updateCanvasDimensions(canvas, width, height);
        if (!noUpdates) Browser.updateResizeListeners();
      },windowedWidth:0,windowedHeight:0,setFullscreenCanvasSize:function () {
        // check if SDL is available   
        if (typeof SDL != "undefined") {
        	var flags = HEAPU32[((SDL.screen+Runtime.QUANTUM_SIZE*0)>>2)];
        	flags = flags | 0x00800000; // set SDL_FULLSCREEN flag
        	HEAP32[((SDL.screen+Runtime.QUANTUM_SIZE*0)>>2)]=flags
        }
        Browser.updateResizeListeners();
      },setWindowedCanvasSize:function () {
        // check if SDL is available       
        if (typeof SDL != "undefined") {
        	var flags = HEAPU32[((SDL.screen+Runtime.QUANTUM_SIZE*0)>>2)];
        	flags = flags & ~0x00800000; // clear SDL_FULLSCREEN flag
        	HEAP32[((SDL.screen+Runtime.QUANTUM_SIZE*0)>>2)]=flags
        }
        Browser.updateResizeListeners();
      },updateCanvasDimensions:function (canvas, wNative, hNative) {
        if (wNative && hNative) {
          canvas.widthNative = wNative;
          canvas.heightNative = hNative;
        } else {
          wNative = canvas.widthNative;
          hNative = canvas.heightNative;
        }
        var w = wNative;
        var h = hNative;
        if (Module['forcedAspectRatio'] && Module['forcedAspectRatio'] > 0) {
          if (w/h < Module['forcedAspectRatio']) {
            w = Math.round(h * Module['forcedAspectRatio']);
          } else {
            h = Math.round(w / Module['forcedAspectRatio']);
          }
        }
        if (((document['fullscreenElement'] || document['mozFullScreenElement'] ||
             document['msFullscreenElement'] || document['webkitFullscreenElement'] ||
             document['webkitCurrentFullScreenElement']) === canvas.parentNode) && (typeof screen != 'undefined')) {
           var factor = Math.min(screen.width / w, screen.height / h);
           w = Math.round(w * factor);
           h = Math.round(h * factor);
        }
        if (Browser.resizeCanvas) {
          if (canvas.width  != w) canvas.width  = w;
          if (canvas.height != h) canvas.height = h;
          if (typeof canvas.style != 'undefined') {
            canvas.style.removeProperty( "width");
            canvas.style.removeProperty("height");
          }
        } else {
          if (canvas.width  != wNative) canvas.width  = wNative;
          if (canvas.height != hNative) canvas.height = hNative;
          if (typeof canvas.style != 'undefined') {
            if (w != wNative || h != hNative) {
              canvas.style.setProperty( "width", w + "px", "important");
              canvas.style.setProperty("height", h + "px", "important");
            } else {
              canvas.style.removeProperty( "width");
              canvas.style.removeProperty("height");
            }
          }
        }
      },wgetRequests:{},nextWgetRequestHandle:0,getNextWgetRequestHandle:function () {
        var handle = Browser.nextWgetRequestHandle;
        Browser.nextWgetRequestHandle++;
        return handle;
      }};var GLFW={Window:function (id, width, height, title, monitor, share) {
        this.id = id;
        this.x = 0;
        this.y = 0;
        this.fullscreen = false; // Used to determine if app in fullscreen mode
        this.storedX = 0; // Used to store X before fullscreen
        this.storedY = 0; // Used to store Y before fullscreen
        this.width = width;
        this.height = height;
        this.storedWidth = width; // Used to store width before fullscreen
        this.storedHeight = height; // Used to store height before fullscreen
        this.title = title;
        this.monitor = monitor;
        this.share = share;
        this.attributes = GLFW.hints;
        this.inputModes = {
          0x00033001:0x00034001, // GLFW_CURSOR (GLFW_CURSOR_NORMAL)
          0x00033002:0, // GLFW_STICKY_KEYS
          0x00033003:0, // GLFW_STICKY_MOUSE_BUTTONS
        };
        this.buttons = 0;
        this.keys = new Array();
        this.shouldClose = 0;
        this.title = null;
        this.windowPosFunc = null; // GLFWwindowposfun
        this.windowSizeFunc = null; // GLFWwindowsizefun
        this.windowCloseFunc = null; // GLFWwindowclosefun
        this.windowRefreshFunc = null; // GLFWwindowrefreshfun
        this.windowFocusFunc = null; // GLFWwindowfocusfun
        this.windowIconifyFunc = null; // GLFWwindowiconifyfun
        this.framebufferSizeFunc = null; // GLFWframebuffersizefun
        this.mouseButtonFunc = null; // GLFWmousebuttonfun
        this.cursorPosFunc = null; // GLFWcursorposfun
        this.cursorEnterFunc = null; // GLFWcursorenterfun
        this.scrollFunc = null; // GLFWscrollfun
        this.keyFunc = null; // GLFWkeyfun
        this.charFunc = null; // GLFWcharfun
        this.userptr = null;
      },WindowFromId:function (id) {
        if (id <= 0 || !GLFW.windows) return null;
        return GLFW.windows[id - 1];
      },errorFunc:null,monitorFunc:null,active:null,windows:null,monitors:null,monitorString:null,versionString:null,initialTime:null,extensions:null,hints:null,defaultHints:{131073:0,131074:0,131075:1,131076:1,131077:1,135169:8,135170:8,135171:8,135172:8,135173:24,135174:8,135175:0,135176:0,135177:0,135178:0,135179:0,135180:0,135181:0,135182:0,135183:0,139265:196609,139266:1,139267:0,139268:0,139269:0,139270:0,139271:0,139272:0},DOMToGLFWKeyCode:function (keycode) {
        switch (keycode) {
          // these keycodes are only defined for GLFW3, assume they are the same for GLFW2
          case 0x20:return 32; // DOM_VK_SPACE -> GLFW_KEY_SPACE
          case 0xDE:return 39; // DOM_VK_QUOTE -> GLFW_KEY_APOSTROPHE
          case 0xBC:return 44; // DOM_VK_COMMA -> GLFW_KEY_COMMA
          case 0xAD:return 45; // DOM_VK_HYPHEN_MINUS -> GLFW_KEY_MINUS
          case 0xBD:return 45; // DOM_VK_MINUS -> GLFW_KEY_MINUS
          case 0xBE:return 46; // DOM_VK_PERIOD -> GLFW_KEY_PERIOD
          case 0xBF:return 47; // DOM_VK_SLASH -> GLFW_KEY_SLASH
          case 0x30:return 48; // DOM_VK_0 -> GLFW_KEY_0
          case 0x31:return 49; // DOM_VK_1 -> GLFW_KEY_1
          case 0x32:return 50; // DOM_VK_2 -> GLFW_KEY_2
          case 0x33:return 51; // DOM_VK_3 -> GLFW_KEY_3
          case 0x34:return 52; // DOM_VK_4 -> GLFW_KEY_4
          case 0x35:return 53; // DOM_VK_5 -> GLFW_KEY_5
          case 0x36:return 54; // DOM_VK_6 -> GLFW_KEY_6
          case 0x37:return 55; // DOM_VK_7 -> GLFW_KEY_7
          case 0x38:return 56; // DOM_VK_8 -> GLFW_KEY_8
          case 0x39:return 57; // DOM_VK_9 -> GLFW_KEY_9
          case 0x3B:return 59; // DOM_VK_SEMICOLON -> GLFW_KEY_SEMICOLON
          case 0x3D:return 61; // DOM_VK_EQUALS -> GLFW_KEY_EQUAL
          case 0xBB:return 61; // DOM_VK_EQUALS -> GLFW_KEY_EQUAL
          case 0x41:return 65; // DOM_VK_A -> GLFW_KEY_A
          case 0x42:return 66; // DOM_VK_B -> GLFW_KEY_B
          case 0x43:return 67; // DOM_VK_C -> GLFW_KEY_C
          case 0x44:return 68; // DOM_VK_D -> GLFW_KEY_D
          case 0x45:return 69; // DOM_VK_E -> GLFW_KEY_E
          case 0x46:return 70; // DOM_VK_F -> GLFW_KEY_F
          case 0x47:return 71; // DOM_VK_G -> GLFW_KEY_G
          case 0x48:return 72; // DOM_VK_H -> GLFW_KEY_H
          case 0x49:return 73; // DOM_VK_I -> GLFW_KEY_I
          case 0x4A:return 74; // DOM_VK_J -> GLFW_KEY_J
          case 0x4B:return 75; // DOM_VK_K -> GLFW_KEY_K
          case 0x4C:return 76; // DOM_VK_L -> GLFW_KEY_L
          case 0x4D:return 77; // DOM_VK_M -> GLFW_KEY_M
          case 0x4E:return 78; // DOM_VK_N -> GLFW_KEY_N
          case 0x4F:return 79; // DOM_VK_O -> GLFW_KEY_O
          case 0x50:return 80; // DOM_VK_P -> GLFW_KEY_P
          case 0x51:return 81; // DOM_VK_Q -> GLFW_KEY_Q
          case 0x52:return 82; // DOM_VK_R -> GLFW_KEY_R
          case 0x53:return 83; // DOM_VK_S -> GLFW_KEY_S
          case 0x54:return 84; // DOM_VK_T -> GLFW_KEY_T
          case 0x55:return 85; // DOM_VK_U -> GLFW_KEY_U
          case 0x56:return 86; // DOM_VK_V -> GLFW_KEY_V
          case 0x57:return 87; // DOM_VK_W -> GLFW_KEY_W
          case 0x58:return 88; // DOM_VK_X -> GLFW_KEY_X
          case 0x59:return 89; // DOM_VK_Y -> GLFW_KEY_Y
          case 0x5a:return 90; // DOM_VK_Z -> GLFW_KEY_Z
          case 0xDB:return 91; // DOM_VK_OPEN_BRACKET -> GLFW_KEY_LEFT_BRACKET
          case 0xDC:return 92; // DOM_VK_BACKSLASH -> GLFW_KEY_BACKSLASH
          case 0xDD:return 93; // DOM_VK_CLOSE_BRACKET -> GLFW_KEY_RIGHT_BRACKET
          case 0xC0:return 94; // DOM_VK_BACK_QUOTE -> GLFW_KEY_GRAVE_ACCENT
          
  
          case 0x1B:return 256; // DOM_VK_ESCAPE -> GLFW_KEY_ESCAPE
          case 0x0D:return 257; // DOM_VK_RETURN -> GLFW_KEY_ENTER
          case 0x09:return 258; // DOM_VK_TAB -> GLFW_KEY_TAB
          case 0x08:return 259; // DOM_VK_BACK -> GLFW_KEY_BACKSPACE
          case 0x2D:return 260; // DOM_VK_INSERT -> GLFW_KEY_INSERT
          case 0x2E:return 261; // DOM_VK_DELETE -> GLFW_KEY_DELETE
          case 0x27:return 262; // DOM_VK_RIGHT -> GLFW_KEY_RIGHT
          case 0x25:return 263; // DOM_VK_LEFT -> GLFW_KEY_LEFT
          case 0x28:return 264; // DOM_VK_DOWN -> GLFW_KEY_DOWN
          case 0x26:return 265; // DOM_VK_UP -> GLFW_KEY_UP
          case 0x21:return 266; // DOM_VK_PAGE_UP -> GLFW_KEY_PAGE_UP
          case 0x22:return 267; // DOM_VK_PAGE_DOWN -> GLFW_KEY_PAGE_DOWN
          case 0x24:return 268; // DOM_VK_HOME -> GLFW_KEY_HOME
          case 0x23:return 269; // DOM_VK_END -> GLFW_KEY_END
          case 0x14:return 280; // DOM_VK_CAPS_LOCK -> GLFW_KEY_CAPS_LOCK
          case 0x91:return 281; // DOM_VK_SCROLL_LOCK -> GLFW_KEY_SCROLL_LOCK
          case 0x90:return 282; // DOM_VK_NUM_LOCK -> GLFW_KEY_NUM_LOCK
          case 0x2C:return 283; // DOM_VK_SNAPSHOT -> GLFW_KEY_PRINT_SCREEN
          case 0x13:return 284; // DOM_VK_PAUSE -> GLFW_KEY_PAUSE
          case 0x70:return 290; // DOM_VK_F1 -> GLFW_KEY_F1
          case 0x71:return 291; // DOM_VK_F2 -> GLFW_KEY_F2
          case 0x72:return 292; // DOM_VK_F3 -> GLFW_KEY_F3
          case 0x73:return 293; // DOM_VK_F4 -> GLFW_KEY_F4
          case 0x74:return 294; // DOM_VK_F5 -> GLFW_KEY_F5
          case 0x75:return 295; // DOM_VK_F6 -> GLFW_KEY_F6
          case 0x76:return 296; // DOM_VK_F7 -> GLFW_KEY_F7
          case 0x77:return 297; // DOM_VK_F8 -> GLFW_KEY_F8
          case 0x78:return 298; // DOM_VK_F9 -> GLFW_KEY_F9
          case 0x79:return 299; // DOM_VK_F10 -> GLFW_KEY_F10
          case 0x7A:return 300; // DOM_VK_F11 -> GLFW_KEY_F11
          case 0x7B:return 301; // DOM_VK_F12 -> GLFW_KEY_F12
          case 0x7C:return 302; // DOM_VK_F13 -> GLFW_KEY_F13
          case 0x7D:return 303; // DOM_VK_F14 -> GLFW_KEY_F14
          case 0x7E:return 304; // DOM_VK_F15 -> GLFW_KEY_F15
          case 0x7F:return 305; // DOM_VK_F16 -> GLFW_KEY_F16
          case 0x80:return 306; // DOM_VK_F17 -> GLFW_KEY_F17
          case 0x81:return 307; // DOM_VK_F18 -> GLFW_KEY_F18
          case 0x82:return 308; // DOM_VK_F19 -> GLFW_KEY_F19
          case 0x83:return 309; // DOM_VK_F20 -> GLFW_KEY_F20
          case 0x84:return 310; // DOM_VK_F21 -> GLFW_KEY_F21
          case 0x85:return 311; // DOM_VK_F22 -> GLFW_KEY_F22
          case 0x86:return 312; // DOM_VK_F23 -> GLFW_KEY_F23
          case 0x87:return 313; // DOM_VK_F24 -> GLFW_KEY_F24
          case 0x88:return 314; // 0x88 (not used?) -> GLFW_KEY_F25
          case 0x60:return 320; // DOM_VK_NUMPAD0 -> GLFW_KEY_KP_0
          case 0x61:return 321; // DOM_VK_NUMPAD1 -> GLFW_KEY_KP_1
          case 0x62:return 322; // DOM_VK_NUMPAD2 -> GLFW_KEY_KP_2
          case 0x63:return 323; // DOM_VK_NUMPAD3 -> GLFW_KEY_KP_3
          case 0x64:return 324; // DOM_VK_NUMPAD4 -> GLFW_KEY_KP_4
          case 0x65:return 325; // DOM_VK_NUMPAD5 -> GLFW_KEY_KP_5
          case 0x66:return 326; // DOM_VK_NUMPAD6 -> GLFW_KEY_KP_6
          case 0x67:return 327; // DOM_VK_NUMPAD7 -> GLFW_KEY_KP_7
          case 0x68:return 328; // DOM_VK_NUMPAD8 -> GLFW_KEY_KP_8
          case 0x69:return 329; // DOM_VK_NUMPAD9 -> GLFW_KEY_KP_9
          case 0x6E:return 330; // DOM_VK_DECIMAL -> GLFW_KEY_KP_DECIMAL
          case 0x6F:return 331; // DOM_VK_DIVIDE -> GLFW_KEY_KP_DIVIDE
          case 0x6A:return 332; // DOM_VK_MULTIPLY -> GLFW_KEY_KP_MULTIPLY
          case 0x6D:return 333; // DOM_VK_SUBTRACT -> GLFW_KEY_KP_SUBTRACT
          case 0x6B:return 334; // DOM_VK_ADD -> GLFW_KEY_KP_ADD
          // case 0x0D:return 335; // DOM_VK_RETURN -> GLFW_KEY_KP_ENTER (DOM_KEY_LOCATION_RIGHT)
          // case 0x61:return 336; // DOM_VK_EQUALS -> GLFW_KEY_KP_EQUAL (DOM_KEY_LOCATION_RIGHT)
          case 0x10:return 340; // DOM_VK_SHIFT -> GLFW_KEY_LEFT_SHIFT
          case 0x11:return 341; // DOM_VK_CONTROL -> GLFW_KEY_LEFT_CONTROL
          case 0x12:return 342; // DOM_VK_ALT -> GLFW_KEY_LEFT_ALT
          case 0x5B:return 343; // DOM_VK_WIN -> GLFW_KEY_LEFT_SUPER
          // case 0x10:return 344; // DOM_VK_SHIFT -> GLFW_KEY_RIGHT_SHIFT (DOM_KEY_LOCATION_RIGHT)
          // case 0x11:return 345; // DOM_VK_CONTROL -> GLFW_KEY_RIGHT_CONTROL (DOM_KEY_LOCATION_RIGHT)
          // case 0x12:return 346; // DOM_VK_ALT -> GLFW_KEY_RIGHT_ALT (DOM_KEY_LOCATION_RIGHT)
          // case 0x5B:return 347; // DOM_VK_WIN -> GLFW_KEY_RIGHT_SUPER (DOM_KEY_LOCATION_RIGHT)
          case 0x5D:return 348; // DOM_VK_CONTEXT_MENU -> GLFW_KEY_MENU
          // XXX: GLFW_KEY_WORLD_1, GLFW_KEY_WORLD_2 what are these?
          default:return -1; // GLFW_KEY_UNKNOWN
        };
      },getModBits:function (win) {
        var mod = 0;
        if (win.keys[340]) mod |= 0x0001; // GLFW_MOD_SHIFT
        if (win.keys[341]) mod |= 0x0002; // GLFW_MOD_CONTROL
        if (win.keys[342]) mod |= 0x0004; // GLFW_MOD_ALT
        if (win.keys[343]) mod |= 0x0008; // GLFW_MOD_SUPER
        return mod;
      },onKeyPress:function (event) {
        if (!GLFW.active || !GLFW.active.charFunc) return;
  
        // correct unicode charCode is only available with onKeyPress event
        var charCode = event.charCode;
        if (charCode == 0 || (charCode >= 0x00 && charCode <= 0x1F)) return;
  
  
        Module['dynCall_vii'](GLFW.active.charFunc, GLFW.active.id, charCode);
      },onKeyChanged:function (event, status) {
        if (!GLFW.active) return;
  
        var key = GLFW.DOMToGLFWKeyCode(event.keyCode);
        if (key == -1) return;
  
        var repeat = status && GLFW.active.keys[key];
        GLFW.active.keys[key] = status;
        if (!GLFW.active.keyFunc) return;
  
  
        if (repeat) status = 2; // GLFW_REPEAT
        Module['dynCall_viiiii'](GLFW.active.keyFunc, GLFW.active.id, key, event.keyCode, status, GLFW.getModBits(GLFW.active));
      },onKeydown:function (event) {
        GLFW.onKeyChanged(event, 1); // GLFW_PRESS or GLFW_REPEAT
  
        // This logic comes directly from the sdl implementation. We cannot
        // call preventDefault on all keydown events otherwise onKeyPress will
        // not get called
        if (event.keyCode === 8 /* backspace */ || event.keyCode === 9 /* tab */) {
          event.preventDefault();
        }
      },onKeyup:function (event) {
        GLFW.onKeyChanged(event, 0); // GLFW_RELEASE
      },onMousemove:function (event) {
        if (!GLFW.active) return;
  
        Browser.calculateMouseEvent(event);
  
        if (event.target != Module["canvas"] || !GLFW.active.cursorPosFunc) return;
  
  
        Module['dynCall_vidd'](GLFW.active.cursorPosFunc, GLFW.active.id, Browser.mouseX, Browser.mouseY);
      },DOMToGLFWMouseButton:function (event) {
        // DOM and glfw have different button codes.
        // See http://www.w3schools.com/jsref/event_button.asp.
        var eventButton = event['button'];
        if (eventButton > 0) {
          if (eventButton == 1) {
            eventButton = 2;
          } else {
            eventButton = 1;
          }
        }
        return eventButton;
      },onMouseenter:function (event) {
        if (!GLFW.active) return;
  
        if (event.target != Module["canvas"] || !GLFW.active.cursorEnterFunc) return;
  
        Module['dynCall_vii'](GLFW.active.cursorEnterFunc, GLFW.active.id, 1);
      },onMouseleave:function (event) {
        if (!GLFW.active) return;
  
        if (event.target != Module["canvas"] || !GLFW.active.cursorEnterFunc) return;
  
        Module['dynCall_vii'](GLFW.active.cursorEnterFunc, GLFW.active.id, 0);
      },onMouseButtonChanged:function (event, status) {
        if (!GLFW.active) return;
  
        Browser.calculateMouseEvent(event);
  
        if (event.target != Module["canvas"]) return;
  
        eventButton = GLFW.DOMToGLFWMouseButton(event);
  
        if (status == 1) { // GLFW_PRESS
          GLFW.active.buttons |= (1 << eventButton);
          try {
            event.target.setCapture();
          } catch (e) {}
        } else {  // GLFW_RELEASE
          GLFW.active.buttons &= ~(1 << eventButton);
        }
  
        if (!GLFW.active.mouseButtonFunc) return;
  
  
        Module['dynCall_viiii'](GLFW.active.mouseButtonFunc, GLFW.active.id, eventButton, status, GLFW.getModBits(GLFW.active));
      },onMouseButtonDown:function (event) {
        if (!GLFW.active) return;
        GLFW.onMouseButtonChanged(event, 1); // GLFW_PRESS
      },onMouseButtonUp:function (event) {
        if (!GLFW.active) return;
        GLFW.onMouseButtonChanged(event, 0); // GLFW_RELEASE
      },onMouseWheel:function (event) {
        // Note the minus sign that flips browser wheel direction (positive direction scrolls page down) to native wheel direction (positive direction is mouse wheel up)
        var delta = -Browser.getMouseWheelDelta(event);
        delta = (delta == 0) ? 0 : (delta > 0 ? Math.max(delta, 1) : Math.min(delta, -1)); // Quantize to integer so that minimum scroll is at least +/- 1.
        GLFW.wheelPos += delta;
  
        if (!GLFW.active || !GLFW.active.scrollFunc || event.target != Module['canvas']) return;
  
  
        var sx = 0;
        var sy = 0;
        if (event.type == 'mousewheel') {
          sx = event.wheelDeltaX;
          sy = event.wheelDeltaY;
        } else {
          sx = event.deltaX;
          sy = event.deltaY;
        }
  
        Module['dynCall_vidd'](GLFW.active.scrollFunc, GLFW.active.id, sx, sy);
  
        event.preventDefault();
      },onCanvasResize:function (width, height) {
        if (!GLFW.active) return;
  
        var resizeNeeded = true;
  
        // If the client is requestiong fullscreen mode
        if (document["fullscreen"] || document["fullScreen"] || document["mozFullScreen"] || document["webkitIsFullScreen"]) {
          GLFW.active.storedX = GLFW.active.x;
          GLFW.active.storedY = GLFW.active.y;
          GLFW.active.storedWidth = GLFW.active.width;
          GLFW.active.storedHeight = GLFW.active.height;
          GLFW.active.x = GLFW.active.y = 0;
          GLFW.active.width = screen.width;
          GLFW.active.height = screen.height;
          GLFW.active.fullscreen = true;
  
        // If the client is reverting from fullscreen mode
        } else if (GLFW.active.fullscreen == true) {
          GLFW.active.x = GLFW.active.storedX;
          GLFW.active.y = GLFW.active.storedY;
          GLFW.active.width = GLFW.active.storedWidth;
          GLFW.active.height = GLFW.active.storedHeight;
          GLFW.active.fullscreen = false;
  
        // If the width/height values do not match current active window sizes
        } else if (GLFW.active.width != width || GLFW.active.height != height) {
            GLFW.active.width = width;
            GLFW.active.height = height;
        } else {
          resizeNeeded = false;
        }
  
        // If any of the above conditions were true, we need to resize the canvas
        if (resizeNeeded) {
          // resets the canvas size to counter the aspect preservation of Browser.updateCanvasDimensions
          Browser.setCanvasSize(GLFW.active.width, GLFW.active.height, true);
          // TODO: Client dimensions (clientWidth/clientHeight) vs pixel dimensions (width/height) of
          // the canvas should drive window and framebuffer size respectfully.
          GLFW.onWindowSizeChanged();
          GLFW.onFramebufferSizeChanged();
        }
      },onWindowSizeChanged:function () {
        if (!GLFW.active) return;
  
        if (!GLFW.active.windowSizeFunc) return;
  
  
        Module['dynCall_viii'](GLFW.active.windowSizeFunc, GLFW.active.id, GLFW.active.width, GLFW.active.height);
      },onFramebufferSizeChanged:function () {
        if (!GLFW.active) return;
  
        if (!GLFW.active.framebufferSizeFunc) return;
  
        Module['dynCall_viii'](GLFW.active.framebufferSizeFunc, GLFW.active.id, GLFW.active.width, GLFW.active.height);
      },requestFullscreen:function () {
        var RFS = Module["canvas"]['requestFullscreen'] ||
                  Module["canvas"]['mozRequestFullScreen'] ||
                  Module["canvas"]['webkitRequestFullScreen'] ||
                  (function() {});
        RFS.apply(Module["canvas"], []);
      },requestFullScreen:function () {
        Module.printErr('GLFW.requestFullScreen() is deprecated. Please call GLFW.requestFullscreen instead.');
        GLFW.requestFullScreen = function() {
          return GLFW.requestFullscreen();
        }
        return GLFW.requestFullscreen();
      },exitFullscreen:function () {
        var CFS = document['exitFullscreen'] ||
                  document['cancelFullScreen'] ||
                  document['mozCancelFullScreen'] ||
                  document['webkitCancelFullScreen'] ||
            (function() {});
        CFS.apply(document, []);
      },cancelFullScreen:function () {
        Module.printErr('GLFW.cancelFullScreen() is deprecated. Please call GLFW.exitFullscreen instead.');
        GLFW.cancelFullScreen = function() {
          return GLFW.exitFullscreen();
        }
        return GLFW.exitFullscreen();
      },getTime:function () {
        return _emscripten_get_now() / 1000;
      },setWindowTitle:function (winid, title) {
        var win = GLFW.WindowFromId(winid);
        if (!win) return;
  
        win.title = Pointer_stringify(title);
        if (GLFW.active.id == win.id) {
          document.title = win.title;
        }
      },setKeyCallback:function (winid, cbfun) {
        var win = GLFW.WindowFromId(winid);
        if (!win) return;
        win.keyFunc = cbfun;
      },setCharCallback:function (winid, cbfun) {
        var win = GLFW.WindowFromId(winid);
        if (!win) return;
        win.charFunc = cbfun;
      },setMouseButtonCallback:function (winid, cbfun) {
        var win = GLFW.WindowFromId(winid);
        if (!win) return;
        win.mouseButtonFunc = cbfun;
      },setCursorPosCallback:function (winid, cbfun) {
        var win = GLFW.WindowFromId(winid);
        if (!win) return;
        win.cursorPosFunc = cbfun;
      },setScrollCallback:function (winid, cbfun) {
        var win = GLFW.WindowFromId(winid);
        if (!win) return;
        win.scrollFunc = cbfun;
      },setWindowSizeCallback:function (winid, cbfun) {
        var win = GLFW.WindowFromId(winid);
        if (!win) return;
        win.windowSizeFunc = cbfun;
       
      },setWindowCloseCallback:function (winid, cbfun) {
        var win = GLFW.WindowFromId(winid);
        if (!win) return;
        win.windowCloseFunc = cbfun;
      },setWindowRefreshCallback:function (winid, cbfun) {
        var win = GLFW.WindowFromId(winid);
        if (!win) return;
        win.windowRefreshFunc = cbfun;
      },onClickRequestPointerLock:function (e) {
        if (!Browser.pointerLock && Module['canvas'].requestPointerLock) {
          Module['canvas'].requestPointerLock();
          e.preventDefault();
        }
      },setInputMode:function (winid, mode, value) {
        var win = GLFW.WindowFromId(winid);
        if (!win) return;
  
        switch(mode) {
          case 0x00033001: { // GLFW_CURSOR
            switch(value) {
              case 0x00034001: { // GLFW_CURSOR_NORMAL
                win.inputModes[mode] = value;
                Module['canvas'].removeEventListener('click', GLFW.onClickRequestPointerLock, true);
                Module['canvas'].exitPointerLock();
                break;
              }
              case 0x00034002: { // GLFW_CURSOR_HIDDEN
                console.log("glfwSetInputMode called with GLFW_CURSOR_HIDDEN value not implemented.");
                break;
              }
              case 0x00034003: { // GLFW_CURSOR_DISABLED
                win.inputModes[mode] = value;
                Module['canvas'].addEventListener('click', GLFW.onClickRequestPointerLock, true);
                Module['canvas'].requestPointerLock();
                break;
              }
              default: {
                console.log("glfwSetInputMode called with unknown value parameter value: " + value + ".");
                break;
              }
            }
            break;
          }
          case 0x00033002: { // GLFW_STICKY_KEYS
            console.log("glfwSetInputMode called with GLFW_STICKY_KEYS mode not implemented.");
            break;
          }
          case 0x00033003: { // GLFW_STICKY_MOUSE_BUTTONS
            console.log("glfwSetInputMode called with GLFW_STICKY_MOUSE_BUTTONS mode not implemented.");
            break;
          }
          default: {
            console.log("glfwSetInputMode called with unknown mode parameter value: " + mode + ".");
            break;
          }
        }
      },getKey:function (winid, key) {
        var win = GLFW.WindowFromId(winid);
        if (!win) return 0;
        return win.keys[key];
      },getMouseButton:function (winid, button) {
        var win = GLFW.WindowFromId(winid);
        if (!win) return 0;
        return (win.buttons & (1 << button)) > 0;
      },getCursorPos:function (winid, x, y) {
        setValue(x, Browser.mouseX, 'double');
        setValue(y, Browser.mouseY, 'double');
      },getMousePos:function (winid, x, y) {
        setValue(x, Browser.mouseX, 'i32');
        setValue(y, Browser.mouseY, 'i32');
      },setCursorPos:function (winid, x, y) {
      },getWindowPos:function (winid, x, y) {
        var wx = 0;
        var wy = 0;
  
        var win = GLFW.WindowFromId(winid);
        if (win) {
          wx = win.x;
          wy = win.y;
        }
  
        setValue(x, wx, 'i32');
        setValue(y, wy, 'i32');
      },setWindowPos:function (winid, x, y) {
        var win = GLFW.WindowFromId(winid);
        if (!win) return;
        win.x = x;
        win.y = y;
      },getWindowSize:function (winid, width, height) {
        var ww = 0;
        var wh = 0;
  
        var win = GLFW.WindowFromId(winid);
        if (win) {
          ww = win.width;
          wh = win.height;
        }
  
        setValue(width, ww, 'i32');
        setValue(height, wh, 'i32');
      },setWindowSize:function (winid, width, height) {
        var win = GLFW.WindowFromId(winid);
        if (!win) return;
  
        if (GLFW.active.id == win.id) {
          if (width == screen.width && height == screen.height) {
            GLFW.requestFullscreen();
          } else {
            GLFW.exitFullscreen();
            Browser.setCanvasSize(width, height);
            win.width = width;
            win.height = height;
          }
        }
  
        if (!win.windowSizeFunc) return;
  
  
        Module['dynCall_viii'](win.windowSizeFunc, win.id, width, height);
      },createWindow:function (width, height, title, monitor, share) {
        var i, id;
        for (i = 0; i < GLFW.windows.length && GLFW.windows[i] !== null; i++);
        if (i > 0) throw "glfwCreateWindow only supports one window at time currently";
  
        // id for window
        id = i + 1;
  
        // not valid
        if (width <= 0 || height <= 0) return 0;
  
        if (monitor) {
          GLFW.requestFullscreen();
        } else {
          Browser.setCanvasSize(width, height);
        }
  
        // Create context when there are no existing alive windows
        for (i = 0; i < GLFW.windows.length && GLFW.windows[i] == null; i++);
        if (i == GLFW.windows.length) {
          var contextAttributes = {
            antialias: (GLFW.hints[0x0002100D] > 1), // GLFW_SAMPLES
            depth: (GLFW.hints[0x00021005] > 0),     // GLFW_DEPTH_BITS
            stencil: (GLFW.hints[0x00021006] > 0),   // GLFW_STENCIL_BITS
            alpha: (GLFW.hints[0x00021004] > 0)      // GLFW_ALPHA_BITS 
          }
          Module.ctx = Browser.createContext(Module['canvas'], true, true, contextAttributes);
        }
  
        // If context creation failed, do not return a valid window
        if (!Module.ctx) return 0;
  
        // Get non alive id
        var win = new GLFW.Window(id, width, height, title, monitor, share);
  
        // Set window to array
        if (id - 1 == GLFW.windows.length) {
          GLFW.windows.push(win);
        } else {
          GLFW.windows[id - 1] = win;
        }
  
        GLFW.active = win;
        return win.id;
      },destroyWindow:function (winid) {
        var win = GLFW.WindowFromId(winid);
        if (!win) return;
  
        if (win.windowCloseFunc)
          Module['dynCall_vi'](win.windowCloseFunc, win.id);
  
        GLFW.windows[win.id - 1] = null;
        if (GLFW.active.id == win.id)
          GLFW.active = null;
  
        // Destroy context when no alive windows
        for (var i = 0; i < GLFW.windows.length; i++)
          if (GLFW.windows[i] !== null) return;
  
        Module.ctx = Browser.destroyContext(Module['canvas'], true, true);
      },swapBuffers:function (winid) {
      },GLFW2ParamToGLFW3Param:function (param) {
        table = {
          0x00030001:0, // GLFW_MOUSE_CURSOR
          0x00030002:0, // GLFW_STICKY_KEYS
          0x00030003:0, // GLFW_STICKY_MOUSE_BUTTONS
          0x00030004:0, // GLFW_SYSTEM_KEYS
          0x00030005:0, // GLFW_KEY_REPEAT
          0x00030006:0, // GLFW_AUTO_POLL_EVENTS
          0x00020001:0, // GLFW_OPENED
          0x00020002:0, // GLFW_ACTIVE
          0x00020003:0, // GLFW_ICONIFIED
          0x00020004:0, // GLFW_ACCELERATED
          0x00020005:0x00021001, // GLFW_RED_BITS
          0x00020006:0x00021002, // GLFW_GREEN_BITS
          0x00020007:0x00021003, // GLFW_BLUE_BITS
          0x00020008:0x00021004, // GLFW_ALPHA_BITS
          0x00020009:0x00021005, // GLFW_DEPTH_BITS
          0x0002000A:0x00021006, // GLFW_STENCIL_BITS
          0x0002000B:0x0002100F, // GLFW_REFRESH_RATE
          0x0002000C:0x00021007, // GLFW_ACCUM_RED_BITS
          0x0002000D:0x00021008, // GLFW_ACCUM_GREEN_BITS
          0x0002000E:0x00021009, // GLFW_ACCUM_BLUE_BITS
          0x0002000F:0x0002100A, // GLFW_ACCUM_ALPHA_BITS
          0x00020010:0x0002100B, // GLFW_AUX_BUFFERS
          0x00020011:0x0002100C, // GLFW_STEREO
          0x00020012:0, // GLFW_WINDOW_NO_RESIZE
          0x00020013:0x0002100D, // GLFW_FSAA_SAMPLES
          0x00020014:0x00022002, // GLFW_OPENGL_VERSION_MAJOR
          0x00020015:0x00022003, // GLFW_OPENGL_VERSION_MINOR
          0x00020016:0x00022006, // GLFW_OPENGL_FORWARD_COMPAT
          0x00020017:0x00022007, // GLFW_OPENGL_DEBUG_CONTEXT
          0x00020018:0x00022008, // GLFW_OPENGL_PROFILE
        };
        return table[param];
      }};function _glfwGetVideoModes(monitor, count) {
      setValue(count, 0, 'i32');
      return 0;
    }

  function _glLinkProgram(program) {
      GLctx.linkProgram(GL.programs[program]);
      GL.programInfos[program] = null; // uniforms no longer keep the same names after linking
      GL.populateUniformTable(program);
    }

  function _glBindTexture(target, texture) {
      GLctx.bindTexture(target, texture ? GL.textures[texture] : null);
    }

  function _emscripten_glStencilFunc(x0, x1, x2) { GLctx['stencilFunc'](x0, x1, x2) }

  function _glGetString(name_) {
      if (GL.stringCache[name_]) return GL.stringCache[name_];
      var ret; 
      switch(name_) {
        case 0x1F00 /* GL_VENDOR */:
        case 0x1F01 /* GL_RENDERER */:
        case 0x9245 /* UNMASKED_VENDOR_WEBGL */:
        case 0x9246 /* UNMASKED_RENDERER_WEBGL */:
          ret = allocate(intArrayFromString(GLctx.getParameter(name_)), 'i8', ALLOC_NORMAL);
          break;
        case 0x1F02 /* GL_VERSION */:
          var glVersion = GLctx.getParameter(GLctx.VERSION);
          // return GLES version string corresponding to the version of the WebGL context
          {
            glVersion = 'OpenGL ES 2.0 (' + glVersion + ')';
          }
          ret = allocate(intArrayFromString(glVersion), 'i8', ALLOC_NORMAL);
          break;
        case 0x1F03 /* GL_EXTENSIONS */:
          var exts = GLctx.getSupportedExtensions();
          var gl_exts = [];
          for (var i = 0; i < exts.length; ++i) {
            gl_exts.push(exts[i]);
            gl_exts.push("GL_" + exts[i]);
          }
          ret = allocate(intArrayFromString(gl_exts.join(' ')), 'i8', ALLOC_NORMAL);
          break;
        case 0x8B8C /* GL_SHADING_LANGUAGE_VERSION */:
          var glslVersion = GLctx.getParameter(GLctx.SHADING_LANGUAGE_VERSION);
          // extract the version number 'N.M' from the string 'WebGL GLSL ES N.M ...'
          var ver_re = /^WebGL GLSL ES ([0-9]\.[0-9][0-9]?)(?:$| .*)/;
          var ver_num = glslVersion.match(ver_re);
          if (ver_num !== null) {
            if (ver_num[1].length == 3) ver_num[1] = ver_num[1] + '0'; // ensure minor version has 2 digits
            glslVersion = 'OpenGL ES GLSL ES ' + ver_num[1] + ' (' + glslVersion + ')';
          }
          ret = allocate(intArrayFromString(glslVersion), 'i8', ALLOC_NORMAL);
          break;
        default:
          GL.recordError(0x0500/*GL_INVALID_ENUM*/);
          return 0;
      }
      GL.stringCache[name_] = ret;
      return ret;
    }

  function _emscripten_glUniform3iv(location, count, value) {
  
  
      GLctx.uniform3iv(GL.uniforms[location], HEAP32.subarray((value)>>2,(value+count*12)>>2));
    }

  function _emscripten_glShaderSource(shader, count, string, length) {
      var source = GL.getSource(shader, count, string, length);
  
  
      GLctx.shaderSource(GL.shaders[shader], source);
    }

  function _emscripten_glReleaseShaderCompiler() {
      // NOP (as allowed by GLES 2.0 spec)
    }

  function _glfwSetScrollCallback(winid, cbfun) {
      GLFW.setScrollCallback(winid, cbfun);
    }

  function _emscripten_glTexParameterf(x0, x1, x2) { GLctx['texParameterf'](x0, x1, x2) }

  function _emscripten_glTexParameteri(x0, x1, x2) { GLctx['texParameteri'](x0, x1, x2) }

  function _glCompileShader(shader) {
      GLctx.compileShader(GL.shaders[shader]);
    }

  
  
  
  var ERRNO_CODES={EPERM:1,ENOENT:2,ESRCH:3,EINTR:4,EIO:5,ENXIO:6,E2BIG:7,ENOEXEC:8,EBADF:9,ECHILD:10,EAGAIN:11,EWOULDBLOCK:11,ENOMEM:12,EACCES:13,EFAULT:14,ENOTBLK:15,EBUSY:16,EEXIST:17,EXDEV:18,ENODEV:19,ENOTDIR:20,EISDIR:21,EINVAL:22,ENFILE:23,EMFILE:24,ENOTTY:25,ETXTBSY:26,EFBIG:27,ENOSPC:28,ESPIPE:29,EROFS:30,EMLINK:31,EPIPE:32,EDOM:33,ERANGE:34,ENOMSG:42,EIDRM:43,ECHRNG:44,EL2NSYNC:45,EL3HLT:46,EL3RST:47,ELNRNG:48,EUNATCH:49,ENOCSI:50,EL2HLT:51,EDEADLK:35,ENOLCK:37,EBADE:52,EBADR:53,EXFULL:54,ENOANO:55,EBADRQC:56,EBADSLT:57,EDEADLOCK:35,EBFONT:59,ENOSTR:60,ENODATA:61,ETIME:62,ENOSR:63,ENONET:64,ENOPKG:65,EREMOTE:66,ENOLINK:67,EADV:68,ESRMNT:69,ECOMM:70,EPROTO:71,EMULTIHOP:72,EDOTDOT:73,EBADMSG:74,ENOTUNIQ:76,EBADFD:77,EREMCHG:78,ELIBACC:79,ELIBBAD:80,ELIBSCN:81,ELIBMAX:82,ELIBEXEC:83,ENOSYS:38,ENOTEMPTY:39,ENAMETOOLONG:36,ELOOP:40,EOPNOTSUPP:95,EPFNOSUPPORT:96,ECONNRESET:104,ENOBUFS:105,EAFNOSUPPORT:97,EPROTOTYPE:91,ENOTSOCK:88,ENOPROTOOPT:92,ESHUTDOWN:108,ECONNREFUSED:111,EADDRINUSE:98,ECONNABORTED:103,ENETUNREACH:101,ENETDOWN:100,ETIMEDOUT:110,EHOSTDOWN:112,EHOSTUNREACH:113,EINPROGRESS:115,EALREADY:114,EDESTADDRREQ:89,EMSGSIZE:90,EPROTONOSUPPORT:93,ESOCKTNOSUPPORT:94,EADDRNOTAVAIL:99,ENETRESET:102,EISCONN:106,ENOTCONN:107,ETOOMANYREFS:109,EUSERS:87,EDQUOT:122,ESTALE:116,ENOTSUP:95,ENOMEDIUM:123,EILSEQ:84,EOVERFLOW:75,ECANCELED:125,ENOTRECOVERABLE:131,EOWNERDEAD:130,ESTRPIPE:86};
  
  var ERRNO_MESSAGES={0:"Success",1:"Not super-user",2:"No such file or directory",3:"No such process",4:"Interrupted system call",5:"I/O error",6:"No such device or address",7:"Arg list too long",8:"Exec format error",9:"Bad file number",10:"No children",11:"No more processes",12:"Not enough core",13:"Permission denied",14:"Bad address",15:"Block device required",16:"Mount device busy",17:"File exists",18:"Cross-device link",19:"No such device",20:"Not a directory",21:"Is a directory",22:"Invalid argument",23:"Too many open files in system",24:"Too many open files",25:"Not a typewriter",26:"Text file busy",27:"File too large",28:"No space left on device",29:"Illegal seek",30:"Read only file system",31:"Too many links",32:"Broken pipe",33:"Math arg out of domain of func",34:"Math result not representable",35:"File locking deadlock error",36:"File or path name too long",37:"No record locks available",38:"Function not implemented",39:"Directory not empty",40:"Too many symbolic links",42:"No message of desired type",43:"Identifier removed",44:"Channel number out of range",45:"Level 2 not synchronized",46:"Level 3 halted",47:"Level 3 reset",48:"Link number out of range",49:"Protocol driver not attached",50:"No CSI structure available",51:"Level 2 halted",52:"Invalid exchange",53:"Invalid request descriptor",54:"Exchange full",55:"No anode",56:"Invalid request code",57:"Invalid slot",59:"Bad font file fmt",60:"Device not a stream",61:"No data (for no delay io)",62:"Timer expired",63:"Out of streams resources",64:"Machine is not on the network",65:"Package not installed",66:"The object is remote",67:"The link has been severed",68:"Advertise error",69:"Srmount error",70:"Communication error on send",71:"Protocol error",72:"Multihop attempted",73:"Cross mount point (not really error)",74:"Trying to read unreadable message",75:"Value too large for defined data type",76:"Given log. name not unique",77:"f.d. invalid for this operation",78:"Remote address changed",79:"Can   access a needed shared lib",80:"Accessing a corrupted shared lib",81:".lib section in a.out corrupted",82:"Attempting to link in too many libs",83:"Attempting to exec a shared library",84:"Illegal byte sequence",86:"Streams pipe error",87:"Too many users",88:"Socket operation on non-socket",89:"Destination address required",90:"Message too long",91:"Protocol wrong type for socket",92:"Protocol not available",93:"Unknown protocol",94:"Socket type not supported",95:"Not supported",96:"Protocol family not supported",97:"Address family not supported by protocol family",98:"Address already in use",99:"Address not available",100:"Network interface is not configured",101:"Network is unreachable",102:"Connection reset by network",103:"Connection aborted",104:"Connection reset by peer",105:"No buffer space available",106:"Socket is already connected",107:"Socket is not connected",108:"Can't send after socket shutdown",109:"Too many references",110:"Connection timed out",111:"Connection refused",112:"Host is down",113:"Host is unreachable",114:"Socket already connected",115:"Connection already in progress",116:"Stale file handle",122:"Quota exceeded",123:"No medium (in tape drive)",125:"Operation canceled",130:"Previous owner died",131:"State not recoverable"};
  
  function ___setErrNo(value) {
      if (Module['___errno_location']) HEAP32[((Module['___errno_location']())>>2)]=value;
      else Module.printErr('failed to set errno from JS');
      return value;
    }
  
  var PATH={splitPath:function (filename) {
        var splitPathRe = /^(\/?|)([\s\S]*?)((?:\.{1,2}|[^\/]+?|)(\.[^.\/]*|))(?:[\/]*)$/;
        return splitPathRe.exec(filename).slice(1);
      },normalizeArray:function (parts, allowAboveRoot) {
        // if the path tries to go above the root, `up` ends up > 0
        var up = 0;
        for (var i = parts.length - 1; i >= 0; i--) {
          var last = parts[i];
          if (last === '.') {
            parts.splice(i, 1);
          } else if (last === '..') {
            parts.splice(i, 1);
            up++;
          } else if (up) {
            parts.splice(i, 1);
            up--;
          }
        }
        // if the path is allowed to go above the root, restore leading ..s
        if (allowAboveRoot) {
          for (; up--; up) {
            parts.unshift('..');
          }
        }
        return parts;
      },normalize:function (path) {
        var isAbsolute = path.charAt(0) === '/',
            trailingSlash = path.substr(-1) === '/';
        // Normalize the path
        path = PATH.normalizeArray(path.split('/').filter(function(p) {
          return !!p;
        }), !isAbsolute).join('/');
        if (!path && !isAbsolute) {
          path = '.';
        }
        if (path && trailingSlash) {
          path += '/';
        }
        return (isAbsolute ? '/' : '') + path;
      },dirname:function (path) {
        var result = PATH.splitPath(path),
            root = result[0],
            dir = result[1];
        if (!root && !dir) {
          // No dirname whatsoever
          return '.';
        }
        if (dir) {
          // It has a dirname, strip trailing slash
          dir = dir.substr(0, dir.length - 1);
        }
        return root + dir;
      },basename:function (path) {
        // EMSCRIPTEN return '/'' for '/', not an empty string
        if (path === '/') return '/';
        var lastSlash = path.lastIndexOf('/');
        if (lastSlash === -1) return path;
        return path.substr(lastSlash+1);
      },extname:function (path) {
        return PATH.splitPath(path)[3];
      },join:function () {
        var paths = Array.prototype.slice.call(arguments, 0);
        return PATH.normalize(paths.join('/'));
      },join2:function (l, r) {
        return PATH.normalize(l + '/' + r);
      },resolve:function () {
        var resolvedPath = '',
          resolvedAbsolute = false;
        for (var i = arguments.length - 1; i >= -1 && !resolvedAbsolute; i--) {
          var path = (i >= 0) ? arguments[i] : FS.cwd();
          // Skip empty and invalid entries
          if (typeof path !== 'string') {
            throw new TypeError('Arguments to path.resolve must be strings');
          } else if (!path) {
            return ''; // an invalid portion invalidates the whole thing
          }
          resolvedPath = path + '/' + resolvedPath;
          resolvedAbsolute = path.charAt(0) === '/';
        }
        // At this point the path should be resolved to a full absolute path, but
        // handle relative paths to be safe (might happen when process.cwd() fails)
        resolvedPath = PATH.normalizeArray(resolvedPath.split('/').filter(function(p) {
          return !!p;
        }), !resolvedAbsolute).join('/');
        return ((resolvedAbsolute ? '/' : '') + resolvedPath) || '.';
      },relative:function (from, to) {
        from = PATH.resolve(from).substr(1);
        to = PATH.resolve(to).substr(1);
        function trim(arr) {
          var start = 0;
          for (; start < arr.length; start++) {
            if (arr[start] !== '') break;
          }
          var end = arr.length - 1;
          for (; end >= 0; end--) {
            if (arr[end] !== '') break;
          }
          if (start > end) return [];
          return arr.slice(start, end - start + 1);
        }
        var fromParts = trim(from.split('/'));
        var toParts = trim(to.split('/'));
        var length = Math.min(fromParts.length, toParts.length);
        var samePartsLength = length;
        for (var i = 0; i < length; i++) {
          if (fromParts[i] !== toParts[i]) {
            samePartsLength = i;
            break;
          }
        }
        var outputParts = [];
        for (var i = samePartsLength; i < fromParts.length; i++) {
          outputParts.push('..');
        }
        outputParts = outputParts.concat(toParts.slice(samePartsLength));
        return outputParts.join('/');
      }};
  
  var TTY={ttys:[],init:function () {
        // https://github.com/kripken/emscripten/pull/1555
        // if (ENVIRONMENT_IS_NODE) {
        //   // currently, FS.init does not distinguish if process.stdin is a file or TTY
        //   // device, it always assumes it's a TTY device. because of this, we're forcing
        //   // process.stdin to UTF8 encoding to at least make stdin reading compatible
        //   // with text files until FS.init can be refactored.
        //   process['stdin']['setEncoding']('utf8');
        // }
      },shutdown:function () {
        // https://github.com/kripken/emscripten/pull/1555
        // if (ENVIRONMENT_IS_NODE) {
        //   // inolen: any idea as to why node -e 'process.stdin.read()' wouldn't exit immediately (with process.stdin being a tty)?
        //   // isaacs: because now it's reading from the stream, you've expressed interest in it, so that read() kicks off a _read() which creates a ReadReq operation
        //   // inolen: I thought read() in that case was a synchronous operation that just grabbed some amount of buffered data if it exists?
        //   // isaacs: it is. but it also triggers a _read() call, which calls readStart() on the handle
        //   // isaacs: do process.stdin.pause() and i'd think it'd probably close the pending call
        //   process['stdin']['pause']();
        // }
      },register:function (dev, ops) {
        TTY.ttys[dev] = { input: [], output: [], ops: ops };
        FS.registerDevice(dev, TTY.stream_ops);
      },stream_ops:{open:function (stream) {
          var tty = TTY.ttys[stream.node.rdev];
          if (!tty) {
            throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
          }
          stream.tty = tty;
          stream.seekable = false;
        },close:function (stream) {
          // flush any pending line data
          stream.tty.ops.flush(stream.tty);
        },flush:function (stream) {
          stream.tty.ops.flush(stream.tty);
        },read:function (stream, buffer, offset, length, pos /* ignored */) {
          if (!stream.tty || !stream.tty.ops.get_char) {
            throw new FS.ErrnoError(ERRNO_CODES.ENXIO);
          }
          var bytesRead = 0;
          for (var i = 0; i < length; i++) {
            var result;
            try {
              result = stream.tty.ops.get_char(stream.tty);
            } catch (e) {
              throw new FS.ErrnoError(ERRNO_CODES.EIO);
            }
            if (result === undefined && bytesRead === 0) {
              throw new FS.ErrnoError(ERRNO_CODES.EAGAIN);
            }
            if (result === null || result === undefined) break;
            bytesRead++;
            buffer[offset+i] = result;
          }
          if (bytesRead) {
            stream.node.timestamp = Date.now();
          }
          return bytesRead;
        },write:function (stream, buffer, offset, length, pos) {
          if (!stream.tty || !stream.tty.ops.put_char) {
            throw new FS.ErrnoError(ERRNO_CODES.ENXIO);
          }
          for (var i = 0; i < length; i++) {
            try {
              stream.tty.ops.put_char(stream.tty, buffer[offset+i]);
            } catch (e) {
              throw new FS.ErrnoError(ERRNO_CODES.EIO);
            }
          }
          if (length) {
            stream.node.timestamp = Date.now();
          }
          return i;
        }},default_tty_ops:{get_char:function (tty) {
          if (!tty.input.length) {
            var result = null;
            if (ENVIRONMENT_IS_NODE) {
              // we will read data by chunks of BUFSIZE
              var BUFSIZE = 256;
              var buf = new Buffer(BUFSIZE);
              var bytesRead = 0;
  
              var isPosixPlatform = (process.platform != 'win32'); // Node doesn't offer a direct check, so test by exclusion
  
              var fd = process.stdin.fd;
              if (isPosixPlatform) {
                // Linux and Mac cannot use process.stdin.fd (which isn't set up as sync)
                var usingDevice = false;
                try {
                  fd = fs.openSync('/dev/stdin', 'r');
                  usingDevice = true;
                } catch (e) {}
              }
  
              try {
                bytesRead = fs.readSync(fd, buf, 0, BUFSIZE, null);
              } catch(e) {
                // Cross-platform differences: on Windows, reading EOF throws an exception, but on other OSes,
                // reading EOF returns 0. Uniformize behavior by treating the EOF exception to return 0.
                if (e.toString().indexOf('EOF') != -1) bytesRead = 0;
                else throw e;
              }
  
              if (usingDevice) { fs.closeSync(fd); }
              if (bytesRead > 0) {
                result = buf.slice(0, bytesRead).toString('utf-8');
              } else {
                result = null;
              }
  
            } else if (typeof window != 'undefined' &&
              typeof window.prompt == 'function') {
              // Browser.
              result = window.prompt('Input: ');  // returns null on cancel
              if (result !== null) {
                result += '\n';
              }
            } else if (typeof readline == 'function') {
              // Command line.
              result = readline();
              if (result !== null) {
                result += '\n';
              }
            }
            if (!result) {
              return null;
            }
            tty.input = intArrayFromString(result, true);
          }
          return tty.input.shift();
        },put_char:function (tty, val) {
          if (val === null || val === 10) {
            Module['print'](UTF8ArrayToString(tty.output, 0));
            tty.output = [];
          } else {
            if (val != 0) tty.output.push(val); // val == 0 would cut text output off in the middle.
          }
        },flush:function (tty) {
          if (tty.output && tty.output.length > 0) {
            Module['print'](UTF8ArrayToString(tty.output, 0));
            tty.output = [];
          }
        }},default_tty1_ops:{put_char:function (tty, val) {
          if (val === null || val === 10) {
            Module['printErr'](UTF8ArrayToString(tty.output, 0));
            tty.output = [];
          } else {
            if (val != 0) tty.output.push(val);
          }
        },flush:function (tty) {
          if (tty.output && tty.output.length > 0) {
            Module['printErr'](UTF8ArrayToString(tty.output, 0));
            tty.output = [];
          }
        }}};
  
  var MEMFS={ops_table:null,mount:function (mount) {
        return MEMFS.createNode(null, '/', 16384 | 511 /* 0777 */, 0);
      },createNode:function (parent, name, mode, dev) {
        if (FS.isBlkdev(mode) || FS.isFIFO(mode)) {
          // no supported
          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
        }
        if (!MEMFS.ops_table) {
          MEMFS.ops_table = {
            dir: {
              node: {
                getattr: MEMFS.node_ops.getattr,
                setattr: MEMFS.node_ops.setattr,
                lookup: MEMFS.node_ops.lookup,
                mknod: MEMFS.node_ops.mknod,
                rename: MEMFS.node_ops.rename,
                unlink: MEMFS.node_ops.unlink,
                rmdir: MEMFS.node_ops.rmdir,
                readdir: MEMFS.node_ops.readdir,
                symlink: MEMFS.node_ops.symlink
              },
              stream: {
                llseek: MEMFS.stream_ops.llseek
              }
            },
            file: {
              node: {
                getattr: MEMFS.node_ops.getattr,
                setattr: MEMFS.node_ops.setattr
              },
              stream: {
                llseek: MEMFS.stream_ops.llseek,
                read: MEMFS.stream_ops.read,
                write: MEMFS.stream_ops.write,
                allocate: MEMFS.stream_ops.allocate,
                mmap: MEMFS.stream_ops.mmap,
                msync: MEMFS.stream_ops.msync
              }
            },
            link: {
              node: {
                getattr: MEMFS.node_ops.getattr,
                setattr: MEMFS.node_ops.setattr,
                readlink: MEMFS.node_ops.readlink
              },
              stream: {}
            },
            chrdev: {
              node: {
                getattr: MEMFS.node_ops.getattr,
                setattr: MEMFS.node_ops.setattr
              },
              stream: FS.chrdev_stream_ops
            }
          };
        }
        var node = FS.createNode(parent, name, mode, dev);
        if (FS.isDir(node.mode)) {
          node.node_ops = MEMFS.ops_table.dir.node;
          node.stream_ops = MEMFS.ops_table.dir.stream;
          node.contents = {};
        } else if (FS.isFile(node.mode)) {
          node.node_ops = MEMFS.ops_table.file.node;
          node.stream_ops = MEMFS.ops_table.file.stream;
          node.usedBytes = 0; // The actual number of bytes used in the typed array, as opposed to contents.length which gives the whole capacity.
          // When the byte data of the file is populated, this will point to either a typed array, or a normal JS array. Typed arrays are preferred
          // for performance, and used by default. However, typed arrays are not resizable like normal JS arrays are, so there is a small disk size
          // penalty involved for appending file writes that continuously grow a file similar to std::vector capacity vs used -scheme.
          node.contents = null; 
        } else if (FS.isLink(node.mode)) {
          node.node_ops = MEMFS.ops_table.link.node;
          node.stream_ops = MEMFS.ops_table.link.stream;
        } else if (FS.isChrdev(node.mode)) {
          node.node_ops = MEMFS.ops_table.chrdev.node;
          node.stream_ops = MEMFS.ops_table.chrdev.stream;
        }
        node.timestamp = Date.now();
        // add the new node to the parent
        if (parent) {
          parent.contents[name] = node;
        }
        return node;
      },getFileDataAsRegularArray:function (node) {
        if (node.contents && node.contents.subarray) {
          var arr = [];
          for (var i = 0; i < node.usedBytes; ++i) arr.push(node.contents[i]);
          return arr; // Returns a copy of the original data.
        }
        return node.contents; // No-op, the file contents are already in a JS array. Return as-is.
      },getFileDataAsTypedArray:function (node) {
        if (!node.contents) return new Uint8Array;
        if (node.contents.subarray) return node.contents.subarray(0, node.usedBytes); // Make sure to not return excess unused bytes.
        return new Uint8Array(node.contents);
      },expandFileStorage:function (node, newCapacity) {
        // If we are asked to expand the size of a file that already exists, revert to using a standard JS array to store the file
        // instead of a typed array. This makes resizing the array more flexible because we can just .push() elements at the back to
        // increase the size.
        if (node.contents && node.contents.subarray && newCapacity > node.contents.length) {
          node.contents = MEMFS.getFileDataAsRegularArray(node);
          node.usedBytes = node.contents.length; // We might be writing to a lazy-loaded file which had overridden this property, so force-reset it.
        }
  
        if (!node.contents || node.contents.subarray) { // Keep using a typed array if creating a new storage, or if old one was a typed array as well.
          var prevCapacity = node.contents ? node.contents.length : 0;
          if (prevCapacity >= newCapacity) return; // No need to expand, the storage was already large enough.
          // Don't expand strictly to the given requested limit if it's only a very small increase, but instead geometrically grow capacity.
          // For small filesizes (<1MB), perform size*2 geometric increase, but for large sizes, do a much more conservative size*1.125 increase to
          // avoid overshooting the allocation cap by a very large margin.
          var CAPACITY_DOUBLING_MAX = 1024 * 1024;
          newCapacity = Math.max(newCapacity, (prevCapacity * (prevCapacity < CAPACITY_DOUBLING_MAX ? 2.0 : 1.125)) | 0);
          if (prevCapacity != 0) newCapacity = Math.max(newCapacity, 256); // At minimum allocate 256b for each file when expanding.
          var oldContents = node.contents;
          node.contents = new Uint8Array(newCapacity); // Allocate new storage.
          if (node.usedBytes > 0) node.contents.set(oldContents.subarray(0, node.usedBytes), 0); // Copy old data over to the new storage.
          return;
        }
        // Not using a typed array to back the file storage. Use a standard JS array instead.
        if (!node.contents && newCapacity > 0) node.contents = [];
        while (node.contents.length < newCapacity) node.contents.push(0);
      },resizeFileStorage:function (node, newSize) {
        if (node.usedBytes == newSize) return;
        if (newSize == 0) {
          node.contents = null; // Fully decommit when requesting a resize to zero.
          node.usedBytes = 0;
          return;
        }
        if (!node.contents || node.contents.subarray) { // Resize a typed array if that is being used as the backing store.
          var oldContents = node.contents;
          node.contents = new Uint8Array(new ArrayBuffer(newSize)); // Allocate new storage.
          if (oldContents) {
            node.contents.set(oldContents.subarray(0, Math.min(newSize, node.usedBytes))); // Copy old data over to the new storage.
          }
          node.usedBytes = newSize;
          return;
        }
        // Backing with a JS array.
        if (!node.contents) node.contents = [];
        if (node.contents.length > newSize) node.contents.length = newSize;
        else while (node.contents.length < newSize) node.contents.push(0);
        node.usedBytes = newSize;
      },node_ops:{getattr:function (node) {
          var attr = {};
          // device numbers reuse inode numbers.
          attr.dev = FS.isChrdev(node.mode) ? node.id : 1;
          attr.ino = node.id;
          attr.mode = node.mode;
          attr.nlink = 1;
          attr.uid = 0;
          attr.gid = 0;
          attr.rdev = node.rdev;
          if (FS.isDir(node.mode)) {
            attr.size = 4096;
          } else if (FS.isFile(node.mode)) {
            attr.size = node.usedBytes;
          } else if (FS.isLink(node.mode)) {
            attr.size = node.link.length;
          } else {
            attr.size = 0;
          }
          attr.atime = new Date(node.timestamp);
          attr.mtime = new Date(node.timestamp);
          attr.ctime = new Date(node.timestamp);
          // NOTE: In our implementation, st_blocks = Math.ceil(st_size/st_blksize),
          //       but this is not required by the standard.
          attr.blksize = 4096;
          attr.blocks = Math.ceil(attr.size / attr.blksize);
          return attr;
        },setattr:function (node, attr) {
          if (attr.mode !== undefined) {
            node.mode = attr.mode;
          }
          if (attr.timestamp !== undefined) {
            node.timestamp = attr.timestamp;
          }
          if (attr.size !== undefined) {
            MEMFS.resizeFileStorage(node, attr.size);
          }
        },lookup:function (parent, name) {
          throw FS.genericErrors[ERRNO_CODES.ENOENT];
        },mknod:function (parent, name, mode, dev) {
          return MEMFS.createNode(parent, name, mode, dev);
        },rename:function (old_node, new_dir, new_name) {
          // if we're overwriting a directory at new_name, make sure it's empty.
          if (FS.isDir(old_node.mode)) {
            var new_node;
            try {
              new_node = FS.lookupNode(new_dir, new_name);
            } catch (e) {
            }
            if (new_node) {
              for (var i in new_node.contents) {
                throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY);
              }
            }
          }
          // do the internal rewiring
          delete old_node.parent.contents[old_node.name];
          old_node.name = new_name;
          new_dir.contents[new_name] = old_node;
          old_node.parent = new_dir;
        },unlink:function (parent, name) {
          delete parent.contents[name];
        },rmdir:function (parent, name) {
          var node = FS.lookupNode(parent, name);
          for (var i in node.contents) {
            throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY);
          }
          delete parent.contents[name];
        },readdir:function (node) {
          var entries = ['.', '..']
          for (var key in node.contents) {
            if (!node.contents.hasOwnProperty(key)) {
              continue;
            }
            entries.push(key);
          }
          return entries;
        },symlink:function (parent, newname, oldpath) {
          var node = MEMFS.createNode(parent, newname, 511 /* 0777 */ | 40960, 0);
          node.link = oldpath;
          return node;
        },readlink:function (node) {
          if (!FS.isLink(node.mode)) {
            throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
          }
          return node.link;
        }},stream_ops:{read:function (stream, buffer, offset, length, position) {
          var contents = stream.node.contents;
          if (position >= stream.node.usedBytes) return 0;
          var size = Math.min(stream.node.usedBytes - position, length);
          assert(size >= 0);
          if (size > 8 && contents.subarray) { // non-trivial, and typed array
            buffer.set(contents.subarray(position, position + size), offset);
          } else {
            for (var i = 0; i < size; i++) buffer[offset + i] = contents[position + i];
          }
          return size;
        },write:function (stream, buffer, offset, length, position, canOwn) {
          if (!length) return 0;
          var node = stream.node;
          node.timestamp = Date.now();
  
          if (buffer.subarray && (!node.contents || node.contents.subarray)) { // This write is from a typed array to a typed array?
            if (canOwn) {
              assert(position === 0, 'canOwn must imply no weird position inside the file');
              node.contents = buffer.subarray(offset, offset + length);
              node.usedBytes = length;
              return length;
            } else if (node.usedBytes === 0 && position === 0) { // If this is a simple first write to an empty file, do a fast set since we don't need to care about old data.
              node.contents = new Uint8Array(buffer.subarray(offset, offset + length));
              node.usedBytes = length;
              return length;
            } else if (position + length <= node.usedBytes) { // Writing to an already allocated and used subrange of the file?
              node.contents.set(buffer.subarray(offset, offset + length), position);
              return length;
            }
          }
  
          // Appending to an existing file and we need to reallocate, or source data did not come as a typed array.
          MEMFS.expandFileStorage(node, position+length);
          if (node.contents.subarray && buffer.subarray) node.contents.set(buffer.subarray(offset, offset + length), position); // Use typed array write if available.
          else {
            for (var i = 0; i < length; i++) {
             node.contents[position + i] = buffer[offset + i]; // Or fall back to manual write if not.
            }
          }
          node.usedBytes = Math.max(node.usedBytes, position+length);
          return length;
        },llseek:function (stream, offset, whence) {
          var position = offset;
          if (whence === 1) {  // SEEK_CUR.
            position += stream.position;
          } else if (whence === 2) {  // SEEK_END.
            if (FS.isFile(stream.node.mode)) {
              position += stream.node.usedBytes;
            }
          }
          if (position < 0) {
            throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
          }
          return position;
        },allocate:function (stream, offset, length) {
          MEMFS.expandFileStorage(stream.node, offset + length);
          stream.node.usedBytes = Math.max(stream.node.usedBytes, offset + length);
        },mmap:function (stream, buffer, offset, length, position, prot, flags) {
          if (!FS.isFile(stream.node.mode)) {
            throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
          }
          var ptr;
          var allocated;
          var contents = stream.node.contents;
          // Only make a new copy when MAP_PRIVATE is specified.
          if ( !(flags & 2) &&
                (contents.buffer === buffer || contents.buffer === buffer.buffer) ) {
            // We can't emulate MAP_SHARED when the file is not backed by the buffer
            // we're mapping to (e.g. the HEAP buffer).
            allocated = false;
            ptr = contents.byteOffset;
          } else {
            // Try to avoid unnecessary slices.
            if (position > 0 || position + length < stream.node.usedBytes) {
              if (contents.subarray) {
                contents = contents.subarray(position, position + length);
              } else {
                contents = Array.prototype.slice.call(contents, position, position + length);
              }
            }
            allocated = true;
            ptr = _malloc(length);
            if (!ptr) {
              throw new FS.ErrnoError(ERRNO_CODES.ENOMEM);
            }
            buffer.set(contents, ptr);
          }
          return { ptr: ptr, allocated: allocated };
        },msync:function (stream, buffer, offset, length, mmapFlags) {
          if (!FS.isFile(stream.node.mode)) {
            throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
          }
          if (mmapFlags & 2) {
            // MAP_PRIVATE calls need not to be synced back to underlying fs
            return 0;
          }
  
          var bytesWritten = MEMFS.stream_ops.write(stream, buffer, 0, length, offset, false);
          // should we check if bytesWritten and length are the same?
          return 0;
        }}};
  
  var IDBFS={dbs:{},indexedDB:function () {
        if (typeof indexedDB !== 'undefined') return indexedDB;
        var ret = null;
        if (typeof window === 'object') ret = window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB;
        assert(ret, 'IDBFS used, but indexedDB not supported');
        return ret;
      },DB_VERSION:21,DB_STORE_NAME:"FILE_DATA",mount:function (mount) {
        // reuse all of the core MEMFS functionality
        return MEMFS.mount.apply(null, arguments);
      },syncfs:function (mount, populate, callback) {
        IDBFS.getLocalSet(mount, function(err, local) {
          if (err) return callback(err);
  
          IDBFS.getRemoteSet(mount, function(err, remote) {
            if (err) return callback(err);
  
            var src = populate ? remote : local;
            var dst = populate ? local : remote;
  
            IDBFS.reconcile(src, dst, callback);
          });
        });
      },getDB:function (name, callback) {
        // check the cache first
        var db = IDBFS.dbs[name];
        if (db) {
          return callback(null, db);
        }
  
        var req;
        try {
          req = IDBFS.indexedDB().open(name, IDBFS.DB_VERSION);
        } catch (e) {
          return callback(e);
        }
        if (!req) {
          return callback("Unable to connect to IndexedDB");
        }
        req.onupgradeneeded = function(e) {
          var db = e.target.result;
          var transaction = e.target.transaction;
  
          var fileStore;
  
          if (db.objectStoreNames.contains(IDBFS.DB_STORE_NAME)) {
            fileStore = transaction.objectStore(IDBFS.DB_STORE_NAME);
          } else {
            fileStore = db.createObjectStore(IDBFS.DB_STORE_NAME);
          }
  
          if (!fileStore.indexNames.contains('timestamp')) {
            fileStore.createIndex('timestamp', 'timestamp', { unique: false });
          }
        };
        req.onsuccess = function() {
          db = req.result;
  
          // add to the cache
          IDBFS.dbs[name] = db;
          callback(null, db);
        };
        req.onerror = function(e) {
          callback(this.error);
          e.preventDefault();
        };
      },getLocalSet:function (mount, callback) {
        var entries = {};
  
        function isRealDir(p) {
          return p !== '.' && p !== '..';
        };
        function toAbsolute(root) {
          return function(p) {
            return PATH.join2(root, p);
          }
        };
  
        var check = FS.readdir(mount.mountpoint).filter(isRealDir).map(toAbsolute(mount.mountpoint));
  
        while (check.length) {
          var path = check.pop();
          var stat;
  
          try {
            stat = FS.stat(path);
          } catch (e) {
            return callback(e);
          }
  
          if (FS.isDir(stat.mode)) {
            check.push.apply(check, FS.readdir(path).filter(isRealDir).map(toAbsolute(path)));
          }
  
          entries[path] = { timestamp: stat.mtime };
        }
  
        return callback(null, { type: 'local', entries: entries });
      },getRemoteSet:function (mount, callback) {
        var entries = {};
  
        IDBFS.getDB(mount.mountpoint, function(err, db) {
          if (err) return callback(err);
  
          var transaction = db.transaction([IDBFS.DB_STORE_NAME], 'readonly');
          transaction.onerror = function(e) {
            callback(this.error);
            e.preventDefault();
          };
  
          var store = transaction.objectStore(IDBFS.DB_STORE_NAME);
          var index = store.index('timestamp');
  
          index.openKeyCursor().onsuccess = function(event) {
            var cursor = event.target.result;
  
            if (!cursor) {
              return callback(null, { type: 'remote', db: db, entries: entries });
            }
  
            entries[cursor.primaryKey] = { timestamp: cursor.key };
  
            cursor.continue();
          };
        });
      },loadLocalEntry:function (path, callback) {
        var stat, node;
  
        try {
          var lookup = FS.lookupPath(path);
          node = lookup.node;
          stat = FS.stat(path);
        } catch (e) {
          return callback(e);
        }
  
        if (FS.isDir(stat.mode)) {
          return callback(null, { timestamp: stat.mtime, mode: stat.mode });
        } else if (FS.isFile(stat.mode)) {
          // Performance consideration: storing a normal JavaScript array to a IndexedDB is much slower than storing a typed array.
          // Therefore always convert the file contents to a typed array first before writing the data to IndexedDB.
          node.contents = MEMFS.getFileDataAsTypedArray(node);
          return callback(null, { timestamp: stat.mtime, mode: stat.mode, contents: node.contents });
        } else {
          return callback(new Error('node type not supported'));
        }
      },storeLocalEntry:function (path, entry, callback) {
        try {
          if (FS.isDir(entry.mode)) {
            FS.mkdir(path, entry.mode);
          } else if (FS.isFile(entry.mode)) {
            FS.writeFile(path, entry.contents, { encoding: 'binary', canOwn: true });
          } else {
            return callback(new Error('node type not supported'));
          }
  
          FS.chmod(path, entry.mode);
          FS.utime(path, entry.timestamp, entry.timestamp);
        } catch (e) {
          return callback(e);
        }
  
        callback(null);
      },removeLocalEntry:function (path, callback) {
        try {
          var lookup = FS.lookupPath(path);
          var stat = FS.stat(path);
  
          if (FS.isDir(stat.mode)) {
            FS.rmdir(path);
          } else if (FS.isFile(stat.mode)) {
            FS.unlink(path);
          }
        } catch (e) {
          return callback(e);
        }
  
        callback(null);
      },loadRemoteEntry:function (store, path, callback) {
        var req = store.get(path);
        req.onsuccess = function(event) { callback(null, event.target.result); };
        req.onerror = function(e) {
          callback(this.error);
          e.preventDefault();
        };
      },storeRemoteEntry:function (store, path, entry, callback) {
        var req = store.put(entry, path);
        req.onsuccess = function() { callback(null); };
        req.onerror = function(e) {
          callback(this.error);
          e.preventDefault();
        };
      },removeRemoteEntry:function (store, path, callback) {
        var req = store.delete(path);
        req.onsuccess = function() { callback(null); };
        req.onerror = function(e) {
          callback(this.error);
          e.preventDefault();
        };
      },reconcile:function (src, dst, callback) {
        var total = 0;
  
        var create = [];
        Object.keys(src.entries).forEach(function (key) {
          var e = src.entries[key];
          var e2 = dst.entries[key];
          if (!e2 || e.timestamp > e2.timestamp) {
            create.push(key);
            total++;
          }
        });
  
        var remove = [];
        Object.keys(dst.entries).forEach(function (key) {
          var e = dst.entries[key];
          var e2 = src.entries[key];
          if (!e2) {
            remove.push(key);
            total++;
          }
        });
  
        if (!total) {
          return callback(null);
        }
  
        var errored = false;
        var completed = 0;
        var db = src.type === 'remote' ? src.db : dst.db;
        var transaction = db.transaction([IDBFS.DB_STORE_NAME], 'readwrite');
        var store = transaction.objectStore(IDBFS.DB_STORE_NAME);
  
        function done(err) {
          if (err) {
            if (!done.errored) {
              done.errored = true;
              return callback(err);
            }
            return;
          }
          if (++completed >= total) {
            return callback(null);
          }
        };
  
        transaction.onerror = function(e) {
          done(this.error);
          e.preventDefault();
        };
  
        // sort paths in ascending order so directory entries are created
        // before the files inside them
        create.sort().forEach(function (path) {
          if (dst.type === 'local') {
            IDBFS.loadRemoteEntry(store, path, function (err, entry) {
              if (err) return done(err);
              IDBFS.storeLocalEntry(path, entry, done);
            });
          } else {
            IDBFS.loadLocalEntry(path, function (err, entry) {
              if (err) return done(err);
              IDBFS.storeRemoteEntry(store, path, entry, done);
            });
          }
        });
  
        // sort paths in descending order so files are deleted before their
        // parent directories
        remove.sort().reverse().forEach(function(path) {
          if (dst.type === 'local') {
            IDBFS.removeLocalEntry(path, done);
          } else {
            IDBFS.removeRemoteEntry(store, path, done);
          }
        });
      }};
  
  var NODEFS={isWindows:false,staticInit:function () {
        NODEFS.isWindows = !!process.platform.match(/^win/);
      },mount:function (mount) {
        assert(ENVIRONMENT_IS_NODE);
        return NODEFS.createNode(null, '/', NODEFS.getMode(mount.opts.root), 0);
      },createNode:function (parent, name, mode, dev) {
        if (!FS.isDir(mode) && !FS.isFile(mode) && !FS.isLink(mode)) {
          throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
        }
        var node = FS.createNode(parent, name, mode);
        node.node_ops = NODEFS.node_ops;
        node.stream_ops = NODEFS.stream_ops;
        return node;
      },getMode:function (path) {
        var stat;
        try {
          stat = fs.lstatSync(path);
          if (NODEFS.isWindows) {
            // On Windows, directories return permission bits 'rw-rw-rw-', even though they have 'rwxrwxrwx', so
            // propagate write bits to execute bits.
            stat.mode = stat.mode | ((stat.mode & 146) >> 1);
          }
        } catch (e) {
          if (!e.code) throw e;
          throw new FS.ErrnoError(ERRNO_CODES[e.code]);
        }
        return stat.mode;
      },realPath:function (node) {
        var parts = [];
        while (node.parent !== node) {
          parts.push(node.name);
          node = node.parent;
        }
        parts.push(node.mount.opts.root);
        parts.reverse();
        return PATH.join.apply(null, parts);
      },flagsToPermissionStringMap:{0:"r",1:"r+",2:"r+",64:"r",65:"r+",66:"r+",129:"rx+",193:"rx+",514:"w+",577:"w",578:"w+",705:"wx",706:"wx+",1024:"a",1025:"a",1026:"a+",1089:"a",1090:"a+",1153:"ax",1154:"ax+",1217:"ax",1218:"ax+",4096:"rs",4098:"rs+"},flagsToPermissionString:function (flags) {
        flags &= ~0x200000 /*O_PATH*/; // Ignore this flag from musl, otherwise node.js fails to open the file.
        flags &= ~0x800 /*O_NONBLOCK*/; // Ignore this flag from musl, otherwise node.js fails to open the file.
        flags &= ~0x8000 /*O_LARGEFILE*/; // Ignore this flag from musl, otherwise node.js fails to open the file.
        flags &= ~0x80000 /*O_CLOEXEC*/; // Some applications may pass it; it makes no sense for a single process.
        if (flags in NODEFS.flagsToPermissionStringMap) {
          return NODEFS.flagsToPermissionStringMap[flags];
        } else {
          throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
        }
      },node_ops:{getattr:function (node) {
          var path = NODEFS.realPath(node);
          var stat;
          try {
            stat = fs.lstatSync(path);
          } catch (e) {
            if (!e.code) throw e;
            throw new FS.ErrnoError(ERRNO_CODES[e.code]);
          }
          // node.js v0.10.20 doesn't report blksize and blocks on Windows. Fake them with default blksize of 4096.
          // See http://support.microsoft.com/kb/140365
          if (NODEFS.isWindows && !stat.blksize) {
            stat.blksize = 4096;
          }
          if (NODEFS.isWindows && !stat.blocks) {
            stat.blocks = (stat.size+stat.blksize-1)/stat.blksize|0;
          }
          return {
            dev: stat.dev,
            ino: stat.ino,
            mode: stat.mode,
            nlink: stat.nlink,
            uid: stat.uid,
            gid: stat.gid,
            rdev: stat.rdev,
            size: stat.size,
            atime: stat.atime,
            mtime: stat.mtime,
            ctime: stat.ctime,
            blksize: stat.blksize,
            blocks: stat.blocks
          };
        },setattr:function (node, attr) {
          var path = NODEFS.realPath(node);
          try {
            if (attr.mode !== undefined) {
              fs.chmodSync(path, attr.mode);
              // update the common node structure mode as well
              node.mode = attr.mode;
            }
            if (attr.timestamp !== undefined) {
              var date = new Date(attr.timestamp);
              fs.utimesSync(path, date, date);
            }
            if (attr.size !== undefined) {
              fs.truncateSync(path, attr.size);
            }
          } catch (e) {
            if (!e.code) throw e;
            throw new FS.ErrnoError(ERRNO_CODES[e.code]);
          }
        },lookup:function (parent, name) {
          var path = PATH.join2(NODEFS.realPath(parent), name);
          var mode = NODEFS.getMode(path);
          return NODEFS.createNode(parent, name, mode);
        },mknod:function (parent, name, mode, dev) {
          var node = NODEFS.createNode(parent, name, mode, dev);
          // create the backing node for this in the fs root as well
          var path = NODEFS.realPath(node);
          try {
            if (FS.isDir(node.mode)) {
              fs.mkdirSync(path, node.mode);
            } else {
              fs.writeFileSync(path, '', { mode: node.mode });
            }
          } catch (e) {
            if (!e.code) throw e;
            throw new FS.ErrnoError(ERRNO_CODES[e.code]);
          }
          return node;
        },rename:function (oldNode, newDir, newName) {
          var oldPath = NODEFS.realPath(oldNode);
          var newPath = PATH.join2(NODEFS.realPath(newDir), newName);
          try {
            fs.renameSync(oldPath, newPath);
          } catch (e) {
            if (!e.code) throw e;
            throw new FS.ErrnoError(ERRNO_CODES[e.code]);
          }
        },unlink:function (parent, name) {
          var path = PATH.join2(NODEFS.realPath(parent), name);
          try {
            fs.unlinkSync(path);
          } catch (e) {
            if (!e.code) throw e;
            throw new FS.ErrnoError(ERRNO_CODES[e.code]);
          }
        },rmdir:function (parent, name) {
          var path = PATH.join2(NODEFS.realPath(parent), name);
          try {
            fs.rmdirSync(path);
          } catch (e) {
            if (!e.code) throw e;
            throw new FS.ErrnoError(ERRNO_CODES[e.code]);
          }
        },readdir:function (node) {
          var path = NODEFS.realPath(node);
          try {
            return fs.readdirSync(path);
          } catch (e) {
            if (!e.code) throw e;
            throw new FS.ErrnoError(ERRNO_CODES[e.code]);
          }
        },symlink:function (parent, newName, oldPath) {
          var newPath = PATH.join2(NODEFS.realPath(parent), newName);
          try {
            fs.symlinkSync(oldPath, newPath);
          } catch (e) {
            if (!e.code) throw e;
            throw new FS.ErrnoError(ERRNO_CODES[e.code]);
          }
        },readlink:function (node) {
          var path = NODEFS.realPath(node);
          try {
            path = fs.readlinkSync(path);
            path = NODEJS_PATH.relative(NODEJS_PATH.resolve(node.mount.opts.root), path);
            return path;
          } catch (e) {
            if (!e.code) throw e;
            throw new FS.ErrnoError(ERRNO_CODES[e.code]);
          }
        }},stream_ops:{open:function (stream) {
          var path = NODEFS.realPath(stream.node);
          try {
            if (FS.isFile(stream.node.mode)) {
              stream.nfd = fs.openSync(path, NODEFS.flagsToPermissionString(stream.flags));
            }
          } catch (e) {
            if (!e.code) throw e;
            throw new FS.ErrnoError(ERRNO_CODES[e.code]);
          }
        },close:function (stream) {
          try {
            if (FS.isFile(stream.node.mode) && stream.nfd) {
              fs.closeSync(stream.nfd);
            }
          } catch (e) {
            if (!e.code) throw e;
            throw new FS.ErrnoError(ERRNO_CODES[e.code]);
          }
        },read:function (stream, buffer, offset, length, position) {
          if (length === 0) return 0; // node errors on 0 length reads
          // FIXME this is terrible.
          var nbuffer = new Buffer(length);
          var res;
          try {
            res = fs.readSync(stream.nfd, nbuffer, 0, length, position);
          } catch (e) {
            throw new FS.ErrnoError(ERRNO_CODES[e.code]);
          }
          if (res > 0) {
            for (var i = 0; i < res; i++) {
              buffer[offset + i] = nbuffer[i];
            }
          }
          return res;
        },write:function (stream, buffer, offset, length, position) {
          // FIXME this is terrible.
          var nbuffer = new Buffer(buffer.subarray(offset, offset + length));
          var res;
          try {
            res = fs.writeSync(stream.nfd, nbuffer, 0, length, position);
          } catch (e) {
            throw new FS.ErrnoError(ERRNO_CODES[e.code]);
          }
          return res;
        },llseek:function (stream, offset, whence) {
          var position = offset;
          if (whence === 1) {  // SEEK_CUR.
            position += stream.position;
          } else if (whence === 2) {  // SEEK_END.
            if (FS.isFile(stream.node.mode)) {
              try {
                var stat = fs.fstatSync(stream.nfd);
                position += stat.size;
              } catch (e) {
                throw new FS.ErrnoError(ERRNO_CODES[e.code]);
              }
            }
          }
  
          if (position < 0) {
            throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
          }
  
          return position;
        }}};
  
  var WORKERFS={DIR_MODE:16895,FILE_MODE:33279,reader:null,mount:function (mount) {
        assert(ENVIRONMENT_IS_WORKER);
        if (!WORKERFS.reader) WORKERFS.reader = new FileReaderSync();
        var root = WORKERFS.createNode(null, '/', WORKERFS.DIR_MODE, 0);
        var createdParents = {};
        function ensureParent(path) {
          // return the parent node, creating subdirs as necessary
          var parts = path.split('/');
          var parent = root;
          for (var i = 0; i < parts.length-1; i++) {
            var curr = parts.slice(0, i+1).join('/');
            // Issue 4254: Using curr as a node name will prevent the node
            // from being found in FS.nameTable when FS.open is called on
            // a path which holds a child of this node,
            // given that all FS functions assume node names
            // are just their corresponding parts within their given path,
            // rather than incremental aggregates which include their parent's
            // directories.
            if (!createdParents[curr]) {
              createdParents[curr] = WORKERFS.createNode(parent, parts[i], WORKERFS.DIR_MODE, 0);
            }
            parent = createdParents[curr];
          }
          return parent;
        }
        function base(path) {
          var parts = path.split('/');
          return parts[parts.length-1];
        }
        // We also accept FileList here, by using Array.prototype
        Array.prototype.forEach.call(mount.opts["files"] || [], function(file) {
          WORKERFS.createNode(ensureParent(file.name), base(file.name), WORKERFS.FILE_MODE, 0, file, file.lastModifiedDate);
        });
        (mount.opts["blobs"] || []).forEach(function(obj) {
          WORKERFS.createNode(ensureParent(obj["name"]), base(obj["name"]), WORKERFS.FILE_MODE, 0, obj["data"]);
        });
        (mount.opts["packages"] || []).forEach(function(pack) {
          pack['metadata'].files.forEach(function(file) {
            var name = file.filename.substr(1); // remove initial slash
            WORKERFS.createNode(ensureParent(name), base(name), WORKERFS.FILE_MODE, 0, pack['blob'].slice(file.start, file.end));
          });
        });
        return root;
      },createNode:function (parent, name, mode, dev, contents, mtime) {
        var node = FS.createNode(parent, name, mode);
        node.mode = mode;
        node.node_ops = WORKERFS.node_ops;
        node.stream_ops = WORKERFS.stream_ops;
        node.timestamp = (mtime || new Date).getTime();
        assert(WORKERFS.FILE_MODE !== WORKERFS.DIR_MODE);
        if (mode === WORKERFS.FILE_MODE) {
          node.size = contents.size;
          node.contents = contents;
        } else {
          node.size = 4096;
          node.contents = {};
        }
        if (parent) {
          parent.contents[name] = node;
        }
        return node;
      },node_ops:{getattr:function (node) {
          return {
            dev: 1,
            ino: undefined,
            mode: node.mode,
            nlink: 1,
            uid: 0,
            gid: 0,
            rdev: undefined,
            size: node.size,
            atime: new Date(node.timestamp),
            mtime: new Date(node.timestamp),
            ctime: new Date(node.timestamp),
            blksize: 4096,
            blocks: Math.ceil(node.size / 4096),
          };
        },setattr:function (node, attr) {
          if (attr.mode !== undefined) {
            node.mode = attr.mode;
          }
          if (attr.timestamp !== undefined) {
            node.timestamp = attr.timestamp;
          }
        },lookup:function (parent, name) {
          throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
        },mknod:function (parent, name, mode, dev) {
          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
        },rename:function (oldNode, newDir, newName) {
          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
        },unlink:function (parent, name) {
          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
        },rmdir:function (parent, name) {
          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
        },readdir:function (node) {
          var entries = ['.', '..'];
          for (var key in node.contents) {
            if (!node.contents.hasOwnProperty(key)) {
              continue;
            }
            entries.push(key);
          }
          return entries;
        },symlink:function (parent, newName, oldPath) {
          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
        },readlink:function (node) {
          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
        }},stream_ops:{read:function (stream, buffer, offset, length, position) {
          if (position >= stream.node.size) return 0;
          var chunk = stream.node.contents.slice(position, position + length);
          var ab = WORKERFS.reader.readAsArrayBuffer(chunk);
          buffer.set(new Uint8Array(ab), offset);
          return chunk.size;
        },write:function (stream, buffer, offset, length, position) {
          throw new FS.ErrnoError(ERRNO_CODES.EIO);
        },llseek:function (stream, offset, whence) {
          var position = offset;
          if (whence === 1) {  // SEEK_CUR.
            position += stream.position;
          } else if (whence === 2) {  // SEEK_END.
            if (FS.isFile(stream.node.mode)) {
              position += stream.node.size;
            }
          }
          if (position < 0) {
            throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
          }
          return position;
        }}};
  
  var _stdin=STATICTOP; STATICTOP += 16;;
  
  var _stdout=STATICTOP; STATICTOP += 16;;
  
  var _stderr=STATICTOP; STATICTOP += 16;;var FS={root:null,mounts:[],devices:[null],streams:[],nextInode:1,nameTable:null,currentPath:"/",initialized:false,ignorePermissions:true,trackingDelegate:{},tracking:{openFlags:{READ:1,WRITE:2}},ErrnoError:null,genericErrors:{},filesystems:null,syncFSRequests:0,handleFSError:function (e) {
        if (!(e instanceof FS.ErrnoError)) throw e + ' : ' + stackTrace();
        return ___setErrNo(e.errno);
      },lookupPath:function (path, opts) {
        path = PATH.resolve(FS.cwd(), path);
        opts = opts || {};
  
        if (!path) return { path: '', node: null };
  
        var defaults = {
          follow_mount: true,
          recurse_count: 0
        };
        for (var key in defaults) {
          if (opts[key] === undefined) {
            opts[key] = defaults[key];
          }
        }
  
        if (opts.recurse_count > 8) {  // max recursive lookup of 8
          throw new FS.ErrnoError(ERRNO_CODES.ELOOP);
        }
  
        // split the path
        var parts = PATH.normalizeArray(path.split('/').filter(function(p) {
          return !!p;
        }), false);
  
        // start at the root
        var current = FS.root;
        var current_path = '/';
  
        for (var i = 0; i < parts.length; i++) {
          var islast = (i === parts.length-1);
          if (islast && opts.parent) {
            // stop resolving
            break;
          }
  
          current = FS.lookupNode(current, parts[i]);
          current_path = PATH.join2(current_path, parts[i]);
  
          // jump to the mount's root node if this is a mountpoint
          if (FS.isMountpoint(current)) {
            if (!islast || (islast && opts.follow_mount)) {
              current = current.mounted.root;
            }
          }
  
          // by default, lookupPath will not follow a symlink if it is the final path component.
          // setting opts.follow = true will override this behavior.
          if (!islast || opts.follow) {
            var count = 0;
            while (FS.isLink(current.mode)) {
              var link = FS.readlink(current_path);
              current_path = PATH.resolve(PATH.dirname(current_path), link);
  
              var lookup = FS.lookupPath(current_path, { recurse_count: opts.recurse_count });
              current = lookup.node;
  
              if (count++ > 40) {  // limit max consecutive symlinks to 40 (SYMLOOP_MAX).
                throw new FS.ErrnoError(ERRNO_CODES.ELOOP);
              }
            }
          }
        }
  
        return { path: current_path, node: current };
      },getPath:function (node) {
        var path;
        while (true) {
          if (FS.isRoot(node)) {
            var mount = node.mount.mountpoint;
            if (!path) return mount;
            return mount[mount.length-1] !== '/' ? mount + '/' + path : mount + path;
          }
          path = path ? node.name + '/' + path : node.name;
          node = node.parent;
        }
      },hashName:function (parentid, name) {
        var hash = 0;
  
  
        for (var i = 0; i < name.length; i++) {
          hash = ((hash << 5) - hash + name.charCodeAt(i)) | 0;
        }
        return ((parentid + hash) >>> 0) % FS.nameTable.length;
      },hashAddNode:function (node) {
        var hash = FS.hashName(node.parent.id, node.name);
        node.name_next = FS.nameTable[hash];
        FS.nameTable[hash] = node;
      },hashRemoveNode:function (node) {
        var hash = FS.hashName(node.parent.id, node.name);
        if (FS.nameTable[hash] === node) {
          FS.nameTable[hash] = node.name_next;
        } else {
          var current = FS.nameTable[hash];
          while (current) {
            if (current.name_next === node) {
              current.name_next = node.name_next;
              break;
            }
            current = current.name_next;
          }
        }
      },lookupNode:function (parent, name) {
        var err = FS.mayLookup(parent);
        if (err) {
          throw new FS.ErrnoError(err, parent);
        }
        var hash = FS.hashName(parent.id, name);
        for (var node = FS.nameTable[hash]; node; node = node.name_next) {
          var nodeName = node.name;
          if (node.parent.id === parent.id && nodeName === name) {
            return node;
          }
        }
        // if we failed to find it in the cache, call into the VFS
        return FS.lookup(parent, name);
      },createNode:function (parent, name, mode, rdev) {
        if (!FS.FSNode) {
          FS.FSNode = function(parent, name, mode, rdev) {
            if (!parent) {
              parent = this;  // root node sets parent to itself
            }
            this.parent = parent;
            this.mount = parent.mount;
            this.mounted = null;
            this.id = FS.nextInode++;
            this.name = name;
            this.mode = mode;
            this.node_ops = {};
            this.stream_ops = {};
            this.rdev = rdev;
          };
  
          FS.FSNode.prototype = {};
  
          // compatibility
          var readMode = 292 | 73;
          var writeMode = 146;
  
          // NOTE we must use Object.defineProperties instead of individual calls to
          // Object.defineProperty in order to make closure compiler happy
          Object.defineProperties(FS.FSNode.prototype, {
            read: {
              get: function() { return (this.mode & readMode) === readMode; },
              set: function(val) { val ? this.mode |= readMode : this.mode &= ~readMode; }
            },
            write: {
              get: function() { return (this.mode & writeMode) === writeMode; },
              set: function(val) { val ? this.mode |= writeMode : this.mode &= ~writeMode; }
            },
            isFolder: {
              get: function() { return FS.isDir(this.mode); }
            },
            isDevice: {
              get: function() { return FS.isChrdev(this.mode); }
            }
          });
        }
  
        var node = new FS.FSNode(parent, name, mode, rdev);
  
        FS.hashAddNode(node);
  
        return node;
      },destroyNode:function (node) {
        FS.hashRemoveNode(node);
      },isRoot:function (node) {
        return node === node.parent;
      },isMountpoint:function (node) {
        return !!node.mounted;
      },isFile:function (mode) {
        return (mode & 61440) === 32768;
      },isDir:function (mode) {
        return (mode & 61440) === 16384;
      },isLink:function (mode) {
        return (mode & 61440) === 40960;
      },isChrdev:function (mode) {
        return (mode & 61440) === 8192;
      },isBlkdev:function (mode) {
        return (mode & 61440) === 24576;
      },isFIFO:function (mode) {
        return (mode & 61440) === 4096;
      },isSocket:function (mode) {
        return (mode & 49152) === 49152;
      },flagModes:{"r":0,"rs":1052672,"r+":2,"w":577,"wx":705,"xw":705,"w+":578,"wx+":706,"xw+":706,"a":1089,"ax":1217,"xa":1217,"a+":1090,"ax+":1218,"xa+":1218},modeStringToFlags:function (str) {
        var flags = FS.flagModes[str];
        if (typeof flags === 'undefined') {
          throw new Error('Unknown file open mode: ' + str);
        }
        return flags;
      },flagsToPermissionString:function (flag) {
        var perms = ['r', 'w', 'rw'][flag & 3];
        if ((flag & 512)) {
          perms += 'w';
        }
        return perms;
      },nodePermissions:function (node, perms) {
        if (FS.ignorePermissions) {
          return 0;
        }
        // return 0 if any user, group or owner bits are set.
        if (perms.indexOf('r') !== -1 && !(node.mode & 292)) {
          return ERRNO_CODES.EACCES;
        } else if (perms.indexOf('w') !== -1 && !(node.mode & 146)) {
          return ERRNO_CODES.EACCES;
        } else if (perms.indexOf('x') !== -1 && !(node.mode & 73)) {
          return ERRNO_CODES.EACCES;
        }
        return 0;
      },mayLookup:function (dir) {
        var err = FS.nodePermissions(dir, 'x');
        if (err) return err;
        if (!dir.node_ops.lookup) return ERRNO_CODES.EACCES;
        return 0;
      },mayCreate:function (dir, name) {
        try {
          var node = FS.lookupNode(dir, name);
          return ERRNO_CODES.EEXIST;
        } catch (e) {
        }
        return FS.nodePermissions(dir, 'wx');
      },mayDelete:function (dir, name, isdir) {
        var node;
        try {
          node = FS.lookupNode(dir, name);
        } catch (e) {
          return e.errno;
        }
        var err = FS.nodePermissions(dir, 'wx');
        if (err) {
          return err;
        }
        if (isdir) {
          if (!FS.isDir(node.mode)) {
            return ERRNO_CODES.ENOTDIR;
          }
          if (FS.isRoot(node) || FS.getPath(node) === FS.cwd()) {
            return ERRNO_CODES.EBUSY;
          }
        } else {
          if (FS.isDir(node.mode)) {
            return ERRNO_CODES.EISDIR;
          }
        }
        return 0;
      },mayOpen:function (node, flags) {
        if (!node) {
          return ERRNO_CODES.ENOENT;
        }
        if (FS.isLink(node.mode)) {
          return ERRNO_CODES.ELOOP;
        } else if (FS.isDir(node.mode)) {
          if (FS.flagsToPermissionString(flags) !== 'r' || // opening for write
              (flags & 512)) { // TODO: check for O_SEARCH? (== search for dir only)
            return ERRNO_CODES.EISDIR;
          }
        }
        return FS.nodePermissions(node, FS.flagsToPermissionString(flags));
      },MAX_OPEN_FDS:4096,nextfd:function (fd_start, fd_end) {
        fd_start = fd_start || 0;
        fd_end = fd_end || FS.MAX_OPEN_FDS;
        for (var fd = fd_start; fd <= fd_end; fd++) {
          if (!FS.streams[fd]) {
            return fd;
          }
        }
        throw new FS.ErrnoError(ERRNO_CODES.EMFILE);
      },getStream:function (fd) {
        return FS.streams[fd];
      },createStream:function (stream, fd_start, fd_end) {
        if (!FS.FSStream) {
          FS.FSStream = function(){};
          FS.FSStream.prototype = {};
          // compatibility
          Object.defineProperties(FS.FSStream.prototype, {
            object: {
              get: function() { return this.node; },
              set: function(val) { this.node = val; }
            },
            isRead: {
              get: function() { return (this.flags & 2097155) !== 1; }
            },
            isWrite: {
              get: function() { return (this.flags & 2097155) !== 0; }
            },
            isAppend: {
              get: function() { return (this.flags & 1024); }
            }
          });
        }
        // clone it, so we can return an instance of FSStream
        var newStream = new FS.FSStream();
        for (var p in stream) {
          newStream[p] = stream[p];
        }
        stream = newStream;
        var fd = FS.nextfd(fd_start, fd_end);
        stream.fd = fd;
        FS.streams[fd] = stream;
        return stream;
      },closeStream:function (fd) {
        FS.streams[fd] = null;
      },chrdev_stream_ops:{open:function (stream) {
          var device = FS.getDevice(stream.node.rdev);
          // override node's stream ops with the device's
          stream.stream_ops = device.stream_ops;
          // forward the open call
          if (stream.stream_ops.open) {
            stream.stream_ops.open(stream);
          }
        },llseek:function () {
          throw new FS.ErrnoError(ERRNO_CODES.ESPIPE);
        }},major:function (dev) {
        return ((dev) >> 8);
      },minor:function (dev) {
        return ((dev) & 0xff);
      },makedev:function (ma, mi) {
        return ((ma) << 8 | (mi));
      },registerDevice:function (dev, ops) {
        FS.devices[dev] = { stream_ops: ops };
      },getDevice:function (dev) {
        return FS.devices[dev];
      },getMounts:function (mount) {
        var mounts = [];
        var check = [mount];
  
        while (check.length) {
          var m = check.pop();
  
          mounts.push(m);
  
          check.push.apply(check, m.mounts);
        }
  
        return mounts;
      },syncfs:function (populate, callback) {
        if (typeof(populate) === 'function') {
          callback = populate;
          populate = false;
        }
  
        FS.syncFSRequests++;
  
        if (FS.syncFSRequests > 1) {
          console.log('warning: ' + FS.syncFSRequests + ' FS.syncfs operations in flight at once, probably just doing extra work');
        }
  
        var mounts = FS.getMounts(FS.root.mount);
        var completed = 0;
  
        function doCallback(err) {
          assert(FS.syncFSRequests > 0);
          FS.syncFSRequests--;
          return callback(err);
        }
  
        function done(err) {
          if (err) {
            if (!done.errored) {
              done.errored = true;
              return doCallback(err);
            }
            return;
          }
          if (++completed >= mounts.length) {
            doCallback(null);
          }
        };
  
        // sync all mounts
        mounts.forEach(function (mount) {
          if (!mount.type.syncfs) {
            return done(null);
          }
          mount.type.syncfs(mount, populate, done);
        });
      },mount:function (type, opts, mountpoint) {
        var root = mountpoint === '/';
        var pseudo = !mountpoint;
        var node;
  
        if (root && FS.root) {
          throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
        } else if (!root && !pseudo) {
          var lookup = FS.lookupPath(mountpoint, { follow_mount: false });
  
          mountpoint = lookup.path;  // use the absolute path
          node = lookup.node;
  
          if (FS.isMountpoint(node)) {
            throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
          }
  
          if (!FS.isDir(node.mode)) {
            throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR);
          }
        }
  
        var mount = {
          type: type,
          opts: opts,
          mountpoint: mountpoint,
          mounts: []
        };
  
        // create a root node for the fs
        var mountRoot = type.mount(mount);
        mountRoot.mount = mount;
        mount.root = mountRoot;
  
        if (root) {
          FS.root = mountRoot;
        } else if (node) {
          // set as a mountpoint
          node.mounted = mount;
  
          // add the new mount to the current mount's children
          if (node.mount) {
            node.mount.mounts.push(mount);
          }
        }
  
        return mountRoot;
      },unmount:function (mountpoint) {
        var lookup = FS.lookupPath(mountpoint, { follow_mount: false });
  
        if (!FS.isMountpoint(lookup.node)) {
          throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
        }
  
        // destroy the nodes for this mount, and all its child mounts
        var node = lookup.node;
        var mount = node.mounted;
        var mounts = FS.getMounts(mount);
  
        Object.keys(FS.nameTable).forEach(function (hash) {
          var current = FS.nameTable[hash];
  
          while (current) {
            var next = current.name_next;
  
            if (mounts.indexOf(current.mount) !== -1) {
              FS.destroyNode(current);
            }
  
            current = next;
          }
        });
  
        // no longer a mountpoint
        node.mounted = null;
  
        // remove this mount from the child mounts
        var idx = node.mount.mounts.indexOf(mount);
        assert(idx !== -1);
        node.mount.mounts.splice(idx, 1);
      },lookup:function (parent, name) {
        return parent.node_ops.lookup(parent, name);
      },mknod:function (path, mode, dev) {
        var lookup = FS.lookupPath(path, { parent: true });
        var parent = lookup.node;
        var name = PATH.basename(path);
        if (!name || name === '.' || name === '..') {
          throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
        }
        var err = FS.mayCreate(parent, name);
        if (err) {
          throw new FS.ErrnoError(err);
        }
        if (!parent.node_ops.mknod) {
          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
        }
        return parent.node_ops.mknod(parent, name, mode, dev);
      },create:function (path, mode) {
        mode = mode !== undefined ? mode : 438 /* 0666 */;
        mode &= 4095;
        mode |= 32768;
        return FS.mknod(path, mode, 0);
      },mkdir:function (path, mode) {
        mode = mode !== undefined ? mode : 511 /* 0777 */;
        mode &= 511 | 512;
        mode |= 16384;
        return FS.mknod(path, mode, 0);
      },mkdirTree:function (path, mode) {
        var dirs = path.split('/');
        var d = '';
        for (var i = 0; i < dirs.length; ++i) {
          if (!dirs[i]) continue;
          d += '/' + dirs[i];
          try {
            FS.mkdir(d, mode);
          } catch(e) {
            if (e.errno != ERRNO_CODES.EEXIST) throw e;
          }
        }
      },mkdev:function (path, mode, dev) {
        if (typeof(dev) === 'undefined') {
          dev = mode;
          mode = 438 /* 0666 */;
        }
        mode |= 8192;
        return FS.mknod(path, mode, dev);
      },symlink:function (oldpath, newpath) {
        if (!PATH.resolve(oldpath)) {
          throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
        }
        var lookup = FS.lookupPath(newpath, { parent: true });
        var parent = lookup.node;
        if (!parent) {
          throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
        }
        var newname = PATH.basename(newpath);
        var err = FS.mayCreate(parent, newname);
        if (err) {
          throw new FS.ErrnoError(err);
        }
        if (!parent.node_ops.symlink) {
          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
        }
        return parent.node_ops.symlink(parent, newname, oldpath);
      },rename:function (old_path, new_path) {
        var old_dirname = PATH.dirname(old_path);
        var new_dirname = PATH.dirname(new_path);
        var old_name = PATH.basename(old_path);
        var new_name = PATH.basename(new_path);
        // parents must exist
        var lookup, old_dir, new_dir;
        try {
          lookup = FS.lookupPath(old_path, { parent: true });
          old_dir = lookup.node;
          lookup = FS.lookupPath(new_path, { parent: true });
          new_dir = lookup.node;
        } catch (e) {
          throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
        }
        if (!old_dir || !new_dir) throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
        // need to be part of the same mount
        if (old_dir.mount !== new_dir.mount) {
          throw new FS.ErrnoError(ERRNO_CODES.EXDEV);
        }
        // source must exist
        var old_node = FS.lookupNode(old_dir, old_name);
        // old path should not be an ancestor of the new path
        var relative = PATH.relative(old_path, new_dirname);
        if (relative.charAt(0) !== '.') {
          throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
        }
        // new path should not be an ancestor of the old path
        relative = PATH.relative(new_path, old_dirname);
        if (relative.charAt(0) !== '.') {
          throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY);
        }
        // see if the new path already exists
        var new_node;
        try {
          new_node = FS.lookupNode(new_dir, new_name);
        } catch (e) {
          // not fatal
        }
        // early out if nothing needs to change
        if (old_node === new_node) {
          return;
        }
        // we'll need to delete the old entry
        var isdir = FS.isDir(old_node.mode);
        var err = FS.mayDelete(old_dir, old_name, isdir);
        if (err) {
          throw new FS.ErrnoError(err);
        }
        // need delete permissions if we'll be overwriting.
        // need create permissions if new doesn't already exist.
        err = new_node ?
          FS.mayDelete(new_dir, new_name, isdir) :
          FS.mayCreate(new_dir, new_name);
        if (err) {
          throw new FS.ErrnoError(err);
        }
        if (!old_dir.node_ops.rename) {
          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
        }
        if (FS.isMountpoint(old_node) || (new_node && FS.isMountpoint(new_node))) {
          throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
        }
        // if we are going to change the parent, check write permissions
        if (new_dir !== old_dir) {
          err = FS.nodePermissions(old_dir, 'w');
          if (err) {
            throw new FS.ErrnoError(err);
          }
        }
        try {
          if (FS.trackingDelegate['willMovePath']) {
            FS.trackingDelegate['willMovePath'](old_path, new_path);
          }
        } catch(e) {
          console.log("FS.trackingDelegate['willMovePath']('"+old_path+"', '"+new_path+"') threw an exception: " + e.message);
        }
        // remove the node from the lookup hash
        FS.hashRemoveNode(old_node);
        // do the underlying fs rename
        try {
          old_dir.node_ops.rename(old_node, new_dir, new_name);
        } catch (e) {
          throw e;
        } finally {
          // add the node back to the hash (in case node_ops.rename
          // changed its name)
          FS.hashAddNode(old_node);
        }
        try {
          if (FS.trackingDelegate['onMovePath']) FS.trackingDelegate['onMovePath'](old_path, new_path);
        } catch(e) {
          console.log("FS.trackingDelegate['onMovePath']('"+old_path+"', '"+new_path+"') threw an exception: " + e.message);
        }
      },rmdir:function (path) {
        var lookup = FS.lookupPath(path, { parent: true });
        var parent = lookup.node;
        var name = PATH.basename(path);
        var node = FS.lookupNode(parent, name);
        var err = FS.mayDelete(parent, name, true);
        if (err) {
          throw new FS.ErrnoError(err);
        }
        if (!parent.node_ops.rmdir) {
          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
        }
        if (FS.isMountpoint(node)) {
          throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
        }
        try {
          if (FS.trackingDelegate['willDeletePath']) {
            FS.trackingDelegate['willDeletePath'](path);
          }
        } catch(e) {
          console.log("FS.trackingDelegate['willDeletePath']('"+path+"') threw an exception: " + e.message);
        }
        parent.node_ops.rmdir(parent, name);
        FS.destroyNode(node);
        try {
          if (FS.trackingDelegate['onDeletePath']) FS.trackingDelegate['onDeletePath'](path);
        } catch(e) {
          console.log("FS.trackingDelegate['onDeletePath']('"+path+"') threw an exception: " + e.message);
        }
      },readdir:function (path) {
        var lookup = FS.lookupPath(path, { follow: true });
        var node = lookup.node;
        if (!node.node_ops.readdir) {
          throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR);
        }
        return node.node_ops.readdir(node);
      },unlink:function (path) {
        var lookup = FS.lookupPath(path, { parent: true });
        var parent = lookup.node;
        var name = PATH.basename(path);
        var node = FS.lookupNode(parent, name);
        var err = FS.mayDelete(parent, name, false);
        if (err) {
          // According to POSIX, we should map EISDIR to EPERM, but
          // we instead do what Linux does (and we must, as we use
          // the musl linux libc).
          throw new FS.ErrnoError(err);
        }
        if (!parent.node_ops.unlink) {
          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
        }
        if (FS.isMountpoint(node)) {
          throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
        }
        try {
          if (FS.trackingDelegate['willDeletePath']) {
            FS.trackingDelegate['willDeletePath'](path);
          }
        } catch(e) {
          console.log("FS.trackingDelegate['willDeletePath']('"+path+"') threw an exception: " + e.message);
        }
        parent.node_ops.unlink(parent, name);
        FS.destroyNode(node);
        try {
          if (FS.trackingDelegate['onDeletePath']) FS.trackingDelegate['onDeletePath'](path);
        } catch(e) {
          console.log("FS.trackingDelegate['onDeletePath']('"+path+"') threw an exception: " + e.message);
        }
      },readlink:function (path) {
        var lookup = FS.lookupPath(path);
        var link = lookup.node;
        if (!link) {
          throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
        }
        if (!link.node_ops.readlink) {
          throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
        }
        return PATH.resolve(FS.getPath(link.parent), link.node_ops.readlink(link));
      },stat:function (path, dontFollow) {
        var lookup = FS.lookupPath(path, { follow: !dontFollow });
        var node = lookup.node;
        if (!node) {
          throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
        }
        if (!node.node_ops.getattr) {
          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
        }
        return node.node_ops.getattr(node);
      },lstat:function (path) {
        return FS.stat(path, true);
      },chmod:function (path, mode, dontFollow) {
        var node;
        if (typeof path === 'string') {
          var lookup = FS.lookupPath(path, { follow: !dontFollow });
          node = lookup.node;
        } else {
          node = path;
        }
        if (!node.node_ops.setattr) {
          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
        }
        node.node_ops.setattr(node, {
          mode: (mode & 4095) | (node.mode & ~4095),
          timestamp: Date.now()
        });
      },lchmod:function (path, mode) {
        FS.chmod(path, mode, true);
      },fchmod:function (fd, mode) {
        var stream = FS.getStream(fd);
        if (!stream) {
          throw new FS.ErrnoError(ERRNO_CODES.EBADF);
        }
        FS.chmod(stream.node, mode);
      },chown:function (path, uid, gid, dontFollow) {
        var node;
        if (typeof path === 'string') {
          var lookup = FS.lookupPath(path, { follow: !dontFollow });
          node = lookup.node;
        } else {
          node = path;
        }
        if (!node.node_ops.setattr) {
          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
        }
        node.node_ops.setattr(node, {
          timestamp: Date.now()
          // we ignore the uid / gid for now
        });
      },lchown:function (path, uid, gid) {
        FS.chown(path, uid, gid, true);
      },fchown:function (fd, uid, gid) {
        var stream = FS.getStream(fd);
        if (!stream) {
          throw new FS.ErrnoError(ERRNO_CODES.EBADF);
        }
        FS.chown(stream.node, uid, gid);
      },truncate:function (path, len) {
        if (len < 0) {
          throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
        }
        var node;
        if (typeof path === 'string') {
          var lookup = FS.lookupPath(path, { follow: true });
          node = lookup.node;
        } else {
          node = path;
        }
        if (!node.node_ops.setattr) {
          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
        }
        if (FS.isDir(node.mode)) {
          throw new FS.ErrnoError(ERRNO_CODES.EISDIR);
        }
        if (!FS.isFile(node.mode)) {
          throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
        }
        var err = FS.nodePermissions(node, 'w');
        if (err) {
          throw new FS.ErrnoError(err);
        }
        node.node_ops.setattr(node, {
          size: len,
          timestamp: Date.now()
        });
      },ftruncate:function (fd, len) {
        var stream = FS.getStream(fd);
        if (!stream) {
          throw new FS.ErrnoError(ERRNO_CODES.EBADF);
        }
        if ((stream.flags & 2097155) === 0) {
          throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
        }
        FS.truncate(stream.node, len);
      },utime:function (path, atime, mtime) {
        var lookup = FS.lookupPath(path, { follow: true });
        var node = lookup.node;
        node.node_ops.setattr(node, {
          timestamp: Math.max(atime, mtime)
        });
      },open:function (path, flags, mode, fd_start, fd_end) {
        if (path === "") {
          throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
        }
        flags = typeof flags === 'string' ? FS.modeStringToFlags(flags) : flags;
        mode = typeof mode === 'undefined' ? 438 /* 0666 */ : mode;
        if ((flags & 64)) {
          mode = (mode & 4095) | 32768;
        } else {
          mode = 0;
        }
        var node;
        if (typeof path === 'object') {
          node = path;
        } else {
          path = PATH.normalize(path);
          try {
            var lookup = FS.lookupPath(path, {
              follow: !(flags & 131072)
            });
            node = lookup.node;
          } catch (e) {
            // ignore
          }
        }
        // perhaps we need to create the node
        var created = false;
        if ((flags & 64)) {
          if (node) {
            // if O_CREAT and O_EXCL are set, error out if the node already exists
            if ((flags & 128)) {
              throw new FS.ErrnoError(ERRNO_CODES.EEXIST);
            }
          } else {
            // node doesn't exist, try to create it
            node = FS.mknod(path, mode, 0);
            created = true;
          }
        }
        if (!node) {
          throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
        }
        // can't truncate a device
        if (FS.isChrdev(node.mode)) {
          flags &= ~512;
        }
        // if asked only for a directory, then this must be one
        if ((flags & 65536) && !FS.isDir(node.mode)) {
          throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR);
        }
        // check permissions, if this is not a file we just created now (it is ok to
        // create and write to a file with read-only permissions; it is read-only
        // for later use)
        if (!created) {
          var err = FS.mayOpen(node, flags);
          if (err) {
            throw new FS.ErrnoError(err);
          }
        }
        // do truncation if necessary
        if ((flags & 512)) {
          FS.truncate(node, 0);
        }
        // we've already handled these, don't pass down to the underlying vfs
        flags &= ~(128 | 512);
  
        // register the stream with the filesystem
        var stream = FS.createStream({
          node: node,
          path: FS.getPath(node),  // we want the absolute path to the node
          flags: flags,
          seekable: true,
          position: 0,
          stream_ops: node.stream_ops,
          // used by the file family libc calls (fopen, fwrite, ferror, etc.)
          ungotten: [],
          error: false
        }, fd_start, fd_end);
        // call the new stream's open function
        if (stream.stream_ops.open) {
          stream.stream_ops.open(stream);
        }
        if (Module['logReadFiles'] && !(flags & 1)) {
          if (!FS.readFiles) FS.readFiles = {};
          if (!(path in FS.readFiles)) {
            FS.readFiles[path] = 1;
            Module['printErr']('read file: ' + path);
          }
        }
        try {
          if (FS.trackingDelegate['onOpenFile']) {
            var trackingFlags = 0;
            if ((flags & 2097155) !== 1) {
              trackingFlags |= FS.tracking.openFlags.READ;
            }
            if ((flags & 2097155) !== 0) {
              trackingFlags |= FS.tracking.openFlags.WRITE;
            }
            FS.trackingDelegate['onOpenFile'](path, trackingFlags);
          }
        } catch(e) {
          console.log("FS.trackingDelegate['onOpenFile']('"+path+"', flags) threw an exception: " + e.message);
        }
        return stream;
      },close:function (stream) {
        if (stream.getdents) stream.getdents = null; // free readdir state
        try {
          if (stream.stream_ops.close) {
            stream.stream_ops.close(stream);
          }
        } catch (e) {
          throw e;
        } finally {
          FS.closeStream(stream.fd);
        }
      },llseek:function (stream, offset, whence) {
        if (!stream.seekable || !stream.stream_ops.llseek) {
          throw new FS.ErrnoError(ERRNO_CODES.ESPIPE);
        }
        stream.position = stream.stream_ops.llseek(stream, offset, whence);
        stream.ungotten = [];
        return stream.position;
      },read:function (stream, buffer, offset, length, position) {
        if (length < 0 || position < 0) {
          throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
        }
        if ((stream.flags & 2097155) === 1) {
          throw new FS.ErrnoError(ERRNO_CODES.EBADF);
        }
        if (FS.isDir(stream.node.mode)) {
          throw new FS.ErrnoError(ERRNO_CODES.EISDIR);
        }
        if (!stream.stream_ops.read) {
          throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
        }
        var seeking = true;
        if (typeof position === 'undefined') {
          position = stream.position;
          seeking = false;
        } else if (!stream.seekable) {
          throw new FS.ErrnoError(ERRNO_CODES.ESPIPE);
        }
        var bytesRead = stream.stream_ops.read(stream, buffer, offset, length, position);
        if (!seeking) stream.position += bytesRead;
        return bytesRead;
      },write:function (stream, buffer, offset, length, position, canOwn) {
        if (length < 0 || position < 0) {
          throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
        }
        if ((stream.flags & 2097155) === 0) {
          throw new FS.ErrnoError(ERRNO_CODES.EBADF);
        }
        if (FS.isDir(stream.node.mode)) {
          throw new FS.ErrnoError(ERRNO_CODES.EISDIR);
        }
        if (!stream.stream_ops.write) {
          throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
        }
        if (stream.flags & 1024) {
          // seek to the end before writing in append mode
          FS.llseek(stream, 0, 2);
        }
        var seeking = true;
        if (typeof position === 'undefined') {
          position = stream.position;
          seeking = false;
        } else if (!stream.seekable) {
          throw new FS.ErrnoError(ERRNO_CODES.ESPIPE);
        }
        var bytesWritten = stream.stream_ops.write(stream, buffer, offset, length, position, canOwn);
        if (!seeking) stream.position += bytesWritten;
        try {
          if (stream.path && FS.trackingDelegate['onWriteToFile']) FS.trackingDelegate['onWriteToFile'](stream.path);
        } catch(e) {
          console.log("FS.trackingDelegate['onWriteToFile']('"+path+"') threw an exception: " + e.message);
        }
        return bytesWritten;
      },allocate:function (stream, offset, length) {
        if (offset < 0 || length <= 0) {
          throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
        }
        if ((stream.flags & 2097155) === 0) {
          throw new FS.ErrnoError(ERRNO_CODES.EBADF);
        }
        if (!FS.isFile(stream.node.mode) && !FS.isDir(node.mode)) {
          throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
        }
        if (!stream.stream_ops.allocate) {
          throw new FS.ErrnoError(ERRNO_CODES.EOPNOTSUPP);
        }
        stream.stream_ops.allocate(stream, offset, length);
      },mmap:function (stream, buffer, offset, length, position, prot, flags) {
        // TODO if PROT is PROT_WRITE, make sure we have write access
        if ((stream.flags & 2097155) === 1) {
          throw new FS.ErrnoError(ERRNO_CODES.EACCES);
        }
        if (!stream.stream_ops.mmap) {
          throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
        }
        return stream.stream_ops.mmap(stream, buffer, offset, length, position, prot, flags);
      },msync:function (stream, buffer, offset, length, mmapFlags) {
        if (!stream || !stream.stream_ops.msync) {
          return 0;
        }
        return stream.stream_ops.msync(stream, buffer, offset, length, mmapFlags);
      },munmap:function (stream) {
        return 0;
      },ioctl:function (stream, cmd, arg) {
        if (!stream.stream_ops.ioctl) {
          throw new FS.ErrnoError(ERRNO_CODES.ENOTTY);
        }
        return stream.stream_ops.ioctl(stream, cmd, arg);
      },readFile:function (path, opts) {
        opts = opts || {};
        opts.flags = opts.flags || 'r';
        opts.encoding = opts.encoding || 'binary';
        if (opts.encoding !== 'utf8' && opts.encoding !== 'binary') {
          throw new Error('Invalid encoding type "' + opts.encoding + '"');
        }
        var ret;
        var stream = FS.open(path, opts.flags);
        var stat = FS.stat(path);
        var length = stat.size;
        var buf = new Uint8Array(length);
        FS.read(stream, buf, 0, length, 0);
        if (opts.encoding === 'utf8') {
          ret = UTF8ArrayToString(buf, 0);
        } else if (opts.encoding === 'binary') {
          ret = buf;
        }
        FS.close(stream);
        return ret;
      },writeFile:function (path, data, opts) {
        opts = opts || {};
        opts.flags = opts.flags || 'w';
        opts.encoding = opts.encoding || 'utf8';
        if (opts.encoding !== 'utf8' && opts.encoding !== 'binary') {
          throw new Error('Invalid encoding type "' + opts.encoding + '"');
        }
        var stream = FS.open(path, opts.flags, opts.mode);
        if (opts.encoding === 'utf8') {
          var buf = new Uint8Array(lengthBytesUTF8(data)+1);
          var actualNumBytes = stringToUTF8Array(data, buf, 0, buf.length);
          FS.write(stream, buf, 0, actualNumBytes, 0, opts.canOwn);
        } else if (opts.encoding === 'binary') {
          FS.write(stream, data, 0, data.length, 0, opts.canOwn);
        }
        FS.close(stream);
      },cwd:function () {
        return FS.currentPath;
      },chdir:function (path) {
        var lookup = FS.lookupPath(path, { follow: true });
        if (lookup.node === null) {
          throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
        }
        if (!FS.isDir(lookup.node.mode)) {
          throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR);
        }
        var err = FS.nodePermissions(lookup.node, 'x');
        if (err) {
          throw new FS.ErrnoError(err);
        }
        FS.currentPath = lookup.path;
      },createDefaultDirectories:function () {
        FS.mkdir('/tmp');
        FS.mkdir('/home');
        FS.mkdir('/home/web_user');
      },createDefaultDevices:function () {
        // create /dev
        FS.mkdir('/dev');
        // setup /dev/null
        FS.registerDevice(FS.makedev(1, 3), {
          read: function() { return 0; },
          write: function(stream, buffer, offset, length, pos) { return length; }
        });
        FS.mkdev('/dev/null', FS.makedev(1, 3));
        // setup /dev/tty and /dev/tty1
        // stderr needs to print output using Module['printErr']
        // so we register a second tty just for it.
        TTY.register(FS.makedev(5, 0), TTY.default_tty_ops);
        TTY.register(FS.makedev(6, 0), TTY.default_tty1_ops);
        FS.mkdev('/dev/tty', FS.makedev(5, 0));
        FS.mkdev('/dev/tty1', FS.makedev(6, 0));
        // setup /dev/[u]random
        var random_device;
        if (typeof crypto !== 'undefined') {
          // for modern web browsers
          var randomBuffer = new Uint8Array(1);
          random_device = function() { crypto.getRandomValues(randomBuffer); return randomBuffer[0]; };
        } else if (ENVIRONMENT_IS_NODE) {
          // for nodejs
          random_device = function() { return require('crypto').randomBytes(1)[0]; };
        } else {
          // default for ES5 platforms
          random_device = function() { return (Math.random()*256)|0; };
        }
        FS.createDevice('/dev', 'random', random_device);
        FS.createDevice('/dev', 'urandom', random_device);
        // we're not going to emulate the actual shm device,
        // just create the tmp dirs that reside in it commonly
        FS.mkdir('/dev/shm');
        FS.mkdir('/dev/shm/tmp');
      },createSpecialDirectories:function () {
        // create /proc/self/fd which allows /proc/self/fd/6 => readlink gives the name of the stream for fd 6 (see test_unistd_ttyname)
        FS.mkdir('/proc');
        FS.mkdir('/proc/self');
        FS.mkdir('/proc/self/fd');
        FS.mount({
          mount: function() {
            var node = FS.createNode('/proc/self', 'fd', 16384 | 511 /* 0777 */, 73);
            node.node_ops = {
              lookup: function(parent, name) {
                var fd = +name;
                var stream = FS.getStream(fd);
                if (!stream) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
                var ret = {
                  parent: null,
                  mount: { mountpoint: 'fake' },
                  node_ops: { readlink: function() { return stream.path } }
                };
                ret.parent = ret; // make it look like a simple root node
                return ret;
              }
            };
            return node;
          }
        }, {}, '/proc/self/fd');
      },createStandardStreams:function () {
        // TODO deprecate the old functionality of a single
        // input / output callback and that utilizes FS.createDevice
        // and instead require a unique set of stream ops
  
        // by default, we symlink the standard streams to the
        // default tty devices. however, if the standard streams
        // have been overwritten we create a unique device for
        // them instead.
        if (Module['stdin']) {
          FS.createDevice('/dev', 'stdin', Module['stdin']);
        } else {
          FS.symlink('/dev/tty', '/dev/stdin');
        }
        if (Module['stdout']) {
          FS.createDevice('/dev', 'stdout', null, Module['stdout']);
        } else {
          FS.symlink('/dev/tty', '/dev/stdout');
        }
        if (Module['stderr']) {
          FS.createDevice('/dev', 'stderr', null, Module['stderr']);
        } else {
          FS.symlink('/dev/tty1', '/dev/stderr');
        }
  
        // open default streams for the stdin, stdout and stderr devices
        var stdin = FS.open('/dev/stdin', 'r');
        assert(stdin.fd === 0, 'invalid handle for stdin (' + stdin.fd + ')');
  
        var stdout = FS.open('/dev/stdout', 'w');
        assert(stdout.fd === 1, 'invalid handle for stdout (' + stdout.fd + ')');
  
        var stderr = FS.open('/dev/stderr', 'w');
        assert(stderr.fd === 2, 'invalid handle for stderr (' + stderr.fd + ')');
      },ensureErrnoError:function () {
        if (FS.ErrnoError) return;
        FS.ErrnoError = function ErrnoError(errno, node) {
          //Module.printErr(stackTrace()); // useful for debugging
          this.node = node;
          this.setErrno = function(errno) {
            this.errno = errno;
            for (var key in ERRNO_CODES) {
              if (ERRNO_CODES[key] === errno) {
                this.code = key;
                break;
              }
            }
          };
          this.setErrno(errno);
          this.message = ERRNO_MESSAGES[errno];
          if (this.stack) this.stack = demangleAll(this.stack);
        };
        FS.ErrnoError.prototype = new Error();
        FS.ErrnoError.prototype.constructor = FS.ErrnoError;
        // Some errors may happen quite a bit, to avoid overhead we reuse them (and suffer a lack of stack info)
        [ERRNO_CODES.ENOENT].forEach(function(code) {
          FS.genericErrors[code] = new FS.ErrnoError(code);
          FS.genericErrors[code].stack = '<generic error, no stack>';
        });
      },staticInit:function () {
        FS.ensureErrnoError();
  
        FS.nameTable = new Array(4096);
  
        FS.mount(MEMFS, {}, '/');
  
        FS.createDefaultDirectories();
        FS.createDefaultDevices();
        FS.createSpecialDirectories();
  
        FS.filesystems = {
          'MEMFS': MEMFS,
          'IDBFS': IDBFS,
          'NODEFS': NODEFS,
          'WORKERFS': WORKERFS,
        };
      },init:function (input, output, error) {
        assert(!FS.init.initialized, 'FS.init was previously called. If you want to initialize later with custom parameters, remove any earlier calls (note that one is automatically added to the generated code)');
        FS.init.initialized = true;
  
        FS.ensureErrnoError();
  
        // Allow Module.stdin etc. to provide defaults, if none explicitly passed to us here
        Module['stdin'] = input || Module['stdin'];
        Module['stdout'] = output || Module['stdout'];
        Module['stderr'] = error || Module['stderr'];
  
        FS.createStandardStreams();
      },quit:function () {
        FS.init.initialized = false;
        // force-flush all streams, so we get musl std streams printed out
        var fflush = Module['_fflush'];
        if (fflush) fflush(0);
        // close all of our streams
        for (var i = 0; i < FS.streams.length; i++) {
          var stream = FS.streams[i];
          if (!stream) {
            continue;
          }
          FS.close(stream);
        }
      },getMode:function (canRead, canWrite) {
        var mode = 0;
        if (canRead) mode |= 292 | 73;
        if (canWrite) mode |= 146;
        return mode;
      },joinPath:function (parts, forceRelative) {
        var path = PATH.join.apply(null, parts);
        if (forceRelative && path[0] == '/') path = path.substr(1);
        return path;
      },absolutePath:function (relative, base) {
        return PATH.resolve(base, relative);
      },standardizePath:function (path) {
        return PATH.normalize(path);
      },findObject:function (path, dontResolveLastLink) {
        var ret = FS.analyzePath(path, dontResolveLastLink);
        if (ret.exists) {
          return ret.object;
        } else {
          ___setErrNo(ret.error);
          return null;
        }
      },analyzePath:function (path, dontResolveLastLink) {
        // operate from within the context of the symlink's target
        try {
          var lookup = FS.lookupPath(path, { follow: !dontResolveLastLink });
          path = lookup.path;
        } catch (e) {
        }
        var ret = {
          isRoot: false, exists: false, error: 0, name: null, path: null, object: null,
          parentExists: false, parentPath: null, parentObject: null
        };
        try {
          var lookup = FS.lookupPath(path, { parent: true });
          ret.parentExists = true;
          ret.parentPath = lookup.path;
          ret.parentObject = lookup.node;
          ret.name = PATH.basename(path);
          lookup = FS.lookupPath(path, { follow: !dontResolveLastLink });
          ret.exists = true;
          ret.path = lookup.path;
          ret.object = lookup.node;
          ret.name = lookup.node.name;
          ret.isRoot = lookup.path === '/';
        } catch (e) {
          ret.error = e.errno;
        };
        return ret;
      },createFolder:function (parent, name, canRead, canWrite) {
        var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name);
        var mode = FS.getMode(canRead, canWrite);
        return FS.mkdir(path, mode);
      },createPath:function (parent, path, canRead, canWrite) {
        parent = typeof parent === 'string' ? parent : FS.getPath(parent);
        var parts = path.split('/').reverse();
        while (parts.length) {
          var part = parts.pop();
          if (!part) continue;
          var current = PATH.join2(parent, part);
          try {
            FS.mkdir(current);
          } catch (e) {
            // ignore EEXIST
          }
          parent = current;
        }
        return current;
      },createFile:function (parent, name, properties, canRead, canWrite) {
        var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name);
        var mode = FS.getMode(canRead, canWrite);
        return FS.create(path, mode);
      },createDataFile:function (parent, name, data, canRead, canWrite, canOwn) {
        var path = name ? PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name) : parent;
        var mode = FS.getMode(canRead, canWrite);
        var node = FS.create(path, mode);
        if (data) {
          if (typeof data === 'string') {
            var arr = new Array(data.length);
            for (var i = 0, len = data.length; i < len; ++i) arr[i] = data.charCodeAt(i);
            data = arr;
          }
          // make sure we can write to the file
          FS.chmod(node, mode | 146);
          var stream = FS.open(node, 'w');
          FS.write(stream, data, 0, data.length, 0, canOwn);
          FS.close(stream);
          FS.chmod(node, mode);
        }
        return node;
      },createDevice:function (parent, name, input, output) {
        var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name);
        var mode = FS.getMode(!!input, !!output);
        if (!FS.createDevice.major) FS.createDevice.major = 64;
        var dev = FS.makedev(FS.createDevice.major++, 0);
        // Create a fake device that a set of stream ops to emulate
        // the old behavior.
        FS.registerDevice(dev, {
          open: function(stream) {
            stream.seekable = false;
          },
          close: function(stream) {
            // flush any pending line data
            if (output && output.buffer && output.buffer.length) {
              output(10);
            }
          },
          read: function(stream, buffer, offset, length, pos /* ignored */) {
            var bytesRead = 0;
            for (var i = 0; i < length; i++) {
              var result;
              try {
                result = input();
              } catch (e) {
                throw new FS.ErrnoError(ERRNO_CODES.EIO);
              }
              if (result === undefined && bytesRead === 0) {
                throw new FS.ErrnoError(ERRNO_CODES.EAGAIN);
              }
              if (result === null || result === undefined) break;
              bytesRead++;
              buffer[offset+i] = result;
            }
            if (bytesRead) {
              stream.node.timestamp = Date.now();
            }
            return bytesRead;
          },
          write: function(stream, buffer, offset, length, pos) {
            for (var i = 0; i < length; i++) {
              try {
                output(buffer[offset+i]);
              } catch (e) {
                throw new FS.ErrnoError(ERRNO_CODES.EIO);
              }
            }
            if (length) {
              stream.node.timestamp = Date.now();
            }
            return i;
          }
        });
        return FS.mkdev(path, mode, dev);
      },createLink:function (parent, name, target, canRead, canWrite) {
        var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name);
        return FS.symlink(target, path);
      },forceLoadFile:function (obj) {
        if (obj.isDevice || obj.isFolder || obj.link || obj.contents) return true;
        var success = true;
        if (typeof XMLHttpRequest !== 'undefined') {
          throw new Error("Lazy loading should have been performed (contents set) in createLazyFile, but it was not. Lazy loading only works in web workers. Use --embed-file or --preload-file in emcc on the main thread.");
        } else if (Module['read']) {
          // Command-line.
          try {
            // WARNING: Can't read binary files in V8's d8 or tracemonkey's js, as
            //          read() will try to parse UTF8.
            obj.contents = intArrayFromString(Module['read'](obj.url), true);
            obj.usedBytes = obj.contents.length;
          } catch (e) {
            success = false;
          }
        } else {
          throw new Error('Cannot load without read() or XMLHttpRequest.');
        }
        if (!success) ___setErrNo(ERRNO_CODES.EIO);
        return success;
      },createLazyFile:function (parent, name, url, canRead, canWrite) {
        // Lazy chunked Uint8Array (implements get and length from Uint8Array). Actual getting is abstracted away for eventual reuse.
        function LazyUint8Array() {
          this.lengthKnown = false;
          this.chunks = []; // Loaded chunks. Index is the chunk number
        }
        LazyUint8Array.prototype.get = function LazyUint8Array_get(idx) {
          if (idx > this.length-1 || idx < 0) {
            return undefined;
          }
          var chunkOffset = idx % this.chunkSize;
          var chunkNum = (idx / this.chunkSize)|0;
          return this.getter(chunkNum)[chunkOffset];
        }
        LazyUint8Array.prototype.setDataGetter = function LazyUint8Array_setDataGetter(getter) {
          this.getter = getter;
        }
        LazyUint8Array.prototype.cacheLength = function LazyUint8Array_cacheLength() {
          // Find length
          var xhr = new XMLHttpRequest();
          xhr.open('HEAD', url, false);
          xhr.send(null);
          if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status);
          var datalength = Number(xhr.getResponseHeader("Content-length"));
          var header;
          var hasByteServing = (header = xhr.getResponseHeader("Accept-Ranges")) && header === "bytes";
          var usesGzip = (header = xhr.getResponseHeader("Content-Encoding")) && header === "gzip";
  
          var chunkSize = 1024*1024; // Chunk size in bytes
  
          if (!hasByteServing) chunkSize = datalength;
  
          // Function to get a range from the remote URL.
          var doXHR = (function(from, to) {
            if (from > to) throw new Error("invalid range (" + from + ", " + to + ") or no bytes requested!");
            if (to > datalength-1) throw new Error("only " + datalength + " bytes available! programmer error!");
  
            // TODO: Use mozResponseArrayBuffer, responseStream, etc. if available.
            var xhr = new XMLHttpRequest();
            xhr.open('GET', url, false);
            if (datalength !== chunkSize) xhr.setRequestHeader("Range", "bytes=" + from + "-" + to);
  
            // Some hints to the browser that we want binary data.
            if (typeof Uint8Array != 'undefined') xhr.responseType = 'arraybuffer';
            if (xhr.overrideMimeType) {
              xhr.overrideMimeType('text/plain; charset=x-user-defined');
            }
  
            xhr.send(null);
            if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status);
            if (xhr.response !== undefined) {
              return new Uint8Array(xhr.response || []);
            } else {
              return intArrayFromString(xhr.responseText || '', true);
            }
          });
          var lazyArray = this;
          lazyArray.setDataGetter(function(chunkNum) {
            var start = chunkNum * chunkSize;
            var end = (chunkNum+1) * chunkSize - 1; // including this byte
            end = Math.min(end, datalength-1); // if datalength-1 is selected, this is the last block
            if (typeof(lazyArray.chunks[chunkNum]) === "undefined") {
              lazyArray.chunks[chunkNum] = doXHR(start, end);
            }
            if (typeof(lazyArray.chunks[chunkNum]) === "undefined") throw new Error("doXHR failed!");
            return lazyArray.chunks[chunkNum];
          });
  
          if (usesGzip || !datalength) {
            // if the server uses gzip or doesn't supply the length, we have to download the whole file to get the (uncompressed) length
            chunkSize = datalength = 1; // this will force getter(0)/doXHR do download the whole file
            datalength = this.getter(0).length;
            chunkSize = datalength;
            console.log("LazyFiles on gzip forces download of the whole file when length is accessed");
          }
  
          this._length = datalength;
          this._chunkSize = chunkSize;
          this.lengthKnown = true;
        }
        if (typeof XMLHttpRequest !== 'undefined') {
          if (!ENVIRONMENT_IS_WORKER) throw 'Cannot do synchronous binary XHRs outside webworkers in modern browsers. Use --embed-file or --preload-file in emcc';
          var lazyArray = new LazyUint8Array();
          Object.defineProperties(lazyArray, {
            length: {
              get: function() {
                if(!this.lengthKnown) {
                  this.cacheLength();
                }
                return this._length;
              }
            },
            chunkSize: {
              get: function() {
                if(!this.lengthKnown) {
                  this.cacheLength();
                }
                return this._chunkSize;
              }
            }
          });
  
          var properties = { isDevice: false, contents: lazyArray };
        } else {
          var properties = { isDevice: false, url: url };
        }
  
        var node = FS.createFile(parent, name, properties, canRead, canWrite);
        // This is a total hack, but I want to get this lazy file code out of the
        // core of MEMFS. If we want to keep this lazy file concept I feel it should
        // be its own thin LAZYFS proxying calls to MEMFS.
        if (properties.contents) {
          node.contents = properties.contents;
        } else if (properties.url) {
          node.contents = null;
          node.url = properties.url;
        }
        // Add a function that defers querying the file size until it is asked the first time.
        Object.defineProperties(node, {
          usedBytes: {
            get: function() { return this.contents.length; }
          }
        });
        // override each stream op with one that tries to force load the lazy file first
        var stream_ops = {};
        var keys = Object.keys(node.stream_ops);
        keys.forEach(function(key) {
          var fn = node.stream_ops[key];
          stream_ops[key] = function forceLoadLazyFile() {
            if (!FS.forceLoadFile(node)) {
              throw new FS.ErrnoError(ERRNO_CODES.EIO);
            }
            return fn.apply(null, arguments);
          };
        });
        // use a custom read function
        stream_ops.read = function stream_ops_read(stream, buffer, offset, length, position) {
          if (!FS.forceLoadFile(node)) {
            throw new FS.ErrnoError(ERRNO_CODES.EIO);
          }
          var contents = stream.node.contents;
          if (position >= contents.length)
            return 0;
          var size = Math.min(contents.length - position, length);
          assert(size >= 0);
          if (contents.slice) { // normal array
            for (var i = 0; i < size; i++) {
              buffer[offset + i] = contents[position + i];
            }
          } else {
            for (var i = 0; i < size; i++) { // LazyUint8Array from sync binary XHR
              buffer[offset + i] = contents.get(position + i);
            }
          }
          return size;
        };
        node.stream_ops = stream_ops;
        return node;
      },createPreloadedFile:function (parent, name, url, canRead, canWrite, onload, onerror, dontCreateFile, canOwn, preFinish) {
        Browser.init(); // XXX perhaps this method should move onto Browser?
        // TODO we should allow people to just pass in a complete filename instead
        // of parent and name being that we just join them anyways
        var fullname = name ? PATH.resolve(PATH.join2(parent, name)) : parent;
        var dep = getUniqueRunDependency('cp ' + fullname); // might have several active requests for the same fullname
        function processData(byteArray) {
          function finish(byteArray) {
            if (preFinish) preFinish();
            if (!dontCreateFile) {
              FS.createDataFile(parent, name, byteArray, canRead, canWrite, canOwn);
            }
            if (onload) onload();
            removeRunDependency(dep);
          }
          var handled = false;
          Module['preloadPlugins'].forEach(function(plugin) {
            if (handled) return;
            if (plugin['canHandle'](fullname)) {
              plugin['handle'](byteArray, fullname, finish, function() {
                if (onerror) onerror();
                removeRunDependency(dep);
              });
              handled = true;
            }
          });
          if (!handled) finish(byteArray);
        }
        addRunDependency(dep);
        if (typeof url == 'string') {
          Browser.asyncLoad(url, function(byteArray) {
            processData(byteArray);
          }, onerror);
        } else {
          processData(url);
        }
      },indexedDB:function () {
        return window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB;
      },DB_NAME:function () {
        return 'EM_FS_' + window.location.pathname;
      },DB_VERSION:20,DB_STORE_NAME:"FILE_DATA",saveFilesToDB:function (paths, onload, onerror) {
        onload = onload || function(){};
        onerror = onerror || function(){};
        var indexedDB = FS.indexedDB();
        try {
          var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION);
        } catch (e) {
          return onerror(e);
        }
        openRequest.onupgradeneeded = function openRequest_onupgradeneeded() {
          console.log('creating db');
          var db = openRequest.result;
          db.createObjectStore(FS.DB_STORE_NAME);
        };
        openRequest.onsuccess = function openRequest_onsuccess() {
          var db = openRequest.result;
          var transaction = db.transaction([FS.DB_STORE_NAME], 'readwrite');
          var files = transaction.objectStore(FS.DB_STORE_NAME);
          var ok = 0, fail = 0, total = paths.length;
          function finish() {
            if (fail == 0) onload(); else onerror();
          }
          paths.forEach(function(path) {
            var putRequest = files.put(FS.analyzePath(path).object.contents, path);
            putRequest.onsuccess = function putRequest_onsuccess() { ok++; if (ok + fail == total) finish() };
            putRequest.onerror = function putRequest_onerror() { fail++; if (ok + fail == total) finish() };
          });
          transaction.onerror = onerror;
        };
        openRequest.onerror = onerror;
      },loadFilesFromDB:function (paths, onload, onerror) {
        onload = onload || function(){};
        onerror = onerror || function(){};
        var indexedDB = FS.indexedDB();
        try {
          var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION);
        } catch (e) {
          return onerror(e);
        }
        openRequest.onupgradeneeded = onerror; // no database to load from
        openRequest.onsuccess = function openRequest_onsuccess() {
          var db = openRequest.result;
          try {
            var transaction = db.transaction([FS.DB_STORE_NAME], 'readonly');
          } catch(e) {
            onerror(e);
            return;
          }
          var files = transaction.objectStore(FS.DB_STORE_NAME);
          var ok = 0, fail = 0, total = paths.length;
          function finish() {
            if (fail == 0) onload(); else onerror();
          }
          paths.forEach(function(path) {
            var getRequest = files.get(path);
            getRequest.onsuccess = function getRequest_onsuccess() {
              if (FS.analyzePath(path).exists) {
                FS.unlink(path);
              }
              FS.createDataFile(PATH.dirname(path), PATH.basename(path), getRequest.result, true, true, true);
              ok++;
              if (ok + fail == total) finish();
            };
            getRequest.onerror = function getRequest_onerror() { fail++; if (ok + fail == total) finish() };
          });
          transaction.onerror = onerror;
        };
        openRequest.onerror = onerror;
      }};var SYSCALLS={DEFAULT_POLLMASK:5,mappings:{},umask:511,calculateAt:function (dirfd, path) {
        if (path[0] !== '/') {
          // relative path
          var dir;
          if (dirfd === -100) {
            dir = FS.cwd();
          } else {
            var dirstream = FS.getStream(dirfd);
            if (!dirstream) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
            dir = dirstream.path;
          }
          path = PATH.join2(dir, path);
        }
        return path;
      },doStat:function (func, path, buf) {
        try {
          var stat = func(path);
        } catch (e) {
          if (e && e.node && PATH.normalize(path) !== PATH.normalize(FS.getPath(e.node))) {
            // an error occurred while trying to look up the path; we should just report ENOTDIR
            return -ERRNO_CODES.ENOTDIR;
          }
          throw e;
        }
        HEAP32[((buf)>>2)]=stat.dev;
        HEAP32[(((buf)+(4))>>2)]=0;
        HEAP32[(((buf)+(8))>>2)]=stat.ino;
        HEAP32[(((buf)+(12))>>2)]=stat.mode;
        HEAP32[(((buf)+(16))>>2)]=stat.nlink;
        HEAP32[(((buf)+(20))>>2)]=stat.uid;
        HEAP32[(((buf)+(24))>>2)]=stat.gid;
        HEAP32[(((buf)+(28))>>2)]=stat.rdev;
        HEAP32[(((buf)+(32))>>2)]=0;
        HEAP32[(((buf)+(36))>>2)]=stat.size;
        HEAP32[(((buf)+(40))>>2)]=4096;
        HEAP32[(((buf)+(44))>>2)]=stat.blocks;
        HEAP32[(((buf)+(48))>>2)]=(stat.atime.getTime() / 1000)|0;
        HEAP32[(((buf)+(52))>>2)]=0;
        HEAP32[(((buf)+(56))>>2)]=(stat.mtime.getTime() / 1000)|0;
        HEAP32[(((buf)+(60))>>2)]=0;
        HEAP32[(((buf)+(64))>>2)]=(stat.ctime.getTime() / 1000)|0;
        HEAP32[(((buf)+(68))>>2)]=0;
        HEAP32[(((buf)+(72))>>2)]=stat.ino;
        return 0;
      },doMsync:function (addr, stream, len, flags) {
        var buffer = new Uint8Array(HEAPU8.subarray(addr, addr + len));
        FS.msync(stream, buffer, 0, len, flags);
      },doMkdir:function (path, mode) {
        // remove a trailing slash, if one - /a/b/ has basename of '', but
        // we want to create b in the context of this function
        path = PATH.normalize(path);
        if (path[path.length-1] === '/') path = path.substr(0, path.length-1);
        FS.mkdir(path, mode, 0);
        return 0;
      },doMknod:function (path, mode, dev) {
        // we don't want this in the JS API as it uses mknod to create all nodes.
        switch (mode & 61440) {
          case 32768:
          case 8192:
          case 24576:
          case 4096:
          case 49152:
            break;
          default: return -ERRNO_CODES.EINVAL;
        }
        FS.mknod(path, mode, dev);
        return 0;
      },doReadlink:function (path, buf, bufsize) {
        if (bufsize <= 0) return -ERRNO_CODES.EINVAL;
        var ret = FS.readlink(path);
  
        var len = Math.min(bufsize, lengthBytesUTF8(ret));
        var endChar = HEAP8[buf+len];
        stringToUTF8(ret, buf, bufsize+1);
        // readlink is one of the rare functions that write out a C string, but does never append a null to the output buffer(!)
        // stringToUTF8() always appends a null byte, so restore the character under the null byte after the write.
        HEAP8[buf+len] = endChar;
  
        return len;
      },doAccess:function (path, amode) {
        if (amode & ~7) {
          // need a valid mode
          return -ERRNO_CODES.EINVAL;
        }
        var node;
        var lookup = FS.lookupPath(path, { follow: true });
        node = lookup.node;
        var perms = '';
        if (amode & 4) perms += 'r';
        if (amode & 2) perms += 'w';
        if (amode & 1) perms += 'x';
        if (perms /* otherwise, they've just passed F_OK */ && FS.nodePermissions(node, perms)) {
          return -ERRNO_CODES.EACCES;
        }
        return 0;
      },doDup:function (path, flags, suggestFD) {
        var suggest = FS.getStream(suggestFD);
        if (suggest) FS.close(suggest);
        return FS.open(path, flags, 0, suggestFD, suggestFD).fd;
      },doReadv:function (stream, iov, iovcnt, offset) {
        var ret = 0;
        for (var i = 0; i < iovcnt; i++) {
          var ptr = HEAP32[(((iov)+(i*8))>>2)];
          var len = HEAP32[(((iov)+(i*8 + 4))>>2)];
          var curr = FS.read(stream, HEAP8,ptr, len, offset);
          if (curr < 0) return -1;
          ret += curr;
          if (curr < len) break; // nothing more to read
        }
        return ret;
      },doWritev:function (stream, iov, iovcnt, offset) {
        var ret = 0;
        for (var i = 0; i < iovcnt; i++) {
          var ptr = HEAP32[(((iov)+(i*8))>>2)];
          var len = HEAP32[(((iov)+(i*8 + 4))>>2)];
          var curr = FS.write(stream, HEAP8,ptr, len, offset);
          if (curr < 0) return -1;
          ret += curr;
        }
        return ret;
      },varargs:0,get:function (varargs) {
        SYSCALLS.varargs += 4;
        var ret = HEAP32[(((SYSCALLS.varargs)-(4))>>2)];
        return ret;
      },getStr:function () {
        var ret = Pointer_stringify(SYSCALLS.get());
        return ret;
      },getStreamFromFD:function () {
        var stream = FS.getStream(SYSCALLS.get());
        if (!stream) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
        return stream;
      },getSocketFromFD:function () {
        var socket = SOCKFS.getSocket(SYSCALLS.get());
        if (!socket) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
        return socket;
      },getSocketAddress:function (allowNull) {
        var addrp = SYSCALLS.get(), addrlen = SYSCALLS.get();
        if (allowNull && addrp === 0) return null;
        var info = __read_sockaddr(addrp, addrlen);
        if (info.errno) throw new FS.ErrnoError(info.errno);
        info.addr = DNS.lookup_addr(info.addr) || info.addr;
        return info;
      },get64:function () {
        var low = SYSCALLS.get(), high = SYSCALLS.get();
        if (low >= 0) assert(high === 0);
        else assert(high === -1);
        return low;
      },getZero:function () {
        assert(SYSCALLS.get() === 0);
      }};function ___syscall54(which, varargs) {SYSCALLS.varargs = varargs;
  try {
   // ioctl
      var stream = SYSCALLS.getStreamFromFD(), op = SYSCALLS.get();
      switch (op) {
        case 21505: {
          if (!stream.tty) return -ERRNO_CODES.ENOTTY;
          return 0;
        }
        case 21506: {
          if (!stream.tty) return -ERRNO_CODES.ENOTTY;
          return 0; // no-op, not actually adjusting terminal settings
        }
        case 21519: {
          if (!stream.tty) return -ERRNO_CODES.ENOTTY;
          var argp = SYSCALLS.get();
          HEAP32[((argp)>>2)]=0;
          return 0;
        }
        case 21520: {
          if (!stream.tty) return -ERRNO_CODES.ENOTTY;
          return -ERRNO_CODES.EINVAL; // not supported
        }
        case 21531: {
          var argp = SYSCALLS.get();
          return FS.ioctl(stream, op, argp);
        }
        case 21523: {
          // TODO: in theory we should write to the winsize struct that gets
          // passed in, but for now musl doesn't read anything on it
          if (!stream.tty) return -ERRNO_CODES.ENOTTY;
          return 0;
        }
        default: abort('bad ioctl syscall ' + op);
      }
    } catch (e) {
    if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
    return -e.errno;
  }
  }

  function _emscripten_glSampleCoverage(value, invert) {
      GLctx.sampleCoverage(value, !!invert);
    }

  function _glDeleteTextures(n, textures) {
      for (var i = 0; i < n; i++) {
        var id = HEAP32[(((textures)+(i*4))>>2)];
        var texture = GL.textures[id];
        if (!texture) continue; // GL spec: "glDeleteTextures silently ignores 0s and names that do not correspond to existing textures".
        GLctx.deleteTexture(texture);
        texture.name = 0;
        GL.textures[id] = null;
      }
    }

  function _emscripten_glFrustum() {
  Module['printErr']('missing function: emscripten_glFrustum'); abort(-1);
  }

  function _glfwSetWindowSizeCallback(winid, cbfun) {
      GLFW.setWindowSizeCallback(winid, cbfun);
    }

  function _emscripten_glGetTexParameterfv(target, pname, params) {
      if (!params) {
        // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
        // if p == null, issue a GL error to notify user about it. 
        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
        return;
      }
      HEAPF32[((params)>>2)]=GLctx.getTexParameter(target, pname);
    }

  function _emscripten_glUniform4i(location, v0, v1, v2, v3) {
      GLctx.uniform4i(GL.uniforms[location], v0, v1, v2, v3);
    }

  function _emscripten_glBindRenderbuffer(target, renderbuffer) {
      GLctx.bindRenderbuffer(target, renderbuffer ? GL.renderbuffers[renderbuffer] : null);
    }

  function _emscripten_glViewport(x0, x1, x2, x3) { GLctx['viewport'](x0, x1, x2, x3) }

  
  
  var JSEvents={keyEvent:0,mouseEvent:0,wheelEvent:0,uiEvent:0,focusEvent:0,deviceOrientationEvent:0,deviceMotionEvent:0,fullscreenChangeEvent:0,pointerlockChangeEvent:0,visibilityChangeEvent:0,touchEvent:0,lastGamepadState:null,lastGamepadStateFrame:null,numGamepadsConnected:0,previousFullscreenElement:null,previousScreenX:null,previousScreenY:null,removeEventListenersRegistered:false,staticInit:function () {
        if (typeof window !== 'undefined') {
          window.addEventListener("gamepadconnected", function() { ++JSEvents.numGamepadsConnected; });
          window.addEventListener("gamepaddisconnected", function() { --JSEvents.numGamepadsConnected; });
        }
      },registerRemoveEventListeners:function () {
        if (!JSEvents.removeEventListenersRegistered) {
        __ATEXIT__.push(function() {
            for(var i = JSEvents.eventHandlers.length-1; i >= 0; --i) {
              JSEvents._removeHandler(i);
            }
           });
          JSEvents.removeEventListenersRegistered = true;
        }
      },findEventTarget:function (target) {
        if (target) {
          if (typeof target == "number") {
            target = Pointer_stringify(target);
          }
          if (target == '#window') return window;
          else if (target == '#document') return document;
          else if (target == '#screen') return window.screen;
          else if (target == '#canvas') return Module['canvas'];
  
          if (typeof target == 'string') return document.getElementById(target);
          else return target;
        } else {
          // The sensible target varies between events, but use window as the default
          // since DOM events mostly can default to that. Specific callback registrations
          // override their own defaults.
          return window;
        }
      },deferredCalls:[],deferCall:function (targetFunction, precedence, argsList) {
        function arraysHaveEqualContent(arrA, arrB) {
          if (arrA.length != arrB.length) return false;
  
          for(var i in arrA) {
            if (arrA[i] != arrB[i]) return false;
          }
          return true;
        }
        // Test if the given call was already queued, and if so, don't add it again.
        for(var i in JSEvents.deferredCalls) {
          var call = JSEvents.deferredCalls[i];
          if (call.targetFunction == targetFunction && arraysHaveEqualContent(call.argsList, argsList)) {
            return;
          }
        }
        JSEvents.deferredCalls.push({
          targetFunction: targetFunction,
          precedence: precedence,
          argsList: argsList
        });
  
        JSEvents.deferredCalls.sort(function(x,y) { return x.precedence < y.precedence; });
      },removeDeferredCalls:function (targetFunction) {
        for(var i = 0; i < JSEvents.deferredCalls.length; ++i) {
          if (JSEvents.deferredCalls[i].targetFunction == targetFunction) {
            JSEvents.deferredCalls.splice(i, 1);
            --i;
          }
        }
      },canPerformEventHandlerRequests:function () {
        return JSEvents.inEventHandler && JSEvents.currentEventHandler.allowsDeferredCalls;
      },runDeferredCalls:function () {
        if (!JSEvents.canPerformEventHandlerRequests()) {
          return;
        }
        for(var i = 0; i < JSEvents.deferredCalls.length; ++i) {
          var call = JSEvents.deferredCalls[i];
          JSEvents.deferredCalls.splice(i, 1);
          --i;
          call.targetFunction.apply(this, call.argsList);
        }
      },inEventHandler:0,currentEventHandler:null,eventHandlers:[],isInternetExplorer:function () { return navigator.userAgent.indexOf('MSIE') !== -1 || navigator.appVersion.indexOf('Trident/') > 0; },removeAllHandlersOnTarget:function (target, eventTypeString) {
        for(var i = 0; i < JSEvents.eventHandlers.length; ++i) {
          if (JSEvents.eventHandlers[i].target == target && 
            (!eventTypeString || eventTypeString == JSEvents.eventHandlers[i].eventTypeString)) {
             JSEvents._removeHandler(i--);
           }
        }
      },_removeHandler:function (i) {
        var h = JSEvents.eventHandlers[i];
        h.target.removeEventListener(h.eventTypeString, h.eventListenerFunc, h.useCapture);
        JSEvents.eventHandlers.splice(i, 1);
      },registerOrRemoveHandler:function (eventHandler) {
        var jsEventHandler = function jsEventHandler(event) {
          // Increment nesting count for the event handler.
          ++JSEvents.inEventHandler;
          JSEvents.currentEventHandler = eventHandler;
          // Process any old deferred calls the user has placed.
          JSEvents.runDeferredCalls();
          // Process the actual event, calls back to user C code handler.
          eventHandler.handlerFunc(event);
          // Process any new deferred calls that were placed right now from this event handler.
          JSEvents.runDeferredCalls();
          // Out of event handler - restore nesting count.
          --JSEvents.inEventHandler;
        }
        
        if (eventHandler.callbackfunc) {
          eventHandler.eventListenerFunc = jsEventHandler;
          eventHandler.target.addEventListener(eventHandler.eventTypeString, jsEventHandler, eventHandler.useCapture);
          JSEvents.eventHandlers.push(eventHandler);
          JSEvents.registerRemoveEventListeners();
        } else {
          for(var i = 0; i < JSEvents.eventHandlers.length; ++i) {
            if (JSEvents.eventHandlers[i].target == eventHandler.target
             && JSEvents.eventHandlers[i].eventTypeString == eventHandler.eventTypeString) {
               JSEvents._removeHandler(i--);
             }
          }
        }
      },registerKeyEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
        if (!JSEvents.keyEvent) {
          JSEvents.keyEvent = _malloc( 164 );
        }
        var handlerFunc = function(event) {
          var e = event || window.event;
          stringToUTF8(e.key ? e.key : "", JSEvents.keyEvent + 0, 32);
          stringToUTF8(e.code ? e.code : "", JSEvents.keyEvent + 32, 32);
          HEAP32[(((JSEvents.keyEvent)+(64))>>2)]=e.location;
          HEAP32[(((JSEvents.keyEvent)+(68))>>2)]=e.ctrlKey;
          HEAP32[(((JSEvents.keyEvent)+(72))>>2)]=e.shiftKey;
          HEAP32[(((JSEvents.keyEvent)+(76))>>2)]=e.altKey;
          HEAP32[(((JSEvents.keyEvent)+(80))>>2)]=e.metaKey;
          HEAP32[(((JSEvents.keyEvent)+(84))>>2)]=e.repeat;
          stringToUTF8(e.locale ? e.locale : "", JSEvents.keyEvent + 88, 32);
          stringToUTF8(e.char ? e.char : "", JSEvents.keyEvent + 120, 32);
          HEAP32[(((JSEvents.keyEvent)+(152))>>2)]=e.charCode;
          HEAP32[(((JSEvents.keyEvent)+(156))>>2)]=e.keyCode;
          HEAP32[(((JSEvents.keyEvent)+(160))>>2)]=e.which;
          var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.keyEvent, userData);
          if (shouldCancel) {
            e.preventDefault();
          }
        };
  
        var eventHandler = {
          target: JSEvents.findEventTarget(target),
          allowsDeferredCalls: JSEvents.isInternetExplorer() ? false : true, // MSIE doesn't allow fullscreen and pointerlock requests from key handlers, others do.
          eventTypeString: eventTypeString,
          callbackfunc: callbackfunc,
          handlerFunc: handlerFunc,
          useCapture: useCapture
        };
        JSEvents.registerOrRemoveHandler(eventHandler);
      },getBoundingClientRectOrZeros:function (target) {
        return target.getBoundingClientRect ? target.getBoundingClientRect() : { left: 0, top: 0 };
      },fillMouseEventData:function (eventStruct, e, target) {
        HEAPF64[((eventStruct)>>3)]=JSEvents.tick();
        HEAP32[(((eventStruct)+(8))>>2)]=e.screenX;
        HEAP32[(((eventStruct)+(12))>>2)]=e.screenY;
        HEAP32[(((eventStruct)+(16))>>2)]=e.clientX;
        HEAP32[(((eventStruct)+(20))>>2)]=e.clientY;
        HEAP32[(((eventStruct)+(24))>>2)]=e.ctrlKey;
        HEAP32[(((eventStruct)+(28))>>2)]=e.shiftKey;
        HEAP32[(((eventStruct)+(32))>>2)]=e.altKey;
        HEAP32[(((eventStruct)+(36))>>2)]=e.metaKey;
        HEAP16[(((eventStruct)+(40))>>1)]=e.button;
        HEAP16[(((eventStruct)+(42))>>1)]=e.buttons;
        HEAP32[(((eventStruct)+(44))>>2)]=e["movementX"] || e["mozMovementX"] || e["webkitMovementX"] || (e.screenX-JSEvents.previousScreenX);
        HEAP32[(((eventStruct)+(48))>>2)]=e["movementY"] || e["mozMovementY"] || e["webkitMovementY"] || (e.screenY-JSEvents.previousScreenY);
  
        if (Module['canvas']) {
          var rect = Module['canvas'].getBoundingClientRect();
          HEAP32[(((eventStruct)+(60))>>2)]=e.clientX - rect.left;
          HEAP32[(((eventStruct)+(64))>>2)]=e.clientY - rect.top;
        } else { // Canvas is not initialized, return 0.
          HEAP32[(((eventStruct)+(60))>>2)]=0;
          HEAP32[(((eventStruct)+(64))>>2)]=0;
        }
        if (target) {
          var rect = JSEvents.getBoundingClientRectOrZeros(target);
          HEAP32[(((eventStruct)+(52))>>2)]=e.clientX - rect.left;
          HEAP32[(((eventStruct)+(56))>>2)]=e.clientY - rect.top;        
        } else { // No specific target passed, return 0.
          HEAP32[(((eventStruct)+(52))>>2)]=0;
          HEAP32[(((eventStruct)+(56))>>2)]=0;
        }
        // wheel and mousewheel events contain wrong screenX/screenY on chrome/opera
        // https://github.com/kripken/emscripten/pull/4997
        // https://bugs.chromium.org/p/chromium/issues/detail?id=699956
        if (e.type !== 'wheel' && e.type !== 'mousewheel') {
          JSEvents.previousScreenX = e.screenX;
          JSEvents.previousScreenY = e.screenY;
        }
      },registerMouseEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
        if (!JSEvents.mouseEvent) {
          JSEvents.mouseEvent = _malloc( 72 );
        }
        target = JSEvents.findEventTarget(target);
        var handlerFunc = function(event) {
          var e = event || window.event;
          JSEvents.fillMouseEventData(JSEvents.mouseEvent, e, target);
          var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.mouseEvent, userData);
          if (shouldCancel) {
            e.preventDefault();
          }
        };
  
        var eventHandler = {
          target: target,
          allowsDeferredCalls: eventTypeString != 'mousemove' && eventTypeString != 'mouseenter' && eventTypeString != 'mouseleave', // Mouse move events do not allow fullscreen/pointer lock requests to be handled in them!
          eventTypeString: eventTypeString,
          callbackfunc: callbackfunc,
          handlerFunc: handlerFunc,
          useCapture: useCapture
        };
        // In IE, mousedown events don't either allow deferred calls to be run!
        if (JSEvents.isInternetExplorer() && eventTypeString == 'mousedown') eventHandler.allowsDeferredCalls = false;
        JSEvents.registerOrRemoveHandler(eventHandler);
      },registerWheelEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
        if (!JSEvents.wheelEvent) {
          JSEvents.wheelEvent = _malloc( 104 );
        }
        target = JSEvents.findEventTarget(target);
        // The DOM Level 3 events spec event 'wheel'
        var wheelHandlerFunc = function(event) {
          var e = event || window.event;
          JSEvents.fillMouseEventData(JSEvents.wheelEvent, e, target);
          HEAPF64[(((JSEvents.wheelEvent)+(72))>>3)]=e["deltaX"];
          HEAPF64[(((JSEvents.wheelEvent)+(80))>>3)]=e["deltaY"];
          HEAPF64[(((JSEvents.wheelEvent)+(88))>>3)]=e["deltaZ"];
          HEAP32[(((JSEvents.wheelEvent)+(96))>>2)]=e["deltaMode"];
          var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.wheelEvent, userData);
          if (shouldCancel) {
            e.preventDefault();
          }
        };
        // The 'mousewheel' event as implemented in Safari 6.0.5
        var mouseWheelHandlerFunc = function(event) {
          var e = event || window.event;
          JSEvents.fillMouseEventData(JSEvents.wheelEvent, e, target);
          HEAPF64[(((JSEvents.wheelEvent)+(72))>>3)]=e["wheelDeltaX"] || 0;
          HEAPF64[(((JSEvents.wheelEvent)+(80))>>3)]=-(e["wheelDeltaY"] ? e["wheelDeltaY"] : e["wheelDelta"]) /* 1. Invert to unify direction with the DOM Level 3 wheel event. 2. MSIE does not provide wheelDeltaY, so wheelDelta is used as a fallback. */;
          HEAPF64[(((JSEvents.wheelEvent)+(88))>>3)]=0 /* Not available */;
          HEAP32[(((JSEvents.wheelEvent)+(96))>>2)]=0 /* DOM_DELTA_PIXEL */;
          var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.wheelEvent, userData);
          if (shouldCancel) {
            e.preventDefault();
          }
        };
  
        var eventHandler = {
          target: target,
          allowsDeferredCalls: true,
          eventTypeString: eventTypeString,
          callbackfunc: callbackfunc,
          handlerFunc: (eventTypeString == 'wheel') ? wheelHandlerFunc : mouseWheelHandlerFunc,
          useCapture: useCapture
        };
        JSEvents.registerOrRemoveHandler(eventHandler);
      },pageScrollPos:function () {
        if (window.pageXOffset > 0 || window.pageYOffset > 0) {
          return [window.pageXOffset, window.pageYOffset];
        }
        if (typeof document.documentElement.scrollLeft !== 'undefined' || typeof document.documentElement.scrollTop !== 'undefined') {
          return [document.documentElement.scrollLeft, document.documentElement.scrollTop];
        }
        return [document.body.scrollLeft|0, document.body.scrollTop|0];
      },registerUiEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
        if (!JSEvents.uiEvent) {
          JSEvents.uiEvent = _malloc( 36 );
        }
  
        if (eventTypeString == "scroll" && !target) {
          target = document; // By default read scroll events on document rather than window.
        } else {
          target = JSEvents.findEventTarget(target);
        }
  
        var handlerFunc = function(event) {
          var e = event || window.event;
          if (e.target != target) {
            // Never take ui events such as scroll via a 'bubbled' route, but always from the direct element that
            // was targeted. Otherwise e.g. if app logs a message in response to a page scroll, the Emscripten log
            // message box could cause to scroll, generating a new (bubbled) scroll message, causing a new log print,
            // causing a new scroll, etc..
            return;
          }
          var scrollPos = JSEvents.pageScrollPos();
          HEAP32[((JSEvents.uiEvent)>>2)]=e.detail;
          HEAP32[(((JSEvents.uiEvent)+(4))>>2)]=document.body.clientWidth;
          HEAP32[(((JSEvents.uiEvent)+(8))>>2)]=document.body.clientHeight;
          HEAP32[(((JSEvents.uiEvent)+(12))>>2)]=window.innerWidth;
          HEAP32[(((JSEvents.uiEvent)+(16))>>2)]=window.innerHeight;
          HEAP32[(((JSEvents.uiEvent)+(20))>>2)]=window.outerWidth;
          HEAP32[(((JSEvents.uiEvent)+(24))>>2)]=window.outerHeight;
          HEAP32[(((JSEvents.uiEvent)+(28))>>2)]=scrollPos[0];
          HEAP32[(((JSEvents.uiEvent)+(32))>>2)]=scrollPos[1];
          var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.uiEvent, userData);
          if (shouldCancel) {
            e.preventDefault();
          }
        };
  
        var eventHandler = {
          target: target,
          allowsDeferredCalls: false, // Neither scroll or resize events allow running requests inside them.
          eventTypeString: eventTypeString,
          callbackfunc: callbackfunc,
          handlerFunc: handlerFunc,
          useCapture: useCapture
        };
        JSEvents.registerOrRemoveHandler(eventHandler);
      },getNodeNameForTarget:function (target) {
        if (!target) return '';
        if (target == window) return '#window';
        if (target == window.screen) return '#screen';
        return (target && target.nodeName) ? target.nodeName : '';
      },registerFocusEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
        if (!JSEvents.focusEvent) {
          JSEvents.focusEvent = _malloc( 256 );
        }
        var handlerFunc = function(event) {
          var e = event || window.event;
  
          var nodeName = JSEvents.getNodeNameForTarget(e.target);
          var id = e.target.id ? e.target.id : '';
          stringToUTF8(nodeName, JSEvents.focusEvent + 0, 128);
          stringToUTF8(id, JSEvents.focusEvent + 128, 128);
          var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.focusEvent, userData);
          if (shouldCancel) {
            e.preventDefault();
          }
        };
  
        var eventHandler = {
          target: JSEvents.findEventTarget(target),
          allowsDeferredCalls: false,
          eventTypeString: eventTypeString,
          callbackfunc: callbackfunc,
          handlerFunc: handlerFunc,
          useCapture: useCapture
        };
        JSEvents.registerOrRemoveHandler(eventHandler);
      },tick:function () {
        if (window['performance'] && window['performance']['now']) return window['performance']['now']();
        else return Date.now();
      },registerDeviceOrientationEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
        if (!JSEvents.deviceOrientationEvent) {
          JSEvents.deviceOrientationEvent = _malloc( 40 );
        }
        var handlerFunc = function(event) {
          var e = event || window.event;
  
          HEAPF64[((JSEvents.deviceOrientationEvent)>>3)]=JSEvents.tick();
          HEAPF64[(((JSEvents.deviceOrientationEvent)+(8))>>3)]=e.alpha;
          HEAPF64[(((JSEvents.deviceOrientationEvent)+(16))>>3)]=e.beta;
          HEAPF64[(((JSEvents.deviceOrientationEvent)+(24))>>3)]=e.gamma;
          HEAP32[(((JSEvents.deviceOrientationEvent)+(32))>>2)]=e.absolute;
  
          var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.deviceOrientationEvent, userData);
          if (shouldCancel) {
            e.preventDefault();
          }
        };
  
        var eventHandler = {
          target: JSEvents.findEventTarget(target),
          allowsDeferredCalls: false,
          eventTypeString: eventTypeString,
          callbackfunc: callbackfunc,
          handlerFunc: handlerFunc,
          useCapture: useCapture
        };
        JSEvents.registerOrRemoveHandler(eventHandler);
      },registerDeviceMotionEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
        if (!JSEvents.deviceMotionEvent) {
          JSEvents.deviceMotionEvent = _malloc( 80 );
        }
        var handlerFunc = function(event) {
          var e = event || window.event;
  
          HEAPF64[((JSEvents.deviceOrientationEvent)>>3)]=JSEvents.tick();
          HEAPF64[(((JSEvents.deviceMotionEvent)+(8))>>3)]=e.acceleration.x;
          HEAPF64[(((JSEvents.deviceMotionEvent)+(16))>>3)]=e.acceleration.y;
          HEAPF64[(((JSEvents.deviceMotionEvent)+(24))>>3)]=e.acceleration.z;
          HEAPF64[(((JSEvents.deviceMotionEvent)+(32))>>3)]=e.accelerationIncludingGravity.x;
          HEAPF64[(((JSEvents.deviceMotionEvent)+(40))>>3)]=e.accelerationIncludingGravity.y;
          HEAPF64[(((JSEvents.deviceMotionEvent)+(48))>>3)]=e.accelerationIncludingGravity.z;
          HEAPF64[(((JSEvents.deviceMotionEvent)+(56))>>3)]=e.rotationRate.alpha;
          HEAPF64[(((JSEvents.deviceMotionEvent)+(64))>>3)]=e.rotationRate.beta;
          HEAPF64[(((JSEvents.deviceMotionEvent)+(72))>>3)]=e.rotationRate.gamma;
  
          var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.deviceMotionEvent, userData);
          if (shouldCancel) {
            e.preventDefault();
          }
        };
  
        var eventHandler = {
          target: JSEvents.findEventTarget(target),
          allowsDeferredCalls: false,
          eventTypeString: eventTypeString,
          callbackfunc: callbackfunc,
          handlerFunc: handlerFunc,
          useCapture: useCapture
        };
        JSEvents.registerOrRemoveHandler(eventHandler);
      },screenOrientation:function () {
        if (!window.screen) return undefined;
        return window.screen.orientation || window.screen.mozOrientation || window.screen.webkitOrientation || window.screen.msOrientation;
      },fillOrientationChangeEventData:function (eventStruct, e) {
        var orientations  = ["portrait-primary", "portrait-secondary", "landscape-primary", "landscape-secondary"];
        var orientations2 = ["portrait",         "portrait",           "landscape",         "landscape"];
  
        var orientationString = JSEvents.screenOrientation();
        var orientation = orientations.indexOf(orientationString);
        if (orientation == -1) {
          orientation = orientations2.indexOf(orientationString);
        }
  
        HEAP32[((eventStruct)>>2)]=1 << orientation;
        HEAP32[(((eventStruct)+(4))>>2)]=window.orientation;
      },registerOrientationChangeEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
        if (!JSEvents.orientationChangeEvent) {
          JSEvents.orientationChangeEvent = _malloc( 8 );
        }
  
        if (!target) {
          target = window.screen; // Orientation events need to be captured from 'window.screen' instead of 'window'
        } else {
          target = JSEvents.findEventTarget(target);
        }
  
        var handlerFunc = function(event) {
          var e = event || window.event;
  
          JSEvents.fillOrientationChangeEventData(JSEvents.orientationChangeEvent, e);
  
          var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.orientationChangeEvent, userData);
          if (shouldCancel) {
            e.preventDefault();
          }
        };
  
        if (eventTypeString == "orientationchange" && window.screen.mozOrientation !== undefined) {
          eventTypeString = "mozorientationchange";
        }
  
        var eventHandler = {
          target: target,
          allowsDeferredCalls: false,
          eventTypeString: eventTypeString,
          callbackfunc: callbackfunc,
          handlerFunc: handlerFunc,
          useCapture: useCapture
        };
        JSEvents.registerOrRemoveHandler(eventHandler);
      },fullscreenEnabled:function () {
        return document.fullscreenEnabled || document.mozFullScreenEnabled || document.webkitFullscreenEnabled || document.msFullscreenEnabled;
      },fillFullscreenChangeEventData:function (eventStruct, e) {
        var fullscreenElement = document.fullscreenElement || document.mozFullScreenElement || document.webkitFullscreenElement || document.msFullscreenElement;
        var isFullscreen = !!fullscreenElement;
        HEAP32[((eventStruct)>>2)]=isFullscreen;
        HEAP32[(((eventStruct)+(4))>>2)]=JSEvents.fullscreenEnabled();
        // If transitioning to fullscreen, report info about the element that is now fullscreen.
        // If transitioning to windowed mode, report info about the element that just was fullscreen.
        var reportedElement = isFullscreen ? fullscreenElement : JSEvents.previousFullscreenElement;
        var nodeName = JSEvents.getNodeNameForTarget(reportedElement);
        var id = (reportedElement && reportedElement.id) ? reportedElement.id : '';
        stringToUTF8(nodeName, eventStruct + 8, 128);
        stringToUTF8(id, eventStruct + 136, 128);
        HEAP32[(((eventStruct)+(264))>>2)]=reportedElement ? reportedElement.clientWidth : 0;
        HEAP32[(((eventStruct)+(268))>>2)]=reportedElement ? reportedElement.clientHeight : 0;
        HEAP32[(((eventStruct)+(272))>>2)]=screen.width;
        HEAP32[(((eventStruct)+(276))>>2)]=screen.height;
        if (isFullscreen) {
          JSEvents.previousFullscreenElement = fullscreenElement;
        }
      },registerFullscreenChangeEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
        if (!JSEvents.fullscreenChangeEvent) {
          JSEvents.fullscreenChangeEvent = _malloc( 280 );
        }
  
        if (!target) {
          target = document; // Fullscreen change events need to be captured from 'document' by default instead of 'window'
        } else {
          target = JSEvents.findEventTarget(target);
        }
  
        var handlerFunc = function(event) {
          var e = event || window.event;
  
          JSEvents.fillFullscreenChangeEventData(JSEvents.fullscreenChangeEvent, e);
  
          var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.fullscreenChangeEvent, userData);
          if (shouldCancel) {
            e.preventDefault();
          }
        };
  
        var eventHandler = {
          target: target,
          allowsDeferredCalls: false,
          eventTypeString: eventTypeString,
          callbackfunc: callbackfunc,
          handlerFunc: handlerFunc,
          useCapture: useCapture
        };
        JSEvents.registerOrRemoveHandler(eventHandler);
      },resizeCanvasForFullscreen:function (target, strategy) {
        var restoreOldStyle = __registerRestoreOldStyle(target);
        var cssWidth = strategy.softFullscreen ? window.innerWidth : screen.width;
        var cssHeight = strategy.softFullscreen ? window.innerHeight : screen.height;
        var rect = target.getBoundingClientRect();
        var windowedCssWidth = rect.right - rect.left;
        var windowedCssHeight = rect.bottom - rect.top;
        var windowedRttWidth = target.width;
        var windowedRttHeight = target.height;
  
        if (strategy.scaleMode == 3) {
          __setLetterbox(target, (cssHeight - windowedCssHeight) / 2, (cssWidth - windowedCssWidth) / 2);
          cssWidth = windowedCssWidth;
          cssHeight = windowedCssHeight;
        } else if (strategy.scaleMode == 2) {
          if (cssWidth*windowedRttHeight < windowedRttWidth*cssHeight) {
            var desiredCssHeight = windowedRttHeight * cssWidth / windowedRttWidth;
            __setLetterbox(target, (cssHeight - desiredCssHeight) / 2, 0);
            cssHeight = desiredCssHeight;
          } else {
            var desiredCssWidth = windowedRttWidth * cssHeight / windowedRttHeight;
            __setLetterbox(target, 0, (cssWidth - desiredCssWidth) / 2);
            cssWidth = desiredCssWidth;
          }
        }
  
        // If we are adding padding, must choose a background color or otherwise Chrome will give the
        // padding a default white color. Do it only if user has not customized their own background color.
        if (!target.style.backgroundColor) target.style.backgroundColor = 'black';
        // IE11 does the same, but requires the color to be set in the document body.
        if (!document.body.style.backgroundColor) document.body.style.backgroundColor = 'black'; // IE11
        // Firefox always shows black letterboxes independent of style color.
  
        target.style.width = cssWidth + 'px';
        target.style.height = cssHeight + 'px';
  
        if (strategy.filteringMode == 1) {
          target.style.imageRendering = 'optimizeSpeed';
          target.style.imageRendering = '-moz-crisp-edges';
          target.style.imageRendering = '-o-crisp-edges';
          target.style.imageRendering = '-webkit-optimize-contrast';
          target.style.imageRendering = 'optimize-contrast';
          target.style.imageRendering = 'crisp-edges';
          target.style.imageRendering = 'pixelated';
        }
  
        var dpiScale = (strategy.canvasResolutionScaleMode == 2) ? window.devicePixelRatio : 1;
        if (strategy.canvasResolutionScaleMode != 0) {
          target.width = cssWidth * dpiScale;
          target.height = cssHeight * dpiScale;
          if (target.GLctxObject) target.GLctxObject.GLctx.viewport(0, 0, target.width, target.height);
        }
        return restoreOldStyle;
      },requestFullscreen:function (target, strategy) {
        // EMSCRIPTEN_FULLSCREEN_SCALE_DEFAULT + EMSCRIPTEN_FULLSCREEN_CANVAS_SCALE_NONE is a mode where no extra logic is performed to the DOM elements.
        if (strategy.scaleMode != 0 || strategy.canvasResolutionScaleMode != 0) {
          JSEvents.resizeCanvasForFullscreen(target, strategy);
        }
  
        if (target.requestFullscreen) {
          target.requestFullscreen();
        } else if (target.msRequestFullscreen) {
          target.msRequestFullscreen();
        } else if (target.mozRequestFullScreen) {
          target.mozRequestFullScreen();
        } else if (target.mozRequestFullscreen) {
          target.mozRequestFullscreen();
        } else if (target.webkitRequestFullscreen) {
          target.webkitRequestFullscreen(Element.ALLOW_KEYBOARD_INPUT);
        } else {
          if (typeof JSEvents.fullscreenEnabled() === 'undefined') {
            return -1;
          } else {
            return -3;
          }
        }
  
        if (strategy.canvasResizedCallback) {
          Module['dynCall_iiii'](strategy.canvasResizedCallback, 37, 0, strategy.canvasResizedCallbackUserData);
        }
  
        return 0;
      },fillPointerlockChangeEventData:function (eventStruct, e) {
        var pointerLockElement = document.pointerLockElement || document.mozPointerLockElement || document.webkitPointerLockElement || document.msPointerLockElement;
        var isPointerlocked = !!pointerLockElement;
        HEAP32[((eventStruct)>>2)]=isPointerlocked;
        var nodeName = JSEvents.getNodeNameForTarget(pointerLockElement);
        var id = (pointerLockElement && pointerLockElement.id) ? pointerLockElement.id : '';
        stringToUTF8(nodeName, eventStruct + 4, 128);
        stringToUTF8(id, eventStruct + 132, 128);
      },registerPointerlockChangeEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
        if (!JSEvents.pointerlockChangeEvent) {
          JSEvents.pointerlockChangeEvent = _malloc( 260 );
        }
  
        if (!target) {
          target = document; // Pointer lock change events need to be captured from 'document' by default instead of 'window'
        } else {
          target = JSEvents.findEventTarget(target);
        }
  
        var handlerFunc = function(event) {
          var e = event || window.event;
  
          JSEvents.fillPointerlockChangeEventData(JSEvents.pointerlockChangeEvent, e);
  
          var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.pointerlockChangeEvent, userData);
          if (shouldCancel) {
            e.preventDefault();
          }
        };
  
        var eventHandler = {
          target: target,
          allowsDeferredCalls: false,
          eventTypeString: eventTypeString,
          callbackfunc: callbackfunc,
          handlerFunc: handlerFunc,
          useCapture: useCapture
        };
        JSEvents.registerOrRemoveHandler(eventHandler);
      },registerPointerlockErrorEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
        if (!target) {
          target = document; // Pointer lock events need to be captured from 'document' by default instead of 'window'
        } else {
          target = JSEvents.findEventTarget(target);
        }
  
        var handlerFunc = function(event) {
          var e = event || window.event;
  
          var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, 0, userData);
          if (shouldCancel) {
            e.preventDefault();
          }
        };
  
        var eventHandler = {
          target: target,
          allowsDeferredCalls: false,
          eventTypeString: eventTypeString,
          callbackfunc: callbackfunc,
          handlerFunc: handlerFunc,
          useCapture: useCapture
        };
        JSEvents.registerOrRemoveHandler(eventHandler);
      },requestPointerLock:function (target) {
        if (target.requestPointerLock) {
          target.requestPointerLock();
        } else if (target.mozRequestPointerLock) {
          target.mozRequestPointerLock();
        } else if (target.webkitRequestPointerLock) {
          target.webkitRequestPointerLock();
        } else if (target.msRequestPointerLock) {
          target.msRequestPointerLock();
        } else {
          // document.body is known to accept pointer lock, so use that to differentiate if the user passed a bad element,
          // or if the whole browser just doesn't support the feature.
          if (document.body.requestPointerLock || document.body.mozRequestPointerLock || document.body.webkitRequestPointerLock || document.body.msRequestPointerLock) {
            return -3;
          } else {
            return -1;
          }
        }
        return 0;
      },fillVisibilityChangeEventData:function (eventStruct, e) {
        var visibilityStates = [ "hidden", "visible", "prerender", "unloaded" ];
        var visibilityState = visibilityStates.indexOf(document.visibilityState);
  
        HEAP32[((eventStruct)>>2)]=document.hidden;
        HEAP32[(((eventStruct)+(4))>>2)]=visibilityState;
      },registerVisibilityChangeEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
        if (!JSEvents.visibilityChangeEvent) {
          JSEvents.visibilityChangeEvent = _malloc( 8 );
        }
  
        if (!target) {
          target = document; // Visibility change events need to be captured from 'document' by default instead of 'window'
        } else {
          target = JSEvents.findEventTarget(target);
        }
  
        var handlerFunc = function(event) {
          var e = event || window.event;
  
          JSEvents.fillVisibilityChangeEventData(JSEvents.visibilityChangeEvent, e);
  
          var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.visibilityChangeEvent, userData);
          if (shouldCancel) {
            e.preventDefault();
          }
        };
  
        var eventHandler = {
          target: target,
          allowsDeferredCalls: false,
          eventTypeString: eventTypeString,
          callbackfunc: callbackfunc,
          handlerFunc: handlerFunc,
          useCapture: useCapture
        };
        JSEvents.registerOrRemoveHandler(eventHandler);
      },registerTouchEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
        if (!JSEvents.touchEvent) {
          JSEvents.touchEvent = _malloc( 1684 );
        }
  
        target = JSEvents.findEventTarget(target);
  
        var handlerFunc = function(event) {
          var e = event || window.event;
  
          var touches = {};
          for(var i = 0; i < e.touches.length; ++i) {
            var touch = e.touches[i];
            touches[touch.identifier] = touch;
          }
          for(var i = 0; i < e.changedTouches.length; ++i) {
            var touch = e.changedTouches[i];
            touches[touch.identifier] = touch;
            touch.changed = true;
          }
          for(var i = 0; i < e.targetTouches.length; ++i) {
            var touch = e.targetTouches[i];
            touches[touch.identifier].onTarget = true;
          }
          
          var ptr = JSEvents.touchEvent;
          HEAP32[(((ptr)+(4))>>2)]=e.ctrlKey;
          HEAP32[(((ptr)+(8))>>2)]=e.shiftKey;
          HEAP32[(((ptr)+(12))>>2)]=e.altKey;
          HEAP32[(((ptr)+(16))>>2)]=e.metaKey;
          ptr += 20; // Advance to the start of the touch array.
          var canvasRect = Module['canvas'] ? Module['canvas'].getBoundingClientRect() : undefined;
          var targetRect = JSEvents.getBoundingClientRectOrZeros(target);
          var numTouches = 0;
          for(var i in touches) {
            var t = touches[i];
            HEAP32[((ptr)>>2)]=t.identifier;
            HEAP32[(((ptr)+(4))>>2)]=t.screenX;
            HEAP32[(((ptr)+(8))>>2)]=t.screenY;
            HEAP32[(((ptr)+(12))>>2)]=t.clientX;
            HEAP32[(((ptr)+(16))>>2)]=t.clientY;
            HEAP32[(((ptr)+(20))>>2)]=t.pageX;
            HEAP32[(((ptr)+(24))>>2)]=t.pageY;
            HEAP32[(((ptr)+(28))>>2)]=t.changed;
            HEAP32[(((ptr)+(32))>>2)]=t.onTarget;
            if (canvasRect) {
              HEAP32[(((ptr)+(44))>>2)]=t.clientX - canvasRect.left;
              HEAP32[(((ptr)+(48))>>2)]=t.clientY - canvasRect.top;
            } else {
              HEAP32[(((ptr)+(44))>>2)]=0;
              HEAP32[(((ptr)+(48))>>2)]=0;            
            }
            HEAP32[(((ptr)+(36))>>2)]=t.clientX - targetRect.left;
            HEAP32[(((ptr)+(40))>>2)]=t.clientY - targetRect.top;
            
            ptr += 52;
  
            if (++numTouches >= 32) {
              break;
            }
          }
          HEAP32[((JSEvents.touchEvent)>>2)]=numTouches;
  
          var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.touchEvent, userData);
          if (shouldCancel) {
            e.preventDefault();
          }
        };
  
        var eventHandler = {
          target: target,
          allowsDeferredCalls: false, // XXX Currently disabled, see bug https://bugzilla.mozilla.org/show_bug.cgi?id=966493
          // Once the above bug is resolved, enable the following condition if possible:
          // allowsDeferredCalls: eventTypeString == 'touchstart',
          eventTypeString: eventTypeString,
          callbackfunc: callbackfunc,
          handlerFunc: handlerFunc,
          useCapture: useCapture
        };
        JSEvents.registerOrRemoveHandler(eventHandler);
      },fillGamepadEventData:function (eventStruct, e) {
        HEAPF64[((eventStruct)>>3)]=e.timestamp;
        for(var i = 0; i < e.axes.length; ++i) {
          HEAPF64[(((eventStruct+i*8)+(16))>>3)]=e.axes[i];
        }
        for(var i = 0; i < e.buttons.length; ++i) {
          if (typeof(e.buttons[i]) === 'object') {
            HEAPF64[(((eventStruct+i*8)+(528))>>3)]=e.buttons[i].value;
          } else {
            HEAPF64[(((eventStruct+i*8)+(528))>>3)]=e.buttons[i];
          }
        }
        for(var i = 0; i < e.buttons.length; ++i) {
          if (typeof(e.buttons[i]) === 'object') {
            HEAP32[(((eventStruct+i*4)+(1040))>>2)]=e.buttons[i].pressed;
          } else {
            HEAP32[(((eventStruct+i*4)+(1040))>>2)]=e.buttons[i] == 1.0;
          }
        }
        HEAP32[(((eventStruct)+(1296))>>2)]=e.connected;
        HEAP32[(((eventStruct)+(1300))>>2)]=e.index;
        HEAP32[(((eventStruct)+(8))>>2)]=e.axes.length;
        HEAP32[(((eventStruct)+(12))>>2)]=e.buttons.length;
        stringToUTF8(e.id, eventStruct + 1304, 64);
        stringToUTF8(e.mapping, eventStruct + 1368, 64);
      },registerGamepadEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
        if (!JSEvents.gamepadEvent) {
          JSEvents.gamepadEvent = _malloc( 1432 );
        }
  
        var handlerFunc = function(event) {
          var e = event || window.event;
  
          JSEvents.fillGamepadEventData(JSEvents.gamepadEvent, e.gamepad);
  
          var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.gamepadEvent, userData);
          if (shouldCancel) {
            e.preventDefault();
          }
        };
  
        var eventHandler = {
          target: JSEvents.findEventTarget(target),
          allowsDeferredCalls: true,
          eventTypeString: eventTypeString,
          callbackfunc: callbackfunc,
          handlerFunc: handlerFunc,
          useCapture: useCapture
        };
        JSEvents.registerOrRemoveHandler(eventHandler);
      },registerBeforeUnloadEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
        var handlerFunc = function(event) {
          var e = event || window.event;
  
          var confirmationMessage = Module['dynCall_iiii'](callbackfunc, eventTypeId, 0, userData);
          
          if (confirmationMessage) {
            confirmationMessage = Pointer_stringify(confirmationMessage);
          }
          if (confirmationMessage) {
            e.preventDefault();
            e.returnValue = confirmationMessage;
            return confirmationMessage;
          }
        };
  
        var eventHandler = {
          target: JSEvents.findEventTarget(target),
          allowsDeferredCalls: false,
          eventTypeString: eventTypeString,
          callbackfunc: callbackfunc,
          handlerFunc: handlerFunc,
          useCapture: useCapture
        };
        JSEvents.registerOrRemoveHandler(eventHandler);
      },battery:function () { return navigator.battery || navigator.mozBattery || navigator.webkitBattery; },fillBatteryEventData:function (eventStruct, e) {
        HEAPF64[((eventStruct)>>3)]=e.chargingTime;
        HEAPF64[(((eventStruct)+(8))>>3)]=e.dischargingTime;
        HEAPF64[(((eventStruct)+(16))>>3)]=e.level;
        HEAP32[(((eventStruct)+(24))>>2)]=e.charging;
      },registerBatteryEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
        if (!JSEvents.batteryEvent) {
          JSEvents.batteryEvent = _malloc( 32 );
        }
  
        var handlerFunc = function(event) {
          var e = event || window.event;
  
          JSEvents.fillBatteryEventData(JSEvents.batteryEvent, JSEvents.battery());
  
          var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.batteryEvent, userData);
          if (shouldCancel) {
            e.preventDefault();
          }
        };
  
        var eventHandler = {
          target: JSEvents.findEventTarget(target),
          allowsDeferredCalls: false,
          eventTypeString: eventTypeString,
          callbackfunc: callbackfunc,
          handlerFunc: handlerFunc,
          useCapture: useCapture
        };
        JSEvents.registerOrRemoveHandler(eventHandler);
      },registerWebGlEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
        if (!target) {
          target = Module['canvas'];
        }
        var handlerFunc = function(event) {
          var e = event || window.event;
  
          var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, 0, userData);
          if (shouldCancel) {
            e.preventDefault();
          }
        };
  
        var eventHandler = {
          target: JSEvents.findEventTarget(target),
          allowsDeferredCalls: false,
          eventTypeString: eventTypeString,
          callbackfunc: callbackfunc,
          handlerFunc: handlerFunc,
          useCapture: useCapture
        };
        JSEvents.registerOrRemoveHandler(eventHandler);
      }};function __emscripten_sample_gamepad_data() {
      // Polling gamepads generates garbage, so don't do it when we know there are no gamepads connected.
      if (!JSEvents.numGamepadsConnected) return;
  
      // Produce a new Gamepad API sample if we are ticking a new game frame, or if not using emscripten_set_main_loop() at all to drive animation.
      if (Browser.mainLoop.currentFrameNumber !== JSEvents.lastGamepadStateFrame || !Browser.mainLoop.currentFrameNumber) {
        JSEvents.lastGamepadState = navigator.getGamepads ? navigator.getGamepads() : (navigator.webkitGetGamepads ? navigator.webkitGetGamepads : null);
        JSEvents.lastGamepadStateFrame = Browser.mainLoop.currentFrameNumber;
      }
    }function _emscripten_get_gamepad_status(index, gamepadState) {
      __emscripten_sample_gamepad_data();
      if (!JSEvents.lastGamepadState) return -1;
  
      // INVALID_PARAM is returned on a Gamepad index that never was there.
      if (index < 0 || index >= JSEvents.lastGamepadState.length) return -5;
  
      // NO_DATA is returned on a Gamepad index that was removed.
      // For previously disconnected gamepads there should be an empty slot (null/undefined/false) at the index.
      // This is because gamepads must keep their original position in the array.
      // For example, removing the first of two gamepads produces [null/undefined/false, gamepad].
      if (!JSEvents.lastGamepadState[index]) return -7;
  
      JSEvents.fillGamepadEventData(gamepadState, JSEvents.lastGamepadState[index]);
      return 0;
    }

  function _emscripten_glCopyTexImage2D(x0, x1, x2, x3, x4, x5, x6, x7) { GLctx['copyTexImage2D'](x0, x1, x2, x3, x4, x5, x6, x7) }

  function _emscripten_glTexParameterfv(target, pname, params) {
      var param = HEAPF32[((params)>>2)];
      GLctx.texParameterf(target, pname, param);
    }

  function _emscripten_glLinkProgram(program) {
      GLctx.linkProgram(GL.programs[program]);
      GL.programInfos[program] = null; // uniforms no longer keep the same names after linking
      GL.populateUniformTable(program);
    }

  function _emscripten_glUniform3f(location, v0, v1, v2) {
      GLctx.uniform3f(GL.uniforms[location], v0, v1, v2);
    }

  function _emscripten_glGetObjectParameterivARB() {
  Module['printErr']('missing function: emscripten_glGetObjectParameterivARB'); abort(-1);
  }

  function _emscripten_glBlendFunc(x0, x1) { GLctx['blendFunc'](x0, x1) }

  function _emscripten_glUniform3i(location, v0, v1, v2) {
      GLctx.uniform3i(GL.uniforms[location], v0, v1, v2);
    }

  function _emscripten_glStencilOp(x0, x1, x2) { GLctx['stencilOp'](x0, x1, x2) }

  function _glCreateShader(shaderType) {
      var id = GL.getNewId(GL.shaders);
      GL.shaders[id] = GLctx.createShader(shaderType);
      return id;
    }

  function _glUniform1i(location, v0) {
      GLctx.uniform1i(GL.uniforms[location], v0);
    }

  function _emscripten_glBindAttribLocation(program, index, name) {
      name = Pointer_stringify(name);
      GLctx.bindAttribLocation(GL.programs[program], index, name);
    }

  function _glCompressedTexImage2D(target, level, internalFormat, width, height, border, imageSize, data) {
      GLctx['compressedTexImage2D'](target, level, internalFormat, width, height, border, data ? HEAPU8.subarray((data),(data+imageSize)) : null);
    }

  function _glDisable(x0) { GLctx['disable'](x0) }

  function _emscripten_glEnableVertexAttribArray(index) {
      GLctx.enableVertexAttribArray(index);
    }

   
  Module["_memset"] = _memset;

  function _glfwMakeContextCurrent(winid) {}

  function _emscripten_set_touchcancel_callback(target, userData, useCapture, callbackfunc) {
      JSEvents.registerTouchEventCallback(target, userData, useCapture, callbackfunc, 25, "touchcancel");
      return 0;
    }

  function ___lock() {}

  function _emscripten_glBlendFuncSeparate(x0, x1, x2, x3) { GLctx['blendFuncSeparate'](x0, x1, x2, x3) }

  function _glCullFace(x0) { GLctx['cullFace'](x0) }

  function _emscripten_glGetVertexAttribPointerv(index, pname, pointer) {
      if (!pointer) {
        // GLES2 specification does not specify how to behave if pointer is a null pointer. Since calling this function does not make sense
        // if pointer == null, issue a GL error to notify user about it. 
        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
        return;
      }
      HEAP32[((pointer)>>2)]=GLctx.getVertexAttribOffset(index, pname);
    }

  function _emscripten_glVertexAttrib3f(x0, x1, x2, x3) { GLctx['vertexAttrib3f'](x0, x1, x2, x3) }

  function _emscripten_glEnable(x0) { GLctx['enable'](x0) }

  function _emscripten_glNormalPointer() {
  Module['printErr']('missing function: emscripten_glNormalPointer'); abort(-1);
  }

  
  var _emscripten_GetProcAddress=undefined;
  Module["_emscripten_GetProcAddress"] = _emscripten_GetProcAddress;
  
  var EGL={errorCode:12288,defaultDisplayInitialized:false,currentContext:0,currentReadSurface:0,currentDrawSurface:0,stringCache:{},setErrorCode:function (code) {
        EGL.errorCode = code;
      },chooseConfig:function (display, attribList, config, config_size, numConfigs) { 
        if (display != 62000 /* Magic ID for Emscripten 'default display' */) {
          EGL.setErrorCode(0x3008 /* EGL_BAD_DISPLAY */);
          return 0;
        }
        // TODO: read attribList.
        if ((!config || !config_size) && !numConfigs) {
          EGL.setErrorCode(0x300C /* EGL_BAD_PARAMETER */);
          return 0;
        }
        if (numConfigs) {
          HEAP32[((numConfigs)>>2)]=1; // Total number of supported configs: 1.
        }
        if (config && config_size > 0) {
          HEAP32[((config)>>2)]=62002; 
        }
        
        EGL.setErrorCode(0x3000 /* EGL_SUCCESS */);
        return 1;
      }};function _eglGetProcAddress(name_) {
      return _emscripten_GetProcAddress(name_);
    }

  function _glDeleteProgram(id) {
      if (!id) return;
      var program = GL.programs[id];
      if (!program) { // glDeleteProgram actually signals an error when deleting a nonexisting object, unlike some other GL delete functions.
        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
        return;
      }
      GLctx.deleteProgram(program);
      program.name = 0;
      GL.programs[id] = null;
      GL.programInfos[id] = null;
    }

  function _emscripten_get_pointerlock_status(pointerlockStatus) {
      if (pointerlockStatus) JSEvents.fillPointerlockChangeEventData(pointerlockStatus);
      if (!document.body || (!document.body.requestPointerLock && !document.body.mozRequestPointerLock && !document.body.webkitRequestPointerLock && !document.body.msRequestPointerLock)) {
        return -1;
      }
      return 0;
    }

  function _glAttachShader(program, shader) {
      GLctx.attachShader(GL.programs[program],
                              GL.shaders[shader]);
    }

  function _glfwGetPrimaryMonitor() {
      return 1;
    }

  
  function emscriptenWebGLGetVertexAttrib(index, pname, params, type) {
      if (!params) {
        // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
        // if params == null, issue a GL error to notify user about it. 
        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
        return;
      }
      var data = GLctx.getVertexAttrib(index, pname);
      if (pname == 0x889F/*VERTEX_ATTRIB_ARRAY_BUFFER_BINDING*/) {
        HEAP32[((params)>>2)]=data["name"];
      } else if (typeof data == 'number' || typeof data == 'boolean') {
        switch (type) {
          case 'Integer': HEAP32[((params)>>2)]=data; break;
          case 'Float': HEAPF32[((params)>>2)]=data; break;
          case 'FloatToInteger': HEAP32[((params)>>2)]=Math.fround(data); break;
          default: throw 'internal emscriptenWebGLGetVertexAttrib() error, bad type: ' + type;
        }
      } else {
        for (var i = 0; i < data.length; i++) {
          switch (type) {
            case 'Integer': HEAP32[(((params)+(i))>>2)]=data[i]; break;
            case 'Float': HEAPF32[(((params)+(i))>>2)]=data[i]; break;
            case 'FloatToInteger': HEAP32[(((params)+(i))>>2)]=Math.fround(data[i]); break;
            default: throw 'internal emscriptenWebGLGetVertexAttrib() error, bad type: ' + type;
          }
        }
      }
    }function _emscripten_glGetVertexAttribfv(index, pname, params) {
      // N.B. This function may only be called if the vertex attribute was specified using the function glVertexAttrib*f(),
      // otherwise the results are undefined. (GLES3 spec 6.1.12)
      emscriptenWebGLGetVertexAttrib(index, pname, params, 'Float');
    }

  function _emscripten_set_touchstart_callback(target, userData, useCapture, callbackfunc) {
      JSEvents.registerTouchEventCallback(target, userData, useCapture, callbackfunc, 22, "touchstart");
      return 0;
    }

  function _emscripten_glDeleteShader(id) {
      if (!id) return;
      var shader = GL.shaders[id];
      if (!shader) { // glDeleteShader actually signals an error when deleting a nonexisting object, unlike some other GL delete functions.
        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
        return;
      }
      GLctx.deleteShader(shader);
      GL.shaders[id] = null;
    }

  function _emscripten_glVertexPointer(){ throw 'Legacy GL function (glVertexPointer) called. If you want legacy GL emulation, you need to compile with -s LEGACY_GL_EMULATION=1 to enable legacy GL emulation.'; }

  function _emscripten_glDeleteBuffers(n, buffers) {
      for (var i = 0; i < n; i++) {
        var id = HEAP32[(((buffers)+(i*4))>>2)];
        var buffer = GL.buffers[id];
  
        // From spec: "glDeleteBuffers silently ignores 0's and names that do not
        // correspond to existing buffer objects."
        if (!buffer) continue;
  
        GLctx.deleteBuffer(buffer);
        buffer.name = 0;
        GL.buffers[id] = null;
  
        if (id == GL.currArrayBuffer) GL.currArrayBuffer = 0;
        if (id == GL.currElementArrayBuffer) GL.currElementArrayBuffer = 0;
      }
    }

  function _emscripten_glTexParameteriv(target, pname, params) {
      var param = HEAP32[((params)>>2)];
      GLctx.texParameteri(target, pname, param);
    }

  function _glDrawElements(mode, count, type, indices) {
  
      GLctx.drawElements(mode, count, type, indices);
  
    }

  function _glfwTerminate() {
      window.removeEventListener("keydown", GLFW.onKeydown, true);
      window.removeEventListener("keypress", GLFW.onKeyPress, true);
      window.removeEventListener("keyup", GLFW.onKeyup, true);
      Module["canvas"].removeEventListener("mousemove", GLFW.onMousemove, true);
      Module["canvas"].removeEventListener("mousedown", GLFW.onMouseButtonDown, true);
      Module["canvas"].removeEventListener("mouseup", GLFW.onMouseButtonUp, true);
      Module["canvas"].removeEventListener('wheel', GLFW.onMouseWheel, true);
      Module["canvas"].removeEventListener('mousewheel', GLFW.onMouseWheel, true);
      Module["canvas"].removeEventListener('mouseenter', GLFW.onMouseenter, true);
      Module["canvas"].removeEventListener('mouseleave', GLFW.onMouseleave, true);
      Module["canvas"].width = Module["canvas"].height = 1;
      GLFW.windows = null;
      GLFW.active = null;
    }

  function _emscripten_glUniformMatrix2fv(location, count, transpose, value) {
  
  
      var view;
      if (4*count <= GL.MINI_TEMP_BUFFER_SIZE) {
        // avoid allocation when uploading few enough uniforms
        view = GL.miniTempBufferViews[4*count-1];
        for (var i = 0; i < 4*count; i += 4) {
          view[i] = HEAPF32[(((value)+(4*i))>>2)];
          view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)];
          view[i+2] = HEAPF32[(((value)+(4*i+8))>>2)];
          view[i+3] = HEAPF32[(((value)+(4*i+12))>>2)];
        }
      } else {
        view = HEAPF32.subarray((value)>>2,(value+count*16)>>2);
      }
      GLctx.uniformMatrix2fv(GL.uniforms[location], !!transpose, view);
    }

  function ___syscall5(which, varargs) {SYSCALLS.varargs = varargs;
  try {
   // open
      var pathname = SYSCALLS.getStr(), flags = SYSCALLS.get(), mode = SYSCALLS.get() // optional TODO
      var stream = FS.open(pathname, flags, mode);
      return stream.fd;
    } catch (e) {
    if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
    return -e.errno;
  }
  }

  function ___syscall6(which, varargs) {SYSCALLS.varargs = varargs;
  try {
   // close
      var stream = SYSCALLS.getStreamFromFD();
      FS.close(stream);
      return 0;
    } catch (e) {
    if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
    return -e.errno;
  }
  }

  function _llvm_stacksave() {
      var self = _llvm_stacksave;
      if (!self.LLVM_SAVEDSTACKS) {
        self.LLVM_SAVEDSTACKS = [];
      }
      self.LLVM_SAVEDSTACKS.push(Runtime.stackSave());
      return self.LLVM_SAVEDSTACKS.length-1;
    }

  function _emscripten_glGetVertexAttribiv(index, pname, params) {
      // N.B. This function may only be called if the vertex attribute was specified using the function glVertexAttrib*f(),
      // otherwise the results are undefined. (GLES3 spec 6.1.12)
      emscriptenWebGLGetVertexAttrib(index, pname, params, 'FloatToInteger');
    }

  function _emscripten_glUniformMatrix4fv(location, count, transpose, value) {
  
  
      var view;
      if (16*count <= GL.MINI_TEMP_BUFFER_SIZE) {
        // avoid allocation when uploading few enough uniforms
        view = GL.miniTempBufferViews[16*count-1];
        for (var i = 0; i < 16*count; i += 16) {
          view[i] = HEAPF32[(((value)+(4*i))>>2)];
          view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)];
          view[i+2] = HEAPF32[(((value)+(4*i+8))>>2)];
          view[i+3] = HEAPF32[(((value)+(4*i+12))>>2)];
          view[i+4] = HEAPF32[(((value)+(4*i+16))>>2)];
          view[i+5] = HEAPF32[(((value)+(4*i+20))>>2)];
          view[i+6] = HEAPF32[(((value)+(4*i+24))>>2)];
          view[i+7] = HEAPF32[(((value)+(4*i+28))>>2)];
          view[i+8] = HEAPF32[(((value)+(4*i+32))>>2)];
          view[i+9] = HEAPF32[(((value)+(4*i+36))>>2)];
          view[i+10] = HEAPF32[(((value)+(4*i+40))>>2)];
          view[i+11] = HEAPF32[(((value)+(4*i+44))>>2)];
          view[i+12] = HEAPF32[(((value)+(4*i+48))>>2)];
          view[i+13] = HEAPF32[(((value)+(4*i+52))>>2)];
          view[i+14] = HEAPF32[(((value)+(4*i+56))>>2)];
          view[i+15] = HEAPF32[(((value)+(4*i+60))>>2)];
        }
      } else {
        view = HEAPF32.subarray((value)>>2,(value+count*64)>>2);
      }
      GLctx.uniformMatrix4fv(GL.uniforms[location], !!transpose, view);
    }

  function _emscripten_glDrawArraysInstanced(mode, first, count, primcount) {
      GLctx['drawArraysInstanced'](mode, first, count, primcount);
    }

  function _emscripten_glEnableClientState() {
  Module['printErr']('missing function: emscripten_glEnableClientState'); abort(-1);
  }

  function _emscripten_glGetPointerv() {
  Module['printErr']('missing function: emscripten_glGetPointerv'); abort(-1);
  }

  function ___syscall140(which, varargs) {SYSCALLS.varargs = varargs;
  try {
   // llseek
      var stream = SYSCALLS.getStreamFromFD(), offset_high = SYSCALLS.get(), offset_low = SYSCALLS.get(), result = SYSCALLS.get(), whence = SYSCALLS.get();
      var offset = offset_low;
      assert(offset_high === 0);
      FS.llseek(stream, offset, whence);
      HEAP32[((result)>>2)]=stream.position;
      if (stream.getdents && offset === 0 && whence === 0) stream.getdents = null; // reset readdir state
      return 0;
    } catch (e) {
    if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
    return -e.errno;
  }
  }

  function ___syscall146(which, varargs) {SYSCALLS.varargs = varargs;
  try {
   // writev
      var stream = SYSCALLS.getStreamFromFD(), iov = SYSCALLS.get(), iovcnt = SYSCALLS.get();
      return SYSCALLS.doWritev(stream, iov, iovcnt);
    } catch (e) {
    if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
    return -e.errno;
  }
  }

  function _emscripten_glUniform1i(location, v0) {
      GLctx.uniform1i(GL.uniforms[location], v0);
    }

  function ___syscall145(which, varargs) {SYSCALLS.varargs = varargs;
  try {
   // readv
      var stream = SYSCALLS.getStreamFromFD(), iov = SYSCALLS.get(), iovcnt = SYSCALLS.get();
      return SYSCALLS.doReadv(stream, iov, iovcnt);
    } catch (e) {
    if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
    return -e.errno;
  }
  }

  function _emscripten_glStencilMask(x0) { GLctx['stencilMask'](x0) }

  function _emscripten_glStencilFuncSeparate(x0, x1, x2, x3) { GLctx['stencilFuncSeparate'](x0, x1, x2, x3) }

   
  Module["_i64Subtract"] = _i64Subtract;

   
  Module["_i64Add"] = _i64Add;

  function _emscripten_set_touchend_callback(target, userData, useCapture, callbackfunc) {
      JSEvents.registerTouchEventCallback(target, userData, useCapture, callbackfunc, 23, "touchend");
      return 0;
    }

  function _glUseProgram(program) {
      GLctx.useProgram(program ? GL.programs[program] : null);
    }

  function _emscripten_glDisableVertexAttribArray(index) {
      GLctx.disableVertexAttribArray(index);
    }

  function _emscripten_glVertexAttrib1f(x0, x1) { GLctx['vertexAttrib1f'](x0, x1) }

  function _emscripten_glFinish() { GLctx['finish']() }

  function _glDrawArrays(mode, first, count) {
  
      GLctx.drawArrays(mode, first, count);
  
    }

  function _emscripten_glDepthFunc(x0) { GLctx['depthFunc'](x0) }

  function _emscripten_get_num_gamepads() {
      // Polling gamepads generates garbage, so don't do it when we know there are no gamepads connected.
      if (!JSEvents.numGamepadsConnected) return 0;
  
      __emscripten_sample_gamepad_data();
      if (!JSEvents.lastGamepadState) return -1;
      return JSEvents.lastGamepadState.length;
    }

  function _glGetProgramInfoLog(program, maxLength, length, infoLog) {
      var log = GLctx.getProgramInfoLog(GL.programs[program]);
      if (log === null) log = '(unknown error)';
  
      if (maxLength > 0 && infoLog) {
        var numBytesWrittenExclNull = stringToUTF8(log, infoLog, maxLength);
        if (length) HEAP32[((length)>>2)]=numBytesWrittenExclNull;
      } else {
        if (length) HEAP32[((length)>>2)]=0;
      }
    }

  function _emscripten_glUniform4iv(location, count, value) {
  
  
      GLctx.uniform4iv(GL.uniforms[location], HEAP32.subarray((value)>>2,(value+count*16)>>2));
    }

  function _glClear(x0) { GLctx['clear'](x0) }

  function _emscripten_glLoadIdentity(){ throw 'Legacy GL function (glLoadIdentity) called. If you want legacy GL emulation, you need to compile with -s LEGACY_GL_EMULATION=1 to enable legacy GL emulation.'; }

  function _emscripten_glUniform3fv(location, count, value) {
  
  
      var view;
      if (3*count <= GL.MINI_TEMP_BUFFER_SIZE) {
        // avoid allocation when uploading few enough uniforms
        view = GL.miniTempBufferViews[3*count-1];
        for (var i = 0; i < 3*count; i += 3) {
          view[i] = HEAPF32[(((value)+(4*i))>>2)];
          view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)];
          view[i+2] = HEAPF32[(((value)+(4*i+8))>>2)];
        }
      } else {
        view = HEAPF32.subarray((value)>>2,(value+count*12)>>2);
      }
      GLctx.uniform3fv(GL.uniforms[location], view);
    }

  function _emscripten_glIsTexture(texture) {
      var texture = GL.textures[texture];
      if (!texture) return 0;
      return GLctx.isTexture(texture);
    }

  function _glEnableVertexAttribArray(index) {
      GLctx.enableVertexAttribArray(index);
    }

  function _emscripten_glAttachShader(program, shader) {
      GLctx.attachShader(GL.programs[program],
                              GL.shaders[shader]);
    }

  function _glUniform4f(location, v0, v1, v2, v3) {
      GLctx.uniform4f(GL.uniforms[location], v0, v1, v2, v3);
    }

  function _emscripten_request_pointerlock(target, deferUntilInEventHandler) {
      if (!target) target = '#canvas';
      target = JSEvents.findEventTarget(target);
      if (!target) return -4;
      if (!target.requestPointerLock && !target.mozRequestPointerLock && !target.webkitRequestPointerLock && !target.msRequestPointerLock) {
        return -1;
      }
  
      var canPerformRequests = JSEvents.canPerformEventHandlerRequests();
  
      // Queue this function call if we're not currently in an event handler and the user saw it appropriate to do so.
      if (!canPerformRequests) {
        if (deferUntilInEventHandler) {
          JSEvents.deferCall(JSEvents.requestPointerLock, 2 /* priority below fullscreen */, [target]);
          return 1;
        } else {
          return -2;
        }
      }
  
      return JSEvents.requestPointerLock(target);
    }

  function _emscripten_glVertexAttrib2f(x0, x1, x2) { GLctx['vertexAttrib2f'](x0, x1, x2) }

  function _glfwCreateWindow(width, height, title, monitor, share) {
      return GLFW.createWindow(width, height, title, monitor, share);
    }

  function _glfwDefaultWindowHints() {
      GLFW.hints = GLFW.defaultHints;
    }

  function _emscripten_glClearStencil(x0) { GLctx['clearStencil'](x0) }

  function _emscripten_glDetachShader(program, shader) {
      GLctx.detachShader(GL.programs[program],
                              GL.shaders[shader]);
    }

  function _emscripten_glDeleteVertexArrays(n, vaos) {
      for (var i = 0; i < n; i++) {
        var id = HEAP32[(((vaos)+(i*4))>>2)];
        GLctx['deleteVertexArray'](GL.vaos[id]);
        GL.vaos[id] = null;
      }
    }

  function _glfwInit() {
      if (GLFW.windows) return 1; // GL_TRUE
  
      GLFW.initialTime = GLFW.getTime();
      GLFW.hints = GLFW.defaultHints;
      GLFW.windows = new Array()
      GLFW.active = null;
  
      window.addEventListener("keydown", GLFW.onKeydown, true);
      window.addEventListener("keypress", GLFW.onKeyPress, true);
      window.addEventListener("keyup", GLFW.onKeyup, true);
      Module["canvas"].addEventListener("mousemove", GLFW.onMousemove, true);
      Module["canvas"].addEventListener("mousedown", GLFW.onMouseButtonDown, true);
      Module["canvas"].addEventListener("mouseup", GLFW.onMouseButtonUp, true);
      Module["canvas"].addEventListener('wheel', GLFW.onMouseWheel, true);
      Module["canvas"].addEventListener('mousewheel', GLFW.onMouseWheel, true);
      Module["canvas"].addEventListener('mouseenter', GLFW.onMouseenter, true);
      Module["canvas"].addEventListener('mouseleave', GLFW.onMouseleave, true);
  
      Browser.resizeListeners.push(function(width, height) {
         GLFW.onCanvasResize(width, height);
      });
      return 1; // GL_TRUE
    }

  function _emscripten_glGetTexParameteriv(target, pname, params) {
      if (!params) {
        // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
        // if p == null, issue a GL error to notify user about it. 
        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
        return;
      }
      HEAP32[((params)>>2)]=GLctx.getTexParameter(target, pname);
    }

  function _glfwSwapBuffers(winid) {
      GLFW.swapBuffers(winid);
    }

  function _emscripten_glGenerateMipmap(x0) { GLctx['generateMipmap'](x0) }

  function _emscripten_glCullFace(x0) { GLctx['cullFace'](x0) }

  function _emscripten_glUniform4f(location, v0, v1, v2, v3) {
      GLctx.uniform4f(GL.uniforms[location], v0, v1, v2, v3);
    }

  function _glDisableVertexAttribArray(index) {
      GLctx.disableVertexAttribArray(index);
    }

  function _emscripten_glUseProgram(program) {
      GLctx.useProgram(program ? GL.programs[program] : null);
    }

  function _emscripten_glHint(x0, x1) { GLctx['hint'](x0, x1) }

  function _emscripten_glUniform2fv(location, count, value) {
  
  
      var view;
      if (2*count <= GL.MINI_TEMP_BUFFER_SIZE) {
        // avoid allocation when uploading few enough uniforms
        view = GL.miniTempBufferViews[2*count-1];
        for (var i = 0; i < 2*count; i += 2) {
          view[i] = HEAPF32[(((value)+(4*i))>>2)];
          view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)];
        }
      } else {
        view = HEAPF32.subarray((value)>>2,(value+count*8)>>2);
      }
      GLctx.uniform2fv(GL.uniforms[location], view);
    }

  function _glfwSwapInterval(interval) {
      interval = Math.abs(interval); // GLFW uses negative values to enable GLX_EXT_swap_control_tear, which we don't have, so just treat negative and positive the same.
      if (interval == 0) _emscripten_set_main_loop_timing(0/*EM_TIMING_SETTIMEOUT*/, 0);
      else _emscripten_set_main_loop_timing(1/*EM_TIMING_RAF*/, interval);
    }

  function _glGetShaderInfoLog(shader, maxLength, length, infoLog) {
      var log = GLctx.getShaderInfoLog(GL.shaders[shader]);
      if (log === null) log = '(unknown error)';
      if (maxLength > 0 && infoLog) {
        var numBytesWrittenExclNull = stringToUTF8(log, infoLog, maxLength);
        if (length) HEAP32[((length)>>2)]=numBytesWrittenExclNull;
      } else {
        if (length) HEAP32[((length)>>2)]=0;
      }
    }

  function _emscripten_glMatrixMode(){ throw 'Legacy GL function (glMatrixMode) called. If you want legacy GL emulation, you need to compile with -s LEGACY_GL_EMULATION=1 to enable legacy GL emulation.'; }

  function _abort() {
      Module['abort']();
    }

  function _emscripten_glFramebufferRenderbuffer(target, attachment, renderbuffertarget, renderbuffer) {
      GLctx.framebufferRenderbuffer(target, attachment, renderbuffertarget,
                                         GL.renderbuffers[renderbuffer]);
    }

  function _emscripten_glDeleteFramebuffers(n, framebuffers) {
      for (var i = 0; i < n; ++i) {
        var id = HEAP32[(((framebuffers)+(i*4))>>2)];
        var framebuffer = GL.framebuffers[id];
        if (!framebuffer) continue; // GL spec: "glDeleteFramebuffers silently ignores 0s and names that do not correspond to existing framebuffer objects".
        GLctx.deleteFramebuffer(framebuffer);
        framebuffer.name = 0;
        GL.framebuffers[id] = null;
      }
    }

  function _emscripten_glIsBuffer(buffer) {
      var b = GL.buffers[buffer];
      if (!b) return 0;
      return GLctx.isBuffer(b);
    }

  function _emscripten_glUniform2iv(location, count, value) {
  
  
      GLctx.uniform2iv(GL.uniforms[location], HEAP32.subarray((value)>>2,(value+count*8)>>2));
    }

  function _emscripten_glVertexAttrib1fv(index, v) {
  
      GLctx.vertexAttrib1f(index, HEAPF32[v>>2]);
    }

  function _glEnable(x0) { GLctx['enable'](x0) }

  function _emscripten_glGenFramebuffers(n, ids) {
      for (var i = 0; i < n; ++i) {
        var framebuffer = GLctx.createFramebuffer();
        if (!framebuffer) {
          GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
          while(i < n) HEAP32[(((ids)+(i++*4))>>2)]=0;
          return;
        }
        var id = GL.getNewId(GL.framebuffers);
        framebuffer.name = id;
        GL.framebuffers[id] = framebuffer;
        HEAP32[(((ids)+(i*4))>>2)]=id;
      }
    }

  
  
  function emscriptenWebGLComputeImageSize(width, height, sizePerPixel, alignment) {
      function roundedToNextMultipleOf(x, y) {
        return Math.floor((x + y - 1) / y) * y
      }
      var plainRowSize = width * sizePerPixel;
      var alignedRowSize = roundedToNextMultipleOf(plainRowSize, alignment);
      return (height <= 0) ? 0 :
               ((height - 1) * alignedRowSize + plainRowSize);
    }function emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat) {
      var sizePerPixel;
      var numChannels;
      switch(format) {
        case 0x1906 /* GL_ALPHA */:
        case 0x1909 /* GL_LUMINANCE */:
        case 0x1902 /* GL_DEPTH_COMPONENT */:
          numChannels = 1;
          break;
        case 0x190A /* GL_LUMINANCE_ALPHA */:
          numChannels = 2;
          break;
        case 0x1907 /* GL_RGB */:
        case 0x8C40 /* GL_SRGB_EXT */:
          numChannels = 3;
          break;
        case 0x1908 /* GL_RGBA */:
        case 0x8C42 /* GL_SRGB_ALPHA_EXT */:
          numChannels = 4;
          break;
        default:
          GL.recordError(0x0500); // GL_INVALID_ENUM
          return null;
      }
      switch (type) {
        case 0x1401 /* GL_UNSIGNED_BYTE */:
          sizePerPixel = numChannels*1;
          break;
        case 0x1403 /* GL_UNSIGNED_SHORT */:
        case 0x8D61 /* GL_HALF_FLOAT_OES */:
          sizePerPixel = numChannels*2;
          break;
        case 0x1405 /* GL_UNSIGNED_INT */:
        case 0x1406 /* GL_FLOAT */:
          sizePerPixel = numChannels*4;
          break;
        case 0x84FA /* GL_UNSIGNED_INT_24_8_WEBGL/GL_UNSIGNED_INT_24_8 */:
          sizePerPixel = 4;
          break;
        case 0x8363 /* GL_UNSIGNED_SHORT_5_6_5 */:
        case 0x8033 /* GL_UNSIGNED_SHORT_4_4_4_4 */:
        case 0x8034 /* GL_UNSIGNED_SHORT_5_5_5_1 */:
          sizePerPixel = 2;
          break;
        default:
          GL.recordError(0x0500); // GL_INVALID_ENUM
          return null;
      }
      var bytes = emscriptenWebGLComputeImageSize(width, height, sizePerPixel, GL.unpackAlignment);
      switch(type) {
        case 0x1401 /* GL_UNSIGNED_BYTE */:
          return HEAPU8.subarray((pixels),(pixels+bytes));
        case 0x1406 /* GL_FLOAT */:
          return HEAPF32.subarray((pixels)>>2,(pixels+bytes)>>2);
        case 0x1405 /* GL_UNSIGNED_INT */:
        case 0x84FA /* GL_UNSIGNED_INT_24_8_WEBGL/GL_UNSIGNED_INT_24_8 */:
          return HEAPU32.subarray((pixels)>>2,(pixels+bytes)>>2);
        case 0x1403 /* GL_UNSIGNED_SHORT */:
        case 0x8363 /* GL_UNSIGNED_SHORT_5_6_5 */:
        case 0x8033 /* GL_UNSIGNED_SHORT_4_4_4_4 */:
        case 0x8034 /* GL_UNSIGNED_SHORT_5_5_5_1 */:
        case 0x8D61 /* GL_HALF_FLOAT_OES */:
          return HEAPU16.subarray((pixels)>>1,(pixels+bytes)>>1);
        default:
          GL.recordError(0x0500); // GL_INVALID_ENUM
          return null;
      }
    }function _emscripten_glTexSubImage2D(target, level, xoffset, yoffset, width, height, format, type, pixels) {
      var pixelData = null;
      if (pixels) pixelData = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, 0);
      GLctx.texSubImage2D(target, level, xoffset, yoffset, width, height, format, type, pixelData);
    }

  function _emscripten_glPolygonOffset(x0, x1) { GLctx['polygonOffset'](x0, x1) }

  var _emscripten_asm_const_int=true;

  function _emscripten_glUniform2f(location, v0, v1) {
      GLctx.uniform2f(GL.uniforms[location], v0, v1);
    }

  function _glGetAttribLocation(program, name) {
      program = GL.programs[program];
      name = Pointer_stringify(name);
      return GLctx.getAttribLocation(program, name);
    }

  function _glfwWindowHint(target, hint) {
      GLFW.hints[target] = hint;
    }

  function _emscripten_glUniform2i(location, v0, v1) {
      GLctx.uniform2i(GL.uniforms[location], v0, v1);
    }

  function _glBlendFunc(x0, x1) { GLctx['blendFunc'](x0, x1) }

  function _glCreateProgram() {
      var id = GL.getNewId(GL.programs);
      var program = GLctx.createProgram();
      program.name = id;
      GL.programs[id] = program;
      return id;
    }

  function _emscripten_glDeleteRenderbuffers(n, renderbuffers) {
      for (var i = 0; i < n; i++) {
        var id = HEAP32[(((renderbuffers)+(i*4))>>2)];
        var renderbuffer = GL.renderbuffers[id];
        if (!renderbuffer) continue; // GL spec: "glDeleteRenderbuffers silently ignores 0s and names that do not correspond to existing renderbuffer objects".
        GLctx.deleteRenderbuffer(renderbuffer);
        renderbuffer.name = 0;
        GL.renderbuffers[id] = null;
      }
    }

  function _emscripten_glGetBufferParameteriv(target, value, data) {
      if (!data) {
        // GLES2 specification does not specify how to behave if data is a null pointer. Since calling this function does not make sense
        // if data == null, issue a GL error to notify user about it. 
        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
        return;
      }
      HEAP32[((data)>>2)]=GLctx.getBufferParameter(target, value);
    }

  
  function emscriptenWebGLGetUniform(program, location, params, type) {
      if (!params) {
        // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
        // if params == null, issue a GL error to notify user about it. 
        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
        return;
      }
      var data = GLctx.getUniform(GL.programs[program], GL.uniforms[location]);
      if (typeof data == 'number' || typeof data == 'boolean') {
        switch (type) {
          case 'Integer': HEAP32[((params)>>2)]=data; break;
          case 'Float': HEAPF32[((params)>>2)]=data; break;
          default: throw 'internal emscriptenWebGLGetUniform() error, bad type: ' + type;
        }
      } else {
        for (var i = 0; i < data.length; i++) {
          switch (type) {
            case 'Integer': HEAP32[(((params)+(i))>>2)]=data[i]; break;
            case 'Float': HEAPF32[(((params)+(i))>>2)]=data[i]; break;
            default: throw 'internal emscriptenWebGLGetUniform() error, bad type: ' + type;
          }
        }
      }
    }function _emscripten_glGetUniformiv(program, location, params) {
      emscriptenWebGLGetUniform(program, location, params, 'Integer');
    }

  function _emscripten_glDepthMask(flag) {
      GLctx.depthMask(!!flag);
    }


  function _emscripten_glDepthRangef(x0, x1) { GLctx['depthRange'](x0, x1) }

  function _emscripten_glDepthRange(x0, x1) { GLctx['depthRange'](x0, x1) }

  function _emscripten_set_fullscreenchange_callback(target, userData, useCapture, callbackfunc) {
      if (typeof JSEvents.fullscreenEnabled() === 'undefined') return -1;
      if (!target) target = document;
      else {
        target = JSEvents.findEventTarget(target);
        if (!target) return -4;
      }
      JSEvents.registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, 19, "fullscreenchange");
      JSEvents.registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, 19, "mozfullscreenchange");
      JSEvents.registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, 19, "webkitfullscreenchange");
      JSEvents.registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, 19, "msfullscreenchange");
      return 0;
    }

  
   
  Module["___muldsi3"] = ___muldsi3; 
  Module["___muldi3"] = ___muldi3;

  function _emscripten_glGetShaderPrecisionFormat(shaderType, precisionType, range, precision) {
      var result = GLctx.getShaderPrecisionFormat(shaderType, precisionType);
      HEAP32[((range)>>2)]=result.rangeMin;
      HEAP32[(((range)+(4))>>2)]=result.rangeMax;
      HEAP32[((precision)>>2)]=result.precision;
    }

  function _emscripten_glUniform1fv(location, count, value) {
  
  
      var view;
      if (count <= GL.MINI_TEMP_BUFFER_SIZE) {
        // avoid allocation when uploading few enough uniforms
        view = GL.miniTempBufferViews[count-1];
        for (var i = 0; i < count; ++i) {
          view[i] = HEAPF32[(((value)+(4*i))>>2)];
        }
      } else {
        view = HEAPF32.subarray((value)>>2,(value+count*4)>>2);
      }
      GLctx.uniform1fv(GL.uniforms[location], view);
    }

  function _glDeleteBuffers(n, buffers) {
      for (var i = 0; i < n; i++) {
        var id = HEAP32[(((buffers)+(i*4))>>2)];
        var buffer = GL.buffers[id];
  
        // From spec: "glDeleteBuffers silently ignores 0's and names that do not
        // correspond to existing buffer objects."
        if (!buffer) continue;
  
        GLctx.deleteBuffer(buffer);
        buffer.name = 0;
        GL.buffers[id] = null;
  
        if (id == GL.currArrayBuffer) GL.currArrayBuffer = 0;
        if (id == GL.currElementArrayBuffer) GL.currElementArrayBuffer = 0;
      }
    }

  function _emscripten_set_gamepaddisconnected_callback(userData, useCapture, callbackfunc) {
      if (!navigator.getGamepads && !navigator.webkitGetGamepads) return -1;
      JSEvents.registerGamepadEventCallback(window, userData, useCapture, callbackfunc, 27, "gamepaddisconnected");
      return 0;
   }

  function _emscripten_glBindProgramARB() {
  Module['printErr']('missing function: emscripten_glBindProgramARB'); abort(-1);
  }

  function _emscripten_glBindTexture(target, texture) {
      GLctx.bindTexture(target, texture ? GL.textures[texture] : null);
    }

  function _emscripten_glCheckFramebufferStatus(x0) { return GLctx['checkFramebufferStatus'](x0) }

  function _emscripten_glDeleteProgram(id) {
      if (!id) return;
      var program = GL.programs[id];
      if (!program) { // glDeleteProgram actually signals an error when deleting a nonexisting object, unlike some other GL delete functions.
        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
        return;
      }
      GLctx.deleteProgram(program);
      program.name = 0;
      GL.programs[id] = null;
      GL.programInfos[id] = null;
    }

  function _emscripten_glDisable(x0) { GLctx['disable'](x0) }

  function _emscripten_glVertexAttrib3fv(index, v) {
  
      GLctx.vertexAttrib3f(index, HEAPF32[v>>2], HEAPF32[v+4>>2], HEAPF32[v+8>>2]);
    }

  function _glClearColor(x0, x1, x2, x3) { GLctx['clearColor'](x0, x1, x2, x3) }

  function _emscripten_glGetActiveAttrib(program, index, bufSize, length, size, type, name) {
      program = GL.programs[program];
      var info = GLctx.getActiveAttrib(program, index);
      if (!info) return; // If an error occurs, nothing will be written to length, size and type and name.
  
      if (bufSize > 0 && name) {
        var numBytesWrittenExclNull = stringToUTF8(info.name, name, bufSize);
        if (length) HEAP32[((length)>>2)]=numBytesWrittenExclNull;
      } else {
        if (length) HEAP32[((length)>>2)]=0;
      }
  
      if (size) HEAP32[((size)>>2)]=info.size;
      if (type) HEAP32[((type)>>2)]=info.type;
    }

  function _emscripten_glIsFramebuffer(framebuffer) {
      var fb = GL.framebuffers[framebuffer];
      if (!fb) return 0;
      return GLctx.isFramebuffer(fb);
    }

  function _emscripten_glLineWidth(x0) { GLctx['lineWidth'](x0) }

  function _glfwGetCursorPos(winid, x, y) {
      GLFW.getCursorPos(winid, x, y);
    }

  function _emscripten_glGetString(name_) {
      if (GL.stringCache[name_]) return GL.stringCache[name_];
      var ret; 
      switch(name_) {
        case 0x1F00 /* GL_VENDOR */:
        case 0x1F01 /* GL_RENDERER */:
        case 0x9245 /* UNMASKED_VENDOR_WEBGL */:
        case 0x9246 /* UNMASKED_RENDERER_WEBGL */:
          ret = allocate(intArrayFromString(GLctx.getParameter(name_)), 'i8', ALLOC_NORMAL);
          break;
        case 0x1F02 /* GL_VERSION */:
          var glVersion = GLctx.getParameter(GLctx.VERSION);
          // return GLES version string corresponding to the version of the WebGL context
          {
            glVersion = 'OpenGL ES 2.0 (' + glVersion + ')';
          }
          ret = allocate(intArrayFromString(glVersion), 'i8', ALLOC_NORMAL);
          break;
        case 0x1F03 /* GL_EXTENSIONS */:
          var exts = GLctx.getSupportedExtensions();
          var gl_exts = [];
          for (var i = 0; i < exts.length; ++i) {
            gl_exts.push(exts[i]);
            gl_exts.push("GL_" + exts[i]);
          }
          ret = allocate(intArrayFromString(gl_exts.join(' ')), 'i8', ALLOC_NORMAL);
          break;
        case 0x8B8C /* GL_SHADING_LANGUAGE_VERSION */:
          var glslVersion = GLctx.getParameter(GLctx.SHADING_LANGUAGE_VERSION);
          // extract the version number 'N.M' from the string 'WebGL GLSL ES N.M ...'
          var ver_re = /^WebGL GLSL ES ([0-9]\.[0-9][0-9]?)(?:$| .*)/;
          var ver_num = glslVersion.match(ver_re);
          if (ver_num !== null) {
            if (ver_num[1].length == 3) ver_num[1] = ver_num[1] + '0'; // ensure minor version has 2 digits
            glslVersion = 'OpenGL ES GLSL ES ' + ver_num[1] + ' (' + glslVersion + ')';
          }
          ret = allocate(intArrayFromString(glslVersion), 'i8', ALLOC_NORMAL);
          break;
        default:
          GL.recordError(0x0500/*GL_INVALID_ENUM*/);
          return 0;
      }
      GL.stringCache[name_] = ret;
      return ret;
    }

  function _emscripten_glGetAttribLocation(program, name) {
      program = GL.programs[program];
      name = Pointer_stringify(name);
      return GLctx.getAttribLocation(program, name);
    }

  function _emscripten_glRotatef() {
  Module['printErr']('missing function: emscripten_glRotatef'); abort(-1);
  }

  
  function emscriptenWebGLGet(name_, p, type) {
      // Guard against user passing a null pointer.
      // Note that GLES2 spec does not say anything about how passing a null pointer should be treated.
      // Testing on desktop core GL 3, the application crashes on glGetIntegerv to a null pointer, but
      // better to report an error instead of doing anything random.
      if (!p) {
        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
        return;
      }
      var ret = undefined;
      switch(name_) { // Handle a few trivial GLES values
        case 0x8DFA: // GL_SHADER_COMPILER
          ret = 1;
          break;
        case 0x8DF8: // GL_SHADER_BINARY_FORMATS
          if (type !== 'Integer' && type !== 'Integer64') {
            GL.recordError(0x0500); // GL_INVALID_ENUM
          }
          return; // Do not write anything to the out pointer, since no binary formats are supported.
        case 0x8DF9: // GL_NUM_SHADER_BINARY_FORMATS
          ret = 0;
          break;
        case 0x86A2: // GL_NUM_COMPRESSED_TEXTURE_FORMATS
          // WebGL doesn't have GL_NUM_COMPRESSED_TEXTURE_FORMATS (it's obsolete since GL_COMPRESSED_TEXTURE_FORMATS returns a JS array that can be queried for length),
          // so implement it ourselves to allow C++ GLES2 code get the length.
          var formats = GLctx.getParameter(0x86A3 /*GL_COMPRESSED_TEXTURE_FORMATS*/);
          ret = formats.length;
          break;
      }
  
      if (ret === undefined) {
        var result = GLctx.getParameter(name_);
        switch (typeof(result)) {
          case "number":
            ret = result;
            break;
          case "boolean":
            ret = result ? 1 : 0;
            break;
          case "string":
            GL.recordError(0x0500); // GL_INVALID_ENUM
            return;
          case "object":
            if (result === null) {
              // null is a valid result for some (e.g., which buffer is bound - perhaps nothing is bound), but otherwise
              // can mean an invalid name_, which we need to report as an error
              switch(name_) {
                case 0x8894: // ARRAY_BUFFER_BINDING
                case 0x8B8D: // CURRENT_PROGRAM
                case 0x8895: // ELEMENT_ARRAY_BUFFER_BINDING
                case 0x8CA6: // FRAMEBUFFER_BINDING
                case 0x8CA7: // RENDERBUFFER_BINDING
                case 0x8069: // TEXTURE_BINDING_2D
                case 0x8514: { // TEXTURE_BINDING_CUBE_MAP
                  ret = 0;
                  break;
                }
                default: {
                  GL.recordError(0x0500); // GL_INVALID_ENUM
                  return;
                }
              }
            } else if (result instanceof Float32Array ||
                       result instanceof Uint32Array ||
                       result instanceof Int32Array ||
                       result instanceof Array) {
              for (var i = 0; i < result.length; ++i) {
                switch (type) {
                  case 'Integer': HEAP32[(((p)+(i*4))>>2)]=result[i];   break;
                  case 'Float':   HEAPF32[(((p)+(i*4))>>2)]=result[i]; break;
                  case 'Boolean': HEAP8[(((p)+(i))>>0)]=result[i] ? 1 : 0;    break;
                  default: throw 'internal glGet error, bad type: ' + type;
                }
              }
              return;
            } else if (result instanceof WebGLBuffer ||
                       result instanceof WebGLProgram ||
                       result instanceof WebGLFramebuffer ||
                       result instanceof WebGLRenderbuffer ||
                       result instanceof WebGLTexture) {
              ret = result.name | 0;
            } else {
              GL.recordError(0x0500); // GL_INVALID_ENUM
              return;
            }
            break;
          default:
            GL.recordError(0x0500); // GL_INVALID_ENUM
            return;
        }
      }
  
      switch (type) {
        case 'Integer64': (tempI64 = [ret>>>0,(tempDouble=ret,(+(Math_abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math_min((+(Math_floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math_ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[((p)>>2)]=tempI64[0],HEAP32[(((p)+(4))>>2)]=tempI64[1]);    break;
        case 'Integer': HEAP32[((p)>>2)]=ret;    break;
        case 'Float':   HEAPF32[((p)>>2)]=ret;  break;
        case 'Boolean': HEAP8[((p)>>0)]=ret ? 1 : 0; break;
        default: throw 'internal glGet error, bad type: ' + type;
      }
    }function _emscripten_glGetIntegerv(name_, p) {
      emscriptenWebGLGet(name_, p, 'Integer');
    }

  function _emscripten_glGetFramebufferAttachmentParameteriv(target, attachment, pname, params) {
      var result = GLctx.getFramebufferAttachmentParameter(target, attachment, pname);
      HEAP32[((params)>>2)]=result;
    }

  function _llvm_stackrestore(p) {
      var self = _llvm_stacksave;
      var ret = self.LLVM_SAVEDSTACKS[p];
      self.LLVM_SAVEDSTACKS.splice(p, 1);
      Runtime.stackRestore(ret);
    }

  function _glfwSetWindowShouldClose(winid, value) {
      var win = GLFW.WindowFromId(winid);
      if (!win) return;
      win.shouldClose = value;
    }

  function _emscripten_glClientActiveTexture() {
  Module['printErr']('missing function: emscripten_glClientActiveTexture'); abort(-1);
  }

  function _glGenBuffers(n, buffers) {
      for (var i = 0; i < n; i++) {
        var buffer = GLctx.createBuffer();
        if (!buffer) {
          GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
          while(i < n) HEAP32[(((buffers)+(i++*4))>>2)]=0;
          return;
        }
        var id = GL.getNewId(GL.buffers);
        buffer.name = id;
        GL.buffers[id] = buffer;
        HEAP32[(((buffers)+(i*4))>>2)]=id;
      }
    }

  
  function _emscripten_memcpy_big(dest, src, num) {
      HEAPU8.set(HEAPU8.subarray(src, src+num), dest);
      return dest;
    } 
  Module["_memcpy"] = _memcpy;

  function _emscripten_glGetShaderInfoLog(shader, maxLength, length, infoLog) {
      var log = GLctx.getShaderInfoLog(GL.shaders[shader]);
      if (log === null) log = '(unknown error)';
      if (maxLength > 0 && infoLog) {
        var numBytesWrittenExclNull = stringToUTF8(log, infoLog, maxLength);
        if (length) HEAP32[((length)>>2)]=numBytesWrittenExclNull;
      } else {
        if (length) HEAP32[((length)>>2)]=0;
      }
    }

  function _glfwGetTime() {
      return GLFW.getTime() - GLFW.initialTime;
    }

  function _emscripten_glGetRenderbufferParameteriv(target, pname, params) {
      if (!params) {
        // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
        // if params == null, issue a GL error to notify user about it. 
        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
        return;
      }
      HEAP32[((params)>>2)]=GLctx.getRenderbufferParameter(target, pname);
    }

  function _emscripten_glStencilOpSeparate(x0, x1, x2, x3) { GLctx['stencilOpSeparate'](x0, x1, x2, x3) }

  function _emscripten_glReadPixels(x, y, width, height, format, type, pixels) {
      var pixelData = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, format);
      if (!pixelData) {
        GL.recordError(0x0500/*GL_INVALID_ENUM*/);
        return;
      }
      GLctx.readPixels(x, y, width, height, format, type, pixelData);
    }

  function _emscripten_glCompressedTexSubImage2D(target, level, xoffset, yoffset, width, height, format, imageSize, data) {
      GLctx['compressedTexSubImage2D'](target, level, xoffset, yoffset, width, height, format, data ? HEAPU8.subarray((data),(data+imageSize)) : null);
    }

  function _emscripten_glGetError() {
      // First return any GL error generated by the emscripten library_gl.js interop layer.
      if (GL.lastError) {
        var error = GL.lastError;
        GL.lastError = 0/*GL_NO_ERROR*/;
        return error;
      } else { // If there were none, return the GL error from the browser GL context.
        return GLctx.getError();
      }
    }

  function _emscripten_glFramebufferTexture2D(target, attachment, textarget, texture, level) {
      GLctx.framebufferTexture2D(target, attachment, textarget,
                                      GL.textures[texture], level);
    }

  function _emscripten_glIsEnabled(x0) { return GLctx['isEnabled'](x0) }

  function _glClearDepthf(x0) { GLctx['clearDepth'](x0) }

   
  Module["_memmove"] = _memmove;

  function _glGenTextures(n, textures) {
      for (var i = 0; i < n; i++) {
        var texture = GLctx.createTexture();
        if (!texture) {
          GL.recordError(0x0502 /* GL_INVALID_OPERATION */); // GLES + EGL specs don't specify what should happen here, so best to issue an error and create IDs with 0.
          while(i < n) HEAP32[(((textures)+(i++*4))>>2)]=0;
          return;
        }
        var id = GL.getNewId(GL.textures);
        texture.name = id;
        GL.textures[id] = texture;
        HEAP32[(((textures)+(i*4))>>2)]=id;
      }
    }

  function _emscripten_glVertexAttrib4f(x0, x1, x2, x3, x4) { GLctx['vertexAttrib4f'](x0, x1, x2, x3, x4) }

  function _glDepthFunc(x0) { GLctx['depthFunc'](x0) }

  
  
  var cttz_i8 = allocate([8,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,5,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,6,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,5,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,7,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,5,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,6,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,5,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0], "i8", ALLOC_STATIC); 
  Module["_llvm_cttz_i32"] = _llvm_cttz_i32; 
  Module["___udivmoddi4"] = ___udivmoddi4; 
  Module["___uremdi3"] = ___uremdi3;

  function _emscripten_glClearDepthf(x0) { GLctx['clearDepth'](x0) }

  function _emscripten_glClear(x0) { GLctx['clear'](x0) }

  function _emscripten_glBindBuffer(target, buffer) {
      var bufferObj = buffer ? GL.buffers[buffer] : null;
  
  
      GLctx.bindBuffer(target, bufferObj);
    }

  function _emscripten_glGetUniformfv(program, location, params) {
      emscriptenWebGLGetUniform(program, location, params, 'Float');
    }

  function _glGetProgramiv(program, pname, p) {
      if (!p) {
        // GLES2 specification does not specify how to behave if p is a null pointer. Since calling this function does not make sense
        // if p == null, issue a GL error to notify user about it. 
        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
        return;
      }
  
      if (program >= GL.counter) {
        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
        return;
      }
  
      var ptable = GL.programInfos[program];
      if (!ptable) {
        GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
        return;
      }
  
      if (pname == 0x8B84) { // GL_INFO_LOG_LENGTH
        var log = GLctx.getProgramInfoLog(GL.programs[program]);
        if (log === null) log = '(unknown error)';
        HEAP32[((p)>>2)]=log.length + 1;
      } else if (pname == 0x8B87 /* GL_ACTIVE_UNIFORM_MAX_LENGTH */) {
        HEAP32[((p)>>2)]=ptable.maxUniformLength;
      } else if (pname == 0x8B8A /* GL_ACTIVE_ATTRIBUTE_MAX_LENGTH */) {
        if (ptable.maxAttributeLength == -1) {
          var program = GL.programs[program];
          var numAttribs = GLctx.getProgramParameter(program, GLctx.ACTIVE_ATTRIBUTES);
          ptable.maxAttributeLength = 0; // Spec says if there are no active attribs, 0 must be returned.
          for (var i = 0; i < numAttribs; ++i) {
            var activeAttrib = GLctx.getActiveAttrib(program, i);
            ptable.maxAttributeLength = Math.max(ptable.maxAttributeLength, activeAttrib.name.length+1);
          }
        }
        HEAP32[((p)>>2)]=ptable.maxAttributeLength;
      } else if (pname == 0x8A35 /* GL_ACTIVE_UNIFORM_BLOCK_MAX_NAME_LENGTH */) {
        if (ptable.maxUniformBlockNameLength == -1) {
          var program = GL.programs[program];
          var numBlocks = GLctx.getProgramParameter(program, GLctx.ACTIVE_UNIFORM_BLOCKS);
          ptable.maxUniformBlockNameLength = 0;
          for (var i = 0; i < numBlocks; ++i) {
            var activeBlockName = GLctx.getActiveUniformBlockName(program, i);
            ptable.maxUniformBlockNameLength = Math.max(ptable.maxUniformBlockNameLength, activeBlockName.length+1);
          }
        }
        HEAP32[((p)>>2)]=ptable.maxUniformBlockNameLength;
      } else {
        HEAP32[((p)>>2)]=GLctx.getProgramParameter(GL.programs[program], pname);
      }
    }

  function _glVertexAttribPointer(index, size, type, normalized, stride, ptr) {
      GLctx.vertexAttribPointer(index, size, type, !!normalized, stride, ptr);
    }

  function _emscripten_exit_pointerlock() {
      // Make sure no queued up calls will fire after this.
      JSEvents.removeDeferredCalls(JSEvents.requestPointerLock);
  
      if (document.exitPointerLock) {
        document.exitPointerLock();
      } else if (document.msExitPointerLock) {
        document.msExitPointerLock();
      } else if (document.mozExitPointerLock) {
        document.mozExitPointerLock();
      } else if (document.webkitExitPointerLock) {
        document.webkitExitPointerLock();
      } else {
        return -1;
      }
      return 0;
    }

  function _glGetUniformLocation(program, name) {
      name = Pointer_stringify(name);
  
      var arrayOffset = 0;
      // If user passed an array accessor "[index]", parse the array index off the accessor.
      if (name.indexOf(']', name.length-1) !== -1) {
        var ls = name.lastIndexOf('[');
        var arrayIndex = name.slice(ls+1, -1);
        if (arrayIndex.length > 0) {
          arrayOffset = parseInt(arrayIndex);
          if (arrayOffset < 0) {
            return -1;
          }
        }
        name = name.slice(0, ls);
      }
  
      var ptable = GL.programInfos[program];
      if (!ptable) {
        return -1;
      }
      var utable = ptable.uniforms;
      var uniformInfo = utable[name]; // returns pair [ dimension_of_uniform_array, uniform_location ]
      if (uniformInfo && arrayOffset < uniformInfo[0]) { // Check if user asked for an out-of-bounds element, i.e. for 'vec4 colors[3];' user could ask for 'colors[10]' which should return -1.
        return uniformInfo[1]+arrayOffset;
      } else {
        return -1;
      }
    }

  function _emscripten_glGetAttachedShaders(program, maxCount, count, shaders) {
      var result = GLctx.getAttachedShaders(GL.programs[program]);
      var len = result.length;
      if (len > maxCount) {
        len = maxCount;
      }
      HEAP32[((count)>>2)]=len;
      for (var i = 0; i < len; ++i) {
        var id = GL.shaders.indexOf(result[i]);
        assert(id !== -1, 'shader not bound to local id');
        HEAP32[(((shaders)+(i*4))>>2)]=id;
      }
    }

  function _emscripten_glGenRenderbuffers(n, renderbuffers) {
      for (var i = 0; i < n; i++) {
        var renderbuffer = GLctx.createRenderbuffer();
        if (!renderbuffer) {
          GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
          while(i < n) HEAP32[(((renderbuffers)+(i++*4))>>2)]=0;
          return;
        }
        var id = GL.getNewId(GL.renderbuffers);
        renderbuffer.name = id;
        GL.renderbuffers[id] = renderbuffer;
        HEAP32[(((renderbuffers)+(i*4))>>2)]=id;
      }
    }

  function _emscripten_glFrontFace(x0) { GLctx['frontFace'](x0) }

  function _emscripten_glActiveTexture(x0) { GLctx['activeTexture'](x0) }

  function _emscripten_glUniform1iv(location, count, value) {
  
  
      GLctx.uniform1iv(GL.uniforms[location], HEAP32.subarray((value)>>2,(value+count*4)>>2));
    }

  function _emscripten_glTexCoordPointer() {
  Module['printErr']('missing function: emscripten_glTexCoordPointer'); abort(-1);
  }

  function _emscripten_glGetInfoLogARB() {
  Module['printErr']('missing function: emscripten_glGetInfoLogARB'); abort(-1);
  }

  
  function __exit(status) {
      // void _exit(int status);
      // http://pubs.opengroup.org/onlinepubs/000095399/functions/exit.html
      Module['exit'](status);
    }function _exit(status) {
      __exit(status);
    }

  function _emscripten_glRenderbufferStorage(x0, x1, x2, x3) { GLctx['renderbufferStorage'](x0, x1, x2, x3) }

  function _emscripten_glCopyTexSubImage2D(x0, x1, x2, x3, x4, x5, x6, x7) { GLctx['copyTexSubImage2D'](x0, x1, x2, x3, x4, x5, x6, x7) }

  function _glfwSetCursorPosCallback(winid, cbfun) {
      GLFW.setCursorPosCallback(winid, cbfun);
    }

  function _glBindAttribLocation(program, index, name) {
      name = Pointer_stringify(name);
      GLctx.bindAttribLocation(GL.programs[program], index, name);
    }

  function _emscripten_glShaderBinary() {
      GL.recordError(0x0500/*GL_INVALID_ENUM*/);
    }

  function _emscripten_glIsProgram(program) {
      var program = GL.programs[program];
      if (!program) return 0;
      return GLctx.isProgram(program);
    }

  function _emscripten_glBlendColor(x0, x1, x2, x3) { GLctx['blendColor'](x0, x1, x2, x3) }

  function _emscripten_glGetShaderiv(shader, pname, p) {
      if (!p) {
        // GLES2 specification does not specify how to behave if p is a null pointer. Since calling this function does not make sense
        // if p == null, issue a GL error to notify user about it. 
        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
        return;
      }
      if (pname == 0x8B84) { // GL_INFO_LOG_LENGTH
        var log = GLctx.getShaderInfoLog(GL.shaders[shader]);
        if (log === null) log = '(unknown error)';
        HEAP32[((p)>>2)]=log.length + 1;
      } else {
        HEAP32[((p)>>2)]=GLctx.getShaderParameter(GL.shaders[shader], pname);
      }
    }

  function _emscripten_glUniformMatrix3fv(location, count, transpose, value) {
  
  
      var view;
      if (9*count <= GL.MINI_TEMP_BUFFER_SIZE) {
        // avoid allocation when uploading few enough uniforms
        view = GL.miniTempBufferViews[9*count-1];
        for (var i = 0; i < 9*count; i += 9) {
          view[i] = HEAPF32[(((value)+(4*i))>>2)];
          view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)];
          view[i+2] = HEAPF32[(((value)+(4*i+8))>>2)];
          view[i+3] = HEAPF32[(((value)+(4*i+12))>>2)];
          view[i+4] = HEAPF32[(((value)+(4*i+16))>>2)];
          view[i+5] = HEAPF32[(((value)+(4*i+20))>>2)];
          view[i+6] = HEAPF32[(((value)+(4*i+24))>>2)];
          view[i+7] = HEAPF32[(((value)+(4*i+28))>>2)];
          view[i+8] = HEAPF32[(((value)+(4*i+32))>>2)];
        }
      } else {
        view = HEAPF32.subarray((value)>>2,(value+count*36)>>2);
      }
      GLctx.uniformMatrix3fv(GL.uniforms[location], !!transpose, view);
    }

   
  Module["___udivdi3"] = ___udivdi3;

  function _emscripten_glUniform4fv(location, count, value) {
  
  
      var view;
      if (4*count <= GL.MINI_TEMP_BUFFER_SIZE) {
        // avoid allocation when uploading few enough uniforms
        view = GL.miniTempBufferViews[4*count-1];
        for (var i = 0; i < 4*count; i += 4) {
          view[i] = HEAPF32[(((value)+(4*i))>>2)];
          view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)];
          view[i+2] = HEAPF32[(((value)+(4*i+8))>>2)];
          view[i+3] = HEAPF32[(((value)+(4*i+12))>>2)];
        }
      } else {
        view = HEAPF32.subarray((value)>>2,(value+count*16)>>2);
      }
      GLctx.uniform4fv(GL.uniforms[location], view);
    }

  function _glBufferSubData(target, offset, size, data) {
      GLctx.bufferSubData(target, offset, HEAPU8.subarray(data, data+size));
    }

  function _llvm_exp2_f32(x) {
      return Math.pow(2, x);
    }

  function _glGetShaderiv(shader, pname, p) {
      if (!p) {
        // GLES2 specification does not specify how to behave if p is a null pointer. Since calling this function does not make sense
        // if p == null, issue a GL error to notify user about it. 
        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
        return;
      }
      if (pname == 0x8B84) { // GL_INFO_LOG_LENGTH
        var log = GLctx.getShaderInfoLog(GL.shaders[shader]);
        if (log === null) log = '(unknown error)';
        HEAP32[((p)>>2)]=log.length + 1;
      } else {
        HEAP32[((p)>>2)]=GLctx.getShaderParameter(GL.shaders[shader], pname);
      }
    }

  function _emscripten_glBlendEquationSeparate(x0, x1) { GLctx['blendEquationSeparate'](x0, x1) }

  function _glfwSetWindowIconifyCallback(winid, cbfun) {
      var win = GLFW.WindowFromId(winid);
      if (!win) return;
      win.windowIconifyFunc = cbfun;
    }

  function _emscripten_glDrawRangeElements() {
  Module['printErr']('missing function: emscripten_glDrawRangeElements'); abort(-1);
  }

  function _emscripten_glGenTextures(n, textures) {
      for (var i = 0; i < n; i++) {
        var texture = GLctx.createTexture();
        if (!texture) {
          GL.recordError(0x0502 /* GL_INVALID_OPERATION */); // GLES + EGL specs don't specify what should happen here, so best to issue an error and create IDs with 0.
          while(i < n) HEAP32[(((textures)+(i++*4))>>2)]=0;
          return;
        }
        var id = GL.getNewId(GL.textures);
        texture.name = id;
        GL.textures[id] = texture;
        HEAP32[(((textures)+(i*4))>>2)]=id;
      }
    }

  function _emscripten_glVertexAttrib2fv(index, v) {
  
      GLctx.vertexAttrib2f(index, HEAPF32[v>>2], HEAPF32[v+4>>2]);
    }

  function _emscripten_glGetActiveUniform(program, index, bufSize, length, size, type, name) {
      program = GL.programs[program];
      var info = GLctx.getActiveUniform(program, index);
      if (!info) return; // If an error occurs, nothing will be written to length, size, type and name.
  
      if (bufSize > 0 && name) {
        var numBytesWrittenExclNull = stringToUTF8(info.name, name, bufSize);
        if (length) HEAP32[((length)>>2)]=numBytesWrittenExclNull;
      } else {
        if (length) HEAP32[((length)>>2)]=0;
      }
  
      if (size) HEAP32[((size)>>2)]=info.size;
      if (type) HEAP32[((type)>>2)]=info.type;
    }

   
  Module["_roundf"] = _roundf;

  function _emscripten_glDeleteObjectARB() {
  Module['printErr']('missing function: emscripten_glDeleteObjectARB'); abort(-1);
  }

  function _emscripten_set_touchmove_callback(target, userData, useCapture, callbackfunc) {
      JSEvents.registerTouchEventCallback(target, userData, useCapture, callbackfunc, 24, "touchmove");
      return 0;
    }

  function _emscripten_glUniform1f(location, v0) {
      GLctx.uniform1f(GL.uniforms[location], v0);
    }

  function _emscripten_glVertexAttribPointer(index, size, type, normalized, stride, ptr) {
      GLctx.vertexAttribPointer(index, size, type, !!normalized, stride, ptr);
    }

  function _glShaderSource(shader, count, string, length) {
      var source = GL.getSource(shader, count, string, length);
  
  
      GLctx.shaderSource(GL.shaders[shader], source);
    }

  function _emscripten_glDrawArrays(mode, first, count) {
  
      GLctx.drawArrays(mode, first, count);
  
    }

  function _emscripten_glGenBuffers(n, buffers) {
      for (var i = 0; i < n; i++) {
        var buffer = GLctx.createBuffer();
        if (!buffer) {
          GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
          while(i < n) HEAP32[(((buffers)+(i++*4))>>2)]=0;
          return;
        }
        var id = GL.getNewId(GL.buffers);
        buffer.name = id;
        GL.buffers[id] = buffer;
        HEAP32[(((buffers)+(i*4))>>2)]=id;
      }
    }

  function _emscripten_glClearDepth(x0) { GLctx['clearDepth'](x0) }

  function _emscripten_set_keypress_callback(target, userData, useCapture, callbackfunc) {
      JSEvents.registerKeyEventCallback(target, userData, useCapture, callbackfunc, 1, "keypress");
      return 0;
    }

  function _glfwSetCharCallback(winid, cbfun) {
      GLFW.setCharCallback(winid, cbfun);
    }

  function _emscripten_glGetUniformLocation(program, name) {
      name = Pointer_stringify(name);
  
      var arrayOffset = 0;
      // If user passed an array accessor "[index]", parse the array index off the accessor.
      if (name.indexOf(']', name.length-1) !== -1) {
        var ls = name.lastIndexOf('[');
        var arrayIndex = name.slice(ls+1, -1);
        if (arrayIndex.length > 0) {
          arrayOffset = parseInt(arrayIndex);
          if (arrayOffset < 0) {
            return -1;
          }
        }
        name = name.slice(0, ls);
      }
  
      var ptable = GL.programInfos[program];
      if (!ptable) {
        return -1;
      }
      var utable = ptable.uniforms;
      var uniformInfo = utable[name]; // returns pair [ dimension_of_uniform_array, uniform_location ]
      if (uniformInfo && arrayOffset < uniformInfo[0]) { // Check if user asked for an out-of-bounds element, i.e. for 'vec4 colors[3];' user could ask for 'colors[10]' which should return -1.
        return uniformInfo[1]+arrayOffset;
      } else {
        return -1;
      }
    }

  function _glBindBuffer(target, buffer) {
      var bufferObj = buffer ? GL.buffers[buffer] : null;
  
  
      GLctx.bindBuffer(target, bufferObj);
    }

  function _emscripten_glVertexAttrib4fv(index, v) {
  
      GLctx.vertexAttrib4f(index, HEAPF32[v>>2], HEAPF32[v+4>>2], HEAPF32[v+8>>2], HEAPF32[v+12>>2]);
    }

  function _emscripten_glScissor(x0, x1, x2, x3) { GLctx['scissor'](x0, x1, x2, x3) }

  function _glfwSetCursorEnterCallback(winid, cbfun) {
      var win = GLFW.WindowFromId(winid);
      if (!win) return;
      win.cursorEnterFunc = cbfun;
    }

   
  Module["_bitshift64Lshr"] = _bitshift64Lshr;

  function _glBufferData(target, size, data, usage) {
      if (!data) {
        GLctx.bufferData(target, size, usage);
      } else {
        GLctx.bufferData(target, HEAPU8.subarray(data, data+size), usage);
      }
    }

  function _emscripten_glIsShader(shader) {
      var s = GL.shaders[shader];
      if (!s) return 0;
      return GLctx.isShader(s);
    }

  function _emscripten_glDrawBuffers(n, bufs) {
  
      var bufArray = GL.tempFixedLengthArray[n];
      for (var i = 0; i < n; i++) {
        bufArray[i] = HEAP32[(((bufs)+(i*4))>>2)];
      }
  
      GLctx['drawBuffers'](bufArray);
    }

  function _glGetFloatv(name_, p) {
      emscriptenWebGLGet(name_, p, 'Float');
    }

  function _emscripten_glBindFramebuffer(target, framebuffer) {
      GLctx.bindFramebuffer(target, framebuffer ? GL.framebuffers[framebuffer] : null);
    }

  function _emscripten_glBlendEquation(x0) { GLctx['blendEquation'](x0) }

  function _emscripten_glBufferSubData(target, offset, size, data) {
      GLctx.bufferSubData(target, offset, HEAPU8.subarray(data, data+size));
    }

  function _emscripten_glBufferData(target, size, data, usage) {
      if (!data) {
        GLctx.bufferData(target, size, usage);
      } else {
        GLctx.bufferData(target, HEAPU8.subarray(data, data+size), usage);
      }
    }

   
  Module["_sbrk"] = _sbrk;

   
  Module["_bitshift64Shl"] = _bitshift64Shl;

  function _emscripten_glGetShaderSource(shader, bufSize, length, source) {
      var result = GLctx.getShaderSource(GL.shaders[shader]);
      if (!result) return; // If an error occurs, nothing will be written to length or source.
      if (bufSize > 0 && source) {
        var numBytesWrittenExclNull = stringToUTF8(result, source, bufSize);
        if (length) HEAP32[((length)>>2)]=numBytesWrittenExclNull;
      } else {
        if (length) HEAP32[((length)>>2)]=0;
      }
    }

   
  Module["_llvm_bswap_i32"] = _llvm_bswap_i32;

  function _emscripten_set_click_callback(target, userData, useCapture, callbackfunc) {
      JSEvents.registerMouseEventCallback(target, userData, useCapture, callbackfunc, 4, "click");
      return 0;
    }

  function _glfwSetKeyCallback(winid, cbfun) {
      GLFW.setKeyCallback(winid, cbfun);
    }

  function _emscripten_set_gamepadconnected_callback(userData, useCapture, callbackfunc) {
      if (!navigator.getGamepads && !navigator.webkitGetGamepads) return -1;
      JSEvents.registerGamepadEventCallback(window, userData, useCapture, callbackfunc, 26, "gamepadconnected");
      return 0;
    }

  function _emscripten_glGetFloatv(name_, p) {
      emscriptenWebGLGet(name_, p, 'Float');
    }

  function _glTexImage2D(target, level, internalFormat, width, height, border, format, type, pixels) {
  
      var pixelData = null;
      if (pixels) pixelData = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat);
      GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, pixelData);
    }

  function ___assert_fail(condition, filename, line, func) {
      ABORT = true;
      throw 'Assertion failed: ' + Pointer_stringify(condition) + ', at: ' + [filename ? Pointer_stringify(filename) : 'unknown filename', line, func ? Pointer_stringify(func) : 'unknown function'] + ' at ' + stackTrace();
    }

  function _emscripten_glVertexAttribDivisor(index, divisor) {
      GLctx['vertexAttribDivisor'](index, divisor);
    }

  function _emscripten_glDrawElementsInstanced(mode, count, type, indices, primcount) {
      GLctx['drawElementsInstanced'](mode, count, type, indices, primcount);
    }

  function _emscripten_glDrawElements(mode, count, type, indices) {
  
      GLctx.drawElements(mode, count, type, indices);
  
    }

  function _glfwSetMouseButtonCallback(winid, cbfun) {
      GLFW.setMouseButtonCallback(winid, cbfun);
    }

  function _emscripten_glCreateProgram() {
      var id = GL.getNewId(GL.programs);
      var program = GLctx.createProgram();
      program.name = id;
      GL.programs[id] = program;
      return id;
    }

  function _emscripten_glCompressedTexImage2D(target, level, internalFormat, width, height, border, imageSize, data) {
      GLctx['compressedTexImage2D'](target, level, internalFormat, width, height, border, data ? HEAPU8.subarray((data),(data+imageSize)) : null);
    }

  function _emscripten_glClearColor(x0, x1, x2, x3) { GLctx['clearColor'](x0, x1, x2, x3) }

  function _emscripten_glBindVertexArray(vao) {
      GLctx['bindVertexArray'](GL.vaos[vao]);
    }

  function _emscripten_glLoadMatrixf() {
  Module['printErr']('missing function: emscripten_glLoadMatrixf'); abort(-1);
  }

  function _glDeleteShader(id) {
      if (!id) return;
      var shader = GL.shaders[id];
      if (!shader) { // glDeleteShader actually signals an error when deleting a nonexisting object, unlike some other GL delete functions.
        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
        return;
      }
      GLctx.deleteShader(shader);
      GL.shaders[id] = null;
    }

  function _emscripten_glGetProgramiv(program, pname, p) {
      if (!p) {
        // GLES2 specification does not specify how to behave if p is a null pointer. Since calling this function does not make sense
        // if p == null, issue a GL error to notify user about it. 
        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
        return;
      }
  
      if (program >= GL.counter) {
        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
        return;
      }
  
      var ptable = GL.programInfos[program];
      if (!ptable) {
        GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
        return;
      }
  
      if (pname == 0x8B84) { // GL_INFO_LOG_LENGTH
        var log = GLctx.getProgramInfoLog(GL.programs[program]);
        if (log === null) log = '(unknown error)';
        HEAP32[((p)>>2)]=log.length + 1;
      } else if (pname == 0x8B87 /* GL_ACTIVE_UNIFORM_MAX_LENGTH */) {
        HEAP32[((p)>>2)]=ptable.maxUniformLength;
      } else if (pname == 0x8B8A /* GL_ACTIVE_ATTRIBUTE_MAX_LENGTH */) {
        if (ptable.maxAttributeLength == -1) {
          var program = GL.programs[program];
          var numAttribs = GLctx.getProgramParameter(program, GLctx.ACTIVE_ATTRIBUTES);
          ptable.maxAttributeLength = 0; // Spec says if there are no active attribs, 0 must be returned.
          for (var i = 0; i < numAttribs; ++i) {
            var activeAttrib = GLctx.getActiveAttrib(program, i);
            ptable.maxAttributeLength = Math.max(ptable.maxAttributeLength, activeAttrib.name.length+1);
          }
        }
        HEAP32[((p)>>2)]=ptable.maxAttributeLength;
      } else if (pname == 0x8A35 /* GL_ACTIVE_UNIFORM_BLOCK_MAX_NAME_LENGTH */) {
        if (ptable.maxUniformBlockNameLength == -1) {
          var program = GL.programs[program];
          var numBlocks = GLctx.getProgramParameter(program, GLctx.ACTIVE_UNIFORM_BLOCKS);
          ptable.maxUniformBlockNameLength = 0;
          for (var i = 0; i < numBlocks; ++i) {
            var activeBlockName = GLctx.getActiveUniformBlockName(program, i);
            ptable.maxUniformBlockNameLength = Math.max(ptable.maxUniformBlockNameLength, activeBlockName.length+1);
          }
        }
        HEAP32[((p)>>2)]=ptable.maxUniformBlockNameLength;
      } else {
        HEAP32[((p)>>2)]=GLctx.getProgramParameter(GL.programs[program], pname);
      }
    }

  function _emscripten_glGetProgramInfoLog(program, maxLength, length, infoLog) {
      var log = GLctx.getProgramInfoLog(GL.programs[program]);
      if (log === null) log = '(unknown error)';
  
      if (maxLength > 0 && infoLog) {
        var numBytesWrittenExclNull = stringToUTF8(log, infoLog, maxLength);
        if (length) HEAP32[((length)>>2)]=numBytesWrittenExclNull;
      } else {
        if (length) HEAP32[((length)>>2)]=0;
      }
    }

  function _emscripten_glTexImage2D(target, level, internalFormat, width, height, border, format, type, pixels) {
  
      var pixelData = null;
      if (pixels) pixelData = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat);
      GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, pixelData);
    }

  function _glPixelStorei(pname, param) {
      if (pname == 0x0D05 /* GL_PACK_ALIGNMENT */) {
        GL.packAlignment = param;
      } else if (pname == 0x0cf5 /* GL_UNPACK_ALIGNMENT */) {
        GL.unpackAlignment = param;
      }
      GLctx.pixelStorei(pname, param);
    }

  function ___unlock() {}

  function _emscripten_glColorPointer() {
  Module['printErr']('missing function: emscripten_glColorPointer'); abort(-1);
  }

  function _glViewport(x0, x1, x2, x3) { GLctx['viewport'](x0, x1, x2, x3) }

  function _glfwDestroyWindow(winid) {
      return GLFW.destroyWindow(winid);
    }

  function _emscripten_glFlush() { GLctx['flush']() }

  function _glfwSetErrorCallback(cbfun) {
      GLFW.errorFunc = cbfun;
    }

  function _emscripten_glCreateShader(shaderType) {
      var id = GL.getNewId(GL.shaders);
      GL.shaders[id] = GLctx.createShader(shaderType);
      return id;
    }

  function _glUniformMatrix4fv(location, count, transpose, value) {
  
  
      var view;
      if (16*count <= GL.MINI_TEMP_BUFFER_SIZE) {
        // avoid allocation when uploading few enough uniforms
        view = GL.miniTempBufferViews[16*count-1];
        for (var i = 0; i < 16*count; i += 16) {
          view[i] = HEAPF32[(((value)+(4*i))>>2)];
          view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)];
          view[i+2] = HEAPF32[(((value)+(4*i+8))>>2)];
          view[i+3] = HEAPF32[(((value)+(4*i+12))>>2)];
          view[i+4] = HEAPF32[(((value)+(4*i+16))>>2)];
          view[i+5] = HEAPF32[(((value)+(4*i+20))>>2)];
          view[i+6] = HEAPF32[(((value)+(4*i+24))>>2)];
          view[i+7] = HEAPF32[(((value)+(4*i+28))>>2)];
          view[i+8] = HEAPF32[(((value)+(4*i+32))>>2)];
          view[i+9] = HEAPF32[(((value)+(4*i+36))>>2)];
          view[i+10] = HEAPF32[(((value)+(4*i+40))>>2)];
          view[i+11] = HEAPF32[(((value)+(4*i+44))>>2)];
          view[i+12] = HEAPF32[(((value)+(4*i+48))>>2)];
          view[i+13] = HEAPF32[(((value)+(4*i+52))>>2)];
          view[i+14] = HEAPF32[(((value)+(4*i+56))>>2)];
          view[i+15] = HEAPF32[(((value)+(4*i+60))>>2)];
        }
      } else {
        view = HEAPF32.subarray((value)>>2,(value+count*64)>>2);
      }
      GLctx.uniformMatrix4fv(GL.uniforms[location], !!transpose, view);
    }

  function _emscripten_glValidateProgram(program) {
      GLctx.validateProgram(GL.programs[program]);
    }

  function _glTexParameterf(x0, x1, x2) { GLctx['texParameterf'](x0, x1, x2) }

  function _glTexParameteri(x0, x1, x2) { GLctx['texParameteri'](x0, x1, x2) }

  function _glFrontFace(x0) { GLctx['frontFace'](x0) }

  function _emscripten_glColorMask(red, green, blue, alpha) {
      GLctx.colorMask(!!red, !!green, !!blue, !!alpha);
    }

  function _emscripten_glPixelStorei(pname, param) {
      if (pname == 0x0D05 /* GL_PACK_ALIGNMENT */) {
        GL.packAlignment = param;
      } else if (pname == 0x0cf5 /* GL_UNPACK_ALIGNMENT */) {
        GL.unpackAlignment = param;
      }
      GLctx.pixelStorei(pname, param);
    }

  function _emscripten_glDeleteTextures(n, textures) {
      for (var i = 0; i < n; i++) {
        var id = HEAP32[(((textures)+(i*4))>>2)];
        var texture = GL.textures[id];
        if (!texture) continue; // GL spec: "glDeleteTextures silently ignores 0s and names that do not correspond to existing textures".
        GLctx.deleteTexture(texture);
        texture.name = 0;
        GL.textures[id] = null;
      }
    }

  function _emscripten_glCompileShader(shader) {
      GLctx.compileShader(GL.shaders[shader]);
    }

  function _emscripten_glGenVertexArrays(n, arrays) {
  
      for (var i = 0; i < n; i++) {
        var vao = GLctx['createVertexArray']();
        if (!vao) {
          GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
          while(i < n) HEAP32[(((arrays)+(i++*4))>>2)]=0;
          return;
        }
        var id = GL.getNewId(GL.vaos);
        vao.name = id;
        GL.vaos[id] = vao;
        HEAP32[(((arrays)+(i*4))>>2)]=id;
      }
    }

  function _time(ptr) {
      var ret = (Date.now()/1000)|0;
      if (ptr) {
        HEAP32[((ptr)>>2)]=ret;
      }
      return ret;
    }

  function _emscripten_glGetBooleanv(name_, p) {
      emscriptenWebGLGet(name_, p, 'Boolean');
    }

  function ___syscall221(which, varargs) {SYSCALLS.varargs = varargs;
  try {
   // fcntl64
      var stream = SYSCALLS.getStreamFromFD(), cmd = SYSCALLS.get();
      switch (cmd) {
        case 0: {
          var arg = SYSCALLS.get();
          if (arg < 0) {
            return -ERRNO_CODES.EINVAL;
          }
          var newStream;
          newStream = FS.open(stream.path, stream.flags, 0, arg);
          return newStream.fd;
        }
        case 1:
        case 2:
          return 0;  // FD_CLOEXEC makes no sense for a single process.
        case 3:
          return stream.flags;
        case 4: {
          var arg = SYSCALLS.get();
          stream.flags |= arg;
          return 0;
        }
        case 12:
        case 12: {
          var arg = SYSCALLS.get();
          var offset = 0;
          // We're always unlocked.
          HEAP16[(((arg)+(offset))>>1)]=2;
          return 0;
        }
        case 13:
        case 14:
        case 13:
        case 14:
          return 0; // Pretend that the locking is successful.
        case 16:
        case 8:
          return -ERRNO_CODES.EINVAL; // These are for sockets. We don't have them fully implemented yet.
        case 9:
          // musl trusts getown return values, due to a bug where they must be, as they overlap with errors. just return -1 here, so fnctl() returns that, and we set errno ourselves.
          ___setErrNo(ERRNO_CODES.EINVAL);
          return -1;
        default: {
          return -ERRNO_CODES.EINVAL;
        }
      }
    } catch (e) {
    if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
    return -e.errno;
  }
  }
var GLctx; GL.init();
if (ENVIRONMENT_IS_NODE) {
    _emscripten_get_now = function _emscripten_get_now_actual() {
      var t = process['hrtime']();
      return t[0] * 1e3 + t[1] / 1e6;
    };
  } else if (typeof dateNow !== 'undefined') {
    _emscripten_get_now = dateNow;
  } else if (typeof self === 'object' && self['performance'] && typeof self['performance']['now'] === 'function') {
    _emscripten_get_now = function() { return self['performance']['now'](); };
  } else if (typeof performance === 'object' && typeof performance['now'] === 'function') {
    _emscripten_get_now = function() { return performance['now'](); };
  } else {
    _emscripten_get_now = Date.now;
  };
Module["requestFullScreen"] = function Module_requestFullScreen(lockPointer, resizeCanvas, vrDevice) { Module.printErr("Module.requestFullScreen is deprecated. Please call Module.requestFullscreen instead."); Module["requestFullScreen"] = Module["requestFullscreen"]; Browser.requestFullScreen(lockPointer, resizeCanvas, vrDevice) };
  Module["requestFullscreen"] = function Module_requestFullscreen(lockPointer, resizeCanvas, vrDevice) { Browser.requestFullscreen(lockPointer, resizeCanvas, vrDevice) };
  Module["requestAnimationFrame"] = function Module_requestAnimationFrame(func) { Browser.requestAnimationFrame(func) };
  Module["setCanvasSize"] = function Module_setCanvasSize(width, height, noUpdates) { Browser.setCanvasSize(width, height, noUpdates) };
  Module["pauseMainLoop"] = function Module_pauseMainLoop() { Browser.mainLoop.pause() };
  Module["resumeMainLoop"] = function Module_resumeMainLoop() { Browser.mainLoop.resume() };
  Module["getUserMedia"] = function Module_getUserMedia() { Browser.getUserMedia() }
  Module["createContext"] = function Module_createContext(canvas, useWebGL, setInModule, webGLContextAttributes) { return Browser.createContext(canvas, useWebGL, setInModule, webGLContextAttributes) };
FS.staticInit();__ATINIT__.unshift(function() { if (!Module["noFSInit"] && !FS.init.initialized) FS.init() });__ATMAIN__.push(function() { FS.ignorePermissions = false });__ATEXIT__.push(function() { FS.quit() });Module["FS_createFolder"] = FS.createFolder;Module["FS_createPath"] = FS.createPath;Module["FS_createDataFile"] = FS.createDataFile;Module["FS_createPreloadedFile"] = FS.createPreloadedFile;Module["FS_createLazyFile"] = FS.createLazyFile;Module["FS_createLink"] = FS.createLink;Module["FS_createDevice"] = FS.createDevice;Module["FS_unlink"] = FS.unlink;;
__ATINIT__.unshift(function() { TTY.init() });__ATEXIT__.push(function() { TTY.shutdown() });;
if (ENVIRONMENT_IS_NODE) { var fs = require("fs"); var NODEJS_PATH = require("path"); NODEFS.staticInit(); };
JSEvents.staticInit();;
DYNAMICTOP_PTR = allocate(1, "i32", ALLOC_STATIC);

STACK_BASE = STACKTOP = Runtime.alignMemory(STATICTOP);

STACK_MAX = STACK_BASE + TOTAL_STACK;

DYNAMIC_BASE = Runtime.alignMemory(STACK_MAX);

HEAP32[DYNAMICTOP_PTR>>2] = DYNAMIC_BASE;

staticSealed = true; // seal the static portion of memory

assert(DYNAMIC_BASE < TOTAL_MEMORY, "TOTAL_MEMORY not big enough for stack");



function nullFunc_viiiii(x) { Module["printErr"]("Invalid function pointer called with signature 'viiiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)");  Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }

function nullFunc_vd(x) { Module["printErr"]("Invalid function pointer called with signature 'vd'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)");  Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }

function nullFunc_vid(x) { Module["printErr"]("Invalid function pointer called with signature 'vid'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)");  Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }

function nullFunc_vi(x) { Module["printErr"]("Invalid function pointer called with signature 'vi'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)");  Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }

function nullFunc_vii(x) { Module["printErr"]("Invalid function pointer called with signature 'vii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)");  Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }

function nullFunc_ii(x) { Module["printErr"]("Invalid function pointer called with signature 'ii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)");  Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }

function nullFunc_viddd(x) { Module["printErr"]("Invalid function pointer called with signature 'viddd'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)");  Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }

function nullFunc_vidd(x) { Module["printErr"]("Invalid function pointer called with signature 'vidd'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)");  Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }

function nullFunc_iiii(x) { Module["printErr"]("Invalid function pointer called with signature 'iiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)");  Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }

function nullFunc_viiiiiiii(x) { Module["printErr"]("Invalid function pointer called with signature 'viiiiiiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)");  Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }

function nullFunc_viiiiii(x) { Module["printErr"]("Invalid function pointer called with signature 'viiiiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)");  Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }

function nullFunc_viii(x) { Module["printErr"]("Invalid function pointer called with signature 'viii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)");  Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }

function nullFunc_vidddd(x) { Module["printErr"]("Invalid function pointer called with signature 'vidddd'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)");  Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }

function nullFunc_vdi(x) { Module["printErr"]("Invalid function pointer called with signature 'vdi'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)");  Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }

function nullFunc_viiiiiii(x) { Module["printErr"]("Invalid function pointer called with signature 'viiiiiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)");  Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }

function nullFunc_viiiiiiiii(x) { Module["printErr"]("Invalid function pointer called with signature 'viiiiiiiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)");  Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }

function nullFunc_iii(x) { Module["printErr"]("Invalid function pointer called with signature 'iii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)");  Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }

function nullFunc_i(x) { Module["printErr"]("Invalid function pointer called with signature 'i'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)");  Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }

function nullFunc_vdddddd(x) { Module["printErr"]("Invalid function pointer called with signature 'vdddddd'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)");  Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }

function nullFunc_vdddd(x) { Module["printErr"]("Invalid function pointer called with signature 'vdddd'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)");  Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }

function nullFunc_vdd(x) { Module["printErr"]("Invalid function pointer called with signature 'vdd'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)");  Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }

function nullFunc_v(x) { Module["printErr"]("Invalid function pointer called with signature 'v'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)");  Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }

function nullFunc_viid(x) { Module["printErr"]("Invalid function pointer called with signature 'viid'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)");  Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }

function nullFunc_viiii(x) { Module["printErr"]("Invalid function pointer called with signature 'viiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)");  Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }

function invoke_viiiii(index,a1,a2,a3,a4,a5) {
  try {
    Module["dynCall_viiiii"](index,a1,a2,a3,a4,a5);
  } catch(e) {
    if (typeof e !== 'number' && e !== 'longjmp') throw e;
    Module["setThrew"](1, 0);
  }
}

function invoke_vd(index,a1) {
  try {
    Module["dynCall_vd"](index,a1);
  } catch(e) {
    if (typeof e !== 'number' && e !== 'longjmp') throw e;
    Module["setThrew"](1, 0);
  }
}

function invoke_vid(index,a1,a2) {
  try {
    Module["dynCall_vid"](index,a1,a2);
  } catch(e) {
    if (typeof e !== 'number' && e !== 'longjmp') throw e;
    Module["setThrew"](1, 0);
  }
}

function invoke_vi(index,a1) {
  try {
    Module["dynCall_vi"](index,a1);
  } catch(e) {
    if (typeof e !== 'number' && e !== 'longjmp') throw e;
    Module["setThrew"](1, 0);
  }
}

function invoke_vii(index,a1,a2) {
  try {
    Module["dynCall_vii"](index,a1,a2);
  } catch(e) {
    if (typeof e !== 'number' && e !== 'longjmp') throw e;
    Module["setThrew"](1, 0);
  }
}

function invoke_ii(index,a1) {
  try {
    return Module["dynCall_ii"](index,a1);
  } catch(e) {
    if (typeof e !== 'number' && e !== 'longjmp') throw e;
    Module["setThrew"](1, 0);
  }
}

function invoke_viddd(index,a1,a2,a3,a4) {
  try {
    Module["dynCall_viddd"](index,a1,a2,a3,a4);
  } catch(e) {
    if (typeof e !== 'number' && e !== 'longjmp') throw e;
    Module["setThrew"](1, 0);
  }
}

function invoke_vidd(index,a1,a2,a3) {
  try {
    Module["dynCall_vidd"](index,a1,a2,a3);
  } catch(e) {
    if (typeof e !== 'number' && e !== 'longjmp') throw e;
    Module["setThrew"](1, 0);
  }
}

function invoke_iiii(index,a1,a2,a3) {
  try {
    return Module["dynCall_iiii"](index,a1,a2,a3);
  } catch(e) {
    if (typeof e !== 'number' && e !== 'longjmp') throw e;
    Module["setThrew"](1, 0);
  }
}

function invoke_viiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8) {
  try {
    Module["dynCall_viiiiiiii"](index,a1,a2,a3,a4,a5,a6,a7,a8);
  } catch(e) {
    if (typeof e !== 'number' && e !== 'longjmp') throw e;
    Module["setThrew"](1, 0);
  }
}

function invoke_viiiiii(index,a1,a2,a3,a4,a5,a6) {
  try {
    Module["dynCall_viiiiii"](index,a1,a2,a3,a4,a5,a6);
  } catch(e) {
    if (typeof e !== 'number' && e !== 'longjmp') throw e;
    Module["setThrew"](1, 0);
  }
}

function invoke_viii(index,a1,a2,a3) {
  try {
    Module["dynCall_viii"](index,a1,a2,a3);
  } catch(e) {
    if (typeof e !== 'number' && e !== 'longjmp') throw e;
    Module["setThrew"](1, 0);
  }
}

function invoke_vidddd(index,a1,a2,a3,a4,a5) {
  try {
    Module["dynCall_vidddd"](index,a1,a2,a3,a4,a5);
  } catch(e) {
    if (typeof e !== 'number' && e !== 'longjmp') throw e;
    Module["setThrew"](1, 0);
  }
}

function invoke_vdi(index,a1,a2) {
  try {
    Module["dynCall_vdi"](index,a1,a2);
  } catch(e) {
    if (typeof e !== 'number' && e !== 'longjmp') throw e;
    Module["setThrew"](1, 0);
  }
}

function invoke_viiiiiii(index,a1,a2,a3,a4,a5,a6,a7) {
  try {
    Module["dynCall_viiiiiii"](index,a1,a2,a3,a4,a5,a6,a7);
  } catch(e) {
    if (typeof e !== 'number' && e !== 'longjmp') throw e;
    Module["setThrew"](1, 0);
  }
}

function invoke_viiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9) {
  try {
    Module["dynCall_viiiiiiiii"](index,a1,a2,a3,a4,a5,a6,a7,a8,a9);
  } catch(e) {
    if (typeof e !== 'number' && e !== 'longjmp') throw e;
    Module["setThrew"](1, 0);
  }
}

function invoke_iii(index,a1,a2) {
  try {
    return Module["dynCall_iii"](index,a1,a2);
  } catch(e) {
    if (typeof e !== 'number' && e !== 'longjmp') throw e;
    Module["setThrew"](1, 0);
  }
}

function invoke_i(index) {
  try {
    return Module["dynCall_i"](index);
  } catch(e) {
    if (typeof e !== 'number' && e !== 'longjmp') throw e;
    Module["setThrew"](1, 0);
  }
}

function invoke_vdddddd(index,a1,a2,a3,a4,a5,a6) {
  try {
    Module["dynCall_vdddddd"](index,a1,a2,a3,a4,a5,a6);
  } catch(e) {
    if (typeof e !== 'number' && e !== 'longjmp') throw e;
    Module["setThrew"](1, 0);
  }
}

function invoke_vdddd(index,a1,a2,a3,a4) {
  try {
    Module["dynCall_vdddd"](index,a1,a2,a3,a4);
  } catch(e) {
    if (typeof e !== 'number' && e !== 'longjmp') throw e;
    Module["setThrew"](1, 0);
  }
}

function invoke_vdd(index,a1,a2) {
  try {
    Module["dynCall_vdd"](index,a1,a2);
  } catch(e) {
    if (typeof e !== 'number' && e !== 'longjmp') throw e;
    Module["setThrew"](1, 0);
  }
}

function invoke_v(index) {
  try {
    Module["dynCall_v"](index);
  } catch(e) {
    if (typeof e !== 'number' && e !== 'longjmp') throw e;
    Module["setThrew"](1, 0);
  }
}

function invoke_viid(index,a1,a2,a3) {
  try {
    Module["dynCall_viid"](index,a1,a2,a3);
  } catch(e) {
    if (typeof e !== 'number' && e !== 'longjmp') throw e;
    Module["setThrew"](1, 0);
  }
}

function invoke_viiii(index,a1,a2,a3,a4) {
  try {
    Module["dynCall_viiii"](index,a1,a2,a3,a4);
  } catch(e) {
    if (typeof e !== 'number' && e !== 'longjmp') throw e;
    Module["setThrew"](1, 0);
  }
}

Module.asmGlobalArg = { "Math": Math, "Int8Array": Int8Array, "Int16Array": Int16Array, "Int32Array": Int32Array, "Uint8Array": Uint8Array, "Uint16Array": Uint16Array, "Uint32Array": Uint32Array, "Float32Array": Float32Array, "Float64Array": Float64Array, "NaN": NaN, "Infinity": Infinity };

Module.asmLibraryArg = { "abort": abort, "assert": assert, "enlargeMemory": enlargeMemory, "getTotalMemory": getTotalMemory, "abortOnCannotGrowMemory": abortOnCannotGrowMemory, "abortStackOverflow": abortStackOverflow, "nullFunc_viiiii": nullFunc_viiiii, "nullFunc_vd": nullFunc_vd, "nullFunc_vid": nullFunc_vid, "nullFunc_vi": nullFunc_vi, "nullFunc_vii": nullFunc_vii, "nullFunc_ii": nullFunc_ii, "nullFunc_viddd": nullFunc_viddd, "nullFunc_vidd": nullFunc_vidd, "nullFunc_iiii": nullFunc_iiii, "nullFunc_viiiiiiii": nullFunc_viiiiiiii, "nullFunc_viiiiii": nullFunc_viiiiii, "nullFunc_viii": nullFunc_viii, "nullFunc_vidddd": nullFunc_vidddd, "nullFunc_vdi": nullFunc_vdi, "nullFunc_viiiiiii": nullFunc_viiiiiii, "nullFunc_viiiiiiiii": nullFunc_viiiiiiiii, "nullFunc_iii": nullFunc_iii, "nullFunc_i": nullFunc_i, "nullFunc_vdddddd": nullFunc_vdddddd, "nullFunc_vdddd": nullFunc_vdddd, "nullFunc_vdd": nullFunc_vdd, "nullFunc_v": nullFunc_v, "nullFunc_viid": nullFunc_viid, "nullFunc_viiii": nullFunc_viiii, "invoke_viiiii": invoke_viiiii, "invoke_vd": invoke_vd, "invoke_vid": invoke_vid, "invoke_vi": invoke_vi, "invoke_vii": invoke_vii, "invoke_ii": invoke_ii, "invoke_viddd": invoke_viddd, "invoke_vidd": invoke_vidd, "invoke_iiii": invoke_iiii, "invoke_viiiiiiii": invoke_viiiiiiii, "invoke_viiiiii": invoke_viiiiii, "invoke_viii": invoke_viii, "invoke_vidddd": invoke_vidddd, "invoke_vdi": invoke_vdi, "invoke_viiiiiii": invoke_viiiiiii, "invoke_viiiiiiiii": invoke_viiiiiiiii, "invoke_iii": invoke_iii, "invoke_i": invoke_i, "invoke_vdddddd": invoke_vdddddd, "invoke_vdddd": invoke_vdddd, "invoke_vdd": invoke_vdd, "invoke_v": invoke_v, "invoke_viid": invoke_viid, "invoke_viiii": invoke_viiii, "_emscripten_glGetTexParameterfv": _emscripten_glGetTexParameterfv, "_glUseProgram": _glUseProgram, "_emscripten_glShaderSource": _emscripten_glShaderSource, "_glfwCreateWindow": _glfwCreateWindow, "_emscripten_glReleaseShaderCompiler": _emscripten_glReleaseShaderCompiler, "_emscripten_glBlendFuncSeparate": _emscripten_glBlendFuncSeparate, "_emscripten_glVertexAttribPointer": _emscripten_glVertexAttribPointer, "_emscripten_glGetIntegerv": _emscripten_glGetIntegerv, "_emscripten_glCullFace": _emscripten_glCullFace, "_emscripten_glIsProgram": _emscripten_glIsProgram, "_emscripten_glStencilMaskSeparate": _emscripten_glStencilMaskSeparate, "_emscripten_glViewport": _emscripten_glViewport, "_emscripten_glFrontFace": _emscripten_glFrontFace, "___assert_fail": ___assert_fail, "_glDeleteProgram": _glDeleteProgram, "_emscripten_glUniform3fv": _emscripten_glUniform3fv, "_emscripten_glPolygonOffset": _emscripten_glPolygonOffset, "_emscripten_glUseProgram": _emscripten_glUseProgram, "_emscripten_glBlendColor": _emscripten_glBlendColor, "_glBindBuffer": _glBindBuffer, "_emscripten_glDepthFunc": _emscripten_glDepthFunc, "_glGetShaderInfoLog": _glGetShaderInfoLog, "_emscripten_set_fullscreenchange_callback": _emscripten_set_fullscreenchange_callback, "_emscripten_set_touchmove_callback": _emscripten_set_touchmove_callback, "_emscripten_set_main_loop_timing": _emscripten_set_main_loop_timing, "_emscripten_set_gamepaddisconnected_callback": _emscripten_set_gamepaddisconnected_callback, "_glDisable": _glDisable, "_glBlendFunc": _glBlendFunc, "_emscripten_glDisableVertexAttribArray": _emscripten_glDisableVertexAttribArray, "_glGetAttribLocation": _glGetAttribLocation, "_glDisableVertexAttribArray": _glDisableVertexAttribArray, "_glCreateShader": _glCreateShader, "_emscripten_glSampleCoverage": _emscripten_glSampleCoverage, "_emscripten_glVertexPointer": _emscripten_glVertexPointer, "_emscripten_set_touchstart_callback": _emscripten_set_touchstart_callback, "emscriptenWebGLComputeImageSize": emscriptenWebGLComputeImageSize, "_emscripten_glGetBooleanv": _emscripten_glGetBooleanv, "_emscripten_glGetShaderSource": _emscripten_glGetShaderSource, "_glUniform4f": _glUniform4f, "_llvm_stacksave": _llvm_stacksave, "_emscripten_glUniform1i": _emscripten_glUniform1i, "_emscripten_glStencilFuncSeparate": _emscripten_glStencilFuncSeparate, "_emscripten_glFrustum": _emscripten_glFrustum, "_emscripten_glGenBuffers": _emscripten_glGenBuffers, "_emscripten_glDeleteObjectARB": _emscripten_glDeleteObjectARB, "_glfwSetWindowSizeCallback": _glfwSetWindowSizeCallback, "_emscripten_glGetShaderPrecisionFormat": _emscripten_glGetShaderPrecisionFormat, "_glfwInit": _glfwInit, "_glGenBuffers": _glGenBuffers, "_glShaderSource": _glShaderSource, "_emscripten_glGetString": _emscripten_glGetString, "_emscripten_glIsFramebuffer": _emscripten_glIsFramebuffer, "_emscripten_glIsEnabled": _emscripten_glIsEnabled, "_emscripten_glScissor": _emscripten_glScissor, "_emscripten_glVertexAttrib4fv": _emscripten_glVertexAttrib4fv, "_emscripten_glFramebufferTexture2D": _emscripten_glFramebufferTexture2D, "_emscripten_glTexParameteriv": _emscripten_glTexParameteriv, "___syscall145": ___syscall145, "_emscripten_glBindProgramARB": _emscripten_glBindProgramARB, "_emscripten_glStencilOpSeparate": _emscripten_glStencilOpSeparate, "_emscripten_glFramebufferRenderbuffer": _emscripten_glFramebufferRenderbuffer, "___syscall140": ___syscall140, "_glfwSetErrorCallback": _glfwSetErrorCallback, "_glfwDefaultWindowHints": _glfwDefaultWindowHints, "_glfwDestroyWindow": _glfwDestroyWindow, "___syscall146": ___syscall146, "_emscripten_glGetActiveAttrib": _emscripten_glGetActiveAttrib, "_emscripten_glAttachShader": _emscripten_glAttachShader, "_glVertexAttribPointer": _glVertexAttribPointer, "_emscripten_glUniform2i": _emscripten_glUniform2i, "_emscripten_glUniform2f": _emscripten_glUniform2f, "_emscripten_glTexParameterfv": _emscripten_glTexParameterfv, "_emscripten_glUniformMatrix2fv": _emscripten_glUniformMatrix2fv, "_glGetProgramInfoLog": _glGetProgramInfoLog, "_glfwSetScrollCallback": _glfwSetScrollCallback, "_emscripten_glTexParameterf": _emscripten_glTexParameterf, "_emscripten_glGetAttachedShaders": _emscripten_glGetAttachedShaders, "_emscripten_glGenTextures": _emscripten_glGenTextures, "_emscripten_glTexParameteri": _emscripten_glTexParameteri, "_llvm_stackrestore": _llvm_stackrestore, "_glfwMakeContextCurrent": _glfwMakeContextCurrent, "_emscripten_glClear": _emscripten_glClear, "_glDrawElements": _glDrawElements, "_glBufferSubData": _glBufferSubData, "_emscripten_glValidateProgram": _emscripten_glValidateProgram, "_emscripten_glVertexAttrib2fv": _emscripten_glVertexAttrib2fv, "_glViewport": _glViewport, "_emscripten_glUniform4iv": _emscripten_glUniform4iv, "_emscripten_glGetTexParameteriv": _emscripten_glGetTexParameteriv, "___setErrNo": ___setErrNo, "_eglGetProcAddress": _eglGetProcAddress, "_emscripten_glBindAttribLocation": _emscripten_glBindAttribLocation, "_glDeleteTextures": _glDeleteTextures, "_glDepthFunc": _glDepthFunc, "_emscripten_glClientActiveTexture": _emscripten_glClientActiveTexture, "_emscripten_glVertexAttrib2f": _emscripten_glVertexAttrib2f, "_emscripten_glFlush": _emscripten_glFlush, "_emscripten_glCheckFramebufferStatus": _emscripten_glCheckFramebufferStatus, "_emscripten_glGenerateMipmap": _emscripten_glGenerateMipmap, "_emscripten_glGetError": _emscripten_glGetError, "_emscripten_glClearDepthf": _emscripten_glClearDepthf, "_emscripten_glBufferData": _emscripten_glBufferData, "_emscripten_glUniform3i": _emscripten_glUniform3i, "_emscripten_glRotatef": _emscripten_glRotatef, "_emscripten_glDeleteShader": _emscripten_glDeleteShader, "_glEnable": _glEnable, "_emscripten_glReadPixels": _emscripten_glReadPixels, "_emscripten_glMatrixMode": _emscripten_glMatrixMode, "_glGetString": _glGetString, "_emscripten_glClearStencil": _emscripten_glClearStencil, "_emscripten_glGetUniformLocation": _emscripten_glGetUniformLocation, "emscriptenWebGLGet": emscriptenWebGLGet, "_emscripten_glEnableVertexAttribArray": _emscripten_glEnableVertexAttribArray, "_emscripten_glGetAttribLocation": _emscripten_glGetAttribLocation, "_emscripten_get_now": _emscripten_get_now, "_emscripten_glNormalPointer": _emscripten_glNormalPointer, "_glAttachShader": _glAttachShader, "_emscripten_glTexCoordPointer": _emscripten_glTexCoordPointer, "_emscripten_glEnable": _emscripten_glEnable, "_glCreateProgram": _glCreateProgram, "_glUniformMatrix4fv": _glUniformMatrix4fv, "_emscripten_glClearDepth": _emscripten_glClearDepth, "___lock": ___lock, "_llvm_exp2_f32": _llvm_exp2_f32, "___syscall6": ___syscall6, "___syscall5": ___syscall5, "_emscripten_glIsBuffer": _emscripten_glIsBuffer, "_emscripten_glVertexAttrib3f": _emscripten_glVertexAttrib3f, "_time": _time, "_emscripten_glVertexAttrib1f": _emscripten_glVertexAttrib1f, "_emscripten_glGetFramebufferAttachmentParameteriv": _emscripten_glGetFramebufferAttachmentParameteriv, "_emscripten_glBlendEquationSeparate": _emscripten_glBlendEquationSeparate, "_exit": _exit, "_emscripten_glEnableClientState": _emscripten_glEnableClientState, "_emscripten_glUniform4i": _emscripten_glUniform4i, "_emscripten_glDrawRangeElements": _emscripten_glDrawRangeElements, "_glCullFace": _glCullFace, "_emscripten_glGetPointerv": _emscripten_glGetPointerv, "_emscripten_set_keypress_callback": _emscripten_set_keypress_callback, "__emscripten_sample_gamepad_data": __emscripten_sample_gamepad_data, "_emscripten_get_gamepad_status": _emscripten_get_gamepad_status, "_emscripten_glUniform4f": _emscripten_glUniform4f, "_emscripten_glUniform2fv": _emscripten_glUniform2fv, "_glfwGetVideoModes": _glfwGetVideoModes, "_emscripten_set_click_callback": _emscripten_set_click_callback, "_emscripten_glShaderBinary": _emscripten_glShaderBinary, "_emscripten_glDrawElements": _emscripten_glDrawElements, "_emscripten_glBlendFunc": _emscripten_glBlendFunc, "_emscripten_get_num_gamepads": _emscripten_get_num_gamepads, "___syscall221": ___syscall221, "_glCompressedTexImage2D": _glCompressedTexImage2D, "_emscripten_glUniform1iv": _emscripten_glUniform1iv, "_emscripten_glGetVertexAttribPointerv": _emscripten_glGetVertexAttribPointerv, "_glClearDepthf": _glClearDepthf, "_emscripten_glCompressedTexSubImage2D": _emscripten_glCompressedTexSubImage2D, "emscriptenWebGLGetUniform": emscriptenWebGLGetUniform, "_emscripten_glGenRenderbuffers": _emscripten_glGenRenderbuffers, "_emscripten_glDeleteVertexArrays": _emscripten_glDeleteVertexArrays, "_glfwSetWindowShouldClose": _glfwSetWindowShouldClose, "_emscripten_glUniform1fv": _emscripten_glUniform1fv, "_emscripten_glGetActiveUniform": _emscripten_glGetActiveUniform, "_glBindTexture": _glBindTexture, "_emscripten_glUniform3iv": _emscripten_glUniform3iv, "_emscripten_glUniform2iv": _emscripten_glUniform2iv, "_emscripten_glHint": _emscripten_glHint, "_glfwSetCharCallback": _glfwSetCharCallback, "emscriptenWebGLGetVertexAttrib": emscriptenWebGLGetVertexAttrib, "_emscripten_glLoadMatrixf": _emscripten_glLoadMatrixf, "_emscripten_glDeleteProgram": _emscripten_glDeleteProgram, "_emscripten_glDeleteRenderbuffers": _emscripten_glDeleteRenderbuffers, "_emscripten_glDrawElementsInstanced": _emscripten_glDrawElementsInstanced, "_emscripten_glVertexAttrib4f": _emscripten_glVertexAttrib4f, "_glDrawArrays": _glDrawArrays, "_emscripten_glTexSubImage2D": _emscripten_glTexSubImage2D, "_emscripten_memcpy_big": _emscripten_memcpy_big, "_emscripten_glPixelStorei": _emscripten_glPixelStorei, "_glCompileShader": _glCompileShader, "_emscripten_get_pointerlock_status": _emscripten_get_pointerlock_status, "_emscripten_glUniformMatrix3fv": _emscripten_glUniformMatrix3fv, "_emscripten_glColorPointer": _emscripten_glColorPointer, "emscriptenWebGLGetTexPixelData": emscriptenWebGLGetTexPixelData, "_emscripten_glGetBufferParameteriv": _emscripten_glGetBufferParameteriv, "_emscripten_glFinish": _emscripten_glFinish, "_emscripten_request_pointerlock": _emscripten_request_pointerlock, "_glGetFloatv": _glGetFloatv, "_emscripten_asm_const_iii": _emscripten_asm_const_iii, "_emscripten_glDepthMask": _emscripten_glDepthMask, "_glfwSetWindowIconifyCallback": _glfwSetWindowIconifyCallback, "_emscripten_glDrawBuffers": _emscripten_glDrawBuffers, "_glfwTerminate": _glfwTerminate, "_glFrontFace": _glFrontFace, "_emscripten_glGetObjectParameterivARB": _emscripten_glGetObjectParameterivARB, "_emscripten_exit_pointerlock": _emscripten_exit_pointerlock, "_glfwSwapInterval": _glfwSwapInterval, "_glUniform1i": _glUniform1i, "_glEnableVertexAttribArray": _glEnableVertexAttribArray, "_emscripten_glStencilFunc": _emscripten_glStencilFunc, "_abort": _abort, "_emscripten_glGetUniformiv": _emscripten_glGetUniformiv, "_glDeleteBuffers": _glDeleteBuffers, "_glBufferData": _glBufferData, "_glTexImage2D": _glTexImage2D, "_emscripten_glGetShaderiv": _emscripten_glGetShaderiv, "_glfwSetKeyCallback": _glfwSetKeyCallback, "_emscripten_glGenFramebuffers": _emscripten_glGenFramebuffers, "_emscripten_glUniformMatrix4fv": _emscripten_glUniformMatrix4fv, "_emscripten_glLoadIdentity": _emscripten_glLoadIdentity, "_glDeleteShader": _glDeleteShader, "_emscripten_glUniform1f": _emscripten_glUniform1f, "_glGetProgramiv": _glGetProgramiv, "_emscripten_glBindFramebuffer": _emscripten_glBindFramebuffer, "_emscripten_glIsRenderbuffer": _emscripten_glIsRenderbuffer, "_glfwGetTime": _glfwGetTime, "_emscripten_glRenderbufferStorage": _emscripten_glRenderbufferStorage, "_emscripten_set_gamepadconnected_callback": _emscripten_set_gamepadconnected_callback, "_emscripten_glGetVertexAttribiv": _emscripten_glGetVertexAttribiv, "_emscripten_glBindVertexArray": _emscripten_glBindVertexArray, "_emscripten_glDrawArraysInstanced": _emscripten_glDrawArraysInstanced, "_emscripten_set_touchcancel_callback": _emscripten_set_touchcancel_callback, "_emscripten_glCreateShader": _emscripten_glCreateShader, "_emscripten_glStencilMask": _emscripten_glStencilMask, "_emscripten_glDeleteTextures": _emscripten_glDeleteTextures, "_emscripten_glBindRenderbuffer": _emscripten_glBindRenderbuffer, "_glfwGetPrimaryMonitor": _glfwGetPrimaryMonitor, "_glLinkProgram": _glLinkProgram, "_emscripten_glVertexAttribDivisor": _emscripten_glVertexAttribDivisor, "_emscripten_set_touchend_callback": _emscripten_set_touchend_callback, "_emscripten_glGetUniformfv": _emscripten_glGetUniformfv, "_emscripten_glGetVertexAttribfv": _emscripten_glGetVertexAttribfv, "_emscripten_glGetRenderbufferParameteriv": _emscripten_glGetRenderbufferParameteriv, "_emscripten_glDeleteFramebuffers": _emscripten_glDeleteFramebuffers, "_glGetShaderiv": _glGetShaderiv, "_emscripten_glVertexAttrib3fv": _emscripten_glVertexAttrib3fv, "_glGetUniformLocation": _glGetUniformLocation, "_emscripten_glGetInfoLogARB": _emscripten_glGetInfoLogARB, "_emscripten_glCompileShader": _emscripten_glCompileShader, "_glClear": _glClear, "_glGenTextures": _glGenTextures, "_emscripten_glDisable": _emscripten_glDisable, "_emscripten_glDepthRangef": _emscripten_glDepthRangef, "__exit": __exit, "_emscripten_glLineWidth": _emscripten_glLineWidth, "_emscripten_glUniform3f": _emscripten_glUniform3f, "_emscripten_glGetShaderInfoLog": _emscripten_glGetShaderInfoLog, "_emscripten_glStencilOp": _emscripten_glStencilOp, "_glBindAttribLocation": _glBindAttribLocation, "_glPixelStorei": _glPixelStorei, "_emscripten_glColorMask": _emscripten_glColorMask, "_emscripten_glLinkProgram": _emscripten_glLinkProgram, "_emscripten_glBlendEquation": _emscripten_glBlendEquation, "_emscripten_glIsTexture": _emscripten_glIsTexture, "_emscripten_glGetProgramiv": _emscripten_glGetProgramiv, "_emscripten_glVertexAttrib1fv": _emscripten_glVertexAttrib1fv, "_emscripten_glBindTexture": _emscripten_glBindTexture, "_glfwSetMouseButtonCallback": _glfwSetMouseButtonCallback, "_glfwGetCursorPos": _glfwGetCursorPos, "_emscripten_glActiveTexture": _emscripten_glActiveTexture, "_emscripten_glDeleteBuffers": _emscripten_glDeleteBuffers, "___syscall54": ___syscall54, "___unlock": ___unlock, "_emscripten_glBufferSubData": _emscripten_glBufferSubData, "_glfwSwapBuffers": _glfwSwapBuffers, "_emscripten_glDepthRange": _emscripten_glDepthRange, "_emscripten_set_main_loop": _emscripten_set_main_loop, "_emscripten_glGetProgramInfoLog": _emscripten_glGetProgramInfoLog, "_glfwWindowHint": _glfwWindowHint, "_emscripten_glIsShader": _emscripten_glIsShader, "_emscripten_glUniform4fv": _emscripten_glUniform4fv, "_emscripten_glGenVertexArrays": _emscripten_glGenVertexArrays, "_emscripten_glDrawArrays": _emscripten_glDrawArrays, "_emscripten_glCompressedTexImage2D": _emscripten_glCompressedTexImage2D, "_emscripten_glClearColor": _emscripten_glClearColor, "_emscripten_glCreateProgram": _emscripten_glCreateProgram, "_emscripten_glCopyTexSubImage2D": _emscripten_glCopyTexSubImage2D, "_glTexParameteri": _glTexParameteri, "_emscripten_glBindBuffer": _emscripten_glBindBuffer, "_emscripten_glGetFloatv": _emscripten_glGetFloatv, "_emscripten_glDetachShader": _emscripten_glDetachShader, "_glClearColor": _glClearColor, "_glfwSetCursorPosCallback": _glfwSetCursorPosCallback, "_glTexParameterf": _glTexParameterf, "_glfwSetCursorEnterCallback": _glfwSetCursorEnterCallback, "_emscripten_glCopyTexImage2D": _emscripten_glCopyTexImage2D, "_emscripten_glTexImage2D": _emscripten_glTexImage2D, "DYNAMICTOP_PTR": DYNAMICTOP_PTR, "tempDoublePtr": tempDoublePtr, "ABORT": ABORT, "STACKTOP": STACKTOP, "STACK_MAX": STACK_MAX, "cttz_i8": cttz_i8 };
// EMSCRIPTEN_START_ASM
var asm = (function(global, env, buffer) {
  'use asm';
  
  
  var HEAP8 = new global.Int8Array(buffer);
  var HEAP16 = new global.Int16Array(buffer);
  var HEAP32 = new global.Int32Array(buffer);
  var HEAPU8 = new global.Uint8Array(buffer);
  var HEAPU16 = new global.Uint16Array(buffer);
  var HEAPU32 = new global.Uint32Array(buffer);
  var HEAPF32 = new global.Float32Array(buffer);
  var HEAPF64 = new global.Float64Array(buffer);


  var DYNAMICTOP_PTR=env.DYNAMICTOP_PTR|0;
  var tempDoublePtr=env.tempDoublePtr|0;
  var ABORT=env.ABORT|0;
  var STACKTOP=env.STACKTOP|0;
  var STACK_MAX=env.STACK_MAX|0;
  var cttz_i8=env.cttz_i8|0;

  var __THREW__ = 0;
  var threwValue = 0;
  var setjmpId = 0;
  var undef = 0;
  var nan = global.NaN, inf = global.Infinity;
  var tempInt = 0, tempBigInt = 0, tempBigIntP = 0, tempBigIntS = 0, tempBigIntR = 0.0, tempBigIntI = 0, tempBigIntD = 0, tempValue = 0, tempDouble = 0.0;
  var tempRet0 = 0;

  var Math_floor=global.Math.floor;
  var Math_abs=global.Math.abs;
  var Math_sqrt=global.Math.sqrt;
  var Math_pow=global.Math.pow;
  var Math_cos=global.Math.cos;
  var Math_sin=global.Math.sin;
  var Math_tan=global.Math.tan;
  var Math_acos=global.Math.acos;
  var Math_asin=global.Math.asin;
  var Math_atan=global.Math.atan;
  var Math_atan2=global.Math.atan2;
  var Math_exp=global.Math.exp;
  var Math_log=global.Math.log;
  var Math_ceil=global.Math.ceil;
  var Math_imul=global.Math.imul;
  var Math_min=global.Math.min;
  var Math_max=global.Math.max;
  var Math_clz32=global.Math.clz32;
  var abort=env.abort;
  var assert=env.assert;
  var enlargeMemory=env.enlargeMemory;
  var getTotalMemory=env.getTotalMemory;
  var abortOnCannotGrowMemory=env.abortOnCannotGrowMemory;
  var abortStackOverflow=env.abortStackOverflow;
  var nullFunc_viiiii=env.nullFunc_viiiii;
  var nullFunc_vd=env.nullFunc_vd;
  var nullFunc_vid=env.nullFunc_vid;
  var nullFunc_vi=env.nullFunc_vi;
  var nullFunc_vii=env.nullFunc_vii;
  var nullFunc_ii=env.nullFunc_ii;
  var nullFunc_viddd=env.nullFunc_viddd;
  var nullFunc_vidd=env.nullFunc_vidd;
  var nullFunc_iiii=env.nullFunc_iiii;
  var nullFunc_viiiiiiii=env.nullFunc_viiiiiiii;
  var nullFunc_viiiiii=env.nullFunc_viiiiii;
  var nullFunc_viii=env.nullFunc_viii;
  var nullFunc_vidddd=env.nullFunc_vidddd;
  var nullFunc_vdi=env.nullFunc_vdi;
  var nullFunc_viiiiiii=env.nullFunc_viiiiiii;
  var nullFunc_viiiiiiiii=env.nullFunc_viiiiiiiii;
  var nullFunc_iii=env.nullFunc_iii;
  var nullFunc_i=env.nullFunc_i;
  var nullFunc_vdddddd=env.nullFunc_vdddddd;
  var nullFunc_vdddd=env.nullFunc_vdddd;
  var nullFunc_vdd=env.nullFunc_vdd;
  var nullFunc_v=env.nullFunc_v;
  var nullFunc_viid=env.nullFunc_viid;
  var nullFunc_viiii=env.nullFunc_viiii;
  var invoke_viiiii=env.invoke_viiiii;
  var invoke_vd=env.invoke_vd;
  var invoke_vid=env.invoke_vid;
  var invoke_vi=env.invoke_vi;
  var invoke_vii=env.invoke_vii;
  var invoke_ii=env.invoke_ii;
  var invoke_viddd=env.invoke_viddd;
  var invoke_vidd=env.invoke_vidd;
  var invoke_iiii=env.invoke_iiii;
  var invoke_viiiiiiii=env.invoke_viiiiiiii;
  var invoke_viiiiii=env.invoke_viiiiii;
  var invoke_viii=env.invoke_viii;
  var invoke_vidddd=env.invoke_vidddd;
  var invoke_vdi=env.invoke_vdi;
  var invoke_viiiiiii=env.invoke_viiiiiii;
  var invoke_viiiiiiiii=env.invoke_viiiiiiiii;
  var invoke_iii=env.invoke_iii;
  var invoke_i=env.invoke_i;
  var invoke_vdddddd=env.invoke_vdddddd;
  var invoke_vdddd=env.invoke_vdddd;
  var invoke_vdd=env.invoke_vdd;
  var invoke_v=env.invoke_v;
  var invoke_viid=env.invoke_viid;
  var invoke_viiii=env.invoke_viiii;
  var _emscripten_glGetTexParameterfv=env._emscripten_glGetTexParameterfv;
  var _glUseProgram=env._glUseProgram;
  var _emscripten_glShaderSource=env._emscripten_glShaderSource;
  var _glfwCreateWindow=env._glfwCreateWindow;
  var _emscripten_glReleaseShaderCompiler=env._emscripten_glReleaseShaderCompiler;
  var _emscripten_glBlendFuncSeparate=env._emscripten_glBlendFuncSeparate;
  var _emscripten_glVertexAttribPointer=env._emscripten_glVertexAttribPointer;
  var _emscripten_glGetIntegerv=env._emscripten_glGetIntegerv;
  var _emscripten_glCullFace=env._emscripten_glCullFace;
  var _emscripten_glIsProgram=env._emscripten_glIsProgram;
  var _emscripten_glStencilMaskSeparate=env._emscripten_glStencilMaskSeparate;
  var _emscripten_glViewport=env._emscripten_glViewport;
  var _emscripten_glFrontFace=env._emscripten_glFrontFace;
  var ___assert_fail=env.___assert_fail;
  var _glDeleteProgram=env._glDeleteProgram;
  var _emscripten_glUniform3fv=env._emscripten_glUniform3fv;
  var _emscripten_glPolygonOffset=env._emscripten_glPolygonOffset;
  var _emscripten_glUseProgram=env._emscripten_glUseProgram;
  var _emscripten_glBlendColor=env._emscripten_glBlendColor;
  var _glBindBuffer=env._glBindBuffer;
  var _emscripten_glDepthFunc=env._emscripten_glDepthFunc;
  var _glGetShaderInfoLog=env._glGetShaderInfoLog;
  var _emscripten_set_fullscreenchange_callback=env._emscripten_set_fullscreenchange_callback;
  var _emscripten_set_touchmove_callback=env._emscripten_set_touchmove_callback;
  var _emscripten_set_main_loop_timing=env._emscripten_set_main_loop_timing;
  var _emscripten_set_gamepaddisconnected_callback=env._emscripten_set_gamepaddisconnected_callback;
  var _glDisable=env._glDisable;
  var _glBlendFunc=env._glBlendFunc;
  var _emscripten_glDisableVertexAttribArray=env._emscripten_glDisableVertexAttribArray;
  var _glGetAttribLocation=env._glGetAttribLocation;
  var _glDisableVertexAttribArray=env._glDisableVertexAttribArray;
  var _glCreateShader=env._glCreateShader;
  var _emscripten_glSampleCoverage=env._emscripten_glSampleCoverage;
  var _emscripten_glVertexPointer=env._emscripten_glVertexPointer;
  var _emscripten_set_touchstart_callback=env._emscripten_set_touchstart_callback;
  var emscriptenWebGLComputeImageSize=env.emscriptenWebGLComputeImageSize;
  var _emscripten_glGetBooleanv=env._emscripten_glGetBooleanv;
  var _emscripten_glGetShaderSource=env._emscripten_glGetShaderSource;
  var _glUniform4f=env._glUniform4f;
  var _llvm_stacksave=env._llvm_stacksave;
  var _emscripten_glUniform1i=env._emscripten_glUniform1i;
  var _emscripten_glStencilFuncSeparate=env._emscripten_glStencilFuncSeparate;
  var _emscripten_glFrustum=env._emscripten_glFrustum;
  var _emscripten_glGenBuffers=env._emscripten_glGenBuffers;
  var _emscripten_glDeleteObjectARB=env._emscripten_glDeleteObjectARB;
  var _glfwSetWindowSizeCallback=env._glfwSetWindowSizeCallback;
  var _emscripten_glGetShaderPrecisionFormat=env._emscripten_glGetShaderPrecisionFormat;
  var _glfwInit=env._glfwInit;
  var _glGenBuffers=env._glGenBuffers;
  var _glShaderSource=env._glShaderSource;
  var _emscripten_glGetString=env._emscripten_glGetString;
  var _emscripten_glIsFramebuffer=env._emscripten_glIsFramebuffer;
  var _emscripten_glIsEnabled=env._emscripten_glIsEnabled;
  var _emscripten_glScissor=env._emscripten_glScissor;
  var _emscripten_glVertexAttrib4fv=env._emscripten_glVertexAttrib4fv;
  var _emscripten_glFramebufferTexture2D=env._emscripten_glFramebufferTexture2D;
  var _emscripten_glTexParameteriv=env._emscripten_glTexParameteriv;
  var ___syscall145=env.___syscall145;
  var _emscripten_glBindProgramARB=env._emscripten_glBindProgramARB;
  var _emscripten_glStencilOpSeparate=env._emscripten_glStencilOpSeparate;
  var _emscripten_glFramebufferRenderbuffer=env._emscripten_glFramebufferRenderbuffer;
  var ___syscall140=env.___syscall140;
  var _glfwSetErrorCallback=env._glfwSetErrorCallback;
  var _glfwDefaultWindowHints=env._glfwDefaultWindowHints;
  var _glfwDestroyWindow=env._glfwDestroyWindow;
  var ___syscall146=env.___syscall146;
  var _emscripten_glGetActiveAttrib=env._emscripten_glGetActiveAttrib;
  var _emscripten_glAttachShader=env._emscripten_glAttachShader;
  var _glVertexAttribPointer=env._glVertexAttribPointer;
  var _emscripten_glUniform2i=env._emscripten_glUniform2i;
  var _emscripten_glUniform2f=env._emscripten_glUniform2f;
  var _emscripten_glTexParameterfv=env._emscripten_glTexParameterfv;
  var _emscripten_glUniformMatrix2fv=env._emscripten_glUniformMatrix2fv;
  var _glGetProgramInfoLog=env._glGetProgramInfoLog;
  var _glfwSetScrollCallback=env._glfwSetScrollCallback;
  var _emscripten_glTexParameterf=env._emscripten_glTexParameterf;
  var _emscripten_glGetAttachedShaders=env._emscripten_glGetAttachedShaders;
  var _emscripten_glGenTextures=env._emscripten_glGenTextures;
  var _emscripten_glTexParameteri=env._emscripten_glTexParameteri;
  var _llvm_stackrestore=env._llvm_stackrestore;
  var _glfwMakeContextCurrent=env._glfwMakeContextCurrent;
  var _emscripten_glClear=env._emscripten_glClear;
  var _glDrawElements=env._glDrawElements;
  var _glBufferSubData=env._glBufferSubData;
  var _emscripten_glValidateProgram=env._emscripten_glValidateProgram;
  var _emscripten_glVertexAttrib2fv=env._emscripten_glVertexAttrib2fv;
  var _glViewport=env._glViewport;
  var _emscripten_glUniform4iv=env._emscripten_glUniform4iv;
  var _emscripten_glGetTexParameteriv=env._emscripten_glGetTexParameteriv;
  var ___setErrNo=env.___setErrNo;
  var _eglGetProcAddress=env._eglGetProcAddress;
  var _emscripten_glBindAttribLocation=env._emscripten_glBindAttribLocation;
  var _glDeleteTextures=env._glDeleteTextures;
  var _glDepthFunc=env._glDepthFunc;
  var _emscripten_glClientActiveTexture=env._emscripten_glClientActiveTexture;
  var _emscripten_glVertexAttrib2f=env._emscripten_glVertexAttrib2f;
  var _emscripten_glFlush=env._emscripten_glFlush;
  var _emscripten_glCheckFramebufferStatus=env._emscripten_glCheckFramebufferStatus;
  var _emscripten_glGenerateMipmap=env._emscripten_glGenerateMipmap;
  var _emscripten_glGetError=env._emscripten_glGetError;
  var _emscripten_glClearDepthf=env._emscripten_glClearDepthf;
  var _emscripten_glBufferData=env._emscripten_glBufferData;
  var _emscripten_glUniform3i=env._emscripten_glUniform3i;
  var _emscripten_glRotatef=env._emscripten_glRotatef;
  var _emscripten_glDeleteShader=env._emscripten_glDeleteShader;
  var _glEnable=env._glEnable;
  var _emscripten_glReadPixels=env._emscripten_glReadPixels;
  var _emscripten_glMatrixMode=env._emscripten_glMatrixMode;
  var _glGetString=env._glGetString;
  var _emscripten_glClearStencil=env._emscripten_glClearStencil;
  var _emscripten_glGetUniformLocation=env._emscripten_glGetUniformLocation;
  var emscriptenWebGLGet=env.emscriptenWebGLGet;
  var _emscripten_glEnableVertexAttribArray=env._emscripten_glEnableVertexAttribArray;
  var _emscripten_glGetAttribLocation=env._emscripten_glGetAttribLocation;
  var _emscripten_get_now=env._emscripten_get_now;
  var _emscripten_glNormalPointer=env._emscripten_glNormalPointer;
  var _glAttachShader=env._glAttachShader;
  var _emscripten_glTexCoordPointer=env._emscripten_glTexCoordPointer;
  var _emscripten_glEnable=env._emscripten_glEnable;
  var _glCreateProgram=env._glCreateProgram;
  var _glUniformMatrix4fv=env._glUniformMatrix4fv;
  var _emscripten_glClearDepth=env._emscripten_glClearDepth;
  var ___lock=env.___lock;
  var _llvm_exp2_f32=env._llvm_exp2_f32;
  var ___syscall6=env.___syscall6;
  var ___syscall5=env.___syscall5;
  var _emscripten_glIsBuffer=env._emscripten_glIsBuffer;
  var _emscripten_glVertexAttrib3f=env._emscripten_glVertexAttrib3f;
  var _time=env._time;
  var _emscripten_glVertexAttrib1f=env._emscripten_glVertexAttrib1f;
  var _emscripten_glGetFramebufferAttachmentParameteriv=env._emscripten_glGetFramebufferAttachmentParameteriv;
  var _emscripten_glBlendEquationSeparate=env._emscripten_glBlendEquationSeparate;
  var _exit=env._exit;
  var _emscripten_glEnableClientState=env._emscripten_glEnableClientState;
  var _emscripten_glUniform4i=env._emscripten_glUniform4i;
  var _emscripten_glDrawRangeElements=env._emscripten_glDrawRangeElements;
  var _glCullFace=env._glCullFace;
  var _emscripten_glGetPointerv=env._emscripten_glGetPointerv;
  var _emscripten_set_keypress_callback=env._emscripten_set_keypress_callback;
  var __emscripten_sample_gamepad_data=env.__emscripten_sample_gamepad_data;
  var _emscripten_get_gamepad_status=env._emscripten_get_gamepad_status;
  var _emscripten_glUniform4f=env._emscripten_glUniform4f;
  var _emscripten_glUniform2fv=env._emscripten_glUniform2fv;
  var _glfwGetVideoModes=env._glfwGetVideoModes;
  var _emscripten_set_click_callback=env._emscripten_set_click_callback;
  var _emscripten_glShaderBinary=env._emscripten_glShaderBinary;
  var _emscripten_glDrawElements=env._emscripten_glDrawElements;
  var _emscripten_glBlendFunc=env._emscripten_glBlendFunc;
  var _emscripten_get_num_gamepads=env._emscripten_get_num_gamepads;
  var ___syscall221=env.___syscall221;
  var _glCompressedTexImage2D=env._glCompressedTexImage2D;
  var _emscripten_glUniform1iv=env._emscripten_glUniform1iv;
  var _emscripten_glGetVertexAttribPointerv=env._emscripten_glGetVertexAttribPointerv;
  var _glClearDepthf=env._glClearDepthf;
  var _emscripten_glCompressedTexSubImage2D=env._emscripten_glCompressedTexSubImage2D;
  var emscriptenWebGLGetUniform=env.emscriptenWebGLGetUniform;
  var _emscripten_glGenRenderbuffers=env._emscripten_glGenRenderbuffers;
  var _emscripten_glDeleteVertexArrays=env._emscripten_glDeleteVertexArrays;
  var _glfwSetWindowShouldClose=env._glfwSetWindowShouldClose;
  var _emscripten_glUniform1fv=env._emscripten_glUniform1fv;
  var _emscripten_glGetActiveUniform=env._emscripten_glGetActiveUniform;
  var _glBindTexture=env._glBindTexture;
  var _emscripten_glUniform3iv=env._emscripten_glUniform3iv;
  var _emscripten_glUniform2iv=env._emscripten_glUniform2iv;
  var _emscripten_glHint=env._emscripten_glHint;
  var _glfwSetCharCallback=env._glfwSetCharCallback;
  var emscriptenWebGLGetVertexAttrib=env.emscriptenWebGLGetVertexAttrib;
  var _emscripten_glLoadMatrixf=env._emscripten_glLoadMatrixf;
  var _emscripten_glDeleteProgram=env._emscripten_glDeleteProgram;
  var _emscripten_glDeleteRenderbuffers=env._emscripten_glDeleteRenderbuffers;
  var _emscripten_glDrawElementsInstanced=env._emscripten_glDrawElementsInstanced;
  var _emscripten_glVertexAttrib4f=env._emscripten_glVertexAttrib4f;
  var _glDrawArrays=env._glDrawArrays;
  var _emscripten_glTexSubImage2D=env._emscripten_glTexSubImage2D;
  var _emscripten_memcpy_big=env._emscripten_memcpy_big;
  var _emscripten_glPixelStorei=env._emscripten_glPixelStorei;
  var _glCompileShader=env._glCompileShader;
  var _emscripten_get_pointerlock_status=env._emscripten_get_pointerlock_status;
  var _emscripten_glUniformMatrix3fv=env._emscripten_glUniformMatrix3fv;
  var _emscripten_glColorPointer=env._emscripten_glColorPointer;
  var emscriptenWebGLGetTexPixelData=env.emscriptenWebGLGetTexPixelData;
  var _emscripten_glGetBufferParameteriv=env._emscripten_glGetBufferParameteriv;
  var _emscripten_glFinish=env._emscripten_glFinish;
  var _emscripten_request_pointerlock=env._emscripten_request_pointerlock;
  var _glGetFloatv=env._glGetFloatv;
  var _emscripten_asm_const_iii=env._emscripten_asm_const_iii;
  var _emscripten_glDepthMask=env._emscripten_glDepthMask;
  var _glfwSetWindowIconifyCallback=env._glfwSetWindowIconifyCallback;
  var _emscripten_glDrawBuffers=env._emscripten_glDrawBuffers;
  var _glfwTerminate=env._glfwTerminate;
  var _glFrontFace=env._glFrontFace;
  var _emscripten_glGetObjectParameterivARB=env._emscripten_glGetObjectParameterivARB;
  var _emscripten_exit_pointerlock=env._emscripten_exit_pointerlock;
  var _glfwSwapInterval=env._glfwSwapInterval;
  var _glUniform1i=env._glUniform1i;
  var _glEnableVertexAttribArray=env._glEnableVertexAttribArray;
  var _emscripten_glStencilFunc=env._emscripten_glStencilFunc;
  var _abort=env._abort;
  var _emscripten_glGetUniformiv=env._emscripten_glGetUniformiv;
  var _glDeleteBuffers=env._glDeleteBuffers;
  var _glBufferData=env._glBufferData;
  var _glTexImage2D=env._glTexImage2D;
  var _emscripten_glGetShaderiv=env._emscripten_glGetShaderiv;
  var _glfwSetKeyCallback=env._glfwSetKeyCallback;
  var _emscripten_glGenFramebuffers=env._emscripten_glGenFramebuffers;
  var _emscripten_glUniformMatrix4fv=env._emscripten_glUniformMatrix4fv;
  var _emscripten_glLoadIdentity=env._emscripten_glLoadIdentity;
  var _glDeleteShader=env._glDeleteShader;
  var _emscripten_glUniform1f=env._emscripten_glUniform1f;
  var _glGetProgramiv=env._glGetProgramiv;
  var _emscripten_glBindFramebuffer=env._emscripten_glBindFramebuffer;
  var _emscripten_glIsRenderbuffer=env._emscripten_glIsRenderbuffer;
  var _glfwGetTime=env._glfwGetTime;
  var _emscripten_glRenderbufferStorage=env._emscripten_glRenderbufferStorage;
  var _emscripten_set_gamepadconnected_callback=env._emscripten_set_gamepadconnected_callback;
  var _emscripten_glGetVertexAttribiv=env._emscripten_glGetVertexAttribiv;
  var _emscripten_glBindVertexArray=env._emscripten_glBindVertexArray;
  var _emscripten_glDrawArraysInstanced=env._emscripten_glDrawArraysInstanced;
  var _emscripten_set_touchcancel_callback=env._emscripten_set_touchcancel_callback;
  var _emscripten_glCreateShader=env._emscripten_glCreateShader;
  var _emscripten_glStencilMask=env._emscripten_glStencilMask;
  var _emscripten_glDeleteTextures=env._emscripten_glDeleteTextures;
  var _emscripten_glBindRenderbuffer=env._emscripten_glBindRenderbuffer;
  var _glfwGetPrimaryMonitor=env._glfwGetPrimaryMonitor;
  var _glLinkProgram=env._glLinkProgram;
  var _emscripten_glVertexAttribDivisor=env._emscripten_glVertexAttribDivisor;
  var _emscripten_set_touchend_callback=env._emscripten_set_touchend_callback;
  var _emscripten_glGetUniformfv=env._emscripten_glGetUniformfv;
  var _emscripten_glGetVertexAttribfv=env._emscripten_glGetVertexAttribfv;
  var _emscripten_glGetRenderbufferParameteriv=env._emscripten_glGetRenderbufferParameteriv;
  var _emscripten_glDeleteFramebuffers=env._emscripten_glDeleteFramebuffers;
  var _glGetShaderiv=env._glGetShaderiv;
  var _emscripten_glVertexAttrib3fv=env._emscripten_glVertexAttrib3fv;
  var _glGetUniformLocation=env._glGetUniformLocation;
  var _emscripten_glGetInfoLogARB=env._emscripten_glGetInfoLogARB;
  var _emscripten_glCompileShader=env._emscripten_glCompileShader;
  var _glClear=env._glClear;
  var _glGenTextures=env._glGenTextures;
  var _emscripten_glDisable=env._emscripten_glDisable;
  var _emscripten_glDepthRangef=env._emscripten_glDepthRangef;
  var __exit=env.__exit;
  var _emscripten_glLineWidth=env._emscripten_glLineWidth;
  var _emscripten_glUniform3f=env._emscripten_glUniform3f;
  var _emscripten_glGetShaderInfoLog=env._emscripten_glGetShaderInfoLog;
  var _emscripten_glStencilOp=env._emscripten_glStencilOp;
  var _glBindAttribLocation=env._glBindAttribLocation;
  var _glPixelStorei=env._glPixelStorei;
  var _emscripten_glColorMask=env._emscripten_glColorMask;
  var _emscripten_glLinkProgram=env._emscripten_glLinkProgram;
  var _emscripten_glBlendEquation=env._emscripten_glBlendEquation;
  var _emscripten_glIsTexture=env._emscripten_glIsTexture;
  var _emscripten_glGetProgramiv=env._emscripten_glGetProgramiv;
  var _emscripten_glVertexAttrib1fv=env._emscripten_glVertexAttrib1fv;
  var _emscripten_glBindTexture=env._emscripten_glBindTexture;
  var _glfwSetMouseButtonCallback=env._glfwSetMouseButtonCallback;
  var _glfwGetCursorPos=env._glfwGetCursorPos;
  var _emscripten_glActiveTexture=env._emscripten_glActiveTexture;
  var _emscripten_glDeleteBuffers=env._emscripten_glDeleteBuffers;
  var ___syscall54=env.___syscall54;
  var ___unlock=env.___unlock;
  var _emscripten_glBufferSubData=env._emscripten_glBufferSubData;
  var _glfwSwapBuffers=env._glfwSwapBuffers;
  var _emscripten_glDepthRange=env._emscripten_glDepthRange;
  var _emscripten_set_main_loop=env._emscripten_set_main_loop;
  var _emscripten_glGetProgramInfoLog=env._emscripten_glGetProgramInfoLog;
  var _glfwWindowHint=env._glfwWindowHint;
  var _emscripten_glIsShader=env._emscripten_glIsShader;
  var _emscripten_glUniform4fv=env._emscripten_glUniform4fv;
  var _emscripten_glGenVertexArrays=env._emscripten_glGenVertexArrays;
  var _emscripten_glDrawArrays=env._emscripten_glDrawArrays;
  var _emscripten_glCompressedTexImage2D=env._emscripten_glCompressedTexImage2D;
  var _emscripten_glClearColor=env._emscripten_glClearColor;
  var _emscripten_glCreateProgram=env._emscripten_glCreateProgram;
  var _emscripten_glCopyTexSubImage2D=env._emscripten_glCopyTexSubImage2D;
  var _glTexParameteri=env._glTexParameteri;
  var _emscripten_glBindBuffer=env._emscripten_glBindBuffer;
  var _emscripten_glGetFloatv=env._emscripten_glGetFloatv;
  var _emscripten_glDetachShader=env._emscripten_glDetachShader;
  var _glClearColor=env._glClearColor;
  var _glfwSetCursorPosCallback=env._glfwSetCursorPosCallback;
  var _glTexParameterf=env._glTexParameterf;
  var _glfwSetCursorEnterCallback=env._glfwSetCursorEnterCallback;
  var _emscripten_glCopyTexImage2D=env._emscripten_glCopyTexImage2D;
  var _emscripten_glTexImage2D=env._emscripten_glTexImage2D;
  var tempFloat = 0.0;

// EMSCRIPTEN_START_FUNCS

function stackAlloc(size) {
  size = size|0;
  var ret = 0;
  ret = STACKTOP;
  STACKTOP = (STACKTOP + size)|0;
  STACKTOP = (STACKTOP + 15)&-16;
  if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(size|0);

  return ret|0;
}
function stackSave() {
  return STACKTOP|0;
}
function stackRestore(top) {
  top = top|0;
  STACKTOP = top;
}
function establishStackSpace(stackBase, stackMax) {
  stackBase = stackBase|0;
  stackMax = stackMax|0;
  STACKTOP = stackBase;
  STACK_MAX = stackMax;
}

function setThrew(threw, value) {
  threw = threw|0;
  value = value|0;
  if ((__THREW__|0) == 0) {
    __THREW__ = threw;
    threwValue = value;
  }
}

function setTempRet0(value) {
  value = value|0;
  tempRet0 = value;
}
function getTempRet0() {
  return tempRet0|0;
}

function _main() {
 var $$01618 = 0, $$byval_copy8 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0.0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0.0, $22 = 0, $23 = 0, $24 = 0.0;
 var $25 = 0.0, $26 = 0.0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0.0, $33 = 0, $34 = 0, $35 = 0.0, $36 = 0.0, $37 = 0.0, $38 = 0.0, $39 = 0.0, $4 = 0, $40 = 0.0, $5 = 0, $6 = 0;
 var $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 336|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(336|0);
 $$byval_copy8 = sp + 264|0;
 $0 = sp + 296|0;
 $1 = sp + 232|0;
 $2 = sp + 200|0;
 $3 = sp + 168|0;
 $4 = sp + 136|0;
 $5 = sp + 104|0;
 $6 = sp + 72|0;
 $7 = sp + 40|0;
 $8 = sp + 8|0;
 $9 = sp;
 $10 = HEAP32[2]|0;
 $11 = HEAP32[3]|0;
 _InitWindow($10,$11,4272);
 dest=$0; src=4309; stop=dest+32|0; do { HEAP8[dest>>0]=HEAP8[src>>0]|0; dest=dest+1|0; src=src+1|0; } while ((dest|0) < (stop|0));
 HEAP32[5018] = $0;
 HEAP32[5019] = 4341;
 _LoadSpriteFont($1,4853);
 ;HEAP32[20080>>2]=HEAP32[$1>>2]|0;HEAP32[20080+4>>2]=HEAP32[$1+4>>2]|0;HEAP32[20080+8>>2]=HEAP32[$1+8>>2]|0;HEAP32[20080+12>>2]=HEAP32[$1+12>>2]|0;HEAP32[20080+16>>2]=HEAP32[$1+16>>2]|0;HEAP32[20080+20>>2]=HEAP32[$1+20>>2]|0;HEAP32[20080+24>>2]=HEAP32[$1+24>>2]|0;HEAP32[20080+28>>2]=HEAP32[$1+28>>2]|0;
 _LoadSpriteFont($2,4881);
 ;HEAP32[(20112)>>2]=HEAP32[$2>>2]|0;HEAP32[(20112)+4>>2]=HEAP32[$2+4>>2]|0;HEAP32[(20112)+8>>2]=HEAP32[$2+8>>2]|0;HEAP32[(20112)+12>>2]=HEAP32[$2+12>>2]|0;HEAP32[(20112)+16>>2]=HEAP32[$2+16>>2]|0;HEAP32[(20112)+20>>2]=HEAP32[$2+20>>2]|0;HEAP32[(20112)+24>>2]=HEAP32[$2+24>>2]|0;HEAP32[(20112)+28>>2]=HEAP32[$2+28>>2]|0;
 _LoadSpriteFont($3,4911);
 ;HEAP32[(20144)>>2]=HEAP32[$3>>2]|0;HEAP32[(20144)+4>>2]=HEAP32[$3+4>>2]|0;HEAP32[(20144)+8>>2]=HEAP32[$3+8>>2]|0;HEAP32[(20144)+12>>2]=HEAP32[$3+12>>2]|0;HEAP32[(20144)+16>>2]=HEAP32[$3+16>>2]|0;HEAP32[(20144)+20>>2]=HEAP32[$3+20>>2]|0;HEAP32[(20144)+24>>2]=HEAP32[$3+24>>2]|0;HEAP32[(20144)+28>>2]=HEAP32[$3+28>>2]|0;
 _LoadSpriteFont($4,4937);
 ;HEAP32[(20176)>>2]=HEAP32[$4>>2]|0;HEAP32[(20176)+4>>2]=HEAP32[$4+4>>2]|0;HEAP32[(20176)+8>>2]=HEAP32[$4+8>>2]|0;HEAP32[(20176)+12>>2]=HEAP32[$4+12>>2]|0;HEAP32[(20176)+16>>2]=HEAP32[$4+16>>2]|0;HEAP32[(20176)+20>>2]=HEAP32[$4+20>>2]|0;HEAP32[(20176)+24>>2]=HEAP32[$4+24>>2]|0;HEAP32[(20176)+28>>2]=HEAP32[$4+28>>2]|0;
 _LoadSpriteFont($5,4965);
 ;HEAP32[(20208)>>2]=HEAP32[$5>>2]|0;HEAP32[(20208)+4>>2]=HEAP32[$5+4>>2]|0;HEAP32[(20208)+8>>2]=HEAP32[$5+8>>2]|0;HEAP32[(20208)+12>>2]=HEAP32[$5+12>>2]|0;HEAP32[(20208)+16>>2]=HEAP32[$5+16>>2]|0;HEAP32[(20208)+20>>2]=HEAP32[$5+20>>2]|0;HEAP32[(20208)+24>>2]=HEAP32[$5+24>>2]|0;HEAP32[(20208)+28>>2]=HEAP32[$5+28>>2]|0;
 _LoadSpriteFont($6,4993);
 ;HEAP32[(20240)>>2]=HEAP32[$6>>2]|0;HEAP32[(20240)+4>>2]=HEAP32[$6+4>>2]|0;HEAP32[(20240)+8>>2]=HEAP32[$6+8>>2]|0;HEAP32[(20240)+12>>2]=HEAP32[$6+12>>2]|0;HEAP32[(20240)+16>>2]=HEAP32[$6+16>>2]|0;HEAP32[(20240)+20>>2]=HEAP32[$6+20>>2]|0;HEAP32[(20240)+24>>2]=HEAP32[$6+24>>2]|0;HEAP32[(20240)+28>>2]=HEAP32[$6+28>>2]|0;
 _LoadSpriteFont($7,5024);
 ;HEAP32[(20272)>>2]=HEAP32[$7>>2]|0;HEAP32[(20272)+4>>2]=HEAP32[$7+4>>2]|0;HEAP32[(20272)+8>>2]=HEAP32[$7+8>>2]|0;HEAP32[(20272)+12>>2]=HEAP32[$7+12>>2]|0;HEAP32[(20272)+16>>2]=HEAP32[$7+16>>2]|0;HEAP32[(20272)+20>>2]=HEAP32[$7+20>>2]|0;HEAP32[(20272)+24>>2]=HEAP32[$7+24>>2]|0;HEAP32[(20272)+28>>2]=HEAP32[$7+28>>2]|0;
 _LoadSpriteFont($8,5055);
 ;HEAP32[(20304)>>2]=HEAP32[$8>>2]|0;HEAP32[(20304)+4>>2]=HEAP32[$8+4>>2]|0;HEAP32[(20304)+8>>2]=HEAP32[$8+8>>2]|0;HEAP32[(20304)+12>>2]=HEAP32[$8+12>>2]|0;HEAP32[(20304)+16>>2]=HEAP32[$8+16>>2]|0;HEAP32[(20304)+20>>2]=HEAP32[$8+20>>2]|0;HEAP32[(20304)+24>>2]=HEAP32[$8+24>>2]|0;HEAP32[(20304)+28>>2]=HEAP32[$8+28>>2]|0;
 $$01618 = 0;
 while(1) {
  $12 = HEAP32[2]|0;
  $13 = (($12|0) / 2)&-1;
  $14 = (+($13|0));
  $15 = (20080 + ($$01618<<5)|0);
  $16 = HEAP32[5019]|0;
  $17 = (($16) + ($$01618<<6)|0);
  $18 = (((20080 + ($$01618<<5)|0)) + 20|0);
  $19 = HEAP32[$18>>2]|0;
  $20 = $19 << 1;
  $21 = (+($20|0));
  $22 = (16 + ($$01618<<2)|0);
  $23 = HEAP32[$22>>2]|0;
  ;HEAP32[$$byval_copy8>>2]=HEAP32[$15>>2]|0;HEAP32[$$byval_copy8+4>>2]=HEAP32[$15+4>>2]|0;HEAP32[$$byval_copy8+8>>2]=HEAP32[$15+8>>2]|0;HEAP32[$$byval_copy8+12>>2]=HEAP32[$15+12>>2]|0;HEAP32[$$byval_copy8+16>>2]=HEAP32[$15+16>>2]|0;HEAP32[$$byval_copy8+20>>2]=HEAP32[$15+20>>2]|0;HEAP32[$$byval_copy8+24>>2]=HEAP32[$15+24>>2]|0;HEAP32[$$byval_copy8+28>>2]=HEAP32[$15+28>>2]|0;
  _MeasureTextEx($9,$$byval_copy8,$17,$21,$23);
  $24 = +HEAPF32[$9>>2];
  $25 = $24 * 0.5;
  $26 = $14 - $25;
  $27 = (20336 + ($$01618<<3)|0);
  HEAPF32[$27>>2] = $26;
  $28 = HEAP32[$18>>2]|0;
  $29 = ($$01618*45)|0;
  $30 = (($29) + 60)|0;
  $31 = (($30) + ($28))|0;
  $32 = (+($31|0));
  $33 = (((20336 + ($$01618<<3)|0)) + 4|0);
  HEAPF32[$33>>2] = $32;
  $34 = (($$01618) + 1)|0;
  $exitcond = ($34|0)==(8);
  if ($exitcond) {
   break;
  } else {
   $$01618 = $34;
  }
 }
 $35 = +HEAPF32[(20364)>>2];
 $36 = $35 + 8.0;
 HEAPF32[(20364)>>2] = $36;
 $37 = +HEAPF32[(20372)>>2];
 $38 = $37 + 2.0;
 HEAPF32[(20372)>>2] = $38;
 $39 = +HEAPF32[(20396)>>2];
 $40 = $39 + -8.0;
 HEAPF32[(20396)>>2] = $40;
 _emscripten_set_main_loop((1|0),0,1);
 ;HEAP32[$$byval_copy8>>2]=HEAP32[20080>>2]|0;HEAP32[$$byval_copy8+4>>2]=HEAP32[20080+4>>2]|0;HEAP32[$$byval_copy8+8>>2]=HEAP32[20080+8>>2]|0;HEAP32[$$byval_copy8+12>>2]=HEAP32[20080+12>>2]|0;HEAP32[$$byval_copy8+16>>2]=HEAP32[20080+16>>2]|0;HEAP32[$$byval_copy8+20>>2]=HEAP32[20080+20>>2]|0;HEAP32[$$byval_copy8+24>>2]=HEAP32[20080+24>>2]|0;HEAP32[$$byval_copy8+28>>2]=HEAP32[20080+28>>2]|0;
 _UnloadSpriteFont($$byval_copy8);
 ;HEAP32[$$byval_copy8>>2]=HEAP32[(20112)>>2]|0;HEAP32[$$byval_copy8+4>>2]=HEAP32[(20112)+4>>2]|0;HEAP32[$$byval_copy8+8>>2]=HEAP32[(20112)+8>>2]|0;HEAP32[$$byval_copy8+12>>2]=HEAP32[(20112)+12>>2]|0;HEAP32[$$byval_copy8+16>>2]=HEAP32[(20112)+16>>2]|0;HEAP32[$$byval_copy8+20>>2]=HEAP32[(20112)+20>>2]|0;HEAP32[$$byval_copy8+24>>2]=HEAP32[(20112)+24>>2]|0;HEAP32[$$byval_copy8+28>>2]=HEAP32[(20112)+28>>2]|0;
 _UnloadSpriteFont($$byval_copy8);
 ;HEAP32[$$byval_copy8>>2]=HEAP32[(20144)>>2]|0;HEAP32[$$byval_copy8+4>>2]=HEAP32[(20144)+4>>2]|0;HEAP32[$$byval_copy8+8>>2]=HEAP32[(20144)+8>>2]|0;HEAP32[$$byval_copy8+12>>2]=HEAP32[(20144)+12>>2]|0;HEAP32[$$byval_copy8+16>>2]=HEAP32[(20144)+16>>2]|0;HEAP32[$$byval_copy8+20>>2]=HEAP32[(20144)+20>>2]|0;HEAP32[$$byval_copy8+24>>2]=HEAP32[(20144)+24>>2]|0;HEAP32[$$byval_copy8+28>>2]=HEAP32[(20144)+28>>2]|0;
 _UnloadSpriteFont($$byval_copy8);
 ;HEAP32[$$byval_copy8>>2]=HEAP32[(20176)>>2]|0;HEAP32[$$byval_copy8+4>>2]=HEAP32[(20176)+4>>2]|0;HEAP32[$$byval_copy8+8>>2]=HEAP32[(20176)+8>>2]|0;HEAP32[$$byval_copy8+12>>2]=HEAP32[(20176)+12>>2]|0;HEAP32[$$byval_copy8+16>>2]=HEAP32[(20176)+16>>2]|0;HEAP32[$$byval_copy8+20>>2]=HEAP32[(20176)+20>>2]|0;HEAP32[$$byval_copy8+24>>2]=HEAP32[(20176)+24>>2]|0;HEAP32[$$byval_copy8+28>>2]=HEAP32[(20176)+28>>2]|0;
 _UnloadSpriteFont($$byval_copy8);
 ;HEAP32[$$byval_copy8>>2]=HEAP32[(20208)>>2]|0;HEAP32[$$byval_copy8+4>>2]=HEAP32[(20208)+4>>2]|0;HEAP32[$$byval_copy8+8>>2]=HEAP32[(20208)+8>>2]|0;HEAP32[$$byval_copy8+12>>2]=HEAP32[(20208)+12>>2]|0;HEAP32[$$byval_copy8+16>>2]=HEAP32[(20208)+16>>2]|0;HEAP32[$$byval_copy8+20>>2]=HEAP32[(20208)+20>>2]|0;HEAP32[$$byval_copy8+24>>2]=HEAP32[(20208)+24>>2]|0;HEAP32[$$byval_copy8+28>>2]=HEAP32[(20208)+28>>2]|0;
 _UnloadSpriteFont($$byval_copy8);
 ;HEAP32[$$byval_copy8>>2]=HEAP32[(20240)>>2]|0;HEAP32[$$byval_copy8+4>>2]=HEAP32[(20240)+4>>2]|0;HEAP32[$$byval_copy8+8>>2]=HEAP32[(20240)+8>>2]|0;HEAP32[$$byval_copy8+12>>2]=HEAP32[(20240)+12>>2]|0;HEAP32[$$byval_copy8+16>>2]=HEAP32[(20240)+16>>2]|0;HEAP32[$$byval_copy8+20>>2]=HEAP32[(20240)+20>>2]|0;HEAP32[$$byval_copy8+24>>2]=HEAP32[(20240)+24>>2]|0;HEAP32[$$byval_copy8+28>>2]=HEAP32[(20240)+28>>2]|0;
 _UnloadSpriteFont($$byval_copy8);
 ;HEAP32[$$byval_copy8>>2]=HEAP32[(20272)>>2]|0;HEAP32[$$byval_copy8+4>>2]=HEAP32[(20272)+4>>2]|0;HEAP32[$$byval_copy8+8>>2]=HEAP32[(20272)+8>>2]|0;HEAP32[$$byval_copy8+12>>2]=HEAP32[(20272)+12>>2]|0;HEAP32[$$byval_copy8+16>>2]=HEAP32[(20272)+16>>2]|0;HEAP32[$$byval_copy8+20>>2]=HEAP32[(20272)+20>>2]|0;HEAP32[$$byval_copy8+24>>2]=HEAP32[(20272)+24>>2]|0;HEAP32[$$byval_copy8+28>>2]=HEAP32[(20272)+28>>2]|0;
 _UnloadSpriteFont($$byval_copy8);
 ;HEAP32[$$byval_copy8>>2]=HEAP32[(20304)>>2]|0;HEAP32[$$byval_copy8+4>>2]=HEAP32[(20304)+4>>2]|0;HEAP32[$$byval_copy8+8>>2]=HEAP32[(20304)+8>>2]|0;HEAP32[$$byval_copy8+12>>2]=HEAP32[(20304)+12>>2]|0;HEAP32[$$byval_copy8+16>>2]=HEAP32[(20304)+16>>2]|0;HEAP32[$$byval_copy8+20>>2]=HEAP32[(20304)+20>>2]|0;HEAP32[$$byval_copy8+24>>2]=HEAP32[(20304)+24>>2]|0;HEAP32[$$byval_copy8+28>>2]=HEAP32[(20304)+28>>2]|0;
 _UnloadSpriteFont($$byval_copy8);
 _CloseWindow();
 STACKTOP = sp;return 0;
}
function _UpdateDrawFrame() {
 var $$09 = 0, $$byval_copy3 = 0, $$byval_copy4 = 0, $$byval_copy5 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0.0, $2 = 0, $20 = 0, $21 = 0, $22 = 0;
 var $23 = 0, $24 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(64|0);
 $$byval_copy5 = sp + 52|0;
 $$byval_copy4 = sp + 32|0;
 $$byval_copy3 = sp;
 $0 = sp + 48|0;
 $1 = sp + 44|0;
 $2 = sp + 40|0;
 _BeginDrawing();
 HEAP8[$0>>0] = -11;
 $3 = ((($0)) + 1|0);
 HEAP8[$3>>0] = -11;
 $4 = ((($0)) + 2|0);
 HEAP8[$4>>0] = -11;
 $5 = ((($0)) + 3|0);
 HEAP8[$5>>0] = -1;
 ;HEAP8[$$byval_copy5>>0]=HEAP8[$0>>0]|0;HEAP8[$$byval_copy5+1>>0]=HEAP8[$0+1>>0]|0;HEAP8[$$byval_copy5+2>>0]=HEAP8[$0+2>>0]|0;HEAP8[$$byval_copy5+3>>0]=HEAP8[$0+3>>0]|0;
 _ClearBackground($$byval_copy5);
 HEAP8[$1>>0] = 80;
 $6 = ((($1)) + 1|0);
 HEAP8[$6>>0] = 80;
 $7 = ((($1)) + 2|0);
 HEAP8[$7>>0] = 80;
 $8 = ((($1)) + 3|0);
 HEAP8[$8>>0] = -1;
 ;HEAP8[$$byval_copy5>>0]=HEAP8[$1>>0]|0;HEAP8[$$byval_copy5+1>>0]=HEAP8[$1+1>>0]|0;HEAP8[$$byval_copy5+2>>0]=HEAP8[$1+2>>0]|0;HEAP8[$$byval_copy5+3>>0]=HEAP8[$1+3>>0]|0;
 _DrawText(5089,250,20,20,$$byval_copy5);
 HEAP8[$2>>0] = 80;
 $9 = ((($2)) + 1|0);
 HEAP8[$9>>0] = 80;
 $10 = ((($2)) + 2|0);
 HEAP8[$10>>0] = 80;
 $11 = ((($2)) + 3|0);
 HEAP8[$11>>0] = -1;
 ;HEAP8[$$byval_copy5>>0]=HEAP8[$2>>0]|0;HEAP8[$$byval_copy5+1>>0]=HEAP8[$2+1>>0]|0;HEAP8[$$byval_copy5+2>>0]=HEAP8[$2+2>>0]|0;HEAP8[$$byval_copy5+3>>0]=HEAP8[$2+3>>0]|0;
 _DrawLine(220,50,590,50,$$byval_copy5);
 $$09 = 0;
 while(1) {
  $12 = (20080 + ($$09<<5)|0);
  $13 = HEAP32[5019]|0;
  $14 = (($13) + ($$09<<6)|0);
  $15 = (20336 + ($$09<<3)|0);
  $16 = (((20080 + ($$09<<5)|0)) + 20|0);
  $17 = HEAP32[$16>>2]|0;
  $18 = $17 << 1;
  $19 = (+($18|0));
  $20 = (16 + ($$09<<2)|0);
  $21 = HEAP32[$20>>2]|0;
  $22 = HEAP32[5018]|0;
  $23 = (($22) + ($$09<<2)|0);
  ;HEAP32[$$byval_copy3>>2]=HEAP32[$12>>2]|0;HEAP32[$$byval_copy3+4>>2]=HEAP32[$12+4>>2]|0;HEAP32[$$byval_copy3+8>>2]=HEAP32[$12+8>>2]|0;HEAP32[$$byval_copy3+12>>2]=HEAP32[$12+12>>2]|0;HEAP32[$$byval_copy3+16>>2]=HEAP32[$12+16>>2]|0;HEAP32[$$byval_copy3+20>>2]=HEAP32[$12+20>>2]|0;HEAP32[$$byval_copy3+24>>2]=HEAP32[$12+24>>2]|0;HEAP32[$$byval_copy3+28>>2]=HEAP32[$12+28>>2]|0;
  ;HEAP32[$$byval_copy4>>2]=HEAP32[$15>>2]|0;HEAP32[$$byval_copy4+4>>2]=HEAP32[$15+4>>2]|0;
  ;HEAP8[$$byval_copy5>>0]=HEAP8[$23>>0]|0;HEAP8[$$byval_copy5+1>>0]=HEAP8[$23+1>>0]|0;HEAP8[$$byval_copy5+2>>0]=HEAP8[$23+2>>0]|0;HEAP8[$$byval_copy5+3>>0]=HEAP8[$23+3>>0]|0;
  _DrawTextEx($$byval_copy3,$14,$$byval_copy4,$19,$21,$$byval_copy5);
  $24 = (($$09) + 1)|0;
  $exitcond = ($24|0)==(8);
  if ($exitcond) {
   break;
  } else {
   $$09 = $24;
  }
 }
 _EndDrawing();
 STACKTOP = sp;return;
}
function _Vector2Distance($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $2 = 0.0, $3 = 0.0, $4 = 0.0, $5 = 0.0, $6 = 0, $7 = 0.0, $8 = 0, $9 = 0.0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = +HEAPF32[$0>>2];
 $3 = +HEAPF32[$1>>2];
 $4 = $2 - $3;
 $5 = $4 * $4;
 $6 = ((($0)) + 4|0);
 $7 = +HEAPF32[$6>>2];
 $8 = ((($1)) + 4|0);
 $9 = +HEAPF32[$8>>2];
 $10 = $7 - $9;
 $11 = $10 * $10;
 $12 = $5 + $11;
 $13 = (+Math_sqrt((+$12)));
 return (+$13);
}
function _Vector2Angle($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$0 = 0.0, $10 = 0.0, $11 = 0.0, $12 = 0, $13 = 0.0, $2 = 0, $3 = 0.0, $4 = 0, $5 = 0.0, $6 = 0.0, $7 = 0.0, $8 = 0.0, $9 = 0.0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = ((($1)) + 4|0);
 $3 = +HEAPF32[$2>>2];
 $4 = ((($0)) + 4|0);
 $5 = +HEAPF32[$4>>2];
 $6 = $3 - $5;
 $7 = +HEAPF32[$1>>2];
 $8 = +HEAPF32[$0>>2];
 $9 = $7 - $8;
 $10 = (+Math_atan2((+$6),(+$9)));
 $11 = $10 * 57.2957763671875;
 $12 = $11 < 0.0;
 $13 = $11 + 360.0;
 $$0 = $12 ? $13 : $11;
 return (+$$0);
}
function _VectorZero($0) {
 $0 = $0|0;
 var $1 = 0, $2 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 HEAPF32[$0>>2] = 0.0;
 $1 = ((($0)) + 4|0);
 HEAPF32[$1>>2] = 0.0;
 $2 = ((($0)) + 8|0);
 HEAPF32[$2>>2] = 0.0;
 return;
}
function _VectorLength($0) {
 $0 = $0|0;
 var $1 = 0.0, $10 = 0.0, $11 = 0.0, $2 = 0.0, $3 = 0, $4 = 0.0, $5 = 0.0, $6 = 0.0, $7 = 0, $8 = 0.0, $9 = 0.0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = +HEAPF32[$0>>2];
 $2 = $1 * $1;
 $3 = ((($0)) + 4|0);
 $4 = +HEAPF32[$3>>2];
 $5 = $4 * $4;
 $6 = $2 + $5;
 $7 = ((($0)) + 8|0);
 $8 = +HEAPF32[$7>>2];
 $9 = $8 * $8;
 $10 = $6 + $9;
 $11 = (+Math_sqrt((+$10)));
 return (+$11);
}
function _VectorNormalize($0) {
 $0 = $0|0;
 var $$byval_copy = 0, $$op = 0.0, $1 = 0.0, $10 = 0.0, $11 = 0.0, $2 = 0, $3 = 0.0, $4 = 0.0, $5 = 0.0, $6 = 0, $7 = 0.0, $8 = 0.0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $$byval_copy = sp;
 ;HEAP32[$$byval_copy>>2]=HEAP32[$0>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$0+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[$0+8>>2]|0;
 $1 = (+_VectorLength($$byval_copy));
 $2 = $1 == 0.0;
 $$op = 1.0 / $1;
 $3 = $2 ? 1.0 : $$op;
 $4 = +HEAPF32[$0>>2];
 $5 = $4 * $3;
 HEAPF32[$0>>2] = $5;
 $6 = ((($0)) + 4|0);
 $7 = +HEAPF32[$6>>2];
 $8 = $3 * $7;
 HEAPF32[$6>>2] = $8;
 $9 = ((($0)) + 8|0);
 $10 = +HEAPF32[$9>>2];
 $11 = $3 * $10;
 HEAPF32[$9>>2] = $11;
 STACKTOP = sp;return;
}
function _VectorTransform($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0, $14 = 0.0, $15 = 0.0, $16 = 0.0, $17 = 0, $18 = 0.0, $19 = 0.0, $2 = 0.0, $20 = 0, $21 = 0.0, $22 = 0.0, $23 = 0, $24 = 0.0, $25 = 0.0, $26 = 0.0, $27 = 0, $28 = 0.0;
 var $29 = 0.0, $3 = 0, $30 = 0.0, $31 = 0, $32 = 0.0, $33 = 0.0, $34 = 0, $35 = 0.0, $36 = 0.0, $37 = 0, $38 = 0.0, $39 = 0.0, $4 = 0.0, $40 = 0.0, $41 = 0, $42 = 0.0, $43 = 0.0, $44 = 0.0, $45 = 0, $46 = 0.0;
 var $47 = 0.0, $5 = 0, $6 = 0.0, $7 = 0.0, $8 = 0.0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = +HEAPF32[$0>>2];
 $3 = ((($0)) + 4|0);
 $4 = +HEAPF32[$3>>2];
 $5 = ((($0)) + 8|0);
 $6 = +HEAPF32[$5>>2];
 $7 = +HEAPF32[$1>>2];
 $8 = $2 * $7;
 $9 = ((($1)) + 4|0);
 $10 = +HEAPF32[$9>>2];
 $11 = $4 * $10;
 $12 = $8 + $11;
 $13 = ((($1)) + 8|0);
 $14 = +HEAPF32[$13>>2];
 $15 = $6 * $14;
 $16 = $12 + $15;
 $17 = ((($1)) + 12|0);
 $18 = +HEAPF32[$17>>2];
 $19 = $18 + $16;
 HEAPF32[$0>>2] = $19;
 $20 = ((($1)) + 16|0);
 $21 = +HEAPF32[$20>>2];
 $22 = $2 * $21;
 $23 = ((($1)) + 20|0);
 $24 = +HEAPF32[$23>>2];
 $25 = $4 * $24;
 $26 = $22 + $25;
 $27 = ((($1)) + 24|0);
 $28 = +HEAPF32[$27>>2];
 $29 = $6 * $28;
 $30 = $26 + $29;
 $31 = ((($1)) + 28|0);
 $32 = +HEAPF32[$31>>2];
 $33 = $32 + $30;
 HEAPF32[$3>>2] = $33;
 $34 = ((($1)) + 32|0);
 $35 = +HEAPF32[$34>>2];
 $36 = $2 * $35;
 $37 = ((($1)) + 36|0);
 $38 = +HEAPF32[$37>>2];
 $39 = $4 * $38;
 $40 = $36 + $39;
 $41 = ((($1)) + 40|0);
 $42 = +HEAPF32[$41>>2];
 $43 = $6 * $42;
 $44 = $40 + $43;
 $45 = ((($1)) + 44|0);
 $46 = +HEAPF32[$45>>2];
 $47 = $46 + $44;
 HEAPF32[$5>>2] = $47;
 return;
}
function _MatrixTranspose($0) {
 $0 = $0|0;
 var $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $3 = 0, $4 = 0, $5 = 0;
 var $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = ((($0)) + 4|0);
 $2 = HEAP32[$1>>2]|0;
 $3 = ((($0)) + 8|0);
 $4 = HEAP32[$3>>2]|0;
 $5 = ((($0)) + 12|0);
 $6 = HEAP32[$5>>2]|0;
 $7 = ((($0)) + 16|0);
 $8 = HEAP32[$7>>2]|0;
 $9 = ((($0)) + 24|0);
 $10 = HEAP32[$9>>2]|0;
 $11 = ((($0)) + 28|0);
 $12 = HEAP32[$11>>2]|0;
 $13 = ((($0)) + 32|0);
 $14 = HEAP32[$13>>2]|0;
 $15 = ((($0)) + 36|0);
 $16 = HEAP32[$15>>2]|0;
 $17 = ((($0)) + 44|0);
 $18 = HEAP32[$17>>2]|0;
 $19 = ((($0)) + 48|0);
 $20 = HEAP32[$19>>2]|0;
 $21 = ((($0)) + 52|0);
 $22 = HEAP32[$21>>2]|0;
 $23 = ((($0)) + 56|0);
 $24 = HEAP32[$23>>2]|0;
 HEAP32[$1>>2] = $8;
 HEAP32[$3>>2] = $14;
 HEAP32[$5>>2] = $20;
 HEAP32[$7>>2] = $2;
 HEAP32[$9>>2] = $16;
 HEAP32[$11>>2] = $22;
 HEAP32[$13>>2] = $4;
 HEAP32[$15>>2] = $10;
 HEAP32[$17>>2] = $24;
 HEAP32[$19>>2] = $6;
 HEAP32[$21>>2] = $12;
 HEAP32[$23>>2] = $18;
 return;
}
function _MatrixIdentity($0) {
 $0 = $0|0;
 var $$sroa$5$0$$sroa_idx = 0, $$sroa$55$0$$sroa_idx6 = 0, $$sroa$6$0$$sroa_idx = 0, $$sroa$611$0$$sroa_idx12 = 0, $$sroa$7$0$$sroa_idx = 0, $$sroa$717$0$$sroa_idx18 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 HEAPF32[$0>>2] = 1.0;
 $$sroa$5$0$$sroa_idx = ((($0)) + 4|0);
 ;HEAP32[$$sroa$5$0$$sroa_idx>>2]=0|0;HEAP32[$$sroa$5$0$$sroa_idx+4>>2]=0|0;HEAP32[$$sroa$5$0$$sroa_idx+8>>2]=0|0;HEAP32[$$sroa$5$0$$sroa_idx+12>>2]=0|0;
 $$sroa$55$0$$sroa_idx6 = ((($0)) + 20|0);
 HEAPF32[$$sroa$55$0$$sroa_idx6>>2] = 1.0;
 $$sroa$6$0$$sroa_idx = ((($0)) + 24|0);
 ;HEAP32[$$sroa$6$0$$sroa_idx>>2]=0|0;HEAP32[$$sroa$6$0$$sroa_idx+4>>2]=0|0;HEAP32[$$sroa$6$0$$sroa_idx+8>>2]=0|0;HEAP32[$$sroa$6$0$$sroa_idx+12>>2]=0|0;
 $$sroa$611$0$$sroa_idx12 = ((($0)) + 40|0);
 HEAPF32[$$sroa$611$0$$sroa_idx12>>2] = 1.0;
 $$sroa$7$0$$sroa_idx = ((($0)) + 44|0);
 ;HEAP32[$$sroa$7$0$$sroa_idx>>2]=0|0;HEAP32[$$sroa$7$0$$sroa_idx+4>>2]=0|0;HEAP32[$$sroa$7$0$$sroa_idx+8>>2]=0|0;HEAP32[$$sroa$7$0$$sroa_idx+12>>2]=0|0;
 $$sroa$717$0$$sroa_idx18 = ((($0)) + 60|0);
 HEAPF32[$$sroa$717$0$$sroa_idx18>>2] = 1.0;
 return;
}
function _MatrixTranslate($0,$1,$2,$3) {
 $0 = $0|0;
 $1 = +$1;
 $2 = +$2;
 $3 = +$3;
 var $$sroa$13$0$$sroa_idx20 = 0, $$sroa$14$0$$sroa_idx22 = 0, $$sroa$15$0$$sroa_idx24 = 0, $$sroa$16$0$$sroa_idx26 = 0, $$sroa$17$0$$sroa_idx28 = 0, $$sroa$18$0$$sroa_idx30 = 0, $$sroa$4$0$$sroa_idx2 = 0, $$sroa$8$0$$sroa_idx10 = 0, $$sroa$9$0$$sroa_idx12 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 HEAPF32[$0>>2] = 1.0;
 $$sroa$4$0$$sroa_idx2 = ((($0)) + 4|0);
 $$sroa$8$0$$sroa_idx10 = ((($0)) + 20|0);
 ;HEAP32[$$sroa$4$0$$sroa_idx2>>2]=0|0;HEAP32[$$sroa$4$0$$sroa_idx2+4>>2]=0|0;HEAP32[$$sroa$4$0$$sroa_idx2+8>>2]=0|0;HEAP32[$$sroa$4$0$$sroa_idx2+12>>2]=0|0;
 HEAPF32[$$sroa$8$0$$sroa_idx10>>2] = 1.0;
 $$sroa$9$0$$sroa_idx12 = ((($0)) + 24|0);
 $$sroa$13$0$$sroa_idx20 = ((($0)) + 40|0);
 ;HEAP32[$$sroa$9$0$$sroa_idx12>>2]=0|0;HEAP32[$$sroa$9$0$$sroa_idx12+4>>2]=0|0;HEAP32[$$sroa$9$0$$sroa_idx12+8>>2]=0|0;HEAP32[$$sroa$9$0$$sroa_idx12+12>>2]=0|0;
 HEAPF32[$$sroa$13$0$$sroa_idx20>>2] = 1.0;
 $$sroa$14$0$$sroa_idx22 = ((($0)) + 44|0);
 HEAPF32[$$sroa$14$0$$sroa_idx22>>2] = 0.0;
 $$sroa$15$0$$sroa_idx24 = ((($0)) + 48|0);
 HEAPF32[$$sroa$15$0$$sroa_idx24>>2] = $1;
 $$sroa$16$0$$sroa_idx26 = ((($0)) + 52|0);
 HEAPF32[$$sroa$16$0$$sroa_idx26>>2] = $2;
 $$sroa$17$0$$sroa_idx28 = ((($0)) + 56|0);
 HEAPF32[$$sroa$17$0$$sroa_idx28>>2] = $3;
 $$sroa$18$0$$sroa_idx30 = ((($0)) + 60|0);
 HEAPF32[$$sroa$18$0$$sroa_idx30>>2] = 1.0;
 return;
}
function _MatrixRotate($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = +$2;
 var $$ = 0.0, $$221 = 0.0, $$222 = 0.0, $$sroa$10$0$$sroa_idx199 = 0, $$sroa$11$0$$sroa_idx201 = 0, $$sroa$12$0$$sroa_idx203 = 0, $$sroa$13$0$$sroa_idx205 = 0, $$sroa$14$0$$sroa_idx207 = 0, $$sroa$15$0$$sroa_idx209 = 0, $$sroa$16$0$$sroa_idx211 = 0, $$sroa$17$0$$sroa_idx213 = 0, $$sroa$18$0$$sroa_idx215 = 0, $$sroa$4$0$$sroa_idx187 = 0, $$sroa$5$0$$sroa_idx189 = 0, $$sroa$6$0$$sroa_idx191 = 0, $$sroa$7$0$$sroa_idx193 = 0, $$sroa$8$0$$sroa_idx195 = 0, $$sroa$9$0$$sroa_idx197 = 0, $10 = 0.0, $100 = 0.0;
 var $101 = 0.0, $102 = 0.0, $103 = 0.0, $104 = 0.0, $105 = 0.0, $106 = 0.0, $107 = 0.0, $108 = 0.0, $109 = 0.0, $11 = 0.0, $110 = 0.0, $111 = 0.0, $112 = 0.0, $113 = 0.0, $114 = 0.0, $115 = 0.0, $116 = 0.0, $117 = 0.0, $118 = 0.0, $119 = 0.0;
 var $12 = 0.0, $120 = 0.0, $121 = 0.0, $122 = 0.0, $123 = 0.0, $124 = 0.0, $125 = 0.0, $126 = 0.0, $127 = 0.0, $128 = 0.0, $129 = 0.0, $13 = 0.0, $130 = 0.0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0;
 var $138 = 0, $14 = 0.0, $15 = 0, $16 = 0, $17 = 0.0, $18 = 0.0, $19 = 0.0, $20 = 0.0, $21 = 0.0, $22 = 0.0, $23 = 0.0, $24 = 0.0, $25 = 0, $26 = 0.0, $27 = 0, $28 = 0.0, $29 = 0, $3 = 0, $30 = 0.0, $31 = 0;
 var $32 = 0.0, $33 = 0, $34 = 0.0, $35 = 0, $36 = 0.0, $37 = 0, $38 = 0.0, $39 = 0, $4 = 0.0, $40 = 0.0, $41 = 0, $42 = 0.0, $43 = 0, $44 = 0.0, $45 = 0, $46 = 0.0, $47 = 0.0, $48 = 0.0, $49 = 0.0, $5 = 0;
 var $50 = 0.0, $51 = 0.0, $52 = 0.0, $53 = 0.0, $54 = 0.0, $55 = 0.0, $56 = 0.0, $57 = 0.0, $58 = 0.0, $59 = 0.0, $6 = 0.0, $60 = 0.0, $61 = 0.0, $62 = 0.0, $63 = 0.0, $64 = 0.0, $65 = 0.0, $66 = 0.0, $67 = 0.0, $68 = 0.0;
 var $69 = 0.0, $7 = 0, $70 = 0.0, $71 = 0.0, $72 = 0.0, $73 = 0.0, $74 = 0.0, $75 = 0.0, $76 = 0.0, $77 = 0.0, $78 = 0.0, $79 = 0.0, $8 = 0.0, $80 = 0.0, $81 = 0.0, $82 = 0.0, $83 = 0.0, $84 = 0.0, $85 = 0.0, $86 = 0.0;
 var $87 = 0.0, $88 = 0.0, $89 = 0.0, $9 = 0.0, $90 = 0.0, $91 = 0.0, $92 = 0.0, $93 = 0.0, $94 = 0.0, $95 = 0.0, $96 = 0.0, $97 = 0.0, $98 = 0.0, $99 = 0.0, $or$cond = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(64|0);
 $3 = sp;
 _MatrixIdentity($3);
 $4 = +HEAPF32[$1>>2];
 $5 = ((($1)) + 4|0);
 $6 = +HEAPF32[$5>>2];
 $7 = ((($1)) + 8|0);
 $8 = +HEAPF32[$7>>2];
 $9 = $4 * $4;
 $10 = $6 * $6;
 $11 = $9 + $10;
 $12 = $8 * $8;
 $13 = $11 + $12;
 $14 = (+Math_sqrt((+$13)));
 $15 = $14 != 1.0;
 $16 = $14 != 0.0;
 $or$cond = $15 & $16;
 $17 = 1.0 / $14;
 $18 = $4 * $17;
 $19 = $6 * $17;
 $20 = $8 * $17;
 $$ = $or$cond ? $20 : $8;
 $$221 = $or$cond ? $19 : $6;
 $$222 = $or$cond ? $18 : $4;
 $21 = (+Math_sin((+$2)));
 $22 = (+Math_cos((+$2)));
 $23 = 1.0 - $22;
 $24 = +HEAPF32[$3>>2];
 $25 = ((($3)) + 16|0);
 $26 = +HEAPF32[$25>>2];
 $27 = ((($3)) + 32|0);
 $28 = +HEAPF32[$27>>2];
 $29 = ((($3)) + 48|0);
 $30 = +HEAPF32[$29>>2];
 $31 = ((($3)) + 4|0);
 $32 = +HEAPF32[$31>>2];
 $33 = ((($3)) + 20|0);
 $34 = +HEAPF32[$33>>2];
 $35 = ((($3)) + 36|0);
 $36 = +HEAPF32[$35>>2];
 $37 = ((($3)) + 52|0);
 $38 = +HEAPF32[$37>>2];
 $39 = ((($3)) + 8|0);
 $40 = +HEAPF32[$39>>2];
 $41 = ((($3)) + 24|0);
 $42 = +HEAPF32[$41>>2];
 $43 = ((($3)) + 40|0);
 $44 = +HEAPF32[$43>>2];
 $45 = ((($3)) + 56|0);
 $46 = +HEAPF32[$45>>2];
 $47 = $$222 * $$222;
 $48 = $23 * $47;
 $49 = $22 + $48;
 $50 = $$221 * $$222;
 $51 = $23 * $50;
 $52 = $21 * $$;
 $53 = $52 + $51;
 $54 = $$ * $$222;
 $55 = $23 * $54;
 $56 = $21 * $$221;
 $57 = $55 - $56;
 $58 = $51 - $52;
 $59 = $$221 * $$221;
 $60 = $23 * $59;
 $61 = $22 + $60;
 $62 = $$ * $$221;
 $63 = $23 * $62;
 $64 = $21 * $$222;
 $65 = $64 + $63;
 $66 = $56 + $55;
 $67 = $63 - $64;
 $68 = $$ * $$;
 $69 = $23 * $68;
 $70 = $22 + $69;
 $71 = $24 * $49;
 $72 = $53 * $32;
 $73 = $71 + $72;
 $74 = $57 * $40;
 $75 = $73 + $74;
 $76 = $26 * $49;
 $77 = $53 * $34;
 $78 = $76 + $77;
 $79 = $57 * $42;
 $80 = $78 + $79;
 $81 = $28 * $49;
 $82 = $53 * $36;
 $83 = $81 + $82;
 $84 = $57 * $44;
 $85 = $83 + $84;
 $86 = $30 * $49;
 $87 = $53 * $38;
 $88 = $86 + $87;
 $89 = $57 * $46;
 $90 = $88 + $89;
 $91 = $24 * $58;
 $92 = $61 * $32;
 $93 = $91 + $92;
 $94 = $65 * $40;
 $95 = $93 + $94;
 $96 = $26 * $58;
 $97 = $61 * $34;
 $98 = $96 + $97;
 $99 = $65 * $42;
 $100 = $98 + $99;
 $101 = $28 * $58;
 $102 = $61 * $36;
 $103 = $101 + $102;
 $104 = $65 * $44;
 $105 = $103 + $104;
 $106 = $30 * $58;
 $107 = $61 * $38;
 $108 = $106 + $107;
 $109 = $65 * $46;
 $110 = $108 + $109;
 $111 = $24 * $66;
 $112 = $67 * $32;
 $113 = $111 + $112;
 $114 = $70 * $40;
 $115 = $113 + $114;
 $116 = $26 * $66;
 $117 = $67 * $34;
 $118 = $116 + $117;
 $119 = $70 * $42;
 $120 = $118 + $119;
 $121 = $28 * $66;
 $122 = $67 * $36;
 $123 = $121 + $122;
 $124 = $70 * $44;
 $125 = $123 + $124;
 $126 = $30 * $66;
 $127 = $67 * $38;
 $128 = $126 + $127;
 $129 = $70 * $46;
 $130 = $128 + $129;
 $131 = ((($3)) + 12|0);
 $132 = HEAP32[$131>>2]|0;
 $133 = ((($3)) + 28|0);
 $134 = HEAP32[$133>>2]|0;
 $135 = ((($3)) + 44|0);
 $136 = HEAP32[$135>>2]|0;
 $137 = ((($3)) + 60|0);
 $138 = HEAP32[$137>>2]|0;
 HEAPF32[$0>>2] = $75;
 $$sroa$4$0$$sroa_idx187 = ((($0)) + 4|0);
 HEAPF32[$$sroa$4$0$$sroa_idx187>>2] = $95;
 $$sroa$5$0$$sroa_idx189 = ((($0)) + 8|0);
 HEAPF32[$$sroa$5$0$$sroa_idx189>>2] = $115;
 $$sroa$6$0$$sroa_idx191 = ((($0)) + 12|0);
 HEAP32[$$sroa$6$0$$sroa_idx191>>2] = $132;
 $$sroa$7$0$$sroa_idx193 = ((($0)) + 16|0);
 HEAPF32[$$sroa$7$0$$sroa_idx193>>2] = $80;
 $$sroa$8$0$$sroa_idx195 = ((($0)) + 20|0);
 HEAPF32[$$sroa$8$0$$sroa_idx195>>2] = $100;
 $$sroa$9$0$$sroa_idx197 = ((($0)) + 24|0);
 HEAPF32[$$sroa$9$0$$sroa_idx197>>2] = $120;
 $$sroa$10$0$$sroa_idx199 = ((($0)) + 28|0);
 HEAP32[$$sroa$10$0$$sroa_idx199>>2] = $134;
 $$sroa$11$0$$sroa_idx201 = ((($0)) + 32|0);
 HEAPF32[$$sroa$11$0$$sroa_idx201>>2] = $85;
 $$sroa$12$0$$sroa_idx203 = ((($0)) + 36|0);
 HEAPF32[$$sroa$12$0$$sroa_idx203>>2] = $105;
 $$sroa$13$0$$sroa_idx205 = ((($0)) + 40|0);
 HEAPF32[$$sroa$13$0$$sroa_idx205>>2] = $125;
 $$sroa$14$0$$sroa_idx207 = ((($0)) + 44|0);
 HEAP32[$$sroa$14$0$$sroa_idx207>>2] = $136;
 $$sroa$15$0$$sroa_idx209 = ((($0)) + 48|0);
 HEAPF32[$$sroa$15$0$$sroa_idx209>>2] = $90;
 $$sroa$16$0$$sroa_idx211 = ((($0)) + 52|0);
 HEAPF32[$$sroa$16$0$$sroa_idx211>>2] = $110;
 $$sroa$17$0$$sroa_idx213 = ((($0)) + 56|0);
 HEAPF32[$$sroa$17$0$$sroa_idx213>>2] = $130;
 $$sroa$18$0$$sroa_idx215 = ((($0)) + 60|0);
 HEAP32[$$sroa$18$0$$sroa_idx215>>2] = $138;
 STACKTOP = sp;return;
}
function _MatrixScale($0,$1,$2,$3) {
 $0 = $0|0;
 $1 = +$1;
 $2 = +$2;
 $3 = +$3;
 var $$sroa$5$0$$sroa_idx = 0, $$sroa$55$0$$sroa_idx6 = 0, $$sroa$6$0$$sroa_idx = 0, $$sroa$611$0$$sroa_idx12 = 0, $$sroa$7$0$$sroa_idx = 0, $$sroa$717$0$$sroa_idx18 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 HEAPF32[$0>>2] = $1;
 $$sroa$5$0$$sroa_idx = ((($0)) + 4|0);
 ;HEAP32[$$sroa$5$0$$sroa_idx>>2]=0|0;HEAP32[$$sroa$5$0$$sroa_idx+4>>2]=0|0;HEAP32[$$sroa$5$0$$sroa_idx+8>>2]=0|0;HEAP32[$$sroa$5$0$$sroa_idx+12>>2]=0|0;
 $$sroa$55$0$$sroa_idx6 = ((($0)) + 20|0);
 HEAPF32[$$sroa$55$0$$sroa_idx6>>2] = $2;
 $$sroa$6$0$$sroa_idx = ((($0)) + 24|0);
 ;HEAP32[$$sroa$6$0$$sroa_idx>>2]=0|0;HEAP32[$$sroa$6$0$$sroa_idx+4>>2]=0|0;HEAP32[$$sroa$6$0$$sroa_idx+8>>2]=0|0;HEAP32[$$sroa$6$0$$sroa_idx+12>>2]=0|0;
 $$sroa$611$0$$sroa_idx12 = ((($0)) + 40|0);
 HEAPF32[$$sroa$611$0$$sroa_idx12>>2] = $3;
 $$sroa$7$0$$sroa_idx = ((($0)) + 44|0);
 ;HEAP32[$$sroa$7$0$$sroa_idx>>2]=0|0;HEAP32[$$sroa$7$0$$sroa_idx+4>>2]=0|0;HEAP32[$$sroa$7$0$$sroa_idx+8>>2]=0|0;HEAP32[$$sroa$7$0$$sroa_idx+12>>2]=0|0;
 $$sroa$717$0$$sroa_idx18 = ((($0)) + 60|0);
 HEAPF32[$$sroa$717$0$$sroa_idx18>>2] = 1.0;
 return;
}
function _MatrixMultiply($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $$sroa$10$0$$sroa_idx14 = 0, $$sroa$11$0$$sroa_idx16 = 0, $$sroa$12$0$$sroa_idx18 = 0, $$sroa$13$0$$sroa_idx20 = 0, $$sroa$14$0$$sroa_idx22 = 0, $$sroa$15$0$$sroa_idx24 = 0, $$sroa$16$0$$sroa_idx26 = 0, $$sroa$17$0$$sroa_idx28 = 0, $$sroa$18$0$$sroa_idx30 = 0, $$sroa$4$0$$sroa_idx2 = 0, $$sroa$5$0$$sroa_idx4 = 0, $$sroa$6$0$$sroa_idx6 = 0, $$sroa$7$0$$sroa_idx8 = 0, $$sroa$8$0$$sroa_idx10 = 0, $$sroa$9$0$$sroa_idx12 = 0, $10 = 0.0, $100 = 0.0, $101 = 0.0, $102 = 0.0, $103 = 0.0;
 var $104 = 0.0, $105 = 0, $106 = 0.0, $107 = 0.0, $108 = 0, $109 = 0.0, $11 = 0.0, $110 = 0.0, $111 = 0.0, $112 = 0, $113 = 0.0, $114 = 0.0, $115 = 0.0, $116 = 0, $117 = 0.0, $118 = 0.0, $119 = 0.0, $12 = 0, $120 = 0.0, $121 = 0.0;
 var $122 = 0.0, $123 = 0.0, $124 = 0.0, $125 = 0.0, $126 = 0.0, $127 = 0.0, $128 = 0.0, $129 = 0.0, $13 = 0.0, $130 = 0.0, $131 = 0.0, $132 = 0.0, $133 = 0.0, $134 = 0.0, $135 = 0.0, $136 = 0.0, $137 = 0.0, $138 = 0.0, $139 = 0.0, $14 = 0;
 var $140 = 0.0, $141 = 0, $142 = 0.0, $143 = 0.0, $144 = 0, $145 = 0.0, $146 = 0.0, $147 = 0.0, $148 = 0, $149 = 0.0, $15 = 0.0, $150 = 0.0, $151 = 0.0, $152 = 0, $153 = 0.0, $154 = 0.0, $155 = 0.0, $156 = 0.0, $157 = 0.0, $158 = 0.0;
 var $159 = 0.0, $16 = 0.0, $160 = 0.0, $161 = 0.0, $162 = 0.0, $163 = 0.0, $164 = 0.0, $165 = 0.0, $166 = 0.0, $167 = 0.0, $168 = 0.0, $169 = 0.0, $17 = 0.0, $170 = 0.0, $171 = 0.0, $172 = 0.0, $173 = 0.0, $174 = 0.0, $175 = 0.0, $176 = 0.0;
 var $18 = 0, $19 = 0.0, $20 = 0, $21 = 0.0, $22 = 0.0, $23 = 0.0, $24 = 0, $25 = 0.0, $26 = 0.0, $27 = 0, $28 = 0.0, $29 = 0.0, $3 = 0.0, $30 = 0.0, $31 = 0, $32 = 0.0, $33 = 0.0, $34 = 0.0, $35 = 0, $36 = 0.0;
 var $37 = 0.0, $38 = 0.0, $39 = 0, $4 = 0.0, $40 = 0.0, $41 = 0.0, $42 = 0, $43 = 0.0, $44 = 0.0, $45 = 0.0, $46 = 0, $47 = 0.0, $48 = 0.0, $49 = 0.0, $5 = 0.0, $50 = 0, $51 = 0.0, $52 = 0.0, $53 = 0.0, $54 = 0;
 var $55 = 0.0, $56 = 0.0, $57 = 0, $58 = 0.0, $59 = 0.0, $6 = 0, $60 = 0.0, $61 = 0, $62 = 0.0, $63 = 0.0, $64 = 0.0, $65 = 0, $66 = 0.0, $67 = 0.0, $68 = 0.0, $69 = 0, $7 = 0.0, $70 = 0.0, $71 = 0.0, $72 = 0;
 var $73 = 0.0, $74 = 0.0, $75 = 0.0, $76 = 0, $77 = 0.0, $78 = 0.0, $79 = 0.0, $8 = 0, $80 = 0, $81 = 0.0, $82 = 0.0, $83 = 0.0, $84 = 0.0, $85 = 0.0, $86 = 0.0, $87 = 0.0, $88 = 0.0, $89 = 0.0, $9 = 0.0, $90 = 0.0;
 var $91 = 0.0, $92 = 0.0, $93 = 0.0, $94 = 0.0, $95 = 0.0, $96 = 0.0, $97 = 0.0, $98 = 0.0, $99 = 0.0, label = 0, sp = 0;
 sp = STACKTOP;
 $3 = +HEAPF32[$2>>2];
 $4 = +HEAPF32[$1>>2];
 $5 = $3 * $4;
 $6 = ((($2)) + 16|0);
 $7 = +HEAPF32[$6>>2];
 $8 = ((($1)) + 4|0);
 $9 = +HEAPF32[$8>>2];
 $10 = $7 * $9;
 $11 = $5 + $10;
 $12 = ((($2)) + 32|0);
 $13 = +HEAPF32[$12>>2];
 $14 = ((($1)) + 8|0);
 $15 = +HEAPF32[$14>>2];
 $16 = $13 * $15;
 $17 = $11 + $16;
 $18 = ((($2)) + 48|0);
 $19 = +HEAPF32[$18>>2];
 $20 = ((($1)) + 12|0);
 $21 = +HEAPF32[$20>>2];
 $22 = $19 * $21;
 $23 = $17 + $22;
 $24 = ((($1)) + 16|0);
 $25 = +HEAPF32[$24>>2];
 $26 = $3 * $25;
 $27 = ((($1)) + 20|0);
 $28 = +HEAPF32[$27>>2];
 $29 = $7 * $28;
 $30 = $26 + $29;
 $31 = ((($1)) + 24|0);
 $32 = +HEAPF32[$31>>2];
 $33 = $13 * $32;
 $34 = $30 + $33;
 $35 = ((($1)) + 28|0);
 $36 = +HEAPF32[$35>>2];
 $37 = $19 * $36;
 $38 = $34 + $37;
 $39 = ((($1)) + 32|0);
 $40 = +HEAPF32[$39>>2];
 $41 = $3 * $40;
 $42 = ((($1)) + 36|0);
 $43 = +HEAPF32[$42>>2];
 $44 = $7 * $43;
 $45 = $41 + $44;
 $46 = ((($1)) + 40|0);
 $47 = +HEAPF32[$46>>2];
 $48 = $13 * $47;
 $49 = $45 + $48;
 $50 = ((($1)) + 44|0);
 $51 = +HEAPF32[$50>>2];
 $52 = $19 * $51;
 $53 = $49 + $52;
 $54 = ((($1)) + 48|0);
 $55 = +HEAPF32[$54>>2];
 $56 = $3 * $55;
 $57 = ((($1)) + 52|0);
 $58 = +HEAPF32[$57>>2];
 $59 = $7 * $58;
 $60 = $56 + $59;
 $61 = ((($1)) + 56|0);
 $62 = +HEAPF32[$61>>2];
 $63 = $13 * $62;
 $64 = $60 + $63;
 $65 = ((($1)) + 60|0);
 $66 = +HEAPF32[$65>>2];
 $67 = $19 * $66;
 $68 = $64 + $67;
 $69 = ((($2)) + 4|0);
 $70 = +HEAPF32[$69>>2];
 $71 = $4 * $70;
 $72 = ((($2)) + 20|0);
 $73 = +HEAPF32[$72>>2];
 $74 = $9 * $73;
 $75 = $71 + $74;
 $76 = ((($2)) + 36|0);
 $77 = +HEAPF32[$76>>2];
 $78 = $15 * $77;
 $79 = $75 + $78;
 $80 = ((($2)) + 52|0);
 $81 = +HEAPF32[$80>>2];
 $82 = $21 * $81;
 $83 = $79 + $82;
 $84 = $25 * $70;
 $85 = $28 * $73;
 $86 = $84 + $85;
 $87 = $32 * $77;
 $88 = $86 + $87;
 $89 = $36 * $81;
 $90 = $88 + $89;
 $91 = $40 * $70;
 $92 = $43 * $73;
 $93 = $91 + $92;
 $94 = $47 * $77;
 $95 = $93 + $94;
 $96 = $51 * $81;
 $97 = $95 + $96;
 $98 = $55 * $70;
 $99 = $58 * $73;
 $100 = $98 + $99;
 $101 = $62 * $77;
 $102 = $100 + $101;
 $103 = $66 * $81;
 $104 = $102 + $103;
 $105 = ((($2)) + 8|0);
 $106 = +HEAPF32[$105>>2];
 $107 = $4 * $106;
 $108 = ((($2)) + 24|0);
 $109 = +HEAPF32[$108>>2];
 $110 = $9 * $109;
 $111 = $107 + $110;
 $112 = ((($2)) + 40|0);
 $113 = +HEAPF32[$112>>2];
 $114 = $15 * $113;
 $115 = $111 + $114;
 $116 = ((($2)) + 56|0);
 $117 = +HEAPF32[$116>>2];
 $118 = $21 * $117;
 $119 = $115 + $118;
 $120 = $25 * $106;
 $121 = $28 * $109;
 $122 = $120 + $121;
 $123 = $32 * $113;
 $124 = $122 + $123;
 $125 = $36 * $117;
 $126 = $124 + $125;
 $127 = $40 * $106;
 $128 = $43 * $109;
 $129 = $127 + $128;
 $130 = $47 * $113;
 $131 = $129 + $130;
 $132 = $51 * $117;
 $133 = $131 + $132;
 $134 = $55 * $106;
 $135 = $58 * $109;
 $136 = $134 + $135;
 $137 = $62 * $113;
 $138 = $136 + $137;
 $139 = $66 * $117;
 $140 = $138 + $139;
 $141 = ((($2)) + 12|0);
 $142 = +HEAPF32[$141>>2];
 $143 = $4 * $142;
 $144 = ((($2)) + 28|0);
 $145 = +HEAPF32[$144>>2];
 $146 = $9 * $145;
 $147 = $143 + $146;
 $148 = ((($2)) + 44|0);
 $149 = +HEAPF32[$148>>2];
 $150 = $15 * $149;
 $151 = $147 + $150;
 $152 = ((($2)) + 60|0);
 $153 = +HEAPF32[$152>>2];
 $154 = $21 * $153;
 $155 = $151 + $154;
 $156 = $25 * $142;
 $157 = $28 * $145;
 $158 = $156 + $157;
 $159 = $32 * $149;
 $160 = $158 + $159;
 $161 = $36 * $153;
 $162 = $160 + $161;
 $163 = $40 * $142;
 $164 = $43 * $145;
 $165 = $163 + $164;
 $166 = $47 * $149;
 $167 = $165 + $166;
 $168 = $51 * $153;
 $169 = $167 + $168;
 $170 = $55 * $142;
 $171 = $58 * $145;
 $172 = $170 + $171;
 $173 = $62 * $149;
 $174 = $172 + $173;
 $175 = $66 * $153;
 $176 = $174 + $175;
 HEAPF32[$0>>2] = $23;
 $$sroa$4$0$$sroa_idx2 = ((($0)) + 4|0);
 HEAPF32[$$sroa$4$0$$sroa_idx2>>2] = $83;
 $$sroa$5$0$$sroa_idx4 = ((($0)) + 8|0);
 HEAPF32[$$sroa$5$0$$sroa_idx4>>2] = $119;
 $$sroa$6$0$$sroa_idx6 = ((($0)) + 12|0);
 HEAPF32[$$sroa$6$0$$sroa_idx6>>2] = $155;
 $$sroa$7$0$$sroa_idx8 = ((($0)) + 16|0);
 HEAPF32[$$sroa$7$0$$sroa_idx8>>2] = $38;
 $$sroa$8$0$$sroa_idx10 = ((($0)) + 20|0);
 HEAPF32[$$sroa$8$0$$sroa_idx10>>2] = $90;
 $$sroa$9$0$$sroa_idx12 = ((($0)) + 24|0);
 HEAPF32[$$sroa$9$0$$sroa_idx12>>2] = $126;
 $$sroa$10$0$$sroa_idx14 = ((($0)) + 28|0);
 HEAPF32[$$sroa$10$0$$sroa_idx14>>2] = $162;
 $$sroa$11$0$$sroa_idx16 = ((($0)) + 32|0);
 HEAPF32[$$sroa$11$0$$sroa_idx16>>2] = $53;
 $$sroa$12$0$$sroa_idx18 = ((($0)) + 36|0);
 HEAPF32[$$sroa$12$0$$sroa_idx18>>2] = $97;
 $$sroa$13$0$$sroa_idx20 = ((($0)) + 40|0);
 HEAPF32[$$sroa$13$0$$sroa_idx20>>2] = $133;
 $$sroa$14$0$$sroa_idx22 = ((($0)) + 44|0);
 HEAPF32[$$sroa$14$0$$sroa_idx22>>2] = $169;
 $$sroa$15$0$$sroa_idx24 = ((($0)) + 48|0);
 HEAPF32[$$sroa$15$0$$sroa_idx24>>2] = $68;
 $$sroa$16$0$$sroa_idx26 = ((($0)) + 52|0);
 HEAPF32[$$sroa$16$0$$sroa_idx26>>2] = $104;
 $$sroa$17$0$$sroa_idx28 = ((($0)) + 56|0);
 HEAPF32[$$sroa$17$0$$sroa_idx28>>2] = $140;
 $$sroa$18$0$$sroa_idx30 = ((($0)) + 60|0);
 HEAPF32[$$sroa$18$0$$sroa_idx30>>2] = $176;
 return;
}
function _MatrixOrtho($0,$1,$2,$3,$4,$5,$6) {
 $0 = $0|0;
 $1 = +$1;
 $2 = +$2;
 $3 = +$3;
 $4 = +$4;
 $5 = +$5;
 $6 = +$6;
 var $$sroa$10$0$$sroa_idx24 = 0, $$sroa$11$0$$sroa_idx26 = 0, $$sroa$12$0$$sroa_idx28 = 0, $$sroa$13$0$$sroa_idx30 = 0, $$sroa$14$0$$sroa_idx32 = 0, $$sroa$15$0$$sroa_idx34 = 0, $$sroa$16$0$$sroa_idx36 = 0, $$sroa$17$0$$sroa_idx38 = 0, $$sroa$18$0$$sroa_idx40 = 0, $$sroa$4$0$$sroa_idx12 = 0, $$sroa$5$0$$sroa_idx14 = 0, $$sroa$6$0$$sroa_idx16 = 0, $$sroa$7$0$$sroa_idx18 = 0, $$sroa$8$0$$sroa_idx20 = 0, $$sroa$9$0$$sroa_idx22 = 0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0.0;
 var $15 = 0.0, $16 = 0.0, $17 = 0.0, $18 = 0.0, $19 = 0.0, $20 = 0.0, $21 = 0.0, $22 = 0.0, $23 = 0.0, $24 = 0.0, $25 = 0.0, $26 = 0.0, $27 = 0.0, $28 = 0.0, $29 = 0.0, $30 = 0.0, $7 = 0.0, $8 = 0.0, $9 = 0.0, label = 0;
 var sp = 0;
 sp = STACKTOP;
 $7 = $2 - $1;
 $8 = $7;
 $9 = $4 - $3;
 $10 = $9;
 $11 = $6 - $5;
 $12 = $11;
 $13 = 2.0 / $8;
 $14 = 2.0 / $10;
 $15 = -2.0 / $12;
 $16 = $1 + $2;
 $17 = -$16;
 $18 = $8;
 $19 = $17 / $18;
 $20 = $19;
 $21 = $3 + $4;
 $22 = -$21;
 $23 = $10;
 $24 = $22 / $23;
 $25 = $24;
 $26 = $5 + $6;
 $27 = -$26;
 $28 = $12;
 $29 = $27 / $28;
 $30 = $29;
 HEAPF32[$0>>2] = $13;
 $$sroa$4$0$$sroa_idx12 = ((($0)) + 4|0);
 HEAPF32[$$sroa$4$0$$sroa_idx12>>2] = 0.0;
 $$sroa$5$0$$sroa_idx14 = ((($0)) + 8|0);
 HEAPF32[$$sroa$5$0$$sroa_idx14>>2] = 0.0;
 $$sroa$6$0$$sroa_idx16 = ((($0)) + 12|0);
 HEAPF32[$$sroa$6$0$$sroa_idx16>>2] = $20;
 $$sroa$7$0$$sroa_idx18 = ((($0)) + 16|0);
 HEAPF32[$$sroa$7$0$$sroa_idx18>>2] = 0.0;
 $$sroa$8$0$$sroa_idx20 = ((($0)) + 20|0);
 HEAPF32[$$sroa$8$0$$sroa_idx20>>2] = $14;
 $$sroa$9$0$$sroa_idx22 = ((($0)) + 24|0);
 HEAPF32[$$sroa$9$0$$sroa_idx22>>2] = 0.0;
 $$sroa$10$0$$sroa_idx24 = ((($0)) + 28|0);
 HEAPF32[$$sroa$10$0$$sroa_idx24>>2] = $25;
 $$sroa$11$0$$sroa_idx26 = ((($0)) + 32|0);
 HEAPF32[$$sroa$11$0$$sroa_idx26>>2] = 0.0;
 $$sroa$12$0$$sroa_idx28 = ((($0)) + 36|0);
 HEAPF32[$$sroa$12$0$$sroa_idx28>>2] = 0.0;
 $$sroa$13$0$$sroa_idx30 = ((($0)) + 40|0);
 HEAPF32[$$sroa$13$0$$sroa_idx30>>2] = $15;
 $$sroa$14$0$$sroa_idx32 = ((($0)) + 44|0);
 HEAPF32[$$sroa$14$0$$sroa_idx32>>2] = $30;
 $$sroa$15$0$$sroa_idx34 = ((($0)) + 48|0);
 HEAPF32[$$sroa$15$0$$sroa_idx34>>2] = 0.0;
 $$sroa$16$0$$sroa_idx36 = ((($0)) + 52|0);
 HEAPF32[$$sroa$16$0$$sroa_idx36>>2] = 0.0;
 $$sroa$17$0$$sroa_idx38 = ((($0)) + 56|0);
 HEAPF32[$$sroa$17$0$$sroa_idx38>>2] = 0.0;
 $$sroa$18$0$$sroa_idx40 = ((($0)) + 60|0);
 HEAPF32[$$sroa$18$0$$sroa_idx40>>2] = 1.0;
 return;
}
function _ProcessGestureEvent($0) {
 $0 = $0|0;
 var $$$sink = 0, $$sink = 0, $$sink10 = 0, $$sink11 = 0, $$sink16 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0.0, $111 = 0.0;
 var $112 = 0.0, $113 = 0.0, $114 = 0.0, $115 = 0.0, $116 = 0.0, $117 = 0, $118 = 0, $119 = 0, $12 = 0.0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0;
 var $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0;
 var $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0.0, $16 = 0, $160 = 0.0, $161 = 0.0, $162 = 0.0, $163 = 0.0, $164 = 0.0, $165 = 0.0, $166 = 0;
 var $167 = 0.0, $168 = 0, $169 = 0.0, $17 = 0, $170 = 0.0, $171 = 0.0, $172 = 0, $173 = 0.0, $174 = 0.0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0;
 var $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0;
 var $46 = 0, $47 = 0, $48 = 0.0, $49 = 0.0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0.0, $56 = 0.0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0;
 var $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0.0, $81 = 0;
 var $82 = 0.0, $83 = 0.0, $84 = 0.0, $85 = 0.0, $86 = 0.0, $87 = 0.0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $moveDownPosition$byval_copy11 = 0;
 var $moveDownPosition2$byval_copy12 = 0, $or$cond = 0, $or$cond3 = 0, $or$cond5 = 0, $or$cond7 = 0, $or$cond9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $moveDownPosition2$byval_copy12 = sp + 8|0;
 $moveDownPosition$byval_copy11 = sp;
 $1 = ((($0)) + 4|0);
 $2 = HEAP32[$1>>2]|0;
 HEAP32[5101] = $2;
 $3 = ($2|0)<(2);
 $4 = HEAP32[$0>>2]|0;
 $5 = ($4|0)==(1);
 if (!($3)) {
  if ($5) {
   $88 = ((($0)) + 24|0);
   $89 = $88;
   $90 = $89;
   $91 = HEAP32[$90>>2]|0;
   $92 = (($89) + 4)|0;
   $93 = $92;
   $94 = HEAP32[$93>>2]|0;
   $95 = 19800;
   $96 = $95;
   HEAP32[$96>>2] = $91;
   $97 = (($95) + 4)|0;
   $98 = $97;
   HEAP32[$98>>2] = $94;
   $99 = ((($0)) + 32|0);
   $100 = $99;
   $101 = $100;
   $102 = HEAP32[$101>>2]|0;
   $103 = (($100) + 4)|0;
   $104 = $103;
   $105 = HEAP32[$104>>2]|0;
   $106 = 19840;
   $107 = $106;
   HEAP32[$107>>2] = $102;
   $108 = (($106) + 4)|0;
   $109 = $108;
   HEAP32[$109>>2] = $105;
   $110 = +HEAPF32[4960];
   $111 = +HEAPF32[4950];
   $112 = $110 - $111;
   HEAPF32[4962] = $112;
   $113 = +HEAPF32[(19844)>>2];
   $114 = +HEAPF32[(19804)>>2];
   $115 = $113 - $114;
   HEAPF32[(19852)>>2] = $115;
   HEAP32[5100] = 4;
   STACKTOP = sp;return;
  }
  switch ($4|0) {
  case 2:  {
   ;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[19832>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[19832+4>>2]|0;
   ;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[19856>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[19856+4>>2]|0;
   $116 = (+_Vector2Distance($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12));
   HEAPF32[5106] = $116;
   $117 = 19832;
   $118 = $117;
   $119 = HEAP32[$118>>2]|0;
   $120 = (($117) + 4)|0;
   $121 = $120;
   $122 = HEAP32[$121>>2]|0;
   $123 = 19800;
   $124 = $123;
   HEAP32[$124>>2] = $119;
   $125 = (($123) + 4)|0;
   $126 = $125;
   HEAP32[$126>>2] = $122;
   $127 = 19856;
   $128 = $127;
   $129 = HEAP32[$128>>2]|0;
   $130 = (($127) + 4)|0;
   $131 = $130;
   $132 = HEAP32[$131>>2]|0;
   $133 = 19840;
   $134 = $133;
   HEAP32[$134>>2] = $129;
   $135 = (($133) + 4)|0;
   $136 = $135;
   HEAP32[$136>>2] = $132;
   $137 = ((($0)) + 24|0);
   $138 = $137;
   $139 = $138;
   $140 = HEAP32[$139>>2]|0;
   $141 = (($138) + 4)|0;
   $142 = $141;
   $143 = HEAP32[$142>>2]|0;
   $144 = 19832;
   $145 = $144;
   HEAP32[$145>>2] = $140;
   $146 = (($144) + 4)|0;
   $147 = $146;
   HEAP32[$147>>2] = $143;
   $148 = ((($0)) + 32|0);
   $149 = $148;
   $150 = $149;
   $151 = HEAP32[$150>>2]|0;
   $152 = (($149) + 4)|0;
   $153 = $152;
   $154 = HEAP32[$153>>2]|0;
   $155 = 19856;
   $156 = $155;
   HEAP32[$156>>2] = $151;
   $157 = (($155) + 4)|0;
   $158 = $157;
   HEAP32[$158>>2] = $154;
   $159 = +HEAPF32[4964];
   $160 = +HEAPF32[4958];
   $161 = $159 - $160;
   HEAPF32[4962] = $161;
   $162 = +HEAPF32[(19860)>>2];
   $163 = +HEAPF32[(19836)>>2];
   $164 = $162 - $163;
   HEAPF32[(19852)>>2] = $164;
   ;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[19800>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[19800+4>>2]|0;
   ;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[19832>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[19832+4>>2]|0;
   $165 = (+_Vector2Distance($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12));
   $166 = !($165 >= 0.004999999888241291);
   if ($166) {
    ;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[19840>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[19840+4>>2]|0;
    ;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[19856>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[19856+4>>2]|0;
    $167 = (+_Vector2Distance($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12));
    $168 = !($167 >= 0.004999999888241291);
    if ($168) {
     $$sink16 = 4;
    } else {
     label = 29;
    }
   } else {
    label = 29;
   }
   if ((label|0) == 29) {
    ;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[19832>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[19832+4>>2]|0;
    ;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[19856>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[19856+4>>2]|0;
    $169 = (+_Vector2Distance($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12));
    $170 = +HEAPF32[5106];
    $171 = $169 - $170;
    $172 = $171 < 0.0;
    $$sink11 = $172 ? 256 : 512;
    $$sink16 = $$sink11;
   }
   HEAP32[5100] = $$sink16;
   ;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[19832>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[19832+4>>2]|0;
   ;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[19856>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[19856+4>>2]|0;
   $173 = (+_Vector2Angle($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12));
   $174 = 360.0 - $173;
   HEAPF32[5107] = $174;
   STACKTOP = sp;return;
   break;
  }
  case 0:  {
   HEAPF32[5106] = 0.0;
   HEAPF32[5107] = 0.0;
   HEAPF32[4962] = 0.0;
   HEAPF32[(19852)>>2] = 0.0;
   HEAP32[5101] = 0;
   HEAP32[5100] = 0;
   STACKTOP = sp;return;
   break;
  }
  default: {
   STACKTOP = sp;return;
  }
  }
 }
 if ($5) {
  $6 = HEAP32[5102]|0;
  $7 = (($6) + 1)|0;
  HEAP32[5102] = $7;
  $8 = HEAP32[5100]|0;
  $9 = ($8|0)==(0);
  $10 = ($6|0)>(0);
  $or$cond = $10 & $9;
  if ($or$cond) {
   $11 = ((($0)) + 24|0);
   ;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[19800>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[19800+4>>2]|0;
   ;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[$11>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[$11+4>>2]|0;
   $12 = (+_Vector2Distance($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12));
   $13 = $12 < 0.029999999329447746;
   if ($13) {
    HEAP32[5100] = 2;
    HEAP32[5102] = 0;
   } else {
    label = 6;
   }
  } else {
   label = 6;
  }
  if ((label|0) == 6) {
   HEAP32[5102] = 1;
   HEAP32[5100] = 1;
  }
  $14 = ((($0)) + 24|0);
  $15 = $14;
  $16 = $15;
  $17 = HEAP32[$16>>2]|0;
  $18 = (($15) + 4)|0;
  $19 = $18;
  $20 = HEAP32[$19>>2]|0;
  $21 = 19800;
  $22 = $21;
  HEAP32[$22>>2] = $17;
  $23 = (($21) + 4)|0;
  $24 = $23;
  HEAP32[$24>>2] = $20;
  $25 = 19808;
  $26 = $25;
  HEAP32[$26>>2] = $17;
  $27 = (($25) + 4)|0;
  $28 = $27;
  HEAP32[$28>>2] = $20;
  $29 = 19816;
  $30 = $29;
  HEAP32[$30>>2] = $17;
  $31 = (($29) + 4)|0;
  $32 = $31;
  HEAP32[$32>>2] = $20;
  $33 = ((($0)) + 8|0);
  $34 = HEAP32[$33>>2]|0;
  HEAP32[12] = $34;
  HEAPF32[4956] = 0.0;
  HEAPF32[(19828)>>2] = 0.0;
  STACKTOP = sp;return;
 }
 switch ($4|0) {
 case 0:  {
  $35 = HEAP32[5100]|0;
  $36 = ($35|0)==(8);
  if ($36) {
   $37 = ((($0)) + 24|0);
   $38 = $37;
   $39 = $38;
   $40 = HEAP32[$39>>2]|0;
   $41 = (($38) + 4)|0;
   $42 = $41;
   $43 = HEAP32[$42>>2]|0;
   $44 = 19816;
   $45 = $44;
   HEAP32[$45>>2] = $40;
   $46 = (($44) + 4)|0;
   $47 = $46;
   HEAP32[$47>>2] = $43;
  }
  ;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[19800>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[19800+4>>2]|0;
  ;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[19816>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[19816+4>>2]|0;
  $48 = (+_Vector2Distance($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12));
  $49 = $48 / 0.0;
  HEAPF32[5103] = $49;
  HEAP32[5104] = 0;
  $50 = $49 > 5.0000002374872565E-4;
  if ($50) {
   $51 = HEAP32[12]|0;
   $52 = ((($0)) + 8|0);
   $53 = HEAP32[$52>>2]|0;
   $54 = ($51|0)==($53|0);
   if ($54) {
    ;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[19800>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[19800+4>>2]|0;
    ;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[19816>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[19816+4>>2]|0;
    $55 = (+_Vector2Angle($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12));
    $56 = 360.0 - $55;
    HEAPF32[5105] = $56;
    $57 = $56 < 30.0;
    $58 = $56 > 330.0;
    $or$cond3 = $57 | $58;
    if ($or$cond3) {
     $$sink10 = 16;
    } else {
     $59 = $56 > 30.0;
     $60 = $56 < 120.0;
     $or$cond5 = $59 & $60;
     if ($or$cond5) {
      $$sink10 = 64;
     } else {
      $61 = $56 > 120.0;
      $62 = $56 < 210.0;
      $or$cond7 = $61 & $62;
      $63 = $56 > 210.0;
      $64 = $56 < 300.0;
      $or$cond9 = $63 & $64;
      $$sink = $or$cond9 ? 128 : 0;
      $$$sink = $or$cond7 ? 32 : $$sink;
      $$sink10 = $$$sink;
     }
    }
   } else {
    label = 16;
   }
  } else {
   label = 16;
  }
  if ((label|0) == 16) {
   HEAPF32[5103] = 0.0;
   HEAPF32[5105] = 0.0;
   $$sink10 = 0;
  }
  HEAP32[5100] = $$sink10;
  HEAPF32[4952] = 0.0;
  HEAPF32[(19812)>>2] = 0.0;
  HEAP32[5101] = 0;
  STACKTOP = sp;return;
  break;
 }
 case 2:  {
  $65 = HEAP32[5104]|0;
  $66 = ($65|0)==(0);
  if ($66) {
   HEAP32[5104] = 1;
  }
  $67 = ((($0)) + 24|0);
  $68 = $67;
  $69 = $68;
  $70 = HEAP32[$69>>2]|0;
  $71 = (($68) + 4)|0;
  $72 = $71;
  $73 = HEAP32[$72>>2]|0;
  $74 = 19832;
  $75 = $74;
  HEAP32[$75>>2] = $70;
  $76 = (($74) + 4)|0;
  $77 = $76;
  HEAP32[$77>>2] = $73;
  $78 = HEAP32[5100]|0;
  $79 = ($78|0)==(4);
  if ($79) {
   ;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[19800>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[19800+4>>2]|0;
   ;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[19832>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[19832+4>>2]|0;
   $80 = (+_Vector2Distance($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12));
   $81 = !($80 >= 0.014999999664723873);
   if (!($81)) {
    HEAP32[5100] = 8;
   }
  }
  $82 = +HEAPF32[4958];
  $83 = +HEAPF32[4952];
  $84 = $82 - $83;
  HEAPF32[4956] = $84;
  $85 = +HEAPF32[(19836)>>2];
  $86 = +HEAPF32[(19812)>>2];
  $87 = $85 - $86;
  HEAPF32[(19828)>>2] = $87;
  STACKTOP = sp;return;
  break;
 }
 default: {
  STACKTOP = sp;return;
 }
 }
}
function _UpdateGestures() {
 var $$off = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $or$cond3 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $0 = HEAP32[5100]|0;
 $$off = (($0) + -1)|0;
 $1 = ($$off>>>0)<(2);
 $2 = HEAP32[5101]|0;
 $3 = ($2|0)<(2);
 $or$cond3 = $1 & $3;
 if ($or$cond3) {
  HEAP32[5100] = 4;
 }
 $4 = HEAP32[5100]|0;
 $5 = (($4) + -16)|0;
 $6 = $5 >>> 4;
 $7 = $5 << 28;
 $8 = $6 | $7;
 switch ($8|0) {
 case 0: case 1: case 3: case 7:  {
  break;
 }
 default: {
  return;
 }
 }
 HEAP32[5100] = 0;
 return;
}
function _GetMousePosition($0) {
 $0 = $0|0;
 var $1 = 0, $10 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = 19864;
 $2 = $1;
 $3 = HEAP32[$2>>2]|0;
 $4 = (($1) + 4)|0;
 $5 = $4;
 $6 = HEAP32[$5>>2]|0;
 $7 = $0;
 $8 = $7;
 HEAP32[$8>>2] = $3;
 $9 = (($7) + 4)|0;
 $10 = $9;
 HEAP32[$10>>2] = $6;
 return;
}
function _GetScreenWidth() {
 var $0 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $0 = HEAP32[5110]|0;
 return ($0|0);
}
function _GetScreenHeight() {
 var $0 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $0 = HEAP32[5109]|0;
 return ($0|0);
}
function _InitWindow($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $10 = 0, $3 = 0, $4 = 0.0, $5 = 0.0, $6 = 0, $7 = 0.0, $8 = 0.0, $9 = 0, $vararg_buffer = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $vararg_buffer = sp;
 _TraceLog(0,5121,$vararg_buffer);
 HEAP32[5112] = $2;
 _InitGraphicsDevice($0,$1);
 _LoadDefaultFont();
 _InitTimer();
 (_emscripten_set_fullscreenchange_callback((0|0),(0|0),1,(4|0))|0);
 (_emscripten_set_keypress_callback((5150|0),(0|0),1,(5|0))|0);
 (_emscripten_set_click_callback((5150|0),(0|0),1,(6|0))|0);
 (_emscripten_set_touchstart_callback((5150|0),(0|0),1,(7|0))|0);
 (_emscripten_set_touchend_callback((5150|0),(0|0),1,(7|0))|0);
 (_emscripten_set_touchmove_callback((5150|0),(0|0),1,(7|0))|0);
 (_emscripten_set_touchcancel_callback((5150|0),(0|0),1,(7|0))|0);
 (_emscripten_set_gamepadconnected_callback((0|0),1,(8|0))|0);
 (_emscripten_set_gamepaddisconnected_callback((0|0),1,(8|0))|0);
 $3 = HEAP32[5110]|0;
 $4 = (+($3|0));
 $5 = $4 * 0.5;
 HEAPF32[4966] = $5;
 $6 = HEAP32[5109]|0;
 $7 = (+($6|0));
 $8 = $7 * 0.5;
 HEAPF32[(19868)>>2] = $8;
 $9 = HEAP32[5113]|0;
 $10 = ($9|0)==(0);
 if ($10) {
  STACKTOP = sp;return;
 }
 _SetTargetFPS(60);
 _LogoAnimation();
 STACKTOP = sp;return;
}
function _TraceLog($0,$1,$varargs) {
 $0 = $0|0;
 $1 = $1|0;
 $varargs = $varargs|0;
 var $10 = 0, $11 = 0, $12 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $endptr = 0, $strlen = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $2 = sp;
 switch ($0|0) {
 case 0:  {
  ;HEAP8[19904>>0]=HEAP8[9679>>0]|0;HEAP8[19904+1>>0]=HEAP8[9679+1>>0]|0;HEAP8[19904+2>>0]=HEAP8[9679+2>>0]|0;HEAP8[19904+3>>0]=HEAP8[9679+3>>0]|0;HEAP8[19904+4>>0]=HEAP8[9679+4>>0]|0;HEAP8[19904+5>>0]=HEAP8[9679+5>>0]|0;HEAP8[19904+6>>0]=HEAP8[9679+6>>0]|0;
  break;
 }
 case 1:  {
  $3 = 19904;
  $4 = $3;
  HEAP32[$4>>2] = 1330795077;
  $5 = (($3) + 4)|0;
  $6 = $5;
  HEAP32[$6>>2] = 2112082;
  break;
 }
 case 2:  {
  dest=19904; src=9686; stop=dest+10|0; do { HEAP8[dest>>0]=HEAP8[src>>0]|0; dest=dest+1|0; src=src+1|0; } while ((dest|0) < (stop|0));
  break;
 }
 case 3:  {
  $7 = 19904;
  $8 = $7;
  HEAP32[$8>>2] = 1430406468;
  $9 = (($7) + 4)|0;
  $10 = $9;
  HEAP32[$10>>2] = 2112071;
  break;
 }
 default: {
 }
 }
 (_strcat(19904,$1)|0);
 $strlen = (_strlen(19904)|0);
 $endptr = (19904 + ($strlen)|0);
 HEAP8[$endptr>>0]=10&255;HEAP8[$endptr+1>>0]=10>>8;
 HEAP32[$2>>2] = $varargs;
 $11 = ($0|0)==(3);
 if ($11) {
  STACKTOP = sp;return;
 }
 (_vprintf(19904,$2)|0);
 $12 = ($0|0)==(1);
 if ($12) {
  _exit(1);
  // unreachable;
 } else {
  STACKTOP = sp;return;
 }
}
function _InitGraphicsDevice($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$015 = 0, $$byval_copy = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
 var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
 var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0;
 var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0.0, $79 = 0, $8 = 0, $80 = 0;
 var $81 = 0, $82 = 0.0, $83 = 0, $84 = 0, $85 = 0, $9 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer10 = 0, $vararg_buffer14 = 0, $vararg_buffer18 = 0, $vararg_buffer22 = 0, $vararg_buffer3 = 0, $vararg_buffer6 = 0, $vararg_buffer8 = 0, $vararg_ptr13 = 0, $vararg_ptr17 = 0, $vararg_ptr21 = 0, $vararg_ptr5 = 0, dest = 0;
 var label = 0, sp = 0, src = 0, stop = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 144|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(144|0);
 $$byval_copy = sp + 136|0;
 $vararg_buffer22 = sp + 64|0;
 $vararg_buffer18 = sp + 56|0;
 $vararg_buffer14 = sp + 48|0;
 $vararg_buffer10 = sp + 40|0;
 $vararg_buffer8 = sp + 32|0;
 $vararg_buffer6 = sp + 24|0;
 $vararg_buffer3 = sp + 16|0;
 $vararg_buffer1 = sp + 8|0;
 $vararg_buffer = sp;
 $2 = sp + 72|0;
 $3 = sp + 140|0;
 HEAP32[5110] = $0;
 HEAP32[5109] = $1;
 _MatrixIdentity($2);
 dest=20528; src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
 (_glfwSetErrorCallback((2|0))|0);
 $4 = (_glfwInit()|0);
 $5 = ($4|0)==(0);
 if ($5) {
  _TraceLog(1,5821,$vararg_buffer);
 }
 $6 = HEAP32[5110]|0;
 HEAP32[5148] = $6;
 $7 = HEAP32[5109]|0;
 HEAP32[5149] = $7;
 _glfwDefaultWindowHints();
 $8 = HEAP8[23264]|0;
 $9 = $8 & 4;
 $10 = ($9<<24>>24)==(0);
 if ($10) {
  _glfwWindowHint(131075,0);
 } else {
  _glfwWindowHint(131075,1);
 }
 $11 = HEAP8[23264]|0;
 $12 = $11 & 8;
 $13 = ($12<<24>>24)==(0);
 if (!($13)) {
  _glfwWindowHint(131077,1);
 }
 $14 = HEAP8[23264]|0;
 $15 = $14 & 32;
 $16 = ($15<<24>>24)==(0);
 if (!($16)) {
  _glfwWindowHint(135181,4);
  _TraceLog(0,5847,$vararg_buffer1);
 }
 $17 = (_rlGetVersion()|0);
 $18 = ($17|0)==(2);
 if ($18) {
  _glfwWindowHint(139266,2);
  _glfwWindowHint(139267,1);
 } else {
  $19 = (_rlGetVersion()|0);
  $20 = ($19|0)==(3);
  if ($20) {
   _glfwWindowHint(139266,3);
   _glfwWindowHint(139267,3);
   _glfwWindowHint(139272,204801);
   _glfwWindowHint(139270,0);
  }
 }
 $21 = HEAP32[5150]|0;
 $22 = ($21|0)==(0);
 if ($22) {
  $47 = HEAP32[5110]|0;
  $48 = HEAP32[5109]|0;
  $49 = HEAP32[5112]|0;
  $50 = (_glfwCreateWindow(($47|0),($48|0),($49|0),(0|0),(0|0))|0);
  HEAP32[5108] = $50;
  $51 = HEAP32[5110]|0;
  HEAP32[5151] = $51;
  $52 = HEAP32[5109]|0;
  HEAP32[5152] = $52;
  $54 = $50;
 } else {
  $23 = (_glfwGetPrimaryMonitor()|0);
  $24 = (_glfwGetVideoModes(($23|0),($$byval_copy|0))|0);
  $25 = HEAP32[$$byval_copy>>2]|0;
  $26 = ($25|0)>(0);
  L22: do {
   if ($26) {
    $27 = HEAP32[5110]|0;
    $28 = HEAP32[$$byval_copy>>2]|0;
    $29 = HEAP32[5109]|0;
    $$015 = 0;
    while(1) {
     $30 = (($24) + (($$015*24)|0)|0);
     $31 = HEAP32[$30>>2]|0;
     $32 = ($31|0)<($27|0);
     if (!($32)) {
      $33 = (((($24) + (($$015*24)|0)|0)) + 4|0);
      $34 = HEAP32[$33>>2]|0;
      $35 = ($34|0)<($29|0);
      if (!($35)) {
       break;
      }
     }
     $36 = (($$015) + 1)|0;
     $37 = ($36|0)<($28|0);
     if ($37) {
      $$015 = $36;
     } else {
      break L22;
     }
    }
    HEAP32[5148] = $31;
    HEAP32[5149] = $34;
   }
  } while(0);
  $38 = HEAP32[5148]|0;
  $39 = HEAP32[5149]|0;
  HEAP32[$vararg_buffer3>>2] = $38;
  $vararg_ptr5 = ((($vararg_buffer3)) + 4|0);
  HEAP32[$vararg_ptr5>>2] = $39;
  _TraceLog(2,5872,$vararg_buffer3);
  $40 = HEAP32[5148]|0;
  $41 = HEAP32[5149]|0;
  _SetupFramebufferSize($40,$41);
  $42 = HEAP32[5148]|0;
  $43 = HEAP32[5149]|0;
  $44 = HEAP32[5112]|0;
  $45 = (_glfwGetPrimaryMonitor()|0);
  $46 = (_glfwCreateWindow(($42|0),($43|0),($44|0),($45|0),(0|0))|0);
  HEAP32[5108] = $46;
  $54 = $46;
 }
 $53 = ($54|0)==(0|0);
 if ($53) {
  _glfwTerminate();
  _TraceLog(1,5910,$vararg_buffer6);
 } else {
  _TraceLog(0,5943,$vararg_buffer8);
  $55 = HEAP32[5151]|0;
  $56 = HEAP32[5152]|0;
  HEAP32[$vararg_buffer10>>2] = $55;
  $vararg_ptr13 = ((($vararg_buffer10)) + 4|0);
  HEAP32[$vararg_ptr13>>2] = $56;
  _TraceLog(0,5983,$vararg_buffer10);
  $57 = HEAP32[5110]|0;
  $58 = HEAP32[5109]|0;
  HEAP32[$vararg_buffer14>>2] = $57;
  $vararg_ptr17 = ((($vararg_buffer14)) + 4|0);
  HEAP32[$vararg_ptr17>>2] = $58;
  _TraceLog(0,6004,$vararg_buffer14);
  $59 = HEAP32[5153]|0;
  $60 = HEAP32[5154]|0;
  HEAP32[$vararg_buffer18>>2] = $59;
  $vararg_ptr21 = ((($vararg_buffer18)) + 4|0);
  HEAP32[$vararg_ptr21>>2] = $60;
  _TraceLog(0,6025,$vararg_buffer18);
 }
 $61 = HEAP32[5108]|0;
 (_glfwSetWindowSizeCallback(($61|0),(1|0))|0);
 $62 = HEAP32[5108]|0;
 (_glfwSetCursorEnterCallback(($62|0),(3|0))|0);
 $63 = HEAP32[5108]|0;
 (_glfwSetKeyCallback(($63|0),(1|0))|0);
 $64 = HEAP32[5108]|0;
 (_glfwSetMouseButtonCallback(($64|0),(1|0))|0);
 $65 = HEAP32[5108]|0;
 (_glfwSetCursorPosCallback(($65|0),(1|0))|0);
 $66 = HEAP32[5108]|0;
 (_glfwSetCharCallback(($66|0),(4|0))|0);
 $67 = HEAP32[5108]|0;
 (_glfwSetScrollCallback(($67|0),(2|0))|0);
 $68 = HEAP32[5108]|0;
 (_glfwSetWindowIconifyCallback(($68|0),(5|0))|0);
 $69 = HEAP32[5108]|0;
 _glfwMakeContextCurrent(($69|0));
 _glfwSwapInterval(0);
 $70 = HEAP8[23264]|0;
 $71 = $70 & 64;
 $72 = ($71<<24>>24)==(0);
 if ($72) {
  $73 = HEAP32[5110]|0;
  $74 = HEAP32[5109]|0;
  _rlglInit($73,$74);
  _SetupViewport();
  _rlMatrixMode(5889);
  _rlLoadIdentity();
  $75 = HEAP32[5151]|0;
  $76 = HEAP32[5153]|0;
  $77 = (($75) - ($76))|0;
  $78 = (+($77|0));
  $79 = HEAP32[5152]|0;
  $80 = HEAP32[5154]|0;
  $81 = (($79) - ($80))|0;
  $82 = (+($81|0));
  _rlOrtho(0.0,$78,$82,0.0,0.0,1.0);
  _rlMatrixMode(5888);
  _rlLoadIdentity();
  HEAP8[$3>>0] = -11;
  $83 = ((($3)) + 1|0);
  HEAP8[$83>>0] = -11;
  $84 = ((($3)) + 2|0);
  HEAP8[$84>>0] = -11;
  $85 = ((($3)) + 3|0);
  HEAP8[$85>>0] = -1;
  ;HEAP8[$$byval_copy>>0]=HEAP8[$3>>0]|0;HEAP8[$$byval_copy+1>>0]=HEAP8[$3+1>>0]|0;HEAP8[$$byval_copy+2>>0]=HEAP8[$3+2>>0]|0;HEAP8[$$byval_copy+3>>0]=HEAP8[$3+3>>0]|0;
  _ClearBackground($$byval_copy);
  STACKTOP = sp;return;
 }
 _glfwSwapInterval(1);
 _TraceLog(0,6050,$vararg_buffer22);
 $73 = HEAP32[5110]|0;
 $74 = HEAP32[5109]|0;
 _rlglInit($73,$74);
 _SetupViewport();
 _rlMatrixMode(5889);
 _rlLoadIdentity();
 $75 = HEAP32[5151]|0;
 $76 = HEAP32[5153]|0;
 $77 = (($75) - ($76))|0;
 $78 = (+($77|0));
 $79 = HEAP32[5152]|0;
 $80 = HEAP32[5154]|0;
 $81 = (($79) - ($80))|0;
 $82 = (+($81|0));
 _rlOrtho(0.0,$78,$82,0.0,0.0,1.0);
 _rlMatrixMode(5888);
 _rlLoadIdentity();
 HEAP8[$3>>0] = -11;
 $83 = ((($3)) + 1|0);
 HEAP8[$83>>0] = -11;
 $84 = ((($3)) + 2|0);
 HEAP8[$84>>0] = -11;
 $85 = ((($3)) + 3|0);
 HEAP8[$85>>0] = -1;
 ;HEAP8[$$byval_copy>>0]=HEAP8[$3>>0]|0;HEAP8[$$byval_copy+1>>0]=HEAP8[$3+1>>0]|0;HEAP8[$$byval_copy+2>>0]=HEAP8[$3+2>>0]|0;HEAP8[$$byval_copy+3>>0]=HEAP8[$3+3>>0]|0;
 _ClearBackground($$byval_copy);
 STACKTOP = sp;return;
}
function _LoadDefaultFont() {
 var $$ = 0, $$0101 = 0, $$090100 = 0, $$09299 = 0, $$095104 = 0, $$096103 = 0, $$097102 = 0, $$191 = 0, $$193 = 0, $$byval_copy1 = 0, $$lcssa = 0, $$sroa$0$0$$sroa_idx = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0;
 var $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0;
 var $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0;
 var $vararg_buffer = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(64|0);
 $$byval_copy1 = sp + 44|0;
 $vararg_buffer = sp;
 $0 = sp + 4|0;
 $1 = sp + 24|0;
 HEAP32[(20496)>>2] = 224;
 $2 = (_malloc(65536)|0);
 _memset(($2|0),0,65536)|0;
 $$095104 = 0;$$096103 = 0;
 while(1) {
  $3 = (52 + ($$095104<<2)|0);
  $4 = HEAP32[$3>>2]|0;
  $$097102 = 31;
  while(1) {
   $16 = 1 << $$097102;
   $17 = $4 & $16;
   $18 = ($17|0)==(0);
   if (!($18)) {
    $19 = (($$097102) + ($$096103))|0;
    $$sroa$0$0$$sroa_idx = (($2) + ($19<<2)|0);
    HEAP8[$$sroa$0$0$$sroa_idx>>0]=-1&255;HEAP8[$$sroa$0$0$$sroa_idx+1>>0]=(-1>>8)&255;HEAP8[$$sroa$0$0$$sroa_idx+2>>0]=(-1>>16)&255;HEAP8[$$sroa$0$0$$sroa_idx+3>>0]=-1>>24;
   }
   $20 = (($$097102) + -1)|0;
   $21 = ($$097102|0)>(0);
   if ($21) {
    $$097102 = $20;
   } else {
    break;
   }
  }
  $12 = (($$095104) + 1)|0;
  $13 = ($$095104|0)>(511);
  $$ = $13 ? 0 : $12;
  $14 = (($$096103) + 32)|0;
  $15 = ($14|0)<(16384);
  if ($15) {
   $$095104 = $$;$$096103 = $14;
  } else {
   break;
  }
 }
 _LoadImageEx($0,$2,128,128);
 _ImageFormat($0,2);
 _free($2);
 ;HEAP32[$$byval_copy1>>2]=HEAP32[$0>>2]|0;HEAP32[$$byval_copy1+4>>2]=HEAP32[$0+4>>2]|0;HEAP32[$$byval_copy1+8>>2]=HEAP32[$0+8>>2]|0;HEAP32[$$byval_copy1+12>>2]=HEAP32[$0+12>>2]|0;HEAP32[$$byval_copy1+16>>2]=HEAP32[$0+16>>2]|0;
 _LoadTextureFromImage($1,$$byval_copy1);
 ;HEAP32[20472>>2]=HEAP32[$1>>2]|0;HEAP32[20472+4>>2]=HEAP32[$1+4>>2]|0;HEAP32[20472+8>>2]=HEAP32[$1+8>>2]|0;HEAP32[20472+12>>2]=HEAP32[$1+12>>2]|0;HEAP32[20472+16>>2]=HEAP32[$1+16>>2]|0;
 ;HEAP32[$$byval_copy1>>2]=HEAP32[$0>>2]|0;HEAP32[$$byval_copy1+4>>2]=HEAP32[$0+4>>2]|0;HEAP32[$$byval_copy1+8>>2]=HEAP32[$0+8>>2]|0;HEAP32[$$byval_copy1+12>>2]=HEAP32[$0+12>>2]|0;HEAP32[$$byval_copy1+16>>2]=HEAP32[$0+16>>2]|0;
 _UnloadImage($$byval_copy1);
 $5 = HEAP32[(20496)>>2]|0;
 $6 = $5 << 5;
 $7 = (_malloc($6)|0);
 HEAP32[(20500)>>2] = $7;
 $8 = ($5|0)>(0);
 if (!($8)) {
  $$lcssa = $7;
  $22 = ((($$lcssa)) + 16|0);
  $23 = HEAP32[$22>>2]|0;
  HEAP32[(20492)>>2] = $23;
  $24 = HEAP32[5118]|0;
  HEAP32[$vararg_buffer>>2] = $24;
  _TraceLog(0,5345,$vararg_buffer);
  STACKTOP = sp;return;
 }
 $9 = HEAP32[(20476)>>2]|0;
 $10 = HEAP32[(20496)>>2]|0;
 $11 = HEAP32[(20500)>>2]|0;
 $$0101 = 0;$$090100 = 1;$$09299 = 0;$27 = $7;
 while(1) {
  $25 = (($$0101) + 32)|0;
  $26 = (($27) + ($$0101<<5)|0);
  HEAP32[$26>>2] = $25;
  $28 = (((($27) + ($$0101<<5)|0)) + 4|0);
  HEAP32[$28>>2] = $$090100;
  $29 = ($$09299*11)|0;
  $30 = (($29) + 1)|0;
  $31 = (((($27) + ($$0101<<5)|0)) + 8|0);
  HEAP32[$31>>2] = $30;
  $32 = (2100 + ($$0101<<2)|0);
  $33 = HEAP32[$32>>2]|0;
  $34 = (((($27) + ($$0101<<5)|0)) + 12|0);
  HEAP32[$34>>2] = $33;
  $35 = (((($27) + ($$0101<<5)|0)) + 16|0);
  HEAP32[$35>>2] = 10;
  $36 = (($$090100) + 1)|0;
  $37 = (($36) + ($33))|0;
  $38 = ($37|0)<($9|0);
  $39 = (($$09299) + 1)|0;
  if ($38) {
   $$191 = $37;$$193 = $$09299;
  } else {
   $40 = ($39*11)|0;
   $41 = (($40) + 1)|0;
   $42 = (($33) + 2)|0;
   HEAP32[$28>>2] = 1;
   HEAP32[$31>>2] = $41;
   $$191 = $42;$$193 = $39;
  }
  $43 = (((($27) + ($$0101<<5)|0)) + 20|0);
  HEAP32[$43>>2] = 0;
  $44 = (((($27) + ($$0101<<5)|0)) + 24|0);
  HEAP32[$44>>2] = 0;
  $45 = (((($27) + ($$0101<<5)|0)) + 28|0);
  HEAP32[$45>>2] = 0;
  $46 = (($$0101) + 1)|0;
  $47 = ($46|0)<($10|0);
  if ($47) {
   $$0101 = $46;$$090100 = $$191;$$09299 = $$193;$27 = $11;
  } else {
   $$lcssa = $11;
   break;
  }
 }
 $22 = ((($$lcssa)) + 16|0);
 $23 = HEAP32[$22>>2]|0;
 HEAP32[(20492)>>2] = $23;
 $24 = HEAP32[5118]|0;
 HEAP32[$vararg_buffer>>2] = $24;
 _TraceLog(0,5345,$vararg_buffer);
 STACKTOP = sp;return;
}
function _InitTimer() {
 var $0 = 0, $1 = 0.0, label = 0, sp = 0;
 sp = STACKTOP;
 $0 = (_time((0|0))|0);
 _srand($0);
 $1 = (+_GetTime());
 HEAPF64[2487] = $1;
 return;
}
function _EmscriptenFullscreenChangeCallback($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $10 = 0, $11 = 0, $12 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_buffer4 = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, $vararg_ptr3 = 0, $vararg_ptr7 = 0, $vararg_ptr8 = 0, $vararg_ptr9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
 $vararg_buffer4 = sp + 16|0;
 $vararg_buffer = sp;
 $3 = HEAP32[$1>>2]|0;
 $4 = ($3|0)==(0);
 $5 = ((($1)) + 264|0);
 $6 = HEAP32[$5>>2]|0;
 $7 = ((($1)) + 268|0);
 $8 = HEAP32[$7>>2]|0;
 $9 = ((($1)) + 272|0);
 $10 = HEAP32[$9>>2]|0;
 $11 = ((($1)) + 276|0);
 $12 = HEAP32[$11>>2]|0;
 if ($4) {
  HEAP32[$vararg_buffer4>>2] = $6;
  $vararg_ptr7 = ((($vararg_buffer4)) + 4|0);
  HEAP32[$vararg_ptr7>>2] = $8;
  $vararg_ptr8 = ((($vararg_buffer4)) + 8|0);
  HEAP32[$vararg_ptr8>>2] = $10;
  $vararg_ptr9 = ((($vararg_buffer4)) + 12|0);
  HEAP32[$vararg_ptr9>>2] = $12;
  _TraceLog(0,5278,$vararg_buffer4);
  STACKTOP = sp;return 0;
 } else {
  HEAP32[$vararg_buffer>>2] = $6;
  $vararg_ptr1 = ((($vararg_buffer)) + 4|0);
  HEAP32[$vararg_ptr1>>2] = $8;
  $vararg_ptr2 = ((($vararg_buffer)) + 8|0);
  HEAP32[$vararg_ptr2>>2] = $10;
  $vararg_ptr3 = ((($vararg_buffer)) + 12|0);
  HEAP32[$vararg_ptr3>>2] = $12;
  _TraceLog(0,5209,$vararg_buffer);
  STACKTOP = sp;return 0;
 }
 return (0)|0;
}
function _EmscriptenKeyboardCallback($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $3 = 0, $4 = 0, $5 = 0, $6 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $3 = ($0|0)==(1);
 if (!($3)) {
  return 0;
 }
 $4 = ((($1)) + 32|0);
 $5 = (_strcmp($4,5202)|0);
 $6 = ($5|0)==(0);
 if (!($6)) {
  return 0;
 }
 (_emscripten_exit_pointerlock()|0);
 return 0;
}
function _EmscriptenMouseCallback($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $3 = 0, $4 = 0, $5 = 0, $6 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 272|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(272|0);
 $3 = sp;
 $4 = ($0|0)==(4);
 if (!($4)) {
  STACKTOP = sp;return 0;
 }
 (_emscripten_get_pointerlock_status(($3|0))|0);
 $5 = HEAP32[$3>>2]|0;
 $6 = ($5|0)==(0);
 if ($6) {
  (_emscripten_request_pointerlock((0|0),1)|0);
 } else {
  (_emscripten_exit_pointerlock()|0);
  (_emscripten_get_pointerlock_status(($3|0))|0);
 }
 STACKTOP = sp;return 0;
}
function _EmscriptenTouchCallback($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $$byval_copy = 0, $$sink = 0, $$sroa$0$0$$sroa_idx = 0, $$sroa$03$0$$sroa_idx = 0, $$sroa$2$0$$sroa_idx2 = 0, $$sroa$24$0$$sroa_idx5 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0.0, $15 = 0, $16 = 0, $17 = 0.0, $18 = 0, $19 = 0, $20 = 0.0, $21 = 0, $22 = 0, $23 = 0.0;
 var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0;
 var $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0.0, $48 = 0.0, $49 = 0.0, $5 = 0, $50 = 0, $51 = 0.0, $52 = 0.0, $53 = 0.0, $54 = 0, $55 = 0.0, $56 = 0.0, $57 = 0.0, $58 = 0, $59 = 0.0, $6 = 0;
 var $60 = 0.0, $61 = 0.0, $7 = 0, $8 = 0, $9 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 112|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(112|0);
 $$byval_copy = sp + 56|0;
 $3 = sp;
 switch ($0|0) {
 case 22:  {
  $$sink = 1;
  label = 4;
  break;
 }
 case 23:  {
  $$sink = 0;
  label = 4;
  break;
 }
 case 24:  {
  $$sink = 2;
  label = 4;
  break;
 }
 default: {
 }
 }
 if ((label|0) == 4) {
  HEAP32[$3>>2] = $$sink;
 }
 $4 = HEAP32[$1>>2]|0;
 $5 = ((($3)) + 4|0);
 HEAP32[$5>>2] = $4;
 $6 = ((($1)) + 20|0);
 $7 = HEAP32[$6>>2]|0;
 $8 = ((($3)) + 8|0);
 HEAP32[$8>>2] = $7;
 $9 = ((($1)) + 72|0);
 $10 = HEAP32[$9>>2]|0;
 $11 = ((($3)) + 12|0);
 HEAP32[$11>>2] = $10;
 $12 = ((($1)) + 56|0);
 $13 = HEAP32[$12>>2]|0;
 $14 = (+($13|0));
 $15 = ((($1)) + 60|0);
 $16 = HEAP32[$15>>2]|0;
 $17 = (+($16|0));
 $$sroa$03$0$$sroa_idx = ((($3)) + 24|0);
 HEAPF32[$$sroa$03$0$$sroa_idx>>2] = $14;
 $$sroa$24$0$$sroa_idx5 = ((($3)) + 28|0);
 HEAPF32[$$sroa$24$0$$sroa_idx5>>2] = $17;
 $18 = ((($1)) + 108|0);
 $19 = HEAP32[$18>>2]|0;
 $20 = (+($19|0));
 $21 = ((($1)) + 112|0);
 $22 = HEAP32[$21>>2]|0;
 $23 = (+($22|0));
 $$sroa$0$0$$sroa_idx = ((($3)) + 32|0);
 HEAPF32[$$sroa$0$0$$sroa_idx>>2] = $20;
 $$sroa$2$0$$sroa_idx2 = ((($3)) + 36|0);
 HEAPF32[$$sroa$2$0$$sroa_idx2>>2] = $23;
 $24 = ((($3)) + 24|0);
 $25 = $24;
 $26 = $25;
 $27 = HEAP32[$26>>2]|0;
 $28 = (($25) + 4)|0;
 $29 = $28;
 $30 = HEAP32[$29>>2]|0;
 $31 = 19880;
 $32 = $31;
 HEAP32[$32>>2] = $27;
 $33 = (($31) + 4)|0;
 $34 = $33;
 HEAP32[$34>>2] = $30;
 $35 = ((($3)) + 32|0);
 $36 = $35;
 $37 = $36;
 $38 = HEAP32[$37>>2]|0;
 $39 = (($36) + 4)|0;
 $40 = $39;
 $41 = HEAP32[$40>>2]|0;
 $42 = (19888);
 $43 = $42;
 HEAP32[$43>>2] = $38;
 $44 = (($42) + 4)|0;
 $45 = $44;
 HEAP32[$45>>2] = $41;
 $46 = (_GetScreenWidth()|0);
 $47 = (+($46|0));
 $48 = +HEAPF32[$24>>2];
 $49 = $48 / $47;
 HEAPF32[$24>>2] = $49;
 $50 = (_GetScreenHeight()|0);
 $51 = (+($50|0));
 $52 = +HEAPF32[$$sroa$24$0$$sroa_idx5>>2];
 $53 = $52 / $51;
 HEAPF32[$$sroa$24$0$$sroa_idx5>>2] = $53;
 $54 = (_GetScreenWidth()|0);
 $55 = (+($54|0));
 $56 = +HEAPF32[$35>>2];
 $57 = $56 / $55;
 HEAPF32[$35>>2] = $57;
 $58 = (_GetScreenHeight()|0);
 $59 = (+($58|0));
 $60 = +HEAPF32[$$sroa$2$0$$sroa_idx2>>2];
 $61 = $60 / $59;
 HEAPF32[$$sroa$2$0$$sroa_idx2>>2] = $61;
 dest=$$byval_copy; src=$3; stop=dest+56|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
 _ProcessGestureEvent($$byval_copy);
 STACKTOP = sp;return 1;
}
function _EmscriptenGamepadCallback($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $$sink = 0, $10 = 0, $11 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $3 = ((($1)) + 1296|0);
 $4 = HEAP32[$3>>2]|0;
 $5 = ($4|0)==(0);
 if ($5) {
  label = 3;
 } else {
  $6 = ((($1)) + 1300|0);
  $7 = HEAP32[$6>>2]|0;
  $8 = ($7|0)<(4);
  if ($8) {
   $$sink = 1;
  } else {
   label = 3;
  }
 }
 if ((label|0) == 3) {
  $$sink = 0;
 }
 $9 = ((($1)) + 1300|0);
 $10 = HEAP32[$9>>2]|0;
 $11 = (20456 + ($10<<2)|0);
 HEAP32[$11>>2] = $$sink;
 return 0;
}
function _SetTargetFPS($0) {
 $0 = $0|0;
 var $$ = 0.0, $$op = 0.0, $1 = 0, $2 = 0.0, $3 = 0.0, $4 = 0.0, $5 = 0.0, $6 = 0.0, $vararg_buffer = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $vararg_buffer = sp;
 $1 = ($0|0)<(1);
 $2 = (+($0|0));
 $3 = 1.0 / $2;
 $$ = $1 ? 0.0 : $3;
 HEAPF64[2484] = $$;
 $4 = $3;
 $$op = $4 * 1000.0;
 $5 = $$op;
 $6 = $1 ? 0.0 : $5;
 HEAPF64[$vararg_buffer>>3] = $6;
 _TraceLog(0,5158,$vararg_buffer);
 STACKTOP = sp;return;
}
function _LogoAnimation() {
 var label = 0, sp = 0;
 sp = STACKTOP;
 HEAP32[5113] = 0;
 return;
}
function _GetTime() {
 var $0 = 0.0, label = 0, sp = 0;
 sp = STACKTOP;
 $0 = (+_glfwGetTime());
 return (+$0);
}
function _LoadImageEx($0,$1,$2,$3) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 var $$03334 = 0, $$035 = 0, $$sroa$12$0$$sroa_idx21 = 0, $$sroa$15$0$$sroa_idx24 = 0, $$sroa$16$0$$sroa_idx26 = 0, $$sroa$9$0$$sroa_idx18 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0;
 var $24 = 0, $25 = 0, $26 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $4 = $2 << 2;
 $5 = Math_imul($4, $3)|0;
 $6 = (_malloc($5)|0);
 $7 = ($5|0)>(0);
 if ($7) {
  $8 = (($5) + -1)|0;
  $9 = $8 >>> 2;
  $$03334 = 0;$$035 = 0;
  while(1) {
   $10 = (($1) + ($$03334<<2)|0);
   $11 = HEAP8[$10>>0]|0;
   $12 = (($6) + ($$035)|0);
   HEAP8[$12>>0] = $11;
   $13 = (((($1) + ($$03334<<2)|0)) + 1|0);
   $14 = HEAP8[$13>>0]|0;
   $15 = $$035 | 1;
   $16 = (($6) + ($15)|0);
   HEAP8[$16>>0] = $14;
   $17 = (((($1) + ($$03334<<2)|0)) + 2|0);
   $18 = HEAP8[$17>>0]|0;
   $19 = $$035 | 2;
   $20 = (($6) + ($19)|0);
   HEAP8[$20>>0] = $18;
   $21 = (((($1) + ($$03334<<2)|0)) + 3|0);
   $22 = HEAP8[$21>>0]|0;
   $23 = $$035 | 3;
   $24 = (($6) + ($23)|0);
   HEAP8[$24>>0] = $22;
   $25 = (($$03334) + 1)|0;
   $26 = (($$035) + 4)|0;
   $exitcond = ($$03334|0)==($9|0);
   if ($exitcond) {
    break;
   } else {
    $$03334 = $25;$$035 = $26;
   }
  }
 }
 HEAP32[$0>>2] = $6;
 $$sroa$9$0$$sroa_idx18 = ((($0)) + 4|0);
 HEAP32[$$sroa$9$0$$sroa_idx18>>2] = $2;
 $$sroa$12$0$$sroa_idx21 = ((($0)) + 8|0);
 HEAP32[$$sroa$12$0$$sroa_idx21>>2] = $3;
 $$sroa$15$0$$sroa_idx24 = ((($0)) + 12|0);
 HEAP32[$$sroa$15$0$$sroa_idx24>>2] = 1;
 $$sroa$16$0$$sroa_idx26 = ((($0)) + 16|0);
 HEAP32[$$sroa$16$0$$sroa_idx26>>2] = 7;
 return;
}
function _ImageFormat($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$0166199 = 0, $$0167197 = 0, $$0168195 = 0, $$0169192 = 0, $$0170190 = 0, $$0171188 = 0, $$0172189 = 0, $$0202 = 0, $$1194 = 0, $$2201 = 0, $$byval_copy = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0.0, $103 = 0.0, $104 = 0.0, $105 = 0, $106 = 0, $107 = 0;
 var $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0;
 var $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0;
 var $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0;
 var $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0.0, $17 = 0, $170 = 0.0, $171 = 0.0, $172 = 0, $173 = 0, $174 = 0, $175 = 0.0, $176 = 0.0, $177 = 0.0, $178 = 0, $179 = 0, $18 = 0;
 var $180 = 0, $181 = 0.0, $182 = 0.0, $183 = 0.0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0.0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0;
 var $199 = 0, $2 = 0, $20 = 0.0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0;
 var $216 = 0, $217 = 0, $218 = 0.0, $219 = 0.0, $22 = 0, $220 = 0.0, $221 = 0, $222 = 0, $223 = 0, $224 = 0.0, $225 = 0.0, $226 = 0.0, $227 = 0, $228 = 0, $229 = 0, $23 = 0.0, $230 = 0.0, $231 = 0.0, $232 = 0.0, $233 = 0;
 var $234 = 0, $235 = 0, $236 = 0.0, $237 = 0.0, $238 = 0.0, $239 = 0, $24 = 0.0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0.0, $250 = 0, $251 = 0;
 var $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0;
 var $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0.0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0;
 var $289 = 0, $29 = 0.0, $290 = 0, $3 = 0, $30 = 0.0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
 var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0.0, $53 = 0.0, $54 = 0, $55 = 0, $56 = 0.0, $57 = 0.0, $58 = 0.0, $59 = 0, $6 = 0, $60 = 0, $61 = 0.0, $62 = 0.0;
 var $63 = 0.0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0;
 var $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0.0, $91 = 0.0, $92 = 0.0, $93 = 0, $94 = 0, $95 = 0, $96 = 0.0, $97 = 0.0, $98 = 0.0, $99 = 0;
 var $or$cond = 0, $roundf = 0.0, $roundf173 = 0.0, $roundf174 = 0.0, $roundf175 = 0.0, $roundf176 = 0.0, $roundf177 = 0.0, $roundf178 = 0.0, $roundf179 = 0.0, $roundf180 = 0.0, $roundf181 = 0.0, $vararg_buffer = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
 $$byval_copy = sp + 4|0;
 $vararg_buffer = sp;
 $2 = ((($0)) + 16|0);
 $3 = HEAP32[$2>>2]|0;
 $4 = ($3|0)==($1|0);
 if ($4) {
  STACKTOP = sp;return;
 }
 $5 = ($3|0)<(8);
 $6 = ($1|0)<(8);
 $or$cond = $6 & $5;
 if (!($or$cond)) {
  _TraceLog(2,5721,$vararg_buffer);
  STACKTOP = sp;return;
 }
 ;HEAP32[$$byval_copy>>2]=HEAP32[$0>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$0+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[$0+8>>2]|0;HEAP32[$$byval_copy+12>>2]=HEAP32[$0+12>>2]|0;HEAP32[$$byval_copy+16>>2]=HEAP32[$0+16>>2]|0;
 $7 = (_GetImageData($$byval_copy)|0);
 $8 = HEAP32[$0>>2]|0;
 _free($8);
 HEAP32[$2>>2] = $1;
 switch ($1|0) {
 case 1:  {
  $9 = ((($0)) + 4|0);
  $10 = HEAP32[$9>>2]|0;
  $11 = ((($0)) + 8|0);
  $12 = HEAP32[$11>>2]|0;
  $13 = Math_imul($12, $10)|0;
  $14 = (_malloc($13)|0);
  HEAP32[$0>>2] = $14;
  $15 = Math_imul($12, $10)|0;
  $16 = ($15|0)>(0);
  if ($16) {
   $$0171188 = 0;
   while(1) {
    $17 = (($7) + ($$0171188<<2)|0);
    $18 = HEAP8[$17>>0]|0;
    $19 = (+($18&255));
    $20 = $19 * 0.29899999499320984;
    $21 = (((($7) + ($$0171188<<2)|0)) + 1|0);
    $22 = HEAP8[$21>>0]|0;
    $23 = (+($22&255));
    $24 = $23 * 0.58700001239776611;
    $25 = $20 + $24;
    $26 = (((($7) + ($$0171188<<2)|0)) + 2|0);
    $27 = HEAP8[$26>>0]|0;
    $28 = (+($27&255));
    $29 = $28 * 0.11400000005960464;
    $30 = $25 + $29;
    $31 = (~~(($30))&255);
    $32 = HEAP32[$0>>2]|0;
    $33 = (($32) + ($$0171188)|0);
    HEAP8[$33>>0] = $31;
    $34 = (($$0171188) + 1)|0;
    $35 = HEAP32[$9>>2]|0;
    $36 = HEAP32[$11>>2]|0;
    $37 = Math_imul($36, $35)|0;
    $38 = ($34|0)<($37|0);
    if ($38) {
     $$0171188 = $34;
    } else {
     break;
    }
   }
  }
  break;
 }
 case 2:  {
  $39 = ((($0)) + 4|0);
  $40 = HEAP32[$39>>2]|0;
  $41 = ((($0)) + 8|0);
  $42 = HEAP32[$41>>2]|0;
  $43 = $40 << 1;
  $44 = Math_imul($43, $42)|0;
  $45 = (_malloc($44)|0);
  HEAP32[$0>>2] = $45;
  $46 = HEAP32[$39>>2]|0;
  $47 = $46 << 1;
  $48 = Math_imul($47, $42)|0;
  $49 = ($48|0)>(0);
  if ($49) {
   $$0170190 = 0;$$0172189 = 0;
   while(1) {
    $50 = (($7) + ($$0172189<<2)|0);
    $51 = HEAP8[$50>>0]|0;
    $52 = (+($51&255));
    $53 = $52 * 0.29899999499320984;
    $54 = (((($7) + ($$0172189<<2)|0)) + 1|0);
    $55 = HEAP8[$54>>0]|0;
    $56 = (+($55&255));
    $57 = $56 * 0.58700001239776611;
    $58 = $53 + $57;
    $59 = (((($7) + ($$0172189<<2)|0)) + 2|0);
    $60 = HEAP8[$59>>0]|0;
    $61 = (+($60&255));
    $62 = $61 * 0.11400000005960464;
    $63 = $58 + $62;
    $64 = (~~(($63))&255);
    $65 = HEAP32[$0>>2]|0;
    $66 = (($65) + ($$0170190)|0);
    HEAP8[$66>>0] = $64;
    $67 = (((($7) + ($$0172189<<2)|0)) + 3|0);
    $68 = HEAP8[$67>>0]|0;
    $69 = HEAP32[$0>>2]|0;
    $70 = $$0170190 | 1;
    $71 = (($69) + ($70)|0);
    HEAP8[$71>>0] = $68;
    $72 = (($$0172189) + 1)|0;
    $73 = (($$0170190) + 2)|0;
    $74 = HEAP32[$39>>2]|0;
    $75 = HEAP32[$41>>2]|0;
    $76 = $74 << 1;
    $77 = Math_imul($76, $75)|0;
    $78 = ($73|0)<($77|0);
    if ($78) {
     $$0170190 = $73;$$0172189 = $72;
    } else {
     break;
    }
   }
  }
  break;
 }
 case 3:  {
  $79 = ((($0)) + 4|0);
  $80 = HEAP32[$79>>2]|0;
  $81 = ((($0)) + 8|0);
  $82 = HEAP32[$81>>2]|0;
  $83 = $80 << 1;
  $84 = Math_imul($83, $82)|0;
  $85 = (_malloc($84)|0);
  HEAP32[$0>>2] = $85;
  $86 = HEAP32[$79>>2]|0;
  $87 = Math_imul($82, $86)|0;
  $88 = ($87|0)>(0);
  if ($88) {
   $89 = HEAP8[$7>>0]|0;
   $90 = (+($89&255));
   $91 = $90 * 31.0;
   $92 = $91 / 255.0;
   $roundf179 = (+_roundf((+$92)));
   $93 = (~~(($roundf179))&255);
   $94 = ((($7)) + 1|0);
   $95 = HEAP8[$94>>0]|0;
   $96 = (+($95&255));
   $97 = $96 * 63.0;
   $98 = $97 / 255.0;
   $roundf180 = (+_roundf((+$98)));
   $99 = (~~(($roundf180))&255);
   $100 = ((($7)) + 2|0);
   $101 = HEAP8[$100>>0]|0;
   $102 = (+($101&255));
   $103 = $102 * 31.0;
   $104 = $103 / 255.0;
   $roundf181 = (+_roundf((+$104)));
   $105 = (~~(($roundf181))&255);
   $106 = $93&255;
   $107 = $106 << 11;
   $108 = $99&255;
   $109 = $108 << 5;
   $110 = $109 | $107;
   $111 = $105&255;
   $112 = $110 | $111;
   $113 = $112&65535;
   $114 = HEAP32[$0>>2]|0;
   $115 = HEAP32[$79>>2]|0;
   $116 = HEAP32[$81>>2]|0;
   $117 = Math_imul($116, $115)|0;
   $$0169192 = 0;
   while(1) {
    $118 = (($114) + ($$0169192<<1)|0);
    HEAP16[$118>>1] = $113;
    $119 = (($$0169192) + 1)|0;
    $120 = ($119|0)<($117|0);
    if ($120) {
     $$0169192 = $119;
    } else {
     break;
    }
   }
  }
  break;
 }
 case 4:  {
  $121 = ((($0)) + 4|0);
  $122 = HEAP32[$121>>2]|0;
  $123 = ((($0)) + 8|0);
  $124 = HEAP32[$123>>2]|0;
  $125 = ($122*3)|0;
  $126 = Math_imul($125, $124)|0;
  $127 = (_malloc($126)|0);
  HEAP32[$0>>2] = $127;
  $128 = HEAP32[$121>>2]|0;
  $129 = ($128*3)|0;
  $130 = Math_imul($129, $124)|0;
  $131 = ($130|0)>(0);
  if ($131) {
   $$0168195 = 0;$$1194 = 0;
   while(1) {
    $132 = (($7) + ($$1194<<2)|0);
    $133 = HEAP8[$132>>0]|0;
    $134 = HEAP32[$0>>2]|0;
    $135 = (($134) + ($$0168195)|0);
    HEAP8[$135>>0] = $133;
    $136 = (((($7) + ($$1194<<2)|0)) + 1|0);
    $137 = HEAP8[$136>>0]|0;
    $138 = HEAP32[$0>>2]|0;
    $139 = (($$0168195) + 1)|0;
    $140 = (($138) + ($139)|0);
    HEAP8[$140>>0] = $137;
    $141 = (((($7) + ($$1194<<2)|0)) + 2|0);
    $142 = HEAP8[$141>>0]|0;
    $143 = HEAP32[$0>>2]|0;
    $144 = (($$0168195) + 2)|0;
    $145 = (($143) + ($144)|0);
    HEAP8[$145>>0] = $142;
    $146 = (($$1194) + 1)|0;
    $147 = (($$0168195) + 3)|0;
    $148 = HEAP32[$121>>2]|0;
    $149 = HEAP32[$123>>2]|0;
    $150 = ($148*3)|0;
    $151 = Math_imul($150, $149)|0;
    $152 = ($147|0)<($151|0);
    if ($152) {
     $$0168195 = $147;$$1194 = $146;
    } else {
     break;
    }
   }
  }
  break;
 }
 case 5:  {
  $153 = ((($0)) + 4|0);
  $154 = HEAP32[$153>>2]|0;
  $155 = ((($0)) + 8|0);
  $156 = HEAP32[$155>>2]|0;
  $157 = $154 << 1;
  $158 = Math_imul($157, $156)|0;
  $159 = (_malloc($158)|0);
  HEAP32[$0>>2] = $159;
  $160 = HEAP32[$153>>2]|0;
  $161 = Math_imul($156, $160)|0;
  $162 = ($161|0)>(0);
  if ($162) {
   $163 = HEAP32[$0>>2]|0;
   $164 = HEAP32[$153>>2]|0;
   $165 = HEAP32[$155>>2]|0;
   $166 = Math_imul($165, $164)|0;
   $$0167197 = 0;
   while(1) {
    $167 = (($7) + ($$0167197<<2)|0);
    $168 = HEAP8[$167>>0]|0;
    $169 = (+($168&255));
    $170 = $169 * 31.0;
    $171 = $170 / 255.0;
    $roundf176 = (+_roundf((+$171)));
    $172 = (~~(($roundf176))&255);
    $173 = (((($7) + ($$0167197<<2)|0)) + 1|0);
    $174 = HEAP8[$173>>0]|0;
    $175 = (+($174&255));
    $176 = $175 * 31.0;
    $177 = $176 / 255.0;
    $roundf177 = (+_roundf((+$177)));
    $178 = (~~(($roundf177))&255);
    $179 = (((($7) + ($$0167197<<2)|0)) + 2|0);
    $180 = HEAP8[$179>>0]|0;
    $181 = (+($180&255));
    $182 = $181 * 31.0;
    $183 = $182 / 255.0;
    $roundf178 = (+_roundf((+$183)));
    $184 = (~~(($roundf178))&255);
    $185 = (((($7) + ($$0167197<<2)|0)) + 3|0);
    $186 = HEAP8[$185>>0]|0;
    $187 = ($186&255)>(50);
    $188 = $172&255;
    $189 = $188 << 11;
    $190 = $178&255;
    $191 = $190 << 6;
    $192 = $191 | $189;
    $193 = $184&255;
    $194 = $193 << 1;
    $195 = $192 | $194;
    $196 = $187&1;
    $197 = $195 | $196;
    $198 = $197&65535;
    $199 = (($163) + ($$0167197<<1)|0);
    HEAP16[$199>>1] = $198;
    $200 = (($$0167197) + 1)|0;
    $201 = ($200|0)<($166|0);
    if ($201) {
     $$0167197 = $200;
    } else {
     break;
    }
   }
  }
  break;
 }
 case 6:  {
  $202 = ((($0)) + 4|0);
  $203 = HEAP32[$202>>2]|0;
  $204 = ((($0)) + 8|0);
  $205 = HEAP32[$204>>2]|0;
  $206 = $203 << 1;
  $207 = Math_imul($206, $205)|0;
  $208 = (_malloc($207)|0);
  HEAP32[$0>>2] = $208;
  $209 = HEAP32[$202>>2]|0;
  $210 = Math_imul($205, $209)|0;
  $211 = ($210|0)>(0);
  if ($211) {
   $212 = HEAP32[$0>>2]|0;
   $213 = HEAP32[$202>>2]|0;
   $214 = HEAP32[$204>>2]|0;
   $215 = Math_imul($214, $213)|0;
   $$0166199 = 0;
   while(1) {
    $216 = (($7) + ($$0166199<<2)|0);
    $217 = HEAP8[$216>>0]|0;
    $218 = (+($217&255));
    $219 = $218 * 15.0;
    $220 = $219 / 255.0;
    $roundf = (+_roundf((+$220)));
    $221 = (~~(($roundf))&255);
    $222 = (((($7) + ($$0166199<<2)|0)) + 1|0);
    $223 = HEAP8[$222>>0]|0;
    $224 = (+($223&255));
    $225 = $224 * 15.0;
    $226 = $225 / 255.0;
    $roundf173 = (+_roundf((+$226)));
    $227 = (~~(($roundf173))&255);
    $228 = (((($7) + ($$0166199<<2)|0)) + 2|0);
    $229 = HEAP8[$228>>0]|0;
    $230 = (+($229&255));
    $231 = $230 * 15.0;
    $232 = $231 / 255.0;
    $roundf174 = (+_roundf((+$232)));
    $233 = (~~(($roundf174))&255);
    $234 = (((($7) + ($$0166199<<2)|0)) + 3|0);
    $235 = HEAP8[$234>>0]|0;
    $236 = (+($235&255));
    $237 = $236 * 15.0;
    $238 = $237 / 255.0;
    $roundf175 = (+_roundf((+$238)));
    $239 = (~~(($roundf175))&255);
    $240 = $221&255;
    $241 = $240 << 12;
    $242 = $227&255;
    $243 = $242 << 8;
    $244 = $243 | $241;
    $245 = $233&255;
    $246 = $245 << 4;
    $247 = $244 | $246;
    $248 = $239&255;
    $249 = $247 | $248;
    $250 = $249&65535;
    $251 = (($212) + ($$0166199<<1)|0);
    HEAP16[$251>>1] = $250;
    $252 = (($$0166199) + 1)|0;
    $253 = ($252|0)<($215|0);
    if ($253) {
     $$0166199 = $252;
    } else {
     break;
    }
   }
  }
  break;
 }
 case 7:  {
  $254 = ((($0)) + 4|0);
  $255 = HEAP32[$254>>2]|0;
  $256 = ((($0)) + 8|0);
  $257 = HEAP32[$256>>2]|0;
  $258 = $255 << 2;
  $259 = Math_imul($258, $257)|0;
  $260 = (_malloc($259)|0);
  HEAP32[$0>>2] = $260;
  $261 = HEAP32[$254>>2]|0;
  $262 = $261 << 2;
  $263 = Math_imul($262, $257)|0;
  $264 = ($263|0)>(0);
  if ($264) {
   $$0202 = 0;$$2201 = 0;
   while(1) {
    $265 = (($7) + ($$2201<<2)|0);
    $266 = HEAP8[$265>>0]|0;
    $267 = HEAP32[$0>>2]|0;
    $268 = (($267) + ($$0202)|0);
    HEAP8[$268>>0] = $266;
    $269 = (((($7) + ($$2201<<2)|0)) + 1|0);
    $270 = HEAP8[$269>>0]|0;
    $271 = HEAP32[$0>>2]|0;
    $272 = $$0202 | 1;
    $273 = (($271) + ($272)|0);
    HEAP8[$273>>0] = $270;
    $274 = (((($7) + ($$2201<<2)|0)) + 2|0);
    $275 = HEAP8[$274>>0]|0;
    $276 = HEAP32[$0>>2]|0;
    $277 = $$0202 | 2;
    $278 = (($276) + ($277)|0);
    HEAP8[$278>>0] = $275;
    $279 = (((($7) + ($$2201<<2)|0)) + 3|0);
    $280 = HEAP8[$279>>0]|0;
    $281 = HEAP32[$0>>2]|0;
    $282 = $$0202 | 3;
    $283 = (($281) + ($282)|0);
    HEAP8[$283>>0] = $280;
    $284 = (($$2201) + 1)|0;
    $285 = (($$0202) + 4)|0;
    $286 = HEAP32[$254>>2]|0;
    $287 = HEAP32[$256>>2]|0;
    $288 = $286 << 2;
    $289 = Math_imul($288, $287)|0;
    $290 = ($285|0)<($289|0);
    if ($290) {
     $$0202 = $285;$$2201 = $284;
    } else {
     break;
    }
   }
  }
  break;
 }
 default: {
 }
 }
 _free($7);
 STACKTOP = sp;return;
}
function _LoadTextureFromImage($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$sroa$11$0$$sroa_idx8 = 0, $$sroa$5$0$$sroa_idx2 = 0, $$sroa$7$0$$sroa_idx4 = 0, $$sroa$9$0$$sroa_idx6 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = HEAP32[$1>>2]|0;
 $3 = ((($1)) + 4|0);
 $4 = HEAP32[$3>>2]|0;
 $5 = ((($1)) + 8|0);
 $6 = HEAP32[$5>>2]|0;
 $7 = ((($1)) + 16|0);
 $8 = HEAP32[$7>>2]|0;
 $9 = ((($1)) + 12|0);
 $10 = HEAP32[$9>>2]|0;
 $11 = (_rlglLoadTexture($2,$4,$6,$8,$10)|0);
 $12 = HEAP32[$3>>2]|0;
 $13 = HEAP32[$5>>2]|0;
 HEAP32[$0>>2] = $11;
 $$sroa$5$0$$sroa_idx2 = ((($0)) + 4|0);
 HEAP32[$$sroa$5$0$$sroa_idx2>>2] = $12;
 $$sroa$7$0$$sroa_idx4 = ((($0)) + 8|0);
 HEAP32[$$sroa$7$0$$sroa_idx4>>2] = $13;
 $$sroa$9$0$$sroa_idx6 = ((($0)) + 12|0);
 HEAP32[$$sroa$9$0$$sroa_idx6>>2] = $10;
 $$sroa$11$0$$sroa_idx8 = ((($0)) + 16|0);
 HEAP32[$$sroa$11$0$$sroa_idx8>>2] = $8;
 return;
}
function _UnloadImage($0) {
 $0 = $0|0;
 var $1 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = HEAP32[$0>>2]|0;
 _free($1);
 return;
}
function _rlglLoadTexture($0,$1,$2,$3,$4) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 $4 = $4|0;
 var $$0 = 0, $$off = 0, $$off92 = 0, $$off93 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
 var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0;
 var $46 = 0, $47 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond100 = 0, $or$cond7 = 0, $or$cond96 = 0, $or$cond98 = 0, $switch = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer11 = 0, $vararg_buffer15 = 0, $vararg_buffer3 = 0, $vararg_buffer5 = 0, $vararg_buffer7 = 0;
 var $vararg_buffer9 = 0, $vararg_ptr13 = 0, $vararg_ptr14 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 80|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(80|0);
 $vararg_buffer15 = sp + 64|0;
 $vararg_buffer11 = sp + 48|0;
 $vararg_buffer9 = sp + 40|0;
 $vararg_buffer7 = sp + 32|0;
 $vararg_buffer5 = sp + 24|0;
 $vararg_buffer3 = sp + 16|0;
 $vararg_buffer1 = sp + 8|0;
 $vararg_buffer = sp;
 $5 = sp + 68|0;
 _glBindTexture(3553,0);
 HEAP32[$5>>2] = 0;
 $6 = HEAP32[5126]|0;
 $7 = ($6|0)==(0);
 $8 = $3 & -4;
 $switch = ($8|0)==(8);
 $or$cond100 = $switch & $7;
 if ($or$cond100) {
  _TraceLog(2,5390,$vararg_buffer);
  $$0 = HEAP32[$5>>2]|0;
  STACKTOP = sp;return ($$0|0);
 }
 $9 = HEAP32[5127]|0;
 $10 = ($9|0)==(0);
 $11 = ($3|0)==(12);
 $or$cond7 = $11 & $10;
 if ($or$cond7) {
  _TraceLog(2,5434,$vararg_buffer1);
  $$0 = HEAP32[$5>>2]|0;
  STACKTOP = sp;return ($$0|0);
 }
 $12 = HEAP32[5128]|0;
 $13 = ($12|0)==(0);
 $$off = (($3) + -13)|0;
 $14 = ($$off>>>0)<(2);
 $or$cond = $14 & $13;
 if ($or$cond) {
  _TraceLog(2,5479,$vararg_buffer3);
  $$0 = HEAP32[$5>>2]|0;
  STACKTOP = sp;return ($$0|0);
 }
 $15 = HEAP32[5129]|0;
 $16 = ($15|0)==(0);
 $$off92 = (($3) + -15)|0;
 $17 = ($$off92>>>0)<(2);
 $or$cond96 = $17 & $16;
 if ($or$cond96) {
  _TraceLog(2,5524,$vararg_buffer5);
  $$0 = HEAP32[$5>>2]|0;
  STACKTOP = sp;return ($$0|0);
 }
 $18 = HEAP32[5130]|0;
 $19 = ($18|0)==(0);
 $$off93 = (($3) + -17)|0;
 $20 = ($$off93>>>0)<(2);
 $or$cond98 = $20 & $19;
 if ($or$cond98) {
  _TraceLog(2,5569,$vararg_buffer7);
  $$0 = HEAP32[$5>>2]|0;
  STACKTOP = sp;return ($$0|0);
 }
 _glGenTextures(1,($5|0));
 $21 = HEAP32[$5>>2]|0;
 _glBindTexture(3553,($21|0));
 do {
  switch ($3|0) {
  case 1:  {
   _glTexImage2D(3553,0,6409,($1|0),($2|0),0,6409,5121,($0|0));
   break;
  }
  case 2:  {
   _glTexImage2D(3553,0,6410,($1|0),($2|0),0,6410,5121,($0|0));
   break;
  }
  case 3:  {
   _glTexImage2D(3553,0,6407,($1|0),($2|0),0,6407,33635,($0|0));
   break;
  }
  case 4:  {
   _glTexImage2D(3553,0,6407,($1|0),($2|0),0,6407,5121,($0|0));
   break;
  }
  case 5:  {
   _glTexImage2D(3553,0,6408,($1|0),($2|0),0,6408,32820,($0|0));
   break;
  }
  case 6:  {
   _glTexImage2D(3553,0,6408,($1|0),($2|0),0,6408,32819,($0|0));
   break;
  }
  case 7:  {
   _glTexImage2D(3553,0,6408,($1|0),($2|0),0,6408,5121,($0|0));
   break;
  }
  case 8:  {
   $22 = HEAP32[5126]|0;
   $23 = ($22|0)==(0);
   if (!($23)) {
    _LoadCompressedTexture($0,$1,$2,$4,33776);
   }
   break;
  }
  case 9:  {
   $24 = HEAP32[5126]|0;
   $25 = ($24|0)==(0);
   if (!($25)) {
    _LoadCompressedTexture($0,$1,$2,$4,33777);
   }
   break;
  }
  case 10:  {
   $26 = HEAP32[5126]|0;
   $27 = ($26|0)==(0);
   if (!($27)) {
    _LoadCompressedTexture($0,$1,$2,$4,33778);
   }
   break;
  }
  case 11:  {
   $28 = HEAP32[5126]|0;
   $29 = ($28|0)==(0);
   if (!($29)) {
    _LoadCompressedTexture($0,$1,$2,$4,33779);
   }
   break;
  }
  case 12:  {
   $30 = HEAP32[5127]|0;
   $31 = ($30|0)==(0);
   if (!($31)) {
    _LoadCompressedTexture($0,$1,$2,$4,36196);
   }
   break;
  }
  case 13:  {
   $32 = HEAP32[5128]|0;
   $33 = ($32|0)==(0);
   if (!($33)) {
    _LoadCompressedTexture($0,$1,$2,$4,37492);
   }
   break;
  }
  case 14:  {
   $34 = HEAP32[5128]|0;
   $35 = ($34|0)==(0);
   if (!($35)) {
    _LoadCompressedTexture($0,$1,$2,$4,37496);
   }
   break;
  }
  case 15:  {
   $36 = HEAP32[5129]|0;
   $37 = ($36|0)==(0);
   if (!($37)) {
    _LoadCompressedTexture($0,$1,$2,$4,35840);
   }
   break;
  }
  case 16:  {
   $38 = HEAP32[5129]|0;
   $39 = ($38|0)==(0);
   if (!($39)) {
    _LoadCompressedTexture($0,$1,$2,$4,35842);
   }
   break;
  }
  case 17:  {
   $40 = HEAP32[5130]|0;
   $41 = ($40|0)==(0);
   if (!($41)) {
    _LoadCompressedTexture($0,$1,$2,$4,37808);
   }
   break;
  }
  case 18:  {
   $42 = HEAP32[5130]|0;
   $43 = ($42|0)==(0);
   if (!($43)) {
    _LoadCompressedTexture($0,$1,$2,$4,37815);
   }
   break;
  }
  default: {
   _TraceLog(2,5614,$vararg_buffer9);
  }
  }
 } while(0);
 $44 = HEAP32[5131]|0;
 $45 = ($44|0)==(0);
 if ($45) {
  _glTexParameteri(3553,10242,33071);
  _glTexParameteri(3553,10243,33071);
 } else {
  _glTexParameteri(3553,10242,10497);
  _glTexParameteri(3553,10243,10497);
 }
 _glTexParameteri(3553,10240,9728);
 _glTexParameteri(3553,10241,9728);
 _glBindTexture(3553,0);
 $46 = HEAP32[$5>>2]|0;
 $47 = ($46|0)==(0);
 if ($47) {
  _TraceLog(2,5692,$vararg_buffer15);
  $$0 = HEAP32[$5>>2]|0;
  STACKTOP = sp;return ($$0|0);
 } else {
  HEAP32[$vararg_buffer11>>2] = $46;
  $vararg_ptr13 = ((($vararg_buffer11)) + 4|0);
  HEAP32[$vararg_ptr13>>2] = $1;
  $vararg_ptr14 = ((($vararg_buffer11)) + 8|0);
  HEAP32[$vararg_ptr14>>2] = $2;
  _TraceLog(0,5643,$vararg_buffer11);
  $$0 = HEAP32[$5>>2]|0;
  STACKTOP = sp;return ($$0|0);
 }
 return (0)|0;
}
function _LoadCompressedTexture($0,$1,$2,$3,$4) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 $4 = $4|0;
 var $$ = 0, $$03645 = 0, $$03744 = 0, $$038 = 0, $$03943 = 0, $$046 = 0, $$140 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0;
 var $23 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond42 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 _glPixelStorei(3317,1);
 switch ($4|0) {
 case 33776: case 33777: case 36196: case 37492:  {
  $$038 = 8;
  break;
 }
 default: {
  $$038 = 16;
 }
 }
 $5 = ($3|0)<(1);
 $6 = $1 | $2;
 $7 = ($6|0)==(0);
 $or$cond42 = $5 | $7;
 if ($or$cond42) {
  return;
 } else {
  $$03645 = 0;$$03744 = 0;$$03943 = $2;$$046 = $1;
 }
 while(1) {
  $8 = (($$046) + 3)|0;
  $9 = (($8|0) / 4)&-1;
  $10 = (($$03943) + 3)|0;
  $11 = (($10|0) / 4)&-1;
  $12 = Math_imul($11, $$038)|0;
  $13 = Math_imul($12, $9)|0;
  $14 = (($0) + ($$03744)|0);
  _glCompressedTexImage2D(3553,($$03645|0),($4|0),($$046|0),($$03943|0),0,($13|0),($14|0));
  $15 = (($13) + ($$03744))|0;
  $16 = (($$046|0) / 2)&-1;
  $17 = (($$03943|0) / 2)&-1;
  $18 = ($$046|0)<(2);
  $$ = $18 ? 1 : $16;
  $19 = ($$03943|0)<(2);
  $$140 = $19 ? 1 : $17;
  $20 = (($$03645) + 1)|0;
  $21 = ($20|0)>=($3|0);
  $22 = $$ | $$140;
  $23 = ($22|0)==(0);
  $or$cond = $21 | $23;
  if ($or$cond) {
   break;
  } else {
   $$03645 = $20;$$03744 = $15;$$03943 = $$140;$$046 = $$;
  }
 }
 return;
}
function _GetImageData($0) {
 $0 = $0|0;
 var $$0104105 = 0, $$0106 = 0, $$1 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0.0, $103 = 0.0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0;
 var $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0;
 var $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0;
 var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0.0, $4 = 0, $40 = 0.0, $41 = 0;
 var $42 = 0, $43 = 0, $44 = 0, $45 = 0.0, $46 = 0.0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0.0, $52 = 0.0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0;
 var $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0.0, $65 = 0.0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0.0, $71 = 0.0, $72 = 0, $73 = 0, $74 = 0, $75 = 0.0, $76 = 0.0, $77 = 0, $78 = 0;
 var $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0.0, $86 = 0.0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0.0, $92 = 0.0, $93 = 0, $94 = 0, $95 = 0, $96 = 0;
 var $97 = 0.0, $98 = 0.0, $99 = 0, $vararg_buffer = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $vararg_buffer = sp;
 $1 = ((($0)) + 4|0);
 $2 = HEAP32[$1>>2]|0;
 $3 = ((($0)) + 8|0);
 $4 = HEAP32[$3>>2]|0;
 $5 = $2 << 2;
 $6 = Math_imul($5, $4)|0;
 $7 = (_malloc($6)|0);
 $8 = HEAP32[$1>>2]|0;
 $9 = Math_imul($4, $8)|0;
 $10 = ($9|0)>(0);
 if (!($10)) {
  STACKTOP = sp;return ($7|0);
 }
 $11 = ((($0)) + 16|0);
 $12 = HEAP32[$11>>2]|0;
 $13 = HEAP32[$0>>2]|0;
 $$0104105 = 0;$$0106 = 0;
 while(1) {
  switch ($12|0) {
  case 1:  {
   $14 = (($13) + ($$0106)|0);
   $15 = HEAP8[$14>>0]|0;
   $16 = (($7) + ($$0104105<<2)|0);
   HEAP8[$16>>0] = $15;
   $17 = HEAP8[$14>>0]|0;
   $18 = (((($7) + ($$0104105<<2)|0)) + 1|0);
   HEAP8[$18>>0] = $17;
   $19 = HEAP8[$14>>0]|0;
   $20 = (((($7) + ($$0104105<<2)|0)) + 2|0);
   HEAP8[$20>>0] = $19;
   $21 = (((($7) + ($$0104105<<2)|0)) + 3|0);
   HEAP8[$21>>0] = -1;
   $22 = (($$0106) + 1)|0;
   $$1 = $22;
   break;
  }
  case 2:  {
   $23 = (($13) + ($$0106)|0);
   $24 = HEAP8[$23>>0]|0;
   $25 = (($7) + ($$0104105<<2)|0);
   HEAP8[$25>>0] = $24;
   $26 = HEAP8[$23>>0]|0;
   $27 = (((($7) + ($$0104105<<2)|0)) + 1|0);
   HEAP8[$27>>0] = $26;
   $28 = HEAP8[$23>>0]|0;
   $29 = (((($7) + ($$0104105<<2)|0)) + 2|0);
   HEAP8[$29>>0] = $28;
   $30 = (($$0106) + 1)|0;
   $31 = (($13) + ($30)|0);
   $32 = HEAP8[$31>>0]|0;
   $33 = (((($7) + ($$0104105<<2)|0)) + 3|0);
   HEAP8[$33>>0] = $32;
   $34 = (($$0106) + 2)|0;
   $$1 = $34;
   break;
  }
  case 5:  {
   $35 = (($13) + ($$0106<<1)|0);
   $36 = HEAP16[$35>>1]|0;
   $37 = $36&65535;
   $38 = $37 >>> 11;
   $39 = (+($38|0));
   $40 = $39 * 8.0;
   $41 = (~~(($40))&255);
   $42 = (($7) + ($$0104105<<2)|0);
   HEAP8[$42>>0] = $41;
   $43 = $37 >>> 6;
   $44 = $43 & 31;
   $45 = (+($44|0));
   $46 = $45 * 8.0;
   $47 = (~~(($46))&255);
   $48 = (((($7) + ($$0104105<<2)|0)) + 1|0);
   HEAP8[$48>>0] = $47;
   $49 = $37 >>> 1;
   $50 = $49 & 31;
   $51 = (+($50|0));
   $52 = $51 * 8.0;
   $53 = (~~(($52))&255);
   $54 = (((($7) + ($$0104105<<2)|0)) + 2|0);
   HEAP8[$54>>0] = $53;
   $55 = $37 & 1;
   $56 = (0 - ($55))|0;
   $57 = $56&255;
   $58 = (((($7) + ($$0104105<<2)|0)) + 3|0);
   HEAP8[$58>>0] = $57;
   $59 = (($$0106) + 1)|0;
   $$1 = $59;
   break;
  }
  case 3:  {
   $60 = (($13) + ($$0106<<1)|0);
   $61 = HEAP16[$60>>1]|0;
   $62 = $61&65535;
   $63 = $62 >>> 11;
   $64 = (+($63|0));
   $65 = $64 * 8.0;
   $66 = (~~(($65))&255);
   $67 = (($7) + ($$0104105<<2)|0);
   HEAP8[$67>>0] = $66;
   $68 = $62 >>> 5;
   $69 = $68 & 63;
   $70 = (+($69|0));
   $71 = $70 * 4.0;
   $72 = (~~(($71))&255);
   $73 = (((($7) + ($$0104105<<2)|0)) + 1|0);
   HEAP8[$73>>0] = $72;
   $74 = $62 & 31;
   $75 = (+($74|0));
   $76 = $75 * 8.0;
   $77 = (~~(($76))&255);
   $78 = (((($7) + ($$0104105<<2)|0)) + 2|0);
   HEAP8[$78>>0] = $77;
   $79 = (((($7) + ($$0104105<<2)|0)) + 3|0);
   HEAP8[$79>>0] = -1;
   $80 = (($$0106) + 1)|0;
   $$1 = $80;
   break;
  }
  case 6:  {
   $81 = (($13) + ($$0106<<1)|0);
   $82 = HEAP16[$81>>1]|0;
   $83 = $82&65535;
   $84 = $83 >>> 12;
   $85 = (+($84|0));
   $86 = $85 * 17.0;
   $87 = (~~(($86))&255);
   $88 = (($7) + ($$0104105<<2)|0);
   HEAP8[$88>>0] = $87;
   $89 = $83 >>> 8;
   $90 = $89 & 15;
   $91 = (+($90|0));
   $92 = $91 * 17.0;
   $93 = (~~(($92))&255);
   $94 = (((($7) + ($$0104105<<2)|0)) + 1|0);
   HEAP8[$94>>0] = $93;
   $95 = $83 >>> 4;
   $96 = $95 & 15;
   $97 = (+($96|0));
   $98 = $97 * 17.0;
   $99 = (~~(($98))&255);
   $100 = (((($7) + ($$0104105<<2)|0)) + 2|0);
   HEAP8[$100>>0] = $99;
   $101 = $83 & 15;
   $102 = (+($101|0));
   $103 = $102 * 17.0;
   $104 = (~~(($103))&255);
   $105 = (((($7) + ($$0104105<<2)|0)) + 3|0);
   HEAP8[$105>>0] = $104;
   $106 = (($$0106) + 1)|0;
   $$1 = $106;
   break;
  }
  case 7:  {
   $107 = (($13) + ($$0106)|0);
   $108 = HEAP8[$107>>0]|0;
   $109 = (($7) + ($$0104105<<2)|0);
   HEAP8[$109>>0] = $108;
   $110 = (($$0106) + 1)|0;
   $111 = (($13) + ($110)|0);
   $112 = HEAP8[$111>>0]|0;
   $113 = (((($7) + ($$0104105<<2)|0)) + 1|0);
   HEAP8[$113>>0] = $112;
   $114 = (($$0106) + 2)|0;
   $115 = (($13) + ($114)|0);
   $116 = HEAP8[$115>>0]|0;
   $117 = (((($7) + ($$0104105<<2)|0)) + 2|0);
   HEAP8[$117>>0] = $116;
   $118 = (($$0106) + 3)|0;
   $119 = (($13) + ($118)|0);
   $120 = HEAP8[$119>>0]|0;
   $121 = (((($7) + ($$0104105<<2)|0)) + 3|0);
   HEAP8[$121>>0] = $120;
   $122 = (($$0106) + 4)|0;
   $$1 = $122;
   break;
  }
  case 4:  {
   $123 = (($13) + ($$0106)|0);
   $124 = HEAP8[$123>>0]|0;
   $125 = (($7) + ($$0104105<<2)|0);
   HEAP8[$125>>0] = $124;
   $126 = (($$0106) + 1)|0;
   $127 = (($13) + ($126)|0);
   $128 = HEAP8[$127>>0]|0;
   $129 = (((($7) + ($$0104105<<2)|0)) + 1|0);
   HEAP8[$129>>0] = $128;
   $130 = (($$0106) + 2)|0;
   $131 = (($13) + ($130)|0);
   $132 = HEAP8[$131>>0]|0;
   $133 = (((($7) + ($$0104105<<2)|0)) + 2|0);
   HEAP8[$133>>0] = $132;
   $134 = (((($7) + ($$0104105<<2)|0)) + 3|0);
   HEAP8[$134>>0] = -1;
   $135 = (($$0106) + 3)|0;
   $$1 = $135;
   break;
  }
  default: {
   _TraceLog(2,5775,$vararg_buffer);
   $$1 = $$0106;
  }
  }
  $136 = (($$0104105) + 1)|0;
  $137 = HEAP32[$1>>2]|0;
  $138 = HEAP32[$3>>2]|0;
  $139 = Math_imul($138, $137)|0;
  $140 = ($136|0)<($139|0);
  if ($140) {
   $$0104105 = $136;$$0106 = $$1;
  } else {
   break;
  }
 }
 STACKTOP = sp;return ($7|0);
}
function _ErrorCallback($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $vararg_buffer = 0, $vararg_ptr1 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $vararg_buffer = sp;
 HEAP32[$vararg_buffer>>2] = $0;
 $vararg_ptr1 = ((($vararg_buffer)) + 4|0);
 HEAP32[$vararg_ptr1>>2] = $1;
 _TraceLog(2,9641,$vararg_buffer);
 STACKTOP = sp;return;
}
function _rlGetVersion() {
 var label = 0, sp = 0;
 sp = STACKTOP;
 return 4;
}
function _SetupFramebufferSize($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$sink = 0, $$sink1 = 0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0, $14 = 0.0, $15 = 0.0, $16 = 0, $17 = 0, $18 = 0.0, $19 = 0.0, $2 = 0, $20 = 0, $21 = 0, $22 = 0.0, $23 = 0, $24 = 0, $25 = 0, $26 = 0.0;
 var $27 = 0, $28 = 0.0, $29 = 0.0, $3 = 0, $30 = 0, $31 = 0, $32 = 0.0, $33 = 0.0, $34 = 0.0, $35 = 0, $36 = 0.0, $37 = 0, $38 = 0.0, $39 = 0.0, $4 = 0, $40 = 0, $41 = 0.0, $42 = 0, $43 = 0, $44 = 0.0;
 var $45 = 0, $46 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0.0, $9 = 0, $or$cond = 0, $roundf = 0.0, $roundf38 = 0.0, $roundf39 = 0.0, $roundf40 = 0.0, $vararg_buffer = 0, $vararg_buffer4 = 0, $vararg_buffer8 = 0, $vararg_ptr1 = 0, $vararg_ptr11 = 0, $vararg_ptr12 = 0, $vararg_ptr13 = 0, $vararg_ptr2 = 0;
 var $vararg_ptr3 = 0, $vararg_ptr7 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 112|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(112|0);
 $vararg_buffer8 = sp + 24|0;
 $vararg_buffer4 = sp + 16|0;
 $vararg_buffer = sp;
 $2 = sp + 40|0;
 $3 = HEAP32[5110]|0;
 $4 = ($3|0)>($0|0);
 if (!($4)) {
  $5 = HEAP32[5109]|0;
  $6 = ($5|0)>($1|0);
  if (!($6)) {
   $30 = ($3|0)<($0|0);
   $31 = ($5|0)<($1|0);
   $or$cond = $30 | $31;
   if (!($or$cond)) {
    HEAP32[5151] = $3;
    HEAP32[5152] = $5;
    HEAP32[5153] = 0;
    HEAP32[5154] = 0;
    STACKTOP = sp;return;
   }
   HEAP32[$vararg_buffer8>>2] = $3;
   $vararg_ptr11 = ((($vararg_buffer8)) + 4|0);
   HEAP32[$vararg_ptr11>>2] = $5;
   $vararg_ptr12 = ((($vararg_buffer8)) + 8|0);
   HEAP32[$vararg_ptr12>>2] = $0;
   $vararg_ptr13 = ((($vararg_buffer8)) + 12|0);
   HEAP32[$vararg_ptr13>>2] = $1;
   _TraceLog(0,9575,$vararg_buffer8);
   $32 = (+($0|0));
   $33 = (+($1|0));
   $34 = $32 / $33;
   $35 = HEAP32[5110]|0;
   $36 = (+($35|0));
   $37 = HEAP32[5109]|0;
   $38 = (+($37|0));
   $39 = $36 / $38;
   $40 = !($34 <= $39);
   if ($40) {
    $44 = $34 * $38;
    $roundf = (+_roundf((+$44)));
    $45 = (~~(($roundf)));
    HEAP32[5151] = $45;
    HEAP32[5152] = $37;
    $46 = (($45) - ($35))|0;
    HEAP32[5153] = $46;
    $$sink1 = 0;
   } else {
    HEAP32[5151] = $35;
    $41 = $36 / $34;
    $roundf38 = (+_roundf((+$41)));
    $42 = (~~(($roundf38)));
    HEAP32[5152] = $42;
    HEAP32[5153] = 0;
    $43 = (($42) - ($37))|0;
    $$sink1 = $43;
   }
   HEAP32[5154] = $$sink1;
   STACKTOP = sp;return;
  }
 }
 $7 = HEAP32[5109]|0;
 HEAP32[$vararg_buffer>>2] = $3;
 $vararg_ptr1 = ((($vararg_buffer)) + 4|0);
 HEAP32[$vararg_ptr1>>2] = $7;
 $vararg_ptr2 = ((($vararg_buffer)) + 8|0);
 HEAP32[$vararg_ptr2>>2] = $0;
 $vararg_ptr3 = ((($vararg_buffer)) + 12|0);
 HEAP32[$vararg_ptr3>>2] = $1;
 _TraceLog(2,9432,$vararg_buffer);
 $8 = (+($0|0));
 $9 = HEAP32[5110]|0;
 $10 = (+($9|0));
 $11 = $8 / $10;
 $12 = (+($1|0));
 $13 = HEAP32[5109]|0;
 $14 = (+($13|0));
 $15 = $12 / $14;
 $16 = !($11 <= $15);
 if ($16) {
  $22 = $10 * $15;
  $roundf39 = (+_roundf((+$22)));
  $23 = (~~(($roundf39)));
  HEAP32[5151] = $23;
  HEAP32[5152] = $1;
  $24 = (($0) - ($23))|0;
  HEAP32[5153] = $24;
  $$sink = 0;
 } else {
  HEAP32[5151] = $0;
  $17 = HEAP32[5109]|0;
  $18 = (+($17|0));
  $19 = $11 * $18;
  $roundf40 = (+_roundf((+$19)));
  $20 = (~~(($roundf40)));
  HEAP32[5152] = $20;
  HEAP32[5153] = 0;
  $21 = (($1) - ($20))|0;
  $$sink = $21;
 }
 HEAP32[5154] = $$sink;
 $25 = HEAP32[5151]|0;
 $26 = (+($25|0));
 $27 = HEAP32[5110]|0;
 $28 = (+($27|0));
 $29 = $26 / $28;
 _MatrixScale($2,$29,$29,$29);
 dest=20528; src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
 HEAP32[5151] = $0;
 HEAP32[5152] = $1;
 HEAP32[$vararg_buffer4>>2] = $0;
 $vararg_ptr7 = ((($vararg_buffer4)) + 4|0);
 HEAP32[$vararg_ptr7>>2] = $1;
 _TraceLog(2,9510,$vararg_buffer4);
 STACKTOP = sp;return;
}
function _WindowSizeCallback($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $3 = 0.0, $4 = 0.0, label = 0, sp = 0;
 sp = STACKTOP;
 _rlViewport(0,0,$1,$2);
 _rlMatrixMode(5889);
 _rlLoadIdentity();
 $3 = (+($1|0));
 $4 = (+($2|0));
 _rlOrtho(0.0,$3,$4,0.0,0.0,1.0);
 _rlMatrixMode(5888);
 _rlLoadIdentity();
 _rlClearScreenBuffers();
 HEAP32[5110] = $1;
 HEAP32[5109] = $2;
 HEAP32[5151] = $1;
 HEAP32[5152] = $2;
 return;
}
function _CursorEnterCallback($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var label = 0, sp = 0;
 sp = STACKTOP;
 return;
}
function _KeyCallback($0,$1,$2,$3,$4) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 $4 = $4|0;
 var $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $5 = HEAP32[750]|0;
 $6 = ($5|0)==($1|0);
 $7 = ($3|0)==(1);
 $or$cond = $7 & $6;
 if ($or$cond) {
  _glfwSetWindowShouldClose(($0|0),1);
  return;
 }
 $8 = $3&255;
 $9 = (23271 + ($1)|0);
 HEAP8[$9>>0] = $8;
 if (!($7)) {
  return;
 }
 HEAP32[749] = $1;
 return;
}
function _MouseButtonCallback($0,$1,$2,$3) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 var $$byval_copy = 0, $$sink = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0.0, $27 = 0.0;
 var $28 = 0.0, $29 = 0, $30 = 0.0, $31 = 0, $32 = 0.0, $33 = 0.0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 128|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(128|0);
 $$byval_copy = sp + 64|0;
 $4 = sp + 8|0;
 $5 = sp;
 $6 = $2&255;
 $7 = (23265 + ($1)|0);
 HEAP8[$7>>0] = $6;
 $8 = (_IsMouseButtonPressed(0)|0);
 $9 = ($8|0)==(0);
 if ($9) {
  $10 = (_IsMouseButtonReleased(0)|0);
  $11 = ($10|0)==(0);
  if (!($11)) {
   $$sink = 0;
   label = 3;
  }
 } else {
  $$sink = 1;
  label = 3;
 }
 if ((label|0) == 3) {
  HEAP32[$4>>2] = $$sink;
 }
 $12 = ((($4)) + 8|0);
 HEAP32[$12>>2] = 0;
 $13 = ((($4)) + 4|0);
 HEAP32[$13>>2] = 1;
 $14 = ((($4)) + 24|0);
 _GetMousePosition($5);
 $15 = $5;
 $16 = $15;
 $17 = HEAP32[$16>>2]|0;
 $18 = (($15) + 4)|0;
 $19 = $18;
 $20 = HEAP32[$19>>2]|0;
 $21 = $14;
 $22 = $21;
 HEAP32[$22>>2] = $17;
 $23 = (($21) + 4)|0;
 $24 = $23;
 HEAP32[$24>>2] = $20;
 $25 = (_GetScreenWidth()|0);
 $26 = (+($25|0));
 $27 = +HEAPF32[$14>>2];
 $28 = $27 / $26;
 HEAPF32[$14>>2] = $28;
 $29 = (_GetScreenHeight()|0);
 $30 = (+($29|0));
 $31 = ((($4)) + 28|0);
 $32 = +HEAPF32[$31>>2];
 $33 = $32 / $30;
 HEAPF32[$31>>2] = $33;
 dest=$$byval_copy; src=$4; stop=dest+56|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
 _ProcessGestureEvent($$byval_copy);
 STACKTOP = sp;return;
}
function _MouseCursorPosCallback($0,$1,$2) {
 $0 = $0|0;
 $1 = +$1;
 $2 = +$2;
 var $$byval_copy = 0, $$sroa$0$0$$sroa_idx = 0, $$sroa$2$0$$sroa_idx1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0.0, $21 = 0.0, $22 = 0.0, $23 = 0, $24 = 0.0, $25 = 0.0, $26 = 0.0;
 var $3 = 0, $4 = 0, $5 = 0, $6 = 0.0, $7 = 0.0, $8 = 0, $9 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 112|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(112|0);
 $$byval_copy = sp + 56|0;
 $3 = sp;
 HEAP32[$3>>2] = 2;
 $4 = ((($3)) + 8|0);
 HEAP32[$4>>2] = 0;
 $5 = ((($3)) + 4|0);
 HEAP32[$5>>2] = 1;
 $6 = $1;
 $7 = $2;
 $$sroa$0$0$$sroa_idx = ((($3)) + 24|0);
 HEAPF32[$$sroa$0$0$$sroa_idx>>2] = $6;
 $$sroa$2$0$$sroa_idx1 = ((($3)) + 28|0);
 HEAPF32[$$sroa$2$0$$sroa_idx1>>2] = $7;
 $8 = ((($3)) + 24|0);
 $9 = $8;
 $10 = $9;
 $11 = HEAP32[$10>>2]|0;
 $12 = (($9) + 4)|0;
 $13 = $12;
 $14 = HEAP32[$13>>2]|0;
 $15 = 19880;
 $16 = $15;
 HEAP32[$16>>2] = $11;
 $17 = (($15) + 4)|0;
 $18 = $17;
 HEAP32[$18>>2] = $14;
 $19 = (_GetScreenWidth()|0);
 $20 = (+($19|0));
 $21 = +HEAPF32[$8>>2];
 $22 = $21 / $20;
 HEAPF32[$8>>2] = $22;
 $23 = (_GetScreenHeight()|0);
 $24 = (+($23|0));
 $25 = +HEAPF32[$$sroa$2$0$$sroa_idx1>>2];
 $26 = $25 / $24;
 HEAPF32[$$sroa$2$0$$sroa_idx1>>2] = $26;
 dest=$$byval_copy; src=$3; stop=dest+56|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
 _ProcessGestureEvent($$byval_copy);
 STACKTOP = sp;return;
}
function _CharCallback($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var label = 0, sp = 0;
 sp = STACKTOP;
 HEAP32[749] = $1;
 return;
}
function _ScrollCallback($0,$1,$2) {
 $0 = $0|0;
 $1 = +$1;
 $2 = +$2;
 var $3 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $3 = (~~(($2)));
 HEAP32[5524] = $3;
 return;
}
function _WindowIconifyCallback($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$sink = 0, $2 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = ($1|0)!=(0);
 $$sink = $2&1;
 HEAP32[5523] = $$sink;
 return;
}
function _rlglInit($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$05965 = 0, $$06066 = 0, $$06167 = 0, $$062 = 0, $$sink63 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0;
 var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0;
 var $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0;
 var $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0.0, $72 = 0.0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0;
 var $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $9 = 0, $exitcond = 0, $exitcond69 = 0, $exitcond70 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer10 = 0, $vararg_buffer13 = 0, $vararg_buffer15 = 0, $vararg_buffer17 = 0, $vararg_buffer19 = 0;
 var $vararg_buffer21 = 0, $vararg_buffer23 = 0, $vararg_buffer25 = 0, $vararg_buffer27 = 0, $vararg_buffer29 = 0, $vararg_buffer31 = 0, $vararg_buffer34 = 0, $vararg_buffer36 = 0, $vararg_buffer39 = 0, $vararg_buffer4 = 0, $vararg_buffer41 = 0, $vararg_buffer7 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 2464|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(2464|0);
 $vararg_buffer41 = sp + 2184|0;
 $vararg_buffer39 = sp + 2176|0;
 $vararg_buffer36 = sp + 2168|0;
 $vararg_buffer34 = sp + 2160|0;
 $vararg_buffer31 = sp + 2152|0;
 $vararg_buffer29 = sp + 2144|0;
 $vararg_buffer27 = sp + 2136|0;
 $vararg_buffer25 = sp + 2128|0;
 $vararg_buffer23 = sp + 2120|0;
 $vararg_buffer21 = sp + 2112|0;
 $vararg_buffer19 = sp + 2104|0;
 $vararg_buffer17 = sp + 2096|0;
 $vararg_buffer15 = sp + 2088|0;
 $vararg_buffer13 = sp + 2080|0;
 $vararg_buffer10 = sp + 2072|0;
 $vararg_buffer7 = sp + 24|0;
 $vararg_buffer4 = sp + 16|0;
 $vararg_buffer1 = sp + 8|0;
 $vararg_buffer = sp;
 $2 = sp + 2400|0;
 $3 = sp + 2384|0;
 $4 = sp + 2320|0;
 $5 = sp + 2256|0;
 $6 = sp + 2192|0;
 $7 = (_glGetString(7936)|0);
 HEAP32[$vararg_buffer>>2] = $7;
 _TraceLog(0,6073,$vararg_buffer);
 $8 = (_glGetString(7937)|0);
 HEAP32[$vararg_buffer1>>2] = $8;
 _TraceLog(0,6091,$vararg_buffer1);
 $9 = (_glGetString(7938)|0);
 HEAP32[$vararg_buffer4>>2] = $9;
 _TraceLog(0,6109,$vararg_buffer4);
 $10 = (_glGetString(35724)|0);
 HEAP32[$vararg_buffer7>>2] = $10;
 _TraceLog(0,6127,$vararg_buffer7);
 $11 = (_glGetString(7939)|0);
 $12 = (_strlen($11)|0);
 $13 = (($12) + 1)|0;
 $14 = (_malloc($13)|0);
 _memcpy(($14|0),($11|0),($13|0))|0;
 $$062 = 0;$$sink63 = $14;
 while(1) {
  $15 = (_strtok($$sink63,6145)|0);
  $16 = (($vararg_buffer7) + ($$062<<2)|0);
  HEAP32[$16>>2] = $15;
  $17 = ($15|0)==(0|0);
  $18 = (($$062) + 1)|0;
  if ($17) {
   break;
  } else {
   $$062 = $18;$$sink63 = 0;
  }
 }
 _free($14);
 $19 = (($$062) + -1)|0;
 HEAP32[$vararg_buffer10>>2] = $19;
 _TraceLog(0,6147,$vararg_buffer10);
 $20 = ($$062|0)>(1);
 if ($20) {
  $$06167 = 0;
  while(1) {
   $23 = (($vararg_buffer7) + ($$06167<<2)|0);
   $24 = HEAP32[$23>>2]|0;
   $25 = (_strcmp($24,6182)|0);
   $26 = ($25|0)==(0);
   if ($26) {
    HEAP32[5189] = 1;
    $27 = (_eglGetProcAddress((6209|0))|0);
    HEAP32[5190] = $27;
    $28 = (_eglGetProcAddress((6230|0))|0);
    HEAP32[5191] = $28;
    $29 = (_eglGetProcAddress((6251|0))|0);
    HEAP32[5192] = $29;
   }
   $30 = (_strcmp($24,6275)|0);
   $31 = ($30|0)==(0);
   if ($31) {
    HEAP32[5131] = 1;
   }
   $32 = (_strcmp($24,6295)|0);
   $33 = ($32|0)==(0);
   if ($33) {
    label = 12;
   } else {
    $34 = HEAP32[$23>>2]|0;
    $35 = (_strcmp($34,6327)|0);
    $36 = ($35|0)==(0);
    if ($36) {
     label = 12;
    } else {
     $37 = (_strcmp($34,6360)|0);
     $38 = ($37|0)==(0);
     if ($38) {
      label = 12;
     }
    }
   }
   if ((label|0) == 12) {
    label = 0;
    HEAP32[5126] = 1;
   }
   $39 = (_strcmp($24,6400)|0);
   $40 = ($39|0)==(0);
   if ($40) {
    label = 15;
   } else {
    $41 = HEAP32[$23>>2]|0;
    $42 = (_strcmp($41,6436)|0);
    $43 = ($42|0)==(0);
    if ($43) {
     label = 15;
    }
   }
   if ((label|0) == 15) {
    label = 0;
    HEAP32[5127] = 1;
   }
   $44 = HEAP32[$23>>2]|0;
   $45 = (_strcmp($44,6469)|0);
   $46 = ($45|0)==(0);
   if ($46) {
    HEAP32[5128] = 1;
   }
   $47 = (_strcmp($44,6494)|0);
   $48 = ($47|0)==(0);
   if ($48) {
    HEAP32[5129] = 1;
   }
   $49 = (_strcmp($44,6527)|0);
   $50 = ($49|0)==(0);
   if ($50) {
    HEAP32[5130] = 1;
   }
   $51 = (_strcmp($44,6563)|0);
   $52 = ($51|0)==(0);
   if ($52) {
    HEAP32[5193] = 1;
    _glGetFloatv(34047,(20776|0));
   }
   $53 = HEAP32[$23>>2]|0;
   $54 = (_strcmp($53,6597)|0);
   $55 = ($54|0)==(0);
   if ($55) {
    HEAP32[5195] = 1;
   }
   $56 = (($$06167) + 1)|0;
   $exitcond70 = ($56|0)==($19|0);
   if ($exitcond70) {
    break;
   } else {
    $$06167 = $56;
   }
  }
 }
 $21 = HEAP32[5189]|0;
 $22 = ($21|0)==(0);
 if ($22) {
  _TraceLog(2,6700,$vararg_buffer15);
 } else {
  _TraceLog(0,6625,$vararg_buffer13);
 }
 $57 = HEAP32[5131]|0;
 $58 = ($57|0)==(0);
 if ($58) {
  _TraceLog(2,6836,$vararg_buffer19);
 } else {
  _TraceLog(0,6761,$vararg_buffer17);
 }
 $59 = HEAP32[5126]|0;
 $60 = ($59|0)==(0);
 if (!($60)) {
  _TraceLog(0,6928,$vararg_buffer21);
 }
 $61 = HEAP32[5127]|0;
 $62 = ($61|0)==(0);
 if (!($62)) {
  _TraceLog(0,6974,$vararg_buffer23);
 }
 $63 = HEAP32[5128]|0;
 $64 = ($63|0)==(0);
 if (!($64)) {
  _TraceLog(0,7021,$vararg_buffer25);
 }
 $65 = HEAP32[5129]|0;
 $66 = ($65|0)==(0);
 if (!($66)) {
  _TraceLog(0,7072,$vararg_buffer27);
 }
 $67 = HEAP32[5130]|0;
 $68 = ($67|0)==(0);
 if (!($68)) {
  _TraceLog(0,7119,$vararg_buffer29);
 }
 $69 = HEAP32[5193]|0;
 $70 = ($69|0)==(0);
 if (!($70)) {
  $71 = +HEAPF32[5194];
  $72 = $71;
  HEAPF64[$vararg_buffer31>>3] = $72;
  _TraceLog(0,7166,$vararg_buffer31);
 }
 $73 = HEAP32[5195]|0;
 $74 = ($73|0)==(0);
 if (!($74)) {
  _TraceLog(0,7232,$vararg_buffer34);
 }
 HEAP32[$vararg_buffer10>>2] = -1;
 $75 = (_rlglLoadTexture($vararg_buffer10,1,1,7,1)|0);
 HEAP32[5196] = $75;
 $76 = ($75|0)==(0);
 if ($76) {
  _TraceLog(2,7336,$vararg_buffer39);
 } else {
  HEAP32[$vararg_buffer36>>2] = $75;
  _TraceLog(0,7285,$vararg_buffer36);
 }
 _LoadDefaultShader($2);
 dest=20788; src=$2; stop=dest+56|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
 dest=20844; src=$2; stop=dest+56|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
 _LoadDefaultBuffers();
 $77 = (_malloc(49152)|0);
 HEAP32[5225] = $77;
 $$06066 = 0;
 while(1) {
  $79 = HEAP32[5225]|0;
  $80 = (($79) + (($$06066*12)|0)|0);
  _VectorZero($3);
  ;HEAP32[$80>>2]=HEAP32[$3>>2]|0;HEAP32[$80+4>>2]=HEAP32[$3+4>>2]|0;HEAP32[$80+8>>2]=HEAP32[$3+8>>2]|0;
  $81 = (($$06066) + 1)|0;
  $exitcond69 = ($81|0)==(4096);
  if ($exitcond69) {
   break;
  } else {
   $$06066 = $81;
  }
 }
 $78 = (_malloc(36864)|0);
 HEAP32[5226] = $78;
 $$05965 = 0;
 while(1) {
  $82 = (((($78) + (($$05965*144)|0)|0)) + 8|0);
  HEAP32[$82>>2] = 0;
  $83 = (($78) + (($$05965*144)|0)|0);
  HEAP32[$83>>2] = 0;
  $84 = (($$05965) + 1)|0;
  $exitcond = ($84|0)==(256);
  if ($exitcond) {
   break;
  } else {
   $$05965 = $84;
  }
 }
 HEAP32[5227] = 1;
 $85 = HEAP32[5196]|0;
 $86 = ((($78)) + 8|0);
 HEAP32[$86>>2] = $85;
 HEAP32[5228] = 4;
 _MatrixIdentity($4);
 dest=20916; src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
 _MatrixIdentity($4);
 dest=(20980); src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
 _MatrixIdentity($4);
 dest=(21044); src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
 _MatrixIdentity($4);
 dest=(21108); src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
 _MatrixIdentity($4);
 dest=(21172); src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
 _MatrixIdentity($4);
 dest=(21236); src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
 _MatrixIdentity($4);
 dest=(21300); src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
 _MatrixIdentity($4);
 dest=(21364); src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
 _MatrixIdentity($4);
 dest=(21428); src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
 _MatrixIdentity($4);
 dest=(21492); src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
 _MatrixIdentity($4);
 dest=(21556); src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
 _MatrixIdentity($4);
 dest=(21620); src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
 _MatrixIdentity($4);
 dest=(21684); src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
 _MatrixIdentity($4);
 dest=(21748); src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
 _MatrixIdentity($4);
 dest=(21812); src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
 _MatrixIdentity($4);
 dest=(21876); src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
 _MatrixIdentity($5);
 dest=20624; src=$5; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
 _MatrixIdentity($6);
 dest=20688; src=$6; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
 HEAP32[5155] = 20688;
 _glDepthFunc(515);
 _glDisable(2929);
 _glBlendFunc(770,771);
 _glEnable(3042);
 _glCullFace(1029);
 _glFrontFace(2305);
 _glEnable(2884);
 _glClearColor(0.0,0.0,0.0,1.0);
 _glClearDepthf(1.0);
 _glClear(16640);
 HEAP32[5485] = $0;
 HEAP32[5486] = $1;
 _TraceLog(0,7375,$vararg_buffer41);
 STACKTOP = sp;return;
}
function _SetupViewport() {
 var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $0 = HEAP32[5153]|0;
 $1 = (($0|0) / 2)&-1;
 $2 = HEAP32[5154]|0;
 $3 = (($2|0) / 2)&-1;
 $4 = HEAP32[5151]|0;
 $5 = (($4) - ($0))|0;
 $6 = HEAP32[5152]|0;
 $7 = (($6) - ($2))|0;
 _rlViewport($1,$3,$5,$7);
 return;
}
function _rlMatrixMode($0) {
 $0 = $0|0;
 var $modelview$sink = 0, label = 0, sp = 0;
 sp = STACKTOP;
 switch ($0|0) {
 case 5889:  {
  $modelview$sink = 20624;
  label = 3;
  break;
 }
 case 5888:  {
  $modelview$sink = 20688;
  label = 3;
  break;
 }
 default: {
 }
 }
 if ((label|0) == 3) {
  HEAP32[5155] = $modelview$sink;
 }
 HEAP32[5188] = $0;
 return;
}
function _rlLoadIdentity() {
 var $0 = 0, $1 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(64|0);
 $0 = sp;
 $1 = HEAP32[5155]|0;
 _MatrixIdentity($0);
 dest=$1; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
 STACKTOP = sp;return;
}
function _rlOrtho($0,$1,$2,$3,$4,$5) {
 $0 = +$0;
 $1 = +$1;
 $2 = +$2;
 $3 = +$3;
 $4 = +$4;
 $5 = +$5;
 var $$byval_copy = 0, $$byval_copy1 = 0, $6 = 0, $7 = 0, $8 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 256|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(256|0);
 $$byval_copy1 = sp + 192|0;
 $$byval_copy = sp + 128|0;
 $6 = sp + 64|0;
 $7 = sp;
 _MatrixOrtho($6,$0,$1,$2,$3,$4,$5);
 _MatrixTranspose($6);
 $8 = HEAP32[5155]|0;
 dest=$$byval_copy; src=$8; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
 dest=$$byval_copy1; src=$6; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
 _MatrixMultiply($7,$$byval_copy,$$byval_copy1);
 dest=$8; src=$7; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
 STACKTOP = sp;return;
}
function _ClearBackground($0) {
 $0 = $0|0;
 var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = HEAP8[$0>>0]|0;
 $2 = ((($0)) + 1|0);
 $3 = HEAP8[$2>>0]|0;
 $4 = ((($0)) + 2|0);
 $5 = HEAP8[$4>>0]|0;
 $6 = ((($0)) + 3|0);
 $7 = HEAP8[$6>>0]|0;
 _rlClearColor($1,$3,$5,$7);
 return;
}
function _rlClearColor($0,$1,$2,$3) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 var $10 = 0.0, $11 = 0.0, $4 = 0.0, $5 = 0.0, $6 = 0.0, $7 = 0.0, $8 = 0.0, $9 = 0.0, label = 0, sp = 0;
 sp = STACKTOP;
 $4 = (+($0&255));
 $5 = $4 / 255.0;
 $6 = (+($1&255));
 $7 = $6 / 255.0;
 $8 = (+($2&255));
 $9 = $8 / 255.0;
 $10 = (+($3&255));
 $11 = $10 / 255.0;
 _glClearColor((+$5),(+$7),(+$9),(+$11));
 return;
}
function _rlViewport($0,$1,$2,$3) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 var label = 0, sp = 0;
 sp = STACKTOP;
 _glViewport(($0|0),($1|0),($2|0),($3|0));
 return;
}
function _LoadDefaultShader($0) {
 $0 = $0|0;
 var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 1008|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(1008|0);
 $vararg_buffer1 = sp + 8|0;
 $vararg_buffer = sp;
 $1 = sp + 16|0;
 $2 = sp + 513|0;
 $3 = sp + 72|0;
 _memcpy(($2|0),(7951|0),489)|0;
 _memcpy(($3|0),(8440|0),441)|0;
 $4 = (_LoadShaderProgram($2,$3)|0);
 HEAP32[$1>>2] = $4;
 $5 = ($4|0)==(0);
 if ($5) {
  HEAP32[$vararg_buffer1>>2] = $4;
  _TraceLog(2,8929,$vararg_buffer1);
 } else {
  HEAP32[$vararg_buffer>>2] = $4;
  _TraceLog(0,8881,$vararg_buffer);
 }
 $6 = HEAP32[$1>>2]|0;
 $7 = ($6|0)==(0);
 if (!($7)) {
  _LoadDefaultShaderLocations($1);
 }
 dest=$0; src=$1; stop=dest+56|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
 STACKTOP = sp;return;
}
function _LoadDefaultBuffers() {
 var $$05365 = 0, $$05467 = 0, $$05770 = 0, $$05972 = 0, $$066 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0;
 var $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0;
 var $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0;
 var $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0;
 var $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0;
 var $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $exitcond = 0, $exitcond75 = 0, $exitcond78 = 0, $exitcond80 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer10 = 0, $vararg_buffer14 = 0, $vararg_buffer17 = 0;
 var $vararg_buffer3 = 0, $vararg_buffer7 = 0, $vararg_ptr13 = 0, $vararg_ptr20 = 0, $vararg_ptr21 = 0, $vararg_ptr22 = 0, $vararg_ptr6 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(64|0);
 $vararg_buffer17 = sp + 48|0;
 $vararg_buffer14 = sp + 40|0;
 $vararg_buffer10 = sp + 32|0;
 $vararg_buffer7 = sp + 24|0;
 $vararg_buffer3 = sp + 16|0;
 $vararg_buffer1 = sp + 8|0;
 $vararg_buffer = sp;
 $0 = (_malloc(24576)|0);
 HEAP32[(21960)>>2] = $0;
 $1 = (_malloc(8192)|0);
 HEAP32[(21968)>>2] = $1;
 HEAP32[(21964)>>2] = 0;
 HEAP32[(21972)>>2] = 0;
 _memset(($0|0),0,24576)|0;
 $$05972 = 0;
 while(1) {
  $2 = HEAP32[(21968)>>2]|0;
  $3 = (($2) + ($$05972)|0);
  HEAP8[$3>>0] = 0;
  $4 = (($$05972) + 1)|0;
  $exitcond80 = ($4|0)==(8192);
  if ($exitcond80) {
   break;
  } else {
   $$05972 = $4;
  }
 }
 HEAP32[5487] = 0;
 HEAP32[(21956)>>2] = 0;
 HEAP32[(21952)>>2] = 0;
 $5 = (_malloc(73728)|0);
 HEAP32[(22008)>>2] = $5;
 $6 = (_malloc(24576)|0);
 HEAP32[(22016)>>2] = $6;
 HEAP32[(22012)>>2] = 0;
 HEAP32[(22020)>>2] = 0;
 _memset(($5|0),0,73728)|0;
 $$05770 = 0;
 while(1) {
  $7 = HEAP32[(22016)>>2]|0;
  $8 = (($7) + ($$05770)|0);
  HEAP8[$8>>0] = 0;
  $9 = (($$05770) + 1)|0;
  $exitcond78 = ($9|0)==(24576);
  if ($exitcond78) {
   break;
  } else {
   $$05770 = $9;
  }
 }
 HEAP32[5499] = 0;
 HEAP32[(22004)>>2] = 0;
 HEAP32[(22000)>>2] = 0;
 $10 = (_malloc(49152)|0);
 HEAP32[(22056)>>2] = $10;
 $11 = (_malloc(32768)|0);
 HEAP32[(22060)>>2] = $11;
 $12 = (_malloc(16384)|0);
 HEAP32[(22064)>>2] = $12;
 $13 = (_malloc(12288)|0);
 HEAP32[(22068)>>2] = $13;
 $14 = HEAP32[(22056)>>2]|0;
 _memset(($14|0),0,49152)|0;
 $15 = HEAP32[(22060)>>2]|0;
 _memset(($15|0),0,32768)|0;
 $$05467 = 0;
 while(1) {
  $17 = HEAP32[(22064)>>2]|0;
  $18 = (($17) + ($$05467)|0);
  HEAP8[$18>>0] = 0;
  $19 = (($$05467) + 1)|0;
  $exitcond75 = ($19|0)==(16384);
  if ($exitcond75) {
   break;
  } else {
   $$05467 = $19;
  }
 }
 $16 = HEAP32[(22068)>>2]|0;
 $$05365 = 0;$$066 = 0;
 while(1) {
  $22 = $$05365 << 2;
  $23 = $22&65535;
  $24 = (($16) + ($$066<<1)|0);
  HEAP16[$24>>1] = $23;
  $25 = $22 | 1;
  $26 = $25&65535;
  $27 = $$066 | 1;
  $28 = (($16) + ($27<<1)|0);
  HEAP16[$28>>1] = $26;
  $29 = $22 | 2;
  $30 = $29&65535;
  $31 = (($$066) + 2)|0;
  $32 = (($16) + ($31<<1)|0);
  HEAP16[$32>>1] = $30;
  $33 = (($$066) + 3)|0;
  $34 = (($16) + ($33<<1)|0);
  HEAP16[$34>>1] = $23;
  $35 = (($$066) + 4)|0;
  $36 = (($16) + ($35<<1)|0);
  HEAP16[$36>>1] = $30;
  $37 = $22 | 3;
  $38 = $37&65535;
  $39 = (($$066) + 5)|0;
  $40 = (($16) + ($39<<1)|0);
  HEAP16[$40>>1] = $38;
  $41 = (($$05365) + 1)|0;
  $42 = (($$066) + 6)|0;
  $exitcond = ($41|0)==(1024);
  if ($exitcond) {
   break;
  } else {
   $$05365 = $41;$$066 = $42;
  }
 }
 HEAP32[5511] = 0;
 HEAP32[(22048)>>2] = 0;
 HEAP32[(22052)>>2] = 0;
 _TraceLog(0,7422,$vararg_buffer);
 $20 = HEAP32[5189]|0;
 $21 = ($20|0)==(0);
 if (!($21)) {
  $43 = HEAP32[5190]|0;
  FUNCTION_TABLE_vii[$43 & 63](1,(21976));
  $44 = HEAP32[5191]|0;
  $45 = HEAP32[(21976)>>2]|0;
  FUNCTION_TABLE_vi[$44 & 31]($45);
 }
 _glGenBuffers(2,((21980)|0));
 $46 = HEAP32[(21980)>>2]|0;
 _glBindBuffer(34962,($46|0));
 $47 = HEAP32[(21960)>>2]|0;
 _glBufferData(34962,24576,($47|0),35048);
 $48 = HEAP32[(20848)>>2]|0;
 _glEnableVertexAttribArray(($48|0));
 $49 = HEAP32[(20848)>>2]|0;
 _glVertexAttribPointer(($49|0),3,5126,0,0,(0|0));
 _glGenBuffers(2,((21984)|0));
 $50 = HEAP32[(21984)>>2]|0;
 _glBindBuffer(34962,($50|0));
 $51 = HEAP32[(21968)>>2]|0;
 _glBufferData(34962,8192,($51|0),35048);
 $52 = HEAP32[(20868)>>2]|0;
 _glEnableVertexAttribArray(($52|0));
 $53 = HEAP32[(20868)>>2]|0;
 _glVertexAttribPointer(($53|0),4,5121,1,0,(0|0));
 $54 = HEAP32[5189]|0;
 $55 = ($54|0)==(0);
 if ($55) {
  $57 = HEAP32[(21980)>>2]|0;
  $58 = HEAP32[(21984)>>2]|0;
  HEAP32[$vararg_buffer3>>2] = $57;
  $vararg_ptr6 = ((($vararg_buffer3)) + 4|0);
  HEAP32[$vararg_ptr6>>2] = $58;
  _TraceLog(0,7560,$vararg_buffer3);
 } else {
  $56 = HEAP32[(21976)>>2]|0;
  HEAP32[$vararg_buffer1>>2] = $56;
  _TraceLog(0,7495,$vararg_buffer1);
 }
 $59 = HEAP32[5189]|0;
 $60 = ($59|0)==(0);
 if (!($60)) {
  $61 = HEAP32[5190]|0;
  FUNCTION_TABLE_vii[$61 & 63](1,(22024));
  $62 = HEAP32[5191]|0;
  $63 = HEAP32[(22024)>>2]|0;
  FUNCTION_TABLE_vi[$62 & 31]($63);
 }
 _glGenBuffers(1,((22028)|0));
 $64 = HEAP32[(22028)>>2]|0;
 _glBindBuffer(34962,($64|0));
 $65 = HEAP32[(22008)>>2]|0;
 _glBufferData(34962,73728,($65|0),35048);
 $66 = HEAP32[(20848)>>2]|0;
 _glEnableVertexAttribArray(($66|0));
 $67 = HEAP32[(20848)>>2]|0;
 _glVertexAttribPointer(($67|0),3,5126,0,0,(0|0));
 _glGenBuffers(1,((22032)|0));
 $68 = HEAP32[(22032)>>2]|0;
 _glBindBuffer(34962,($68|0));
 $69 = HEAP32[(22016)>>2]|0;
 _glBufferData(34962,24576,($69|0),35048);
 $70 = HEAP32[(20868)>>2]|0;
 _glEnableVertexAttribArray(($70|0));
 $71 = HEAP32[(20868)>>2]|0;
 _glVertexAttribPointer(($71|0),4,5121,1,0,(0|0));
 $72 = HEAP32[5189]|0;
 $73 = ($72|0)==(0);
 if ($73) {
  $75 = HEAP32[(22028)>>2]|0;
  $76 = HEAP32[(22032)>>2]|0;
  HEAP32[$vararg_buffer10>>2] = $75;
  $vararg_ptr13 = ((($vararg_buffer10)) + 4|0);
  HEAP32[$vararg_ptr13>>2] = $76;
  _TraceLog(0,7706,$vararg_buffer10);
 } else {
  $74 = HEAP32[(22024)>>2]|0;
  HEAP32[$vararg_buffer7>>2] = $74;
  _TraceLog(0,7637,$vararg_buffer7);
 }
 $77 = HEAP32[5189]|0;
 $78 = ($77|0)==(0);
 if (!($78)) {
  $79 = HEAP32[5190]|0;
  FUNCTION_TABLE_vii[$79 & 63](1,(22072));
  $80 = HEAP32[5191]|0;
  $81 = HEAP32[(22072)>>2]|0;
  FUNCTION_TABLE_vi[$80 & 31]($81);
 }
 _glGenBuffers(1,((22076)|0));
 $82 = HEAP32[(22076)>>2]|0;
 _glBindBuffer(34962,($82|0));
 $83 = HEAP32[(22056)>>2]|0;
 _glBufferData(34962,49152,($83|0),35048);
 $84 = HEAP32[(20848)>>2]|0;
 _glEnableVertexAttribArray(($84|0));
 $85 = HEAP32[(20848)>>2]|0;
 _glVertexAttribPointer(($85|0),3,5126,0,0,(0|0));
 _glGenBuffers(1,((22080)|0));
 $86 = HEAP32[(22080)>>2]|0;
 _glBindBuffer(34962,($86|0));
 $87 = HEAP32[(22060)>>2]|0;
 _glBufferData(34962,32768,($87|0),35048);
 $88 = HEAP32[(20852)>>2]|0;
 _glEnableVertexAttribArray(($88|0));
 $89 = HEAP32[(20852)>>2]|0;
 _glVertexAttribPointer(($89|0),2,5126,0,0,(0|0));
 _glGenBuffers(1,((22084)|0));
 $90 = HEAP32[(22084)>>2]|0;
 _glBindBuffer(34962,($90|0));
 $91 = HEAP32[(22064)>>2]|0;
 _glBufferData(34962,16384,($91|0),35048);
 $92 = HEAP32[(20868)>>2]|0;
 _glEnableVertexAttribArray(($92|0));
 $93 = HEAP32[(20868)>>2]|0;
 _glVertexAttribPointer(($93|0),4,5121,1,0,(0|0));
 _glGenBuffers(1,((22088)|0));
 $94 = HEAP32[(22088)>>2]|0;
 _glBindBuffer(34963,($94|0));
 $95 = HEAP32[(22068)>>2]|0;
 _glBufferData(34963,12288,($95|0),35044);
 $96 = HEAP32[5189]|0;
 $97 = ($96|0)==(0);
 if ($97) {
  $99 = HEAP32[(22076)>>2]|0;
  $100 = HEAP32[(22080)>>2]|0;
  $101 = HEAP32[(22084)>>2]|0;
  $102 = HEAP32[(22088)>>2]|0;
  HEAP32[$vararg_buffer17>>2] = $99;
  $vararg_ptr20 = ((($vararg_buffer17)) + 4|0);
  HEAP32[$vararg_ptr20>>2] = $100;
  $vararg_ptr21 = ((($vararg_buffer17)) + 8|0);
  HEAP32[$vararg_ptr21>>2] = $101;
  $vararg_ptr22 = ((($vararg_buffer17)) + 12|0);
  HEAP32[$vararg_ptr22>>2] = $102;
  _TraceLog(0,7852,$vararg_buffer17);
 } else {
  $98 = HEAP32[(22072)>>2]|0;
  HEAP32[$vararg_buffer14>>2] = $98;
  _TraceLog(0,7787,$vararg_buffer14);
 }
 $103 = HEAP32[5189]|0;
 $104 = ($103|0)==(0);
 if ($104) {
  STACKTOP = sp;return;
 }
 $105 = HEAP32[5191]|0;
 FUNCTION_TABLE_vi[$105 & 31](0);
 STACKTOP = sp;return;
}
function _LoadShaderProgram($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$0 = 0, $$alloca_mul = 0, $$alloca_mul34 = 0, $$alloca_mul36 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0;
 var $25 = 0, $26 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer10 = 0, $vararg_buffer13 = 0, $vararg_buffer16 = 0, $vararg_buffer19 = 0, $vararg_buffer22 = 0, $vararg_buffer4 = 0, $vararg_buffer7 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 96|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(96|0);
 $vararg_buffer22 = sp + 64|0;
 $vararg_buffer19 = sp + 56|0;
 $vararg_buffer16 = sp + 48|0;
 $vararg_buffer13 = sp + 40|0;
 $vararg_buffer10 = sp + 32|0;
 $vararg_buffer7 = sp + 24|0;
 $vararg_buffer4 = sp + 16|0;
 $vararg_buffer1 = sp + 8|0;
 $vararg_buffer = sp;
 $2 = sp + 80|0;
 $3 = sp + 76|0;
 $4 = sp + 72|0;
 $5 = sp + 68|0;
 $6 = (_glCreateShader(35633)|0);
 $7 = (_glCreateShader(35632)|0);
 HEAP32[$2>>2] = $0;
 HEAP32[$3>>2] = $1;
 _glShaderSource(($6|0),1,($2|0),(0|0));
 _glShaderSource(($7|0),1,($3|0),(0|0));
 HEAP32[$4>>2] = 0;
 _glCompileShader(($6|0));
 _glGetShaderiv(($6|0),35713,($4|0));
 $8 = HEAP32[$4>>2]|0;
 $9 = ($8|0)==(1);
 if ($9) {
  HEAP32[$vararg_buffer4>>2] = $6;
  _TraceLog(0,9185,$vararg_buffer4);
 } else {
  HEAP32[$vararg_buffer>>2] = $6;
  _TraceLog(2,9133,$vararg_buffer);
  HEAP32[$vararg_buffer>>2] = 0;
  _glGetShaderiv(($6|0),35716,($vararg_buffer|0));
  $10 = HEAP32[$vararg_buffer>>2]|0;
  $11 = (_llvm_stacksave()|0);
  $$alloca_mul = $10;
  $12 = STACKTOP; STACKTOP = STACKTOP + ((((1*$$alloca_mul)|0)+15)&-16)|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(((((1*$$alloca_mul)|0)+15)&-16)|0);;
  $13 = HEAP32[$vararg_buffer>>2]|0;
  _glGetShaderInfoLog(($6|0),($13|0),($5|0),($12|0));
  HEAP32[$vararg_buffer1>>2] = $12;
  _TraceLog(0,9182,$vararg_buffer1);
  _llvm_stackrestore(($11|0));
 }
 _glCompileShader(($7|0));
 _glGetShaderiv(($7|0),35713,($4|0));
 $14 = HEAP32[$4>>2]|0;
 $15 = ($14|0)==(1);
 if ($15) {
  HEAP32[$vararg_buffer13>>2] = $7;
  _TraceLog(0,9286,$vararg_buffer13);
 } else {
  HEAP32[$vararg_buffer7>>2] = $7;
  _TraceLog(2,9235,$vararg_buffer7);
  HEAP32[$vararg_buffer7>>2] = 0;
  _glGetShaderiv(($7|0),35716,($vararg_buffer7|0));
  $16 = HEAP32[$vararg_buffer7>>2]|0;
  $17 = (_llvm_stacksave()|0);
  $$alloca_mul34 = $16;
  $18 = STACKTOP; STACKTOP = STACKTOP + ((((1*$$alloca_mul34)|0)+15)&-16)|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(((((1*$$alloca_mul34)|0)+15)&-16)|0);;
  $19 = HEAP32[$vararg_buffer7>>2]|0;
  _glGetShaderInfoLog(($7|0),($19|0),($5|0),($18|0));
  HEAP32[$vararg_buffer10>>2] = $18;
  _TraceLog(0,9182,$vararg_buffer10);
  _llvm_stackrestore(($17|0));
 }
 $20 = (_glCreateProgram()|0);
 _glAttachShader(($20|0),($6|0));
 _glAttachShader(($20|0),($7|0));
 _glBindAttribLocation(($20|0),0,(8977|0));
 _glBindAttribLocation(($20|0),1,(8992|0));
 _glBindAttribLocation(($20|0),2,(9023|0));
 _glBindAttribLocation(($20|0),3,(9050|0));
 _glBindAttribLocation(($20|0),4,(9036|0));
 _glBindAttribLocation(($20|0),5,(9007|0));
 _glLinkProgram(($20|0));
 _glGetProgramiv(($20|0),35714,($4|0));
 $21 = HEAP32[$4>>2]|0;
 $22 = ($21|0)==(0);
 if ($22) {
  HEAP32[$vararg_buffer16>>2] = $20;
  _TraceLog(2,9338,$vararg_buffer16);
  HEAP32[$vararg_buffer16>>2] = 0;
  _glGetProgramiv(($20|0),35716,($vararg_buffer16|0));
  $23 = HEAP32[$vararg_buffer16>>2]|0;
  $24 = (_llvm_stacksave()|0);
  $$alloca_mul36 = $23;
  $25 = STACKTOP; STACKTOP = STACKTOP + ((((1*$$alloca_mul36)|0)+15)&-16)|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(((((1*$$alloca_mul36)|0)+15)&-16)|0);;
  $26 = HEAP32[$vararg_buffer16>>2]|0;
  _glGetProgramInfoLog(($20|0),($26|0),($5|0),($25|0));
  HEAP32[$vararg_buffer19>>2] = $25;
  _TraceLog(0,9182,$vararg_buffer19);
  _glDeleteProgram(($20|0));
  _llvm_stackrestore(($24|0));
  $$0 = 0;
  _glDeleteShader(($6|0));
  _glDeleteShader(($7|0));
  STACKTOP = sp;return ($$0|0);
 } else {
  HEAP32[$vararg_buffer22>>2] = $20;
  _TraceLog(0,9384,$vararg_buffer22);
  $$0 = $20;
  _glDeleteShader(($6|0));
  _glDeleteShader(($7|0));
  STACKTOP = sp;return ($$0|0);
 }
 return (0)|0;
}
function _LoadDefaultShaderLocations($0) {
 $0 = $0|0;
 var $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0;
 var $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0;
 var sp = 0;
 sp = STACKTOP;
 $1 = HEAP32[$0>>2]|0;
 $2 = (_glGetAttribLocation(($1|0),(8977|0))|0);
 $3 = ((($0)) + 4|0);
 HEAP32[$3>>2] = $2;
 $4 = HEAP32[$0>>2]|0;
 $5 = (_glGetAttribLocation(($4|0),(8992|0))|0);
 $6 = ((($0)) + 8|0);
 HEAP32[$6>>2] = $5;
 $7 = HEAP32[$0>>2]|0;
 $8 = (_glGetAttribLocation(($7|0),(9007|0))|0);
 $9 = ((($0)) + 12|0);
 HEAP32[$9>>2] = $8;
 $10 = HEAP32[$0>>2]|0;
 $11 = (_glGetAttribLocation(($10|0),(9023|0))|0);
 $12 = ((($0)) + 16|0);
 HEAP32[$12>>2] = $11;
 $13 = HEAP32[$0>>2]|0;
 $14 = (_glGetAttribLocation(($13|0),(9036|0))|0);
 $15 = ((($0)) + 20|0);
 HEAP32[$15>>2] = $14;
 $16 = HEAP32[$0>>2]|0;
 $17 = (_glGetAttribLocation(($16|0),(9050|0))|0);
 $18 = ((($0)) + 24|0);
 HEAP32[$18>>2] = $17;
 $19 = HEAP32[$0>>2]|0;
 $20 = (_glGetUniformLocation(($19|0),(9062|0))|0);
 $21 = ((($0)) + 28|0);
 HEAP32[$21>>2] = $20;
 $22 = HEAP32[$0>>2]|0;
 $23 = (_glGetUniformLocation(($22|0),(9072|0))|0);
 $24 = ((($0)) + 32|0);
 HEAP32[$24>>2] = $23;
 $25 = HEAP32[$0>>2]|0;
 $26 = (_glGetUniformLocation(($25|0),(9083|0))|0);
 $27 = ((($0)) + 36|0);
 HEAP32[$27>>2] = $26;
 $28 = HEAP32[$0>>2]|0;
 $29 = (_glGetUniformLocation(($28|0),(9094|0))|0);
 $30 = ((($0)) + 40|0);
 HEAP32[$30>>2] = $29;
 $31 = HEAP32[$0>>2]|0;
 $32 = (_glGetUniformLocation(($31|0),(9106|0))|0);
 $33 = ((($0)) + 44|0);
 HEAP32[$33>>2] = $32;
 $34 = HEAP32[$0>>2]|0;
 $35 = (_glGetUniformLocation(($34|0),(9115|0))|0);
 $36 = ((($0)) + 48|0);
 HEAP32[$36>>2] = $35;
 $37 = HEAP32[$0>>2]|0;
 $38 = (_glGetUniformLocation(($37|0),(9124|0))|0);
 $39 = ((($0)) + 52|0);
 HEAP32[$39>>2] = $38;
 return;
}
function _IsMouseButtonPressed($0) {
 $0 = $0|0;
 var $$0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $or$cond = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = (23265 + ($0)|0);
 $2 = HEAP8[$1>>0]|0;
 $3 = (23268 + ($0)|0);
 $4 = HEAP8[$3>>0]|0;
 $5 = ($2<<24>>24)!=($4<<24>>24);
 $6 = ($2<<24>>24)==(1);
 $or$cond = $6 & $5;
 $$0 = $or$cond&1;
 return ($$0|0);
}
function _IsMouseButtonReleased($0) {
 $0 = $0|0;
 var $$0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $or$cond = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = (23265 + ($0)|0);
 $2 = HEAP8[$1>>0]|0;
 $3 = (23268 + ($0)|0);
 $4 = HEAP8[$3>>0]|0;
 $5 = ($2<<24>>24)!=($4<<24>>24);
 $6 = ($2<<24>>24)==(0);
 $or$cond = $6 & $5;
 $$0 = $or$cond&1;
 return ($$0|0);
}
function _rlClearScreenBuffers() {
 var label = 0, sp = 0;
 sp = STACKTOP;
 _glClear(16640);
 return;
}
function _CloseWindow() {
 var $0 = 0, $vararg_buffer = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $vararg_buffer = sp;
 _UnloadDefaultFont();
 _rlglClose();
 $0 = HEAP32[5108]|0;
 _glfwDestroyWindow(($0|0));
 _glfwTerminate();
 _TraceLog(0,9696,$vararg_buffer);
 STACKTOP = sp;return;
}
function _UnloadDefaultFont() {
 var $$byval_copy = 0, $0 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
 $$byval_copy = sp;
 ;HEAP32[$$byval_copy>>2]=HEAP32[20472>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[20472+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[20472+8>>2]|0;HEAP32[$$byval_copy+12>>2]=HEAP32[20472+12>>2]|0;HEAP32[$$byval_copy+16>>2]=HEAP32[20472+16>>2]|0;
 _UnloadTexture($$byval_copy);
 $0 = HEAP32[(20500)>>2]|0;
 _free($0);
 STACKTOP = sp;return;
}
function _rlglClose() {
 var $0 = 0, $1 = 0, $vararg_buffer = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $vararg_buffer = sp;
 _UnloadDefaultShader();
 _UnloadDefaultBuffers();
 _glDeleteTextures(1,(20784|0));
 $0 = HEAP32[5196]|0;
 HEAP32[$vararg_buffer>>2] = $0;
 _TraceLog(0,9723,$vararg_buffer);
 $1 = HEAP32[5226]|0;
 _free($1);
 STACKTOP = sp;return;
}
function _UnloadDefaultShader() {
 var $0 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 _glUseProgram(0);
 $0 = HEAP32[5197]|0;
 _glDeleteProgram(($0|0));
 return;
}
function _UnloadDefaultBuffers() {
 var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $0 = HEAP32[5189]|0;
 $1 = ($0|0)==(0);
 if (!($1)) {
  $2 = HEAP32[5191]|0;
  FUNCTION_TABLE_vi[$2 & 31](0);
 }
 _glDisableVertexAttribArray(0);
 _glDisableVertexAttribArray(1);
 _glDisableVertexAttribArray(2);
 _glDisableVertexAttribArray(3);
 _glBindBuffer(34962,0);
 _glBindBuffer(34963,0);
 _glDeleteBuffers(1,((21980)|0));
 _glDeleteBuffers(1,((21984)|0));
 _glDeleteBuffers(1,((22028)|0));
 _glDeleteBuffers(1,((22032)|0));
 _glDeleteBuffers(1,((22076)|0));
 _glDeleteBuffers(1,((22080)|0));
 _glDeleteBuffers(1,((22084)|0));
 _glDeleteBuffers(1,((22088)|0));
 $3 = HEAP32[5189]|0;
 $4 = ($3|0)==(0);
 if (!($4)) {
  $5 = HEAP32[5192]|0;
  FUNCTION_TABLE_vii[$5 & 63](1,(21976));
  $6 = HEAP32[5192]|0;
  FUNCTION_TABLE_vii[$6 & 63](1,(22024));
  $7 = HEAP32[5192]|0;
  FUNCTION_TABLE_vii[$7 & 63](1,(22072));
 }
 $8 = HEAP32[(21960)>>2]|0;
 _free($8);
 $9 = HEAP32[(21968)>>2]|0;
 _free($9);
 $10 = HEAP32[(22008)>>2]|0;
 _free($10);
 $11 = HEAP32[(22016)>>2]|0;
 _free($11);
 $12 = HEAP32[(22056)>>2]|0;
 _free($12);
 $13 = HEAP32[(22060)>>2]|0;
 _free($13);
 $14 = HEAP32[(22064)>>2]|0;
 _free($14);
 $15 = HEAP32[(22068)>>2]|0;
 _free($15);
 return;
}
function _UnloadTexture($0) {
 $0 = $0|0;
 var $1 = 0, $2 = 0, $3 = 0, $vararg_buffer = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $vararg_buffer = sp;
 $1 = HEAP32[$0>>2]|0;
 $2 = ($1|0)==(0);
 if ($2) {
  STACKTOP = sp;return;
 }
 _rlDeleteTextures($1);
 $3 = HEAP32[$0>>2]|0;
 HEAP32[$vararg_buffer>>2] = $3;
 _TraceLog(0,9788,$vararg_buffer);
 STACKTOP = sp;return;
}
function _rlDeleteTextures($0) {
 $0 = $0|0;
 var $1 = 0, $2 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $1 = sp;
 HEAP32[$1>>2] = $0;
 $2 = ($0|0)==(0);
 if (!($2)) {
  _glDeleteTextures(1,($1|0));
 }
 STACKTOP = sp;return;
}
function _BeginDrawing() {
 var $0 = 0.0, $1 = 0.0, $2 = 0.0, $downscaleView$byval_copy = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(64|0);
 $downscaleView$byval_copy = sp;
 $0 = (+_GetTime());
 HEAPF64[2504] = $0;
 $1 = +HEAPF64[2487];
 $2 = $0 - $1;
 HEAPF64[2505] = $2;
 HEAPF64[2487] = $0;
 _rlClearScreenBuffers();
 _rlLoadIdentity();
 dest=$downscaleView$byval_copy; src=20528; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
 (_MatrixToFloat($downscaleView$byval_copy)|0);
 _rlMultMatrixf(22100);
 STACKTOP = sp;return;
}
function _MatrixToFloat($0) {
 $0 = $0|0;
 var $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0;
 var $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = HEAP32[$0>>2]|0;
 HEAP32[5525] = $1;
 $2 = ((($0)) + 4|0);
 $3 = HEAP32[$2>>2]|0;
 HEAP32[(22104)>>2] = $3;
 $4 = ((($0)) + 8|0);
 $5 = HEAP32[$4>>2]|0;
 HEAP32[(22108)>>2] = $5;
 $6 = ((($0)) + 12|0);
 $7 = HEAP32[$6>>2]|0;
 HEAP32[(22112)>>2] = $7;
 $8 = ((($0)) + 16|0);
 $9 = HEAP32[$8>>2]|0;
 HEAP32[(22116)>>2] = $9;
 $10 = ((($0)) + 20|0);
 $11 = HEAP32[$10>>2]|0;
 HEAP32[(22120)>>2] = $11;
 $12 = ((($0)) + 24|0);
 $13 = HEAP32[$12>>2]|0;
 HEAP32[(22124)>>2] = $13;
 $14 = ((($0)) + 28|0);
 $15 = HEAP32[$14>>2]|0;
 HEAP32[(22128)>>2] = $15;
 $16 = ((($0)) + 32|0);
 $17 = HEAP32[$16>>2]|0;
 HEAP32[(22132)>>2] = $17;
 $18 = ((($0)) + 36|0);
 $19 = HEAP32[$18>>2]|0;
 HEAP32[(22136)>>2] = $19;
 $20 = ((($0)) + 40|0);
 $21 = HEAP32[$20>>2]|0;
 HEAP32[(22140)>>2] = $21;
 $22 = ((($0)) + 44|0);
 $23 = HEAP32[$22>>2]|0;
 HEAP32[(22144)>>2] = $23;
 $24 = ((($0)) + 48|0);
 $25 = HEAP32[$24>>2]|0;
 HEAP32[(22148)>>2] = $25;
 $26 = ((($0)) + 52|0);
 $27 = HEAP32[$26>>2]|0;
 HEAP32[(22152)>>2] = $27;
 $28 = ((($0)) + 56|0);
 $29 = HEAP32[$28>>2]|0;
 HEAP32[(22156)>>2] = $29;
 $30 = ((($0)) + 60|0);
 $31 = HEAP32[$30>>2]|0;
 HEAP32[(22160)>>2] = $31;
 return (22100|0);
}
function _rlMultMatrixf($0) {
 $0 = $0|0;
 var $$byval_copy = 0, $$byval_copy1 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
 var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0;
 var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 256|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(256|0);
 $$byval_copy1 = sp + 192|0;
 $$byval_copy = sp + 128|0;
 $1 = sp + 64|0;
 $2 = sp;
 $3 = HEAP32[$0>>2]|0;
 HEAP32[$1>>2] = $3;
 $4 = ((($1)) + 4|0);
 $5 = ((($0)) + 4|0);
 $6 = HEAP32[$5>>2]|0;
 HEAP32[$4>>2] = $6;
 $7 = ((($1)) + 8|0);
 $8 = ((($0)) + 8|0);
 $9 = HEAP32[$8>>2]|0;
 HEAP32[$7>>2] = $9;
 $10 = ((($1)) + 12|0);
 $11 = ((($0)) + 12|0);
 $12 = HEAP32[$11>>2]|0;
 HEAP32[$10>>2] = $12;
 $13 = ((($1)) + 16|0);
 $14 = ((($0)) + 16|0);
 $15 = HEAP32[$14>>2]|0;
 HEAP32[$13>>2] = $15;
 $16 = ((($1)) + 20|0);
 $17 = ((($0)) + 20|0);
 $18 = HEAP32[$17>>2]|0;
 HEAP32[$16>>2] = $18;
 $19 = ((($1)) + 24|0);
 $20 = ((($0)) + 24|0);
 $21 = HEAP32[$20>>2]|0;
 HEAP32[$19>>2] = $21;
 $22 = ((($1)) + 28|0);
 $23 = ((($0)) + 28|0);
 $24 = HEAP32[$23>>2]|0;
 HEAP32[$22>>2] = $24;
 $25 = ((($1)) + 32|0);
 $26 = ((($0)) + 32|0);
 $27 = HEAP32[$26>>2]|0;
 HEAP32[$25>>2] = $27;
 $28 = ((($1)) + 36|0);
 $29 = ((($0)) + 36|0);
 $30 = HEAP32[$29>>2]|0;
 HEAP32[$28>>2] = $30;
 $31 = ((($1)) + 40|0);
 $32 = ((($0)) + 40|0);
 $33 = HEAP32[$32>>2]|0;
 HEAP32[$31>>2] = $33;
 $34 = ((($1)) + 44|0);
 $35 = ((($0)) + 44|0);
 $36 = HEAP32[$35>>2]|0;
 HEAP32[$34>>2] = $36;
 $37 = ((($1)) + 48|0);
 $38 = ((($0)) + 48|0);
 $39 = HEAP32[$38>>2]|0;
 HEAP32[$37>>2] = $39;
 $40 = ((($1)) + 52|0);
 $41 = ((($0)) + 52|0);
 $42 = HEAP32[$41>>2]|0;
 HEAP32[$40>>2] = $42;
 $43 = ((($1)) + 56|0);
 $44 = ((($0)) + 56|0);
 $45 = HEAP32[$44>>2]|0;
 HEAP32[$43>>2] = $45;
 $46 = ((($1)) + 60|0);
 $47 = ((($0)) + 60|0);
 $48 = HEAP32[$47>>2]|0;
 HEAP32[$46>>2] = $48;
 $49 = HEAP32[5155]|0;
 dest=$$byval_copy; src=$49; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
 dest=$$byval_copy1; src=$1; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
 _MatrixMultiply($2,$$byval_copy,$$byval_copy1);
 dest=$49; src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
 STACKTOP = sp;return;
}
function _EndDrawing() {
 var $0 = 0.0, $1 = 0.0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $2 = 0.0, $3 = 0.0, $4 = 0.0, $5 = 0.0, $6 = 0, $7 = 0.0, $8 = 0.0, $9 = 0.0, label = 0, sp = 0;
 sp = STACKTOP;
 _rlglDraw();
 _SwapBuffers();
 _PollInputEvents();
 $0 = (+_GetTime());
 HEAPF64[2504] = $0;
 $1 = +HEAPF64[2487];
 $2 = $0 - $1;
 HEAPF64[2506] = $2;
 HEAPF64[2487] = $0;
 $3 = +HEAPF64[2505];
 $4 = $2 + $3;
 HEAPF64[2507] = $4;
 $5 = +HEAPF64[2484];
 $6 = $4 < $5;
 if (!($6)) {
  return;
 }
 $7 = $5 - $4;
 $8 = $7 * 1000.0;
 $9 = $8;
 _Wait($9);
 $10 = (+_GetTime());
 HEAPF64[2504] = $10;
 $11 = +HEAPF64[2487];
 $12 = $10 - $11;
 HEAPF64[2487] = $10;
 $13 = +HEAPF64[2507];
 $14 = $12 + $13;
 HEAPF64[2507] = $14;
 return;
}
function _rlglDraw() {
 var label = 0, sp = 0;
 sp = STACKTOP;
 _UpdateDefaultBuffers();
 _DrawDefaultBuffers();
 return;
}
function _SwapBuffers() {
 var $0 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $0 = HEAP32[5108]|0;
 _glfwSwapBuffers(($0|0));
 return;
}
function _PollInputEvents() {
 var $$04857 = 0, $$05160 = 0, $$058 = 0, $$lcssa = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0;
 var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0.0, $31 = 0.0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0.0, $40 = 0;
 var $5 = 0.0, $6 = 0.0, $7 = 0.0, $8 = 0, $9 = 0, $scevgep = 0, $scevgep67 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 1456|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(1456|0);
 $0 = sp + 1440|0;
 $1 = sp + 1432|0;
 $2 = sp;
 _UpdateGestures();
 HEAP32[749] = -1;
 HEAP32[751] = -1;
 HEAP32[5541] = 0;
 $3 = HEAP32[5108]|0;
 _glfwGetCursorPos(($3|0),($0|0),($1|0));
 $4 = +HEAPF64[$0>>3];
 $5 = $4;
 HEAPF32[4966] = $5;
 $6 = +HEAPF64[$1>>3];
 $7 = $6;
 HEAPF32[(19868)>>2] = $7;
 _memcpy((23783|0),(23271|0),512)|0;
 ;HEAP8[23268>>0]=HEAP8[23265>>0]|0;HEAP8[23268+1>>0]=HEAP8[23265+1>>0]|0;HEAP8[23268+2>>0]=HEAP8[23265+2>>0]|0;
 $8 = HEAP32[5524]|0;
 HEAP32[5111] = $8;
 HEAP32[5524] = 0;
 $9 = (_emscripten_get_num_gamepads()|0);
 $10 = ($9|0)>(0);
 if (!($10)) {
  STACKTOP = sp;return;
 }
 $11 = ((($2)) + 12|0);
 $12 = ((($2)) + 8|0);
 $$05160 = 0;
 while(1) {
  $scevgep = (24295 + ($$05160<<5)|0);
  $scevgep67 = (24423 + ($$05160<<5)|0);
  dest=$scevgep; src=$scevgep67; stop=dest+32|0; do { HEAP8[dest>>0]=HEAP8[src>>0]|0; dest=dest+1|0; src=src+1|0; } while ((dest|0) < (stop|0));
  $13 = (_emscripten_get_gamepad_status(($$05160|0),($2|0))|0);
  $14 = ($13|0)==(0);
  if ($14) {
   $15 = HEAP32[$11>>2]|0;
   $16 = ($15|0)>(0);
   if ($16) {
    $17 = HEAP32[$11>>2]|0;
    $$04857 = 0;
    while(1) {
     $21 = (((($2)) + 1040|0) + ($$04857<<2)|0);
     $22 = HEAP32[$21>>2]|0;
     $23 = ($22|0)==(1);
     $24 = ((24423 + ($$05160<<5)|0) + ($$04857)|0);
     if ($23) {
      HEAP8[$24>>0] = 1;
      HEAP32[751] = $$04857;
     } else {
      HEAP8[$24>>0] = 0;
     }
     $25 = (($$04857) + 1)|0;
     $26 = ($25|0)<($17|0);
     $27 = ($25|0)<(32);
     $28 = $27 & $26;
     if ($28) {
      $$04857 = $25;
     } else {
      break;
     }
    }
   }
   $18 = HEAP32[$12>>2]|0;
   $19 = ($18|0)>(0);
   if ($19) {
    $20 = HEAP32[$12>>2]|0;
    $$058 = 0;
    while(1) {
     $29 = (((($2)) + 16|0) + ($$058<<3)|0);
     $30 = +HEAPF64[$29>>3];
     $31 = $30;
     $32 = ((22168 + ($$05160<<5)|0) + ($$058<<2)|0);
     HEAPF32[$32>>2] = $31;
     $33 = (($$058) + 1)|0;
     $34 = ($33|0)<($20|0);
     $35 = ($33|0)<(8);
     $36 = $35 & $34;
     if ($36) {
      $$058 = $33;
     } else {
      $$lcssa = $20;
      break;
     }
    }
   } else {
    $$lcssa = $18;
   }
   HEAP32[5541] = $$lcssa;
  }
  $37 = (($$05160) + 1)|0;
  $38 = ($37|0)<($9|0);
  $39 = ($37|0)<(4);
  $40 = $38 & $39;
  if ($40) {
   $$05160 = $37;
  } else {
   break;
  }
 }
 STACKTOP = sp;return;
}
function _Wait($0) {
 $0 = +$0;
 var $1 = 0.0, $2 = 0.0, $3 = 0.0, $4 = 0.0, $5 = 0, $6 = 0.0, $7 = 0.0, $8 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = (+_GetTime());
 $2 = 0.0 - $1;
 $3 = $0 / 1000.0;
 $4 = $3;
 $5 = $2 < $4;
 if (!($5)) {
  return;
 }
 while(1) {
  $6 = (+_GetTime());
  $7 = $6 - $1;
  $8 = $7 < $4;
  if (!($8)) {
   break;
  }
 }
 return;
}
function _UpdateDefaultBuffers() {
 var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
 var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
 var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $0 = HEAP32[5487]|0;
 $1 = ($0|0)>(0);
 if ($1) {
  $2 = HEAP32[5189]|0;
  $3 = ($2|0)==(0);
  if (!($3)) {
   $4 = HEAP32[5191]|0;
   $5 = HEAP32[(21976)>>2]|0;
   FUNCTION_TABLE_vi[$4 & 31]($5);
  }
  $6 = HEAP32[(21980)>>2]|0;
  _glBindBuffer(34962,($6|0));
  $7 = HEAP32[5487]|0;
  $8 = ($7*12)|0;
  $9 = HEAP32[(21960)>>2]|0;
  _glBufferSubData(34962,0,($8|0),($9|0));
  $10 = HEAP32[(21984)>>2]|0;
  _glBindBuffer(34962,($10|0));
  $11 = HEAP32[(21956)>>2]|0;
  $12 = $11 << 2;
  $13 = HEAP32[(21968)>>2]|0;
  _glBufferSubData(34962,0,($12|0),($13|0));
 }
 $14 = HEAP32[5499]|0;
 $15 = ($14|0)>(0);
 if ($15) {
  $16 = HEAP32[5189]|0;
  $17 = ($16|0)==(0);
  if (!($17)) {
   $18 = HEAP32[5191]|0;
   $19 = HEAP32[(22024)>>2]|0;
   FUNCTION_TABLE_vi[$18 & 31]($19);
  }
  $20 = HEAP32[(22028)>>2]|0;
  _glBindBuffer(34962,($20|0));
  $21 = HEAP32[5499]|0;
  $22 = ($21*12)|0;
  $23 = HEAP32[(22008)>>2]|0;
  _glBufferSubData(34962,0,($22|0),($23|0));
  $24 = HEAP32[(22032)>>2]|0;
  _glBindBuffer(34962,($24|0));
  $25 = HEAP32[(22004)>>2]|0;
  $26 = $25 << 2;
  $27 = HEAP32[(22016)>>2]|0;
  _glBufferSubData(34962,0,($26|0),($27|0));
 }
 $28 = HEAP32[5511]|0;
 $29 = ($28|0)>(0);
 if ($29) {
  $30 = HEAP32[5189]|0;
  $31 = ($30|0)==(0);
  if (!($31)) {
   $32 = HEAP32[5191]|0;
   $33 = HEAP32[(22072)>>2]|0;
   FUNCTION_TABLE_vi[$32 & 31]($33);
  }
  $34 = HEAP32[(22076)>>2]|0;
  _glBindBuffer(34962,($34|0));
  $35 = HEAP32[5511]|0;
  $36 = ($35*12)|0;
  $37 = HEAP32[(22056)>>2]|0;
  _glBufferSubData(34962,0,($36|0),($37|0));
  $38 = HEAP32[(22080)>>2]|0;
  _glBindBuffer(34962,($38|0));
  $39 = HEAP32[5511]|0;
  $40 = $39 << 3;
  $41 = HEAP32[(22060)>>2]|0;
  _glBufferSubData(34962,0,($40|0),($41|0));
  $42 = HEAP32[(22084)>>2]|0;
  _glBindBuffer(34962,($42|0));
  $43 = HEAP32[5511]|0;
  $44 = $43 << 2;
  $45 = HEAP32[(22064)>>2]|0;
  _glBufferSubData(34962,0,($44|0),($45|0));
 }
 $46 = HEAP32[5189]|0;
 $47 = ($46|0)==(0);
 if ($47) {
  return;
 }
 $48 = HEAP32[5191]|0;
 FUNCTION_TABLE_vi[$48 & 31](0);
 return;
}
function _DrawDefaultBuffers() {
 var $$ = 0, $$02830 = 0, $$02932 = 0, $$031 = 0, $$byval_copy2 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0;
 var $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0;
 var $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0;
 var $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0;
 var $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $modelview$byval_copy = 0;
 var $or$cond = 0, $or$cond3 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 320|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(320|0);
 $$byval_copy2 = sp + 256|0;
 $modelview$byval_copy = sp + 192|0;
 $0 = sp + 128|0;
 $1 = sp + 64|0;
 $2 = sp;
 dest=$0; src=20624; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
 dest=$1; src=20688; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
 $3 = HEAP32[5574]|0;
 $4 = ($3|0)!=(0);
 $$ = $4 ? 2 : 1;
 $$02932 = 0;
 while(1) {
  if ($4) {
   dest=$modelview$byval_copy; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
   dest=$$byval_copy2; src=$1; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
   _SetStereoView($$02932,$modelview$byval_copy,$$byval_copy2);
  }
  $8 = HEAP32[5487]|0;
  $9 = ($8|0)>(0);
  $10 = HEAP32[5499]|0;
  $11 = ($10|0)>(0);
  $or$cond = $9 | $11;
  $12 = HEAP32[5511]|0;
  $13 = ($12|0)>(0);
  $or$cond3 = $or$cond | $13;
  if ($or$cond3) {
   $14 = HEAP32[5211]|0;
   _glUseProgram(($14|0));
   dest=$modelview$byval_copy; src=20688; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
   dest=$$byval_copy2; src=20624; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
   _MatrixMultiply($2,$modelview$byval_copy,$$byval_copy2);
   $15 = HEAP32[(20872)>>2]|0;
   dest=$$byval_copy2; src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
   $16 = (_MatrixToFloat($$byval_copy2)|0);
   _glUniformMatrix4fv(($15|0),1,0,($16|0));
   $17 = HEAP32[(20876)>>2]|0;
   _glUniform4f(($17|0),1.0,1.0,1.0,1.0);
   $18 = HEAP32[(20888)>>2]|0;
   _glUniform1i(($18|0),0);
  }
  $19 = HEAP32[5487]|0;
  $20 = ($19|0)>(0);
  if ($20) {
   $21 = HEAP32[5196]|0;
   _glBindTexture(3553,($21|0));
   $22 = HEAP32[5189]|0;
   $23 = ($22|0)==(0);
   if ($23) {
    $26 = HEAP32[(21980)>>2]|0;
    _glBindBuffer(34962,($26|0));
    $27 = HEAP32[(20848)>>2]|0;
    _glVertexAttribPointer(($27|0),3,5126,0,0,(0|0));
    $28 = HEAP32[(20848)>>2]|0;
    _glEnableVertexAttribArray(($28|0));
    $29 = HEAP32[(21984)>>2]|0;
    _glBindBuffer(34962,($29|0));
    $30 = HEAP32[(20868)>>2]|0;
    _glVertexAttribPointer(($30|0),4,5121,1,0,(0|0));
    $31 = HEAP32[(20868)>>2]|0;
    _glEnableVertexAttribArray(($31|0));
   } else {
    $24 = HEAP32[5191]|0;
    $25 = HEAP32[(21976)>>2]|0;
    FUNCTION_TABLE_vi[$24 & 31]($25);
   }
   $32 = HEAP32[5487]|0;
   _glDrawArrays(1,0,($32|0));
   $33 = HEAP32[5189]|0;
   $34 = ($33|0)==(0);
   if ($34) {
    _glBindBuffer(34962,0);
   }
   _glBindTexture(3553,0);
  }
  $35 = HEAP32[5499]|0;
  $36 = ($35|0)>(0);
  if ($36) {
   $37 = HEAP32[5196]|0;
   _glBindTexture(3553,($37|0));
   $38 = HEAP32[5189]|0;
   $39 = ($38|0)==(0);
   if ($39) {
    $42 = HEAP32[(22028)>>2]|0;
    _glBindBuffer(34962,($42|0));
    $43 = HEAP32[(20848)>>2]|0;
    _glVertexAttribPointer(($43|0),3,5126,0,0,(0|0));
    $44 = HEAP32[(20848)>>2]|0;
    _glEnableVertexAttribArray(($44|0));
    $45 = HEAP32[(22032)>>2]|0;
    _glBindBuffer(34962,($45|0));
    $46 = HEAP32[(20868)>>2]|0;
    _glVertexAttribPointer(($46|0),4,5121,1,0,(0|0));
    $47 = HEAP32[(20868)>>2]|0;
    _glEnableVertexAttribArray(($47|0));
   } else {
    $40 = HEAP32[5191]|0;
    $41 = HEAP32[(22024)>>2]|0;
    FUNCTION_TABLE_vi[$40 & 31]($41);
   }
   $48 = HEAP32[5499]|0;
   _glDrawArrays(4,0,($48|0));
   $49 = HEAP32[5189]|0;
   $50 = ($49|0)==(0);
   if ($50) {
    _glBindBuffer(34962,0);
   }
   _glBindTexture(3553,0);
  }
  $51 = HEAP32[5511]|0;
  $52 = ($51|0)>(0);
  if ($52) {
   $53 = HEAP32[5189]|0;
   $54 = ($53|0)==(0);
   if ($54) {
    $57 = HEAP32[(22076)>>2]|0;
    _glBindBuffer(34962,($57|0));
    $58 = HEAP32[(20848)>>2]|0;
    _glVertexAttribPointer(($58|0),3,5126,0,0,(0|0));
    $59 = HEAP32[(20848)>>2]|0;
    _glEnableVertexAttribArray(($59|0));
    $60 = HEAP32[(22080)>>2]|0;
    _glBindBuffer(34962,($60|0));
    $61 = HEAP32[(20852)>>2]|0;
    _glVertexAttribPointer(($61|0),2,5126,0,0,(0|0));
    $62 = HEAP32[(20852)>>2]|0;
    _glEnableVertexAttribArray(($62|0));
    $63 = HEAP32[(22084)>>2]|0;
    _glBindBuffer(34962,($63|0));
    $64 = HEAP32[(20868)>>2]|0;
    _glVertexAttribPointer(($64|0),4,5121,1,0,(0|0));
    $65 = HEAP32[(20868)>>2]|0;
    _glEnableVertexAttribArray(($65|0));
    $66 = HEAP32[(22088)>>2]|0;
    _glBindBuffer(34963,($66|0));
   } else {
    $55 = HEAP32[5191]|0;
    $56 = HEAP32[(22072)>>2]|0;
    FUNCTION_TABLE_vi[$55 & 31]($56);
   }
   $67 = HEAP32[5227]|0;
   $68 = ($67|0)>(0);
   if ($68) {
    $$02830 = 0;$$031 = 0;
    while(1) {
     $71 = HEAP32[5226]|0;
     $72 = (($71) + (($$031*144)|0)|0);
     $73 = HEAP32[$72>>2]|0;
     $74 = (($73|0) / 4)&-1;
     $75 = ($74*6)|0;
     $76 = (((($71) + (($$031*144)|0)|0)) + 8|0);
     $77 = HEAP32[$76>>2]|0;
     _glBindTexture(3553,($77|0));
     $78 = $$02830 << 1;
     $79 = $78;
     _glDrawElements(4,($75|0),5123,($79|0));
     $80 = HEAP32[5226]|0;
     $81 = (($80) + (($$031*144)|0)|0);
     $82 = HEAP32[$81>>2]|0;
     $83 = (($82|0) / 4)&-1;
     $84 = ($83*6)|0;
     $85 = (($84) + ($$02830))|0;
     $86 = (($$031) + 1)|0;
     $87 = HEAP32[5227]|0;
     $88 = ($86|0)<($87|0);
     if ($88) {
      $$02830 = $85;$$031 = $86;
     } else {
      break;
     }
    }
   }
   $69 = HEAP32[5189]|0;
   $70 = ($69|0)==(0);
   if ($70) {
    _glBindBuffer(34962,0);
    _glBindBuffer(34963,0);
   }
   _glBindTexture(3553,0);
  }
  $89 = HEAP32[5189]|0;
  $90 = ($89|0)==(0);
  if (!($90)) {
   $91 = HEAP32[5191]|0;
   FUNCTION_TABLE_vi[$91 & 31](0);
  }
  _glUseProgram(0);
  $92 = (($$02932) + 1)|0;
  $93 = ($92|0)<($$|0);
  if ($93) {
   $$02932 = $92;
  } else {
   break;
  }
 }
 HEAP32[5227] = 1;
 $5 = HEAP32[5196]|0;
 $6 = HEAP32[5226]|0;
 $7 = ((($6)) + 8|0);
 HEAP32[$7>>2] = $5;
 HEAP32[$6>>2] = 0;
 HEAP32[5487] = 0;
 HEAP32[(21956)>>2] = 0;
 HEAP32[5499] = 0;
 HEAP32[(22004)>>2] = 0;
 HEAP32[5511] = 0;
 HEAP32[(22048)>>2] = 0;
 HEAP32[(22052)>>2] = 0;
 HEAPF32[752] = -1.0;
 dest=20624; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
 dest=20688; src=$1; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
 STACKTOP = sp;return;
}
function _SetStereoView($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $$byval_copy = 0, $$byval_copy3 = 0, $10 = 0, $11 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 256|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(256|0);
 $$byval_copy3 = sp + 192|0;
 $$byval_copy = sp + 64|0;
 $3 = sp;
 $4 = sp + 128|0;
 dest=$3; src=$1; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
 $5 = HEAP32[5485]|0;
 $6 = Math_imul($5, $0)|0;
 $7 = (($6|0) / 2)&-1;
 $8 = (($5|0) / 2)&-1;
 $9 = HEAP32[5486]|0;
 _rlViewport($7,0,$8,$9);
 $10 = (22528 + ($0<<6)|0);
 dest=$$byval_copy; src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
 dest=$$byval_copy3; src=$10; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
 _MatrixMultiply($4,$$byval_copy,$$byval_copy3);
 $11 = (22400 + ($0<<6)|0);
 dest=$3; src=$11; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
 dest=$$byval_copy3; src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
 _SetMatrixModelview($$byval_copy3);
 dest=$$byval_copy3; src=$3; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
 _SetMatrixProjection($$byval_copy3);
 STACKTOP = sp;return;
}
function _SetMatrixModelview($0) {
 $0 = $0|0;
 var dest = 0, label = 0, sp = 0, src = 0, stop = 0;
 sp = STACKTOP;
 dest=20688; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
 return;
}
function _SetMatrixProjection($0) {
 $0 = $0|0;
 var dest = 0, label = 0, sp = 0, src = 0, stop = 0;
 sp = STACKTOP;
 dest=20624; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
 return;
}
function _rlPushMatrix() {
 var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $vararg_buffer = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $vararg_buffer = sp;
 $0 = HEAP32[5664]|0;
 $1 = ($0|0)==(15);
 if ($1) {
  HEAP32[$vararg_buffer>>2] = 16;
  _TraceLog(1,9838,$vararg_buffer);
 }
 $2 = HEAP32[5664]|0;
 $3 = (20916 + ($2<<6)|0);
 $4 = HEAP32[5155]|0;
 dest=$3; src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
 _rlLoadIdentity();
 $5 = HEAP32[5664]|0;
 $6 = (($5) + 1)|0;
 HEAP32[5664] = $6;
 $7 = HEAP32[5188]|0;
 $8 = ($7|0)==(5888);
 if (!($8)) {
  STACKTOP = sp;return;
 }
 HEAP32[5665] = 1;
 STACKTOP = sp;return;
}
function _rlPopMatrix() {
 var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $0 = HEAP32[5664]|0;
 $1 = ($0|0)>(0);
 if (!($1)) {
  return;
 }
 $2 = HEAP32[5664]|0;
 $3 = (($2) + -1)|0;
 $4 = (20916 + ($3<<6)|0);
 $5 = HEAP32[5155]|0;
 _memmove(($5|0),($4|0),64)|0;
 $6 = (($2) + -1)|0;
 HEAP32[5664] = $6;
 return;
}
function _IsFileExtension($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$ = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = (_strrchr($0,46)|0);
 $3 = ($2|0)==(0|0);
 if ($3) {
  return 0;
 } else {
  $4 = (_strcmp($2,$1)|0);
  $5 = ($4|0)==(0);
  $$ = $5&1;
  return ($$|0);
 }
 return (0)|0;
}
function _rlTranslatef($0,$1,$2) {
 $0 = +$0;
 $1 = +$1;
 $2 = +$2;
 var $$byval_copy = 0, $$byval_copy1 = 0, $3 = 0, $4 = 0, $5 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 256|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(256|0);
 $$byval_copy1 = sp + 192|0;
 $$byval_copy = sp + 128|0;
 $3 = sp + 64|0;
 $4 = sp;
 _MatrixTranslate($3,$0,$1,$2);
 _MatrixTranspose($3);
 $5 = HEAP32[5155]|0;
 dest=$$byval_copy; src=$5; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
 dest=$$byval_copy1; src=$3; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
 _MatrixMultiply($4,$$byval_copy,$$byval_copy1);
 dest=$5; src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
 STACKTOP = sp;return;
}
function _rlRotatef($0,$1,$2,$3) {
 $0 = +$0;
 $1 = +$1;
 $2 = +$2;
 $3 = +$3;
 var $$byval_copy1 = 0, $$byval_copy2 = 0, $10 = 0.0, $11 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 336|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(336|0);
 $$byval_copy2 = sp + 272|0;
 $$byval_copy1 = sp + 208|0;
 $4 = sp + 144|0;
 $5 = sp + 64|0;
 $6 = sp + 80|0;
 $7 = sp;
 _MatrixIdentity($4);
 HEAPF32[$5>>2] = $1;
 $8 = ((($5)) + 4|0);
 HEAPF32[$8>>2] = $2;
 $9 = ((($5)) + 8|0);
 HEAPF32[$9>>2] = $3;
 _VectorNormalize($5);
 $10 = $0 * 0.01745329238474369;
 ;HEAP32[$$byval_copy2>>2]=HEAP32[$5>>2]|0;HEAP32[$$byval_copy2+4>>2]=HEAP32[$5+4>>2]|0;HEAP32[$$byval_copy2+8>>2]=HEAP32[$5+8>>2]|0;
 _MatrixRotate($6,$$byval_copy2,$10);
 dest=$4; src=$6; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
 _MatrixTranspose($4);
 $11 = HEAP32[5155]|0;
 dest=$$byval_copy1; src=$11; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
 dest=$$byval_copy2; src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
 _MatrixMultiply($7,$$byval_copy1,$$byval_copy2);
 dest=$11; src=$7; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
 STACKTOP = sp;return;
}
function _rlBegin($0) {
 $0 = $0|0;
 var label = 0, sp = 0;
 sp = STACKTOP;
 HEAP32[5228] = $0;
 return;
}
function _rlEnd() {
 var $$03956 = 0, $$04052 = 0, $$04154 = 0, $$04248 = 0, $$04347 = 0, $$byval_copy = 0, $$promoted = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0;
 var $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0;
 var $128 = 0, $129 = 0, $13 = 0.0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0;
 var $146 = 0, $147 = 0, $148 = 0.0, $149 = 0.0, $15 = 0.0, $16 = 0, $17 = 0.0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0;
 var $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0;
 var $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0;
 var $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0;
 var $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $exitcond = 0, $exitcond60 = 0, $exitcond63 = 0;
 var $scevgep = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(64|0);
 $$byval_copy = sp;
 $0 = HEAP32[5665]|0;
 $1 = ($0|0)==(0);
 if (!($1)) {
  $2 = HEAP32[5666]|0;
  $3 = ($2|0)>(0);
  if ($3) {
   $$03956 = 0;
   while(1) {
    $6 = HEAP32[5225]|0;
    $7 = (($6) + (($$03956*12)|0)|0);
    $8 = HEAP32[5155]|0;
    dest=$$byval_copy; src=$8; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
    _VectorTransform($7,$$byval_copy);
    $9 = (($$03956) + 1)|0;
    $5 = HEAP32[5666]|0;
    $10 = ($9|0)<($5|0);
    if ($10) {
     $$03956 = $9;
    } else {
     break;
    }
   }
   HEAP32[5665] = 0;
   $4 = ($5|0)>(0);
   if ($4) {
    $$04154 = 0;
    while(1) {
     $11 = HEAP32[5225]|0;
     $12 = (($11) + (($$04154*12)|0)|0);
     $13 = +HEAPF32[$12>>2];
     $14 = (((($11) + (($$04154*12)|0)|0)) + 4|0);
     $15 = +HEAPF32[$14>>2];
     $16 = (((($11) + (($$04154*12)|0)|0)) + 8|0);
     $17 = +HEAPF32[$16>>2];
     _rlVertex3f($13,$15,$17);
     $18 = (($$04154) + 1)|0;
     $19 = HEAP32[5666]|0;
     $20 = ($18|0)<($19|0);
     if ($20) {
      $$04154 = $18;
     } else {
      break;
     }
    }
   }
  } else {
   HEAP32[5665] = 0;
  }
  HEAP32[5666] = 0;
 }
 $21 = HEAP32[5228]|0;
 switch ($21|0) {
 case 1:  {
  $22 = HEAP32[5487]|0;
  $23 = HEAP32[(21956)>>2]|0;
  $24 = ($22|0)==($23|0);
  if ($24) {
   $148 = +HEAPF32[752];
   $149 = $148 + 4.9999998736893758E-5;
   HEAPF32[752] = $149;
   STACKTOP = sp;return;
  }
  $25 = (($22) - ($23))|0;
  $26 = ($25|0)>(0);
  if ($26) {
   $$04347 = 0;
  } else {
   $148 = +HEAPF32[752];
   $149 = $148 + 4.9999998736893758E-5;
   HEAPF32[752] = $149;
   STACKTOP = sp;return;
  }
  while(1) {
   $27 = HEAP32[(21968)>>2]|0;
   $28 = HEAP32[(21956)>>2]|0;
   $29 = $28 << 2;
   $30 = (($29) + -4)|0;
   $31 = (($27) + ($30)|0);
   $32 = HEAP8[$31>>0]|0;
   $33 = (($27) + ($29)|0);
   HEAP8[$33>>0] = $32;
   $34 = HEAP32[(21968)>>2]|0;
   $35 = HEAP32[(21956)>>2]|0;
   $36 = $35 << 2;
   $37 = (($36) + -3)|0;
   $38 = (($34) + ($37)|0);
   $39 = HEAP8[$38>>0]|0;
   $40 = $36 | 1;
   $41 = (($34) + ($40)|0);
   HEAP8[$41>>0] = $39;
   $42 = HEAP32[(21968)>>2]|0;
   $43 = HEAP32[(21956)>>2]|0;
   $44 = $43 << 2;
   $45 = (($44) + -2)|0;
   $46 = (($42) + ($45)|0);
   $47 = HEAP8[$46>>0]|0;
   $48 = $44 | 2;
   $49 = (($42) + ($48)|0);
   HEAP8[$49>>0] = $47;
   $50 = HEAP32[(21968)>>2]|0;
   $51 = HEAP32[(21956)>>2]|0;
   $52 = $51 << 2;
   $53 = (($52) + -1)|0;
   $54 = (($50) + ($53)|0);
   $55 = HEAP8[$54>>0]|0;
   $56 = $52 | 3;
   $57 = (($50) + ($56)|0);
   HEAP8[$57>>0] = $55;
   $58 = HEAP32[(21956)>>2]|0;
   $59 = (($58) + 1)|0;
   HEAP32[(21956)>>2] = $59;
   $60 = (($$04347) + 1)|0;
   $exitcond = ($60|0)==($25|0);
   if ($exitcond) {
    break;
   } else {
    $$04347 = $60;
   }
  }
  $148 = +HEAPF32[752];
  $149 = $148 + 4.9999998736893758E-5;
  HEAPF32[752] = $149;
  STACKTOP = sp;return;
  break;
 }
 case 4:  {
  $61 = HEAP32[5499]|0;
  $62 = HEAP32[(22004)>>2]|0;
  $63 = ($61|0)==($62|0);
  if ($63) {
   $148 = +HEAPF32[752];
   $149 = $148 + 4.9999998736893758E-5;
   HEAPF32[752] = $149;
   STACKTOP = sp;return;
  }
  $64 = (($61) - ($62))|0;
  $65 = ($64|0)>(0);
  if ($65) {
   $$04248 = 0;
  } else {
   $148 = +HEAPF32[752];
   $149 = $148 + 4.9999998736893758E-5;
   HEAPF32[752] = $149;
   STACKTOP = sp;return;
  }
  while(1) {
   $66 = HEAP32[(22016)>>2]|0;
   $67 = HEAP32[(22004)>>2]|0;
   $68 = $67 << 2;
   $69 = (($68) + -4)|0;
   $70 = (($66) + ($69)|0);
   $71 = HEAP8[$70>>0]|0;
   $72 = (($66) + ($68)|0);
   HEAP8[$72>>0] = $71;
   $73 = HEAP32[(22016)>>2]|0;
   $74 = HEAP32[(22004)>>2]|0;
   $75 = $74 << 2;
   $76 = (($75) + -3)|0;
   $77 = (($73) + ($76)|0);
   $78 = HEAP8[$77>>0]|0;
   $79 = $75 | 1;
   $80 = (($73) + ($79)|0);
   HEAP8[$80>>0] = $78;
   $81 = HEAP32[(22016)>>2]|0;
   $82 = HEAP32[(22004)>>2]|0;
   $83 = $82 << 2;
   $84 = (($83) + -2)|0;
   $85 = (($81) + ($84)|0);
   $86 = HEAP8[$85>>0]|0;
   $87 = $83 | 2;
   $88 = (($81) + ($87)|0);
   HEAP8[$88>>0] = $86;
   $89 = HEAP32[(22016)>>2]|0;
   $90 = HEAP32[(22004)>>2]|0;
   $91 = $90 << 2;
   $92 = (($91) + -1)|0;
   $93 = (($89) + ($92)|0);
   $94 = HEAP8[$93>>0]|0;
   $95 = $91 | 3;
   $96 = (($89) + ($95)|0);
   HEAP8[$96>>0] = $94;
   $97 = HEAP32[(22004)>>2]|0;
   $98 = (($97) + 1)|0;
   HEAP32[(22004)>>2] = $98;
   $99 = (($$04248) + 1)|0;
   $exitcond60 = ($99|0)==($64|0);
   if ($exitcond60) {
    break;
   } else {
    $$04248 = $99;
   }
  }
  $148 = +HEAPF32[752];
  $149 = $148 + 4.9999998736893758E-5;
  HEAPF32[752] = $149;
  STACKTOP = sp;return;
  break;
 }
 case 7:  {
  $100 = HEAP32[5511]|0;
  $101 = HEAP32[(22052)>>2]|0;
  $102 = ($100|0)==($101|0);
  if (!($102)) {
   $103 = (($100) - ($101))|0;
   $104 = ($103|0)>(0);
   if ($104) {
    $$04052 = 0;
    while(1) {
     $105 = HEAP32[(22064)>>2]|0;
     $106 = HEAP32[(22052)>>2]|0;
     $107 = $106 << 2;
     $108 = (($107) + -4)|0;
     $109 = (($105) + ($108)|0);
     $110 = HEAP8[$109>>0]|0;
     $111 = (($105) + ($107)|0);
     HEAP8[$111>>0] = $110;
     $112 = HEAP32[(22064)>>2]|0;
     $113 = HEAP32[(22052)>>2]|0;
     $114 = $113 << 2;
     $115 = (($114) + -3)|0;
     $116 = (($112) + ($115)|0);
     $117 = HEAP8[$116>>0]|0;
     $118 = $114 | 1;
     $119 = (($112) + ($118)|0);
     HEAP8[$119>>0] = $117;
     $120 = HEAP32[(22064)>>2]|0;
     $121 = HEAP32[(22052)>>2]|0;
     $122 = $121 << 2;
     $123 = (($122) + -2)|0;
     $124 = (($120) + ($123)|0);
     $125 = HEAP8[$124>>0]|0;
     $126 = $122 | 2;
     $127 = (($120) + ($126)|0);
     HEAP8[$127>>0] = $125;
     $128 = HEAP32[(22064)>>2]|0;
     $129 = HEAP32[(22052)>>2]|0;
     $130 = $129 << 2;
     $131 = (($130) + -1)|0;
     $132 = (($128) + ($131)|0);
     $133 = HEAP8[$132>>0]|0;
     $134 = $130 | 3;
     $135 = (($128) + ($134)|0);
     HEAP8[$135>>0] = $133;
     $136 = HEAP32[(22052)>>2]|0;
     $137 = (($136) + 1)|0;
     HEAP32[(22052)>>2] = $137;
     $138 = (($$04052) + 1)|0;
     $exitcond63 = ($138|0)==($103|0);
     if ($exitcond63) {
      break;
     } else {
      $$04052 = $138;
     }
    }
   }
  }
  $139 = HEAP32[5511]|0;
  $140 = HEAP32[(22048)>>2]|0;
  $141 = ($139|0)>($140|0);
  if (!($141)) {
   $148 = +HEAPF32[752];
   $149 = $148 + 4.9999998736893758E-5;
   HEAPF32[752] = $149;
   STACKTOP = sp;return;
  }
  $142 = HEAP32[(22060)>>2]|0;
  $$promoted = HEAP32[(22048)>>2]|0;
  $143 = $$promoted << 1;
  $scevgep = (($142) + ($143<<2)|0);
  $144 = (($139) - ($140))|0;
  $145 = $144 << 3;
  _memset(($scevgep|0),0,($145|0))|0;
  $146 = (($139) + ($$promoted))|0;
  $147 = (($146) - ($140))|0;
  HEAP32[(22048)>>2] = $147;
  $148 = +HEAPF32[752];
  $149 = $148 + 4.9999998736893758E-5;
  HEAPF32[752] = $149;
  STACKTOP = sp;return;
  break;
 }
 default: {
  $148 = +HEAPF32[752];
  $149 = $148 + 4.9999998736893758E-5;
  HEAPF32[752] = $149;
  STACKTOP = sp;return;
 }
 }
}
function _rlVertex3f($0,$1,$2) {
 $0 = +$0;
 $1 = +$1;
 $2 = +$2;
 var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0;
 var $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0;
 var $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer3 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
 $vararg_buffer3 = sp + 16|0;
 $vararg_buffer1 = sp + 8|0;
 $vararg_buffer = sp;
 $3 = HEAP32[5665]|0;
 $4 = ($3|0)==(0);
 if (!($4)) {
  $5 = HEAP32[5225]|0;
  $6 = HEAP32[5666]|0;
  $7 = (($5) + (($6*12)|0)|0);
  HEAPF32[$7>>2] = $0;
  $8 = (((($5) + (($6*12)|0)|0)) + 4|0);
  HEAPF32[$8>>2] = $1;
  $9 = (((($5) + (($6*12)|0)|0)) + 8|0);
  HEAPF32[$9>>2] = $2;
  $10 = (($6) + 1)|0;
  HEAP32[5666] = $10;
  STACKTOP = sp;return;
 }
 $11 = HEAP32[5228]|0;
 switch ($11|0) {
 case 1:  {
  $12 = HEAP32[5487]|0;
  $13 = ($12|0)<(2048);
  if ($13) {
   $14 = HEAP32[(21960)>>2]|0;
   $15 = ($12*3)|0;
   $16 = (($14) + ($15<<2)|0);
   HEAPF32[$16>>2] = $0;
   $17 = (($15) + 1)|0;
   $18 = (($14) + ($17<<2)|0);
   HEAPF32[$18>>2] = $1;
   $19 = (($15) + 2)|0;
   $20 = (($14) + ($19<<2)|0);
   HEAPF32[$20>>2] = $2;
   $21 = (($12) + 1)|0;
   HEAP32[5487] = $21;
   STACKTOP = sp;return;
  } else {
   _TraceLog(1,9876,$vararg_buffer);
   STACKTOP = sp;return;
  }
  break;
 }
 case 4:  {
  $22 = HEAP32[5499]|0;
  $23 = ($22|0)<(6144);
  if ($23) {
   $24 = HEAP32[(22008)>>2]|0;
   $25 = ($22*3)|0;
   $26 = (($24) + ($25<<2)|0);
   HEAPF32[$26>>2] = $0;
   $27 = (($25) + 1)|0;
   $28 = (($24) + ($27<<2)|0);
   HEAPF32[$28>>2] = $1;
   $29 = (($25) + 2)|0;
   $30 = (($24) + ($29<<2)|0);
   HEAPF32[$30>>2] = $2;
   $31 = (($22) + 1)|0;
   HEAP32[5499] = $31;
   STACKTOP = sp;return;
  } else {
   _TraceLog(1,9901,$vararg_buffer1);
   STACKTOP = sp;return;
  }
  break;
 }
 case 7:  {
  $32 = HEAP32[5511]|0;
  $33 = ($32|0)<(4096);
  if ($33) {
   $34 = HEAP32[(22056)>>2]|0;
   $35 = ($32*3)|0;
   $36 = (($34) + ($35<<2)|0);
   HEAPF32[$36>>2] = $0;
   $37 = (($35) + 1)|0;
   $38 = (($34) + ($37<<2)|0);
   HEAPF32[$38>>2] = $1;
   $39 = (($35) + 2)|0;
   $40 = (($34) + ($39<<2)|0);
   HEAPF32[$40>>2] = $2;
   $41 = (($32) + 1)|0;
   HEAP32[5511] = $41;
   $42 = HEAP32[5226]|0;
   $43 = HEAP32[5227]|0;
   $44 = (($43) + -1)|0;
   $45 = (($42) + (($44*144)|0)|0);
   $46 = HEAP32[$45>>2]|0;
   $47 = (($46) + 1)|0;
   HEAP32[$45>>2] = $47;
   STACKTOP = sp;return;
  } else {
   _TraceLog(1,9930,$vararg_buffer3);
   STACKTOP = sp;return;
  }
  break;
 }
 default: {
  STACKTOP = sp;return;
 }
 }
}
function _rlVertex2f($0,$1) {
 $0 = +$0;
 $1 = +$1;
 var $2 = 0.0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = +HEAPF32[752];
 _rlVertex3f($0,$1,$2);
 return;
}
function _rlVertex2i($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $2 = 0.0, $3 = 0.0, $4 = 0.0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = (+($0|0));
 $3 = (+($1|0));
 $4 = +HEAPF32[752];
 _rlVertex3f($2,$3,$4);
 return;
}
function _rlTexCoord2f($0,$1) {
 $0 = +$0;
 $1 = +$1;
 var $10 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = HEAP32[5228]|0;
 $3 = ($2|0)==(7);
 if (!($3)) {
  return;
 }
 $4 = HEAP32[(22060)>>2]|0;
 $5 = HEAP32[(22048)>>2]|0;
 $6 = $5 << 1;
 $7 = (($4) + ($6<<2)|0);
 HEAPF32[$7>>2] = $0;
 $8 = $6 | 1;
 $9 = (($4) + ($8<<2)|0);
 HEAPF32[$9>>2] = $1;
 $10 = (($5) + 1)|0;
 HEAP32[(22048)>>2] = $10;
 return;
}
function _rlNormal3f($0,$1,$2) {
 $0 = +$0;
 $1 = +$1;
 $2 = +$2;
 var label = 0, sp = 0;
 sp = STACKTOP;
 return;
}
function _rlColor4ub($0,$1,$2,$3) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 var $$sink37 = 0, $$sink38 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $4 = 0, $5 = 0;
 var $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $4 = HEAP32[5228]|0;
 switch ($4|0) {
 case 1:  {
  $$sink37 = (21956);$$sink38 = (21968);
  break;
 }
 case 4:  {
  $$sink37 = (22004);$$sink38 = (22016);
  break;
 }
 case 7:  {
  $$sink37 = (22052);$$sink38 = (22064);
  break;
 }
 default: {
  return;
 }
 }
 $5 = HEAP32[$$sink38>>2]|0;
 $6 = HEAP32[$$sink37>>2]|0;
 $7 = $6 << 2;
 $8 = (($5) + ($7)|0);
 HEAP8[$8>>0] = $0;
 $9 = HEAP32[$$sink38>>2]|0;
 $10 = HEAP32[$$sink37>>2]|0;
 $11 = $10 << 2;
 $12 = $11 | 1;
 $13 = (($9) + ($12)|0);
 HEAP8[$13>>0] = $1;
 $14 = HEAP32[$$sink38>>2]|0;
 $15 = HEAP32[$$sink37>>2]|0;
 $16 = $15 << 2;
 $17 = $16 | 2;
 $18 = (($14) + ($17)|0);
 HEAP8[$18>>0] = $2;
 $19 = HEAP32[$$sink38>>2]|0;
 $20 = HEAP32[$$sink37>>2]|0;
 $21 = $20 << 2;
 $22 = $21 | 3;
 $23 = (($19) + ($22)|0);
 HEAP8[$23>>0] = $3;
 $24 = HEAP32[$$sink37>>2]|0;
 $25 = (($24) + 1)|0;
 HEAP32[$$sink37>>2] = $25;
 return;
}
function _rlEnableTexture($0) {
 $0 = $0|0;
 var $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = HEAP32[5226]|0;
 $2 = HEAP32[5227]|0;
 $3 = (($2) + -1)|0;
 $4 = (((($1) + (($3*144)|0)|0)) + 8|0);
 $5 = HEAP32[$4>>2]|0;
 $6 = ($5|0)==($0|0);
 if ($6) {
  return;
 }
 $7 = (($1) + (($3*144)|0)|0);
 $8 = HEAP32[$7>>2]|0;
 $9 = ($8|0)>(0);
 if ($9) {
  $10 = (($2) + 1)|0;
  HEAP32[5227] = $10;
 }
 $11 = HEAP32[5227]|0;
 $12 = (($11) + -1)|0;
 $13 = (((($1) + (($12*144)|0)|0)) + 8|0);
 HEAP32[$13>>2] = $0;
 $14 = (($1) + (($12*144)|0)|0);
 HEAP32[$14>>2] = 0;
 return;
}
function _rlDisableTexture() {
 var $0 = 0, $1 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $0 = HEAP32[5511]|0;
 $1 = ($0|0)>(4095);
 if (!($1)) {
  return;
 }
 _rlglDraw();
 return;
}
function _rlTextureParameters($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $10 = 0.0, $3 = 0, $4 = 0, $5 = 0, $6 = 0.0, $7 = 0.0, $8 = 0, $9 = 0, $or$cond = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer4 = 0, $vararg_ptr3 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
 $vararg_buffer4 = sp + 24|0;
 $vararg_buffer1 = sp + 8|0;
 $vararg_buffer = sp;
 _glBindTexture(3553,($0|0));
 L1: do {
  switch ($1|0) {
  case 10243: case 10242:  {
   $3 = ($2|0)!=(34626);
   $4 = HEAP32[5195]|0;
   $5 = ($4|0)!=(0);
   $or$cond = $3 | $5;
   if ($or$cond) {
    _glTexParameteri(3553,($1|0),($2|0));
    break L1;
   } else {
    _TraceLog(2,9955,$vararg_buffer);
    break L1;
   }
   break;
  }
  case 10241: case 10240:  {
   _glTexParameteri(3553,($1|0),($2|0));
   break;
  }
  case 12288:  {
   $6 = (+($2|0));
   $7 = +HEAPF32[5194];
   $8 = !($6 <= $7);
   if (!($8)) {
    _glTexParameterf(3553,34046,(+$6));
    break L1;
   }
   $9 = $7 > 0.0;
   if ($9) {
    $10 = $7;
    HEAP32[$vararg_buffer1>>2] = $0;
    $vararg_ptr3 = ((($vararg_buffer1)) + 8|0);
    HEAPF64[$vararg_ptr3>>3] = $10;
    _TraceLog(2,9992,$vararg_buffer1);
    _glTexParameterf(3553,34046,(+$6));
    break L1;
   } else {
    _TraceLog(2,10054,$vararg_buffer4);
    break L1;
   }
   break;
  }
  default: {
  }
  }
 } while(0);
 _glBindTexture(3553,0);
 STACKTOP = sp;return;
}
function _DrawLine($0,$1,$2,$3,$4) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 $4 = $4|0;
 var $10 = 0, $11 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 _rlBegin(1);
 $5 = HEAP8[$4>>0]|0;
 $6 = ((($4)) + 1|0);
 $7 = HEAP8[$6>>0]|0;
 $8 = ((($4)) + 2|0);
 $9 = HEAP8[$8>>0]|0;
 $10 = ((($4)) + 3|0);
 $11 = HEAP8[$10>>0]|0;
 _rlColor4ub($5,$7,$9,$11);
 _rlVertex2i($0,$1);
 _rlVertex2i($2,$3);
 _rlEnd();
 return;
}
function _stbi__err($0) {
 $0 = $0|0;
 var label = 0, sp = 0;
 sp = STACKTOP;
 HEAP32[5667] = $0;
 return;
}
function _stbi_load_from_file($0,$1,$2,$3,$4) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 $4 = $4|0;
 var $10 = 0, $11 = 0, $12 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 192|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(192|0);
 $5 = sp;
 _stbi__start_file($5,$0);
 $6 = (_stbi__load_and_postprocess_8bit($5,$1,$2,$3,$4)|0);
 $7 = ($6|0)==(0|0);
 if ($7) {
  STACKTOP = sp;return ($6|0);
 }
 $8 = ((($5)) + 172|0);
 $9 = HEAP32[$8>>2]|0;
 $10 = ((($5)) + 168|0);
 $11 = HEAP32[$10>>2]|0;
 $12 = (($11) - ($9))|0;
 (_fseek($0,$12,1)|0);
 STACKTOP = sp;return ($6|0);
}
function _stbi__start_file($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var label = 0, sp = 0;
 sp = STACKTOP;
 _stbi__start_callbacks($0,3124,$1);
 return;
}
function _stbi__load_and_postprocess_8bit($0,$1,$2,$3,$4) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 $4 = $4|0;
 var $$0 = 0, $$070 = 0, $$07175 = 0, $$07276 = 0, $$07378 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0;
 var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $40 = 0, $41 = 0, $42 = 0, $5 = 0, $6 = 0;
 var $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $exitcond79 = 0, $exitcond80 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $5 = sp;
 $6 = (_stbi__load_main($0,$1,$2,$3,$4,$5)|0);
 $7 = ($6|0)==(0|0);
 if ($7) {
  $$0 = 0;
  STACKTOP = sp;return ($$0|0);
 }
 $8 = HEAP32[$5>>2]|0;
 switch ($8|0) {
 case 8:  {
  $$070 = $6;
  break;
 }
 case 16:  {
  label = 4;
  break;
 }
 default: {
  ___assert_fail((10090|0),(10116|0),1041,(10139|0));
  // unreachable;
 }
 }
 if ((label|0) == 4) {
  $9 = HEAP32[$1>>2]|0;
  $10 = HEAP32[$2>>2]|0;
  $11 = ($4|0)==(0);
  if ($11) {
   $12 = HEAP32[$3>>2]|0;
   $13 = $12;
  } else {
   $13 = $4;
  }
  $14 = (_stbi__convert_16_to_8($6,$9,$10,$13)|0);
  HEAP32[$5>>2] = 8;
  $$070 = $14;
 }
 $15 = HEAP32[5668]|0;
 $16 = ($15|0)==(0);
 if ($16) {
  $$0 = $$070;
  STACKTOP = sp;return ($$0|0);
 }
 $17 = HEAP32[$1>>2]|0;
 $18 = HEAP32[$2>>2]|0;
 $19 = ($4|0)==(0);
 if ($19) {
  $20 = HEAP32[$3>>2]|0;
  $25 = $20;
 } else {
  $25 = $4;
 }
 $21 = $18 >> 1;
 $22 = ($21|0)>(0);
 if (!($22)) {
  $$0 = $$070;
  STACKTOP = sp;return ($$0|0);
 }
 $23 = ($17|0)>(0);
 $24 = ($25|0)>(0);
 $26 = (($18) + -1)|0;
 $$07378 = 0;
 while(1) {
  if ($23) {
   $27 = Math_imul($$07378, $17)|0;
   $28 = (($26) - ($$07378))|0;
   $29 = Math_imul($28, $17)|0;
   $$07276 = 0;
   while(1) {
    if ($24) {
     $30 = (($$07276) + ($27))|0;
     $31 = Math_imul($30, $25)|0;
     $32 = (($$07276) + ($29))|0;
     $33 = Math_imul($32, $25)|0;
     $$07175 = 0;
     while(1) {
      $34 = (($$07175) + ($31))|0;
      $35 = (($$070) + ($34)|0);
      $36 = HEAP8[$35>>0]|0;
      $37 = (($$07175) + ($33))|0;
      $38 = (($$070) + ($37)|0);
      $39 = HEAP8[$38>>0]|0;
      HEAP8[$35>>0] = $39;
      HEAP8[$38>>0] = $36;
      $40 = (($$07175) + 1)|0;
      $exitcond = ($40|0)==($25|0);
      if ($exitcond) {
       break;
      } else {
       $$07175 = $40;
      }
     }
    }
    $41 = (($$07276) + 1)|0;
    $exitcond79 = ($41|0)==($17|0);
    if ($exitcond79) {
     break;
    } else {
     $$07276 = $41;
    }
   }
  }
  $42 = (($$07378) + 1)|0;
  $exitcond80 = ($42|0)==($21|0);
  if ($exitcond80) {
   $$0 = $$070;
   break;
  } else {
   $$07378 = $42;
  }
 }
 STACKTOP = sp;return ($$0|0);
}
function _stbi__load_main($0,$1,$2,$3,$4,$5) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 $4 = $4|0;
 $5 = $5|0;
 var $$0 = 0, $10 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 HEAP32[$5>>2] = 8;
 $6 = ((($5)) + 8|0);
 HEAP32[$6>>2] = 0;
 $7 = ((($5)) + 4|0);
 HEAP32[$7>>2] = 0;
 $8 = (_stbi__png_test($0)|0);
 $9 = ($8|0)==(0);
 if ($9) {
  _stbi__err(10180);
  $$0 = 0;
  return ($$0|0);
 } else {
  $10 = (_stbi__png_load($0,$1,$2,$3,$4,$5)|0);
  $$0 = $10;
  return ($$0|0);
 }
 return (0)|0;
}
function _stbi__convert_16_to_8($0,$1,$2,$3) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 var $$0 = 0, $$01819 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $4 = Math_imul($2, $1)|0;
 $5 = Math_imul($4, $3)|0;
 $6 = (_stbi__malloc($5)|0);
 $7 = ($6|0)==(0|0);
 if ($7) {
  _stbi__err(10171);
  $$0 = 0;
  return ($$0|0);
 }
 $8 = ($5|0)>(0);
 if ($8) {
  $$01819 = 0;
  while(1) {
   $9 = (($0) + ($$01819<<1)|0);
   $10 = HEAP16[$9>>1]|0;
   $11 = ($10&65535) >>> 8;
   $12 = $11&255;
   $13 = (($6) + ($$01819)|0);
   HEAP8[$13>>0] = $12;
   $14 = (($$01819) + 1)|0;
   $exitcond = ($14|0)==($5|0);
   if ($exitcond) {
    break;
   } else {
    $$01819 = $14;
   }
  }
 }
 _free($0);
 $$0 = $6;
 return ($$0|0);
}
function _stbi__malloc($0) {
 $0 = $0|0;
 var $1 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = (_malloc($0)|0);
 return ($1|0);
}
function _stbi__png_test($0) {
 $0 = $0|0;
 var $1 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = (_stbi__check_png_header($0)|0);
 _stbi__rewind($0);
 return ($1|0);
}
function _stbi__png_load($0,$1,$2,$3,$4,$5) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 $4 = $4|0;
 $5 = $5|0;
 var $6 = 0, $7 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
 $6 = sp;
 HEAP32[$6>>2] = $0;
 $7 = (_stbi__do_png($6,$1,$2,$3,$4,$5)|0);
 STACKTOP = sp;return ($7|0);
}
function _stbi__do_png($0,$1,$2,$3,$4,$5) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 $4 = $4|0;
 $5 = $5|0;
 var $$ = 0, $$0 = 0, $$045 = 0, $$1 = 0, $$2 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0;
 var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $40 = 0, $41 = 0, $6 = 0, $7 = 0, $8 = 0;
 var $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $6 = ($4>>>0)>(4);
 if ($6) {
  _stbi__err(10199);
  $$045 = 0;
  return ($$045|0);
 }
 $7 = (_stbi__parse_png_file($0,0,$4)|0);
 $8 = ($7|0)==(0);
 if ($8) {
  $$2 = 0;
 } else {
  $9 = ((($0)) + 16|0);
  $10 = HEAP32[$9>>2]|0;
  $11 = ($10|0)>(8);
  $$ = $11 ? $10 : 8;
  HEAP32[$5>>2] = $$;
  $12 = ((($0)) + 12|0);
  $13 = HEAP32[$12>>2]|0;
  HEAP32[$12>>2] = 0;
  $14 = ($4|0)==(0);
  if ($14) {
   $$1 = $13;
  } else {
   $15 = HEAP32[$0>>2]|0;
   $16 = ((($15)) + 12|0);
   $17 = HEAP32[$16>>2]|0;
   $18 = ($17|0)==($4|0);
   if ($18) {
    $$1 = $13;
   } else {
    $19 = HEAP32[$5>>2]|0;
    $20 = ($19|0)==(8);
    $21 = ((($15)) + 4|0);
    $22 = HEAP32[$21>>2]|0;
    $23 = HEAP32[$15>>2]|0;
    if ($20) {
     $24 = (_stbi__convert_format($13,$17,$4,$23,$22)|0);
     $$0 = $24;
    } else {
     $25 = (_stbi__convert_format16($13,$17,$4,$23,$22)|0);
     $$0 = $25;
    }
    $26 = HEAP32[$0>>2]|0;
    $27 = ((($26)) + 12|0);
    HEAP32[$27>>2] = $4;
    $28 = ($$0|0)==(0|0);
    if ($28) {
     $$045 = 0;
     return ($$045|0);
    } else {
     $$1 = $$0;
    }
   }
  }
  $29 = HEAP32[$0>>2]|0;
  $30 = HEAP32[$29>>2]|0;
  HEAP32[$1>>2] = $30;
  $31 = ((($29)) + 4|0);
  $32 = HEAP32[$31>>2]|0;
  HEAP32[$2>>2] = $32;
  $33 = ($3|0)==(0|0);
  if ($33) {
   $$2 = $$1;
  } else {
   $34 = ((($29)) + 8|0);
   $35 = HEAP32[$34>>2]|0;
   HEAP32[$3>>2] = $35;
   $$2 = $$1;
  }
 }
 $36 = ((($0)) + 12|0);
 $37 = HEAP32[$36>>2]|0;
 _free($37);
 HEAP32[$36>>2] = 0;
 $38 = ((($0)) + 8|0);
 $39 = HEAP32[$38>>2]|0;
 _free($39);
 HEAP32[$38>>2] = 0;
 $40 = ((($0)) + 4|0);
 $41 = HEAP32[$40>>2]|0;
 _free($41);
 HEAP32[$40>>2] = 0;
 $$045 = $$2;
 return ($$045|0);
}
function _stbi__parse_png_file($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $$ = 0, $$$0217 = 0, $$0206 = 0, $$0211 = 0, $$0214 = 0, $$0217 = 0, $$0226593 = 0, $$0228 = 0, $$0231 = 0, $$0235 = 0, $$0239591 = 0, $$0241 = 0, $$0245 = 0, $$1207 = 0, $$1212 = 0, $$1215 = 0, $$1218 = 0, $$1227588 = 0, $$1229 = 0, $$1240589 = 0;
 var $$1246 = 0, $$2219 = 0, $$2233 = 0, $$2237 = 0, $$2243 = 0, $$254 = 0, $$3209 = 0, $$3220 = 0, $$4 = 0, $$6$ph = 0, $$7 = 0, $$lobit = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0;
 var $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0;
 var $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0;
 var $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0;
 var $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0;
 var $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0;
 var $198 = 0, $199 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $22 = 0, $23 = 0;
 var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0;
 var $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0;
 var $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0;
 var $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0;
 var $97 = 0, $98 = 0, $99 = 0, $notlhs = 0, $notrhs = 0, $or$cond = 0, $or$cond11 = 0, $or$cond248 = 0, $or$cond5$not = 0, $or$cond7 = 0, $switch$split112D = 0, $switch$split142D = 0, $switch$split2D = 0, $switch$split52D = 0, $switch$split82D = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 1056|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(1056|0);
 $3 = sp + 32|0;
 $4 = sp + 22|0;
 $5 = sp + 16|0;
 $6 = sp + 8|0;
 $7 = sp;
 $8 = HEAP32[$0>>2]|0;
 $9 = ((($0)) + 8|0);
 HEAP32[$9>>2] = 0;
 $10 = ((($0)) + 4|0);
 HEAP32[$10>>2] = 0;
 $11 = ((($0)) + 12|0);
 HEAP32[$11>>2] = 0;
 $12 = (_stbi__check_png_header($8)|0);
 $13 = ($12|0)==(0);
 if ($13) {
  $$7 = 0;
  STACKTOP = sp;return ($$7|0);
 }
 $14 = ($1|0)==(1);
 if ($14) {
  $$7 = 1;
  STACKTOP = sp;return ($$7|0);
 }
 $15 = ((($6)) + 4|0);
 $16 = ((($8)) + 4|0);
 $17 = ((($0)) + 16|0);
 $18 = ((($8)) + 8|0);
 $19 = ($1|0)==(2);
 $20 = ((($8)) + 8|0);
 $21 = ((($8)) + 8|0);
 $22 = ((($0)) + 16|0);
 $23 = ($1|0)==(2);
 $24 = ($1|0)==(2);
 $$0206 = 0;$$0211 = 0;$$0214 = 0;$$0217 = 0;$$0228 = 0;$$0231 = 0;$$0235 = 0;$$0241 = 1;$$0245 = 0;
 L7: while(1) {
  _stbi__get_chunk_header($6,$8);
  $25 = HEAP32[$15>>2]|0;
  $switch$split2D = ($25|0)<(1229472850);
  L9: do {
   if ($switch$split2D) {
    $switch$split52D = ($25|0)<(1229209940);
    if ($switch$split52D) {
     switch ($25|0) {
     case 1130840649:  {
      break;
     }
     default: {
      label = 103;
      break L9;
     }
     }
     $26 = HEAP32[$6>>2]|0;
     _stbi__skip($8,$26);
     $$1212 = $$0211;$$1215 = $$0214;$$1229 = 1;$$1246 = $$0245;$$2233 = $$0231;$$2237 = $$0235;$$2243 = $$0241;$$3209 = $$0206;$$3220 = $$0217;
     break;
    }
    $switch$split112D = ($25|0)<(1229278788);
    if (!($switch$split112D)) {
     switch ($25|0) {
     case 1229278788:  {
      label = 85;
      break L7;
      break;
     }
     default: {
      label = 103;
      break L9;
     }
     }
    }
    switch ($25|0) {
    case 1229209940:  {
     break;
    }
    default: {
     label = 103;
     break L9;
    }
    }
    $130 = ($$0241|0)==(0);
    if (!($130)) {
     label = 70;
     break L7;
    }
    $131 = ($$0206<<24>>24)==(0);
    $132 = ($$0245|0)!=(0);
    $or$cond = $132 | $131;
    if (!($or$cond)) {
     label = 72;
     break L7;
    }
    if ($24) {
     label = 74;
     break L7;
    }
    $135 = HEAP32[$6>>2]|0;
    $136 = (($135) + ($$0214))|0;
    $137 = ($136|0)<($$0214|0);
    if ($137) {
     $$6$ph = 0;
     break L7;
    }
    $138 = ($136>>>0)>($$0217>>>0);
    if ($138) {
     $139 = ($$0217|0)==(0);
     $140 = ($135>>>0)>(4096);
     $141 = $140 ? $135 : 4096;
     $$$0217 = $139 ? $141 : $$0217;
     $142 = HEAP32[$6>>2]|0;
     $143 = (($142) + ($$0214))|0;
     $$1218 = $$$0217;
     while(1) {
      $144 = ($143>>>0)>($$1218>>>0);
      $145 = $$1218 << 1;
      if ($144) {
       $$1218 = $145;
      } else {
       break;
      }
     }
     $146 = HEAP32[$10>>2]|0;
     $147 = (_realloc($146,$$1218)|0);
     $148 = ($147|0)==(0|0);
     if ($148) {
      label = 81;
      break L7;
     }
     HEAP32[$10>>2] = $147;
     $$2219 = $$1218;
    } else {
     $$2219 = $$0217;
    }
    $149 = HEAP32[$10>>2]|0;
    $150 = (($149) + ($$0214)|0);
    $151 = HEAP32[$6>>2]|0;
    $152 = (_stbi__getn($8,$150,$151)|0);
    $153 = ($152|0)==(0);
    if ($153) {
     label = 83;
     break L7;
    }
    $154 = HEAP32[$6>>2]|0;
    $155 = (($154) + ($$0214))|0;
    $$1212 = $$0211;$$1215 = $155;$$1229 = $$0228;$$1246 = $$0245;$$2233 = $$0231;$$2237 = $$0235;$$2243 = $$0241;$$3209 = $$0206;$$3220 = $$2219;
   } else {
    $switch$split82D = ($25|0)<(1347179589);
    if ($switch$split82D) {
     switch ($25|0) {
     case 1229472850:  {
      break;
     }
     default: {
      label = 103;
      break L9;
     }
     }
     $27 = ($$0241|0)==(0);
     if ($27) {
      label = 7;
      break L7;
     }
     $28 = HEAP32[$6>>2]|0;
     $29 = ($28|0)==(13);
     if (!($29)) {
      label = 9;
      break L7;
     }
     $30 = (_stbi__get32be($8)|0);
     HEAP32[$8>>2] = $30;
     $31 = ($30>>>0)>(16777216);
     if ($31) {
      label = 11;
      break L7;
     }
     $32 = (_stbi__get32be($8)|0);
     HEAP32[$16>>2] = $32;
     $33 = ($32>>>0)>(16777216);
     if ($33) {
      label = 13;
      break L7;
     }
     $34 = (_stbi__get8($8)|0);
     $35 = $34&255;
     HEAP32[$17>>2] = $35;
     switch ($34<<24>>24) {
     case 16: case 8: case 4: case 2: case 1:  {
      break;
     }
     default: {
      label = 15;
      break L7;
     }
     }
     $36 = (_stbi__get8($8)|0);
     $37 = $36&255;
     $38 = ($36&255)>(6);
     if ($38) {
      label = 17;
      break L7;
     }
     $39 = ($36<<24>>24)==(3);
     if ($39) {
      $40 = HEAP32[$17>>2]|0;
      $41 = ($40|0)==(16);
      if ($41) {
       label = 20;
       break L7;
      } else {
       $$1207 = 3;
      }
     } else {
      $42 = $37 & 1;
      $43 = ($42|0)==(0);
      if ($43) {
       $$1207 = $$0206;
      } else {
       label = 22;
       break L7;
      }
     }
     $44 = (_stbi__get8($8)|0);
     $45 = ($44<<24>>24)==(0);
     if (!($45)) {
      label = 24;
      break L7;
     }
     $46 = (_stbi__get8($8)|0);
     $47 = ($46<<24>>24)==(0);
     if (!($47)) {
      label = 26;
      break L7;
     }
     $48 = (_stbi__get8($8)|0);
     $49 = $48&255;
     $50 = ($48&255)>(1);
     if ($50) {
      label = 28;
      break L7;
     }
     $51 = HEAP32[$8>>2]|0;
     $52 = ($51|0)==(0);
     if ($52) {
      label = 31;
      break L7;
     }
     $53 = HEAP32[$16>>2]|0;
     $54 = ($53|0)==(0);
     if ($54) {
      label = 31;
      break L7;
     }
     $55 = ($$1207<<24>>24)==(0);
     $56 = (1073741824 / ($51>>>0))&-1;
     if (!($55)) {
      HEAP32[$20>>2] = 1;
      $63 = $56 >>> 2;
      $64 = ($63>>>0)<($53>>>0);
      if ($64) {
       label = 37;
       break L7;
      } else {
       $$1212 = $$0211;$$1215 = $$0214;$$1229 = $$0228;$$1246 = $$0245;$$2233 = $37;$$2237 = $49;$$2243 = 0;$$3209 = $$1207;$$3220 = $$0217;
       break;
      }
     }
     $57 = $37 & 2;
     $58 = $57 | 1;
     $59 = $37 >>> 2;
     $$lobit = $59 & 1;
     $60 = (($58) + ($$lobit))|0;
     HEAP32[$18>>2] = $60;
     $61 = (($56>>>0) / ($60>>>0))&-1;
     $62 = ($61>>>0)<($53>>>0);
     if ($62) {
      label = 34;
      break L7;
     }
     if ($19) {
      $$6$ph = 1;
      break L7;
     } else {
      $$1212 = $$0211;$$1215 = $$0214;$$1229 = $$0228;$$1246 = $$0245;$$2233 = $37;$$2237 = $49;$$2243 = 0;$$3209 = 0;$$3220 = $$0217;
      break;
     }
    }
    $switch$split142D = ($25|0)<(1951551059);
    if ($switch$split142D) {
     switch ($25|0) {
     case 1347179589:  {
      break;
     }
     default: {
      label = 103;
      break L9;
     }
     }
     $65 = ($$0241|0)==(0);
     if (!($65)) {
      label = 39;
      break L7;
     }
     $66 = HEAP32[$6>>2]|0;
     $67 = ($66>>>0)>(768);
     if ($67) {
      label = 41;
      break L7;
     }
     $68 = (($66>>>0) / 3)&-1;
     $69 = ($68*3)|0;
     $70 = ($69|0)==($66|0);
     if (!($70)) {
      label = 44;
      break L7;
     }
     $71 = ($66>>>0)>(2);
     if ($71) {
      $$0226593 = 0;
     } else {
      $$1212 = $$0211;$$1215 = $$0214;$$1229 = $$0228;$$1246 = $68;$$2233 = $$0231;$$2237 = $$0235;$$2243 = 0;$$3209 = $$0206;$$3220 = $$0217;
      break;
     }
     while(1) {
      $72 = (_stbi__get8($8)|0);
      $73 = $$0226593 << 2;
      $74 = (($3) + ($73)|0);
      HEAP8[$74>>0] = $72;
      $75 = (_stbi__get8($8)|0);
      $76 = $73 | 1;
      $77 = (($3) + ($76)|0);
      HEAP8[$77>>0] = $75;
      $78 = (_stbi__get8($8)|0);
      $79 = $73 | 2;
      $80 = (($3) + ($79)|0);
      HEAP8[$80>>0] = $78;
      $81 = $73 | 3;
      $82 = (($3) + ($81)|0);
      HEAP8[$82>>0] = -1;
      $83 = (($$0226593) + 1)|0;
      $84 = ($83>>>0)<($68>>>0);
      if ($84) {
       $$0226593 = $83;
      } else {
       $$1212 = $$0211;$$1215 = $$0214;$$1229 = $$0228;$$1246 = $68;$$2233 = $$0231;$$2237 = $$0235;$$2243 = $$0241;$$3209 = $$0206;$$3220 = $$0217;
       break L9;
      }
     }
    }
    switch ($25|0) {
    case 1951551059:  {
     break;
    }
    default: {
     label = 103;
     break L9;
    }
    }
    $85 = ($$0241|0)==(0);
    if (!($85)) {
     label = 47;
     break L7;
    }
    $86 = HEAP32[$10>>2]|0;
    $87 = ($86|0)==(0|0);
    if (!($87)) {
     label = 49;
     break L7;
    }
    $88 = ($$0206<<24>>24)==(0);
    if (!($88)) {
     if ($23) {
      label = 52;
      break L7;
     }
     $90 = ($$0245|0)==(0);
     if ($90) {
      label = 54;
      break L7;
     }
     $91 = HEAP32[$6>>2]|0;
     $92 = ($91>>>0)>($$0245>>>0);
     if ($92) {
      label = 58;
      break L7;
     }
     $93 = HEAP32[$6>>2]|0;
     $94 = ($93|0)==(0);
     if ($94) {
      $$1212 = $$0211;$$1215 = $$0214;$$1229 = $$0228;$$1246 = $$0245;$$2233 = $$0231;$$2237 = $$0235;$$2243 = 0;$$3209 = 4;$$3220 = $$0217;
      break;
     }
     $95 = HEAP32[$6>>2]|0;
     $$1227588 = 0;
     while(1) {
      $96 = (_stbi__get8($8)|0);
      $97 = $$1227588 << 2;
      $98 = $97 | 3;
      $99 = (($3) + ($98)|0);
      HEAP8[$99>>0] = $96;
      $100 = (($$1227588) + 1)|0;
      $101 = ($100>>>0)<($95>>>0);
      if ($101) {
       $$1227588 = $100;
      } else {
       $$1212 = $$0211;$$1215 = $$0214;$$1229 = $$0228;$$1246 = $$0245;$$2233 = $$0231;$$2237 = $$0235;$$2243 = $$0241;$$3209 = 4;$$3220 = $$0217;
       break L9;
      }
     }
    }
    $102 = HEAP32[$21>>2]|0;
    $103 = $102 & 1;
    $104 = ($103|0)==(0);
    if ($104) {
     label = 61;
     break L7;
    }
    $105 = HEAP32[$6>>2]|0;
    $106 = $102 << 1;
    $107 = ($105|0)==($106|0);
    if (!($107)) {
     label = 63;
     break L7;
    }
    $108 = HEAP32[$22>>2]|0;
    $109 = ($108|0)==(16);
    $110 = HEAP32[$21>>2]|0;
    $111 = ($110|0)>(0);
    if ($109) {
     if ($111) {
      $$0239591 = 0;
     } else {
      $$1212 = 1;$$1215 = $$0214;$$1229 = $$0228;$$1246 = $$0245;$$2233 = $$0231;$$2237 = $$0235;$$2243 = 0;$$3209 = 0;$$3220 = $$0217;
      break;
     }
     while(1) {
      $112 = (_stbi__get16be($8)|0);
      $113 = $112&65535;
      $114 = (($5) + ($$0239591<<1)|0);
      HEAP16[$114>>1] = $113;
      $115 = (($$0239591) + 1)|0;
      $116 = HEAP32[$21>>2]|0;
      $117 = ($115|0)<($116|0);
      if ($117) {
       $$0239591 = $115;
      } else {
       $$1212 = 1;$$1215 = $$0214;$$1229 = $$0228;$$1246 = $$0245;$$2233 = $$0231;$$2237 = $$0235;$$2243 = $$0241;$$3209 = $$0206;$$3220 = $$0217;
       break;
      }
     }
    } else {
     if ($111) {
      $$1240589 = 0;
     } else {
      $$1212 = 1;$$1215 = $$0214;$$1229 = $$0228;$$1246 = $$0245;$$2233 = $$0231;$$2237 = $$0235;$$2243 = 0;$$3209 = 0;$$3220 = $$0217;
      break;
     }
     while(1) {
      $118 = (_stbi__get16be($8)|0);
      $119 = $118 & 255;
      $120 = HEAP32[$22>>2]|0;
      $121 = (10513 + ($120)|0);
      $122 = HEAP8[$121>>0]|0;
      $123 = $122&255;
      $124 = Math_imul($123, $119)|0;
      $125 = $124&255;
      $126 = (($4) + ($$1240589)|0);
      HEAP8[$126>>0] = $125;
      $127 = (($$1240589) + 1)|0;
      $128 = HEAP32[$21>>2]|0;
      $129 = ($127|0)<($128|0);
      if ($129) {
       $$1240589 = $127;
      } else {
       $$1212 = 1;$$1215 = $$0214;$$1229 = $$0228;$$1246 = $$0245;$$2233 = $$0231;$$2237 = $$0235;$$2243 = $$0241;$$3209 = $$0206;$$3220 = $$0217;
       break;
      }
     }
    }
   }
  } while(0);
  if ((label|0) == 103) {
   label = 0;
   $202 = ($$0241|0)==(0);
   if (!($202)) {
    label = 104;
    break;
   }
   $203 = $25 & 536870912;
   $204 = ($203|0)==(0);
   if ($204) {
    label = 106;
    break;
   }
   $213 = HEAP32[$6>>2]|0;
   _stbi__skip($8,$213);
   $$1212 = $$0211;$$1215 = $$0214;$$1229 = $$0228;$$1246 = $$0245;$$2233 = $$0231;$$2237 = $$0235;$$2243 = 0;$$3209 = $$0206;$$3220 = $$0217;
  }
  (_stbi__get32be($8)|0);
  $$0206 = $$3209;$$0211 = $$1212;$$0214 = $$1215;$$0217 = $$3220;$$0228 = $$1229;$$0231 = $$2233;$$0235 = $$2237;$$0241 = $$2243;$$0245 = $$1246;
 }
 switch (label|0) {
  case 7: {
   _stbi__err(10287);
   $$6$ph = 0;
   break;
  }
  case 9: {
   _stbi__err(10301);
   $$6$ph = 0;
   break;
  }
  case 11: {
   _stbi__err(10314);
   $$6$ph = 0;
   break;
  }
  case 13: {
   _stbi__err(10314);
   $$6$ph = 0;
   break;
  }
  case 15: {
   _stbi__err(10324);
   $$6$ph = 0;
   break;
  }
  case 17: {
   _stbi__err(10344);
   $$6$ph = 0;
   break;
  }
  case 20: {
   _stbi__err(10344);
   $$6$ph = 0;
   break;
  }
  case 22: {
   _stbi__err(10344);
   $$6$ph = 0;
   break;
  }
  case 24: {
   _stbi__err(10354);
   $$6$ph = 0;
   break;
  }
  case 26: {
   _stbi__err(10370);
   $$6$ph = 0;
   break;
  }
  case 28: {
   _stbi__err(10388);
   $$6$ph = 0;
   break;
  }
  case 31: {
   _stbi__err(10409);
   $$6$ph = 0;
   break;
  }
  case 34: {
   _stbi__err(10314);
   $$6$ph = 0;
   break;
  }
  case 37: {
   _stbi__err(10314);
   $$6$ph = 0;
   break;
  }
  case 39: {
   _stbi__err(10423);
   $$6$ph = 0;
   break;
  }
  case 41: {
   _stbi__err(10438);
   $$6$ph = 0;
   break;
  }
  case 44: {
   _stbi__err(10438);
   $$6$ph = 0;
   break;
  }
  case 47: {
   _stbi__err(10423);
   $$6$ph = 0;
   break;
  }
  case 49: {
   _stbi__err(10451);
   $$6$ph = 0;
   break;
  }
  case 52: {
   $89 = ((($8)) + 8|0);
   HEAP32[$89>>2] = 4;
   $$6$ph = 1;
   break;
  }
  case 54: {
   _stbi__err(10467);
   $$6$ph = 0;
   break;
  }
  case 58: {
   _stbi__err(10484);
   $$6$ph = 0;
   break;
  }
  case 61: {
   _stbi__err(10497);
   $$6$ph = 0;
   break;
  }
  case 63: {
   _stbi__err(10484);
   $$6$ph = 0;
   break;
  }
  case 70: {
   _stbi__err(10423);
   $$6$ph = 0;
   break;
  }
  case 72: {
   _stbi__err(10522);
   $$6$ph = 0;
   break;
  }
  case 74: {
   $133 = $$0206&255;
   $134 = ((($8)) + 8|0);
   HEAP32[$134>>2] = $133;
   $$6$ph = 1;
   break;
  }
  case 81: {
   _stbi__err(10171);
   $$6$ph = 0;
   break;
  }
  case 83: {
   _stbi__err(10530);
   $$6$ph = 0;
   break;
  }
  case 85: {
   $156 = ($$0241|0)==(0);
   do {
    if ($156) {
     $157 = ($1|0)==(0);
     if ($157) {
      $158 = HEAP32[$10>>2]|0;
      $159 = ($158|0)==(0|0);
      if ($159) {
       _stbi__err(10540);
       $$4 = 0;
       break;
      }
      $160 = HEAP32[$8>>2]|0;
      $161 = ((($0)) + 16|0);
      $162 = HEAP32[$161>>2]|0;
      $163 = Math_imul($162, $160)|0;
      $164 = (($163) + 7)|0;
      $165 = $164 >>> 3;
      $166 = ((($8)) + 4|0);
      $167 = HEAP32[$166>>2]|0;
      $168 = ((($8)) + 8|0);
      $169 = HEAP32[$168>>2]|0;
      $170 = Math_imul($169, $167)|0;
      $171 = Math_imul($170, $165)|0;
      $172 = (($171) + ($167))|0;
      HEAP32[$7>>2] = $172;
      $173 = ($$0228|0)!=(0);
      $174 = $173 ^ 1;
      $175 = $174&1;
      $176 = (_stbi_zlib_decode_malloc_guesssize_headerflag($158,$$0214,$172,$7,$175)|0);
      HEAP32[$9>>2] = $176;
      $177 = ($176|0)==(0|0);
      if ($177) {
       $$4 = 0;
      } else {
       $178 = HEAP32[$10>>2]|0;
       _free($178);
       HEAP32[$10>>2] = 0;
       $179 = HEAP32[$168>>2]|0;
       $180 = (($179) + 1)|0;
       $notlhs = ($180|0)!=($2|0);
       $notrhs = ($2|0)==(3);
       $or$cond5$not = $notrhs | $notlhs;
       $181 = ($$0206<<24>>24)!=(0);
       $or$cond7 = $181 | $or$cond5$not;
       $182 = ($$0211<<24>>24)==(0);
       $or$cond248 = $182 & $or$cond7;
       $$254 = $or$cond248 ? $179 : $180;
       $183 = ((($8)) + 12|0);
       HEAP32[$183>>2] = $$254;
       $184 = HEAP32[$9>>2]|0;
       $185 = HEAP32[$7>>2]|0;
       $186 = HEAP32[$161>>2]|0;
       $187 = (_stbi__create_png_image($0,$184,$185,$$254,$186,$$0231,$$0235)|0);
       $188 = ($187|0)==(0);
       if ($188) {
        $$4 = 0;
       } else {
        do {
         if (!($182)) {
          $189 = HEAP32[$161>>2]|0;
          $190 = ($189|0)==(16);
          if ($190) {
           $191 = HEAP32[$183>>2]|0;
           _stbi__compute_transparency16($0,$5,$191);
           break;
          } else {
           $192 = HEAP32[$183>>2]|0;
           _stbi__compute_transparency($0,$4,$192);
           break;
          }
         }
        } while(0);
        $193 = HEAP32[5669]|0;
        $194 = ($193|0)!=(0);
        $or$cond11 = $173 & $194;
        if ($or$cond11) {
         $195 = HEAP32[$183>>2]|0;
         $196 = ($195|0)>(2);
         if ($196) {
          _stbi__de_iphone($0);
         }
        }
        if ($181) {
         $197 = $$0206&255;
         HEAP32[$168>>2] = $197;
         $198 = ($2|0)>(2);
         $$ = $198 ? $2 : $197;
         HEAP32[$183>>2] = $$;
         $199 = (_stbi__expand_png_palette($0,$3,$$)|0);
         $200 = ($199|0)==(0);
         if ($200) {
          $$4 = 0;
          break;
         }
        }
        $201 = HEAP32[$9>>2]|0;
        _free($201);
        HEAP32[$9>>2] = 0;
        $$4 = 1;
       }
      }
     } else {
      $$4 = 1;
     }
    } else {
     _stbi__err(10423);
     $$4 = 0;
    }
   } while(0);
   $$6$ph = $$4;
   break;
  }
  case 104: {
   _stbi__err(10423);
   $$6$ph = 0;
   break;
  }
  case 106: {
   $205 = $25 >>> 24;
   $206 = $205&255;
   HEAP8[10548] = $206;
   $207 = HEAP32[$15>>2]|0;
   $208 = $207 >>> 16;
   $209 = $208&255;
   HEAP8[(10549)>>0] = $209;
   $210 = $207 >>> 8;
   $211 = $210&255;
   HEAP8[(10550)>>0] = $211;
   $212 = $207&255;
   HEAP8[(10551)>>0] = $212;
   _stbi__err(10548);
   $$6$ph = 0;
   break;
  }
 }
 $$7 = $$6$ph;
 STACKTOP = sp;return ($$7|0);
}
function _stbi__convert_format($0,$1,$2,$3,$4) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 $4 = $4|0;
 var $$0151255 = 0, $$0163 = 0, $$0164259 = 0, $$0165 = 0, $$0165254 = 0, $$0165257 = 0, $$0256 = 0, $$10161205 = 0, $$10175 = 0, $$10175204 = 0, $$10175207 = 0, $$10206 = 0, $$11162201 = 0, $$11176 = 0, $$11176200 = 0, $$11176203 = 0, $$11202 = 0, $$1152250 = 0, $$1166 = 0, $$1166249 = 0;
 var $$1166252 = 0, $$1251 = 0, $$2153245 = 0, $$2167 = 0, $$2167244 = 0, $$2167247 = 0, $$2246 = 0, $$3154240 = 0, $$3168 = 0, $$3168239 = 0, $$3168242 = 0, $$3241 = 0, $$4155235 = 0, $$4169 = 0, $$4169234 = 0, $$4169237 = 0, $$4236 = 0, $$5156230 = 0, $$5170 = 0, $$5170229 = 0;
 var $$5170232 = 0, $$5231 = 0, $$6157225 = 0, $$6171 = 0, $$6171224 = 0, $$6171227 = 0, $$6226 = 0, $$7158220 = 0, $$7172 = 0, $$7172219 = 0, $$7172222 = 0, $$7221 = 0, $$8159215 = 0, $$8173 = 0, $$8173214 = 0, $$8173217 = 0, $$8216 = 0, $$9160210 = 0, $$9174 = 0, $$9174209 = 0;
 var $$9174212 = 0, $$9211 = 0, $$off = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0;
 var $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0;
 var $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
 var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0;
 var $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0;
 var $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0;
 var $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, label = 0;
 var sp = 0;
 sp = STACKTOP;
 $5 = ($2|0)==($1|0);
 if ($5) {
  $$0163 = $0;
  return ($$0163|0);
 }
 $$off = (($2) + -1)|0;
 $6 = ($$off>>>0)<(4);
 if (!($6)) {
  ___assert_fail((10212|0),(10116|0),1477,(10266|0));
  // unreachable;
 }
 $7 = (_stbi__malloc_mad3($2,$3,$4)|0);
 $8 = ($7|0)==(0|0);
 if ($8) {
  _free($0);
  _stbi__err(10171);
  $$0163 = 0;
  return ($$0163|0);
 }
 $9 = ($4|0)>(0);
 L11: do {
  if ($9) {
   $10 = $1 << 3;
   $11 = (($10) + ($2))|0;
   $$0165254 = (($3) + -1)|0;
   $12 = ($$0165254|0)>(-1);
   $$1166249 = (($3) + -1)|0;
   $13 = ($$1166249|0)>(-1);
   $$2167244 = (($3) + -1)|0;
   $14 = ($$2167244|0)>(-1);
   $$3168239 = (($3) + -1)|0;
   $15 = ($$3168239|0)>(-1);
   $$4169234 = (($3) + -1)|0;
   $16 = ($$4169234|0)>(-1);
   $$5170229 = (($3) + -1)|0;
   $17 = ($$5170229|0)>(-1);
   $$6171224 = (($3) + -1)|0;
   $18 = ($$6171224|0)>(-1);
   $$7172219 = (($3) + -1)|0;
   $19 = ($$7172219|0)>(-1);
   $$8173214 = (($3) + -1)|0;
   $20 = ($$8173214|0)>(-1);
   $$9174209 = (($3) + -1)|0;
   $21 = ($$9174209|0)>(-1);
   $$10175204 = (($3) + -1)|0;
   $22 = ($$10175204|0)>(-1);
   $$11176200 = (($3) + -1)|0;
   $23 = ($$11176200|0)>(-1);
   $$0164259 = 0;
   L13: while(1) {
    $24 = Math_imul($$0164259, $3)|0;
    $25 = Math_imul($24, $1)|0;
    $26 = (($0) + ($25)|0);
    $27 = Math_imul($24, $2)|0;
    $28 = (($7) + ($27)|0);
    do {
     switch ($11|0) {
     case 10:  {
      if ($12) {
       $$0151255 = $26;$$0165257 = $$0165254;$$0256 = $28;
       while(1) {
        $29 = HEAP8[$$0151255>>0]|0;
        HEAP8[$$0256>>0] = $29;
        $30 = ((($$0256)) + 1|0);
        HEAP8[$30>>0] = -1;
        $31 = ((($$0151255)) + 1|0);
        $32 = ((($$0256)) + 2|0);
        $$0165 = (($$0165257) + -1)|0;
        $33 = ($$0165|0)>(-1);
        if ($33) {
         $$0151255 = $31;$$0165257 = $$0165;$$0256 = $32;
        } else {
         break;
        }
       }
      }
      break;
     }
     case 11:  {
      if ($13) {
       $$1152250 = $26;$$1166252 = $$1166249;$$1251 = $28;
       while(1) {
        $34 = HEAP8[$$1152250>>0]|0;
        $35 = ((($$1251)) + 2|0);
        HEAP8[$35>>0] = $34;
        $36 = ((($$1251)) + 1|0);
        HEAP8[$36>>0] = $34;
        HEAP8[$$1251>>0] = $34;
        $37 = ((($$1152250)) + 1|0);
        $38 = ((($$1251)) + 3|0);
        $$1166 = (($$1166252) + -1)|0;
        $39 = ($$1166|0)>(-1);
        if ($39) {
         $$1152250 = $37;$$1166252 = $$1166;$$1251 = $38;
        } else {
         break;
        }
       }
      }
      break;
     }
     case 12:  {
      if ($14) {
       $$2153245 = $26;$$2167247 = $$2167244;$$2246 = $28;
       while(1) {
        $40 = HEAP8[$$2153245>>0]|0;
        $41 = ((($$2246)) + 2|0);
        HEAP8[$41>>0] = $40;
        $42 = ((($$2246)) + 1|0);
        HEAP8[$42>>0] = $40;
        HEAP8[$$2246>>0] = $40;
        $43 = ((($$2246)) + 3|0);
        HEAP8[$43>>0] = -1;
        $44 = ((($$2153245)) + 1|0);
        $45 = ((($$2246)) + 4|0);
        $$2167 = (($$2167247) + -1)|0;
        $46 = ($$2167|0)>(-1);
        if ($46) {
         $$2153245 = $44;$$2167247 = $$2167;$$2246 = $45;
        } else {
         break;
        }
       }
      }
      break;
     }
     case 17:  {
      if ($15) {
       $$3154240 = $26;$$3168242 = $$3168239;$$3241 = $28;
       while(1) {
        $47 = HEAP8[$$3154240>>0]|0;
        HEAP8[$$3241>>0] = $47;
        $48 = ((($$3154240)) + 2|0);
        $49 = ((($$3241)) + 1|0);
        $$3168 = (($$3168242) + -1)|0;
        $50 = ($$3168|0)>(-1);
        if ($50) {
         $$3154240 = $48;$$3168242 = $$3168;$$3241 = $49;
        } else {
         break;
        }
       }
      }
      break;
     }
     case 19:  {
      if ($16) {
       $$4155235 = $26;$$4169237 = $$4169234;$$4236 = $28;
       while(1) {
        $51 = HEAP8[$$4155235>>0]|0;
        $52 = ((($$4236)) + 2|0);
        HEAP8[$52>>0] = $51;
        $53 = ((($$4236)) + 1|0);
        HEAP8[$53>>0] = $51;
        HEAP8[$$4236>>0] = $51;
        $54 = ((($$4155235)) + 2|0);
        $55 = ((($$4236)) + 3|0);
        $$4169 = (($$4169237) + -1)|0;
        $56 = ($$4169|0)>(-1);
        if ($56) {
         $$4155235 = $54;$$4169237 = $$4169;$$4236 = $55;
        } else {
         break;
        }
       }
      }
      break;
     }
     case 20:  {
      if ($17) {
       $$5156230 = $26;$$5170232 = $$5170229;$$5231 = $28;
       while(1) {
        $57 = HEAP8[$$5156230>>0]|0;
        $58 = ((($$5231)) + 2|0);
        HEAP8[$58>>0] = $57;
        $59 = ((($$5231)) + 1|0);
        HEAP8[$59>>0] = $57;
        HEAP8[$$5231>>0] = $57;
        $60 = ((($$5156230)) + 1|0);
        $61 = HEAP8[$60>>0]|0;
        $62 = ((($$5231)) + 3|0);
        HEAP8[$62>>0] = $61;
        $63 = ((($$5156230)) + 2|0);
        $64 = ((($$5231)) + 4|0);
        $$5170 = (($$5170232) + -1)|0;
        $65 = ($$5170|0)>(-1);
        if ($65) {
         $$5156230 = $63;$$5170232 = $$5170;$$5231 = $64;
        } else {
         break;
        }
       }
      }
      break;
     }
     case 28:  {
      if ($18) {
       $$6157225 = $26;$$6171227 = $$6171224;$$6226 = $28;
       while(1) {
        $66 = HEAP8[$$6157225>>0]|0;
        HEAP8[$$6226>>0] = $66;
        $67 = ((($$6157225)) + 1|0);
        $68 = HEAP8[$67>>0]|0;
        $69 = ((($$6226)) + 1|0);
        HEAP8[$69>>0] = $68;
        $70 = ((($$6157225)) + 2|0);
        $71 = HEAP8[$70>>0]|0;
        $72 = ((($$6226)) + 2|0);
        HEAP8[$72>>0] = $71;
        $73 = ((($$6226)) + 3|0);
        HEAP8[$73>>0] = -1;
        $74 = ((($$6157225)) + 3|0);
        $75 = ((($$6226)) + 4|0);
        $$6171 = (($$6171227) + -1)|0;
        $76 = ($$6171|0)>(-1);
        if ($76) {
         $$6157225 = $74;$$6171227 = $$6171;$$6226 = $75;
        } else {
         break;
        }
       }
      }
      break;
     }
     case 25:  {
      if ($19) {
       $$7158220 = $26;$$7172222 = $$7172219;$$7221 = $28;
       while(1) {
        $77 = HEAP8[$$7158220>>0]|0;
        $78 = $77&255;
        $79 = ((($$7158220)) + 1|0);
        $80 = HEAP8[$79>>0]|0;
        $81 = $80&255;
        $82 = ((($$7158220)) + 2|0);
        $83 = HEAP8[$82>>0]|0;
        $84 = $83&255;
        $85 = (_stbi__compute_y($78,$81,$84)|0);
        HEAP8[$$7221>>0] = $85;
        $86 = ((($$7158220)) + 3|0);
        $87 = ((($$7221)) + 1|0);
        $$7172 = (($$7172222) + -1)|0;
        $88 = ($$7172|0)>(-1);
        if ($88) {
         $$7158220 = $86;$$7172222 = $$7172;$$7221 = $87;
        } else {
         break;
        }
       }
      }
      break;
     }
     case 26:  {
      if ($20) {
       $$8159215 = $26;$$8173217 = $$8173214;$$8216 = $28;
       while(1) {
        $89 = HEAP8[$$8159215>>0]|0;
        $90 = $89&255;
        $91 = ((($$8159215)) + 1|0);
        $92 = HEAP8[$91>>0]|0;
        $93 = $92&255;
        $94 = ((($$8159215)) + 2|0);
        $95 = HEAP8[$94>>0]|0;
        $96 = $95&255;
        $97 = (_stbi__compute_y($90,$93,$96)|0);
        HEAP8[$$8216>>0] = $97;
        $98 = ((($$8216)) + 1|0);
        HEAP8[$98>>0] = -1;
        $99 = ((($$8159215)) + 3|0);
        $100 = ((($$8216)) + 2|0);
        $$8173 = (($$8173217) + -1)|0;
        $101 = ($$8173|0)>(-1);
        if ($101) {
         $$8159215 = $99;$$8173217 = $$8173;$$8216 = $100;
        } else {
         break;
        }
       }
      }
      break;
     }
     case 33:  {
      if ($21) {
       $$9160210 = $26;$$9174212 = $$9174209;$$9211 = $28;
       while(1) {
        $102 = HEAP8[$$9160210>>0]|0;
        $103 = $102&255;
        $104 = ((($$9160210)) + 1|0);
        $105 = HEAP8[$104>>0]|0;
        $106 = $105&255;
        $107 = ((($$9160210)) + 2|0);
        $108 = HEAP8[$107>>0]|0;
        $109 = $108&255;
        $110 = (_stbi__compute_y($103,$106,$109)|0);
        HEAP8[$$9211>>0] = $110;
        $111 = ((($$9160210)) + 4|0);
        $112 = ((($$9211)) + 1|0);
        $$9174 = (($$9174212) + -1)|0;
        $113 = ($$9174|0)>(-1);
        if ($113) {
         $$9160210 = $111;$$9174212 = $$9174;$$9211 = $112;
        } else {
         break;
        }
       }
      }
      break;
     }
     case 34:  {
      if ($22) {
       $$10161205 = $26;$$10175207 = $$10175204;$$10206 = $28;
       while(1) {
        $114 = HEAP8[$$10161205>>0]|0;
        $115 = $114&255;
        $116 = ((($$10161205)) + 1|0);
        $117 = HEAP8[$116>>0]|0;
        $118 = $117&255;
        $119 = ((($$10161205)) + 2|0);
        $120 = HEAP8[$119>>0]|0;
        $121 = $120&255;
        $122 = (_stbi__compute_y($115,$118,$121)|0);
        HEAP8[$$10206>>0] = $122;
        $123 = ((($$10161205)) + 3|0);
        $124 = HEAP8[$123>>0]|0;
        $125 = ((($$10206)) + 1|0);
        HEAP8[$125>>0] = $124;
        $126 = ((($$10161205)) + 4|0);
        $127 = ((($$10206)) + 2|0);
        $$10175 = (($$10175207) + -1)|0;
        $128 = ($$10175|0)>(-1);
        if ($128) {
         $$10161205 = $126;$$10175207 = $$10175;$$10206 = $127;
        } else {
         break;
        }
       }
      }
      break;
     }
     case 35:  {
      if ($23) {
       $$11162201 = $26;$$11176203 = $$11176200;$$11202 = $28;
       while(1) {
        $129 = HEAP8[$$11162201>>0]|0;
        HEAP8[$$11202>>0] = $129;
        $130 = ((($$11162201)) + 1|0);
        $131 = HEAP8[$130>>0]|0;
        $132 = ((($$11202)) + 1|0);
        HEAP8[$132>>0] = $131;
        $133 = ((($$11162201)) + 2|0);
        $134 = HEAP8[$133>>0]|0;
        $135 = ((($$11202)) + 2|0);
        HEAP8[$135>>0] = $134;
        $136 = ((($$11162201)) + 4|0);
        $137 = ((($$11202)) + 3|0);
        $$11176 = (($$11176203) + -1)|0;
        $138 = ($$11176|0)>(-1);
        if ($138) {
         $$11162201 = $136;$$11176203 = $$11176;$$11202 = $137;
        } else {
         break;
        }
       }
      }
      break;
     }
     default: {
      break L13;
     }
     }
    } while(0);
    $139 = (($$0164259) + 1)|0;
    $140 = ($139|0)<($4|0);
    if ($140) {
     $$0164259 = $139;
    } else {
     break L11;
    }
   }
   ___assert_fail((13672|0),(10116|0),1506,(10266|0));
   // unreachable;
  }
 } while(0);
 _free($0);
 $$0163 = $7;
 return ($$0163|0);
}
function _stbi__convert_format16($0,$1,$2,$3,$4) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 $4 = $4|0;
 var $$0151255 = 0, $$0163 = 0, $$0164259 = 0, $$0165 = 0, $$0165254 = 0, $$0165257 = 0, $$0256 = 0, $$10161205 = 0, $$10175 = 0, $$10175204 = 0, $$10175207 = 0, $$10206 = 0, $$11162201 = 0, $$11176 = 0, $$11176200 = 0, $$11176203 = 0, $$11202 = 0, $$1152250 = 0, $$1166 = 0, $$1166249 = 0;
 var $$1166252 = 0, $$1251 = 0, $$2153245 = 0, $$2167 = 0, $$2167244 = 0, $$2167247 = 0, $$2246 = 0, $$3154240 = 0, $$3168 = 0, $$3168239 = 0, $$3168242 = 0, $$3241 = 0, $$4155235 = 0, $$4169 = 0, $$4169234 = 0, $$4169237 = 0, $$4236 = 0, $$5156230 = 0, $$5170 = 0, $$5170229 = 0;
 var $$5170232 = 0, $$5231 = 0, $$6157225 = 0, $$6171 = 0, $$6171224 = 0, $$6171227 = 0, $$6226 = 0, $$7158220 = 0, $$7172 = 0, $$7172219 = 0, $$7172222 = 0, $$7221 = 0, $$8159215 = 0, $$8173 = 0, $$8173214 = 0, $$8173217 = 0, $$8216 = 0, $$9160210 = 0, $$9174 = 0, $$9174209 = 0;
 var $$9174212 = 0, $$9211 = 0, $$off = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0;
 var $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0;
 var $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0;
 var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $40 = 0, $41 = 0, $42 = 0;
 var $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0;
 var $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0;
 var $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0;
 var $98 = 0, $99 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $5 = ($2|0)==($1|0);
 if ($5) {
  $$0163 = $0;
  return ($$0163|0);
 }
 $$off = (($2) + -1)|0;
 $6 = ($$off>>>0)<(4);
 if (!($6)) {
  ___assert_fail((10212|0),(10116|0),1526,(10243|0));
  // unreachable;
 }
 $7 = $2 << 1;
 $8 = Math_imul($7, $3)|0;
 $9 = Math_imul($8, $4)|0;
 $10 = (_stbi__malloc($9)|0);
 $11 = ($10|0)==(0|0);
 if ($11) {
  _free($0);
  _stbi__err(10171);
  $$0163 = 0;
  return ($$0163|0);
 }
 $12 = ($4|0)>(0);
 L11: do {
  if ($12) {
   $13 = $1 << 3;
   $14 = (($13) + ($2))|0;
   $$0165254 = (($3) + -1)|0;
   $15 = ($$0165254|0)>(-1);
   $$1166249 = (($3) + -1)|0;
   $16 = ($$1166249|0)>(-1);
   $$2167244 = (($3) + -1)|0;
   $17 = ($$2167244|0)>(-1);
   $$3168239 = (($3) + -1)|0;
   $18 = ($$3168239|0)>(-1);
   $$4169234 = (($3) + -1)|0;
   $19 = ($$4169234|0)>(-1);
   $$5170229 = (($3) + -1)|0;
   $20 = ($$5170229|0)>(-1);
   $$6171224 = (($3) + -1)|0;
   $21 = ($$6171224|0)>(-1);
   $$7172219 = (($3) + -1)|0;
   $22 = ($$7172219|0)>(-1);
   $$8173214 = (($3) + -1)|0;
   $23 = ($$8173214|0)>(-1);
   $$9174209 = (($3) + -1)|0;
   $24 = ($$9174209|0)>(-1);
   $$10175204 = (($3) + -1)|0;
   $25 = ($$10175204|0)>(-1);
   $$11176200 = (($3) + -1)|0;
   $26 = ($$11176200|0)>(-1);
   $$0164259 = 0;
   L13: while(1) {
    $27 = Math_imul($$0164259, $3)|0;
    $28 = Math_imul($27, $1)|0;
    $29 = (($0) + ($28<<1)|0);
    $30 = Math_imul($27, $2)|0;
    $31 = (($10) + ($30<<1)|0);
    do {
     switch ($14|0) {
     case 10:  {
      if ($15) {
       $$0151255 = $29;$$0165257 = $$0165254;$$0256 = $31;
       while(1) {
        $32 = HEAP16[$$0151255>>1]|0;
        HEAP16[$$0256>>1] = $32;
        $33 = ((($$0256)) + 2|0);
        HEAP16[$33>>1] = -1;
        $34 = ((($$0151255)) + 2|0);
        $35 = ((($$0256)) + 4|0);
        $$0165 = (($$0165257) + -1)|0;
        $36 = ($$0165|0)>(-1);
        if ($36) {
         $$0151255 = $34;$$0165257 = $$0165;$$0256 = $35;
        } else {
         break;
        }
       }
      }
      break;
     }
     case 11:  {
      if ($16) {
       $$1152250 = $29;$$1166252 = $$1166249;$$1251 = $31;
       while(1) {
        $37 = HEAP16[$$1152250>>1]|0;
        $38 = ((($$1251)) + 4|0);
        HEAP16[$38>>1] = $37;
        $39 = ((($$1251)) + 2|0);
        HEAP16[$39>>1] = $37;
        HEAP16[$$1251>>1] = $37;
        $40 = ((($$1152250)) + 2|0);
        $41 = ((($$1251)) + 6|0);
        $$1166 = (($$1166252) + -1)|0;
        $42 = ($$1166|0)>(-1);
        if ($42) {
         $$1152250 = $40;$$1166252 = $$1166;$$1251 = $41;
        } else {
         break;
        }
       }
      }
      break;
     }
     case 12:  {
      if ($17) {
       $$2153245 = $29;$$2167247 = $$2167244;$$2246 = $31;
       while(1) {
        $43 = HEAP16[$$2153245>>1]|0;
        $44 = ((($$2246)) + 4|0);
        HEAP16[$44>>1] = $43;
        $45 = ((($$2246)) + 2|0);
        HEAP16[$45>>1] = $43;
        HEAP16[$$2246>>1] = $43;
        $46 = ((($$2246)) + 6|0);
        HEAP16[$46>>1] = -1;
        $47 = ((($$2153245)) + 2|0);
        $48 = ((($$2246)) + 8|0);
        $$2167 = (($$2167247) + -1)|0;
        $49 = ($$2167|0)>(-1);
        if ($49) {
         $$2153245 = $47;$$2167247 = $$2167;$$2246 = $48;
        } else {
         break;
        }
       }
      }
      break;
     }
     case 17:  {
      if ($18) {
       $$3154240 = $29;$$3168242 = $$3168239;$$3241 = $31;
       while(1) {
        $50 = HEAP16[$$3154240>>1]|0;
        HEAP16[$$3241>>1] = $50;
        $51 = ((($$3154240)) + 4|0);
        $52 = ((($$3241)) + 2|0);
        $$3168 = (($$3168242) + -1)|0;
        $53 = ($$3168|0)>(-1);
        if ($53) {
         $$3154240 = $51;$$3168242 = $$3168;$$3241 = $52;
        } else {
         break;
        }
       }
      }
      break;
     }
     case 19:  {
      if ($19) {
       $$4155235 = $29;$$4169237 = $$4169234;$$4236 = $31;
       while(1) {
        $54 = HEAP16[$$4155235>>1]|0;
        $55 = ((($$4236)) + 4|0);
        HEAP16[$55>>1] = $54;
        $56 = ((($$4236)) + 2|0);
        HEAP16[$56>>1] = $54;
        HEAP16[$$4236>>1] = $54;
        $57 = ((($$4155235)) + 4|0);
        $58 = ((($$4236)) + 6|0);
        $$4169 = (($$4169237) + -1)|0;
        $59 = ($$4169|0)>(-1);
        if ($59) {
         $$4155235 = $57;$$4169237 = $$4169;$$4236 = $58;
        } else {
         break;
        }
       }
      }
      break;
     }
     case 20:  {
      if ($20) {
       $$5156230 = $29;$$5170232 = $$5170229;$$5231 = $31;
       while(1) {
        $60 = HEAP16[$$5156230>>1]|0;
        $61 = ((($$5231)) + 4|0);
        HEAP16[$61>>1] = $60;
        $62 = ((($$5231)) + 2|0);
        HEAP16[$62>>1] = $60;
        HEAP16[$$5231>>1] = $60;
        $63 = ((($$5156230)) + 2|0);
        $64 = HEAP16[$63>>1]|0;
        $65 = ((($$5231)) + 6|0);
        HEAP16[$65>>1] = $64;
        $66 = ((($$5156230)) + 4|0);
        $67 = ((($$5231)) + 8|0);
        $$5170 = (($$5170232) + -1)|0;
        $68 = ($$5170|0)>(-1);
        if ($68) {
         $$5156230 = $66;$$5170232 = $$5170;$$5231 = $67;
        } else {
         break;
        }
       }
      }
      break;
     }
     case 28:  {
      if ($21) {
       $$6157225 = $29;$$6171227 = $$6171224;$$6226 = $31;
       while(1) {
        $69 = HEAP16[$$6157225>>1]|0;
        HEAP16[$$6226>>1] = $69;
        $70 = ((($$6157225)) + 2|0);
        $71 = HEAP16[$70>>1]|0;
        $72 = ((($$6226)) + 2|0);
        HEAP16[$72>>1] = $71;
        $73 = ((($$6157225)) + 4|0);
        $74 = HEAP16[$73>>1]|0;
        $75 = ((($$6226)) + 4|0);
        HEAP16[$75>>1] = $74;
        $76 = ((($$6226)) + 6|0);
        HEAP16[$76>>1] = -1;
        $77 = ((($$6157225)) + 6|0);
        $78 = ((($$6226)) + 8|0);
        $$6171 = (($$6171227) + -1)|0;
        $79 = ($$6171|0)>(-1);
        if ($79) {
         $$6157225 = $77;$$6171227 = $$6171;$$6226 = $78;
        } else {
         break;
        }
       }
      }
      break;
     }
     case 25:  {
      if ($22) {
       $$7158220 = $29;$$7172222 = $$7172219;$$7221 = $31;
       while(1) {
        $80 = HEAP16[$$7158220>>1]|0;
        $81 = $80&65535;
        $82 = ((($$7158220)) + 2|0);
        $83 = HEAP16[$82>>1]|0;
        $84 = $83&65535;
        $85 = ((($$7158220)) + 4|0);
        $86 = HEAP16[$85>>1]|0;
        $87 = $86&65535;
        $88 = (_stbi__compute_y_16($81,$84,$87)|0);
        HEAP16[$$7221>>1] = $88;
        $89 = ((($$7158220)) + 6|0);
        $90 = ((($$7221)) + 2|0);
        $$7172 = (($$7172222) + -1)|0;
        $91 = ($$7172|0)>(-1);
        if ($91) {
         $$7158220 = $89;$$7172222 = $$7172;$$7221 = $90;
        } else {
         break;
        }
       }
      }
      break;
     }
     case 26:  {
      if ($23) {
       $$8159215 = $29;$$8173217 = $$8173214;$$8216 = $31;
       while(1) {
        $92 = HEAP16[$$8159215>>1]|0;
        $93 = $92&65535;
        $94 = ((($$8159215)) + 2|0);
        $95 = HEAP16[$94>>1]|0;
        $96 = $95&65535;
        $97 = ((($$8159215)) + 4|0);
        $98 = HEAP16[$97>>1]|0;
        $99 = $98&65535;
        $100 = (_stbi__compute_y_16($93,$96,$99)|0);
        HEAP16[$$8216>>1] = $100;
        $101 = ((($$8216)) + 2|0);
        HEAP16[$101>>1] = -1;
        $102 = ((($$8159215)) + 6|0);
        $103 = ((($$8216)) + 4|0);
        $$8173 = (($$8173217) + -1)|0;
        $104 = ($$8173|0)>(-1);
        if ($104) {
         $$8159215 = $102;$$8173217 = $$8173;$$8216 = $103;
        } else {
         break;
        }
       }
      }
      break;
     }
     case 33:  {
      if ($24) {
       $$9160210 = $29;$$9174212 = $$9174209;$$9211 = $31;
       while(1) {
        $105 = HEAP16[$$9160210>>1]|0;
        $106 = $105&65535;
        $107 = ((($$9160210)) + 2|0);
        $108 = HEAP16[$107>>1]|0;
        $109 = $108&65535;
        $110 = ((($$9160210)) + 4|0);
        $111 = HEAP16[$110>>1]|0;
        $112 = $111&65535;
        $113 = (_stbi__compute_y_16($106,$109,$112)|0);
        HEAP16[$$9211>>1] = $113;
        $114 = ((($$9160210)) + 8|0);
        $115 = ((($$9211)) + 2|0);
        $$9174 = (($$9174212) + -1)|0;
        $116 = ($$9174|0)>(-1);
        if ($116) {
         $$9160210 = $114;$$9174212 = $$9174;$$9211 = $115;
        } else {
         break;
        }
       }
      }
      break;
     }
     case 34:  {
      if ($25) {
       $$10161205 = $29;$$10175207 = $$10175204;$$10206 = $31;
       while(1) {
        $117 = HEAP16[$$10161205>>1]|0;
        $118 = $117&65535;
        $119 = ((($$10161205)) + 2|0);
        $120 = HEAP16[$119>>1]|0;
        $121 = $120&65535;
        $122 = ((($$10161205)) + 4|0);
        $123 = HEAP16[$122>>1]|0;
        $124 = $123&65535;
        $125 = (_stbi__compute_y_16($118,$121,$124)|0);
        HEAP16[$$10206>>1] = $125;
        $126 = ((($$10161205)) + 6|0);
        $127 = HEAP16[$126>>1]|0;
        $128 = ((($$10206)) + 2|0);
        HEAP16[$128>>1] = $127;
        $129 = ((($$10161205)) + 8|0);
        $130 = ((($$10206)) + 4|0);
        $$10175 = (($$10175207) + -1)|0;
        $131 = ($$10175|0)>(-1);
        if ($131) {
         $$10161205 = $129;$$10175207 = $$10175;$$10206 = $130;
        } else {
         break;
        }
       }
      }
      break;
     }
     case 35:  {
      if ($26) {
       $$11162201 = $29;$$11176203 = $$11176200;$$11202 = $31;
       while(1) {
        $132 = HEAP16[$$11162201>>1]|0;
        HEAP16[$$11202>>1] = $132;
        $133 = ((($$11162201)) + 2|0);
        $134 = HEAP16[$133>>1]|0;
        $135 = ((($$11202)) + 2|0);
        HEAP16[$135>>1] = $134;
        $136 = ((($$11162201)) + 4|0);
        $137 = HEAP16[$136>>1]|0;
        $138 = ((($$11202)) + 4|0);
        HEAP16[$138>>1] = $137;
        $139 = ((($$11162201)) + 8|0);
        $140 = ((($$11202)) + 6|0);
        $$11176 = (($$11176203) + -1)|0;
        $141 = ($$11176|0)>(-1);
        if ($141) {
         $$11162201 = $139;$$11176203 = $$11176;$$11202 = $140;
        } else {
         break;
        }
       }
      }
      break;
     }
     default: {
      break L13;
     }
     }
    } while(0);
    $142 = (($$0164259) + 1)|0;
    $143 = ($142|0)<($4|0);
    if ($143) {
     $$0164259 = $142;
    } else {
     break L11;
    }
   }
   ___assert_fail((13672|0),(10116|0),1555,(10243|0));
   // unreachable;
  }
 } while(0);
 _free($0);
 $$0163 = $10;
 return ($$0163|0);
}
function _stbi__compute_y_16($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $3 = ($0*77)|0;
 $4 = ($1*150)|0;
 $5 = (($4) + ($3))|0;
 $6 = ($2*29)|0;
 $7 = (($5) + ($6))|0;
 $8 = $7 >>> 8;
 $9 = $8&65535;
 return ($9|0);
}
function _stbi__malloc_mad3($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $$0 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $3 = (_stbi__mad3sizes_valid($0,$1,$2)|0);
 $4 = ($3|0)==(0);
 if ($4) {
  $$0 = 0;
  return ($$0|0);
 }
 $5 = Math_imul($1, $0)|0;
 $6 = Math_imul($5, $2)|0;
 $7 = (_stbi__malloc($6)|0);
 $$0 = $7;
 return ($$0|0);
}
function _stbi__compute_y($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $3 = ($0*77)|0;
 $4 = ($1*150)|0;
 $5 = (($4) + ($3))|0;
 $6 = ($2*29)|0;
 $7 = (($5) + ($6))|0;
 $8 = $7 >>> 8;
 $9 = $8&255;
 return ($9|0);
}
function _stbi__mad3sizes_valid($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $10 = 0, $11 = 0, $12 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $3 = (_stbi__mul2sizes_valid($0,$1)|0);
 $4 = ($3|0)==(0);
 if ($4) {
  $12 = 0;
 } else {
  $5 = Math_imul($1, $0)|0;
  $6 = (_stbi__mul2sizes_valid($5,$2)|0);
  $7 = ($6|0)==(0);
  if ($7) {
   $12 = 0;
  } else {
   $8 = Math_imul($5, $2)|0;
   $9 = (_stbi__addsizes_valid($8)|0);
   $10 = ($9|0)!=(0);
   $12 = $10;
  }
 }
 $11 = $12&1;
 return ($11|0);
}
function _stbi__mul2sizes_valid($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$0 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = $1 | $0;
 $3 = ($2|0)<(0);
 if ($3) {
  $$0 = 0;
 } else {
  $4 = ($1|0)==(0);
  if ($4) {
   $$0 = 1;
  } else {
   $5 = (2147483647 / ($1|0))&-1;
   $6 = ($5|0)>=($0|0);
   $7 = $6&1;
   $$0 = $7;
  }
 }
 return ($$0|0);
}
function _stbi__addsizes_valid($0) {
 $0 = $0|0;
 var label = 0, sp = 0;
 sp = STACKTOP;
 return 1;
}
function _stbi__check_png_header($0) {
 $0 = $0|0;
 var $$05 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = (_stbi__get8($0)|0);
 $2 = ($1<<24>>24)==(-119);
 if ($2) {
  $3 = (_stbi__get8($0)|0);
  $4 = ($3<<24>>24)==(80);
  if ($4) {
   $5 = (_stbi__get8($0)|0);
   $6 = ($5<<24>>24)==(78);
   if ($6) {
    $7 = (_stbi__get8($0)|0);
    $8 = ($7<<24>>24)==(71);
    if ($8) {
     $9 = (_stbi__get8($0)|0);
     $10 = ($9<<24>>24)==(13);
     if ($10) {
      $11 = (_stbi__get8($0)|0);
      $12 = ($11<<24>>24)==(10);
      if ($12) {
       $13 = (_stbi__get8($0)|0);
       $14 = ($13<<24>>24)==(26);
       if ($14) {
        $15 = (_stbi__get8($0)|0);
        $16 = ($15<<24>>24)==(10);
        if ($16) {
         $$05 = 1;
         return ($$05|0);
        }
       }
      }
     }
    }
   }
  }
 }
 _stbi__err(11525);
 $$05 = 0;
 return ($$05|0);
}
function _stbi__get_chunk_header($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$sroa$4$0$$sroa_idx2 = 0, $2 = 0, $3 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = (_stbi__get32be($1)|0);
 $3 = (_stbi__get32be($1)|0);
 HEAP32[$0>>2] = $2;
 $$sroa$4$0$$sroa_idx2 = ((($0)) + 4|0);
 HEAP32[$$sroa$4$0$$sroa_idx2>>2] = $3;
 return;
}
function _stbi__skip($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0;
 var $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = ($1|0)<(0);
 if ($2) {
  $3 = ((($0)) + 172|0);
  $4 = HEAP32[$3>>2]|0;
  $5 = ((($0)) + 168|0);
  HEAP32[$5>>2] = $4;
  return;
 }
 $6 = ((($0)) + 16|0);
 $7 = HEAP32[$6>>2]|0;
 $8 = ($7|0)==(0|0);
 if (!($8)) {
  $9 = ((($0)) + 172|0);
  $10 = HEAP32[$9>>2]|0;
  $11 = ((($0)) + 168|0);
  $12 = HEAP32[$11>>2]|0;
  $13 = $10;
  $14 = (($13) - ($12))|0;
  $15 = ($14|0)<($1|0);
  if ($15) {
   HEAP32[$11>>2] = $10;
   $16 = ((($0)) + 20|0);
   $17 = HEAP32[$16>>2]|0;
   $18 = ((($0)) + 28|0);
   $19 = HEAP32[$18>>2]|0;
   $20 = (($1) - ($14))|0;
   FUNCTION_TABLE_vii[$17 & 63]($19,$20);
   return;
  }
 }
 $21 = ((($0)) + 168|0);
 $22 = HEAP32[$21>>2]|0;
 $23 = (($22) + ($1)|0);
 HEAP32[$21>>2] = $23;
 return;
}
function _stbi__get32be($0) {
 $0 = $0|0;
 var $1 = 0, $2 = 0, $3 = 0, $4 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = (_stbi__get16be($0)|0);
 $2 = $1 << 16;
 $3 = (_stbi__get16be($0)|0);
 $4 = (($2) + ($3))|0;
 return ($4|0);
}
function _stbi__get8($0) {
 $0 = $0|0;
 var $$0 = 0, $$sink6 = 0, $1 = 0, $10 = 0, $11 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = ((($0)) + 168|0);
 $2 = HEAP32[$1>>2]|0;
 $3 = ((($0)) + 172|0);
 $4 = HEAP32[$3>>2]|0;
 $5 = ($2>>>0)<($4>>>0);
 do {
  if ($5) {
   $$sink6 = $2;
  } else {
   $6 = ((($0)) + 32|0);
   $7 = HEAP32[$6>>2]|0;
   $8 = ($7|0)==(0);
   if ($8) {
    $$0 = 0;
    return ($$0|0);
   } else {
    _stbi__refill_buffer($0);
    $9 = HEAP32[$1>>2]|0;
    $$sink6 = $9;
    break;
   }
  }
 } while(0);
 $10 = ((($$sink6)) + 1|0);
 HEAP32[$1>>2] = $10;
 $11 = HEAP8[$$sink6>>0]|0;
 $$0 = $11;
 return ($$0|0);
}
function _stbi__get16be($0) {
 $0 = $0|0;
 var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = (_stbi__get8($0)|0);
 $2 = $1&255;
 $3 = $2 << 8;
 $4 = (_stbi__get8($0)|0);
 $5 = $4&255;
 $6 = $3 | $5;
 return ($6|0);
}
function _stbi__getn($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $$1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0;
 var $29 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $3 = ((($0)) + 16|0);
 $4 = HEAP32[$3>>2]|0;
 $5 = ($4|0)==(0|0);
 if (!($5)) {
  $6 = ((($0)) + 172|0);
  $7 = HEAP32[$6>>2]|0;
  $8 = ((($0)) + 168|0);
  $9 = HEAP32[$8>>2]|0;
  $10 = $9;
  $11 = (($7) - ($10))|0;
  $12 = ($11|0)<($2|0);
  if ($12) {
   _memcpy(($1|0),($9|0),($11|0))|0;
   $13 = HEAP32[$3>>2]|0;
   $14 = ((($0)) + 28|0);
   $15 = HEAP32[$14>>2]|0;
   $16 = (($1) + ($11)|0);
   $17 = (($2) - ($11))|0;
   $18 = (FUNCTION_TABLE_iiii[$13 & 15]($15,$16,$17)|0);
   $19 = ($18|0)==($17|0);
   $20 = $19&1;
   $21 = HEAP32[$6>>2]|0;
   HEAP32[$8>>2] = $21;
   $$1 = $20;
   return ($$1|0);
  }
 }
 $22 = ((($0)) + 168|0);
 $23 = HEAP32[$22>>2]|0;
 $24 = (($23) + ($2)|0);
 $25 = ((($0)) + 172|0);
 $26 = HEAP32[$25>>2]|0;
 $27 = ($24>>>0)>($26>>>0);
 if ($27) {
  $$1 = 0;
  return ($$1|0);
 }
 _memcpy(($1|0),($23|0),($2|0))|0;
 $28 = HEAP32[$22>>2]|0;
 $29 = (($28) + ($2)|0);
 HEAP32[$22>>2] = $29;
 $$1 = 1;
 return ($$1|0);
}
function _stbi_zlib_decode_malloc_guesssize_headerflag($0,$1,$2,$3,$4) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 $4 = $4|0;
 var $$0 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 4080|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(4080|0);
 $5 = sp;
 $6 = (_stbi__malloc($2)|0);
 $7 = ($6|0)==(0|0);
 do {
  if ($7) {
   $$0 = 0;
  } else {
   HEAP32[$5>>2] = $0;
   $8 = (($0) + ($1)|0);
   $9 = ((($5)) + 4|0);
   HEAP32[$9>>2] = $8;
   $10 = (_stbi__do_zlib($5,$6,$2,1,$4)|0);
   $11 = ($10|0)==(0);
   $12 = ((($5)) + 20|0);
   $13 = HEAP32[$12>>2]|0;
   if ($11) {
    _free($13);
    $$0 = 0;
    break;
   }
   $14 = ($3|0)==(0|0);
   if ($14) {
    $$0 = $13;
   } else {
    $15 = ((($5)) + 16|0);
    $16 = HEAP32[$15>>2]|0;
    $17 = $13;
    $18 = (($16) - ($17))|0;
    HEAP32[$3>>2] = $18;
    $$0 = $13;
   }
  }
 } while(0);
 STACKTOP = sp;return ($$0|0);
}
function _stbi__create_png_image($0,$1,$2,$3,$4,$5,$6) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 $4 = $4|0;
 $5 = $5|0;
 $6 = $6|0;
 var $$0103117 = 0, $$0106116 = 0, $$0107115 = 0, $$095119 = 0, $$099118 = 0, $$3102$ph = 0, $$398$ph = 0, $$4 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0;
 var $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $40 = 0, $41 = 0;
 var $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $60 = 0, $61 = 0;
 var $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0;
 var $80 = 0, $81 = 0, $82 = 0, $9 = 0, $or$cond = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $7 = ($4|0)==(16);
 $8 = $7 ? 2 : 1;
 $9 = Math_imul($8, $3)|0;
 $10 = ($6|0)==(0);
 $11 = HEAP32[$0>>2]|0;
 $12 = HEAP32[$11>>2]|0;
 $13 = ((($11)) + 4|0);
 $14 = HEAP32[$13>>2]|0;
 if ($10) {
  $15 = (_stbi__create_png_image_raw($0,$1,$2,$3,$12,$14,$4,$5)|0);
  $$4 = $15;
  return ($$4|0);
 }
 $16 = (_stbi__malloc_mad3($12,$14,$9)|0);
 $17 = ((($0)) + 12|0);
 $18 = ((($0)) + 12|0);
 $$0103117 = 0;$$095119 = $1;$$099118 = $2;
 while(1) {
  $19 = HEAP32[$0>>2]|0;
  $20 = HEAP32[$19>>2]|0;
  $21 = (3012 + ($$0103117<<2)|0);
  $22 = HEAP32[$21>>2]|0;
  $23 = (3040 + ($$0103117<<2)|0);
  $24 = HEAP32[$23>>2]|0;
  $25 = (($20) + -1)|0;
  $26 = (($25) - ($22))|0;
  $27 = (($26) + ($24))|0;
  $28 = (($27>>>0) / ($24>>>0))&-1;
  $29 = ((($19)) + 4|0);
  $30 = HEAP32[$29>>2]|0;
  $31 = (3068 + ($$0103117<<2)|0);
  $32 = HEAP32[$31>>2]|0;
  $33 = (3096 + ($$0103117<<2)|0);
  $34 = HEAP32[$33>>2]|0;
  $35 = (($30) + -1)|0;
  $36 = (($35) - ($32))|0;
  $37 = (($36) + ($34))|0;
  $38 = (($37>>>0) / ($34>>>0))&-1;
  $39 = ($24>>>0)<=($27>>>0);
  $40 = ($34>>>0)<=($37>>>0);
  $or$cond = $39 & $40;
  if ($or$cond) {
   $41 = ((($19)) + 8|0);
   $42 = HEAP32[$41>>2]|0;
   $43 = Math_imul($28, $4)|0;
   $44 = Math_imul($43, $42)|0;
   $45 = (($44) + 7)|0;
   $46 = $45 >> 3;
   $47 = (($46) + 1)|0;
   $48 = Math_imul($47, $38)|0;
   $49 = (_stbi__create_png_image_raw($0,$$095119,$$099118,$3,$28,$38,$4,$5)|0);
   $50 = ($49|0)==(0);
   if ($50) {
    label = 13;
    break;
   }
   $51 = ($38|0)>(0);
   if ($51) {
    $52 = ($28|0)>(0);
    $$0106116 = 0;
    while(1) {
     if ($52) {
      $53 = HEAP32[$33>>2]|0;
      $54 = Math_imul($53, $$0106116)|0;
      $55 = HEAP32[$31>>2]|0;
      $56 = (($54) + ($55))|0;
      $57 = HEAP32[$23>>2]|0;
      $58 = HEAP32[$21>>2]|0;
      $59 = Math_imul($56, $9)|0;
      $60 = Math_imul($$0106116, $28)|0;
      $$0107115 = 0;
      while(1) {
       $61 = Math_imul($57, $$0107115)|0;
       $62 = (($61) + ($58))|0;
       $63 = HEAP32[$0>>2]|0;
       $64 = HEAP32[$63>>2]|0;
       $65 = Math_imul($59, $64)|0;
       $66 = (($16) + ($65)|0);
       $67 = Math_imul($62, $9)|0;
       $68 = (($66) + ($67)|0);
       $69 = HEAP32[$18>>2]|0;
       $70 = (($$0107115) + ($60))|0;
       $71 = Math_imul($70, $9)|0;
       $72 = (($69) + ($71)|0);
       _memcpy(($68|0),($72|0),($9|0))|0;
       $73 = (($$0107115) + 1)|0;
       $74 = ($73|0)<($28|0);
       if ($74) {
        $$0107115 = $73;
       } else {
        break;
       }
      }
     }
     $75 = (($$0106116) + 1)|0;
     $76 = ($75|0)<($38|0);
     if ($76) {
      $$0106116 = $75;
     } else {
      break;
     }
    }
   }
   $77 = HEAP32[$17>>2]|0;
   _free($77);
   $78 = (($$095119) + ($48)|0);
   $79 = (($$099118) - ($48))|0;
   $$3102$ph = $79;$$398$ph = $78;
  } else {
   $$3102$ph = $$099118;$$398$ph = $$095119;
  }
  $80 = (($$0103117) + 1)|0;
  $81 = ($80|0)<(7);
  if ($81) {
   $$0103117 = $80;$$095119 = $$398$ph;$$099118 = $$3102$ph;
  } else {
   label = 15;
   break;
  }
 }
 if ((label|0) == 13) {
  _free($16);
  $$4 = 0;
  return ($$4|0);
 }
 else if ((label|0) == 15) {
  $82 = ((($0)) + 12|0);
  HEAP32[$82>>2] = $16;
  $$4 = 1;
  return ($$4|0);
 }
 return (0)|0;
}
function _stbi__compute_transparency16($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $$0323 = 0, $$04 = 0, $$1335 = 0, $$16 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
 var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $exitcond9 = 0, $not$ = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $3 = HEAP32[$0>>2]|0;
 $4 = HEAP32[$3>>2]|0;
 $5 = ((($3)) + 4|0);
 $6 = HEAP32[$5>>2]|0;
 $7 = Math_imul($6, $4)|0;
 $8 = ((($0)) + 12|0);
 $9 = HEAP32[$8>>2]|0;
 switch ($2|0) {
 case 2:  {
  $13 = ($7|0)==(0);
  if ($13) {
   return;
  } else {
   $$0323 = 0;$$04 = $9;
  }
  while(1) {
   $14 = HEAP16[$$04>>1]|0;
   $15 = HEAP16[$1>>1]|0;
   $not$ = ($14<<16>>16)!=($15<<16>>16);
   $16 = $not$ << 31 >> 31;
   $17 = ((($$04)) + 2|0);
   HEAP16[$17>>1] = $16;
   $18 = ((($$04)) + 4|0);
   $19 = (($$0323) + 1)|0;
   $exitcond = ($19|0)==($7|0);
   if ($exitcond) {
    break;
   } else {
    $$0323 = $19;$$04 = $18;
   }
  }
  return;
  break;
 }
 case 4:  {
  $10 = ($7|0)==(0);
  if ($10) {
   return;
  }
  $11 = ((($1)) + 2|0);
  $12 = ((($1)) + 4|0);
  $$1335 = 0;$$16 = $9;
  while(1) {
   $20 = HEAP16[$$16>>1]|0;
   $21 = HEAP16[$1>>1]|0;
   $22 = ($20<<16>>16)==($21<<16>>16);
   if ($22) {
    $23 = ((($$16)) + 2|0);
    $24 = HEAP16[$23>>1]|0;
    $25 = HEAP16[$11>>1]|0;
    $26 = ($24<<16>>16)==($25<<16>>16);
    if ($26) {
     $27 = ((($$16)) + 4|0);
     $28 = HEAP16[$27>>1]|0;
     $29 = HEAP16[$12>>1]|0;
     $30 = ($28<<16>>16)==($29<<16>>16);
     if ($30) {
      $31 = ((($$16)) + 6|0);
      HEAP16[$31>>1] = 0;
     }
    }
   }
   $32 = ((($$16)) + 8|0);
   $33 = (($$1335) + 1)|0;
   $exitcond9 = ($33|0)==($7|0);
   if ($exitcond9) {
    break;
   } else {
    $$1335 = $33;$$16 = $32;
   }
  }
  return;
  break;
 }
 default: {
  ___assert_fail((10607|0),(10116|0),4569,(10659|0));
  // unreachable;
 }
 }
}
function _stbi__compute_transparency($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $$0323 = 0, $$04 = 0, $$1335 = 0, $$16 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
 var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $exitcond9 = 0, $not$ = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $3 = HEAP32[$0>>2]|0;
 $4 = HEAP32[$3>>2]|0;
 $5 = ((($3)) + 4|0);
 $6 = HEAP32[$5>>2]|0;
 $7 = Math_imul($6, $4)|0;
 $8 = ((($0)) + 12|0);
 $9 = HEAP32[$8>>2]|0;
 switch ($2|0) {
 case 2:  {
  $13 = ($7|0)==(0);
  if ($13) {
   return;
  } else {
   $$0323 = 0;$$04 = $9;
  }
  while(1) {
   $14 = HEAP8[$$04>>0]|0;
   $15 = HEAP8[$1>>0]|0;
   $not$ = ($14<<24>>24)!=($15<<24>>24);
   $16 = $not$ << 31 >> 31;
   $17 = ((($$04)) + 1|0);
   HEAP8[$17>>0] = $16;
   $18 = ((($$04)) + 2|0);
   $19 = (($$0323) + 1)|0;
   $exitcond = ($19|0)==($7|0);
   if ($exitcond) {
    break;
   } else {
    $$0323 = $19;$$04 = $18;
   }
  }
  return;
  break;
 }
 case 4:  {
  $10 = ($7|0)==(0);
  if ($10) {
   return;
  }
  $11 = ((($1)) + 1|0);
  $12 = ((($1)) + 2|0);
  $$1335 = 0;$$16 = $9;
  while(1) {
   $20 = HEAP8[$$16>>0]|0;
   $21 = HEAP8[$1>>0]|0;
   $22 = ($20<<24>>24)==($21<<24>>24);
   if ($22) {
    $23 = ((($$16)) + 1|0);
    $24 = HEAP8[$23>>0]|0;
    $25 = HEAP8[$11>>0]|0;
    $26 = ($24<<24>>24)==($25<<24>>24);
    if ($26) {
     $27 = ((($$16)) + 2|0);
     $28 = HEAP8[$27>>0]|0;
     $29 = HEAP8[$12>>0]|0;
     $30 = ($28<<24>>24)==($29<<24>>24);
     if ($30) {
      $31 = ((($$16)) + 3|0);
      HEAP8[$31>>0] = 0;
     }
    }
   }
   $32 = ((($$16)) + 4|0);
   $33 = (($$1335) + 1)|0;
   $exitcond9 = ($33|0)==($7|0);
   if ($exitcond9) {
    break;
   } else {
    $$1335 = $33;$$16 = $32;
   }
  }
  return;
  break;
 }
 default: {
  ___assert_fail((10607|0),(10116|0),4544,(10632|0));
  // unreachable;
 }
 }
}
function _stbi__de_iphone($0) {
 $0 = $0|0;
 var $$05158 = 0, $$059 = 0, $$15263 = 0, $$164 = 0, $$25360 = 0, $$261 = 0, $$sink = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0;
 var $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0;
 var $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $exitcond68 = 0, $exitcond69 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = HEAP32[$0>>2]|0;
 $2 = HEAP32[$1>>2]|0;
 $3 = ((($1)) + 4|0);
 $4 = HEAP32[$3>>2]|0;
 $5 = Math_imul($4, $2)|0;
 $6 = ((($0)) + 12|0);
 $7 = HEAP32[$6>>2]|0;
 $8 = ((($1)) + 12|0);
 $9 = HEAP32[$8>>2]|0;
 switch ($9|0) {
 case 3:  {
  $10 = ($5|0)==(0);
  if ($10) {
   return;
  } else {
   $$05158 = $7;$$059 = 0;
  }
  while(1) {
   $11 = HEAP8[$$05158>>0]|0;
   $12 = ((($$05158)) + 2|0);
   $13 = HEAP8[$12>>0]|0;
   HEAP8[$$05158>>0] = $13;
   HEAP8[$12>>0] = $11;
   $14 = ((($$05158)) + 3|0);
   $15 = (($$059) + 1)|0;
   $exitcond = ($15|0)==($5|0);
   if ($exitcond) {
    break;
   } else {
    $$05158 = $14;$$059 = $15;
   }
  }
  return;
  break;
 }
 case 4:  {
  $16 = HEAP32[5670]|0;
  $17 = ($16|0)==(0);
  $18 = ($5|0)!=(0);
  if ($17) {
   if ($18) {
    $$25360 = $7;$$261 = 0;
   } else {
    return;
   }
   while(1) {
    $42 = HEAP8[$$25360>>0]|0;
    $43 = ((($$25360)) + 2|0);
    $44 = HEAP8[$43>>0]|0;
    HEAP8[$$25360>>0] = $44;
    HEAP8[$43>>0] = $42;
    $45 = ((($$25360)) + 4|0);
    $46 = (($$261) + 1)|0;
    $exitcond68 = ($46|0)==($5|0);
    if ($exitcond68) {
     break;
    } else {
     $$25360 = $45;$$261 = $46;
    }
   }
   return;
  }
  if ($18) {
   $$15263 = $7;$$164 = 0;
  } else {
   return;
  }
  while(1) {
   $19 = ((($$15263)) + 3|0);
   $20 = HEAP8[$19>>0]|0;
   $21 = HEAP8[$$15263>>0]|0;
   $22 = ($20<<24>>24)==(0);
   $23 = ((($$15263)) + 2|0);
   $24 = HEAP8[$23>>0]|0;
   if ($22) {
    HEAP8[$$15263>>0] = $24;
    $$sink = $21;
   } else {
    $25 = $24&255;
    $26 = ($25*255)|0;
    $27 = $20&255;
    $28 = (($26>>>0) / ($27>>>0))&-1;
    $29 = $28&255;
    HEAP8[$$15263>>0] = $29;
    $30 = ((($$15263)) + 1|0);
    $31 = HEAP8[$30>>0]|0;
    $32 = $31&255;
    $33 = ($32*255)|0;
    $34 = (($33>>>0) / ($27>>>0))&-1;
    $35 = $34&255;
    HEAP8[$30>>0] = $35;
    $36 = $21&255;
    $37 = ($36*255)|0;
    $38 = (($37>>>0) / ($27>>>0))&-1;
    $39 = $38&255;
    $$sink = $39;
   }
   HEAP8[$23>>0] = $$sink;
   $40 = ((($$15263)) + 4|0);
   $41 = (($$164) + 1)|0;
   $exitcond69 = ($41|0)==($5|0);
   if ($exitcond69) {
    break;
   } else {
    $$15263 = $40;$$164 = $41;
   }
  }
  return;
  break;
 }
 default: {
  ___assert_fail((10573|0),(10116|0),4650,(10591|0));
  // unreachable;
 }
 }
}
function _stbi__expand_png_palette($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $$0 = 0, $$0574 = 0, $$0583 = 0, $$1595 = 0, $$16 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0;
 var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0;
 var $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $exitcond9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $3 = HEAP32[$0>>2]|0;
 $4 = HEAP32[$3>>2]|0;
 $5 = ((($3)) + 4|0);
 $6 = HEAP32[$5>>2]|0;
 $7 = Math_imul($6, $4)|0;
 $8 = ((($0)) + 12|0);
 $9 = HEAP32[$8>>2]|0;
 $10 = (_stbi__malloc_mad2($7,$2)|0);
 $11 = ($10|0)==(0|0);
 if ($11) {
  _stbi__err(10171);
  $$0 = 0;
  return ($$0|0);
 }
 $12 = ($2|0)==(3);
 $13 = ($7|0)!=(0);
 if ($12) {
  if ($13) {
   $$0574 = 0;$$0583 = $10;
   while(1) {
    $14 = (($9) + ($$0574)|0);
    $15 = HEAP8[$14>>0]|0;
    $16 = $15&255;
    $17 = $16 << 2;
    $18 = (($1) + ($17)|0);
    $19 = HEAP8[$18>>0]|0;
    HEAP8[$$0583>>0] = $19;
    $20 = $17 | 1;
    $21 = (($1) + ($20)|0);
    $22 = HEAP8[$21>>0]|0;
    $23 = ((($$0583)) + 1|0);
    HEAP8[$23>>0] = $22;
    $24 = $17 | 2;
    $25 = (($1) + ($24)|0);
    $26 = HEAP8[$25>>0]|0;
    $27 = ((($$0583)) + 2|0);
    HEAP8[$27>>0] = $26;
    $28 = ((($$0583)) + 3|0);
    $29 = (($$0574) + 1)|0;
    $exitcond = ($29|0)==($7|0);
    if ($exitcond) {
     break;
    } else {
     $$0574 = $29;$$0583 = $28;
    }
   }
  }
 } else {
  if ($13) {
   $$1595 = $10;$$16 = 0;
   while(1) {
    $30 = (($9) + ($$16)|0);
    $31 = HEAP8[$30>>0]|0;
    $32 = $31&255;
    $33 = $32 << 2;
    $34 = (($1) + ($33)|0);
    $35 = HEAP8[$34>>0]|0;
    HEAP8[$$1595>>0] = $35;
    $36 = $33 | 1;
    $37 = (($1) + ($36)|0);
    $38 = HEAP8[$37>>0]|0;
    $39 = ((($$1595)) + 1|0);
    HEAP8[$39>>0] = $38;
    $40 = $33 | 2;
    $41 = (($1) + ($40)|0);
    $42 = HEAP8[$41>>0]|0;
    $43 = ((($$1595)) + 2|0);
    HEAP8[$43>>0] = $42;
    $44 = $33 | 3;
    $45 = (($1) + ($44)|0);
    $46 = HEAP8[$45>>0]|0;
    $47 = ((($$1595)) + 3|0);
    HEAP8[$47>>0] = $46;
    $48 = ((($$1595)) + 4|0);
    $49 = (($$16) + 1)|0;
    $exitcond9 = ($49|0)==($7|0);
    if ($exitcond9) {
     break;
    } else {
     $$1595 = $48;$$16 = $49;
    }
   }
  }
 }
 $50 = HEAP32[$8>>2]|0;
 _free($50);
 HEAP32[$8>>2] = $10;
 $$0 = 1;
 return ($$0|0);
}
function _stbi__malloc_mad2($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$0 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = (_stbi__mad2sizes_valid($0,$1)|0);
 $3 = ($2|0)==(0);
 if ($3) {
  $$0 = 0;
  return ($$0|0);
 }
 $4 = Math_imul($1, $0)|0;
 $5 = (_stbi__malloc($4)|0);
 $$0 = $5;
 return ($$0|0);
}
function _stbi__mad2sizes_valid($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = (_stbi__mul2sizes_valid($0,$1)|0);
 $3 = ($2|0)==(0);
 if ($3) {
  $8 = 0;
  $7 = $8&1;
  return ($7|0);
 }
 $4 = Math_imul($1, $0)|0;
 $5 = (_stbi__addsizes_valid($4)|0);
 $6 = ($5|0)!=(0);
 $8 = $6;
 $7 = $8&1;
 return ($7|0);
}
function _stbi__create_png_image_raw($0,$1,$2,$3,$4,$5,$6,$7) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 $4 = $4|0;
 $5 = $5|0;
 $6 = $6|0;
 $7 = $7|0;
 var $$0568 = 0, $$0568724 = 0, $$0568725 = 0, $$0571$lcssa = 0, $$0571715 = 0, $$0574$lcssa = 0, $$0574714 = 0, $$0577817 = 0, $$0588 = 0, $$0597 = 0, $$0608816 = 0, $$0611815 = 0, $$0614 = 0, $$0614793 = 0, $$0614796 = 0, $$0623814 = 0, $$0625734 = 0, $$0731 = 0, $$1 = 0, $$10635764 = 0;
 var $$11$ph = 0, $$11636755 = 0, $$12747 = 0, $$13739 = 0, $$14$lcssa = 0, $$14713 = 0, $$15$lcssa = 0, $$15705 = 0, $$1572$lcssa = 0, $$1572707 = 0, $$1575$lcssa = 0, $$1575706 = 0, $$1578 = 0, $$16$lcssa = 0, $$1609 = 0, $$1612 = 0, $$1615 = 0, $$1615785 = 0, $$1615788 = 0, $$1624727 = 0;
 var $$1626812 = 0, $$16700 = 0, $$1721 = 0, $$1722 = 0, $$2 = 0, $$2573$lcssa = 0, $$2573702 = 0, $$2579795 = 0, $$2599794 = 0, $$2616 = 0, $$2616776 = 0, $$2616780 = 0, $$2627810 = 0, $$3580787 = 0, $$3592778 = 0, $$3600786 = 0, $$3617 = 0, $$3617767 = 0, $$3617771 = 0, $$3628808 = 0;
 var $$4$lcssa = 0, $$4581779 = 0, $$4593769 = 0, $$4601777 = 0, $$4618 = 0, $$4618758 = 0, $$4618762 = 0, $$4629806 = 0, $$4701 = 0, $$5582770 = 0, $$5594760 = 0, $$5602768 = 0, $$5619 = 0, $$5619750 = 0, $$5619753 = 0, $$5630804 = 0, $$6583761 = 0, $$6603759 = 0, $$6620 = 0, $$6620742 = 0;
 var $$6620745 = 0, $$6631802 = 0, $$7584752 = 0, $$7604751 = 0, $$7621798 = 0, $$7632790 = 0, $$8585744 = 0, $$8605743 = 0, $$8622729 = 0, $$8633782 = 0, $$9586 = 0, $$9606799 = 0, $$9634773 = 0, $$not = 0, $$sink = 0, $$sink1 = 0, $$sink641 = 0, $10 = 0, $100 = 0, $101 = 0;
 var $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0;
 var $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0;
 var $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0;
 var $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0;
 var $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0;
 var $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0;
 var $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0;
 var $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0;
 var $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0;
 var $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0;
 var $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $30 = 0, $300 = 0, $301 = 0;
 var $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0, $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0;
 var $320 = 0, $321 = 0, $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0, $332 = 0, $333 = 0, $334 = 0, $335 = 0, $336 = 0, $337 = 0, $338 = 0;
 var $339 = 0, $34 = 0, $340 = 0, $341 = 0, $342 = 0, $343 = 0, $344 = 0, $345 = 0, $346 = 0, $347 = 0, $348 = 0, $349 = 0, $35 = 0, $350 = 0, $351 = 0, $352 = 0, $353 = 0, $354 = 0, $355 = 0, $356 = 0;
 var $357 = 0, $358 = 0, $359 = 0, $36 = 0, $360 = 0, $361 = 0, $362 = 0, $363 = 0, $364 = 0, $365 = 0, $366 = 0, $367 = 0, $368 = 0, $369 = 0, $37 = 0, $370 = 0, $371 = 0, $372 = 0, $373 = 0, $374 = 0;
 var $375 = 0, $376 = 0, $377 = 0, $378 = 0, $379 = 0, $38 = 0, $380 = 0, $381 = 0, $382 = 0, $383 = 0, $384 = 0, $385 = 0, $386 = 0, $387 = 0, $388 = 0, $389 = 0, $39 = 0, $390 = 0, $391 = 0, $392 = 0;
 var $393 = 0, $394 = 0, $395 = 0, $396 = 0, $397 = 0, $398 = 0, $399 = 0, $40 = 0, $400 = 0, $401 = 0, $402 = 0, $403 = 0, $404 = 0, $405 = 0, $406 = 0, $407 = 0, $408 = 0, $409 = 0, $41 = 0, $410 = 0;
 var $411 = 0, $412 = 0, $413 = 0, $414 = 0, $415 = 0, $416 = 0, $417 = 0, $418 = 0, $419 = 0, $42 = 0, $420 = 0, $421 = 0, $422 = 0, $423 = 0, $424 = 0, $425 = 0, $426 = 0, $427 = 0, $428 = 0, $429 = 0;
 var $43 = 0, $430 = 0, $431 = 0, $432 = 0, $433 = 0, $434 = 0, $435 = 0, $436 = 0, $437 = 0, $438 = 0, $439 = 0, $44 = 0, $440 = 0, $441 = 0, $442 = 0, $443 = 0, $444 = 0, $445 = 0, $446 = 0, $447 = 0;
 var $448 = 0, $449 = 0, $45 = 0, $450 = 0, $451 = 0, $452 = 0, $453 = 0, $454 = 0, $455 = 0, $456 = 0, $457 = 0, $458 = 0, $459 = 0, $46 = 0, $460 = 0, $461 = 0, $462 = 0, $463 = 0, $464 = 0, $465 = 0;
 var $466 = 0, $467 = 0, $468 = 0, $469 = 0, $47 = 0, $470 = 0, $471 = 0, $472 = 0, $473 = 0, $474 = 0, $475 = 0, $476 = 0, $477 = 0, $478 = 0, $479 = 0, $48 = 0, $480 = 0, $481 = 0, $482 = 0, $483 = 0;
 var $484 = 0, $485 = 0, $486 = 0, $487 = 0, $488 = 0, $489 = 0, $49 = 0, $490 = 0, $491 = 0, $492 = 0, $493 = 0, $494 = 0, $495 = 0, $496 = 0, $497 = 0, $498 = 0, $499 = 0, $50 = 0, $500 = 0, $501 = 0;
 var $502 = 0, $503 = 0, $504 = 0, $505 = 0, $506 = 0, $507 = 0, $508 = 0, $509 = 0, $51 = 0, $510 = 0, $511 = 0, $512 = 0, $513 = 0, $514 = 0, $515 = 0, $516 = 0, $517 = 0, $518 = 0, $519 = 0, $52 = 0;
 var $520 = 0, $521 = 0, $522 = 0, $523 = 0, $524 = 0, $525 = 0, $526 = 0, $527 = 0, $528 = 0, $529 = 0, $53 = 0, $530 = 0, $531 = 0, $532 = 0, $533 = 0, $534 = 0, $535 = 0, $536 = 0, $537 = 0, $538 = 0;
 var $539 = 0, $54 = 0, $540 = 0, $541 = 0, $542 = 0, $543 = 0, $544 = 0, $545 = 0, $546 = 0, $547 = 0, $548 = 0, $549 = 0, $55 = 0, $550 = 0, $551 = 0, $552 = 0, $553 = 0, $554 = 0, $555 = 0, $556 = 0;
 var $557 = 0, $558 = 0, $559 = 0, $56 = 0, $560 = 0, $561 = 0, $562 = 0, $563 = 0, $564 = 0, $565 = 0, $566 = 0, $567 = 0, $568 = 0, $569 = 0, $57 = 0, $570 = 0, $571 = 0, $572 = 0, $573 = 0, $574 = 0;
 var $575 = 0, $576 = 0, $577 = 0, $578 = 0, $579 = 0, $58 = 0, $580 = 0, $581 = 0, $582 = 0, $583 = 0, $584 = 0, $585 = 0, $586 = 0, $587 = 0, $588 = 0, $589 = 0, $59 = 0, $590 = 0, $591 = 0, $592 = 0;
 var $593 = 0, $594 = 0, $595 = 0, $596 = 0, $597 = 0, $598 = 0, $599 = 0, $60 = 0, $600 = 0, $601 = 0, $602 = 0, $603 = 0, $604 = 0, $605 = 0, $606 = 0, $607 = 0, $608 = 0, $609 = 0, $61 = 0, $610 = 0;
 var $611 = 0, $612 = 0, $613 = 0, $614 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0;
 var $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0;
 var $96 = 0, $97 = 0, $98 = 0, $99 = 0, $brmerge = 0, $brmerge894 = 0, $exitcond = 0, $exitcond864 = 0, $exitcond865 = 0, $exitcond867 = 0, $exitcond869 = 0, $exitcond871 = 0, $exitcond873 = 0, $exitcond875 = 0, $exitcond877 = 0, $exitcond880 = 0, $exitcond881 = 0, $exitcond882 = 0, $exitcond883 = 0, $exitcond884 = 0;
 var $exitcond885 = 0, $exitcond886 = 0, $indvars$iv = 0, $indvars$iv$next = 0, $indvars$iv$next849 = 0, $indvars$iv$next852 = 0, $indvars$iv$next855 = 0, $indvars$iv$next858 = 0, $indvars$iv$next861 = 0, $indvars$iv848 = 0, $indvars$iv851 = 0, $indvars$iv854 = 0, $indvars$iv857 = 0, $indvars$iv860 = 0, $or$cond = 0, $scevgep = 0, $scevgep850 = 0, $scevgep853 = 0, $scevgep856 = 0, $scevgep859 = 0;
 var $scevgep862 = 0, $scevgep866 = 0, $scevgep868 = 0, $scevgep870 = 0, $scevgep872 = 0, $scevgep874 = 0, $scevgep876 = 0, $scevgep879 = 0, $trunc = 0, $trunc637 = 0, $trunc638 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $8 = ($6|0)==(16);
 $9 = $8 ? 2 : 1;
 $10 = HEAP32[$0>>2]|0;
 $11 = Math_imul($4, $3)|0;
 $12 = Math_imul($9, $11)|0;
 $13 = ((($10)) + 8|0);
 $14 = HEAP32[$13>>2]|0;
 $15 = Math_imul($9, $3)|0;
 $16 = Math_imul($14, $9)|0;
 $17 = ($14|0)==($3|0);
 $18 = (($14) + 1)|0;
 $19 = ($18|0)==($3|0);
 $or$cond = $17 | $19;
 if (!($or$cond)) {
  ___assert_fail((10688|0),(10116|0),4294,(10729|0));
  // unreachable;
 }
 $20 = (_stbi__malloc_mad3($4,$5,$15)|0);
 $21 = ((($0)) + 12|0);
 HEAP32[$21>>2] = $20;
 $22 = ($20|0)==(0|0);
 if ($22) {
  _stbi__err(10171);
  $$2 = 0;
  return ($$2|0);
 }
 $23 = Math_imul($14, $4)|0;
 $24 = Math_imul($23, $6)|0;
 $25 = (($24) + 7)|0;
 $26 = $25 >>> 3;
 $27 = (($26) + 1)|0;
 $28 = Math_imul($27, $5)|0;
 $29 = HEAP32[$10>>2]|0;
 $30 = ($29|0)==($4|0);
 if ($30) {
  $31 = ((($10)) + 4|0);
  $32 = HEAP32[$31>>2]|0;
  $33 = ($32|0)==($5|0);
  if ($33) {
   $34 = ($28|0)==($2|0);
   if (!($34)) {
    _stbi__err(10756);
    $$2 = 0;
    return ($$2|0);
   }
  } else {
   label = 9;
  }
 } else {
  label = 9;
 }
 if ((label|0) == 9) {
  $35 = ($28>>>0)>($2>>>0);
  if ($35) {
   _stbi__err(10756);
   $$2 = 0;
   return ($$2|0);
  }
 }
 $36 = ($5|0)==(0);
 L18: do {
  if (!($36)) {
   $37 = ($6|0)<(8);
   $38 = ($26>>>0)>($4>>>0);
   $39 = (($11) - ($26))|0;
   $40 = (0 - ($12))|0;
   $41 = ($6|0)==(8);
   $brmerge = $37 | $17;
   $42 = ($4|0)==(0);
   $$0614793 = (($4) + -1)|0;
   $43 = ($$0614793|0)==(0);
   $$1615785 = (($4) + -1)|0;
   $44 = ($$1615785|0)==(0);
   $$2616776 = (($4) + -1)|0;
   $45 = ($$2616776|0)==(0);
   $$3617767 = (($4) + -1)|0;
   $46 = ($$3617767|0)==(0);
   $$4618758 = (($4) + -1)|0;
   $47 = ($$4618758|0)==(0);
   $$5619750 = (($4) + -1)|0;
   $48 = ($$5619750|0)==(0);
   $$6620742 = (($4) + -1)|0;
   $49 = ($$6620742|0)==(0);
   $$not = $8 ^ 1;
   $brmerge894 = $42 | $$not;
   $$0577817 = $1;$$0608816 = $4;$$0611815 = $16;$$0623814 = 0;
   while(1) {
    $50 = HEAP32[$21>>2]|0;
    $51 = Math_imul($$0623814, $12)|0;
    $52 = (($50) + ($51)|0);
    $53 = ((($$0577817)) + 1|0);
    $54 = HEAP8[$$0577817>>0]|0;
    $55 = $54&255;
    $56 = ($54&255)>(4);
    if ($56) {
     label = 105;
     break;
    }
    if ($37) {
     if ($38) {
      label = 16;
      break;
     }
     $57 = (($52) + ($39)|0);
     $$0597 = $57;$$1609 = $26;$$1612 = 1;
    } else {
     $$0597 = $52;$$1609 = $$0608816;$$1612 = $$0611815;
    }
    $58 = (($$0597) + ($40)|0);
    $59 = ($$0623814|0)==(0);
    if ($59) {
     $60 = (10795 + ($55)|0);
     $61 = HEAP8[$60>>0]|0;
     $62 = $61&255;
     $$0588 = $62;
    } else {
     $$0588 = $55;
    }
    $63 = ($$1612|0)>(0);
    L30: do {
     if ($63) {
      $trunc638 = $$0588&255;
      $$0625734 = 0;
      while(1) {
       switch ($trunc638<<24>>24) {
       case 0:  {
        $64 = (($53) + ($$0625734)|0);
        $65 = HEAP8[$64>>0]|0;
        $$sink = $65;
        label = 30;
        break;
       }
       case 1:  {
        $66 = (($53) + ($$0625734)|0);
        $67 = HEAP8[$66>>0]|0;
        $$sink = $67;
        label = 30;
        break;
       }
       case 2:  {
        $68 = (($53) + ($$0625734)|0);
        $69 = HEAP8[$68>>0]|0;
        $70 = $69&255;
        $71 = (($58) + ($$0625734)|0);
        $72 = HEAP8[$71>>0]|0;
        $73 = $72&255;
        $74 = (($73) + ($70))|0;
        $75 = $74&255;
        $$sink = $75;
        label = 30;
        break;
       }
       case 3:  {
        $76 = (($53) + ($$0625734)|0);
        $77 = HEAP8[$76>>0]|0;
        $78 = $77&255;
        $79 = (($58) + ($$0625734)|0);
        $80 = HEAP8[$79>>0]|0;
        $81 = $80&255;
        $82 = $81 >>> 1;
        $83 = (($82) + ($78))|0;
        $84 = $83&255;
        $$sink = $84;
        label = 30;
        break;
       }
       case 4:  {
        $85 = (($53) + ($$0625734)|0);
        $86 = HEAP8[$85>>0]|0;
        $87 = $86&255;
        $88 = (($58) + ($$0625734)|0);
        $89 = HEAP8[$88>>0]|0;
        $90 = $89&255;
        $91 = (_stbi__paeth(0,$90,0)|0);
        $92 = (($91) + ($87))|0;
        $93 = $92&255;
        $$sink = $93;
        label = 30;
        break;
       }
       case 5:  {
        $94 = (($53) + ($$0625734)|0);
        $95 = HEAP8[$94>>0]|0;
        $$sink = $95;
        label = 30;
        break;
       }
       case 6:  {
        $96 = (($53) + ($$0625734)|0);
        $97 = HEAP8[$96>>0]|0;
        $$sink = $97;
        label = 30;
        break;
       }
       default: {
       }
       }
       if ((label|0) == 30) {
        label = 0;
        $$sink1 = (($$0597) + ($$0625734)|0);
        HEAP8[$$sink1>>0] = $$sink;
       }
       $98 = (($$0625734) + 1)|0;
       $exitcond864 = ($98|0)==($$1612|0);
       if ($exitcond864) {
        break L30;
       } else {
        $$0625734 = $98;
       }
      }
     }
    } while(0);
    do {
     if ($41) {
      if (!($17)) {
       $99 = (($$0597) + ($14)|0);
       HEAP8[$99>>0] = -1;
      }
      $100 = (($53) + ($14)|0);
      $$1578 = $100;$$sink641 = $3;
     } else {
      if (!($8)) {
       $105 = ((($$0577817)) + 2|0);
       $$1578 = $105;$$sink641 = 1;
       break;
      }
      if (!($17)) {
       $101 = (($$1612) + 1)|0;
       $102 = (($$0597) + ($101)|0);
       $103 = (($$0597) + ($$1612)|0);
       HEAP8[$103>>0] = -1;
       HEAP8[$102>>0] = -1;
      }
      $104 = (($53) + ($$1612)|0);
      $$1578 = $104;$$sink641 = $15;
     }
    } while(0);
    $106 = (($$0597) + ($$sink641)|0);
    $107 = (($58) + ($$sink641)|0);
    if ($brmerge) {
     $108 = (($$1609) + -1)|0;
     $109 = Math_imul($108, $$1612)|0;
     $trunc637 = $$0588&255;
     switch ($trunc637<<24>>24) {
     case 0:  {
      _memcpy(($106|0),($$1578|0),($109|0))|0;
      break;
     }
     case 1:  {
      $115 = ($109|0)>(0);
      if ($115) {
       $$1626812 = 0;
       while(1) {
        $116 = (($$1578) + ($$1626812)|0);
        $117 = HEAP8[$116>>0]|0;
        $118 = $117&255;
        $119 = (($$1626812) - ($$1612))|0;
        $120 = (($106) + ($119)|0);
        $121 = HEAP8[$120>>0]|0;
        $122 = $121&255;
        $123 = (($122) + ($118))|0;
        $124 = $123&255;
        $125 = (($106) + ($$1626812)|0);
        HEAP8[$125>>0] = $124;
        $126 = (($$1626812) + 1)|0;
        $exitcond886 = ($126|0)==($109|0);
        if ($exitcond886) {
         break;
        } else {
         $$1626812 = $126;
        }
       }
      }
      break;
     }
     case 2:  {
      $114 = ($109|0)>(0);
      if ($114) {
       $$2627810 = 0;
       while(1) {
        $127 = (($$1578) + ($$2627810)|0);
        $128 = HEAP8[$127>>0]|0;
        $129 = $128&255;
        $130 = (($107) + ($$2627810)|0);
        $131 = HEAP8[$130>>0]|0;
        $132 = $131&255;
        $133 = (($132) + ($129))|0;
        $134 = $133&255;
        $135 = (($106) + ($$2627810)|0);
        HEAP8[$135>>0] = $134;
        $136 = (($$2627810) + 1)|0;
        $exitcond885 = ($136|0)==($109|0);
        if ($exitcond885) {
         break;
        } else {
         $$2627810 = $136;
        }
       }
      }
      break;
     }
     case 3:  {
      $113 = ($109|0)>(0);
      if ($113) {
       $$3628808 = 0;
       while(1) {
        $137 = (($$1578) + ($$3628808)|0);
        $138 = HEAP8[$137>>0]|0;
        $139 = $138&255;
        $140 = (($107) + ($$3628808)|0);
        $141 = HEAP8[$140>>0]|0;
        $142 = $141&255;
        $143 = (($$3628808) - ($$1612))|0;
        $144 = (($106) + ($143)|0);
        $145 = HEAP8[$144>>0]|0;
        $146 = $145&255;
        $147 = (($146) + ($142))|0;
        $148 = $147 >>> 1;
        $149 = (($148) + ($139))|0;
        $150 = $149&255;
        $151 = (($106) + ($$3628808)|0);
        HEAP8[$151>>0] = $150;
        $152 = (($$3628808) + 1)|0;
        $exitcond884 = ($152|0)==($109|0);
        if ($exitcond884) {
         break;
        } else {
         $$3628808 = $152;
        }
       }
      }
      break;
     }
     case 4:  {
      $112 = ($109|0)>(0);
      if ($112) {
       $$4629806 = 0;
       while(1) {
        $153 = (($$1578) + ($$4629806)|0);
        $154 = HEAP8[$153>>0]|0;
        $155 = $154&255;
        $156 = (($$4629806) - ($$1612))|0;
        $157 = (($106) + ($156)|0);
        $158 = HEAP8[$157>>0]|0;
        $159 = $158&255;
        $160 = (($107) + ($$4629806)|0);
        $161 = HEAP8[$160>>0]|0;
        $162 = $161&255;
        $163 = (($107) + ($156)|0);
        $164 = HEAP8[$163>>0]|0;
        $165 = $164&255;
        $166 = (_stbi__paeth($159,$162,$165)|0);
        $167 = (($166) + ($155))|0;
        $168 = $167&255;
        $169 = (($106) + ($$4629806)|0);
        HEAP8[$169>>0] = $168;
        $170 = (($$4629806) + 1)|0;
        $exitcond883 = ($170|0)==($109|0);
        if ($exitcond883) {
         break;
        } else {
         $$4629806 = $170;
        }
       }
      }
      break;
     }
     case 5:  {
      $111 = ($109|0)>(0);
      if ($111) {
       $$5630804 = 0;
       while(1) {
        $171 = (($$1578) + ($$5630804)|0);
        $172 = HEAP8[$171>>0]|0;
        $173 = $172&255;
        $174 = (($$5630804) - ($$1612))|0;
        $175 = (($106) + ($174)|0);
        $176 = HEAP8[$175>>0]|0;
        $177 = $176&255;
        $178 = $177 >>> 1;
        $179 = (($178) + ($173))|0;
        $180 = $179&255;
        $181 = (($106) + ($$5630804)|0);
        HEAP8[$181>>0] = $180;
        $182 = (($$5630804) + 1)|0;
        $exitcond882 = ($182|0)==($109|0);
        if ($exitcond882) {
         break;
        } else {
         $$5630804 = $182;
        }
       }
      }
      break;
     }
     case 6:  {
      $110 = ($109|0)>(0);
      if ($110) {
       $$6631802 = 0;
       while(1) {
        $183 = (($$1578) + ($$6631802)|0);
        $184 = HEAP8[$183>>0]|0;
        $185 = $184&255;
        $186 = (($$6631802) - ($$1612))|0;
        $187 = (($106) + ($186)|0);
        $188 = HEAP8[$187>>0]|0;
        $189 = $188&255;
        $190 = (_stbi__paeth($189,0,0)|0);
        $191 = (($190) + ($185))|0;
        $192 = $191&255;
        $193 = (($106) + ($$6631802)|0);
        HEAP8[$193>>0] = $192;
        $194 = (($$6631802) + 1)|0;
        $exitcond881 = ($194|0)==($109|0);
        if ($exitcond881) {
         break;
        } else {
         $$6631802 = $194;
        }
       }
      }
      break;
     }
     default: {
     }
     }
     $195 = (($$1578) + ($109)|0);
     $$11$ph = $195;
    } else {
     if (!($19)) {
      label = 58;
      break;
     }
     $trunc = $$0588&255;
     switch ($trunc<<24>>24) {
     case 0:  {
      if ($43) {
       $$9586 = $$1578;
      } else {
       $208 = ($$1612|0)>(0);
       $209 = Math_imul($$6620742, $$1612)|0;
       $$0614796 = $$0614793;$$2579795 = $$1578;$$2599794 = $106;
       while(1) {
        if ($208) {
         $$7632790 = 0;
         while(1) {
          $210 = (($$2579795) + ($$7632790)|0);
          $211 = HEAP8[$210>>0]|0;
          $212 = (($$2599794) + ($$7632790)|0);
          HEAP8[$212>>0] = $211;
          $213 = (($$7632790) + 1)|0;
          $exitcond877 = ($213|0)==($$1612|0);
          if ($exitcond877) {
           break;
          } else {
           $$7632790 = $213;
          }
         }
        }
        $214 = (($$2599794) + ($$1612)|0);
        HEAP8[$214>>0] = -1;
        $215 = (($$2579795) + ($$1612)|0);
        $216 = (($$2599794) + ($15)|0);
        $$0614 = (($$0614796) + -1)|0;
        $217 = ($$0614|0)==(0);
        if ($217) {
         break;
        } else {
         $$0614796 = $$0614;$$2579795 = $215;$$2599794 = $216;
        }
       }
       $scevgep879 = (($$1578) + ($209)|0);
       $$9586 = $scevgep879;
      }
      break;
     }
     case 1:  {
      if ($44) {
       $$9586 = $$1578;
      } else {
       $206 = ($$1612|0)>(0);
       $207 = Math_imul($$6620742, $$1612)|0;
       $$1615788 = $$1615785;$$3580787 = $$1578;$$3600786 = $106;
       while(1) {
        if ($206) {
         $$8633782 = 0;
         while(1) {
          $218 = (($$3580787) + ($$8633782)|0);
          $219 = HEAP8[$218>>0]|0;
          $220 = $219&255;
          $221 = (($$8633782) - ($15))|0;
          $222 = (($$3600786) + ($221)|0);
          $223 = HEAP8[$222>>0]|0;
          $224 = $223&255;
          $225 = (($224) + ($220))|0;
          $226 = $225&255;
          $227 = (($$3600786) + ($$8633782)|0);
          HEAP8[$227>>0] = $226;
          $228 = (($$8633782) + 1)|0;
          $exitcond875 = ($228|0)==($$1612|0);
          if ($exitcond875) {
           break;
          } else {
           $$8633782 = $228;
          }
         }
        }
        $229 = (($$3600786) + ($$1612)|0);
        HEAP8[$229>>0] = -1;
        $230 = (($$3580787) + ($$1612)|0);
        $231 = (($$3600786) + ($15)|0);
        $$1615 = (($$1615788) + -1)|0;
        $232 = ($$1615|0)==(0);
        if ($232) {
         break;
        } else {
         $$1615788 = $$1615;$$3580787 = $230;$$3600786 = $231;
        }
       }
       $scevgep876 = (($$1578) + ($207)|0);
       $$9586 = $scevgep876;
      }
      break;
     }
     case 2:  {
      if ($45) {
       $$9586 = $$1578;
      } else {
       $204 = ($$1612|0)>(0);
       $205 = Math_imul($$6620742, $$1612)|0;
       $$2616780 = $$2616776;$$3592778 = $107;$$4581779 = $$1578;$$4601777 = $106;
       while(1) {
        if ($204) {
         $$9634773 = 0;
         while(1) {
          $233 = (($$4581779) + ($$9634773)|0);
          $234 = HEAP8[$233>>0]|0;
          $235 = $234&255;
          $236 = (($$3592778) + ($$9634773)|0);
          $237 = HEAP8[$236>>0]|0;
          $238 = $237&255;
          $239 = (($238) + ($235))|0;
          $240 = $239&255;
          $241 = (($$4601777) + ($$9634773)|0);
          HEAP8[$241>>0] = $240;
          $242 = (($$9634773) + 1)|0;
          $exitcond873 = ($242|0)==($$1612|0);
          if ($exitcond873) {
           break;
          } else {
           $$9634773 = $242;
          }
         }
        }
        $243 = (($$4601777) + ($$1612)|0);
        HEAP8[$243>>0] = -1;
        $244 = (($$4581779) + ($$1612)|0);
        $245 = (($$4601777) + ($15)|0);
        $246 = (($$3592778) + ($15)|0);
        $$2616 = (($$2616780) + -1)|0;
        $247 = ($$2616|0)==(0);
        if ($247) {
         break;
        } else {
         $$2616780 = $$2616;$$3592778 = $246;$$4581779 = $244;$$4601777 = $245;
        }
       }
       $scevgep874 = (($$1578) + ($205)|0);
       $$9586 = $scevgep874;
      }
      break;
     }
     case 3:  {
      if ($46) {
       $$9586 = $$1578;
      } else {
       $202 = ($$1612|0)>(0);
       $203 = Math_imul($$6620742, $$1612)|0;
       $$3617771 = $$3617767;$$4593769 = $107;$$5582770 = $$1578;$$5602768 = $106;
       while(1) {
        if ($202) {
         $$10635764 = 0;
         while(1) {
          $248 = (($$5582770) + ($$10635764)|0);
          $249 = HEAP8[$248>>0]|0;
          $250 = $249&255;
          $251 = (($$4593769) + ($$10635764)|0);
          $252 = HEAP8[$251>>0]|0;
          $253 = $252&255;
          $254 = (($$10635764) - ($15))|0;
          $255 = (($$5602768) + ($254)|0);
          $256 = HEAP8[$255>>0]|0;
          $257 = $256&255;
          $258 = (($257) + ($253))|0;
          $259 = $258 >>> 1;
          $260 = (($259) + ($250))|0;
          $261 = $260&255;
          $262 = (($$5602768) + ($$10635764)|0);
          HEAP8[$262>>0] = $261;
          $263 = (($$10635764) + 1)|0;
          $exitcond871 = ($263|0)==($$1612|0);
          if ($exitcond871) {
           break;
          } else {
           $$10635764 = $263;
          }
         }
        }
        $264 = (($$5602768) + ($$1612)|0);
        HEAP8[$264>>0] = -1;
        $265 = (($$5582770) + ($$1612)|0);
        $266 = (($$5602768) + ($15)|0);
        $267 = (($$4593769) + ($15)|0);
        $$3617 = (($$3617771) + -1)|0;
        $268 = ($$3617|0)==(0);
        if ($268) {
         break;
        } else {
         $$3617771 = $$3617;$$4593769 = $267;$$5582770 = $265;$$5602768 = $266;
        }
       }
       $scevgep872 = (($$1578) + ($203)|0);
       $$9586 = $scevgep872;
      }
      break;
     }
     case 4:  {
      if ($47) {
       $$9586 = $$1578;
      } else {
       $200 = ($$1612|0)>(0);
       $201 = Math_imul($$6620742, $$1612)|0;
       $$4618762 = $$4618758;$$5594760 = $107;$$6583761 = $$1578;$$6603759 = $106;
       while(1) {
        if ($200) {
         $$11636755 = 0;
         while(1) {
          $269 = (($$6583761) + ($$11636755)|0);
          $270 = HEAP8[$269>>0]|0;
          $271 = $270&255;
          $272 = (($$11636755) - ($15))|0;
          $273 = (($$6603759) + ($272)|0);
          $274 = HEAP8[$273>>0]|0;
          $275 = $274&255;
          $276 = (($$5594760) + ($$11636755)|0);
          $277 = HEAP8[$276>>0]|0;
          $278 = $277&255;
          $279 = (($$5594760) + ($272)|0);
          $280 = HEAP8[$279>>0]|0;
          $281 = $280&255;
          $282 = (_stbi__paeth($275,$278,$281)|0);
          $283 = (($282) + ($271))|0;
          $284 = $283&255;
          $285 = (($$6603759) + ($$11636755)|0);
          HEAP8[$285>>0] = $284;
          $286 = (($$11636755) + 1)|0;
          $exitcond869 = ($286|0)==($$1612|0);
          if ($exitcond869) {
           break;
          } else {
           $$11636755 = $286;
          }
         }
        }
        $287 = (($$6603759) + ($$1612)|0);
        HEAP8[$287>>0] = -1;
        $288 = (($$6583761) + ($$1612)|0);
        $289 = (($$6603759) + ($15)|0);
        $290 = (($$5594760) + ($15)|0);
        $$4618 = (($$4618762) + -1)|0;
        $291 = ($$4618|0)==(0);
        if ($291) {
         break;
        } else {
         $$4618762 = $$4618;$$5594760 = $290;$$6583761 = $288;$$6603759 = $289;
        }
       }
       $scevgep870 = (($$1578) + ($201)|0);
       $$9586 = $scevgep870;
      }
      break;
     }
     case 5:  {
      if ($48) {
       $$9586 = $$1578;
      } else {
       $198 = ($$1612|0)>(0);
       $199 = Math_imul($$6620742, $$1612)|0;
       $$5619753 = $$5619750;$$7584752 = $$1578;$$7604751 = $106;
       while(1) {
        if ($198) {
         $$12747 = 0;
         while(1) {
          $292 = (($$7584752) + ($$12747)|0);
          $293 = HEAP8[$292>>0]|0;
          $294 = $293&255;
          $295 = (($$12747) - ($15))|0;
          $296 = (($$7604751) + ($295)|0);
          $297 = HEAP8[$296>>0]|0;
          $298 = $297&255;
          $299 = $298 >>> 1;
          $300 = (($299) + ($294))|0;
          $301 = $300&255;
          $302 = (($$7604751) + ($$12747)|0);
          HEAP8[$302>>0] = $301;
          $303 = (($$12747) + 1)|0;
          $exitcond867 = ($303|0)==($$1612|0);
          if ($exitcond867) {
           break;
          } else {
           $$12747 = $303;
          }
         }
        }
        $304 = (($$7604751) + ($$1612)|0);
        HEAP8[$304>>0] = -1;
        $305 = (($$7584752) + ($$1612)|0);
        $306 = (($$7604751) + ($15)|0);
        $$5619 = (($$5619753) + -1)|0;
        $307 = ($$5619|0)==(0);
        if ($307) {
         break;
        } else {
         $$5619753 = $$5619;$$7584752 = $305;$$7604751 = $306;
        }
       }
       $scevgep868 = (($$1578) + ($199)|0);
       $$9586 = $scevgep868;
      }
      break;
     }
     case 6:  {
      if ($49) {
       $$9586 = $$1578;
      } else {
       $196 = ($$1612|0)>(0);
       $197 = Math_imul($$6620742, $$1612)|0;
       $$6620745 = $$6620742;$$8585744 = $$1578;$$8605743 = $106;
       while(1) {
        if ($196) {
         $$13739 = 0;
         while(1) {
          $308 = (($$8585744) + ($$13739)|0);
          $309 = HEAP8[$308>>0]|0;
          $310 = $309&255;
          $311 = (($$13739) - ($15))|0;
          $312 = (($$8605743) + ($311)|0);
          $313 = HEAP8[$312>>0]|0;
          $314 = $313&255;
          $315 = (_stbi__paeth($314,0,0)|0);
          $316 = (($315) + ($310))|0;
          $317 = $316&255;
          $318 = (($$8605743) + ($$13739)|0);
          HEAP8[$318>>0] = $317;
          $319 = (($$13739) + 1)|0;
          $exitcond865 = ($319|0)==($$1612|0);
          if ($exitcond865) {
           break;
          } else {
           $$13739 = $319;
          }
         }
        }
        $320 = (($$8605743) + ($$1612)|0);
        HEAP8[$320>>0] = -1;
        $321 = (($$8585744) + ($$1612)|0);
        $322 = (($$8605743) + ($15)|0);
        $$6620 = (($$6620745) + -1)|0;
        $323 = ($$6620|0)==(0);
        if ($323) {
         break;
        } else {
         $$6620745 = $$6620;$$8585744 = $321;$$8605743 = $322;
        }
       }
       $scevgep866 = (($$1578) + ($197)|0);
       $$9586 = $scevgep866;
      }
      break;
     }
     default: {
      $$9586 = $$1578;
     }
     }
     if ($brmerge894) {
      $$11$ph = $$9586;
     } else {
      $324 = HEAP32[$21>>2]|0;
      $325 = (($324) + ($51)|0);
      $326 = (($$1612) + 1)|0;
      $$7621798 = 0;$$9606799 = $325;
      while(1) {
       $327 = (($$9606799) + ($326)|0);
       HEAP8[$327>>0] = -1;
       $328 = (($$7621798) + 1)|0;
       $329 = (($$9606799) + ($15)|0);
       $exitcond880 = ($328|0)==($4|0);
       if ($exitcond880) {
        $$11$ph = $$9586;
        break;
       } else {
        $$7621798 = $328;$$9606799 = $329;
       }
      }
     }
    }
    $330 = (($$0623814) + 1)|0;
    $331 = ($330>>>0)<($5>>>0);
    if ($331) {
     $$0577817 = $$11$ph;$$0608816 = $$1609;$$0611815 = $$1612;$$0623814 = $330;
    } else {
     break L18;
    }
   }
   if ((label|0) == 16) {
    ___assert_fail((10774|0),(10116|0),4315,(10729|0));
    // unreachable;
   }
   else if ((label|0) == 58) {
    ___assert_fail((10800|0),(10116|0),4377,(10729|0));
    // unreachable;
   }
   else if ((label|0) == 105) {
    _stbi__err(10817);
    $$2 = 0;
    return ($$2|0);
   }
  }
 } while(0);
 $332 = ($6|0)<(8);
 if (!($332)) {
  if (!($8)) {
   $$2 = 1;
   return ($$2|0);
  }
  $601 = Math_imul($4, $3)|0;
  $602 = Math_imul($601, $5)|0;
  $603 = ($602|0)==(0);
  if ($603) {
   $$2 = 1;
   return ($$2|0);
  }
  $604 = HEAP32[$21>>2]|0;
  $$0731 = $604;$$8622729 = 0;
  while(1) {
   $605 = HEAP8[$$0731>>0]|0;
   $606 = $605&255;
   $607 = $606 << 8;
   $608 = ((($$0731)) + 1|0);
   $609 = HEAP8[$608>>0]|0;
   $610 = $609&255;
   $611 = $607 | $610;
   $612 = $611&65535;
   HEAP16[$$0731>>1] = $612;
   $613 = (($$8622729) + 1)|0;
   $614 = ((($$0731)) + 2|0);
   $exitcond = ($613|0)==($602|0);
   if ($exitcond) {
    $$2 = 1;
    break;
   } else {
    $$0731 = $614;$$8622729 = $613;
   }
  }
  return ($$2|0);
 }
 $333 = ($5|0)==(0);
 if ($333) {
  $$2 = 1;
  return ($$2|0);
 }
 $334 = (0 - ($26))|0;
 $335 = ($7|0)==(0);
 $336 = (10513 + ($6)|0);
 $$0568724 = (($4) + -1)|0;
 $337 = ($$0568724|0)>(-1);
 $$1721 = (($4) + -1)|0;
 $338 = ($$1721|0)>(-1);
 $339 = ($23|0)>(1);
 $340 = ($23|0)>(3);
 $341 = ($23|0)>(7);
 $342 = (($23) + -8)|0;
 $343 = $342 >>> 3;
 $344 = $343 << 3;
 $345 = (($344) + 8)|0;
 $346 = (($342) - ($344))|0;
 $347 = (($343) + ($11))|0;
 $348 = (($347) + 1)|0;
 $349 = (($348) - ($26))|0;
 $350 = (($23) + -4)|0;
 $351 = $350 >>> 2;
 $352 = $351 << 2;
 $353 = (($352) + 4)|0;
 $354 = (($350) - ($352))|0;
 $355 = (($351) + ($11))|0;
 $356 = (($355) + 1)|0;
 $357 = (($356) - ($26))|0;
 $358 = (($23) + -2)|0;
 $359 = $358 >>> 1;
 $360 = $359 << 1;
 $361 = (($360) + 2)|0;
 $362 = (($358) - ($360))|0;
 $363 = (($359) + ($11))|0;
 $364 = (($363) + 1)|0;
 $365 = (($364) - ($26))|0;
 $$1624727 = 0;$indvars$iv = $345;$indvars$iv848 = $349;$indvars$iv851 = $353;$indvars$iv854 = $357;$indvars$iv857 = $361;$indvars$iv860 = $365;
 L174: while(1) {
  $366 = HEAP32[$21>>2]|0;
  $367 = Math_imul($$1624727, $12)|0;
  $368 = (($366) + ($367)|0);
  $369 = (($368) + ($11)|0);
  $370 = (($369) + ($334)|0);
  if ($335) {
   $371 = HEAP8[$336>>0]|0;
   $372 = $371&255;
   $377 = $372;
  } else {
   $377 = 1;
  }
  switch ($6|0) {
  case 4:  {
   if ($339) {
    $scevgep859 = (($366) + ($indvars$iv857)|0);
    $$0571715 = $370;$$0574714 = $368;$$14713 = $23;
    while(1) {
     $373 = HEAP8[$$0571715>>0]|0;
     $374 = $373&255;
     $375 = $374 >>> 4;
     $376 = Math_imul($375, $377)|0;
     $378 = $376&255;
     $379 = ((($$0574714)) + 1|0);
     HEAP8[$$0574714>>0] = $378;
     $380 = HEAP8[$$0571715>>0]|0;
     $381 = $380 & 15;
     $382 = $381&255;
     $383 = Math_imul($382, $377)|0;
     $384 = $383&255;
     $385 = ((($$0574714)) + 2|0);
     HEAP8[$379>>0] = $384;
     $386 = (($$14713) + -2)|0;
     $387 = ((($$0571715)) + 1|0);
     $388 = ($386|0)>(1);
     if ($388) {
      $$0571715 = $387;$$0574714 = $385;$$14713 = $386;
     } else {
      break;
     }
    }
    $scevgep862 = (($366) + ($indvars$iv860)|0);
    $$0571$lcssa = $scevgep862;$$0574$lcssa = $scevgep859;$$14$lcssa = $362;
   } else {
    $$0571$lcssa = $370;$$0574$lcssa = $368;$$14$lcssa = $23;
   }
   $389 = ($$14$lcssa|0)==(1);
   if ($389) {
    $390 = HEAP8[$$0571$lcssa>>0]|0;
    $391 = $390&255;
    $392 = $391 >>> 4;
    $393 = Math_imul($392, $377)|0;
    $394 = $393&255;
    HEAP8[$$0574$lcssa>>0] = $394;
   }
   break;
  }
  case 2:  {
   if ($340) {
    $scevgep853 = (($366) + ($indvars$iv851)|0);
    $$15705 = $23;$$1572707 = $370;$$1575706 = $368;
    while(1) {
     $395 = HEAP8[$$1572707>>0]|0;
     $396 = $395&255;
     $397 = $396 >>> 6;
     $398 = Math_imul($397, $377)|0;
     $399 = $398&255;
     $400 = ((($$1575706)) + 1|0);
     HEAP8[$$1575706>>0] = $399;
     $401 = HEAP8[$$1572707>>0]|0;
     $402 = $401&255;
     $403 = $402 >>> 4;
     $404 = $403 & 3;
     $405 = Math_imul($404, $377)|0;
     $406 = $405&255;
     $407 = ((($$1575706)) + 2|0);
     HEAP8[$400>>0] = $406;
     $408 = HEAP8[$$1572707>>0]|0;
     $409 = $408&255;
     $410 = $409 >>> 2;
     $411 = $410 & 3;
     $412 = Math_imul($411, $377)|0;
     $413 = $412&255;
     $414 = ((($$1575706)) + 3|0);
     HEAP8[$407>>0] = $413;
     $415 = HEAP8[$$1572707>>0]|0;
     $416 = $415 & 3;
     $417 = $416&255;
     $418 = Math_imul($417, $377)|0;
     $419 = $418&255;
     $420 = ((($$1575706)) + 4|0);
     HEAP8[$414>>0] = $419;
     $421 = (($$15705) + -4)|0;
     $422 = ((($$1572707)) + 1|0);
     $423 = ($421|0)>(3);
     if ($423) {
      $$15705 = $421;$$1572707 = $422;$$1575706 = $420;
     } else {
      break;
     }
    }
    $scevgep856 = (($366) + ($indvars$iv854)|0);
    $$15$lcssa = $354;$$1572$lcssa = $scevgep856;$$1575$lcssa = $scevgep853;
   } else {
    $$15$lcssa = $23;$$1572$lcssa = $370;$$1575$lcssa = $368;
   }
   $424 = ($$15$lcssa|0)>(0);
   if ($424) {
    $425 = HEAP8[$$1572$lcssa>>0]|0;
    $426 = $425&255;
    $427 = $426 >>> 6;
    $428 = Math_imul($427, $377)|0;
    $429 = $428&255;
    HEAP8[$$1575$lcssa>>0] = $429;
    $430 = ($$15$lcssa|0)==(1);
    if (!($430)) {
     $431 = ((($$1575$lcssa)) + 1|0);
     $432 = HEAP8[$$1572$lcssa>>0]|0;
     $433 = $432&255;
     $434 = $433 >>> 4;
     $435 = $434 & 3;
     $436 = Math_imul($435, $377)|0;
     $437 = $436&255;
     HEAP8[$431>>0] = $437;
     $438 = ($$15$lcssa|0)>(2);
     if ($438) {
      $439 = ((($$1575$lcssa)) + 2|0);
      $440 = HEAP8[$$1572$lcssa>>0]|0;
      $441 = $440&255;
      $442 = $441 >>> 2;
      $443 = $442 & 3;
      $444 = Math_imul($443, $377)|0;
      $445 = $444&255;
      HEAP8[$439>>0] = $445;
     }
    }
   }
   break;
  }
  case 1:  {
   if ($341) {
    $scevgep = (($366) + ($indvars$iv)|0);
    $$16700 = $23;$$2573702 = $370;$$4701 = $368;
    while(1) {
     $446 = HEAP8[$$2573702>>0]|0;
     $447 = $446&255;
     $448 = $447 >>> 7;
     $449 = (0 - ($448))|0;
     $450 = $377 & $449;
     $451 = $450&255;
     $452 = ((($$4701)) + 1|0);
     HEAP8[$$4701>>0] = $451;
     $453 = HEAP8[$$2573702>>0]|0;
     $454 = $453&255;
     $455 = $454 >>> 6;
     $456 = $455 & 1;
     $457 = (0 - ($456))|0;
     $458 = $377 & $457;
     $459 = $458&255;
     $460 = ((($$4701)) + 2|0);
     HEAP8[$452>>0] = $459;
     $461 = HEAP8[$$2573702>>0]|0;
     $462 = $461&255;
     $463 = $462 >>> 5;
     $464 = $463 & 1;
     $465 = (0 - ($464))|0;
     $466 = $377 & $465;
     $467 = $466&255;
     $468 = ((($$4701)) + 3|0);
     HEAP8[$460>>0] = $467;
     $469 = HEAP8[$$2573702>>0]|0;
     $470 = $469&255;
     $471 = $470 >>> 4;
     $472 = $471 & 1;
     $473 = (0 - ($472))|0;
     $474 = $377 & $473;
     $475 = $474&255;
     $476 = ((($$4701)) + 4|0);
     HEAP8[$468>>0] = $475;
     $477 = HEAP8[$$2573702>>0]|0;
     $478 = $477&255;
     $479 = $478 >>> 3;
     $480 = $479 & 1;
     $481 = (0 - ($480))|0;
     $482 = $377 & $481;
     $483 = $482&255;
     $484 = ((($$4701)) + 5|0);
     HEAP8[$476>>0] = $483;
     $485 = HEAP8[$$2573702>>0]|0;
     $486 = $485&255;
     $487 = $486 >>> 2;
     $488 = $487 & 1;
     $489 = (0 - ($488))|0;
     $490 = $377 & $489;
     $491 = $490&255;
     $492 = ((($$4701)) + 6|0);
     HEAP8[$484>>0] = $491;
     $493 = HEAP8[$$2573702>>0]|0;
     $494 = $493&255;
     $495 = $494 >>> 1;
     $496 = $495 & 1;
     $497 = (0 - ($496))|0;
     $498 = $377 & $497;
     $499 = $498&255;
     $500 = ((($$4701)) + 7|0);
     HEAP8[$492>>0] = $499;
     $501 = HEAP8[$$2573702>>0]|0;
     $502 = $501 & 1;
     $503 = $502&255;
     $504 = (0 - ($503))|0;
     $505 = $377 & $504;
     $506 = $505&255;
     $507 = ((($$4701)) + 8|0);
     HEAP8[$500>>0] = $506;
     $508 = (($$16700) + -8)|0;
     $509 = ((($$2573702)) + 1|0);
     $510 = ($508|0)>(7);
     if ($510) {
      $$16700 = $508;$$2573702 = $509;$$4701 = $507;
     } else {
      break;
     }
    }
    $scevgep850 = (($366) + ($indvars$iv848)|0);
    $$16$lcssa = $346;$$2573$lcssa = $scevgep850;$$4$lcssa = $scevgep;
   } else {
    $$16$lcssa = $23;$$2573$lcssa = $370;$$4$lcssa = $368;
   }
   $511 = ($$16$lcssa|0)>(0);
   if ($511) {
    $512 = HEAP8[$$2573$lcssa>>0]|0;
    $513 = $512&255;
    $514 = $513 >>> 7;
    $515 = (0 - ($514))|0;
    $516 = $377 & $515;
    $517 = $516&255;
    HEAP8[$$4$lcssa>>0] = $517;
    $518 = ($$16$lcssa|0)==(1);
    if (!($518)) {
     $519 = ((($$4$lcssa)) + 1|0);
     $520 = HEAP8[$$2573$lcssa>>0]|0;
     $521 = $520&255;
     $522 = $521 >>> 6;
     $523 = $522 & 1;
     $524 = (0 - ($523))|0;
     $525 = $377 & $524;
     $526 = $525&255;
     HEAP8[$519>>0] = $526;
     $527 = ($$16$lcssa|0)>(2);
     if ($527) {
      $528 = ((($$4$lcssa)) + 2|0);
      $529 = HEAP8[$$2573$lcssa>>0]|0;
      $530 = $529&255;
      $531 = $530 >>> 5;
      $532 = $531 & 1;
      $533 = (0 - ($532))|0;
      $534 = $377 & $533;
      $535 = $534&255;
      HEAP8[$528>>0] = $535;
      $536 = ($$16$lcssa|0)==(3);
      if (!($536)) {
       $537 = ((($$4$lcssa)) + 3|0);
       $538 = HEAP8[$$2573$lcssa>>0]|0;
       $539 = $538&255;
       $540 = $539 >>> 4;
       $541 = $540 & 1;
       $542 = (0 - ($541))|0;
       $543 = $377 & $542;
       $544 = $543&255;
       HEAP8[$537>>0] = $544;
       $545 = ($$16$lcssa|0)>(4);
       if ($545) {
        $546 = ((($$4$lcssa)) + 4|0);
        $547 = HEAP8[$$2573$lcssa>>0]|0;
        $548 = $547&255;
        $549 = $548 >>> 3;
        $550 = $549 & 1;
        $551 = (0 - ($550))|0;
        $552 = $377 & $551;
        $553 = $552&255;
        HEAP8[$546>>0] = $553;
        $554 = ($$16$lcssa|0)==(5);
        if (!($554)) {
         $555 = ((($$4$lcssa)) + 5|0);
         $556 = HEAP8[$$2573$lcssa>>0]|0;
         $557 = $556&255;
         $558 = $557 >>> 2;
         $559 = $558 & 1;
         $560 = (0 - ($559))|0;
         $561 = $377 & $560;
         $562 = $561&255;
         HEAP8[$555>>0] = $562;
         $563 = ($$16$lcssa|0)>(6);
         if ($563) {
          $564 = ((($$4$lcssa)) + 6|0);
          $565 = HEAP8[$$2573$lcssa>>0]|0;
          $566 = $565&255;
          $567 = $566 >>> 1;
          $568 = $567 & 1;
          $569 = (0 - ($568))|0;
          $570 = $377 & $569;
          $571 = $570&255;
          HEAP8[$564>>0] = $571;
         }
        }
       }
      }
     }
    }
   }
   break;
  }
  default: {
  }
  }
  L213: do {
   if (!($17)) {
    $572 = HEAP32[$21>>2]|0;
    $573 = (($572) + ($367)|0);
    switch ($14|0) {
    case 1:  {
     if ($337) {
      $$0568725 = $$0568724;
     } else {
      break L213;
     }
     while(1) {
      $574 = $$0568725 << 1;
      $575 = $574 | 1;
      $576 = (($573) + ($575)|0);
      HEAP8[$576>>0] = -1;
      $577 = (($573) + ($$0568725)|0);
      $578 = HEAP8[$577>>0]|0;
      $579 = (($573) + ($574)|0);
      HEAP8[$579>>0] = $578;
      $$0568 = (($$0568725) + -1)|0;
      $580 = ($$0568|0)>(-1);
      if ($580) {
       $$0568725 = $$0568;
      } else {
       break;
      }
     }
     break;
    }
    case 3:  {
     if ($338) {
      $$1722 = $$1721;
     } else {
      break L213;
     }
     while(1) {
      $581 = $$1722 << 2;
      $582 = $581 | 3;
      $583 = (($573) + ($582)|0);
      HEAP8[$583>>0] = -1;
      $584 = ($$1722*3)|0;
      $585 = (($584) + 2)|0;
      $586 = (($573) + ($585)|0);
      $587 = HEAP8[$586>>0]|0;
      $588 = $581 | 2;
      $589 = (($573) + ($588)|0);
      HEAP8[$589>>0] = $587;
      $590 = (($584) + 1)|0;
      $591 = (($573) + ($590)|0);
      $592 = HEAP8[$591>>0]|0;
      $593 = $581 | 1;
      $594 = (($573) + ($593)|0);
      HEAP8[$594>>0] = $592;
      $595 = (($573) + ($584)|0);
      $596 = HEAP8[$595>>0]|0;
      $597 = (($573) + ($581)|0);
      HEAP8[$597>>0] = $596;
      $$1 = (($$1722) + -1)|0;
      $598 = ($$1|0)>(-1);
      if ($598) {
       $$1722 = $$1;
      } else {
       break;
      }
     }
     break;
    }
    default: {
     label = 144;
     break L174;
    }
    }
   }
  } while(0);
  $599 = (($$1624727) + 1)|0;
  $600 = ($599>>>0)<($5>>>0);
  $indvars$iv$next = (($indvars$iv) + ($12))|0;
  $indvars$iv$next849 = (($indvars$iv848) + ($12))|0;
  $indvars$iv$next852 = (($indvars$iv851) + ($12))|0;
  $indvars$iv$next855 = (($indvars$iv854) + ($12))|0;
  $indvars$iv$next858 = (($indvars$iv857) + ($12))|0;
  $indvars$iv$next861 = (($indvars$iv860) + ($12))|0;
  if ($600) {
   $$1624727 = $599;$indvars$iv = $indvars$iv$next;$indvars$iv848 = $indvars$iv$next849;$indvars$iv851 = $indvars$iv$next852;$indvars$iv854 = $indvars$iv$next855;$indvars$iv857 = $indvars$iv$next858;$indvars$iv860 = $indvars$iv$next861;
  } else {
   $$2 = 1;
   label = 151;
   break;
  }
 }
 if ((label|0) == 144) {
  ___assert_fail((10832|0),(10116|0),4466,(10729|0));
  // unreachable;
 }
 else if ((label|0) == 151) {
  return ($$2|0);
 }
 return (0)|0;
}
function _stbi__paeth($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $$ = 0, $$0 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $ispos = 0, $ispos26 = 0, $ispos28 = 0, $neg = 0, $neg27 = 0, $neg29 = 0, $or$cond = 0;
 var label = 0, sp = 0;
 sp = STACKTOP;
 $3 = (($1) + ($0))|0;
 $4 = (($3) - ($2))|0;
 $5 = (($4) - ($0))|0;
 $ispos = ($5|0)>(-1);
 $neg = (0 - ($5))|0;
 $6 = $ispos ? $5 : $neg;
 $7 = (($4) - ($1))|0;
 $ispos26 = ($7|0)>(-1);
 $neg27 = (0 - ($7))|0;
 $8 = $ispos26 ? $7 : $neg27;
 $9 = (($4) - ($2))|0;
 $ispos28 = ($9|0)>(-1);
 $neg29 = (0 - ($9))|0;
 $10 = $ispos28 ? $9 : $neg29;
 $11 = ($6|0)>($8|0);
 $12 = ($6|0)>($10|0);
 $or$cond = $11 | $12;
 $13 = ($8|0)>($10|0);
 $$ = $13 ? $2 : $1;
 $$0 = $or$cond ? $$ : $0;
 return ($$0|0);
}
function _stbi__do_zlib($0,$1,$2,$3,$4) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 $4 = $4|0;
 var $10 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $5 = ((($0)) + 20|0);
 HEAP32[$5>>2] = $1;
 $6 = ((($0)) + 16|0);
 HEAP32[$6>>2] = $1;
 $7 = (($1) + ($2)|0);
 $8 = ((($0)) + 24|0);
 HEAP32[$8>>2] = $7;
 $9 = ((($0)) + 28|0);
 HEAP32[$9>>2] = $3;
 $10 = (_stbi__parse_zlib($0,$4)|0);
 return ($10|0);
}
function _stbi__parse_zlib($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$0 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0;
 var $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = ($1|0)==(0);
 if (!($2)) {
  $3 = (_stbi__parse_zlib_header($0)|0);
  $4 = ($3|0)==(0);
  if ($4) {
   $$0 = 0;
   return ($$0|0);
  }
 }
 $5 = ((($0)) + 8|0);
 HEAP32[$5>>2] = 0;
 $6 = ((($0)) + 12|0);
 HEAP32[$6>>2] = 0;
 $7 = ((($0)) + 32|0);
 $8 = ((($0)) + 2052|0);
 L5: while(1) {
  $9 = (_stbi__zreceive($0,1)|0);
  $10 = (_stbi__zreceive($0,2)|0);
  switch ($10|0) {
  case 3:  {
   $$0 = 0;
   label = 11;
   break L5;
   break;
  }
  case 0:  {
   $11 = (_stbi__parse_uncompressed_block($0)|0);
   $12 = ($11|0)==(0);
   if ($12) {
    $$0 = 0;
    label = 11;
    break L5;
   }
   break;
  }
  case 1:  {
   $13 = (_stbi__zbuild_huffman($7,10843,288)|0);
   $14 = ($13|0)==(0);
   if ($14) {
    $$0 = 0;
    label = 11;
    break L5;
   }
   $15 = (_stbi__zbuild_huffman($8,11131,32)|0);
   $16 = ($15|0)==(0);
   if ($16) {
    $$0 = 0;
    label = 11;
    break L5;
   } else {
    label = 9;
   }
   break;
  }
  default: {
   $17 = (_stbi__compute_huffman_codes($0)|0);
   $18 = ($17|0)==(0);
   if ($18) {
    $$0 = 0;
    label = 11;
    break L5;
   } else {
    label = 9;
   }
  }
  }
  if ((label|0) == 9) {
   label = 0;
   $19 = (_stbi__parse_huffman_block($0)|0);
   $20 = ($19|0)==(0);
   if ($20) {
    $$0 = 0;
    label = 11;
    break;
   }
  }
  $21 = ($9|0)==(0);
  if (!($21)) {
   $$0 = 1;
   label = 11;
   break;
  }
 }
 if ((label|0) == 11) {
  return ($$0|0);
 }
 return (0)|0;
}
function _stbi__parse_zlib_header($0) {
 $0 = $0|0;
 var $$0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = (_stbi__zget8($0)|0);
 $2 = $1&255;
 $3 = $2 & 15;
 $4 = (_stbi__zget8($0)|0);
 $5 = $4&255;
 $6 = $2 << 8;
 $7 = $6 | $5;
 $8 = (($7>>>0) % 31)&-1;
 $9 = ($8|0)==(0);
 if (!($9)) {
  _stbi__err(11478);
  $$0 = 0;
  return ($$0|0);
 }
 $10 = $5 & 32;
 $11 = ($10|0)==(0);
 if (!($11)) {
  _stbi__err(11494);
  $$0 = 0;
  return ($$0|0);
 }
 $12 = ($3|0)==(8);
 if ($12) {
  $$0 = 1;
  return ($$0|0);
 }
 _stbi__err(11509);
 $$0 = 0;
 return ($$0|0);
}
function _stbi__zreceive($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $10 = 0, $11 = 0, $12 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = ((($0)) + 8|0);
 $3 = HEAP32[$2>>2]|0;
 $4 = ($3|0)<($1|0);
 if ($4) {
  _stbi__fill_bits($0);
 }
 $5 = ((($0)) + 12|0);
 $6 = HEAP32[$5>>2]|0;
 $7 = 1 << $1;
 $8 = (($7) + -1)|0;
 $9 = $6 & $8;
 $10 = $6 >>> $1;
 HEAP32[$5>>2] = $10;
 $11 = HEAP32[$2>>2]|0;
 $12 = (($11) - ($1))|0;
 HEAP32[$2>>2] = $12;
 return ($9|0);
}
function _stbi__parse_uncompressed_block($0) {
 $0 = $0|0;
 var $$0$lcssa = 0, $$034 = 0, $$037 = 0, $$136 = 0, $$lcssa = 0, $$ph = 0, $$pr = 0, $$promoted = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0;
 var $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0;
 var $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0;
 var $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $exitcond47 = 0, $smax = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $1 = sp;
 $2 = ((($0)) + 8|0);
 $3 = HEAP32[$2>>2]|0;
 $4 = $3 & 7;
 $5 = ($4|0)==(0);
 if ($5) {
  $$ph = $3;
 } else {
  (_stbi__zreceive($0,$4)|0);
  $$pr = HEAP32[$2>>2]|0;
  $$ph = $$pr;
 }
 $6 = ($$ph|0)>(0);
 if ($6) {
  $7 = ((($0)) + 12|0);
  $$promoted = HEAP32[$7>>2]|0;
  $8 = $$ph ^ -1;
  $9 = ($8|0)>(-9);
  $smax = $9 ? $8 : -9;
  $10 = (($$ph) + ($smax))|0;
  $11 = (($10) + 8)|0;
  $12 = $11 >>> 3;
  $13 = (($12) + 1)|0;
  $14 = $12 << 3;
  $$037 = 0;$16 = $$promoted;
  while(1) {
   $15 = $16&255;
   $17 = (($$037) + 1)|0;
   $18 = (($1) + ($$037)|0);
   HEAP8[$18>>0] = $15;
   $19 = $16 >>> 8;
   $exitcond47 = ($17|0)==($13|0);
   if ($exitcond47) {
    break;
   } else {
    $$037 = $17;$16 = $19;
   }
  }
  $20 = (($$ph) + -8)|0;
  $21 = (($20) - ($14))|0;
  HEAP32[$7>>2] = $19;
  HEAP32[$2>>2] = $21;
  $$0$lcssa = $13;$$lcssa = $21;
 } else {
  $$0$lcssa = 0;$$lcssa = $$ph;
 }
 $22 = ($$lcssa|0)==(0);
 if (!($22)) {
  ___assert_fail((11400|0),(10116|0),4033,(11417|0));
  // unreachable;
 }
 $23 = ($$0$lcssa|0)<(4);
 if ($23) {
  $$136 = $$0$lcssa;
  while(1) {
   $24 = (_stbi__zget8($0)|0);
   $25 = (($$136) + 1)|0;
   $26 = (($1) + ($$136)|0);
   HEAP8[$26>>0] = $24;
   $exitcond = ($25|0)==(4);
   if ($exitcond) {
    break;
   } else {
    $$136 = $25;
   }
  }
 }
 $27 = ((($1)) + 1|0);
 $28 = HEAP8[$27>>0]|0;
 $29 = $28&255;
 $30 = $29 << 8;
 $31 = HEAP8[$1>>0]|0;
 $32 = $31&255;
 $33 = $30 | $32;
 $34 = ((($1)) + 3|0);
 $35 = HEAP8[$34>>0]|0;
 $36 = $35&255;
 $37 = $36 << 8;
 $38 = ((($1)) + 2|0);
 $39 = HEAP8[$38>>0]|0;
 $40 = $39&255;
 $41 = $37 | $40;
 $42 = $33 ^ 65535;
 $43 = ($41|0)==($42|0);
 if (!($43)) {
  _stbi__err(11448);
  $$034 = 0;
  STACKTOP = sp;return ($$034|0);
 }
 $44 = HEAP32[$0>>2]|0;
 $45 = (($44) + ($33)|0);
 $46 = ((($0)) + 4|0);
 $47 = HEAP32[$46>>2]|0;
 $48 = ($45>>>0)>($47>>>0);
 if ($48) {
  _stbi__err(11461);
  $$034 = 0;
  STACKTOP = sp;return ($$034|0);
 }
 $49 = ((($0)) + 16|0);
 $50 = HEAP32[$49>>2]|0;
 $51 = (($50) + ($33)|0);
 $52 = ((($0)) + 24|0);
 $53 = HEAP32[$52>>2]|0;
 $54 = ($51>>>0)>($53>>>0);
 if ($54) {
  $55 = (_stbi__zexpand($0,$50,$33)|0);
  $56 = ($55|0)==(0);
  if ($56) {
   $$034 = 0;
   STACKTOP = sp;return ($$034|0);
  }
 }
 $57 = HEAP32[$49>>2]|0;
 $58 = HEAP32[$0>>2]|0;
 _memcpy(($57|0),($58|0),($33|0))|0;
 $59 = HEAP32[$0>>2]|0;
 $60 = (($59) + ($33)|0);
 HEAP32[$0>>2] = $60;
 $61 = HEAP32[$49>>2]|0;
 $62 = (($61) + ($33)|0);
 HEAP32[$49>>2] = $62;
 $$034 = 1;
 STACKTOP = sp;return ($$034|0);
}
function _stbi__zbuild_huffman($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $$075 = 0, $$07688 = 0, $$07785 = 0, $$07884 = 0, $$081 = 0, $$286 = 0, $$382 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0;
 var $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0;
 var $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0;
 var $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0;
 var $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0;
 var $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $exitcond = 0, $exitcond91 = 0, $or$cond = 0, dest = 0, label = 0, sp = 0, stop = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 144|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(144|0);
 $3 = sp + 72|0;
 $4 = sp;
 dest=$4; stop=dest+68|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0));
 _memset(($0|0),0,1024)|0;
 $5 = ($2|0)>(0);
 if ($5) {
  $$07688 = 0;
  while(1) {
   $6 = (($1) + ($$07688)|0);
   $7 = HEAP8[$6>>0]|0;
   $8 = $7&255;
   $9 = (($4) + ($8<<2)|0);
   $10 = HEAP32[$9>>2]|0;
   $11 = (($10) + 1)|0;
   HEAP32[$9>>2] = $11;
   $12 = (($$07688) + 1)|0;
   $exitcond91 = ($12|0)==($2|0);
   if ($exitcond91) {
    break;
   } else {
    $$07688 = $12;
   }
  }
 }
 HEAP32[$4>>2] = 0;
 $16 = ((($4)) + 4|0);
 $17 = HEAP32[$16>>2]|0;
 $18 = ($17|0)>(2);
 if (!($18)) {
  $13 = ((($4)) + 8|0);
  $14 = HEAP32[$13>>2]|0;
  $15 = ($14|0)>(4);
  if (!($15)) {
   $69 = ((($4)) + 12|0);
   $70 = HEAP32[$69>>2]|0;
   $71 = ($70|0)>(8);
   if (!($71)) {
    $72 = ((($4)) + 16|0);
    $73 = HEAP32[$72>>2]|0;
    $74 = ($73|0)>(16);
    if (!($74)) {
     $75 = ((($4)) + 20|0);
     $76 = HEAP32[$75>>2]|0;
     $77 = ($76|0)>(32);
     if (!($77)) {
      $78 = ((($4)) + 24|0);
      $79 = HEAP32[$78>>2]|0;
      $80 = ($79|0)>(64);
      if (!($80)) {
       $81 = ((($4)) + 28|0);
       $82 = HEAP32[$81>>2]|0;
       $83 = ($82|0)>(128);
       if (!($83)) {
        $84 = ((($4)) + 32|0);
        $85 = HEAP32[$84>>2]|0;
        $86 = ($85|0)>(256);
        if (!($86)) {
         $87 = ((($4)) + 36|0);
         $88 = HEAP32[$87>>2]|0;
         $89 = ($88|0)>(512);
         if (!($89)) {
          $90 = ((($4)) + 40|0);
          $91 = HEAP32[$90>>2]|0;
          $92 = ($91|0)>(1024);
          if (!($92)) {
           $93 = ((($4)) + 44|0);
           $94 = HEAP32[$93>>2]|0;
           $95 = ($94|0)>(2048);
           if (!($95)) {
            $96 = ((($4)) + 48|0);
            $97 = HEAP32[$96>>2]|0;
            $98 = ($97|0)>(4096);
            if (!($98)) {
             $99 = ((($4)) + 52|0);
             $100 = HEAP32[$99>>2]|0;
             $101 = ($100|0)>(8192);
             if (!($101)) {
              $102 = ((($4)) + 56|0);
              $103 = HEAP32[$102>>2]|0;
              $104 = ($103|0)>(16384);
              if (!($104)) {
               $105 = ((($4)) + 60|0);
               $106 = HEAP32[$105>>2]|0;
               $107 = ($106|0)>(32768);
               if (!($107)) {
                $$07785 = 0;$$07884 = 0;$$286 = 1;
                while(1) {
                 $19 = (($3) + ($$286<<2)|0);
                 HEAP32[$19>>2] = $$07884;
                 $20 = $$07884&65535;
                 $21 = (((($0)) + 1024|0) + ($$286<<1)|0);
                 HEAP16[$21>>1] = $20;
                 $22 = $$07785&65535;
                 $23 = (((($0)) + 1124|0) + ($$286<<1)|0);
                 HEAP16[$23>>1] = $22;
                 $24 = (($4) + ($$286<<2)|0);
                 $25 = HEAP32[$24>>2]|0;
                 $26 = (($25) + ($$07884))|0;
                 $27 = ($25|0)!=(0);
                 $28 = 1 << $$286;
                 $29 = ($26|0)>($28|0);
                 $or$cond = $27 & $29;
                 if ($or$cond) {
                  label = 7;
                  break;
                 }
                 $30 = (16 - ($$286))|0;
                 $31 = $26 << $30;
                 $32 = (((($0)) + 1056|0) + ($$286<<2)|0);
                 HEAP32[$32>>2] = $31;
                 $33 = $26 << 1;
                 $34 = (($25) + ($$07785))|0;
                 $35 = (($$286) + 1)|0;
                 $36 = ($35|0)<(16);
                 if ($36) {
                  $$07785 = $34;$$07884 = $33;$$286 = $35;
                 } else {
                  break;
                 }
                }
                if ((label|0) == 7) {
                 _stbi__err(11338);
                 $$075 = 0;
                 STACKTOP = sp;return ($$075|0);
                }
                $37 = ((($0)) + 1120|0);
                HEAP32[$37>>2] = 65536;
                $38 = ($2|0)>(0);
                if ($38) {
                 $$382 = 0;
                } else {
                 $$075 = 1;
                 STACKTOP = sp;return ($$075|0);
                }
                while(1) {
                 $39 = (($1) + ($$382)|0);
                 $40 = HEAP8[$39>>0]|0;
                 $41 = $40&255;
                 $42 = ($40<<24>>24)==(0);
                 if (!($42)) {
                  $43 = (($3) + ($41<<2)|0);
                  $44 = HEAP32[$43>>2]|0;
                  $45 = (((($0)) + 1024|0) + ($41<<1)|0);
                  $46 = HEAP16[$45>>1]|0;
                  $47 = $46&65535;
                  $48 = (($44) - ($47))|0;
                  $49 = (((($0)) + 1124|0) + ($41<<1)|0);
                  $50 = HEAP16[$49>>1]|0;
                  $51 = $50&65535;
                  $52 = (($48) + ($51))|0;
                  $53 = $41 << 9;
                  $54 = $53 | $$382;
                  $55 = $54&65535;
                  $56 = (((($0)) + 1156|0) + ($52)|0);
                  HEAP8[$56>>0] = $40;
                  $57 = $$382&65535;
                  $58 = (((($0)) + 1444|0) + ($52<<1)|0);
                  HEAP16[$58>>1] = $57;
                  $59 = ($40&255)<(10);
                  do {
                   if ($59) {
                    $60 = (_stbi__bit_reverse($44,$41)|0);
                    $61 = ($60|0)<(512);
                    if (!($61)) {
                     break;
                    }
                    $62 = 1 << $41;
                    $$081 = $60;
                    while(1) {
                     $63 = (($0) + ($$081<<1)|0);
                     HEAP16[$63>>1] = $55;
                     $64 = (($$081) + ($62))|0;
                     $65 = ($64|0)<(512);
                     if ($65) {
                      $$081 = $64;
                     } else {
                      break;
                     }
                    }
                   }
                  } while(0);
                  $66 = HEAP32[$43>>2]|0;
                  $67 = (($66) + 1)|0;
                  HEAP32[$43>>2] = $67;
                 }
                 $68 = (($$382) + 1)|0;
                 $exitcond = ($68|0)==($2|0);
                 if ($exitcond) {
                  $$075 = 1;
                  break;
                 } else {
                  $$382 = $68;
                 }
                }
                STACKTOP = sp;return ($$075|0);
               }
              }
             }
            }
           }
          }
         }
        }
       }
      }
     }
    }
   }
  }
 }
 _stbi__err(11390);
 $$075 = 0;
 STACKTOP = sp;return ($$075|0);
}
function _stbi__compute_huffman_codes($0) {
 $0 = $0|0;
 var $$ = 0, $$0 = 0, $$061 = 0, $$06579 = 0, $$066$be = 0, $$066$lcssa = 0, $$06678 = 0, $$4 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0;
 var $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0;
 var $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $not$ = 0, dest = 0;
 var label = 0, sp = 0, stop = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 2496|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(2496|0);
 $1 = sp;
 $2 = sp + 2039|0;
 $3 = sp + 2020|0;
 $4 = (_stbi__zreceive($0,5)|0);
 $5 = (($4) + 257)|0;
 $6 = (_stbi__zreceive($0,5)|0);
 $7 = (($6) + 1)|0;
 $8 = (_stbi__zreceive($0,4)|0);
 $9 = (($8) + 4)|0;
 $10 = (($7) + ($5))|0;
 dest=$3; stop=dest+19|0; do { HEAP8[dest>>0]=0|0; dest=dest+1|0; } while ((dest|0) < (stop|0));
 $11 = ($9|0)>(0);
 if ($11) {
  $$06579 = 0;
  while(1) {
   $12 = (_stbi__zreceive($0,3)|0);
   $13 = $12&255;
   $14 = (12175 + ($$06579)|0);
   $15 = HEAP8[$14>>0]|0;
   $16 = $15&255;
   $17 = (($3) + ($16)|0);
   HEAP8[$17>>0] = $13;
   $18 = (($$06579) + 1)|0;
   $exitcond = ($18|0)==($9|0);
   if ($exitcond) {
    break;
   } else {
    $$06579 = $18;
   }
  }
 }
 $19 = (_stbi__zbuild_huffman($1,$3,19)|0);
 $20 = ($19|0)==(0);
 if ($20) {
  $$4 = 0;
  STACKTOP = sp;return ($$4|0);
 }
 $21 = ($10|0)>(0);
 L8: do {
  if ($21) {
   $$06678 = 0;
   L9: while(1) {
    $22 = (_stbi__zhuffman_decode($0,$1)|0);
    $23 = ($22>>>0)>(18);
    if ($23) {
     label = 6;
     break;
    }
    $24 = ($22|0)<(16);
    if ($24) {
     $25 = $22&255;
     $26 = (($$06678) + 1)|0;
     $27 = (($2) + ($$06678)|0);
     HEAP8[$27>>0] = $25;
     $$066$be = $26;
    } else {
     switch ($22|0) {
     case 16:  {
      $28 = (_stbi__zreceive($0,2)|0);
      $29 = ($$06678|0)==(0);
      if ($29) {
       label = 11;
       break L9;
      }
      $30 = (($28) + 3)|0;
      $31 = (($$06678) + -1)|0;
      $32 = (($2) + ($31)|0);
      $33 = HEAP8[$32>>0]|0;
      $$0 = $33;$$061 = $30;
      break;
     }
     case 17:  {
      $34 = (_stbi__zreceive($0,3)|0);
      $35 = (($34) + 3)|0;
      $$0 = 0;$$061 = $35;
      break;
     }
     case 18:  {
      $36 = (_stbi__zreceive($0,7)|0);
      $37 = (($36) + 11)|0;
      $$0 = 0;$$061 = $37;
      break;
     }
     default: {
      label = 14;
      break L9;
     }
     }
     $38 = (($10) - ($$06678))|0;
     $39 = ($38|0)<($$061|0);
     if ($39) {
      label = 17;
      break;
     }
     $40 = (($2) + ($$06678)|0);
     _memset(($40|0),($$0|0),($$061|0))|0;
     $41 = (($$061) + ($$06678))|0;
     $$066$be = $41;
    }
    $42 = ($10|0)>($$066$be|0);
    if ($42) {
     $$06678 = $$066$be;
    } else {
     $$066$lcssa = $$066$be;
     break L8;
    }
   }
   if ((label|0) == 6) {
    _stbi__err(11338);
    $$4 = 0;
    STACKTOP = sp;return ($$4|0);
   }
   else if ((label|0) == 11) {
    _stbi__err(11338);
    $$4 = 0;
    STACKTOP = sp;return ($$4|0);
   }
   else if ((label|0) == 14) {
    ___assert_fail((11354|0),(10116|0),4006,(11362|0));
    // unreachable;
   }
   else if ((label|0) == 17) {
    _stbi__err(11338);
    $$4 = 0;
    STACKTOP = sp;return ($$4|0);
   }
  } else {
   $$066$lcssa = 0;
  }
 } while(0);
 $43 = ($10|0)==($$066$lcssa|0);
 if (!($43)) {
  _stbi__err(11338);
  $$4 = 0;
  STACKTOP = sp;return ($$4|0);
 }
 $44 = ((($0)) + 32|0);
 $45 = (_stbi__zbuild_huffman($44,$2,$5)|0);
 $46 = ($45|0)==(0);
 if ($46) {
  $$4 = 0;
  STACKTOP = sp;return ($$4|0);
 }
 $47 = ((($0)) + 2052|0);
 $48 = (($2) + ($5)|0);
 $49 = (_stbi__zbuild_huffman($47,$48,$7)|0);
 $not$ = ($49|0)!=(0);
 $$ = $not$&1;
 $$4 = $$;
 STACKTOP = sp;return ($$4|0);
}
function _stbi__parse_huffman_block($0) {
 $0 = $0|0;
 var $$063 = 0, $$064 = 0, $$067 = 0, $$070 = 0, $$171 = 0, $$266 = 0, $$272 = 0, $$3$ph = 0, $$5 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0;
 var $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0;
 var $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0;
 var $56 = 0, $57 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $scevgep = 0, $scevgep92 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = ((($0)) + 16|0);
 $2 = HEAP32[$1>>2]|0;
 $3 = ((($0)) + 32|0);
 $4 = ((($0)) + 24|0);
 $5 = ((($0)) + 2052|0);
 $6 = ((($0)) + 20|0);
 $7 = ((($0)) + 24|0);
 $$070 = $2;
 while(1) {
  $10 = (_stbi__zhuffman_decode($0,$3)|0);
  $11 = ($10|0)<(256);
  if ($11) {
   $12 = ($10|0)<(0);
   if ($12) {
    label = 6;
    break;
   }
   $13 = HEAP32[$4>>2]|0;
   $14 = ($$070>>>0)<($13>>>0);
   if ($14) {
    $$171 = $$070;
   } else {
    $15 = (_stbi__zexpand($0,$$070,1)|0);
    $16 = ($15|0)==(0);
    if ($16) {
     $$3$ph = 0;
     label = 28;
     break;
    }
    $17 = HEAP32[$1>>2]|0;
    $$171 = $17;
   }
   $18 = $10&255;
   $19 = ((($$171)) + 1|0);
   HEAP8[$$171>>0] = $18;
   $$070 = $19;
   continue;
  }
  $20 = ($10|0)==(256);
  if ($20) {
   label = 12;
   break;
  }
  $21 = (($10) + -257)|0;
  $22 = (3272 + ($21<<2)|0);
  $23 = HEAP32[$22>>2]|0;
  $24 = (($10) + -265)|0;
  $25 = ($24>>>0)<(20);
  if ($25) {
   $26 = (3148 + ($21<<2)|0);
   $27 = HEAP32[$26>>2]|0;
   $28 = (_stbi__zreceive($0,$27)|0);
   $29 = (($28) + ($23))|0;
   $$064 = $29;
  } else {
   $$064 = $23;
  }
  $30 = (_stbi__zhuffman_decode($0,$5)|0);
  $31 = ($30|0)<(0);
  if ($31) {
   label = 16;
   break;
  }
  $32 = (3524 + ($30<<2)|0);
  $33 = HEAP32[$32>>2]|0;
  $34 = (($30) + -4)|0;
  $35 = ($34>>>0)<(26);
  if ($35) {
   $36 = (3396 + ($30<<2)|0);
   $37 = HEAP32[$36>>2]|0;
   $38 = (_stbi__zreceive($0,$37)|0);
   $39 = (($38) + ($33))|0;
   $$063 = $39;
  } else {
   $$063 = $33;
  }
  $40 = HEAP32[$6>>2]|0;
  $41 = $$070;
  $42 = (($41) - ($40))|0;
  $43 = ($42|0)<($$063|0);
  if ($43) {
   label = 20;
   break;
  }
  $44 = (($$070) + ($$064)|0);
  $45 = HEAP32[$7>>2]|0;
  $46 = ($44>>>0)>($45>>>0);
  if ($46) {
   $47 = (_stbi__zexpand($0,$$070,$$064)|0);
   $48 = ($47|0)==(0);
   if ($48) {
    $$3$ph = 0;
    label = 28;
    break;
   }
   $49 = HEAP32[$1>>2]|0;
   $$272 = $49;
  } else {
   $$272 = $$070;
  }
  $50 = (0 - ($$063))|0;
  $9 = (($$272) + ($50)|0);
  $51 = ($$063|0)==(1);
  $52 = ($$064|0)!=(0);
  if ($51) {
   if (!($52)) {
    $$070 = $$272;
    continue;
   }
   $8 = HEAP8[$9>>0]|0;
   _memset(($$272|0),($8|0),($$064|0))|0;
   $scevgep92 = (($$272) + ($$064)|0);
   $$070 = $scevgep92;
   continue;
  }
  if ($52) {
   $$067 = $9;$$266 = $$064;$$5 = $$272;
  } else {
   $$070 = $$272;
   continue;
  }
  while(1) {
   $53 = ((($$067)) + 1|0);
   $54 = HEAP8[$$067>>0]|0;
   $55 = ((($$5)) + 1|0);
   HEAP8[$$5>>0] = $54;
   $56 = (($$266) + -1)|0;
   $57 = ($56|0)==(0);
   if ($57) {
    break;
   } else {
    $$067 = $53;$$266 = $56;$$5 = $55;
   }
  }
  $scevgep = (($$272) + ($$064)|0);
  $$070 = $scevgep;
 }
 if ((label|0) == 6) {
  _stbi__err(11163);
  $$3$ph = 0;
  return ($$3$ph|0);
 }
 else if ((label|0) == 12) {
  HEAP32[$1>>2] = $$070;
  $$3$ph = 1;
  return ($$3$ph|0);
 }
 else if ((label|0) == 16) {
  _stbi__err(11163);
  $$3$ph = 0;
  return ($$3$ph|0);
 }
 else if ((label|0) == 20) {
  _stbi__err(11180);
  $$3$ph = 0;
  return ($$3$ph|0);
 }
 else if ((label|0) == 28) {
  return ($$3$ph|0);
 }
 return (0)|0;
}
function _stbi__zhuffman_decode($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$0 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = ((($0)) + 8|0);
 $3 = HEAP32[$2>>2]|0;
 $4 = ($3|0)<(16);
 if ($4) {
  _stbi__fill_bits($0);
 }
 $5 = ((($0)) + 12|0);
 $6 = HEAP32[$5>>2]|0;
 $7 = $6 & 511;
 $8 = (($1) + ($7<<1)|0);
 $9 = HEAP16[$8>>1]|0;
 $10 = $9&65535;
 $11 = ($9<<16>>16)==(0);
 if ($11) {
  $17 = (_stbi__zhuffman_decode_slowpath($0,$1)|0);
  $$0 = $17;
  return ($$0|0);
 } else {
  $12 = $10 >>> 9;
  $13 = $6 >>> $12;
  HEAP32[$5>>2] = $13;
  $14 = HEAP32[$2>>2]|0;
  $15 = (($14) - ($12))|0;
  HEAP32[$2>>2] = $15;
  $16 = $10 & 511;
  $$0 = $16;
  return ($$0|0);
 }
 return (0)|0;
}
function _stbi__zexpand($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $$0 = 0, $$029 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0;
 var $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $3 = ((($0)) + 16|0);
 HEAP32[$3>>2] = $1;
 $4 = ((($0)) + 28|0);
 $5 = HEAP32[$4>>2]|0;
 $6 = ($5|0)==(0);
 if ($6) {
  _stbi__err(11189);
  $$0 = 0;
  return ($$0|0);
 }
 $7 = ((($0)) + 20|0);
 $8 = HEAP32[$7>>2]|0;
 $9 = $1;
 $10 = $8;
 $11 = (($9) - ($10))|0;
 $12 = ((($0)) + 24|0);
 $13 = HEAP32[$12>>2]|0;
 $14 = (($13) - ($10))|0;
 $15 = (($11) + ($2))|0;
 $$029 = $14;
 while(1) {
  $16 = ($15|0)>($$029|0);
  $17 = $$029 << 1;
  if ($16) {
   $$029 = $17;
  } else {
   break;
  }
 }
 $18 = (_realloc($8,$$029)|0);
 $19 = ($18|0)==(0|0);
 if ($19) {
  _stbi__err(10171);
  $$0 = 0;
  return ($$0|0);
 } else {
  HEAP32[$7>>2] = $18;
  $20 = (($18) + ($11)|0);
  HEAP32[$3>>2] = $20;
  $21 = (($18) + ($$029)|0);
  HEAP32[$12>>2] = $21;
  $$0 = 1;
  return ($$0|0);
 }
 return (0)|0;
}
function _stbi__fill_bits($0) {
 $0 = $0|0;
 var $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = ((($0)) + 12|0);
 $2 = ((($0)) + 8|0);
 while(1) {
  $3 = HEAP32[$1>>2]|0;
  $4 = HEAP32[$2>>2]|0;
  $5 = 1 << $4;
  $6 = ($3>>>0)<($5>>>0);
  if (!($6)) {
   label = 3;
   break;
  }
  $7 = (_stbi__zget8($0)|0);
  $8 = $7&255;
  $9 = HEAP32[$2>>2]|0;
  $10 = $8 << $9;
  $11 = HEAP32[$1>>2]|0;
  $12 = $11 | $10;
  HEAP32[$1>>2] = $12;
  $13 = (($9) + 8)|0;
  HEAP32[$2>>2] = $13;
  $14 = ($13|0)<(25);
  if (!($14)) {
   label = 5;
   break;
  }
 }
 if ((label|0) == 3) {
  ___assert_fail((11285|0),(10116|0),3848,(11322|0));
  // unreachable;
 }
 else if ((label|0) == 5) {
  return;
 }
}
function _stbi__zhuffman_decode_slowpath($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$0 = 0, $$025 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
 var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = ((($0)) + 12|0);
 $3 = HEAP32[$2>>2]|0;
 $4 = (_stbi__bit_reverse($3,16)|0);
 $$025 = 10;
 while(1) {
  $5 = (((($1)) + 1056|0) + ($$025<<2)|0);
  $6 = HEAP32[$5>>2]|0;
  $7 = ($4|0)<($6|0);
  $8 = (($$025) + 1)|0;
  if ($7) {
   break;
  } else {
   $$025 = $8;
  }
 }
 $9 = ($$025|0)==(16);
 if ($9) {
  $$0 = -1;
  return ($$0|0);
 }
 $10 = (16 - ($$025))|0;
 $11 = $4 >> $10;
 $12 = (((($1)) + 1024|0) + ($$025<<1)|0);
 $13 = HEAP16[$12>>1]|0;
 $14 = $13&65535;
 $15 = (($11) - ($14))|0;
 $16 = (((($1)) + 1124|0) + ($$025<<1)|0);
 $17 = HEAP16[$16>>1]|0;
 $18 = $17&65535;
 $19 = (($15) + ($18))|0;
 $20 = (((($1)) + 1156|0) + ($19)|0);
 $21 = HEAP8[$20>>0]|0;
 $22 = $21&255;
 $23 = ($22|0)==($$025|0);
 if (!($23)) {
  ___assert_fail((11209|0),(10116|0),3876,(11225|0));
  // unreachable;
 }
 $24 = HEAP32[$2>>2]|0;
 $25 = $24 >>> $$025;
 HEAP32[$2>>2] = $25;
 $26 = ((($0)) + 8|0);
 $27 = HEAP32[$26>>2]|0;
 $28 = (($27) - ($$025))|0;
 HEAP32[$26>>2] = $28;
 $29 = (((($1)) + 1444|0) + ($19<<1)|0);
 $30 = HEAP16[$29>>1]|0;
 $31 = $30&65535;
 $$0 = $31;
 return ($$0|0);
}
function _stbi__bit_reverse($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $2 = 0, $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = ($1|0)<(17);
 if ($2) {
  $3 = (_stbi__bitreverse16($0)|0);
  $4 = (16 - ($1))|0;
  $5 = $3 >> $4;
  return ($5|0);
 } else {
  ___assert_fail((11256|0),(10116|0),3766,(11267|0));
  // unreachable;
 }
 return (0)|0;
}
function _stbi__bitreverse16($0) {
 $0 = $0|0;
 var $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0;
 var sp = 0;
 sp = STACKTOP;
 $1 = $0 >>> 1;
 $2 = $1 & 21845;
 $3 = $0 << 1;
 $4 = $3 & 43690;
 $5 = $2 | $4;
 $6 = $5 >>> 2;
 $7 = $6 & 13107;
 $8 = $5 << 2;
 $9 = $8 & 52428;
 $10 = $7 | $9;
 $11 = $10 >>> 4;
 $12 = $11 & 3855;
 $13 = $10 << 4;
 $14 = $13 & 61680;
 $15 = $12 | $14;
 $16 = $15 >>> 8;
 $17 = $15 << 8;
 $18 = $17 & 65280;
 $19 = $18 | $16;
 return ($19|0);
}
function _stbi__zget8($0) {
 $0 = $0|0;
 var $$0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = HEAP32[$0>>2]|0;
 $2 = ((($0)) + 4|0);
 $3 = HEAP32[$2>>2]|0;
 $4 = ($1>>>0)<($3>>>0);
 if (!($4)) {
  $$0 = 0;
  return ($$0|0);
 }
 $5 = ((($1)) + 1|0);
 HEAP32[$0>>2] = $5;
 $6 = HEAP8[$1>>0]|0;
 $$0 = $6;
 return ($$0|0);
}
function _stbi__refill_buffer($0) {
 $0 = $0|0;
 var $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = ((($0)) + 16|0);
 $2 = HEAP32[$1>>2]|0;
 $3 = ((($0)) + 28|0);
 $4 = HEAP32[$3>>2]|0;
 $5 = ((($0)) + 40|0);
 $6 = ((($0)) + 36|0);
 $7 = HEAP32[$6>>2]|0;
 $8 = (FUNCTION_TABLE_iiii[$2 & 15]($4,$5,$7)|0);
 $9 = ($8|0)==(0);
 if ($9) {
  $10 = ((($0)) + 32|0);
  HEAP32[$10>>2] = 0;
  $11 = ((($0)) + 168|0);
  HEAP32[$11>>2] = $5;
  $12 = ((($0)) + 41|0);
  $13 = ((($0)) + 172|0);
  HEAP32[$13>>2] = $12;
  HEAP8[$5>>0] = 0;
  return;
 } else {
  $14 = ((($0)) + 168|0);
  HEAP32[$14>>2] = $5;
  $15 = (((($0)) + 40|0) + ($8)|0);
  $16 = ((($0)) + 172|0);
  HEAP32[$16>>2] = $15;
  return;
 }
}
function _stbi__rewind($0) {
 $0 = $0|0;
 var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = ((($0)) + 176|0);
 $2 = HEAP32[$1>>2]|0;
 $3 = ((($0)) + 168|0);
 HEAP32[$3>>2] = $2;
 $4 = ((($0)) + 180|0);
 $5 = HEAP32[$4>>2]|0;
 $6 = ((($0)) + 172|0);
 HEAP32[$6>>2] = $5;
 return;
}
function _stbi__start_callbacks($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $10 = 0, $11 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $3 = ((($0)) + 16|0);
 ;HEAP32[$3>>2]=HEAP32[$1>>2]|0;HEAP32[$3+4>>2]=HEAP32[$1+4>>2]|0;HEAP32[$3+8>>2]=HEAP32[$1+8>>2]|0;
 $4 = ((($0)) + 28|0);
 HEAP32[$4>>2] = $2;
 $5 = ((($0)) + 36|0);
 HEAP32[$5>>2] = 128;
 $6 = ((($0)) + 32|0);
 HEAP32[$6>>2] = 1;
 $7 = ((($0)) + 40|0);
 $8 = ((($0)) + 176|0);
 HEAP32[$8>>2] = $7;
 _stbi__refill_buffer($0);
 $9 = ((($0)) + 172|0);
 $10 = HEAP32[$9>>2]|0;
 $11 = ((($0)) + 180|0);
 HEAP32[$11>>2] = $10;
 return;
}
function _stbi__stdio_read($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $3 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $3 = (_fread($1,1,$2,$0)|0);
 return ($3|0);
}
function _stbi__stdio_skip($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var label = 0, sp = 0;
 sp = STACKTOP;
 (_fseek($0,$1,1)|0);
 return;
}
function _stbi__stdio_eof($0) {
 $0 = $0|0;
 var $1 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = (_feof($0)|0);
 return ($1|0);
}
function _LoadImage($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$sink = 0, $$sroa$0$0 = 0, $$sroa$0$0$copyload = 0, $$sroa$0$1 = 0, $$sroa$0$144 = 0, $$sroa$10$0 = 0, $$sroa$10$0$$sroa_idx19 = 0, $$sroa$10$0$$sroa_idx20 = 0, $$sroa$10$0$copyload = 0, $$sroa$10$1 = 0, $$sroa$10$140 = 0, $$sroa$10$141 = 0, $$sroa$13$0 = 0, $$sroa$13$0$$sroa_idx23 = 0, $$sroa$13$0$$sroa_idx24 = 0, $$sroa$13$0$copyload = 0, $$sroa$13$1 = 0, $$sroa$13$146 = 0, $$sroa$13$147 = 0, $$sroa$15$0 = 0;
 var $$sroa$15$0$$sroa_idx27 = 0, $$sroa$15$0$$sroa_idx28 = 0, $$sroa$15$0$copyload = 0, $$sroa$15$1 = 0, $$sroa$15$2 = 0, $$sroa$15$248 = 0, $$sroa$15$249 = 0, $$sroa$7$0 = 0, $$sroa$7$0$$sroa_idx15 = 0, $$sroa$7$0$$sroa_idx16 = 0, $$sroa$7$0$copyload = 0, $$sroa$7$1 = 0, $$sroa$7$142 = 0, $$sroa$7$143 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0;
 var $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0;
 var $vararg_buffer1 = 0, $vararg_buffer4 = 0, $vararg_buffer9 = 0, $vararg_ptr7 = 0, $vararg_ptr8 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 80|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(80|0);
 $vararg_buffer9 = sp + 32|0;
 $vararg_buffer4 = sp + 16|0;
 $vararg_buffer1 = sp + 8|0;
 $vararg_buffer = sp;
 $2 = sp + 48|0;
 $3 = sp + 44|0;
 $4 = sp + 40|0;
 $5 = sp + 36|0;
 $6 = (_IsFileExtension($1,12362)|0);
 $7 = ($6|0)==(0);
 do {
  if ($7) {
   $19 = (_IsFileExtension($1,11584)|0);
   $20 = ($19|0)==(0);
   if ($20) {
    HEAP32[$vararg_buffer1>>2] = $1;
    _TraceLog(2,11589,$vararg_buffer1);
    $$sroa$10$141 = 0;$$sroa$13$147 = 0;$$sroa$15$249 = 0;$$sroa$7$143 = 0;
    break;
   }
   HEAP32[$3>>2] = 0;
   HEAP32[$4>>2] = 0;
   HEAP32[$5>>2] = 0;
   $21 = (_fopen($1,13035)|0);
   $22 = (_stbi_load_from_file($21,$3,$4,$5,0)|0);
   (_fclose($21)|0);
   $23 = HEAP32[$3>>2]|0;
   $24 = HEAP32[$4>>2]|0;
   $25 = HEAP32[$5>>2]|0;
   switch ($25|0) {
   case 1:  {
    $$sink = 1;
    label = 11;
    break;
   }
   case 2:  {
    $$sink = 2;
    label = 11;
    break;
   }
   case 3:  {
    $$sink = 4;
    label = 11;
    break;
   }
   case 4:  {
    $$sink = 7;
    label = 11;
    break;
   }
   default: {
    $$sroa$15$1 = 0;
   }
   }
   if ((label|0) == 11) {
    $$sroa$15$1 = $$sink;
   }
   $$sroa$0$1 = $22;$$sroa$10$1 = $24;$$sroa$13$1 = 1;$$sroa$15$2 = $$sroa$15$1;$$sroa$7$1 = $23;
   label = 14;
  } else {
   $8 = (_LoadResource($1,0)|0);
   $9 = HEAP32[$8>>2]|0;
   $10 = ($9|0)==(1);
   if ($10) {
    $11 = ((($8)) + 20|0);
    $12 = HEAP32[$11>>2]|0;
    $13 = ((($8)) + 4|0);
    $14 = HEAP32[$13>>2]|0;
    $15 = ((($8)) + 8|0);
    $16 = HEAP32[$15>>2]|0;
    $17 = ((($8)) + 12|0);
    $18 = HEAP32[$17>>2]|0;
    _LoadImagePro($2,$12,$14,$16,$18);
    $$sroa$0$0$copyload = HEAP32[$2>>2]|0;
    $$sroa$7$0$$sroa_idx15 = ((($2)) + 4|0);
    $$sroa$7$0$copyload = HEAP32[$$sroa$7$0$$sroa_idx15>>2]|0;
    $$sroa$10$0$$sroa_idx19 = ((($2)) + 8|0);
    $$sroa$10$0$copyload = HEAP32[$$sroa$10$0$$sroa_idx19>>2]|0;
    $$sroa$13$0$$sroa_idx23 = ((($2)) + 12|0);
    $$sroa$13$0$copyload = HEAP32[$$sroa$13$0$$sroa_idx23>>2]|0;
    $$sroa$15$0$$sroa_idx27 = ((($2)) + 16|0);
    $$sroa$15$0$copyload = HEAP32[$$sroa$15$0$$sroa_idx27>>2]|0;
    $$sroa$0$0 = $$sroa$0$0$copyload;$$sroa$10$0 = $$sroa$10$0$copyload;$$sroa$13$0 = $$sroa$13$0$copyload;$$sroa$15$0 = $$sroa$15$0$copyload;$$sroa$7$0 = $$sroa$7$0$copyload;
   } else {
    HEAP32[$vararg_buffer>>2] = $1;
    _TraceLog(2,11537,$vararg_buffer);
    $$sroa$0$0 = 0;$$sroa$10$0 = 0;$$sroa$13$0 = 0;$$sroa$15$0 = 0;$$sroa$7$0 = 0;
   }
   _UnloadResource($8);
   $$sroa$0$1 = $$sroa$0$0;$$sroa$10$1 = $$sroa$10$0;$$sroa$13$1 = $$sroa$13$0;$$sroa$15$2 = $$sroa$15$0;$$sroa$7$1 = $$sroa$7$0;
   label = 14;
  }
 } while(0);
 if ((label|0) == 14) {
  $26 = ($$sroa$0$1|0)==(0|0);
  if ($26) {
   $$sroa$10$141 = $$sroa$10$1;$$sroa$13$147 = $$sroa$13$1;$$sroa$15$249 = $$sroa$15$2;$$sroa$7$143 = $$sroa$7$1;
  } else {
   HEAP32[$vararg_buffer4>>2] = $1;
   $vararg_ptr7 = ((($vararg_buffer4)) + 4|0);
   HEAP32[$vararg_ptr7>>2] = $$sroa$7$1;
   $vararg_ptr8 = ((($vararg_buffer4)) + 8|0);
   HEAP32[$vararg_ptr8>>2] = $$sroa$10$1;
   _TraceLog(0,11625,$vararg_buffer4);
   $$sroa$0$144 = $$sroa$0$1;$$sroa$10$140 = $$sroa$10$1;$$sroa$13$146 = $$sroa$13$1;$$sroa$15$248 = $$sroa$15$2;$$sroa$7$142 = $$sroa$7$1;
   HEAP32[$0>>2] = $$sroa$0$144;
   $$sroa$7$0$$sroa_idx16 = ((($0)) + 4|0);
   HEAP32[$$sroa$7$0$$sroa_idx16>>2] = $$sroa$7$142;
   $$sroa$10$0$$sroa_idx20 = ((($0)) + 8|0);
   HEAP32[$$sroa$10$0$$sroa_idx20>>2] = $$sroa$10$140;
   $$sroa$13$0$$sroa_idx24 = ((($0)) + 12|0);
   HEAP32[$$sroa$13$0$$sroa_idx24>>2] = $$sroa$13$146;
   $$sroa$15$0$$sroa_idx28 = ((($0)) + 16|0);
   HEAP32[$$sroa$15$0$$sroa_idx28>>2] = $$sroa$15$248;
   STACKTOP = sp;return;
  }
 }
 HEAP32[$vararg_buffer9>>2] = $1;
 _TraceLog(2,11664,$vararg_buffer9);
 $$sroa$0$144 = 0;$$sroa$10$140 = $$sroa$10$141;$$sroa$13$146 = $$sroa$13$147;$$sroa$15$248 = $$sroa$15$249;$$sroa$7$142 = $$sroa$7$143;
 HEAP32[$0>>2] = $$sroa$0$144;
 $$sroa$7$0$$sroa_idx16 = ((($0)) + 4|0);
 HEAP32[$$sroa$7$0$$sroa_idx16>>2] = $$sroa$7$142;
 $$sroa$10$0$$sroa_idx20 = ((($0)) + 8|0);
 HEAP32[$$sroa$10$0$$sroa_idx20>>2] = $$sroa$10$140;
 $$sroa$13$0$$sroa_idx24 = ((($0)) + 12|0);
 HEAP32[$$sroa$13$0$$sroa_idx24>>2] = $$sroa$13$146;
 $$sroa$15$0$$sroa_idx28 = ((($0)) + 16|0);
 HEAP32[$$sroa$15$0$$sroa_idx28>>2] = $$sroa$15$248;
 STACKTOP = sp;return;
}
function _LoadResource($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$0$lcssa = 0, $$05665 = 0, $$05764 = 0, $$1 = 0, $$2 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0;
 var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0;
 var $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0;
 var $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond60 = 0;
 var $or$cond62 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer4 = 0, $vararg_buffer8 = 0, $vararg_ptr11 = 0, $vararg_ptr7 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 80|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(80|0);
 $vararg_buffer8 = sp + 24|0;
 $vararg_buffer4 = sp + 16|0;
 $vararg_buffer1 = sp + 8|0;
 $vararg_buffer = sp;
 $2 = sp + 64|0;
 $3 = sp + 32|0;
 $4 = (_fopen($0,13035)|0);
 $5 = ($4|0)==(0|0);
 if ($5) {
  HEAP32[$vararg_buffer>>2] = $0;
  _TraceLog(2,11723,$vararg_buffer);
  $$2 = 0;
  STACKTOP = sp;return ($$2|0);
 }
 (_fread($2,1,1,$4)|0);
 $6 = ((($2)) + 1|0);
 (_fread($6,1,1,$4)|0);
 $7 = ((($2)) + 2|0);
 (_fread($7,1,1,$4)|0);
 $8 = ((($2)) + 3|0);
 (_fread($8,1,1,$4)|0);
 $9 = ((($2)) + 4|0);
 (_fread($9,2,1,$4)|0);
 $10 = ((($2)) + 6|0);
 (_fread($10,2,1,$4)|0);
 $11 = HEAP8[$2>>0]|0;
 $12 = ($11<<24>>24)==(114);
 $13 = HEAP8[$6>>0]|0;
 $14 = ($13<<24>>24)==(82);
 $or$cond = $12 | $14;
 $15 = HEAP8[$7>>0]|0;
 $16 = ($15<<24>>24)==(69);
 $or$cond60 = $or$cond | $16;
 $17 = HEAP8[$8>>0]|0;
 $18 = ($17<<24>>24)==(83);
 $or$cond62 = $or$cond60 | $18;
 if ($or$cond62) {
  $19 = HEAP16[$10>>1]|0;
  $20 = ($19<<16>>16)==(0);
  if ($20) {
   $$0$lcssa = 0;
  } else {
   $21 = ((($3)) + 7|0);
   $22 = HEAP16[$10>>1]|0;
   $23 = $22&65535;
   $24 = ((($3)) + 8|0);
   $25 = ((($3)) + 4|0);
   $26 = ((($3)) + 16|0);
   $27 = ((($3)) + 20|0);
   $28 = ((($3)) + 24|0);
   $29 = ((($3)) + 28|0);
   $30 = ((($3)) + 8|0);
   $31 = ((($3)) + 5|0);
   $32 = ((($3)) + 12|0);
   $$05665 = 0;
   while(1) {
    (_fread($3,32,1,$4)|0);
    $36 = HEAP8[$21>>0]|0;
    $37 = $36&255;
    $38 = ($37*24)|0;
    $39 = (_malloc($38)|0);
    $40 = HEAP32[$3>>2]|0;
    $41 = ($40|0)==($1|0);
    if ($41) {
     $42 = HEAP8[$21>>0]|0;
     $43 = ($42<<24>>24)==(0);
     if (!($43)) {
      $$05764 = 0;
      while(1) {
       $44 = HEAP8[$25>>0]|0;
       $45 = $44&255;
       $46 = (($39) + (($$05764*24)|0)|0);
       HEAP32[$46>>2] = $45;
       $47 = HEAP32[$26>>2]|0;
       $48 = (((($39) + (($$05764*24)|0)|0)) + 4|0);
       HEAP32[$48>>2] = $47;
       $49 = HEAP32[$27>>2]|0;
       $50 = (((($39) + (($$05764*24)|0)|0)) + 8|0);
       HEAP32[$50>>2] = $49;
       $51 = HEAP32[$28>>2]|0;
       $52 = (((($39) + (($$05764*24)|0)|0)) + 12|0);
       HEAP32[$52>>2] = $51;
       $53 = HEAP32[$29>>2]|0;
       $54 = (((($39) + (($$05764*24)|0)|0)) + 16|0);
       HEAP32[$54>>2] = $53;
       $55 = HEAP32[$30>>2]|0;
       $56 = (_malloc($55)|0);
       (_fread($56,$55,1,$4)|0);
       $57 = HEAP8[$31>>0]|0;
       $58 = ($57<<24>>24)==(1);
       if ($58) {
        $59 = HEAP32[$30>>2]|0;
        $60 = HEAP32[$32>>2]|0;
        $61 = (_DecompressData($56,$59,$60)|0);
        $62 = (((($39) + (($$05764*24)|0)|0)) + 20|0);
        HEAP32[$62>>2] = $61;
        _free($56);
       } else {
        $63 = (((($39) + (($$05764*24)|0)|0)) + 20|0);
        HEAP32[$63>>2] = $56;
       }
       $64 = (((($39) + (($$05764*24)|0)|0)) + 20|0);
       $65 = HEAP32[$64>>2]|0;
       $66 = ($65|0)==(0|0);
       if (!($66)) {
        $67 = HEAP32[$3>>2]|0;
        HEAP32[$vararg_buffer4>>2] = $0;
        $vararg_ptr7 = ((($vararg_buffer4)) + 4|0);
        HEAP32[$vararg_ptr7>>2] = $67;
        _TraceLog(0,11820,$vararg_buffer4);
       }
       (_fread($3,32,1,$4)|0);
       $68 = (($$05764) + 1)|0;
       $69 = HEAP8[$21>>0]|0;
       $70 = $69&255;
       $71 = ($68|0)<($70|0);
       if ($71) {
        $$05764 = $68;
       } else {
        break;
       }
      }
     }
    } else {
     $72 = HEAP32[$24>>2]|0;
     (_fseek($4,$72,1)|0);
    }
    $73 = (($$05665) + 1)|0;
    $74 = ($73|0)<($23|0);
    if ($74) {
     $$05665 = $73;
    } else {
     $$0$lcssa = $39;
     break;
    }
   }
  }
  $33 = ((($$0$lcssa)) + 20|0);
  $34 = HEAP32[$33>>2]|0;
  $35 = ($34|0)==(0|0);
  if ($35) {
   HEAP32[$vararg_buffer8>>2] = $0;
   $vararg_ptr11 = ((($vararg_buffer8)) + 4|0);
   HEAP32[$vararg_ptr11>>2] = $1;
   _TraceLog(2,11866,$vararg_buffer8);
   $$1 = $$0$lcssa;
  } else {
   $$1 = $$0$lcssa;
  }
 } else {
  HEAP32[$vararg_buffer1>>2] = $0;
  _TraceLog(2,11774,$vararg_buffer1);
  $$1 = 0;
 }
 (_fclose($4)|0);
 $$2 = $$1;
 STACKTOP = sp;return ($$2|0);
}
function _LoadImagePro($0,$1,$2,$3,$4) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 $4 = $4|0;
 var $$byval_copy = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 48|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(48|0);
 $$byval_copy = sp + 20|0;
 $5 = sp;
 HEAP32[$5>>2] = $1;
 $6 = ((($5)) + 4|0);
 HEAP32[$6>>2] = $2;
 $7 = ((($5)) + 8|0);
 HEAP32[$7>>2] = $3;
 $8 = ((($5)) + 12|0);
 HEAP32[$8>>2] = 1;
 $9 = ((($5)) + 16|0);
 HEAP32[$9>>2] = $4;
 ;HEAP32[$$byval_copy>>2]=HEAP32[$5>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$5+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[$5+8>>2]|0;HEAP32[$$byval_copy+12>>2]=HEAP32[$5+12>>2]|0;HEAP32[$$byval_copy+16>>2]=HEAP32[$5+16>>2]|0;
 _ImageCopy($0,$$byval_copy);
 STACKTOP = sp;return;
}
function _UnloadResource($0) {
 $0 = $0|0;
 var $1 = 0, $2 = 0, $3 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = ((($0)) + 20|0);
 $2 = HEAP32[$1>>2]|0;
 $3 = ($2|0)==(0|0);
 if ($3) {
  return;
 }
 _free($2);
 return;
}
function _ImageCopy($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$0 = 0, $$sroa$6$0 = 0, $$sroa$6$0$$sroa_idx10 = 0, $$sroa$7$0 = 0, $$sroa$7$0$$sroa_idx12 = 0, $$sroa$8$0 = 0, $$sroa$8$0$$sroa_idx14 = 0, $$sroa$9$0 = 0, $$sroa$9$0$$sroa_idx16 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0;
 var $20 = 0, $21 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $vararg_buffer = sp;
 $2 = ((($1)) + 4|0);
 $3 = HEAP32[$2>>2]|0;
 $4 = ((($1)) + 8|0);
 $5 = HEAP32[$4>>2]|0;
 $6 = Math_imul($5, $3)|0;
 $7 = ((($1)) + 16|0);
 $8 = HEAP32[$7>>2]|0;
 switch ($8|0) {
 case 17: case 14: case 11: case 10: case 1:  {
  $$0 = $6;
  break;
 }
 case 6: case 5: case 3: case 2:  {
  $9 = $6 << 1;
  $$0 = $9;
  break;
 }
 case 4:  {
  $10 = ($6*3)|0;
  $$0 = $10;
  break;
 }
 case 7:  {
  $11 = $6 << 2;
  $$0 = $11;
  break;
 }
 case 16: case 15: case 13: case 12: case 9: case 8:  {
  $12 = (($6|0) / 2)&-1;
  $$0 = $12;
  break;
 }
 case 18:  {
  $13 = (($6|0) / 4)&-1;
  $$0 = $13;
  break;
 }
 default: {
  _TraceLog(2,11695,$vararg_buffer);
  $$0 = $6;
 }
 }
 $14 = (_malloc($$0)|0);
 $15 = ($14|0)==(0|0);
 if ($15) {
  $$sroa$6$0 = 0;$$sroa$7$0 = 0;$$sroa$8$0 = 0;$$sroa$9$0 = 0;
 } else {
  $16 = HEAP32[$1>>2]|0;
  _memcpy(($14|0),($16|0),($$0|0))|0;
  $17 = HEAP32[$2>>2]|0;
  $18 = HEAP32[$4>>2]|0;
  $19 = ((($1)) + 12|0);
  $20 = HEAP32[$19>>2]|0;
  $21 = HEAP32[$7>>2]|0;
  $$sroa$6$0 = $17;$$sroa$7$0 = $18;$$sroa$8$0 = $20;$$sroa$9$0 = $21;
 }
 HEAP32[$0>>2] = $14;
 $$sroa$6$0$$sroa_idx10 = ((($0)) + 4|0);
 HEAP32[$$sroa$6$0$$sroa_idx10>>2] = $$sroa$6$0;
 $$sroa$7$0$$sroa_idx12 = ((($0)) + 8|0);
 HEAP32[$$sroa$7$0$$sroa_idx12>>2] = $$sroa$7$0;
 $$sroa$8$0$$sroa_idx14 = ((($0)) + 12|0);
 HEAP32[$$sroa$8$0$$sroa_idx14>>2] = $$sroa$8$0;
 $$sroa$9$0$$sroa_idx16 = ((($0)) + 16|0);
 HEAP32[$$sroa$9$0$$sroa_idx16>>2] = $$sroa$9$0;
 STACKTOP = sp;return;
}
function _DecompressData($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer10 = 0, $vararg_buffer3 = 0, $vararg_buffer5 = 0, $vararg_buffer7 = 0, $vararg_ptr13 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 48|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(48|0);
 $vararg_buffer10 = sp + 40|0;
 $vararg_buffer7 = sp + 32|0;
 $vararg_buffer5 = sp + 24|0;
 $vararg_buffer3 = sp + 16|0;
 $vararg_buffer1 = sp + 8|0;
 $vararg_buffer = sp;
 $3 = (_malloc($2)|0);
 $4 = ($3|0)==(0|0);
 if ($4) {
  _TraceLog(2,11916,$vararg_buffer);
  STACKTOP = sp;return ($3|0);
 }
 $5 = (_tinfl_decompress_mem_to_mem($3,$2,$0,$1,1)|0);
 $6 = ($5|0)==(-1);
 if ($6) {
  _TraceLog(2,11955,$vararg_buffer1);
  _free($3);
 }
 $7 = ($5|0)==($2|0);
 if (!($7)) {
  _TraceLog(2,11981,$vararg_buffer3);
  HEAP32[$vararg_buffer5>>2] = $2;
  _TraceLog(2,12044,$vararg_buffer5);
  HEAP32[$vararg_buffer7>>2] = $5;
  _TraceLog(2,12079,$vararg_buffer7);
 }
 HEAP32[$vararg_buffer10>>2] = $1;
 $vararg_ptr13 = ((($vararg_buffer10)) + 4|0);
 HEAP32[$vararg_ptr13>>2] = $5;
 _TraceLog(0,12114,$vararg_buffer10);
 STACKTOP = sp;return ($3|0);
}
function _tinfl_decompress_mem_to_mem($0,$1,$2,$3,$4) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 $4 = $4|0;
 var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 11008|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(11008|0);
 $5 = sp + 11000|0;
 $6 = sp;
 $7 = sp + 8|0;
 HEAP32[$5>>2] = $1;
 HEAP32[$6>>2] = $3;
 HEAP32[$7>>2] = 0;
 $8 = $4 & -7;
 $9 = $8 | 4;
 $10 = (_tinfl_decompress($7,$2,$6,$0,$0,$5,$9)|0);
 $11 = ($10|0)!=(0);
 $12 = HEAP32[$5>>2]|0;
 $13 = $11 ? -1 : $12;
 STACKTOP = sp;return ($13|0);
}
function _tinfl_decompress($0,$1,$2,$3,$4,$5,$6) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 $4 = $4|0;
 $5 = $5|0;
 $6 = $6|0;
 var $$ = 0, $$$301127 = 0, $$010861840 = 0, $$010871839 = 0, $$010881838 = 0, $$010911856 = 0, $$010941846 = 0, $$010951864 = 0, $$01097 = 0, $$01194 = 0, $$011971855 = 0, $$01202 = 0, $$01202$shrunk = 0, $$01203 = 0, $$01300 = 0, $$01300$shrunk = 0, $$01309 = 0, $$01410 = 0, $$01410$shrunk = 0, $$01411 = 0;
 var $$01411$shrunk = 0, $$01412 = 0, $$01413 = 0, $$01413$shrunk = 0, $$01416 = 0, $$01507 = 0, $$01607 = 0, $$01834 = 0, $$0937$lcssa = 0, $$09371833 = 0, $$0938$lcssa = 0, $$09381832 = 0, $$0941$lcssa = 0, $$09411816 = 0, $$09431831 = 0, $$09441830 = 0, $$0947 = 0, $$0947$shrunk = 0, $$0948 = 0, $$0949 = 0;
 var $$0950 = 0, $$0950$shrunk = 0, $$0951 = 0, $$0952 = 0, $$0952$shrunk = 0, $$0953 = 0, $$0956 = 0, $$0959 = 0, $$0959$shrunk = 0, $$0960 = 0, $$0963 = 0, $$0967 = 0, $$0971 = 0, $$0971$shrunk = 0, $$0972 = 0, $$0975 = 0, $$0978 = 0, $$0979 = 0, $$0979$shrunk = 0, $$0980 = 0;
 var $$0980$shrunk = 0, $$0981 = 0, $$0984 = 0, $$0987 = 0, $$0991 = 0, $$1$lcssa = 0, $$100 = 0, $$1001409 = 0, $$101426 = 0, $$101617 = 0, $$110891852 = 0, $$11098 = 0, $$11098$ph = 0, $$111427 = 0, $$111518 = 0, $$111618 = 0, $$11198 = 0, $$11204 = 0, $$11204$ph = 0, $$11310 = 0;
 var $$11310$ph = 0, $$11417 = 0, $$11508 = 0, $$11608 = 0, $$11818 = 0, $$121428 = 0, $$121428$ph = 0, $$121519 = 0, $$121619 = 0, $$121619$ph = 0, $$13 = 0, $$131004 = 0, $$131110 = 0, $$131216 = 0, $$131322 = 0, $$131429 = 0, $$131520 = 0, $$131620 = 0, $$14 = 0, $$141005 = 0;
 var $$141111 = 0, $$141217 = 0, $$141323 = 0, $$141430 = 0, $$141521 = 0, $$141621 = 0, $$15 = 0, $$151006 = 0, $$151112 = 0, $$151218 = 0, $$151324 = 0, $$151431 = 0, $$151522 = 0, $$151622 = 0, $$16 = 0, $$161007 = 0, $$161113 = 0, $$161113$ph = 0, $$161219 = 0, $$161325 = 0;
 var $$161432 = 0, $$161523 = 0, $$161623 = 0, $$17 = 0, $$17$ph = 0, $$171008 = 0, $$171008$ph = 0, $$171114 = 0, $$171220 = 0, $$171220$ph = 0, $$171326 = 0, $$171326$ph = 0, $$171433 = 0, $$171524 = 0, $$171624 = 0, $$1753 = 0, $$1754 = 0, $$18 = 0, $$181009 = 0, $$181115 = 0;
 var $$181221 = 0, $$181327 = 0, $$181434 = 0, $$181525 = 0, $$181625 = 0, $$19 = 0, $$191010 = 0, $$191116 = 0, $$191222 = 0, $$191328 = 0, $$191435 = 0, $$191526 = 0, $$191626 = 0, $$1939$lcssa = 0, $$19391817 = 0, $$19421823 = 0, $$1945$lcssa = 0, $$19451815 = 0, $$1954 = 0, $$1957 = 0;
 var $$1961 = 0, $$1961$ = 0, $$1964 = 0, $$1968 = 0, $$1973 = 0, $$1976 = 0, $$1982 = 0, $$1985 = 0, $$1988 = 0, $$1988$ph = 0, $$1992 = 0, $$1992$ph = 0, $$2$lcssa = 0, $$20 = 0, $$201011 = 0, $$201117 = 0, $$201223 = 0, $$201329 = 0, $$201436 = 0, $$201527 = 0;
 var $$201627 = 0, $$21 = 0, $$21099 = 0, $$211012 = 0, $$211118 = 0, $$211224 = 0, $$211330 = 0, $$211437 = 0, $$211437$ph = 0, $$211528 = 0, $$211628 = 0, $$211628$ph = 0, $$21196 = 0, $$21199$lcssa = 0, $$211991845 = 0, $$21205 = 0, $$21311 = 0, $$21418 = 0, $$21509 = 0, $$21609 = 0;
 var $$21825 = 0, $$22 = 0, $$221013 = 0, $$221119 = 0, $$221225 = 0, $$221331 = 0, $$221438 = 0, $$221529 = 0, $$221629 = 0, $$23 = 0, $$231014 = 0, $$231120 = 0, $$231226 = 0, $$231332 = 0, $$231439 = 0, $$231530 = 0, $$231630 = 0, $$24 = 0, $$241015 = 0, $$241121 = 0;
 var $$241227 = 0, $$241333 = 0, $$241440 = 0, $$241531 = 0, $$241631 = 0, $$25 = 0, $$251016 = 0, $$251122 = 0, $$251122$ph = 0, $$251228 = 0, $$251334 = 0, $$251441 = 0, $$251532 = 0, $$251632 = 0, $$26 = 0, $$26$ph = 0, $$261017 = 0, $$261017$ph = 0, $$261123 = 0, $$261229 = 0;
 var $$261229$ph = 0, $$261335 = 0, $$261335$ph = 0, $$261442 = 0, $$261533 = 0, $$261633 = 0, $$27 = 0, $$271018 = 0, $$271124 = 0, $$271230 = 0, $$271336 = 0, $$271443 = 0, $$271534 = 0, $$271634 = 0, $$28 = 0, $$281019 = 0, $$281125 = 0, $$281231 = 0, $$281337 = 0, $$281444 = 0;
 var $$281535 = 0, $$281635 = 0, $$29 = 0, $$291020 = 0, $$291126 = 0, $$291232 = 0, $$291338 = 0, $$291445 = 0, $$291536 = 0, $$291636 = 0, $$2940$lcssa = 0, $$29401824 = 0, $$2946$lcssa = 0, $$29461822 = 0, $$2955 = 0, $$2958 = 0, $$2965 = 0, $$2969 = 0, $$2974 = 0, $$2977 = 0;
 var $$2983 = 0, $$2986 = 0, $$2989 = 0, $$2993 = 0, $$30 = 0, $$301021 = 0, $$301127 = 0, $$301233 = 0, $$301339 = 0, $$301446 = 0, $$301537 = 0, $$301637 = 0, $$31 = 0, $$31100$v = 0, $$311022 = 0, $$311128 = 0, $$311234 = 0, $$311340 = 0, $$311447 = 0, $$311538 = 0;
 var $$311638 = 0, $$31200 = 0, $$31206 = 0, $$31206$ph = 0, $$31312 = 0, $$31312$ph = 0, $$31419 = 0, $$31419$ph = 0, $$31610 = 0, $$31610$ph = 0, $$32 = 0, $$321023 = 0, $$321129 = 0, $$321235 = 0, $$321341 = 0, $$321448 = 0, $$321448$ph = 0, $$321539 = 0, $$321639 = 0, $$321639$ph = 0;
 var $$33 = 0, $$331024 = 0, $$331130 = 0, $$331236 = 0, $$331342 = 0, $$331449 = 0, $$331540 = 0, $$331640 = 0, $$34 = 0, $$341025 = 0, $$341131 = 0, $$341237 = 0, $$341343 = 0, $$341450 = 0, $$341541 = 0, $$341641 = 0, $$35 = 0, $$351026 = 0, $$351132 = 0, $$351238 = 0;
 var $$351344 = 0, $$351451 = 0, $$351542 = 0, $$351642 = 0, $$36 = 0, $$361027 = 0, $$361027$ph = 0, $$361133 = 0, $$361133$ph = 0, $$361239 = 0, $$361345 = 0, $$361452 = 0, $$361543 = 0, $$361643 = 0, $$37 = 0, $$37$ph = 0, $$371028 = 0, $$371134 = 0, $$371240 = 0, $$371240$ph = 0;
 var $$371346 = 0, $$371346$ph = 0, $$371453 = 0, $$371453$ph = 0, $$371544 = 0, $$371644 = 0, $$371644$ph = 0, $$38 = 0, $$381029 = 0, $$381135 = 0, $$381241 = 0, $$381347 = 0, $$381454 = 0, $$381545 = 0, $$381645 = 0, $$39 = 0, $$391030 = 0, $$391136 = 0, $$391242 = 0, $$391348 = 0;
 var $$391455 = 0, $$391546 = 0, $$391646 = 0, $$3966 = 0, $$3970 = 0, $$3990 = 0, $$3990$ph = 0, $$3994 = 0, $$3994$ph = 0, $$40 = 0, $$401031 = 0, $$401137 = 0, $$401243 = 0, $$401349 = 0, $$401456 = 0, $$401547 = 0, $$401647 = 0, $$41 = 0, $$411032 = 0, $$411032$ph = 0;
 var $$411138 = 0, $$411138$ph = 0, $$411244 = 0, $$411350 = 0, $$411457 = 0, $$411548 = 0, $$411648 = 0, $$41201 = 0, $$41420 = 0, $$41511 = 0, $$41611 = 0, $$42 = 0, $$42$ph = 0, $$421033 = 0, $$421139 = 0, $$421245 = 0, $$421245$ph = 0, $$421351 = 0, $$421351$ph = 0, $$421458 = 0;
 var $$421549 = 0, $$421649 = 0, $$43 = 0, $$431034 = 0, $$431140 = 0, $$431246 = 0, $$431352 = 0, $$431459 = 0, $$431550 = 0, $$431650 = 0, $$44 = 0, $$441035 = 0, $$441141 = 0, $$441247 = 0, $$441353 = 0, $$441460 = 0, $$441460$ph = 0, $$441551 = 0, $$441651 = 0, $$441651$ph = 0;
 var $$45 = 0, $$451036 = 0, $$451142 = 0, $$451248 = 0, $$451354 = 0, $$451461 = 0, $$451552 = 0, $$451652 = 0, $$46 = 0, $$461037 = 0, $$461143 = 0, $$461249 = 0, $$461355 = 0, $$461462 = 0, $$461553 = 0, $$461653 = 0, $$47 = 0, $$471038 = 0, $$471144 = 0, $$471250 = 0;
 var $$471356 = 0, $$471463 = 0, $$471554 = 0, $$471654 = 0, $$48 = 0, $$481039 = 0, $$481039$ph = 0, $$481145 = 0, $$481145$ph = 0, $$481251 = 0, $$481357 = 0, $$481464 = 0, $$481555 = 0, $$481655 = 0, $$49 = 0, $$49$ph = 0, $$491040 = 0, $$491146 = 0, $$491252 = 0, $$491252$ph = 0;
 var $$491358 = 0, $$491358$ph = 0, $$491465 = 0, $$491465$ph = 0, $$491556 = 0, $$491656 = 0, $$491656$ph = 0, $$5 = 0, $$50 = 0, $$501041 = 0, $$501147 = 0, $$501253 = 0, $$501359 = 0, $$501466 = 0, $$501557 = 0, $$501657 = 0, $$51 = 0, $$51102 = 0, $$511042 = 0, $$511148 = 0;
 var $$511254 = 0, $$511360 = 0, $$511467 = 0, $$511558 = 0, $$511658 = 0, $$51208 = 0, $$51314 = 0, $$51512 = 0, $$52 = 0, $$521043 = 0, $$521043$ph = 0, $$521149 = 0, $$521255 = 0, $$521361 = 0, $$521468 = 0, $$521559 = 0, $$521659 = 0, $$53 = 0, $$531044 = 0, $$531150 = 0;
 var $$531150$ph = 0, $$531256 = 0, $$531362 = 0, $$531469 = 0, $$531560 = 0, $$531660 = 0, $$54 = 0, $$54$ph = 0, $$541045 = 0, $$541151 = 0, $$541257 = 0, $$541257$ph = 0, $$541363 = 0, $$541363$ph = 0, $$541470$ph = 0, $$541561 = 0, $$541661$lcssa = 0, $$541661$ph = 0, $$5416611868 = 0, $$55 = 0;
 var $$551046 = 0, $$551152 = 0, $$551258 = 0, $$551364 = 0, $$551471 = 0, $$551562 = 0, $$551662 = 0, $$56 = 0, $$561047 = 0, $$561153 = 0, $$561259 = 0, $$561365 = 0, $$561472 = 0, $$561563 = 0, $$561663 = 0, $$57 = 0, $$571048$ph = 0, $$571154 = 0, $$571260 = 0, $$571366 = 0;
 var $$571473 = 0, $$571473$ph = 0, $$571564 = 0, $$571664 = 0, $$571664$ph = 0, $$58 = 0, $$581049 = 0, $$581155$lcssa = 0, $$581155$ph = 0, $$5811551871 = 0, $$581261 = 0, $$581367 = 0, $$581474 = 0, $$581565$lcssa = 0, $$581565$ph = 0, $$5815651869 = 0, $$581665 = 0, $$59$lcssa = 0, $$59$ph = 0, $$591050 = 0;
 var $$591156 = 0, $$591262$ph = 0, $$591368$lcssa = 0, $$591368$ph = 0, $$5913681870 = 0, $$591475 = 0, $$591566 = 0, $$591666 = 0, $$591872 = 0, $$5996 = 0, $$6 = 0, $$60 = 0, $$601051 = 0, $$601051$ph = 0, $$601157 = 0, $$601263 = 0, $$601369 = 0, $$601476 = 0, $$601567 = 0, $$61 = 0;
 var $$61103 = 0, $$611052 = 0, $$611158 = 0, $$611158$ph = 0, $$611264 = 0, $$611370 = 0, $$611477 = 0, $$611568 = 0, $$611668 = 0, $$61209 = 0, $$61315 = 0, $$61513 = 0, $$62 = 0, $$62$ph = 0, $$621053 = 0, $$621159 = 0, $$621265 = 0, $$621265$ph = 0, $$621371 = 0, $$621371$ph = 0;
 var $$621478 = 0, $$621569 = 0, $$621669 = 0, $$63 = 0, $$631054 = 0, $$631266 = 0, $$631372 = 0, $$631479 = 0, $$631479$ph = 0, $$631570 = 0, $$631670 = 0, $$64 = 0, $$641055 = 0, $$641161 = 0, $$641267 = 0, $$641373 = 0, $$641480 = 0, $$641571 = 0, $$641671 = 0, $$641671$ph = 0;
 var $$65 = 0, $$651056 = 0, $$651162 = 0, $$651268 = 0, $$651374 = 0, $$651481 = 0, $$651572 = 0, $$651672 = 0, $$66 = 0, $$661057 = 0, $$661057$ph = 0, $$661163 = 0, $$661269 = 0, $$661375 = 0, $$661482 = 0, $$661673 = 0, $$671058 = 0, $$671164 = 0, $$671164$ph = 0, $$671270 = 0;
 var $$671483 = 0, $$671574 = 0, $$671674 = 0, $$68 = 0, $$681059 = 0, $$681165 = 0, $$681271 = 0, $$681271$ph = 0, $$681377 = 0, $$681484 = 0, $$681484$ph = 0, $$681575 = 0, $$681675 = 0, $$69 = 0, $$691060 = 0, $$691166 = 0, $$691272 = 0, $$691378 = 0, $$691485 = 0, $$691576 = 0;
 var $$691676 = 0, $$691676$ph = 0, $$6997 = 0, $$7 = 0, $$70 = 0, $$701061 = 0, $$701167 = 0, $$701273 = 0, $$701379 = 0, $$701486 = 0, $$701577 = 0, $$701677 = 0, $$71 = 0, $$71$ph = 0, $$71104 = 0, $$711062 = 0, $$711062$ph = 0, $$711168 = 0, $$711274 = 0, $$711380 = 0;
 var $$711380$ph = 0, $$711487 = 0, $$711578 = 0, $$711678 = 0, $$71210 = 0, $$71316 = 0, $$71514 = 0, $$72 = 0, $$721063 = 0, $$721169 = 0, $$721169$ph = 0, $$721275 = 0, $$721381 = 0, $$721488 = 0, $$721488$ph = 0, $$721579 = 0, $$721679 = 0, $$73 = 0, $$731064 = 0, $$731170 = 0;
 var $$731276 = 0, $$731276$ph = 0, $$731382 = 0, $$731489 = 0, $$731580 = 0, $$731680 = 0, $$731680$ph = 0, $$74 = 0, $$741065 = 0, $$741065$ph = 0, $$741171 = 0, $$741277 = 0, $$741383 = 0, $$741490 = 0, $$741581 = 0, $$741681 = 0, $$75 = 0, $$751066 = 0, $$751172 = 0, $$751278 = 0;
 var $$751384 = 0, $$751491 = 0, $$751582 = 0, $$751682 = 0, $$76 = 0, $$76$ph = 0, $$761067 = 0, $$761173 = 0, $$761173$ph = 0, $$761279 = 0, $$761279$ph = 0, $$761385 = 0, $$761385$ph = 0, $$761492 = 0, $$761583 = 0, $$761683 = 0, $$77 = 0, $$771068 = 0, $$771174 = 0, $$771280 = 0;
 var $$771386 = 0, $$771584 = 0, $$771684 = 0, $$78 = 0, $$781069 = 0, $$781175 = 0, $$781281 = 0, $$781387 = 0, $$781585 = 0, $$781685 = 0, $$79 = 0, $$791070 = 0, $$791176 = 0, $$791282 = 0, $$791388 = 0, $$791586 = 0, $$791686 = 0, $$7998 = 0, $$8 = 0, $$8$ph = 0;
 var $$80 = 0, $$80$ph = 0, $$801071 = 0, $$801177 = 0, $$801283 = 0, $$801389 = 0, $$801389$ph = 0, $$801496 = 0, $$801587 = 0, $$801687 = 0, $$81 = 0, $$81105 = 0, $$81105$ph = 0, $$811178 = 0, $$811284 = 0, $$811390 = 0, $$811497 = 0, $$811588 = 0, $$81211 = 0, $$81211$ph = 0;
 var $$81317 = 0, $$81317$ph = 0, $$81424 = 0, $$81515 = 0, $$81615 = 0, $$82 = 0, $$821179 = 0, $$821285 = 0, $$821391 = 0, $$821498 = 0, $$821589 = 0, $$83 = 0, $$831180 = 0, $$831392 = 0, $$831499 = 0, $$831590 = 0, $$84 = 0, $$841075 = 0, $$841393 = 0, $$841500 = 0;
 var $$841500$ph = 0, $$841591 = 0, $$841691 = 0, $$85 = 0, $$851076 = 0, $$851394 = 0, $$851501 = 0, $$851592 = 0, $$851692 = 0, $$86 = 0, $$861077 = 0, $$861289 = 0, $$861395 = 0, $$861502 = 0, $$861693 = 0, $$871078 = 0, $$871184 = 0, $$871290 = 0, $$871503 = 0, $$871694 = 0;
 var $$881079 = 0, $$881079$ph = 0, $$881185 = 0, $$881291 = 0, $$881504 = 0, $$881595 = 0, $$881695 = 0, $$881695$ph = 0, $$891080 = 0, $$891186 = 0, $$891292 = 0, $$891505 = 0, $$891596 = 0, $$891696 = 0, $$8999 = 0, $$8999$ph = 0, $$9 = 0, $$90 = 0, $$901081 = 0, $$901187 = 0;
 var $$901187$ph = 0, $$901293 = 0, $$901293$ph = 0, $$901399 = 0, $$901506 = 0, $$901597 = 0, $$901697 = 0, $$91 = 0, $$91000 = 0, $$91106 = 0, $$911082 = 0, $$911188 = 0, $$911294 = 0, $$911400 = 0, $$911598 = 0, $$911698 = 0, $$91212 = 0, $$91318 = 0, $$91425 = 0, $$91616 = 0;
 var $$92 = 0, $$921083 = 0, $$921189 = 0, $$921295 = 0, $$921401 = 0, $$921599 = 0, $$921699 = 0, $$93 = 0, $$931084 = 0, $$931190 = 0, $$931296 = 0, $$931402 = 0, $$931600 = 0, $$931700 = 0, $$94 = 0, $$94$ph = 0, $$941085 = 0, $$941191 = 0, $$941297 = 0, $$941403 = 0;
 var $$941403$ph = 0, $$941601 = 0, $$941701 = 0, $$95 = 0, $$951192 = 0, $$951298 = 0, $$951404 = 0, $$951602 = 0, $$96 = 0, $$961193 = 0, $$961299 = 0, $$961405 = 0, $$961603 = 0, $$97 = 0, $$971406 = 0, $$971604 = 0, $$98 = 0, $$981407 = 0, $$981605 = 0, $$99 = 0;
 var $$991408 = 0, $$991606 = 0, $$lcssa1778 = 0, $$lcssa1779 = 0, $$lcssa1799 = 0, $$lcssa1802 = 0, $$not = 0, $$not1747 = 0, $$sink12 = 0, $$sink13 = 0, $$sink16 = 0, $$sink17 = 0, $$sink1705 = 0, $$sink1710 = 0, $$sink1713 = 0, $$sink1716 = 0, $$sink1719 = 0, $$sink1722 = 0, $$sink1729 = 0, $$sink1732 = 0;
 var $$sink1736 = 0, $$sink1739 = 0, $$sink1743 = 0, $$sink1746 = 0, $$sink1750 = 0, $$sink3 = 0, $$sink3$shrunk = 0, $$sink30 = 0, $$sink9 = 0, $$sink9$shrunk = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0;
 var $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0;
 var $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0;
 var $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0;
 var $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0;
 var $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0;
 var $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0;
 var $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0;
 var $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0;
 var $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0;
 var $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0;
 var $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0;
 var $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0, $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0, $321 = 0, $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0;
 var $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0, $332 = 0, $333 = 0, $334 = 0, $335 = 0, $336 = 0, $337 = 0, $338 = 0, $339 = 0, $34 = 0, $340 = 0, $341 = 0, $342 = 0, $343 = 0, $344 = 0;
 var $345 = 0, $346 = 0, $347 = 0, $348 = 0, $349 = 0, $35 = 0, $350 = 0, $351 = 0, $352 = 0, $353 = 0, $354 = 0, $355 = 0, $356 = 0, $357 = 0, $358 = 0, $359 = 0, $36 = 0, $360 = 0, $361 = 0, $362 = 0;
 var $363 = 0, $364 = 0, $365 = 0, $366 = 0, $367 = 0, $368 = 0, $369 = 0, $37 = 0, $370 = 0, $371 = 0, $372 = 0, $373 = 0, $374 = 0, $375 = 0, $376 = 0, $377 = 0, $378 = 0, $379 = 0, $38 = 0, $380 = 0;
 var $381 = 0, $382 = 0, $383 = 0, $384 = 0, $385 = 0, $386 = 0, $387 = 0, $388 = 0, $389 = 0, $39 = 0, $390 = 0, $391 = 0, $392 = 0, $393 = 0, $394 = 0, $395 = 0, $396 = 0, $397 = 0, $398 = 0, $399 = 0;
 var $40 = 0, $400 = 0, $401 = 0, $402 = 0, $403 = 0, $404 = 0, $405 = 0, $406 = 0, $407 = 0, $408 = 0, $409 = 0, $41 = 0, $410 = 0, $411 = 0, $412 = 0, $413 = 0, $414 = 0, $415 = 0, $416 = 0, $417 = 0;
 var $418 = 0, $419 = 0, $42 = 0, $420 = 0, $421 = 0, $422 = 0, $423 = 0, $424 = 0, $425 = 0, $426 = 0, $427 = 0, $428 = 0, $429 = 0, $43 = 0, $430 = 0, $431 = 0, $432 = 0, $433 = 0, $434 = 0, $435 = 0;
 var $436 = 0, $437 = 0, $438 = 0, $439 = 0, $44 = 0, $440 = 0, $441 = 0, $442 = 0, $443 = 0, $444 = 0, $445 = 0, $446 = 0, $447 = 0, $448 = 0, $449 = 0, $45 = 0, $450 = 0, $451 = 0, $452 = 0, $453 = 0;
 var $454 = 0, $455 = 0, $456 = 0, $457 = 0, $458 = 0, $459 = 0, $46 = 0, $460 = 0, $461 = 0, $462 = 0, $463 = 0, $464 = 0, $465 = 0, $466 = 0, $467 = 0, $468 = 0, $469 = 0, $47 = 0, $470 = 0, $471 = 0;
 var $472 = 0, $473 = 0, $474 = 0, $475 = 0, $476 = 0, $477 = 0, $478 = 0, $479 = 0, $48 = 0, $480 = 0, $481 = 0, $482 = 0, $483 = 0, $484 = 0, $485 = 0, $486 = 0, $487 = 0, $488 = 0, $489 = 0, $49 = 0;
 var $490 = 0, $491 = 0, $492 = 0, $493 = 0, $494 = 0, $495 = 0, $496 = 0, $497 = 0, $498 = 0, $499 = 0, $50 = 0, $500 = 0, $501 = 0, $502 = 0, $503 = 0, $504 = 0, $505 = 0, $506 = 0, $507 = 0, $508 = 0;
 var $509 = 0, $51 = 0, $510 = 0, $511 = 0, $512 = 0, $513 = 0, $514 = 0, $515 = 0, $516 = 0, $517 = 0, $518 = 0, $519 = 0, $52 = 0, $520 = 0, $521 = 0, $522 = 0, $523 = 0, $524 = 0, $525 = 0, $526 = 0;
 var $527 = 0, $528 = 0, $529 = 0, $53 = 0, $530 = 0, $531 = 0, $532 = 0, $533 = 0, $534 = 0, $535 = 0, $536 = 0, $537 = 0, $538 = 0, $539 = 0, $54 = 0, $540 = 0, $541 = 0, $542 = 0, $543 = 0, $544 = 0;
 var $545 = 0, $546 = 0, $547 = 0, $548 = 0, $549 = 0, $55 = 0, $550 = 0, $551 = 0, $552 = 0, $553 = 0, $554 = 0, $555 = 0, $556 = 0, $557 = 0, $558 = 0, $559 = 0, $56 = 0, $560 = 0, $561 = 0, $562 = 0;
 var $563 = 0, $564 = 0, $565 = 0, $566 = 0, $567 = 0, $568 = 0, $569 = 0, $57 = 0, $570 = 0, $571 = 0, $572 = 0, $573 = 0, $574 = 0, $575 = 0, $576 = 0, $577 = 0, $578 = 0, $579 = 0, $58 = 0, $580 = 0;
 var $581 = 0, $582 = 0, $583 = 0, $584 = 0, $585 = 0, $586 = 0, $587 = 0, $588 = 0, $589 = 0, $59 = 0, $590 = 0, $591 = 0, $592 = 0, $593 = 0, $594 = 0, $595 = 0, $596 = 0, $597 = 0, $598 = 0, $599 = 0;
 var $60 = 0, $600 = 0, $601 = 0, $602 = 0, $603 = 0, $604 = 0, $605 = 0, $606 = 0, $607 = 0, $608 = 0, $609 = 0, $61 = 0, $610 = 0, $611 = 0, $612 = 0, $613 = 0, $614 = 0, $615 = 0, $616 = 0, $617 = 0;
 var $618 = 0, $619 = 0, $62 = 0, $620 = 0, $621 = 0, $622 = 0, $623 = 0, $624 = 0, $625 = 0, $626 = 0, $627 = 0, $628 = 0, $629 = 0, $63 = 0, $630 = 0, $631 = 0, $632 = 0, $633 = 0, $634 = 0, $635 = 0;
 var $636 = 0, $637 = 0, $638 = 0, $639 = 0, $64 = 0, $640 = 0, $641 = 0, $642 = 0, $643 = 0, $644 = 0, $645 = 0, $646 = 0, $647 = 0, $648 = 0, $649 = 0, $65 = 0, $650 = 0, $651 = 0, $652 = 0, $653 = 0;
 var $654 = 0, $655 = 0, $656 = 0, $657 = 0, $658 = 0, $659 = 0, $66 = 0, $660 = 0, $661 = 0, $662 = 0, $663 = 0, $664 = 0, $665 = 0, $666 = 0, $667 = 0, $668 = 0, $669 = 0, $67 = 0, $670 = 0, $671 = 0;
 var $672 = 0, $673 = 0, $674 = 0, $675 = 0, $676 = 0, $677 = 0, $678 = 0, $679 = 0, $68 = 0, $680 = 0, $681 = 0, $682 = 0, $683 = 0, $684 = 0, $685 = 0, $686 = 0, $687 = 0, $688 = 0, $689 = 0, $69 = 0;
 var $690 = 0, $691 = 0, $692 = 0, $693 = 0, $694 = 0, $695 = 0, $696 = 0, $697 = 0, $698 = 0, $699 = 0, $7 = 0, $70 = 0, $700 = 0, $701 = 0, $702 = 0, $703 = 0, $704 = 0, $705 = 0, $706 = 0, $707 = 0;
 var $708 = 0, $709 = 0, $71 = 0, $710 = 0, $711 = 0, $712 = 0, $713 = 0, $714 = 0, $715 = 0, $716 = 0, $717 = 0, $718 = 0, $719 = 0, $72 = 0, $720 = 0, $721 = 0, $722 = 0, $723 = 0, $724 = 0, $725 = 0;
 var $726 = 0, $727 = 0, $728 = 0, $729 = 0, $73 = 0, $730 = 0, $731 = 0, $732 = 0, $733 = 0, $734 = 0, $735 = 0, $736 = 0, $737 = 0, $738 = 0, $739 = 0, $74 = 0, $740 = 0, $741 = 0, $742 = 0, $743 = 0;
 var $744 = 0, $745 = 0, $746 = 0, $747 = 0, $748 = 0, $749 = 0, $75 = 0, $750 = 0, $751 = 0, $752 = 0, $753 = 0, $754 = 0, $755 = 0, $756 = 0, $757 = 0, $758 = 0, $759 = 0, $76 = 0, $760 = 0, $761 = 0;
 var $762 = 0, $763 = 0, $764 = 0, $765 = 0, $766 = 0, $767 = 0, $768 = 0, $769 = 0, $77 = 0, $770 = 0, $771 = 0, $772 = 0, $773 = 0, $774 = 0, $775 = 0, $776 = 0, $777 = 0, $778 = 0, $779 = 0, $78 = 0;
 var $780 = 0, $781 = 0, $782 = 0, $783 = 0, $784 = 0, $785 = 0, $786 = 0, $787 = 0, $788 = 0, $789 = 0, $79 = 0, $790 = 0, $791 = 0, $792 = 0, $793 = 0, $794 = 0, $795 = 0, $796 = 0, $797 = 0, $798 = 0;
 var $799 = 0, $8 = 0, $80 = 0, $800 = 0, $801 = 0, $802 = 0, $803 = 0, $804 = 0, $805 = 0, $806 = 0, $807 = 0, $808 = 0, $809 = 0, $81 = 0, $810 = 0, $811 = 0, $812 = 0, $813 = 0, $814 = 0, $815 = 0;
 var $816 = 0, $817 = 0, $818 = 0, $819 = 0, $82 = 0, $820 = 0, $821 = 0, $822 = 0, $823 = 0, $824 = 0, $825 = 0, $826 = 0, $827 = 0, $828 = 0, $829 = 0, $83 = 0, $830 = 0, $831 = 0, $832 = 0, $833 = 0;
 var $834 = 0, $835 = 0, $836 = 0, $837 = 0, $838 = 0, $839 = 0, $84 = 0, $840 = 0, $841 = 0, $842 = 0, $843 = 0, $844 = 0, $845 = 0, $846 = 0, $847 = 0, $848 = 0, $849 = 0, $85 = 0, $850 = 0, $851 = 0;
 var $852 = 0, $853 = 0, $854 = 0, $855 = 0, $856 = 0, $857 = 0, $858 = 0, $859 = 0, $86 = 0, $860 = 0, $861 = 0, $862 = 0, $863 = 0, $864 = 0, $865 = 0, $866 = 0, $867 = 0, $868 = 0, $869 = 0, $87 = 0;
 var $870 = 0, $871 = 0, $872 = 0, $873 = 0, $874 = 0, $875 = 0, $876 = 0, $877 = 0, $878 = 0, $879 = 0, $88 = 0, $880 = 0, $881 = 0, $882 = 0, $883 = 0, $884 = 0, $885 = 0, $886 = 0, $887 = 0, $888 = 0;
 var $889 = 0, $89 = 0, $890 = 0, $891 = 0, $892 = 0, $893 = 0, $894 = 0, $895 = 0, $896 = 0, $897 = 0, $898 = 0, $899 = 0, $9 = 0, $90 = 0, $900 = 0, $901 = 0, $902 = 0, $903 = 0, $904 = 0, $905 = 0;
 var $906 = 0, $907 = 0, $908 = 0, $909 = 0, $91 = 0, $910 = 0, $911 = 0, $912 = 0, $913 = 0, $914 = 0, $915 = 0, $916 = 0, $917 = 0, $918 = 0, $919 = 0, $92 = 0, $920 = 0, $921 = 0, $922 = 0, $923 = 0;
 var $924 = 0, $925 = 0, $926 = 0, $927 = 0, $928 = 0, $929 = 0, $93 = 0, $930 = 0, $931 = 0, $932 = 0, $933 = 0, $934 = 0, $935 = 0, $936 = 0, $937 = 0, $938 = 0, $939 = 0, $94 = 0, $940 = 0, $941 = 0;
 var $942 = 0, $943 = 0, $944 = 0, $945 = 0, $946 = 0, $947 = 0, $948 = 0, $949 = 0, $95 = 0, $950 = 0, $951 = 0, $952 = 0, $953 = 0, $954 = 0, $955 = 0, $956 = 0, $957 = 0, $958 = 0, $959 = 0, $96 = 0;
 var $960 = 0, $961 = 0, $962 = 0, $963 = 0, $964 = 0, $965 = 0, $966 = 0, $97 = 0, $98 = 0, $99 = 0, $brmerge = 0, $exitcond = 0, $not$ = 0, $not$1755 = 0, $or$cond = 0, $or$cond1702 = 0, $or$cond1752 = 0, $or$cond24 = 0, $or$cond29 = 0, $scevgep = 0;
 var $scevgep1947 = 0, $scevgep1948 = 0, $scevgep1955 = 0, $scevgep1957 = 0, $scevgep1959 = 0, $scevgep19611962 = 0, $trunc = 0, $trunc$clear = 0, dest = 0, label = 0, sp = 0, stop = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 144|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(144|0);
 $7 = sp + 64|0;
 $8 = sp;
 $9 = HEAP32[$2>>2]|0;
 $10 = (($1) + ($9)|0);
 $11 = HEAP32[$5>>2]|0;
 $12 = (($4) + ($11)|0);
 $13 = $6 & 4;
 $14 = ($13|0)!=(0);
 $15 = $4;
 $16 = $3;
 $17 = $16 ^ -1;
 $18 = (($15) + ($17))|0;
 $19 = (($18) + ($11))|0;
 $$1753 = $14 ? -1 : $19;
 $20 = (($$1753) + 1)|0;
 $21 = $20 & $$1753;
 $22 = ($21|0)!=(0);
 $23 = ($4>>>0)<($3>>>0);
 $or$cond1702 = $23 | $22;
 if ($or$cond1702) {
  HEAP32[$5>>2] = 0;
  HEAP32[$2>>2] = 0;
  $$0951 = -3;
  STACKTOP = sp;return ($$0951|0);
 }
 $24 = ((($0)) + 4|0);
 $25 = HEAP32[$24>>2]|0;
 $26 = ((($0)) + 56|0);
 $27 = HEAP32[$26>>2]|0;
 $28 = ((($0)) + 32|0);
 $29 = HEAP32[$28>>2]|0;
 $30 = ((($0)) + 36|0);
 $31 = HEAP32[$30>>2]|0;
 $32 = ((($0)) + 40|0);
 $33 = HEAP32[$32>>2]|0;
 $34 = ((($0)) + 60|0);
 $35 = HEAP32[$34>>2]|0;
 $36 = HEAP32[$0>>2]|0;
 L5: do {
  switch ($36|0) {
  case 0:  {
   $37 = ((($0)) + 12|0);
   HEAP32[$37>>2] = 0;
   $38 = ((($0)) + 8|0);
   HEAP32[$38>>2] = 0;
   $39 = ((($0)) + 28|0);
   HEAP32[$39>>2] = 1;
   $40 = ((($0)) + 16|0);
   HEAP32[$40>>2] = 1;
   $41 = $6 & 1;
   $42 = ($41|0)==(0);
   if ($42) {
    $$01416 = $35;$$01607 = $4;$$41511 = $1;$$5 = 0;$$51102 = 0;$$51208 = 0;$$51314 = 0;$$5996 = 0;
    label = 14;
   } else {
    $43 = ($9|0)<(1);
    if ($43) {
     $$01097 = 0;$$01203 = 0;$$01309 = 0;$$0987 = 0;$$0991 = 0;
     label = 6;
    } else {
     $$11098$ph = 0;$$11204$ph = 0;$$11310$ph = 0;$$1988$ph = 0;$$1992$ph = 0;
     label = 8;
    }
   }
   break;
  }
  case 1:  {
   $46 = ($9|0)>(0);
   if ($46) {
    $$11098$ph = $31;$$11204$ph = $33;$$11310$ph = $27;$$1988$ph = $25;$$1992$ph = $29;
    label = 8;
   } else {
    $$01097 = $31;$$01203 = $33;$$01309 = $27;$$0987 = $25;$$0991 = $29;
    label = 6;
   }
   break;
  }
  case 2:  {
   $53 = ($9|0)>(0);
   if ($53) {
    $$31206$ph = $33;$$31312$ph = $27;$$3990$ph = $25;$$3994$ph = $29;$$sink1705 = $1;
    label = 12;
   } else {
    $$11508 = $1;$$21099 = $31;$$21205 = $33;$$21311 = $27;$$2989 = $25;$$2993 = $29;
    label = 10;
   }
   break;
  }
  case 36:  {
   $$0960 = -1;$$891505 = $35;$$931084 = $29;$$931700 = $4;$$951192 = $31;$$951298 = $33;$$981605 = $1;$$99 = $25;$$991408 = $27;$$sink30 = 36;
   label = 243;
   break;
  }
  case 3:  {
   $75 = ($9|0)>(0);
   if ($75) {
    $$31419$ph = $35;$$31610$ph = $4;$$8$ph = $25;$$81105$ph = $31;$$81211$ph = $33;$$81317$ph = $27;$$8999$ph = $29;$$sink1710 = $1;
    label = 18;
   } else {
    $$21418 = $35;$$21609 = $4;$$61513 = $1;$$7 = $25;$$71104 = $31;$$71210 = $33;$$71316 = $27;$$7998 = $29;
    label = 16;
   }
   break;
  }
  case 5:  {
   $90 = ($9|0)>(0);
   if ($90) {
    $91 = ((($1)) + 1|0);
    $92 = HEAP8[$1>>0]|0;
    $93 = $92&255;
    $$01412 = $93;$$111518 = $91;
   } else {
    $88 = $6 & 2;
    $89 = ($88|0)==(0);
    if ($89) {
     $$01412 = 0;$$111518 = $1;
    } else {
     $$0960 = 1;$$891505 = $35;$$931084 = $29;$$931700 = $4;$$951192 = $31;$$951298 = $33;$$981605 = $1;$$99 = $25;$$991408 = $27;$$sink30 = 5;
     label = 243;
     break L5;
    }
   }
   $94 = $$01412 << $25;
   $95 = $94 | $27;
   $96 = (($25) + 8)|0;
   $$121519 = $$111518;$$13 = $96;$$131004 = $29;$$131216 = $33;$$131322 = $95;$$81424 = $35;$$81615 = $4;
   label = 25;
   break;
  }
  case 6:  {
   $106 = ($9|0)>(0);
   if ($106) {
    $$121428$ph = $35;$$121619$ph = $4;$$161113$ph = $31;$$17$ph = $25;$$171008$ph = $29;$$171220$ph = $33;$$171326$ph = $27;$$sink1713 = $1;
    label = 32;
   } else {
    $$111427 = $35;$$111618 = $4;$$151112 = $31;$$151522 = $1;$$16 = $25;$$161007 = $29;$$161219 = $33;$$161325 = $27;
    label = 30;
   }
   break;
  }
  case 7:  {
   $120 = ($9|0)>(0);
   if ($120) {
    $121 = ((($1)) + 1|0);
    $122 = HEAP8[$1>>0]|0;
    $$151431 = $35;$$151622 = $4;$$191116 = $31;$$191526 = $121;$$20 = $25;$$201011 = $29;$$201223 = $33;$$201329 = $27;$$sink12 = $122;
    label = 39;
   } else {
    $$141430 = $35;$$141621 = $4;$$181115 = $31;$$181525 = $1;$$19 = $25;$$191010 = $29;$$191222 = $33;$$191328 = $27;
    label = 36;
   }
   break;
  }
  case 39:  {
   $$171433 = $35;$$171624 = $4;$$211118 = $31;$$211528 = $1;$$22 = $25;$$221013 = $29;$$221225 = $33;$$221331 = $27;
   label = 43;
   break;
  }
  case 51:  {
   $152 = ($9|0)>(0);
   if ($152) {
    $$211437$ph = $35;$$211628$ph = $4;$$251122$ph = $31;$$26$ph = $25;$$261017$ph = $29;$$261229$ph = $33;$$261335$ph = $27;$$sink1716 = $1;
    label = 49;
   } else {
    $$201436 = $35;$$201627 = $4;$$241121 = $31;$$241531 = $1;$$25 = $25;$$251016 = $29;$$251228 = $33;$$251334 = $27;
    label = 47;
   }
   break;
  }
  case 52:  {
   $$231439 = $35;$$231630 = $4;$$271018 = $29;$$271124 = $31;$$271534 = $1;$$28 = $25;$$281231 = $33;$$281337 = $27;
   label = 52;
   break;
  }
  case 9:  {
   $$251441 = $35;$$251632 = $4;$$291020 = $29;$$291126 = $31;$$291536 = $1;$$30 = $25;$$301233 = $33;$$301339 = $27;
   label = 55;
   break;
  }
  case 38:  {
   $$261442 = $35;$$261633 = $4;$$301021 = $29;$$301127 = $31;$$301537 = $1;$$31 = $25;$$311234 = $33;$$311340 = $27;
   label = 56;
   break;
  }
  case 40:  {
   $$271443 = $35;$$271634 = $4;$$311022 = $29;$$311128 = $31;$$311538 = $1;$$32 = $25;$$321235 = $33;$$321341 = $27;
   label = 58;
   break;
  }
  case 10:  {
   $$281444 = $35;$$281635 = $4;$$321023 = $29;$$321129 = $31;$$321539 = $1;$$33 = $25;$$331236 = $33;$$331342 = $27;
   label = 60;
   break;
  }
  case 11:  {
   $193 = ($9|0)>(0);
   if ($193) {
    $$321448$ph = $35;$$321639$ph = $4;$$361027$ph = $29;$$361133$ph = $31;$$37$ph = $25;$$371240$ph = $33;$$371346$ph = $27;$$sink1719 = $1;
    label = 66;
   } else {
    $$311447 = $35;$$311638 = $4;$$351026 = $29;$$351132 = $31;$$351542 = $1;$$36 = $25;$$361239 = $33;$$361345 = $27;
    label = 64;
   }
   break;
  }
  case 14:  {
   $224 = ($9|0)>(0);
   if ($224) {
    $$371453$ph = $35;$$371644$ph = $4;$$411032$ph = $29;$$411138$ph = $31;$$42$ph = $25;$$421245$ph = $33;$$421351$ph = $27;$$sink1722 = $1;
    label = 75;
   } else {
    $$361452 = $35;$$361643 = $4;$$401031 = $29;$$401137 = $31;$$401547 = $1;$$41 = $25;$$411244 = $33;$$411350 = $27;
    label = 73;
   }
   break;
  }
  case 35:  {
   $$401456 = $35;$$401647 = $4;$$441035 = $29;$$441141 = $31;$$441551 = $1;$$45 = $25;$$451248 = $33;$$451354 = $27;
   label = 86;
   break;
  }
  case 16:  {
   $452 = ($9|0)>(0);
   if ($452) {
    $$441460$ph = $35;$$441651$ph = $4;$$481039$ph = $29;$$481145$ph = $31;$$49$ph = $25;$$491252$ph = $33;$$491358$ph = $27;$$sink1729 = $1;
    label = 116;
   } else {
    $$431459 = $35;$$431650 = $4;$$471038 = $29;$$471144 = $31;$$471554 = $1;$$48 = $25;$$481251 = $33;$$481357 = $27;
    label = 114;
   }
   break;
  }
  case 17:  {
   $$461462 = $35;$$461653 = $4;$$491040 = $29;$$501147 = $31;$$501557 = $1;$$51 = $25;$$511254 = $33;$$511360 = $27;
   label = 125;
   break;
  }
  case 18:  {
   $503 = ($9|0)>(0);
   if ($503) {
    $$491465$ph = $35;$$491656$ph = $4;$$521043$ph = $29;$$531150$ph = $31;$$54$ph = $25;$$541257$ph = $33;$$541363$ph = $27;$$sink1732 = $1;
    label = 130;
   } else {
    $$481464 = $35;$$481655 = $4;$$511042 = $29;$$521149 = $31;$$521559 = $1;$$53 = $25;$$531256 = $33;$$531362 = $27;
    label = 128;
   }
   break;
  }
  case 21:  {
   $$511467 = $35;$$511658 = $4;$$541045 = $29;$$551152 = $31;$$551562 = $1;$$56 = $25;$$561259 = $33;$$561365 = $27;
   label = 136;
   break;
  }
  case 23:  {
   $572 = ($9|0)>(0);
   if ($572) {
    $$571473$ph = $35;$$571664$ph = $4;$$601051$ph = $29;$$611158$ph = $31;$$62$ph = $25;$$621265$ph = $33;$$621371$ph = $27;$$sink1736 = $1;
    label = 153;
   } else {
    $$561472 = $35;$$561663 = $4;$$591050 = $29;$$601157 = $31;$$601567 = $1;$$61 = $25;$$611264 = $33;$$611370 = $27;
    label = 151;
   }
   break;
  }
  case 24:  {
   $$591475 = $35;$$591666 = $4;$$621053 = $29;$$621159 = $31;$$631570 = $1;$$64 = $25;$$641267 = $33;$$641373 = $27;
   label = 160;
   break;
  }
  case 25:  {
   $696 = ($9|0)>(0);
   if ($696) {
    $$631479$ph = $35;$$641671$ph = $4;$$661057$ph = $29;$$671164$ph = $31;$$681271$ph = $33;$$71$ph = $25;$$711380$ph = $27;$$sink1739 = $1;
    label = 182;
   } else {
    $$621478 = $35;$$631670 = $4;$$651056 = $29;$$661163 = $31;$$671270 = $33;$$691576 = $1;$$70 = $25;$$701379 = $27;
    label = 180;
   }
   break;
  }
  case 26:  {
   $737 = ($9|0)>(0);
   if ($737) {
    $$681484$ph = $35;$$691676$ph = $4;$$711062$ph = $29;$$721169$ph = $31;$$731276$ph = $33;$$76$ph = $25;$$761385$ph = $27;$$sink1743 = $1;
    label = 195;
   } else {
    $$671483 = $35;$$681675 = $4;$$701061 = $29;$$711168 = $31;$$721275 = $33;$$741581 = $1;$$75 = $25;$$751384 = $27;
    label = 193;
   }
   break;
  }
  case 27:  {
   $784 = ($9|0)>(0);
   if ($784) {
    $$721488$ph = $35;$$731680$ph = $4;$$741065$ph = $29;$$761173$ph = $31;$$761279$ph = $33;$$80$ph = $25;$$801389$ph = $27;$$sink1746 = $1;
    label = 206;
   } else {
    $$711487 = $35;$$721679 = $4;$$731064 = $29;$$751172 = $31;$$751278 = $33;$$781585 = $1;$$79 = $25;$$791388 = $27;
    label = 204;
   }
   break;
  }
  case 37:  {
   $$731489 = $35;$$761683 = $4;$$771068 = $29;$$791176 = $31;$$791282 = $33;$$821589 = $1;$$83 = $25;$$831392 = $27;
   label = 210;
   break;
  }
  case 53:  {
   $$751491 = $35;$$781685 = $4;$$791070 = $29;$$811178 = $31;$$811284 = $33;$$841591 = $1;$$85 = $25;$$851394 = $27;
   label = 213;
   break;
  }
  case 32:  {
   $842 = ($9|0)>(0);
   if ($842) {
    $843 = ((($1)) + 1|0);
    $844 = HEAP8[$1>>0]|0;
    $845 = $844&255;
    $$0949 = $845;$$881595 = $843;
   } else {
    $840 = $6 & 2;
    $841 = ($840|0)==(0);
    if ($841) {
     $$0949 = 0;$$881595 = $1;
    } else {
     $$0960 = 1;$$891505 = $35;$$931084 = $29;$$931700 = $4;$$951192 = $31;$$951298 = $33;$$981605 = $1;$$99 = $25;$$991408 = $27;$$sink30 = 32;
     label = 243;
     break L5;
    }
   }
   $846 = $$0949 << $25;
   $847 = $846 | $27;
   $848 = (($25) + 8)|0;
   $$801496 = $35;$$841075 = $29;$$841691 = $4;$$861289 = $33;$$891596 = $$881595;$$90 = $848;$$901399 = $847;
   label = 226;
   break;
  }
  case 41:  {
   $858 = ($9|0)>(0);
   if ($858) {
    $$841500$ph = $35;$$881079$ph = $29;$$881695$ph = $4;$$901187$ph = $31;$$901293$ph = $33;$$94$ph = $25;$$941403$ph = $27;$$sink1750 = $1;
    label = 233;
   } else {
    $$831499 = $35;$$871078 = $29;$$871694 = $4;$$891186 = $31;$$891292 = $33;$$921599 = $1;$$93 = $25;$$931402 = $27;
    label = 231;
   }
   break;
  }
  case 42:  {
   $871 = ($9|0)>(0);
   if ($871) {
    $872 = ((($1)) + 1|0);
    $873 = HEAP8[$1>>0]|0;
    $874 = $873&255;
    $$0948 = $874;$$871503 = $35;$$911082 = $29;$$911698 = $4;$$931190 = $31;$$931296 = $33;$$961603 = $872;$$97 = $25;$$971406 = $27;
    label = 241;
   } else {
    $$861502 = $35;$$901081 = $29;$$901697 = $4;$$921189 = $31;$$921295 = $33;$$951602 = $1;$$96 = $25;$$961405 = $27;
    label = 237;
   }
   break;
  }
  case 34:  {
   $$881504 = $35;$$921083 = $29;$$921699 = $4;$$941191 = $31;$$941297 = $33;$$971604 = $1;$$98 = $25;$$981407 = $27;
   label = 242;
   break;
  }
  default: {
   $$100 = $25;$$1001409 = $27;$$1961 = -1;$$901506 = $35;$$941085 = $29;$$941701 = $4;$$961193 = $31;$$961299 = $33;$$991606 = $1;
   label = 244;
  }
  }
 } while(0);
 if ((label|0) == 6) {
  $44 = $6 & 2;
  $45 = ($44|0)==(0);
  if ($45) {
   $$01507 = $1;$$11098 = $$01097;$$11204 = $$01203;$$11310 = $$01309;$$1988 = $$0987;$$1992 = $$0991;$$sink3$shrunk = 0;
   label = 9;
  } else {
   $$0960 = 1;$$891505 = $35;$$931084 = $$0991;$$931700 = $4;$$951192 = $$01097;$$951298 = $$01203;$$981605 = $1;$$99 = $$0987;$$991408 = $$01309;$$sink30 = 1;
   label = 243;
  }
 }
 else if ((label|0) == 8) {
  $47 = ((($1)) + 1|0);
  $48 = HEAP8[$1>>0]|0;
  $$01507 = $47;$$11098 = $$11098$ph;$$11204 = $$11204$ph;$$11310 = $$11310$ph;$$1988 = $$1988$ph;$$1992 = $$1992$ph;$$sink3$shrunk = $48;
  label = 9;
 }
 if ((label|0) == 9) {
  $$sink3 = $$sink3$shrunk&255;
  $49 = ((($0)) + 8|0);
  HEAP32[$49>>2] = $$sink3;
  $50 = ($$01507>>>0)<($10>>>0);
  if ($50) {
   $$31206$ph = $$11204;$$31312$ph = $$11310;$$3990$ph = $$1988;$$3994$ph = $$1992;$$sink1705 = $$01507;
   label = 12;
  } else {
   $$11508 = $$01507;$$21099 = $$11098;$$21205 = $$11204;$$21311 = $$11310;$$2989 = $$1988;$$2993 = $$1992;
   label = 10;
  }
 }
 if ((label|0) == 10) {
  $51 = $6 & 2;
  $52 = ($51|0)==(0);
  if ($52) {
   $$21509 = $$11508;$$31206 = $$21205;$$31312 = $$21311;$$3990 = $$2989;$$3994 = $$2993;$$sink9$shrunk = 0;
   label = 13;
  } else {
   $$0960 = 1;$$891505 = $35;$$931084 = $$2993;$$931700 = $4;$$951192 = $$21099;$$951298 = $$21205;$$981605 = $$11508;$$99 = $$2989;$$991408 = $$21311;$$sink30 = 2;
   label = 243;
  }
 }
 else if ((label|0) == 12) {
  $54 = ((($$sink1705)) + 1|0);
  $55 = HEAP8[$$sink1705>>0]|0;
  $$21509 = $54;$$31206 = $$31206$ph;$$31312 = $$31312$ph;$$3990 = $$3990$ph;$$3994 = $$3994$ph;$$sink9$shrunk = $55;
  label = 13;
 }
 if ((label|0) == 13) {
  $$sink9 = $$sink9$shrunk&255;
  $56 = ((($0)) + 12|0);
  HEAP32[$56>>2] = $$sink9;
  $57 = ((($0)) + 8|0);
  $58 = HEAP32[$57>>2]|0;
  $59 = $58 << 8;
  $60 = $59 | $$sink9;
  $61 = (($60>>>0) % 31)&-1;
  $62 = $$sink9 & 32;
  $63 = $61 | $62;
  $64 = $58 & 15;
  $65 = ($64|0)!=(8);
  $not$ = ($63|0)!=(0);
  $$1754 = $65 | $not$;
  $66 = $58 >>> 4;
  $67 = 256 << $66;
  $68 = ($67>>>0)>(32768);
  $69 = ($20>>>0)<($67>>>0);
  $$ = $68 | $69;
  $not$1755 = $14 ^ 1;
  $70 = $$ & $not$1755;
  $$31100$v = $70 | $$1754;
  if ($$31100$v) {
   $$0960 = -1;$$891505 = $35;$$931084 = $$3994;$$931700 = $4;$$951192 = 1;$$951298 = $$31206;$$981605 = $$21509;$$99 = $$3990;$$991408 = $$31312;$$sink30 = 36;
   label = 243;
  } else {
   $$01416 = $35;$$01607 = $4;$$41511 = $$21509;$$5 = $$3990;$$51102 = 0;$$51208 = $$31206;$$51314 = $$31312;$$5996 = $$3994;
   label = 14;
  }
 }
 L46: while(1) {
  switch (label|0) {
   case 14: {
    label = 0;
    $71 = ($$5>>>0)<(3);
    if ($71) {
     $$11417 = $$01416;$$11608 = $$01607;$$51512 = $$41511;$$6 = $$5;$$61103 = $$51102;$$61209 = $$51208;$$61315 = $$51314;$$6997 = $$5996;
     label = 15;
    } else {
     $$41420 = $$01416;$$41611 = $$01607;$$81515 = $$41511;$$9 = $$5;$$91000 = $$5996;$$91106 = $$51102;$$91212 = $$51208;$$91318 = $$51314;
     label = 20;
    }
    break;
   }
   case 16: {
    label = 0;
    $73 = $6 & 2;
    $74 = ($73|0)==(0);
    if ($74) {
     $$01413$shrunk = 0;$$31419 = $$21418;$$31610 = $$21609;$$71514 = $$61513;$$8 = $$7;$$81105 = $$71104;$$81211 = $$71210;$$81317 = $$71316;$$8999 = $$7998;
     label = 19;
    } else {
     $$0960 = 1;$$891505 = $$21418;$$931084 = $$7998;$$931700 = $$21609;$$951192 = $$71104;$$951298 = $$71210;$$981605 = $$61513;$$99 = $$7;$$991408 = $$71316;$$sink30 = 3;
     label = 243;
     continue L46;
    }
    break;
   }
   case 18: {
    label = 0;
    $76 = ((($$sink1710)) + 1|0);
    $77 = HEAP8[$$sink1710>>0]|0;
    $$01413$shrunk = $77;$$31419 = $$31419$ph;$$31610 = $$31610$ph;$$71514 = $76;$$8 = $$8$ph;$$81105 = $$81105$ph;$$81211 = $$81211$ph;$$81317 = $$81317$ph;$$8999 = $$8999$ph;
    label = 19;
    break;
   }
   case 25: {
    label = 0;
    $97 = $$13 & 7;
    $98 = $$131322 >>> $97;
    $99 = (($$13) - ($97))|0;
    $$131110 = 0;$$131520 = $$121519;$$14 = $99;$$141005 = $$131004;$$141217 = $$131216;$$141323 = $98;$$91425 = $$81424;$$91616 = $$81615;
    label = 26;
    break;
   }
   case 30: {
    label = 0;
    $104 = $6 & 2;
    $105 = ($104|0)==(0);
    if ($105) {
     $$01411$shrunk = 0;$$121428 = $$111427;$$121619 = $$111618;$$161113 = $$151112;$$161523 = $$151522;$$17 = $$16;$$171008 = $$161007;$$171220 = $$161219;$$171326 = $$161325;
     label = 33;
    } else {
     $$0960 = 1;$$891505 = $$111427;$$931084 = $$161007;$$931700 = $$111618;$$951192 = $$151112;$$951298 = $$161219;$$981605 = $$151522;$$99 = $$16;$$991408 = $$161325;$$sink30 = 6;
     label = 243;
     continue L46;
    }
    break;
   }
   case 32: {
    label = 0;
    $107 = ((($$sink1713)) + 1|0);
    $108 = HEAP8[$$sink1713>>0]|0;
    $$01411$shrunk = $108;$$121428 = $$121428$ph;$$121619 = $$121619$ph;$$161113 = $$161113$ph;$$161523 = $107;$$17 = $$17$ph;$$171008 = $$171008$ph;$$171220 = $$171220$ph;$$171326 = $$171326$ph;
    label = 33;
    break;
   }
   case 36: {
    label = 0;
    $118 = $6 & 2;
    $119 = ($118|0)==(0);
    if ($119) {
     $$151431 = $$141430;$$151622 = $$141621;$$191116 = $$181115;$$191526 = $$181525;$$20 = $$19;$$201011 = $$191010;$$201223 = $$191222;$$201329 = $$191328;$$sink12 = 0;
     label = 39;
     continue L46;
    } else {
     $$0960 = 1;$$891505 = $$141430;$$931084 = $$191010;$$931700 = $$141621;$$951192 = $$181115;$$951298 = $$191222;$$981605 = $$181525;$$99 = $$19;$$991408 = $$191328;$$sink30 = 7;
     label = 243;
     continue L46;
    }
    break;
   }
   case 39: {
    label = 0;
    $$sink13 = (((($0)) + 10528|0) + ($$191116)|0);
    HEAP8[$$sink13>>0] = $$sink12;
    $$161432 = $$151431;$$161623 = $$151622;$$201117 = $$191116;$$201527 = $$191526;$$21 = $$20;$$211012 = $$201011;$$211224 = $$201223;$$211330 = $$201329;
    label = 41;
    break;
   }
   case 43: {
    label = 0;
    $$0960 = -1;$$891505 = $$171433;$$931084 = $$221013;$$931700 = $$171624;$$951192 = $$211118;$$951298 = $$221225;$$981605 = $$211528;$$99 = $$22;$$991408 = $$221331;$$sink30 = 39;
    label = 243;
    continue L46;
    break;
   }
   case 47: {
    label = 0;
    $150 = $6 & 2;
    $151 = ($150|0)==(0);
    if ($151) {
     $$01410$shrunk = 0;$$211437 = $$201436;$$211628 = $$201627;$$251122 = $$241121;$$251532 = $$241531;$$26 = $$25;$$261017 = $$251016;$$261229 = $$251228;$$261335 = $$251334;
     label = 50;
    } else {
     $$0960 = 1;$$891505 = $$201436;$$931084 = $$251016;$$931700 = $$201627;$$951192 = $$241121;$$951298 = $$251228;$$981605 = $$241531;$$99 = $$25;$$991408 = $$251334;$$sink30 = 51;
     label = 243;
     continue L46;
    }
    break;
   }
   case 49: {
    label = 0;
    $153 = ((($$sink1716)) + 1|0);
    $154 = HEAP8[$$sink1716>>0]|0;
    $$01410$shrunk = $154;$$211437 = $$211437$ph;$$211628 = $$211628$ph;$$251122 = $$251122$ph;$$251532 = $153;$$26 = $$26$ph;$$261017 = $$261017$ph;$$261229 = $$261229$ph;$$261335 = $$261335$ph;
    label = 50;
    break;
   }
   case 52: {
    label = 0;
    $162 = ($$231630>>>0)<($12>>>0);
    if (!($162)) {
     $$0960 = 2;$$891505 = $$231439;$$931084 = $$271018;$$931700 = $$231630;$$951192 = $$271124;$$951298 = $$281231;$$981605 = $$271534;$$99 = $$28;$$991408 = $$281337;$$sink30 = 52;
     label = 243;
     continue L46;
    }
    $163 = $$271018&255;
    $164 = ((($$231630)) + 1|0);
    HEAP8[$$231630>>0] = $163;
    $165 = (($$271124) + -1)|0;
    $$181434 = $$231439;$$181625 = $164;$$221119 = $165;$$221529 = $$271534;$$23 = $$28;$$231014 = $$271018;$$231226 = $$281231;$$231332 = $$281337;
    label = 44;
    break;
   }
   case 55: {
    label = 0;
    $167 = ($$251632>>>0)<($12>>>0);
    if ($167) {
     $$261442 = $$251441;$$261633 = $$251632;$$301021 = $$291020;$$301127 = $$291126;$$301537 = $$291536;$$31 = $$30;$$311234 = $$301233;$$311340 = $$301339;
     label = 56;
     continue L46;
    } else {
     $$0960 = 2;$$891505 = $$251441;$$931084 = $$291020;$$931700 = $$251632;$$951192 = $$291126;$$951298 = $$301233;$$981605 = $$291536;$$99 = $$30;$$991408 = $$301339;$$sink30 = 9;
     label = 243;
     continue L46;
    }
    break;
   }
   case 56: {
    label = 0;
    $168 = ($$301537>>>0)<($10>>>0);
    if ($168) {
     $171 = $12;
     $172 = $$261633;
     $173 = (($171) - ($172))|0;
     $174 = $10;
     $175 = $$301537;
     $176 = (($174) - ($175))|0;
     $177 = ($173>>>0)<($176>>>0);
     $$sink17 = $177 ? $12 : $10;
     $$sink16 = $177 ? $$261633 : $$301537;
     $178 = $$sink17;
     $179 = $$sink16;
     $180 = (($178) - ($179))|0;
     $181 = ($180>>>0)<($$301127>>>0);
     $$$301127 = $181 ? $180 : $$301127;
     _memcpy(($$261633|0),($$301537|0),($$$301127|0))|0;
     $182 = (($$301537) + ($$$301127)|0);
     $183 = (($$261633) + ($$$301127)|0);
     $184 = (($$301127) - ($$$301127))|0;
     $$241440 = $$261442;$$241631 = $183;$$281019 = $$301021;$$281125 = $184;$$281535 = $182;$$29 = $$31;$$291232 = $$311234;$$291338 = $$311340;
     label = 54;
     break;
    } else {
     $169 = $6 & 2;
     $170 = ($169|0)==(0);
     if ($170) {
      $$271443 = $$261442;$$271634 = $$261633;$$311022 = $$301021;$$311128 = $$301127;$$311538 = $$301537;$$32 = $$31;$$321235 = $$311234;$$321341 = $$311340;
      label = 58;
      continue L46;
     } else {
      $$0960 = 1;$$891505 = $$261442;$$931084 = $$301021;$$931700 = $$261633;$$951192 = $$301127;$$951298 = $$311234;$$981605 = $$301537;$$99 = $$31;$$991408 = $$311340;$$sink30 = 38;
      label = 243;
      continue L46;
     }
    }
    break;
   }
   case 58: {
    label = 0;
    $$0960 = -1;$$891505 = $$271443;$$931084 = $$311022;$$931700 = $$271634;$$951192 = $$311128;$$951298 = $$321235;$$981605 = $$311538;$$99 = $$32;$$991408 = $$321341;$$sink30 = 40;
    label = 243;
    continue L46;
    break;
   }
   case 60: {
    label = 0;
    $$0960 = -1;$$891505 = $$281444;$$931084 = $$321023;$$931700 = $$281635;$$951192 = $$321129;$$951298 = $$331236;$$981605 = $$321539;$$99 = $$33;$$991408 = $$331342;$$sink30 = 10;
    label = 243;
    continue L46;
    break;
   }
   case 64: {
    label = 0;
    $191 = $6 & 2;
    $192 = ($191|0)==(0);
    if ($192) {
     $$01300$shrunk = 0;$$321448 = $$311447;$$321639 = $$311638;$$361027 = $$351026;$$361133 = $$351132;$$361543 = $$351542;$$37 = $$36;$$371240 = $$361239;$$371346 = $$361345;
     label = 67;
    } else {
     $$0960 = 1;$$891505 = $$311447;$$931084 = $$351026;$$931700 = $$311638;$$951192 = $$351132;$$951298 = $$361239;$$981605 = $$351542;$$99 = $$36;$$991408 = $$361345;$$sink30 = 11;
     label = 243;
     continue L46;
    }
    break;
   }
   case 66: {
    label = 0;
    $194 = ((($$sink1719)) + 1|0);
    $195 = HEAP8[$$sink1719>>0]|0;
    $$01300$shrunk = $195;$$321448 = $$321448$ph;$$321639 = $$321639$ph;$$361027 = $$361027$ph;$$361133 = $$361133$ph;$$361543 = $194;$$37 = $$37$ph;$$371240 = $$371240$ph;$$371346 = $$371346$ph;
    label = 67;
    break;
   }
   case 73: {
    label = 0;
    $222 = $6 & 2;
    $223 = ($222|0)==(0);
    if ($223) {
     $$01202$shrunk = 0;$$371453 = $$361452;$$371644 = $$361643;$$411032 = $$401031;$$411138 = $$401137;$$411548 = $$401547;$$42 = $$41;$$421245 = $$411244;$$421351 = $$411350;
     label = 76;
    } else {
     $$0960 = 1;$$891505 = $$361452;$$931084 = $$401031;$$931700 = $$361643;$$951192 = $$401137;$$951298 = $$411244;$$981605 = $$401547;$$99 = $$41;$$991408 = $$411350;$$sink30 = 14;
     label = 243;
     continue L46;
    }
    break;
   }
   case 75: {
    label = 0;
    $225 = ((($$sink1722)) + 1|0);
    $226 = HEAP8[$$sink1722>>0]|0;
    $$01202$shrunk = $226;$$371453 = $$371453$ph;$$371644 = $$371644$ph;$$411032 = $$411032$ph;$$411138 = $$411138$ph;$$411548 = $225;$$42 = $$42$ph;$$421245 = $$421245$ph;$$421351 = $$421351$ph;
    label = 76;
    break;
   }
   case 86: {
    label = 0;
    $$0960 = -1;$$891505 = $$401456;$$931084 = $$441035;$$931700 = $$401647;$$951192 = $$441141;$$951298 = $$451248;$$981605 = $$441551;$$99 = $$45;$$991408 = $$451354;$$sink30 = 35;
    label = 243;
    continue L46;
    break;
   }
   case 114: {
    label = 0;
    $450 = $6 & 2;
    $451 = ($450|0)==(0);
    if ($451) {
     $$0980$shrunk = 0;$$441460 = $$431459;$$441651 = $$431650;$$481039 = $$471038;$$481145 = $$471144;$$481555 = $$471554;$$49 = $$48;$$491252 = $$481251;$$491358 = $$481357;
     label = 117;
    } else {
     $$0960 = 1;$$891505 = $$431459;$$931084 = $$471038;$$931700 = $$431650;$$951192 = $$471144;$$951298 = $$481251;$$981605 = $$471554;$$99 = $$48;$$991408 = $$481357;$$sink30 = 16;
     label = 243;
     continue L46;
    }
    break;
   }
   case 116: {
    label = 0;
    $453 = ((($$sink1729)) + 1|0);
    $454 = HEAP8[$$sink1729>>0]|0;
    $$0980$shrunk = $454;$$441460 = $$441460$ph;$$441651 = $$441651$ph;$$481039 = $$481039$ph;$$481145 = $$481145$ph;$$481555 = $453;$$49 = $$49$ph;$$491252 = $$491252$ph;$$491358 = $$491358$ph;
    label = 117;
    break;
   }
   case 125: {
    label = 0;
    $$0960 = -1;$$891505 = $$461462;$$931084 = $$491040;$$931700 = $$461653;$$951192 = $$501147;$$951298 = $$511254;$$981605 = $$501557;$$99 = $$51;$$991408 = $$511360;$$sink30 = 17;
    label = 243;
    continue L46;
    break;
   }
   case 128: {
    label = 0;
    $501 = $6 & 2;
    $502 = ($501|0)==(0);
    if ($502) {
     $$0979$shrunk = 0;$$491465 = $$481464;$$491656 = $$481655;$$521043 = $$511042;$$531150 = $$521149;$$531560 = $$521559;$$54 = $$53;$$541257 = $$531256;$$541363 = $$531362;
     label = 131;
    } else {
     $$0960 = 1;$$891505 = $$481464;$$931084 = $$511042;$$931700 = $$481655;$$951192 = $$521149;$$951298 = $$531256;$$981605 = $$521559;$$99 = $$53;$$991408 = $$531362;$$sink30 = 18;
     label = 243;
     continue L46;
    }
    break;
   }
   case 130: {
    label = 0;
    $504 = ((($$sink1732)) + 1|0);
    $505 = HEAP8[$$sink1732>>0]|0;
    $$0979$shrunk = $505;$$491465 = $$491465$ph;$$491656 = $$491656$ph;$$521043 = $$521043$ph;$$531150 = $$531150$ph;$$531560 = $504;$$54 = $$54$ph;$$541257 = $$541257$ph;$$541363 = $$541363$ph;
    label = 131;
    break;
   }
   case 136: {
    label = 0;
    $$0960 = -1;$$891505 = $$511467;$$931084 = $$541045;$$931700 = $$511658;$$951192 = $$551152;$$951298 = $$561259;$$981605 = $$551562;$$99 = $$56;$$991408 = $$561365;$$sink30 = 21;
    label = 243;
    continue L46;
    break;
   }
   case 151: {
    label = 0;
    $570 = $6 & 2;
    $571 = ($570|0)==(0);
    if ($571) {
     $$0971$shrunk = 0;$$571473 = $$561472;$$571664 = $$561663;$$601051 = $$591050;$$611158 = $$601157;$$611568 = $$601567;$$62 = $$61;$$621265 = $$611264;$$621371 = $$611370;
     label = 154;
    } else {
     $$0960 = 1;$$891505 = $$561472;$$931084 = $$591050;$$931700 = $$561663;$$951192 = $$601157;$$951298 = $$611264;$$981605 = $$601567;$$99 = $$61;$$991408 = $$611370;$$sink30 = 23;
     label = 243;
     continue L46;
    }
    break;
   }
   case 153: {
    label = 0;
    $573 = ((($$sink1736)) + 1|0);
    $574 = HEAP8[$$sink1736>>0]|0;
    $$0971$shrunk = $574;$$571473 = $$571473$ph;$$571664 = $$571664$ph;$$601051 = $$601051$ph;$$611158 = $$611158$ph;$$611568 = $573;$$62 = $$62$ph;$$621265 = $$621265$ph;$$621371 = $$621371$ph;
    label = 154;
    break;
   }
   case 160: {
    label = 0;
    $610 = ($$591666>>>0)<($12>>>0);
    if (!($610)) {
     $$0960 = 2;$$891505 = $$591475;$$931084 = $$621053;$$931700 = $$591666;$$951192 = $$621159;$$951298 = $$641267;$$981605 = $$631570;$$99 = $$64;$$991408 = $$641373;$$sink30 = 24;
     label = 243;
     continue L46;
    }
    $611 = $$621159&255;
    $612 = ((($$591666)) + 1|0);
    HEAP8[$$591666>>0] = $611;
    $$541470$ph = $$591475;$$541661$ph = $612;$$571048$ph = $$621053;$$581155$ph = $$621159;$$581565$ph = $$631570;$$59$ph = $$64;$$591262$ph = $$641267;$$591368$ph = $$641373;
    label = 140;
    break;
   }
   case 180: {
    label = 0;
    $694 = $6 & 2;
    $695 = ($694|0)==(0);
    if ($695) {
     $$0959$shrunk = 0;$$631479 = $$621478;$$641671 = $$631670;$$661057 = $$651056;$$671164 = $$661163;$$681271 = $$671270;$$701577 = $$691576;$$71 = $$70;$$711380 = $$701379;
     label = 183;
    } else {
     $$0960 = 1;$$891505 = $$621478;$$931084 = $$651056;$$931700 = $$631670;$$951192 = $$661163;$$951298 = $$671270;$$981605 = $$691576;$$99 = $$70;$$991408 = $$701379;$$sink30 = 25;
     label = 243;
     continue L46;
    }
    break;
   }
   case 182: {
    label = 0;
    $697 = ((($$sink1739)) + 1|0);
    $698 = HEAP8[$$sink1739>>0]|0;
    $$0959$shrunk = $698;$$631479 = $$631479$ph;$$641671 = $$641671$ph;$$661057 = $$661057$ph;$$671164 = $$671164$ph;$$681271 = $$681271$ph;$$701577 = $697;$$71 = $$71$ph;$$711380 = $$711380$ph;
    label = 183;
    break;
   }
   case 193: {
    label = 0;
    $735 = $6 & 2;
    $736 = ($735|0)==(0);
    if ($736) {
     $$0952$shrunk = 0;$$681484 = $$671483;$$691676 = $$681675;$$711062 = $$701061;$$721169 = $$711168;$$731276 = $$721275;$$751582 = $$741581;$$76 = $$75;$$761385 = $$751384;
     label = 196;
    } else {
     $$0960 = 1;$$891505 = $$671483;$$931084 = $$701061;$$931700 = $$681675;$$951192 = $$711168;$$951298 = $$721275;$$981605 = $$741581;$$99 = $$75;$$991408 = $$751384;$$sink30 = 26;
     label = 243;
     continue L46;
    }
    break;
   }
   case 195: {
    label = 0;
    $738 = ((($$sink1743)) + 1|0);
    $739 = HEAP8[$$sink1743>>0]|0;
    $$0952$shrunk = $739;$$681484 = $$681484$ph;$$691676 = $$691676$ph;$$711062 = $$711062$ph;$$721169 = $$721169$ph;$$731276 = $$731276$ph;$$751582 = $738;$$76 = $$76$ph;$$761385 = $$761385$ph;
    label = 196;
    break;
   }
   case 204: {
    label = 0;
    $782 = $6 & 2;
    $783 = ($782|0)==(0);
    if ($783) {
     $$0950$shrunk = 0;$$721488 = $$711487;$$731680 = $$721679;$$741065 = $$731064;$$761173 = $$751172;$$761279 = $$751278;$$791586 = $$781585;$$80 = $$79;$$801389 = $$791388;
     label = 207;
    } else {
     $$0960 = 1;$$891505 = $$711487;$$931084 = $$731064;$$931700 = $$721679;$$951192 = $$751172;$$951298 = $$751278;$$981605 = $$781585;$$99 = $$79;$$991408 = $$791388;$$sink30 = 27;
     label = 243;
     continue L46;
    }
    break;
   }
   case 206: {
    label = 0;
    $785 = ((($$sink1746)) + 1|0);
    $786 = HEAP8[$$sink1746>>0]|0;
    $$0950$shrunk = $786;$$721488 = $$721488$ph;$$731680 = $$731680$ph;$$741065 = $$741065$ph;$$761173 = $$761173$ph;$$761279 = $$761279$ph;$$791586 = $785;$$80 = $$80$ph;$$801389 = $$801389$ph;
    label = 207;
    break;
   }
   case 210: {
    label = 0;
    $$0960 = -1;$$891505 = $$731489;$$931084 = $$771068;$$931700 = $$761683;$$951192 = $$791176;$$951298 = $$791282;$$981605 = $$821589;$$99 = $$83;$$991408 = $$831392;$$sink30 = 37;
    label = 243;
    continue L46;
    break;
   }
   case 213: {
    label = 0;
    $809 = ($$781685>>>0)<($12>>>0);
    if (!($809)) {
     $$0960 = 2;$$891505 = $$751491;$$931084 = $$791070;$$931700 = $$781685;$$951192 = $$811178;$$951298 = $$811284;$$981605 = $$841591;$$99 = $$85;$$991408 = $$851394;$$sink30 = 53;
     label = 243;
     continue L46;
    }
    $810 = (($$751491) + 1)|0;
    $811 = (($$751491) - ($$791070))|0;
    $812 = $811 & $$1753;
    $813 = (($3) + ($812)|0);
    $814 = HEAP8[$813>>0]|0;
    $815 = ((($$781685)) + 1|0);
    HEAP8[$$781685>>0] = $814;
    $$741490 = $810;$$771684 = $815;$$781069 = $$791070;$$801177 = $$811178;$$801283 = $$811284;$$831590 = $$841591;$$84 = $$85;$$841393 = $$851394;
    label = 212;
    break;
   }
   case 226: {
    label = 0;
    $849 = $$90 & 7;
    $850 = $$901399 >>> $849;
    $851 = (($$90) - ($849))|0;
    $$811497 = $$801496;$$851076 = $$841075;$$851692 = $$841691;$$871184 = 0;$$871290 = $$861289;$$901597 = $$891596;$$91 = $851;$$911400 = $850;
    label = 227;
    break;
   }
   case 231: {
    label = 0;
    $856 = $6 & 2;
    $857 = ($856|0)==(0);
    if ($857) {
     $$0947$shrunk = 0;$$841500 = $$831499;$$881079 = $$871078;$$881695 = $$871694;$$901187 = $$891186;$$901293 = $$891292;$$931600 = $$921599;$$94 = $$93;$$941403 = $$931402;
     label = 234;
    } else {
     $$0960 = 1;$$891505 = $$831499;$$931084 = $$871078;$$931700 = $$871694;$$951192 = $$891186;$$951298 = $$891292;$$981605 = $$921599;$$99 = $$93;$$991408 = $$931402;$$sink30 = 41;
     label = 243;
     continue L46;
    }
    break;
   }
   case 233: {
    label = 0;
    $859 = ((($$sink1750)) + 1|0);
    $860 = HEAP8[$$sink1750>>0]|0;
    $$0947$shrunk = $860;$$841500 = $$841500$ph;$$881079 = $$881079$ph;$$881695 = $$881695$ph;$$901187 = $$901187$ph;$$901293 = $$901293$ph;$$931600 = $859;$$94 = $$94$ph;$$941403 = $$941403$ph;
    label = 234;
    break;
   }
   case 237: {
    label = 0;
    $869 = $6 & 2;
    $870 = ($869|0)==(0);
    if ($870) {
     $$0948 = 0;$$871503 = $$861502;$$911082 = $$901081;$$911698 = $$901697;$$931190 = $$921189;$$931296 = $$921295;$$961603 = $$951602;$$97 = $$96;$$971406 = $$961405;
     label = 241;
     continue L46;
    } else {
     $$0960 = 1;$$891505 = $$861502;$$931084 = $$901081;$$931700 = $$901697;$$951192 = $$921189;$$951298 = $$921295;$$981605 = $$951602;$$99 = $$96;$$991408 = $$961405;$$sink30 = 42;
     label = 243;
     continue L46;
    }
    break;
   }
   case 241: {
    label = 0;
    $878 = ((($0)) + 16|0);
    $879 = HEAP32[$878>>2]|0;
    $880 = $879 << 8;
    $881 = $880 | $$0948;
    HEAP32[$878>>2] = $881;
    $882 = (($$931190) + 1)|0;
    $$811497 = $$871503;$$851076 = $$911082;$$851692 = $$911698;$$871184 = $882;$$871290 = $$931296;$$901597 = $$961603;$$91 = $$97;$$911400 = $$971406;
    label = 227;
    break;
   }
   case 242: {
    label = 0;
    $$0960 = 0;$$891505 = $$881504;$$931084 = $$921083;$$931700 = $$921699;$$951192 = $$941191;$$951298 = $$941297;$$981605 = $$971604;$$99 = $$98;$$991408 = $$981407;$$sink30 = 34;
    label = 243;
    continue L46;
    break;
   }
   case 243: {
    label = 0;
    HEAP32[$0>>2] = $$sink30;
    $$100 = $$99;$$1001409 = $$991408;$$1961 = $$0960;$$901506 = $$891505;$$941085 = $$931084;$$941701 = $$931700;$$961193 = $$951192;$$961299 = $$951298;$$991606 = $$981605;
    label = 244;
    continue L46;
    break;
   }
   case 244: {
    label = 0;
    HEAP32[$24>>2] = $$100;
    HEAP32[$26>>2] = $$1001409;
    HEAP32[$28>>2] = $$941085;
    HEAP32[$30>>2] = $$961193;
    HEAP32[$32>>2] = $$961299;
    HEAP32[$34>>2] = $$901506;
    $883 = $$991606;
    $884 = $1;
    $885 = (($883) - ($884))|0;
    HEAP32[$2>>2] = $885;
    $886 = $$941701;
    $887 = $4;
    $888 = (($886) - ($887))|0;
    HEAP32[$5>>2] = $888;
    $889 = $6 & 9;
    $890 = ($889|0)!=(0);
    $891 = ($$1961|0)>(-1);
    $or$cond29 = $890 & $891;
    if ($or$cond29) {
     break L46;
    } else {
     $$0951 = $$1961;
     label = 258;
     break L46;
    }
    break;
   }
  }
  switch (label|0) {
   case 19: {
    label = 0;
    $$01413 = $$01413$shrunk&255;
    $78 = $$01413 << $$8;
    $79 = $78 | $$81317;
    $80 = (($$8) + 8)|0;
    $81 = ($80>>>0)<(3);
    if ($81) {
     $$11417 = $$31419;$$11608 = $$31610;$$51512 = $$71514;$$6 = $80;$$61103 = $$81105;$$61209 = $$81211;$$61315 = $79;$$6997 = $$8999;
     label = 15;
    } else {
     $$41420 = $$31419;$$41611 = $$31610;$$81515 = $$71514;$$9 = $80;$$91000 = $$8999;$$91106 = $$81105;$$91212 = $$81211;$$91318 = $79;
     label = 20;
    }
    break;
   }
   case 33: {
    label = 0;
    $$01411 = $$01411$shrunk&255;
    $109 = $$01411 << $$17;
    $110 = $109 | $$171326;
    $111 = (($$17) + 8)|0;
    $112 = ($$17>>>0)>(4294967287);
    if ($112) {
     $$101426 = $$121428;$$101617 = $$121619;$$141111 = $$161113;$$141521 = $$161523;$$15 = $111;$$151006 = $$171008;$$151218 = $$171220;$$151324 = $110;
     label = 29;
    } else {
     $$131429 = $$121428;$$131620 = $$121619;$$171114 = $$161113;$$171524 = $$161523;$$18 = $111;$$181009 = $$171008;$$181221 = $$171220;$$181327 = $110;
     label = 34;
    }
    break;
   }
   case 50: {
    label = 0;
    $$01410 = $$01410$shrunk&255;
    $155 = $$01410 << $$26;
    $156 = $155 | $$261335;
    $157 = (($$26) + 8)|0;
    $158 = ($$26>>>0)>(4294967287);
    if ($158) {
     $$191435 = $$211437;$$191626 = $$211628;$$231120 = $$251122;$$231530 = $$251532;$$24 = $157;$$241015 = $$261017;$$241227 = $$261229;$$241333 = $156;
     label = 46;
    } else {
     $$221438 = $$211437;$$221629 = $$211628;$$261123 = $$251122;$$261533 = $$251532;$$27 = $157;$$271230 = $$261229;$$271336 = $156;
     label = 51;
    }
    break;
   }
   case 67: {
    label = 0;
    $$01300 = $$01300$shrunk&255;
    $196 = $$01300 << $$37;
    $197 = $196 | $$371346;
    $198 = (($$37) + 8)|0;
    $199 = (12171 + ($$361133)|0);
    $200 = HEAP8[$199>>0]|0;
    $201 = $200 << 24 >> 24;
    $202 = ($198>>>0)<($201>>>0);
    if ($202) {
     $$301446 = $$321448;$$301637 = $$321639;$$341025 = $$361027;$$341131 = $$361133;$$341541 = $$361543;$$35 = $198;$$351238 = $$371240;$$351344 = $197;
     label = 63;
    } else {
     $$331449 = $$321448;$$331640 = $$321639;$$371028 = $$361027;$$371134 = $$361133;$$371544 = $$361543;$$38 = $198;$$381241 = $$371240;$$381347 = $197;
     label = 68;
    }
    break;
   }
   case 76: {
    label = 0;
    $$01202 = $$01202$shrunk&255;
    $227 = $$01202 << $$42;
    $228 = $227 | $$421351;
    $229 = (($$42) + 8)|0;
    $230 = ($229>>>0)<(3);
    if ($230) {
     $$351451 = $$371453;$$351642 = $$371644;$$391030 = $$411032;$$391136 = $$411138;$$391546 = $$411548;$$40 = $229;$$401243 = $$421245;$$401349 = $228;
     label = 72;
    } else {
     $$381454 = $$371453;$$381645 = $$371644;$$421033 = $$411032;$$421139 = $$411138;$$421549 = $$411548;$$43 = $229;$$431246 = $$421245;$$431352 = $228;
     label = 77;
    }
    break;
   }
   case 117: {
    label = 0;
    $$0980 = $$0980$shrunk&255;
    $455 = $$0980 << $$49;
    $456 = $455 | $$491358;
    $457 = (($$49) + 8)|0;
    $458 = ($457>>>0)<(15);
    if ($458) {
     $$421458 = $$441460;$$421649 = $$441651;$$461037 = $$481039;$$461143 = $$481145;$$461553 = $$481555;$$47 = $457;$$471250 = $$491252;$$471356 = $456;
     label = 108;
    } else {
     $$451461 = $$441460;$$451652 = $$441651;$$491146 = $$481145;$$491556 = $$481555;$$50 = $457;$$501253 = $$491252;$$501359 = $456;
     label = 119;
    }
    break;
   }
   case 131: {
    label = 0;
    $$0979 = $$0979$shrunk&255;
    $506 = $$0979 << $$54;
    $507 = $506 | $$541363;
    $508 = (($$54) + 8)|0;
    $509 = ($508>>>0)<($$541257>>>0);
    if ($509) {
     $$471463 = $$491465;$$471654 = $$491656;$$501041 = $$521043;$$511148 = $$531150;$$511558 = $$531560;$$52 = $508;$$521255 = $$541257;$$521361 = $507;
     label = 127;
    } else {
     $$501466 = $$491465;$$501657 = $$491656;$$531044 = $$521043;$$541151 = $$531150;$$541561 = $$531560;$$55 = $508;$$551258 = $$541257;$$551364 = $507;
     label = 132;
    }
    break;
   }
   case 154: {
    label = 0;
    $$0971 = $$0971$shrunk&255;
    $575 = $$0971 << $$62;
    $576 = $575 | $$621371;
    $577 = (($$62) + 8)|0;
    $578 = ($577>>>0)<(15);
    if ($578) {
     $$551471 = $$571473;$$551662 = $$571664;$$581049 = $$601051;$$591156 = $$611158;$$591566 = $$611568;$$60 = $577;$$601263 = $$621265;$$601369 = $576;
     label = 145;
    } else {
     $$581474 = $$571473;$$581665 = $$571664;$$611052 = $$601051;$$621569 = $$611568;$$63 = $577;$$631266 = $$621265;$$631372 = $576;
     label = 156;
    }
    break;
   }
   case 183: {
    label = 0;
    $$0959 = $$0959$shrunk&255;
    $699 = $$0959 << $$71;
    $700 = $699 | $$711380;
    $701 = (($$71) + 8)|0;
    $702 = ($701>>>0)<($$681271>>>0);
    if ($702) {
     $$611477 = $$631479;$$621669 = $$641671;$$641055 = $$661057;$$651162 = $$671164;$$661269 = $$681271;$$681575 = $$701577;$$69 = $701;$$691378 = $700;
     label = 179;
    } else {
     $$641480 = $$631479;$$651672 = $$641671;$$671058 = $$661057;$$681165 = $$671164;$$691272 = $$681271;$$711578 = $$701577;$$72 = $701;$$721381 = $700;
     label = 184;
    }
    break;
   }
   case 196: {
    label = 0;
    $$0952 = $$0952$shrunk&255;
    $740 = $$0952 << $$76;
    $741 = $740 | $$761385;
    $742 = (($$76) + 8)|0;
    $743 = ($742>>>0)<(15);
    if ($743) {
     $$661482 = $$681484;$$671674 = $$691676;$$691060 = $$711062;$$701167 = $$721169;$$711274 = $$731276;$$731580 = $$751582;$$74 = $742;$$741383 = $741;
     label = 187;
    } else {
     $$691485 = $$681484;$$701677 = $$691676;$$731170 = $$721169;$$761583 = $$751582;$$77 = $742;$$771386 = $741;
     label = 198;
    }
    break;
   }
   case 207: {
    label = 0;
    $$0950 = $$0950$shrunk&255;
    $787 = $$0950 << $$80;
    $788 = $787 | $$801389;
    $789 = (($$80) + 8)|0;
    $790 = ($789>>>0)<($$761279>>>0);
    if ($790) {
     $$701486 = $$721488;$$711678 = $$731680;$$721063 = $$741065;$$741171 = $$761173;$$741277 = $$761279;$$771584 = $$791586;$$78 = $789;$$781387 = $788;
     label = 203;
    } else {
     $$741681 = $$731680;$$751066 = $$741065;$$771174 = $$761173;$$771280 = $$761279;$$801587 = $$791586;$$81 = $789;$$811390 = $788;
     label = 208;
    }
    break;
   }
   case 227: {
    label = 0;
    $852 = ($$871184>>>0)<(4);
    if (!($852)) {
     $$881504 = $$811497;$$921083 = $$851076;$$921699 = $$851692;$$941191 = $$871184;$$941297 = $$871290;$$971604 = $$901597;$$98 = $$91;$$981407 = $$911400;
     label = 242;
     continue L46;
    }
    $853 = ($$91|0)==(0);
    if (!($853)) {
     $854 = ($$91>>>0)<(8);
     if ($854) {
      $$821498 = $$811497;$$861077 = $$851076;$$861693 = $$851692;$$881185 = $$871184;$$881291 = $$871290;$$911598 = $$901597;$$92 = $$91;$$921401 = $$911400;
      label = 230;
      break;
     } else {
      $$851501 = $$811497;$$891080 = $$851076;$$891696 = $$851692;$$911188 = $$871184;$$911294 = $$871290;$$941601 = $$901597;$$95 = $$91;$$951404 = $$911400;
      label = 235;
      break;
     }
    }
    $868 = ($$901597>>>0)<($10>>>0);
    if (!($868)) {
     $$861502 = $$811497;$$901081 = $$851076;$$901697 = $$851692;$$921189 = $$871184;$$921295 = $$871290;$$951602 = $$901597;$$96 = 0;$$961405 = $$911400;
     label = 237;
     continue L46;
    }
    $875 = ((($$901597)) + 1|0);
    $876 = HEAP8[$$901597>>0]|0;
    $877 = $876&255;
    $$0948 = $877;$$871503 = $$811497;$$911082 = $$851076;$$911698 = $$851692;$$931190 = $$871184;$$931296 = $$871290;$$961603 = $875;$$97 = 0;$$971406 = $$911400;
    label = 241;
    continue L46;
    break;
   }
   case 234: {
    label = 0;
    $$0947 = $$0947$shrunk&255;
    $861 = $$0947 << $$94;
    $862 = $861 | $$941403;
    $863 = (($$94) + 8)|0;
    $864 = ($$94>>>0)>(4294967287);
    if ($864) {
     $$821498 = $$841500;$$861077 = $$881079;$$861693 = $$881695;$$881185 = $$901187;$$881291 = $$901293;$$911598 = $$931600;$$92 = $863;$$921401 = $862;
     label = 230;
    } else {
     $$851501 = $$841500;$$891080 = $$881079;$$891696 = $$881695;$$911188 = $$901187;$$911294 = $$901293;$$941601 = $$931600;$$95 = $863;$$951404 = $862;
     label = 235;
    }
    break;
   }
  }
  L119: do {
   if ((label|0) == 15) {
    label = 0;
    $72 = ($$51512>>>0)<($10>>>0);
    if ($72) {
     $$31419$ph = $$11417;$$31610$ph = $$11608;$$8$ph = $$6;$$81105$ph = $$61103;$$81211$ph = $$61209;$$81317$ph = $$61315;$$8999$ph = $$6997;$$sink1710 = $$51512;
     label = 18;
     continue L46;
    } else {
     $$21418 = $$11417;$$21609 = $$11608;$$61513 = $$51512;$$7 = $$6;$$71104 = $$61103;$$71210 = $$61209;$$71316 = $$61315;$$7998 = $$6997;
     label = 16;
     continue L46;
    }
   }
   else if ((label|0) == 20) {
    label = 0;
    $82 = $$91318 & 7;
    $83 = ((($0)) + 20|0);
    HEAP32[$83>>2] = $82;
    $84 = $$91318 >>> 3;
    $85 = (($$9) + -3)|0;
    $86 = $82 >>> 1;
    $87 = ((($0)) + 24|0);
    HEAP32[$87>>2] = $86;
    $trunc = $86&255;
    $trunc$clear = $trunc & 3;
    switch ($trunc$clear<<24>>24) {
    case 0:  {
     $$121519 = $$81515;$$13 = $85;$$131004 = $$91000;$$131216 = $$91212;$$131322 = $84;$$81424 = $$41420;$$81615 = $$41611;
     label = 25;
     continue L46;
     break;
    }
    case 3:  {
     $$281444 = $$41420;$$281635 = $$41611;$$321023 = $$91000;$$321129 = $$91106;$$321539 = $$81515;$$33 = $85;$$331236 = $$91212;$$331342 = $84;
     label = 60;
     continue L46;
     break;
    }
    case 1:  {
     break;
    }
    default: {
     $$291445 = $$41420;$$291636 = $$41611;$$331024 = $$91000;$$331130 = 0;$$331540 = $$81515;$$34 = $85;$$341237 = $$91212;$$341343 = $84;
     label = 61;
     break L119;
    }
    }
    $240 = ((($0)) + 44|0);
    HEAP32[$240>>2] = 288;
    $241 = ((($0)) + 48|0);
    HEAP32[$241>>2] = 32;
    $242 = ((($0)) + 3552|0);
    ;HEAP32[$242>>2]=84215045|0;HEAP32[$242+4>>2]=84215045|0;HEAP32[$242+8>>2]=84215045|0;HEAP32[$242+12>>2]=84215045|0;HEAP32[$242+16>>2]=84215045|0;HEAP32[$242+20>>2]=84215045|0;HEAP32[$242+24>>2]=84215045|0;HEAP32[$242+28>>2]=84215045|0;
    $scevgep19611962 = ((($0)) + 64|0);
    _memset(($scevgep19611962|0),8,144)|0;
    $scevgep1959 = ((($0)) + 208|0);
    dest=$scevgep1959; stop=dest+112|0; do { HEAP8[dest>>0]=9|0; dest=dest+1|0; } while ((dest|0) < (stop|0));
    $scevgep1957 = ((($0)) + 320|0);
    dest=$scevgep1957; stop=dest+24|0; do { HEAP8[dest>>0]=7|0; dest=dest+1|0; } while ((dest|0) < (stop|0));
    $scevgep1955 = ((($0)) + 344|0);
    $243 = $scevgep1955;
    $244 = $243;
    HEAP8[$244>>0]=134744072&255;HEAP8[$244+1>>0]=(134744072>>8)&255;HEAP8[$244+2>>0]=(134744072>>16)&255;HEAP8[$244+3>>0]=134744072>>24;
    $245 = (($243) + 4)|0;
    $246 = $245;
    HEAP8[$246>>0]=134744072&255;HEAP8[$246+1>>0]=(134744072>>8)&255;HEAP8[$246+2>>0]=(134744072>>16)&255;HEAP8[$246+3>>0]=134744072>>24;
    $$391455 = $$41420;$$391646 = $$41611;$$431034 = $$91000;$$431140 = $$91106;$$431550 = $$81515;$$44 = $85;$$441247 = $$91212;$$441353 = $84;
    label = 80;
   }
   else if ((label|0) == 230) {
    label = 0;
    $855 = ($$911598>>>0)<($10>>>0);
    if ($855) {
     $$841500$ph = $$821498;$$881079$ph = $$861077;$$881695$ph = $$861693;$$901187$ph = $$881185;$$901293$ph = $$881291;$$94$ph = $$92;$$941403$ph = $$921401;$$sink1750 = $$911598;
     label = 233;
     continue L46;
    } else {
     $$831499 = $$821498;$$871078 = $$861077;$$871694 = $$861693;$$891186 = $$881185;$$891292 = $$881291;$$921599 = $$911598;$$93 = $$92;$$931402 = $$921401;
     label = 231;
     continue L46;
    }
   }
   else if ((label|0) == 235) {
    label = 0;
    $865 = $$951404 & 255;
    $866 = $$951404 >>> 8;
    $867 = (($$95) + -8)|0;
    $$0948 = $865;$$871503 = $$851501;$$911082 = $$891080;$$911698 = $$891696;$$931190 = $$911188;$$931296 = $$911294;$$961603 = $$941601;$$97 = $867;$$971406 = $866;
    label = 241;
    continue L46;
   }
  } while(0);
  L125: while(1) {
   L126:    switch (label|0) {
    case 26: {
     label = 0;
     $100 = ($$131110>>>0)<(4);
     if (!($100)) {
      $127 = ((($0)) + 10528|0);
      $128 = HEAP8[$127>>0]|0;
      $129 = $128&255;
      $130 = ((($0)) + 10529|0);
      $131 = HEAP8[$130>>0]|0;
      $132 = $131&255;
      $133 = $132 << 8;
      $134 = $133 | $129;
      $135 = ((($0)) + 10530|0);
      $136 = HEAP8[$135>>0]|0;
      $137 = $136&255;
      $138 = ((($0)) + 10531|0);
      $139 = HEAP8[$138>>0]|0;
      $140 = $139&255;
      $141 = $140 << 8;
      $142 = $141 | $137;
      $143 = $142 ^ 65535;
      $144 = ($134|0)==($143|0);
      if ($144) {
       $$181434 = $$91425;$$181625 = $$91616;$$221119 = $134;$$221529 = $$131520;$$23 = $$14;$$231014 = $$141005;$$231226 = $$141217;$$231332 = $$141323;
       label = 44;
       continue L125;
      } else {
       $$171433 = $$91425;$$171624 = $$91616;$$211118 = $134;$$211528 = $$131520;$$22 = $$14;$$221013 = $$141005;$$221225 = $$141217;$$221331 = $$141323;
       label = 43;
       continue L46;
      }
     }
     $101 = ($$14|0)==(0);
     if (!($101)) {
      $102 = ($$14>>>0)<(8);
      if ($102) {
       $$101426 = $$91425;$$101617 = $$91616;$$141111 = $$131110;$$141521 = $$131520;$$15 = $$14;$$151006 = $$141005;$$151218 = $$141217;$$151324 = $$141323;
       label = 29;
       continue L125;
      } else {
       $$131429 = $$91425;$$131620 = $$91616;$$171114 = $$131110;$$171524 = $$131520;$$18 = $$14;$$181009 = $$141005;$$181221 = $$141217;$$181327 = $$141323;
       label = 34;
       continue L125;
      }
     }
     $117 = ($$131520>>>0)<($10>>>0);
     if (!($117)) {
      $$141430 = $$91425;$$141621 = $$91616;$$181115 = $$131110;$$181525 = $$131520;$$19 = 0;$$191010 = $$141005;$$191222 = $$141217;$$191328 = $$141323;
      label = 36;
      continue L46;
     }
     $123 = ((($$131520)) + 1|0);
     $124 = HEAP8[$$131520>>0]|0;
     $125 = (((($0)) + 10528|0) + ($$131110)|0);
     HEAP8[$125>>0] = $124;
     $$161432 = $$91425;$$161623 = $$91616;$$201117 = $$131110;$$201527 = $123;$$21 = 0;$$211012 = $$141005;$$211224 = $$141217;$$211330 = $$141323;
     label = 41;
     continue L125;
     break;
    }
    case 29: {
     label = 0;
     $103 = ($$141521>>>0)<($10>>>0);
     if ($103) {
      $$121428$ph = $$101426;$$121619$ph = $$101617;$$161113$ph = $$141111;$$17$ph = $$15;$$171008$ph = $$151006;$$171220$ph = $$151218;$$171326$ph = $$151324;$$sink1713 = $$141521;
      label = 32;
      continue L46;
     } else {
      $$111427 = $$101426;$$111618 = $$101617;$$151112 = $$141111;$$151522 = $$141521;$$16 = $$15;$$161007 = $$151006;$$161219 = $$151218;$$161325 = $$151324;
      label = 30;
      continue L46;
     }
     break;
    }
    case 34: {
     label = 0;
     $113 = $$181327&255;
     $114 = (((($0)) + 10528|0) + ($$171114)|0);
     HEAP8[$114>>0] = $113;
     $115 = $$181327 >>> 8;
     $116 = (($$18) + -8)|0;
     $$161432 = $$131429;$$161623 = $$131620;$$201117 = $$171114;$$201527 = $$171524;$$21 = $116;$$211012 = $$181009;$$211224 = $$181221;$$211330 = $115;
     label = 41;
     continue L125;
     break;
    }
    case 41: {
     label = 0;
     $126 = (($$201117) + 1)|0;
     $$131110 = $126;$$131520 = $$201527;$$14 = $$21;$$141005 = $$211012;$$141217 = $$211224;$$141323 = $$211330;$$91425 = $$161432;$$91616 = $$161623;
     label = 26;
     continue L125;
     break;
    }
    case 44: {
     label = 0;
     $145 = ($$221119|0)!=(0);
     $146 = ($$23|0)!=(0);
     $147 = $145 & $146;
     if (!($147)) {
      $$241440 = $$181434;$$241631 = $$181625;$$281019 = $$231014;$$281125 = $$221119;$$281535 = $$221529;$$29 = $$23;$$291232 = $$231226;$$291338 = $$231332;
      label = 54;
      continue L125;
     }
     $148 = ($$23>>>0)<(8);
     if ($148) {
      $$191435 = $$181434;$$191626 = $$181625;$$231120 = $$221119;$$231530 = $$221529;$$24 = $$23;$$241015 = $$231014;$$241227 = $$231226;$$241333 = $$231332;
      label = 46;
      continue L125;
     } else {
      $$221438 = $$181434;$$221629 = $$181625;$$261123 = $$221119;$$261533 = $$221529;$$27 = $$23;$$271230 = $$231226;$$271336 = $$231332;
      label = 51;
      continue L125;
     }
     break;
    }
    case 46: {
     label = 0;
     $149 = ($$231530>>>0)<($10>>>0);
     if ($149) {
      $$211437$ph = $$191435;$$211628$ph = $$191626;$$251122$ph = $$231120;$$26$ph = $$24;$$261017$ph = $$241015;$$261229$ph = $$241227;$$261335$ph = $$241333;$$sink1716 = $$231530;
      label = 49;
      continue L46;
     } else {
      $$201436 = $$191435;$$201627 = $$191626;$$241121 = $$231120;$$241531 = $$231530;$$25 = $$24;$$251016 = $$241015;$$251228 = $$241227;$$251334 = $$241333;
      label = 47;
      continue L46;
     }
     break;
    }
    case 51: {
     label = 0;
     $159 = $$271336 & 255;
     $160 = $$271336 >>> 8;
     $161 = (($$27) + -8)|0;
     $$231439 = $$221438;$$231630 = $$221629;$$271018 = $159;$$271124 = $$261123;$$271534 = $$261533;$$28 = $161;$$281231 = $$271230;$$281337 = $160;
     label = 52;
     continue L46;
     break;
    }
    case 54: {
     label = 0;
     $166 = ($$281125|0)==(0);
     if ($166) {
      $$761492 = $$241440;$$801071 = $$281019;$$801687 = $$241631;$$821285 = $$291232;$$831180 = 0;$$851592 = $$281535;$$86 = $$29;$$861395 = $$291338;
      label = 220;
      break L125;
     } else {
      $$251441 = $$241440;$$251632 = $$241631;$$291020 = $$281019;$$291126 = $$281125;$$291536 = $$281535;$$30 = $$29;$$301233 = $$291232;$$301339 = $$291338;
      label = 55;
      continue L46;
     }
     break;
    }
    case 61: {
     label = 0;
     $185 = ($$331130>>>0)<(3);
     if ($185) {
      $186 = (12171 + ($$331130)|0);
      $187 = HEAP8[$186>>0]|0;
      $188 = $187 << 24 >> 24;
      $189 = ($$34>>>0)<($188>>>0);
      if ($189) {
       $$301446 = $$291445;$$301637 = $$291636;$$341025 = $$331024;$$341131 = $$331130;$$341541 = $$331540;$$35 = $$34;$$351238 = $$341237;$$351344 = $$341343;
       label = 63;
       continue L125;
      } else {
       $$331449 = $$291445;$$331640 = $$291636;$$371028 = $$331024;$$371134 = $$331130;$$371544 = $$331540;$$38 = $$34;$$381241 = $$341237;$$381347 = $$341343;
       label = 68;
       continue L125;
      }
     } else {
      $216 = ((($0)) + 7040|0);
      _memset(($216|0),0,288)|0;
      $$341450 = $$291445;$$341641 = $$291636;$$381029 = $$331024;$$381135 = 0;$$381545 = $$331540;$$39 = $$34;$$391242 = $$341237;$$391348 = $$341343;
      label = 70;
      break;
     }
     break;
    }
    case 63: {
     label = 0;
     $190 = ($$341541>>>0)<($10>>>0);
     if ($190) {
      $$321448$ph = $$301446;$$321639$ph = $$301637;$$361027$ph = $$341025;$$361133$ph = $$341131;$$37$ph = $$35;$$371240$ph = $$351238;$$371346$ph = $$351344;$$sink1719 = $$341541;
      label = 66;
      continue L46;
     } else {
      $$311447 = $$301446;$$311638 = $$301637;$$351026 = $$341025;$$351132 = $$341131;$$351542 = $$341541;$$36 = $$35;$$361239 = $$351238;$$361345 = $$351344;
      label = 64;
      continue L46;
     }
     break;
    }
    case 68: {
     label = 0;
     $203 = (12171 + ($$371134)|0);
     $204 = HEAP8[$203>>0]|0;
     $205 = $204 << 24 >> 24;
     $206 = 1 << $205;
     $207 = (($206) + -1)|0;
     $208 = $207 & $$381347;
     $209 = (((($0)) + 44|0) + ($$371134<<2)|0);
     $210 = $$381347 >>> $205;
     $211 = (($$38) - ($205))|0;
     $212 = (3136 + ($$371134<<2)|0);
     $213 = HEAP32[$212>>2]|0;
     $214 = (($208) + ($213))|0;
     HEAP32[$209>>2] = $214;
     $215 = (($$371134) + 1)|0;
     $$291445 = $$331449;$$291636 = $$331640;$$331024 = $$371028;$$331130 = $215;$$331540 = $$371544;$$34 = $211;$$341237 = $$381241;$$341343 = $210;
     label = 61;
     continue L125;
     break;
    }
    case 72: {
     label = 0;
     $221 = ($$391546>>>0)<($10>>>0);
     if ($221) {
      $$371453$ph = $$351451;$$371644$ph = $$351642;$$411032$ph = $$391030;$$411138$ph = $$391136;$$42$ph = $$40;$$421245$ph = $$401243;$$421351$ph = $$401349;$$sink1722 = $$391546;
      label = 75;
      continue L46;
     } else {
      $$361452 = $$351451;$$361643 = $$351642;$$401031 = $$391030;$$401137 = $$391136;$$401547 = $$391546;$$41 = $$40;$$411244 = $$401243;$$411350 = $$401349;
      label = 73;
      continue L46;
     }
     break;
    }
    case 77: {
     label = 0;
     $231 = $$431352 & 7;
     $232 = $$431352 >>> 3;
     $233 = (($$43) + -3)|0;
     $234 = $231&255;
     $235 = (12175 + ($$421139)|0);
     $236 = HEAP8[$235>>0]|0;
     $237 = $236&255;
     $238 = (((($0)) + 7040|0) + ($237)|0);
     HEAP8[$238>>0] = $234;
     $239 = (($$421139) + 1)|0;
     $$341450 = $$381454;$$341641 = $$381645;$$381029 = $$421033;$$381135 = $239;$$381545 = $$421549;$$39 = $233;$$391242 = $$431246;$$391348 = $232;
     label = 70;
     break;
    }
    case 80: {
     label = 0;
     $247 = ((($0)) + 24|0);
     $248 = HEAP32[$247>>2]|0;
     $249 = ($248|0)>(-1);
     if ($249) {
      dest=$8; stop=dest+64|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0));
      $250 = (((((($0)) + 64|0) + (($248*3488)|0)|0)) + 288|0);
      _memset(($250|0),0,3200)|0;
      $251 = HEAP32[$247>>2]|0;
      $252 = (((($0)) + 44|0) + ($251<<2)|0);
      $253 = HEAP32[$252>>2]|0;
      $254 = ($253|0)==(0);
      if (!($254)) {
       $255 = HEAP32[$247>>2]|0;
       $256 = (((($0)) + 44|0) + ($255<<2)|0);
       $257 = HEAP32[$256>>2]|0;
       $$010951864 = 0;
       while(1) {
        $258 = ((((($0)) + 64|0) + (($248*3488)|0)|0) + ($$010951864)|0);
        $259 = HEAP8[$258>>0]|0;
        $260 = $259&255;
        $261 = (($8) + ($260<<2)|0);
        $262 = HEAP32[$261>>2]|0;
        $263 = (($262) + 1)|0;
        HEAP32[$261>>2] = $263;
        $264 = (($$010951864) + 1)|0;
        $265 = ($264>>>0)<($257>>>0);
        if ($265) {
         $$010951864 = $264;
        } else {
         break;
        }
       }
      }
      $266 = ((($7)) + 4|0);
      HEAP32[$266>>2] = 0;
      HEAP32[$7>>2] = 0;
      $267 = ((($8)) + 4|0);
      $268 = HEAP32[$267>>2]|0;
      $269 = $268 << 1;
      $270 = ((($7)) + 8|0);
      HEAP32[$270>>2] = $269;
      $271 = ((($8)) + 8|0);
      $272 = HEAP32[$271>>2]|0;
      $273 = (($272) + ($268))|0;
      $274 = (($272) + ($269))|0;
      $275 = $274 << 1;
      $276 = ((($7)) + 12|0);
      HEAP32[$276>>2] = $275;
      $277 = ((($8)) + 12|0);
      $278 = HEAP32[$277>>2]|0;
      $279 = (($278) + ($273))|0;
      $280 = (($278) + ($275))|0;
      $281 = $280 << 1;
      $282 = ((($7)) + 16|0);
      HEAP32[$282>>2] = $281;
      $283 = ((($8)) + 16|0);
      $284 = HEAP32[$283>>2]|0;
      $285 = (($284) + ($279))|0;
      $286 = (($284) + ($281))|0;
      $287 = $286 << 1;
      $288 = ((($7)) + 20|0);
      HEAP32[$288>>2] = $287;
      $289 = ((($8)) + 20|0);
      $290 = HEAP32[$289>>2]|0;
      $291 = (($290) + ($285))|0;
      $292 = (($290) + ($287))|0;
      $293 = $292 << 1;
      $294 = ((($7)) + 24|0);
      HEAP32[$294>>2] = $293;
      $295 = ((($8)) + 24|0);
      $296 = HEAP32[$295>>2]|0;
      $297 = (($296) + ($291))|0;
      $298 = (($296) + ($293))|0;
      $299 = $298 << 1;
      $300 = ((($7)) + 28|0);
      HEAP32[$300>>2] = $299;
      $301 = ((($8)) + 28|0);
      $302 = HEAP32[$301>>2]|0;
      $303 = (($302) + ($297))|0;
      $304 = (($302) + ($299))|0;
      $305 = $304 << 1;
      $306 = ((($7)) + 32|0);
      HEAP32[$306>>2] = $305;
      $307 = ((($8)) + 32|0);
      $308 = HEAP32[$307>>2]|0;
      $309 = (($308) + ($303))|0;
      $310 = (($308) + ($305))|0;
      $311 = $310 << 1;
      $312 = ((($7)) + 36|0);
      HEAP32[$312>>2] = $311;
      $313 = ((($8)) + 36|0);
      $314 = HEAP32[$313>>2]|0;
      $315 = (($314) + ($309))|0;
      $316 = (($314) + ($311))|0;
      $317 = $316 << 1;
      $318 = ((($7)) + 40|0);
      HEAP32[$318>>2] = $317;
      $319 = ((($8)) + 40|0);
      $320 = HEAP32[$319>>2]|0;
      $321 = (($320) + ($315))|0;
      $322 = (($320) + ($317))|0;
      $323 = $322 << 1;
      $324 = ((($7)) + 44|0);
      HEAP32[$324>>2] = $323;
      $325 = ((($8)) + 44|0);
      $326 = HEAP32[$325>>2]|0;
      $327 = (($326) + ($321))|0;
      $328 = (($326) + ($323))|0;
      $329 = $328 << 1;
      $330 = ((($7)) + 48|0);
      HEAP32[$330>>2] = $329;
      $331 = ((($8)) + 48|0);
      $332 = HEAP32[$331>>2]|0;
      $333 = (($332) + ($327))|0;
      $334 = (($332) + ($329))|0;
      $335 = $334 << 1;
      $336 = ((($7)) + 52|0);
      HEAP32[$336>>2] = $335;
      $337 = ((($8)) + 52|0);
      $338 = HEAP32[$337>>2]|0;
      $339 = (($338) + ($333))|0;
      $340 = (($338) + ($335))|0;
      $341 = $340 << 1;
      $342 = ((($7)) + 56|0);
      HEAP32[$342>>2] = $341;
      $343 = ((($8)) + 56|0);
      $344 = HEAP32[$343>>2]|0;
      $345 = (($344) + ($339))|0;
      $346 = (($344) + ($341))|0;
      $347 = $346 << 1;
      $348 = ((($7)) + 60|0);
      HEAP32[$348>>2] = $347;
      $349 = ((($8)) + 60|0);
      $350 = HEAP32[$349>>2]|0;
      $351 = (($350) + ($345))|0;
      $352 = (($350) + ($347))|0;
      $353 = $352 << 1;
      $354 = ((($7)) + 64|0);
      HEAP32[$354>>2] = $353;
      $355 = ($353|0)!=(65536);
      $356 = ($351>>>0)>(1);
      $or$cond = $355 & $356;
      if ($or$cond) {
       $$401456 = $$391455;$$401647 = $$391646;$$441035 = $$431034;$$441141 = $$431140;$$441551 = $$431550;$$45 = $$44;$$451248 = $$441247;$$451354 = $$441353;
       label = 86;
       continue L46;
      }
      $357 = HEAP32[$247>>2]|0;
      $358 = (((($0)) + 44|0) + ($357<<2)|0);
      $359 = HEAP32[$358>>2]|0;
      $360 = ($359|0)==(0);
      if ($360) {
       $$lcssa1779 = $357;
      } else {
       $$010911856 = 0;$$011971855 = -1;
       while(1) {
        $361 = ((((($0)) + 64|0) + (($248*3488)|0)|0) + ($$010911856)|0);
        $362 = HEAP8[$361>>0]|0;
        $363 = $362&255;
        $364 = ($362<<24>>24)==(0);
        L142: do {
         if ($364) {
          $$41201 = $$011971855;
         } else {
          $365 = (($7) + ($363<<2)|0);
          $366 = HEAP32[$365>>2]|0;
          $367 = (($366) + 1)|0;
          HEAP32[$365>>2] = $367;
          $$010861840 = $366;$$010871839 = $363;$$010881838 = 0;
          while(1) {
           $368 = $$010881838 << 1;
           $369 = $$010861840 & 1;
           $370 = $369 | $368;
           $371 = (($$010871839) + -1)|0;
           $372 = $$010861840 >>> 1;
           $373 = ($371|0)==(0);
           if ($373) {
            break;
           } else {
            $$010861840 = $372;$$010871839 = $371;$$010881838 = $370;
           }
          }
          $374 = ($362&255)<(11);
          if ($374) {
           $375 = $363 << 9;
           $376 = $375 | $$010911856;
           $377 = $376&65535;
           $378 = ($370>>>0)<(1024);
           if (!($378)) {
            $$41201 = $$011971855;
            break;
           }
           $379 = 1 << $363;
           $$110891852 = $370;
           while(1) {
            $380 = ((((((($0)) + 64|0) + (($248*3488)|0)|0)) + 288|0) + ($$110891852<<1)|0);
            HEAP16[$380>>1] = $377;
            $381 = (($$110891852) + ($379))|0;
            $382 = ($381>>>0)<(1024);
            if ($382) {
             $$110891852 = $381;
            } else {
             $$41201 = $$011971855;
             break L142;
            }
           }
          }
          $383 = $370 & 1023;
          $384 = ((((((($0)) + 64|0) + (($248*3488)|0)|0)) + 288|0) + ($383<<1)|0);
          $385 = HEAP16[$384>>1]|0;
          $386 = $385 << 16 >> 16;
          $387 = ($385<<16>>16)==(0);
          if ($387) {
           $388 = (($$011971855) + -2)|0;
           $389 = $$011971855&65535;
           HEAP16[$384>>1] = $389;
           $$01194 = $$011971855;$$11198 = $388;
          } else {
           $$01194 = $386;$$11198 = $$011971855;
          }
          $390 = $$010881838 >>> 9;
          $391 = ($362&255)>(11);
          $392 = $390 & 1;
          $393 = (($392) - ($$01194))|0;
          $394 = (($393) + -1)|0;
          if ($391) {
           $395 = $390 & 4194303;
           $$010941846 = $363;$$211991845 = $$11198;$397 = $394;$406 = $395;
           while(1) {
            $396 = ((((((($0)) + 64|0) + (($248*3488)|0)|0)) + 2336|0) + ($397<<1)|0);
            $398 = HEAP16[$396>>1]|0;
            $399 = ($398<<16>>16)==(0);
            if ($399) {
             $400 = $$211991845&65535;
             HEAP16[$396>>1] = $400;
             $401 = (($$211991845) + -2)|0;
             $$21196 = $$211991845;$$31200 = $401;
            } else {
             $402 = $398 << 16 >> 16;
             $$21196 = $402;$$31200 = $$211991845;
            }
            $403 = (($$010941846) + -1)|0;
            $404 = ($403>>>0)>(11);
            $405 = $406 >>> 1;
            $407 = $405 & 1;
            $408 = (($407) - ($$21196))|0;
            $409 = (($408) + -1)|0;
            if ($404) {
             $$010941846 = $403;$$211991845 = $$31200;$397 = $409;$406 = $405;
            } else {
             $$21199$lcssa = $$31200;$$lcssa1778 = $409;
             break;
            }
           }
          } else {
           $$21199$lcssa = $$11198;$$lcssa1778 = $394;
          }
          $410 = $$010911856&65535;
          $411 = ((((((($0)) + 64|0) + (($248*3488)|0)|0)) + 2336|0) + ($$lcssa1778<<1)|0);
          HEAP16[$411>>1] = $410;
          $$41201 = $$21199$lcssa;
         }
        } while(0);
        $412 = (($$010911856) + 1)|0;
        $413 = HEAP32[$247>>2]|0;
        $414 = (((($0)) + 44|0) + ($413<<2)|0);
        $415 = HEAP32[$414>>2]|0;
        $416 = ($412>>>0)<($415>>>0);
        if ($416) {
         $$010911856 = $412;$$011971855 = $$41201;
        } else {
         $$lcssa1779 = $413;
         break;
        }
       }
      }
      $417 = ($$lcssa1779|0)==(2);
      if ($417) {
       $$411457 = $$391455;$$411648 = $$391646;$$451036 = $$431034;$$451142 = 0;$$451552 = $$431550;$$46 = $$44;$$461249 = $$441247;$$461355 = $$441353;
       label = 105;
      } else {
       $$521468 = $$391455;$$521659 = $$391646;$$551046 = $$431034;$$561153 = $$431140;$$561563 = $$431550;$$57 = $$44;$$571260 = $$441247;$$571366 = $$441353;
       label = 138;
      }
     } else {
      $$531469 = $$391455;$$531660 = $$391646;$$561047 = $$431034;$$571154 = $$431140;$$571564 = $$431550;$$58 = $$44;$$581261 = $$441247;$$581367 = $$441353;
      label = 139;
     }
     break;
    }
    case 108: {
     label = 0;
     $429 = $$471356 & 1023;
     $430 = (((($0)) + 7328|0) + ($429<<1)|0);
     $431 = HEAP16[$430>>1]|0;
     $432 = $431 << 16 >> 16;
     $433 = ($431<<16>>16)>(-1);
     if ($433) {
      $434 = $432 >> 9;
      $435 = (($434) + -1)|0;
      $436 = ($435>>>0)<($$47>>>0);
      if ($436) {
       $$451461 = $$421458;$$451652 = $$421649;$$491146 = $$461143;$$491556 = $$461553;$$50 = $$47;$$501253 = $$471250;$$501359 = $$471356;
       label = 119;
       continue L125;
      } else {
       label = 113;
       break L125;
      }
     }
     $437 = ($$47>>>0)>(10);
     if ($437) {
      $$0981 = 10;$$0984 = $432;
     } else {
      label = 113;
      break L125;
     }
     while(1) {
      $438 = $$0984 ^ -1;
      $439 = $$471356 >>> $$0981;
      $440 = $439 & 1;
      $441 = (($440) + ($438))|0;
      $442 = (((($0)) + 9376|0) + ($441<<1)|0);
      $443 = HEAP16[$442>>1]|0;
      $444 = ($443<<16>>16)<(0);
      if (!($444)) {
       $$451461 = $$421458;$$451652 = $$421649;$$491146 = $$461143;$$491556 = $$461553;$$50 = $$47;$$501253 = $$471250;$$501359 = $$471356;
       label = 119;
       continue L125;
      }
      $445 = (($$0981) + 1)|0;
      $446 = $443 << 16 >> 16;
      $447 = (($$0981) + 2)|0;
      $448 = ($$47>>>0)<($447>>>0);
      if ($448) {
       label = 113;
       break L125;
      } else {
       $$0981 = $445;$$0984 = $446;
      }
     }
     break;
    }
    case 119: {
     label = 0;
     $471 = $$501359 & 1023;
     $472 = (((($0)) + 7328|0) + ($471<<1)|0);
     $473 = HEAP16[$472>>1]|0;
     $474 = $473 << 16 >> 16;
     $475 = ($473<<16>>16)>(-1);
     if ($475) {
      $476 = $474 >> 9;
      $477 = $474 & 511;
      $$2983 = $476;$$2986 = $477;
     } else {
      $$1982 = 10;$$1985 = $474;
      while(1) {
       $478 = $$1985 ^ -1;
       $479 = (($$1982) + 1)|0;
       $480 = $$501359 >>> $$1982;
       $481 = $480 & 1;
       $482 = (($481) + ($478))|0;
       $483 = (((($0)) + 9376|0) + ($482<<1)|0);
       $484 = HEAP16[$483>>1]|0;
       $485 = $484 << 16 >> 16;
       $486 = ($484<<16>>16)<(0);
       if ($486) {
        $$1982 = $479;$$1985 = $485;
       } else {
        $$2983 = $479;$$2986 = $485;
        break;
       }
      }
     }
     $487 = $$501359 >>> $$2983;
     $488 = (($$50) - ($$2983))|0;
     $489 = ($$2986>>>0)<(16);
     if ($489) {
      $490 = $$2986&255;
      $491 = (($$491146) + 1)|0;
      $492 = (((($0)) + 10532|0) + ($$491146)|0);
      HEAP8[$492>>0] = $490;
      $$411457 = $$451461;$$411648 = $$451652;$$451036 = $$2986;$$451142 = $491;$$451552 = $$491556;$$46 = $488;$$461249 = $$501253;$$461355 = $487;
      label = 105;
      break;
     }
     $493 = ($$2986|0)!=(16);
     $494 = ($$491146|0)!=(0);
     $or$cond24 = $494 | $493;
     if (!($or$cond24)) {
      $$461462 = $$451461;$$461653 = $$451652;$$491040 = $$2986;$$501147 = $$491146;$$501557 = $$491556;$$51 = $488;$$511254 = $$501253;$$511360 = $487;
      label = 125;
      continue L46;
     }
     $495 = (($$2986) + -16)|0;
     $496 = (12194 + ($495)|0);
     $497 = HEAP8[$496>>0]|0;
     $498 = $497 << 24 >> 24;
     $499 = ($488>>>0)<($498>>>0);
     if ($499) {
      $$471463 = $$451461;$$471654 = $$451652;$$501041 = $$2986;$$511148 = $$491146;$$511558 = $$491556;$$52 = $488;$$521255 = $498;$$521361 = $487;
      label = 127;
      continue L125;
     } else {
      $$501466 = $$451461;$$501657 = $$451652;$$531044 = $$2986;$$541151 = $$491146;$$541561 = $$491556;$$55 = $488;$$551258 = $498;$$551364 = $487;
      label = 132;
      continue L125;
     }
     break;
    }
    case 127: {
     label = 0;
     $500 = ($$511558>>>0)<($10>>>0);
     if ($500) {
      $$491465$ph = $$471463;$$491656$ph = $$471654;$$521043$ph = $$501041;$$531150$ph = $$511148;$$54$ph = $$52;$$541257$ph = $$521255;$$541363$ph = $$521361;$$sink1732 = $$511558;
      label = 130;
      continue L46;
     } else {
      $$481464 = $$471463;$$481655 = $$471654;$$511042 = $$501041;$$521149 = $$511148;$$521559 = $$511558;$$53 = $$52;$$531256 = $$521255;$$531362 = $$521361;
      label = 128;
      continue L46;
     }
     break;
    }
    case 132: {
     label = 0;
     $510 = 1 << $$551258;
     $511 = (($510) + -1)|0;
     $512 = $511 & $$551364;
     $513 = $$551364 >>> $$551258;
     $514 = (($$55) - ($$551258))|0;
     $515 = (($$531044) + -16)|0;
     $516 = (12198 + ($515)|0);
     $517 = HEAP8[$516>>0]|0;
     $518 = $517 << 24 >> 24;
     $519 = (($518) + ($512))|0;
     $520 = (((($0)) + 10532|0) + ($$541151)|0);
     $521 = ($$531044|0)==(16);
     if ($521) {
      $522 = (($$541151) + -1)|0;
      $523 = (((($0)) + 10532|0) + ($522)|0);
      $524 = HEAP8[$523>>0]|0;
      $525 = $524&255;
      $527 = $525;
     } else {
      $527 = 0;
     }
     $526 = $527&255;
     _memset(($520|0),($526|0),($519|0))|0;
     $528 = (($519) + ($$541151))|0;
     $$411457 = $$501466;$$411648 = $$501657;$$451036 = $$531044;$$451142 = $528;$$451552 = $$541561;$$46 = $514;$$461249 = $$551258;$$461355 = $513;
     label = 105;
     break;
    }
    case 140: {
     label = 0;
     $539 = $10;
     $540 = $$581565$ph;
     $541 = (($539) - ($540))|0;
     $542 = ($541|0)<(4);
     $543 = ($$59$ph>>>0)<(15);
     L241: do {
      if ($542) {
       $$541661$lcssa = $$541661$ph;$$581155$lcssa = $$581155$ph;$$581565$lcssa = $$581565$ph;$$59$lcssa = $$59$ph;$$591368$lcssa = $$591368$ph;$$lcssa1799 = $543;$$lcssa1802 = $541;
      } else {
       $544 = $12;
       $$5416611868 = $$541661$ph;$$5811551871 = $$581155$ph;$$5815651869 = $$581565$ph;$$5913681870 = $$591368$ph;$$591872 = $$59$ph;$965 = $543;$966 = $541;
       while(1) {
        $545 = $$5416611868;
        $546 = (($544) - ($545))|0;
        $547 = ($546|0)<(2);
        if ($547) {
         $$541661$lcssa = $$5416611868;$$581155$lcssa = $$5811551871;$$581565$lcssa = $$5815651869;$$59$lcssa = $$591872;$$591368$lcssa = $$5913681870;$$lcssa1799 = $965;$$lcssa1802 = $966;
         break L241;
        }
        if ($965) {
         $613 = HEAP8[$$5815651869>>0]|0;
         $614 = $613&255;
         $615 = ((($$5815651869)) + 1|0);
         $616 = HEAP8[$615>>0]|0;
         $617 = $616&255;
         $618 = $617 << 8;
         $619 = $618 | $614;
         $620 = $619 << $$591872;
         $621 = $620 | $$5913681870;
         $622 = ((($$5815651869)) + 2|0);
         $623 = (($$591872) + 16)|0;
         $$641571 = $622;$$65 = $623;$$651374 = $621;
        } else {
         $$641571 = $$5815651869;$$65 = $$591872;$$651374 = $$5913681870;
        }
        $624 = $$651374 & 1023;
        $625 = (((($0)) + 352|0) + ($624<<1)|0);
        $626 = HEAP16[$625>>1]|0;
        $627 = $626 << 16 >> 16;
        $628 = ($626<<16>>16)>(-1);
        if ($628) {
         $629 = $627 >> 9;
         $$1964 = $629;$$1968 = $627;
        } else {
         $$0963 = 10;$$0967 = $627;
         while(1) {
          $630 = $$0967 ^ -1;
          $631 = (($$0963) + 1)|0;
          $632 = $$651374 >>> $$0963;
          $633 = $632 & 1;
          $634 = (($633) + ($630))|0;
          $635 = (((($0)) + 2400|0) + ($634<<1)|0);
          $636 = HEAP16[$635>>1]|0;
          $637 = $636 << 16 >> 16;
          $638 = ($636<<16>>16)<(0);
          if ($638) {
           $$0963 = $631;$$0967 = $637;
          } else {
           $$1964 = $631;$$1968 = $637;
           break;
          }
         }
        }
        $639 = $$651374 >>> $$1964;
        $640 = (($$65) - ($$1964))|0;
        $641 = $$1968 & 256;
        $642 = ($641|0)==(0);
        if (!($642)) {
         $$601476 = $$541470$ph;$$611668 = $$5416611868;$$631054 = $$571048$ph;$$641161 = $$1968;$$651268 = $$591262$ph;$$671574 = $$641571;$$68 = $640;$$681377 = $639;
         label = 176;
         break L126;
        }
        $643 = ($640>>>0)<(15);
        if ($643) {
         $644 = HEAP8[$$641571>>0]|0;
         $645 = $644&255;
         $646 = ((($$641571)) + 1|0);
         $647 = HEAP8[$646>>0]|0;
         $648 = $647&255;
         $649 = $648 << 8;
         $650 = $649 | $645;
         $651 = $650 << $640;
         $652 = $651 | $639;
         $653 = ((($$641571)) + 2|0);
         $654 = (($640) + 16)|0;
         $$651572 = $653;$$66 = $654;$$661375 = $652;
        } else {
         $$651572 = $$641571;$$66 = $640;$$661375 = $639;
        }
        $655 = $$661375 & 1023;
        $656 = (((($0)) + 352|0) + ($655<<1)|0);
        $657 = HEAP16[$656>>1]|0;
        $658 = $657 << 16 >> 16;
        $659 = ($657<<16>>16)>(-1);
        if ($659) {
         $660 = $658 >> 9;
         $$3966 = $660;$$3970 = $658;
        } else {
         $$2965 = 10;$$2969 = $658;
         while(1) {
          $661 = $$2969 ^ -1;
          $662 = (($$2965) + 1)|0;
          $663 = $$661375 >>> $$2965;
          $664 = $663 & 1;
          $665 = (($664) + ($661))|0;
          $666 = (((($0)) + 2400|0) + ($665<<1)|0);
          $667 = HEAP16[$666>>1]|0;
          $668 = $667 << 16 >> 16;
          $669 = ($667<<16>>16)<(0);
          if ($669) {
           $$2965 = $662;$$2969 = $668;
          } else {
           $$3966 = $662;$$3970 = $668;
           break;
          }
         }
        }
        $670 = $$661375 >>> $$3966;
        $671 = (($$66) - ($$3966))|0;
        $672 = $$1968&255;
        HEAP8[$$5416611868>>0] = $672;
        $673 = $$3970 & 256;
        $674 = ($673|0)==(0);
        if (!($674)) {
         break;
        }
        $676 = $$3970&255;
        $677 = ((($$5416611868)) + 1|0);
        HEAP8[$677>>0] = $676;
        $678 = ((($$5416611868)) + 2|0);
        $679 = $$651572;
        $680 = (($539) - ($679))|0;
        $681 = ($680|0)<(4);
        $682 = ($671>>>0)<(15);
        if ($681) {
         $$541661$lcssa = $678;$$581155$lcssa = $$1968;$$581565$lcssa = $$651572;$$59$lcssa = $671;$$591368$lcssa = $670;$$lcssa1799 = $682;$$lcssa1802 = $680;
         break L241;
        } else {
         $$5416611868 = $678;$$5811551871 = $$1968;$$5815651869 = $$651572;$$5913681870 = $670;$$591872 = $671;$965 = $682;$966 = $680;
        }
       }
       $675 = ((($$5416611868)) + 1|0);
       $$601476 = $$541470$ph;$$611668 = $675;$$631054 = $$571048$ph;$$641161 = $$3970;$$651268 = $$591262$ph;$$671574 = $$651572;$$68 = $671;$$681377 = $670;
       label = 176;
       break L126;
      }
     } while(0);
     if (!($$lcssa1799)) {
      $$581474 = $$541470$ph;$$581665 = $$541661$lcssa;$$611052 = $$571048$ph;$$621569 = $$581565$lcssa;$$63 = $$59$lcssa;$$631266 = $$591262$ph;$$631372 = $$591368$lcssa;
      label = 156;
      continue L125;
     }
     $548 = ($$lcssa1802|0)<(2);
     if ($548) {
      $$551471 = $$541470$ph;$$551662 = $$541661$lcssa;$$581049 = $$571048$ph;$$591156 = $$581155$lcssa;$$591566 = $$581565$lcssa;$$60 = $$59$lcssa;$$601263 = $$591262$ph;$$601369 = $$591368$lcssa;
      label = 145;
      continue L125;
     }
     $579 = HEAP8[$$581565$lcssa>>0]|0;
     $580 = $579&255;
     $581 = $580 << $$59$lcssa;
     $582 = ((($$581565$lcssa)) + 1|0);
     $583 = HEAP8[$582>>0]|0;
     $584 = $583&255;
     $585 = (($$59$lcssa) + 8)|0;
     $586 = $584 << $585;
     $587 = $581 | $$591368$lcssa;
     $588 = $587 | $586;
     $589 = ((($$581565$lcssa)) + 2|0);
     $590 = (($$59$lcssa) + 16)|0;
     $$581474 = $$541470$ph;$$581665 = $$541661$lcssa;$$611052 = $$571048$ph;$$621569 = $589;$$63 = $590;$$631266 = $$591262$ph;$$631372 = $588;
     label = 156;
     continue L125;
     break;
    }
    case 145: {
     label = 0;
     $549 = $$601369 & 1023;
     $550 = (((($0)) + 352|0) + ($549<<1)|0);
     $551 = HEAP16[$550>>1]|0;
     $552 = $551 << 16 >> 16;
     $553 = ($551<<16>>16)>(-1);
     if ($553) {
      $554 = $552 >> 9;
      $555 = (($554) + -1)|0;
      $556 = ($555>>>0)<($$60>>>0);
      if ($556) {
       $$581474 = $$551471;$$581665 = $$551662;$$611052 = $$581049;$$621569 = $$591566;$$63 = $$60;$$631266 = $$601263;$$631372 = $$601369;
       label = 156;
       continue L125;
      } else {
       label = 150;
       break L125;
      }
     }
     $557 = ($$60>>>0)>(10);
     if ($557) {
      $$0972 = 10;$$0975 = $552;
     } else {
      label = 150;
      break L125;
     }
     while(1) {
      $558 = $$0975 ^ -1;
      $559 = $$601369 >>> $$0972;
      $560 = $559 & 1;
      $561 = (($560) + ($558))|0;
      $562 = (((($0)) + 2400|0) + ($561<<1)|0);
      $563 = HEAP16[$562>>1]|0;
      $564 = ($563<<16>>16)<(0);
      if (!($564)) {
       $$581474 = $$551471;$$581665 = $$551662;$$611052 = $$581049;$$621569 = $$591566;$$63 = $$60;$$631266 = $$601263;$$631372 = $$601369;
       label = 156;
       continue L125;
      }
      $565 = (($$0972) + 1)|0;
      $566 = $563 << 16 >> 16;
      $567 = (($$0972) + 2)|0;
      $568 = ($$60>>>0)<($567>>>0);
      if ($568) {
       label = 150;
       break L125;
      } else {
       $$0972 = $565;$$0975 = $566;
      }
     }
     break;
    }
    case 156: {
     label = 0;
     $591 = $$631372 & 1023;
     $592 = (((($0)) + 352|0) + ($591<<1)|0);
     $593 = HEAP16[$592>>1]|0;
     $594 = $593 << 16 >> 16;
     $595 = ($593<<16>>16)>(-1);
     if ($595) {
      $596 = $594 >> 9;
      $597 = $594 & 511;
      $$2974 = $596;$$2977 = $597;
     } else {
      $$1973 = 10;$$1976 = $594;
      while(1) {
       $598 = $$1976 ^ -1;
       $599 = (($$1973) + 1)|0;
       $600 = $$631372 >>> $$1973;
       $601 = $600 & 1;
       $602 = (($601) + ($598))|0;
       $603 = (((($0)) + 2400|0) + ($602<<1)|0);
       $604 = HEAP16[$603>>1]|0;
       $605 = $604 << 16 >> 16;
       $606 = ($604<<16>>16)<(0);
       if ($606) {
        $$1973 = $599;$$1976 = $605;
       } else {
        $$2974 = $599;$$2977 = $605;
        break;
       }
      }
     }
     $607 = $$631372 >>> $$2974;
     $608 = (($$63) - ($$2974))|0;
     $609 = ($$2977>>>0)>(255);
     if ($609) {
      $$601476 = $$581474;$$611668 = $$581665;$$631054 = $$611052;$$641161 = $$2977;$$651268 = $$631266;$$671574 = $$621569;$$68 = $608;$$681377 = $607;
      label = 176;
     } else {
      $$591475 = $$581474;$$591666 = $$581665;$$621053 = $$611052;$$621159 = $$2977;$$631570 = $$621569;$$64 = $608;$$641267 = $$631266;$$641373 = $607;
      label = 160;
      continue L46;
     }
     break;
    }
    case 179: {
     label = 0;
     $693 = ($$681575>>>0)<($10>>>0);
     if ($693) {
      $$631479$ph = $$611477;$$641671$ph = $$621669;$$661057$ph = $$641055;$$671164$ph = $$651162;$$681271$ph = $$661269;$$71$ph = $$69;$$711380$ph = $$691378;$$sink1739 = $$681575;
      label = 182;
      continue L46;
     } else {
      $$621478 = $$611477;$$631670 = $$621669;$$651056 = $$641055;$$661163 = $$651162;$$671270 = $$661269;$$691576 = $$681575;$$70 = $$69;$$701379 = $$691378;
      label = 180;
      continue L46;
     }
     break;
    }
    case 184: {
     label = 0;
     $703 = 1 << $$691272;
     $704 = (($703) + -1)|0;
     $705 = $704 & $$721381;
     $706 = $$721381 >>> $$691272;
     $707 = (($$72) - ($$691272))|0;
     $708 = (($705) + ($$681165))|0;
     $$651481 = $$641480;$$661673 = $$651672;$$681059 = $$671058;$$691166 = $708;$$701273 = $$691272;$$721579 = $$711578;$$73 = $707;$$731382 = $706;
     label = 185;
     break;
    }
    case 187: {
     label = 0;
     $714 = $$741383 & 1023;
     $715 = (((($0)) + 3840|0) + ($714<<1)|0);
     $716 = HEAP16[$715>>1]|0;
     $717 = $716 << 16 >> 16;
     $718 = ($716<<16>>16)>(-1);
     if ($718) {
      $719 = $717 >> 9;
      $720 = (($719) + -1)|0;
      $721 = ($720>>>0)<($$74>>>0);
      if ($721) {
       $$691485 = $$661482;$$701677 = $$671674;$$731170 = $$701167;$$761583 = $$731580;$$77 = $$74;$$771386 = $$741383;
       label = 198;
       continue L125;
      } else {
       label = 192;
       break L125;
      }
     }
     $722 = ($$74>>>0)>(10);
     if ($722) {
      $$0953 = 10;$$0956 = $717;
     } else {
      label = 192;
      break L125;
     }
     while(1) {
      $723 = $$0956 ^ -1;
      $724 = $$741383 >>> $$0953;
      $725 = $724 & 1;
      $726 = (($725) + ($723))|0;
      $727 = (((($0)) + 5888|0) + ($726<<1)|0);
      $728 = HEAP16[$727>>1]|0;
      $729 = ($728<<16>>16)<(0);
      if (!($729)) {
       $$691485 = $$661482;$$701677 = $$671674;$$731170 = $$701167;$$761583 = $$731580;$$77 = $$74;$$771386 = $$741383;
       label = 198;
       continue L125;
      }
      $730 = (($$0953) + 1)|0;
      $731 = $728 << 16 >> 16;
      $732 = (($$0953) + 2)|0;
      $733 = ($$74>>>0)<($732>>>0);
      if ($733) {
       label = 192;
       break L125;
      } else {
       $$0953 = $730;$$0956 = $731;
      }
     }
     break;
    }
    case 198: {
     label = 0;
     $756 = $$771386 & 1023;
     $757 = (((($0)) + 3840|0) + ($756<<1)|0);
     $758 = HEAP16[$757>>1]|0;
     $759 = $758 << 16 >> 16;
     $760 = ($758<<16>>16)>(-1);
     if ($760) {
      $761 = $759 >> 9;
      $762 = $759 & 511;
      $$2955 = $761;$$2958 = $762;
     } else {
      $$1954 = 10;$$1957 = $759;
      while(1) {
       $763 = $$1957 ^ -1;
       $764 = (($$1954) + 1)|0;
       $765 = $$771386 >>> $$1954;
       $766 = $765 & 1;
       $767 = (($766) + ($763))|0;
       $768 = (((($0)) + 5888|0) + ($767<<1)|0);
       $769 = HEAP16[$768>>1]|0;
       $770 = $769 << 16 >> 16;
       $771 = ($769<<16>>16)<(0);
       if ($771) {
        $$1954 = $764;$$1957 = $770;
       } else {
        $$2955 = $764;$$2958 = $770;
        break;
       }
      }
     }
     $772 = $$771386 >>> $$2955;
     $773 = (($$77) - ($$2955))|0;
     $774 = (3396 + ($$2958<<2)|0);
     $775 = HEAP32[$774>>2]|0;
     $776 = (3524 + ($$2958<<2)|0);
     $777 = HEAP32[$776>>2]|0;
     $778 = (($$2958) + -4)|0;
     $779 = ($778>>>0)<(26);
     if ($779) {
      $780 = ($773>>>0)<($775>>>0);
      if ($780) {
       $$701486 = $$691485;$$711678 = $$701677;$$721063 = $777;$$741171 = $$731170;$$741277 = $775;$$771584 = $$761583;$$78 = $773;$$781387 = $772;
       label = 203;
       continue L125;
      } else {
       $$741681 = $$701677;$$751066 = $777;$$771174 = $$731170;$$771280 = $775;$$801587 = $$761583;$$81 = $773;$$811390 = $772;
       label = 208;
       continue L125;
      }
     } else {
      $$751682 = $$701677;$$761067 = $777;$$781175 = $$731170;$$781281 = $775;$$811588 = $$761583;$$82 = $773;$$821391 = $772;
      label = 209;
     }
     break;
    }
    case 203: {
     label = 0;
     $781 = ($$771584>>>0)<($10>>>0);
     if ($781) {
      $$721488$ph = $$701486;$$731680$ph = $$711678;$$741065$ph = $$721063;$$761173$ph = $$741171;$$761279$ph = $$741277;$$80$ph = $$78;$$801389$ph = $$781387;$$sink1746 = $$771584;
      label = 206;
      continue L46;
     } else {
      $$711487 = $$701486;$$721679 = $$711678;$$731064 = $$721063;$$751172 = $$741171;$$751278 = $$741277;$$781585 = $$771584;$$79 = $$78;$$791388 = $$781387;
      label = 204;
      continue L46;
     }
     break;
    }
    case 208: {
     label = 0;
     $791 = 1 << $$771280;
     $792 = (($791) + -1)|0;
     $793 = $792 & $$811390;
     $794 = $$811390 >>> $$771280;
     $795 = (($$81) - ($$771280))|0;
     $796 = (($793) + ($$751066))|0;
     $$751682 = $$741681;$$761067 = $796;$$781175 = $$771174;$$781281 = $$771280;$$811588 = $$801587;$$82 = $795;$$821391 = $794;
     label = 209;
     break;
    }
    case 212: {
     label = 0;
     $807 = (($$801177) + -1)|0;
     $808 = ($$801177|0)==(0);
     if ($808) {
      $$531469 = $$741490;$$531660 = $$771684;$$561047 = $$781069;$$571154 = $807;$$571564 = $$831590;$$58 = $$84;$$581261 = $$801283;$$581367 = $$841393;
      label = 139;
     } else {
      $$751491 = $$741490;$$781685 = $$771684;$$791070 = $$781069;$$811178 = $807;$$811284 = $$801283;$$841591 = $$831590;$$85 = $$84;$$851394 = $$841393;
      label = 213;
      continue L46;
     }
     break;
    }
   }
   do {
    if ((label|0) == 70) {
     label = 0;
     $217 = ((($0)) + 52|0);
     $218 = HEAP32[$217>>2]|0;
     $219 = ($$381135>>>0)<($218>>>0);
     if ($219) {
      $220 = ($$39>>>0)<(3);
      if ($220) {
       $$351451 = $$341450;$$351642 = $$341641;$$391030 = $$381029;$$391136 = $$381135;$$391546 = $$381545;$$40 = $$39;$$401243 = $$391242;$$401349 = $$391348;
       label = 72;
       continue L125;
      } else {
       $$381454 = $$341450;$$381645 = $$341641;$$421033 = $$381029;$$421139 = $$381135;$$421549 = $$381545;$$43 = $$39;$$431246 = $$391242;$$431352 = $$391348;
       label = 77;
       continue L125;
      }
     } else {
      HEAP32[$217>>2] = 19;
      $$391455 = $$341450;$$391646 = $$341641;$$431034 = $$381029;$$431140 = $$381135;$$431550 = $$381545;$$44 = $$39;$$441247 = $$391242;$$441353 = $$391348;
      label = 80;
      continue L125;
     }
    }
    else if ((label|0) == 105) {
     label = 0;
     $418 = ((($0)) + 44|0);
     $419 = HEAP32[$418>>2]|0;
     $420 = ((($0)) + 48|0);
     $421 = HEAP32[$420>>2]|0;
     $422 = (($421) + ($419))|0;
     $423 = ($$451142>>>0)<($422>>>0);
     if (!($423)) {
      $529 = ($422|0)==($$451142|0);
      if (!($529)) {
       $$511467 = $$411457;$$511658 = $$411648;$$541045 = $$451036;$$551152 = $$451142;$$551562 = $$451552;$$56 = $$46;$$561259 = $$461249;$$561365 = $$461355;
       label = 136;
       continue L46;
      }
      $530 = ((($0)) + 64|0);
      $531 = ((($0)) + 10532|0);
      _memcpy(($530|0),($531|0),($419|0))|0;
      $532 = ((($0)) + 3552|0);
      $533 = HEAP32[$418>>2]|0;
      $534 = (((($0)) + 10532|0) + ($533)|0);
      $535 = HEAP32[$420>>2]|0;
      _memcpy(($532|0),($534|0),($535|0))|0;
      $$521468 = $$411457;$$521659 = $$411648;$$551046 = $$451036;$$561153 = $$451142;$$561563 = $$451552;$$57 = $$46;$$571260 = $$461249;$$571366 = $$461355;
      label = 138;
      break;
     }
     $424 = ($$46>>>0)<(15);
     if (!($424)) {
      $$451461 = $$411457;$$451652 = $$411648;$$491146 = $$451142;$$491556 = $$451552;$$50 = $$46;$$501253 = $$461249;$$501359 = $$461355;
      label = 119;
      continue L125;
     }
     $425 = $10;
     $426 = $$451552;
     $427 = (($425) - ($426))|0;
     $428 = ($427|0)<(2);
     if ($428) {
      $$421458 = $$411457;$$421649 = $$411648;$$461037 = $$451036;$$461143 = $$451142;$$461553 = $$451552;$$47 = $$46;$$471250 = $$461249;$$471356 = $$461355;
      label = 108;
      continue L125;
     }
     $459 = HEAP8[$$451552>>0]|0;
     $460 = $459&255;
     $461 = $460 << $$46;
     $462 = ((($$451552)) + 1|0);
     $463 = HEAP8[$462>>0]|0;
     $464 = $463&255;
     $465 = (($$46) + 8)|0;
     $466 = $464 << $465;
     $467 = $461 | $$461355;
     $468 = $467 | $466;
     $469 = ((($$451552)) + 2|0);
     $470 = (($$46) + 16)|0;
     $$451461 = $$411457;$$451652 = $$411648;$$491146 = $$451142;$$491556 = $469;$$50 = $470;$$501253 = $$461249;$$501359 = $468;
     label = 119;
     continue L125;
    }
    else if ((label|0) == 176) {
     label = 0;
     $683 = $$641161 & 511;
     $684 = ($683|0)==(256);
     if ($684) {
      $$761492 = $$601476;$$801071 = $$631054;$$801687 = $$611668;$$821285 = $$651268;$$831180 = 256;$$851592 = $$671574;$$86 = $$68;$$861395 = $$681377;
      label = 220;
      break L125;
     }
     $685 = (($683) + -257)|0;
     $686 = (3148 + ($685<<2)|0);
     $687 = HEAP32[$686>>2]|0;
     $688 = (3272 + ($685<<2)|0);
     $689 = HEAP32[$688>>2]|0;
     $690 = (($683) + -265)|0;
     $691 = ($690>>>0)<(20);
     if ($691) {
      $692 = ($$68>>>0)<($687>>>0);
      if ($692) {
       $$611477 = $$601476;$$621669 = $$611668;$$641055 = $$631054;$$651162 = $689;$$661269 = $687;$$681575 = $$671574;$$69 = $$68;$$691378 = $$681377;
       label = 179;
       continue L125;
      } else {
       $$641480 = $$601476;$$651672 = $$611668;$$671058 = $$631054;$$681165 = $689;$$691272 = $687;$$711578 = $$671574;$$72 = $$68;$$721381 = $$681377;
       label = 184;
       continue L125;
      }
     } else {
      $$651481 = $$601476;$$661673 = $$611668;$$681059 = $$631054;$$691166 = $689;$$701273 = $687;$$721579 = $$671574;$$73 = $$68;$$731382 = $$681377;
      label = 185;
     }
    }
    else if ((label|0) == 209) {
     label = 0;
     $797 = $$751682;
     $798 = $3;
     $799 = (($797) - ($798))|0;
     $$not = ($799>>>0)>=($$761067>>>0);
     $$not1747 = $14 ^ 1;
     $brmerge = $$not | $$not1747;
     if (!($brmerge)) {
      $$731489 = $799;$$761683 = $$751682;$$771068 = $$761067;$$791176 = $$781175;$$791282 = $$781281;$$821589 = $$811588;$$83 = $$82;$$831392 = $$821391;
      label = 210;
      continue L46;
     }
     $800 = (($799) - ($$761067))|0;
     $801 = $800 & $$1753;
     $802 = (($3) + ($801)|0);
     $803 = ($$751682>>>0)>($802>>>0);
     $804 = $803 ? $$751682 : $802;
     $805 = (($804) + ($$781175)|0);
     $806 = ($805>>>0)>($12>>>0);
     if ($806) {
      $$741490 = $799;$$771684 = $$751682;$$781069 = $$761067;$$801177 = $$781175;$$801283 = $$781281;$$831590 = $$811588;$$84 = $$82;$$841393 = $$821391;
      label = 212;
      continue L125;
     } else {
      $$0978 = $802;$$791686 = $$751682;$$821179 = $$781175;
     }
     while(1) {
      $816 = HEAP8[$$0978>>0]|0;
      HEAP8[$$791686>>0] = $816;
      $817 = ((($$0978)) + 1|0);
      $818 = HEAP8[$817>>0]|0;
      $819 = ((($$791686)) + 1|0);
      HEAP8[$819>>0] = $818;
      $820 = ((($$0978)) + 2|0);
      $821 = HEAP8[$820>>0]|0;
      $822 = ((($$791686)) + 2|0);
      HEAP8[$822>>0] = $821;
      $823 = ((($$791686)) + 3|0);
      $824 = ((($$0978)) + 3|0);
      $825 = (($$821179) + -3)|0;
      $826 = ($825|0)>(2);
      if ($826) {
       $$0978 = $824;$$791686 = $823;$$821179 = $825;
      } else {
       break;
      }
     }
     $827 = ($825|0)>(0);
     if ($827) {
      $828 = HEAP8[$824>>0]|0;
      HEAP8[$823>>0] = $828;
      $829 = ($825|0)==(1);
      if (!($829)) {
       $830 = ((($$0978)) + 4|0);
       $831 = HEAP8[$830>>0]|0;
       $832 = ((($$791686)) + 4|0);
       HEAP8[$832>>0] = $831;
      }
      $833 = (($823) + ($825)|0);
      $$531469 = $799;$$531660 = $833;$$561047 = $$761067;$$571154 = $825;$$571564 = $$811588;$$58 = $$82;$$581261 = $$781281;$$581367 = $$821391;
      label = 139;
     } else {
      $$531469 = $799;$$531660 = $823;$$561047 = $$761067;$$571154 = $825;$$571564 = $$811588;$$58 = $$82;$$581261 = $$781281;$$581367 = $$821391;
      label = 139;
     }
    }
   } while(0);
   if ((label|0) == 138) {
    label = 0;
    $536 = ((($0)) + 24|0);
    $537 = HEAP32[$536>>2]|0;
    $538 = (($537) + -1)|0;
    HEAP32[$536>>2] = $538;
    $$391455 = $$521468;$$391646 = $$521659;$$431034 = $$551046;$$431140 = $$561153;$$431550 = $$561563;$$44 = $$57;$$441247 = $$571260;$$441353 = $$571366;
    label = 80;
    continue;
   }
   else if ((label|0) == 139) {
    label = 0;
    $$541470$ph = $$531469;$$541661$ph = $$531660;$$571048$ph = $$561047;$$581155$ph = $$571154;$$581565$ph = $$571564;$$59$ph = $$58;$$591262$ph = $$581261;$$591368$ph = $$581367;
    label = 140;
    continue;
   }
   else if ((label|0) == 185) {
    label = 0;
    $709 = ($$73>>>0)<(15);
    if (!($709)) {
     $$691485 = $$651481;$$701677 = $$661673;$$731170 = $$691166;$$761583 = $$721579;$$77 = $$73;$$771386 = $$731382;
     label = 198;
     continue;
    }
    $710 = $10;
    $711 = $$721579;
    $712 = (($710) - ($711))|0;
    $713 = ($712|0)<(2);
    if ($713) {
     $$661482 = $$651481;$$671674 = $$661673;$$691060 = $$681059;$$701167 = $$691166;$$711274 = $$701273;$$731580 = $$721579;$$74 = $$73;$$741383 = $$731382;
     label = 187;
     continue;
    }
    $744 = HEAP8[$$721579>>0]|0;
    $745 = $744&255;
    $746 = $745 << $$73;
    $747 = ((($$721579)) + 1|0);
    $748 = HEAP8[$747>>0]|0;
    $749 = $748&255;
    $750 = (($$73) + 8)|0;
    $751 = $749 << $750;
    $752 = $746 | $$731382;
    $753 = $752 | $751;
    $754 = ((($$721579)) + 2|0);
    $755 = (($$73) + 16)|0;
    $$691485 = $$651481;$$701677 = $$661673;$$731170 = $$691166;$$761583 = $754;$$77 = $755;$$771386 = $753;
    label = 198;
    continue;
   }
  }
  if ((label|0) == 113) {
   label = 0;
   $449 = ($$461553>>>0)<($10>>>0);
   if ($449) {
    $$441460$ph = $$421458;$$441651$ph = $$421649;$$481039$ph = $$461037;$$481145$ph = $$461143;$$49$ph = $$47;$$491252$ph = $$471250;$$491358$ph = $$471356;$$sink1729 = $$461553;
    label = 116;
    continue;
   } else {
    $$431459 = $$421458;$$431650 = $$421649;$$471038 = $$461037;$$471144 = $$461143;$$471554 = $$461553;$$48 = $$47;$$481251 = $$471250;$$481357 = $$471356;
    label = 114;
    continue;
   }
  }
  else if ((label|0) == 150) {
   label = 0;
   $569 = ($$591566>>>0)<($10>>>0);
   if ($569) {
    $$571473$ph = $$551471;$$571664$ph = $$551662;$$601051$ph = $$581049;$$611158$ph = $$591156;$$62$ph = $$60;$$621265$ph = $$601263;$$621371$ph = $$601369;$$sink1736 = $$591566;
    label = 153;
    continue;
   } else {
    $$561472 = $$551471;$$561663 = $$551662;$$591050 = $$581049;$$601157 = $$591156;$$601567 = $$591566;$$61 = $$60;$$611264 = $$601263;$$611370 = $$601369;
    label = 151;
    continue;
   }
  }
  else if ((label|0) == 192) {
   label = 0;
   $734 = ($$731580>>>0)<($10>>>0);
   if ($734) {
    $$681484$ph = $$661482;$$691676$ph = $$671674;$$711062$ph = $$691060;$$721169$ph = $$701167;$$731276$ph = $$711274;$$76$ph = $$74;$$761385$ph = $$741383;$$sink1743 = $$731580;
    label = 195;
    continue;
   } else {
    $$671483 = $$661482;$$681675 = $$671674;$$701061 = $$691060;$$711168 = $$701167;$$721275 = $$711274;$$741581 = $$731580;$$75 = $$74;$$751384 = $$741383;
    label = 193;
    continue;
   }
  }
  else if ((label|0) == 220) {
   label = 0;
   $834 = ((($0)) + 20|0);
   $835 = HEAP32[$834>>2]|0;
   $836 = $835 & 1;
   $837 = ($836|0)==(0);
   if ($837) {
    $$01416 = $$761492;$$01607 = $$801687;$$41511 = $$851592;$$5 = $$86;$$51102 = $$831180;$$51208 = $$821285;$$51314 = $$861395;$$5996 = $$801071;
    label = 14;
    continue;
   }
   $838 = $6 & 1;
   $839 = ($838|0)==(0);
   if ($839) {
    $$881504 = $$761492;$$921083 = $$801071;$$921699 = $$801687;$$941191 = $$831180;$$941297 = $$821285;$$971604 = $$851592;$$98 = $$86;$$981407 = $$861395;
    label = 242;
    continue;
   } else {
    $$801496 = $$761492;$$841075 = $$801071;$$841691 = $$801687;$$861289 = $$821285;$$891596 = $$851592;$$90 = $$86;$$901399 = $$861395;
    label = 226;
    continue;
   }
  }
 }
 if ((label|0) == 258) {
  STACKTOP = sp;return ($$0951|0);
 }
 $892 = ((($0)) + 28|0);
 $893 = HEAP32[$892>>2]|0;
 $894 = $893 & 65535;
 $895 = $893 >>> 16;
 $896 = ($888|0)==(0);
 if ($896) {
  $$0937$lcssa = $895;$$0938$lcssa = $894;
 } else {
  $897 = (($888>>>0) % 5552)&-1;
  $$01834 = $897;$$09371833 = $895;$$09381832 = $894;$$09431831 = $888;$$09441830 = $4;
  while(1) {
   $898 = ($$01834>>>0)>(7);
   if ($898) {
    $899 = (($$01834) + -8)|0;
    $900 = $899 & -8;
    $scevgep = ((($$09441830)) + 8|0);
    $$09411816 = 0;$$11818 = $$09371833;$$19391817 = $$09381832;$$19451815 = $$09441830;
    while(1) {
     $904 = HEAP8[$$19451815>>0]|0;
     $905 = $904&255;
     $906 = (($905) + ($$19391817))|0;
     $907 = (($906) + ($$11818))|0;
     $908 = ((($$19451815)) + 1|0);
     $909 = HEAP8[$908>>0]|0;
     $910 = $909&255;
     $911 = (($906) + ($910))|0;
     $912 = (($907) + ($911))|0;
     $913 = ((($$19451815)) + 2|0);
     $914 = HEAP8[$913>>0]|0;
     $915 = $914&255;
     $916 = (($911) + ($915))|0;
     $917 = (($912) + ($916))|0;
     $918 = ((($$19451815)) + 3|0);
     $919 = HEAP8[$918>>0]|0;
     $920 = $919&255;
     $921 = (($916) + ($920))|0;
     $922 = (($917) + ($921))|0;
     $923 = ((($$19451815)) + 4|0);
     $924 = HEAP8[$923>>0]|0;
     $925 = $924&255;
     $926 = (($921) + ($925))|0;
     $927 = (($922) + ($926))|0;
     $928 = ((($$19451815)) + 5|0);
     $929 = HEAP8[$928>>0]|0;
     $930 = $929&255;
     $931 = (($926) + ($930))|0;
     $932 = (($927) + ($931))|0;
     $933 = ((($$19451815)) + 6|0);
     $934 = HEAP8[$933>>0]|0;
     $935 = $934&255;
     $936 = (($931) + ($935))|0;
     $937 = (($932) + ($936))|0;
     $938 = ((($$19451815)) + 7|0);
     $939 = HEAP8[$938>>0]|0;
     $940 = $939&255;
     $941 = (($936) + ($940))|0;
     $942 = (($937) + ($941))|0;
     $943 = (($$09411816) + 8)|0;
     $944 = ((($$19451815)) + 8|0);
     $945 = $943 | 7;
     $946 = ($945>>>0)<($$01834>>>0);
     if ($946) {
      $$09411816 = $943;$$11818 = $942;$$19391817 = $941;$$19451815 = $944;
     } else {
      break;
     }
    }
    $901 = (($900) + 8)|0;
    $scevgep1947 = (($scevgep) + ($900)|0);
    $$0941$lcssa = $901;$$1$lcssa = $942;$$1939$lcssa = $941;$$1945$lcssa = $scevgep1947;
   } else {
    $$0941$lcssa = 0;$$1$lcssa = $$09371833;$$1939$lcssa = $$09381832;$$1945$lcssa = $$09441830;
   }
   $902 = ($$01834>>>0)>($$0941$lcssa>>>0);
   if ($902) {
    $903 = (($$01834) - ($$0941$lcssa))|0;
    $$19421823 = $$0941$lcssa;$$21825 = $$1$lcssa;$$29401824 = $$1939$lcssa;$$29461822 = $$1945$lcssa;
    while(1) {
     $947 = ((($$29461822)) + 1|0);
     $948 = HEAP8[$$29461822>>0]|0;
     $949 = $948&255;
     $950 = (($949) + ($$29401824))|0;
     $951 = (($950) + ($$21825))|0;
     $952 = (($$19421823) + 1)|0;
     $exitcond = ($952|0)==($$01834|0);
     if ($exitcond) {
      break;
     } else {
      $$19421823 = $952;$$21825 = $951;$$29401824 = $950;$$29461822 = $947;
     }
    }
    $scevgep1948 = (($$1945$lcssa) + ($903)|0);
    $$2$lcssa = $951;$$2940$lcssa = $950;$$2946$lcssa = $scevgep1948;
   } else {
    $$2$lcssa = $$1$lcssa;$$2940$lcssa = $$1939$lcssa;$$2946$lcssa = $$1945$lcssa;
   }
   $953 = (($$2940$lcssa>>>0) % 65521)&-1;
   $954 = (($$2$lcssa>>>0) % 65521)&-1;
   $955 = (($$09431831) - ($$01834))|0;
   $956 = ($955|0)==(0);
   if ($956) {
    $$0937$lcssa = $954;$$0938$lcssa = $953;
    break;
   } else {
    $$01834 = 5552;$$09371833 = $954;$$09381832 = $953;$$09431831 = $955;$$09441830 = $$2946$lcssa;
   }
  }
 }
 $957 = $$0937$lcssa << 16;
 $958 = $957 | $$0938$lcssa;
 HEAP32[$892>>2] = $958;
 $959 = ($$1961|0)!=(0);
 $960 = $6 & 1;
 $961 = ($960|0)==(0);
 $or$cond1752 = $961 | $959;
 if ($or$cond1752) {
  $$0951 = $$1961;
  STACKTOP = sp;return ($$0951|0);
 } else {
  $962 = ((($0)) + 16|0);
  $963 = HEAP32[$962>>2]|0;
  $964 = ($958|0)==($963|0);
  $$1961$ = $964 ? $$1961 : -2;
  STACKTOP = sp;return ($$1961$|0);
 }
 return (0)|0;
}
function _ImageAlphaMask($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$0 = 0, $$031 = 0, $$032 = 0, $$033 = 0, $$byval_copy3 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0;
 var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0;
 var $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, label = 0;
 var sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(64|0);
 $$byval_copy3 = sp + 32|0;
 $vararg_buffer1 = sp + 8|0;
 $vararg_buffer = sp;
 $2 = sp + 12|0;
 $3 = ((($0)) + 4|0);
 $4 = HEAP32[$3>>2]|0;
 $5 = ((($1)) + 4|0);
 $6 = HEAP32[$5>>2]|0;
 $7 = ($4|0)==($6|0);
 if ($7) {
  $8 = ((($0)) + 8|0);
  $9 = HEAP32[$8>>2]|0;
  $10 = ((($1)) + 8|0);
  $11 = HEAP32[$10>>2]|0;
  $12 = ($9|0)==($11|0);
  if ($12) {
   $13 = ((($0)) + 16|0);
   $14 = HEAP32[$13>>2]|0;
   $15 = ($14|0)>(7);
   if ($15) {
    _TraceLog(2,12240,$vararg_buffer1);
    STACKTOP = sp;return;
   }
   ;HEAP32[$$byval_copy3>>2]=HEAP32[$1>>2]|0;HEAP32[$$byval_copy3+4>>2]=HEAP32[$1+4>>2]|0;HEAP32[$$byval_copy3+8>>2]=HEAP32[$1+8>>2]|0;HEAP32[$$byval_copy3+12>>2]=HEAP32[$1+12>>2]|0;HEAP32[$$byval_copy3+16>>2]=HEAP32[$1+16>>2]|0;
   _ImageCopy($2,$$byval_copy3);
   $16 = ((($2)) + 16|0);
   $17 = HEAP32[$16>>2]|0;
   $18 = ($17|0)==(1);
   if (!($18)) {
    _ImageFormat($2,1);
   }
   $19 = HEAP32[$13>>2]|0;
   L11: do {
    switch ($19|0) {
    case 1:  {
     _ImageFormat($0,2);
     $20 = ((($2)) + 4|0);
     $21 = HEAP32[$20>>2]|0;
     $22 = ((($2)) + 8|0);
     $23 = HEAP32[$22>>2]|0;
     $24 = Math_imul($23, $21)|0;
     $25 = HEAP32[$2>>2]|0;
     $$032 = 1;$$033 = 0;
     while(1) {
      $26 = ($$033|0)<($24|0);
      if (!($26)) {
       $27 = HEAP32[$3>>2]|0;
       $28 = HEAP32[$8>>2]|0;
       $29 = Math_imul($28, $27)|0;
       $30 = ($$033|0)<($29|0);
       if (!($30)) {
        break L11;
       }
      }
      $31 = (($25) + ($$033)|0);
      $32 = HEAP8[$31>>0]|0;
      $33 = HEAP32[$0>>2]|0;
      $34 = (($33) + ($$032)|0);
      HEAP8[$34>>0] = $32;
      $35 = (($$033) + 1)|0;
      $36 = (($$032) + 2)|0;
      $$032 = $36;$$033 = $35;
     }
     break;
    }
    case 7:  {
     label = 14;
     break;
    }
    default: {
     _ImageFormat($0,7);
     label = 14;
    }
    }
   } while(0);
   L19: do {
    if ((label|0) == 14) {
     $37 = ((($2)) + 4|0);
     $38 = HEAP32[$37>>2]|0;
     $39 = ((($2)) + 8|0);
     $40 = HEAP32[$39>>2]|0;
     $41 = Math_imul($40, $38)|0;
     $42 = HEAP32[$2>>2]|0;
     $$0 = 3;$$031 = 0;
     while(1) {
      $43 = ($$031|0)<($41|0);
      if (!($43)) {
       $44 = HEAP32[$3>>2]|0;
       $45 = HEAP32[$8>>2]|0;
       $46 = Math_imul($45, $44)|0;
       $47 = ($$031|0)<($46|0);
       if (!($47)) {
        break L19;
       }
      }
      $48 = (($42) + ($$031)|0);
      $49 = HEAP8[$48>>0]|0;
      $50 = HEAP32[$0>>2]|0;
      $51 = (($50) + ($$0)|0);
      HEAP8[$51>>0] = $49;
      $52 = (($$031) + 1)|0;
      $53 = (($$0) + 4)|0;
      $$0 = $53;$$031 = $52;
     }
    }
   } while(0);
   ;HEAP32[$$byval_copy3>>2]=HEAP32[$2>>2]|0;HEAP32[$$byval_copy3+4>>2]=HEAP32[$2+4>>2]|0;HEAP32[$$byval_copy3+8>>2]=HEAP32[$2+8>>2]|0;HEAP32[$$byval_copy3+12>>2]=HEAP32[$2+12>>2]|0;HEAP32[$$byval_copy3+16>>2]=HEAP32[$2+16>>2]|0;
   _UnloadImage($$byval_copy3);
   STACKTOP = sp;return;
  }
 }
 _TraceLog(2,12202,$vararg_buffer);
 STACKTOP = sp;return;
}
function _GetDefaultFont($0) {
 $0 = $0|0;
 var label = 0, sp = 0;
 sp = STACKTOP;
 ;HEAP32[$0>>2]=HEAP32[20472>>2]|0;HEAP32[$0+4>>2]=HEAP32[20472+4>>2]|0;HEAP32[$0+8>>2]=HEAP32[20472+8>>2]|0;HEAP32[$0+12>>2]=HEAP32[20472+12>>2]|0;HEAP32[$0+16>>2]=HEAP32[20472+16>>2]|0;HEAP32[$0+20>>2]=HEAP32[20472+20>>2]|0;HEAP32[$0+24>>2]=HEAP32[20472+24>>2]|0;HEAP32[$0+28>>2]=HEAP32[20472+28>>2]|0;
 return;
}
function _MeasureTextEx($0,$1,$2,$3,$4) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = +$3;
 $4 = $4|0;
 var $$0$lcssa = 0, $$05064 = 0, $$052$lcssa = 0.0, $$05263 = 0.0, $$05462 = 0, $$055$lcssa = 0.0, $$05561 = 0.0, $$058$lcssa = 0.0, $$05860 = 0.0, $$065 = 0, $$151 = 0, $$151$$0 = 0, $$153 = 0.0, $$156 = 0.0, $$159 = 0.0, $$2 = 0.0, $$257 = 0.0, $$3 = 0.0, $$byval_copy = 0, $$pn = 0.0;
 var $$pn$in = 0, $$sroa$4$0$$sroa_idx2 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0.0, $14 = 0, $15 = 0.0, $16 = 0.0, $17 = 0.0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0;
 var $28 = 0, $29 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0.0, $36 = 0.0, $37 = 0.0, $38 = 0, $39 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0.0, $9 = 0.0, $exitcond = 0, $phitmp = 0, label = 0;
 var sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
 $$byval_copy = sp;
 $5 = (_strlen($2)|0);
 $6 = ((($1)) + 20|0);
 $7 = HEAP32[$6>>2]|0;
 $8 = (+($7|0));
 $9 = $3 / $8;
 $10 = ($5|0)>(0);
 if (!($10)) {
  $$0$lcssa = -1;$$052$lcssa = 0.0;$$055$lcssa = 0.0;$$058$lcssa = $8;
  $12 = $$055$lcssa < $$052$lcssa;
  $$3 = $12 ? $$052$lcssa : $$055$lcssa;
  $13 = $9 * $$3;
  $14 = Math_imul($$0$lcssa, $4)|0;
  $15 = (+($14|0));
  $16 = $13 + $15;
  $17 = $9 * $$058$lcssa;
  HEAPF32[$0>>2] = $16;
  $$sroa$4$0$$sroa_idx2 = ((($0)) + 4|0);
  HEAPF32[$$sroa$4$0$$sroa_idx2>>2] = $17;
  STACKTOP = sp;return;
 }
 $11 = ((($1)) + 28|0);
 $$05064 = 0;$$05263 = 0.0;$$05462 = 0;$$05561 = 0.0;$$05860 = $8;$$065 = 0;
 while(1) {
  $18 = (($$05064) + 1)|0;
  $19 = (($2) + ($$05462)|0);
  $20 = HEAP8[$19>>0]|0;
  $21 = ($20<<24>>24)==(10);
  if ($21) {
   $33 = $$05561 < $$05263;
   $$156 = $33 ? $$05263 : $$05561;
   $34 = HEAP32[$6>>2]|0;
   $35 = (+($34|0));
   $36 = $35 * 1.5;
   $37 = $$05860 + $36;
   $$151 = 0;$$159 = $37;$$2 = 0.0;$$257 = $$156;
  } else {
   $22 = $20 << 24 >> 24;
   ;HEAP32[$$byval_copy>>2]=HEAP32[$1>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$1+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[$1+8>>2]|0;HEAP32[$$byval_copy+12>>2]=HEAP32[$1+12>>2]|0;HEAP32[$$byval_copy+16>>2]=HEAP32[$1+16>>2]|0;HEAP32[$$byval_copy+20>>2]=HEAP32[$1+20>>2]|0;HEAP32[$$byval_copy+24>>2]=HEAP32[$1+24>>2]|0;HEAP32[$$byval_copy+28>>2]=HEAP32[$1+28>>2]|0;
   $23 = (_GetCharIndex($$byval_copy,$22)|0);
   $24 = HEAP32[$11>>2]|0;
   $25 = (((($24) + ($23<<5)|0)) + 28|0);
   $26 = HEAP32[$25>>2]|0;
   $27 = ($26|0)==(0);
   if ($27) {
    $28 = (((($24) + ($23<<5)|0)) + 20|0);
    $29 = (((($24) + ($23<<5)|0)) + 12|0);
    $30 = HEAP32[$29>>2]|0;
    $31 = HEAP32[$28>>2]|0;
    $32 = (($31) + ($30))|0;
    $$pn$in = $32;
   } else {
    $$pn$in = $26;
   }
   $$pn = (+($$pn$in|0));
   $$153 = $$05263 + $$pn;
   $$151 = $18;$$159 = $$05860;$$2 = $$153;$$257 = $$05561;
  }
  $38 = ($$065|0)<($$151|0);
  $$151$$0 = $38 ? $$151 : $$065;
  $39 = (($$05462) + 1)|0;
  $exitcond = ($39|0)==($5|0);
  if ($exitcond) {
   break;
  } else {
   $$05064 = $$151;$$05263 = $$2;$$05462 = $39;$$05561 = $$257;$$05860 = $$159;$$065 = $$151$$0;
  }
 }
 $phitmp = (($$151$$0) + -1)|0;
 $$0$lcssa = $phitmp;$$052$lcssa = $$2;$$055$lcssa = $$257;$$058$lcssa = $$159;
 $12 = $$055$lcssa < $$052$lcssa;
 $$3 = $12 ? $$052$lcssa : $$055$lcssa;
 $13 = $9 * $$3;
 $14 = Math_imul($$0$lcssa, $4)|0;
 $15 = (+($14|0));
 $16 = $13 + $15;
 $17 = $9 * $$058$lcssa;
 HEAPF32[$0>>2] = $16;
 $$sroa$4$0$$sroa_idx2 = ((($0)) + 4|0);
 HEAPF32[$$sroa$4$0$$sroa_idx2>>2] = $17;
 STACKTOP = sp;return;
}
function _GetCharIndex($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$08 = 0, $$09 = 0, $10 = 0, $11 = 0, $12 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = ((($0)) + 24|0);
 $3 = HEAP32[$2>>2]|0;
 $4 = ($3|0)>(0);
 if (!($4)) {
  $$08 = 0;
  return ($$08|0);
 }
 $5 = ((($0)) + 28|0);
 $6 = HEAP32[$5>>2]|0;
 $$09 = 0;
 while(1) {
  $7 = (($6) + ($$09<<5)|0);
  $8 = HEAP32[$7>>2]|0;
  $9 = ($8|0)==($1|0);
  if ($9) {
   $$08 = $$09;
   label = 5;
   break;
  }
  $10 = (($$09) + 1)|0;
  $11 = HEAP32[$2>>2]|0;
  $12 = ($10|0)<($11|0);
  if ($12) {
   $$09 = $10;
  } else {
   $$08 = 0;
   label = 5;
   break;
  }
 }
 if ((label|0) == 5) {
  return ($$08|0);
 }
 return (0)|0;
}
function _SetTextureFilter($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0;
 var $9 = 0, $vararg_buffer = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $vararg_buffer = sp;
 switch ($1|0) {
 case 0:  {
  $2 = ((($0)) + 12|0);
  $3 = HEAP32[$2>>2]|0;
  $4 = ($3|0)>(1);
  $5 = HEAP32[$0>>2]|0;
  if ($4) {
   _rlTextureParameters($5,10241,9984);
   $6 = HEAP32[$0>>2]|0;
   _rlTextureParameters($6,10240,9728);
   STACKTOP = sp;return;
  } else {
   _rlTextureParameters($5,10241,9728);
   $7 = HEAP32[$0>>2]|0;
   _rlTextureParameters($7,10240,9728);
   STACKTOP = sp;return;
  }
  break;
 }
 case 1:  {
  $8 = ((($0)) + 12|0);
  $9 = HEAP32[$8>>2]|0;
  $10 = ($9|0)>(1);
  $11 = HEAP32[$0>>2]|0;
  if ($10) {
   _rlTextureParameters($11,10241,9985);
   $12 = HEAP32[$0>>2]|0;
   _rlTextureParameters($12,10240,9729);
   STACKTOP = sp;return;
  } else {
   _rlTextureParameters($11,10241,9729);
   $13 = HEAP32[$0>>2]|0;
   _rlTextureParameters($13,10240,9729);
   STACKTOP = sp;return;
  }
  break;
 }
 case 2:  {
  $14 = ((($0)) + 12|0);
  $15 = HEAP32[$14>>2]|0;
  $16 = ($15|0)>(1);
  $17 = HEAP32[$0>>2]|0;
  if ($16) {
   _rlTextureParameters($17,10241,9987);
   $18 = HEAP32[$0>>2]|0;
   _rlTextureParameters($18,10240,9729);
   STACKTOP = sp;return;
  } else {
   HEAP32[$vararg_buffer>>2] = $17;
   _TraceLog(2,12297,$vararg_buffer);
   $19 = HEAP32[$0>>2]|0;
   _rlTextureParameters($19,10241,9729);
   _rlTextureParameters($19,10240,9729);
   STACKTOP = sp;return;
  }
  break;
 }
 case 3:  {
  $20 = HEAP32[$0>>2]|0;
  _rlTextureParameters($20,12288,4);
  STACKTOP = sp;return;
  break;
 }
 case 4:  {
  $21 = HEAP32[$0>>2]|0;
  _rlTextureParameters($21,12288,8);
  STACKTOP = sp;return;
  break;
 }
 case 5:  {
  $22 = HEAP32[$0>>2]|0;
  _rlTextureParameters($22,12288,16);
  STACKTOP = sp;return;
  break;
 }
 default: {
  STACKTOP = sp;return;
 }
 }
}
function _DrawTexturePro($0,$1,$2,$3,$4,$5) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 $4 = +$4;
 $5 = $5|0;
 var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0.0, $22 = 0, $23 = 0, $24 = 0.0, $25 = 0.0, $26 = 0.0, $27 = 0, $28 = 0.0, $29 = 0.0;
 var $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0.0, $39 = 0, $40 = 0, $41 = 0.0, $42 = 0.0, $43 = 0, $44 = 0, $45 = 0.0, $46 = 0, $47 = 0, $48 = 0.0, $49 = 0.0;
 var $50 = 0, $51 = 0.0, $52 = 0, $53 = 0.0, $54 = 0.0, $55 = 0, $56 = 0, $57 = 0, $58 = 0.0, $59 = 0, $6 = 0, $60 = 0.0, $61 = 0.0, $62 = 0, $63 = 0, $64 = 0.0, $65 = 0, $66 = 0, $67 = 0, $68 = 0.0;
 var $69 = 0, $7 = 0, $70 = 0.0, $71 = 0.0, $72 = 0, $73 = 0, $74 = 0, $75 = 0.0, $76 = 0, $77 = 0.0, $78 = 0.0, $79 = 0, $8 = 0, $80 = 0, $81 = 0.0, $82 = 0, $83 = 0.0, $84 = 0, $85 = 0, $86 = 0;
 var $87 = 0.0, $88 = 0, $89 = 0.0, $9 = 0, $90 = 0.0, $91 = 0, $92 = 0.0, $93 = 0, $94 = 0.0, $95 = 0.0, $96 = 0, $97 = 0.0, label = 0, sp = 0;
 sp = STACKTOP;
 $6 = HEAP32[$0>>2]|0;
 $7 = ($6|0)==(0);
 if ($7) {
  return;
 }
 $8 = ((($1)) + 8|0);
 $9 = HEAP32[$8>>2]|0;
 $10 = ($9|0)<(0);
 if ($10) {
  $11 = HEAP32[$1>>2]|0;
  $12 = (($11) - ($9))|0;
  HEAP32[$1>>2] = $12;
 }
 $13 = ((($1)) + 12|0);
 $14 = HEAP32[$13>>2]|0;
 $15 = ($14|0)<(0);
 if ($15) {
  $16 = ((($1)) + 4|0);
  $17 = HEAP32[$16>>2]|0;
  $18 = (($17) - ($14))|0;
  HEAP32[$16>>2] = $18;
 }
 $19 = HEAP32[$0>>2]|0;
 _rlEnableTexture($19);
 _rlPushMatrix();
 $20 = HEAP32[$2>>2]|0;
 $21 = (+($20|0));
 $22 = ((($2)) + 4|0);
 $23 = HEAP32[$22>>2]|0;
 $24 = (+($23|0));
 _rlTranslatef($21,$24,0.0);
 _rlRotatef($4,0.0,0.0,1.0);
 $25 = +HEAPF32[$3>>2];
 $26 = -$25;
 $27 = ((($3)) + 4|0);
 $28 = +HEAPF32[$27>>2];
 $29 = -$28;
 _rlTranslatef($26,$29,0.0);
 _rlBegin(7);
 $30 = HEAP8[$5>>0]|0;
 $31 = ((($5)) + 1|0);
 $32 = HEAP8[$31>>0]|0;
 $33 = ((($5)) + 2|0);
 $34 = HEAP8[$33>>0]|0;
 $35 = ((($5)) + 3|0);
 $36 = HEAP8[$35>>0]|0;
 _rlColor4ub($30,$32,$34,$36);
 $37 = HEAP32[$1>>2]|0;
 $38 = (+($37|0));
 $39 = ((($0)) + 4|0);
 $40 = HEAP32[$39>>2]|0;
 $41 = (+($40|0));
 $42 = $38 / $41;
 $43 = ((($1)) + 4|0);
 $44 = HEAP32[$43>>2]|0;
 $45 = (+($44|0));
 $46 = ((($0)) + 8|0);
 $47 = HEAP32[$46>>2]|0;
 $48 = (+($47|0));
 $49 = $45 / $48;
 _rlTexCoord2f($42,$49);
 _rlVertex2f(0.0,0.0);
 $50 = HEAP32[$1>>2]|0;
 $51 = (+($50|0));
 $52 = HEAP32[$39>>2]|0;
 $53 = (+($52|0));
 $54 = $51 / $53;
 $55 = HEAP32[$43>>2]|0;
 $56 = HEAP32[$13>>2]|0;
 $57 = (($56) + ($55))|0;
 $58 = (+($57|0));
 $59 = HEAP32[$46>>2]|0;
 $60 = (+($59|0));
 $61 = $58 / $60;
 _rlTexCoord2f($54,$61);
 $62 = ((($2)) + 12|0);
 $63 = HEAP32[$62>>2]|0;
 $64 = (+($63|0));
 _rlVertex2f(0.0,$64);
 $65 = HEAP32[$1>>2]|0;
 $66 = HEAP32[$8>>2]|0;
 $67 = (($66) + ($65))|0;
 $68 = (+($67|0));
 $69 = HEAP32[$39>>2]|0;
 $70 = (+($69|0));
 $71 = $68 / $70;
 $72 = HEAP32[$43>>2]|0;
 $73 = HEAP32[$13>>2]|0;
 $74 = (($73) + ($72))|0;
 $75 = (+($74|0));
 $76 = HEAP32[$46>>2]|0;
 $77 = (+($76|0));
 $78 = $75 / $77;
 _rlTexCoord2f($71,$78);
 $79 = ((($2)) + 8|0);
 $80 = HEAP32[$79>>2]|0;
 $81 = (+($80|0));
 $82 = HEAP32[$62>>2]|0;
 $83 = (+($82|0));
 _rlVertex2f($81,$83);
 $84 = HEAP32[$1>>2]|0;
 $85 = HEAP32[$8>>2]|0;
 $86 = (($85) + ($84))|0;
 $87 = (+($86|0));
 $88 = HEAP32[$39>>2]|0;
 $89 = (+($88|0));
 $90 = $87 / $89;
 $91 = HEAP32[$43>>2]|0;
 $92 = (+($91|0));
 $93 = HEAP32[$46>>2]|0;
 $94 = (+($93|0));
 $95 = $92 / $94;
 _rlTexCoord2f($90,$95);
 $96 = HEAP32[$79>>2]|0;
 $97 = (+($96|0));
 _rlVertex2f($97,0.0);
 _rlEnd();
 _rlPopMatrix();
 _rlDisableTexture();
 return;
}
function _LoadSpriteFont($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$byval_copy2 = 0, $$byval_copy5 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
 var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
 var $45 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 256|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(256|0);
 $$byval_copy5 = sp + 232|0;
 $$byval_copy2 = sp + 212|0;
 $vararg_buffer = sp;
 $2 = sp + 96|0;
 $3 = sp + 192|0;
 $4 = sp + 160|0;
 $5 = sp + 128|0;
 $6 = sp + 40|0;
 $7 = sp + 252|0;
 $8 = sp + 64|0;
 $9 = sp + 8|0;
 ;HEAP32[$2>>2]=0|0;HEAP32[$2+4>>2]=0|0;HEAP32[$2+8>>2]=0|0;HEAP32[$2+12>>2]=0|0;HEAP32[$2+16>>2]=0|0;HEAP32[$2+20>>2]=0|0;HEAP32[$2+24>>2]=0|0;HEAP32[$2+28>>2]=0|0;
 $10 = (_IsFileExtension($1,12362)|0);
 $11 = ($10|0)==(0);
 do {
  if ($11) {
   $35 = (_IsFileExtension($1,12368)|0);
   $36 = ($35|0)==(0);
   if (!($36)) {
    _LoadSpriteFontTTF($4,$1,32,0,0);
    ;HEAP32[$2>>2]=HEAP32[$4>>2]|0;HEAP32[$2+4>>2]=HEAP32[$4+4>>2]|0;HEAP32[$2+8>>2]=HEAP32[$4+8>>2]|0;HEAP32[$2+12>>2]=HEAP32[$4+12>>2]|0;HEAP32[$2+16>>2]=HEAP32[$4+16>>2]|0;HEAP32[$2+20>>2]=HEAP32[$4+20>>2]|0;HEAP32[$2+24>>2]=HEAP32[$4+24>>2]|0;HEAP32[$2+28>>2]=HEAP32[$4+28>>2]|0;
    break;
   }
   $37 = (_IsFileExtension($1,12373)|0);
   $38 = ($37|0)==(0);
   if (!($38)) {
    _LoadBMFont($5,$1);
    ;HEAP32[$2>>2]=HEAP32[$5>>2]|0;HEAP32[$2+4>>2]=HEAP32[$5+4>>2]|0;HEAP32[$2+8>>2]=HEAP32[$5+8>>2]|0;HEAP32[$2+12>>2]=HEAP32[$5+12>>2]|0;HEAP32[$2+16>>2]=HEAP32[$5+16>>2]|0;HEAP32[$2+20>>2]=HEAP32[$5+20>>2]|0;HEAP32[$2+24>>2]=HEAP32[$5+24>>2]|0;HEAP32[$2+28>>2]=HEAP32[$5+28>>2]|0;
    break;
   }
   _LoadImage($6,$1);
   $39 = HEAP32[$6>>2]|0;
   $40 = ($39|0)==(0|0);
   if (!($40)) {
    HEAP8[$7>>0] = -1;
    $41 = ((($7)) + 1|0);
    HEAP8[$41>>0] = 0;
    $42 = ((($7)) + 2|0);
    HEAP8[$42>>0] = -1;
    $43 = ((($7)) + 3|0);
    HEAP8[$43>>0] = -1;
    ;HEAP32[$$byval_copy2>>2]=HEAP32[$6>>2]|0;HEAP32[$$byval_copy2+4>>2]=HEAP32[$6+4>>2]|0;HEAP32[$$byval_copy2+8>>2]=HEAP32[$6+8>>2]|0;HEAP32[$$byval_copy2+12>>2]=HEAP32[$6+12>>2]|0;HEAP32[$$byval_copy2+16>>2]=HEAP32[$6+16>>2]|0;
    ;HEAP8[$$byval_copy5>>0]=HEAP8[$7>>0]|0;HEAP8[$$byval_copy5+1>>0]=HEAP8[$7+1>>0]|0;HEAP8[$$byval_copy5+2>>0]=HEAP8[$7+2>>0]|0;HEAP8[$$byval_copy5+3>>0]=HEAP8[$7+3>>0]|0;
    _LoadImageFont($8,$$byval_copy2,$$byval_copy5);
    ;HEAP32[$2>>2]=HEAP32[$8>>2]|0;HEAP32[$2+4>>2]=HEAP32[$8+4>>2]|0;HEAP32[$2+8>>2]=HEAP32[$8+8>>2]|0;HEAP32[$2+12>>2]=HEAP32[$8+12>>2]|0;HEAP32[$2+16>>2]=HEAP32[$8+16>>2]|0;HEAP32[$2+20>>2]=HEAP32[$8+20>>2]|0;HEAP32[$2+24>>2]=HEAP32[$8+24>>2]|0;HEAP32[$2+28>>2]=HEAP32[$8+28>>2]|0;
   }
   ;HEAP32[$$byval_copy5>>2]=HEAP32[$6>>2]|0;HEAP32[$$byval_copy5+4>>2]=HEAP32[$6+4>>2]|0;HEAP32[$$byval_copy5+8>>2]=HEAP32[$6+8>>2]|0;HEAP32[$$byval_copy5+12>>2]=HEAP32[$6+12>>2]|0;HEAP32[$$byval_copy5+16>>2]=HEAP32[$6+16>>2]|0;
   _UnloadImage($$byval_copy5);
  } else {
   $12 = (_LoadResource($1,0)|0);
   $13 = HEAP32[$12>>2]|0;
   $14 = ($13|0)==(5);
   if ($14) {
    $15 = ((($12)) + 20|0);
    $16 = HEAP32[$15>>2]|0;
    $17 = ((($12)) + 4|0);
    $18 = HEAP32[$17>>2]|0;
    $19 = ((($12)) + 8|0);
    $20 = HEAP32[$19>>2]|0;
    $21 = ((($12)) + 12|0);
    $22 = HEAP32[$21>>2]|0;
    _LoadImagePro($$byval_copy2,$16,$18,$20,$22);
    ;HEAP32[$$byval_copy5>>2]=HEAP32[$$byval_copy2>>2]|0;HEAP32[$$byval_copy5+4>>2]=HEAP32[$$byval_copy2+4>>2]|0;HEAP32[$$byval_copy5+8>>2]=HEAP32[$$byval_copy2+8>>2]|0;HEAP32[$$byval_copy5+12>>2]=HEAP32[$$byval_copy2+12>>2]|0;HEAP32[$$byval_copy5+16>>2]=HEAP32[$$byval_copy2+16>>2]|0;
    _LoadTextureFromImage($3,$$byval_copy5);
    ;HEAP32[$2>>2]=HEAP32[$3>>2]|0;HEAP32[$2+4>>2]=HEAP32[$3+4>>2]|0;HEAP32[$2+8>>2]=HEAP32[$3+8>>2]|0;HEAP32[$2+12>>2]=HEAP32[$3+12>>2]|0;HEAP32[$2+16>>2]=HEAP32[$3+16>>2]|0;
    ;HEAP32[$$byval_copy5>>2]=HEAP32[$$byval_copy2>>2]|0;HEAP32[$$byval_copy5+4>>2]=HEAP32[$$byval_copy2+4>>2]|0;HEAP32[$$byval_copy5+8>>2]=HEAP32[$$byval_copy2+8>>2]|0;HEAP32[$$byval_copy5+12>>2]=HEAP32[$$byval_copy2+12>>2]|0;HEAP32[$$byval_copy5+16>>2]=HEAP32[$$byval_copy2+16>>2]|0;
    _UnloadImage($$byval_copy5);
   }
   $23 = ((($12)) + 24|0);
   $24 = HEAP32[$23>>2]|0;
   $25 = ($24|0)==(6);
   if ($25) {
    $26 = ((($12)) + 28|0);
    $27 = HEAP32[$26>>2]|0;
    $28 = ((($2)) + 20|0);
    HEAP32[$28>>2] = $27;
    $29 = ((($12)) + 32|0);
    $30 = HEAP32[$29>>2]|0;
    $31 = ((($2)) + 24|0);
    HEAP32[$31>>2] = $30;
    $32 = ((($12)) + 44|0);
    $33 = HEAP32[$32>>2]|0;
    $34 = ((($2)) + 28|0);
    HEAP32[$34>>2] = $33;
   }
  }
 } while(0);
 $44 = HEAP32[$2>>2]|0;
 $45 = ($44|0)==(0);
 if ($45) {
  HEAP32[$vararg_buffer>>2] = $1;
  _TraceLog(2,12378,$vararg_buffer);
  _GetDefaultFont($9);
  ;HEAP32[$2>>2]=HEAP32[$9>>2]|0;HEAP32[$2+4>>2]=HEAP32[$9+4>>2]|0;HEAP32[$2+8>>2]=HEAP32[$9+8>>2]|0;HEAP32[$2+12>>2]=HEAP32[$9+12>>2]|0;HEAP32[$2+16>>2]=HEAP32[$9+16>>2]|0;HEAP32[$2+20>>2]=HEAP32[$9+20>>2]|0;HEAP32[$2+24>>2]=HEAP32[$9+24>>2]|0;HEAP32[$2+28>>2]=HEAP32[$9+28>>2]|0;
  ;HEAP32[$0>>2]=HEAP32[$2>>2]|0;HEAP32[$0+4>>2]=HEAP32[$2+4>>2]|0;HEAP32[$0+8>>2]=HEAP32[$2+8>>2]|0;HEAP32[$0+12>>2]=HEAP32[$2+12>>2]|0;HEAP32[$0+16>>2]=HEAP32[$2+16>>2]|0;HEAP32[$0+20>>2]=HEAP32[$2+20>>2]|0;HEAP32[$0+24>>2]=HEAP32[$2+24>>2]|0;HEAP32[$0+28>>2]=HEAP32[$2+28>>2]|0;
  STACKTOP = sp;return;
 } else {
  ;HEAP32[$$byval_copy5>>2]=HEAP32[$2>>2]|0;HEAP32[$$byval_copy5+4>>2]=HEAP32[$2+4>>2]|0;HEAP32[$$byval_copy5+8>>2]=HEAP32[$2+8>>2]|0;HEAP32[$$byval_copy5+12>>2]=HEAP32[$2+12>>2]|0;HEAP32[$$byval_copy5+16>>2]=HEAP32[$2+16>>2]|0;
  _SetTextureFilter($$byval_copy5,0);
  ;HEAP32[$0>>2]=HEAP32[$2>>2]|0;HEAP32[$0+4>>2]=HEAP32[$2+4>>2]|0;HEAP32[$0+8>>2]=HEAP32[$2+8>>2]|0;HEAP32[$0+12>>2]=HEAP32[$2+12>>2]|0;HEAP32[$0+16>>2]=HEAP32[$2+16>>2]|0;HEAP32[$0+20>>2]=HEAP32[$2+20>>2]|0;HEAP32[$0+24>>2]=HEAP32[$2+24>>2]|0;HEAP32[$0+28>>2]=HEAP32[$2+28>>2]|0;
  STACKTOP = sp;return;
 }
}
function _LoadSpriteFontTTF($0,$1,$2,$3,$4) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 $4 = $4|0;
 var $$048 = 0, $$sroa$0$0 = 0, $$sroa$0$0$copyload = 0, $$sroa$0$0$copyload15 = 0, $$sroa$0$0$copyload17 = 0, $$sroa$0$1 = 0, $$sroa$8 = 0, $$sroa$8$0$$sroa_idx = 0, $$sroa$8$0$$sroa_idx23 = 0, $$sroa$8$0$$sroa_idx26 = 0, $$sroa$8$0$$sroa_idx29 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $5 = 0, $6 = 0;
 var $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $or$cond = 0, $vararg_buffer = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 144|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(144|0);
 $vararg_buffer = sp;
 $$sroa$8 = sp + 104|0;
 $5 = sp + 72|0;
 $6 = sp + 40|0;
 $7 = sp + 8|0;
 ;HEAP32[$$sroa$8>>2]=0|0;HEAP32[$$sroa$8+4>>2]=0|0;HEAP32[$$sroa$8+8>>2]=0|0;HEAP32[$$sroa$8+12>>2]=0|0;HEAP32[$$sroa$8+16>>2]=0|0;HEAP32[$$sroa$8+20>>2]=0|0;HEAP32[$$sroa$8+24>>2]=0|0;
 $8 = (_IsFileExtension($1,12368)|0);
 $9 = ($8|0)==(0);
 if (!($9)) {
  $10 = ($4|0)==(0|0);
  $11 = ($3|0)==(0);
  $or$cond = $11 | $10;
  if ($or$cond) {
   $12 = (_malloc(380)|0);
   $$048 = 0;
   while(1) {
    $13 = (($$048) + 32)|0;
    $14 = (($12) + ($$048<<2)|0);
    HEAP32[$14>>2] = $13;
    $15 = (($$048) + 1)|0;
    $exitcond = ($15|0)==(95);
    if ($exitcond) {
     break;
    } else {
     $$048 = $15;
    }
   }
   _LoadTTF($5,$1,$2,95,$12);
   $$sroa$0$0$copyload = HEAP32[$5>>2]|0;
   $$sroa$8$0$$sroa_idx = ((($5)) + 4|0);
   ;HEAP32[$$sroa$8>>2]=HEAP32[$$sroa$8$0$$sroa_idx>>2]|0;HEAP32[$$sroa$8+4>>2]=HEAP32[$$sroa$8$0$$sroa_idx+4>>2]|0;HEAP32[$$sroa$8+8>>2]=HEAP32[$$sroa$8$0$$sroa_idx+8>>2]|0;HEAP32[$$sroa$8+12>>2]=HEAP32[$$sroa$8$0$$sroa_idx+12>>2]|0;HEAP32[$$sroa$8+16>>2]=HEAP32[$$sroa$8$0$$sroa_idx+16>>2]|0;HEAP32[$$sroa$8+20>>2]=HEAP32[$$sroa$8$0$$sroa_idx+20>>2]|0;HEAP32[$$sroa$8+24>>2]=HEAP32[$$sroa$8$0$$sroa_idx+24>>2]|0;
   $$sroa$0$0 = $$sroa$0$0$copyload;
  } else {
   _LoadTTF($6,$1,$2,$3,$4);
   $$sroa$0$0$copyload15 = HEAP32[$6>>2]|0;
   $$sroa$8$0$$sroa_idx23 = ((($6)) + 4|0);
   ;HEAP32[$$sroa$8>>2]=HEAP32[$$sroa$8$0$$sroa_idx23>>2]|0;HEAP32[$$sroa$8+4>>2]=HEAP32[$$sroa$8$0$$sroa_idx23+4>>2]|0;HEAP32[$$sroa$8+8>>2]=HEAP32[$$sroa$8$0$$sroa_idx23+8>>2]|0;HEAP32[$$sroa$8+12>>2]=HEAP32[$$sroa$8$0$$sroa_idx23+12>>2]|0;HEAP32[$$sroa$8+16>>2]=HEAP32[$$sroa$8$0$$sroa_idx23+16>>2]|0;HEAP32[$$sroa$8+20>>2]=HEAP32[$$sroa$8$0$$sroa_idx23+20>>2]|0;HEAP32[$$sroa$8+24>>2]=HEAP32[$$sroa$8$0$$sroa_idx23+24>>2]|0;
   $$sroa$0$0 = $$sroa$0$0$copyload15;
  }
  $16 = ($$sroa$0$0|0)==(0);
  if (!($16)) {
   $$sroa$0$1 = $$sroa$0$0;
   HEAP32[$0>>2] = $$sroa$0$1;
   $$sroa$8$0$$sroa_idx29 = ((($0)) + 4|0);
   ;HEAP32[$$sroa$8$0$$sroa_idx29>>2]=HEAP32[$$sroa$8>>2]|0;HEAP32[$$sroa$8$0$$sroa_idx29+4>>2]=HEAP32[$$sroa$8+4>>2]|0;HEAP32[$$sroa$8$0$$sroa_idx29+8>>2]=HEAP32[$$sroa$8+8>>2]|0;HEAP32[$$sroa$8$0$$sroa_idx29+12>>2]=HEAP32[$$sroa$8+12>>2]|0;HEAP32[$$sroa$8$0$$sroa_idx29+16>>2]=HEAP32[$$sroa$8+16>>2]|0;HEAP32[$$sroa$8$0$$sroa_idx29+20>>2]=HEAP32[$$sroa$8+20>>2]|0;HEAP32[$$sroa$8$0$$sroa_idx29+24>>2]=HEAP32[$$sroa$8+24>>2]|0;
   STACKTOP = sp;return;
  }
 }
 HEAP32[$vararg_buffer>>2] = $1;
 _TraceLog(2,12922,$vararg_buffer);
 _GetDefaultFont($7);
 $$sroa$0$0$copyload17 = HEAP32[$7>>2]|0;
 $$sroa$8$0$$sroa_idx26 = ((($7)) + 4|0);
 ;HEAP32[$$sroa$8>>2]=HEAP32[$$sroa$8$0$$sroa_idx26>>2]|0;HEAP32[$$sroa$8+4>>2]=HEAP32[$$sroa$8$0$$sroa_idx26+4>>2]|0;HEAP32[$$sroa$8+8>>2]=HEAP32[$$sroa$8$0$$sroa_idx26+8>>2]|0;HEAP32[$$sroa$8+12>>2]=HEAP32[$$sroa$8$0$$sroa_idx26+12>>2]|0;HEAP32[$$sroa$8+16>>2]=HEAP32[$$sroa$8$0$$sroa_idx26+16>>2]|0;HEAP32[$$sroa$8+20>>2]=HEAP32[$$sroa$8$0$$sroa_idx26+20>>2]|0;HEAP32[$$sroa$8+24>>2]=HEAP32[$$sroa$8$0$$sroa_idx26+24>>2]|0;
 $$sroa$0$1 = $$sroa$0$0$copyload17;
 HEAP32[$0>>2] = $$sroa$0$1;
 $$sroa$8$0$$sroa_idx29 = ((($0)) + 4|0);
 ;HEAP32[$$sroa$8$0$$sroa_idx29>>2]=HEAP32[$$sroa$8>>2]|0;HEAP32[$$sroa$8$0$$sroa_idx29+4>>2]=HEAP32[$$sroa$8+4>>2]|0;HEAP32[$$sroa$8$0$$sroa_idx29+8>>2]=HEAP32[$$sroa$8+8>>2]|0;HEAP32[$$sroa$8$0$$sroa_idx29+12>>2]=HEAP32[$$sroa$8+12>>2]|0;HEAP32[$$sroa$8$0$$sroa_idx29+16>>2]=HEAP32[$$sroa$8+16>>2]|0;HEAP32[$$sroa$8$0$$sroa_idx29+20>>2]=HEAP32[$$sroa$8+20>>2]|0;HEAP32[$$sroa$8$0$$sroa_idx29+24>>2]=HEAP32[$$sroa$8+24>>2]|0;
 STACKTOP = sp;return;
}
function _LoadBMFont($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$05355 = 0, $$056 = 0, $$byval_copy52 = 0, $$sroa$0$0$$sroa_idx = 0, $$sroa$2$0$$sroa_idx1 = 0, $$sroa$3$0$$sroa_idx2 = 0, $$sroa$4$0$$sroa_idx3 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0;
 var $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0;
 var $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0;
 var $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0;
 var $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $9 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer11 = 0, $vararg_buffer16 = 0, $vararg_buffer19 = 0, $vararg_buffer23 = 0, $vararg_buffer26 = 0, $vararg_buffer34 = 0, $vararg_buffer44 = 0, $vararg_buffer7 = 0, $vararg_ptr10 = 0;
 var $vararg_ptr14 = 0, $vararg_ptr15 = 0, $vararg_ptr22 = 0, $vararg_ptr29 = 0, $vararg_ptr33 = 0, $vararg_ptr37 = 0, $vararg_ptr38 = 0, $vararg_ptr39 = 0, $vararg_ptr4 = 0, $vararg_ptr40 = 0, $vararg_ptr41 = 0, $vararg_ptr42 = 0, $vararg_ptr43 = 0, $vararg_ptr5 = 0, $vararg_ptr6 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 704|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(704|0);
 $$byval_copy52 = sp + 152|0;
 $vararg_buffer44 = sp + 144|0;
 $vararg_buffer34 = sp + 112|0;
 $vararg_buffer26 = sp + 88|0;
 $vararg_buffer23 = sp + 64|0;
 $vararg_buffer19 = sp + 56|0;
 $vararg_buffer16 = sp + 48|0;
 $vararg_buffer11 = sp + 32|0;
 $vararg_buffer7 = sp + 24|0;
 $vararg_buffer1 = sp + 8|0;
 $vararg_buffer = sp;
 $2 = sp + 288|0;
 $3 = sp + 448|0;
 $4 = sp + 260|0;
 $5 = sp + 236|0;
 $6 = sp + 232|0;
 $7 = sp + 320|0;
 $8 = sp + 196|0;
 $9 = sp + 192|0;
 $10 = sp + 264|0;
 $11 = sp + 240|0;
 $12 = sp + 188|0;
 $13 = sp + 184|0;
 $14 = sp + 200|0;
 ;HEAP32[$2>>2]=0|0;HEAP32[$2+4>>2]=0|0;HEAP32[$2+8>>2]=0|0;HEAP32[$2+12>>2]=0|0;HEAP32[$2+16>>2]=0|0;HEAP32[$2+20>>2]=0|0;HEAP32[$2+24>>2]=0|0;HEAP32[$2+28>>2]=0|0;
 HEAP32[$4>>2] = 0;
 HEAP32[$8>>2] = 0;
 $15 = (_fopen($1,12520)|0);
 $16 = ($15|0)==(0|0);
 if ($16) {
  HEAP32[$vararg_buffer>>2] = $1;
  _TraceLog(2,12523,$vararg_buffer);
  ;HEAP32[$0>>2]=HEAP32[$2>>2]|0;HEAP32[$0+4>>2]=HEAP32[$2+4>>2]|0;HEAP32[$0+8>>2]=HEAP32[$2+8>>2]|0;HEAP32[$0+12>>2]=HEAP32[$2+12>>2]|0;HEAP32[$0+16>>2]=HEAP32[$2+16>>2]|0;HEAP32[$0+20>>2]=HEAP32[$2+20>>2]|0;HEAP32[$0+24>>2]=HEAP32[$2+24>>2]|0;HEAP32[$0+28>>2]=HEAP32[$2+28>>2]|0;
  STACKTOP = sp;return;
 }
 (_fgets($3,256,$15)|0);
 (_fgets($3,256,$15)|0);
 $17 = (_strstr($3,12557)|0);
 HEAP32[$vararg_buffer1>>2] = $4;
 $vararg_ptr4 = ((($vararg_buffer1)) + 4|0);
 HEAP32[$vararg_ptr4>>2] = $9;
 $vararg_ptr5 = ((($vararg_buffer1)) + 8|0);
 HEAP32[$vararg_ptr5>>2] = $5;
 $vararg_ptr6 = ((($vararg_buffer1)) + 12|0);
 HEAP32[$vararg_ptr6>>2] = $6;
 (_sscanf($17,12568,$vararg_buffer1)|0);
 $18 = HEAP32[$4>>2]|0;
 HEAP32[$vararg_buffer7>>2] = $1;
 $vararg_ptr10 = ((($vararg_buffer7)) + 4|0);
 HEAP32[$vararg_ptr10>>2] = $18;
 _TraceLog(3,12610,$vararg_buffer7);
 $19 = HEAP32[$5>>2]|0;
 $20 = HEAP32[$6>>2]|0;
 HEAP32[$vararg_buffer11>>2] = $1;
 $vararg_ptr14 = ((($vararg_buffer11)) + 4|0);
 HEAP32[$vararg_ptr14>>2] = $19;
 $vararg_ptr15 = ((($vararg_buffer11)) + 8|0);
 HEAP32[$vararg_ptr15>>2] = $20;
 _TraceLog(3,12629,$vararg_buffer11);
 (_fgets($3,256,$15)|0);
 $21 = (_strstr($3,12660)|0);
 HEAP32[$vararg_buffer16>>2] = $7;
 (_sscanf($21,12665,$vararg_buffer16)|0);
 HEAP32[$vararg_buffer19>>2] = $1;
 $vararg_ptr22 = ((($vararg_buffer19)) + 4|0);
 HEAP32[$vararg_ptr22>>2] = $7;
 _TraceLog(3,12681,$vararg_buffer19);
 (_fgets($3,256,$15)|0);
 $22 = (_strstr($3,12712)|0);
 HEAP32[$vararg_buffer23>>2] = $8;
 (_sscanf($22,12718,$vararg_buffer23)|0);
 $23 = HEAP32[$8>>2]|0;
 HEAP32[$vararg_buffer26>>2] = $1;
 $vararg_ptr29 = ((($vararg_buffer26)) + 4|0);
 HEAP32[$vararg_ptr29>>2] = $23;
 _TraceLog(3,12727,$vararg_buffer26);
 $24 = (_strrchr($1,47)|0);
 $25 = (_strlen($1)|0);
 $26 = (_strlen($24)|0);
 $27 = (_strlen($7)|0);
 $28 = (($25) + 4)|0;
 $29 = (($28) - ($26))|0;
 $30 = (($29) + ($27))|0;
 $31 = (_malloc($30)|0);
 HEAP8[$31>>0] = 0;
 $32 = (_strlen($1)|0);
 $33 = (_strlen($24)|0);
 $34 = (($32) + 1)|0;
 $35 = (($34) - ($33))|0;
 (_strncat($31,$1,$35)|0);
 $36 = (_strlen($7)|0);
 (_strncat($31,$7,$36)|0);
 HEAP32[$$byval_copy52>>2] = $1;
 $vararg_ptr33 = ((($$byval_copy52)) + 4|0);
 HEAP32[$vararg_ptr33>>2] = $31;
 _TraceLog(3,12751,$$byval_copy52);
 _LoadImage($vararg_buffer26,$31);
 $37 = ((($vararg_buffer26)) + 16|0);
 $38 = HEAP32[$37>>2]|0;
 $39 = ($38|0)==(1);
 if ($39) {
  ;HEAP32[$$byval_copy52>>2]=HEAP32[$vararg_buffer26>>2]|0;HEAP32[$$byval_copy52+4>>2]=HEAP32[$vararg_buffer26+4>>2]|0;HEAP32[$$byval_copy52+8>>2]=HEAP32[$vararg_buffer26+8>>2]|0;HEAP32[$$byval_copy52+12>>2]=HEAP32[$vararg_buffer26+12>>2]|0;HEAP32[$$byval_copy52+16>>2]=HEAP32[$vararg_buffer26+16>>2]|0;
  _ImageCopy($vararg_buffer23,$$byval_copy52);
  $40 = ((($vararg_buffer23)) + 4|0);
  $41 = HEAP32[$40>>2]|0;
  $42 = ((($vararg_buffer23)) + 8|0);
  $43 = HEAP32[$42>>2]|0;
  $44 = Math_imul($43, $41)|0;
  $45 = ($44|0)>(0);
  if ($45) {
   $$056 = 0;
   while(1) {
    $46 = HEAP32[$vararg_buffer23>>2]|0;
    $47 = (($46) + ($$056)|0);
    HEAP8[$47>>0] = -1;
    $48 = (($$056) + 1)|0;
    $49 = HEAP32[$40>>2]|0;
    $50 = HEAP32[$42>>2]|0;
    $51 = Math_imul($50, $49)|0;
    $52 = ($48|0)<($51|0);
    if ($52) {
     $$056 = $48;
    } else {
     break;
    }
   }
  }
  ;HEAP32[$$byval_copy52>>2]=HEAP32[$vararg_buffer26>>2]|0;HEAP32[$$byval_copy52+4>>2]=HEAP32[$vararg_buffer26+4>>2]|0;HEAP32[$$byval_copy52+8>>2]=HEAP32[$vararg_buffer26+8>>2]|0;HEAP32[$$byval_copy52+12>>2]=HEAP32[$vararg_buffer26+12>>2]|0;HEAP32[$$byval_copy52+16>>2]=HEAP32[$vararg_buffer26+16>>2]|0;
  _ImageAlphaMask($vararg_buffer23,$$byval_copy52);
  ;HEAP32[$$byval_copy52>>2]=HEAP32[$vararg_buffer23>>2]|0;HEAP32[$$byval_copy52+4>>2]=HEAP32[$vararg_buffer23+4>>2]|0;HEAP32[$$byval_copy52+8>>2]=HEAP32[$vararg_buffer23+8>>2]|0;HEAP32[$$byval_copy52+12>>2]=HEAP32[$vararg_buffer23+12>>2]|0;HEAP32[$$byval_copy52+16>>2]=HEAP32[$vararg_buffer23+16>>2]|0;
  _LoadTextureFromImage($10,$$byval_copy52);
  ;HEAP32[$2>>2]=HEAP32[$10>>2]|0;HEAP32[$2+4>>2]=HEAP32[$10+4>>2]|0;HEAP32[$2+8>>2]=HEAP32[$10+8>>2]|0;HEAP32[$2+12>>2]=HEAP32[$10+12>>2]|0;HEAP32[$2+16>>2]=HEAP32[$10+16>>2]|0;
  ;HEAP32[$$byval_copy52>>2]=HEAP32[$vararg_buffer23>>2]|0;HEAP32[$$byval_copy52+4>>2]=HEAP32[$vararg_buffer23+4>>2]|0;HEAP32[$$byval_copy52+8>>2]=HEAP32[$vararg_buffer23+8>>2]|0;HEAP32[$$byval_copy52+12>>2]=HEAP32[$vararg_buffer23+12>>2]|0;HEAP32[$$byval_copy52+16>>2]=HEAP32[$vararg_buffer23+16>>2]|0;
  _UnloadImage($$byval_copy52);
 } else {
  ;HEAP32[$$byval_copy52>>2]=HEAP32[$vararg_buffer26>>2]|0;HEAP32[$$byval_copy52+4>>2]=HEAP32[$vararg_buffer26+4>>2]|0;HEAP32[$$byval_copy52+8>>2]=HEAP32[$vararg_buffer26+8>>2]|0;HEAP32[$$byval_copy52+12>>2]=HEAP32[$vararg_buffer26+12>>2]|0;HEAP32[$$byval_copy52+16>>2]=HEAP32[$vararg_buffer26+16>>2]|0;
  _LoadTextureFromImage($11,$$byval_copy52);
  ;HEAP32[$2>>2]=HEAP32[$11>>2]|0;HEAP32[$2+4>>2]=HEAP32[$11+4>>2]|0;HEAP32[$2+8>>2]=HEAP32[$11+8>>2]|0;HEAP32[$2+12>>2]=HEAP32[$11+12>>2]|0;HEAP32[$2+16>>2]=HEAP32[$11+16>>2]|0;
 }
 $53 = HEAP32[$4>>2]|0;
 $54 = ((($2)) + 20|0);
 HEAP32[$54>>2] = $53;
 $55 = HEAP32[$8>>2]|0;
 $56 = ((($2)) + 24|0);
 HEAP32[$56>>2] = $55;
 $57 = $55 << 5;
 $58 = (_malloc($57)|0);
 $59 = ((($2)) + 28|0);
 HEAP32[$59>>2] = $58;
 ;HEAP32[$$byval_copy52>>2]=HEAP32[$vararg_buffer26>>2]|0;HEAP32[$$byval_copy52+4>>2]=HEAP32[$vararg_buffer26+4>>2]|0;HEAP32[$$byval_copy52+8>>2]=HEAP32[$vararg_buffer26+8>>2]|0;HEAP32[$$byval_copy52+12>>2]=HEAP32[$vararg_buffer26+12>>2]|0;HEAP32[$$byval_copy52+16>>2]=HEAP32[$vararg_buffer26+16>>2]|0;
 _UnloadImage($$byval_copy52);
 _free($31);
 $60 = HEAP32[$8>>2]|0;
 $61 = ($60|0)>(0);
 if ($61) {
  $$05355 = 0;
  while(1) {
   (_fgets($3,256,$15)|0);
   HEAP32[$vararg_buffer34>>2] = $vararg_buffer23;
   $vararg_ptr37 = ((($vararg_buffer34)) + 4|0);
   HEAP32[$vararg_ptr37>>2] = $vararg_buffer19;
   $vararg_ptr38 = ((($vararg_buffer34)) + 8|0);
   HEAP32[$vararg_ptr38>>2] = $vararg_buffer16;
   $vararg_ptr39 = ((($vararg_buffer34)) + 12|0);
   HEAP32[$vararg_ptr39>>2] = $vararg_buffer11;
   $vararg_ptr40 = ((($vararg_buffer34)) + 16|0);
   HEAP32[$vararg_ptr40>>2] = $vararg_buffer7;
   $vararg_ptr41 = ((($vararg_buffer34)) + 20|0);
   HEAP32[$vararg_ptr41>>2] = $vararg_buffer1;
   $vararg_ptr42 = ((($vararg_buffer34)) + 24|0);
   HEAP32[$vararg_ptr42>>2] = $12;
   $vararg_ptr43 = ((($vararg_buffer34)) + 28|0);
   HEAP32[$vararg_ptr43>>2] = $13;
   (_sscanf($3,12786,$vararg_buffer34)|0);
   $64 = HEAP32[$vararg_buffer23>>2]|0;
   $65 = HEAP32[$59>>2]|0;
   $66 = (($65) + ($$05355<<5)|0);
   HEAP32[$66>>2] = $64;
   $67 = HEAP32[$59>>2]|0;
   $68 = HEAP32[$vararg_buffer19>>2]|0;
   $69 = HEAP32[$vararg_buffer16>>2]|0;
   $70 = HEAP32[$vararg_buffer11>>2]|0;
   $71 = HEAP32[$vararg_buffer7>>2]|0;
   $$sroa$0$0$$sroa_idx = (((($67) + ($$05355<<5)|0)) + 4|0);
   HEAP32[$$sroa$0$0$$sroa_idx>>2] = $68;
   $$sroa$2$0$$sroa_idx1 = (((($67) + ($$05355<<5)|0)) + 8|0);
   HEAP32[$$sroa$2$0$$sroa_idx1>>2] = $69;
   $$sroa$3$0$$sroa_idx2 = (((($67) + ($$05355<<5)|0)) + 12|0);
   HEAP32[$$sroa$3$0$$sroa_idx2>>2] = $70;
   $$sroa$4$0$$sroa_idx3 = (((($67) + ($$05355<<5)|0)) + 16|0);
   HEAP32[$$sroa$4$0$$sroa_idx3>>2] = $71;
   $72 = HEAP32[$vararg_buffer1>>2]|0;
   $73 = HEAP32[$59>>2]|0;
   $74 = (((($73) + ($$05355<<5)|0)) + 20|0);
   HEAP32[$74>>2] = $72;
   $75 = HEAP32[$12>>2]|0;
   $76 = HEAP32[$59>>2]|0;
   $77 = (((($76) + ($$05355<<5)|0)) + 24|0);
   HEAP32[$77>>2] = $75;
   $78 = HEAP32[$13>>2]|0;
   $79 = HEAP32[$59>>2]|0;
   $80 = (((($79) + ($$05355<<5)|0)) + 28|0);
   HEAP32[$80>>2] = $78;
   $81 = (($$05355) + 1)|0;
   $82 = HEAP32[$8>>2]|0;
   $83 = ($81|0)<($82|0);
   if ($83) {
    $$05355 = $81;
   } else {
    break;
   }
  }
 }
 (_fclose($15)|0);
 $62 = HEAP32[$2>>2]|0;
 $63 = ($62|0)==(0);
 if ($63) {
  ;HEAP32[$$byval_copy52>>2]=HEAP32[$2>>2]|0;HEAP32[$$byval_copy52+4>>2]=HEAP32[$2+4>>2]|0;HEAP32[$$byval_copy52+8>>2]=HEAP32[$2+8>>2]|0;HEAP32[$$byval_copy52+12>>2]=HEAP32[$2+12>>2]|0;HEAP32[$$byval_copy52+16>>2]=HEAP32[$2+16>>2]|0;HEAP32[$$byval_copy52+20>>2]=HEAP32[$2+20>>2]|0;HEAP32[$$byval_copy52+24>>2]=HEAP32[$2+24>>2]|0;HEAP32[$$byval_copy52+28>>2]=HEAP32[$2+28>>2]|0;
  _UnloadSpriteFont($$byval_copy52);
  _GetDefaultFont($14);
  ;HEAP32[$2>>2]=HEAP32[$14>>2]|0;HEAP32[$2+4>>2]=HEAP32[$14+4>>2]|0;HEAP32[$2+8>>2]=HEAP32[$14+8>>2]|0;HEAP32[$2+12>>2]=HEAP32[$14+12>>2]|0;HEAP32[$2+16>>2]=HEAP32[$14+16>>2]|0;HEAP32[$2+20>>2]=HEAP32[$14+20>>2]|0;HEAP32[$2+24>>2]=HEAP32[$14+24>>2]|0;HEAP32[$2+28>>2]=HEAP32[$14+28>>2]|0;
 } else {
  HEAP32[$vararg_buffer44>>2] = $1;
  _TraceLog(0,12860,$vararg_buffer44);
 }
 ;HEAP32[$0>>2]=HEAP32[$2>>2]|0;HEAP32[$0+4>>2]=HEAP32[$2+4>>2]|0;HEAP32[$0+8>>2]=HEAP32[$2+8>>2]|0;HEAP32[$0+12>>2]=HEAP32[$2+12>>2]|0;HEAP32[$0+16>>2]=HEAP32[$2+16>>2]|0;HEAP32[$0+20>>2]=HEAP32[$2+20>>2]|0;HEAP32[$0+24>>2]=HEAP32[$2+24>>2]|0;HEAP32[$0+28>>2]=HEAP32[$2+28>>2]|0;
 STACKTOP = sp;return;
}
function _LoadImageFont($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $$0195$lcssa = 0, $$019552 = 0, $$019622 = 0, $$0197 = 0, $$020032 = 0, $$0201$lcssa = 0, $$020131 = 0, $$0203 = 0, $$021 = 0, $$1$lcssa = 0, $$119927 = 0, $$1202$lcssa = 0, $$120226 = 0, $$135 = 0, $$2 = 0, $$byval_copy4 = 0, $$sroa$0 = 0, $$sroa$5$0$$sroa_idx15 = 0, $$sroa$6$0$$sroa_idx17 = 0, $$sroa$9$0$$sroa_idx20 = 0;
 var $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0;
 var $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0;
 var $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0;
 var $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0;
 var $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0;
 var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0;
 var $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0;
 var $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0;
 var $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0;
 var $97 = 0, $98 = 0, $99 = 0, $exitcond = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 5232|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(5232|0);
 $$byval_copy4 = sp + 5200|0;
 $vararg_buffer1 = sp + 48|0;
 $vararg_buffer = sp + 24|0;
 $3 = sp + 4176|0;
 $4 = sp + 56|0;
 $$sroa$0 = sp;
 $5 = sp + 4152|0;
 ;HEAP32[$$byval_copy4>>2]=HEAP32[$1>>2]|0;HEAP32[$$byval_copy4+4>>2]=HEAP32[$1+4>>2]|0;HEAP32[$$byval_copy4+8>>2]=HEAP32[$1+8>>2]|0;HEAP32[$$byval_copy4+12>>2]=HEAP32[$1+12>>2]|0;HEAP32[$$byval_copy4+16>>2]=HEAP32[$1+16>>2]|0;
 $6 = (_GetImageData($$byval_copy4)|0);
 $7 = ((($1)) + 8|0);
 $8 = HEAP32[$7>>2]|0;
 $9 = ($8|0)>(0);
 L1: do {
  if ($9) {
   $10 = ((($1)) + 4|0);
   $11 = HEAP32[$10>>2]|0;
   $12 = ($11|0)>(0);
   $13 = HEAP8[$2>>0]|0;
   $14 = ((($2)) + 1|0);
   $15 = HEAP8[$14>>0]|0;
   $16 = ((($2)) + 2|0);
   $17 = HEAP8[$16>>0]|0;
   $18 = ((($2)) + 3|0);
   $19 = HEAP8[$18>>0]|0;
   $20 = HEAP8[$2>>0]|0;
   $21 = ((($2)) + 1|0);
   $22 = HEAP8[$21>>0]|0;
   $23 = ((($2)) + 2|0);
   $24 = HEAP8[$23>>0]|0;
   $25 = ((($2)) + 3|0);
   $26 = HEAP8[$25>>0]|0;
   $27 = HEAP32[$10>>2]|0;
   $$019552 = 0;
   while(1) {
    L5: do {
     if ($12) {
      $$135 = 0;$29 = $11;
      while(1) {
       $28 = Math_imul($29, $$019552)|0;
       $30 = (($28) + ($$135))|0;
       $31 = (($6) + ($30<<2)|0);
       $32 = HEAP8[$31>>0]|0;
       $33 = ($32<<24>>24)==($20<<24>>24);
       if (!($33)) {
        $$1$lcssa = $$135;
        break L5;
       }
       $34 = (((($6) + ($30<<2)|0)) + 1|0);
       $35 = HEAP8[$34>>0]|0;
       $36 = ($35<<24>>24)==($22<<24>>24);
       if (!($36)) {
        $$1$lcssa = $$135;
        break L5;
       }
       $37 = (((($6) + ($30<<2)|0)) + 2|0);
       $38 = HEAP8[$37>>0]|0;
       $39 = ($38<<24>>24)==($24<<24>>24);
       if (!($39)) {
        $$1$lcssa = $$135;
        break L5;
       }
       $40 = (((($6) + ($30<<2)|0)) + 3|0);
       $41 = HEAP8[$40>>0]|0;
       $42 = ($41<<24>>24)==($26<<24>>24);
       if (!($42)) {
        $$1$lcssa = $$135;
        break L5;
       }
       $43 = (($$135) + 1)|0;
       $44 = HEAP32[$10>>2]|0;
       $45 = ($43|0)<($44|0);
       if ($45) {
        $$135 = $43;$29 = $44;
       } else {
        $$1$lcssa = $43;
        break;
       }
      }
     } else {
      $$1$lcssa = 0;
     }
    } while(0);
    $46 = Math_imul($27, $$019552)|0;
    $47 = (($46) + ($$1$lcssa))|0;
    $48 = (($6) + ($47<<2)|0);
    $49 = HEAP8[$48>>0]|0;
    $50 = ($49<<24>>24)==($13<<24>>24);
    if (!($50)) {
     $$0195$lcssa = $$019552;$$2 = $$1$lcssa;
     break L1;
    }
    $51 = (((($6) + ($47<<2)|0)) + 1|0);
    $52 = HEAP8[$51>>0]|0;
    $53 = ($52<<24>>24)==($15<<24>>24);
    if (!($53)) {
     $$0195$lcssa = $$019552;$$2 = $$1$lcssa;
     break L1;
    }
    $54 = (((($6) + ($47<<2)|0)) + 2|0);
    $55 = HEAP8[$54>>0]|0;
    $56 = ($55<<24>>24)==($17<<24>>24);
    if (!($56)) {
     $$0195$lcssa = $$019552;$$2 = $$1$lcssa;
     break L1;
    }
    $57 = (((($6) + ($47<<2)|0)) + 3|0);
    $58 = HEAP8[$57>>0]|0;
    $59 = ($58<<24>>24)==($19<<24>>24);
    if (!($59)) {
     $$0195$lcssa = $$019552;$$2 = $$1$lcssa;
     break L1;
    }
    $60 = (($$019552) + 1)|0;
    $61 = HEAP32[$7>>2]|0;
    $62 = ($60|0)<($61|0);
    if ($62) {
     $$019552 = $60;
    } else {
     $$0195$lcssa = $60;$$2 = $$1$lcssa;
     break;
    }
   }
  } else {
   $$0195$lcssa = 0;$$2 = 0;
  }
 } while(0);
 $63 = ((($1)) + 4|0);
 $64 = HEAP32[$63>>2]|0;
 $65 = HEAP8[$2>>0]|0;
 $66 = ((($2)) + 1|0);
 $67 = HEAP8[$66>>0]|0;
 $68 = ((($2)) + 2|0);
 $69 = HEAP8[$68>>0]|0;
 $70 = ((($2)) + 3|0);
 $71 = HEAP8[$70>>0]|0;
 $$0203 = 0;
 while(1) {
  $72 = (($$0203) + ($$0195$lcssa))|0;
  $73 = Math_imul($72, $64)|0;
  $74 = (($73) + ($$2))|0;
  $75 = (($6) + ($74<<2)|0);
  $76 = HEAP8[$75>>0]|0;
  $77 = ($76<<24>>24)==($65<<24>>24);
  if ($77) {
   $78 = (((($6) + ($74<<2)|0)) + 1|0);
   $79 = HEAP8[$78>>0]|0;
   $80 = ($79<<24>>24)==($67<<24>>24);
   if ($80) {
    $81 = (((($6) + ($74<<2)|0)) + 2|0);
    $82 = HEAP8[$81>>0]|0;
    $83 = ($82<<24>>24)==($69<<24>>24);
    if ($83) {
     $84 = (((($6) + ($74<<2)|0)) + 3|0);
     $85 = HEAP8[$84>>0]|0;
     $86 = ($85<<24>>24)==($71<<24>>24);
     if ($86) {
      break;
     }
    }
   }
  }
  $96 = (($$0203) + 1)|0;
  $$0203 = $96;
 }
 $87 = HEAP32[$7>>2]|0;
 $88 = ($$0195$lcssa|0)<($87|0);
 if ($88) {
  $89 = HEAP32[$63>>2]|0;
  $90 = ($$2|0)<($89|0);
  $91 = HEAP32[$7>>2]|0;
  $92 = HEAP8[$2>>0]|0;
  $93 = HEAP8[$66>>0]|0;
  $94 = HEAP8[$68>>0]|0;
  $95 = HEAP8[$70>>0]|0;
  $$020032 = 0;$$020131 = 0;$99 = $$0195$lcssa;
  while(1) {
   L30: do {
    if ($90) {
     $$119927 = $$2;$$120226 = $$020131;$98 = $89;
     while(1) {
      $97 = Math_imul($98, $99)|0;
      $100 = (($97) + ($$119927))|0;
      $101 = (($6) + ($100<<2)|0);
      $102 = HEAP8[$101>>0]|0;
      $103 = ($102<<24>>24)==($92<<24>>24);
      if ($103) {
       $104 = (((($6) + ($100<<2)|0)) + 1|0);
       $105 = HEAP8[$104>>0]|0;
       $106 = ($105<<24>>24)==($93<<24>>24);
       if ($106) {
        $107 = (((($6) + ($100<<2)|0)) + 2|0);
        $108 = HEAP8[$107>>0]|0;
        $109 = ($108<<24>>24)==($94<<24>>24);
        if ($109) {
         $110 = (((($6) + ($100<<2)|0)) + 3|0);
         $111 = HEAP8[$110>>0]|0;
         $112 = ($111<<24>>24)==($95<<24>>24);
         if ($112) {
          $$1202$lcssa = $$120226;
          break L30;
         }
        }
       }
      }
      $113 = (($$120226) + 32)|0;
      $114 = (($3) + ($$120226<<2)|0);
      HEAP32[$114>>2] = $113;
      $115 = (($4) + ($$120226<<4)|0);
      HEAP32[$115>>2] = $$119927;
      $116 = (((($4) + ($$120226<<4)|0)) + 4|0);
      HEAP32[$116>>2] = $99;
      $117 = (((($4) + ($$120226<<4)|0)) + 12|0);
      HEAP32[$117>>2] = $$0203;
      $118 = HEAP32[$63>>2]|0;
      $119 = Math_imul($118, $99)|0;
      $$0197 = 0;
      while(1) {
       $120 = (($$0197) + ($$119927))|0;
       $121 = (($120) + ($119))|0;
       $122 = (($6) + ($121<<2)|0);
       $123 = HEAP8[$122>>0]|0;
       $124 = ($123<<24>>24)==($92<<24>>24);
       if ($124) {
        $125 = (((($6) + ($121<<2)|0)) + 1|0);
        $126 = HEAP8[$125>>0]|0;
        $127 = ($126<<24>>24)==($93<<24>>24);
        if ($127) {
         $128 = (((($6) + ($121<<2)|0)) + 2|0);
         $129 = HEAP8[$128>>0]|0;
         $130 = ($129<<24>>24)==($94<<24>>24);
         if ($130) {
          $131 = (((($6) + ($121<<2)|0)) + 3|0);
          $132 = HEAP8[$131>>0]|0;
          $133 = ($132<<24>>24)==($95<<24>>24);
          if ($133) {
           break;
          }
         }
        }
       }
       $134 = (($$0197) + 1)|0;
       $$0197 = $134;
      }
      $135 = (((($4) + ($$120226<<4)|0)) + 8|0);
      HEAP32[$135>>2] = $$0197;
      $136 = (($$120226) + 1)|0;
      $137 = (($$119927) + ($$2))|0;
      $138 = (($137) + ($$0197))|0;
      $139 = HEAP32[$63>>2]|0;
      $140 = ($138|0)<($139|0);
      if ($140) {
       $$119927 = $138;$$120226 = $136;$98 = $139;
      } else {
       $$1202$lcssa = $136;
       break;
      }
     }
    } else {
     $$1202$lcssa = $$020131;
    }
   } while(0);
   $141 = (($$020032) + 1)|0;
   $142 = Math_imul($141, $72)|0;
   $143 = (($142) + ($$0195$lcssa))|0;
   $144 = ($143|0)<($91|0);
   if ($144) {
    $$020032 = $141;$$020131 = $$1202$lcssa;$99 = $143;
   } else {
    $$0201$lcssa = $$1202$lcssa;
    break;
   }
  }
 } else {
  $$0201$lcssa = 0;
 }
 _TraceLog(3,12434,$vararg_buffer);
 $145 = HEAP32[$7>>2]|0;
 $146 = HEAP32[$63>>2]|0;
 $147 = Math_imul($146, $145)|0;
 $148 = ($147|0)>(0);
 if ($148) {
  $149 = HEAP8[$2>>0]|0;
  $150 = HEAP8[$66>>0]|0;
  $151 = HEAP8[$68>>0]|0;
  $152 = HEAP8[$70>>0]|0;
  $$019622 = 0;
  while(1) {
   $158 = (($6) + ($$019622<<2)|0);
   $159 = HEAP8[$158>>0]|0;
   $160 = ($159<<24>>24)==($149<<24>>24);
   if ($160) {
    $161 = (((($6) + ($$019622<<2)|0)) + 1|0);
    $162 = HEAP8[$161>>0]|0;
    $163 = ($162<<24>>24)==($150<<24>>24);
    if ($163) {
     $164 = (((($6) + ($$019622<<2)|0)) + 2|0);
     $165 = HEAP8[$164>>0]|0;
     $166 = ($165<<24>>24)==($151<<24>>24);
     if ($166) {
      $167 = (((($6) + ($$019622<<2)|0)) + 3|0);
      $168 = HEAP8[$167>>0]|0;
      $169 = ($168<<24>>24)==($152<<24>>24);
      if ($169) {
       HEAP8[$158>>0]=0&255;HEAP8[$158+1>>0]=(0>>8)&255;HEAP8[$158+2>>0]=(0>>16)&255;HEAP8[$158+3>>0]=0>>24;
      }
     }
    }
   }
   $170 = (($$019622) + 1)|0;
   $171 = HEAP32[$7>>2]|0;
   $172 = HEAP32[$63>>2]|0;
   $173 = Math_imul($172, $171)|0;
   $174 = ($170|0)<($173|0);
   if ($174) {
    $$019622 = $170;
   } else {
    break;
   }
  }
 }
 $153 = HEAP32[$63>>2]|0;
 $154 = HEAP32[$7>>2]|0;
 _LoadImageEx($vararg_buffer,$6,$153,$154);
 _free($6);
 ;HEAP32[$$sroa$0>>2]=0|0;HEAP32[$$sroa$0+4>>2]=0|0;HEAP32[$$sroa$0+8>>2]=0|0;HEAP32[$$sroa$0+12>>2]=0|0;HEAP32[$$sroa$0+16>>2]=0|0;
 ;HEAP32[$$byval_copy4>>2]=HEAP32[$vararg_buffer>>2]|0;HEAP32[$$byval_copy4+4>>2]=HEAP32[$vararg_buffer+4>>2]|0;HEAP32[$$byval_copy4+8>>2]=HEAP32[$vararg_buffer+8>>2]|0;HEAP32[$$byval_copy4+12>>2]=HEAP32[$vararg_buffer+12>>2]|0;HEAP32[$$byval_copy4+16>>2]=HEAP32[$vararg_buffer+16>>2]|0;
 _LoadTextureFromImage($5,$$byval_copy4);
 ;HEAP32[$$sroa$0>>2]=HEAP32[$5>>2]|0;HEAP32[$$sroa$0+4>>2]=HEAP32[$5+4>>2]|0;HEAP32[$$sroa$0+8>>2]=HEAP32[$5+8>>2]|0;HEAP32[$$sroa$0+12>>2]=HEAP32[$5+12>>2]|0;HEAP32[$$sroa$0+16>>2]=HEAP32[$5+16>>2]|0;
 ;HEAP32[$$byval_copy4>>2]=HEAP32[$vararg_buffer>>2]|0;HEAP32[$$byval_copy4+4>>2]=HEAP32[$vararg_buffer+4>>2]|0;HEAP32[$$byval_copy4+8>>2]=HEAP32[$vararg_buffer+8>>2]|0;HEAP32[$$byval_copy4+12>>2]=HEAP32[$vararg_buffer+12>>2]|0;HEAP32[$$byval_copy4+16>>2]=HEAP32[$vararg_buffer+16>>2]|0;
 _UnloadImage($$byval_copy4);
 $155 = $$0201$lcssa << 5;
 $156 = (_malloc($155)|0);
 $157 = ($$0201$lcssa|0)>(0);
 if ($157) {
  $$021 = 0;
 } else {
  $175 = ((($156)) + 16|0);
  $176 = HEAP32[$175>>2]|0;
  _TraceLog(0,12478,$vararg_buffer1);
  ;HEAP32[$0>>2]=HEAP32[$$sroa$0>>2]|0;HEAP32[$0+4>>2]=HEAP32[$$sroa$0+4>>2]|0;HEAP32[$0+8>>2]=HEAP32[$$sroa$0+8>>2]|0;HEAP32[$0+12>>2]=HEAP32[$$sroa$0+12>>2]|0;HEAP32[$0+16>>2]=HEAP32[$$sroa$0+16>>2]|0;
  $$sroa$5$0$$sroa_idx15 = ((($0)) + 20|0);
  HEAP32[$$sroa$5$0$$sroa_idx15>>2] = $176;
  $$sroa$6$0$$sroa_idx17 = ((($0)) + 24|0);
  HEAP32[$$sroa$6$0$$sroa_idx17>>2] = $$0201$lcssa;
  $$sroa$9$0$$sroa_idx20 = ((($0)) + 28|0);
  HEAP32[$$sroa$9$0$$sroa_idx20>>2] = $156;
  STACKTOP = sp;return;
 }
 while(1) {
  $177 = (($3) + ($$021<<2)|0);
  $178 = HEAP32[$177>>2]|0;
  $179 = (($156) + ($$021<<5)|0);
  HEAP32[$179>>2] = $178;
  $180 = (((($156) + ($$021<<5)|0)) + 4|0);
  $181 = (($4) + ($$021<<4)|0);
  ;HEAP32[$180>>2]=HEAP32[$181>>2]|0;HEAP32[$180+4>>2]=HEAP32[$181+4>>2]|0;HEAP32[$180+8>>2]=HEAP32[$181+8>>2]|0;HEAP32[$180+12>>2]=HEAP32[$181+12>>2]|0;
  $182 = (((($156) + ($$021<<5)|0)) + 20|0);
  HEAP32[$182>>2] = 0;
  $183 = (((($156) + ($$021<<5)|0)) + 24|0);
  HEAP32[$183>>2] = 0;
  $184 = (((($156) + ($$021<<5)|0)) + 28|0);
  HEAP32[$184>>2] = 0;
  $185 = (($$021) + 1)|0;
  $exitcond = ($185|0)==($$0201$lcssa|0);
  if ($exitcond) {
   break;
  } else {
   $$021 = $185;
  }
 }
 $175 = ((($156)) + 16|0);
 $176 = HEAP32[$175>>2]|0;
 _TraceLog(0,12478,$vararg_buffer1);
 ;HEAP32[$0>>2]=HEAP32[$$sroa$0>>2]|0;HEAP32[$0+4>>2]=HEAP32[$$sroa$0+4>>2]|0;HEAP32[$0+8>>2]=HEAP32[$$sroa$0+8>>2]|0;HEAP32[$0+12>>2]=HEAP32[$$sroa$0+12>>2]|0;HEAP32[$0+16>>2]=HEAP32[$$sroa$0+16>>2]|0;
 $$sroa$5$0$$sroa_idx15 = ((($0)) + 20|0);
 HEAP32[$$sroa$5$0$$sroa_idx15>>2] = $176;
 $$sroa$6$0$$sroa_idx17 = ((($0)) + 24|0);
 HEAP32[$$sroa$6$0$$sroa_idx17>>2] = $$0201$lcssa;
 $$sroa$9$0$$sroa_idx20 = ((($0)) + 28|0);
 HEAP32[$$sroa$9$0$$sroa_idx20>>2] = $156;
 STACKTOP = sp;return;
}
function _UnloadSpriteFont($0) {
 $0 = $0|0;
 var $$byval_copy = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $vararg_buffer = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(64|0);
 $$byval_copy = sp + 40|0;
 $vararg_buffer = sp;
 $1 = sp + 8|0;
 $2 = HEAP32[$0>>2]|0;
 _GetDefaultFont($1);
 $3 = HEAP32[$1>>2]|0;
 $4 = ($2|0)==($3|0);
 if ($4) {
  STACKTOP = sp;return;
 }
 ;HEAP32[$$byval_copy>>2]=HEAP32[$0>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$0+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[$0+8>>2]|0;HEAP32[$$byval_copy+12>>2]=HEAP32[$0+12>>2]|0;HEAP32[$$byval_copy+16>>2]=HEAP32[$0+16>>2]|0;
 _UnloadTexture($$byval_copy);
 $5 = ((($0)) + 28|0);
 $6 = HEAP32[$5>>2]|0;
 _free($6);
 _TraceLog(3,12896,$vararg_buffer);
 STACKTOP = sp;return;
}
function _LoadTTF($0,$1,$2,$3,$4) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 $4 = $4|0;
 var $$0124130 = 0, $$0125129 = 0, $$0128 = 0, $$byval_copy9 = 0, $$sroa$0 = 0, $$sroa$10$0$$sroa_idx58 = 0, $$sroa$10$0$$sroa_idx59 = 0, $$sroa$6$0$$sroa_idx49 = 0, $$sroa$6$0$$sroa_idx50 = 0, $$sroa$7$0$$sroa_idx53 = 0, $$sroa$7$0$$sroa_idx54 = 0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $15 = 0.0, $16 = 0.0, $17 = 0.0, $18 = 0;
 var $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0;
 var $39 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0;
 var $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0.0, $70 = 0, $71 = 0.0, $72 = 0, $73 = 0, $74 = 0, $75 = 0.0;
 var $76 = 0, $77 = 0, $78 = 0, $79 = 0.0, $8 = 0.0, $80 = 0, $81 = 0, $82 = 0, $9 = 0.0, $exitcond = 0, $exp2 = 0.0, $vararg_buffer2 = 0, $vararg_buffer5 = 0, $vararg_buffer7 = 0, $vararg_ptr1 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 112|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(112|0);
 $$byval_copy9 = sp + 48|0;
 $vararg_buffer7 = sp + 40|0;
 $vararg_buffer5 = sp + 32|0;
 $vararg_buffer2 = sp + 24|0;
 $$sroa$0 = sp;
 $5 = sp + 68|0;
 $6 = sp + 88|0;
 $7 = (+($2|0));
 $8 = $7 * 3.0;
 $9 = $8 * 0.25;
 $10 = (+Math_ceil((+$9)));
 $11 = (+($3|0));
 $12 = (+Math_sqrt((+$11)));
 $13 = (+Math_ceil((+$12)));
 $14 = $10 * $13;
 $15 = (+Math_log((+$14)));
 $16 = $15 / 0.69314718246459961;
 $17 = (+Math_ceil((+$16)));
 $exp2 = (+_llvm_exp2_f32((+$17)));
 $18 = (~~(($exp2)));
 HEAP32[$$byval_copy9>>2] = $18;
 $vararg_ptr1 = ((($$byval_copy9)) + 4|0);
 HEAP32[$vararg_ptr1>>2] = $18;
 _TraceLog(0,12981,$$byval_copy9);
 $19 = (_malloc(16777216)|0);
 $20 = Math_imul($18, $18)|0;
 $21 = (_malloc($20)|0);
 $22 = ($3*20)|0;
 $23 = (_malloc($22)|0);
 ;HEAP32[$$sroa$0>>2]=0|0;HEAP32[$$sroa$0+4>>2]=0|0;HEAP32[$$sroa$0+8>>2]=0|0;HEAP32[$$sroa$0+12>>2]=0|0;HEAP32[$$sroa$0+16>>2]=0|0;
 $24 = (_fopen($1,13035)|0);
 $25 = ($24|0)==(0|0);
 if ($25) {
  HEAP32[$vararg_buffer2>>2] = $1;
  _TraceLog(2,13038,$vararg_buffer2);
  ;HEAP32[$0>>2]=HEAP32[$$sroa$0>>2]|0;HEAP32[$0+4>>2]=HEAP32[$$sroa$0+4>>2]|0;HEAP32[$0+8>>2]=HEAP32[$$sroa$0+8>>2]|0;HEAP32[$0+12>>2]=HEAP32[$$sroa$0+12>>2]|0;HEAP32[$0+16>>2]=HEAP32[$$sroa$0+16>>2]|0;
  $$sroa$6$0$$sroa_idx49 = ((($0)) + 20|0);
  HEAP32[$$sroa$6$0$$sroa_idx49>>2] = 0;
  $$sroa$7$0$$sroa_idx53 = ((($0)) + 24|0);
  HEAP32[$$sroa$7$0$$sroa_idx53>>2] = 0;
  $$sroa$10$0$$sroa_idx58 = ((($0)) + 28|0);
  HEAP32[$$sroa$10$0$$sroa_idx58>>2] = 0;
  STACKTOP = sp;return;
 }
 (_fread($19,1,16777216,$24)|0);
 $26 = HEAP32[$4>>2]|0;
 $27 = ($26|0)==(32);
 if (!($27)) {
  _TraceLog(2,13072,$vararg_buffer5);
 }
 $28 = HEAP32[$4>>2]|0;
 $29 = (_stbtt_BakeFontBitmap($19,$7,$21,$18,$18,$28,$3,$23)|0);
 $30 = ($29|0)<(0);
 if ($30) {
  _TraceLog(2,13139,$vararg_buffer7);
 }
 _free($19);
 $31 = $20 << 1;
 $32 = (_malloc($31)|0);
 $33 = ($20|0)==(0);
 if (!($33)) {
  $$0124130 = 0;$$0125129 = 0;
  while(1) {
   $41 = (($32) + ($$0124130)|0);
   HEAP8[$41>>0] = -1;
   $42 = (($21) + ($$0125129)|0);
   $43 = HEAP8[$42>>0]|0;
   $44 = $$0124130 | 1;
   $45 = (($32) + ($44)|0);
   HEAP8[$45>>0] = $43;
   $46 = (($$0125129) + 1)|0;
   $47 = (($$0124130) + 2)|0;
   $48 = ($46|0)<($20|0);
   if ($48) {
    $$0124130 = $47;$$0125129 = $46;
   } else {
    break;
   }
  }
 }
 _free($21);
 $34 = ((($5)) + 4|0);
 HEAP32[$34>>2] = $18;
 $35 = ((($5)) + 8|0);
 HEAP32[$35>>2] = $18;
 $36 = ((($5)) + 12|0);
 HEAP32[$36>>2] = 1;
 $37 = ((($5)) + 16|0);
 HEAP32[$37>>2] = 2;
 HEAP32[$5>>2] = $32;
 ;HEAP32[$$byval_copy9>>2]=HEAP32[$5>>2]|0;HEAP32[$$byval_copy9+4>>2]=HEAP32[$5+4>>2]|0;HEAP32[$$byval_copy9+8>>2]=HEAP32[$5+8>>2]|0;HEAP32[$$byval_copy9+12>>2]=HEAP32[$5+12>>2]|0;HEAP32[$$byval_copy9+16>>2]=HEAP32[$5+16>>2]|0;
 _LoadTextureFromImage($6,$$byval_copy9);
 ;HEAP32[$$sroa$0>>2]=HEAP32[$6>>2]|0;HEAP32[$$sroa$0+4>>2]=HEAP32[$6+4>>2]|0;HEAP32[$$sroa$0+8>>2]=HEAP32[$6+8>>2]|0;HEAP32[$$sroa$0+12>>2]=HEAP32[$6+12>>2]|0;HEAP32[$$sroa$0+16>>2]=HEAP32[$6+16>>2]|0;
 ;HEAP32[$$byval_copy9>>2]=HEAP32[$5>>2]|0;HEAP32[$$byval_copy9+4>>2]=HEAP32[$5+4>>2]|0;HEAP32[$$byval_copy9+8>>2]=HEAP32[$5+8>>2]|0;HEAP32[$$byval_copy9+12>>2]=HEAP32[$5+12>>2]|0;HEAP32[$$byval_copy9+16>>2]=HEAP32[$5+16>>2]|0;
 _UnloadImage($$byval_copy9);
 $38 = $3 << 5;
 $39 = (_malloc($38)|0);
 $40 = ($3|0)>(0);
 if ($40) {
  $$0128 = 0;
  while(1) {
   $49 = (($4) + ($$0128<<2)|0);
   $50 = HEAP32[$49>>2]|0;
   $51 = (($39) + ($$0128<<5)|0);
   HEAP32[$51>>2] = $50;
   $52 = (($23) + (($$0128*20)|0)|0);
   $53 = HEAP16[$52>>1]|0;
   $54 = $53&65535;
   $55 = (((($39) + ($$0128<<5)|0)) + 4|0);
   HEAP32[$55>>2] = $54;
   $56 = (((($23) + (($$0128*20)|0)|0)) + 2|0);
   $57 = HEAP16[$56>>1]|0;
   $58 = $57&65535;
   $59 = (((($39) + ($$0128<<5)|0)) + 8|0);
   HEAP32[$59>>2] = $58;
   $60 = (((($23) + (($$0128*20)|0)|0)) + 4|0);
   $61 = HEAP16[$60>>1]|0;
   $62 = $61&65535;
   $63 = (($62) - ($54))|0;
   $64 = (((($39) + ($$0128<<5)|0)) + 12|0);
   HEAP32[$64>>2] = $63;
   $65 = (((($23) + (($$0128*20)|0)|0)) + 6|0);
   $66 = HEAP16[$65>>1]|0;
   $67 = $66&65535;
   $68 = (($67) - ($58))|0;
   $69 = (((($39) + ($$0128<<5)|0)) + 16|0);
   HEAP32[$69>>2] = $68;
   $70 = (((($23) + (($$0128*20)|0)|0)) + 8|0);
   $71 = +HEAPF32[$70>>2];
   $72 = (~~(($71)));
   $73 = (((($39) + ($$0128<<5)|0)) + 20|0);
   HEAP32[$73>>2] = $72;
   $74 = (((($23) + (($$0128*20)|0)|0)) + 12|0);
   $75 = +HEAPF32[$74>>2];
   $76 = (~~(($75)));
   $77 = (((($39) + ($$0128<<5)|0)) + 24|0);
   HEAP32[$77>>2] = $76;
   $78 = (((($23) + (($$0128*20)|0)|0)) + 16|0);
   $79 = +HEAPF32[$78>>2];
   $80 = (~~(($79)));
   $81 = (((($39) + ($$0128<<5)|0)) + 28|0);
   HEAP32[$81>>2] = $80;
   $82 = (($$0128) + 1)|0;
   $exitcond = ($82|0)==($3|0);
   if ($exitcond) {
    break;
   } else {
    $$0128 = $82;
   }
  }
 }
 _free($23);
 ;HEAP32[$0>>2]=HEAP32[$$sroa$0>>2]|0;HEAP32[$0+4>>2]=HEAP32[$$sroa$0+4>>2]|0;HEAP32[$0+8>>2]=HEAP32[$$sroa$0+8>>2]|0;HEAP32[$0+12>>2]=HEAP32[$$sroa$0+12>>2]|0;HEAP32[$0+16>>2]=HEAP32[$$sroa$0+16>>2]|0;
 $$sroa$6$0$$sroa_idx50 = ((($0)) + 20|0);
 HEAP32[$$sroa$6$0$$sroa_idx50>>2] = $2;
 $$sroa$7$0$$sroa_idx54 = ((($0)) + 24|0);
 HEAP32[$$sroa$7$0$$sroa_idx54>>2] = $3;
 $$sroa$10$0$$sroa_idx59 = ((($0)) + 28|0);
 HEAP32[$$sroa$10$0$$sroa_idx59>>2] = $39;
 STACKTOP = sp;return;
}
function _stbtt_BakeFontBitmap($0,$1,$2,$3,$4,$5,$6,$7) {
 $0 = $0|0;
 $1 = +$1;
 $2 = $2|0;
 $3 = $3|0;
 $4 = $4|0;
 $5 = $5|0;
 $6 = $6|0;
 $7 = $7|0;
 var $8 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $8 = (_stbtt_BakeFontBitmap_internal($0,$1,$2,$3,$4,$5,$6,$7)|0);
 return ($8|0);
}
function _stbtt_BakeFontBitmap_internal($0,$1,$2,$3,$4,$5,$6,$7) {
 $0 = $0|0;
 $1 = +$1;
 $2 = $2|0;
 $3 = $3|0;
 $4 = $4|0;
 $5 = $5|0;
 $6 = $6|0;
 $7 = $7|0;
 var $$05 = 0, $$084$ = 0, $$0844 = 0, $$087$$091 = 0, $$0873 = 0, $$089 = 0, $$0902 = 0, $$091$ = 0, $$0911 = 0, $$1 = 0, $$2 = 0, $$286 = 0, $$293 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0;
 var $17 = 0, $18 = 0.0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0;
 var $37 = 0, $38 = 0, $39 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $50 = 0, $51 = 0.0, $52 = 0.0, $53 = 0, $54 = 0, $55 = 0.0, $56 = 0;
 var $57 = 0, $58 = 0.0, $59 = 0, $60 = 0, $61 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 144|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(144|0);
 $8 = sp + 24|0;
 $9 = sp + 20|0;
 $10 = sp + 16|0;
 $11 = sp + 12|0;
 $12 = sp + 8|0;
 $13 = sp + 4|0;
 $14 = sp;
 HEAP32[$8>>2] = 0;
 $15 = (_stbtt_InitFont($8,$0)|0);
 $16 = ($15|0)==(0);
 if ($16) {
  $$2 = -1;
  STACKTOP = sp;return ($$2|0);
 }
 $17 = Math_imul($4, $3)|0;
 _memset(($2|0),0,($17|0))|0;
 $18 = (+_stbtt_ScaleForPixelHeight($8,$1));
 $19 = ($6|0)>(0);
 if (!($19)) {
  $$2 = 1;
  STACKTOP = sp;return ($$2|0);
 }
 $$05 = 0;$$0844 = 1;$$0873 = 1;$$0902 = 0;$$0911 = 1;
 while(1) {
  $22 = (($$0902) + ($5))|0;
  $23 = (_stbtt_FindGlyphIndex($8,$22)|0);
  _stbtt_GetGlyphHMetrics($8,$23,$9,$10);
  _stbtt_GetGlyphBitmapBox($8,$23,$18,$18,$11,$12,$13,$14);
  $24 = HEAP32[$13>>2]|0;
  $25 = HEAP32[$11>>2]|0;
  $26 = (($24) - ($25))|0;
  $27 = HEAP32[$14>>2]|0;
  $28 = HEAP32[$12>>2]|0;
  $29 = (($27) - ($28))|0;
  $30 = (($$0844) + 1)|0;
  $31 = (($30) + ($26))|0;
  $32 = ($31|0)<($3|0);
  $$087$$091 = $32 ? $$0873 : $$0911;
  $$084$ = $32 ? $$0844 : 1;
  $33 = (($$087$$091) + ($29))|0;
  $34 = (($33) + 1)|0;
  $35 = ($34|0)<($4|0);
  if ($35) {
   $37 = (($$084$) + ($26))|0;
   $38 = ($37|0)<($3|0);
   if (!($38)) {
    label = 8;
    break;
   }
   $39 = (($2) + ($$084$)|0);
   $40 = Math_imul($$087$$091, $3)|0;
   $41 = (($39) + ($40)|0);
   _stbtt_MakeGlyphBitmap($8,$41,$26,$29,$3,$18,$18,$23);
   $42 = $$084$&65535;
   $43 = (($7) + (($$0902*20)|0)|0);
   HEAP16[$43>>1] = $42;
   $44 = $$087$$091&65535;
   $45 = (((($7) + (($$0902*20)|0)|0)) + 2|0);
   HEAP16[$45>>1] = $44;
   $46 = $37&65535;
   $47 = (((($7) + (($$0902*20)|0)|0)) + 4|0);
   HEAP16[$47>>1] = $46;
   $48 = $33&65535;
   $49 = (((($7) + (($$0902*20)|0)|0)) + 6|0);
   HEAP16[$49>>1] = $48;
   $50 = HEAP32[$9>>2]|0;
   $51 = (+($50|0));
   $52 = $18 * $51;
   $53 = (((($7) + (($$0902*20)|0)|0)) + 16|0);
   HEAPF32[$53>>2] = $52;
   $54 = HEAP32[$11>>2]|0;
   $55 = (+($54|0));
   $56 = (((($7) + (($$0902*20)|0)|0)) + 8|0);
   HEAPF32[$56>>2] = $55;
   $57 = HEAP32[$12>>2]|0;
   $58 = (+($57|0));
   $59 = (((($7) + (($$0902*20)|0)|0)) + 12|0);
   HEAPF32[$59>>2] = $58;
   $60 = (($37) + 1)|0;
   $61 = ($33|0)<($$0911|0);
   $$091$ = $61 ? $$0911 : $34;
   $$089 = 1;$$1 = $$05;$$286 = $60;$$293 = $$091$;
  } else {
   $36 = (0 - ($$0902))|0;
   $$089 = 0;$$1 = $36;$$286 = $$084$;$$293 = $$0911;
  }
  $21 = (($$0902) + 1)|0;
  if (!($$089)) {
   $$2 = $$1;
   label = 11;
   break;
  }
  $20 = ($21|0)<($6|0);
  if ($20) {
   $$05 = $$1;$$0844 = $$286;$$0873 = $$087$$091;$$0902 = $21;$$0911 = $$293;
  } else {
   $$2 = $$293;
   label = 11;
   break;
  }
 }
 if ((label|0) == 8) {
  ___assert_fail((13202|0),(13212|0),3274,(13238|0));
  // unreachable;
 }
 else if ((label|0) == 11) {
  STACKTOP = sp;return ($$2|0);
 }
 return (0)|0;
}
function _stbtt_InitFont($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $2 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = (_stbtt_InitFont_internal($0,$1)|0);
 return ($2|0);
}
function _stbtt_ScaleForPixelHeight($0,$1) {
 $0 = $0|0;
 $1 = +$1;
 var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0.0, $15 = 0.0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = ((($0)) + 4|0);
 $3 = HEAP32[$2>>2]|0;
 $4 = ((($0)) + 28|0);
 $5 = HEAP32[$4>>2]|0;
 $6 = (($3) + ($5)|0);
 $7 = ((($6)) + 4|0);
 $8 = (_ttSHORT($7)|0);
 $9 = $8 << 16 >> 16;
 $10 = ((($6)) + 6|0);
 $11 = (_ttSHORT($10)|0);
 $12 = $11 << 16 >> 16;
 $13 = (($9) - ($12))|0;
 $14 = (+($13|0));
 $15 = $1 / $14;
 return (+$15);
}
function _stbtt_FindGlyphIndex($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$ = 0, $$$1172 = 0, $$0163180 = 0, $$0164179 = 0, $$0165 = 0, $$0165$ph = 0, $$0168$ph = 0, $$1172$lcssa = 0, $$1172178 = 0, $$2 = 0, $$2$shrunk = 0, $$5 = 0, $$8 = 0, $$neg = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0;
 var $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0;
 var $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
 var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
 var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0;
 var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0;
 var $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0;
 var $switch = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = ((($0)) + 4|0);
 $3 = HEAP32[$2>>2]|0;
 $4 = ((($0)) + 40|0);
 $5 = HEAP32[$4>>2]|0;
 $6 = (($3) + ($5)|0);
 $7 = (_ttUSHORT($6)|0);
 switch ($7<<16>>16) {
 case 0:  {
  $8 = ((($6)) + 2|0);
  $9 = (_ttUSHORT($8)|0);
  $10 = $9&65535;
  $11 = (($10) + -6)|0;
  $12 = ($11|0)>($1|0);
  if (!($12)) {
   $$8 = 0;
   return ($$8|0);
  }
  $13 = ((($6)) + 6|0);
  $14 = (($13) + ($1)|0);
  $15 = HEAP8[$14>>0]|0;
  $16 = $15&255;
  $$8 = $16;
  return ($$8|0);
  break;
 }
 case 6:  {
  $17 = ((($6)) + 6|0);
  $18 = (_ttUSHORT($17)|0);
  $19 = $18&65535;
  $20 = ($19>>>0)>($1>>>0);
  if ($20) {
   $$8 = 0;
   return ($$8|0);
  }
  $21 = ((($6)) + 8|0);
  $22 = (_ttUSHORT($21)|0);
  $23 = $22&65535;
  $24 = (($23) + ($19))|0;
  $25 = ($24>>>0)>($1>>>0);
  if (!($25)) {
   $$8 = 0;
   return ($$8|0);
  }
  $26 = ((($6)) + 10|0);
  $27 = (($1) - ($19))|0;
  $28 = $27 << 1;
  $29 = (($26) + ($28)|0);
  $30 = (_ttUSHORT($29)|0);
  $31 = $30&65535;
  $$8 = $31;
  return ($$8|0);
  break;
 }
 case 2:  {
  ___assert_fail((13672|0),(13212|0),1347,(14014|0));
  // unreachable;
  break;
 }
 case 4:  {
  $32 = ((($6)) + 6|0);
  $33 = (_ttUSHORT($32)|0);
  $34 = ($33&65535) >>> 1;
  $35 = ($1|0)>(65535);
  if ($35) {
   $$8 = 0;
   return ($$8|0);
  }
  $36 = (($5) + 14)|0;
  $37 = ((($6)) + 12|0);
  $38 = (_ttUSHORT($37)|0);
  $39 = ((($6)) + 10|0);
  $40 = (_ttUSHORT($39)|0);
  $41 = $38 & -2;
  $42 = (($3) + ($36)|0);
  $43 = $41&65535;
  $44 = (($42) + ($43)|0);
  $45 = (_ttUSHORT($44)|0);
  $46 = $45&65535;
  $47 = ($46|0)>($1|0);
  $48 = $47 ? 0 : $43;
  $$ = (($5) + 12)|0;
  $49 = (($$) + ($48))|0;
  $50 = ($40<<16>>16)==(0);
  if ($50) {
   $$1172$lcssa = $49;
  } else {
   $51 = ((($6)) + 8|0);
   $52 = (_ttUSHORT($51)|0);
   $53 = ($52&65535) >>> 1;
   $$0163180 = $53;$$0164179 = $40;$$1172178 = $49;
   while(1) {
    $54 = ($$0163180&65535) >>> 1;
    $55 = (($3) + ($$1172178)|0);
    $56 = ($54 << 1)&65535;
    $57 = $56&65535;
    $58 = (($55) + ($57)|0);
    $59 = (_ttUSHORT($58)|0);
    $60 = $59&65535;
    $61 = ($60|0)<($1|0);
    $62 = $61 ? $57 : 0;
    $$$1172 = (($62) + ($$1172178))|0;
    $63 = (($$0164179) + -1)<<16>>16;
    $64 = ($63<<16>>16)==(0);
    if ($64) {
     $$1172$lcssa = $$$1172;
     break;
    } else {
     $$0163180 = $54;$$0164179 = $63;$$1172178 = $$$1172;
    }
   }
  }
  $$neg = (-14 - ($5))|0;
  $65 = (($$neg) + 2)|0;
  $66 = (($65) + ($$1172$lcssa))|0;
  $67 = $66 & 131070;
  $68 = (($42) + ($67)|0);
  $69 = (_ttUSHORT($68)|0);
  $70 = $69&65535;
  $71 = ($70|0)<($1|0);
  if ($71) {
   ___assert_fail((14035|0),(13212|0),1383,(14014|0));
   // unreachable;
  }
  $72 = ((($6)) + 14|0);
  $73 = $34&65535;
  $74 = ($34 << 1)&65535;
  $75 = $74&65535;
  $76 = (($72) + ($75)|0);
  $77 = ((($76)) + 2|0);
  $78 = (($77) + ($67)|0);
  $79 = (_ttUSHORT($78)|0);
  $80 = $79&65535;
  $81 = ($80|0)>($1|0);
  do {
   if ($81) {
    $$2$shrunk = 0;
   } else {
    $82 = ($73*6)|0;
    $83 = (($72) + ($82)|0);
    $84 = ((($83)) + 2|0);
    $85 = (($84) + ($67)|0);
    $86 = (_ttUSHORT($85)|0);
    $87 = ($86<<16>>16)==(0);
    if ($87) {
     $88 = $73 << 2;
     $89 = (($72) + ($88)|0);
     $90 = ((($89)) + 2|0);
     $91 = (($90) + ($67)|0);
     $92 = (_ttSHORT($91)|0);
     $93 = $92&65535;
     $94 = (($93) + ($1))|0;
     $95 = $94&65535;
     $$2$shrunk = $95;
     break;
    } else {
     $96 = $86&65535;
     $97 = (($3) + ($96)|0);
     $98 = (($1) - ($80))|0;
     $99 = $98 << 1;
     $100 = (($97) + ($99)|0);
     $101 = (($100) + ($5)|0);
     $102 = ((($101)) + 14|0);
     $103 = (($102) + ($82)|0);
     $104 = ((($103)) + 2|0);
     $105 = (($104) + ($67)|0);
     $106 = (_ttUSHORT($105)|0);
     $$2$shrunk = $106;
     break;
    }
   }
  } while(0);
  $$2 = $$2$shrunk&65535;
  $$8 = $$2;
  return ($$8|0);
  break;
 }
 default: {
  $107 = ($7<<16>>16)==(12);
  $108 = $7 & -2;
  $switch = ($108<<16>>16)==(12);
  if (!($switch)) {
   ___assert_fail((13672|0),(13212|0),1418,(14014|0));
   // unreachable;
  }
  $109 = ((($6)) + 12|0);
  $110 = (_ttULONG($109)|0);
  $111 = ((($6)) + 16|0);
  $$0165$ph = $110;$$0168$ph = 0;
  L6: while(1) {
   $$0165 = $$0165$ph;
   while(1) {
    $112 = ($$0165|0)>($$0168$ph|0);
    if (!($112)) {
     $$8 = 0;
     label = 27;
     break L6;
    }
    $113 = (($$0165) - ($$0168$ph))|0;
    $114 = $113 >> 1;
    $115 = (($114) + ($$0168$ph))|0;
    $116 = ($115*12)|0;
    $117 = (($111) + ($116)|0);
    $118 = (_ttULONG($117)|0);
    $119 = ($118>>>0)>($1>>>0);
    if ($119) {
     $$0165 = $115;
    } else {
     break;
    }
   }
   $120 = ((($117)) + 4|0);
   $121 = (_ttULONG($120)|0);
   $122 = ($121>>>0)<($1>>>0);
   $123 = (($115) + 1)|0;
   if ($122) {
    $$0165$ph = $$0165;$$0168$ph = $123;
   } else {
    break;
   }
  }
  if ((label|0) == 27) {
   return ($$8|0);
  }
  $124 = ((($117)) + 8|0);
  $125 = (_ttULONG($124)|0);
  $126 = (($1) - ($118))|0;
  $127 = $107 ? $126 : 0;
  $$5 = (($125) + ($127))|0;
  $$8 = $$5;
  return ($$8|0);
 }
 }
 return (0)|0;
}
function _stbtt_GetGlyphHMetrics($0,$1,$2,$3) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0;
 var $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0;
 var $49 = 0, $5 = 0, $50 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $4 = ((($0)) + 4|0);
 $5 = HEAP32[$4>>2]|0;
 $6 = ((($0)) + 28|0);
 $7 = HEAP32[$6>>2]|0;
 $8 = (($5) + ($7)|0);
 $9 = ((($8)) + 34|0);
 $10 = (_ttUSHORT($9)|0);
 $11 = $10&65535;
 $12 = ($11|0)>($1|0);
 $13 = ($2|0)!=(0|0);
 if ($12) {
  if ($13) {
   $14 = ((($0)) + 32|0);
   $15 = HEAP32[$14>>2]|0;
   $16 = (($5) + ($15)|0);
   $17 = $1 << 2;
   $18 = (($16) + ($17)|0);
   $19 = (_ttSHORT($18)|0);
   $20 = $19 << 16 >> 16;
   HEAP32[$2>>2] = $20;
  }
  $21 = ($3|0)==(0|0);
  if ($21) {
   return;
  }
  $22 = HEAP32[$4>>2]|0;
  $23 = ((($0)) + 32|0);
  $24 = HEAP32[$23>>2]|0;
  $25 = (($22) + ($24)|0);
  $26 = $1 << 2;
  $27 = (($25) + ($26)|0);
  $28 = ((($27)) + 2|0);
  $29 = (_ttSHORT($28)|0);
  $30 = $29 << 16 >> 16;
  HEAP32[$3>>2] = $30;
  return;
 } else {
  if ($13) {
   $31 = ((($0)) + 32|0);
   $32 = HEAP32[$31>>2]|0;
   $33 = (($5) + ($32)|0);
   $34 = $11 << 2;
   $35 = (($34) + -4)|0;
   $36 = (($33) + ($35)|0);
   $37 = (_ttSHORT($36)|0);
   $38 = $37 << 16 >> 16;
   HEAP32[$2>>2] = $38;
  }
  $39 = ($3|0)==(0|0);
  if ($39) {
   return;
  }
  $40 = HEAP32[$4>>2]|0;
  $41 = ((($0)) + 32|0);
  $42 = HEAP32[$41>>2]|0;
  $43 = (($40) + ($42)|0);
  $44 = $11 << 2;
  $45 = (($43) + ($44)|0);
  $46 = (($1) - ($11))|0;
  $47 = $46 << 1;
  $48 = (($45) + ($47)|0);
  $49 = (_ttSHORT($48)|0);
  $50 = $49 << 16 >> 16;
  HEAP32[$3>>2] = $50;
  return;
 }
}
function _stbtt_GetGlyphBitmapBox($0,$1,$2,$3,$4,$5,$6,$7) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = +$2;
 $3 = +$3;
 $4 = $4|0;
 $5 = $5|0;
 $6 = $6|0;
 $7 = $7|0;
 var label = 0, sp = 0;
 sp = STACKTOP;
 _stbtt_GetGlyphBitmapBoxSubpixel($0,$1,$2,$3,$4,$5,$6,$7);
 return;
}
function _stbtt_MakeGlyphBitmap($0,$1,$2,$3,$4,$5,$6,$7) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 $4 = $4|0;
 $5 = +$5;
 $6 = +$6;
 $7 = $7|0;
 var label = 0, sp = 0;
 sp = STACKTOP;
 _stbtt_MakeGlyphBitmapSubpixel($0,$1,$2,$3,$4,$5,$6,$7);
 return;
}
function _stbtt_MakeGlyphBitmapSubpixel($0,$1,$2,$3,$4,$5,$6,$7) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 $4 = $4|0;
 $5 = +$5;
 $6 = +$6;
 $7 = $7|0;
 var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $8 = 0, $9 = 0, $or$cond = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
 $8 = sp + 24|0;
 $9 = sp + 20|0;
 $10 = sp + 16|0;
 $11 = sp;
 $12 = (_stbtt_GetGlyphShape($0,$7,$10)|0);
 _stbtt_GetGlyphBitmapBoxSubpixel($0,$7,$5,$6,$8,$9,0,0);
 $13 = ((($11)) + 12|0);
 HEAP32[$13>>2] = $1;
 HEAP32[$11>>2] = $2;
 $14 = ((($11)) + 4|0);
 HEAP32[$14>>2] = $3;
 $15 = ((($11)) + 8|0);
 HEAP32[$15>>2] = $4;
 $16 = ($2|0)==(0);
 $17 = ($3|0)==(0);
 $or$cond = $16 | $17;
 if ($or$cond) {
  $21 = HEAP32[$10>>2]|0;
  _free($21);
  STACKTOP = sp;return;
 }
 $18 = HEAP32[$10>>2]|0;
 $19 = HEAP32[$8>>2]|0;
 $20 = HEAP32[$9>>2]|0;
 _stbtt_Rasterize($11,$18,$12,$5,$6,$19,$20);
 $21 = HEAP32[$10>>2]|0;
 _free($21);
 STACKTOP = sp;return;
}
function _stbtt_GetGlyphShape($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $$0 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $3 = ((($0)) + 56|0);
 $4 = HEAP32[$3>>2]|0;
 $5 = ($4|0)==(0);
 if ($5) {
  $6 = (_stbtt__GetGlyphShapeTT($0,$1,$2)|0);
  $$0 = $6;
  return ($$0|0);
 } else {
  $7 = (_stbtt__GetGlyphShapeT2($0,$1,$2)|0);
  $$0 = $7;
  return ($$0|0);
 }
 return (0)|0;
}
function _stbtt_GetGlyphBitmapBoxSubpixel($0,$1,$2,$3,$4,$5,$6,$7) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = +$2;
 $3 = +$3;
 $4 = $4|0;
 $5 = $5|0;
 $6 = $6|0;
 $7 = $7|0;
 var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0.0, $20 = 0.0, $21 = 0.0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0.0, $27 = 0.0, $28 = 0.0, $29 = 0;
 var $30 = 0, $31 = 0, $32 = 0.0, $33 = 0.0, $34 = 0.0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0.0, $40 = 0.0, $41 = 0.0, $42 = 0, $8 = 0, $9 = 0, $ceilf = 0.0, $ceilf1 = 0.0, $floorf = 0.0, $floorf2 = 0.0, label = 0;
 var sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $8 = sp + 12|0;
 $9 = sp + 8|0;
 $10 = sp + 4|0;
 $11 = sp;
 HEAP32[$8>>2] = 0;
 HEAP32[$9>>2] = 0;
 $12 = (_stbtt_GetGlyphBox($0,$1,$8,$9,$10,$11)|0);
 $13 = ($12|0)==(0);
 $14 = ($4|0)!=(0|0);
 if ($13) {
  if ($14) {
   HEAP32[$4>>2] = 0;
  }
  $15 = ($5|0)==(0|0);
  if (!($15)) {
   HEAP32[$5>>2] = 0;
  }
  $16 = ($6|0)==(0|0);
  if (!($16)) {
   HEAP32[$6>>2] = 0;
  }
  $17 = ($7|0)==(0|0);
  if ($17) {
   STACKTOP = sp;return;
  }
  HEAP32[$7>>2] = 0;
  STACKTOP = sp;return;
 } else {
  if ($14) {
   $18 = HEAP32[$8>>2]|0;
   $19 = (+($18|0));
   $20 = $19 * $2;
   $21 = $20 + 0.0;
   $floorf2 = (+Math_floor((+$21)));
   $22 = (~~(($floorf2)));
   HEAP32[$4>>2] = $22;
  }
  $23 = ($5|0)==(0|0);
  if (!($23)) {
   $24 = HEAP32[$11>>2]|0;
   $25 = (0 - ($24))|0;
   $26 = (+($25|0));
   $27 = $26 * $3;
   $28 = $27 + 0.0;
   $floorf = (+Math_floor((+$28)));
   $29 = (~~(($floorf)));
   HEAP32[$5>>2] = $29;
  }
  $30 = ($6|0)==(0|0);
  if (!($30)) {
   $31 = HEAP32[$10>>2]|0;
   $32 = (+($31|0));
   $33 = $32 * $2;
   $34 = $33 + 0.0;
   $ceilf1 = (+Math_ceil((+$34)));
   $35 = (~~(($ceilf1)));
   HEAP32[$6>>2] = $35;
  }
  $36 = ($7|0)==(0|0);
  if ($36) {
   STACKTOP = sp;return;
  }
  $37 = HEAP32[$9>>2]|0;
  $38 = (0 - ($37))|0;
  $39 = (+($38|0));
  $40 = $39 * $3;
  $41 = $40 + 0.0;
  $ceilf = (+Math_ceil((+$41)));
  $42 = (~~(($ceilf)));
  HEAP32[$7>>2] = $42;
  STACKTOP = sp;return;
 }
}
function _stbtt_Rasterize($0,$1,$2,$3,$4,$5,$6) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = +$3;
 $4 = +$4;
 $5 = $5|0;
 $6 = $6|0;
 var $10 = 0.0, $11 = 0.0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $7 = sp + 4|0;
 $8 = sp;
 $9 = $3 > $4;
 $10 = $9 ? $4 : $3;
 $11 = 0.34999999403953552 / $10;
 $12 = (_stbtt_FlattenCurves($1,$2,$11,$8,$7)|0);
 $13 = ($12|0)==(0|0);
 if ($13) {
  STACKTOP = sp;return;
 }
 $14 = HEAP32[$8>>2]|0;
 $15 = HEAP32[$7>>2]|0;
 _stbtt__rasterize($0,$12,$14,$15,$3,$4,$5,$6);
 _free($14);
 _free($12);
 STACKTOP = sp;return;
}
function _stbtt_FlattenCurves($0,$1,$2,$3,$4) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = +$2;
 $3 = $3|0;
 $4 = $4|0;
 var $$$0113 = 0, $$010 = 0.0, $$01079 = 0.0, $$011014 = 0, $$011113 = 0, $$011316 = 0, $$011715 = 0, $$0119 = 0, $$012012 = 0, $$1 = 0.0, $$1108 = 0.0, $$1112$lcssa = 0, $$11128 = 0, $$11185 = 0, $$1121 = 0, $$2 = 0, $$2115$lcssa = 0, $$21157 = 0, $$3116 = 0, $10 = 0;
 var $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $30 = 0;
 var $31 = 0, $32 = 0, $33 = 0, $34 = 0.0, $35 = 0, $36 = 0, $37 = 0.0, $38 = 0, $39 = 0, $40 = 0.0, $41 = 0, $42 = 0, $43 = 0.0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0.0, $49 = 0, $5 = 0;
 var $50 = 0, $51 = 0.0, $52 = 0, $53 = 0.0, $54 = 0, $55 = 0, $56 = 0.0, $57 = 0, $58 = 0.0, $59 = 0, $6 = 0.0, $60 = 0.0, $61 = 0, $62 = 0, $63 = 0.0, $64 = 0, $65 = 0, $66 = 0.0, $67 = 0, $68 = 0;
 var $69 = 0.0, $7 = 0, $70 = 0, $71 = 0, $72 = 0.0, $73 = 0, $74 = 0.0, $75 = 0, $76 = 0, $77 = 0.0, $78 = 0, $79 = 0.0, $8 = 0, $80 = 0, $81 = 0.0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0;
 var $87 = 0, $88 = 0, $89 = 0, $9 = 0, $exitcond = 0, $exitcond21 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $5 = sp;
 HEAP32[$5>>2] = 0;
 $6 = $2 * $2;
 $7 = ($1|0)>(0);
 if ($7) {
  $$011316 = 0;$$011715 = 0;
 } else {
  HEAP32[$4>>2] = 0;
  $$0119 = 0;
  STACKTOP = sp;return ($$0119|0);
 }
 while(1) {
  $8 = (((($0) + (($$011715*14)|0)|0)) + 12|0);
  $9 = HEAP8[$8>>0]|0;
  $10 = ($9<<24>>24)==(1);
  $11 = $10&1;
  $$$0113 = (($11) + ($$011316))|0;
  $12 = (($$011715) + 1)|0;
  $exitcond21 = ($12|0)==($1|0);
  if ($exitcond21) {
   break;
  } else {
   $$011316 = $$$0113;$$011715 = $12;
  }
 }
 HEAP32[$4>>2] = $$$0113;
 $13 = ($$$0113|0)==(0);
 if ($13) {
  $$0119 = 0;
  STACKTOP = sp;return ($$0119|0);
 }
 $14 = $$$0113 << 2;
 $15 = (_malloc($14)|0);
 HEAP32[$3>>2] = $15;
 $16 = ($15|0)==(0|0);
 if ($16) {
  HEAP32[$4>>2] = 0;
  $$0119 = 0;
  STACKTOP = sp;return ($$0119|0);
 }
 $17 = ($1|0)>(0);
 $$011014 = 0;$$011113 = 0;$$012012 = 0;
 while(1) {
  $18 = ($$011014|0)==(1);
  if ($18) {
   $19 = HEAP32[$5>>2]|0;
   $20 = $19 << 3;
   $21 = (_malloc($20)|0);
   $22 = ($21|0)==(0|0);
   if ($22) {
    break;
   } else {
    $$1121 = $21;
   }
  } else {
   $$1121 = $$012012;
  }
  HEAP32[$5>>2] = 0;
  L19: do {
   if ($17) {
    $$010 = 0.0;$$01079 = 0.0;$$11128 = $$011113;$$11185 = 0;$$21157 = -1;
    while(1) {
     $23 = (($0) + (($$11185*14)|0)|0);
     $24 = (((($0) + (($$11185*14)|0)|0)) + 12|0);
     $25 = HEAP8[$24>>0]|0;
     switch ($25<<24>>24) {
     case 1:  {
      $26 = ($$21157|0)>(-1);
      if ($26) {
       $27 = HEAP32[$5>>2]|0;
       $28 = (($27) - ($$11128))|0;
       $29 = HEAP32[$3>>2]|0;
       $30 = (($29) + ($$21157<<2)|0);
       HEAP32[$30>>2] = $28;
      }
      $31 = (($$21157) + 1)|0;
      $32 = HEAP32[$5>>2]|0;
      $33 = HEAP16[$23>>1]|0;
      $34 = (+($33<<16>>16));
      $35 = (((($0) + (($$11185*14)|0)|0)) + 2|0);
      $36 = HEAP16[$35>>1]|0;
      $37 = (+($36<<16>>16));
      $38 = (($32) + 1)|0;
      HEAP32[$5>>2] = $38;
      _stbtt__add_point($$1121,$32,$34,$37);
      $$1 = $37;$$1108 = $34;$$2 = $32;$$3116 = $31;
      break;
     }
     case 2:  {
      $39 = HEAP16[$23>>1]|0;
      $40 = (+($39<<16>>16));
      $41 = (((($0) + (($$11185*14)|0)|0)) + 2|0);
      $42 = HEAP16[$41>>1]|0;
      $43 = (+($42<<16>>16));
      $44 = HEAP32[$5>>2]|0;
      $45 = (($44) + 1)|0;
      HEAP32[$5>>2] = $45;
      _stbtt__add_point($$1121,$44,$40,$43);
      $$1 = $43;$$1108 = $40;$$2 = $$11128;$$3116 = $$21157;
      break;
     }
     case 3:  {
      $46 = (((($0) + (($$11185*14)|0)|0)) + 4|0);
      $47 = HEAP16[$46>>1]|0;
      $48 = (+($47<<16>>16));
      $49 = (((($0) + (($$11185*14)|0)|0)) + 6|0);
      $50 = HEAP16[$49>>1]|0;
      $51 = (+($50<<16>>16));
      $52 = HEAP16[$23>>1]|0;
      $53 = (+($52<<16>>16));
      $54 = (((($0) + (($$11185*14)|0)|0)) + 2|0);
      $55 = HEAP16[$54>>1]|0;
      $56 = (+($55<<16>>16));
      _stbtt__tesselate_curve($$1121,$5,$$01079,$$010,$48,$51,$53,$56,$6,0);
      $57 = HEAP16[$23>>1]|0;
      $58 = (+($57<<16>>16));
      $59 = HEAP16[$54>>1]|0;
      $60 = (+($59<<16>>16));
      $$1 = $60;$$1108 = $58;$$2 = $$11128;$$3116 = $$21157;
      break;
     }
     case 4:  {
      $61 = (((($0) + (($$11185*14)|0)|0)) + 4|0);
      $62 = HEAP16[$61>>1]|0;
      $63 = (+($62<<16>>16));
      $64 = (((($0) + (($$11185*14)|0)|0)) + 6|0);
      $65 = HEAP16[$64>>1]|0;
      $66 = (+($65<<16>>16));
      $67 = (((($0) + (($$11185*14)|0)|0)) + 8|0);
      $68 = HEAP16[$67>>1]|0;
      $69 = (+($68<<16>>16));
      $70 = (((($0) + (($$11185*14)|0)|0)) + 10|0);
      $71 = HEAP16[$70>>1]|0;
      $72 = (+($71<<16>>16));
      $73 = HEAP16[$23>>1]|0;
      $74 = (+($73<<16>>16));
      $75 = (((($0) + (($$11185*14)|0)|0)) + 2|0);
      $76 = HEAP16[$75>>1]|0;
      $77 = (+($76<<16>>16));
      _stbtt__tesselate_cubic($$1121,$5,$$01079,$$010,$63,$66,$69,$72,$74,$77,$6,0);
      $78 = HEAP16[$23>>1]|0;
      $79 = (+($78<<16>>16));
      $80 = HEAP16[$75>>1]|0;
      $81 = (+($80<<16>>16));
      $$1 = $81;$$1108 = $79;$$2 = $$11128;$$3116 = $$21157;
      break;
     }
     default: {
      $$1 = $$010;$$1108 = $$01079;$$2 = $$11128;$$3116 = $$21157;
     }
     }
     $82 = (($$11185) + 1)|0;
     $exitcond = ($82|0)==($1|0);
     if ($exitcond) {
      $$1112$lcssa = $$2;$$2115$lcssa = $$3116;
      break L19;
     } else {
      $$010 = $$1;$$01079 = $$1108;$$11128 = $$2;$$11185 = $82;$$21157 = $$3116;
     }
    }
   } else {
    $$1112$lcssa = $$011113;$$2115$lcssa = -1;
   }
  } while(0);
  $83 = HEAP32[$5>>2]|0;
  $84 = (($83) - ($$1112$lcssa))|0;
  $85 = HEAP32[$3>>2]|0;
  $86 = (($85) + ($$2115$lcssa<<2)|0);
  HEAP32[$86>>2] = $84;
  $87 = (($$011014) + 1)|0;
  $88 = ($87|0)<(2);
  if ($88) {
   $$011014 = $87;$$011113 = $$1112$lcssa;$$012012 = $$1121;
  } else {
   $$0119 = $$1121;
   label = 21;
   break;
  }
 }
 if ((label|0) == 21) {
  STACKTOP = sp;return ($$0119|0);
 }
 $89 = HEAP32[$3>>2]|0;
 _free($89);
 HEAP32[$3>>2] = 0;
 HEAP32[$4>>2] = 0;
 $$0119 = 0;
 STACKTOP = sp;return ($$0119|0);
}
function _stbtt__rasterize($0,$1,$2,$3,$4,$5,$6,$7) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 $4 = +$4;
 $5 = +$5;
 $6 = $6|0;
 $7 = $7|0;
 var $$0 = 0, $$0101 = 0, $$0102$lcssa = 0, $$010211 = 0, $$010410 = 0, $$01064 = 0, $$01072 = 0, $$01081 = 0, $$01081$phi = 0, $$1$lcssa = 0, $$11055 = 0, $$16 = 0, $$2$lcssa = 0, $$23 = 0, $$3 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0;
 var $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0.0, $27 = 0, $28 = 0, $29 = 0.0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0.0;
 var $35 = 0.0, $36 = 0.0, $37 = 0, $38 = 0, $39 = 0.0, $40 = 0.0, $41 = 0.0, $42 = 0, $43 = 0, $44 = 0.0, $45 = 0.0, $46 = 0.0, $47 = 0, $48 = 0, $49 = 0.0, $50 = 0.0, $51 = 0.0, $52 = 0, $53 = 0, $54 = 0;
 var $55 = 0, $56 = 0, $8 = 0.0, $9 = 0, $exitcond = 0, $exitcond16 = 0, $phitmp = 0, $phitmp17 = 0, $storemerge = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $8 = -$5;
 $9 = ($3|0)>(0);
 if ($9) {
  $$010211 = 0;$$010410 = 0;
  while(1) {
   $10 = (($2) + ($$010410<<2)|0);
   $11 = HEAP32[$10>>2]|0;
   $12 = (($11) + ($$010211))|0;
   $13 = (($$010410) + 1)|0;
   $exitcond16 = ($13|0)==($3|0);
   if ($exitcond16) {
    break;
   } else {
    $$010211 = $12;$$010410 = $13;
   }
  }
  $phitmp = ($12*20)|0;
  $phitmp17 = (($phitmp) + 20)|0;
  $$0102$lcssa = $phitmp17;
 } else {
  $$0102$lcssa = 20;
 }
 $14 = (_malloc($$0102$lcssa)|0);
 $15 = ($14|0)==(0|0);
 if ($15) {
  return;
 }
 $16 = ($3|0)>(0);
 if ($16) {
  $$01064 = 0;$$11055 = 0;$$16 = 0;
  while(1) {
   $17 = (($1) + ($$01064<<3)|0);
   $18 = (($2) + ($$11055<<2)|0);
   $19 = HEAP32[$18>>2]|0;
   $20 = (($19) + ($$01064))|0;
   $21 = ($19|0)>(0);
   if ($21) {
    $22 = (($19) + -1)|0;
    $23 = HEAP32[$18>>2]|0;
    $$01072 = 0;$$01081 = $22;$$23 = $$16;
    while(1) {
     $24 = (($17) + ($$01081<<3)|0);
     $25 = ((($24)) + 4|0);
     $26 = +HEAPF32[$25>>2];
     $27 = (($17) + ($$01072<<3)|0);
     $28 = ((($27)) + 4|0);
     $29 = +HEAPF32[$28>>2];
     $30 = $26 == $29;
     if ($30) {
      $$3 = $$23;
     } else {
      $31 = (((($14) + (($$23*20)|0)|0)) + 16|0);
      $32 = $26 > $29;
      $storemerge = $32&1;
      $$0101 = $32 ? $$01081 : $$01072;
      $$0 = $32 ? $$01072 : $$01081;
      HEAP32[$31>>2] = $storemerge;
      $33 = (($17) + ($$0101<<3)|0);
      $34 = +HEAPF32[$33>>2];
      $35 = $34 * $4;
      $36 = $35 + 0.0;
      $37 = (($14) + (($$23*20)|0)|0);
      HEAPF32[$37>>2] = $36;
      $38 = ((($33)) + 4|0);
      $39 = +HEAPF32[$38>>2];
      $40 = $39 * $8;
      $41 = $40 + 0.0;
      $42 = (((($14) + (($$23*20)|0)|0)) + 4|0);
      HEAPF32[$42>>2] = $41;
      $43 = (($17) + ($$0<<3)|0);
      $44 = +HEAPF32[$43>>2];
      $45 = $44 * $4;
      $46 = $45 + 0.0;
      $47 = (((($14) + (($$23*20)|0)|0)) + 8|0);
      HEAPF32[$47>>2] = $46;
      $48 = ((($43)) + 4|0);
      $49 = +HEAPF32[$48>>2];
      $50 = $49 * $8;
      $51 = $50 + 0.0;
      $52 = (((($14) + (($$23*20)|0)|0)) + 12|0);
      HEAPF32[$52>>2] = $51;
      $53 = (($$23) + 1)|0;
      $$3 = $53;
     }
     $54 = (($$01072) + 1)|0;
     $55 = ($54|0)<($23|0);
     if ($55) {
      $$01081$phi = $$01072;$$01072 = $54;$$23 = $$3;$$01081 = $$01081$phi;
     } else {
      $$2$lcssa = $$3;
      break;
     }
    }
   } else {
    $$2$lcssa = $$16;
   }
   $56 = (($$11055) + 1)|0;
   $exitcond = ($56|0)==($3|0);
   if ($exitcond) {
    $$1$lcssa = $$2$lcssa;
    break;
   } else {
    $$01064 = $20;$$11055 = $56;$$16 = $$2$lcssa;
   }
  }
 } else {
  $$1$lcssa = 0;
 }
 _stbtt__sort_edges($14,$$1$lcssa);
 _stbtt__rasterize_sorted_edges($0,$14,$$1$lcssa,$6,$7);
 _free($14);
 return;
}
function _stbtt__sort_edges($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var label = 0, sp = 0;
 sp = STACKTOP;
 _stbtt__sort_edges_quicksort($0,$1);
 _stbtt__sort_edges_ins_sort($0,$1);
 return;
}
function _stbtt__rasterize_sorted_edges($0,$1,$2,$3,$4) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 $4 = $4|0;
 var $$ = 0, $$010025 = 0, $$010123 = 0, $$010219 = 0.0, $$010318 = 0, $$0104 = 0, $$0105$ph15 = 0, $$026 = 0, $$1$lcssa = 0, $$116 = 0, $$sroa$0 = 0, $$sroa$0$0$$sroa$0$0$$0$1 = 0, $$sroa$0$0$$sroa$0$0$$0$1079 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0;
 var $17 = 0.0, $18 = 0.0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0.0, $26 = 0.0, $27 = 0, $28 = 0, $29 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0.0, $34 = 0, $35 = 0, $36 = 0;
 var $37 = 0.0, $38 = 0, $39 = 0, $40 = 0, $41 = 0.0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0.0, $49 = 0, $5 = 0, $50 = 0.0, $51 = 0, $52 = 0, $53 = 0, $54 = 0.0, $55 = 0;
 var $56 = 0, $57 = 0, $58 = 0, $59 = 0.0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0.0, $69 = 0.0, $7 = 0, $70 = 0, $71 = 0.0, $72 = 0.0, $73 = 0.0;
 var $74 = 0.0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0.0, $89 = 0, $9 = 0, $90 = 0.0, $91 = 0.0;
 var $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $fabsf = 0.0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 544|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(544|0);
 $5 = sp + 520|0;
 $$sroa$0 = sp + 516|0;
 $6 = sp;
 ;HEAP32[$5>>2]=0|0;HEAP32[$5+4>>2]=0|0;HEAP32[$5+8>>2]=0|0;
 HEAP32[$$sroa$0>>2] = 0;
 $7 = HEAP32[$0>>2]|0;
 $8 = ($7|0)>(64);
 if ($8) {
  $9 = $7 << 3;
  $10 = $9 | 4;
  $11 = (_malloc($10)|0);
  $$0104 = $11;
 } else {
  $$0104 = $6;
 }
 $12 = HEAP32[$0>>2]|0;
 $13 = (($$0104) + ($12<<2)|0);
 $14 = ((($0)) + 4|0);
 $15 = HEAP32[$14>>2]|0;
 $16 = (($15) + ($4))|0;
 $17 = (+($16|0));
 $18 = $17 + 1.0;
 $19 = (((($1) + (($2*20)|0)|0)) + 4|0);
 HEAPF32[$19>>2] = $18;
 $20 = HEAP32[$14>>2]|0;
 $21 = ($20|0)>(0);
 L5: do {
  if ($21) {
   $22 = ((($13)) + 4|0);
   $23 = ((($0)) + 12|0);
   $24 = ((($0)) + 8|0);
   $$010025 = $4;$$010123 = 0;$$026 = $1;
   L7: while(1) {
    $25 = (+($$010025|0));
    $26 = $25 + 1.0;
    $27 = HEAP32[$0>>2]|0;
    $28 = $27 << 2;
    _memset(($$0104|0),0,($28|0))|0;
    $29 = (($28) + 4)|0;
    _memset(($13|0),0,($29|0))|0;
    $30 = HEAP32[$$sroa$0>>2]|0;
    $31 = ($30|0)==(0|0);
    L9: do {
     if (!($31)) {
      $$0105$ph15 = $$sroa$0;$99 = $30;
      while(1) {
       $36 = $99;
       while(1) {
        $35 = ((($36)) + 24|0);
        $37 = +HEAPF32[$35>>2];
        $38 = !($37 <= $25);
        if ($38) {
         break;
        }
        $39 = HEAP32[$36>>2]|0;
        HEAP32[$$0105$ph15>>2] = $39;
        $40 = ((($36)) + 16|0);
        $41 = +HEAPF32[$40>>2];
        $42 = $41 != 0.0;
        if (!($42)) {
         label = 11;
         break L7;
        }
        HEAPF32[$40>>2] = 0.0;
        _stbtt__hheap_free($5,$36);
        $43 = HEAP32[$$0105$ph15>>2]|0;
        $44 = ($43|0)==(0|0);
        if ($44) {
         break L9;
        } else {
         $36 = $43;
        }
       }
       $45 = HEAP32[$36>>2]|0;
       $46 = ($45|0)==(0|0);
       if ($46) {
        break;
       } else {
        $$0105$ph15 = $36;$99 = $45;
       }
      }
     }
    } while(0);
    $32 = ((($$026)) + 4|0);
    $33 = +HEAPF32[$32>>2];
    $34 = !($33 <= $26);
    if ($34) {
     $$1$lcssa = $$026;
    } else {
     $$116 = $$026;$50 = $33;
     while(1) {
      $47 = ((($$116)) + 12|0);
      $48 = +HEAPF32[$47>>2];
      $49 = $50 != $48;
      if ($49) {
       $51 = (_stbtt__new_active($5,$$116,$3,$25)|0);
       $52 = ($51|0)==(0|0);
       if (!($52)) {
        $53 = ((($51)) + 24|0);
        $54 = +HEAPF32[$53>>2];
        $55 = !($54 >= $25);
        if ($55) {
         label = 17;
         break L7;
        }
        $$sroa$0$0$$sroa$0$0$$0$1 = HEAP32[$$sroa$0>>2]|0;
        HEAP32[$51>>2] = $$sroa$0$0$$sroa$0$0$$0$1;
        $56 = $51;
        HEAP32[$$sroa$0>>2] = $56;
       }
      }
      $57 = ((($$116)) + 20|0);
      $58 = ((($$116)) + 24|0);
      $59 = +HEAPF32[$58>>2];
      $60 = !($59 <= $26);
      if ($60) {
       $$1$lcssa = $57;
       break;
      } else {
       $$116 = $57;$50 = $59;
      }
     }
    }
    $$sroa$0$0$$sroa$0$0$$0$1079 = HEAP32[$$sroa$0>>2]|0;
    $61 = ($$sroa$0$0$$sroa$0$0$$0$1079|0)==(0|0);
    if (!($61)) {
     $62 = HEAP32[$0>>2]|0;
     _stbtt__fill_active_edges_new($$0104,$22,$62,$$sroa$0$0$$sroa$0$0$$0$1079,$25);
    }
    $63 = HEAP32[$0>>2]|0;
    $64 = ($63|0)>(0);
    if ($64) {
     $$010219 = 0.0;$$010318 = 0;
     while(1) {
      $67 = (($13) + ($$010318<<2)|0);
      $68 = +HEAPF32[$67>>2];
      $69 = $$010219 + $68;
      $70 = (($$0104) + ($$010318<<2)|0);
      $71 = +HEAPF32[$70>>2];
      $72 = $71 + $69;
      $fabsf = (+Math_abs((+$72)));
      $73 = $fabsf * 255.0;
      $74 = $73 + 0.5;
      $75 = (~~(($74)));
      $76 = ($75|0)<(255);
      $$ = $76 ? $75 : 255;
      $77 = $$&255;
      $78 = HEAP32[$23>>2]|0;
      $79 = HEAP32[$24>>2]|0;
      $80 = Math_imul($79, $$010123)|0;
      $81 = (($80) + ($$010318))|0;
      $82 = (($78) + ($81)|0);
      HEAP8[$82>>0] = $77;
      $83 = (($$010318) + 1)|0;
      $84 = HEAP32[$0>>2]|0;
      $85 = ($83|0)<($84|0);
      if ($85) {
       $$010219 = $69;$$010318 = $83;
      } else {
       break;
      }
     }
    }
    $65 = HEAP32[$$sroa$0>>2]|0;
    $66 = ($65|0)==(0|0);
    if (!($66)) {
     $87 = $65;
     while(1) {
      $86 = ((($87)) + 8|0);
      $88 = +HEAPF32[$86>>2];
      $89 = ((($87)) + 4|0);
      $90 = +HEAPF32[$89>>2];
      $91 = $88 + $90;
      HEAPF32[$89>>2] = $91;
      $92 = HEAP32[$87>>2]|0;
      $93 = ($92|0)==(0|0);
      if ($93) {
       break;
      } else {
       $87 = $92;
      }
     }
    }
    $94 = (($$010025) + 1)|0;
    $95 = (($$010123) + 1)|0;
    $96 = HEAP32[$14>>2]|0;
    $97 = ($95|0)<($96|0);
    if ($97) {
     $$010025 = $94;$$010123 = $95;$$026 = $$1$lcssa;
    } else {
     break L5;
    }
   }
   if ((label|0) == 11) {
    ___assert_fail((13268|0),(13212|0),2775,(13281|0));
    // unreachable;
   }
   else if ((label|0) == 17) {
    ___assert_fail((13311|0),(13212|0),2788,(13281|0));
    // unreachable;
   }
  }
 } while(0);
 _stbtt__hheap_cleanup($5);
 $98 = ($$0104|0)==($6|0);
 if ($98) {
  STACKTOP = sp;return;
 }
 _free($$0104);
 STACKTOP = sp;return;
}
function _stbtt__hheap_free($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $2 = 0, $3 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = ((($0)) + 4|0);
 $3 = HEAP32[$2>>2]|0;
 HEAP32[$1>>2] = $3;
 HEAP32[$2>>2] = $1;
 return;
}
function _stbtt__new_active($0,$1,$2,$3) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = +$3;
 var $10 = 0.0, $11 = 0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $15 = 0, $16 = 0, $17 = 0, $18 = 0.0, $19 = 0.0, $20 = 0, $21 = 0.0, $22 = 0.0, $23 = 0.0, $24 = 0.0, $25 = 0.0, $26 = 0, $27 = 0.0, $28 = 0.0, $29 = 0;
 var $30 = 0, $31 = 0, $32 = 0.0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $4 = 0, $5 = 0, $6 = 0.0, $7 = 0.0, $8 = 0.0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $4 = (_stbtt__hheap_alloc($0)|0);
 $5 = ((($1)) + 8|0);
 $6 = +HEAPF32[$5>>2];
 $7 = +HEAPF32[$1>>2];
 $8 = $6 - $7;
 $9 = ((($1)) + 12|0);
 $10 = +HEAPF32[$9>>2];
 $11 = ((($1)) + 4|0);
 $12 = +HEAPF32[$11>>2];
 $13 = $10 - $12;
 $14 = $8 / $13;
 $15 = ($4|0)==(0|0);
 if ($15) {
  ___assert_fail((13601|0),(13212|0),2374,(13617|0));
  // unreachable;
 } else {
  $16 = ((($4)) + 8|0);
  HEAPF32[$16>>2] = $14;
  $17 = $14 != 0.0;
  $18 = 1.0 / $14;
  $19 = $17 ? $18 : 0.0;
  $20 = ((($4)) + 12|0);
  HEAPF32[$20>>2] = $19;
  $21 = +HEAPF32[$1>>2];
  $22 = +HEAPF32[$11>>2];
  $23 = $3 - $22;
  $24 = $14 * $23;
  $25 = $21 + $24;
  $26 = ((($4)) + 4|0);
  $27 = (+($2|0));
  $28 = $25 - $27;
  HEAPF32[$26>>2] = $28;
  $29 = ((($1)) + 16|0);
  $30 = HEAP32[$29>>2]|0;
  $31 = ($30|0)!=(0);
  $32 = $31 ? 1.0 : -1.0;
  $33 = ((($4)) + 16|0);
  HEAPF32[$33>>2] = $32;
  $34 = ((($4)) + 20|0);
  HEAPF32[$34>>2] = $22;
  $35 = HEAP32[$9>>2]|0;
  $36 = ((($4)) + 24|0);
  HEAP32[$36>>2] = $35;
  HEAP32[$4>>2] = 0;
  return ($4|0);
 }
 return (0)|0;
}
function _stbtt__fill_active_edges_new($0,$1,$2,$3,$4) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 $4 = +$4;
 var $$0350 = 0.0, $$0351 = 0.0, $$0352 = 0.0, $$0354 = 0.0, $$0356370 = 0, $$0357 = 0.0, $$0359$lcssa = 0.0, $$0359372 = 0.0, $$0360 = 0.0, $$0361371 = 0, $$0374 = 0, $$1 = 0.0, $$1353 = 0.0, $$1355 = 0.0, $$1358 = 0.0, $10 = 0.0, $100 = 0.0, $101 = 0, $102 = 0, $103 = 0;
 var $104 = 0.0, $105 = 0.0, $106 = 0.0, $107 = 0.0, $108 = 0.0, $109 = 0.0, $11 = 0, $110 = 0.0, $111 = 0.0, $112 = 0.0, $113 = 0.0, $114 = 0.0, $115 = 0.0, $116 = 0, $117 = 0.0, $118 = 0.0, $119 = 0.0, $12 = 0, $120 = 0.0, $121 = 0;
 var $122 = 0.0, $123 = 0.0, $124 = 0.0, $125 = 0, $126 = 0.0, $127 = 0.0, $128 = 0.0, $129 = 0.0, $13 = 0.0, $130 = 0.0, $131 = 0.0, $132 = 0.0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0;
 var $140 = 0, $141 = 0, $142 = 0, $15 = 0, $16 = 0.0, $17 = 0, $18 = 0, $19 = 0.0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0.0, $25 = 0, $26 = 0.0, $27 = 0, $28 = 0.0, $29 = 0, $30 = 0, $31 = 0.0;
 var $32 = 0.0, $33 = 0.0, $34 = 0.0, $35 = 0, $36 = 0.0, $37 = 0.0, $38 = 0.0, $39 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0.0, $47 = 0, $48 = 0, $49 = 0, $5 = 0.0, $50 = 0.0;
 var $51 = 0.0, $52 = 0.0, $53 = 0.0, $54 = 0.0, $55 = 0.0, $56 = 0.0, $57 = 0.0, $58 = 0.0, $59 = 0, $6 = 0, $60 = 0.0, $61 = 0.0, $62 = 0.0, $63 = 0.0, $64 = 0, $65 = 0.0, $66 = 0.0, $67 = 0, $68 = 0.0, $69 = 0.0;
 var $7 = 0.0, $70 = 0.0, $71 = 0.0, $72 = 0.0, $73 = 0, $74 = 0, $75 = 0, $76 = 0.0, $77 = 0.0, $78 = 0.0, $79 = 0.0, $8 = 0, $80 = 0, $81 = 0.0, $82 = 0.0, $83 = 0.0, $84 = 0.0, $85 = 0.0, $86 = 0.0, $87 = 0.0;
 var $88 = 0.0, $89 = 0.0, $9 = 0, $90 = 0, $91 = 0.0, $92 = 0.0, $93 = 0.0, $94 = 0, $95 = 0.0, $96 = 0.0, $97 = 0, $98 = 0.0, $99 = 0.0, $exitcond = 0, $exitcond380 = 0, $fabsf = 0.0, $or$cond = 0, $or$cond362 = 0, $or$cond363 = 0, $or$cond364 = 0;
 var $or$cond365 = 0, $or$cond366 = 0, $or$cond367 = 0, $or$cond368 = 0, $or$cond369 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $5 = $4 + 1.0;
 $6 = ($3|0)==(0|0);
 if ($6) {
  return;
 }
 $7 = (+($2|0));
 $8 = ((($1)) + -4|0);
 $9 = ((($1)) + -4|0);
 $10 = (+($2|0));
 $11 = ($2|0)>(0);
 $$0374 = $3;
 L4: while(1) {
  $12 = ((($$0374)) + 24|0);
  $13 = +HEAPF32[$12>>2];
  $14 = !($13 >= $4);
  if ($14) {
   label = 4;
   break;
  }
  $15 = ((($$0374)) + 8|0);
  $16 = +HEAPF32[$15>>2];
  $17 = $16 == 0.0;
  $18 = ((($$0374)) + 4|0);
  $19 = +HEAPF32[$18>>2];
  do {
   if ($17) {
    $20 = $19 < $7;
    if ($20) {
     $21 = !($19 >= 0.0);
     if ($21) {
      _stbtt__handle_clipped_edge($8,0,$$0374,$19,$4,$19,$5);
      break;
     } else {
      $22 = (~~(($19)));
      _stbtt__handle_clipped_edge($0,$22,$$0374,$19,$4,$19,$5);
      $23 = (($22) + 1)|0;
      _stbtt__handle_clipped_edge($9,$23,$$0374,$19,$4,$19,$5);
      break;
     }
    }
   } else {
    $24 = $16 + $19;
    $25 = ((($$0374)) + 12|0);
    $26 = +HEAPF32[$25>>2];
    $27 = ((($$0374)) + 20|0);
    $28 = +HEAPF32[$27>>2];
    $29 = !($28 <= $5);
    if ($29) {
     label = 11;
     break L4;
    }
    $30 = $28 > $4;
    $31 = $28 - $4;
    $32 = $16 * $31;
    $33 = $19 + $32;
    $$0354 = $30 ? $28 : $4;
    $$0351 = $30 ? $33 : $19;
    $34 = +HEAPF32[$12>>2];
    $35 = $34 < $5;
    $36 = $34 - $4;
    $37 = $16 * $36;
    $38 = $19 + $37;
    $$0357 = $35 ? $34 : $5;
    $$0352 = $35 ? $38 : $24;
    $39 = $$0351 >= 0.0;
    $40 = $$0352 >= 0.0;
    $or$cond = $39 & $40;
    if ($or$cond) {
     $41 = $$0351 < $10;
     $42 = $$0352 < $10;
     $or$cond362 = $41 & $42;
     if ($or$cond362) {
      $43 = (~~(($$0351)));
      $44 = (~~(($$0352)));
      $45 = ($43|0)==($44|0);
      if ($45) {
       $46 = $$0357 - $$0354;
       $47 = ($43|0)>(-1);
       $48 = ($43|0)<($2|0);
       $or$cond363 = $47 & $48;
       if (!($or$cond363)) {
        label = 17;
        break L4;
       }
       $49 = ((($$0374)) + 16|0);
       $50 = +HEAPF32[$49>>2];
       $51 = (+($43|0));
       $52 = $$0351 - $51;
       $53 = $$0352 - $51;
       $54 = $52 + $53;
       $55 = $54 * 0.5;
       $56 = 1.0 - $55;
       $57 = $56 * $50;
       $58 = $46 * $57;
       $59 = (($0) + ($43<<2)|0);
       $60 = +HEAPF32[$59>>2];
       $61 = $60 + $58;
       HEAPF32[$59>>2] = $61;
       $62 = +HEAPF32[$49>>2];
       $63 = $46 * $62;
       $64 = (($1) + ($43<<2)|0);
       $65 = +HEAPF32[$64>>2];
       $66 = $65 + $63;
       HEAPF32[$64>>2] = $66;
       break;
      }
      $67 = $$0351 > $$0352;
      if ($67) {
       $68 = -$26;
       $69 = $$0357 - $4;
       $70 = $5 - $69;
       $71 = $$0354 - $4;
       $72 = $5 - $71;
       $$0350 = $24;$$0360 = $68;$$1 = $$0352;$$1353 = $$0351;$$1355 = $70;$$1358 = $72;
      } else {
       $$0350 = $19;$$0360 = $26;$$1 = $$0351;$$1353 = $$0352;$$1355 = $$0354;$$1358 = $$0357;
      }
      $73 = (~~(($$1)));
      $74 = (~~(($$1353)));
      $75 = (($73) + 1)|0;
      $76 = (+($75|0));
      $77 = $76 - $$0350;
      $78 = $$0360 * $77;
      $79 = $78 + $4;
      $80 = ((($$0374)) + 16|0);
      $81 = +HEAPF32[$80>>2];
      $82 = $79 - $$1355;
      $83 = $81 * $82;
      $84 = (+($73|0));
      $85 = $$1 - $84;
      $86 = $85 + 1.0;
      $87 = $86 * 0.5;
      $88 = 1.0 - $87;
      $89 = $88 * $83;
      $90 = (($0) + ($73<<2)|0);
      $91 = +HEAPF32[$90>>2];
      $92 = $91 + $89;
      HEAPF32[$90>>2] = $92;
      $93 = $$0360 * $81;
      $94 = ($74|0)>($75|0);
      if ($94) {
       $95 = $93 * 0.5;
       $$0359372 = $83;$$0361371 = $75;
       while(1) {
        $96 = $95 + $$0359372;
        $97 = (($0) + ($$0361371<<2)|0);
        $98 = +HEAPF32[$97>>2];
        $99 = $96 + $98;
        HEAPF32[$97>>2] = $99;
        $100 = $93 + $$0359372;
        $101 = (($$0361371) + 1)|0;
        $exitcond380 = ($101|0)==($74|0);
        if ($exitcond380) {
         $$0359$lcssa = $100;
         break;
        } else {
         $$0359372 = $100;$$0361371 = $101;
        }
       }
      } else {
       $$0359$lcssa = $83;
      }
      $fabsf = (+Math_abs((+$$0359$lcssa)));
      $102 = !($fabsf <= 1.0099999904632568);
      if ($102) {
       label = 25;
       break L4;
      }
      $103 = (($74) - ($75))|0;
      $104 = (+($103|0));
      $105 = $$0360 * $104;
      $106 = $105 + $79;
      $107 = (+($74|0));
      $108 = $$1353 - $107;
      $109 = $108 + 0.0;
      $110 = $109 * 0.5;
      $111 = 1.0 - $110;
      $112 = $81 * $111;
      $113 = $$1358 - $106;
      $114 = $112 * $113;
      $115 = $114 + $$0359$lcssa;
      $116 = (($0) + ($74<<2)|0);
      $117 = +HEAPF32[$116>>2];
      $118 = $115 + $117;
      HEAPF32[$116>>2] = $118;
      $119 = $$1358 - $$1355;
      $120 = $119 * $81;
      $121 = (($1) + ($74<<2)|0);
      $122 = +HEAPF32[$121>>2];
      $123 = $120 + $122;
      HEAPF32[$121>>2] = $123;
      break;
     }
    }
    if ($11) {
     $$0356370 = 0;
     while(1) {
      $124 = (+($$0356370|0));
      $125 = (($$0356370) + 1)|0;
      $126 = (+($125|0));
      $127 = $124 - $19;
      $128 = $127 / $16;
      $129 = $128 + $4;
      $130 = $126 - $19;
      $131 = $130 / $16;
      $132 = $131 + $4;
      $133 = $19 < $124;
      $134 = $24 > $126;
      $or$cond364 = $133 & $134;
      do {
       if ($or$cond364) {
        _stbtt__handle_clipped_edge($0,$$0356370,$$0374,$19,$4,$124,$129);
        _stbtt__handle_clipped_edge($0,$$0356370,$$0374,$124,$129,$126,$132);
        _stbtt__handle_clipped_edge($0,$$0356370,$$0374,$126,$132,$24,$5);
       } else {
        $135 = $24 < $124;
        $136 = $19 > $126;
        $or$cond365 = $135 & $136;
        if ($or$cond365) {
         _stbtt__handle_clipped_edge($0,$$0356370,$$0374,$19,$4,$126,$132);
         _stbtt__handle_clipped_edge($0,$$0356370,$$0374,$126,$132,$124,$129);
         _stbtt__handle_clipped_edge($0,$$0356370,$$0374,$124,$129,$24,$5);
         break;
        }
        $137 = $24 > $124;
        $or$cond366 = $133 & $137;
        if ($or$cond366) {
         _stbtt__handle_clipped_edge($0,$$0356370,$$0374,$19,$4,$124,$129);
         _stbtt__handle_clipped_edge($0,$$0356370,$$0374,$124,$129,$24,$5);
         break;
        }
        $138 = $19 > $124;
        $or$cond367 = $135 & $138;
        if ($or$cond367) {
         _stbtt__handle_clipped_edge($0,$$0356370,$$0374,$19,$4,$124,$129);
         _stbtt__handle_clipped_edge($0,$$0356370,$$0374,$124,$129,$24,$5);
         break;
        }
        $139 = $19 < $126;
        $or$cond368 = $139 & $134;
        if ($or$cond368) {
         _stbtt__handle_clipped_edge($0,$$0356370,$$0374,$19,$4,$126,$132);
         _stbtt__handle_clipped_edge($0,$$0356370,$$0374,$126,$132,$24,$5);
         break;
        }
        $140 = $24 < $126;
        $or$cond369 = $140 & $136;
        if ($or$cond369) {
         _stbtt__handle_clipped_edge($0,$$0356370,$$0374,$19,$4,$126,$132);
         _stbtt__handle_clipped_edge($0,$$0356370,$$0374,$126,$132,$24,$5);
         break;
        } else {
         _stbtt__handle_clipped_edge($0,$$0356370,$$0374,$19,$4,$24,$5);
         break;
        }
       }
      } while(0);
      $exitcond = ($125|0)==($2|0);
      if ($exitcond) {
       break;
      } else {
       $$0356370 = $125;
      }
     }
    }
   }
  } while(0);
  $141 = HEAP32[$$0374>>2]|0;
  $142 = ($141|0)==(0|0);
  if ($142) {
   label = 42;
   break;
  } else {
   $$0374 = $141;
  }
 }
 if ((label|0) == 4) {
  ___assert_fail((13331|0),(13212|0),2586,(13346|0));
  // unreachable;
 }
 else if ((label|0) == 11) {
  ___assert_fail((13375|0),(13212|0),2605,(13346|0));
  // unreachable;
 }
 else if ((label|0) == 17) {
  ___assert_fail((13411|0),(13212|0),2633,(13346|0));
  // unreachable;
 }
 else if ((label|0) == 25) {
  ___assert_fail((13429|0),(13212|0),2670,(13346|0));
  // unreachable;
 }
 else if ((label|0) == 42) {
  return;
 }
}
function _stbtt__hheap_cleanup($0) {
 $0 = $0|0;
 var $$in12 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = HEAP32[$0>>2]|0;
 $2 = ($1|0)==(0|0);
 if ($2) {
  return;
 } else {
  $$in12 = $1;
 }
 while(1) {
  $3 = HEAP32[$$in12>>2]|0;
  _free($$in12);
  $4 = ($3|0)==(0|0);
  if ($4) {
   break;
  } else {
   $$in12 = $3;
  }
 }
 return;
}
function _stbtt__handle_clipped_edge($0,$1,$2,$3,$4,$5,$6) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = +$3;
 $4 = +$4;
 $5 = +$5;
 $6 = +$6;
 var $$0 = 0.0, $$077 = 0.0, $$078 = 0.0, $$079 = 0.0, $10 = 0.0, $11 = 0, $12 = 0.0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0.0, $18 = 0.0, $19 = 0.0, $20 = 0.0, $21 = 0.0, $22 = 0.0, $23 = 0.0, $24 = 0, $25 = 0.0;
 var $26 = 0.0, $27 = 0.0, $28 = 0.0, $29 = 0.0, $30 = 0.0, $31 = 0.0, $32 = 0, $33 = 0, $34 = 0.0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0;
 var $46 = 0, $47 = 0.0, $48 = 0.0, $49 = 0.0, $50 = 0, $51 = 0.0, $52 = 0.0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $60 = 0.0, $61 = 0.0, $62 = 0.0, $63 = 0.0, $64 = 0.0, $65 = 0.0;
 var $66 = 0.0, $67 = 0.0, $68 = 0.0, $69 = 0, $7 = 0, $70 = 0.0, $71 = 0.0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond80 = 0, $or$cond81 = 0, $or$cond82 = 0, $or$cond83 = 0, $or$cond84 = 0, $or$cond85 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $7 = $4 == $6;
 if ($7) {
  return;
 }
 $8 = $4 < $6;
 if (!($8)) {
  ___assert_fail((13449|0),(13212|0),2544,(13457|0));
  // unreachable;
 }
 $9 = ((($2)) + 20|0);
 $10 = +HEAPF32[$9>>2];
 $11 = ((($2)) + 24|0);
 $12 = +HEAPF32[$11>>2];
 $13 = !($10 <= $12);
 if ($13) {
  ___assert_fail((13484|0),(13212|0),2545,(13457|0));
  // unreachable;
 }
 $14 = $12 < $4;
 $15 = $10 > $6;
 $or$cond = $15 | $14;
 if ($or$cond) {
  return;
 }
 $16 = $10 > $4;
 if ($16) {
  $17 = $5 - $3;
  $18 = $10 - $4;
  $19 = $17 * $18;
  $20 = $6 - $4;
  $21 = $19 / $20;
  $22 = $21 + $3;
  $$078 = $10;$$079 = $22;
 } else {
  $$078 = $4;$$079 = $3;
 }
 $23 = +HEAPF32[$11>>2];
 $24 = $23 < $6;
 if ($24) {
  $25 = $5 - $$079;
  $26 = $23 - $6;
  $27 = $25 * $26;
  $28 = $6 - $$078;
  $29 = $27 / $28;
  $30 = $29 + $5;
  $$0 = $23;$$077 = $30;
 } else {
  $$0 = $6;$$077 = $5;
 }
 $31 = (+($1|0));
 $32 = $$079 == $31;
 $33 = (($1) + 1)|0;
 $34 = (+($33|0));
 do {
  if ($32) {
   $35 = !($$077 <= $34);
   if ($35) {
    ___assert_fail((13499|0),(13212|0),2558,(13457|0));
    // unreachable;
   }
  } else {
   $36 = $$079 == $34;
   if ($36) {
    $37 = !($$077 >= $31);
    if (!($37)) {
     break;
    }
    ___assert_fail((13509|0),(13212|0),2560,(13457|0));
    // unreachable;
   }
   $38 = !($$079 <= $31);
   if (!($38)) {
    $39 = !($$077 <= $31);
    if (!($39)) {
     break;
    }
    ___assert_fail((13517|0),(13212|0),2562,(13457|0));
    // unreachable;
   }
   $40 = !($$079 >= $34);
   if ($40) {
    $42 = !($$077 >= $31);
    $43 = !($$077 <= $34);
    $or$cond80 = $42 | $43;
    if (!($or$cond80)) {
     break;
    }
    ___assert_fail((13535|0),(13212|0),2566,(13457|0));
    // unreachable;
   } else {
    $41 = !($$077 >= $34);
    if (!($41)) {
     break;
    }
    ___assert_fail((13525|0),(13212|0),2564,(13457|0));
    // unreachable;
   }
  }
 } while(0);
 $44 = !($$079 <= $31);
 $45 = !($$077 <= $31);
 $or$cond81 = $44 | $45;
 if (!($or$cond81)) {
  $46 = ((($2)) + 16|0);
  $47 = +HEAPF32[$46>>2];
  $48 = $$0 - $$078;
  $49 = $48 * $47;
  $50 = (($0) + ($1<<2)|0);
  $51 = +HEAPF32[$50>>2];
  $52 = $51 + $49;
  HEAPF32[$50>>2] = $52;
  return;
 }
 $53 = !($$079 >= $34);
 $54 = !($$077 >= $34);
 $or$cond82 = $53 | $54;
 if (!($or$cond82)) {
  return;
 }
 $55 = !($$079 >= $31);
 $56 = !($$079 <= $34);
 $or$cond83 = $55 | $56;
 $57 = !($$077 >= $31);
 $or$cond84 = $or$cond83 | $57;
 $58 = !($$077 <= $34);
 $or$cond85 = $58 | $or$cond84;
 if ($or$cond85) {
  ___assert_fail((13556|0),(13212|0),2573,(13457|0));
  // unreachable;
 }
 $59 = ((($2)) + 16|0);
 $60 = +HEAPF32[$59>>2];
 $61 = $$0 - $$078;
 $62 = $61 * $60;
 $63 = $$079 - $31;
 $64 = $$077 - $31;
 $65 = $63 + $64;
 $66 = $65 * 0.5;
 $67 = 1.0 - $66;
 $68 = $67 * $62;
 $69 = (($0) + ($1<<2)|0);
 $70 = +HEAPF32[$69>>2];
 $71 = $70 + $68;
 HEAPF32[$69>>2] = $71;
 return;
}
function _stbtt__hheap_alloc($0) {
 $0 = $0|0;
 var $$1 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = ((($0)) + 4|0);
 $2 = HEAP32[$1>>2]|0;
 $3 = ($2|0)==(0|0);
 if (!($3)) {
  $4 = HEAP32[$2>>2]|0;
  HEAP32[$1>>2] = $4;
  $$1 = $2;
  return ($$1|0);
 }
 $5 = ((($0)) + 8|0);
 $6 = HEAP32[$5>>2]|0;
 $7 = ($6|0)==(0);
 do {
  if ($7) {
   $8 = (_malloc(56004)|0);
   $9 = ($8|0)==(0|0);
   if ($9) {
    $$1 = 0;
    return ($$1|0);
   } else {
    $10 = HEAP32[$0>>2]|0;
    HEAP32[$8>>2] = $10;
    HEAP32[$0>>2] = $8;
    HEAP32[$5>>2] = 2000;
    break;
   }
  }
 } while(0);
 $11 = HEAP32[$5>>2]|0;
 $12 = (($11) + -1)|0;
 HEAP32[$5>>2] = $12;
 $13 = HEAP32[$0>>2]|0;
 $14 = ($12*28)|0;
 $15 = (($13) + ($14)|0);
 $$1 = $15;
 return ($$1|0);
}
function _stbtt__sort_edges_quicksort($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$079 = 0, $$081 = 0, $$08390 = 0, $$091 = 0, $$1 = 0, $$180 = 0, $$182 = 0, $$184 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0.0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0.0, $2 = 0, $20 = 0;
 var $21 = 0.0, $22 = 0, $23 = 0, $24 = 0, $25 = 0.0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $4 = 0, $5 = 0, $6 = 0.0, $7 = 0;
 var $8 = 0, $9 = 0.0, $tmp = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
 $2 = sp;
 $3 = ($1|0)>(12);
 if (!($3)) {
  STACKTOP = sp;return;
 }
 $$08390 = $1;$$091 = $0;
 while(1) {
  $4 = $$08390 >>> 1;
  $5 = ((($$091)) + 4|0);
  $6 = +HEAPF32[$5>>2];
  $7 = (($$091) + (($4*20)|0)|0);
  $8 = (((($$091) + (($4*20)|0)|0)) + 4|0);
  $9 = +HEAPF32[$8>>2];
  $10 = $6 < $9;
  $11 = (($$08390) + -1)|0;
  $12 = (((($$091) + (($11*20)|0)|0)) + 4|0);
  $13 = +HEAPF32[$12>>2];
  $14 = $9 < $13;
  $15 = $10 ^ $14;
  $16 = $6 < $13;
  $tmp = $16 ^ $14;
  $17 = $tmp ? $11 : 0;
  $18 = (($$091) + (($17*20)|0)|0);
  if ($15) {
   ;HEAP32[$2>>2]=HEAP32[$18>>2]|0;HEAP32[$2+4>>2]=HEAP32[$18+4>>2]|0;HEAP32[$2+8>>2]=HEAP32[$18+8>>2]|0;HEAP32[$2+12>>2]=HEAP32[$18+12>>2]|0;HEAP32[$2+16>>2]=HEAP32[$18+16>>2]|0;
   ;HEAP32[$18>>2]=HEAP32[$7>>2]|0;HEAP32[$18+4>>2]=HEAP32[$7+4>>2]|0;HEAP32[$18+8>>2]=HEAP32[$7+8>>2]|0;HEAP32[$18+12>>2]=HEAP32[$7+12>>2]|0;HEAP32[$18+16>>2]=HEAP32[$7+16>>2]|0;
   ;HEAP32[$7>>2]=HEAP32[$2>>2]|0;HEAP32[$7+4>>2]=HEAP32[$2+4>>2]|0;HEAP32[$7+8>>2]=HEAP32[$2+8>>2]|0;HEAP32[$7+12>>2]=HEAP32[$2+12>>2]|0;HEAP32[$7+16>>2]=HEAP32[$2+16>>2]|0;
  }
  ;HEAP32[$2>>2]=HEAP32[$$091>>2]|0;HEAP32[$2+4>>2]=HEAP32[$$091+4>>2]|0;HEAP32[$2+8>>2]=HEAP32[$$091+8>>2]|0;HEAP32[$2+12>>2]=HEAP32[$$091+12>>2]|0;HEAP32[$2+16>>2]=HEAP32[$$091+16>>2]|0;
  ;HEAP32[$$091>>2]=HEAP32[$7>>2]|0;HEAP32[$$091+4>>2]=HEAP32[$7+4>>2]|0;HEAP32[$$091+8>>2]=HEAP32[$7+8>>2]|0;HEAP32[$$091+12>>2]=HEAP32[$7+12>>2]|0;HEAP32[$$091+16>>2]=HEAP32[$7+16>>2]|0;
  ;HEAP32[$7>>2]=HEAP32[$2>>2]|0;HEAP32[$7+4>>2]=HEAP32[$2+4>>2]|0;HEAP32[$7+8>>2]=HEAP32[$2+8>>2]|0;HEAP32[$7+12>>2]=HEAP32[$2+12>>2]|0;HEAP32[$7+16>>2]=HEAP32[$2+16>>2]|0;
  $$079 = $11;$$081 = 1;
  while(1) {
   $19 = +HEAPF32[$5>>2];
   $$182 = $$081;
   while(1) {
    $20 = (((($$091) + (($$182*20)|0)|0)) + 4|0);
    $21 = +HEAPF32[$20>>2];
    $22 = $21 < $19;
    $23 = (($$182) + 1)|0;
    if ($22) {
     $$182 = $23;
    } else {
     $$180 = $$079;
     break;
    }
   }
   while(1) {
    $24 = (((($$091) + (($$180*20)|0)|0)) + 4|0);
    $25 = +HEAPF32[$24>>2];
    $26 = $19 < $25;
    $27 = (($$180) + -1)|0;
    if ($26) {
     $$180 = $27;
    } else {
     break;
    }
   }
   $28 = (($$091) + (($$182*20)|0)|0);
   $29 = ($$182|0)<($$180|0);
   if (!($29)) {
    break;
   }
   $30 = (($$091) + (($$180*20)|0)|0);
   ;HEAP32[$2>>2]=HEAP32[$28>>2]|0;HEAP32[$2+4>>2]=HEAP32[$28+4>>2]|0;HEAP32[$2+8>>2]=HEAP32[$28+8>>2]|0;HEAP32[$2+12>>2]=HEAP32[$28+12>>2]|0;HEAP32[$2+16>>2]=HEAP32[$28+16>>2]|0;
   ;HEAP32[$28>>2]=HEAP32[$30>>2]|0;HEAP32[$28+4>>2]=HEAP32[$30+4>>2]|0;HEAP32[$28+8>>2]=HEAP32[$30+8>>2]|0;HEAP32[$28+12>>2]=HEAP32[$30+12>>2]|0;HEAP32[$28+16>>2]=HEAP32[$30+16>>2]|0;
   ;HEAP32[$30>>2]=HEAP32[$2>>2]|0;HEAP32[$30+4>>2]=HEAP32[$2+4>>2]|0;HEAP32[$30+8>>2]=HEAP32[$2+8>>2]|0;HEAP32[$30+12>>2]=HEAP32[$2+12>>2]|0;HEAP32[$30+16>>2]=HEAP32[$2+16>>2]|0;
   $31 = (($$182) + 1)|0;
   $32 = (($$180) + -1)|0;
   $$079 = $32;$$081 = $31;
  }
  $33 = (($$08390) - ($$182))|0;
  $34 = ($$180|0)<($33|0);
  if ($34) {
   _stbtt__sort_edges_quicksort($$091,$$180);
   $$1 = $28;$$184 = $33;
  } else {
   _stbtt__sort_edges_quicksort($28,$33);
   $$1 = $$091;$$184 = $$180;
  }
  $35 = ($$184|0)>(12);
  if ($35) {
   $$08390 = $$184;$$091 = $$1;
  } else {
   break;
  }
 }
 STACKTOP = sp;return;
}
function _stbtt__sort_edges_ins_sort($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$03251 = 0, $$033 = 0, $$2$ph = 0, $$sroa$0$0$copyload48 = 0, $$sroa$4$0$$sroa_idx37 = 0, $$sroa$4$0$$sroa_idx38 = 0, $$sroa$4$0$copyload = 0.0, $$sroa$5 = 0, $$sroa$5$0$$sroa_idx = 0, $$sroa$5$0$$sroa_idx42 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0.0, $7 = 0;
 var $8 = 0, $9 = 0, $exitcond = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $$sroa$5 = sp;
 $2 = ($1|0)>(1);
 if (!($2)) {
  STACKTOP = sp;return;
 }
 $$03251 = 1;
 while(1) {
  $3 = (($0) + (($$03251*20)|0)|0);
  $$sroa$0$0$copyload48 = HEAP32[$3>>2]|0;
  $$sroa$4$0$$sroa_idx37 = (((($0) + (($$03251*20)|0)|0)) + 4|0);
  $$sroa$4$0$copyload = +HEAPF32[$$sroa$4$0$$sroa_idx37>>2];
  $$sroa$5$0$$sroa_idx = (((($0) + (($$03251*20)|0)|0)) + 8|0);
  ;HEAP32[$$sroa$5>>2]=HEAP32[$$sroa$5$0$$sroa_idx>>2]|0;HEAP32[$$sroa$5+4>>2]=HEAP32[$$sroa$5$0$$sroa_idx+4>>2]|0;HEAP32[$$sroa$5+8>>2]=HEAP32[$$sroa$5$0$$sroa_idx+8>>2]|0;
  $$033 = $$03251;
  while(1) {
   $4 = (($$033) + -1)|0;
   $5 = (((($0) + (($4*20)|0)|0)) + 4|0);
   $6 = +HEAPF32[$5>>2];
   $7 = $$sroa$4$0$copyload < $6;
   if (!($7)) {
    $$2$ph = $$033;
    break;
   }
   $8 = (($0) + (($4*20)|0)|0);
   $9 = (($0) + (($$033*20)|0)|0);
   ;HEAP32[$9>>2]=HEAP32[$8>>2]|0;HEAP32[$9+4>>2]=HEAP32[$8+4>>2]|0;HEAP32[$9+8>>2]=HEAP32[$8+8>>2]|0;HEAP32[$9+12>>2]=HEAP32[$8+12>>2]|0;HEAP32[$9+16>>2]=HEAP32[$8+16>>2]|0;
   $10 = ($$033|0)>(1);
   if ($10) {
    $$033 = $4;
   } else {
    $$2$ph = $4;
    break;
   }
  }
  $11 = ($$03251|0)==($$2$ph|0);
  if (!($11)) {
   $$sroa$5$0$$sroa_idx42 = (((($0) + (($$2$ph*20)|0)|0)) + 8|0);
   $$sroa$4$0$$sroa_idx38 = (((($0) + (($$2$ph*20)|0)|0)) + 4|0);
   $12 = (($0) + (($$2$ph*20)|0)|0);
   HEAP32[$12>>2] = $$sroa$0$0$copyload48;
   HEAPF32[$$sroa$4$0$$sroa_idx38>>2] = $$sroa$4$0$copyload;
   ;HEAP32[$$sroa$5$0$$sroa_idx42>>2]=HEAP32[$$sroa$5>>2]|0;HEAP32[$$sroa$5$0$$sroa_idx42+4>>2]=HEAP32[$$sroa$5+4>>2]|0;HEAP32[$$sroa$5$0$$sroa_idx42+8>>2]=HEAP32[$$sroa$5+8>>2]|0;
  }
  $13 = (($$03251) + 1)|0;
  $exitcond = ($13|0)==($1|0);
  if ($exitcond) {
   break;
  } else {
   $$03251 = $13;
  }
 }
 STACKTOP = sp;return;
}
function _stbtt__add_point($0,$1,$2,$3) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = +$2;
 $3 = +$3;
 var $4 = 0, $5 = 0, $6 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $4 = ($0|0)==(0|0);
 if ($4) {
  return;
 }
 $5 = (((($0) + ($1<<3)|0)) + 4|0);
 $6 = (($0) + ($1<<3)|0);
 HEAPF32[$6>>2] = $2;
 HEAPF32[$5>>2] = $3;
 return;
}
function _stbtt__tesselate_curve($0,$1,$2,$3,$4,$5,$6,$7,$8,$9) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = +$2;
 $3 = +$3;
 $4 = +$4;
 $5 = +$5;
 $6 = +$6;
 $7 = +$7;
 $8 = +$8;
 $9 = $9|0;
 var $$tr210 = 0.0, $$tr210$phi = 0.0, $$tr311 = 0.0, $$tr311$phi = 0.0, $$tr412 = 0.0, $$tr513 = 0.0, $$tr914 = 0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $15 = 0.0, $16 = 0.0, $17 = 0.0, $18 = 0, $19 = 0.0, $20 = 0.0, $21 = 0.0, $22 = 0.0;
 var $23 = 0.0, $24 = 0.0, $25 = 0.0, $26 = 0.0, $27 = 0.0, $28 = 0.0, $29 = 0.0, $30 = 0, $31 = 0.0, $32 = 0.0, $33 = 0.0, $34 = 0.0, $35 = 0, $36 = 0.0, $37 = 0.0, $38 = 0.0, $39 = 0.0, $40 = 0.0, $41 = 0.0, $42 = 0.0;
 var $43 = 0.0, $44 = 0.0, $45 = 0.0, $46 = 0.0, $47 = 0.0, $48 = 0.0, $49 = 0.0, $50 = 0.0, $51 = 0.0, $52 = 0.0, $53 = 0.0, $54 = 0.0, $55 = 0.0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $10 = $4 * 2.0;
 $11 = $10 + $2;
 $12 = $11 + $6;
 $13 = $12 * 0.25;
 $14 = $5 * 2.0;
 $15 = $14 + $3;
 $16 = $15 + $7;
 $17 = $16 * 0.25;
 $18 = ($9|0)>(16);
 if ($18) {
  return;
 }
 $19 = $7 + $3;
 $20 = $19 * 0.5;
 $21 = $20 - $17;
 $22 = $6 + $2;
 $23 = $22 * 0.5;
 $24 = $23 - $13;
 $$tr210 = $2;$$tr311 = $3;$$tr412 = $4;$$tr513 = $5;$$tr914 = $9;$26 = $24;$28 = $21;$36 = $13;$37 = $17;
 while(1) {
  $25 = $26 * $26;
  $27 = $28 * $28;
  $29 = $25 + $27;
  $30 = $29 > $8;
  if (!($30)) {
   break;
  }
  $31 = $$tr210 + $$tr412;
  $32 = $31 * 0.5;
  $33 = $$tr311 + $$tr513;
  $34 = $33 * 0.5;
  $35 = (($$tr914) + 1)|0;
  _stbtt__tesselate_curve($0,$1,$$tr210,$$tr311,$32,$34,$36,$37,$8,$35);
  $38 = $$tr412 + $6;
  $39 = $38 * 0.5;
  $40 = $$tr513 + $7;
  $41 = $40 * 0.5;
  $42 = $39 * 2.0;
  $43 = $36 + $42;
  $44 = $43 + $6;
  $45 = $44 * 0.25;
  $46 = $41 * 2.0;
  $47 = $37 + $46;
  $48 = $47 + $7;
  $49 = $48 * 0.25;
  $50 = $36 + $6;
  $51 = $50 * 0.5;
  $52 = $51 - $45;
  $53 = $37 + $7;
  $54 = $53 * 0.5;
  $55 = $54 - $49;
  $56 = ($$tr914|0)>(15);
  if ($56) {
   label = 6;
   break;
  } else {
   $$tr311$phi = $37;$$tr210$phi = $36;$$tr412 = $39;$$tr513 = $41;$$tr914 = $35;$26 = $52;$28 = $55;$36 = $45;$37 = $49;$$tr311 = $$tr311$phi;$$tr210 = $$tr210$phi;
  }
 }
 if ((label|0) == 6) {
  return;
 }
 $57 = HEAP32[$1>>2]|0;
 _stbtt__add_point($0,$57,$6,$7);
 $58 = HEAP32[$1>>2]|0;
 $59 = (($58) + 1)|0;
 HEAP32[$1>>2] = $59;
 return;
}
function _stbtt__tesselate_cubic($0,$1,$2,$3,$4,$5,$6,$7,$8,$9,$10,$11) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = +$2;
 $3 = +$3;
 $4 = +$4;
 $5 = +$5;
 $6 = +$6;
 $7 = +$7;
 $8 = +$8;
 $9 = +$9;
 $10 = +$10;
 $11 = $11|0;
 var $$tr138 = 0.0, $$tr139 = 0.0, $$tr140 = 0.0, $$tr141 = 0.0, $$tr142 = 0.0, $$tr143 = 0.0, $$tr147 = 0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $15 = 0.0, $16 = 0.0, $17 = 0.0, $18 = 0.0, $19 = 0.0, $20 = 0.0, $21 = 0.0, $22 = 0.0, $23 = 0.0, $24 = 0.0;
 var $25 = 0.0, $26 = 0.0, $27 = 0.0, $28 = 0.0, $29 = 0.0, $30 = 0.0, $31 = 0.0, $32 = 0.0, $33 = 0.0, $34 = 0.0, $35 = 0.0, $36 = 0.0, $37 = 0.0, $38 = 0.0, $39 = 0.0, $40 = 0.0, $41 = 0, $42 = 0.0, $43 = 0.0, $44 = 0.0;
 var $45 = 0, $46 = 0.0, $47 = 0.0, $48 = 0.0, $49 = 0.0, $50 = 0.0, $51 = 0.0, $52 = 0.0, $53 = 0.0, $54 = 0.0, $55 = 0.0, $56 = 0.0, $57 = 0.0, $58 = 0.0, $59 = 0.0, $60 = 0.0, $61 = 0.0, $62 = 0.0, $63 = 0.0, $64 = 0.0;
 var $65 = 0.0, $66 = 0.0, $67 = 0.0, $68 = 0.0, $69 = 0.0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $sqrtf = 0.0, label = 0, sp = 0;
 sp = STACKTOP;
 $$tr138 = $2;$$tr139 = $3;$$tr140 = $4;$$tr141 = $5;$$tr142 = $6;$$tr143 = $7;$$tr147 = $11;
 while(1) {
  $12 = $$tr140 - $$tr138;
  $13 = $$tr141 - $$tr139;
  $14 = $$tr142 - $$tr140;
  $15 = $$tr143 - $$tr141;
  $16 = $8 - $$tr142;
  $17 = $9 - $$tr143;
  $18 = $8 - $$tr138;
  $19 = $9 - $$tr139;
  $20 = $12 * $12;
  $21 = $13 * $13;
  $22 = $20 + $21;
  $23 = $22;
  $24 = (+Math_sqrt((+$23)));
  $25 = $14 * $14;
  $26 = $15 * $15;
  $27 = $25 + $26;
  $28 = $27;
  $29 = (+Math_sqrt((+$28)));
  $30 = $24 + $29;
  $31 = $16 * $16;
  $32 = $17 * $17;
  $33 = $31 + $32;
  $34 = $33;
  $35 = (+Math_sqrt((+$34)));
  $36 = $30 + $35;
  $37 = $36;
  $38 = $18 * $18;
  $39 = $19 * $19;
  $40 = $38 + $39;
  $sqrtf = (+Math_sqrt((+$40)));
  $41 = ($$tr147|0)>(16);
  if ($41) {
   label = 6;
   break;
  }
  $42 = $37 * $37;
  $43 = $sqrtf * $sqrtf;
  $44 = $42 - $43;
  $45 = $44 > $10;
  if (!($45)) {
   break;
  }
  $46 = $$tr138 + $$tr140;
  $47 = $46 * 0.5;
  $48 = $$tr139 + $$tr141;
  $49 = $48 * 0.5;
  $50 = $$tr140 + $$tr142;
  $51 = $50 * 0.5;
  $52 = $$tr141 + $$tr143;
  $53 = $52 * 0.5;
  $54 = $$tr142 + $8;
  $55 = $54 * 0.5;
  $56 = $$tr143 + $9;
  $57 = $56 * 0.5;
  $58 = $47 + $51;
  $59 = $58 * 0.5;
  $60 = $49 + $53;
  $61 = $60 * 0.5;
  $62 = $51 + $55;
  $63 = $62 * 0.5;
  $64 = $53 + $57;
  $65 = $64 * 0.5;
  $66 = $59 + $63;
  $67 = $66 * 0.5;
  $68 = $61 + $65;
  $69 = $68 * 0.5;
  $70 = (($$tr147) + 1)|0;
  _stbtt__tesselate_cubic($0,$1,$$tr138,$$tr139,$47,$49,$59,$61,$67,$69,$10,$70);
  $$tr138 = $67;$$tr139 = $69;$$tr140 = $63;$$tr141 = $65;$$tr142 = $55;$$tr143 = $57;$$tr147 = $70;
 }
 if ((label|0) == 6) {
  return;
 }
 $71 = HEAP32[$1>>2]|0;
 _stbtt__add_point($0,$71,$8,$9);
 $72 = HEAP32[$1>>2]|0;
 $73 = (($72) + 1)|0;
 HEAP32[$1>>2] = $73;
 return;
}
function _stbtt_GetGlyphBox($0,$1,$2,$3,$4,$5) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 $4 = $4|0;
 $5 = $5|0;
 var $$1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0;
 var $29 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $6 = ((($0)) + 56|0);
 $7 = HEAP32[$6>>2]|0;
 $8 = ($7|0)==(0);
 if (!($8)) {
  _stbtt__GetGlyphInfoT2($0,$1,$2,$3,$4,$5);
  $$1 = 1;
  return ($$1|0);
 }
 $9 = (_stbtt__GetGlyfOffset($0,$1)|0);
 $10 = ($9|0)<(0);
 if ($10) {
  $$1 = 0;
  return ($$1|0);
 }
 $11 = ($2|0)==(0|0);
 if (!($11)) {
  $12 = ((($0)) + 4|0);
  $13 = HEAP32[$12>>2]|0;
  $14 = (($13) + ($9)|0);
  $15 = ((($14)) + 2|0);
  $16 = (_ttSHORT($15)|0);
  $17 = $16 << 16 >> 16;
  HEAP32[$2>>2] = $17;
 }
 $18 = ($3|0)==(0|0);
 if (!($18)) {
  $19 = ((($0)) + 4|0);
  $20 = HEAP32[$19>>2]|0;
  $21 = (($20) + ($9)|0);
  $22 = ((($21)) + 4|0);
  $23 = (_ttSHORT($22)|0);
  $24 = $23 << 16 >> 16;
  HEAP32[$3>>2] = $24;
 }
 $25 = ($4|0)==(0|0);
 if (!($25)) {
  $26 = ((($0)) + 4|0);
  $27 = HEAP32[$26>>2]|0;
  $28 = (($27) + ($9)|0);
  $29 = ((($28)) + 6|0);
  $30 = (_ttSHORT($29)|0);
  $31 = $30 << 16 >> 16;
  HEAP32[$4>>2] = $31;
 }
 $32 = ($5|0)==(0|0);
 if ($32) {
  $$1 = 1;
  return ($$1|0);
 }
 $33 = ((($0)) + 4|0);
 $34 = HEAP32[$33>>2]|0;
 $35 = (($34) + ($9)|0);
 $36 = ((($35)) + 8|0);
 $37 = (_ttSHORT($36)|0);
 $38 = $37 << 16 >> 16;
 HEAP32[$5>>2] = $38;
 $$1 = 1;
 return ($$1|0);
}
function _stbtt__GetGlyphInfoT2($0,$1,$2,$3,$4,$5) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 $4 = $4|0;
 $5 = $5|0;
 var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, dest = 0, label = 0, sp = 0;
 var stop = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 48|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(48|0);
 $6 = sp;
 $7 = ((($6)) + 4|0);
 dest=$7; stop=dest+44|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0));
 HEAP32[$6>>2] = 1;
 $8 = (_stbtt__run_charstring($0,$1,$6)|0);
 $9 = ($2|0)==(0|0);
 $10 = ($8|0)!=(0);
 if ($9) {
  STACKTOP = sp;return;
 }
 $11 = ((($6)) + 24|0);
 $12 = HEAP32[$11>>2]|0;
 $13 = $10 ? $12 : 0;
 HEAP32[$2>>2] = $13;
 $14 = ((($6)) + 32|0);
 $15 = HEAP32[$14>>2]|0;
 $16 = $10 ? $15 : 0;
 HEAP32[$3>>2] = $16;
 $17 = ((($6)) + 28|0);
 $18 = HEAP32[$17>>2]|0;
 $19 = $10 ? $18 : 0;
 HEAP32[$4>>2] = $19;
 $20 = ((($6)) + 36|0);
 $21 = HEAP32[$20>>2]|0;
 $22 = $10 ? $21 : 0;
 HEAP32[$5>>2] = $22;
 STACKTOP = sp;return;
}
function _stbtt__GetGlyfOffset($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$023 = 0, $$024 = 0, $$pn = 0, $$sink = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0;
 var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = ((($0)) + 56|0);
 $3 = HEAP32[$2>>2]|0;
 $4 = ($3|0)==(0);
 if (!($4)) {
  ___assert_fail((13635|0),(13212|0),1440,(13651|0));
  // unreachable;
 }
 $5 = ((($0)) + 12|0);
 $6 = HEAP32[$5>>2]|0;
 $7 = ($6|0)>($1|0);
 if (!($7)) {
  $$024 = -1;
  return ($$024|0);
 }
 $8 = ((($0)) + 44|0);
 $9 = HEAP32[$8>>2]|0;
 $10 = ($9|0)>(1);
 if ($10) {
  $$024 = -1;
  return ($$024|0);
 }
 $11 = ($9|0)==(0);
 $12 = ((($0)) + 24|0);
 $13 = HEAP32[$12>>2]|0;
 $14 = ((($0)) + 4|0);
 $15 = HEAP32[$14>>2]|0;
 $16 = ((($0)) + 16|0);
 $17 = HEAP32[$16>>2]|0;
 $18 = (($15) + ($17)|0);
 if ($11) {
  $19 = $1 << 1;
  $20 = (($18) + ($19)|0);
  $21 = (_ttUSHORT($20)|0);
  $22 = $21&65535;
  $23 = $22 << 1;
  $24 = ((($20)) + 2|0);
  $25 = (_ttUSHORT($24)|0);
  $26 = $25&65535;
  $27 = $26 << 1;
  $$pn = $23;$$sink = $27;
 } else {
  $28 = $1 << 2;
  $29 = (($18) + ($28)|0);
  $30 = (_ttULONG($29)|0);
  $31 = ((($29)) + 4|0);
  $32 = (_ttULONG($31)|0);
  $$pn = $30;$$sink = $32;
 }
 $33 = (($$sink) + ($13))|0;
 $$023 = (($$pn) + ($13))|0;
 $34 = ($$023|0)==($33|0);
 $35 = $34 ? -1 : $$023;
 $$024 = $35;
 return ($$024|0);
}
function _ttSHORT($0) {
 $0 = $0|0;
 var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = HEAP8[$0>>0]|0;
 $2 = $1&255;
 $3 = $2 << 8;
 $4 = ((($0)) + 1|0);
 $5 = HEAP8[$4>>0]|0;
 $6 = $5&255;
 $7 = $3 | $6;
 $8 = $7&65535;
 return ($8|0);
}
function _ttUSHORT($0) {
 $0 = $0|0;
 var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = HEAP8[$0>>0]|0;
 $2 = $1&255;
 $3 = $2 << 8;
 $4 = ((($0)) + 1|0);
 $5 = HEAP8[$4>>0]|0;
 $6 = $5&255;
 $7 = $3 | $6;
 $8 = $7&65535;
 return ($8|0);
}
function _ttULONG($0) {
 $0 = $0|0;
 var $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = HEAP8[$0>>0]|0;
 $2 = $1&255;
 $3 = $2 << 24;
 $4 = ((($0)) + 1|0);
 $5 = HEAP8[$4>>0]|0;
 $6 = $5&255;
 $7 = $6 << 16;
 $8 = $7 | $3;
 $9 = ((($0)) + 2|0);
 $10 = HEAP8[$9>>0]|0;
 $11 = $10&255;
 $12 = $11 << 8;
 $13 = $8 | $12;
 $14 = ((($0)) + 3|0);
 $15 = HEAP8[$14>>0]|0;
 $16 = $15&255;
 $17 = $13 | $16;
 return ($17|0);
}
function _stbtt__run_charstring($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $$ = 0, $$0274$be = 0, $$0274335 = 0, $$0276$be = 0, $$0276334 = 0, $$0279 = 0.0, $$0280 = 0.0, $$0282318 = 0.0, $$0285$be = 0, $$0285333 = 0, $$0288$be = 0, $$0288332 = 0, $$0290329 = 0, $$0294$be = 0, $$0294331 = 0, $$1277 = 0, $$1283 = 0.0, $$1286 = 0, $$1291 = 0, $$2292 = 0;
 var $$3 = 0, $$3293 = 0, $$363 = 0.0, $$4 = 0, $$5327 = 0, $$6$lcssa = 0, $$6322 = 0, $$7$lcssa = 0, $$7319 = 0, $$8317 = 0, $$byval_copy1 = 0, $$lcssa = 0, $$lcssa316 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0.0, $103 = 0, $104 = 0, $105 = 0.0;
 var $106 = 0, $107 = 0.0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0.0, $113 = 0.0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0.0, $119 = 0, $12 = 0, $120 = 0, $121 = 0.0, $122 = 0, $123 = 0;
 var $124 = 0.0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0.0, $13 = 0, $130 = 0, $131 = 0.0, $132 = 0.0, $133 = 0, $134 = 0, $135 = 0, $136 = 0.0, $137 = 0, $138 = 0, $139 = 0.0, $14 = 0, $140 = 0, $141 = 0;
 var $142 = 0.0, $143 = 0, $144 = 0, $145 = 0.0, $146 = 0, $147 = 0, $148 = 0.0, $149 = 0, $15 = 0, $150 = 0, $151 = 0.0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0.0, $16 = 0;
 var $160 = 0, $161 = 0, $162 = 0.0, $163 = 0, $164 = 0, $165 = 0.0, $166 = 0, $167 = 0, $168 = 0.0, $169 = 0, $17 = 0, $170 = 0, $171 = 0.0, $172 = 0, $173 = 0, $174 = 0.0, $175 = 0, $176 = 0, $177 = 0, $178 = 0;
 var $179 = 0, $18 = 0, $180 = 0, $181 = 0.0, $182 = 0, $183 = 0.0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0.0, $189 = 0, $19 = 0, $190 = 0, $191 = 0.0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0;
 var $197 = 0, $198 = 0.0, $199 = 0, $20 = 0, $200 = 0.0, $201 = 0, $202 = 0, $203 = 0.0, $204 = 0, $205 = 0, $206 = 0.0, $207 = 0, $208 = 0, $209 = 0.0, $21 = 0, $210 = 0, $211 = 0.0, $212 = 0, $213 = 0, $214 = 0;
 var $215 = 0, $216 = 0, $217 = 0.0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0.0, $223 = 0, $224 = 0.0, $225 = 0, $226 = 0.0, $227 = 0, $228 = 0, $229 = 0.0, $23 = 0, $230 = 0, $231 = 0, $232 = 0;
 var $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0.0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0;
 var $251 = 0, $252 = 0.0, $253 = 0.0, $254 = 0.0, $255 = 0.0, $256 = 0.0, $257 = 0.0, $258 = 0.0, $259 = 0.0, $26 = 0, $260 = 0, $261 = 0.0, $262 = 0.0, $263 = 0.0, $264 = 0.0, $265 = 0.0, $266 = 0.0, $267 = 0.0, $268 = 0.0, $269 = 0.0;
 var $27 = 0, $270 = 0.0, $271 = 0.0, $272 = 0.0, $273 = 0, $274 = 0.0, $275 = 0.0, $276 = 0.0, $277 = 0.0, $278 = 0.0, $279 = 0.0, $28 = 0, $280 = 0.0, $281 = 0.0, $282 = 0.0, $283 = 0.0, $284 = 0.0, $285 = 0.0, $286 = 0, $287 = 0.0;
 var $288 = 0.0, $289 = 0.0, $29 = 0, $290 = 0.0, $291 = 0.0, $292 = 0.0, $293 = 0.0, $294 = 0.0, $295 = 0.0, $296 = 0.0, $297 = 0.0, $298 = 0.0, $299 = 0.0, $3 = 0, $30 = 0, $300 = 0.0, $301 = 0.0, $302 = 0.0, $303 = 0.0, $304 = 0.0;
 var $305 = 0.0, $306 = 0, $307 = 0.0, $308 = 0.0, $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0, $314 = 0, $315 = 0.0, $316 = 0.0, $317 = 0, $318 = 0, $319 = 0.0, $32 = 0, $320 = 0, $321 = 0, $322 = 0;
 var $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0;
 var $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0.0, $64 = 0, $65 = 0, $66 = 0.0, $67 = 0, $68 = 0, $69 = 0;
 var $7 = 0, $70 = 0.0, $71 = 0, $72 = 0, $73 = 0, $74 = 0.0, $75 = 0, $76 = 0, $77 = 0.0, $78 = 0, $79 = 0, $8 = 0, $80 = 0.0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0;
 var $88 = 0.0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0.0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0.0, $fabsf = 0.0, $fabsf296 = 0.0, $not$ = 0, $or$cond3 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 368|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(368|0);
 $$byval_copy1 = sp + 352|0;
 $3 = sp + 160|0;
 $4 = sp + 40|0;
 $5 = sp + 24|0;
 $6 = sp;
 $7 = sp + 12|0;
 $8 = ((($0)) + 84|0);
 ;HEAP32[$5>>2]=HEAP32[$8>>2]|0;HEAP32[$5+4>>2]=HEAP32[$8+4>>2]|0;HEAP32[$5+8>>2]=HEAP32[$8+8>>2]|0;
 $9 = ((($0)) + 60|0);
 ;HEAP32[$$byval_copy1>>2]=HEAP32[$9>>2]|0;HEAP32[$$byval_copy1+4>>2]=HEAP32[$9+4>>2]|0;HEAP32[$$byval_copy1+8>>2]=HEAP32[$9+8>>2]|0;
 _stbtt__cff_index_get($6,$$byval_copy1,$1);
 $10 = ((($6)) + 4|0);
 $11 = HEAP32[$10>>2]|0;
 $12 = ((($6)) + 8|0);
 $13 = HEAP32[$12>>2]|0;
 $14 = ($11|0)<($13|0);
 if (!($14)) {
  $$3 = 0;
  STACKTOP = sp;return ($$3|0);
 }
 $15 = ((($0)) + 116|0);
 $16 = ((($0)) + 72|0);
 $17 = ((($3)) + 4|0);
 $18 = ((($3)) + 8|0);
 $19 = ((($3)) + 12|0);
 $20 = ((($3)) + 16|0);
 $21 = ((($3)) + 20|0);
 $22 = ((($3)) + 24|0);
 $23 = ((($3)) + 4|0);
 $24 = ((($3)) + 8|0);
 $25 = ((($3)) + 12|0);
 $26 = ((($3)) + 16|0);
 $27 = ((($3)) + 20|0);
 $28 = ((($3)) + 24|0);
 $29 = ((($3)) + 28|0);
 $30 = ((($3)) + 32|0);
 $31 = ((($3)) + 36|0);
 $32 = ((($3)) + 40|0);
 $33 = ((($3)) + 44|0);
 $34 = ((($3)) + 4|0);
 $35 = ((($3)) + 8|0);
 $36 = ((($3)) + 12|0);
 $37 = ((($3)) + 16|0);
 $38 = ((($3)) + 20|0);
 $39 = ((($3)) + 24|0);
 $40 = ((($3)) + 28|0);
 $41 = ((($3)) + 32|0);
 $42 = ((($3)) + 4|0);
 $43 = ((($3)) + 8|0);
 $44 = ((($3)) + 12|0);
 $45 = ((($3)) + 16|0);
 $46 = ((($3)) + 20|0);
 $47 = ((($3)) + 24|0);
 $48 = ((($3)) + 28|0);
 $49 = ((($3)) + 32|0);
 $50 = ((($3)) + 36|0);
 $51 = ((($3)) + 40|0);
 $$0274335 = 1;$$0276334 = 0;$$0285333 = 0;$$0288332 = 0;$$0294331 = 0;
 L4: while(1) {
  $52 = (_stbtt__buf_get8($6)|0);
  L6: do {
   switch ($52<<24>>24) {
   case 14:  {
    label = 63;
    break L4;
    break;
   }
   case 20: case 19:  {
    $53 = ($$0274335|0)==(0);
    if ($53) {
     $$1277 = $$0276334;
    } else {
     $54 = (($$0294331|0) / 2)&-1;
     $55 = (($$0276334) + ($54))|0;
     $$1277 = $55;
    }
    $56 = (($$1277) + 7)|0;
    $57 = (($56|0) / 8)&-1;
    _stbtt__buf_skip($6,$57);
    $$0274$be = 0;$$0276$be = $$1277;$$0285$be = $$0285333;$$0288$be = $$0288332;$$0294$be = 0;
    label = 73;
    break;
   }
   case 23: case 18: case 3: case 1:  {
    $58 = (($$0294331|0) / 2)&-1;
    $59 = (($$0276334) + ($58))|0;
    $$0274$be = $$0274335;$$0276$be = $59;$$0285$be = $$0285333;$$0288$be = $$0288332;$$0294$be = 0;
    label = 73;
    break;
   }
   case 21:  {
    $60 = ($$0294331|0)<(2);
    if ($60) {
     $$3 = 0;
     label = 80;
     break L4;
    }
    $61 = (($$0294331) + -2)|0;
    $62 = (($3) + ($61<<2)|0);
    $63 = +HEAPF32[$62>>2];
    $64 = (($$0294331) + -1)|0;
    $65 = (($3) + ($64<<2)|0);
    $66 = +HEAPF32[$65>>2];
    _stbtt__csctx_rmove_to($2,$63,$66);
    $$0274$be = 0;$$0276$be = $$0276334;$$0285$be = $$0285333;$$0288$be = $$0288332;$$0294$be = 0;
    label = 73;
    break;
   }
   case 4:  {
    $67 = ($$0294331|0)<(1);
    if ($67) {
     $$3 = 0;
     label = 80;
     break L4;
    }
    $68 = (($$0294331) + -1)|0;
    $69 = (($3) + ($68<<2)|0);
    $70 = +HEAPF32[$69>>2];
    _stbtt__csctx_rmove_to($2,0.0,$70);
    $$0274$be = 0;$$0276$be = $$0276334;$$0285$be = $$0285333;$$0288$be = $$0288332;$$0294$be = 0;
    label = 73;
    break;
   }
   case 22:  {
    $71 = ($$0294331|0)<(1);
    if ($71) {
     $$3 = 0;
     label = 80;
     break L4;
    }
    $72 = (($$0294331) + -1)|0;
    $73 = (($3) + ($72<<2)|0);
    $74 = +HEAPF32[$73>>2];
    _stbtt__csctx_rmove_to($2,$74,0.0);
    $$0274$be = 0;$$0276$be = $$0276334;$$0285$be = $$0285333;$$0288$be = $$0288332;$$0294$be = 0;
    label = 73;
    break;
   }
   case 5:  {
    $75 = ($$0294331|0)<(2);
    if ($75) {
     $$3 = 0;
     label = 80;
     break L4;
    } else {
     $$0290329 = 0;$79 = 1;
    }
    while(1) {
     $76 = (($3) + ($$0290329<<2)|0);
     $77 = +HEAPF32[$76>>2];
     $78 = (($3) + ($79<<2)|0);
     $80 = +HEAPF32[$78>>2];
     _stbtt__csctx_rline_to($2,$77,$80);
     $81 = (($$0290329) + 2)|0;
     $82 = $81 | 1;
     $83 = ($82|0)<($$0294331|0);
     if ($83) {
      $$0290329 = $81;$79 = $82;
     } else {
      $$0274$be = $$0274335;$$0276$be = $$0276334;$$0285$be = $$0285333;$$0288$be = $$0288332;$$0294$be = 0;
      label = 73;
      break;
     }
    }
    break;
   }
   case 7:  {
    $84 = ($$0294331|0)<(1);
    if ($84) {
     $$3 = 0;
     label = 80;
     break L4;
    } else {
     $$2292 = 0;
     label = 20;
    }
    break;
   }
   case 6:  {
    $85 = ($$0294331|0)<(1);
    if ($85) {
     $$3 = 0;
     label = 80;
     break L4;
    } else {
     $$1291 = 0;
     label = 18;
    }
    break;
   }
   case 31:  {
    $94 = ($$0294331|0)<(4);
    if ($94) {
     $$3 = 0;
     label = 80;
     break L4;
    } else {
     $$4 = 0;
     label = 28;
    }
    break;
   }
   case 30:  {
    $95 = ($$0294331|0)<(4);
    if ($95) {
     $$3 = 0;
     label = 80;
     break L4;
    } else {
     $$3293 = 0;
     label = 24;
    }
    break;
   }
   case 8:  {
    $134 = ($$0294331|0)<(6);
    if ($134) {
     $$3 = 0;
     label = 80;
     break L4;
    } else {
     $$5327 = 0;$150 = 5;
    }
    while(1) {
     $135 = (($3) + ($$5327<<2)|0);
     $136 = +HEAPF32[$135>>2];
     $137 = $$5327 | 1;
     $138 = (($3) + ($137<<2)|0);
     $139 = +HEAPF32[$138>>2];
     $140 = (($$5327) + 2)|0;
     $141 = (($3) + ($140<<2)|0);
     $142 = +HEAPF32[$141>>2];
     $143 = (($$5327) + 3)|0;
     $144 = (($3) + ($143<<2)|0);
     $145 = +HEAPF32[$144>>2];
     $146 = (($$5327) + 4)|0;
     $147 = (($3) + ($146<<2)|0);
     $148 = +HEAPF32[$147>>2];
     $149 = (($3) + ($150<<2)|0);
     $151 = +HEAPF32[$149>>2];
     _stbtt__csctx_rccurve_to($2,$136,$139,$142,$145,$148,$151);
     $152 = (($$5327) + 6)|0;
     $153 = (($$5327) + 11)|0;
     $154 = ($153|0)<($$0294331|0);
     if ($154) {
      $$5327 = $152;$150 = $153;
     } else {
      $$0274$be = $$0274335;$$0276$be = $$0276334;$$0285$be = $$0285333;$$0288$be = $$0288332;$$0294$be = 0;
      label = 73;
      break;
     }
    }
    break;
   }
   case 24:  {
    $155 = ($$0294331|0)<(8);
    if ($155) {
     $$3 = 0;
     label = 80;
     break L4;
    }
    $156 = (($$0294331) + -2)|0;
    $157 = ($156|0)>(5);
    if ($157) {
     $$6322 = 0;$161 = 1;$173 = 5;
     while(1) {
      $158 = (($3) + ($$6322<<2)|0);
      $159 = +HEAPF32[$158>>2];
      $160 = (($3) + ($161<<2)|0);
      $162 = +HEAPF32[$160>>2];
      $163 = (($$6322) + 2)|0;
      $164 = (($3) + ($163<<2)|0);
      $165 = +HEAPF32[$164>>2];
      $166 = (($$6322) + 3)|0;
      $167 = (($3) + ($166<<2)|0);
      $168 = +HEAPF32[$167>>2];
      $169 = (($$6322) + 4)|0;
      $170 = (($3) + ($169<<2)|0);
      $171 = +HEAPF32[$170>>2];
      $172 = (($3) + ($173<<2)|0);
      $174 = +HEAPF32[$172>>2];
      _stbtt__csctx_rccurve_to($2,$159,$162,$165,$168,$171,$174);
      $175 = (($$6322) + 6)|0;
      $176 = (($$6322) + 11)|0;
      $177 = ($176|0)<($156|0);
      $178 = $175 | 1;
      if ($177) {
       $$6322 = $175;$161 = $178;$173 = $176;
      } else {
       $$6$lcssa = $175;$$lcssa316 = $178;
       break;
      }
     }
    } else {
     $$6$lcssa = 0;$$lcssa316 = 1;
    }
    $179 = ($$lcssa316|0)<($$0294331|0);
    if (!($179)) {
     $$3 = 0;
     label = 80;
     break L4;
    }
    $180 = (($3) + ($$6$lcssa<<2)|0);
    $181 = +HEAPF32[$180>>2];
    $182 = (($3) + ($$lcssa316<<2)|0);
    $183 = +HEAPF32[$182>>2];
    _stbtt__csctx_rline_to($2,$181,$183);
    $$0274$be = $$0274335;$$0276$be = $$0276334;$$0285$be = $$0285333;$$0288$be = $$0288332;$$0294$be = 0;
    label = 73;
    break;
   }
   case 25:  {
    $184 = ($$0294331|0)<(8);
    if ($184) {
     $$3 = 0;
     label = 80;
     break L4;
    }
    $185 = (($$0294331) + -6)|0;
    $186 = ($185|0)>(1);
    if ($186) {
     $$7319 = 0;$190 = 1;
     while(1) {
      $187 = (($3) + ($$7319<<2)|0);
      $188 = +HEAPF32[$187>>2];
      $189 = (($3) + ($190<<2)|0);
      $191 = +HEAPF32[$189>>2];
      _stbtt__csctx_rline_to($2,$188,$191);
      $192 = (($$7319) + 2)|0;
      $193 = $192 | 1;
      $194 = ($193|0)<($185|0);
      if ($194) {
       $$7319 = $192;$190 = $193;
      } else {
       $$7$lcssa = $192;$$lcssa = $193;
       break;
      }
     }
    } else {
     $$7$lcssa = 0;$$lcssa = 1;
    }
    $195 = (($$7$lcssa) + 5)|0;
    $196 = ($195|0)<($$0294331|0);
    if (!($196)) {
     $$3 = 0;
     label = 80;
     break L4;
    }
    $197 = (($3) + ($$7$lcssa<<2)|0);
    $198 = +HEAPF32[$197>>2];
    $199 = (($3) + ($$lcssa<<2)|0);
    $200 = +HEAPF32[$199>>2];
    $201 = (($$7$lcssa) + 2)|0;
    $202 = (($3) + ($201<<2)|0);
    $203 = +HEAPF32[$202>>2];
    $204 = (($$7$lcssa) + 3)|0;
    $205 = (($3) + ($204<<2)|0);
    $206 = +HEAPF32[$205>>2];
    $207 = (($$7$lcssa) + 4)|0;
    $208 = (($3) + ($207<<2)|0);
    $209 = +HEAPF32[$208>>2];
    $210 = (($3) + ($195<<2)|0);
    $211 = +HEAPF32[$210>>2];
    _stbtt__csctx_rccurve_to($2,$198,$200,$203,$206,$209,$211);
    $$0274$be = $$0274335;$$0276$be = $$0276334;$$0285$be = $$0285333;$$0288$be = $$0288332;$$0294$be = 0;
    label = 73;
    break;
   }
   case 27: case 26:  {
    $212 = ($$0294331|0)<(4);
    if ($212) {
     $$3 = 0;
     label = 80;
     break L4;
    }
    $213 = $$0294331 & 1;
    $214 = ($213|0)==(0);
    $215 = (($213) + 3)|0;
    $216 = ($215|0)<($$0294331|0);
    if ($216) {
     $not$ = $214 ^ 1;
     $$ = $not$&1;
     $217 = +HEAPF32[$3>>2];
     $$363 = $214 ? 0.0 : $217;
     $218 = ($52<<24>>24)==(27);
     $$0282318 = $$363;$$8317 = $$;$228 = $215;
     while(1) {
      $219 = (($$8317) + 2)|0;
      $220 = (($$8317) + 1)|0;
      $221 = (($3) + ($219<<2)|0);
      $222 = +HEAPF32[$221>>2];
      $223 = (($3) + ($$8317<<2)|0);
      $224 = +HEAPF32[$223>>2];
      $225 = (($3) + ($220<<2)|0);
      $226 = +HEAPF32[$225>>2];
      $227 = (($3) + ($228<<2)|0);
      $229 = +HEAPF32[$227>>2];
      if ($218) {
       _stbtt__csctx_rccurve_to($2,$224,$$0282318,$226,$222,$229,0.0);
      } else {
       _stbtt__csctx_rccurve_to($2,$$0282318,$224,$226,$222,0.0,$229);
      }
      $230 = (($$8317) + 4)|0;
      $231 = (($$8317) + 7)|0;
      $232 = ($231|0)<($$0294331|0);
      if ($232) {
       $$0282318 = 0.0;$$8317 = $230;$228 = $231;
      } else {
       $$0274$be = $$0274335;$$0276$be = $$0276334;$$0285$be = $$0285333;$$0288$be = $$0288332;$$0294$be = 0;
       label = 73;
       break;
      }
     }
    } else {
     $$0274$be = $$0274335;$$0276$be = $$0276334;$$0285$be = $$0285333;$$0288$be = $$0288332;$$0294$be = 0;
     label = 73;
    }
    break;
   }
   case 10:  {
    $233 = ($$0285333|0)==(0);
    if ($233) {
     $234 = HEAP32[$15>>2]|0;
     $235 = ($234|0)==(0);
     if ($235) {
      $$1286 = 1;
      label = 54;
     } else {
      _stbtt__cid_get_glyph_subrs($5,$0,$1);
      $$1286 = 1;
      label = 54;
     }
    } else {
     $$1286 = $$0285333;
     label = 54;
    }
    break;
   }
   case 29:  {
    $$1286 = $$0285333;
    label = 54;
    break;
   }
   case 11:  {
    $247 = ($$0288332|0)<(1);
    if ($247) {
     $$3 = 0;
     label = 80;
     break L4;
    }
    $248 = (($$0288332) + -1)|0;
    $249 = (($4) + (($248*12)|0)|0);
    ;HEAP32[$6>>2]=HEAP32[$249>>2]|0;HEAP32[$6+4>>2]=HEAP32[$249+4>>2]|0;HEAP32[$6+8>>2]=HEAP32[$249+8>>2]|0;
    $$0274$be = $$0274335;$$0276$be = $$0276334;$$0285$be = $$0285333;$$0288$be = $248;$$0294$be = $$0294331;
    label = 73;
    break;
   }
   case 12:  {
    $250 = (_stbtt__buf_get8($6)|0);
    switch ($250<<24>>24) {
    case 34:  {
     $251 = ($$0294331|0)<(7);
     if ($251) {
      $$3 = 0;
      label = 80;
      break L4;
     }
     $252 = +HEAPF32[$3>>2];
     $253 = +HEAPF32[$17>>2];
     $254 = +HEAPF32[$18>>2];
     $255 = +HEAPF32[$19>>2];
     $256 = +HEAPF32[$20>>2];
     $257 = +HEAPF32[$21>>2];
     $258 = +HEAPF32[$22>>2];
     _stbtt__csctx_rccurve_to($2,$252,0.0,$253,$254,$255,0.0);
     $259 = -$254;
     _stbtt__csctx_rccurve_to($2,$256,0.0,$257,$259,$258,0.0);
     $$0274$be = $$0274335;$$0276$be = $$0276334;$$0285$be = $$0285333;$$0288$be = $$0288332;$$0294$be = 0;
     label = 73;
     break L6;
     break;
    }
    case 35:  {
     $260 = ($$0294331|0)<(13);
     if ($260) {
      $$3 = 0;
      label = 80;
      break L4;
     }
     $261 = +HEAPF32[$3>>2];
     $262 = +HEAPF32[$23>>2];
     $263 = +HEAPF32[$24>>2];
     $264 = +HEAPF32[$25>>2];
     $265 = +HEAPF32[$26>>2];
     $266 = +HEAPF32[$27>>2];
     $267 = +HEAPF32[$28>>2];
     $268 = +HEAPF32[$29>>2];
     $269 = +HEAPF32[$30>>2];
     $270 = +HEAPF32[$31>>2];
     $271 = +HEAPF32[$32>>2];
     $272 = +HEAPF32[$33>>2];
     _stbtt__csctx_rccurve_to($2,$261,$262,$263,$264,$265,$266);
     _stbtt__csctx_rccurve_to($2,$267,$268,$269,$270,$271,$272);
     $$0274$be = $$0274335;$$0276$be = $$0276334;$$0285$be = $$0285333;$$0288$be = $$0288332;$$0294$be = 0;
     label = 73;
     break L6;
     break;
    }
    case 36:  {
     $273 = ($$0294331|0)<(9);
     if ($273) {
      $$3 = 0;
      label = 80;
      break L4;
     }
     $274 = +HEAPF32[$3>>2];
     $275 = +HEAPF32[$34>>2];
     $276 = +HEAPF32[$35>>2];
     $277 = +HEAPF32[$36>>2];
     $278 = +HEAPF32[$37>>2];
     $279 = +HEAPF32[$38>>2];
     $280 = +HEAPF32[$39>>2];
     $281 = +HEAPF32[$40>>2];
     $282 = +HEAPF32[$41>>2];
     _stbtt__csctx_rccurve_to($2,$274,$275,$276,$277,$278,0.0);
     $283 = $275 + $277;
     $284 = $283 + $281;
     $285 = -$284;
     _stbtt__csctx_rccurve_to($2,$279,0.0,$280,$281,$282,$285);
     $$0274$be = $$0274335;$$0276$be = $$0276334;$$0285$be = $$0285333;$$0288$be = $$0288332;$$0294$be = 0;
     label = 73;
     break L6;
     break;
    }
    case 37:  {
     $286 = ($$0294331|0)<(11);
     if ($286) {
      $$3 = 0;
      label = 80;
      break L4;
     }
     $287 = +HEAPF32[$3>>2];
     $288 = +HEAPF32[$42>>2];
     $289 = +HEAPF32[$43>>2];
     $290 = +HEAPF32[$44>>2];
     $291 = +HEAPF32[$45>>2];
     $292 = +HEAPF32[$46>>2];
     $293 = +HEAPF32[$47>>2];
     $294 = +HEAPF32[$48>>2];
     $295 = +HEAPF32[$49>>2];
     $296 = +HEAPF32[$50>>2];
     $297 = +HEAPF32[$51>>2];
     $298 = $287 + $289;
     $299 = $298 + $291;
     $300 = $299 + $293;
     $301 = $300 + $295;
     $302 = $288 + $290;
     $303 = $302 + $292;
     $304 = $303 + $294;
     $305 = $304 + $296;
     $fabsf = (+Math_abs((+$301)));
     $fabsf296 = (+Math_abs((+$305)));
     $306 = $fabsf > $fabsf296;
     $307 = -$305;
     $308 = -$301;
     $$0280 = $306 ? $297 : $308;
     $$0279 = $306 ? $307 : $297;
     _stbtt__csctx_rccurve_to($2,$287,$288,$289,$290,$291,$292);
     _stbtt__csctx_rccurve_to($2,$293,$294,$295,$296,$$0280,$$0279);
     $$0274$be = $$0274335;$$0276$be = $$0276334;$$0285$be = $$0285333;$$0288$be = $$0288332;$$0294$be = 0;
     label = 73;
     break L6;
     break;
    }
    default: {
     $$3 = 0;
     label = 80;
     break L4;
    }
    }
    break;
   }
   case -1:  {
    label = 76;
    break;
   }
   case 28:  {
    label = 77;
    break;
   }
   default: {
    $312 = ($52&255)<(32);
    $313 = ($52<<24>>24)==(-1);
    $or$cond3 = $312 | $313;
    if ($or$cond3) {
     $$3 = 0;
     label = 80;
     break L4;
    }
    if ($313) {
     label = 76;
    } else {
     label = 77;
    }
   }
   }
  } while(0);
  if ((label|0) == 54) {
   label = 0;
   $236 = ($$0294331|0)<(1);
   if ($236) {
    $$3 = 0;
    label = 80;
    break;
   }
   $237 = (($$0294331) + -1)|0;
   $238 = (($3) + ($237<<2)|0);
   $239 = +HEAPF32[$238>>2];
   $240 = (~~(($239)));
   $241 = ($$0288332|0)>(9);
   if ($241) {
    $$3 = 0;
    label = 80;
    break;
   }
   $242 = (($$0288332) + 1)|0;
   $243 = (($4) + (($$0288332*12)|0)|0);
   ;HEAP32[$243>>2]=HEAP32[$6>>2]|0;HEAP32[$243+4>>2]=HEAP32[$6+4>>2]|0;HEAP32[$243+8>>2]=HEAP32[$6+8>>2]|0;
   $244 = ($52<<24>>24)==(10);
   if ($244) {
    ;HEAP32[$7>>2]=HEAP32[$5>>2]|0;HEAP32[$7+4>>2]=HEAP32[$5+4>>2]|0;HEAP32[$7+8>>2]=HEAP32[$5+8>>2]|0;
   } else {
    ;HEAP32[$7>>2]=HEAP32[$16>>2]|0;HEAP32[$7+4>>2]=HEAP32[$16+4>>2]|0;HEAP32[$7+8>>2]=HEAP32[$16+8>>2]|0;
   }
   ;HEAP32[$$byval_copy1>>2]=HEAP32[$7>>2]|0;HEAP32[$$byval_copy1+4>>2]=HEAP32[$7+4>>2]|0;HEAP32[$$byval_copy1+8>>2]=HEAP32[$7+8>>2]|0;
   _stbtt__get_subr($6,$$byval_copy1,$240);
   $245 = HEAP32[$12>>2]|0;
   $246 = ($245|0)==(0);
   if ($246) {
    $$3 = 0;
    label = 80;
    break;
   }
   HEAP32[$10>>2] = 0;
   $$0274$be = $$0274335;$$0276$be = $$0276334;$$0285$be = $$1286;$$0288$be = $242;$$0294$be = $237;
   label = 73;
  }
  else if ((label|0) == 76) {
   label = 0;
   $314 = (_stbtt__buf_get($6,4)|0);
   $315 = (+($314>>>0));
   $316 = $315 * 1.52587890625E-5;
   $$1283 = $316;
   label = 78;
  }
  else if ((label|0) == 77) {
   label = 0;
   _stbtt__buf_skip($6,-1);
   $317 = (_stbtt__cff_int($6)|0);
   $318 = $317&65535;
   $319 = (+($318<<16>>16));
   $$1283 = $319;
   label = 78;
  }
  if ((label|0) == 78) {
   label = 0;
   $320 = ($$0294331|0)>(47);
   if ($320) {
    $$3 = 0;
    label = 80;
    break;
   }
   $321 = (($$0294331) + 1)|0;
   $322 = (($3) + ($$0294331<<2)|0);
   HEAPF32[$322>>2] = $$1283;
   $$0274$be = $$0274335;$$0276$be = $$0276334;$$0285$be = $$0285333;$$0288$be = $$0288332;$$0294$be = $321;
   label = 73;
  }
  while(1) {
   if ((label|0) == 18) {
    label = 0;
    $86 = ($$1291|0)<($$0294331|0);
    if (!($86)) {
     $$0274$be = $$0274335;$$0276$be = $$0276334;$$0285$be = $$0285333;$$0288$be = $$0288332;$$0294$be = 0;
     label = 73;
     continue;
    }
    $87 = (($3) + ($$1291<<2)|0);
    $88 = +HEAPF32[$87>>2];
    _stbtt__csctx_rline_to($2,$88,0.0);
    $89 = (($$1291) + 1)|0;
    $$2292 = $89;
    label = 20;
    continue;
   }
   else if ((label|0) == 20) {
    label = 0;
    $90 = ($$2292|0)<($$0294331|0);
    if (!($90)) {
     $$0274$be = $$0274335;$$0276$be = $$0276334;$$0285$be = $$0285333;$$0288$be = $$0288332;$$0294$be = 0;
     label = 73;
     continue;
    }
    $91 = (($3) + ($$2292<<2)|0);
    $92 = +HEAPF32[$91>>2];
    _stbtt__csctx_rline_to($2,0.0,$92);
    $93 = (($$2292) + 1)|0;
    $$1291 = $93;
    label = 18;
    continue;
   }
   else if ((label|0) == 24) {
    label = 0;
    $96 = (($$3293) + 3)|0;
    $97 = ($96|0)<($$0294331|0);
    if (!($97)) {
     $$0274$be = $$0274335;$$0276$be = $$0276334;$$0285$be = $$0285333;$$0288$be = $$0288332;$$0294$be = 0;
     label = 73;
     continue;
    }
    $98 = (($3) + ($$3293<<2)|0);
    $99 = +HEAPF32[$98>>2];
    $100 = (($$3293) + 1)|0;
    $101 = (($3) + ($100<<2)|0);
    $102 = +HEAPF32[$101>>2];
    $103 = (($$3293) + 2)|0;
    $104 = (($3) + ($103<<2)|0);
    $105 = +HEAPF32[$104>>2];
    $106 = (($3) + ($96<<2)|0);
    $107 = +HEAPF32[$106>>2];
    $108 = (($$0294331) - ($$3293))|0;
    $109 = ($108|0)==(5);
    if ($109) {
     $110 = (($$3293) + 4)|0;
     $111 = (($3) + ($110<<2)|0);
     $112 = +HEAPF32[$111>>2];
     $113 = $112;
    } else {
     $113 = 0.0;
    }
    _stbtt__csctx_rccurve_to($2,0.0,$99,$102,$105,$107,$113);
    $114 = (($$3293) + 4)|0;
    $$4 = $114;
    label = 28;
    continue;
   }
   else if ((label|0) == 28) {
    label = 0;
    $115 = (($$4) + 3)|0;
    $116 = ($115|0)<($$0294331|0);
    if (!($116)) {
     $$0274$be = $$0274335;$$0276$be = $$0276334;$$0285$be = $$0285333;$$0288$be = $$0288332;$$0294$be = 0;
     label = 73;
     continue;
    }
    $117 = (($3) + ($$4<<2)|0);
    $118 = +HEAPF32[$117>>2];
    $119 = (($$4) + 1)|0;
    $120 = (($3) + ($119<<2)|0);
    $121 = +HEAPF32[$120>>2];
    $122 = (($$4) + 2)|0;
    $123 = (($3) + ($122<<2)|0);
    $124 = +HEAPF32[$123>>2];
    $125 = (($$0294331) - ($$4))|0;
    $126 = ($125|0)==(5);
    if ($126) {
     $127 = (($$4) + 4)|0;
     $128 = (($3) + ($127<<2)|0);
     $129 = +HEAPF32[$128>>2];
     $132 = $129;
    } else {
     $132 = 0.0;
    }
    $130 = (($3) + ($115<<2)|0);
    $131 = +HEAPF32[$130>>2];
    _stbtt__csctx_rccurve_to($2,$118,0.0,$121,$124,$132,$131);
    $133 = (($$4) + 4)|0;
    $$3293 = $133;
    label = 24;
    continue;
   }
   else if ((label|0) == 73) {
    label = 0;
    $309 = HEAP32[$10>>2]|0;
    $310 = HEAP32[$12>>2]|0;
    $311 = ($309|0)<($310|0);
    if ($311) {
     $$0274335 = $$0274$be;$$0276334 = $$0276$be;$$0285333 = $$0285$be;$$0288332 = $$0288$be;$$0294331 = $$0294$be;
     continue L4;
    } else {
     $$3 = 0;
     label = 80;
     break L4;
    }
   }
  }
 }
 if ((label|0) == 63) {
  _stbtt__csctx_close_shape($2);
  $$3 = 1;
  STACKTOP = sp;return ($$3|0);
 }
 else if ((label|0) == 80) {
  STACKTOP = sp;return ($$3|0);
 }
 return (0)|0;
}
function _stbtt__cff_index_get($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $$off = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, label = 0, sp = 0;
 sp = STACKTOP;
 _stbtt__buf_seek($1,0);
 $3 = (_stbtt__buf_get($1,2)|0);
 $4 = (_stbtt__buf_get8($1)|0);
 $5 = $4&255;
 $6 = ($2|0)>(-1);
 $7 = ($3|0)>($2|0);
 $or$cond = $6 & $7;
 if (!($or$cond)) {
  ___assert_fail((13877|0),(13212|0),1118,(13897|0));
  // unreachable;
 }
 $$off = (($4) + -1)<<24>>24;
 $8 = ($$off&255)<(4);
 if ($8) {
  $9 = Math_imul($5, $2)|0;
  _stbtt__buf_skip($1,$9);
  $10 = (_stbtt__buf_get($1,$5)|0);
  $11 = (_stbtt__buf_get($1,$5)|0);
  $12 = (($3) + 1)|0;
  $13 = Math_imul($5, $12)|0;
  $14 = (($13) + 2)|0;
  $15 = (($14) + ($10))|0;
  $16 = (($11) - ($10))|0;
  _stbtt__buf_range($0,$1,$15,$16);
  return;
 } else {
  ___assert_fail((13794|0),(13212|0),1119,(13897|0));
  // unreachable;
 }
}
function _stbtt__buf_get8($0) {
 $0 = $0|0;
 var $$0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = ((($0)) + 4|0);
 $2 = HEAP32[$1>>2]|0;
 $3 = ((($0)) + 8|0);
 $4 = HEAP32[$3>>2]|0;
 $5 = ($2|0)<($4|0);
 if (!($5)) {
  $$0 = 0;
  return ($$0|0);
 }
 $6 = (($2) + 1)|0;
 $7 = HEAP32[$0>>2]|0;
 HEAP32[$1>>2] = $6;
 $8 = (($7) + ($2)|0);
 $9 = HEAP8[$8>>0]|0;
 $$0 = $9;
 return ($$0|0);
}
function _stbtt__buf_skip($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $2 = 0, $3 = 0, $4 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = ((($0)) + 4|0);
 $3 = HEAP32[$2>>2]|0;
 $4 = (($3) + ($1))|0;
 _stbtt__buf_seek($0,$4);
 return;
}
function _stbtt__csctx_rmove_to($0,$1,$2) {
 $0 = $0|0;
 $1 = +$1;
 $2 = +$2;
 var $10 = 0, $11 = 0.0, $12 = 0, $13 = 0, $3 = 0, $4 = 0.0, $5 = 0.0, $6 = 0, $7 = 0, $8 = 0.0, $9 = 0.0, label = 0, sp = 0;
 sp = STACKTOP;
 _stbtt__csctx_close_shape($0);
 $3 = ((($0)) + 16|0);
 $4 = +HEAPF32[$3>>2];
 $5 = $4 + $1;
 HEAPF32[$3>>2] = $5;
 $6 = ((($0)) + 8|0);
 HEAPF32[$6>>2] = $5;
 $7 = ((($0)) + 20|0);
 $8 = +HEAPF32[$7>>2];
 $9 = $8 + $2;
 HEAPF32[$7>>2] = $9;
 $10 = ((($0)) + 12|0);
 HEAPF32[$10>>2] = $9;
 $11 = +HEAPF32[$3>>2];
 $12 = (~~(($11)));
 $13 = (~~(($9)));
 _stbtt__csctx_v($0,1,$12,$13,0,0,0,0);
 return;
}
function _stbtt__csctx_rline_to($0,$1,$2) {
 $0 = $0|0;
 $1 = +$1;
 $2 = +$2;
 var $10 = 0, $3 = 0, $4 = 0.0, $5 = 0.0, $6 = 0, $7 = 0.0, $8 = 0.0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $3 = ((($0)) + 16|0);
 $4 = +HEAPF32[$3>>2];
 $5 = $4 + $1;
 HEAPF32[$3>>2] = $5;
 $6 = ((($0)) + 20|0);
 $7 = +HEAPF32[$6>>2];
 $8 = $7 + $2;
 HEAPF32[$6>>2] = $8;
 $9 = (~~(($5)));
 $10 = (~~(($8)));
 _stbtt__csctx_v($0,2,$9,$10,0,0,0,0);
 return;
}
function _stbtt__csctx_rccurve_to($0,$1,$2,$3,$4,$5,$6) {
 $0 = $0|0;
 $1 = +$1;
 $2 = +$2;
 $3 = +$3;
 $4 = +$4;
 $5 = +$5;
 $6 = +$6;
 var $10 = 0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $15 = 0.0, $16 = 0.0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $7 = 0, $8 = 0.0, $9 = 0.0, label = 0, sp = 0;
 sp = STACKTOP;
 $7 = ((($0)) + 16|0);
 $8 = +HEAPF32[$7>>2];
 $9 = $8 + $1;
 $10 = ((($0)) + 20|0);
 $11 = +HEAPF32[$10>>2];
 $12 = $11 + $2;
 $13 = $9 + $3;
 $14 = $12 + $4;
 $15 = $13 + $5;
 HEAPF32[$7>>2] = $15;
 $16 = $14 + $6;
 HEAPF32[$10>>2] = $16;
 $17 = (~~(($15)));
 $18 = (~~(($16)));
 $19 = (~~(($9)));
 $20 = (~~(($12)));
 $21 = (~~(($13)));
 $22 = (~~(($14)));
 _stbtt__csctx_v($0,4,$17,$18,$19,$20,$21,$22);
 return;
}
function _stbtt__cid_get_glyph_subrs($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $$02931 = 0, $$03034 = 0, $$035 = 0, $$byval_copy1 = 0, $$byval_copy2 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0;
 var $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 48|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(48|0);
 $$byval_copy2 = sp + 36|0;
 $$byval_copy1 = sp + 24|0;
 $3 = sp;
 $4 = sp + 12|0;
 $5 = ((($1)) + 108|0);
 ;HEAP32[$3>>2]=HEAP32[$5>>2]|0;HEAP32[$3+4>>2]=HEAP32[$5+4>>2]|0;HEAP32[$3+8>>2]=HEAP32[$5+8>>2]|0;
 _stbtt__buf_seek($3,0);
 $6 = (_stbtt__buf_get8($3)|0);
 L1: do {
  switch ($6<<24>>24) {
  case 0:  {
   _stbtt__buf_skip($3,$2);
   $7 = (_stbtt__buf_get8($3)|0);
   $8 = $7&255;
   $$02931 = $8;
   break;
  }
  case 3:  {
   $9 = (_stbtt__buf_get($3,2)|0);
   $10 = (_stbtt__buf_get($3,2)|0);
   $11 = ($9|0)>(0);
   if ($11) {
    $$03034 = $10;$$035 = 0;
    while(1) {
     $14 = (_stbtt__buf_get8($3)|0);
     $15 = (_stbtt__buf_get($3,2)|0);
     $16 = ($$03034|0)<=($2|0);
     $17 = ($15|0)>($2|0);
     $or$cond = $16 & $17;
     $13 = (($$035) + 1)|0;
     if ($or$cond) {
      break;
     }
     $12 = ($13|0)<($9|0);
     if ($12) {
      $$03034 = $15;$$035 = $13;
     } else {
      label = 6;
      break L1;
     }
    }
    $18 = $14&255;
    $$02931 = $18;
   } else {
    label = 6;
   }
   break;
  }
  default: {
   label = 6;
  }
  }
 } while(0);
 if ((label|0) == 6) {
  _stbtt__new_buf($$byval_copy2,0,0);
  $$02931 = -1;
 }
 $19 = ((($1)) + 48|0);
 $20 = ((($1)) + 96|0);
 ;HEAP32[$$byval_copy2>>2]=HEAP32[$20>>2]|0;HEAP32[$$byval_copy2+4>>2]=HEAP32[$20+4>>2]|0;HEAP32[$$byval_copy2+8>>2]=HEAP32[$20+8>>2]|0;
 _stbtt__cff_index_get($4,$$byval_copy2,$$02931);
 ;HEAP32[$$byval_copy1>>2]=HEAP32[$19>>2]|0;HEAP32[$$byval_copy1+4>>2]=HEAP32[$19+4>>2]|0;HEAP32[$$byval_copy1+8>>2]=HEAP32[$19+8>>2]|0;
 ;HEAP32[$$byval_copy2>>2]=HEAP32[$4>>2]|0;HEAP32[$$byval_copy2+4>>2]=HEAP32[$4+4>>2]|0;HEAP32[$$byval_copy2+8>>2]=HEAP32[$4+8>>2]|0;
 _stbtt__get_subrs($0,$$byval_copy1,$$byval_copy2);
 STACKTOP = sp;return;
}
function _stbtt__get_subr($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $$ = 0, $$0 = 0, $$byval_copy = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $or$cond = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $$byval_copy = sp;
 $3 = (_stbtt__cff_index_count($1)|0);
 $4 = ($3|0)>(33899);
 $5 = ($3|0)>(1239);
 $$ = $5 ? 1131 : 107;
 $$0 = $4 ? 32768 : $$;
 $6 = (($$0) + ($2))|0;
 $7 = ($6|0)>(-1);
 $8 = ($6|0)<($3|0);
 $or$cond = $7 & $8;
 if ($or$cond) {
  ;HEAP32[$$byval_copy>>2]=HEAP32[$1>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$1+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[$1+8>>2]|0;
  _stbtt__cff_index_get($0,$$byval_copy,$6);
  STACKTOP = sp;return;
 } else {
  _stbtt__new_buf($0,0,0);
  STACKTOP = sp;return;
 }
}
function _stbtt__csctx_close_shape($0) {
 $0 = $0|0;
 var $1 = 0, $10 = 0, $11 = 0, $12 = 0, $2 = 0.0, $3 = 0, $4 = 0.0, $5 = 0, $6 = 0, $7 = 0.0, $8 = 0, $9 = 0.0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = ((($0)) + 8|0);
 $2 = +HEAPF32[$1>>2];
 $3 = ((($0)) + 16|0);
 $4 = +HEAPF32[$3>>2];
 $5 = $2 != $4;
 $6 = ((($0)) + 12|0);
 $7 = +HEAPF32[$6>>2];
 if (!($5)) {
  $8 = ((($0)) + 20|0);
  $9 = +HEAPF32[$8>>2];
  $10 = $7 != $9;
  if (!($10)) {
   return;
  }
 }
 $11 = (~~(($2)));
 $12 = (~~(($7)));
 _stbtt__csctx_v($0,2,$11,$12,0,0,0,0);
 return;
}
function _stbtt__buf_get($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$01011 = 0, $$012 = 0, $$off = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $exitcond = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $$off = (($1) + -1)|0;
 $2 = ($$off>>>0)<(4);
 if ($2) {
  $$01011 = 0;$$012 = 0;
 } else {
  ___assert_fail((13689|0),(13212|0),1014,(13706|0));
  // unreachable;
 }
 while(1) {
  $3 = $$01011 << 8;
  $4 = (_stbtt__buf_get8($0)|0);
  $5 = $4&255;
  $6 = $5 | $3;
  $7 = (($$012) + 1)|0;
  $exitcond = ($7|0)==($1|0);
  if ($exitcond) {
   break;
  } else {
   $$01011 = $6;$$012 = $7;
  }
 }
 return ($6|0);
}
function _stbtt__cff_int($0) {
 $0 = $0|0;
 var $$0 = 0, $$off = 0, $$off19 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $3 = 0, $4 = 0, $5 = 0;
 var $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond5 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = (_stbtt__buf_get8($0)|0);
 $2 = $1&255;
 $$off = (($1) + -32)<<24>>24;
 $3 = ($$off&255)<(215);
 if ($3) {
  $4 = (($2) + -139)|0;
  $$0 = $4;
  return ($$0|0);
 }
 $$off19 = (($1) + 9)<<24>>24;
 $5 = ($$off19&255)<(4);
 if ($5) {
  $6 = $2 << 8;
  $7 = (($6) + -63232)|0;
  $8 = (_stbtt__buf_get8($0)|0);
  $9 = $8&255;
  $10 = $9 | $7;
  $11 = (($10) + 108)|0;
  $$0 = $11;
  return ($$0|0);
 }
 $12 = ($1&255)>(250);
 $13 = ($1<<24>>24)!=(-1);
 $or$cond5 = $12 & $13;
 if ($or$cond5) {
  $14 = (251 - ($2))|0;
  $15 = $14 << 8;
  $16 = (_stbtt__buf_get8($0)|0);
  $17 = $16&255;
  $18 = (($15) + -108)|0;
  $19 = (($18) - ($17))|0;
  $$0 = $19;
  return ($$0|0);
 }
 switch ($1<<24>>24) {
 case 28:  {
  $20 = (_stbtt__buf_get($0,2)|0);
  $$0 = $20;
  return ($$0|0);
  break;
 }
 case 29:  {
  $21 = (_stbtt__buf_get($0,4)|0);
  $$0 = $21;
  return ($$0|0);
  break;
 }
 default: {
  ___assert_fail((13672|0),(13212|0),1064,(13674|0));
  // unreachable;
 }
 }
 return (0)|0;
}
function _stbtt__csctx_v($0,$1,$2,$3,$4,$5,$6,$7) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 $4 = $4|0;
 $5 = $5|0;
 $6 = $6|0;
 $7 = $7|0;
 var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $8 = 0, $9 = 0, label = 0;
 var sp = 0;
 sp = STACKTOP;
 $8 = HEAP32[$0>>2]|0;
 $9 = ($8|0)==(0);
 if ($9) {
  $11 = ((($0)) + 40|0);
  $12 = HEAP32[$11>>2]|0;
  $13 = ((($0)) + 44|0);
  $14 = HEAP32[$13>>2]|0;
  $15 = (($12) + (($14*14)|0)|0);
  _stbtt_setvertex($15,$1,$2,$3,$4,$5);
  $16 = $6&65535;
  $17 = HEAP32[$11>>2]|0;
  $18 = HEAP32[$13>>2]|0;
  $19 = (((($17) + (($18*14)|0)|0)) + 8|0);
  HEAP16[$19>>1] = $16;
  $20 = $7&65535;
  $21 = HEAP32[$11>>2]|0;
  $22 = HEAP32[$13>>2]|0;
  $23 = (((($21) + (($22*14)|0)|0)) + 10|0);
  HEAP16[$23>>1] = $20;
 } else {
  _stbtt__track_vertex($0,$2,$3);
  $10 = ($1<<24>>24)==(4);
  if ($10) {
   _stbtt__track_vertex($0,$4,$5);
   _stbtt__track_vertex($0,$6,$7);
  }
 }
 $24 = ((($0)) + 44|0);
 $25 = HEAP32[$24>>2]|0;
 $26 = (($25) + 1)|0;
 HEAP32[$24>>2] = $26;
 return;
}
function _stbtt__track_vertex($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $3 = 0, $4 = 0;
 var $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $3 = ((($0)) + 28|0);
 $4 = HEAP32[$3>>2]|0;
 $5 = ($4|0)<($1|0);
 if ($5) {
  label = 3;
 } else {
  $6 = ((($0)) + 4|0);
  $7 = HEAP32[$6>>2]|0;
  $8 = ($7|0)==(0);
  if ($8) {
   label = 3;
  }
 }
 if ((label|0) == 3) {
  HEAP32[$3>>2] = $1;
 }
 $9 = ((($0)) + 36|0);
 $10 = HEAP32[$9>>2]|0;
 $11 = ($10|0)<($2|0);
 if ($11) {
  label = 6;
 } else {
  $12 = ((($0)) + 4|0);
  $13 = HEAP32[$12>>2]|0;
  $14 = ($13|0)==(0);
  if ($14) {
   label = 6;
  }
 }
 if ((label|0) == 6) {
  HEAP32[$9>>2] = $2;
 }
 $15 = ((($0)) + 24|0);
 $16 = HEAP32[$15>>2]|0;
 $17 = ($16|0)>($1|0);
 if ($17) {
  label = 9;
 } else {
  $18 = ((($0)) + 4|0);
  $19 = HEAP32[$18>>2]|0;
  $20 = ($19|0)==(0);
  if ($20) {
   label = 9;
  }
 }
 if ((label|0) == 9) {
  HEAP32[$15>>2] = $1;
 }
 $21 = ((($0)) + 32|0);
 $22 = HEAP32[$21>>2]|0;
 $23 = ($22|0)>($2|0);
 if (!($23)) {
  $24 = ((($0)) + 4|0);
  $25 = HEAP32[$24>>2]|0;
  $26 = ($25|0)==(0);
  if (!($26)) {
   $27 = ((($0)) + 4|0);
   HEAP32[$27>>2] = 1;
   return;
  }
 }
 HEAP32[$21>>2] = $2;
 $27 = ((($0)) + 4|0);
 HEAP32[$27>>2] = 1;
 return;
}
function _stbtt_setvertex($0,$1,$2,$3,$4,$5) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 $4 = $4|0;
 $5 = $5|0;
 var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $6 = ((($0)) + 12|0);
 HEAP8[$6>>0] = $1;
 $7 = $2&65535;
 HEAP16[$0>>1] = $7;
 $8 = $3&65535;
 $9 = ((($0)) + 2|0);
 HEAP16[$9>>1] = $8;
 $10 = $4&65535;
 $11 = ((($0)) + 4|0);
 HEAP16[$11>>1] = $10;
 $12 = $5&65535;
 $13 = ((($0)) + 6|0);
 HEAP16[$13>>1] = $12;
 return;
}
function _stbtt__cff_index_count($0) {
 $0 = $0|0;
 var $1 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 _stbtt__buf_seek($0,0);
 $1 = (_stbtt__buf_get($0,2)|0);
 return ($1|0);
}
function _stbtt__new_buf($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $$sroa$4$0$$sroa_idx2 = 0, $$sroa$5$0$$sroa_idx4 = 0, $3 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $3 = ($2>>>0)<(1073741824);
 if ($3) {
  HEAP32[$0>>2] = $1;
  $$sroa$4$0$$sroa_idx2 = ((($0)) + 4|0);
  HEAP32[$$sroa$4$0$$sroa_idx2>>2] = 0;
  $$sroa$5$0$$sroa_idx4 = ((($0)) + 8|0);
  HEAP32[$$sroa$5$0$$sroa_idx4>>2] = $2;
  return;
 } else {
  ___assert_fail((13721|0),(13212|0),1023,(13739|0));
  // unreachable;
 }
}
function _stbtt__buf_seek($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $or$cond = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = ((($0)) + 8|0);
 $3 = HEAP32[$2>>2]|0;
 $4 = ($3|0)<($1|0);
 $5 = ($1|0)<(0);
 $or$cond = $5 | $4;
 if ($or$cond) {
  ___assert_fail((13754|0),(13212|0),1001,(13778|0));
  // unreachable;
 } else {
  $6 = ((($0)) + 4|0);
  HEAP32[$6>>2] = $1;
  return;
 }
}
function _stbtt__get_subrs($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
 $3 = sp + 20|0;
 $4 = sp;
 $5 = sp + 8|0;
 HEAP32[$3>>2] = 0;
 $6 = $4;
 $7 = $6;
 HEAP32[$7>>2] = 0;
 $8 = (($6) + 4)|0;
 $9 = $8;
 HEAP32[$9>>2] = 0;
 _stbtt__dict_get_ints($2,18,2,$4);
 $10 = ((($4)) + 4|0);
 $11 = HEAP32[$10>>2]|0;
 $12 = ($11|0)==(0);
 if (!($12)) {
  $13 = HEAP32[$4>>2]|0;
  $14 = ($13|0)==(0);
  if (!($14)) {
   _stbtt__buf_range($5,$1,$11,$13);
   _stbtt__dict_get_ints($5,19,1,$3);
   $15 = HEAP32[$3>>2]|0;
   $16 = ($15|0)==(0);
   if ($16) {
    _stbtt__new_buf($0,0,0);
    STACKTOP = sp;return;
   } else {
    $17 = HEAP32[$10>>2]|0;
    $18 = (($17) + ($15))|0;
    _stbtt__buf_seek($1,$18);
    _stbtt__cff_get_index($0,$1);
    STACKTOP = sp;return;
   }
  }
 }
 _stbtt__new_buf($0,0,0);
 STACKTOP = sp;return;
}
function _stbtt__dict_get_ints($0,$1,$2,$3) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 var $$07 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $4 = sp;
 _stbtt__dict_get($4,$0,$1);
 $5 = ((($4)) + 4|0);
 $6 = ($2|0)>(0);
 if (!($6)) {
  STACKTOP = sp;return;
 }
 $7 = ((($4)) + 8|0);
 $$07 = 0;
 while(1) {
  $8 = HEAP32[$5>>2]|0;
  $9 = HEAP32[$7>>2]|0;
  $10 = ($8|0)<($9|0);
  if (!($10)) {
   label = 5;
   break;
  }
  $11 = (_stbtt__cff_int($4)|0);
  $12 = (($3) + ($$07<<2)|0);
  HEAP32[$12>>2] = $11;
  $13 = (($$07) + 1)|0;
  $14 = ($13|0)<($2|0);
  if ($14) {
   $$07 = $13;
  } else {
   label = 5;
   break;
  }
 }
 if ((label|0) == 5) {
  STACKTOP = sp;return;
 }
}
function _stbtt__buf_range($0,$1,$2,$3) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $4 = sp;
 _stbtt__new_buf($4,0,0);
 $5 = $3 | $2;
 $6 = ($5|0)<(0);
 if (!($6)) {
  $7 = ((($1)) + 8|0);
  $8 = HEAP32[$7>>2]|0;
  $9 = ($8|0)<($2|0);
  $10 = (($8) - ($2))|0;
  $11 = ($10|0)<($3|0);
  $or$cond = $9 | $11;
  if (!($or$cond)) {
   $12 = HEAP32[$1>>2]|0;
   $13 = (($12) + ($2)|0);
   HEAP32[$4>>2] = $13;
   $14 = ((($4)) + 8|0);
   HEAP32[$14>>2] = $3;
   ;HEAP32[$0>>2]=HEAP32[$4>>2]|0;HEAP32[$0+4>>2]=HEAP32[$4+4>>2]|0;HEAP32[$0+8>>2]=HEAP32[$4+8>>2]|0;
   STACKTOP = sp;return;
  }
 }
 ;HEAP32[$0>>2]=HEAP32[$4>>2]|0;HEAP32[$0+4>>2]=HEAP32[$4+4>>2]|0;HEAP32[$0+8>>2]=HEAP32[$4+8>>2]|0;
 STACKTOP = sp;return;
}
function _stbtt__cff_get_index($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$off = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = ((($1)) + 4|0);
 $3 = HEAP32[$2>>2]|0;
 $4 = (_stbtt__buf_get($1,2)|0);
 $5 = ($4|0)==(0);
 if ($5) {
  $12 = HEAP32[$2>>2]|0;
  $13 = (($12) - ($3))|0;
  _stbtt__buf_range($0,$1,$3,$13);
  return;
 }
 $6 = (_stbtt__buf_get8($1)|0);
 $7 = $6&255;
 $$off = (($6) + -1)<<24>>24;
 $8 = ($$off&255)<(4);
 if (!($8)) {
  ___assert_fail((13794|0),(13212|0),1049,(13823|0));
  // unreachable;
 }
 $9 = Math_imul($7, $4)|0;
 _stbtt__buf_skip($1,$9);
 $10 = (_stbtt__buf_get($1,$7)|0);
 $11 = (($10) + -1)|0;
 _stbtt__buf_skip($1,$11);
 $12 = HEAP32[$2>>2]|0;
 $13 = (($12) - ($3))|0;
 _stbtt__buf_range($0,$1,$3,$13);
 return;
}
function _stbtt__dict_get($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $$021 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0;
 var sp = 0;
 sp = STACKTOP;
 _stbtt__buf_seek($1,0);
 $3 = ((($1)) + 4|0);
 $4 = ((($1)) + 8|0);
 while(1) {
  $5 = HEAP32[$3>>2]|0;
  $6 = HEAP32[$4>>2]|0;
  $7 = ($5|0)<($6|0);
  if (!($7)) {
   label = 9;
   break;
  }
  $8 = (_stbtt__buf_peek8($1)|0);
  $9 = ($8&255)>(27);
  if ($9) {
   while(1) {
    _stbtt__cff_skip_operand($1);
    $10 = (_stbtt__buf_peek8($1)|0);
    $11 = ($10&255)>(27);
    if (!($11)) {
     break;
    }
   }
  }
  $12 = HEAP32[$3>>2]|0;
  $13 = (_stbtt__buf_get8($1)|0);
  $14 = $13&255;
  $15 = ($13<<24>>24)==(12);
  if ($15) {
   $16 = (_stbtt__buf_get8($1)|0);
   $17 = $16&255;
   $18 = $17 | 256;
   $$021 = $18;
  } else {
   $$021 = $14;
  }
  $19 = ($$021|0)==($2|0);
  if ($19) {
   label = 8;
   break;
  }
 }
 if ((label|0) == 8) {
  $20 = (($12) - ($5))|0;
  _stbtt__buf_range($0,$1,$5,$20);
  return;
 }
 else if ((label|0) == 9) {
  _stbtt__buf_range($0,$1,0,0);
  return;
 }
}
function _stbtt__buf_peek8($0) {
 $0 = $0|0;
 var $$0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = ((($0)) + 4|0);
 $2 = HEAP32[$1>>2]|0;
 $3 = ((($0)) + 8|0);
 $4 = HEAP32[$3>>2]|0;
 $5 = ($2|0)<($4|0);
 if (!($5)) {
  $$0 = 0;
  return ($$0|0);
 }
 $6 = HEAP32[$0>>2]|0;
 $7 = (($6) + ($2)|0);
 $8 = HEAP8[$7>>0]|0;
 $$0 = $8;
 return ($$0|0);
}
function _stbtt__cff_skip_operand($0) {
 $0 = $0|0;
 var $$mask = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = (_stbtt__buf_peek8($0)|0);
 $2 = ($1&255)>(27);
 if (!($2)) {
  ___assert_fail((13844|0),(13212|0),1070,(13853|0));
  // unreachable;
 }
 $3 = ($1<<24>>24)==(30);
 if (!($3)) {
  (_stbtt__cff_int($0)|0);
  return;
 }
 _stbtt__buf_skip($0,1);
 $4 = ((($0)) + 4|0);
 $5 = ((($0)) + 8|0);
 while(1) {
  $6 = HEAP32[$4>>2]|0;
  $7 = HEAP32[$5>>2]|0;
  $8 = ($6|0)<($7|0);
  if (!($8)) {
   label = 8;
   break;
  }
  $9 = (_stbtt__buf_get8($0)|0);
  $10 = $9&255;
  $11 = $10 & 15;
  $12 = ($11|0)==(15);
  $$mask = $10 & 240;
  $13 = ($$mask|0)==(240);
  $or$cond = $12 | $13;
  if ($or$cond) {
   label = 8;
   break;
  }
 }
 if ((label|0) == 8) {
  return;
 }
}
function _stbtt__GetGlyphShapeTT($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $$0348453 = 0, $$0353439 = 0, $$0361449 = 0, $$0363450 = 0, $$0364448 = 0, $$0366447 = 0, $$0372451 = 0, $$0377437 = 0, $$0379436 = 0, $$0381446 = 0, $$0387435 = 0, $$0390434 = 0, $$0393433 = 0, $$0396432 = 0, $$0399431 = 0, $$0401430 = 0, $$0403440 = 0, $$0405443 = 0, $$0407429 = 0, $$0409428 = 0;
 var $$1349 = 0, $$1354 = 0, $$1362 = 0, $$1365 = 0, $$1367445 = 0, $$1378 = 0, $$1380 = 0, $$1382 = 0, $$1388 = 0, $$1391 = 0, $$1394 = 0, $$1397 = 0, $$1400 = 0, $$1402 = 0, $$1404 = 0, $$1406 = 0, $$1408 = 0, $$1410 = 0, $$2368442 = 0, $$2374 = 0;
 var $$2383444 = 0, $$2389 = 0, $$2392 = 0, $$2395 = 0, $$2398 = 0, $$3356 = 0, $$3369438 = 0, $$3384 = 0, $$4 = 0, $$4352 = 0, $$4370 = 0, $$4385441 = 0, $$5371 = 0, $$5386 = 0, $$5452 = 0, $$6 = 0, $$9 = 0, $$sink = 0, $$sroa$0$0 = 0.0, $$sroa$10$0 = 0.0;
 var $$sroa$17$0 = 0.0, $$sroa$24$0 = 0.0, $$sroa$31$0 = 0.0, $$sroa$35$0 = 0.0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0;
 var $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0;
 var $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0;
 var $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0.0, $155 = 0, $156 = 0, $157 = 0.0, $158 = 0, $159 = 0.0, $16 = 0, $160 = 0, $161 = 0, $162 = 0.0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0.0, $168 = 0.0;
 var $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0.0, $174 = 0.0, $175 = 0, $176 = 0, $177 = 0.0, $178 = 0.0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0.0, $184 = 0.0, $185 = 0, $186 = 0;
 var $187 = 0.0, $188 = 0.0, $189 = 0, $19 = 0, $190 = 0, $191 = 0.0, $192 = 0.0, $193 = 0, $194 = 0, $195 = 0.0, $196 = 0.0, $197 = 0, $198 = 0.0, $199 = 0.0, $20 = 0, $200 = 0.0, $201 = 0.0, $202 = 0.0, $203 = 0.0, $204 = 0;
 var $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0.0, $213 = 0.0, $214 = 0.0, $215 = 0.0, $216 = 0.0, $217 = 0.0, $218 = 0.0, $219 = 0, $22 = 0, $220 = 0.0, $221 = 0.0, $222 = 0.0;
 var $223 = 0.0, $224 = 0.0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0.0, $231 = 0.0, $232 = 0.0, $233 = 0.0, $234 = 0.0, $235 = 0.0, $236 = 0.0, $237 = 0, $238 = 0.0, $239 = 0.0, $24 = 0, $240 = 0.0;
 var $241 = 0.0, $242 = 0.0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0;
 var $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0;
 var $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0;
 var $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0;
 var $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0;
 var $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $exitcond = 0, $exitcond458 = 0, $exitcond459 = 0, $exitcond460 = 0, $sext = 0, $sext412 = 0, $sqrtf = 0.0, $sqrtf411 = 0.0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $3 = sp;
 $4 = ((($0)) + 4|0);
 $5 = HEAP32[$4>>2]|0;
 $6 = (_stbtt__GetGlyfOffset($0,$1)|0);
 HEAP32[$2>>2] = 0;
 $7 = ($6|0)<(0);
 if ($7) {
  $$4 = 0;
  STACKTOP = sp;return ($$4|0);
 }
 $8 = (($5) + ($6)|0);
 $9 = (_ttSHORT($8)|0);
 $10 = ($9<<16>>16)>(0);
 L4: do {
  if ($10) {
   $11 = $9 << 16 >> 16;
   $12 = ((($8)) + 10|0);
   $13 = $11 << 1;
   $14 = (($12) + ($13)|0);
   $15 = (_ttUSHORT($14)|0);
   $16 = ((($14)) + -2|0);
   $17 = (_ttUSHORT($16)|0);
   $18 = $17&65535;
   $19 = $13 | 1;
   $20 = (($19) + ($18))|0;
   $21 = ($20*14)|0;
   $22 = (_malloc($21)|0);
   $23 = ($22|0)==(0|0);
   if ($23) {
    $$4 = 0;
    STACKTOP = sp;return ($$4|0);
   }
   $24 = ((($14)) + 2|0);
   $25 = $15&65535;
   $26 = (($24) + ($25)|0);
   $$0361449 = 0;$$0364448 = 0;$$0366447 = 0;$$0381446 = $26;
   while(1) {
    $27 = ($$0364448<<24>>24)==(0);
    if ($27) {
     $28 = ((($$0381446)) + 1|0);
     $29 = HEAP8[$$0381446>>0]|0;
     $30 = $29 & 8;
     $31 = ($30<<24>>24)==(0);
     if ($31) {
      $$1362 = $29;$$1365 = 0;$$1382 = $28;
     } else {
      $32 = ((($$0381446)) + 2|0);
      $33 = HEAP8[$28>>0]|0;
      $$1362 = $29;$$1365 = $33;$$1382 = $32;
     }
    } else {
     $34 = (($$0364448) + -1)<<24>>24;
     $$1362 = $$0361449;$$1365 = $34;$$1382 = $$0381446;
    }
    $35 = (($$0366447) + ($13))|0;
    $36 = (((($22) + (($35*14)|0)|0)) + 12|0);
    HEAP8[$36>>0] = $$1362;
    $37 = (($$0366447) + 1)|0;
    $exitcond459 = ($$0366447|0)==($18|0);
    if ($exitcond459) {
     $$0405443 = 0;$$1367445 = 0;$$2383444 = $$1382;
     break;
    } else {
     $$0361449 = $$1362;$$0364448 = $$1365;$$0366447 = $37;$$0381446 = $$1382;
    }
   }
   while(1) {
    $38 = (($$1367445) + ($13))|0;
    $39 = (((($22) + (($38*14)|0)|0)) + 12|0);
    $40 = HEAP8[$39>>0]|0;
    $41 = $40&255;
    $42 = $41 & 2;
    $43 = ($42|0)==(0);
    $44 = $41 & 16;
    $45 = ($44|0)!=(0);
    if ($43) {
     if ($45) {
      $$1406 = $$0405443;$$3384 = $$2383444;
     } else {
      $52 = HEAP8[$$2383444>>0]|0;
      $53 = $52&255;
      $54 = $53 << 8;
      $55 = ((($$2383444)) + 1|0);
      $56 = HEAP8[$55>>0]|0;
      $57 = $56&255;
      $58 = $54 | $57;
      $sext412 = $58 << 16;
      $59 = $sext412 >> 16;
      $60 = (($59) + ($$0405443))|0;
      $61 = ((($$2383444)) + 2|0);
      $$1406 = $60;$$3384 = $61;
     }
    } else {
     $46 = ((($$2383444)) + 1|0);
     $47 = HEAP8[$$2383444>>0]|0;
     $48 = $47&255;
     $49 = (0 - ($48))|0;
     $50 = $45 ? $48 : $49;
     $51 = (($50) + ($$0405443))|0;
     $$1406 = $51;$$3384 = $46;
    }
    $62 = $$1406&65535;
    $63 = (($22) + (($38*14)|0)|0);
    HEAP16[$63>>1] = $62;
    $64 = (($$1367445) + 1)|0;
    $exitcond458 = ($$1367445|0)==($18|0);
    if ($exitcond458) {
     $$0403440 = 0;$$2368442 = 0;$$4385441 = $$3384;
     break;
    } else {
     $$0405443 = $$1406;$$1367445 = $64;$$2383444 = $$3384;
    }
   }
   while(1) {
    $65 = (($$2368442) + ($13))|0;
    $66 = (((($22) + (($65*14)|0)|0)) + 12|0);
    $67 = HEAP8[$66>>0]|0;
    $68 = $67&255;
    $69 = $68 & 4;
    $70 = ($69|0)==(0);
    $71 = $68 & 32;
    $72 = ($71|0)!=(0);
    if ($70) {
     if ($72) {
      $$1404 = $$0403440;$$5386 = $$4385441;
     } else {
      $79 = HEAP8[$$4385441>>0]|0;
      $80 = $79&255;
      $81 = $80 << 8;
      $82 = ((($$4385441)) + 1|0);
      $83 = HEAP8[$82>>0]|0;
      $84 = $83&255;
      $85 = $81 | $84;
      $sext = $85 << 16;
      $86 = $sext >> 16;
      $87 = (($86) + ($$0403440))|0;
      $88 = ((($$4385441)) + 2|0);
      $$1404 = $87;$$5386 = $88;
     }
    } else {
     $73 = ((($$4385441)) + 1|0);
     $74 = HEAP8[$$4385441>>0]|0;
     $75 = $74&255;
     $76 = (0 - ($75))|0;
     $77 = $72 ? $75 : $76;
     $78 = (($77) + ($$0403440))|0;
     $$1404 = $78;$$5386 = $73;
    }
    $89 = $$1404&65535;
    $90 = (((($22) + (($65*14)|0)|0)) + 2|0);
    HEAP16[$90>>1] = $89;
    $91 = (($$2368442) + 1)|0;
    $exitcond = ($$2368442|0)==($18|0);
    if ($exitcond) {
     $$0353439 = 0;$$0377437 = 0;$$0379436 = 0;$$0387435 = 0;$$0390434 = 0;$$0393433 = 0;$$0396432 = 0;$$0399431 = 0;$$0401430 = 0;$$0407429 = 0;$$0409428 = 0;$$3369438 = 0;
     break;
    } else {
     $$0403440 = $$1404;$$2368442 = $91;$$4385441 = $$5386;
    }
   }
   while(1) {
    $92 = (($$3369438) + ($13))|0;
    $93 = (((($22) + (($92*14)|0)|0)) + 12|0);
    $94 = HEAP8[$93>>0]|0;
    $95 = (($22) + (($92*14)|0)|0);
    $96 = HEAP16[$95>>1]|0;
    $97 = $96 << 16 >> 16;
    $98 = (((($22) + (($92*14)|0)|0)) + 2|0);
    $99 = HEAP16[$98>>1]|0;
    $100 = $99 << 16 >> 16;
    $101 = ($$0379436|0)==($$3369438|0);
    $102 = $94 & 1;
    $103 = ($102<<24>>24)!=(0);
    do {
     if ($101) {
      $104 = ($$3369438|0)==(0);
      if ($104) {
       $$1354 = $$0353439;
      } else {
       $105 = (_stbtt__close_shape($22,$$0353439,$$0409428,$$0407429,$$0396432,$$0393433,$$0390434,$$0387435,$$0401430,$$0399431)|0);
       $$1354 = $105;
      }
      $106 = $103 ^ 1;
      $107 = $106&1;
      do {
       if ($103) {
        $$1388 = $$0387435;$$1391 = $$0390434;$$1394 = $100;$$1397 = $97;$$4370 = $$3369438;
       } else {
        $108 = (($92) + 1)|0;
        $109 = (((($22) + (($108*14)|0)|0)) + 12|0);
        $110 = HEAP8[$109>>0]|0;
        $111 = $110 & 1;
        $112 = ($111<<24>>24)==(0);
        $113 = (((($22) + (($108*14)|0)|0)) + 2|0);
        $114 = HEAP16[$113>>1]|0;
        $115 = (($22) + (($108*14)|0)|0);
        $116 = HEAP16[$115>>1]|0;
        $117 = $114 << 16 >> 16;
        $118 = $116 << 16 >> 16;
        if ($112) {
         $119 = (($118) + ($97))|0;
         $120 = $119 >> 1;
         $121 = (($117) + ($100))|0;
         $122 = $121 >> 1;
         $$1388 = $100;$$1391 = $97;$$1394 = $122;$$1397 = $120;$$4370 = $$3369438;
         break;
        } else {
         $123 = (($$3369438) + 1)|0;
         $$1388 = $100;$$1391 = $97;$$1394 = $117;$$1397 = $118;$$4370 = $123;
         break;
        }
       }
      } while(0);
      $124 = (($$1354) + 1)|0;
      $125 = (($22) + (($$1354*14)|0)|0);
      _stbtt_setvertex($125,1,$$1397,$$1394,0,0);
      $126 = $$0377437 << 1;
      $127 = (($12) + ($126)|0);
      $128 = (_ttUSHORT($127)|0);
      $129 = $128&65535;
      $130 = (($129) + 1)|0;
      $131 = (($$0377437) + 1)|0;
      $$1378 = $131;$$1380 = $130;$$1400 = $$0399431;$$1402 = $$0401430;$$1408 = $107;$$1410 = 0;$$2389 = $$1388;$$2392 = $$1391;$$2395 = $$1394;$$2398 = $$1397;$$3356 = $124;$$5371 = $$4370;
     } else {
      $132 = ($$0409428|0)!=(0);
      $133 = (($$0353439) + 1)|0;
      $134 = (($22) + (($$0353439*14)|0)|0);
      if (!($103)) {
       if (!($132)) {
        $$1378 = $$0377437;$$1380 = $$0379436;$$1400 = $100;$$1402 = $97;$$1408 = $$0407429;$$1410 = 1;$$2389 = $$0387435;$$2392 = $$0390434;$$2395 = $$0393433;$$2398 = $$0396432;$$3356 = $$0353439;$$5371 = $$3369438;
        break;
       }
       $135 = (($100) + ($$0399431))|0;
       $136 = $135 >> 1;
       $137 = (($97) + ($$0401430))|0;
       $138 = $137 >> 1;
       _stbtt_setvertex($134,3,$138,$136,$$0401430,$$0399431);
       $$1378 = $$0377437;$$1380 = $$0379436;$$1400 = $100;$$1402 = $97;$$1408 = $$0407429;$$1410 = 1;$$2389 = $$0387435;$$2392 = $$0390434;$$2395 = $$0393433;$$2398 = $$0396432;$$3356 = $133;$$5371 = $$3369438;
       break;
      }
      if ($132) {
       _stbtt_setvertex($134,3,$97,$100,$$0401430,$$0399431);
       $$1378 = $$0377437;$$1380 = $$0379436;$$1400 = $$0399431;$$1402 = $$0401430;$$1408 = $$0407429;$$1410 = 0;$$2389 = $$0387435;$$2392 = $$0390434;$$2395 = $$0393433;$$2398 = $$0396432;$$3356 = $133;$$5371 = $$3369438;
       break;
      } else {
       _stbtt_setvertex($134,2,$97,$100,0,0);
       $$1378 = $$0377437;$$1380 = $$0379436;$$1400 = $$0399431;$$1402 = $$0401430;$$1408 = $$0407429;$$1410 = 0;$$2389 = $$0387435;$$2392 = $$0390434;$$2395 = $$0393433;$$2398 = $$0396432;$$3356 = $133;$$5371 = $$3369438;
       break;
      }
     }
    } while(0);
    $139 = (($$5371) + 1)|0;
    $140 = ($$5371|0)<($18|0);
    if ($140) {
     $$0353439 = $$3356;$$0377437 = $$1378;$$0379436 = $$1380;$$0387435 = $$2389;$$0390434 = $$2392;$$0393433 = $$2395;$$0396432 = $$2398;$$0399431 = $$1400;$$0401430 = $$1402;$$0407429 = $$1408;$$0409428 = $$1410;$$3369438 = $139;
    } else {
     break;
    }
   }
   $141 = (_stbtt__close_shape($22,$$3356,$$1410,$$1408,$$2398,$$2395,$$2392,$$2389,$$1402,$$1400)|0);
   $$4352 = $22;$$9 = $141;
  } else {
   $142 = ($9<<16>>16)==(-1);
   if (!($142)) {
    $264 = ($9<<16>>16)<(0);
    if (!($264)) {
     $$4352 = 0;$$9 = 0;
     break;
    }
    ___assert_fail((13672|0),(13212|0),1724,(13991|0));
    // unreachable;
   }
   $143 = ((($8)) + 10|0);
   $$0348453 = 0;$$0372451 = $143;$$5452 = 0;$250 = 0;$255 = 0;$260 = 0;
   while(1) {
    HEAP32[$3>>2] = 0;
    $144 = (_ttSHORT($$0372451)|0);
    $145 = ((($$0372451)) + 2|0);
    $146 = (_ttSHORT($145)|0);
    $147 = ((($$0372451)) + 4|0);
    $148 = $144&65535;
    $149 = $148 & 2;
    $150 = ($149|0)==(0);
    if ($150) {
     label = 42;
     break;
    }
    $151 = $148 & 1;
    $152 = ($151|0)==(0);
    if ($152) {
     $158 = HEAP8[$147>>0]|0;
     $159 = (+($158<<24>>24));
     $160 = ((($$0372451)) + 5|0);
     $161 = HEAP8[$160>>0]|0;
     $162 = (+($161<<24>>24));
     $$sink = 6;$$sroa$31$0 = $159;$$sroa$35$0 = $162;
    } else {
     $153 = (_ttSHORT($147)|0);
     $154 = (+($153<<16>>16));
     $155 = ((($$0372451)) + 6|0);
     $156 = (_ttSHORT($155)|0);
     $157 = (+($156<<16>>16));
     $$sink = 8;$$sroa$31$0 = $154;$$sroa$35$0 = $157;
    }
    $163 = (($$0372451) + ($$sink)|0);
    $164 = $148 & 8;
    $165 = ($164|0)==(0);
    do {
     if ($165) {
      $170 = $148 & 64;
      $171 = ($170|0)==(0);
      if (!($171)) {
       $172 = (_ttSHORT($163)|0);
       $173 = (+($172<<16>>16));
       $174 = $173 * 6.103515625E-5;
       $175 = ((($163)) + 2|0);
       $176 = (_ttSHORT($175)|0);
       $177 = (+($176<<16>>16));
       $178 = $177 * 6.103515625E-5;
       $179 = ((($163)) + 4|0);
       $$2374 = $179;$$sroa$0$0 = $174;$$sroa$10$0 = 0.0;$$sroa$17$0 = 0.0;$$sroa$24$0 = $178;
       break;
      }
      $180 = $148 & 128;
      $181 = ($180|0)==(0);
      if ($181) {
       $$2374 = $163;$$sroa$0$0 = 1.0;$$sroa$10$0 = 0.0;$$sroa$17$0 = 0.0;$$sroa$24$0 = 1.0;
      } else {
       $182 = (_ttSHORT($163)|0);
       $183 = (+($182<<16>>16));
       $184 = $183 * 6.103515625E-5;
       $185 = ((($163)) + 2|0);
       $186 = (_ttSHORT($185)|0);
       $187 = (+($186<<16>>16));
       $188 = $187 * 6.103515625E-5;
       $189 = ((($163)) + 4|0);
       $190 = (_ttSHORT($189)|0);
       $191 = (+($190<<16>>16));
       $192 = $191 * 6.103515625E-5;
       $193 = ((($163)) + 6|0);
       $194 = (_ttSHORT($193)|0);
       $195 = (+($194<<16>>16));
       $196 = $195 * 6.103515625E-5;
       $197 = ((($163)) + 8|0);
       $$2374 = $197;$$sroa$0$0 = $184;$$sroa$10$0 = $188;$$sroa$17$0 = $192;$$sroa$24$0 = $196;
      }
     } else {
      $166 = (_ttSHORT($163)|0);
      $167 = (+($166<<16>>16));
      $168 = $167 * 6.103515625E-5;
      $169 = ((($163)) + 2|0);
      $$2374 = $169;$$sroa$0$0 = $168;$$sroa$10$0 = 0.0;$$sroa$17$0 = 0.0;$$sroa$24$0 = $168;
     }
    } while(0);
    $198 = $$sroa$0$0 * $$sroa$0$0;
    $199 = $$sroa$10$0 * $$sroa$10$0;
    $200 = $199 + $198;
    $sqrtf = (+Math_sqrt((+$200)));
    $201 = $$sroa$17$0 * $$sroa$17$0;
    $202 = $$sroa$24$0 * $$sroa$24$0;
    $203 = $202 + $201;
    $sqrtf411 = (+Math_sqrt((+$203)));
    $204 = $146&65535;
    $205 = (_stbtt_GetGlyphShape($0,$204,$3)|0);
    $206 = ($205|0)>(0);
    if ($206) {
     $207 = HEAP32[$3>>2]|0;
     $$0363450 = 0;
     while(1) {
      $208 = (($207) + (($$0363450*14)|0)|0);
      $209 = HEAP16[$208>>1]|0;
      $210 = (((($207) + (($$0363450*14)|0)|0)) + 2|0);
      $211 = HEAP16[$210>>1]|0;
      $212 = (+($209<<16>>16));
      $213 = $$sroa$0$0 * $212;
      $214 = (+($211<<16>>16));
      $215 = $$sroa$17$0 * $214;
      $216 = $213 + $215;
      $217 = $$sroa$31$0 + $216;
      $218 = $sqrtf * $217;
      $219 = (~~(($218)));
      HEAP16[$208>>1] = $219;
      $220 = $$sroa$10$0 * $212;
      $221 = $$sroa$24$0 * $214;
      $222 = $220 + $221;
      $223 = $$sroa$35$0 + $222;
      $224 = $sqrtf411 * $223;
      $225 = (~~(($224)));
      HEAP16[$210>>1] = $225;
      $226 = (((($207) + (($$0363450*14)|0)|0)) + 4|0);
      $227 = HEAP16[$226>>1]|0;
      $228 = (((($207) + (($$0363450*14)|0)|0)) + 6|0);
      $229 = HEAP16[$228>>1]|0;
      $230 = (+($227<<16>>16));
      $231 = $$sroa$0$0 * $230;
      $232 = (+($229<<16>>16));
      $233 = $$sroa$17$0 * $232;
      $234 = $231 + $233;
      $235 = $$sroa$31$0 + $234;
      $236 = $sqrtf * $235;
      $237 = (~~(($236)));
      HEAP16[$226>>1] = $237;
      $238 = $$sroa$10$0 * $230;
      $239 = $$sroa$24$0 * $232;
      $240 = $238 + $239;
      $241 = $$sroa$35$0 + $240;
      $242 = $sqrtf411 * $241;
      $243 = (~~(($242)));
      HEAP16[$228>>1] = $243;
      $244 = (($$0363450) + 1)|0;
      $exitcond460 = ($244|0)==($205|0);
      if ($exitcond460) {
       break;
      } else {
       $$0363450 = $244;
      }
     }
     $245 = (($205) + ($$5452))|0;
     $246 = ($245*14)|0;
     $247 = (_malloc($246)|0);
     $248 = ($247|0)==(0|0);
     if ($248) {
      break;
     }
     $253 = ($$5452|0)>(0);
     if ($253) {
      $254 = ($$5452*14)|0;
      _memcpy(($247|0),($255|0),($254|0))|0;
     }
     $256 = (($247) + (($$5452*14)|0)|0);
     $257 = HEAP32[$3>>2]|0;
     $258 = ($205*14)|0;
     _memcpy(($256|0),($257|0),($258|0))|0;
     $259 = ($$0348453|0)==(0|0);
     if (!($259)) {
      _free($260);
     }
     $261 = HEAP32[$3>>2]|0;
     _free($261);
     $$1349 = $247;$$6 = $245;$265 = $247;$266 = $247;$267 = $247;
    } else {
     $$1349 = $$0348453;$$6 = $$5452;$265 = $250;$266 = $260;$267 = $255;
    }
    $262 = $148 & 32;
    $263 = ($262|0)==(0);
    if ($263) {
     $$4352 = $$1349;$$9 = $$6;
     break L4;
    } else {
     $$0348453 = $$1349;$$0372451 = $$2374;$$5452 = $$6;$250 = $265;$255 = $267;$260 = $266;
    }
   }
   if ((label|0) == 42) {
    ___assert_fail((13672|0),(13212|0),1671,(13991|0));
    // unreachable;
   }
   $249 = ($$0348453|0)==(0|0);
   if (!($249)) {
    _free($250);
   }
   $251 = HEAP32[$3>>2]|0;
   $252 = ($251|0)==(0|0);
   if (!($252)) {
    _free($251);
   }
   $$4 = 0;
   STACKTOP = sp;return ($$4|0);
  }
 } while(0);
 HEAP32[$2>>2] = $$4352;
 $$4 = $$9;
 STACKTOP = sp;return ($$4|0);
}
function _stbtt__GetGlyphShapeT2($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $$0 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, dest = 0, label = 0, sp = 0;
 var stop = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 96|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(96|0);
 $3 = sp + 48|0;
 $4 = sp;
 $5 = ((($3)) + 4|0);
 dest=$5; stop=dest+44|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0));
 HEAP32[$3>>2] = 1;
 dest=$4; stop=dest+48|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0));
 $6 = (_stbtt__run_charstring($0,$1,$3)|0);
 $7 = ($6|0)==(0);
 if (!($7)) {
  $8 = ((($3)) + 44|0);
  $9 = HEAP32[$8>>2]|0;
  $10 = ($9*14)|0;
  $11 = (_malloc($10)|0);
  HEAP32[$2>>2] = $11;
  $12 = ((($4)) + 40|0);
  HEAP32[$12>>2] = $11;
  $13 = (_stbtt__run_charstring($0,$1,$4)|0);
  $14 = ($13|0)==(0);
  if (!($14)) {
   $15 = ((($4)) + 44|0);
   $16 = HEAP32[$15>>2]|0;
   $17 = HEAP32[$8>>2]|0;
   $18 = ($16|0)==($17|0);
   if ($18) {
    $$0 = $16;
    STACKTOP = sp;return ($$0|0);
   } else {
    ___assert_fail((13918|0),(13212|0),2114,(13968|0));
    // unreachable;
   }
  }
 }
 HEAP32[$2>>2] = 0;
 $$0 = 0;
 STACKTOP = sp;return ($$0|0);
}
function _stbtt__close_shape($0,$1,$2,$3,$4,$5,$6,$7,$8,$9) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 $4 = $4|0;
 $5 = $5|0;
 $6 = $6|0;
 $7 = $7|0;
 $8 = $8|0;
 $9 = $9|0;
 var $$0 = 0, $$1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $10 = ($3|0)==(0);
 $11 = ($2|0)!=(0);
 $12 = (($1) + 1)|0;
 $13 = (($0) + (($1*14)|0)|0);
 if (!($10)) {
  if ($11) {
   $14 = (($9) + ($7))|0;
   $15 = $14 >> 1;
   $16 = (($8) + ($6))|0;
   $17 = $16 >> 1;
   _stbtt_setvertex($13,3,$17,$15,$8,$9);
   $$0 = $12;
  } else {
   $$0 = $1;
  }
  $18 = (($$0) + 1)|0;
  $19 = (($0) + (($$0*14)|0)|0);
  _stbtt_setvertex($19,3,$4,$5,$6,$7);
  $$1 = $18;
  return ($$1|0);
 }
 if ($11) {
  _stbtt_setvertex($13,3,$4,$5,$8,$9);
  $$1 = $12;
  return ($$1|0);
 } else {
  _stbtt_setvertex($13,2,$4,$5,0,0);
  $$1 = $12;
  return ($$1|0);
 }
 return (0)|0;
}
function _stbtt_InitFont_internal($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$0902 = 0, $$1 = 0, $$byval_copy1 = 0, $$byval_copy2 = 0, $$pr = 0, $$sink = 0, $10 = 0, $100 = 0, $101 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0;
 var $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0;
 var $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0;
 var $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0;
 var $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0;
 var $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $exitcond = 0, $or$cond = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 192|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(192|0);
 $$byval_copy2 = sp + 172|0;
 $$byval_copy1 = sp + 160|0;
 $2 = sp + 148|0;
 $3 = sp + 136|0;
 $4 = sp + 124|0;
 $5 = sp + 112|0;
 $6 = sp + 108|0;
 $7 = sp + 104|0;
 $8 = sp + 100|0;
 $9 = sp + 96|0;
 $10 = sp + 84|0;
 $11 = sp + 72|0;
 $12 = sp + 60|0;
 $13 = sp + 48|0;
 $14 = sp + 36|0;
 $15 = sp + 24|0;
 $16 = sp + 12|0;
 $17 = sp;
 $18 = ((($0)) + 4|0);
 HEAP32[$18>>2] = $1;
 $19 = ((($0)) + 8|0);
 HEAP32[$19>>2] = 0;
 $20 = ((($0)) + 48|0);
 _stbtt__new_buf($2,0,0);
 ;HEAP32[$20>>2]=HEAP32[$2>>2]|0;HEAP32[$20+4>>2]=HEAP32[$2+4>>2]|0;HEAP32[$20+8>>2]=HEAP32[$2+8>>2]|0;
 $21 = (_stbtt__find_table($1,14091)|0);
 $22 = (_stbtt__find_table($1,14096)|0);
 $23 = ((($0)) + 16|0);
 HEAP32[$23>>2] = $22;
 $24 = (_stbtt__find_table($1,14101)|0);
 $25 = ((($0)) + 20|0);
 HEAP32[$25>>2] = $24;
 $26 = (_stbtt__find_table($1,14106)|0);
 $27 = ((($0)) + 24|0);
 HEAP32[$27>>2] = $26;
 $28 = (_stbtt__find_table($1,14111)|0);
 $29 = ((($0)) + 28|0);
 HEAP32[$29>>2] = $28;
 $30 = (_stbtt__find_table($1,14116)|0);
 $31 = ((($0)) + 32|0);
 HEAP32[$31>>2] = $30;
 $32 = (_stbtt__find_table($1,14121)|0);
 $33 = ((($0)) + 36|0);
 HEAP32[$33>>2] = $32;
 $34 = ($21|0)==(0);
 if ($34) {
  $$1 = 0;
  STACKTOP = sp;return ($$1|0);
 }
 $35 = HEAP32[$25>>2]|0;
 $36 = ($35|0)==(0);
 if ($36) {
  $$1 = 0;
  STACKTOP = sp;return ($$1|0);
 }
 $37 = HEAP32[$29>>2]|0;
 $38 = ($37|0)==(0);
 if ($38) {
  $$1 = 0;
  STACKTOP = sp;return ($$1|0);
 }
 $39 = HEAP32[$31>>2]|0;
 $40 = ($39|0)==(0);
 if ($40) {
  $$1 = 0;
  STACKTOP = sp;return ($$1|0);
 }
 $41 = HEAP32[$27>>2]|0;
 $42 = ($41|0)==(0);
 L13: do {
  if ($42) {
   HEAP32[$6>>2] = 2;
   HEAP32[$7>>2] = 0;
   HEAP32[$8>>2] = 0;
   HEAP32[$9>>2] = 0;
   $45 = (_stbtt__find_table($1,14126)|0);
   $46 = ($45|0)==(0);
   do {
    if (!($46)) {
     $47 = ((($0)) + 96|0);
     _stbtt__new_buf($10,0,0);
     ;HEAP32[$47>>2]=HEAP32[$10>>2]|0;HEAP32[$47+4>>2]=HEAP32[$10+4>>2]|0;HEAP32[$47+8>>2]=HEAP32[$10+8>>2]|0;
     $48 = ((($0)) + 108|0);
     _stbtt__new_buf($11,0,0);
     ;HEAP32[$48>>2]=HEAP32[$11>>2]|0;HEAP32[$48+4>>2]=HEAP32[$11+4>>2]|0;HEAP32[$48+8>>2]=HEAP32[$11+8>>2]|0;
     $49 = (($1) + ($45)|0);
     _stbtt__new_buf($12,$49,536870912);
     ;HEAP32[$20>>2]=HEAP32[$12>>2]|0;HEAP32[$20+4>>2]=HEAP32[$12+4>>2]|0;HEAP32[$20+8>>2]=HEAP32[$12+8>>2]|0;
     ;HEAP32[$3>>2]=HEAP32[$12>>2]|0;HEAP32[$3+4>>2]=HEAP32[$12+4>>2]|0;HEAP32[$3+8>>2]=HEAP32[$12+8>>2]|0;
     _stbtt__buf_skip($3,2);
     $50 = (_stbtt__buf_get8($3)|0);
     $51 = $50&255;
     _stbtt__buf_seek($3,$51);
     _stbtt__cff_get_index($$byval_copy2,$3);
     _stbtt__cff_get_index($5,$3);
     ;HEAP32[$$byval_copy2>>2]=HEAP32[$5>>2]|0;HEAP32[$$byval_copy2+4>>2]=HEAP32[$5+4>>2]|0;HEAP32[$$byval_copy2+8>>2]=HEAP32[$5+8>>2]|0;
     _stbtt__cff_index_get($4,$$byval_copy2,0);
     _stbtt__cff_get_index($$byval_copy2,$3);
     $52 = ((($0)) + 72|0);
     _stbtt__cff_get_index($13,$3);
     ;HEAP32[$52>>2]=HEAP32[$13>>2]|0;HEAP32[$52+4>>2]=HEAP32[$13+4>>2]|0;HEAP32[$52+8>>2]=HEAP32[$13+8>>2]|0;
     _stbtt__dict_get_ints($4,17,1,$7);
     _stbtt__dict_get_ints($4,262,1,$6);
     _stbtt__dict_get_ints($4,292,1,$8);
     _stbtt__dict_get_ints($4,293,1,$9);
     $53 = ((($0)) + 84|0);
     ;HEAP32[$$byval_copy1>>2]=HEAP32[$3>>2]|0;HEAP32[$$byval_copy1+4>>2]=HEAP32[$3+4>>2]|0;HEAP32[$$byval_copy1+8>>2]=HEAP32[$3+8>>2]|0;
     ;HEAP32[$$byval_copy2>>2]=HEAP32[$4>>2]|0;HEAP32[$$byval_copy2+4>>2]=HEAP32[$4+4>>2]|0;HEAP32[$$byval_copy2+8>>2]=HEAP32[$4+8>>2]|0;
     _stbtt__get_subrs($14,$$byval_copy1,$$byval_copy2);
     ;HEAP32[$53>>2]=HEAP32[$14>>2]|0;HEAP32[$53+4>>2]=HEAP32[$14+4>>2]|0;HEAP32[$53+8>>2]=HEAP32[$14+8>>2]|0;
     $54 = HEAP32[$6>>2]|0;
     $55 = ($54|0)!=(2);
     $56 = HEAP32[$7>>2]|0;
     $57 = ($56|0)==(0);
     $or$cond = $55 | $57;
     if (!($or$cond)) {
      $58 = HEAP32[$8>>2]|0;
      $59 = ($58|0)==(0);
      if (!($59)) {
       $60 = HEAP32[$9>>2]|0;
       $61 = ($60|0)==(0);
       if ($61) {
        break;
       }
       _stbtt__buf_seek($3,$58);
       _stbtt__cff_get_index($15,$3);
       ;HEAP32[$47>>2]=HEAP32[$15>>2]|0;HEAP32[$47+4>>2]=HEAP32[$15+4>>2]|0;HEAP32[$47+8>>2]=HEAP32[$15+8>>2]|0;
       $62 = HEAP32[$9>>2]|0;
       $63 = ((($3)) + 8|0);
       $64 = HEAP32[$63>>2]|0;
       $65 = (($64) - ($62))|0;
       _stbtt__buf_range($16,$3,$62,$65);
       ;HEAP32[$48>>2]=HEAP32[$16>>2]|0;HEAP32[$48+4>>2]=HEAP32[$16+4>>2]|0;HEAP32[$48+8>>2]=HEAP32[$16+8>>2]|0;
      }
      $66 = HEAP32[$7>>2]|0;
      _stbtt__buf_seek($3,$66);
      $67 = ((($0)) + 60|0);
      _stbtt__cff_get_index($17,$3);
      ;HEAP32[$67>>2]=HEAP32[$17>>2]|0;HEAP32[$67+4>>2]=HEAP32[$17+4>>2]|0;HEAP32[$67+8>>2]=HEAP32[$17+8>>2]|0;
      break L13;
     }
    }
   } while(0);
   $$1 = 0;
   STACKTOP = sp;return ($$1|0);
  } else {
   $43 = HEAP32[$23>>2]|0;
   $44 = ($43|0)==(0);
   if ($44) {
    $$1 = 0;
    STACKTOP = sp;return ($$1|0);
   }
  }
 } while(0);
 $68 = (_stbtt__find_table($1,14131)|0);
 $69 = ($68|0)==(0);
 if ($69) {
  $$sink = 65535;
 } else {
  $70 = (($1) + ($68)|0);
  $71 = ((($70)) + 4|0);
  $72 = (_ttUSHORT($71)|0);
  $73 = $72&65535;
  $$sink = $73;
 }
 $74 = ((($0)) + 12|0);
 HEAP32[$74>>2] = $$sink;
 $75 = (($1) + ($21)|0);
 $76 = ((($75)) + 2|0);
 $77 = (_ttUSHORT($76)|0);
 $78 = $77&65535;
 $79 = ((($0)) + 40|0);
 HEAP32[$79>>2] = 0;
 $80 = ($77<<16>>16)==(0);
 if ($80) {
  $$1 = 0;
  STACKTOP = sp;return ($$1|0);
 }
 $81 = (($21) + 4)|0;
 $$0902 = 0;
 while(1) {
  $82 = $$0902 << 3;
  $83 = (($81) + ($82))|0;
  $84 = (($1) + ($83)|0);
  $85 = (_ttUSHORT($84)|0);
  L35: do {
   switch ($85<<16>>16) {
   case 3:  {
    $86 = ((($84)) + 2|0);
    $87 = (_ttUSHORT($86)|0);
    switch ($87<<16>>16) {
    case 10: case 1:  {
     break;
    }
    default: {
     break L35;
    }
    }
    $88 = ((($84)) + 4|0);
    $89 = (_ttULONG($88)|0);
    $90 = (($89) + ($21))|0;
    HEAP32[$79>>2] = $90;
    break;
   }
   case 0:  {
    $91 = ((($84)) + 4|0);
    $92 = (_ttULONG($91)|0);
    $93 = (($92) + ($21))|0;
    HEAP32[$79>>2] = $93;
    break;
   }
   default: {
   }
   }
  } while(0);
  $94 = (($$0902) + 1)|0;
  $exitcond = ($94|0)==($78|0);
  if ($exitcond) {
   break;
  } else {
   $$0902 = $94;
  }
 }
 $$pr = HEAP32[$79>>2]|0;
 $95 = ($$pr|0)==(0);
 if ($95) {
  $$1 = 0;
  STACKTOP = sp;return ($$1|0);
 }
 $96 = HEAP32[$25>>2]|0;
 $97 = (($1) + ($96)|0);
 $98 = ((($97)) + 50|0);
 $99 = (_ttUSHORT($98)|0);
 $100 = $99&65535;
 $101 = ((($0)) + 44|0);
 HEAP32[$101>>2] = $100;
 $$1 = 1;
 STACKTOP = sp;return ($$1|0);
}
function _stbtt__find_table($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$0312 = 0, $$2 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
 var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0;
 var sp = 0;
 sp = STACKTOP;
 $2 = ((($0)) + 4|0);
 $3 = (_ttUSHORT($2)|0);
 $4 = $3&65535;
 $5 = ($3<<16>>16)==(0);
 if ($5) {
  $$2 = 0;
  return ($$2|0);
 }
 $6 = HEAP8[$1>>0]|0;
 $7 = $6 << 24 >> 24;
 $8 = ((($1)) + 1|0);
 $9 = ((($1)) + 2|0);
 $10 = ((($1)) + 3|0);
 $$0312 = 0;
 while(1) {
  $11 = $$0312 << 4;
  $12 = $11 | 12;
  $13 = (($0) + ($12)|0);
  $14 = HEAP8[$13>>0]|0;
  $15 = $14&255;
  $16 = ($15|0)==($7|0);
  if ($16) {
   $17 = ((($13)) + 1|0);
   $18 = HEAP8[$17>>0]|0;
   $19 = $18&255;
   $20 = HEAP8[$8>>0]|0;
   $21 = $20 << 24 >> 24;
   $22 = ($19|0)==($21|0);
   if ($22) {
    $23 = ((($13)) + 2|0);
    $24 = HEAP8[$23>>0]|0;
    $25 = $24&255;
    $26 = HEAP8[$9>>0]|0;
    $27 = $26 << 24 >> 24;
    $28 = ($25|0)==($27|0);
    if ($28) {
     $29 = ((($13)) + 3|0);
     $30 = HEAP8[$29>>0]|0;
     $31 = $30&255;
     $32 = HEAP8[$10>>0]|0;
     $33 = $32 << 24 >> 24;
     $34 = ($31|0)==($33|0);
     if ($34) {
      break;
     }
    }
   }
  }
  $37 = (($$0312) + 1)|0;
  $38 = ($37|0)<($4|0);
  if ($38) {
   $$0312 = $37;
  } else {
   $$2 = 0;
   label = 9;
   break;
  }
 }
 if ((label|0) == 9) {
  return ($$2|0);
 }
 $35 = ((($13)) + 8|0);
 $36 = (_ttULONG($35)|0);
 $$2 = $36;
 return ($$2|0);
}
function _DrawText($0,$1,$2,$3,$4) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 $4 = $4|0;
 var $$ = 0, $$byval_copy = 0, $$byval_copy1 = 0, $$byval_copy2 = 0, $10 = 0.0, $11 = 0, $12 = 0.0, $13 = 0, $14 = 0, $15 = 0.0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 128|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(128|0);
 $$byval_copy2 = sp + 112|0;
 $$byval_copy1 = sp + 104|0;
 $$byval_copy = sp + 72|0;
 $5 = sp + 32|0;
 $6 = sp + 64|0;
 $7 = sp;
 _GetDefaultFont($5);
 $8 = HEAP32[$5>>2]|0;
 $9 = ($8|0)==(0);
 if ($9) {
  STACKTOP = sp;return;
 }
 $10 = (+($1|0));
 HEAPF32[$6>>2] = $10;
 $11 = ((($6)) + 4|0);
 $12 = (+($2|0));
 HEAPF32[$11>>2] = $12;
 $13 = ($3|0)>(10);
 $$ = $13 ? $3 : 10;
 $14 = (($$>>>0) / 10)&-1;
 _GetDefaultFont($7);
 $15 = (+($$|0));
 ;HEAP32[$$byval_copy>>2]=HEAP32[$7>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$7+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[$7+8>>2]|0;HEAP32[$$byval_copy+12>>2]=HEAP32[$7+12>>2]|0;HEAP32[$$byval_copy+16>>2]=HEAP32[$7+16>>2]|0;HEAP32[$$byval_copy+20>>2]=HEAP32[$7+20>>2]|0;HEAP32[$$byval_copy+24>>2]=HEAP32[$7+24>>2]|0;HEAP32[$$byval_copy+28>>2]=HEAP32[$7+28>>2]|0;
 ;HEAP32[$$byval_copy1>>2]=HEAP32[$6>>2]|0;HEAP32[$$byval_copy1+4>>2]=HEAP32[$6+4>>2]|0;
 ;HEAP8[$$byval_copy2>>0]=HEAP8[$4>>0]|0;HEAP8[$$byval_copy2+1>>0]=HEAP8[$4+1>>0]|0;HEAP8[$$byval_copy2+2>>0]=HEAP8[$4+2>>0]|0;HEAP8[$$byval_copy2+3>>0]=HEAP8[$4+3>>0]|0;
 _DrawTextEx($$byval_copy,$0,$$byval_copy1,$15,$14,$$byval_copy2);
 STACKTOP = sp;return;
}
function _DrawTextEx($0,$1,$2,$3,$4,$5) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = +$3;
 $4 = $4|0;
 $5 = $5|0;
 var $$04954 = 0, $$05153 = 0, $$055 = 0, $$1 = 0, $$150 = 0, $$152 = 0, $$2 = 0, $$byval_copy1 = 0, $$byval_copy2 = 0, $$byval_copy3 = 0, $$byval_copy4 = 0, $$byval_copy5 = 0, $$sink = 0, $10 = 0, $11 = 0.0, $12 = 0.0, $13 = 0, $14 = 0, $15 = 0.0, $16 = 0;
 var $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0.0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0.0, $28 = 0.0, $29 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0;
 var $37 = 0, $38 = 0, $39 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0.0, $45 = 0.0, $46 = 0, $47 = 0, $48 = 0.0, $49 = 0.0, $50 = 0.0, $51 = 0, $52 = 0.0, $53 = 0.0, $54 = 0.0, $55 = 0, $56 = 0;
 var $57 = 0.0, $58 = 0.0, $59 = 0.0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0.0, $64 = 0.0, $65 = 0, $66 = 0, $67 = 0, $68 = 0.0, $69 = 0.0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0;
 var $75 = 0, $76 = 0, $77 = 0.0, $78 = 0.0, $79 = 0.0, $8 = 0, $80 = 0, $81 = 0, $82 = 0.0, $83 = 0.0, $84 = 0.0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 128|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(128|0);
 $$byval_copy5 = sp + 88|0;
 $$byval_copy4 = sp + 80|0;
 $$byval_copy3 = sp + 64|0;
 $$byval_copy2 = sp + 48|0;
 $$byval_copy1 = sp + 24|0;
 $6 = sp + 8|0;
 $7 = sp;
 $8 = (_strlen($1)|0);
 $9 = ((($0)) + 20|0);
 $10 = HEAP32[$9>>2]|0;
 $11 = (+($10|0));
 $12 = $3 / $11;
 $13 = ($8|0)>(0);
 if (!($13)) {
  STACKTOP = sp;return;
 }
 $14 = ((($0)) + 28|0);
 $15 = +HEAPF32[$2>>2];
 $16 = ((($6)) + 4|0);
 $17 = ((($2)) + 4|0);
 $18 = ((($6)) + 8|0);
 $19 = ((($6)) + 12|0);
 $20 = ((($7)) + 4|0);
 $21 = (+($4|0));
 $$04954 = 0;$$05153 = 0;$$055 = 0;
 while(1) {
  $22 = (($1) + ($$055)|0);
  $23 = HEAP8[$22>>0]|0;
  switch ($23<<24>>24) {
  case 10:  {
   $24 = HEAP32[$9>>2]|0;
   $25 = (($24|0) / 2)&-1;
   $26 = (($25) + ($24))|0;
   $27 = (+($26|0));
   $28 = $12 * $27;
   $29 = (~~(($28)));
   $30 = (($29) + ($$05153))|0;
   $$150 = 0;$$152 = $30;$$2 = $$055;
   break;
  }
  case -62:  {
   $31 = (($$055) + 1)|0;
   $32 = (($1) + ($31)|0);
   $33 = HEAP8[$32>>0]|0;
   $34 = $33&255;
   $$1 = $31;$$sink = $34;
   label = 9;
   break;
  }
  case -61:  {
   $35 = (($$055) + 1)|0;
   $36 = (($1) + ($35)|0);
   $37 = HEAP8[$36>>0]|0;
   $38 = $37&255;
   $39 = (($38) + 64)|0;
   $$1 = $35;$$sink = $39;
   label = 9;
   break;
  }
  default: {
   $40 = $23 << 24 >> 24;
   $$1 = $$055;$$sink = $40;
   label = 9;
  }
  }
  do {
   if ((label|0) == 9) {
    label = 0;
    ;HEAP32[$$byval_copy5>>2]=HEAP32[$0>>2]|0;HEAP32[$$byval_copy5+4>>2]=HEAP32[$0+4>>2]|0;HEAP32[$$byval_copy5+8>>2]=HEAP32[$0+8>>2]|0;HEAP32[$$byval_copy5+12>>2]=HEAP32[$0+12>>2]|0;HEAP32[$$byval_copy5+16>>2]=HEAP32[$0+16>>2]|0;HEAP32[$$byval_copy5+20>>2]=HEAP32[$0+20>>2]|0;HEAP32[$$byval_copy5+24>>2]=HEAP32[$0+24>>2]|0;HEAP32[$$byval_copy5+28>>2]=HEAP32[$0+28>>2]|0;
    $41 = (_GetCharIndex($$byval_copy5,$$sink)|0);
    $42 = HEAP32[$14>>2]|0;
    $43 = (((($42) + ($41<<5)|0)) + 4|0);
    $44 = (+($$04954|0));
    $45 = $44 + $15;
    $46 = (((($42) + ($41<<5)|0)) + 20|0);
    $47 = HEAP32[$46>>2]|0;
    $48 = (+($47|0));
    $49 = $12 * $48;
    $50 = $45 + $49;
    $51 = (~~(($50)));
    HEAP32[$6>>2] = $51;
    $52 = +HEAPF32[$17>>2];
    $53 = (+($$05153|0));
    $54 = $53 + $52;
    $55 = (((($42) + ($41<<5)|0)) + 24|0);
    $56 = HEAP32[$55>>2]|0;
    $57 = (+($56|0));
    $58 = $12 * $57;
    $59 = $54 + $58;
    $60 = (~~(($59)));
    HEAP32[$16>>2] = $60;
    $61 = (((($42) + ($41<<5)|0)) + 12|0);
    $62 = HEAP32[$61>>2]|0;
    $63 = (+($62|0));
    $64 = $12 * $63;
    $65 = (~~(($64)));
    HEAP32[$18>>2] = $65;
    $66 = (((($42) + ($41<<5)|0)) + 16|0);
    $67 = HEAP32[$66>>2]|0;
    $68 = (+($67|0));
    $69 = $12 * $68;
    $70 = (~~(($69)));
    HEAP32[$19>>2] = $70;
    HEAPF32[$7>>2] = 0.0;
    HEAPF32[$20>>2] = 0.0;
    ;HEAP32[$$byval_copy1>>2]=HEAP32[$0>>2]|0;HEAP32[$$byval_copy1+4>>2]=HEAP32[$0+4>>2]|0;HEAP32[$$byval_copy1+8>>2]=HEAP32[$0+8>>2]|0;HEAP32[$$byval_copy1+12>>2]=HEAP32[$0+12>>2]|0;HEAP32[$$byval_copy1+16>>2]=HEAP32[$0+16>>2]|0;
    ;HEAP32[$$byval_copy2>>2]=HEAP32[$43>>2]|0;HEAP32[$$byval_copy2+4>>2]=HEAP32[$43+4>>2]|0;HEAP32[$$byval_copy2+8>>2]=HEAP32[$43+8>>2]|0;HEAP32[$$byval_copy2+12>>2]=HEAP32[$43+12>>2]|0;
    ;HEAP32[$$byval_copy3>>2]=HEAP32[$6>>2]|0;HEAP32[$$byval_copy3+4>>2]=HEAP32[$6+4>>2]|0;HEAP32[$$byval_copy3+8>>2]=HEAP32[$6+8>>2]|0;HEAP32[$$byval_copy3+12>>2]=HEAP32[$6+12>>2]|0;
    ;HEAP32[$$byval_copy4>>2]=HEAP32[$7>>2]|0;HEAP32[$$byval_copy4+4>>2]=HEAP32[$7+4>>2]|0;
    ;HEAP8[$$byval_copy5>>0]=HEAP8[$5>>0]|0;HEAP8[$$byval_copy5+1>>0]=HEAP8[$5+1>>0]|0;HEAP8[$$byval_copy5+2>>0]=HEAP8[$5+2>>0]|0;HEAP8[$$byval_copy5+3>>0]=HEAP8[$5+3>>0]|0;
    _DrawTexturePro($$byval_copy1,$$byval_copy2,$$byval_copy3,$$byval_copy4,0.0,$$byval_copy5);
    $71 = HEAP32[$14>>2]|0;
    $72 = (((($71) + ($41<<5)|0)) + 28|0);
    $73 = HEAP32[$72>>2]|0;
    $74 = ($73|0)==(0);
    if ($74) {
     $75 = (((($71) + ($41<<5)|0)) + 12|0);
     $76 = HEAP32[$75>>2]|0;
     $77 = (+($76|0));
     $78 = $12 * $77;
     $79 = $21 + $78;
     $80 = (~~(($79)));
     $81 = (($80) + ($$04954))|0;
     $$150 = $81;$$152 = $$05153;$$2 = $$1;
     break;
    } else {
     $82 = (+($73|0));
     $83 = $12 * $82;
     $84 = $21 + $83;
     $85 = (~~(($84)));
     $86 = (($85) + ($$04954))|0;
     $$150 = $86;$$152 = $$05153;$$2 = $$1;
     break;
    }
   }
  } while(0);
  $87 = (($$2) + 1)|0;
  $88 = ($87|0)<($8|0);
  if ($88) {
   $$04954 = $$150;$$05153 = $$152;$$055 = $87;
  } else {
   break;
  }
 }
 STACKTOP = sp;return;
}
function _emscripten_GetProcAddress($0) {
 $0 = $0|0;
 var $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0;
 var $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0;
 var $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0;
 var $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0;
 var $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0;
 var $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0;
 var $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0;
 var $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0;
 var $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0;
 var $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0;
 var $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0;
 var $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0, $314 = 0;
 var $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0, $321 = 0, $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0, $332 = 0;
 var $333 = 0, $334 = 0, $335 = 0, $336 = 0, $337 = 0, $338 = 0, $339 = 0, $34 = 0, $340 = 0, $341 = 0, $342 = 0, $343 = 0, $344 = 0, $345 = 0, $346 = 0, $347 = 0, $348 = 0, $349 = 0, $35 = 0, $350 = 0;
 var $351 = 0, $352 = 0, $353 = 0, $354 = 0, $355 = 0, $356 = 0, $357 = 0, $358 = 0, $359 = 0, $36 = 0, $360 = 0, $361 = 0, $362 = 0, $363 = 0, $364 = 0, $365 = 0, $366 = 0, $367 = 0, $368 = 0, $369 = 0;
 var $37 = 0, $370 = 0, $371 = 0, $372 = 0, $373 = 0, $374 = 0, $375 = 0, $376 = 0, $377 = 0, $378 = 0, $379 = 0, $38 = 0, $380 = 0, $381 = 0, $382 = 0, $383 = 0, $384 = 0, $385 = 0, $386 = 0, $387 = 0;
 var $388 = 0, $389 = 0, $39 = 0, $390 = 0, $391 = 0, $392 = 0, $393 = 0, $394 = 0, $395 = 0, $396 = 0, $397 = 0, $398 = 0, $399 = 0, $4 = 0, $40 = 0, $400 = 0, $401 = 0, $402 = 0, $403 = 0, $404 = 0;
 var $405 = 0, $406 = 0, $407 = 0, $408 = 0, $409 = 0, $41 = 0, $410 = 0, $411 = 0, $412 = 0, $413 = 0, $414 = 0, $415 = 0, $416 = 0, $417 = 0, $418 = 0, $419 = 0, $42 = 0, $420 = 0, $421 = 0, $422 = 0;
 var $423 = 0, $424 = 0, $425 = 0, $426 = 0, $427 = 0, $428 = 0, $429 = 0, $43 = 0, $430 = 0, $431 = 0, $432 = 0, $433 = 0, $434 = 0, $435 = 0, $436 = 0, $437 = 0, $438 = 0, $439 = 0, $44 = 0, $440 = 0;
 var $441 = 0, $442 = 0, $443 = 0, $444 = 0, $445 = 0, $446 = 0, $447 = 0, $448 = 0, $449 = 0, $45 = 0, $450 = 0, $451 = 0, $452 = 0, $453 = 0, $454 = 0, $455 = 0, $456 = 0, $457 = 0, $458 = 0, $459 = 0;
 var $46 = 0, $460 = 0, $461 = 0, $462 = 0, $463 = 0, $464 = 0, $465 = 0, $466 = 0, $467 = 0, $468 = 0, $469 = 0, $47 = 0, $470 = 0, $471 = 0, $472 = 0, $473 = 0, $474 = 0, $475 = 0, $476 = 0, $477 = 0;
 var $478 = 0, $479 = 0, $48 = 0, $480 = 0, $481 = 0, $482 = 0, $483 = 0, $484 = 0, $485 = 0, $486 = 0, $487 = 0, $488 = 0, $489 = 0, $49 = 0, $490 = 0, $491 = 0, $492 = 0, $493 = 0, $494 = 0, $495 = 0;
 var $496 = 0, $497 = 0, $498 = 0, $499 = 0, $5 = 0, $50 = 0, $500 = 0, $501 = 0, $502 = 0, $503 = 0, $504 = 0, $505 = 0, $506 = 0, $507 = 0, $508 = 0, $509 = 0, $51 = 0, $510 = 0, $511 = 0, $512 = 0;
 var $513 = 0, $514 = 0, $515 = 0, $516 = 0, $517 = 0, $518 = 0, $519 = 0, $52 = 0, $520 = 0, $521 = 0, $522 = 0, $523 = 0, $524 = 0, $525 = 0, $526 = 0, $527 = 0, $528 = 0, $529 = 0, $53 = 0, $530 = 0;
 var $531 = 0, $532 = 0, $533 = 0, $534 = 0, $535 = 0, $536 = 0, $537 = 0, $538 = 0, $539 = 0, $54 = 0, $540 = 0, $541 = 0, $542 = 0, $543 = 0, $544 = 0, $545 = 0, $546 = 0, $547 = 0, $548 = 0, $549 = 0;
 var $55 = 0, $550 = 0, $551 = 0, $552 = 0, $553 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0;
 var $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0;
 var $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $1 = sp + 12|0;
 $2 = sp + 8|0;
 $3 = sp + 4|0;
 $4 = sp;
 HEAP32[$2>>2] = $0;
 $5 = HEAP32[$2>>2]|0;
 $6 = (_strlen($5)|0);
 $7 = (($6) + 1)|0;
 $8 = (_malloc($7)|0);
 HEAP32[$3>>2] = $8;
 $9 = HEAP32[$3>>2]|0;
 $10 = HEAP32[$2>>2]|0;
 (_strcpy($9,$10)|0);
 $11 = HEAP32[$3>>2]|0;
 $12 = (_strstr($11,14136)|0);
 HEAP32[$4>>2] = $12;
 $13 = HEAP32[$4>>2]|0;
 $14 = ($13|0)!=(0|0);
 if ($14) {
  $15 = HEAP32[$4>>2]|0;
  HEAP8[$15>>0] = 0;
 }
 $16 = HEAP32[$3>>2]|0;
 $17 = (_strstr($16,14140)|0);
 HEAP32[$4>>2] = $17;
 $18 = HEAP32[$4>>2]|0;
 $19 = ($18|0)!=(0|0);
 if ($19) {
  $20 = HEAP32[$4>>2]|0;
  HEAP8[$20>>0] = 0;
 }
 $21 = HEAP32[$3>>2]|0;
 $22 = (_strstr($21,14144)|0);
 HEAP32[$4>>2] = $22;
 $23 = HEAP32[$4>>2]|0;
 $24 = ($23|0)!=(0|0);
 if ($24) {
  $25 = HEAP32[$4>>2]|0;
  HEAP8[$25>>0] = 0;
 }
 $26 = HEAP32[$3>>2]|0;
 $27 = (_strstr($26,14148)|0);
 HEAP32[$4>>2] = $27;
 $28 = HEAP32[$4>>2]|0;
 $29 = ($28|0)!=(0|0);
 if ($29) {
  $30 = HEAP32[$4>>2]|0;
  HEAP8[$30>>0] = 0;
 }
 $31 = HEAP32[$3>>2]|0;
 $32 = (_strcmp($31,14154)|0);
 $33 = ($32|0)!=(0);
 do {
  if ($33) {
   $34 = HEAP32[$3>>2]|0;
   $35 = (_strcmp($34,14192)|0);
   $36 = ($35|0)!=(0);
   if (!($36)) {
    HEAP32[$3>>2] = 14211;
    break;
   }
   $37 = HEAP32[$3>>2]|0;
   $38 = (_strcmp($37,14224)|0);
   $39 = ($38|0)!=(0);
   if (!($39)) {
    HEAP32[$3>>2] = 14245;
    break;
   }
   $40 = HEAP32[$3>>2]|0;
   $41 = (_strcmp($40,14260)|0);
   $42 = ($41|0)!=(0);
   if (!($42)) {
    HEAP32[$3>>2] = 14275;
    break;
   }
   $43 = HEAP32[$3>>2]|0;
   $44 = (_strcmp($43,14290)|0);
   $45 = ($44|0)!=(0);
   if (!($45)) {
    HEAP32[$3>>2] = 14305;
   }
  } else {
   HEAP32[$3>>2] = 14176;
  }
 } while(0);
 $46 = HEAP32[$3>>2]|0;
 $47 = (_strcmp($46,14320)|0);
 $48 = ($47|0)!=(0);
 do {
  if ($48) {
   $49 = HEAP32[$3>>2]|0;
   $50 = (_strcmp($49,14334)|0);
   $51 = ($50|0)!=(0);
   if (!($51)) {
    HEAP32[$1>>2] = 3;
    break;
   }
   $52 = HEAP32[$3>>2]|0;
   $53 = (_strcmp($52,14346)|0);
   $54 = ($53|0)!=(0);
   if (!($54)) {
    HEAP32[$1>>2] = 7;
    break;
   }
   $55 = HEAP32[$3>>2]|0;
   $56 = (_strcmp($55,14360)|0);
   $57 = ($56|0)!=(0);
   if (!($57)) {
    HEAP32[$1>>2] = 8;
    break;
   }
   $58 = HEAP32[$3>>2]|0;
   $59 = (_strcmp($58,14372)|0);
   $60 = ($59|0)!=(0);
   if (!($60)) {
    HEAP32[$1>>2] = 9;
    break;
   }
   $61 = HEAP32[$3>>2]|0;
   $62 = (_strcmp($61,14386)|0);
   $63 = ($62|0)!=(0);
   if (!($63)) {
    HEAP32[$1>>2] = 10;
    break;
   }
   $64 = HEAP32[$3>>2]|0;
   $65 = (_strcmp($64,14400)|0);
   $66 = ($65|0)!=(0);
   if (!($66)) {
    HEAP32[$1>>2] = 11;
    break;
   }
   $67 = HEAP32[$3>>2]|0;
   $68 = (_strcmp($67,14417)|0);
   $69 = ($68|0)!=(0);
   if (!($69)) {
    HEAP32[$1>>2] = 1;
    break;
   }
   $70 = HEAP32[$3>>2]|0;
   $71 = (_strcmp($70,14440)|0);
   $72 = ($71|0)!=(0);
   if (!($72)) {
    HEAP32[$1>>2] = 1;
    break;
   }
   $73 = HEAP32[$3>>2]|0;
   $74 = (_strcmp($73,14466)|0);
   $75 = ($74|0)!=(0);
   if (!($75)) {
    HEAP32[$1>>2] = 2;
    break;
   }
   $76 = HEAP32[$3>>2]|0;
   $77 = (_strcmp($76,14479)|0);
   $78 = ($77|0)!=(0);
   if (!($78)) {
    HEAP32[$1>>2] = 3;
    break;
   }
   $79 = HEAP32[$3>>2]|0;
   $80 = (_strcmp($79,14495)|0);
   $81 = ($80|0)!=(0);
   if (!($81)) {
    HEAP32[$1>>2] = 1;
    break;
   }
   $82 = HEAP32[$3>>2]|0;
   $83 = (_strcmp($82,14508)|0);
   $84 = ($83|0)!=(0);
   if (!($84)) {
    HEAP32[$1>>2] = 12;
    break;
   }
   $85 = HEAP32[$3>>2]|0;
   $86 = (_strcmp($85,14522)|0);
   $87 = ($86|0)!=(0);
   if (!($87)) {
    HEAP32[$1>>2] = 2;
    break;
   }
   $88 = HEAP32[$3>>2]|0;
   $89 = (_strcmp($88,14542)|0);
   $90 = ($89|0)!=(0);
   if (!($90)) {
    HEAP32[$1>>2] = 3;
    break;
   }
   $91 = HEAP32[$3>>2]|0;
   $92 = (_strcmp($91,14562)|0);
   $93 = ($92|0)!=(0);
   if (!($93)) {
    HEAP32[$1>>2] = 4;
    break;
   }
   $94 = HEAP32[$3>>2]|0;
   $95 = (_strcmp($94,14579)|0);
   $96 = ($95|0)!=(0);
   if (!($96)) {
    HEAP32[$1>>2] = 5;
    break;
   }
   $97 = HEAP32[$3>>2]|0;
   $98 = (_strcmp($97,14596)|0);
   $99 = ($98|0)!=(0);
   if (!($99)) {
    HEAP32[$1>>2] = 4;
    break;
   }
   $100 = HEAP32[$3>>2]|0;
   $101 = (_strcmp($100,14608)|0);
   $102 = ($101|0)!=(0);
   if (!($102)) {
    HEAP32[$1>>2] = 13;
    break;
   }
   $103 = HEAP32[$3>>2]|0;
   $104 = (_strcmp($103,14621)|0);
   $105 = ($104|0)!=(0);
   if (!($105)) {
    HEAP32[$1>>2] = 14;
    break;
   }
   $106 = HEAP32[$3>>2]|0;
   $107 = (_strcmp($106,14637)|0);
   $108 = ($107|0)!=(0);
   if (!($108)) {
    HEAP32[$1>>2] = 6;
    break;
   }
   $109 = HEAP32[$3>>2]|0;
   $110 = (_strcmp($109,14660)|0);
   $111 = ($110|0)!=(0);
   if (!($111)) {
    HEAP32[$1>>2] = 2;
    break;
   }
   $112 = HEAP32[$3>>2]|0;
   $113 = (_strcmp($112,14673)|0);
   $114 = ($113|0)!=(0);
   if (!($114)) {
    HEAP32[$1>>2] = 3;
    break;
   }
   $115 = HEAP32[$3>>2]|0;
   $116 = (_strcmp($115,14689)|0);
   $117 = ($116|0)!=(0);
   if (!($117)) {
    HEAP32[$1>>2] = 5;
    break;
   }
   $118 = HEAP32[$3>>2]|0;
   $119 = (_strcmp($118,14700)|0);
   $120 = ($119|0)!=(0);
   if (!($120)) {
    HEAP32[$1>>2] = 15;
    break;
   }
   $121 = HEAP32[$3>>2]|0;
   $122 = (_strcmp($121,14719)|0);
   $123 = ($122|0)!=(0);
   if (!($123)) {
    HEAP32[$1>>2] = 16;
    break;
   }
   $124 = HEAP32[$3>>2]|0;
   $125 = (_strcmp($124,14741)|0);
   $126 = ($125|0)!=(0);
   if (!($126)) {
    HEAP32[$1>>2] = 17;
    break;
   }
   $127 = HEAP32[$3>>2]|0;
   $128 = (_strcmp($127,14760)|0);
   $129 = ($128|0)!=(0);
   if (!($129)) {
    HEAP32[$1>>2] = 7;
    break;
   }
   $130 = HEAP32[$3>>2]|0;
   $131 = (_strcmp($130,14789)|0);
   $132 = ($131|0)!=(0);
   if (!($132)) {
    HEAP32[$1>>2] = 6;
    break;
   }
   $133 = HEAP32[$3>>2]|0;
   $134 = (_strcmp($133,14806)|0);
   $135 = ($134|0)!=(0);
   if (!($135)) {
    HEAP32[$1>>2] = 8;
    break;
   }
   $136 = HEAP32[$3>>2]|0;
   $137 = (_strcmp($136,14821)|0);
   $138 = ($137|0)!=(0);
   if (!($138)) {
    HEAP32[$1>>2] = 9;
    break;
   }
   $139 = HEAP32[$3>>2]|0;
   $140 = (_strcmp($139,14836)|0);
   $141 = ($140|0)!=(0);
   if (!($141)) {
    HEAP32[$1>>2] = 1;
    break;
   }
   $142 = HEAP32[$3>>2]|0;
   $143 = (_strcmp($142,14857)|0);
   $144 = ($143|0)!=(0);
   if (!($144)) {
    HEAP32[$1>>2] = 10;
    break;
   }
   $145 = HEAP32[$3>>2]|0;
   $146 = (_strcmp($145,14877)|0);
   $147 = ($146|0)!=(0);
   if (!($147)) {
    HEAP32[$1>>2] = 11;
    break;
   }
   $148 = HEAP32[$3>>2]|0;
   $149 = (_strcmp($148,14897)|0);
   $150 = ($149|0)!=(0);
   if (!($150)) {
    HEAP32[$1>>2] = 12;
    break;
   }
   $151 = HEAP32[$3>>2]|0;
   $152 = (_strcmp($151,14923)|0);
   $153 = ($152|0)!=(0);
   if (!($153)) {
    HEAP32[$1>>2] = 2;
    break;
   }
   $154 = HEAP32[$3>>2]|0;
   $155 = (_strcmp($154,14942)|0);
   $156 = ($155|0)!=(0);
   if (!($156)) {
    HEAP32[$1>>2] = 1;
    break;
   }
   $157 = HEAP32[$3>>2]|0;
   $158 = (_strcmp($157,14954)|0);
   $159 = ($158|0)!=(0);
   if (!($159)) {
    HEAP32[$1>>2] = 3;
    break;
   }
   $160 = HEAP32[$3>>2]|0;
   $161 = (_strcmp($160,14966)|0);
   $162 = ($161|0)!=(0);
   if (!($162)) {
    HEAP32[$1>>2] = 1;
    break;
   }
   $163 = HEAP32[$3>>2]|0;
   $164 = (_strcmp($163,14978)|0);
   $165 = ($164|0)!=(0);
   if (!($165)) {
    HEAP32[$1>>2] = 1;
    break;
   }
   $166 = HEAP32[$3>>2]|0;
   $167 = (_strcmp($166,14990)|0);
   $168 = ($167|0)!=(0);
   if (!($168)) {
    HEAP32[$1>>2] = 18;
    break;
   }
   $169 = HEAP32[$3>>2]|0;
   $170 = (_strcmp($169,15002)|0);
   $171 = ($170|0)!=(0);
   if (!($171)) {
    HEAP32[$1>>2] = 13;
    break;
   }
   $172 = HEAP32[$3>>2]|0;
   $173 = (_strcmp($172,15014)|0);
   $174 = ($173|0)!=(0);
   if (!($174)) {
    HEAP32[$1>>2] = 4;
    break;
   }
   $175 = HEAP32[$3>>2]|0;
   $176 = (_strcmp($175,15026)|0);
   $177 = ($176|0)!=(0);
   if (!($177)) {
    HEAP32[$1>>2] = 2;
    break;
   }
   $178 = HEAP32[$3>>2]|0;
   $179 = (_strcmp($178,15038)|0);
   $180 = ($179|0)!=(0);
   if (!($180)) {
    HEAP32[$1>>2] = 14;
    break;
   }
   $181 = HEAP32[$3>>2]|0;
   $182 = (_strcmp($181,15051)|0);
   $183 = ($182|0)!=(0);
   if (!($183)) {
    HEAP32[$1>>2] = 15;
    break;
   }
   $184 = HEAP32[$3>>2]|0;
   $185 = (_strcmp($184,15064)|0);
   $186 = ($185|0)!=(0);
   if (!($186)) {
    HEAP32[$1>>2] = 16;
    break;
   }
   $187 = HEAP32[$3>>2]|0;
   $188 = (_strcmp($187,15077)|0);
   $189 = ($188|0)!=(0);
   if (!($189)) {
    HEAP32[$1>>2] = 17;
    break;
   }
   $190 = HEAP32[$3>>2]|0;
   $191 = (_strcmp($190,15090)|0);
   $192 = ($191|0)!=(0);
   if (!($192)) {
    HEAP32[$1>>2] = 18;
    break;
   }
   $193 = HEAP32[$3>>2]|0;
   $194 = (_strcmp($193,15103)|0);
   $195 = ($194|0)!=(0);
   if (!($195)) {
    HEAP32[$1>>2] = 19;
    break;
   }
   $196 = HEAP32[$3>>2]|0;
   $197 = (_strcmp($196,15116)|0);
   $198 = ($197|0)!=(0);
   if (!($198)) {
    HEAP32[$1>>2] = 20;
    break;
   }
   $199 = HEAP32[$3>>2]|0;
   $200 = (_strcmp($199,15129)|0);
   $201 = ($200|0)!=(0);
   if (!($201)) {
    HEAP32[$1>>2] = 21;
    break;
   }
   $202 = HEAP32[$3>>2]|0;
   $203 = (_strcmp($202,15142)|0);
   $204 = ($203|0)!=(0);
   if (!($204)) {
    HEAP32[$1>>2] = 5;
    break;
   }
   $205 = HEAP32[$3>>2]|0;
   $206 = (_strcmp($205,15161)|0);
   $207 = ($206|0)!=(0);
   if (!($207)) {
    HEAP32[$1>>2] = 6;
    break;
   }
   $208 = HEAP32[$3>>2]|0;
   $209 = (_strcmp($208,15180)|0);
   $210 = ($209|0)!=(0);
   if (!($210)) {
    HEAP32[$1>>2] = 7;
    break;
   }
   $211 = HEAP32[$3>>2]|0;
   $212 = (_strcmp($211,15199)|0);
   $213 = ($212|0)!=(0);
   if (!($213)) {
    HEAP32[$1>>2] = 19;
    break;
   }
   $214 = HEAP32[$3>>2]|0;
   $215 = (_strcmp($214,15212)|0);
   $216 = ($215|0)!=(0);
   if (!($216)) {
    HEAP32[$1>>2] = 20;
    break;
   }
   $217 = HEAP32[$3>>2]|0;
   $218 = (_strcmp($217,15230)|0);
   $219 = ($218|0)!=(0);
   if (!($219)) {
    HEAP32[$1>>2] = 21;
    break;
   }
   $220 = HEAP32[$3>>2]|0;
   $221 = (_strcmp($220,15248)|0);
   $222 = ($221|0)!=(0);
   if (!($222)) {
    HEAP32[$1>>2] = 22;
    break;
   }
   $223 = HEAP32[$3>>2]|0;
   $224 = (_strcmp($223,15266)|0);
   $225 = ($224|0)!=(0);
   if (!($225)) {
    HEAP32[$1>>2] = 23;
    break;
   }
   $226 = HEAP32[$3>>2]|0;
   $227 = (_strcmp($226,15284)|0);
   $228 = ($227|0)!=(0);
   if (!($228)) {
    HEAP32[$1>>2] = 2;
    break;
   }
   $229 = HEAP32[$3>>2]|0;
   $230 = (_strcmp($229,15304)|0);
   $231 = ($230|0)!=(0);
   if (!($231)) {
    HEAP32[$1>>2] = 3;
    break;
   }
   $232 = HEAP32[$3>>2]|0;
   $233 = (_strcmp($232,14245)|0);
   $234 = ($233|0)!=(0);
   if (!($234)) {
    HEAP32[$1>>2] = 7;
    break;
   }
   $235 = HEAP32[$3>>2]|0;
   $236 = (_strcmp($235,15322)|0);
   $237 = ($236|0)!=(0);
   if (!($237)) {
    HEAP32[$1>>2] = 1;
    break;
   }
   $238 = HEAP32[$3>>2]|0;
   $239 = (_strcmp($238,15337)|0);
   $240 = ($239|0)!=(0);
   if (!($240)) {
    HEAP32[$1>>2] = 8;
    break;
   }
   $241 = HEAP32[$3>>2]|0;
   $242 = (_strcmp($241,15358)|0);
   $243 = ($242|0)!=(0);
   if (!($243)) {
    HEAP32[$1>>2] = 9;
    break;
   }
   $244 = HEAP32[$3>>2]|0;
   $245 = (_strcmp($244,15373)|0);
   $246 = ($245|0)!=(0);
   if (!($246)) {
    HEAP32[$1>>2] = 10;
    break;
   }
   $247 = HEAP32[$3>>2]|0;
   $248 = (_strcmp($247,15391)|0);
   $249 = ($248|0)!=(0);
   if (!($249)) {
    HEAP32[$1>>2] = 2;
    break;
   }
   $250 = HEAP32[$3>>2]|0;
   $251 = (_strcmp($250,15407)|0);
   $252 = ($251|0)!=(0);
   if (!($252)) {
    HEAP32[$1>>2] = 11;
    break;
   }
   $253 = HEAP32[$3>>2]|0;
   $254 = (_strcmp($253,15426)|0);
   $255 = ($254|0)!=(0);
   if (!($255)) {
    HEAP32[$1>>2] = 22;
    break;
   }
   $256 = HEAP32[$3>>2]|0;
   $257 = (_strcmp($256,15440)|0);
   $258 = ($257|0)!=(0);
   if (!($258)) {
    HEAP32[$1>>2] = 23;
    break;
   }
   $259 = HEAP32[$3>>2]|0;
   $260 = (_strcmp($259,15455)|0);
   $261 = ($260|0)!=(0);
   if (!($261)) {
    HEAP32[$1>>2] = 8;
    break;
   }
   $262 = HEAP32[$3>>2]|0;
   $263 = (_strcmp($262,14176)|0);
   $264 = ($263|0)!=(0);
   if (!($264)) {
    HEAP32[$1>>2] = 1;
    break;
   }
   $265 = HEAP32[$3>>2]|0;
   $266 = (_strcmp($265,15466)|0);
   $267 = ($266|0)!=(0);
   if (!($267)) {
    HEAP32[$1>>2] = 3;
    break;
   }
   $268 = HEAP32[$3>>2]|0;
   $269 = (_strcmp($268,14275)|0);
   $270 = ($269|0)!=(0);
   if (!($270)) {
    HEAP32[$1>>2] = 24;
    break;
   }
   $271 = HEAP32[$3>>2]|0;
   $272 = (_strcmp($271,14305)|0);
   $273 = ($272|0)!=(0);
   if (!($273)) {
    HEAP32[$1>>2] = 25;
    break;
   }
   $274 = HEAP32[$3>>2]|0;
   $275 = (_strcmp($274,15482)|0);
   $276 = ($275|0)!=(0);
   if (!($276)) {
    HEAP32[$1>>2] = 12;
    break;
   }
   $277 = HEAP32[$3>>2]|0;
   $278 = (_strcmp($277,15509)|0);
   $279 = ($278|0)!=(0);
   if (!($279)) {
    HEAP32[$1>>2] = 4;
    break;
   }
   $280 = HEAP32[$3>>2]|0;
   $281 = (_strcmp($280,15523)|0);
   $282 = ($281|0)!=(0);
   if (!($282)) {
    HEAP32[$1>>2] = 13;
    break;
   }
   $283 = HEAP32[$3>>2]|0;
   $284 = (_strcmp($283,14211)|0);
   $285 = ($284|0)!=(0);
   if (!($285)) {
    HEAP32[$1>>2] = 5;
    break;
   }
   $286 = HEAP32[$3>>2]|0;
   $287 = (_strcmp($286,15543)|0);
   $288 = ($287|0)!=(0);
   if (!($288)) {
    HEAP32[$1>>2] = 6;
    break;
   }
   $289 = HEAP32[$3>>2]|0;
   $290 = (_strcmp($289,15561)|0);
   $291 = ($290|0)!=(0);
   if (!($291)) {
    HEAP32[$1>>2] = 9;
    break;
   }
   $292 = HEAP32[$3>>2]|0;
   $293 = (_strcmp($292,15573)|0);
   $294 = ($293|0)!=(0);
   if (!($294)) {
    HEAP32[$1>>2] = 24;
    break;
   }
   $295 = HEAP32[$3>>2]|0;
   $296 = (_strcmp($295,15594)|0);
   $297 = ($296|0)!=(0);
   if (!($297)) {
    HEAP32[$1>>2] = 26;
    break;
   }
   $298 = HEAP32[$3>>2]|0;
   $299 = (_strcmp($298,15612)|0);
   $300 = ($299|0)!=(0);
   if (!($300)) {
    HEAP32[$1>>2] = 27;
    break;
   }
   $301 = HEAP32[$3>>2]|0;
   $302 = (_strcmp($301,15630)|0);
   $303 = ($302|0)!=(0);
   if (!($303)) {
    HEAP32[$1>>2] = 28;
    break;
   }
   $304 = HEAP32[$3>>2]|0;
   $305 = (_strcmp($304,15651)|0);
   $306 = ($305|0)!=(0);
   if (!($306)) {
    HEAP32[$1>>2] = 14;
    break;
   }
   $307 = HEAP32[$3>>2]|0;
   $308 = (_strcmp($307,15677)|0);
   $309 = ($308|0)!=(0);
   if (!($309)) {
    HEAP32[$1>>2] = 3;
    break;
   }
   $310 = HEAP32[$3>>2]|0;
   $311 = (_strcmp($310,15700)|0);
   $312 = ($311|0)!=(0);
   if (!($312)) {
    HEAP32[$1>>2] = 15;
    break;
   }
   $313 = HEAP32[$3>>2]|0;
   $314 = (_strcmp($313,15738)|0);
   $315 = ($314|0)!=(0);
   if (!($315)) {
    HEAP32[$1>>2] = 10;
    break;
   }
   $316 = HEAP32[$3>>2]|0;
   $317 = (_strcmp($316,15754)|0);
   $318 = ($317|0)!=(0);
   if (!($318)) {
    HEAP32[$1>>2] = 7;
    break;
   }
   $319 = HEAP32[$3>>2]|0;
   $320 = (_strcmp($319,15769)|0);
   $321 = ($320|0)!=(0);
   if (!($321)) {
    HEAP32[$1>>2] = 25;
    break;
   }
   $322 = HEAP32[$3>>2]|0;
   $323 = (_strcmp($322,15792)|0);
   $324 = ($323|0)!=(0);
   if (!($324)) {
    HEAP32[$1>>2] = 16;
    break;
   }
   $325 = HEAP32[$3>>2]|0;
   $326 = (_strcmp($325,15805)|0);
   $327 = ($326|0)!=(0);
   if (!($327)) {
    HEAP32[$1>>2] = 29;
    break;
   }
   $328 = HEAP32[$3>>2]|0;
   $329 = (_strcmp($328,15819)|0);
   $330 = ($329|0)!=(0);
   if (!($330)) {
    HEAP32[$1>>2] = 30;
    break;
   }
   $331 = HEAP32[$3>>2]|0;
   $332 = (_strcmp($331,15833)|0);
   $333 = ($332|0)!=(0);
   if (!($333)) {
    HEAP32[$1>>2] = 1;
    break;
   }
   $334 = HEAP32[$3>>2]|0;
   $335 = (_strcmp($334,15853)|0);
   $336 = ($335|0)!=(0);
   if (!($336)) {
    HEAP32[$1>>2] = 8;
    break;
   }
   $337 = HEAP32[$3>>2]|0;
   $338 = (_strcmp($337,15873)|0);
   $339 = ($338|0)!=(0);
   if (!($339)) {
    HEAP32[$1>>2] = 17;
    break;
   }
   $340 = HEAP32[$3>>2]|0;
   $341 = (_strcmp($340,15889)|0);
   $342 = ($341|0)!=(0);
   if (!($342)) {
    HEAP32[$1>>2] = 18;
    break;
   }
   $343 = HEAP32[$3>>2]|0;
   $344 = (_strcmp($343,15907)|0);
   $345 = ($344|0)!=(0);
   if (!($345)) {
    HEAP32[$1>>2] = 26;
    break;
   }
   $346 = HEAP32[$3>>2]|0;
   $347 = (_strcmp($346,15923)|0);
   $348 = ($347|0)!=(0);
   if (!($348)) {
    HEAP32[$1>>2] = 19;
    break;
   }
   $349 = HEAP32[$3>>2]|0;
   $350 = (_strcmp($349,15938)|0);
   $351 = ($350|0)!=(0);
   if (!($351)) {
    HEAP32[$1>>2] = 9;
    break;
   }
   $352 = HEAP32[$3>>2]|0;
   $353 = (_strcmp($352,15960)|0);
   $354 = ($353|0)!=(0);
   if (!($354)) {
    HEAP32[$1>>2] = 31;
    break;
   }
   $355 = HEAP32[$3>>2]|0;
   $356 = (_strcmp($355,15978)|0);
   $357 = ($356|0)!=(0);
   if (!($357)) {
    HEAP32[$1>>2] = 32;
    break;
   }
   $358 = HEAP32[$3>>2]|0;
   $359 = (_strcmp($358,15999)|0);
   $360 = ($359|0)!=(0);
   if (!($360)) {
    HEAP32[$1>>2] = 10;
    break;
   }
   $361 = HEAP32[$3>>2]|0;
   $362 = (_strcmp($361,16017)|0);
   $363 = ($362|0)!=(0);
   if (!($363)) {
    HEAP32[$1>>2] = 11;
    break;
   }
   $364 = HEAP32[$3>>2]|0;
   $365 = (_strcmp($364,16030)|0);
   $366 = ($365|0)!=(0);
   if (!($366)) {
    HEAP32[$1>>2] = 2;
    break;
   }
   $367 = HEAP32[$3>>2]|0;
   $368 = (_strcmp($367,16045)|0);
   $369 = ($368|0)!=(0);
   if (!($369)) {
    HEAP32[$1>>2] = 12;
    break;
   }
   $370 = HEAP32[$3>>2]|0;
   $371 = (_strcmp($370,16059)|0);
   $372 = ($371|0)!=(0);
   if (!($372)) {
    HEAP32[$1>>2] = 1;
    break;
   }
   $373 = HEAP32[$3>>2]|0;
   $374 = (_strcmp($373,16069)|0);
   $375 = ($374|0)!=(0);
   if (!($375)) {
    HEAP32[$1>>2] = 1;
    break;
   }
   $376 = HEAP32[$3>>2]|0;
   $377 = (_strcmp($376,16079)|0);
   $378 = ($377|0)!=(0);
   if (!($378)) {
    HEAP32[$1>>2] = 2;
    break;
   }
   $379 = HEAP32[$3>>2]|0;
   $380 = (_strcmp($379,16101)|0);
   $381 = ($380|0)!=(0);
   if (!($381)) {
    HEAP32[$1>>2] = 13;
    break;
   }
   $382 = HEAP32[$3>>2]|0;
   $383 = (_strcmp($382,16127)|0);
   $384 = ($383|0)!=(0);
   if (!($384)) {
    HEAP32[$1>>2] = 14;
    break;
   }
   $385 = HEAP32[$3>>2]|0;
   $386 = (_strcmp($385,16154)|0);
   $387 = ($386|0)!=(0);
   if (!($387)) {
    HEAP32[$1>>2] = 27;
    break;
   }
   $388 = HEAP32[$3>>2]|0;
   $389 = (_strcmp($388,16167)|0);
   $390 = ($389|0)!=(0);
   if (!($390)) {
    HEAP32[$1>>2] = 20;
    break;
   }
   $391 = HEAP32[$3>>2]|0;
   $392 = (_strcmp($391,16182)|0);
   $393 = ($392|0)!=(0);
   if (!($393)) {
    HEAP32[$1>>2] = 4;
    break;
   }
   $394 = HEAP32[$3>>2]|0;
   $395 = (_strcmp($394,16197)|0);
   $396 = ($395|0)!=(0);
   if (!($396)) {
    HEAP32[$1>>2] = 3;
    break;
   }
   $397 = HEAP32[$3>>2]|0;
   $398 = (_strcmp($397,16221)|0);
   $399 = ($398|0)!=(0);
   if (!($399)) {
    HEAP32[$1>>2] = 2;
    break;
   }
   $400 = HEAP32[$3>>2]|0;
   $401 = (_strcmp($400,16232)|0);
   $402 = ($401|0)!=(0);
   if (!($402)) {
    HEAP32[$1>>2] = 33;
    break;
   }
   $403 = HEAP32[$3>>2]|0;
   $404 = (_strcmp($403,16254)|0);
   $405 = ($404|0)!=(0);
   if (!($405)) {
    HEAP32[$1>>2] = 21;
    break;
   }
   $406 = HEAP32[$3>>2]|0;
   $407 = (_strcmp($406,16276)|0);
   $408 = ($407|0)!=(0);
   if (!($408)) {
    HEAP32[$1>>2] = 5;
    break;
   }
   $409 = HEAP32[$3>>2]|0;
   $410 = (_strcmp($409,16300)|0);
   $411 = ($410|0)!=(0);
   if (!($411)) {
    HEAP32[$1>>2] = 4;
    break;
   }
   $412 = HEAP32[$3>>2]|0;
   $413 = (_strcmp($412,16309)|0);
   $414 = ($413|0)!=(0);
   if (!($414)) {
    HEAP32[$1>>2] = 5;
    break;
   }
   $415 = HEAP32[$3>>2]|0;
   $416 = (_strcmp($415,16317)|0);
   $417 = ($416|0)!=(0);
   if (!($417)) {
    HEAP32[$1>>2] = 1;
    break;
   }
   $418 = HEAP32[$3>>2]|0;
   $419 = (_strcmp($418,16330)|0);
   $420 = ($419|0)!=(0);
   if (!($420)) {
    HEAP32[$1>>2] = 2;
    break;
   }
   $421 = HEAP32[$3>>2]|0;
   $422 = (_strcmp($421,16344)|0);
   $423 = ($422|0)!=(0);
   if (!($423)) {
    HEAP32[$1>>2] = 15;
    break;
   }
   $424 = HEAP32[$3>>2]|0;
   $425 = (_strcmp($424,16356)|0);
   $426 = ($425|0)!=(0);
   if (!($426)) {
    HEAP32[$1>>2] = 16;
    break;
   }
   $427 = HEAP32[$3>>2]|0;
   $428 = (_strcmp($427,16365)|0);
   $429 = ($428|0)!=(0);
   if (!($429)) {
    HEAP32[$1>>2] = 17;
    break;
   }
   $430 = HEAP32[$3>>2]|0;
   $431 = (_strcmp($430,16375)|0);
   $432 = ($431|0)!=(0);
   if (!($432)) {
    HEAP32[$1>>2] = 18;
    break;
   }
   $433 = HEAP32[$3>>2]|0;
   $434 = (_strcmp($433,16387)|0);
   $435 = ($434|0)!=(0);
   if (!($435)) {
    HEAP32[$1>>2] = 19;
    break;
   }
   $436 = HEAP32[$3>>2]|0;
   $437 = (_strcmp($436,16398)|0);
   $438 = ($437|0)!=(0);
   if (!($438)) {
    HEAP32[$1>>2] = 20;
    break;
   }
   $439 = HEAP32[$3>>2]|0;
   $440 = (_strcmp($439,16406)|0);
   $441 = ($440|0)!=(0);
   if (!($441)) {
    HEAP32[$1>>2] = 3;
    break;
   }
   $442 = HEAP32[$3>>2]|0;
   $443 = (_strcmp($442,16418)|0);
   $444 = ($443|0)!=(0);
   if (!($444)) {
    HEAP32[$1>>2] = 21;
    break;
   }
   $445 = HEAP32[$3>>2]|0;
   $446 = (_strcmp($445,16433)|0);
   $447 = ($446|0)!=(0);
   if (!($447)) {
    HEAP32[$1>>2] = 22;
    break;
   }
   $448 = HEAP32[$3>>2]|0;
   $449 = (_strcmp($448,16445)|0);
   $450 = ($449|0)!=(0);
   if (!($450)) {
    HEAP32[$1>>2] = 23;
    break;
   }
   $451 = HEAP32[$3>>2]|0;
   $452 = (_strcmp($451,16459)|0);
   $453 = ($452|0)!=(0);
   if (!($453)) {
    HEAP32[$1>>2] = 11;
    break;
   }
   $454 = HEAP32[$3>>2]|0;
   $455 = (_strcmp($454,16484)|0);
   $456 = ($455|0)!=(0);
   if (!($456)) {
    HEAP32[$1>>2] = 24;
    break;
   }
   $457 = HEAP32[$3>>2]|0;
   $458 = (_strcmp($457,16501)|0);
   $459 = ($458|0)!=(0);
   if (!($459)) {
    HEAP32[$1>>2] = 25;
    break;
   }
   $460 = HEAP32[$3>>2]|0;
   $461 = (_strcmp($460,16517)|0);
   $462 = ($461|0)!=(0);
   if (!($462)) {
    HEAP32[$1>>2] = 26;
    break;
   }
   $463 = HEAP32[$3>>2]|0;
   $464 = (_strcmp($463,16533)|0);
   $465 = ($464|0)!=(0);
   if (!($465)) {
    HEAP32[$1>>2] = 12;
    break;
   }
   $466 = HEAP32[$3>>2]|0;
   $467 = (_strcmp($466,16545)|0);
   $468 = ($467|0)!=(0);
   if (!($468)) {
    HEAP32[$1>>2] = 34;
    break;
   }
   $469 = HEAP32[$3>>2]|0;
   $470 = (_strcmp($469,16557)|0);
   $471 = ($470|0)!=(0);
   if (!($471)) {
    HEAP32[$1>>2] = 35;
    break;
   }
   $472 = HEAP32[$3>>2]|0;
   $473 = (_strcmp($472,16581)|0);
   $474 = ($473|0)!=(0);
   if (!($474)) {
    HEAP32[$1>>2] = 1;
    break;
   }
   $475 = HEAP32[$3>>2]|0;
   $476 = (_strcmp($475,16594)|0);
   $477 = ($476|0)!=(0);
   if (!($477)) {
    HEAP32[$1>>2] = 2;
    break;
   }
   $478 = HEAP32[$3>>2]|0;
   $479 = (_strcmp($478,16608)|0);
   $480 = ($479|0)!=(0);
   if (!($480)) {
    HEAP32[$1>>2] = 36;
    break;
   }
   $481 = HEAP32[$3>>2]|0;
   $482 = (_strcmp($481,16630)|0);
   $483 = ($482|0)!=(0);
   if (!($483)) {
    HEAP32[$1>>2] = 37;
    break;
   }
   $484 = HEAP32[$3>>2]|0;
   $485 = (_strcmp($484,16637)|0);
   $486 = ($485|0)!=(0);
   if (!($486)) {
    HEAP32[$1>>2] = 3;
    break;
   }
   $487 = HEAP32[$3>>2]|0;
   $488 = (_strcmp($487,16653)|0);
   $489 = ($488|0)!=(0);
   if (!($489)) {
    HEAP32[$1>>2] = 2;
    break;
   }
   $490 = HEAP32[$3>>2]|0;
   $491 = (_strcmp($490,16670)|0);
   $492 = ($491|0)!=(0);
   if (!($492)) {
    HEAP32[$1>>2] = 1;
    break;
   }
   $493 = HEAP32[$3>>2]|0;
   $494 = (_strcmp($493,16687)|0);
   $495 = ($494|0)!=(0);
   if (!($495)) {
    HEAP32[$1>>2] = 28;
    break;
   }
   $496 = HEAP32[$3>>2]|0;
   $497 = (_strcmp($496,16703)|0);
   $498 = ($497|0)!=(0);
   if (!($498)) {
    HEAP32[$1>>2] = 1;
    break;
   }
   $499 = HEAP32[$3>>2]|0;
   $500 = (_strcmp($499,16719)|0);
   $501 = ($500|0)!=(0);
   if (!($501)) {
    HEAP32[$1>>2] = 4;
    break;
   }
   $502 = HEAP32[$3>>2]|0;
   $503 = (_strcmp($502,16736)|0);
   $504 = ($503|0)!=(0);
   if (!($504)) {
    HEAP32[$1>>2] = 29;
    break;
   }
   $505 = HEAP32[$3>>2]|0;
   $506 = (_strcmp($505,16750)|0);
   $507 = ($506|0)!=(0);
   if (!($507)) {
    HEAP32[$1>>2] = 30;
    break;
   }
   $508 = HEAP32[$3>>2]|0;
   $509 = (_strcmp($508,16762)|0);
   $510 = ($509|0)!=(0);
   if (!($510)) {
    HEAP32[$1>>2] = 22;
    break;
   }
   $511 = HEAP32[$3>>2]|0;
   $512 = (_strcmp($511,16773)|0);
   $513 = ($512|0)!=(0);
   if (!($513)) {
    HEAP32[$1>>2] = 2;
    break;
   }
   $514 = HEAP32[$3>>2]|0;
   $515 = (_strcmp($514,16786)|0);
   $516 = ($515|0)!=(0);
   if (!($516)) {
    HEAP32[$1>>2] = 23;
    break;
   }
   $517 = HEAP32[$3>>2]|0;
   $518 = (_strcmp($517,16796)|0);
   $519 = ($518|0)!=(0);
   if (!($519)) {
    HEAP32[$1>>2] = 2;
    break;
   }
   $520 = HEAP32[$3>>2]|0;
   $521 = (_strcmp($520,16813)|0);
   $522 = ($521|0)!=(0);
   if (!($522)) {
    HEAP32[$1>>2] = 24;
    break;
   }
   $523 = HEAP32[$3>>2]|0;
   $524 = (_strcmp($523,16825)|0);
   $525 = ($524|0)!=(0);
   if (!($525)) {
    HEAP32[$1>>2] = 25;
    break;
   }
   $526 = HEAP32[$3>>2]|0;
   $527 = (_strcmp($526,16847)|0);
   $528 = ($527|0)!=(0);
   if (!($528)) {
    HEAP32[$1>>2] = 26;
    break;
   }
   $529 = HEAP32[$3>>2]|0;
   $530 = (_strcmp($529,16867)|0);
   $531 = ($530|0)!=(0);
   if (!($531)) {
    HEAP32[$1>>2] = 3;
    break;
   }
   $532 = HEAP32[$3>>2]|0;
   $533 = (_strcmp($532,16880)|0);
   $534 = ($533|0)!=(0);
   if (!($534)) {
    HEAP32[$1>>2] = 27;
    break;
   }
   $535 = HEAP32[$3>>2]|0;
   $536 = (_strcmp($535,16902)|0);
   $537 = ($536|0)!=(0);
   if (!($537)) {
    HEAP32[$1>>2] = 28;
    break;
   }
   $538 = HEAP32[$3>>2]|0;
   $539 = (_strcmp($538,16922)|0);
   $540 = ($539|0)!=(0);
   if (!($540)) {
    HEAP32[$1>>2] = 2;
    break;
   }
   $541 = HEAP32[$3>>2]|0;
   $542 = (_strcmp($541,16939)|0);
   $543 = ($542|0)!=(0);
   if (!($543)) {
    HEAP32[$1>>2] = 2;
    break;
   }
   $544 = HEAP32[$3>>2]|0;
   $545 = (_strcmp($544,16956)|0);
   $546 = ($545|0)!=(0);
   if (!($546)) {
    HEAP32[$1>>2] = 3;
    break;
   }
   $547 = HEAP32[$3>>2]|0;
   $548 = (_strcmp($547,16976)|0);
   $549 = ($548|0)!=(0);
   if ($549) {
    $550 = HEAP32[$2>>2]|0;
    $551 = HEAP32[$3>>2]|0;
    $552 = _emscripten_asm_const_iii(0, ($550|0), ($551|0))|0;
    HEAP32[$1>>2] = 0;
    break;
   } else {
    HEAP32[$1>>2] = 38;
    break;
   }
  } else {
   HEAP32[$1>>2] = 6;
  }
 } while(0);
 $553 = HEAP32[$1>>2]|0;
 STACKTOP = sp;return ($553|0);
}
function _emscripten_get_global_libc() {
 var label = 0, sp = 0;
 sp = STACKTOP;
 return (22684|0);
}
function ___stdio_close($0) {
 $0 = $0|0;
 var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $vararg_buffer = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $vararg_buffer = sp;
 $1 = ((($0)) + 60|0);
 $2 = HEAP32[$1>>2]|0;
 $3 = (_dummy_738($2)|0);
 HEAP32[$vararg_buffer>>2] = $3;
 $4 = (___syscall6(6,($vararg_buffer|0))|0);
 $5 = (___syscall_ret($4)|0);
 STACKTOP = sp;return ($5|0);
}
function ___stdio_write($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $$0 = 0, $$04756 = 0, $$04855 = 0, $$04954 = 0, $$051 = 0, $$1 = 0, $$150 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0;
 var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0;
 var $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_buffer3 = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, $vararg_ptr6 = 0;
 var $vararg_ptr7 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 48|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(48|0);
 $vararg_buffer3 = sp + 16|0;
 $vararg_buffer = sp;
 $3 = sp + 32|0;
 $4 = ((($0)) + 28|0);
 $5 = HEAP32[$4>>2]|0;
 HEAP32[$3>>2] = $5;
 $6 = ((($3)) + 4|0);
 $7 = ((($0)) + 20|0);
 $8 = HEAP32[$7>>2]|0;
 $9 = (($8) - ($5))|0;
 HEAP32[$6>>2] = $9;
 $10 = ((($3)) + 8|0);
 HEAP32[$10>>2] = $1;
 $11 = ((($3)) + 12|0);
 HEAP32[$11>>2] = $2;
 $12 = (($9) + ($2))|0;
 $13 = ((($0)) + 60|0);
 $14 = HEAP32[$13>>2]|0;
 $15 = $3;
 HEAP32[$vararg_buffer>>2] = $14;
 $vararg_ptr1 = ((($vararg_buffer)) + 4|0);
 HEAP32[$vararg_ptr1>>2] = $15;
 $vararg_ptr2 = ((($vararg_buffer)) + 8|0);
 HEAP32[$vararg_ptr2>>2] = 2;
 $16 = (___syscall146(146,($vararg_buffer|0))|0);
 $17 = (___syscall_ret($16)|0);
 $18 = ($12|0)==($17|0);
 L1: do {
  if ($18) {
   label = 3;
  } else {
   $$04756 = 2;$$04855 = $12;$$04954 = $3;$26 = $17;
   while(1) {
    $25 = ($26|0)<(0);
    if ($25) {
     break;
    }
    $34 = (($$04855) - ($26))|0;
    $35 = ((($$04954)) + 4|0);
    $36 = HEAP32[$35>>2]|0;
    $37 = ($26>>>0)>($36>>>0);
    $38 = ((($$04954)) + 8|0);
    $$150 = $37 ? $38 : $$04954;
    $39 = $37 << 31 >> 31;
    $$1 = (($39) + ($$04756))|0;
    $40 = $37 ? $36 : 0;
    $$0 = (($26) - ($40))|0;
    $41 = HEAP32[$$150>>2]|0;
    $42 = (($41) + ($$0)|0);
    HEAP32[$$150>>2] = $42;
    $43 = ((($$150)) + 4|0);
    $44 = HEAP32[$43>>2]|0;
    $45 = (($44) - ($$0))|0;
    HEAP32[$43>>2] = $45;
    $46 = HEAP32[$13>>2]|0;
    $47 = $$150;
    HEAP32[$vararg_buffer3>>2] = $46;
    $vararg_ptr6 = ((($vararg_buffer3)) + 4|0);
    HEAP32[$vararg_ptr6>>2] = $47;
    $vararg_ptr7 = ((($vararg_buffer3)) + 8|0);
    HEAP32[$vararg_ptr7>>2] = $$1;
    $48 = (___syscall146(146,($vararg_buffer3|0))|0);
    $49 = (___syscall_ret($48)|0);
    $50 = ($34|0)==($49|0);
    if ($50) {
     label = 3;
     break L1;
    } else {
     $$04756 = $$1;$$04855 = $34;$$04954 = $$150;$26 = $49;
    }
   }
   $27 = ((($0)) + 16|0);
   HEAP32[$27>>2] = 0;
   HEAP32[$4>>2] = 0;
   HEAP32[$7>>2] = 0;
   $28 = HEAP32[$0>>2]|0;
   $29 = $28 | 32;
   HEAP32[$0>>2] = $29;
   $30 = ($$04756|0)==(2);
   if ($30) {
    $$051 = 0;
   } else {
    $31 = ((($$04954)) + 4|0);
    $32 = HEAP32[$31>>2]|0;
    $33 = (($2) - ($32))|0;
    $$051 = $33;
   }
  }
 } while(0);
 if ((label|0) == 3) {
  $19 = ((($0)) + 44|0);
  $20 = HEAP32[$19>>2]|0;
  $21 = ((($0)) + 48|0);
  $22 = HEAP32[$21>>2]|0;
  $23 = (($20) + ($22)|0);
  $24 = ((($0)) + 16|0);
  HEAP32[$24>>2] = $23;
  HEAP32[$4>>2] = $20;
  HEAP32[$7>>2] = $20;
  $$051 = $2;
 }
 STACKTOP = sp;return ($$051|0);
}
function ___stdio_seek($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $$pre = 0, $10 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, $vararg_ptr3 = 0, $vararg_ptr4 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
 $vararg_buffer = sp;
 $3 = sp + 20|0;
 $4 = ((($0)) + 60|0);
 $5 = HEAP32[$4>>2]|0;
 $6 = $3;
 HEAP32[$vararg_buffer>>2] = $5;
 $vararg_ptr1 = ((($vararg_buffer)) + 4|0);
 HEAP32[$vararg_ptr1>>2] = 0;
 $vararg_ptr2 = ((($vararg_buffer)) + 8|0);
 HEAP32[$vararg_ptr2>>2] = $1;
 $vararg_ptr3 = ((($vararg_buffer)) + 12|0);
 HEAP32[$vararg_ptr3>>2] = $6;
 $vararg_ptr4 = ((($vararg_buffer)) + 16|0);
 HEAP32[$vararg_ptr4>>2] = $2;
 $7 = (___syscall140(140,($vararg_buffer|0))|0);
 $8 = (___syscall_ret($7)|0);
 $9 = ($8|0)<(0);
 if ($9) {
  HEAP32[$3>>2] = -1;
  $10 = -1;
 } else {
  $$pre = HEAP32[$3>>2]|0;
  $10 = $$pre;
 }
 STACKTOP = sp;return ($10|0);
}
function ___syscall_ret($0) {
 $0 = $0|0;
 var $$0 = 0, $1 = 0, $2 = 0, $3 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = ($0>>>0)>(4294963200);
 if ($1) {
  $2 = (0 - ($0))|0;
  $3 = (___errno_location()|0);
  HEAP32[$3>>2] = $2;
  $$0 = -1;
 } else {
  $$0 = $0;
 }
 return ($$0|0);
}
function ___errno_location() {
 var $0 = 0, $1 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $0 = (___pthread_self_108()|0);
 $1 = ((($0)) + 64|0);
 return ($1|0);
}
function ___pthread_self_108() {
 var $0 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $0 = (_pthread_self()|0);
 return ($0|0);
}
function _pthread_self() {
 var label = 0, sp = 0;
 sp = STACKTOP;
 return (3856|0);
}
function _dummy_738($0) {
 $0 = $0|0;
 var label = 0, sp = 0;
 sp = STACKTOP;
 return ($0|0);
}
function ___stdio_read($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $$0 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0;
 var $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
 $vararg_buffer = sp;
 $3 = sp + 16|0;
 HEAP32[$3>>2] = $1;
 $4 = ((($3)) + 4|0);
 $5 = ((($0)) + 48|0);
 $6 = HEAP32[$5>>2]|0;
 $7 = ($6|0)!=(0);
 $8 = $7&1;
 $9 = (($2) - ($8))|0;
 HEAP32[$4>>2] = $9;
 $10 = ((($3)) + 8|0);
 $11 = ((($0)) + 44|0);
 $12 = HEAP32[$11>>2]|0;
 HEAP32[$10>>2] = $12;
 $13 = ((($3)) + 12|0);
 HEAP32[$13>>2] = $6;
 $14 = ((($0)) + 60|0);
 $15 = HEAP32[$14>>2]|0;
 $16 = $3;
 HEAP32[$vararg_buffer>>2] = $15;
 $vararg_ptr1 = ((($vararg_buffer)) + 4|0);
 HEAP32[$vararg_ptr1>>2] = $16;
 $vararg_ptr2 = ((($vararg_buffer)) + 8|0);
 HEAP32[$vararg_ptr2>>2] = 2;
 $17 = (___syscall145(145,($vararg_buffer|0))|0);
 $18 = (___syscall_ret($17)|0);
 $19 = ($18|0)<(1);
 if ($19) {
  $20 = $18 & 48;
  $21 = $20 ^ 16;
  $22 = HEAP32[$0>>2]|0;
  $23 = $22 | $21;
  HEAP32[$0>>2] = $23;
  $$0 = $18;
 } else {
  $24 = HEAP32[$4>>2]|0;
  $25 = ($18>>>0)>($24>>>0);
  if ($25) {
   $26 = (($18) - ($24))|0;
   $27 = HEAP32[$11>>2]|0;
   $28 = ((($0)) + 4|0);
   HEAP32[$28>>2] = $27;
   $29 = (($27) + ($26)|0);
   $30 = ((($0)) + 8|0);
   HEAP32[$30>>2] = $29;
   $31 = HEAP32[$5>>2]|0;
   $32 = ($31|0)==(0);
   if ($32) {
    $$0 = $2;
   } else {
    $33 = ((($27)) + 1|0);
    HEAP32[$28>>2] = $33;
    $34 = HEAP8[$27>>0]|0;
    $35 = (($2) + -1)|0;
    $36 = (($1) + ($35)|0);
    HEAP8[$36>>0] = $34;
    $$0 = $2;
   }
  } else {
   $$0 = $18;
  }
 }
 STACKTOP = sp;return ($$0|0);
}
function ___stdout_write($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
 $vararg_buffer = sp;
 $3 = sp + 16|0;
 $4 = ((($0)) + 36|0);
 HEAP32[$4>>2] = 9;
 $5 = HEAP32[$0>>2]|0;
 $6 = $5 & 64;
 $7 = ($6|0)==(0);
 if ($7) {
  $8 = ((($0)) + 60|0);
  $9 = HEAP32[$8>>2]|0;
  $10 = $3;
  HEAP32[$vararg_buffer>>2] = $9;
  $vararg_ptr1 = ((($vararg_buffer)) + 4|0);
  HEAP32[$vararg_ptr1>>2] = 21523;
  $vararg_ptr2 = ((($vararg_buffer)) + 8|0);
  HEAP32[$vararg_ptr2>>2] = $10;
  $11 = (___syscall54(54,($vararg_buffer|0))|0);
  $12 = ($11|0)==(0);
  if (!($12)) {
   $13 = ((($0)) + 75|0);
   HEAP8[$13>>0] = -1;
  }
 }
 $14 = (___stdio_write($0,$1,$2)|0);
 STACKTOP = sp;return ($14|0);
}
function ___shlim($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$sink = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = ((($0)) + 104|0);
 HEAP32[$2>>2] = $1;
 $3 = ((($0)) + 8|0);
 $4 = HEAP32[$3>>2]|0;
 $5 = ((($0)) + 4|0);
 $6 = HEAP32[$5>>2]|0;
 $7 = $4;
 $8 = $6;
 $9 = (($7) - ($8))|0;
 $10 = ((($0)) + 108|0);
 HEAP32[$10>>2] = $9;
 $11 = ($1|0)!=(0);
 $12 = ($9|0)>($1|0);
 $or$cond = $11 & $12;
 $13 = (($6) + ($1)|0);
 $$sink = $or$cond ? $13 : $4;
 $14 = ((($0)) + 100|0);
 HEAP32[$14>>2] = $$sink;
 return;
}
function ___intscan($0,$1,$2,$3,$4) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 $4 = $4|0;
 var $$0154222 = 0, $$0157 = 0, $$0157$ = 0, $$0159 = 0, $$1155192 = 0, $$1158 = 0, $$1160 = 0, $$1160169 = 0, $$1165 = 0, $$1165167 = 0, $$1165168 = 0, $$166 = 0, $$2156210 = 0, $$2161$be = 0, $$2161$lcssa = 0, $$3162$be = 0, $$3162215 = 0, $$4163$be = 0, $$4163$lcssa = 0, $$5$be = 0;
 var $$6$be = 0, $$6$lcssa = 0, $$7$be = 0, $$7198 = 0, $$8 = 0, $$9$be = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0;
 var $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0;
 var $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0;
 var $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0;
 var $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0;
 var $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0;
 var $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0;
 var $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0;
 var $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0;
 var $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0;
 var $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0;
 var $294 = 0, $295 = 0, $296 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0;
 var $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0;
 var $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0;
 var $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $or$cond = 0, $or$cond12 = 0;
 var $or$cond187 = 0, $or$cond5 = 0, $or$cond7 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $5 = ($1>>>0)>(36);
 L1: do {
  if ($5) {
   $8 = (___errno_location()|0);
   HEAP32[$8>>2] = 22;
   $289 = 0;$290 = 0;
  } else {
   $6 = ((($0)) + 4|0);
   $7 = ((($0)) + 100|0);
   while(1) {
    $9 = HEAP32[$6>>2]|0;
    $10 = HEAP32[$7>>2]|0;
    $11 = ($9>>>0)<($10>>>0);
    if ($11) {
     $12 = ((($9)) + 1|0);
     HEAP32[$6>>2] = $12;
     $13 = HEAP8[$9>>0]|0;
     $14 = $13&255;
     $16 = $14;
    } else {
     $15 = (___shgetc($0)|0);
     $16 = $15;
    }
    $17 = (_isspace($16)|0);
    $18 = ($17|0)==(0);
    if ($18) {
     break;
    }
   }
   L11: do {
    switch ($16|0) {
    case 43: case 45:  {
     $19 = ($16|0)==(45);
     $20 = $19 << 31 >> 31;
     $21 = HEAP32[$6>>2]|0;
     $22 = HEAP32[$7>>2]|0;
     $23 = ($21>>>0)<($22>>>0);
     if ($23) {
      $24 = ((($21)) + 1|0);
      HEAP32[$6>>2] = $24;
      $25 = HEAP8[$21>>0]|0;
      $26 = $25&255;
      $$0157 = $20;$$0159 = $26;
      break L11;
     } else {
      $27 = (___shgetc($0)|0);
      $$0157 = $20;$$0159 = $27;
      break L11;
     }
     break;
    }
    default: {
     $$0157 = 0;$$0159 = $16;
    }
    }
   } while(0);
   $28 = ($1|0)==(0);
   $29 = $1 | 16;
   $30 = ($29|0)==(16);
   $31 = ($$0159|0)==(48);
   $or$cond5 = $30 & $31;
   do {
    if ($or$cond5) {
     $32 = HEAP32[$6>>2]|0;
     $33 = HEAP32[$7>>2]|0;
     $34 = ($32>>>0)<($33>>>0);
     if ($34) {
      $35 = ((($32)) + 1|0);
      HEAP32[$6>>2] = $35;
      $36 = HEAP8[$32>>0]|0;
      $37 = $36&255;
      $40 = $37;
     } else {
      $38 = (___shgetc($0)|0);
      $40 = $38;
     }
     $39 = $40 | 32;
     $41 = ($39|0)==(120);
     if (!($41)) {
      if ($28) {
       $$1160169 = $40;$$1165168 = 8;
       label = 46;
       break;
      } else {
       $$1160 = $40;$$1165 = $1;
       label = 32;
       break;
      }
     }
     $42 = HEAP32[$6>>2]|0;
     $43 = HEAP32[$7>>2]|0;
     $44 = ($42>>>0)<($43>>>0);
     if ($44) {
      $45 = ((($42)) + 1|0);
      HEAP32[$6>>2] = $45;
      $46 = HEAP8[$42>>0]|0;
      $47 = $46&255;
      $50 = $47;
     } else {
      $48 = (___shgetc($0)|0);
      $50 = $48;
     }
     $49 = ((17093) + ($50)|0);
     $51 = HEAP8[$49>>0]|0;
     $52 = ($51&255)>(15);
     if ($52) {
      $53 = HEAP32[$7>>2]|0;
      $54 = ($53|0)!=(0|0);
      if ($54) {
       $55 = HEAP32[$6>>2]|0;
       $56 = ((($55)) + -1|0);
       HEAP32[$6>>2] = $56;
      }
      $57 = ($2|0)==(0);
      if ($57) {
       ___shlim($0,0);
       $289 = 0;$290 = 0;
       break L1;
      }
      if (!($54)) {
       $289 = 0;$290 = 0;
       break L1;
      }
      $58 = HEAP32[$6>>2]|0;
      $59 = ((($58)) + -1|0);
      HEAP32[$6>>2] = $59;
      $289 = 0;$290 = 0;
      break L1;
     } else {
      $$1160169 = $50;$$1165168 = 16;
      label = 46;
     }
    } else {
     $$166 = $28 ? 10 : $1;
     $60 = ((17093) + ($$0159)|0);
     $61 = HEAP8[$60>>0]|0;
     $62 = $61&255;
     $63 = ($62>>>0)<($$166>>>0);
     if ($63) {
      $$1160 = $$0159;$$1165 = $$166;
      label = 32;
     } else {
      $64 = HEAP32[$7>>2]|0;
      $65 = ($64|0)==(0|0);
      if (!($65)) {
       $66 = HEAP32[$6>>2]|0;
       $67 = ((($66)) + -1|0);
       HEAP32[$6>>2] = $67;
      }
      ___shlim($0,0);
      $68 = (___errno_location()|0);
      HEAP32[$68>>2] = 22;
      $289 = 0;$290 = 0;
      break L1;
     }
    }
   } while(0);
   L43: do {
    if ((label|0) == 32) {
     $69 = ($$1165|0)==(10);
     if ($69) {
      $70 = (($$1160) + -48)|0;
      $71 = ($70>>>0)<(10);
      if ($71) {
       $$0154222 = 0;$74 = $70;
       while(1) {
        $72 = ($$0154222*10)|0;
        $73 = (($72) + ($74))|0;
        $75 = HEAP32[$6>>2]|0;
        $76 = HEAP32[$7>>2]|0;
        $77 = ($75>>>0)<($76>>>0);
        if ($77) {
         $78 = ((($75)) + 1|0);
         HEAP32[$6>>2] = $78;
         $79 = HEAP8[$75>>0]|0;
         $80 = $79&255;
         $$2161$be = $80;
        } else {
         $81 = (___shgetc($0)|0);
         $$2161$be = $81;
        }
        $82 = (($$2161$be) + -48)|0;
        $83 = ($82>>>0)<(10);
        $84 = ($73>>>0)<(429496729);
        $85 = $83 & $84;
        if ($85) {
         $$0154222 = $73;$74 = $82;
        } else {
         break;
        }
       }
       $$2161$lcssa = $$2161$be;$291 = $73;$292 = 0;
      } else {
       $$2161$lcssa = $$1160;$291 = 0;$292 = 0;
      }
      $86 = (($$2161$lcssa) + -48)|0;
      $87 = ($86>>>0)<(10);
      if ($87) {
       $$3162215 = $$2161$lcssa;$88 = $291;$89 = $292;$93 = $86;
       while(1) {
        $90 = (___muldi3(($88|0),($89|0),10,0)|0);
        $91 = tempRet0;
        $92 = ($93|0)<(0);
        $94 = $92 << 31 >> 31;
        $95 = $93 ^ -1;
        $96 = $94 ^ -1;
        $97 = ($91>>>0)>($96>>>0);
        $98 = ($90>>>0)>($95>>>0);
        $99 = ($91|0)==($96|0);
        $100 = $99 & $98;
        $101 = $97 | $100;
        if ($101) {
         $$1165167 = 10;$$8 = $$3162215;$293 = $88;$294 = $89;
         label = 72;
         break L43;
        }
        $102 = (_i64Add(($90|0),($91|0),($93|0),($94|0))|0);
        $103 = tempRet0;
        $104 = HEAP32[$6>>2]|0;
        $105 = HEAP32[$7>>2]|0;
        $106 = ($104>>>0)<($105>>>0);
        if ($106) {
         $107 = ((($104)) + 1|0);
         HEAP32[$6>>2] = $107;
         $108 = HEAP8[$104>>0]|0;
         $109 = $108&255;
         $$3162$be = $109;
        } else {
         $110 = (___shgetc($0)|0);
         $$3162$be = $110;
        }
        $111 = (($$3162$be) + -48)|0;
        $112 = ($111>>>0)<(10);
        $113 = ($103>>>0)<(429496729);
        $114 = ($102>>>0)<(2576980378);
        $115 = ($103|0)==(429496729);
        $116 = $115 & $114;
        $117 = $113 | $116;
        $or$cond7 = $112 & $117;
        if ($or$cond7) {
         $$3162215 = $$3162$be;$88 = $102;$89 = $103;$93 = $111;
        } else {
         break;
        }
       }
       $118 = ($111>>>0)>(9);
       if ($118) {
        $$1158 = $$0157;$263 = $103;$265 = $102;
       } else {
        $$1165167 = 10;$$8 = $$3162$be;$293 = $102;$294 = $103;
        label = 72;
       }
      } else {
       $$1158 = $$0157;$263 = $292;$265 = $291;
      }
     } else {
      $$1160169 = $$1160;$$1165168 = $$1165;
      label = 46;
     }
    }
   } while(0);
   L63: do {
    if ((label|0) == 46) {
     $119 = (($$1165168) + -1)|0;
     $120 = $119 & $$1165168;
     $121 = ($120|0)==(0);
     if ($121) {
      $126 = ($$1165168*23)|0;
      $127 = $126 >>> 5;
      $128 = $127 & 7;
      $129 = (17349 + ($128)|0);
      $130 = HEAP8[$129>>0]|0;
      $131 = $130 << 24 >> 24;
      $132 = ((17093) + ($$1160169)|0);
      $133 = HEAP8[$132>>0]|0;
      $134 = $133&255;
      $135 = ($134>>>0)<($$1165168>>>0);
      if ($135) {
       $$1155192 = 0;$138 = $134;
       while(1) {
        $136 = $$1155192 << $131;
        $137 = $138 | $136;
        $139 = HEAP32[$6>>2]|0;
        $140 = HEAP32[$7>>2]|0;
        $141 = ($139>>>0)<($140>>>0);
        if ($141) {
         $142 = ((($139)) + 1|0);
         HEAP32[$6>>2] = $142;
         $143 = HEAP8[$139>>0]|0;
         $144 = $143&255;
         $$4163$be = $144;
        } else {
         $145 = (___shgetc($0)|0);
         $$4163$be = $145;
        }
        $146 = ((17093) + ($$4163$be)|0);
        $147 = HEAP8[$146>>0]|0;
        $148 = $147&255;
        $149 = ($148>>>0)<($$1165168>>>0);
        $150 = ($137>>>0)<(134217728);
        $151 = $150 & $149;
        if ($151) {
         $$1155192 = $137;$138 = $148;
        } else {
         break;
        }
       }
       $$4163$lcssa = $$4163$be;$155 = $147;$158 = 0;$160 = $137;
      } else {
       $$4163$lcssa = $$1160169;$155 = $133;$158 = 0;$160 = 0;
      }
      $152 = (_bitshift64Lshr(-1,-1,($131|0))|0);
      $153 = tempRet0;
      $154 = $155&255;
      $156 = ($154>>>0)>=($$1165168>>>0);
      $157 = ($158>>>0)>($153>>>0);
      $159 = ($160>>>0)>($152>>>0);
      $161 = ($158|0)==($153|0);
      $162 = $161 & $159;
      $163 = $157 | $162;
      $or$cond187 = $156 | $163;
      if ($or$cond187) {
       $$1165167 = $$1165168;$$8 = $$4163$lcssa;$293 = $160;$294 = $158;
       label = 72;
       break;
      } else {
       $164 = $160;$165 = $158;$169 = $155;
      }
      while(1) {
       $166 = (_bitshift64Shl(($164|0),($165|0),($131|0))|0);
       $167 = tempRet0;
       $168 = $169&255;
       $170 = $168 | $166;
       $171 = HEAP32[$6>>2]|0;
       $172 = HEAP32[$7>>2]|0;
       $173 = ($171>>>0)<($172>>>0);
       if ($173) {
        $174 = ((($171)) + 1|0);
        HEAP32[$6>>2] = $174;
        $175 = HEAP8[$171>>0]|0;
        $176 = $175&255;
        $$5$be = $176;
       } else {
        $177 = (___shgetc($0)|0);
        $$5$be = $177;
       }
       $178 = ((17093) + ($$5$be)|0);
       $179 = HEAP8[$178>>0]|0;
       $180 = $179&255;
       $181 = ($180>>>0)>=($$1165168>>>0);
       $182 = ($167>>>0)>($153>>>0);
       $183 = ($170>>>0)>($152>>>0);
       $184 = ($167|0)==($153|0);
       $185 = $184 & $183;
       $186 = $182 | $185;
       $or$cond = $181 | $186;
       if ($or$cond) {
        $$1165167 = $$1165168;$$8 = $$5$be;$293 = $170;$294 = $167;
        label = 72;
        break L63;
       } else {
        $164 = $170;$165 = $167;$169 = $179;
       }
      }
     }
     $122 = ((17093) + ($$1160169)|0);
     $123 = HEAP8[$122>>0]|0;
     $124 = $123&255;
     $125 = ($124>>>0)<($$1165168>>>0);
     if ($125) {
      $$2156210 = 0;$189 = $124;
      while(1) {
       $187 = Math_imul($$2156210, $$1165168)|0;
       $188 = (($189) + ($187))|0;
       $190 = HEAP32[$6>>2]|0;
       $191 = HEAP32[$7>>2]|0;
       $192 = ($190>>>0)<($191>>>0);
       if ($192) {
        $193 = ((($190)) + 1|0);
        HEAP32[$6>>2] = $193;
        $194 = HEAP8[$190>>0]|0;
        $195 = $194&255;
        $$6$be = $195;
       } else {
        $196 = (___shgetc($0)|0);
        $$6$be = $196;
       }
       $197 = ((17093) + ($$6$be)|0);
       $198 = HEAP8[$197>>0]|0;
       $199 = $198&255;
       $200 = ($199>>>0)<($$1165168>>>0);
       $201 = ($188>>>0)<(119304647);
       $202 = $201 & $200;
       if ($202) {
        $$2156210 = $188;$189 = $199;
       } else {
        break;
       }
      }
      $$6$lcssa = $$6$be;$204 = $198;$295 = $188;$296 = 0;
     } else {
      $$6$lcssa = $$1160169;$204 = $123;$295 = 0;$296 = 0;
     }
     $203 = $204&255;
     $205 = ($203>>>0)<($$1165168>>>0);
     if ($205) {
      $206 = (___udivdi3(-1,-1,($$1165168|0),0)|0);
      $207 = tempRet0;
      $$7198 = $$6$lcssa;$209 = $296;$211 = $295;$218 = $204;
      while(1) {
       $208 = ($209>>>0)>($207>>>0);
       $210 = ($211>>>0)>($206>>>0);
       $212 = ($209|0)==($207|0);
       $213 = $212 & $210;
       $214 = $208 | $213;
       if ($214) {
        $$1165167 = $$1165168;$$8 = $$7198;$293 = $211;$294 = $209;
        label = 72;
        break L63;
       }
       $215 = (___muldi3(($211|0),($209|0),($$1165168|0),0)|0);
       $216 = tempRet0;
       $217 = $218&255;
       $219 = $217 ^ -1;
       $220 = ($216>>>0)>(4294967295);
       $221 = ($215>>>0)>($219>>>0);
       $222 = ($216|0)==(-1);
       $223 = $222 & $221;
       $224 = $220 | $223;
       if ($224) {
        $$1165167 = $$1165168;$$8 = $$7198;$293 = $211;$294 = $209;
        label = 72;
        break L63;
       }
       $225 = (_i64Add(($217|0),0,($215|0),($216|0))|0);
       $226 = tempRet0;
       $227 = HEAP32[$6>>2]|0;
       $228 = HEAP32[$7>>2]|0;
       $229 = ($227>>>0)<($228>>>0);
       if ($229) {
        $230 = ((($227)) + 1|0);
        HEAP32[$6>>2] = $230;
        $231 = HEAP8[$227>>0]|0;
        $232 = $231&255;
        $$7$be = $232;
       } else {
        $233 = (___shgetc($0)|0);
        $$7$be = $233;
       }
       $234 = ((17093) + ($$7$be)|0);
       $235 = HEAP8[$234>>0]|0;
       $236 = $235&255;
       $237 = ($236>>>0)<($$1165168>>>0);
       if ($237) {
        $$7198 = $$7$be;$209 = $226;$211 = $225;$218 = $235;
       } else {
        $$1165167 = $$1165168;$$8 = $$7$be;$293 = $225;$294 = $226;
        label = 72;
        break;
       }
      }
     } else {
      $$1165167 = $$1165168;$$8 = $$6$lcssa;$293 = $295;$294 = $296;
      label = 72;
     }
    }
   } while(0);
   if ((label|0) == 72) {
    $238 = ((17093) + ($$8)|0);
    $239 = HEAP8[$238>>0]|0;
    $240 = $239&255;
    $241 = ($240>>>0)<($$1165167>>>0);
    if ($241) {
     while(1) {
      $242 = HEAP32[$6>>2]|0;
      $243 = HEAP32[$7>>2]|0;
      $244 = ($242>>>0)<($243>>>0);
      if ($244) {
       $245 = ((($242)) + 1|0);
       HEAP32[$6>>2] = $245;
       $246 = HEAP8[$242>>0]|0;
       $247 = $246&255;
       $$9$be = $247;
      } else {
       $248 = (___shgetc($0)|0);
       $$9$be = $248;
      }
      $249 = ((17093) + ($$9$be)|0);
      $250 = HEAP8[$249>>0]|0;
      $251 = $250&255;
      $252 = ($251>>>0)<($$1165167>>>0);
      if (!($252)) {
       break;
      }
     }
     $253 = (___errno_location()|0);
     HEAP32[$253>>2] = 34;
     $254 = $3 & 1;
     $255 = ($254|0)==(0);
     $256 = (0)==(0);
     $257 = $255 & $256;
     $$0157$ = $257 ? $$0157 : 0;
     $$1158 = $$0157$;$263 = $4;$265 = $3;
    } else {
     $$1158 = $$0157;$263 = $294;$265 = $293;
    }
   }
   $258 = HEAP32[$7>>2]|0;
   $259 = ($258|0)==(0|0);
   if (!($259)) {
    $260 = HEAP32[$6>>2]|0;
    $261 = ((($260)) + -1|0);
    HEAP32[$6>>2] = $261;
   }
   $262 = ($263>>>0)<($4>>>0);
   $264 = ($265>>>0)<($3>>>0);
   $266 = ($263|0)==($4|0);
   $267 = $266 & $264;
   $268 = $262 | $267;
   if (!($268)) {
    $269 = $3 & 1;
    $270 = ($269|0)!=(0);
    $271 = (0)!=(0);
    $272 = $270 | $271;
    $273 = ($$1158|0)!=(0);
    $or$cond12 = $272 | $273;
    if (!($or$cond12)) {
     $274 = (___errno_location()|0);
     HEAP32[$274>>2] = 34;
     $275 = (_i64Add(($3|0),($4|0),-1,-1)|0);
     $276 = tempRet0;
     $289 = $276;$290 = $275;
     break;
    }
    $277 = ($263>>>0)>($4>>>0);
    $278 = ($265>>>0)>($3>>>0);
    $279 = ($263|0)==($4|0);
    $280 = $279 & $278;
    $281 = $277 | $280;
    if ($281) {
     $282 = (___errno_location()|0);
     HEAP32[$282>>2] = 34;
     $289 = $4;$290 = $3;
     break;
    }
   }
   $283 = ($$1158|0)<(0);
   $284 = $283 << 31 >> 31;
   $285 = $265 ^ $$1158;
   $286 = $263 ^ $284;
   $287 = (_i64Subtract(($285|0),($286|0),($$1158|0),($284|0))|0);
   $288 = tempRet0;
   $289 = $288;$290 = $287;
  }
 } while(0);
 tempRet0 = ($289);
 return ($290|0);
}
function ___shgetc($0) {
 $0 = $0|0;
 var $$0 = 0, $$phi$trans$insert = 0, $$phi$trans$insert28$phi$trans$insert = 0, $$pre = 0, $$pre$phi34Z2D = 0, $$pre29$pre = 0, $$pre35 = 0, $$sink = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0;
 var $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0;
 var $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = ((($0)) + 104|0);
 $2 = HEAP32[$1>>2]|0;
 $3 = ($2|0)==(0);
 if ($3) {
  label = 3;
 } else {
  $4 = ((($0)) + 108|0);
  $5 = HEAP32[$4>>2]|0;
  $6 = ($5|0)<($2|0);
  if ($6) {
   label = 3;
  } else {
   label = 4;
  }
 }
 if ((label|0) == 3) {
  $7 = (___uflow($0)|0);
  $8 = ($7|0)<(0);
  if ($8) {
   label = 4;
  } else {
   $10 = HEAP32[$1>>2]|0;
   $11 = ($10|0)==(0);
   $$phi$trans$insert = ((($0)) + 8|0);
   if ($11) {
    $$pre = HEAP32[$$phi$trans$insert>>2]|0;
    $$phi$trans$insert28$phi$trans$insert = ((($0)) + 4|0);
    $$pre29$pre = HEAP32[$$phi$trans$insert28$phi$trans$insert>>2]|0;
    $$pre35 = ((($0)) + 108|0);
    $$pre$phi34Z2D = $$pre35;$$sink = $$pre;$26 = $$pre;$29 = $$pre29$pre;
   } else {
    $12 = HEAP32[$$phi$trans$insert>>2]|0;
    $13 = ((($0)) + 4|0);
    $14 = HEAP32[$13>>2]|0;
    $15 = $14;
    $16 = (($12) - ($15))|0;
    $17 = ((($0)) + 108|0);
    $18 = HEAP32[$17>>2]|0;
    $19 = (($10) - ($18))|0;
    $20 = ($16|0)<($19|0);
    $21 = $12;
    if ($20) {
     $$pre$phi34Z2D = $17;$$sink = $21;$26 = $21;$29 = $14;
    } else {
     $22 = (($19) + -1)|0;
     $23 = (($14) + ($22)|0);
     $$pre$phi34Z2D = $17;$$sink = $23;$26 = $21;$29 = $14;
    }
   }
   $24 = ((($0)) + 100|0);
   HEAP32[$24>>2] = $$sink;
   $25 = ($26|0)==(0|0);
   if (!($25)) {
    $27 = $26;
    $28 = $29;
    $30 = HEAP32[$$pre$phi34Z2D>>2]|0;
    $31 = (($27) + 1)|0;
    $32 = (($31) - ($28))|0;
    $33 = (($32) + ($30))|0;
    HEAP32[$$pre$phi34Z2D>>2] = $33;
   }
   $34 = ((($29)) + -1|0);
   $35 = HEAP8[$34>>0]|0;
   $36 = $35&255;
   $37 = ($36|0)==($7|0);
   if ($37) {
    $$0 = $7;
   } else {
    $38 = $7&255;
    HEAP8[$34>>0] = $38;
    $$0 = $7;
   }
  }
 }
 if ((label|0) == 4) {
  $9 = ((($0)) + 100|0);
  HEAP32[$9>>2] = 0;
  $$0 = -1;
 }
 return ($$0|0);
}
function _isspace($0) {
 $0 = $0|0;
 var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = ($0|0)==(32);
 $2 = (($0) + -9)|0;
 $3 = ($2>>>0)<(5);
 $4 = $1 | $3;
 $5 = $4&1;
 return ($5|0);
}
function ___uflow($0) {
 $0 = $0|0;
 var $$0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $1 = sp;
 $2 = (___toread($0)|0);
 $3 = ($2|0)==(0);
 if ($3) {
  $4 = ((($0)) + 32|0);
  $5 = HEAP32[$4>>2]|0;
  $6 = (FUNCTION_TABLE_iiii[$5 & 15]($0,$1,1)|0);
  $7 = ($6|0)==(1);
  if ($7) {
   $8 = HEAP8[$1>>0]|0;
   $9 = $8&255;
   $$0 = $9;
  } else {
   $$0 = -1;
  }
 } else {
  $$0 = -1;
 }
 STACKTOP = sp;return ($$0|0);
}
function ___toread($0) {
 $0 = $0|0;
 var $$0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
 var $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $sext = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = ((($0)) + 74|0);
 $2 = HEAP8[$1>>0]|0;
 $3 = $2 << 24 >> 24;
 $4 = (($3) + 255)|0;
 $5 = $4 | $3;
 $6 = $5&255;
 HEAP8[$1>>0] = $6;
 $7 = ((($0)) + 20|0);
 $8 = HEAP32[$7>>2]|0;
 $9 = ((($0)) + 28|0);
 $10 = HEAP32[$9>>2]|0;
 $11 = ($8>>>0)>($10>>>0);
 if ($11) {
  $12 = ((($0)) + 36|0);
  $13 = HEAP32[$12>>2]|0;
  (FUNCTION_TABLE_iiii[$13 & 15]($0,0,0)|0);
 }
 $14 = ((($0)) + 16|0);
 HEAP32[$14>>2] = 0;
 HEAP32[$9>>2] = 0;
 HEAP32[$7>>2] = 0;
 $15 = HEAP32[$0>>2]|0;
 $16 = $15 & 4;
 $17 = ($16|0)==(0);
 if ($17) {
  $19 = ((($0)) + 44|0);
  $20 = HEAP32[$19>>2]|0;
  $21 = ((($0)) + 48|0);
  $22 = HEAP32[$21>>2]|0;
  $23 = (($20) + ($22)|0);
  $24 = ((($0)) + 8|0);
  HEAP32[$24>>2] = $23;
  $25 = ((($0)) + 4|0);
  HEAP32[$25>>2] = $23;
  $26 = $15 << 27;
  $sext = $26 >> 31;
  $$0 = $sext;
 } else {
  $18 = $15 | 32;
  HEAP32[$0>>2] = $18;
  $$0 = -1;
 }
 return ($$0|0);
}
function _copysign($0,$1) {
 $0 = +$0;
 $1 = +$1;
 var $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0.0, label = 0, sp = 0;
 sp = STACKTOP;
 HEAPF64[tempDoublePtr>>3] = $0;$2 = HEAP32[tempDoublePtr>>2]|0;
 $3 = HEAP32[tempDoublePtr+4>>2]|0;
 HEAPF64[tempDoublePtr>>3] = $1;$4 = HEAP32[tempDoublePtr>>2]|0;
 $5 = HEAP32[tempDoublePtr+4>>2]|0;
 $6 = $3 & 2147483647;
 $7 = $5 & -2147483648;
 $8 = $7 | $6;
 HEAP32[tempDoublePtr>>2] = $2;HEAP32[tempDoublePtr+4>>2] = $8;$9 = +HEAPF64[tempDoublePtr>>3];
 return (+$9);
}
function _strcmp($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$011 = 0, $$0710 = 0, $$lcssa = 0, $$lcssa8 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond9 = 0, label = 0;
 var sp = 0;
 sp = STACKTOP;
 $2 = HEAP8[$0>>0]|0;
 $3 = HEAP8[$1>>0]|0;
 $4 = ($2<<24>>24)!=($3<<24>>24);
 $5 = ($2<<24>>24)==(0);
 $or$cond9 = $5 | $4;
 if ($or$cond9) {
  $$lcssa = $3;$$lcssa8 = $2;
 } else {
  $$011 = $1;$$0710 = $0;
  while(1) {
   $6 = ((($$0710)) + 1|0);
   $7 = ((($$011)) + 1|0);
   $8 = HEAP8[$6>>0]|0;
   $9 = HEAP8[$7>>0]|0;
   $10 = ($8<<24>>24)!=($9<<24>>24);
   $11 = ($8<<24>>24)==(0);
   $or$cond = $11 | $10;
   if ($or$cond) {
    $$lcssa = $9;$$lcssa8 = $8;
    break;
   } else {
    $$011 = $7;$$0710 = $6;
   }
  }
 }
 $12 = $$lcssa8&255;
 $13 = $$lcssa&255;
 $14 = (($12) - ($13))|0;
 return ($14|0);
}
function _memcmp($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $$01318 = 0, $$01417 = 0, $$019 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $3 = ($2|0)==(0);
 L1: do {
  if ($3) {
   $14 = 0;
  } else {
   $$01318 = $0;$$01417 = $2;$$019 = $1;
   while(1) {
    $4 = HEAP8[$$01318>>0]|0;
    $5 = HEAP8[$$019>>0]|0;
    $6 = ($4<<24>>24)==($5<<24>>24);
    if (!($6)) {
     break;
    }
    $7 = (($$01417) + -1)|0;
    $8 = ((($$01318)) + 1|0);
    $9 = ((($$019)) + 1|0);
    $10 = ($7|0)==(0);
    if ($10) {
     $14 = 0;
     break L1;
    } else {
     $$01318 = $8;$$01417 = $7;$$019 = $9;
    }
   }
   $11 = $4&255;
   $12 = $5&255;
   $13 = (($11) - ($12))|0;
   $14 = $13;
  }
 } while(0);
 return ($14|0);
}
function _vfprintf($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $$ = 0, $$0 = 0, $$1 = 0, $$1$ = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
 var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $5 = 0, $6 = 0, $7 = 0;
 var $8 = 0, $9 = 0, $vacopy_currentptr = 0, dest = 0, label = 0, sp = 0, stop = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 224|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(224|0);
 $3 = sp + 120|0;
 $4 = sp + 80|0;
 $5 = sp;
 $6 = sp + 136|0;
 dest=$4; stop=dest+40|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0));
 $vacopy_currentptr = HEAP32[$2>>2]|0;
 HEAP32[$3>>2] = $vacopy_currentptr;
 $7 = (_printf_core(0,$1,$3,$5,$4)|0);
 $8 = ($7|0)<(0);
 if ($8) {
  $$0 = -1;
 } else {
  $9 = ((($0)) + 76|0);
  $10 = HEAP32[$9>>2]|0;
  $11 = ($10|0)>(-1);
  if ($11) {
   $12 = (___lockfile($0)|0);
   $40 = $12;
  } else {
   $40 = 0;
  }
  $13 = HEAP32[$0>>2]|0;
  $14 = $13 & 32;
  $15 = ((($0)) + 74|0);
  $16 = HEAP8[$15>>0]|0;
  $17 = ($16<<24>>24)<(1);
  if ($17) {
   $18 = $13 & -33;
   HEAP32[$0>>2] = $18;
  }
  $19 = ((($0)) + 48|0);
  $20 = HEAP32[$19>>2]|0;
  $21 = ($20|0)==(0);
  if ($21) {
   $23 = ((($0)) + 44|0);
   $24 = HEAP32[$23>>2]|0;
   HEAP32[$23>>2] = $6;
   $25 = ((($0)) + 28|0);
   HEAP32[$25>>2] = $6;
   $26 = ((($0)) + 20|0);
   HEAP32[$26>>2] = $6;
   HEAP32[$19>>2] = 80;
   $27 = ((($6)) + 80|0);
   $28 = ((($0)) + 16|0);
   HEAP32[$28>>2] = $27;
   $29 = (_printf_core($0,$1,$3,$5,$4)|0);
   $30 = ($24|0)==(0|0);
   if ($30) {
    $$1 = $29;
   } else {
    $31 = ((($0)) + 36|0);
    $32 = HEAP32[$31>>2]|0;
    (FUNCTION_TABLE_iiii[$32 & 15]($0,0,0)|0);
    $33 = HEAP32[$26>>2]|0;
    $34 = ($33|0)==(0|0);
    $$ = $34 ? -1 : $29;
    HEAP32[$23>>2] = $24;
    HEAP32[$19>>2] = 0;
    HEAP32[$28>>2] = 0;
    HEAP32[$25>>2] = 0;
    HEAP32[$26>>2] = 0;
    $$1 = $$;
   }
  } else {
   $22 = (_printf_core($0,$1,$3,$5,$4)|0);
   $$1 = $22;
  }
  $35 = HEAP32[$0>>2]|0;
  $36 = $35 & 32;
  $37 = ($36|0)==(0);
  $$1$ = $37 ? $$1 : -1;
  $38 = $35 | $14;
  HEAP32[$0>>2] = $38;
  $39 = ($40|0)==(0);
  if (!($39)) {
   ___unlockfile($0);
  }
  $$0 = $$1$;
 }
 STACKTOP = sp;return ($$0|0);
}
function _printf_core($0,$1,$2,$3,$4) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 $4 = $4|0;
 var $$ = 0, $$$ = 0, $$$0259 = 0, $$$0262 = 0, $$$0269 = 0, $$$4266 = 0, $$$5 = 0, $$0 = 0, $$0228 = 0, $$0228$ = 0, $$0229322 = 0, $$0232 = 0, $$0235 = 0, $$0237 = 0, $$0240$lcssa = 0, $$0240$lcssa357 = 0, $$0240321 = 0, $$0243 = 0, $$0247 = 0, $$0249$lcssa = 0;
 var $$0249306 = 0, $$0252 = 0, $$0253 = 0, $$0254 = 0, $$0254$$0254$ = 0, $$0259 = 0, $$0262$lcssa = 0, $$0262311 = 0, $$0269 = 0, $$0269$phi = 0, $$1 = 0, $$1230333 = 0, $$1233 = 0, $$1236 = 0, $$1238 = 0, $$1241332 = 0, $$1244320 = 0, $$1248 = 0, $$1250 = 0, $$1255 = 0;
 var $$1260 = 0, $$1263 = 0, $$1263$ = 0, $$1270 = 0, $$2 = 0, $$2234 = 0, $$2239 = 0, $$2242305 = 0, $$2245 = 0, $$2251 = 0, $$2256 = 0, $$2256$ = 0, $$2256$$$2256 = 0, $$2261 = 0, $$2271 = 0, $$284$ = 0, $$289 = 0, $$290 = 0, $$3257 = 0, $$3265 = 0;
 var $$3272 = 0, $$3303 = 0, $$377 = 0, $$4258355 = 0, $$4266 = 0, $$5 = 0, $$6268 = 0, $$lcssa295 = 0, $$pre = 0, $$pre346 = 0, $$pre347 = 0, $$pre347$pre = 0, $$pre349 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0;
 var $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0;
 var $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0;
 var $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0;
 var $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0;
 var $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0;
 var $197 = 0, $198 = 0, $199 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0;
 var $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0;
 var $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0;
 var $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0;
 var $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0;
 var $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0;
 var $306 = 0.0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0, $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0, $321 = 0, $322 = 0, $323 = 0;
 var $324 = 0, $325 = 0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
 var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0;
 var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0;
 var $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0;
 var $arglist_current = 0, $arglist_current2 = 0, $arglist_next = 0, $arglist_next3 = 0, $expanded = 0, $expanded10 = 0, $expanded11 = 0, $expanded13 = 0, $expanded14 = 0, $expanded15 = 0, $expanded4 = 0, $expanded6 = 0, $expanded7 = 0, $expanded8 = 0, $isdigit = 0, $isdigit275 = 0, $isdigit277 = 0, $isdigittmp = 0, $isdigittmp$ = 0, $isdigittmp274 = 0;
 var $isdigittmp276 = 0, $narrow = 0, $or$cond = 0, $or$cond281 = 0, $or$cond283 = 0, $or$cond286 = 0, $storemerge = 0, $storemerge273310 = 0, $storemerge278 = 0, $trunc = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(64|0);
 $5 = sp + 16|0;
 $6 = sp;
 $7 = sp + 24|0;
 $8 = sp + 8|0;
 $9 = sp + 20|0;
 HEAP32[$5>>2] = $1;
 $10 = ($0|0)!=(0|0);
 $11 = ((($7)) + 40|0);
 $12 = $11;
 $13 = ((($7)) + 39|0);
 $14 = ((($8)) + 4|0);
 $$0243 = 0;$$0247 = 0;$$0269 = 0;$21 = $1;
 L1: while(1) {
  $15 = ($$0247|0)>(-1);
  do {
   if ($15) {
    $16 = (2147483647 - ($$0247))|0;
    $17 = ($$0243|0)>($16|0);
    if ($17) {
     $18 = (___errno_location()|0);
     HEAP32[$18>>2] = 75;
     $$1248 = -1;
     break;
    } else {
     $19 = (($$0243) + ($$0247))|0;
     $$1248 = $19;
     break;
    }
   } else {
    $$1248 = $$0247;
   }
  } while(0);
  $20 = HEAP8[$21>>0]|0;
  $22 = ($20<<24>>24)==(0);
  if ($22) {
   label = 87;
   break;
  } else {
   $23 = $20;$25 = $21;
  }
  L9: while(1) {
   switch ($23<<24>>24) {
   case 37:  {
    $$0249306 = $25;$27 = $25;
    label = 9;
    break L9;
    break;
   }
   case 0:  {
    $$0249$lcssa = $25;$39 = $25;
    break L9;
    break;
   }
   default: {
   }
   }
   $24 = ((($25)) + 1|0);
   HEAP32[$5>>2] = $24;
   $$pre = HEAP8[$24>>0]|0;
   $23 = $$pre;$25 = $24;
  }
  L12: do {
   if ((label|0) == 9) {
    while(1) {
     label = 0;
     $26 = ((($27)) + 1|0);
     $28 = HEAP8[$26>>0]|0;
     $29 = ($28<<24>>24)==(37);
     if (!($29)) {
      $$0249$lcssa = $$0249306;$39 = $27;
      break L12;
     }
     $30 = ((($$0249306)) + 1|0);
     $31 = ((($27)) + 2|0);
     HEAP32[$5>>2] = $31;
     $32 = HEAP8[$31>>0]|0;
     $33 = ($32<<24>>24)==(37);
     if ($33) {
      $$0249306 = $30;$27 = $31;
      label = 9;
     } else {
      $$0249$lcssa = $30;$39 = $31;
      break;
     }
    }
   }
  } while(0);
  $34 = $$0249$lcssa;
  $35 = $21;
  $36 = (($34) - ($35))|0;
  if ($10) {
   _out($0,$21,$36);
  }
  $37 = ($36|0)==(0);
  if (!($37)) {
   $$0269$phi = $$0269;$$0243 = $36;$$0247 = $$1248;$21 = $39;$$0269 = $$0269$phi;
   continue;
  }
  $38 = ((($39)) + 1|0);
  $40 = HEAP8[$38>>0]|0;
  $41 = $40 << 24 >> 24;
  $isdigittmp = (($41) + -48)|0;
  $isdigit = ($isdigittmp>>>0)<(10);
  if ($isdigit) {
   $42 = ((($39)) + 2|0);
   $43 = HEAP8[$42>>0]|0;
   $44 = ($43<<24>>24)==(36);
   $45 = ((($39)) + 3|0);
   $$377 = $44 ? $45 : $38;
   $$$0269 = $44 ? 1 : $$0269;
   $isdigittmp$ = $44 ? $isdigittmp : -1;
   $$0253 = $isdigittmp$;$$1270 = $$$0269;$storemerge = $$377;
  } else {
   $$0253 = -1;$$1270 = $$0269;$storemerge = $38;
  }
  HEAP32[$5>>2] = $storemerge;
  $46 = HEAP8[$storemerge>>0]|0;
  $47 = $46 << 24 >> 24;
  $48 = (($47) + -32)|0;
  $49 = ($48>>>0)<(32);
  L24: do {
   if ($49) {
    $$0262311 = 0;$329 = $46;$51 = $48;$storemerge273310 = $storemerge;
    while(1) {
     $50 = 1 << $51;
     $52 = $50 & 75913;
     $53 = ($52|0)==(0);
     if ($53) {
      $$0262$lcssa = $$0262311;$$lcssa295 = $329;$62 = $storemerge273310;
      break L24;
     }
     $54 = $50 | $$0262311;
     $55 = ((($storemerge273310)) + 1|0);
     HEAP32[$5>>2] = $55;
     $56 = HEAP8[$55>>0]|0;
     $57 = $56 << 24 >> 24;
     $58 = (($57) + -32)|0;
     $59 = ($58>>>0)<(32);
     if ($59) {
      $$0262311 = $54;$329 = $56;$51 = $58;$storemerge273310 = $55;
     } else {
      $$0262$lcssa = $54;$$lcssa295 = $56;$62 = $55;
      break;
     }
    }
   } else {
    $$0262$lcssa = 0;$$lcssa295 = $46;$62 = $storemerge;
   }
  } while(0);
  $60 = ($$lcssa295<<24>>24)==(42);
  if ($60) {
   $61 = ((($62)) + 1|0);
   $63 = HEAP8[$61>>0]|0;
   $64 = $63 << 24 >> 24;
   $isdigittmp276 = (($64) + -48)|0;
   $isdigit277 = ($isdigittmp276>>>0)<(10);
   if ($isdigit277) {
    $65 = ((($62)) + 2|0);
    $66 = HEAP8[$65>>0]|0;
    $67 = ($66<<24>>24)==(36);
    if ($67) {
     $68 = (($4) + ($isdigittmp276<<2)|0);
     HEAP32[$68>>2] = 10;
     $69 = HEAP8[$61>>0]|0;
     $70 = $69 << 24 >> 24;
     $71 = (($70) + -48)|0;
     $72 = (($3) + ($71<<3)|0);
     $73 = $72;
     $74 = $73;
     $75 = HEAP32[$74>>2]|0;
     $76 = (($73) + 4)|0;
     $77 = $76;
     $78 = HEAP32[$77>>2]|0;
     $79 = ((($62)) + 3|0);
     $$0259 = $75;$$2271 = 1;$storemerge278 = $79;
    } else {
     label = 23;
    }
   } else {
    label = 23;
   }
   if ((label|0) == 23) {
    label = 0;
    $80 = ($$1270|0)==(0);
    if (!($80)) {
     $$0 = -1;
     break;
    }
    if ($10) {
     $arglist_current = HEAP32[$2>>2]|0;
     $81 = $arglist_current;
     $82 = ((0) + 4|0);
     $expanded4 = $82;
     $expanded = (($expanded4) - 1)|0;
     $83 = (($81) + ($expanded))|0;
     $84 = ((0) + 4|0);
     $expanded8 = $84;
     $expanded7 = (($expanded8) - 1)|0;
     $expanded6 = $expanded7 ^ -1;
     $85 = $83 & $expanded6;
     $86 = $85;
     $87 = HEAP32[$86>>2]|0;
     $arglist_next = ((($86)) + 4|0);
     HEAP32[$2>>2] = $arglist_next;
     $$0259 = $87;$$2271 = 0;$storemerge278 = $61;
    } else {
     $$0259 = 0;$$2271 = 0;$storemerge278 = $61;
    }
   }
   HEAP32[$5>>2] = $storemerge278;
   $88 = ($$0259|0)<(0);
   $89 = $$0262$lcssa | 8192;
   $90 = (0 - ($$0259))|0;
   $$$0262 = $88 ? $89 : $$0262$lcssa;
   $$$0259 = $88 ? $90 : $$0259;
   $$1260 = $$$0259;$$1263 = $$$0262;$$3272 = $$2271;$94 = $storemerge278;
  } else {
   $91 = (_getint($5)|0);
   $92 = ($91|0)<(0);
   if ($92) {
    $$0 = -1;
    break;
   }
   $$pre346 = HEAP32[$5>>2]|0;
   $$1260 = $91;$$1263 = $$0262$lcssa;$$3272 = $$1270;$94 = $$pre346;
  }
  $93 = HEAP8[$94>>0]|0;
  $95 = ($93<<24>>24)==(46);
  do {
   if ($95) {
    $96 = ((($94)) + 1|0);
    $97 = HEAP8[$96>>0]|0;
    $98 = ($97<<24>>24)==(42);
    if (!($98)) {
     $125 = ((($94)) + 1|0);
     HEAP32[$5>>2] = $125;
     $126 = (_getint($5)|0);
     $$pre347$pre = HEAP32[$5>>2]|0;
     $$0254 = $126;$$pre347 = $$pre347$pre;
     break;
    }
    $99 = ((($94)) + 2|0);
    $100 = HEAP8[$99>>0]|0;
    $101 = $100 << 24 >> 24;
    $isdigittmp274 = (($101) + -48)|0;
    $isdigit275 = ($isdigittmp274>>>0)<(10);
    if ($isdigit275) {
     $102 = ((($94)) + 3|0);
     $103 = HEAP8[$102>>0]|0;
     $104 = ($103<<24>>24)==(36);
     if ($104) {
      $105 = (($4) + ($isdigittmp274<<2)|0);
      HEAP32[$105>>2] = 10;
      $106 = HEAP8[$99>>0]|0;
      $107 = $106 << 24 >> 24;
      $108 = (($107) + -48)|0;
      $109 = (($3) + ($108<<3)|0);
      $110 = $109;
      $111 = $110;
      $112 = HEAP32[$111>>2]|0;
      $113 = (($110) + 4)|0;
      $114 = $113;
      $115 = HEAP32[$114>>2]|0;
      $116 = ((($94)) + 4|0);
      HEAP32[$5>>2] = $116;
      $$0254 = $112;$$pre347 = $116;
      break;
     }
    }
    $117 = ($$3272|0)==(0);
    if (!($117)) {
     $$0 = -1;
     break L1;
    }
    if ($10) {
     $arglist_current2 = HEAP32[$2>>2]|0;
     $118 = $arglist_current2;
     $119 = ((0) + 4|0);
     $expanded11 = $119;
     $expanded10 = (($expanded11) - 1)|0;
     $120 = (($118) + ($expanded10))|0;
     $121 = ((0) + 4|0);
     $expanded15 = $121;
     $expanded14 = (($expanded15) - 1)|0;
     $expanded13 = $expanded14 ^ -1;
     $122 = $120 & $expanded13;
     $123 = $122;
     $124 = HEAP32[$123>>2]|0;
     $arglist_next3 = ((($123)) + 4|0);
     HEAP32[$2>>2] = $arglist_next3;
     $330 = $124;
    } else {
     $330 = 0;
    }
    HEAP32[$5>>2] = $99;
    $$0254 = $330;$$pre347 = $99;
   } else {
    $$0254 = -1;$$pre347 = $94;
   }
  } while(0);
  $$0252 = 0;$128 = $$pre347;
  while(1) {
   $127 = HEAP8[$128>>0]|0;
   $129 = $127 << 24 >> 24;
   $130 = (($129) + -65)|0;
   $131 = ($130>>>0)>(57);
   if ($131) {
    $$0 = -1;
    break L1;
   }
   $132 = ((($128)) + 1|0);
   HEAP32[$5>>2] = $132;
   $133 = HEAP8[$128>>0]|0;
   $134 = $133 << 24 >> 24;
   $135 = (($134) + -65)|0;
   $136 = ((17358 + (($$0252*58)|0)|0) + ($135)|0);
   $137 = HEAP8[$136>>0]|0;
   $138 = $137&255;
   $139 = (($138) + -1)|0;
   $140 = ($139>>>0)<(8);
   if ($140) {
    $$0252 = $138;$128 = $132;
   } else {
    break;
   }
  }
  $141 = ($137<<24>>24)==(0);
  if ($141) {
   $$0 = -1;
   break;
  }
  $142 = ($137<<24>>24)==(19);
  $143 = ($$0253|0)>(-1);
  do {
   if ($142) {
    if ($143) {
     $$0 = -1;
     break L1;
    } else {
     label = 49;
    }
   } else {
    if ($143) {
     $144 = (($4) + ($$0253<<2)|0);
     HEAP32[$144>>2] = $138;
     $145 = (($3) + ($$0253<<3)|0);
     $146 = $145;
     $147 = $146;
     $148 = HEAP32[$147>>2]|0;
     $149 = (($146) + 4)|0;
     $150 = $149;
     $151 = HEAP32[$150>>2]|0;
     $152 = $6;
     $153 = $152;
     HEAP32[$153>>2] = $148;
     $154 = (($152) + 4)|0;
     $155 = $154;
     HEAP32[$155>>2] = $151;
     label = 49;
     break;
    }
    if (!($10)) {
     $$0 = 0;
     break L1;
    }
    _pop_arg($6,$138,$2);
   }
  } while(0);
  if ((label|0) == 49) {
   label = 0;
   if (!($10)) {
    $$0243 = 0;$$0247 = $$1248;$$0269 = $$3272;$21 = $132;
    continue;
   }
  }
  $156 = HEAP8[$128>>0]|0;
  $157 = $156 << 24 >> 24;
  $158 = ($$0252|0)!=(0);
  $159 = $157 & 15;
  $160 = ($159|0)==(3);
  $or$cond281 = $158 & $160;
  $161 = $157 & -33;
  $$0235 = $or$cond281 ? $161 : $157;
  $162 = $$1263 & 8192;
  $163 = ($162|0)==(0);
  $164 = $$1263 & -65537;
  $$1263$ = $163 ? $$1263 : $164;
  L71: do {
   switch ($$0235|0) {
   case 110:  {
    $trunc = $$0252&255;
    switch ($trunc<<24>>24) {
    case 0:  {
     $171 = HEAP32[$6>>2]|0;
     HEAP32[$171>>2] = $$1248;
     $$0243 = 0;$$0247 = $$1248;$$0269 = $$3272;$21 = $132;
     continue L1;
     break;
    }
    case 1:  {
     $172 = HEAP32[$6>>2]|0;
     HEAP32[$172>>2] = $$1248;
     $$0243 = 0;$$0247 = $$1248;$$0269 = $$3272;$21 = $132;
     continue L1;
     break;
    }
    case 2:  {
     $173 = ($$1248|0)<(0);
     $174 = $173 << 31 >> 31;
     $175 = HEAP32[$6>>2]|0;
     $176 = $175;
     $177 = $176;
     HEAP32[$177>>2] = $$1248;
     $178 = (($176) + 4)|0;
     $179 = $178;
     HEAP32[$179>>2] = $174;
     $$0243 = 0;$$0247 = $$1248;$$0269 = $$3272;$21 = $132;
     continue L1;
     break;
    }
    case 3:  {
     $180 = $$1248&65535;
     $181 = HEAP32[$6>>2]|0;
     HEAP16[$181>>1] = $180;
     $$0243 = 0;$$0247 = $$1248;$$0269 = $$3272;$21 = $132;
     continue L1;
     break;
    }
    case 4:  {
     $182 = $$1248&255;
     $183 = HEAP32[$6>>2]|0;
     HEAP8[$183>>0] = $182;
     $$0243 = 0;$$0247 = $$1248;$$0269 = $$3272;$21 = $132;
     continue L1;
     break;
    }
    case 6:  {
     $184 = HEAP32[$6>>2]|0;
     HEAP32[$184>>2] = $$1248;
     $$0243 = 0;$$0247 = $$1248;$$0269 = $$3272;$21 = $132;
     continue L1;
     break;
    }
    case 7:  {
     $185 = ($$1248|0)<(0);
     $186 = $185 << 31 >> 31;
     $187 = HEAP32[$6>>2]|0;
     $188 = $187;
     $189 = $188;
     HEAP32[$189>>2] = $$1248;
     $190 = (($188) + 4)|0;
     $191 = $190;
     HEAP32[$191>>2] = $186;
     $$0243 = 0;$$0247 = $$1248;$$0269 = $$3272;$21 = $132;
     continue L1;
     break;
    }
    default: {
     $$0243 = 0;$$0247 = $$1248;$$0269 = $$3272;$21 = $132;
     continue L1;
    }
    }
    break;
   }
   case 112:  {
    $192 = ($$0254>>>0)>(8);
    $193 = $192 ? $$0254 : 8;
    $194 = $$1263$ | 8;
    $$1236 = 120;$$1255 = $193;$$3265 = $194;
    label = 61;
    break;
   }
   case 88: case 120:  {
    $$1236 = $$0235;$$1255 = $$0254;$$3265 = $$1263$;
    label = 61;
    break;
   }
   case 111:  {
    $210 = $6;
    $211 = $210;
    $212 = HEAP32[$211>>2]|0;
    $213 = (($210) + 4)|0;
    $214 = $213;
    $215 = HEAP32[$214>>2]|0;
    $216 = (_fmt_o($212,$215,$11)|0);
    $217 = $$1263$ & 8;
    $218 = ($217|0)==(0);
    $219 = $216;
    $220 = (($12) - ($219))|0;
    $221 = ($$0254|0)>($220|0);
    $222 = (($220) + 1)|0;
    $223 = $218 | $221;
    $$0254$$0254$ = $223 ? $$0254 : $222;
    $$0228 = $216;$$1233 = 0;$$1238 = 17822;$$2256 = $$0254$$0254$;$$4266 = $$1263$;$248 = $212;$250 = $215;
    label = 67;
    break;
   }
   case 105: case 100:  {
    $224 = $6;
    $225 = $224;
    $226 = HEAP32[$225>>2]|0;
    $227 = (($224) + 4)|0;
    $228 = $227;
    $229 = HEAP32[$228>>2]|0;
    $230 = ($229|0)<(0);
    if ($230) {
     $231 = (_i64Subtract(0,0,($226|0),($229|0))|0);
     $232 = tempRet0;
     $233 = $6;
     $234 = $233;
     HEAP32[$234>>2] = $231;
     $235 = (($233) + 4)|0;
     $236 = $235;
     HEAP32[$236>>2] = $232;
     $$0232 = 1;$$0237 = 17822;$242 = $231;$243 = $232;
     label = 66;
     break L71;
    } else {
     $237 = $$1263$ & 2048;
     $238 = ($237|0)==(0);
     $239 = $$1263$ & 1;
     $240 = ($239|0)==(0);
     $$ = $240 ? 17822 : (17824);
     $$$ = $238 ? $$ : (17823);
     $241 = $$1263$ & 2049;
     $narrow = ($241|0)!=(0);
     $$284$ = $narrow&1;
     $$0232 = $$284$;$$0237 = $$$;$242 = $226;$243 = $229;
     label = 66;
     break L71;
    }
    break;
   }
   case 117:  {
    $165 = $6;
    $166 = $165;
    $167 = HEAP32[$166>>2]|0;
    $168 = (($165) + 4)|0;
    $169 = $168;
    $170 = HEAP32[$169>>2]|0;
    $$0232 = 0;$$0237 = 17822;$242 = $167;$243 = $170;
    label = 66;
    break;
   }
   case 99:  {
    $259 = $6;
    $260 = $259;
    $261 = HEAP32[$260>>2]|0;
    $262 = (($259) + 4)|0;
    $263 = $262;
    $264 = HEAP32[$263>>2]|0;
    $265 = $261&255;
    HEAP8[$13>>0] = $265;
    $$2 = $13;$$2234 = 0;$$2239 = 17822;$$2251 = $11;$$5 = 1;$$6268 = $164;
    break;
   }
   case 109:  {
    $266 = (___errno_location()|0);
    $267 = HEAP32[$266>>2]|0;
    $268 = (_strerror($267)|0);
    $$1 = $268;
    label = 71;
    break;
   }
   case 115:  {
    $269 = HEAP32[$6>>2]|0;
    $270 = ($269|0)!=(0|0);
    $271 = $270 ? $269 : 17832;
    $$1 = $271;
    label = 71;
    break;
   }
   case 67:  {
    $278 = $6;
    $279 = $278;
    $280 = HEAP32[$279>>2]|0;
    $281 = (($278) + 4)|0;
    $282 = $281;
    $283 = HEAP32[$282>>2]|0;
    HEAP32[$8>>2] = $280;
    HEAP32[$14>>2] = 0;
    HEAP32[$6>>2] = $8;
    $$4258355 = -1;$331 = $8;
    label = 75;
    break;
   }
   case 83:  {
    $$pre349 = HEAP32[$6>>2]|0;
    $284 = ($$0254|0)==(0);
    if ($284) {
     _pad_674($0,32,$$1260,0,$$1263$);
     $$0240$lcssa357 = 0;
     label = 84;
    } else {
     $$4258355 = $$0254;$331 = $$pre349;
     label = 75;
    }
    break;
   }
   case 65: case 71: case 70: case 69: case 97: case 103: case 102: case 101:  {
    $306 = +HEAPF64[$6>>3];
    $307 = (_fmt_fp($0,$306,$$1260,$$0254,$$1263$,$$0235)|0);
    $$0243 = $307;$$0247 = $$1248;$$0269 = $$3272;$21 = $132;
    continue L1;
    break;
   }
   default: {
    $$2 = $21;$$2234 = 0;$$2239 = 17822;$$2251 = $11;$$5 = $$0254;$$6268 = $$1263$;
   }
   }
  } while(0);
  L95: do {
   if ((label|0) == 61) {
    label = 0;
    $195 = $6;
    $196 = $195;
    $197 = HEAP32[$196>>2]|0;
    $198 = (($195) + 4)|0;
    $199 = $198;
    $200 = HEAP32[$199>>2]|0;
    $201 = $$1236 & 32;
    $202 = (_fmt_x($197,$200,$11,$201)|0);
    $203 = ($197|0)==(0);
    $204 = ($200|0)==(0);
    $205 = $203 & $204;
    $206 = $$3265 & 8;
    $207 = ($206|0)==(0);
    $or$cond283 = $207 | $205;
    $208 = $$1236 >> 4;
    $209 = (17822 + ($208)|0);
    $$289 = $or$cond283 ? 17822 : $209;
    $$290 = $or$cond283 ? 0 : 2;
    $$0228 = $202;$$1233 = $$290;$$1238 = $$289;$$2256 = $$1255;$$4266 = $$3265;$248 = $197;$250 = $200;
    label = 67;
   }
   else if ((label|0) == 66) {
    label = 0;
    $244 = (_fmt_u($242,$243,$11)|0);
    $$0228 = $244;$$1233 = $$0232;$$1238 = $$0237;$$2256 = $$0254;$$4266 = $$1263$;$248 = $242;$250 = $243;
    label = 67;
   }
   else if ((label|0) == 71) {
    label = 0;
    $272 = (_memchr($$1,0,$$0254)|0);
    $273 = ($272|0)==(0|0);
    $274 = $272;
    $275 = $$1;
    $276 = (($274) - ($275))|0;
    $277 = (($$1) + ($$0254)|0);
    $$3257 = $273 ? $$0254 : $276;
    $$1250 = $273 ? $277 : $272;
    $$2 = $$1;$$2234 = 0;$$2239 = 17822;$$2251 = $$1250;$$5 = $$3257;$$6268 = $164;
   }
   else if ((label|0) == 75) {
    label = 0;
    $$0229322 = $331;$$0240321 = 0;$$1244320 = 0;
    while(1) {
     $285 = HEAP32[$$0229322>>2]|0;
     $286 = ($285|0)==(0);
     if ($286) {
      $$0240$lcssa = $$0240321;$$2245 = $$1244320;
      break;
     }
     $287 = (_wctomb($9,$285)|0);
     $288 = ($287|0)<(0);
     $289 = (($$4258355) - ($$0240321))|0;
     $290 = ($287>>>0)>($289>>>0);
     $or$cond286 = $288 | $290;
     if ($or$cond286) {
      $$0240$lcssa = $$0240321;$$2245 = $287;
      break;
     }
     $291 = ((($$0229322)) + 4|0);
     $292 = (($287) + ($$0240321))|0;
     $293 = ($$4258355>>>0)>($292>>>0);
     if ($293) {
      $$0229322 = $291;$$0240321 = $292;$$1244320 = $287;
     } else {
      $$0240$lcssa = $292;$$2245 = $287;
      break;
     }
    }
    $294 = ($$2245|0)<(0);
    if ($294) {
     $$0 = -1;
     break L1;
    }
    _pad_674($0,32,$$1260,$$0240$lcssa,$$1263$);
    $295 = ($$0240$lcssa|0)==(0);
    if ($295) {
     $$0240$lcssa357 = 0;
     label = 84;
    } else {
     $$1230333 = $331;$$1241332 = 0;
     while(1) {
      $296 = HEAP32[$$1230333>>2]|0;
      $297 = ($296|0)==(0);
      if ($297) {
       $$0240$lcssa357 = $$0240$lcssa;
       label = 84;
       break L95;
      }
      $298 = (_wctomb($9,$296)|0);
      $299 = (($298) + ($$1241332))|0;
      $300 = ($299|0)>($$0240$lcssa|0);
      if ($300) {
       $$0240$lcssa357 = $$0240$lcssa;
       label = 84;
       break L95;
      }
      $301 = ((($$1230333)) + 4|0);
      _out($0,$9,$298);
      $302 = ($299>>>0)<($$0240$lcssa>>>0);
      if ($302) {
       $$1230333 = $301;$$1241332 = $299;
      } else {
       $$0240$lcssa357 = $$0240$lcssa;
       label = 84;
       break;
      }
     }
    }
   }
  } while(0);
  if ((label|0) == 67) {
   label = 0;
   $245 = ($$2256|0)>(-1);
   $246 = $$4266 & -65537;
   $$$4266 = $245 ? $246 : $$4266;
   $247 = ($248|0)!=(0);
   $249 = ($250|0)!=(0);
   $251 = $247 | $249;
   $252 = ($$2256|0)!=(0);
   $or$cond = $252 | $251;
   $253 = $$0228;
   $254 = (($12) - ($253))|0;
   $255 = $251 ^ 1;
   $256 = $255&1;
   $257 = (($256) + ($254))|0;
   $258 = ($$2256|0)>($257|0);
   $$2256$ = $258 ? $$2256 : $257;
   $$2256$$$2256 = $or$cond ? $$2256$ : $$2256;
   $$0228$ = $or$cond ? $$0228 : $11;
   $$2 = $$0228$;$$2234 = $$1233;$$2239 = $$1238;$$2251 = $11;$$5 = $$2256$$$2256;$$6268 = $$$4266;
  }
  else if ((label|0) == 84) {
   label = 0;
   $303 = $$1263$ ^ 8192;
   _pad_674($0,32,$$1260,$$0240$lcssa357,$303);
   $304 = ($$1260|0)>($$0240$lcssa357|0);
   $305 = $304 ? $$1260 : $$0240$lcssa357;
   $$0243 = $305;$$0247 = $$1248;$$0269 = $$3272;$21 = $132;
   continue;
  }
  $308 = $$2251;
  $309 = $$2;
  $310 = (($308) - ($309))|0;
  $311 = ($$5|0)<($310|0);
  $$$5 = $311 ? $310 : $$5;
  $312 = (($$$5) + ($$2234))|0;
  $313 = ($$1260|0)<($312|0);
  $$2261 = $313 ? $312 : $$1260;
  _pad_674($0,32,$$2261,$312,$$6268);
  _out($0,$$2239,$$2234);
  $314 = $$6268 ^ 65536;
  _pad_674($0,48,$$2261,$312,$314);
  _pad_674($0,48,$$$5,$310,0);
  _out($0,$$2,$310);
  $315 = $$6268 ^ 8192;
  _pad_674($0,32,$$2261,$312,$315);
  $$0243 = $$2261;$$0247 = $$1248;$$0269 = $$3272;$21 = $132;
 }
 L114: do {
  if ((label|0) == 87) {
   $316 = ($0|0)==(0|0);
   if ($316) {
    $317 = ($$0269|0)==(0);
    if ($317) {
     $$0 = 0;
    } else {
     $$2242305 = 1;
     while(1) {
      $318 = (($4) + ($$2242305<<2)|0);
      $319 = HEAP32[$318>>2]|0;
      $320 = ($319|0)==(0);
      if ($320) {
       $$3303 = $$2242305;
       break;
      }
      $321 = (($3) + ($$2242305<<3)|0);
      _pop_arg($321,$319,$2);
      $322 = (($$2242305) + 1)|0;
      $323 = ($322|0)<(10);
      if ($323) {
       $$2242305 = $322;
      } else {
       $$0 = 1;
       break L114;
      }
     }
     while(1) {
      $326 = (($4) + ($$3303<<2)|0);
      $327 = HEAP32[$326>>2]|0;
      $328 = ($327|0)==(0);
      $325 = (($$3303) + 1)|0;
      if (!($328)) {
       $$0 = -1;
       break L114;
      }
      $324 = ($325|0)<(10);
      if ($324) {
       $$3303 = $325;
      } else {
       $$0 = 1;
       break;
      }
     }
    }
   } else {
    $$0 = $$1248;
   }
  }
 } while(0);
 STACKTOP = sp;return ($$0|0);
}
function ___lockfile($0) {
 $0 = $0|0;
 var label = 0, sp = 0;
 sp = STACKTOP;
 return 0;
}
function ___unlockfile($0) {
 $0 = $0|0;
 var label = 0, sp = 0;
 sp = STACKTOP;
 return;
}
function _out($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $3 = HEAP32[$0>>2]|0;
 $4 = $3 & 32;
 $5 = ($4|0)==(0);
 if ($5) {
  (___fwritex($1,$2,$0)|0);
 }
 return;
}
function _getint($0) {
 $0 = $0|0;
 var $$0$lcssa = 0, $$06 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $isdigit = 0, $isdigit5 = 0, $isdigittmp = 0, $isdigittmp4 = 0, $isdigittmp7 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = HEAP32[$0>>2]|0;
 $2 = HEAP8[$1>>0]|0;
 $3 = $2 << 24 >> 24;
 $isdigittmp4 = (($3) + -48)|0;
 $isdigit5 = ($isdigittmp4>>>0)<(10);
 if ($isdigit5) {
  $$06 = 0;$7 = $1;$isdigittmp7 = $isdigittmp4;
  while(1) {
   $4 = ($$06*10)|0;
   $5 = (($isdigittmp7) + ($4))|0;
   $6 = ((($7)) + 1|0);
   HEAP32[$0>>2] = $6;
   $8 = HEAP8[$6>>0]|0;
   $9 = $8 << 24 >> 24;
   $isdigittmp = (($9) + -48)|0;
   $isdigit = ($isdigittmp>>>0)<(10);
   if ($isdigit) {
    $$06 = $5;$7 = $6;$isdigittmp7 = $isdigittmp;
   } else {
    $$0$lcssa = $5;
    break;
   }
  }
 } else {
  $$0$lcssa = 0;
 }
 return ($$0$lcssa|0);
}
function _pop_arg($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $$mask = 0, $$mask31 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0.0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0;
 var $116 = 0.0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0;
 var $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0;
 var $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0;
 var $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0;
 var $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $arglist_current = 0, $arglist_current11 = 0, $arglist_current14 = 0, $arglist_current17 = 0;
 var $arglist_current2 = 0, $arglist_current20 = 0, $arglist_current23 = 0, $arglist_current26 = 0, $arglist_current5 = 0, $arglist_current8 = 0, $arglist_next = 0, $arglist_next12 = 0, $arglist_next15 = 0, $arglist_next18 = 0, $arglist_next21 = 0, $arglist_next24 = 0, $arglist_next27 = 0, $arglist_next3 = 0, $arglist_next6 = 0, $arglist_next9 = 0, $expanded = 0, $expanded28 = 0, $expanded30 = 0, $expanded31 = 0;
 var $expanded32 = 0, $expanded34 = 0, $expanded35 = 0, $expanded37 = 0, $expanded38 = 0, $expanded39 = 0, $expanded41 = 0, $expanded42 = 0, $expanded44 = 0, $expanded45 = 0, $expanded46 = 0, $expanded48 = 0, $expanded49 = 0, $expanded51 = 0, $expanded52 = 0, $expanded53 = 0, $expanded55 = 0, $expanded56 = 0, $expanded58 = 0, $expanded59 = 0;
 var $expanded60 = 0, $expanded62 = 0, $expanded63 = 0, $expanded65 = 0, $expanded66 = 0, $expanded67 = 0, $expanded69 = 0, $expanded70 = 0, $expanded72 = 0, $expanded73 = 0, $expanded74 = 0, $expanded76 = 0, $expanded77 = 0, $expanded79 = 0, $expanded80 = 0, $expanded81 = 0, $expanded83 = 0, $expanded84 = 0, $expanded86 = 0, $expanded87 = 0;
 var $expanded88 = 0, $expanded90 = 0, $expanded91 = 0, $expanded93 = 0, $expanded94 = 0, $expanded95 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $3 = ($1>>>0)>(20);
 L1: do {
  if (!($3)) {
   do {
    switch ($1|0) {
    case 9:  {
     $arglist_current = HEAP32[$2>>2]|0;
     $4 = $arglist_current;
     $5 = ((0) + 4|0);
     $expanded28 = $5;
     $expanded = (($expanded28) - 1)|0;
     $6 = (($4) + ($expanded))|0;
     $7 = ((0) + 4|0);
     $expanded32 = $7;
     $expanded31 = (($expanded32) - 1)|0;
     $expanded30 = $expanded31 ^ -1;
     $8 = $6 & $expanded30;
     $9 = $8;
     $10 = HEAP32[$9>>2]|0;
     $arglist_next = ((($9)) + 4|0);
     HEAP32[$2>>2] = $arglist_next;
     HEAP32[$0>>2] = $10;
     break L1;
     break;
    }
    case 10:  {
     $arglist_current2 = HEAP32[$2>>2]|0;
     $11 = $arglist_current2;
     $12 = ((0) + 4|0);
     $expanded35 = $12;
     $expanded34 = (($expanded35) - 1)|0;
     $13 = (($11) + ($expanded34))|0;
     $14 = ((0) + 4|0);
     $expanded39 = $14;
     $expanded38 = (($expanded39) - 1)|0;
     $expanded37 = $expanded38 ^ -1;
     $15 = $13 & $expanded37;
     $16 = $15;
     $17 = HEAP32[$16>>2]|0;
     $arglist_next3 = ((($16)) + 4|0);
     HEAP32[$2>>2] = $arglist_next3;
     $18 = ($17|0)<(0);
     $19 = $18 << 31 >> 31;
     $20 = $0;
     $21 = $20;
     HEAP32[$21>>2] = $17;
     $22 = (($20) + 4)|0;
     $23 = $22;
     HEAP32[$23>>2] = $19;
     break L1;
     break;
    }
    case 11:  {
     $arglist_current5 = HEAP32[$2>>2]|0;
     $24 = $arglist_current5;
     $25 = ((0) + 4|0);
     $expanded42 = $25;
     $expanded41 = (($expanded42) - 1)|0;
     $26 = (($24) + ($expanded41))|0;
     $27 = ((0) + 4|0);
     $expanded46 = $27;
     $expanded45 = (($expanded46) - 1)|0;
     $expanded44 = $expanded45 ^ -1;
     $28 = $26 & $expanded44;
     $29 = $28;
     $30 = HEAP32[$29>>2]|0;
     $arglist_next6 = ((($29)) + 4|0);
     HEAP32[$2>>2] = $arglist_next6;
     $31 = $0;
     $32 = $31;
     HEAP32[$32>>2] = $30;
     $33 = (($31) + 4)|0;
     $34 = $33;
     HEAP32[$34>>2] = 0;
     break L1;
     break;
    }
    case 12:  {
     $arglist_current8 = HEAP32[$2>>2]|0;
     $35 = $arglist_current8;
     $36 = ((0) + 8|0);
     $expanded49 = $36;
     $expanded48 = (($expanded49) - 1)|0;
     $37 = (($35) + ($expanded48))|0;
     $38 = ((0) + 8|0);
     $expanded53 = $38;
     $expanded52 = (($expanded53) - 1)|0;
     $expanded51 = $expanded52 ^ -1;
     $39 = $37 & $expanded51;
     $40 = $39;
     $41 = $40;
     $42 = $41;
     $43 = HEAP32[$42>>2]|0;
     $44 = (($41) + 4)|0;
     $45 = $44;
     $46 = HEAP32[$45>>2]|0;
     $arglist_next9 = ((($40)) + 8|0);
     HEAP32[$2>>2] = $arglist_next9;
     $47 = $0;
     $48 = $47;
     HEAP32[$48>>2] = $43;
     $49 = (($47) + 4)|0;
     $50 = $49;
     HEAP32[$50>>2] = $46;
     break L1;
     break;
    }
    case 13:  {
     $arglist_current11 = HEAP32[$2>>2]|0;
     $51 = $arglist_current11;
     $52 = ((0) + 4|0);
     $expanded56 = $52;
     $expanded55 = (($expanded56) - 1)|0;
     $53 = (($51) + ($expanded55))|0;
     $54 = ((0) + 4|0);
     $expanded60 = $54;
     $expanded59 = (($expanded60) - 1)|0;
     $expanded58 = $expanded59 ^ -1;
     $55 = $53 & $expanded58;
     $56 = $55;
     $57 = HEAP32[$56>>2]|0;
     $arglist_next12 = ((($56)) + 4|0);
     HEAP32[$2>>2] = $arglist_next12;
     $58 = $57&65535;
     $59 = $58 << 16 >> 16;
     $60 = ($59|0)<(0);
     $61 = $60 << 31 >> 31;
     $62 = $0;
     $63 = $62;
     HEAP32[$63>>2] = $59;
     $64 = (($62) + 4)|0;
     $65 = $64;
     HEAP32[$65>>2] = $61;
     break L1;
     break;
    }
    case 14:  {
     $arglist_current14 = HEAP32[$2>>2]|0;
     $66 = $arglist_current14;
     $67 = ((0) + 4|0);
     $expanded63 = $67;
     $expanded62 = (($expanded63) - 1)|0;
     $68 = (($66) + ($expanded62))|0;
     $69 = ((0) + 4|0);
     $expanded67 = $69;
     $expanded66 = (($expanded67) - 1)|0;
     $expanded65 = $expanded66 ^ -1;
     $70 = $68 & $expanded65;
     $71 = $70;
     $72 = HEAP32[$71>>2]|0;
     $arglist_next15 = ((($71)) + 4|0);
     HEAP32[$2>>2] = $arglist_next15;
     $$mask31 = $72 & 65535;
     $73 = $0;
     $74 = $73;
     HEAP32[$74>>2] = $$mask31;
     $75 = (($73) + 4)|0;
     $76 = $75;
     HEAP32[$76>>2] = 0;
     break L1;
     break;
    }
    case 15:  {
     $arglist_current17 = HEAP32[$2>>2]|0;
     $77 = $arglist_current17;
     $78 = ((0) + 4|0);
     $expanded70 = $78;
     $expanded69 = (($expanded70) - 1)|0;
     $79 = (($77) + ($expanded69))|0;
     $80 = ((0) + 4|0);
     $expanded74 = $80;
     $expanded73 = (($expanded74) - 1)|0;
     $expanded72 = $expanded73 ^ -1;
     $81 = $79 & $expanded72;
     $82 = $81;
     $83 = HEAP32[$82>>2]|0;
     $arglist_next18 = ((($82)) + 4|0);
     HEAP32[$2>>2] = $arglist_next18;
     $84 = $83&255;
     $85 = $84 << 24 >> 24;
     $86 = ($85|0)<(0);
     $87 = $86 << 31 >> 31;
     $88 = $0;
     $89 = $88;
     HEAP32[$89>>2] = $85;
     $90 = (($88) + 4)|0;
     $91 = $90;
     HEAP32[$91>>2] = $87;
     break L1;
     break;
    }
    case 16:  {
     $arglist_current20 = HEAP32[$2>>2]|0;
     $92 = $arglist_current20;
     $93 = ((0) + 4|0);
     $expanded77 = $93;
     $expanded76 = (($expanded77) - 1)|0;
     $94 = (($92) + ($expanded76))|0;
     $95 = ((0) + 4|0);
     $expanded81 = $95;
     $expanded80 = (($expanded81) - 1)|0;
     $expanded79 = $expanded80 ^ -1;
     $96 = $94 & $expanded79;
     $97 = $96;
     $98 = HEAP32[$97>>2]|0;
     $arglist_next21 = ((($97)) + 4|0);
     HEAP32[$2>>2] = $arglist_next21;
     $$mask = $98 & 255;
     $99 = $0;
     $100 = $99;
     HEAP32[$100>>2] = $$mask;
     $101 = (($99) + 4)|0;
     $102 = $101;
     HEAP32[$102>>2] = 0;
     break L1;
     break;
    }
    case 17:  {
     $arglist_current23 = HEAP32[$2>>2]|0;
     $103 = $arglist_current23;
     $104 = ((0) + 8|0);
     $expanded84 = $104;
     $expanded83 = (($expanded84) - 1)|0;
     $105 = (($103) + ($expanded83))|0;
     $106 = ((0) + 8|0);
     $expanded88 = $106;
     $expanded87 = (($expanded88) - 1)|0;
     $expanded86 = $expanded87 ^ -1;
     $107 = $105 & $expanded86;
     $108 = $107;
     $109 = +HEAPF64[$108>>3];
     $arglist_next24 = ((($108)) + 8|0);
     HEAP32[$2>>2] = $arglist_next24;
     HEAPF64[$0>>3] = $109;
     break L1;
     break;
    }
    case 18:  {
     $arglist_current26 = HEAP32[$2>>2]|0;
     $110 = $arglist_current26;
     $111 = ((0) + 8|0);
     $expanded91 = $111;
     $expanded90 = (($expanded91) - 1)|0;
     $112 = (($110) + ($expanded90))|0;
     $113 = ((0) + 8|0);
     $expanded95 = $113;
     $expanded94 = (($expanded95) - 1)|0;
     $expanded93 = $expanded94 ^ -1;
     $114 = $112 & $expanded93;
     $115 = $114;
     $116 = +HEAPF64[$115>>3];
     $arglist_next27 = ((($115)) + 8|0);
     HEAP32[$2>>2] = $arglist_next27;
     HEAPF64[$0>>3] = $116;
     break L1;
     break;
    }
    default: {
     break L1;
    }
    }
   } while(0);
  }
 } while(0);
 return;
}
function _fmt_x($0,$1,$2,$3) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 var $$05$lcssa = 0, $$056 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0;
 var sp = 0;
 sp = STACKTOP;
 $4 = ($0|0)==(0);
 $5 = ($1|0)==(0);
 $6 = $4 & $5;
 if ($6) {
  $$05$lcssa = $2;
 } else {
  $$056 = $2;$15 = $1;$8 = $0;
  while(1) {
   $7 = $8 & 15;
   $9 = (17870 + ($7)|0);
   $10 = HEAP8[$9>>0]|0;
   $11 = $10&255;
   $12 = $11 | $3;
   $13 = $12&255;
   $14 = ((($$056)) + -1|0);
   HEAP8[$14>>0] = $13;
   $16 = (_bitshift64Lshr(($8|0),($15|0),4)|0);
   $17 = tempRet0;
   $18 = ($16|0)==(0);
   $19 = ($17|0)==(0);
   $20 = $18 & $19;
   if ($20) {
    $$05$lcssa = $14;
    break;
   } else {
    $$056 = $14;$15 = $17;$8 = $16;
   }
  }
 }
 return ($$05$lcssa|0);
}
function _fmt_o($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $$0$lcssa = 0, $$06 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $3 = ($0|0)==(0);
 $4 = ($1|0)==(0);
 $5 = $3 & $4;
 if ($5) {
  $$0$lcssa = $2;
 } else {
  $$06 = $2;$11 = $1;$7 = $0;
  while(1) {
   $6 = $7&255;
   $8 = $6 & 7;
   $9 = $8 | 48;
   $10 = ((($$06)) + -1|0);
   HEAP8[$10>>0] = $9;
   $12 = (_bitshift64Lshr(($7|0),($11|0),3)|0);
   $13 = tempRet0;
   $14 = ($12|0)==(0);
   $15 = ($13|0)==(0);
   $16 = $14 & $15;
   if ($16) {
    $$0$lcssa = $10;
    break;
   } else {
    $$06 = $10;$11 = $13;$7 = $12;
   }
  }
 }
 return ($$0$lcssa|0);
}
function _fmt_u($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $$010$lcssa$off0 = 0, $$012 = 0, $$09$lcssa = 0, $$0914 = 0, $$1$lcssa = 0, $$111 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0;
 var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $3 = ($1>>>0)>(0);
 $4 = ($0>>>0)>(4294967295);
 $5 = ($1|0)==(0);
 $6 = $5 & $4;
 $7 = $3 | $6;
 if ($7) {
  $$0914 = $2;$8 = $0;$9 = $1;
  while(1) {
   $10 = (___uremdi3(($8|0),($9|0),10,0)|0);
   $11 = tempRet0;
   $12 = $10&255;
   $13 = $12 | 48;
   $14 = ((($$0914)) + -1|0);
   HEAP8[$14>>0] = $13;
   $15 = (___udivdi3(($8|0),($9|0),10,0)|0);
   $16 = tempRet0;
   $17 = ($9>>>0)>(9);
   $18 = ($8>>>0)>(4294967295);
   $19 = ($9|0)==(9);
   $20 = $19 & $18;
   $21 = $17 | $20;
   if ($21) {
    $$0914 = $14;$8 = $15;$9 = $16;
   } else {
    break;
   }
  }
  $$010$lcssa$off0 = $15;$$09$lcssa = $14;
 } else {
  $$010$lcssa$off0 = $0;$$09$lcssa = $2;
 }
 $22 = ($$010$lcssa$off0|0)==(0);
 if ($22) {
  $$1$lcssa = $$09$lcssa;
 } else {
  $$012 = $$010$lcssa$off0;$$111 = $$09$lcssa;
  while(1) {
   $23 = (($$012>>>0) % 10)&-1;
   $24 = $23 | 48;
   $25 = $24&255;
   $26 = ((($$111)) + -1|0);
   HEAP8[$26>>0] = $25;
   $27 = (($$012>>>0) / 10)&-1;
   $28 = ($$012>>>0)<(10);
   if ($28) {
    $$1$lcssa = $26;
    break;
   } else {
    $$012 = $27;$$111 = $26;
   }
  }
 }
 return ($$1$lcssa|0);
}
function _strerror($0) {
 $0 = $0|0;
 var $1 = 0, $2 = 0, $3 = 0, $4 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = (___pthread_self_105()|0);
 $2 = ((($1)) + 188|0);
 $3 = HEAP32[$2>>2]|0;
 $4 = (___strerror_l($0,$3)|0);
 return ($4|0);
}
function _memchr($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $$0$lcssa = 0, $$035$lcssa = 0, $$035$lcssa65 = 0, $$03555 = 0, $$036$lcssa = 0, $$036$lcssa64 = 0, $$03654 = 0, $$046 = 0, $$137$lcssa = 0, $$13745 = 0, $$140 = 0, $$2 = 0, $$23839 = 0, $$3 = 0, $$lcssa = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0;
 var $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0;
 var $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond53 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $3 = $1 & 255;
 $4 = $0;
 $5 = $4 & 3;
 $6 = ($5|0)!=(0);
 $7 = ($2|0)!=(0);
 $or$cond53 = $7 & $6;
 L1: do {
  if ($or$cond53) {
   $8 = $1&255;
   $$03555 = $0;$$03654 = $2;
   while(1) {
    $9 = HEAP8[$$03555>>0]|0;
    $10 = ($9<<24>>24)==($8<<24>>24);
    if ($10) {
     $$035$lcssa65 = $$03555;$$036$lcssa64 = $$03654;
     label = 6;
     break L1;
    }
    $11 = ((($$03555)) + 1|0);
    $12 = (($$03654) + -1)|0;
    $13 = $11;
    $14 = $13 & 3;
    $15 = ($14|0)!=(0);
    $16 = ($12|0)!=(0);
    $or$cond = $16 & $15;
    if ($or$cond) {
     $$03555 = $11;$$03654 = $12;
    } else {
     $$035$lcssa = $11;$$036$lcssa = $12;$$lcssa = $16;
     label = 5;
     break;
    }
   }
  } else {
   $$035$lcssa = $0;$$036$lcssa = $2;$$lcssa = $7;
   label = 5;
  }
 } while(0);
 if ((label|0) == 5) {
  if ($$lcssa) {
   $$035$lcssa65 = $$035$lcssa;$$036$lcssa64 = $$036$lcssa;
   label = 6;
  } else {
   $$2 = $$035$lcssa;$$3 = 0;
  }
 }
 L8: do {
  if ((label|0) == 6) {
   $17 = HEAP8[$$035$lcssa65>>0]|0;
   $18 = $1&255;
   $19 = ($17<<24>>24)==($18<<24>>24);
   if ($19) {
    $$2 = $$035$lcssa65;$$3 = $$036$lcssa64;
   } else {
    $20 = Math_imul($3, 16843009)|0;
    $21 = ($$036$lcssa64>>>0)>(3);
    L11: do {
     if ($21) {
      $$046 = $$035$lcssa65;$$13745 = $$036$lcssa64;
      while(1) {
       $22 = HEAP32[$$046>>2]|0;
       $23 = $22 ^ $20;
       $24 = (($23) + -16843009)|0;
       $25 = $23 & -2139062144;
       $26 = $25 ^ -2139062144;
       $27 = $26 & $24;
       $28 = ($27|0)==(0);
       if (!($28)) {
        break;
       }
       $29 = ((($$046)) + 4|0);
       $30 = (($$13745) + -4)|0;
       $31 = ($30>>>0)>(3);
       if ($31) {
        $$046 = $29;$$13745 = $30;
       } else {
        $$0$lcssa = $29;$$137$lcssa = $30;
        label = 11;
        break L11;
       }
      }
      $$140 = $$046;$$23839 = $$13745;
     } else {
      $$0$lcssa = $$035$lcssa65;$$137$lcssa = $$036$lcssa64;
      label = 11;
     }
    } while(0);
    if ((label|0) == 11) {
     $32 = ($$137$lcssa|0)==(0);
     if ($32) {
      $$2 = $$0$lcssa;$$3 = 0;
      break;
     } else {
      $$140 = $$0$lcssa;$$23839 = $$137$lcssa;
     }
    }
    while(1) {
     $33 = HEAP8[$$140>>0]|0;
     $34 = ($33<<24>>24)==($18<<24>>24);
     if ($34) {
      $$2 = $$140;$$3 = $$23839;
      break L8;
     }
     $35 = ((($$140)) + 1|0);
     $36 = (($$23839) + -1)|0;
     $37 = ($36|0)==(0);
     if ($37) {
      $$2 = $35;$$3 = 0;
      break;
     } else {
      $$140 = $35;$$23839 = $36;
     }
    }
   }
  }
 } while(0);
 $38 = ($$3|0)!=(0);
 $39 = $38 ? $$2 : 0;
 return ($39|0);
}
function _pad_674($0,$1,$2,$3,$4) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 $4 = $4|0;
 var $$0$lcssa = 0, $$011 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 256|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(256|0);
 $5 = sp;
 $6 = $4 & 73728;
 $7 = ($6|0)==(0);
 $8 = ($2|0)>($3|0);
 $or$cond = $8 & $7;
 if ($or$cond) {
  $9 = (($2) - ($3))|0;
  $10 = ($9>>>0)<(256);
  $11 = $10 ? $9 : 256;
  _memset(($5|0),($1|0),($11|0))|0;
  $12 = ($9>>>0)>(255);
  if ($12) {
   $13 = (($2) - ($3))|0;
   $$011 = $9;
   while(1) {
    _out($0,$5,256);
    $14 = (($$011) + -256)|0;
    $15 = ($14>>>0)>(255);
    if ($15) {
     $$011 = $14;
    } else {
     break;
    }
   }
   $16 = $13 & 255;
   $$0$lcssa = $16;
  } else {
   $$0$lcssa = $9;
  }
  _out($0,$5,$$0$lcssa);
 }
 STACKTOP = sp;return;
}
function _wctomb($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$0 = 0, $2 = 0, $3 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = ($0|0)==(0|0);
 if ($2) {
  $$0 = 0;
 } else {
  $3 = (_wcrtomb($0,$1,0)|0);
  $$0 = $3;
 }
 return ($$0|0);
}
function _fmt_fp($0,$1,$2,$3,$4,$5) {
 $0 = $0|0;
 $1 = +$1;
 $2 = $2|0;
 $3 = $3|0;
 $4 = $4|0;
 $5 = $5|0;
 var $$ = 0, $$$ = 0, $$$$559 = 0.0, $$$3484 = 0, $$$3484691 = 0, $$$3484692 = 0, $$$3501 = 0, $$$4502 = 0, $$$542 = 0.0, $$$559 = 0.0, $$0 = 0, $$0463$lcssa = 0, $$0463584 = 0, $$0464594 = 0, $$0471 = 0.0, $$0479 = 0, $$0487642 = 0, $$0488 = 0, $$0488653 = 0, $$0488655 = 0;
 var $$0496$$9 = 0, $$0497654 = 0, $$0498 = 0, $$0509582 = 0.0, $$0510 = 0, $$0511 = 0, $$0514637 = 0, $$0520 = 0, $$0521 = 0, $$0521$ = 0, $$0523 = 0, $$0525 = 0, $$0527 = 0, $$0527629 = 0, $$0527631 = 0, $$0530636 = 0, $$1465 = 0, $$1467 = 0.0, $$1469 = 0.0, $$1472 = 0.0;
 var $$1480 = 0, $$1482$lcssa = 0, $$1482661 = 0, $$1489641 = 0, $$1499$lcssa = 0, $$1499660 = 0, $$1508583 = 0, $$1512$lcssa = 0, $$1512607 = 0, $$1515 = 0, $$1524 = 0, $$1526 = 0, $$1528614 = 0, $$1531$lcssa = 0, $$1531630 = 0, $$1598 = 0, $$2 = 0, $$2473 = 0.0, $$2476 = 0, $$2476$$547 = 0;
 var $$2476$$549 = 0, $$2483$ph = 0, $$2500 = 0, $$2513 = 0, $$2516618 = 0, $$2529 = 0, $$2532617 = 0, $$3 = 0.0, $$3477 = 0, $$3484$lcssa = 0, $$3484648 = 0, $$3501$lcssa = 0, $$3501647 = 0, $$3533613 = 0, $$4 = 0.0, $$4478$lcssa = 0, $$4478590 = 0, $$4492 = 0, $$4502 = 0, $$4518 = 0;
 var $$5$lcssa = 0, $$534$ = 0, $$539 = 0, $$539$ = 0, $$542 = 0.0, $$546 = 0, $$548 = 0, $$5486$lcssa = 0, $$5486623 = 0, $$5493597 = 0, $$5519$ph = 0, $$555 = 0, $$556 = 0, $$559 = 0.0, $$5602 = 0, $$6 = 0, $$6494589 = 0, $$7495601 = 0, $$7505 = 0, $$7505$ = 0;
 var $$7505$ph = 0, $$8 = 0, $$9$ph = 0, $$lcssa673 = 0, $$neg = 0, $$neg567 = 0, $$pn = 0, $$pn566 = 0, $$pr = 0, $$pr564 = 0, $$pre = 0, $$pre$phi690Z2D = 0, $$pre689 = 0, $$sink545$lcssa = 0, $$sink545622 = 0, $$sink562 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0;
 var $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0.0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0.0, $117 = 0.0, $118 = 0.0, $119 = 0, $12 = 0, $120 = 0;
 var $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0;
 var $14 = 0.0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0;
 var $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0;
 var $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0;
 var $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0;
 var $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0.0, $229 = 0.0, $23 = 0;
 var $230 = 0, $231 = 0.0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0;
 var $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0;
 var $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0;
 var $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0;
 var $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0, $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0;
 var $321 = 0, $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0, $332 = 0, $333 = 0, $334 = 0, $335 = 0, $336 = 0, $337 = 0, $338 = 0, $339 = 0;
 var $34 = 0, $340 = 0, $341 = 0, $342 = 0, $343 = 0, $344 = 0, $345 = 0, $346 = 0, $347 = 0, $348 = 0, $349 = 0, $35 = 0.0, $350 = 0, $351 = 0, $352 = 0, $353 = 0, $354 = 0, $355 = 0, $356 = 0, $357 = 0;
 var $358 = 0, $359 = 0, $36 = 0.0, $360 = 0, $361 = 0, $362 = 0, $363 = 0, $364 = 0, $365 = 0, $366 = 0, $367 = 0, $368 = 0, $369 = 0, $37 = 0, $370 = 0, $371 = 0, $372 = 0, $373 = 0, $374 = 0, $375 = 0;
 var $376 = 0, $377 = 0, $378 = 0, $379 = 0, $38 = 0, $380 = 0, $381 = 0, $382 = 0, $383 = 0, $384 = 0, $385 = 0, $386 = 0, $387 = 0, $388 = 0, $39 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
 var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $50 = 0, $51 = 0.0, $52 = 0, $53 = 0, $54 = 0, $55 = 0.0, $56 = 0.0, $57 = 0.0, $58 = 0.0, $59 = 0.0, $6 = 0, $60 = 0.0, $61 = 0, $62 = 0, $63 = 0;
 var $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0;
 var $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0.0, $88 = 0.0, $89 = 0.0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $exitcond = 0;
 var $narrow = 0, $not$ = 0, $notlhs = 0, $notrhs = 0, $or$cond = 0, $or$cond3$not = 0, $or$cond537 = 0, $or$cond541 = 0, $or$cond544 = 0, $or$cond554 = 0, $or$cond6 = 0, $scevgep684 = 0, $scevgep684685 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 560|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(560|0);
 $6 = sp + 8|0;
 $7 = sp;
 $8 = sp + 524|0;
 $9 = $8;
 $10 = sp + 512|0;
 HEAP32[$7>>2] = 0;
 $11 = ((($10)) + 12|0);
 (___DOUBLE_BITS_675($1)|0);
 $12 = tempRet0;
 $13 = ($12|0)<(0);
 if ($13) {
  $14 = -$1;
  $$0471 = $14;$$0520 = 1;$$0521 = 17839;
 } else {
  $15 = $4 & 2048;
  $16 = ($15|0)==(0);
  $17 = $4 & 1;
  $18 = ($17|0)==(0);
  $$ = $18 ? (17840) : (17845);
  $$$ = $16 ? $$ : (17842);
  $19 = $4 & 2049;
  $narrow = ($19|0)!=(0);
  $$534$ = $narrow&1;
  $$0471 = $1;$$0520 = $$534$;$$0521 = $$$;
 }
 (___DOUBLE_BITS_675($$0471)|0);
 $20 = tempRet0;
 $21 = $20 & 2146435072;
 $22 = ($21>>>0)<(2146435072);
 $23 = (0)<(0);
 $24 = ($21|0)==(2146435072);
 $25 = $24 & $23;
 $26 = $22 | $25;
 do {
  if ($26) {
   $35 = (+_frexpl($$0471,$7));
   $36 = $35 * 2.0;
   $37 = $36 != 0.0;
   if ($37) {
    $38 = HEAP32[$7>>2]|0;
    $39 = (($38) + -1)|0;
    HEAP32[$7>>2] = $39;
   }
   $40 = $5 | 32;
   $41 = ($40|0)==(97);
   if ($41) {
    $42 = $5 & 32;
    $43 = ($42|0)==(0);
    $44 = ((($$0521)) + 9|0);
    $$0521$ = $43 ? $$0521 : $44;
    $45 = $$0520 | 2;
    $46 = ($3>>>0)>(11);
    $47 = (12 - ($3))|0;
    $48 = ($47|0)==(0);
    $49 = $46 | $48;
    do {
     if ($49) {
      $$1472 = $36;
     } else {
      $$0509582 = 8.0;$$1508583 = $47;
      while(1) {
       $50 = (($$1508583) + -1)|0;
       $51 = $$0509582 * 16.0;
       $52 = ($50|0)==(0);
       if ($52) {
        break;
       } else {
        $$0509582 = $51;$$1508583 = $50;
       }
      }
      $53 = HEAP8[$$0521$>>0]|0;
      $54 = ($53<<24>>24)==(45);
      if ($54) {
       $55 = -$36;
       $56 = $55 - $51;
       $57 = $51 + $56;
       $58 = -$57;
       $$1472 = $58;
       break;
      } else {
       $59 = $36 + $51;
       $60 = $59 - $51;
       $$1472 = $60;
       break;
      }
     }
    } while(0);
    $61 = HEAP32[$7>>2]|0;
    $62 = ($61|0)<(0);
    $63 = (0 - ($61))|0;
    $64 = $62 ? $63 : $61;
    $65 = ($64|0)<(0);
    $66 = $65 << 31 >> 31;
    $67 = (_fmt_u($64,$66,$11)|0);
    $68 = ($67|0)==($11|0);
    if ($68) {
     $69 = ((($10)) + 11|0);
     HEAP8[$69>>0] = 48;
     $$0511 = $69;
    } else {
     $$0511 = $67;
    }
    $70 = $61 >> 31;
    $71 = $70 & 2;
    $72 = (($71) + 43)|0;
    $73 = $72&255;
    $74 = ((($$0511)) + -1|0);
    HEAP8[$74>>0] = $73;
    $75 = (($5) + 15)|0;
    $76 = $75&255;
    $77 = ((($$0511)) + -2|0);
    HEAP8[$77>>0] = $76;
    $notrhs = ($3|0)<(1);
    $78 = $4 & 8;
    $79 = ($78|0)==(0);
    $$0523 = $8;$$2473 = $$1472;
    while(1) {
     $80 = (~~(($$2473)));
     $81 = (17870 + ($80)|0);
     $82 = HEAP8[$81>>0]|0;
     $83 = $82&255;
     $84 = $83 | $42;
     $85 = $84&255;
     $86 = ((($$0523)) + 1|0);
     HEAP8[$$0523>>0] = $85;
     $87 = (+($80|0));
     $88 = $$2473 - $87;
     $89 = $88 * 16.0;
     $90 = $86;
     $91 = (($90) - ($9))|0;
     $92 = ($91|0)==(1);
     if ($92) {
      $notlhs = $89 == 0.0;
      $or$cond3$not = $notrhs & $notlhs;
      $or$cond = $79 & $or$cond3$not;
      if ($or$cond) {
       $$1524 = $86;
      } else {
       $93 = ((($$0523)) + 2|0);
       HEAP8[$86>>0] = 46;
       $$1524 = $93;
      }
     } else {
      $$1524 = $86;
     }
     $94 = $89 != 0.0;
     if ($94) {
      $$0523 = $$1524;$$2473 = $89;
     } else {
      break;
     }
    }
    $95 = ($3|0)!=(0);
    $96 = $77;
    $97 = $11;
    $98 = $$1524;
    $99 = (($98) - ($9))|0;
    $100 = (($97) - ($96))|0;
    $101 = (($99) + -2)|0;
    $102 = ($101|0)<($3|0);
    $or$cond537 = $95 & $102;
    $103 = (($3) + 2)|0;
    $$pn = $or$cond537 ? $103 : $99;
    $$0525 = (($100) + ($45))|0;
    $104 = (($$0525) + ($$pn))|0;
    _pad_674($0,32,$2,$104,$4);
    _out($0,$$0521$,$45);
    $105 = $4 ^ 65536;
    _pad_674($0,48,$2,$104,$105);
    _out($0,$8,$99);
    $106 = (($$pn) - ($99))|0;
    _pad_674($0,48,$106,0,0);
    _out($0,$77,$100);
    $107 = $4 ^ 8192;
    _pad_674($0,32,$2,$104,$107);
    $$sink562 = $104;
    break;
   }
   $108 = ($3|0)<(0);
   $$539 = $108 ? 6 : $3;
   if ($37) {
    $109 = $36 * 268435456.0;
    $110 = HEAP32[$7>>2]|0;
    $111 = (($110) + -28)|0;
    HEAP32[$7>>2] = $111;
    $$3 = $109;$$pr = $111;
   } else {
    $$pre = HEAP32[$7>>2]|0;
    $$3 = $36;$$pr = $$pre;
   }
   $112 = ($$pr|0)<(0);
   $113 = ((($6)) + 288|0);
   $$556 = $112 ? $6 : $113;
   $$0498 = $$556;$$4 = $$3;
   while(1) {
    $114 = (~~(($$4))>>>0);
    HEAP32[$$0498>>2] = $114;
    $115 = ((($$0498)) + 4|0);
    $116 = (+($114>>>0));
    $117 = $$4 - $116;
    $118 = $117 * 1.0E+9;
    $119 = $118 != 0.0;
    if ($119) {
     $$0498 = $115;$$4 = $118;
    } else {
     break;
    }
   }
   $120 = ($$pr|0)>(0);
   if ($120) {
    $$1482661 = $$556;$$1499660 = $115;$122 = $$pr;
    while(1) {
     $121 = ($122|0)<(29);
     $123 = $121 ? $122 : 29;
     $$0488653 = ((($$1499660)) + -4|0);
     $124 = ($$0488653>>>0)<($$1482661>>>0);
     if ($124) {
      $$2483$ph = $$1482661;
     } else {
      $$0488655 = $$0488653;$$0497654 = 0;
      while(1) {
       $125 = HEAP32[$$0488655>>2]|0;
       $126 = (_bitshift64Shl(($125|0),0,($123|0))|0);
       $127 = tempRet0;
       $128 = (_i64Add(($126|0),($127|0),($$0497654|0),0)|0);
       $129 = tempRet0;
       $130 = (___uremdi3(($128|0),($129|0),1000000000,0)|0);
       $131 = tempRet0;
       HEAP32[$$0488655>>2] = $130;
       $132 = (___udivdi3(($128|0),($129|0),1000000000,0)|0);
       $133 = tempRet0;
       $$0488 = ((($$0488655)) + -4|0);
       $134 = ($$0488>>>0)<($$1482661>>>0);
       if ($134) {
        break;
       } else {
        $$0488655 = $$0488;$$0497654 = $132;
       }
      }
      $135 = ($132|0)==(0);
      if ($135) {
       $$2483$ph = $$1482661;
      } else {
       $136 = ((($$1482661)) + -4|0);
       HEAP32[$136>>2] = $132;
       $$2483$ph = $136;
      }
     }
     $$2500 = $$1499660;
     while(1) {
      $137 = ($$2500>>>0)>($$2483$ph>>>0);
      if (!($137)) {
       break;
      }
      $138 = ((($$2500)) + -4|0);
      $139 = HEAP32[$138>>2]|0;
      $140 = ($139|0)==(0);
      if ($140) {
       $$2500 = $138;
      } else {
       break;
      }
     }
     $141 = HEAP32[$7>>2]|0;
     $142 = (($141) - ($123))|0;
     HEAP32[$7>>2] = $142;
     $143 = ($142|0)>(0);
     if ($143) {
      $$1482661 = $$2483$ph;$$1499660 = $$2500;$122 = $142;
     } else {
      $$1482$lcssa = $$2483$ph;$$1499$lcssa = $$2500;$$pr564 = $142;
      break;
     }
    }
   } else {
    $$1482$lcssa = $$556;$$1499$lcssa = $115;$$pr564 = $$pr;
   }
   $144 = ($$pr564|0)<(0);
   if ($144) {
    $145 = (($$539) + 25)|0;
    $146 = (($145|0) / 9)&-1;
    $147 = (($146) + 1)|0;
    $148 = ($40|0)==(102);
    $$3484648 = $$1482$lcssa;$$3501647 = $$1499$lcssa;$150 = $$pr564;
    while(1) {
     $149 = (0 - ($150))|0;
     $151 = ($149|0)<(9);
     $152 = $151 ? $149 : 9;
     $153 = ($$3484648>>>0)<($$3501647>>>0);
     if ($153) {
      $157 = 1 << $152;
      $158 = (($157) + -1)|0;
      $159 = 1000000000 >>> $152;
      $$0487642 = 0;$$1489641 = $$3484648;
      while(1) {
       $160 = HEAP32[$$1489641>>2]|0;
       $161 = $160 & $158;
       $162 = $160 >>> $152;
       $163 = (($162) + ($$0487642))|0;
       HEAP32[$$1489641>>2] = $163;
       $164 = Math_imul($161, $159)|0;
       $165 = ((($$1489641)) + 4|0);
       $166 = ($165>>>0)<($$3501647>>>0);
       if ($166) {
        $$0487642 = $164;$$1489641 = $165;
       } else {
        break;
       }
      }
      $167 = HEAP32[$$3484648>>2]|0;
      $168 = ($167|0)==(0);
      $169 = ((($$3484648)) + 4|0);
      $$$3484 = $168 ? $169 : $$3484648;
      $170 = ($164|0)==(0);
      if ($170) {
       $$$3484692 = $$$3484;$$4502 = $$3501647;
      } else {
       $171 = ((($$3501647)) + 4|0);
       HEAP32[$$3501647>>2] = $164;
       $$$3484692 = $$$3484;$$4502 = $171;
      }
     } else {
      $154 = HEAP32[$$3484648>>2]|0;
      $155 = ($154|0)==(0);
      $156 = ((($$3484648)) + 4|0);
      $$$3484691 = $155 ? $156 : $$3484648;
      $$$3484692 = $$$3484691;$$4502 = $$3501647;
     }
     $172 = $148 ? $$556 : $$$3484692;
     $173 = $$4502;
     $174 = $172;
     $175 = (($173) - ($174))|0;
     $176 = $175 >> 2;
     $177 = ($176|0)>($147|0);
     $178 = (($172) + ($147<<2)|0);
     $$$4502 = $177 ? $178 : $$4502;
     $179 = HEAP32[$7>>2]|0;
     $180 = (($179) + ($152))|0;
     HEAP32[$7>>2] = $180;
     $181 = ($180|0)<(0);
     if ($181) {
      $$3484648 = $$$3484692;$$3501647 = $$$4502;$150 = $180;
     } else {
      $$3484$lcssa = $$$3484692;$$3501$lcssa = $$$4502;
      break;
     }
    }
   } else {
    $$3484$lcssa = $$1482$lcssa;$$3501$lcssa = $$1499$lcssa;
   }
   $182 = ($$3484$lcssa>>>0)<($$3501$lcssa>>>0);
   $183 = $$556;
   if ($182) {
    $184 = $$3484$lcssa;
    $185 = (($183) - ($184))|0;
    $186 = $185 >> 2;
    $187 = ($186*9)|0;
    $188 = HEAP32[$$3484$lcssa>>2]|0;
    $189 = ($188>>>0)<(10);
    if ($189) {
     $$1515 = $187;
    } else {
     $$0514637 = $187;$$0530636 = 10;
     while(1) {
      $190 = ($$0530636*10)|0;
      $191 = (($$0514637) + 1)|0;
      $192 = ($188>>>0)<($190>>>0);
      if ($192) {
       $$1515 = $191;
       break;
      } else {
       $$0514637 = $191;$$0530636 = $190;
      }
     }
    }
   } else {
    $$1515 = 0;
   }
   $193 = ($40|0)!=(102);
   $194 = $193 ? $$1515 : 0;
   $195 = (($$539) - ($194))|0;
   $196 = ($40|0)==(103);
   $197 = ($$539|0)!=(0);
   $198 = $197 & $196;
   $$neg = $198 << 31 >> 31;
   $199 = (($195) + ($$neg))|0;
   $200 = $$3501$lcssa;
   $201 = (($200) - ($183))|0;
   $202 = $201 >> 2;
   $203 = ($202*9)|0;
   $204 = (($203) + -9)|0;
   $205 = ($199|0)<($204|0);
   if ($205) {
    $206 = ((($$556)) + 4|0);
    $207 = (($199) + 9216)|0;
    $208 = (($207|0) / 9)&-1;
    $209 = (($208) + -1024)|0;
    $210 = (($206) + ($209<<2)|0);
    $211 = (($207|0) % 9)&-1;
    $$0527629 = (($211) + 1)|0;
    $212 = ($$0527629|0)<(9);
    if ($212) {
     $$0527631 = $$0527629;$$1531630 = 10;
     while(1) {
      $213 = ($$1531630*10)|0;
      $$0527 = (($$0527631) + 1)|0;
      $exitcond = ($$0527|0)==(9);
      if ($exitcond) {
       $$1531$lcssa = $213;
       break;
      } else {
       $$0527631 = $$0527;$$1531630 = $213;
      }
     }
    } else {
     $$1531$lcssa = 10;
    }
    $214 = HEAP32[$210>>2]|0;
    $215 = (($214>>>0) % ($$1531$lcssa>>>0))&-1;
    $216 = ($215|0)==(0);
    $217 = ((($210)) + 4|0);
    $218 = ($217|0)==($$3501$lcssa|0);
    $or$cond541 = $218 & $216;
    if ($or$cond541) {
     $$4492 = $210;$$4518 = $$1515;$$8 = $$3484$lcssa;
    } else {
     $219 = (($214>>>0) / ($$1531$lcssa>>>0))&-1;
     $220 = $219 & 1;
     $221 = ($220|0)==(0);
     $$542 = $221 ? 9007199254740992.0 : 9007199254740994.0;
     $222 = (($$1531$lcssa|0) / 2)&-1;
     $223 = ($215>>>0)<($222>>>0);
     $224 = ($215|0)==($222|0);
     $or$cond544 = $218 & $224;
     $$559 = $or$cond544 ? 1.0 : 1.5;
     $$$559 = $223 ? 0.5 : $$559;
     $225 = ($$0520|0)==(0);
     if ($225) {
      $$1467 = $$$559;$$1469 = $$542;
     } else {
      $226 = HEAP8[$$0521>>0]|0;
      $227 = ($226<<24>>24)==(45);
      $228 = -$$542;
      $229 = -$$$559;
      $$$542 = $227 ? $228 : $$542;
      $$$$559 = $227 ? $229 : $$$559;
      $$1467 = $$$$559;$$1469 = $$$542;
     }
     $230 = (($214) - ($215))|0;
     HEAP32[$210>>2] = $230;
     $231 = $$1469 + $$1467;
     $232 = $231 != $$1469;
     if ($232) {
      $233 = (($230) + ($$1531$lcssa))|0;
      HEAP32[$210>>2] = $233;
      $234 = ($233>>>0)>(999999999);
      if ($234) {
       $$5486623 = $$3484$lcssa;$$sink545622 = $210;
       while(1) {
        $235 = ((($$sink545622)) + -4|0);
        HEAP32[$$sink545622>>2] = 0;
        $236 = ($235>>>0)<($$5486623>>>0);
        if ($236) {
         $237 = ((($$5486623)) + -4|0);
         HEAP32[$237>>2] = 0;
         $$6 = $237;
        } else {
         $$6 = $$5486623;
        }
        $238 = HEAP32[$235>>2]|0;
        $239 = (($238) + 1)|0;
        HEAP32[$235>>2] = $239;
        $240 = ($239>>>0)>(999999999);
        if ($240) {
         $$5486623 = $$6;$$sink545622 = $235;
        } else {
         $$5486$lcssa = $$6;$$sink545$lcssa = $235;
         break;
        }
       }
      } else {
       $$5486$lcssa = $$3484$lcssa;$$sink545$lcssa = $210;
      }
      $241 = $$5486$lcssa;
      $242 = (($183) - ($241))|0;
      $243 = $242 >> 2;
      $244 = ($243*9)|0;
      $245 = HEAP32[$$5486$lcssa>>2]|0;
      $246 = ($245>>>0)<(10);
      if ($246) {
       $$4492 = $$sink545$lcssa;$$4518 = $244;$$8 = $$5486$lcssa;
      } else {
       $$2516618 = $244;$$2532617 = 10;
       while(1) {
        $247 = ($$2532617*10)|0;
        $248 = (($$2516618) + 1)|0;
        $249 = ($245>>>0)<($247>>>0);
        if ($249) {
         $$4492 = $$sink545$lcssa;$$4518 = $248;$$8 = $$5486$lcssa;
         break;
        } else {
         $$2516618 = $248;$$2532617 = $247;
        }
       }
      }
     } else {
      $$4492 = $210;$$4518 = $$1515;$$8 = $$3484$lcssa;
     }
    }
    $250 = ((($$4492)) + 4|0);
    $251 = ($$3501$lcssa>>>0)>($250>>>0);
    $$$3501 = $251 ? $250 : $$3501$lcssa;
    $$5519$ph = $$4518;$$7505$ph = $$$3501;$$9$ph = $$8;
   } else {
    $$5519$ph = $$1515;$$7505$ph = $$3501$lcssa;$$9$ph = $$3484$lcssa;
   }
   $$7505 = $$7505$ph;
   while(1) {
    $252 = ($$7505>>>0)>($$9$ph>>>0);
    if (!($252)) {
     $$lcssa673 = 0;
     break;
    }
    $253 = ((($$7505)) + -4|0);
    $254 = HEAP32[$253>>2]|0;
    $255 = ($254|0)==(0);
    if ($255) {
     $$7505 = $253;
    } else {
     $$lcssa673 = 1;
     break;
    }
   }
   $256 = (0 - ($$5519$ph))|0;
   do {
    if ($196) {
     $not$ = $197 ^ 1;
     $257 = $not$&1;
     $$539$ = (($257) + ($$539))|0;
     $258 = ($$539$|0)>($$5519$ph|0);
     $259 = ($$5519$ph|0)>(-5);
     $or$cond6 = $258 & $259;
     if ($or$cond6) {
      $260 = (($5) + -1)|0;
      $$neg567 = (($$539$) + -1)|0;
      $261 = (($$neg567) - ($$5519$ph))|0;
      $$0479 = $260;$$2476 = $261;
     } else {
      $262 = (($5) + -2)|0;
      $263 = (($$539$) + -1)|0;
      $$0479 = $262;$$2476 = $263;
     }
     $264 = $4 & 8;
     $265 = ($264|0)==(0);
     if ($265) {
      if ($$lcssa673) {
       $266 = ((($$7505)) + -4|0);
       $267 = HEAP32[$266>>2]|0;
       $268 = ($267|0)==(0);
       if ($268) {
        $$2529 = 9;
       } else {
        $269 = (($267>>>0) % 10)&-1;
        $270 = ($269|0)==(0);
        if ($270) {
         $$1528614 = 0;$$3533613 = 10;
         while(1) {
          $271 = ($$3533613*10)|0;
          $272 = (($$1528614) + 1)|0;
          $273 = (($267>>>0) % ($271>>>0))&-1;
          $274 = ($273|0)==(0);
          if ($274) {
           $$1528614 = $272;$$3533613 = $271;
          } else {
           $$2529 = $272;
           break;
          }
         }
        } else {
         $$2529 = 0;
        }
       }
      } else {
       $$2529 = 9;
      }
      $275 = $$0479 | 32;
      $276 = ($275|0)==(102);
      $277 = $$7505;
      $278 = (($277) - ($183))|0;
      $279 = $278 >> 2;
      $280 = ($279*9)|0;
      $281 = (($280) + -9)|0;
      if ($276) {
       $282 = (($281) - ($$2529))|0;
       $283 = ($282|0)>(0);
       $$546 = $283 ? $282 : 0;
       $284 = ($$2476|0)<($$546|0);
       $$2476$$547 = $284 ? $$2476 : $$546;
       $$1480 = $$0479;$$3477 = $$2476$$547;$$pre$phi690Z2D = 0;
       break;
      } else {
       $285 = (($281) + ($$5519$ph))|0;
       $286 = (($285) - ($$2529))|0;
       $287 = ($286|0)>(0);
       $$548 = $287 ? $286 : 0;
       $288 = ($$2476|0)<($$548|0);
       $$2476$$549 = $288 ? $$2476 : $$548;
       $$1480 = $$0479;$$3477 = $$2476$$549;$$pre$phi690Z2D = 0;
       break;
      }
     } else {
      $$1480 = $$0479;$$3477 = $$2476;$$pre$phi690Z2D = $264;
     }
    } else {
     $$pre689 = $4 & 8;
     $$1480 = $5;$$3477 = $$539;$$pre$phi690Z2D = $$pre689;
    }
   } while(0);
   $289 = $$3477 | $$pre$phi690Z2D;
   $290 = ($289|0)!=(0);
   $291 = $290&1;
   $292 = $$1480 | 32;
   $293 = ($292|0)==(102);
   if ($293) {
    $294 = ($$5519$ph|0)>(0);
    $295 = $294 ? $$5519$ph : 0;
    $$2513 = 0;$$pn566 = $295;
   } else {
    $296 = ($$5519$ph|0)<(0);
    $297 = $296 ? $256 : $$5519$ph;
    $298 = ($297|0)<(0);
    $299 = $298 << 31 >> 31;
    $300 = (_fmt_u($297,$299,$11)|0);
    $301 = $11;
    $302 = $300;
    $303 = (($301) - ($302))|0;
    $304 = ($303|0)<(2);
    if ($304) {
     $$1512607 = $300;
     while(1) {
      $305 = ((($$1512607)) + -1|0);
      HEAP8[$305>>0] = 48;
      $306 = $305;
      $307 = (($301) - ($306))|0;
      $308 = ($307|0)<(2);
      if ($308) {
       $$1512607 = $305;
      } else {
       $$1512$lcssa = $305;
       break;
      }
     }
    } else {
     $$1512$lcssa = $300;
    }
    $309 = $$5519$ph >> 31;
    $310 = $309 & 2;
    $311 = (($310) + 43)|0;
    $312 = $311&255;
    $313 = ((($$1512$lcssa)) + -1|0);
    HEAP8[$313>>0] = $312;
    $314 = $$1480&255;
    $315 = ((($$1512$lcssa)) + -2|0);
    HEAP8[$315>>0] = $314;
    $316 = $315;
    $317 = (($301) - ($316))|0;
    $$2513 = $315;$$pn566 = $317;
   }
   $318 = (($$0520) + 1)|0;
   $319 = (($318) + ($$3477))|0;
   $$1526 = (($319) + ($291))|0;
   $320 = (($$1526) + ($$pn566))|0;
   _pad_674($0,32,$2,$320,$4);
   _out($0,$$0521,$$0520);
   $321 = $4 ^ 65536;
   _pad_674($0,48,$2,$320,$321);
   if ($293) {
    $322 = ($$9$ph>>>0)>($$556>>>0);
    $$0496$$9 = $322 ? $$556 : $$9$ph;
    $323 = ((($8)) + 9|0);
    $324 = $323;
    $325 = ((($8)) + 8|0);
    $$5493597 = $$0496$$9;
    while(1) {
     $326 = HEAP32[$$5493597>>2]|0;
     $327 = (_fmt_u($326,0,$323)|0);
     $328 = ($$5493597|0)==($$0496$$9|0);
     if ($328) {
      $334 = ($327|0)==($323|0);
      if ($334) {
       HEAP8[$325>>0] = 48;
       $$1465 = $325;
      } else {
       $$1465 = $327;
      }
     } else {
      $329 = ($327>>>0)>($8>>>0);
      if ($329) {
       $330 = $327;
       $331 = (($330) - ($9))|0;
       _memset(($8|0),48,($331|0))|0;
       $$0464594 = $327;
       while(1) {
        $332 = ((($$0464594)) + -1|0);
        $333 = ($332>>>0)>($8>>>0);
        if ($333) {
         $$0464594 = $332;
        } else {
         $$1465 = $332;
         break;
        }
       }
      } else {
       $$1465 = $327;
      }
     }
     $335 = $$1465;
     $336 = (($324) - ($335))|0;
     _out($0,$$1465,$336);
     $337 = ((($$5493597)) + 4|0);
     $338 = ($337>>>0)>($$556>>>0);
     if ($338) {
      break;
     } else {
      $$5493597 = $337;
     }
    }
    $339 = ($289|0)==(0);
    if (!($339)) {
     _out($0,17886,1);
    }
    $340 = ($337>>>0)<($$7505>>>0);
    $341 = ($$3477|0)>(0);
    $342 = $340 & $341;
    if ($342) {
     $$4478590 = $$3477;$$6494589 = $337;
     while(1) {
      $343 = HEAP32[$$6494589>>2]|0;
      $344 = (_fmt_u($343,0,$323)|0);
      $345 = ($344>>>0)>($8>>>0);
      if ($345) {
       $346 = $344;
       $347 = (($346) - ($9))|0;
       _memset(($8|0),48,($347|0))|0;
       $$0463584 = $344;
       while(1) {
        $348 = ((($$0463584)) + -1|0);
        $349 = ($348>>>0)>($8>>>0);
        if ($349) {
         $$0463584 = $348;
        } else {
         $$0463$lcssa = $348;
         break;
        }
       }
      } else {
       $$0463$lcssa = $344;
      }
      $350 = ($$4478590|0)<(9);
      $351 = $350 ? $$4478590 : 9;
      _out($0,$$0463$lcssa,$351);
      $352 = ((($$6494589)) + 4|0);
      $353 = (($$4478590) + -9)|0;
      $354 = ($352>>>0)<($$7505>>>0);
      $355 = ($$4478590|0)>(9);
      $356 = $354 & $355;
      if ($356) {
       $$4478590 = $353;$$6494589 = $352;
      } else {
       $$4478$lcssa = $353;
       break;
      }
     }
    } else {
     $$4478$lcssa = $$3477;
    }
    $357 = (($$4478$lcssa) + 9)|0;
    _pad_674($0,48,$357,9,0);
   } else {
    $358 = ((($$9$ph)) + 4|0);
    $$7505$ = $$lcssa673 ? $$7505 : $358;
    $359 = ($$3477|0)>(-1);
    if ($359) {
     $360 = ((($8)) + 9|0);
     $361 = ($$pre$phi690Z2D|0)==(0);
     $362 = $360;
     $363 = (0 - ($9))|0;
     $364 = ((($8)) + 8|0);
     $$5602 = $$3477;$$7495601 = $$9$ph;
     while(1) {
      $365 = HEAP32[$$7495601>>2]|0;
      $366 = (_fmt_u($365,0,$360)|0);
      $367 = ($366|0)==($360|0);
      if ($367) {
       HEAP8[$364>>0] = 48;
       $$0 = $364;
      } else {
       $$0 = $366;
      }
      $368 = ($$7495601|0)==($$9$ph|0);
      do {
       if ($368) {
        $372 = ((($$0)) + 1|0);
        _out($0,$$0,1);
        $373 = ($$5602|0)<(1);
        $or$cond554 = $361 & $373;
        if ($or$cond554) {
         $$2 = $372;
         break;
        }
        _out($0,17886,1);
        $$2 = $372;
       } else {
        $369 = ($$0>>>0)>($8>>>0);
        if (!($369)) {
         $$2 = $$0;
         break;
        }
        $scevgep684 = (($$0) + ($363)|0);
        $scevgep684685 = $scevgep684;
        _memset(($8|0),48,($scevgep684685|0))|0;
        $$1598 = $$0;
        while(1) {
         $370 = ((($$1598)) + -1|0);
         $371 = ($370>>>0)>($8>>>0);
         if ($371) {
          $$1598 = $370;
         } else {
          $$2 = $370;
          break;
         }
        }
       }
      } while(0);
      $374 = $$2;
      $375 = (($362) - ($374))|0;
      $376 = ($$5602|0)>($375|0);
      $377 = $376 ? $375 : $$5602;
      _out($0,$$2,$377);
      $378 = (($$5602) - ($375))|0;
      $379 = ((($$7495601)) + 4|0);
      $380 = ($379>>>0)<($$7505$>>>0);
      $381 = ($378|0)>(-1);
      $382 = $380 & $381;
      if ($382) {
       $$5602 = $378;$$7495601 = $379;
      } else {
       $$5$lcssa = $378;
       break;
      }
     }
    } else {
     $$5$lcssa = $$3477;
    }
    $383 = (($$5$lcssa) + 18)|0;
    _pad_674($0,48,$383,18,0);
    $384 = $11;
    $385 = $$2513;
    $386 = (($384) - ($385))|0;
    _out($0,$$2513,$386);
   }
   $387 = $4 ^ 8192;
   _pad_674($0,32,$2,$320,$387);
   $$sink562 = $320;
  } else {
   $27 = $5 & 32;
   $28 = ($27|0)!=(0);
   $29 = $28 ? 17858 : 17862;
   $30 = ($$0471 != $$0471) | (0.0 != 0.0);
   $31 = $28 ? 19789 : 17866;
   $$0510 = $30 ? $31 : $29;
   $32 = (($$0520) + 3)|0;
   $33 = $4 & -65537;
   _pad_674($0,32,$2,$32,$33);
   _out($0,$$0521,$$0520);
   _out($0,$$0510,3);
   $34 = $4 ^ 8192;
   _pad_674($0,32,$2,$32,$34);
   $$sink562 = $32;
  }
 } while(0);
 $388 = ($$sink562|0)<($2|0);
 $$555 = $388 ? $2 : $$sink562;
 STACKTOP = sp;return ($$555|0);
}
function ___DOUBLE_BITS_675($0) {
 $0 = +$0;
 var $1 = 0, $2 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 HEAPF64[tempDoublePtr>>3] = $0;$1 = HEAP32[tempDoublePtr>>2]|0;
 $2 = HEAP32[tempDoublePtr+4>>2]|0;
 tempRet0 = ($2);
 return ($1|0);
}
function _frexpl($0,$1) {
 $0 = +$0;
 $1 = $1|0;
 var $2 = 0.0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = (+_frexp($0,$1));
 return (+$2);
}
function _frexp($0,$1) {
 $0 = +$0;
 $1 = $1|0;
 var $$0 = 0.0, $$016 = 0.0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0.0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0.0, $9 = 0.0, $storemerge = 0, $trunc$clear = 0, label = 0;
 var sp = 0;
 sp = STACKTOP;
 HEAPF64[tempDoublePtr>>3] = $0;$2 = HEAP32[tempDoublePtr>>2]|0;
 $3 = HEAP32[tempDoublePtr+4>>2]|0;
 $4 = (_bitshift64Lshr(($2|0),($3|0),52)|0);
 $5 = tempRet0;
 $6 = $4&65535;
 $trunc$clear = $6 & 2047;
 switch ($trunc$clear<<16>>16) {
 case 0:  {
  $7 = $0 != 0.0;
  if ($7) {
   $8 = $0 * 1.8446744073709552E+19;
   $9 = (+_frexp($8,$1));
   $10 = HEAP32[$1>>2]|0;
   $11 = (($10) + -64)|0;
   $$016 = $9;$storemerge = $11;
  } else {
   $$016 = $0;$storemerge = 0;
  }
  HEAP32[$1>>2] = $storemerge;
  $$0 = $$016;
  break;
 }
 case 2047:  {
  $$0 = $0;
  break;
 }
 default: {
  $12 = $4 & 2047;
  $13 = (($12) + -1022)|0;
  HEAP32[$1>>2] = $13;
  $14 = $3 & -2146435073;
  $15 = $14 | 1071644672;
  HEAP32[tempDoublePtr>>2] = $2;HEAP32[tempDoublePtr+4>>2] = $15;$16 = +HEAPF64[tempDoublePtr>>3];
  $$0 = $16;
 }
 }
 return (+$$0);
}
function _wcrtomb($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $$0 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0;
 var $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0;
 var $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $not$ = 0, $or$cond = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $3 = ($0|0)==(0|0);
 do {
  if ($3) {
   $$0 = 1;
  } else {
   $4 = ($1>>>0)<(128);
   if ($4) {
    $5 = $1&255;
    HEAP8[$0>>0] = $5;
    $$0 = 1;
    break;
   }
   $6 = (___pthread_self_448()|0);
   $7 = ((($6)) + 188|0);
   $8 = HEAP32[$7>>2]|0;
   $9 = HEAP32[$8>>2]|0;
   $not$ = ($9|0)==(0|0);
   if ($not$) {
    $10 = $1 & -128;
    $11 = ($10|0)==(57216);
    if ($11) {
     $13 = $1&255;
     HEAP8[$0>>0] = $13;
     $$0 = 1;
     break;
    } else {
     $12 = (___errno_location()|0);
     HEAP32[$12>>2] = 84;
     $$0 = -1;
     break;
    }
   }
   $14 = ($1>>>0)<(2048);
   if ($14) {
    $15 = $1 >>> 6;
    $16 = $15 | 192;
    $17 = $16&255;
    $18 = ((($0)) + 1|0);
    HEAP8[$0>>0] = $17;
    $19 = $1 & 63;
    $20 = $19 | 128;
    $21 = $20&255;
    HEAP8[$18>>0] = $21;
    $$0 = 2;
    break;
   }
   $22 = ($1>>>0)<(55296);
   $23 = $1 & -8192;
   $24 = ($23|0)==(57344);
   $or$cond = $22 | $24;
   if ($or$cond) {
    $25 = $1 >>> 12;
    $26 = $25 | 224;
    $27 = $26&255;
    $28 = ((($0)) + 1|0);
    HEAP8[$0>>0] = $27;
    $29 = $1 >>> 6;
    $30 = $29 & 63;
    $31 = $30 | 128;
    $32 = $31&255;
    $33 = ((($0)) + 2|0);
    HEAP8[$28>>0] = $32;
    $34 = $1 & 63;
    $35 = $34 | 128;
    $36 = $35&255;
    HEAP8[$33>>0] = $36;
    $$0 = 3;
    break;
   }
   $37 = (($1) + -65536)|0;
   $38 = ($37>>>0)<(1048576);
   if ($38) {
    $39 = $1 >>> 18;
    $40 = $39 | 240;
    $41 = $40&255;
    $42 = ((($0)) + 1|0);
    HEAP8[$0>>0] = $41;
    $43 = $1 >>> 12;
    $44 = $43 & 63;
    $45 = $44 | 128;
    $46 = $45&255;
    $47 = ((($0)) + 2|0);
    HEAP8[$42>>0] = $46;
    $48 = $1 >>> 6;
    $49 = $48 & 63;
    $50 = $49 | 128;
    $51 = $50&255;
    $52 = ((($0)) + 3|0);
    HEAP8[$47>>0] = $51;
    $53 = $1 & 63;
    $54 = $53 | 128;
    $55 = $54&255;
    HEAP8[$52>>0] = $55;
    $$0 = 4;
    break;
   } else {
    $56 = (___errno_location()|0);
    HEAP32[$56>>2] = 84;
    $$0 = -1;
    break;
   }
  }
 } while(0);
 return ($$0|0);
}
function ___pthread_self_448() {
 var $0 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $0 = (_pthread_self()|0);
 return ($0|0);
}
function ___pthread_self_105() {
 var $0 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $0 = (_pthread_self()|0);
 return ($0|0);
}
function ___strerror_l($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$012$lcssa = 0, $$01214 = 0, $$016 = 0, $$113 = 0, $$115 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0;
 var label = 0, sp = 0;
 sp = STACKTOP;
 $$016 = 0;
 while(1) {
  $3 = (17888 + ($$016)|0);
  $4 = HEAP8[$3>>0]|0;
  $5 = $4&255;
  $6 = ($5|0)==($0|0);
  if ($6) {
   label = 2;
   break;
  }
  $7 = (($$016) + 1)|0;
  $8 = ($7|0)==(87);
  if ($8) {
   $$01214 = 17976;$$115 = 87;
   label = 5;
   break;
  } else {
   $$016 = $7;
  }
 }
 if ((label|0) == 2) {
  $2 = ($$016|0)==(0);
  if ($2) {
   $$012$lcssa = 17976;
  } else {
   $$01214 = 17976;$$115 = $$016;
   label = 5;
  }
 }
 if ((label|0) == 5) {
  while(1) {
   label = 0;
   $$113 = $$01214;
   while(1) {
    $9 = HEAP8[$$113>>0]|0;
    $10 = ($9<<24>>24)==(0);
    $11 = ((($$113)) + 1|0);
    if ($10) {
     break;
    } else {
     $$113 = $11;
    }
   }
   $12 = (($$115) + -1)|0;
   $13 = ($12|0)==(0);
   if ($13) {
    $$012$lcssa = $11;
    break;
   } else {
    $$01214 = $11;$$115 = $12;
    label = 5;
   }
  }
 }
 $14 = ((($1)) + 20|0);
 $15 = HEAP32[$14>>2]|0;
 $16 = (___lctrans($$012$lcssa,$15)|0);
 return ($16|0);
}
function ___lctrans($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $2 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = (___lctrans_impl($0,$1)|0);
 return ($2|0);
}
function ___lctrans_impl($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$0 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = ($1|0)==(0|0);
 if ($2) {
  $$0 = 0;
 } else {
  $3 = HEAP32[$1>>2]|0;
  $4 = ((($1)) + 4|0);
  $5 = HEAP32[$4>>2]|0;
  $6 = (___mo_lookup($3,$5,$0)|0);
  $$0 = $6;
 }
 $7 = ($$0|0)!=(0|0);
 $8 = $7 ? $$0 : $0;
 return ($8|0);
}
function ___mo_lookup($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $$ = 0, $$090 = 0, $$094 = 0, $$191 = 0, $$195 = 0, $$4 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0;
 var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0;
 var $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0;
 var $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond102 = 0, $or$cond104 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $3 = HEAP32[$0>>2]|0;
 $4 = (($3) + 1794895138)|0;
 $5 = ((($0)) + 8|0);
 $6 = HEAP32[$5>>2]|0;
 $7 = (_swapc($6,$4)|0);
 $8 = ((($0)) + 12|0);
 $9 = HEAP32[$8>>2]|0;
 $10 = (_swapc($9,$4)|0);
 $11 = ((($0)) + 16|0);
 $12 = HEAP32[$11>>2]|0;
 $13 = (_swapc($12,$4)|0);
 $14 = $1 >>> 2;
 $15 = ($7>>>0)<($14>>>0);
 L1: do {
  if ($15) {
   $16 = $7 << 2;
   $17 = (($1) - ($16))|0;
   $18 = ($10>>>0)<($17>>>0);
   $19 = ($13>>>0)<($17>>>0);
   $or$cond = $18 & $19;
   if ($or$cond) {
    $20 = $13 | $10;
    $21 = $20 & 3;
    $22 = ($21|0)==(0);
    if ($22) {
     $23 = $10 >>> 2;
     $24 = $13 >>> 2;
     $$090 = 0;$$094 = $7;
     while(1) {
      $25 = $$094 >>> 1;
      $26 = (($$090) + ($25))|0;
      $27 = $26 << 1;
      $28 = (($27) + ($23))|0;
      $29 = (($0) + ($28<<2)|0);
      $30 = HEAP32[$29>>2]|0;
      $31 = (_swapc($30,$4)|0);
      $32 = (($28) + 1)|0;
      $33 = (($0) + ($32<<2)|0);
      $34 = HEAP32[$33>>2]|0;
      $35 = (_swapc($34,$4)|0);
      $36 = ($35>>>0)<($1>>>0);
      $37 = (($1) - ($35))|0;
      $38 = ($31>>>0)<($37>>>0);
      $or$cond102 = $36 & $38;
      if (!($or$cond102)) {
       $$4 = 0;
       break L1;
      }
      $39 = (($35) + ($31))|0;
      $40 = (($0) + ($39)|0);
      $41 = HEAP8[$40>>0]|0;
      $42 = ($41<<24>>24)==(0);
      if (!($42)) {
       $$4 = 0;
       break L1;
      }
      $43 = (($0) + ($35)|0);
      $44 = (_strcmp($2,$43)|0);
      $45 = ($44|0)==(0);
      if ($45) {
       break;
      }
      $62 = ($$094|0)==(1);
      $63 = ($44|0)<(0);
      $64 = (($$094) - ($25))|0;
      $$195 = $63 ? $25 : $64;
      $$191 = $63 ? $$090 : $26;
      if ($62) {
       $$4 = 0;
       break L1;
      } else {
       $$090 = $$191;$$094 = $$195;
      }
     }
     $46 = (($27) + ($24))|0;
     $47 = (($0) + ($46<<2)|0);
     $48 = HEAP32[$47>>2]|0;
     $49 = (_swapc($48,$4)|0);
     $50 = (($46) + 1)|0;
     $51 = (($0) + ($50<<2)|0);
     $52 = HEAP32[$51>>2]|0;
     $53 = (_swapc($52,$4)|0);
     $54 = ($53>>>0)<($1>>>0);
     $55 = (($1) - ($53))|0;
     $56 = ($49>>>0)<($55>>>0);
     $or$cond104 = $54 & $56;
     if ($or$cond104) {
      $57 = (($0) + ($53)|0);
      $58 = (($53) + ($49))|0;
      $59 = (($0) + ($58)|0);
      $60 = HEAP8[$59>>0]|0;
      $61 = ($60<<24>>24)==(0);
      $$ = $61 ? $57 : 0;
      $$4 = $$;
     } else {
      $$4 = 0;
     }
    } else {
     $$4 = 0;
    }
   } else {
    $$4 = 0;
   }
  } else {
   $$4 = 0;
  }
 } while(0);
 return ($$4|0);
}
function _swapc($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$ = 0, $2 = 0, $3 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = ($1|0)==(0);
 $3 = (_llvm_bswap_i32(($0|0))|0);
 $$ = $2 ? $0 : $3;
 return ($$|0);
}
function ___fwritex($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $$038 = 0, $$042 = 0, $$1 = 0, $$139 = 0, $$141 = 0, $$143 = 0, $$pre = 0, $$pre47 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0;
 var $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0;
 var label = 0, sp = 0;
 sp = STACKTOP;
 $3 = ((($2)) + 16|0);
 $4 = HEAP32[$3>>2]|0;
 $5 = ($4|0)==(0|0);
 if ($5) {
  $7 = (___towrite($2)|0);
  $8 = ($7|0)==(0);
  if ($8) {
   $$pre = HEAP32[$3>>2]|0;
   $12 = $$pre;
   label = 5;
  } else {
   $$1 = 0;
  }
 } else {
  $6 = $4;
  $12 = $6;
  label = 5;
 }
 L5: do {
  if ((label|0) == 5) {
   $9 = ((($2)) + 20|0);
   $10 = HEAP32[$9>>2]|0;
   $11 = (($12) - ($10))|0;
   $13 = ($11>>>0)<($1>>>0);
   $14 = $10;
   if ($13) {
    $15 = ((($2)) + 36|0);
    $16 = HEAP32[$15>>2]|0;
    $17 = (FUNCTION_TABLE_iiii[$16 & 15]($2,$0,$1)|0);
    $$1 = $17;
    break;
   }
   $18 = ((($2)) + 75|0);
   $19 = HEAP8[$18>>0]|0;
   $20 = ($19<<24>>24)>(-1);
   L10: do {
    if ($20) {
     $$038 = $1;
     while(1) {
      $21 = ($$038|0)==(0);
      if ($21) {
       $$139 = 0;$$141 = $0;$$143 = $1;$31 = $14;
       break L10;
      }
      $22 = (($$038) + -1)|0;
      $23 = (($0) + ($22)|0);
      $24 = HEAP8[$23>>0]|0;
      $25 = ($24<<24>>24)==(10);
      if ($25) {
       break;
      } else {
       $$038 = $22;
      }
     }
     $26 = ((($2)) + 36|0);
     $27 = HEAP32[$26>>2]|0;
     $28 = (FUNCTION_TABLE_iiii[$27 & 15]($2,$0,$$038)|0);
     $29 = ($28>>>0)<($$038>>>0);
     if ($29) {
      $$1 = $28;
      break L5;
     }
     $30 = (($0) + ($$038)|0);
     $$042 = (($1) - ($$038))|0;
     $$pre47 = HEAP32[$9>>2]|0;
     $$139 = $$038;$$141 = $30;$$143 = $$042;$31 = $$pre47;
    } else {
     $$139 = 0;$$141 = $0;$$143 = $1;$31 = $14;
    }
   } while(0);
   _memcpy(($31|0),($$141|0),($$143|0))|0;
   $32 = HEAP32[$9>>2]|0;
   $33 = (($32) + ($$143)|0);
   HEAP32[$9>>2] = $33;
   $34 = (($$139) + ($$143))|0;
   $$1 = $34;
  }
 } while(0);
 return ($$1|0);
}
function ___towrite($0) {
 $0 = $0|0;
 var $$0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0;
 var $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = ((($0)) + 74|0);
 $2 = HEAP8[$1>>0]|0;
 $3 = $2 << 24 >> 24;
 $4 = (($3) + 255)|0;
 $5 = $4 | $3;
 $6 = $5&255;
 HEAP8[$1>>0] = $6;
 $7 = HEAP32[$0>>2]|0;
 $8 = $7 & 8;
 $9 = ($8|0)==(0);
 if ($9) {
  $11 = ((($0)) + 8|0);
  HEAP32[$11>>2] = 0;
  $12 = ((($0)) + 4|0);
  HEAP32[$12>>2] = 0;
  $13 = ((($0)) + 44|0);
  $14 = HEAP32[$13>>2]|0;
  $15 = ((($0)) + 28|0);
  HEAP32[$15>>2] = $14;
  $16 = ((($0)) + 20|0);
  HEAP32[$16>>2] = $14;
  $17 = ((($0)) + 48|0);
  $18 = HEAP32[$17>>2]|0;
  $19 = (($14) + ($18)|0);
  $20 = ((($0)) + 16|0);
  HEAP32[$20>>2] = $19;
  $$0 = 0;
 } else {
  $10 = $7 | 32;
  HEAP32[$0>>2] = $10;
  $$0 = -1;
 }
 return ($$0|0);
}
function ___floatscan($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $$0 = 0, $$0105$ph = 0, $$0106$ph = 0, $$0107$lcssa = 0, $$0107127 = 0, $$0113 = 0, $$0114 = 0.0, $$1$lcssa = 0, $$1108 = 0, $$1128 = 0, $$2 = 0, $$2109125 = 0, $$3110 = 0, $$3126 = 0, $$4 = 0, $$4111 = 0, $$5 = 0, $$6 = 0, $$in = 0, $$old8 = 0;
 var $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0;
 var $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0.0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0.0, $14 = 0, $15 = 0;
 var $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0;
 var $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0;
 var $53 = 0.0, $54 = 0.0, $55 = 0.0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0;
 var $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0;
 var $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $or$cond = 0, $or$cond5 = 0, $or$cond7 = 0, $or$cond9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 switch ($1|0) {
 case 0:  {
  $$0105$ph = -149;$$0106$ph = 24;
  label = 4;
  break;
 }
 case 1:  {
  $$0105$ph = -1074;$$0106$ph = 53;
  label = 4;
  break;
 }
 case 2:  {
  $$0105$ph = -1074;$$0106$ph = 53;
  label = 4;
  break;
 }
 default: {
  $$0114 = 0.0;
 }
 }
 L4: do {
  if ((label|0) == 4) {
   $3 = ((($0)) + 4|0);
   $4 = ((($0)) + 100|0);
   while(1) {
    $5 = HEAP32[$3>>2]|0;
    $6 = HEAP32[$4>>2]|0;
    $7 = ($5>>>0)<($6>>>0);
    if ($7) {
     $8 = ((($5)) + 1|0);
     HEAP32[$3>>2] = $8;
     $9 = HEAP8[$5>>0]|0;
     $10 = $9&255;
     $12 = $10;
    } else {
     $11 = (___shgetc($0)|0);
     $12 = $11;
    }
    $13 = (_isspace($12)|0);
    $14 = ($13|0)==(0);
    if ($14) {
     break;
    }
   }
   L13: do {
    switch ($12|0) {
    case 43: case 45:  {
     $15 = ($12|0)==(45);
     $16 = $15&1;
     $17 = $16 << 1;
     $18 = (1 - ($17))|0;
     $19 = HEAP32[$3>>2]|0;
     $20 = HEAP32[$4>>2]|0;
     $21 = ($19>>>0)<($20>>>0);
     if ($21) {
      $22 = ((($19)) + 1|0);
      HEAP32[$3>>2] = $22;
      $23 = HEAP8[$19>>0]|0;
      $24 = $23&255;
      $$0 = $24;$$0113 = $18;
      break L13;
     } else {
      $25 = (___shgetc($0)|0);
      $$0 = $25;$$0113 = $18;
      break L13;
     }
     break;
    }
    default: {
     $$0 = $12;$$0113 = 1;
    }
    }
   } while(0);
   $$0107127 = 0;$$1128 = $$0;
   while(1) {
    $26 = $$1128 | 32;
    $27 = (19780 + ($$0107127)|0);
    $28 = HEAP8[$27>>0]|0;
    $29 = $28 << 24 >> 24;
    $30 = ($26|0)==($29|0);
    if (!($30)) {
     $$0107$lcssa = $$0107127;$$1$lcssa = $$1128;
     break;
    }
    $31 = ($$0107127>>>0)<(7);
    do {
     if ($31) {
      $32 = HEAP32[$3>>2]|0;
      $33 = HEAP32[$4>>2]|0;
      $34 = ($32>>>0)<($33>>>0);
      if ($34) {
       $35 = ((($32)) + 1|0);
       HEAP32[$3>>2] = $35;
       $36 = HEAP8[$32>>0]|0;
       $37 = $36&255;
       $$2 = $37;
       break;
      } else {
       $38 = (___shgetc($0)|0);
       $$2 = $38;
       break;
      }
     } else {
      $$2 = $$1128;
     }
    } while(0);
    $39 = (($$0107127) + 1)|0;
    $40 = ($39>>>0)<(8);
    if ($40) {
     $$0107127 = $39;$$1128 = $$2;
    } else {
     $$0107$lcssa = $39;$$1$lcssa = $$2;
     break;
    }
   }
   L29: do {
    switch ($$0107$lcssa|0) {
    case 8:  {
     break;
    }
    case 3:  {
     label = 23;
     break;
    }
    default: {
     $41 = ($$0107$lcssa>>>0)>(3);
     $42 = ($2|0)!=(0);
     $or$cond5 = $42 & $41;
     if ($or$cond5) {
      $43 = ($$0107$lcssa|0)==(8);
      if ($43) {
       break L29;
      } else {
       label = 23;
       break L29;
      }
     }
     $56 = ($$0107$lcssa|0)==(0);
     L34: do {
      if ($56) {
       $$2109125 = 0;$$3126 = $$1$lcssa;
       while(1) {
        $57 = $$3126 | 32;
        $58 = (19789 + ($$2109125)|0);
        $59 = HEAP8[$58>>0]|0;
        $60 = $59 << 24 >> 24;
        $61 = ($57|0)==($60|0);
        if (!($61)) {
         $$3110 = $$2109125;$$5 = $$3126;
         break L34;
        }
        $62 = ($$2109125>>>0)<(2);
        do {
         if ($62) {
          $63 = HEAP32[$3>>2]|0;
          $64 = HEAP32[$4>>2]|0;
          $65 = ($63>>>0)<($64>>>0);
          if ($65) {
           $66 = ((($63)) + 1|0);
           HEAP32[$3>>2] = $66;
           $67 = HEAP8[$63>>0]|0;
           $68 = $67&255;
           $$4 = $68;
           break;
          } else {
           $69 = (___shgetc($0)|0);
           $$4 = $69;
           break;
          }
         } else {
          $$4 = $$3126;
         }
        } while(0);
        $70 = (($$2109125) + 1)|0;
        $71 = ($70>>>0)<(3);
        if ($71) {
         $$2109125 = $70;$$3126 = $$4;
        } else {
         $$3110 = $70;$$5 = $$4;
         break;
        }
       }
      } else {
       $$3110 = $$0107$lcssa;$$5 = $$1$lcssa;
      }
     } while(0);
     switch ($$3110|0) {
     case 3:  {
      $72 = HEAP32[$3>>2]|0;
      $73 = HEAP32[$4>>2]|0;
      $74 = ($72>>>0)<($73>>>0);
      if ($74) {
       $75 = ((($72)) + 1|0);
       HEAP32[$3>>2] = $75;
       $76 = HEAP8[$72>>0]|0;
       $77 = $76&255;
       $80 = $77;
      } else {
       $78 = (___shgetc($0)|0);
       $80 = $78;
      }
      $79 = ($80|0)==(40);
      if ($79) {
       $$4111 = 1;
      } else {
       $81 = HEAP32[$4>>2]|0;
       $82 = ($81|0)==(0|0);
       if ($82) {
        $$0114 = nan;
        break L4;
       }
       $83 = HEAP32[$3>>2]|0;
       $84 = ((($83)) + -1|0);
       HEAP32[$3>>2] = $84;
       $$0114 = nan;
       break L4;
      }
      while(1) {
       $85 = HEAP32[$3>>2]|0;
       $86 = HEAP32[$4>>2]|0;
       $87 = ($85>>>0)<($86>>>0);
       if ($87) {
        $88 = ((($85)) + 1|0);
        HEAP32[$3>>2] = $88;
        $89 = HEAP8[$85>>0]|0;
        $90 = $89&255;
        $93 = $90;
       } else {
        $91 = (___shgetc($0)|0);
        $93 = $91;
       }
       $92 = (($93) + -48)|0;
       $94 = ($92>>>0)<(10);
       $95 = (($93) + -65)|0;
       $96 = ($95>>>0)<(26);
       $or$cond = $94 | $96;
       if (!($or$cond)) {
        $97 = (($93) + -97)|0;
        $98 = ($97>>>0)<(26);
        $99 = ($93|0)==(95);
        $or$cond7 = $99 | $98;
        if (!($or$cond7)) {
         break;
        }
       }
       $111 = (($$4111) + 1)|0;
       $$4111 = $111;
      }
      $100 = ($93|0)==(41);
      if ($100) {
       $$0114 = nan;
       break L4;
      }
      $101 = HEAP32[$4>>2]|0;
      $102 = ($101|0)==(0|0);
      if (!($102)) {
       $103 = HEAP32[$3>>2]|0;
       $104 = ((($103)) + -1|0);
       HEAP32[$3>>2] = $104;
      }
      if (!($42)) {
       $106 = (___errno_location()|0);
       HEAP32[$106>>2] = 22;
       ___shlim($0,0);
       $$0114 = 0.0;
       break L4;
      }
      $105 = ($$4111|0)==(0);
      if ($105) {
       $$0114 = nan;
       break L4;
      } else {
       $$in = $$4111;
      }
      while(1) {
       $107 = (($$in) + -1)|0;
       if (!($102)) {
        $108 = HEAP32[$3>>2]|0;
        $109 = ((($108)) + -1|0);
        HEAP32[$3>>2] = $109;
       }
       $110 = ($107|0)==(0);
       if ($110) {
        $$0114 = nan;
        break L4;
       } else {
        $$in = $107;
       }
      }
      break;
     }
     case 0:  {
      $117 = ($$5|0)==(48);
      if ($117) {
       $118 = HEAP32[$3>>2]|0;
       $119 = HEAP32[$4>>2]|0;
       $120 = ($118>>>0)<($119>>>0);
       if ($120) {
        $121 = ((($118)) + 1|0);
        HEAP32[$3>>2] = $121;
        $122 = HEAP8[$118>>0]|0;
        $123 = $122&255;
        $126 = $123;
       } else {
        $124 = (___shgetc($0)|0);
        $126 = $124;
       }
       $125 = $126 | 32;
       $127 = ($125|0)==(120);
       if ($127) {
        $128 = (+_hexfloat($0,$$0106$ph,$$0105$ph,$$0113,$2));
        $$0114 = $128;
        break L4;
       }
       $129 = HEAP32[$4>>2]|0;
       $130 = ($129|0)==(0|0);
       if ($130) {
        $$6 = 48;
       } else {
        $131 = HEAP32[$3>>2]|0;
        $132 = ((($131)) + -1|0);
        HEAP32[$3>>2] = $132;
        $$6 = 48;
       }
      } else {
       $$6 = $$5;
      }
      $133 = (+_decfloat($0,$$6,$$0106$ph,$$0105$ph,$$0113,$2));
      $$0114 = $133;
      break L4;
      break;
     }
     default: {
      $112 = HEAP32[$4>>2]|0;
      $113 = ($112|0)==(0|0);
      if (!($113)) {
       $114 = HEAP32[$3>>2]|0;
       $115 = ((($114)) + -1|0);
       HEAP32[$3>>2] = $115;
      }
      $116 = (___errno_location()|0);
      HEAP32[$116>>2] = 22;
      ___shlim($0,0);
      $$0114 = 0.0;
      break L4;
     }
     }
    }
    }
   } while(0);
   if ((label|0) == 23) {
    $44 = HEAP32[$4>>2]|0;
    $45 = ($44|0)==(0|0);
    if (!($45)) {
     $46 = HEAP32[$3>>2]|0;
     $47 = ((($46)) + -1|0);
     HEAP32[$3>>2] = $47;
    }
    $48 = ($2|0)!=(0);
    $49 = ($$0107$lcssa>>>0)>(3);
    $or$cond9 = $48 & $49;
    if ($or$cond9) {
     $$1108 = $$0107$lcssa;
     while(1) {
      if (!($45)) {
       $50 = HEAP32[$3>>2]|0;
       $51 = ((($50)) + -1|0);
       HEAP32[$3>>2] = $51;
      }
      $52 = (($$1108) + -1)|0;
      $$old8 = ($52>>>0)>(3);
      if ($$old8) {
       $$1108 = $52;
      } else {
       break;
      }
     }
    }
   }
   $53 = (+($$0113|0));
   $54 = $53 * inf;
   $55 = $54;
   $$0114 = $55;
  }
 } while(0);
 return (+$$0114);
}
function _hexfloat($0,$1,$2,$3,$4) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 $4 = $4|0;
 var $$0 = 0, $$0133 = 0, $$0142 = 0, $$0146 = 0, $$0148 = 0, $$0148$ = 0, $$0151 = 0.0, $$0152 = 0.0, $$0155 = 0.0, $$0155$ = 0.0, $$0159 = 0, $$0165 = 0.0, $$0166 = 0, $$0166169 = 0, $$0166170 = 0, $$1$ph = 0, $$1147 = 0, $$1149 = 0, $$1153 = 0.0, $$1156 = 0.0;
 var $$1160 = 0, $$2 = 0, $$2$lcssa = 0, $$2144 = 0, $$2150 = 0, $$2154 = 0.0, $$2157 = 0.0, $$2161 = 0, $$3145 = 0, $$3158$lcssa = 0.0, $$3158179 = 0.0, $$3162$lcssa = 0, $$3162183 = 0, $$4 = 0.0, $$4163$lcssa = 0, $$4163178 = 0, $$5 = 0.0, $$5164 = 0, $$6 = 0, $$pn = 0.0;
 var $$pre = 0.0, $$pre$phiZ2D = 0.0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0;
 var $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0;
 var $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0.0, $143 = 0.0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0;
 var $152 = 0, $153 = 0.0, $154 = 0.0, $155 = 0.0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0.0, $167 = 0.0, $168 = 0.0, $169 = 0, $17 = 0;
 var $170 = 0, $171 = 0.0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0;
 var $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0.0, $197 = 0, $198 = 0.0, $199 = 0.0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0.0, $206 = 0.0;
 var $207 = 0.0, $208 = 0.0, $209 = 0.0, $21 = 0, $210 = 0.0, $211 = 0, $212 = 0, $213 = 0.0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0;
 var $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0;
 var $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0.0, $67 = 0.0;
 var $68 = 0.0, $69 = 0.0, $7 = 0, $70 = 0, $71 = 0, $72 = 0.0, $73 = 0.0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0;
 var $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0.0, $96 = 0.0, $97 = 0, $98 = 0, $99 = 0, $not$ = 0, $or$cond = 0, $or$cond168 = 0, $or$cond206 = 0, $or$cond4 = 0;
 var $or$cond6 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $5 = ((($0)) + 4|0);
 $6 = HEAP32[$5>>2]|0;
 $7 = ((($0)) + 100|0);
 $8 = HEAP32[$7>>2]|0;
 $9 = ($6>>>0)<($8>>>0);
 if ($9) {
  $10 = ((($6)) + 1|0);
  HEAP32[$5>>2] = $10;
  $11 = HEAP8[$6>>0]|0;
  $12 = $11&255;
  $$0 = $12;$$0142 = 0;
 } else {
  $13 = (___shgetc($0)|0);
  $$0 = $13;$$0142 = 0;
 }
 L4: while(1) {
  switch ($$0|0) {
  case 46:  {
   label = 8;
   break L4;
   break;
  }
  case 48:  {
   break;
  }
  default: {
   $$0146 = 0;$$0148 = 0;$$0152 = 1.0;$$0155 = 0.0;$$0159 = 0;$$2 = $$0;$$2144 = $$0142;$101 = 0;$53 = 0;$55 = 0;$99 = 0;
   break L4;
  }
  }
  $14 = HEAP32[$5>>2]|0;
  $15 = HEAP32[$7>>2]|0;
  $16 = ($14>>>0)<($15>>>0);
  if ($16) {
   $17 = ((($14)) + 1|0);
   HEAP32[$5>>2] = $17;
   $18 = HEAP8[$14>>0]|0;
   $19 = $18&255;
   $$0 = $19;$$0142 = 1;
   continue;
  } else {
   $20 = (___shgetc($0)|0);
   $$0 = $20;$$0142 = 1;
   continue;
  }
 }
 if ((label|0) == 8) {
  $21 = HEAP32[$5>>2]|0;
  $22 = HEAP32[$7>>2]|0;
  $23 = ($21>>>0)<($22>>>0);
  if ($23) {
   $24 = ((($21)) + 1|0);
   HEAP32[$5>>2] = $24;
   $25 = HEAP8[$21>>0]|0;
   $26 = $25&255;
   $$1$ph = $26;
  } else {
   $27 = (___shgetc($0)|0);
   $$1$ph = $27;
  }
  $28 = ($$1$ph|0)==(48);
  if ($28) {
   $36 = 0;$37 = 0;
   while(1) {
    $29 = HEAP32[$5>>2]|0;
    $30 = HEAP32[$7>>2]|0;
    $31 = ($29>>>0)<($30>>>0);
    if ($31) {
     $32 = ((($29)) + 1|0);
     HEAP32[$5>>2] = $32;
     $33 = HEAP8[$29>>0]|0;
     $34 = $33&255;
     $41 = $34;
    } else {
     $35 = (___shgetc($0)|0);
     $41 = $35;
    }
    $38 = (_i64Add(($36|0),($37|0),-1,-1)|0);
    $39 = tempRet0;
    $40 = ($41|0)==(48);
    if ($40) {
     $36 = $38;$37 = $39;
    } else {
     $$0146 = 1;$$0148 = 0;$$0152 = 1.0;$$0155 = 0.0;$$0159 = 0;$$2 = $41;$$2144 = 1;$101 = $39;$53 = 0;$55 = 0;$99 = $38;
     break;
    }
   }
  } else {
   $$0146 = 1;$$0148 = 0;$$0152 = 1.0;$$0155 = 0.0;$$0159 = 0;$$2 = $$1$ph;$$2144 = $$0142;$101 = 0;$53 = 0;$55 = 0;$99 = 0;
  }
 }
 while(1) {
  $42 = (($$2) + -48)|0;
  $43 = ($42>>>0)<(10);
  $44 = ($$2|0)==(46);
  if (!($43)) {
   $45 = $$2 | 32;
   $46 = (($45) + -97)|0;
   $47 = ($46>>>0)<(6);
   $or$cond6 = $44 | $47;
   if (!($or$cond6)) {
    $$2$lcssa = $$2;
    break;
   }
  }
  if ($44) {
   $48 = ($$0146|0)==(0);
   if ($48) {
    $$1147 = 1;$$2150 = $$0148;$$2154 = $$0152;$$2157 = $$0155;$$2161 = $$0159;$$3145 = $$2144;$214 = $55;$215 = $53;$216 = $55;$217 = $53;
   } else {
    $$2$lcssa = 46;
    break;
   }
  } else {
   $49 = ($$2|0)>(57);
   $50 = $$2 | 32;
   $51 = (($50) + -87)|0;
   $$0133 = $49 ? $51 : $42;
   $52 = ($53|0)<(0);
   $54 = ($55>>>0)<(8);
   $56 = ($53|0)==(0);
   $57 = $56 & $54;
   $58 = $52 | $57;
   do {
    if ($58) {
     $59 = $$0159 << 4;
     $60 = (($$0133) + ($59))|0;
     $$1149 = $$0148;$$1153 = $$0152;$$1156 = $$0155;$$1160 = $60;
    } else {
     $61 = ($53|0)<(0);
     $62 = ($55>>>0)<(14);
     $63 = ($53|0)==(0);
     $64 = $63 & $62;
     $65 = $61 | $64;
     if ($65) {
      $66 = (+($$0133|0));
      $67 = $$0152 * 0.0625;
      $68 = $67 * $66;
      $69 = $$0155 + $68;
      $$1149 = $$0148;$$1153 = $67;$$1156 = $69;$$1160 = $$0159;
      break;
     } else {
      $70 = ($$0133|0)==(0);
      $71 = ($$0148|0)!=(0);
      $or$cond = $71 | $70;
      $72 = $$0152 * 0.5;
      $73 = $$0155 + $72;
      $$0155$ = $or$cond ? $$0155 : $73;
      $$0148$ = $or$cond ? $$0148 : 1;
      $$1149 = $$0148$;$$1153 = $$0152;$$1156 = $$0155$;$$1160 = $$0159;
      break;
     }
    }
   } while(0);
   $74 = (_i64Add(($55|0),($53|0),1,0)|0);
   $75 = tempRet0;
   $$1147 = $$0146;$$2150 = $$1149;$$2154 = $$1153;$$2157 = $$1156;$$2161 = $$1160;$$3145 = 1;$214 = $99;$215 = $101;$216 = $74;$217 = $75;
  }
  $76 = HEAP32[$5>>2]|0;
  $77 = HEAP32[$7>>2]|0;
  $78 = ($76>>>0)<($77>>>0);
  if ($78) {
   $79 = ((($76)) + 1|0);
   HEAP32[$5>>2] = $79;
   $80 = HEAP8[$76>>0]|0;
   $81 = $80&255;
   $$0146 = $$1147;$$0148 = $$2150;$$0152 = $$2154;$$0155 = $$2157;$$0159 = $$2161;$$2 = $81;$$2144 = $$3145;$101 = $215;$53 = $217;$55 = $216;$99 = $214;
   continue;
  } else {
   $82 = (___shgetc($0)|0);
   $$0146 = $$1147;$$0148 = $$2150;$$0152 = $$2154;$$0155 = $$2157;$$0159 = $$2161;$$2 = $82;$$2144 = $$3145;$101 = $215;$53 = $217;$55 = $216;$99 = $214;
   continue;
  }
 }
 $83 = ($$2144|0)==(0);
 do {
  if ($83) {
   $84 = HEAP32[$7>>2]|0;
   $85 = ($84|0)!=(0|0);
   if ($85) {
    $86 = HEAP32[$5>>2]|0;
    $87 = ((($86)) + -1|0);
    HEAP32[$5>>2] = $87;
   }
   $88 = ($4|0)==(0);
   if ($88) {
    ___shlim($0,0);
   } else {
    if ($85) {
     $89 = HEAP32[$5>>2]|0;
     $90 = ((($89)) + -1|0);
     HEAP32[$5>>2] = $90;
    }
    $91 = ($$0146|0)==(0);
    $92 = ($84|0)==(0|0);
    $or$cond206 = $91 | $92;
    if (!($or$cond206)) {
     $93 = HEAP32[$5>>2]|0;
     $94 = ((($93)) + -1|0);
     HEAP32[$5>>2] = $94;
    }
   }
   $95 = (+($3|0));
   $96 = $95 * 0.0;
   $$0165 = $96;
  } else {
   $97 = ($$0146|0)==(0);
   $98 = $97 ? $55 : $99;
   $100 = $97 ? $53 : $101;
   $102 = ($53|0)<(0);
   $103 = ($55>>>0)<(8);
   $104 = ($53|0)==(0);
   $105 = $104 & $103;
   $106 = $102 | $105;
   if ($106) {
    $$3162183 = $$0159;$108 = $55;$109 = $53;
    while(1) {
     $107 = $$3162183 << 4;
     $110 = (_i64Add(($108|0),($109|0),1,0)|0);
     $111 = tempRet0;
     $112 = ($111|0)<(0);
     $113 = ($110>>>0)<(8);
     $114 = ($111|0)==(0);
     $115 = $114 & $113;
     $116 = $112 | $115;
     if ($116) {
      $$3162183 = $107;$108 = $110;$109 = $111;
     } else {
      $$3162$lcssa = $107;
      break;
     }
    }
   } else {
    $$3162$lcssa = $$0159;
   }
   $117 = $$2$lcssa | 32;
   $118 = ($117|0)==(112);
   if ($118) {
    $119 = (_scanexp($0,$4)|0);
    $120 = tempRet0;
    $121 = ($119|0)==(0);
    $122 = ($120|0)==(-2147483648);
    $123 = $121 & $122;
    if ($123) {
     $124 = ($4|0)==(0);
     if ($124) {
      ___shlim($0,0);
      $$0165 = 0.0;
      break;
     }
     $125 = HEAP32[$7>>2]|0;
     $126 = ($125|0)==(0|0);
     if ($126) {
      $137 = 0;$138 = 0;
     } else {
      $127 = HEAP32[$5>>2]|0;
      $128 = ((($127)) + -1|0);
      HEAP32[$5>>2] = $128;
      $137 = 0;$138 = 0;
     }
    } else {
     $137 = $119;$138 = $120;
    }
   } else {
    $129 = HEAP32[$7>>2]|0;
    $130 = ($129|0)==(0|0);
    if ($130) {
     $137 = 0;$138 = 0;
    } else {
     $131 = HEAP32[$5>>2]|0;
     $132 = ((($131)) + -1|0);
     HEAP32[$5>>2] = $132;
     $137 = 0;$138 = 0;
    }
   }
   $133 = (_bitshift64Shl(($98|0),($100|0),2)|0);
   $134 = tempRet0;
   $135 = (_i64Add(($133|0),($134|0),-32,-1)|0);
   $136 = tempRet0;
   $139 = (_i64Add(($135|0),($136|0),($137|0),($138|0))|0);
   $140 = tempRet0;
   $141 = ($$3162$lcssa|0)==(0);
   if ($141) {
    $142 = (+($3|0));
    $143 = $142 * 0.0;
    $$0165 = $143;
    break;
   }
   $144 = (0 - ($2))|0;
   $145 = ($144|0)<(0);
   $146 = $145 << 31 >> 31;
   $147 = ($140|0)>($146|0);
   $148 = ($139>>>0)>($144>>>0);
   $149 = ($140|0)==($146|0);
   $150 = $149 & $148;
   $151 = $147 | $150;
   if ($151) {
    $152 = (___errno_location()|0);
    HEAP32[$152>>2] = 34;
    $153 = (+($3|0));
    $154 = $153 * 1.7976931348623157E+308;
    $155 = $154 * 1.7976931348623157E+308;
    $$0165 = $155;
    break;
   }
   $156 = (($2) + -106)|0;
   $157 = ($156|0)<(0);
   $158 = $157 << 31 >> 31;
   $159 = ($140|0)<($158|0);
   $160 = ($139>>>0)<($156>>>0);
   $161 = ($140|0)==($158|0);
   $162 = $161 & $160;
   $163 = $159 | $162;
   if ($163) {
    $165 = (___errno_location()|0);
    HEAP32[$165>>2] = 34;
    $166 = (+($3|0));
    $167 = $166 * 2.2250738585072014E-308;
    $168 = $167 * 2.2250738585072014E-308;
    $$0165 = $168;
    break;
   }
   $164 = ($$3162$lcssa|0)>(-1);
   if ($164) {
    $$3158179 = $$0155;$$4163178 = $$3162$lcssa;$173 = $139;$174 = $140;
    while(1) {
     $169 = !($$3158179 >= 0.5);
     $170 = $$4163178 << 1;
     $171 = $$3158179 + -1.0;
     $not$ = $169 ^ 1;
     $172 = $not$&1;
     $$5164 = $170 | $172;
     $$pn = $169 ? $$3158179 : $171;
     $$4 = $$3158179 + $$pn;
     $175 = (_i64Add(($173|0),($174|0),-1,-1)|0);
     $176 = tempRet0;
     $177 = ($$5164|0)>(-1);
     if ($177) {
      $$3158179 = $$4;$$4163178 = $$5164;$173 = $175;$174 = $176;
     } else {
      $$3158$lcssa = $$4;$$4163$lcssa = $$5164;$184 = $175;$185 = $176;
      break;
     }
    }
   } else {
    $$3158$lcssa = $$0155;$$4163$lcssa = $$3162$lcssa;$184 = $139;$185 = $140;
   }
   $178 = ($1|0)<(0);
   $179 = $178 << 31 >> 31;
   $180 = ($2|0)<(0);
   $181 = $180 << 31 >> 31;
   $182 = (_i64Subtract(32,0,($2|0),($181|0))|0);
   $183 = tempRet0;
   $186 = (_i64Add(($182|0),($183|0),($184|0),($185|0))|0);
   $187 = tempRet0;
   $188 = ($179|0)>($187|0);
   $189 = ($1>>>0)>($186>>>0);
   $190 = ($179|0)==($187|0);
   $191 = $190 & $189;
   $192 = $188 | $191;
   if ($192) {
    $193 = ($186|0)>(0);
    if ($193) {
     $$0166 = $186;
     label = 59;
    } else {
     $$0166170 = 0;$197 = 84;
     label = 61;
    }
   } else {
    $$0166 = $1;
    label = 59;
   }
   if ((label|0) == 59) {
    $194 = ($$0166|0)<(53);
    $195 = (84 - ($$0166))|0;
    if ($194) {
     $$0166170 = $$0166;$197 = $195;
     label = 61;
    } else {
     $$pre = (+($3|0));
     $$0151 = 0.0;$$0166169 = $$0166;$$pre$phiZ2D = $$pre;
    }
   }
   if ((label|0) == 61) {
    $196 = (+($3|0));
    $198 = (+_scalbn(1.0,$197));
    $199 = (+_copysignl($198,$196));
    $$0151 = $199;$$0166169 = $$0166170;$$pre$phiZ2D = $196;
   }
   $200 = ($$0166169|0)<(32);
   $201 = $$3158$lcssa != 0.0;
   $or$cond4 = $201 & $200;
   $202 = $$4163$lcssa & 1;
   $203 = ($202|0)==(0);
   $or$cond168 = $203 & $or$cond4;
   $204 = $or$cond168&1;
   $$6 = (($204) + ($$4163$lcssa))|0;
   $$5 = $or$cond168 ? 0.0 : $$3158$lcssa;
   $205 = (+($$6>>>0));
   $206 = $$pre$phiZ2D * $205;
   $207 = $$0151 + $206;
   $208 = $$pre$phiZ2D * $$5;
   $209 = $208 + $207;
   $210 = $209 - $$0151;
   $211 = $210 != 0.0;
   if (!($211)) {
    $212 = (___errno_location()|0);
    HEAP32[$212>>2] = 34;
   }
   $213 = (+_scalbnl($210,$184));
   $$0165 = $213;
  }
 } while(0);
 return (+$$0165);
}
function _decfloat($0,$1,$2,$3,$4,$5) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 $4 = $4|0;
 $5 = $5|0;
 var $$ = 0, $$$0345 = 0, $$$0350 = 0, $$$0385 = 0, $$$0401 = 0, $$$5355 = 0, $$$5390 = 0, $$0329 = 0, $$0332490 = 0, $$0333 = 0, $$0334 = 0, $$0336486 = 0, $$0340496 = 0, $$0341$lcssa = 0, $$0341463 = 0, $$0341464 = 0, $$0341465 = 0, $$0341513 = 0, $$0345$lcssa = 0, $$0345467 = 0;
 var $$0345468 = 0, $$0345469 = 0, $$0345512 = 0, $$0350$lcssa554 = 0, $$0350494 = 0, $$0360 = 0.0, $$0361 = 0.0, $$0365484 = 0.0, $$0372 = 0, $$0380 = 0, $$0380$ph = 0, $$0385$lcssa553 = 0, $$0385493 = 0, $$0393 = 0, $$0396 = 0, $$0401$lcssa = 0, $$0401473 = 0, $$0401474 = 0, $$0401475 = 0, $$0401509 = 0;
 var $$1 = 0.0, $$10 = 0, $$1330$be = 0, $$1330$ph = 0, $$1335 = 0, $$1337 = 0, $$1362 = 0.0, $$1366 = 0.0, $$1373 = 0, $$1373$ph448 = 0, $$1381 = 0, $$1381$ph = 0, $$1381$ph558 = 0, $$1394$lcssa = 0, $$1394511 = 0, $$2 = 0, $$2343 = 0, $$2347 = 0, $$2352$ph449 = 0, $$2367 = 0.0;
 var $$2371$v = 0, $$2374 = 0, $$2387$ph447 = 0, $$2395 = 0, $$2398 = 0, $$2403 = 0, $$3$be = 0, $$3$lcssa = 0, $$3344503 = 0, $$3348 = 0, $$3364 = 0.0, $$3368 = 0.0, $$3375 = 0, $$3383 = 0, $$3399$lcssa = 0, $$3399510 = 0, $$3514 = 0, $$413 = 0, $$425 = 0, $$4349495 = 0;
 var $$4354 = 0, $$4354$ph = 0, $$4354$ph559 = 0, $$4376 = 0, $$4384 = 0, $$4389$ph = 0, $$4389$ph445 = 0, $$4400 = 0, $$4485 = 0, $$5 = 0, $$5$in = 0, $$5355488 = 0, $$5390487 = 0, $$6378$ph = 0, $$6489 = 0, $$9483 = 0, $$neg442 = 0, $$neg443 = 0, $$pre = 0, $$promoted = 0;
 var $$sink = 0, $$sink421$off0 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0.0, $103 = 0.0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0;
 var $116 = 0, $117 = 0, $118 = 0, $119 = 0.0, $12 = 0, $120 = 0.0, $121 = 0.0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0.0, $132 = 0.0, $133 = 0.0;
 var $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0.0, $144 = 0.0, $145 = 0.0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0;
 var $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0.0, $159 = 0.0, $16 = 0, $160 = 0.0, $161 = 0, $162 = 0.0, $163 = 0.0, $164 = 0.0, $165 = 0, $166 = 0, $167 = 0, $168 = 0.0, $169 = 0.0, $17 = 0;
 var $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0.0, $177 = 0.0, $178 = 0.0, $179 = 0, $18 = 0, $180 = 0.0, $181 = 0.0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0;
 var $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0;
 var $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0;
 var $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0;
 var $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0;
 var $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0;
 var $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0;
 var $298 = 0, $299 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0.0, $304 = 0, $305 = 0, $306 = 0.0, $307 = 0.0, $308 = 0, $309 = 0.0, $31 = 0, $310 = 0.0, $311 = 0, $312 = 0, $313 = 0, $314 = 0, $315 = 0;
 var $316 = 0, $317 = 0.0, $318 = 0.0, $319 = 0, $32 = 0, $320 = 0.0, $321 = 0.0, $322 = 0.0, $323 = 0.0, $324 = 0, $325 = 0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0, $332 = 0, $333 = 0;
 var $334 = 0.0, $335 = 0.0, $336 = 0, $337 = 0.0, $338 = 0.0, $339 = 0, $34 = 0, $340 = 0, $341 = 0, $342 = 0.0, $343 = 0.0, $344 = 0.0, $345 = 0.0, $346 = 0, $347 = 0, $348 = 0.0, $349 = 0, $35 = 0, $350 = 0.0, $351 = 0.0;
 var $352 = 0.0, $353 = 0, $354 = 0, $355 = 0, $356 = 0.0, $357 = 0, $358 = 0.0, $359 = 0, $36 = 0, $360 = 0, $361 = 0, $362 = 0, $363 = 0, $364 = 0, $365 = 0.0, $366 = 0, $367 = 0, $368 = 0, $369 = 0, $37 = 0;
 var $370 = 0, $371 = 0, $372 = 0, $373 = 0, $374 = 0, $375 = 0, $376 = 0, $377 = 0, $378 = 0, $379 = 0, $38 = 0, $380 = 0, $381 = 0, $382 = 0, $383 = 0, $384 = 0, $385 = 0, $39 = 0, $40 = 0, $41 = 0;
 var $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0;
 var $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0;
 var $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0;
 var $98 = 0, $99 = 0, $cond = 0, $exitcond = 0, $exitcond551 = 0, $narrow = 0, $not$ = 0, $or$cond = 0, $or$cond11 = 0, $or$cond14 = 0, $or$cond415 = 0, $or$cond417 = 0, $or$cond419 = 0, $or$cond420 = 0, $or$cond422 = 0, $or$cond422$not = 0, $or$cond423 = 0, $or$cond426 = 0, $or$cond5 = 0, $sum = 0;
 var label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 512|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(512|0);
 $6 = sp;
 $sum = (($3) + ($2))|0;
 $7 = (0 - ($sum))|0;
 $8 = ((($0)) + 4|0);
 $9 = ((($0)) + 100|0);
 $$0329 = $1;$$0396 = 0;
 L1: while(1) {
  switch ($$0329|0) {
  case 46:  {
   label = 6;
   break L1;
   break;
  }
  case 48:  {
   break;
  }
  default: {
   $$0393 = 0;$$2 = $$0329;$$2398 = $$0396;$366 = 0;$367 = 0;
   break L1;
  }
  }
  $10 = HEAP32[$8>>2]|0;
  $11 = HEAP32[$9>>2]|0;
  $12 = ($10>>>0)<($11>>>0);
  if ($12) {
   $13 = ((($10)) + 1|0);
   HEAP32[$8>>2] = $13;
   $14 = HEAP8[$10>>0]|0;
   $15 = $14&255;
   $$0329 = $15;$$0396 = 1;
   continue;
  } else {
   $16 = (___shgetc($0)|0);
   $$0329 = $16;$$0396 = 1;
   continue;
  }
 }
 if ((label|0) == 6) {
  $17 = HEAP32[$8>>2]|0;
  $18 = HEAP32[$9>>2]|0;
  $19 = ($17>>>0)<($18>>>0);
  if ($19) {
   $20 = ((($17)) + 1|0);
   HEAP32[$8>>2] = $20;
   $21 = HEAP8[$17>>0]|0;
   $22 = $21&255;
   $$1330$ph = $22;
  } else {
   $23 = (___shgetc($0)|0);
   $$1330$ph = $23;
  }
  $24 = ($$1330$ph|0)==(48);
  if ($24) {
   $25 = 0;$26 = 0;
   while(1) {
    $27 = (_i64Add(($25|0),($26|0),-1,-1)|0);
    $28 = tempRet0;
    $29 = HEAP32[$8>>2]|0;
    $30 = HEAP32[$9>>2]|0;
    $31 = ($29>>>0)<($30>>>0);
    if ($31) {
     $32 = ((($29)) + 1|0);
     HEAP32[$8>>2] = $32;
     $33 = HEAP8[$29>>0]|0;
     $34 = $33&255;
     $$1330$be = $34;
    } else {
     $35 = (___shgetc($0)|0);
     $$1330$be = $35;
    }
    $36 = ($$1330$be|0)==(48);
    if ($36) {
     $25 = $27;$26 = $28;
    } else {
     $$0393 = 1;$$2 = $$1330$be;$$2398 = 1;$366 = $27;$367 = $28;
     break;
    }
   }
  } else {
   $$0393 = 1;$$2 = $$1330$ph;$$2398 = $$0396;$366 = 0;$367 = 0;
  }
 }
 HEAP32[$6>>2] = 0;
 $37 = (($$2) + -48)|0;
 $38 = ($37>>>0)<(10);
 $39 = ($$2|0)==(46);
 $40 = $39 | $38;
 L20: do {
  if ($40) {
   $41 = ((($6)) + 496|0);
   $$0341513 = 0;$$0345512 = 0;$$0401509 = 0;$$1394511 = $$0393;$$3399510 = $$2398;$$3514 = $$2;$368 = $39;$369 = $37;$370 = $366;$371 = $367;$44 = 0;$45 = 0;
   L22: while(1) {
    do {
     if ($368) {
      $cond = ($$1394511|0)==(0);
      if ($cond) {
       $$2343 = $$0341513;$$2347 = $$0345512;$$2395 = 1;$$2403 = $$0401509;$$4400 = $$3399510;$372 = $44;$373 = $45;$374 = $44;$375 = $45;
      } else {
       break L22;
      }
     } else {
      $43 = ($$0345512|0)<(125);
      $46 = (_i64Add(($44|0),($45|0),1,0)|0);
      $47 = tempRet0;
      $48 = ($$3514|0)!=(48);
      if (!($43)) {
       if (!($48)) {
        $$2343 = $$0341513;$$2347 = $$0345512;$$2395 = $$1394511;$$2403 = $$0401509;$$4400 = $$3399510;$372 = $370;$373 = $371;$374 = $46;$375 = $47;
        break;
       }
       $57 = HEAP32[$41>>2]|0;
       $58 = $57 | 1;
       HEAP32[$41>>2] = $58;
       $$2343 = $$0341513;$$2347 = $$0345512;$$2395 = $$1394511;$$2403 = $$0401509;$$4400 = $$3399510;$372 = $370;$373 = $371;$374 = $46;$375 = $47;
       break;
      }
      $$$0401 = $48 ? $46 : $$0401509;
      $49 = ($$0341513|0)==(0);
      $$pre = (($6) + ($$0345512<<2)|0);
      if ($49) {
       $$sink = $369;
      } else {
       $50 = HEAP32[$$pre>>2]|0;
       $51 = ($50*10)|0;
       $52 = (($$3514) + -48)|0;
       $53 = (($52) + ($51))|0;
       $$sink = $53;
      }
      HEAP32[$$pre>>2] = $$sink;
      $54 = (($$0341513) + 1)|0;
      $55 = ($54|0)==(9);
      $56 = $55&1;
      $$$0345 = (($56) + ($$0345512))|0;
      $$413 = $55 ? 0 : $54;
      $$2343 = $$413;$$2347 = $$$0345;$$2395 = $$1394511;$$2403 = $$$0401;$$4400 = 1;$372 = $370;$373 = $371;$374 = $46;$375 = $47;
     }
    } while(0);
    $59 = HEAP32[$8>>2]|0;
    $60 = HEAP32[$9>>2]|0;
    $61 = ($59>>>0)<($60>>>0);
    if ($61) {
     $62 = ((($59)) + 1|0);
     HEAP32[$8>>2] = $62;
     $63 = HEAP8[$59>>0]|0;
     $64 = $63&255;
     $$3$be = $64;
    } else {
     $65 = (___shgetc($0)|0);
     $$3$be = $65;
    }
    $66 = (($$3$be) + -48)|0;
    $67 = ($66>>>0)<(10);
    $68 = ($$3$be|0)==(46);
    $69 = $68 | $67;
    if ($69) {
     $$0341513 = $$2343;$$0345512 = $$2347;$$0401509 = $$2403;$$1394511 = $$2395;$$3399510 = $$4400;$$3514 = $$3$be;$368 = $68;$369 = $66;$370 = $372;$371 = $373;$44 = $374;$45 = $375;
    } else {
     $$0341$lcssa = $$2343;$$0345$lcssa = $$2347;$$0401$lcssa = $$2403;$$1394$lcssa = $$2395;$$3$lcssa = $$3$be;$$3399$lcssa = $$4400;$72 = $372;$73 = $374;$75 = $373;$76 = $375;
     label = 29;
     break L20;
    }
   }
   $42 = ($$3399510|0)!=(0);
   $$0341465 = $$0341513;$$0345469 = $$0345512;$$0401475 = $$0401509;$376 = $44;$377 = $45;$378 = $370;$379 = $371;$380 = $42;
   label = 37;
  } else {
   $$0341$lcssa = 0;$$0345$lcssa = 0;$$0401$lcssa = 0;$$1394$lcssa = $$0393;$$3$lcssa = $$2;$$3399$lcssa = $$2398;$72 = $366;$73 = 0;$75 = $367;$76 = 0;
   label = 29;
  }
 } while(0);
 do {
  if ((label|0) == 29) {
   $70 = ($$1394$lcssa|0)==(0);
   $71 = $70 ? $73 : $72;
   $74 = $70 ? $76 : $75;
   $77 = ($$3399$lcssa|0)!=(0);
   $78 = $$3$lcssa | 32;
   $79 = ($78|0)==(101);
   $or$cond415 = $77 & $79;
   if (!($or$cond415)) {
    $94 = ($$3$lcssa|0)>(-1);
    if ($94) {
     $$0341465 = $$0341$lcssa;$$0345469 = $$0345$lcssa;$$0401475 = $$0401$lcssa;$376 = $73;$377 = $76;$378 = $71;$379 = $74;$380 = $77;
     label = 37;
     break;
    } else {
     $$0341464 = $$0341$lcssa;$$0345468 = $$0345$lcssa;$$0401474 = $$0401$lcssa;$381 = $73;$382 = $76;$383 = $77;$384 = $71;$385 = $74;
     label = 39;
     break;
    }
   }
   $80 = (_scanexp($0,$5)|0);
   $81 = tempRet0;
   $82 = ($80|0)==(0);
   $83 = ($81|0)==(-2147483648);
   $84 = $82 & $83;
   if ($84) {
    $85 = ($5|0)==(0);
    if ($85) {
     ___shlim($0,0);
     $$1 = 0.0;
     break;
    }
    $86 = HEAP32[$9>>2]|0;
    $87 = ($86|0)==(0|0);
    if ($87) {
     $90 = 0;$91 = 0;
    } else {
     $88 = HEAP32[$8>>2]|0;
     $89 = ((($88)) + -1|0);
     HEAP32[$8>>2] = $89;
     $90 = 0;$91 = 0;
    }
   } else {
    $90 = $80;$91 = $81;
   }
   $92 = (_i64Add(($90|0),($91|0),($71|0),($74|0))|0);
   $93 = tempRet0;
   $$0341463 = $$0341$lcssa;$$0345467 = $$0345$lcssa;$$0401473 = $$0401$lcssa;$105 = $92;$106 = $73;$108 = $93;$109 = $76;
   label = 41;
  }
 } while(0);
 if ((label|0) == 37) {
  $95 = HEAP32[$9>>2]|0;
  $96 = ($95|0)==(0|0);
  if ($96) {
   $$0341464 = $$0341465;$$0345468 = $$0345469;$$0401474 = $$0401475;$381 = $376;$382 = $377;$383 = $380;$384 = $378;$385 = $379;
   label = 39;
  } else {
   $97 = HEAP32[$8>>2]|0;
   $98 = ((($97)) + -1|0);
   HEAP32[$8>>2] = $98;
   if ($380) {
    $$0341463 = $$0341465;$$0345467 = $$0345469;$$0401473 = $$0401475;$105 = $378;$106 = $376;$108 = $379;$109 = $377;
    label = 41;
   } else {
    label = 40;
   }
  }
 }
 if ((label|0) == 39) {
  if ($383) {
   $$0341463 = $$0341464;$$0345467 = $$0345468;$$0401473 = $$0401474;$105 = $384;$106 = $381;$108 = $385;$109 = $382;
   label = 41;
  } else {
   label = 40;
  }
 }
 do {
  if ((label|0) == 40) {
   $99 = (___errno_location()|0);
   HEAP32[$99>>2] = 22;
   ___shlim($0,0);
   $$1 = 0.0;
  }
  else if ((label|0) == 41) {
   $100 = HEAP32[$6>>2]|0;
   $101 = ($100|0)==(0);
   if ($101) {
    $102 = (+($4|0));
    $103 = $102 * 0.0;
    $$1 = $103;
    break;
   }
   $104 = ($105|0)==($106|0);
   $107 = ($108|0)==($109|0);
   $110 = $104 & $107;
   $111 = ($109|0)<(0);
   $112 = ($106>>>0)<(10);
   $113 = ($109|0)==(0);
   $114 = $113 & $112;
   $115 = $111 | $114;
   $or$cond = $115 & $110;
   if ($or$cond) {
    $116 = ($2|0)>(30);
    $117 = $100 >>> $2;
    $118 = ($117|0)==(0);
    $or$cond417 = $116 | $118;
    if ($or$cond417) {
     $119 = (+($4|0));
     $120 = (+($100>>>0));
     $121 = $119 * $120;
     $$1 = $121;
     break;
    }
   }
   $122 = (($3|0) / -2)&-1;
   $123 = ($122|0)<(0);
   $124 = $123 << 31 >> 31;
   $125 = ($108|0)>($124|0);
   $126 = ($105>>>0)>($122>>>0);
   $127 = ($108|0)==($124|0);
   $128 = $127 & $126;
   $129 = $125 | $128;
   if ($129) {
    $130 = (___errno_location()|0);
    HEAP32[$130>>2] = 34;
    $131 = (+($4|0));
    $132 = $131 * 1.7976931348623157E+308;
    $133 = $132 * 1.7976931348623157E+308;
    $$1 = $133;
    break;
   }
   $134 = (($3) + -106)|0;
   $135 = ($134|0)<(0);
   $136 = $135 << 31 >> 31;
   $137 = ($108|0)<($136|0);
   $138 = ($105>>>0)<($134>>>0);
   $139 = ($108|0)==($136|0);
   $140 = $139 & $138;
   $141 = $137 | $140;
   if ($141) {
    $142 = (___errno_location()|0);
    HEAP32[$142>>2] = 34;
    $143 = (+($4|0));
    $144 = $143 * 2.2250738585072014E-308;
    $145 = $144 * 2.2250738585072014E-308;
    $$1 = $145;
    break;
   }
   $146 = ($$0341463|0)==(0);
   if ($146) {
    $$3348 = $$0345467;
   } else {
    $147 = ($$0341463|0)<(9);
    if ($147) {
     $148 = (($6) + ($$0345467<<2)|0);
     $$promoted = HEAP32[$148>>2]|0;
     $$3344503 = $$0341463;$150 = $$promoted;
     while(1) {
      $149 = ($150*10)|0;
      $151 = (($$3344503) + 1)|0;
      $exitcond551 = ($151|0)==(9);
      if ($exitcond551) {
       break;
      } else {
       $$3344503 = $151;$150 = $149;
      }
     }
     HEAP32[$148>>2] = $149;
    }
    $152 = (($$0345467) + 1)|0;
    $$3348 = $152;
   }
   $153 = ($$0401473|0)<(9);
   if ($153) {
    $154 = ($$0401473|0)<=($105|0);
    $155 = ($105|0)<(18);
    $or$cond5 = $154 & $155;
    if ($or$cond5) {
     $156 = ($105|0)==(9);
     $157 = HEAP32[$6>>2]|0;
     if ($156) {
      $158 = (+($4|0));
      $159 = (+($157>>>0));
      $160 = $158 * $159;
      $$1 = $160;
      break;
     }
     $161 = ($105|0)<(9);
     if ($161) {
      $162 = (+($4|0));
      $163 = (+($157>>>0));
      $164 = $162 * $163;
      $165 = (8 - ($105))|0;
      $166 = (4232 + ($165<<2)|0);
      $167 = HEAP32[$166>>2]|0;
      $168 = (+($167|0));
      $169 = $164 / $168;
      $$1 = $169;
      break;
     }
     $$neg442 = Math_imul($105, -3)|0;
     $$neg443 = (($2) + 27)|0;
     $170 = (($$neg443) + ($$neg442))|0;
     $171 = ($170|0)>(30);
     $172 = $157 >>> $170;
     $173 = ($172|0)==(0);
     $or$cond419 = $171 | $173;
     if ($or$cond419) {
      $174 = (($105) + -10)|0;
      $175 = (4232 + ($174<<2)|0);
      $176 = (+($4|0));
      $177 = (+($157>>>0));
      $178 = $176 * $177;
      $179 = HEAP32[$175>>2]|0;
      $180 = (+($179|0));
      $181 = $178 * $180;
      $$1 = $181;
      break;
     }
    }
   }
   $182 = (($105|0) % 9)&-1;
   $183 = ($182|0)==(0);
   if ($183) {
    $$0380$ph = 0;$$1373$ph448 = $$3348;$$2352$ph449 = 0;$$2387$ph447 = $105;
   } else {
    $184 = ($105|0)>(-1);
    $185 = (($182) + 9)|0;
    $186 = $184 ? $182 : $185;
    $187 = (8 - ($186))|0;
    $188 = (4232 + ($187<<2)|0);
    $189 = HEAP32[$188>>2]|0;
    $190 = ($$3348|0)==(0);
    if ($190) {
     $$0350$lcssa554 = 0;$$0372 = 0;$$0385$lcssa553 = $105;
    } else {
     $191 = (1000000000 / ($189|0))&-1;
     $$0340496 = 0;$$0350494 = 0;$$0385493 = $105;$$4349495 = 0;
     while(1) {
      $192 = (($6) + ($$4349495<<2)|0);
      $193 = HEAP32[$192>>2]|0;
      $194 = (($193>>>0) % ($189>>>0))&-1;
      $195 = (($193>>>0) / ($189>>>0))&-1;
      $196 = (($195) + ($$0340496))|0;
      HEAP32[$192>>2] = $196;
      $197 = Math_imul($191, $194)|0;
      $198 = ($$4349495|0)==($$0350494|0);
      $199 = ($196|0)==(0);
      $or$cond420 = $198 & $199;
      $200 = (($$0350494) + 1)|0;
      $201 = $200 & 127;
      $202 = (($$0385493) + -9)|0;
      $$$0385 = $or$cond420 ? $202 : $$0385493;
      $$$0350 = $or$cond420 ? $201 : $$0350494;
      $203 = (($$4349495) + 1)|0;
      $204 = ($203|0)==($$3348|0);
      if ($204) {
       break;
      } else {
       $$0340496 = $197;$$0350494 = $$$0350;$$0385493 = $$$0385;$$4349495 = $203;
      }
     }
     $205 = ($197|0)==(0);
     if ($205) {
      $$0350$lcssa554 = $$$0350;$$0372 = $$3348;$$0385$lcssa553 = $$$0385;
     } else {
      $206 = (($6) + ($$3348<<2)|0);
      $207 = (($$3348) + 1)|0;
      HEAP32[$206>>2] = $197;
      $$0350$lcssa554 = $$$0350;$$0372 = $207;$$0385$lcssa553 = $$$0385;
     }
    }
    $208 = (9 - ($186))|0;
    $209 = (($208) + ($$0385$lcssa553))|0;
    $$0380$ph = 0;$$1373$ph448 = $$0372;$$2352$ph449 = $$0350$lcssa554;$$2387$ph447 = $209;
   }
   L101: while(1) {
    $210 = ($$2387$ph447|0)<(18);
    $211 = ($$2387$ph447|0)==(18);
    $212 = (($6) + ($$2352$ph449<<2)|0);
    $$0380 = $$0380$ph;$$1373 = $$1373$ph448;
    while(1) {
     if (!($210)) {
      if (!($211)) {
       $$1381$ph = $$0380;$$4354$ph = $$2352$ph449;$$4389$ph445 = $$2387$ph447;$$6378$ph = $$1373;
       break L101;
      }
      $213 = HEAP32[$212>>2]|0;
      $214 = ($213>>>0)<(9007199);
      if (!($214)) {
       $$1381$ph = $$0380;$$4354$ph = $$2352$ph449;$$4389$ph445 = 18;$$6378$ph = $$1373;
       break L101;
      }
     }
     $215 = (($$1373) + 127)|0;
     $$0334 = 0;$$2374 = $$1373;$$5$in = $215;
     while(1) {
      $$5 = $$5$in & 127;
      $216 = (($6) + ($$5<<2)|0);
      $217 = HEAP32[$216>>2]|0;
      $218 = (_bitshift64Shl(($217|0),0,29)|0);
      $219 = tempRet0;
      $220 = (_i64Add(($218|0),($219|0),($$0334|0),0)|0);
      $221 = tempRet0;
      $222 = ($221>>>0)>(0);
      $223 = ($220>>>0)>(1000000000);
      $224 = ($221|0)==(0);
      $225 = $224 & $223;
      $226 = $222 | $225;
      if ($226) {
       $227 = (___udivdi3(($220|0),($221|0),1000000000,0)|0);
       $228 = tempRet0;
       $229 = (___uremdi3(($220|0),($221|0),1000000000,0)|0);
       $230 = tempRet0;
       $$1335 = $227;$$sink421$off0 = $229;
      } else {
       $$1335 = 0;$$sink421$off0 = $220;
      }
      HEAP32[$216>>2] = $$sink421$off0;
      $231 = (($$2374) + 127)|0;
      $232 = $231 & 127;
      $233 = ($$5|0)!=($232|0);
      $234 = ($$5|0)==($$2352$ph449|0);
      $or$cond422 = $233 | $234;
      $or$cond422$not = $or$cond422 ^ 1;
      $235 = ($$sink421$off0|0)==(0);
      $or$cond423 = $235 & $or$cond422$not;
      $$3375 = $or$cond423 ? $$5 : $$2374;
      $236 = (($$5) + -1)|0;
      if ($234) {
       break;
      } else {
       $$0334 = $$1335;$$2374 = $$3375;$$5$in = $236;
      }
     }
     $237 = (($$0380) + -29)|0;
     $238 = ($$1335|0)==(0);
     if ($238) {
      $$0380 = $237;$$1373 = $$3375;
     } else {
      break;
     }
    }
    $239 = (($$2387$ph447) + 9)|0;
    $240 = (($$2352$ph449) + 127)|0;
    $241 = $240 & 127;
    $242 = ($241|0)==($$3375|0);
    $243 = (($$3375) + 127)|0;
    $244 = $243 & 127;
    $245 = (($$3375) + 126)|0;
    $246 = $245 & 127;
    $247 = (($6) + ($246<<2)|0);
    if ($242) {
     $248 = (($6) + ($244<<2)|0);
     $249 = HEAP32[$248>>2]|0;
     $250 = HEAP32[$247>>2]|0;
     $251 = $250 | $249;
     HEAP32[$247>>2] = $251;
     $$4376 = $244;
    } else {
     $$4376 = $$3375;
    }
    $252 = (($6) + ($241<<2)|0);
    HEAP32[$252>>2] = $$1335;
    $$0380$ph = $237;$$1373$ph448 = $$4376;$$2352$ph449 = $241;$$2387$ph447 = $239;
   }
   L119: while(1) {
    $289 = (($$6378$ph) + 1)|0;
    $287 = $289 & 127;
    $290 = (($$6378$ph) + 127)|0;
    $291 = $290 & 127;
    $292 = (($6) + ($291<<2)|0);
    $$1381$ph558 = $$1381$ph;$$4354$ph559 = $$4354$ph;$$4389$ph = $$4389$ph445;
    while(1) {
     $265 = ($$4389$ph|0)==(18);
     $293 = ($$4389$ph|0)>(27);
     $$425 = $293 ? 9 : 1;
     $$1381 = $$1381$ph558;$$4354 = $$4354$ph559;
     while(1) {
      $$0336486 = 0;
      while(1) {
       $253 = (($$0336486) + ($$4354))|0;
       $254 = $253 & 127;
       $255 = ($254|0)==($$6378$ph|0);
       if ($255) {
        $$1337 = 2;
        label = 88;
        break;
       }
       $256 = (($6) + ($254<<2)|0);
       $257 = HEAP32[$256>>2]|0;
       $258 = (4264 + ($$0336486<<2)|0);
       $259 = HEAP32[$258>>2]|0;
       $260 = ($257>>>0)<($259>>>0);
       if ($260) {
        $$1337 = 2;
        label = 88;
        break;
       }
       $261 = ($257>>>0)>($259>>>0);
       if ($261) {
        break;
       }
       $262 = (($$0336486) + 1)|0;
       $263 = ($262|0)<(2);
       if ($263) {
        $$0336486 = $262;
       } else {
        $$1337 = $262;
        label = 88;
        break;
       }
      }
      if ((label|0) == 88) {
       label = 0;
       $264 = ($$1337|0)==(2);
       $or$cond11 = $265 & $264;
       if ($or$cond11) {
        $$0365484 = 0.0;$$4485 = 0;$$9483 = $$6378$ph;
        break L119;
       }
      }
      $266 = (($$425) + ($$1381))|0;
      $267 = ($$4354|0)==($$6378$ph|0);
      if ($267) {
       $$1381 = $266;$$4354 = $$6378$ph;
      } else {
       break;
      }
     }
     $268 = 1 << $$425;
     $269 = (($268) + -1)|0;
     $270 = 1000000000 >>> $$425;
     $$0332490 = 0;$$5355488 = $$4354;$$5390487 = $$4389$ph;$$6489 = $$4354;
     while(1) {
      $271 = (($6) + ($$6489<<2)|0);
      $272 = HEAP32[$271>>2]|0;
      $273 = $272 & $269;
      $274 = $272 >>> $$425;
      $275 = (($274) + ($$0332490))|0;
      HEAP32[$271>>2] = $275;
      $276 = Math_imul($273, $270)|0;
      $277 = ($$6489|0)==($$5355488|0);
      $278 = ($275|0)==(0);
      $or$cond426 = $277 & $278;
      $279 = (($$5355488) + 1)|0;
      $280 = $279 & 127;
      $281 = (($$5390487) + -9)|0;
      $$$5390 = $or$cond426 ? $281 : $$5390487;
      $$$5355 = $or$cond426 ? $280 : $$5355488;
      $282 = (($$6489) + 1)|0;
      $283 = $282 & 127;
      $284 = ($283|0)==($$6378$ph|0);
      if ($284) {
       break;
      } else {
       $$0332490 = $276;$$5355488 = $$$5355;$$5390487 = $$$5390;$$6489 = $283;
      }
     }
     $285 = ($276|0)==(0);
     if ($285) {
      $$1381$ph558 = $266;$$4354$ph559 = $$$5355;$$4389$ph = $$$5390;
      continue;
     }
     $286 = ($287|0)==($$$5355|0);
     if (!($286)) {
      break;
     }
     $294 = HEAP32[$292>>2]|0;
     $295 = $294 | 1;
     HEAP32[$292>>2] = $295;
     $$1381$ph558 = $266;$$4354$ph559 = $$$5355;$$4389$ph = $$$5390;
    }
    $288 = (($6) + ($$6378$ph<<2)|0);
    HEAP32[$288>>2] = $276;
    $$1381$ph = $266;$$4354$ph = $$$5355;$$4389$ph445 = $$$5390;$$6378$ph = $287;
   }
   while(1) {
    $296 = (($$4485) + ($$4354))|0;
    $297 = $296 & 127;
    $298 = ($297|0)==($$9483|0);
    $299 = (($$9483) + 1)|0;
    $300 = $299 & 127;
    if ($298) {
     $301 = (($300) + -1)|0;
     $302 = (($6) + ($301<<2)|0);
     HEAP32[$302>>2] = 0;
     $$10 = $300;
    } else {
     $$10 = $$9483;
    }
    $303 = $$0365484 * 1.0E+9;
    $304 = (($6) + ($297<<2)|0);
    $305 = HEAP32[$304>>2]|0;
    $306 = (+($305>>>0));
    $307 = $303 + $306;
    $308 = (($$4485) + 1)|0;
    $exitcond = ($308|0)==(2);
    if ($exitcond) {
     break;
    } else {
     $$0365484 = $307;$$4485 = $308;$$9483 = $$10;
    }
   }
   $309 = (+($4|0));
   $310 = $309 * $307;
   $311 = (($$1381) + 53)|0;
   $312 = (($311) - ($3))|0;
   $313 = ($312|0)<($2|0);
   $314 = ($312|0)>(0);
   $$ = $314 ? $312 : 0;
   $$0333 = $313 ? $$ : $2;
   $315 = ($$0333|0)<(53);
   if ($315) {
    $316 = (105 - ($$0333))|0;
    $317 = (+_scalbn(1.0,$316));
    $318 = (+_copysignl($317,$310));
    $319 = (53 - ($$0333))|0;
    $320 = (+_scalbn(1.0,$319));
    $321 = (+_fmodl($310,$320));
    $322 = $310 - $321;
    $323 = $318 + $322;
    $$0360 = $318;$$0361 = $321;$$1366 = $323;
   } else {
    $$0360 = 0.0;$$0361 = 0.0;$$1366 = $310;
   }
   $324 = (($$4354) + 2)|0;
   $325 = $324 & 127;
   $326 = ($325|0)==($$10|0);
   if ($326) {
    $$3364 = $$0361;
   } else {
    $327 = (($6) + ($325<<2)|0);
    $328 = HEAP32[$327>>2]|0;
    $329 = ($328>>>0)<(500000000);
    do {
     if ($329) {
      $330 = ($328|0)==(0);
      if ($330) {
       $331 = (($$4354) + 3)|0;
       $332 = $331 & 127;
       $333 = ($332|0)==($$10|0);
       if ($333) {
        $$1362 = $$0361;
        break;
       }
      }
      $334 = $309 * 0.25;
      $335 = $334 + $$0361;
      $$1362 = $335;
     } else {
      $336 = ($328|0)==(500000000);
      if (!($336)) {
       $337 = $309 * 0.75;
       $338 = $337 + $$0361;
       $$1362 = $338;
       break;
      }
      $339 = (($$4354) + 3)|0;
      $340 = $339 & 127;
      $341 = ($340|0)==($$10|0);
      if ($341) {
       $342 = $309 * 0.5;
       $343 = $342 + $$0361;
       $$1362 = $343;
       break;
      } else {
       $344 = $309 * 0.75;
       $345 = $344 + $$0361;
       $$1362 = $345;
       break;
      }
     }
    } while(0);
    $346 = (53 - ($$0333))|0;
    $347 = ($346|0)>(1);
    if ($347) {
     $348 = (+_fmodl($$1362,1.0));
     $349 = $348 != 0.0;
     if ($349) {
      $$3364 = $$1362;
     } else {
      $350 = $$1362 + 1.0;
      $$3364 = $350;
     }
    } else {
     $$3364 = $$1362;
    }
   }
   $351 = $$1366 + $$3364;
   $352 = $351 - $$0360;
   $353 = $311 & 2147483647;
   $354 = (-2 - ($sum))|0;
   $355 = ($353|0)>($354|0);
   do {
    if ($355) {
     $356 = (+Math_abs((+$352)));
     $357 = !($356 >= 9007199254740992.0);
     $358 = $352 * 0.5;
     $not$ = $357 ^ 1;
     $359 = $not$&1;
     $$3383 = (($359) + ($$1381))|0;
     $$2367 = $357 ? $352 : $358;
     $360 = (($$3383) + 50)|0;
     $361 = ($360|0)>($7|0);
     if (!($361)) {
      $362 = ($$0333|0)!=($312|0);
      $narrow = $362 | $357;
      $$2371$v = $313 & $narrow;
      $363 = $$3364 != 0.0;
      $or$cond14 = $363 & $$2371$v;
      if (!($or$cond14)) {
       $$3368 = $$2367;$$4384 = $$3383;
       break;
      }
     }
     $364 = (___errno_location()|0);
     HEAP32[$364>>2] = 34;
     $$3368 = $$2367;$$4384 = $$3383;
    } else {
     $$3368 = $352;$$4384 = $$1381;
    }
   } while(0);
   $365 = (+_scalbnl($$3368,$$4384));
   $$1 = $365;
  }
 } while(0);
 STACKTOP = sp;return (+$$1);
}
function _scanexp($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$0 = 0, $$04861 = 0, $$049 = 0, $$1$be = 0, $$160 = 0, $$2$be = 0, $$2$lcssa = 0, $$254 = 0, $$3$be = 0, $$lcssa = 0, $$pre = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0;
 var $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0;
 var $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0;
 var $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0;
 var $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0;
 var $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $or$cond3 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = ((($0)) + 4|0);
 $3 = HEAP32[$2>>2]|0;
 $4 = ((($0)) + 100|0);
 $5 = HEAP32[$4>>2]|0;
 $6 = ($3>>>0)<($5>>>0);
 if ($6) {
  $7 = ((($3)) + 1|0);
  HEAP32[$2>>2] = $7;
  $8 = HEAP8[$3>>0]|0;
  $9 = $8&255;
  $11 = $9;
 } else {
  $10 = (___shgetc($0)|0);
  $11 = $10;
 }
 switch ($11|0) {
 case 43: case 45:  {
  $12 = ($11|0)==(45);
  $13 = $12&1;
  $14 = HEAP32[$2>>2]|0;
  $15 = HEAP32[$4>>2]|0;
  $16 = ($14>>>0)<($15>>>0);
  if ($16) {
   $17 = ((($14)) + 1|0);
   HEAP32[$2>>2] = $17;
   $18 = HEAP8[$14>>0]|0;
   $19 = $18&255;
   $22 = $19;
  } else {
   $20 = (___shgetc($0)|0);
   $22 = $20;
  }
  $21 = (($22) + -48)|0;
  $23 = ($21>>>0)>(9);
  $24 = ($1|0)!=(0);
  $or$cond3 = $24 & $23;
  if ($or$cond3) {
   $25 = HEAP32[$4>>2]|0;
   $26 = ($25|0)==(0|0);
   if ($26) {
    $$0 = $13;$$049 = $22;
   } else {
    $27 = HEAP32[$2>>2]|0;
    $28 = ((($27)) + -1|0);
    HEAP32[$2>>2] = $28;
    $$0 = $13;$$049 = $22;
   }
  } else {
   $$0 = $13;$$049 = $22;
  }
  break;
 }
 default: {
  $$0 = 0;$$049 = $11;
 }
 }
 $29 = (($$049) + -48)|0;
 $30 = ($29>>>0)>(9);
 if ($30) {
  $31 = HEAP32[$4>>2]|0;
  $32 = ($31|0)==(0|0);
  if ($32) {
   $100 = -2147483648;$101 = 0;
  } else {
   $33 = HEAP32[$2>>2]|0;
   $34 = ((($33)) + -1|0);
   HEAP32[$2>>2] = $34;
   $100 = -2147483648;$101 = 0;
  }
 } else {
  $$04861 = 0;$$160 = $$049;
  while(1) {
   $35 = ($$04861*10)|0;
   $36 = (($$160) + -48)|0;
   $37 = (($36) + ($35))|0;
   $38 = HEAP32[$2>>2]|0;
   $39 = HEAP32[$4>>2]|0;
   $40 = ($38>>>0)<($39>>>0);
   if ($40) {
    $41 = ((($38)) + 1|0);
    HEAP32[$2>>2] = $41;
    $42 = HEAP8[$38>>0]|0;
    $43 = $42&255;
    $$1$be = $43;
   } else {
    $44 = (___shgetc($0)|0);
    $$1$be = $44;
   }
   $45 = (($$1$be) + -48)|0;
   $46 = ($45>>>0)<(10);
   $47 = ($37|0)<(214748364);
   $48 = $46 & $47;
   if ($48) {
    $$04861 = $37;$$160 = $$1$be;
   } else {
    break;
   }
  }
  $49 = ($37|0)<(0);
  $50 = $49 << 31 >> 31;
  $51 = (($$1$be) + -48)|0;
  $52 = ($51>>>0)<(10);
  if ($52) {
   $$254 = $$1$be;$56 = $37;$57 = $50;
   while(1) {
    $58 = (___muldi3(($56|0),($57|0),10,0)|0);
    $59 = tempRet0;
    $60 = ($$254|0)<(0);
    $61 = $60 << 31 >> 31;
    $62 = (_i64Add(($$254|0),($61|0),-48,-1)|0);
    $63 = tempRet0;
    $64 = (_i64Add(($62|0),($63|0),($58|0),($59|0))|0);
    $65 = tempRet0;
    $66 = HEAP32[$2>>2]|0;
    $67 = HEAP32[$4>>2]|0;
    $68 = ($66>>>0)<($67>>>0);
    if ($68) {
     $69 = ((($66)) + 1|0);
     HEAP32[$2>>2] = $69;
     $70 = HEAP8[$66>>0]|0;
     $71 = $70&255;
     $$2$be = $71;
    } else {
     $72 = (___shgetc($0)|0);
     $$2$be = $72;
    }
    $73 = (($$2$be) + -48)|0;
    $74 = ($73>>>0)<(10);
    $75 = ($65|0)<(21474836);
    $76 = ($64>>>0)<(2061584302);
    $77 = ($65|0)==(21474836);
    $78 = $77 & $76;
    $79 = $75 | $78;
    $80 = $74 & $79;
    if ($80) {
     $$254 = $$2$be;$56 = $64;$57 = $65;
    } else {
     $$2$lcssa = $$2$be;$94 = $64;$95 = $65;
     break;
    }
   }
  } else {
   $$2$lcssa = $$1$be;$94 = $37;$95 = $50;
  }
  $53 = (($$2$lcssa) + -48)|0;
  $54 = ($53>>>0)<(10);
  $55 = HEAP32[$4>>2]|0;
  if ($54) {
   $83 = $55;
   while(1) {
    $81 = HEAP32[$2>>2]|0;
    $82 = ($81>>>0)<($83>>>0);
    if ($82) {
     $84 = ((($81)) + 1|0);
     HEAP32[$2>>2] = $84;
     $85 = HEAP8[$81>>0]|0;
     $86 = $85&255;
     $$3$be = $86;$102 = $83;
    } else {
     $87 = (___shgetc($0)|0);
     $$pre = HEAP32[$4>>2]|0;
     $$3$be = $87;$102 = $$pre;
    }
    $88 = (($$3$be) + -48)|0;
    $89 = ($88>>>0)<(10);
    if ($89) {
     $83 = $102;
    } else {
     $$lcssa = $102;
     break;
    }
   }
  } else {
   $$lcssa = $55;
  }
  $90 = ($$lcssa|0)==(0|0);
  if (!($90)) {
   $91 = HEAP32[$2>>2]|0;
   $92 = ((($91)) + -1|0);
   HEAP32[$2>>2] = $92;
  }
  $93 = ($$0|0)!=(0);
  $96 = (_i64Subtract(0,0,($94|0),($95|0))|0);
  $97 = tempRet0;
  $98 = $93 ? $96 : $94;
  $99 = $93 ? $97 : $95;
  $100 = $99;$101 = $98;
 }
 tempRet0 = ($100);
 return ($101|0);
}
function _scalbn($0,$1) {
 $0 = +$0;
 $1 = $1|0;
 var $$ = 0, $$$ = 0, $$0 = 0.0, $$020 = 0, $$1 = 0, $$1$ = 0, $$21 = 0.0, $$22 = 0.0, $10 = 0.0, $11 = 0, $12 = 0, $13 = 0.0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0.0, $2 = 0, $20 = 0.0;
 var $3 = 0.0, $4 = 0, $5 = 0, $6 = 0.0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = ($1|0)>(1023);
 if ($2) {
  $3 = $0 * 8.9884656743115795E+307;
  $4 = (($1) + -1023)|0;
  $5 = ($4|0)>(1023);
  $6 = $3 * 8.9884656743115795E+307;
  $7 = (($1) + -2046)|0;
  $8 = ($7|0)<(1023);
  $$ = $8 ? $7 : 1023;
  $$$ = $5 ? $$ : $4;
  $$21 = $5 ? $6 : $3;
  $$0 = $$21;$$020 = $$$;
 } else {
  $9 = ($1|0)<(-1022);
  if ($9) {
   $10 = $0 * 2.2250738585072014E-308;
   $11 = (($1) + 1022)|0;
   $12 = ($11|0)<(-1022);
   $13 = $10 * 2.2250738585072014E-308;
   $14 = (($1) + 2044)|0;
   $15 = ($14|0)>(-1022);
   $$1 = $15 ? $14 : -1022;
   $$1$ = $12 ? $$1 : $11;
   $$22 = $12 ? $13 : $10;
   $$0 = $$22;$$020 = $$1$;
  } else {
   $$0 = $0;$$020 = $1;
  }
 }
 $16 = (($$020) + 1023)|0;
 $17 = (_bitshift64Shl(($16|0),0,52)|0);
 $18 = tempRet0;
 HEAP32[tempDoublePtr>>2] = $17;HEAP32[tempDoublePtr+4>>2] = $18;$19 = +HEAPF64[tempDoublePtr>>3];
 $20 = $$0 * $19;
 return (+$20);
}
function _copysignl($0,$1) {
 $0 = +$0;
 $1 = +$1;
 var $2 = 0.0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = (+_copysign($0,$1));
 return (+$2);
}
function _fmodl($0,$1) {
 $0 = +$0;
 $1 = +$1;
 var $2 = 0.0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = (+_fmod($0,$1));
 return (+$2);
}
function _scalbnl($0,$1) {
 $0 = +$0;
 $1 = $1|0;
 var $2 = 0.0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = (+_scalbn($0,$1));
 return (+$2);
}
function _fmod($0,$1) {
 $0 = +$0;
 $1 = +$1;
 var $$ = 0.0, $$070 = 0.0, $$071$lcssa = 0, $$07194 = 0, $$073$lcssa = 0, $$073100 = 0, $$172$ph = 0, $$174 = 0, $$275$lcssa = 0, $$27586 = 0, $$376$lcssa = 0, $$37683 = 0, $$lcssa = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0.0, $104 = 0, $105 = 0;
 var $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0;
 var $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0.0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0;
 var $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0.0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0;
 var $160 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0.0, $28 = 0.0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0;
 var $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0.0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0;
 var $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0;
 var $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0;
 var $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $or$cond = 0, label = 0, sp = 0;
 sp = STACKTOP;
 HEAPF64[tempDoublePtr>>3] = $0;$2 = HEAP32[tempDoublePtr>>2]|0;
 $3 = HEAP32[tempDoublePtr+4>>2]|0;
 HEAPF64[tempDoublePtr>>3] = $1;$4 = HEAP32[tempDoublePtr>>2]|0;
 $5 = HEAP32[tempDoublePtr+4>>2]|0;
 $6 = (_bitshift64Lshr(($2|0),($3|0),52)|0);
 $7 = tempRet0;
 $8 = $6 & 2047;
 $9 = (_bitshift64Lshr(($4|0),($5|0),52)|0);
 $10 = tempRet0;
 $11 = $9 & 2047;
 $12 = $3 & -2147483648;
 $13 = (_bitshift64Shl(($4|0),($5|0),1)|0);
 $14 = tempRet0;
 $15 = ($13|0)==(0);
 $16 = ($14|0)==(0);
 $17 = $15 & $16;
 L1: do {
  if ($17) {
   label = 3;
  } else {
   $18 = (___DOUBLE_BITS_272($1)|0);
   $19 = tempRet0;
   $20 = $19 & 2147483647;
   $21 = ($20>>>0)>(2146435072);
   $22 = ($18>>>0)>(0);
   $23 = ($20|0)==(2146435072);
   $24 = $23 & $22;
   $25 = $21 | $24;
   $26 = ($8|0)==(2047);
   $or$cond = $26 | $25;
   if ($or$cond) {
    label = 3;
   } else {
    $29 = (_bitshift64Shl(($2|0),($3|0),1)|0);
    $30 = tempRet0;
    $31 = ($30>>>0)>($14>>>0);
    $32 = ($29>>>0)>($13>>>0);
    $33 = ($30|0)==($14|0);
    $34 = $33 & $32;
    $35 = $31 | $34;
    if (!($35)) {
     $36 = ($29|0)==($13|0);
     $37 = ($30|0)==($14|0);
     $38 = $36 & $37;
     $39 = $0 * 0.0;
     $$ = $38 ? $39 : $0;
     return (+$$);
    }
    $40 = ($8|0)==(0);
    if ($40) {
     $41 = (_bitshift64Shl(($2|0),($3|0),12)|0);
     $42 = tempRet0;
     $43 = ($42|0)>(-1);
     $44 = ($41>>>0)>(4294967295);
     $45 = ($42|0)==(-1);
     $46 = $45 & $44;
     $47 = $43 | $46;
     if ($47) {
      $$073100 = 0;$49 = $41;$50 = $42;
      while(1) {
       $48 = (($$073100) + -1)|0;
       $51 = (_bitshift64Shl(($49|0),($50|0),1)|0);
       $52 = tempRet0;
       $53 = ($52|0)>(-1);
       $54 = ($51>>>0)>(4294967295);
       $55 = ($52|0)==(-1);
       $56 = $55 & $54;
       $57 = $53 | $56;
       if ($57) {
        $$073100 = $48;$49 = $51;$50 = $52;
       } else {
        $$073$lcssa = $48;
        break;
       }
      }
     } else {
      $$073$lcssa = 0;
     }
     $58 = (1 - ($$073$lcssa))|0;
     $59 = (_bitshift64Shl(($2|0),($3|0),($58|0))|0);
     $60 = tempRet0;
     $$174 = $$073$lcssa;$87 = $59;$88 = $60;
    } else {
     $61 = $3 & 1048575;
     $62 = $61 | 1048576;
     $$174 = $8;$87 = $2;$88 = $62;
    }
    $63 = ($11|0)==(0);
    if ($63) {
     $64 = (_bitshift64Shl(($4|0),($5|0),12)|0);
     $65 = tempRet0;
     $66 = ($65|0)>(-1);
     $67 = ($64>>>0)>(4294967295);
     $68 = ($65|0)==(-1);
     $69 = $68 & $67;
     $70 = $66 | $69;
     if ($70) {
      $$07194 = 0;$72 = $64;$73 = $65;
      while(1) {
       $71 = (($$07194) + -1)|0;
       $74 = (_bitshift64Shl(($72|0),($73|0),1)|0);
       $75 = tempRet0;
       $76 = ($75|0)>(-1);
       $77 = ($74>>>0)>(4294967295);
       $78 = ($75|0)==(-1);
       $79 = $78 & $77;
       $80 = $76 | $79;
       if ($80) {
        $$07194 = $71;$72 = $74;$73 = $75;
       } else {
        $$071$lcssa = $71;
        break;
       }
      }
     } else {
      $$071$lcssa = 0;
     }
     $81 = (1 - ($$071$lcssa))|0;
     $82 = (_bitshift64Shl(($4|0),($5|0),($81|0))|0);
     $83 = tempRet0;
     $$172$ph = $$071$lcssa;$89 = $82;$90 = $83;
    } else {
     $84 = $5 & 1048575;
     $85 = $84 | 1048576;
     $$172$ph = $11;$89 = $4;$90 = $85;
    }
    $86 = ($$174|0)>($$172$ph|0);
    $91 = (_i64Subtract(($87|0),($88|0),($89|0),($90|0))|0);
    $92 = tempRet0;
    $93 = ($92|0)>(-1);
    $94 = ($91>>>0)>(4294967295);
    $95 = ($92|0)==(-1);
    $96 = $95 & $94;
    $97 = $93 | $96;
    L23: do {
     if ($86) {
      $$27586 = $$174;$101 = $92;$156 = $97;$157 = $87;$158 = $88;$99 = $91;
      while(1) {
       if ($156) {
        $98 = ($99|0)==(0);
        $100 = ($101|0)==(0);
        $102 = $98 & $100;
        if ($102) {
         break;
        } else {
         $104 = $99;$105 = $101;
        }
       } else {
        $104 = $157;$105 = $158;
       }
       $106 = (_bitshift64Shl(($104|0),($105|0),1)|0);
       $107 = tempRet0;
       $108 = (($$27586) + -1)|0;
       $109 = ($108|0)>($$172$ph|0);
       $110 = (_i64Subtract(($106|0),($107|0),($89|0),($90|0))|0);
       $111 = tempRet0;
       $112 = ($111|0)>(-1);
       $113 = ($110>>>0)>(4294967295);
       $114 = ($111|0)==(-1);
       $115 = $114 & $113;
       $116 = $112 | $115;
       if ($109) {
        $$27586 = $108;$101 = $111;$156 = $116;$157 = $106;$158 = $107;$99 = $110;
       } else {
        $$275$lcssa = $108;$$lcssa = $116;$118 = $110;$120 = $111;$159 = $106;$160 = $107;
        break L23;
       }
      }
      $103 = $0 * 0.0;
      $$070 = $103;
      break L1;
     } else {
      $$275$lcssa = $$174;$$lcssa = $97;$118 = $91;$120 = $92;$159 = $87;$160 = $88;
     }
    } while(0);
    if ($$lcssa) {
     $117 = ($118|0)==(0);
     $119 = ($120|0)==(0);
     $121 = $117 & $119;
     if ($121) {
      $129 = $0 * 0.0;
      $$070 = $129;
      break;
     } else {
      $123 = $120;$125 = $118;
     }
    } else {
     $123 = $160;$125 = $159;
    }
    $122 = ($123>>>0)<(1048576);
    $124 = ($125>>>0)<(0);
    $126 = ($123|0)==(1048576);
    $127 = $126 & $124;
    $128 = $122 | $127;
    if ($128) {
     $$37683 = $$275$lcssa;$130 = $125;$131 = $123;
     while(1) {
      $132 = (_bitshift64Shl(($130|0),($131|0),1)|0);
      $133 = tempRet0;
      $134 = (($$37683) + -1)|0;
      $135 = ($133>>>0)<(1048576);
      $136 = ($132>>>0)<(0);
      $137 = ($133|0)==(1048576);
      $138 = $137 & $136;
      $139 = $135 | $138;
      if ($139) {
       $$37683 = $134;$130 = $132;$131 = $133;
      } else {
       $$376$lcssa = $134;$141 = $132;$142 = $133;
       break;
      }
     }
    } else {
     $$376$lcssa = $$275$lcssa;$141 = $125;$142 = $123;
    }
    $140 = ($$376$lcssa|0)>(0);
    if ($140) {
     $143 = (_i64Add(($141|0),($142|0),0,-1048576)|0);
     $144 = tempRet0;
     $145 = (_bitshift64Shl(($$376$lcssa|0),0,52)|0);
     $146 = tempRet0;
     $147 = $143 | $145;
     $148 = $144 | $146;
     $153 = $148;$155 = $147;
    } else {
     $149 = (1 - ($$376$lcssa))|0;
     $150 = (_bitshift64Lshr(($141|0),($142|0),($149|0))|0);
     $151 = tempRet0;
     $153 = $151;$155 = $150;
    }
    $152 = $153 | $12;
    HEAP32[tempDoublePtr>>2] = $155;HEAP32[tempDoublePtr+4>>2] = $152;$154 = +HEAPF64[tempDoublePtr>>3];
    $$070 = $154;
   }
  }
 } while(0);
 if ((label|0) == 3) {
  $27 = $0 * $1;
  $28 = $27 / $27;
  $$070 = $28;
 }
 return (+$$070);
}
function ___DOUBLE_BITS_272($0) {
 $0 = +$0;
 var $1 = 0, $2 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 HEAPF64[tempDoublePtr>>3] = $0;$1 = HEAP32[tempDoublePtr>>2]|0;
 $2 = HEAP32[tempDoublePtr+4>>2]|0;
 tempRet0 = ($2);
 return ($1|0);
}
function _strlen($0) {
 $0 = $0|0;
 var $$0 = 0, $$015$lcssa = 0, $$01519 = 0, $$1$lcssa = 0, $$pn = 0, $$pre = 0, $$sink = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0;
 var $21 = 0, $22 = 0, $23 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = $0;
 $2 = $1 & 3;
 $3 = ($2|0)==(0);
 L1: do {
  if ($3) {
   $$015$lcssa = $0;
   label = 4;
  } else {
   $$01519 = $0;$23 = $1;
   while(1) {
    $4 = HEAP8[$$01519>>0]|0;
    $5 = ($4<<24>>24)==(0);
    if ($5) {
     $$sink = $23;
     break L1;
    }
    $6 = ((($$01519)) + 1|0);
    $7 = $6;
    $8 = $7 & 3;
    $9 = ($8|0)==(0);
    if ($9) {
     $$015$lcssa = $6;
     label = 4;
     break;
    } else {
     $$01519 = $6;$23 = $7;
    }
   }
  }
 } while(0);
 if ((label|0) == 4) {
  $$0 = $$015$lcssa;
  while(1) {
   $10 = HEAP32[$$0>>2]|0;
   $11 = (($10) + -16843009)|0;
   $12 = $10 & -2139062144;
   $13 = $12 ^ -2139062144;
   $14 = $13 & $11;
   $15 = ($14|0)==(0);
   $16 = ((($$0)) + 4|0);
   if ($15) {
    $$0 = $16;
   } else {
    break;
   }
  }
  $17 = $10&255;
  $18 = ($17<<24>>24)==(0);
  if ($18) {
   $$1$lcssa = $$0;
  } else {
   $$pn = $$0;
   while(1) {
    $19 = ((($$pn)) + 1|0);
    $$pre = HEAP8[$19>>0]|0;
    $20 = ($$pre<<24>>24)==(0);
    if ($20) {
     $$1$lcssa = $19;
     break;
    } else {
     $$pn = $19;
    }
   }
  }
  $21 = $$1$lcssa;
  $$sink = $21;
 }
 $22 = (($$sink) - ($1))|0;
 return ($22|0);
}
function _strchr($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = (___strchrnul($0,$1)|0);
 $3 = HEAP8[$2>>0]|0;
 $4 = $1&255;
 $5 = ($3<<24>>24)==($4<<24>>24);
 $6 = $5 ? $2 : 0;
 return ($6|0);
}
function ___strchrnul($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$0 = 0, $$029$lcssa = 0, $$02936 = 0, $$030$lcssa = 0, $$03039 = 0, $$1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0;
 var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0;
 var $41 = 0, $42 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond33 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = $1 & 255;
 $3 = ($2|0)==(0);
 L1: do {
  if ($3) {
   $8 = (_strlen($0)|0);
   $9 = (($0) + ($8)|0);
   $$0 = $9;
  } else {
   $4 = $0;
   $5 = $4 & 3;
   $6 = ($5|0)==(0);
   if ($6) {
    $$030$lcssa = $0;
   } else {
    $7 = $1&255;
    $$03039 = $0;
    while(1) {
     $10 = HEAP8[$$03039>>0]|0;
     $11 = ($10<<24>>24)==(0);
     $12 = ($10<<24>>24)==($7<<24>>24);
     $or$cond = $11 | $12;
     if ($or$cond) {
      $$0 = $$03039;
      break L1;
     }
     $13 = ((($$03039)) + 1|0);
     $14 = $13;
     $15 = $14 & 3;
     $16 = ($15|0)==(0);
     if ($16) {
      $$030$lcssa = $13;
      break;
     } else {
      $$03039 = $13;
     }
    }
   }
   $17 = Math_imul($2, 16843009)|0;
   $18 = HEAP32[$$030$lcssa>>2]|0;
   $19 = (($18) + -16843009)|0;
   $20 = $18 & -2139062144;
   $21 = $20 ^ -2139062144;
   $22 = $21 & $19;
   $23 = ($22|0)==(0);
   L10: do {
    if ($23) {
     $$02936 = $$030$lcssa;$25 = $18;
     while(1) {
      $24 = $25 ^ $17;
      $26 = (($24) + -16843009)|0;
      $27 = $24 & -2139062144;
      $28 = $27 ^ -2139062144;
      $29 = $28 & $26;
      $30 = ($29|0)==(0);
      if (!($30)) {
       $$029$lcssa = $$02936;
       break L10;
      }
      $31 = ((($$02936)) + 4|0);
      $32 = HEAP32[$31>>2]|0;
      $33 = (($32) + -16843009)|0;
      $34 = $32 & -2139062144;
      $35 = $34 ^ -2139062144;
      $36 = $35 & $33;
      $37 = ($36|0)==(0);
      if ($37) {
       $$02936 = $31;$25 = $32;
      } else {
       $$029$lcssa = $31;
       break;
      }
     }
    } else {
     $$029$lcssa = $$030$lcssa;
    }
   } while(0);
   $38 = $1&255;
   $$1 = $$029$lcssa;
   while(1) {
    $39 = HEAP8[$$1>>0]|0;
    $40 = ($39<<24>>24)==(0);
    $41 = ($39<<24>>24)==($38<<24>>24);
    $or$cond33 = $40 | $41;
    $42 = ((($$1)) + 1|0);
    if ($or$cond33) {
     $$0 = $$1;
     break;
    } else {
     $$1 = $42;
    }
   }
  }
 } while(0);
 return ($$0|0);
}
function _mbrtowc($0,$1,$2,$3) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 var $$ = 0, $$0 = 0, $$03952 = 0, $$04051 = 0, $$04350 = 0, $$1 = 0, $$141 = 0, $$144 = 0, $$2 = 0, $$47 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0;
 var $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0;
 var $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0;
 var $not$ = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $4 = sp;
 $5 = ($3|0)==(0|0);
 $$ = $5 ? 22748 : $3;
 $6 = HEAP32[$$>>2]|0;
 $7 = ($1|0)==(0|0);
 L1: do {
  if ($7) {
   $8 = ($6|0)==(0);
   if ($8) {
    $$0 = 0;
   } else {
    label = 17;
   }
  } else {
   $9 = ($0|0)==(0|0);
   $$47 = $9 ? $4 : $0;
   $10 = ($2|0)==(0);
   if ($10) {
    $$0 = -2;
   } else {
    $11 = ($6|0)==(0);
    if ($11) {
     $12 = HEAP8[$1>>0]|0;
     $13 = ($12<<24>>24)>(-1);
     if ($13) {
      $14 = $12&255;
      HEAP32[$$47>>2] = $14;
      $15 = ($12<<24>>24)!=(0);
      $16 = $15&1;
      $$0 = $16;
      break;
     }
     $17 = (___pthread_self_439()|0);
     $18 = ((($17)) + 188|0);
     $19 = HEAP32[$18>>2]|0;
     $20 = HEAP32[$19>>2]|0;
     $not$ = ($20|0)==(0|0);
     $21 = HEAP8[$1>>0]|0;
     if ($not$) {
      $22 = $21 << 24 >> 24;
      $23 = $22 & 57343;
      HEAP32[$$47>>2] = $23;
      $$0 = 1;
      break;
     }
     $24 = $21&255;
     $25 = (($24) + -194)|0;
     $26 = ($25>>>0)>(50);
     if ($26) {
      label = 17;
      break;
     }
     $27 = ((($1)) + 1|0);
     $28 = (3652 + ($25<<2)|0);
     $29 = HEAP32[$28>>2]|0;
     $30 = (($2) + -1)|0;
     $31 = ($30|0)==(0);
     if ($31) {
      $$2 = $29;
     } else {
      $$03952 = $27;$$04051 = $29;$$04350 = $30;
      label = 11;
     }
    } else {
     $$03952 = $1;$$04051 = $6;$$04350 = $2;
     label = 11;
    }
    L14: do {
     if ((label|0) == 11) {
      $32 = HEAP8[$$03952>>0]|0;
      $33 = $32&255;
      $34 = $33 >>> 3;
      $35 = (($34) + -16)|0;
      $36 = $$04051 >> 26;
      $37 = (($34) + ($36))|0;
      $38 = $35 | $37;
      $39 = ($38>>>0)>(7);
      if ($39) {
       label = 17;
       break L1;
      } else {
       $$1 = $$03952;$$141 = $$04051;$$144 = $$04350;$43 = $32;
      }
      while(1) {
       $40 = $$141 << 6;
       $41 = ((($$1)) + 1|0);
       $42 = $43&255;
       $44 = (($42) + -128)|0;
       $45 = $44 | $40;
       $46 = (($$144) + -1)|0;
       $47 = ($45|0)<(0);
       if (!($47)) {
        break;
       }
       $49 = ($46|0)==(0);
       if ($49) {
        $$2 = $45;
        break L14;
       }
       $50 = HEAP8[$41>>0]|0;
       $51 = $50 & -64;
       $52 = ($51<<24>>24)==(-128);
       if ($52) {
        $$1 = $41;$$141 = $45;$$144 = $46;$43 = $50;
       } else {
        label = 17;
        break L1;
       }
      }
      HEAP32[$$>>2] = 0;
      HEAP32[$$47>>2] = $45;
      $48 = (($2) - ($46))|0;
      $$0 = $48;
      break L1;
     }
    } while(0);
    HEAP32[$$>>2] = $$2;
    $$0 = -2;
   }
  }
 } while(0);
 if ((label|0) == 17) {
  HEAP32[$$>>2] = 0;
  $53 = (___errno_location()|0);
  HEAP32[$53>>2] = 84;
  $$0 = -1;
 }
 STACKTOP = sp;return ($$0|0);
}
function ___pthread_self_439() {
 var $0 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $0 = (_pthread_self()|0);
 return ($0|0);
}
function _strcpy($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var label = 0, sp = 0;
 sp = STACKTOP;
 (___stpcpy($0,$1)|0);
 return ($0|0);
}
function ___stpcpy($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$0$lcssa = 0, $$025$lcssa = 0, $$02536 = 0, $$026$lcssa = 0, $$02642 = 0, $$027$lcssa = 0, $$02741 = 0, $$029 = 0, $$037 = 0, $$1$ph = 0, $$128$ph = 0, $$12834 = 0, $$135 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0;
 var $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0;
 var $35 = 0, $36 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = $1;
 $3 = $0;
 $4 = $2 ^ $3;
 $5 = $4 & 3;
 $6 = ($5|0)==(0);
 L1: do {
  if ($6) {
   $7 = $2 & 3;
   $8 = ($7|0)==(0);
   if ($8) {
    $$026$lcssa = $1;$$027$lcssa = $0;
   } else {
    $$02642 = $1;$$02741 = $0;
    while(1) {
     $9 = HEAP8[$$02642>>0]|0;
     HEAP8[$$02741>>0] = $9;
     $10 = ($9<<24>>24)==(0);
     if ($10) {
      $$029 = $$02741;
      break L1;
     }
     $11 = ((($$02642)) + 1|0);
     $12 = ((($$02741)) + 1|0);
     $13 = $11;
     $14 = $13 & 3;
     $15 = ($14|0)==(0);
     if ($15) {
      $$026$lcssa = $11;$$027$lcssa = $12;
      break;
     } else {
      $$02642 = $11;$$02741 = $12;
     }
    }
   }
   $16 = HEAP32[$$026$lcssa>>2]|0;
   $17 = (($16) + -16843009)|0;
   $18 = $16 & -2139062144;
   $19 = $18 ^ -2139062144;
   $20 = $19 & $17;
   $21 = ($20|0)==(0);
   if ($21) {
    $$02536 = $$027$lcssa;$$037 = $$026$lcssa;$24 = $16;
    while(1) {
     $22 = ((($$037)) + 4|0);
     $23 = ((($$02536)) + 4|0);
     HEAP32[$$02536>>2] = $24;
     $25 = HEAP32[$22>>2]|0;
     $26 = (($25) + -16843009)|0;
     $27 = $25 & -2139062144;
     $28 = $27 ^ -2139062144;
     $29 = $28 & $26;
     $30 = ($29|0)==(0);
     if ($30) {
      $$02536 = $23;$$037 = $22;$24 = $25;
     } else {
      $$0$lcssa = $22;$$025$lcssa = $23;
      break;
     }
    }
   } else {
    $$0$lcssa = $$026$lcssa;$$025$lcssa = $$027$lcssa;
   }
   $$1$ph = $$0$lcssa;$$128$ph = $$025$lcssa;
   label = 8;
  } else {
   $$1$ph = $1;$$128$ph = $0;
   label = 8;
  }
 } while(0);
 if ((label|0) == 8) {
  $31 = HEAP8[$$1$ph>>0]|0;
  HEAP8[$$128$ph>>0] = $31;
  $32 = ($31<<24>>24)==(0);
  if ($32) {
   $$029 = $$128$ph;
  } else {
   $$12834 = $$128$ph;$$135 = $$1$ph;
   while(1) {
    $33 = ((($$135)) + 1|0);
    $34 = ((($$12834)) + 1|0);
    $35 = HEAP8[$33>>0]|0;
    HEAP8[$34>>0] = $35;
    $36 = ($35<<24>>24)==(0);
    if ($36) {
     $$029 = $34;
     break;
    } else {
     $$12834 = $34;$$135 = $33;
    }
   }
  }
 }
 return ($$029|0);
}
function ___unlist_locked_file($0) {
 $0 = $0|0;
 var $$pre = 0, $$sink = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = ((($0)) + 68|0);
 $2 = HEAP32[$1>>2]|0;
 $3 = ($2|0)==(0);
 if (!($3)) {
  $4 = ((($0)) + 116|0);
  $5 = HEAP32[$4>>2]|0;
  $6 = ($5|0)==(0|0);
  $$pre = ((($0)) + 112|0);
  if (!($6)) {
   $7 = HEAP32[$$pre>>2]|0;
   $8 = ((($5)) + 112|0);
   HEAP32[$8>>2] = $7;
  }
  $9 = HEAP32[$$pre>>2]|0;
  $10 = ($9|0)==(0|0);
  if ($10) {
   $12 = (___pthread_self_607()|0);
   $13 = ((($12)) + 232|0);
   $$sink = $13;
  } else {
   $11 = ((($9)) + 116|0);
   $$sink = $11;
  }
  HEAP32[$$sink>>2] = $5;
 }
 return;
}
function ___pthread_self_607() {
 var $0 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $0 = (_pthread_self()|0);
 return ($0|0);
}
function _fopen($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$0 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $memchr = 0, $vararg_buffer = 0, $vararg_buffer3 = 0, $vararg_buffer8 = 0, $vararg_ptr1 = 0;
 var $vararg_ptr2 = 0, $vararg_ptr6 = 0, $vararg_ptr7 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 48|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(48|0);
 $vararg_buffer8 = sp + 32|0;
 $vararg_buffer3 = sp + 16|0;
 $vararg_buffer = sp;
 $2 = HEAP8[$1>>0]|0;
 $3 = $2 << 24 >> 24;
 $memchr = (_memchr(19793,$3,4)|0);
 $4 = ($memchr|0)==(0|0);
 if ($4) {
  $5 = (___errno_location()|0);
  HEAP32[$5>>2] = 22;
  $$0 = 0;
 } else {
  $6 = (___fmodeflags($1)|0);
  $7 = $0;
  $8 = $6 | 32768;
  HEAP32[$vararg_buffer>>2] = $7;
  $vararg_ptr1 = ((($vararg_buffer)) + 4|0);
  HEAP32[$vararg_ptr1>>2] = $8;
  $vararg_ptr2 = ((($vararg_buffer)) + 8|0);
  HEAP32[$vararg_ptr2>>2] = 438;
  $9 = (___syscall5(5,($vararg_buffer|0))|0);
  $10 = (___syscall_ret($9)|0);
  $11 = ($10|0)<(0);
  if ($11) {
   $$0 = 0;
  } else {
   $12 = $6 & 524288;
   $13 = ($12|0)==(0);
   if (!($13)) {
    HEAP32[$vararg_buffer3>>2] = $10;
    $vararg_ptr6 = ((($vararg_buffer3)) + 4|0);
    HEAP32[$vararg_ptr6>>2] = 2;
    $vararg_ptr7 = ((($vararg_buffer3)) + 8|0);
    HEAP32[$vararg_ptr7>>2] = 1;
    (___syscall221(221,($vararg_buffer3|0))|0);
   }
   $14 = (___fdopen($10,$1)|0);
   $15 = ($14|0)==(0|0);
   if ($15) {
    HEAP32[$vararg_buffer8>>2] = $10;
    (___syscall6(6,($vararg_buffer8|0))|0);
    $$0 = 0;
   } else {
    $$0 = $14;
   }
  }
 }
 STACKTOP = sp;return ($$0|0);
}
function ___fmodeflags($0) {
 $0 = $0|0;
 var $$ = 0, $$$4 = 0, $$0 = 0, $$0$ = 0, $$2 = 0, $$2$ = 0, $$4 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0;
 var $8 = 0, $9 = 0, $not$ = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = (_strchr($0,43)|0);
 $2 = ($1|0)==(0|0);
 $3 = HEAP8[$0>>0]|0;
 $not$ = ($3<<24>>24)!=(114);
 $$ = $not$&1;
 $$0 = $2 ? $$ : 2;
 $4 = (_strchr($0,120)|0);
 $5 = ($4|0)==(0|0);
 $6 = $$0 | 128;
 $$0$ = $5 ? $$0 : $6;
 $7 = (_strchr($0,101)|0);
 $8 = ($7|0)==(0|0);
 $9 = $$0$ | 524288;
 $$2 = $8 ? $$0$ : $9;
 $10 = ($3<<24>>24)==(114);
 $11 = $$2 | 64;
 $$2$ = $10 ? $$2 : $11;
 $12 = ($3<<24>>24)==(119);
 $13 = $$2$ | 512;
 $$4 = $12 ? $13 : $$2$;
 $14 = ($3<<24>>24)==(97);
 $15 = $$4 | 1024;
 $$$4 = $14 ? $15 : $$4;
 return ($$$4|0);
}
function ___fdopen($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$0 = 0, $$pre = 0, $$pre31 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
 var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $5 = 0, $6 = 0;
 var $7 = 0, $8 = 0, $9 = 0, $memchr = 0, $vararg_buffer = 0, $vararg_buffer12 = 0, $vararg_buffer3 = 0, $vararg_buffer7 = 0, $vararg_ptr1 = 0, $vararg_ptr10 = 0, $vararg_ptr11 = 0, $vararg_ptr15 = 0, $vararg_ptr16 = 0, $vararg_ptr2 = 0, $vararg_ptr6 = 0, dest = 0, label = 0, sp = 0, stop = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(64|0);
 $vararg_buffer12 = sp + 40|0;
 $vararg_buffer7 = sp + 24|0;
 $vararg_buffer3 = sp + 16|0;
 $vararg_buffer = sp;
 $2 = sp + 56|0;
 $3 = HEAP8[$1>>0]|0;
 $4 = $3 << 24 >> 24;
 $memchr = (_memchr(19793,$4,4)|0);
 $5 = ($memchr|0)==(0|0);
 if ($5) {
  $6 = (___errno_location()|0);
  HEAP32[$6>>2] = 22;
  $$0 = 0;
 } else {
  $7 = (_malloc(1156)|0);
  $8 = ($7|0)==(0|0);
  if ($8) {
   $$0 = 0;
  } else {
   dest=$7; stop=dest+124|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0));
   $9 = (_strchr($1,43)|0);
   $10 = ($9|0)==(0|0);
   if ($10) {
    $11 = ($3<<24>>24)==(114);
    $12 = $11 ? 8 : 4;
    HEAP32[$7>>2] = $12;
   }
   $13 = (_strchr($1,101)|0);
   $14 = ($13|0)==(0|0);
   if ($14) {
    $16 = $3;
   } else {
    HEAP32[$vararg_buffer>>2] = $0;
    $vararg_ptr1 = ((($vararg_buffer)) + 4|0);
    HEAP32[$vararg_ptr1>>2] = 2;
    $vararg_ptr2 = ((($vararg_buffer)) + 8|0);
    HEAP32[$vararg_ptr2>>2] = 1;
    (___syscall221(221,($vararg_buffer|0))|0);
    $$pre = HEAP8[$1>>0]|0;
    $16 = $$pre;
   }
   $15 = ($16<<24>>24)==(97);
   if ($15) {
    HEAP32[$vararg_buffer3>>2] = $0;
    $vararg_ptr6 = ((($vararg_buffer3)) + 4|0);
    HEAP32[$vararg_ptr6>>2] = 3;
    $17 = (___syscall221(221,($vararg_buffer3|0))|0);
    $18 = $17 & 1024;
    $19 = ($18|0)==(0);
    if ($19) {
     $20 = $17 | 1024;
     HEAP32[$vararg_buffer7>>2] = $0;
     $vararg_ptr10 = ((($vararg_buffer7)) + 4|0);
     HEAP32[$vararg_ptr10>>2] = 4;
     $vararg_ptr11 = ((($vararg_buffer7)) + 8|0);
     HEAP32[$vararg_ptr11>>2] = $20;
     (___syscall221(221,($vararg_buffer7|0))|0);
    }
    $21 = HEAP32[$7>>2]|0;
    $22 = $21 | 128;
    HEAP32[$7>>2] = $22;
    $29 = $22;
   } else {
    $$pre31 = HEAP32[$7>>2]|0;
    $29 = $$pre31;
   }
   $23 = ((($7)) + 60|0);
   HEAP32[$23>>2] = $0;
   $24 = ((($7)) + 132|0);
   $25 = ((($7)) + 44|0);
   HEAP32[$25>>2] = $24;
   $26 = ((($7)) + 48|0);
   HEAP32[$26>>2] = 1024;
   $27 = ((($7)) + 75|0);
   HEAP8[$27>>0] = -1;
   $28 = $29 & 8;
   $30 = ($28|0)==(0);
   if ($30) {
    $31 = $2;
    HEAP32[$vararg_buffer12>>2] = $0;
    $vararg_ptr15 = ((($vararg_buffer12)) + 4|0);
    HEAP32[$vararg_ptr15>>2] = 21523;
    $vararg_ptr16 = ((($vararg_buffer12)) + 8|0);
    HEAP32[$vararg_ptr16>>2] = $31;
    $32 = (___syscall54(54,($vararg_buffer12|0))|0);
    $33 = ($32|0)==(0);
    if ($33) {
     HEAP8[$27>>0] = 10;
    }
   }
   $34 = ((($7)) + 32|0);
   HEAP32[$34>>2] = 10;
   $35 = ((($7)) + 36|0);
   HEAP32[$35>>2] = 9;
   $36 = ((($7)) + 40|0);
   HEAP32[$36>>2] = 3;
   $37 = ((($7)) + 12|0);
   HEAP32[$37>>2] = 2;
   $38 = HEAP32[(22688)>>2]|0;
   $39 = ($38|0)==(0);
   if ($39) {
    $40 = ((($7)) + 76|0);
    HEAP32[$40>>2] = -1;
   }
   $41 = (___ofl_add($7)|0);
   $$0 = $7;
  }
 }
 STACKTOP = sp;return ($$0|0);
}
function ___ofl_add($0) {
 $0 = $0|0;
 var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = (___ofl_lock()|0);
 $2 = HEAP32[$1>>2]|0;
 $3 = ((($0)) + 56|0);
 HEAP32[$3>>2] = $2;
 $4 = HEAP32[$1>>2]|0;
 $5 = ($4|0)==(0|0);
 if (!($5)) {
  $6 = ((($4)) + 52|0);
  HEAP32[$6>>2] = $0;
 }
 HEAP32[$1>>2] = $0;
 ___ofl_unlock();
 return ($0|0);
}
function ___ofl_lock() {
 var label = 0, sp = 0;
 sp = STACKTOP;
 ___lock((22752|0));
 return (22760|0);
}
function ___ofl_unlock() {
 var label = 0, sp = 0;
 sp = STACKTOP;
 ___unlock((22752|0));
 return;
}
function _fclose($0) {
 $0 = $0|0;
 var $$pre = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
 var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = ((($0)) + 76|0);
 $2 = HEAP32[$1>>2]|0;
 $3 = ($2|0)>(-1);
 if ($3) {
  $4 = (___lockfile($0)|0);
  $29 = $4;
 } else {
  $29 = 0;
 }
 ___unlist_locked_file($0);
 $5 = HEAP32[$0>>2]|0;
 $6 = $5 & 1;
 $7 = ($6|0)!=(0);
 if (!($7)) {
  $8 = (___ofl_lock()|0);
  $9 = ((($0)) + 52|0);
  $10 = HEAP32[$9>>2]|0;
  $11 = ($10|0)==(0|0);
  $12 = $10;
  $$pre = ((($0)) + 56|0);
  if (!($11)) {
   $13 = HEAP32[$$pre>>2]|0;
   $14 = ((($10)) + 56|0);
   HEAP32[$14>>2] = $13;
  }
  $15 = HEAP32[$$pre>>2]|0;
  $16 = ($15|0)==(0|0);
  if (!($16)) {
   $17 = ((($15)) + 52|0);
   HEAP32[$17>>2] = $12;
  }
  $18 = HEAP32[$8>>2]|0;
  $19 = ($18|0)==($0|0);
  if ($19) {
   HEAP32[$8>>2] = $15;
  }
  ___ofl_unlock();
 }
 $20 = (_fflush($0)|0);
 $21 = ((($0)) + 12|0);
 $22 = HEAP32[$21>>2]|0;
 $23 = (FUNCTION_TABLE_ii[$22 & 15]($0)|0);
 $24 = $23 | $20;
 $25 = ((($0)) + 92|0);
 $26 = HEAP32[$25>>2]|0;
 $27 = ($26|0)==(0|0);
 if (!($27)) {
  _free($26);
 }
 if ($7) {
  $28 = ($29|0)==(0);
  if (!($28)) {
   ___unlockfile($0);
  }
 } else {
  _free($0);
 }
 return ($24|0);
}
function _fflush($0) {
 $0 = $0|0;
 var $$0 = 0, $$023 = 0, $$02325 = 0, $$02327 = 0, $$024$lcssa = 0, $$02426 = 0, $$1 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0;
 var $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $phitmp = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = ($0|0)==(0|0);
 do {
  if ($1) {
   $8 = HEAP32[1057]|0;
   $9 = ($8|0)==(0|0);
   if ($9) {
    $29 = 0;
   } else {
    $10 = HEAP32[1057]|0;
    $11 = (_fflush($10)|0);
    $29 = $11;
   }
   $12 = (___ofl_lock()|0);
   $$02325 = HEAP32[$12>>2]|0;
   $13 = ($$02325|0)==(0|0);
   if ($13) {
    $$024$lcssa = $29;
   } else {
    $$02327 = $$02325;$$02426 = $29;
    while(1) {
     $14 = ((($$02327)) + 76|0);
     $15 = HEAP32[$14>>2]|0;
     $16 = ($15|0)>(-1);
     if ($16) {
      $17 = (___lockfile($$02327)|0);
      $26 = $17;
     } else {
      $26 = 0;
     }
     $18 = ((($$02327)) + 20|0);
     $19 = HEAP32[$18>>2]|0;
     $20 = ((($$02327)) + 28|0);
     $21 = HEAP32[$20>>2]|0;
     $22 = ($19>>>0)>($21>>>0);
     if ($22) {
      $23 = (___fflush_unlocked($$02327)|0);
      $24 = $23 | $$02426;
      $$1 = $24;
     } else {
      $$1 = $$02426;
     }
     $25 = ($26|0)==(0);
     if (!($25)) {
      ___unlockfile($$02327);
     }
     $27 = ((($$02327)) + 56|0);
     $$023 = HEAP32[$27>>2]|0;
     $28 = ($$023|0)==(0|0);
     if ($28) {
      $$024$lcssa = $$1;
      break;
     } else {
      $$02327 = $$023;$$02426 = $$1;
     }
    }
   }
   ___ofl_unlock();
   $$0 = $$024$lcssa;
  } else {
   $2 = ((($0)) + 76|0);
   $3 = HEAP32[$2>>2]|0;
   $4 = ($3|0)>(-1);
   if (!($4)) {
    $5 = (___fflush_unlocked($0)|0);
    $$0 = $5;
    break;
   }
   $6 = (___lockfile($0)|0);
   $phitmp = ($6|0)==(0);
   $7 = (___fflush_unlocked($0)|0);
   if ($phitmp) {
    $$0 = $7;
   } else {
    ___unlockfile($0);
    $$0 = $7;
   }
  }
 } while(0);
 return ($$0|0);
}
function ___fflush_unlocked($0) {
 $0 = $0|0;
 var $$0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0;
 var $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = ((($0)) + 20|0);
 $2 = HEAP32[$1>>2]|0;
 $3 = ((($0)) + 28|0);
 $4 = HEAP32[$3>>2]|0;
 $5 = ($2>>>0)>($4>>>0);
 if ($5) {
  $6 = ((($0)) + 36|0);
  $7 = HEAP32[$6>>2]|0;
  (FUNCTION_TABLE_iiii[$7 & 15]($0,0,0)|0);
  $8 = HEAP32[$1>>2]|0;
  $9 = ($8|0)==(0|0);
  if ($9) {
   $$0 = -1;
  } else {
   label = 3;
  }
 } else {
  label = 3;
 }
 if ((label|0) == 3) {
  $10 = ((($0)) + 4|0);
  $11 = HEAP32[$10>>2]|0;
  $12 = ((($0)) + 8|0);
  $13 = HEAP32[$12>>2]|0;
  $14 = ($11>>>0)<($13>>>0);
  if ($14) {
   $15 = $11;
   $16 = $13;
   $17 = (($15) - ($16))|0;
   $18 = ((($0)) + 40|0);
   $19 = HEAP32[$18>>2]|0;
   (FUNCTION_TABLE_iiii[$19 & 15]($0,$17,1)|0);
  }
  $20 = ((($0)) + 16|0);
  HEAP32[$20>>2] = 0;
  HEAP32[$3>>2] = 0;
  HEAP32[$1>>2] = 0;
  HEAP32[$12>>2] = 0;
  HEAP32[$10>>2] = 0;
  $$0 = 0;
 }
 return ($$0|0);
}
function _fgets($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $$0 = 0, $$06266 = 0, $$063 = 0, $$064 = 0, $$1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0;
 var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0;
 var $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond3 = 0;
 var $sext$mask = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $3 = ((($2)) + 76|0);
 $4 = HEAP32[$3>>2]|0;
 $5 = ($4|0)>(-1);
 if ($5) {
  $6 = (___lockfile($2)|0);
  $17 = $6;
 } else {
  $17 = 0;
 }
 $7 = (($1) + -1)|0;
 $8 = ($1|0)<(2);
 $9 = ($7|0)!=(0);
 if ($8) {
  $10 = ((($2)) + 74|0);
  $11 = HEAP8[$10>>0]|0;
  $12 = $11 << 24 >> 24;
  $13 = (($12) + 255)|0;
  $14 = $13 | $12;
  $15 = $14&255;
  HEAP8[$10>>0] = $15;
  $16 = ($17|0)==(0);
  if (!($16)) {
   ___unlockfile($2);
  }
  if ($9) {
   $$0 = 0;
  } else {
   HEAP8[$0>>0] = 0;
   $$0 = $0;
  }
 } else {
  L11: do {
   if ($9) {
    $18 = ((($2)) + 4|0);
    $19 = ((($2)) + 8|0);
    $$063 = $7;$$064 = $0;
    while(1) {
     $20 = HEAP32[$18>>2]|0;
     $21 = HEAP32[$19>>2]|0;
     $22 = $20;
     $23 = (($21) - ($22))|0;
     $24 = (_memchr($20,10,$23)|0);
     $25 = ($24|0)==(0|0);
     $26 = $24;
     $27 = (1 - ($22))|0;
     $28 = (($27) + ($26))|0;
     $29 = $25 ? $23 : $28;
     $30 = ($29>>>0)<($$063>>>0);
     $31 = $30 ? $29 : $$063;
     _memcpy(($$064|0),($20|0),($31|0))|0;
     $32 = HEAP32[$18>>2]|0;
     $33 = (($32) + ($31)|0);
     HEAP32[$18>>2] = $33;
     $34 = (($$064) + ($31)|0);
     $35 = (($$063) - ($31))|0;
     $36 = ($35|0)!=(0);
     $or$cond = $25 & $36;
     if (!($or$cond)) {
      $$1 = $34;
      label = 17;
      break L11;
     }
     $37 = HEAP32[$19>>2]|0;
     $38 = ($33>>>0)<($37>>>0);
     if ($38) {
      $39 = ((($33)) + 1|0);
      HEAP32[$18>>2] = $39;
      $40 = HEAP8[$33>>0]|0;
      $41 = $40&255;
      $50 = $41;
     } else {
      $42 = (___uflow($2)|0);
      $43 = ($42|0)<(0);
      if ($43) {
       break;
      } else {
       $50 = $42;
      }
     }
     $48 = (($35) + -1)|0;
     $49 = $50&255;
     $51 = ((($34)) + 1|0);
     HEAP8[$34>>0] = $49;
     $sext$mask = $50 & 255;
     $52 = ($sext$mask|0)!=(10);
     $53 = ($48|0)!=(0);
     $or$cond3 = $53 & $52;
     if ($or$cond3) {
      $$063 = $48;$$064 = $51;
     } else {
      $$1 = $51;
      label = 17;
      break L11;
     }
    }
    $44 = ($34|0)==($0|0);
    if ($44) {
     $$06266 = 0;
    } else {
     $45 = HEAP32[$2>>2]|0;
     $46 = $45 & 16;
     $47 = ($46|0)==(0);
     if ($47) {
      $$06266 = 0;
     } else {
      $$1 = $34;
      label = 17;
     }
    }
   } else {
    $$1 = $0;
    label = 17;
   }
  } while(0);
  if ((label|0) == 17) {
   $54 = ($0|0)==(0|0);
   if ($54) {
    $$06266 = 0;
   } else {
    HEAP8[$$1>>0] = 0;
    $$06266 = $0;
   }
  }
  $55 = ($17|0)==(0);
  if ($55) {
   $$0 = $$06266;
  } else {
   ___unlockfile($2);
   $$0 = $$06266;
  }
 }
 return ($$0|0);
}
function _feof($0) {
 $0 = $0|0;
 var $$lobit = 0, $$lobit8 = 0, $$lobit9 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $phitmp = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = ((($0)) + 76|0);
 $2 = HEAP32[$1>>2]|0;
 $3 = ($2|0)>(-1);
 if ($3) {
  $6 = (___lockfile($0)|0);
  $phitmp = ($6|0)==(0);
  $7 = HEAP32[$0>>2]|0;
  $8 = $7 >>> 4;
  $$lobit = $8 & 1;
  if ($phitmp) {
   $$lobit9 = $$lobit;
  } else {
   ___unlockfile($0);
   $$lobit9 = $$lobit;
  }
 } else {
  $4 = HEAP32[$0>>2]|0;
  $5 = $4 >>> 4;
  $$lobit8 = $5 & 1;
  $$lobit9 = $$lobit8;
 }
 return ($$lobit9|0);
}
function _sscanf($0,$1,$varargs) {
 $0 = $0|0;
 $1 = $1|0;
 $varargs = $varargs|0;
 var $2 = 0, $3 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $2 = sp;
 HEAP32[$2>>2] = $varargs;
 $3 = (_vsscanf($0,$1,$2)|0);
 STACKTOP = sp;return ($3|0);
}
function _vsscanf($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, dest = 0, label = 0, sp = 0, stop = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 128|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(128|0);
 $3 = sp;
 dest=$3; stop=dest+124|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0));
 $4 = ((($3)) + 32|0);
 HEAP32[$4>>2] = 11;
 $5 = ((($3)) + 44|0);
 HEAP32[$5>>2] = $0;
 $6 = ((($3)) + 76|0);
 HEAP32[$6>>2] = -1;
 $7 = ((($3)) + 84|0);
 HEAP32[$7>>2] = $0;
 $8 = (_vfscanf($3,$1,$2)|0);
 STACKTOP = sp;return ($8|0);
}
function _do_read($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $3 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $3 = (___string_read($0,$1,$2)|0);
 return ($3|0);
}
function _vfscanf($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $$ = 0, $$$0266 = 0, $$$0268 = 0, $$$0305 = 0, $$$3 = 0, $$0266$lcssa = 0, $$0266417 = 0, $$0268 = 0, $$0272 = 0, $$0273429 = 0, $$0276$ph = 0, $$0278$ph = 0, $$0278$ph$phi = 0, $$0278$ph336 = 0, $$0283428 = 0, $$0286420 = 0, $$0288$ = 0, $$0288425 = 0, $$0292 = 0, $$0293 = 0;
 var $$0305423 = 0, $$10 = 0, $$11 = 0, $$1267 = 0, $$1271 = 0, $$1274 = 0, $$1277$ph = 0, $$1279 = 0, $$1284 = 0, $$1289 = 0, $$2 = 0, $$2275 = 0, $$2280 = 0, $$2280$ph = 0, $$2280$ph$phi = 0, $$2285 = 0, $$2290 = 0, $$2307$ph = 0, $$3$lcssa = 0, $$319 = 0;
 var $$320 = 0, $$321 = 0, $$322 = 0, $$327 = 0, $$328$le439 = 0, $$328$le441 = 0, $$3281 = 0, $$3291 = 0, $$3416 = 0, $$4282 = 0, $$4309 = 0, $$5 = 0, $$5299 = 0, $$5310 = 0, $$6 = 0, $$6311 = 0, $$7 = 0, $$7$ph = 0, $$7312 = 0, $$8 = 0;
 var $$8313 = 0, $$9 = 0, $$9314 = 0, $$9314$ph = 0, $$lcssa355 = 0, $$not = 0, $$old4 = 0, $$ph = 0, $$ph353 = 0, $$pre = 0, $$pre$phi516Z2D = 0, $$pre507 = 0, $$pre509 = 0, $$pre511 = 0, $$pre512 = 0, $$pre513 = 0, $$pre514 = 0, $$pre515 = 0, $$sink443 = 0, $$sroa$2$0$$sroa_idx13 = 0;
 var $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0;
 var $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0;
 var $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0;
 var $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0;
 var $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0;
 var $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0;
 var $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0;
 var $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0;
 var $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0;
 var $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0;
 var $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0.0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0.0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0;
 var $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0;
 var $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0;
 var $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0;
 var $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0;
 var $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $arglist_current = 0, $arglist_next = 0, $expanded = 0, $expanded1 = 0, $expanded3 = 0, $expanded4 = 0, $expanded5 = 0, $factor = 0, $factor331 = 0, $isdigit = 0;
 var $isdigit316 = 0, $isdigit316415 = 0, $isdigittmp = 0, $isdigittmp315 = 0, $isdigittmp315414 = 0, $narrow = 0, $narrow469 = 0, $or$cond = 0, $or$cond3 = 0, $or$cond318 = 0, $or$cond5 = 0, $trunc = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 288|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(288|0);
 $3 = sp + 8|0;
 $4 = sp + 17|0;
 $5 = sp;
 $6 = sp + 16|0;
 $7 = ((($0)) + 76|0);
 $8 = HEAP32[$7>>2]|0;
 $9 = ($8|0)>(-1);
 if ($9) {
  $10 = (___lockfile($0)|0);
  $306 = $10;
 } else {
  $306 = 0;
 }
 $11 = HEAP8[$1>>0]|0;
 $12 = ($11<<24>>24)==(0);
 L4: do {
  if ($12) {
   $$3291 = 0;
  } else {
   $13 = ((($0)) + 4|0);
   $14 = ((($0)) + 100|0);
   $15 = ((($0)) + 108|0);
   $16 = ((($0)) + 8|0);
   $17 = ((($4)) + 10|0);
   $18 = ((($4)) + 33|0);
   $$sroa$2$0$$sroa_idx13 = ((($3)) + 4|0);
   $19 = ((($4)) + 46|0);
   $20 = ((($4)) + 94|0);
   $21 = ((($4)) + 1|0);
   $22 = ((($4)) + 1|0);
   $$0273429 = $1;$$0283428 = 0;$$0288425 = 0;$$0305423 = 0;$102 = 0;$24 = $11;
   L6: while(1) {
    $23 = $24&255;
    $25 = (_isspace($23)|0);
    $26 = ($25|0)==(0);
    L8: do {
     if ($26) {
      $53 = ($24<<24>>24)==(37);
      L10: do {
       if ($53) {
        $54 = ((($$0273429)) + 1|0);
        $55 = HEAP8[$54>>0]|0;
        L12: do {
         switch ($55<<24>>24) {
         case 37:  {
          break L10;
          break;
         }
         case 42:  {
          $76 = ((($$0273429)) + 2|0);
          $$0293 = 0;$$2275 = $76;
          break;
         }
         default: {
          $77 = $55&255;
          $isdigittmp = (($77) + -48)|0;
          $isdigit = ($isdigittmp>>>0)<(10);
          if ($isdigit) {
           $78 = ((($$0273429)) + 2|0);
           $79 = HEAP8[$78>>0]|0;
           $80 = ($79<<24>>24)==(36);
           if ($80) {
            $81 = (_arg_n($2,$isdigittmp)|0);
            $82 = ((($$0273429)) + 3|0);
            $$0293 = $81;$$2275 = $82;
            break L12;
           }
          }
          $arglist_current = HEAP32[$2>>2]|0;
          $83 = $arglist_current;
          $84 = ((0) + 4|0);
          $expanded1 = $84;
          $expanded = (($expanded1) - 1)|0;
          $85 = (($83) + ($expanded))|0;
          $86 = ((0) + 4|0);
          $expanded5 = $86;
          $expanded4 = (($expanded5) - 1)|0;
          $expanded3 = $expanded4 ^ -1;
          $87 = $85 & $expanded3;
          $88 = $87;
          $89 = HEAP32[$88>>2]|0;
          $arglist_next = ((($88)) + 4|0);
          HEAP32[$2>>2] = $arglist_next;
          $$0293 = $89;$$2275 = $54;
         }
         }
        } while(0);
        $90 = HEAP8[$$2275>>0]|0;
        $91 = $90&255;
        $isdigittmp315414 = (($91) + -48)|0;
        $isdigit316415 = ($isdigittmp315414>>>0)<(10);
        if ($isdigit316415) {
         $$0266417 = 0;$$3416 = $$2275;$95 = $91;
         while(1) {
          $92 = ($$0266417*10)|0;
          $93 = (($92) + -48)|0;
          $94 = (($93) + ($95))|0;
          $96 = ((($$3416)) + 1|0);
          $97 = HEAP8[$96>>0]|0;
          $98 = $97&255;
          $isdigittmp315 = (($98) + -48)|0;
          $isdigit316 = ($isdigittmp315>>>0)<(10);
          if ($isdigit316) {
           $$0266417 = $94;$$3416 = $96;$95 = $98;
          } else {
           $$0266$lcssa = $94;$$3$lcssa = $96;$$lcssa355 = $97;
           break;
          }
         }
        } else {
         $$0266$lcssa = 0;$$3$lcssa = $$2275;$$lcssa355 = $90;
        }
        $99 = ($$lcssa355<<24>>24)==(109);
        $100 = ($$0293|0)!=(0|0);
        $101 = ((($$3$lcssa)) + 1|0);
        $$$0305 = $99 ? 0 : $$0305423;
        $$327 = $99 ? 0 : $102;
        $$$3 = $99 ? $101 : $$3$lcssa;
        $narrow = $100 & $99;
        $103 = ((($$$3)) + 1|0);
        $104 = HEAP8[$$$3>>0]|0;
        switch ($104<<24>>24) {
        case 104:  {
         $105 = HEAP8[$103>>0]|0;
         $106 = ($105<<24>>24)==(104);
         $107 = ((($$$3)) + 2|0);
         $$319 = $106 ? $107 : $103;
         $$320 = $106 ? -2 : -1;
         $$0268 = $$320;$$5 = $$319;
         break;
        }
        case 108:  {
         $108 = HEAP8[$103>>0]|0;
         $109 = ($108<<24>>24)==(108);
         $110 = ((($$$3)) + 2|0);
         $$321 = $109 ? $110 : $103;
         $$322 = $109 ? 3 : 1;
         $$0268 = $$322;$$5 = $$321;
         break;
        }
        case 106:  {
         $$0268 = 3;$$5 = $103;
         break;
        }
        case 116: case 122:  {
         $$0268 = 1;$$5 = $103;
         break;
        }
        case 76:  {
         $$0268 = 2;$$5 = $103;
         break;
        }
        case 110: case 112: case 67: case 83: case 91: case 99: case 115: case 88: case 71: case 70: case 69: case 65: case 103: case 102: case 101: case 97: case 120: case 117: case 111: case 105: case 100:  {
         $$0268 = 0;$$5 = $$$3;
         break;
        }
        default: {
         $$7312 = $$$0305;$309 = $$327;$narrow469 = $narrow;
         label = 137;
         break L6;
        }
        }
        $111 = HEAP8[$$5>>0]|0;
        $112 = $111&255;
        $113 = $112 & 47;
        $114 = ($113|0)==(3);
        $115 = $112 | 32;
        $$ = $114 ? $115 : $112;
        $$$0268 = $114 ? 1 : $$0268;
        $trunc = $$&255;
        switch ($trunc<<24>>24) {
        case 99:  {
         $116 = ($$0266$lcssa|0)>(1);
         $$$0266 = $116 ? $$0266$lcssa : 1;
         $$1267 = $$$0266;$$1284 = $$0283428;
         break;
        }
        case 91:  {
         $$1267 = $$0266$lcssa;$$1284 = $$0283428;
         break;
        }
        case 110:  {
         $117 = ($$0283428|0)<(0);
         $118 = $117 << 31 >> 31;
         _store_int($$0293,$$$0268,$$0283428,$118);
         $$11 = $$5;$$1289 = $$0288425;$$2285 = $$0283428;$$6311 = $$$0305;$307 = $$327;
         break L8;
         break;
        }
        default: {
         ___shlim($0,0);
         while(1) {
          $119 = HEAP32[$13>>2]|0;
          $120 = HEAP32[$14>>2]|0;
          $121 = ($119>>>0)<($120>>>0);
          if ($121) {
           $122 = ((($119)) + 1|0);
           HEAP32[$13>>2] = $122;
           $123 = HEAP8[$119>>0]|0;
           $124 = $123&255;
           $126 = $124;
          } else {
           $125 = (___shgetc($0)|0);
           $126 = $125;
          }
          $127 = (_isspace($126)|0);
          $128 = ($127|0)==(0);
          if ($128) {
           break;
          }
         }
         $129 = HEAP32[$14>>2]|0;
         $130 = ($129|0)==(0|0);
         if ($130) {
          $$pre507 = HEAP32[$13>>2]|0;
          $138 = $$pre507;
         } else {
          $131 = HEAP32[$13>>2]|0;
          $132 = ((($131)) + -1|0);
          HEAP32[$13>>2] = $132;
          $133 = $132;
          $138 = $133;
         }
         $134 = HEAP32[$15>>2]|0;
         $135 = HEAP32[$16>>2]|0;
         $136 = (($134) + ($$0283428))|0;
         $137 = (($136) + ($138))|0;
         $139 = (($137) - ($135))|0;
         $$1267 = $$0266$lcssa;$$1284 = $139;
        }
        }
        ___shlim($0,$$1267);
        $140 = HEAP32[$13>>2]|0;
        $141 = HEAP32[$14>>2]|0;
        $142 = ($140>>>0)<($141>>>0);
        if ($142) {
         $143 = ((($140)) + 1|0);
         HEAP32[$13>>2] = $143;
         $147 = $141;
        } else {
         $144 = (___shgetc($0)|0);
         $145 = ($144|0)<(0);
         if ($145) {
          $$7312 = $$$0305;$309 = $$327;$narrow469 = $narrow;
          label = 137;
          break L6;
         }
         $$pre509 = HEAP32[$14>>2]|0;
         $147 = $$pre509;
        }
        $146 = ($147|0)==(0|0);
        if (!($146)) {
         $148 = HEAP32[$13>>2]|0;
         $149 = ((($148)) + -1|0);
         HEAP32[$13>>2] = $149;
        }
        L55: do {
         switch ($trunc<<24>>24) {
         case 91: case 99: case 115:  {
          $150 = ($$|0)==(99);
          $151 = $$ | 16;
          $152 = ($151|0)==(115);
          L57: do {
           if ($152) {
            $153 = ($$|0)==(115);
            _memset(($21|0),-1,256)|0;
            HEAP8[$4>>0] = 0;
            if ($153) {
             HEAP8[$18>>0] = 0;
             ;HEAP8[$17>>0]=0|0;HEAP8[$17+1>>0]=0|0;HEAP8[$17+2>>0]=0|0;HEAP8[$17+3>>0]=0|0;HEAP8[$17+4>>0]=0|0;
             $$9 = $$5;
            } else {
             $$9 = $$5;
            }
           } else {
            $154 = ((($$5)) + 1|0);
            $155 = HEAP8[$154>>0]|0;
            $156 = ($155<<24>>24)==(94);
            $157 = ((($$5)) + 2|0);
            $$0292 = $156&1;
            $$6 = $156 ? $157 : $154;
            $158 = $156&1;
            _memset(($22|0),($158|0),256)|0;
            HEAP8[$4>>0] = 0;
            $159 = HEAP8[$$6>>0]|0;
            switch ($159<<24>>24) {
            case 45:  {
             $$sink443 = $19;
             label = 64;
             break;
            }
            case 93:  {
             $$sink443 = $20;
             label = 64;
             break;
            }
            default: {
             $$pre514 = $$0292 ^ 1;
             $$pre515 = $$pre514&255;
             $$7$ph = $$6;$$pre$phi516Z2D = $$pre515;
            }
            }
            if ((label|0) == 64) {
             label = 0;
             $160 = ((($$6)) + 1|0);
             $161 = $$0292 ^ 1;
             $162 = $161&255;
             HEAP8[$$sink443>>0] = $162;
             $$7$ph = $160;$$pre$phi516Z2D = $162;
            }
            $$7 = $$7$ph;
            while(1) {
             $163 = HEAP8[$$7>>0]|0;
             L69: do {
              switch ($163<<24>>24) {
              case 0:  {
               $$7312 = $$$0305;$309 = $$327;$narrow469 = $narrow;
               label = 137;
               break L6;
               break;
              }
              case 93:  {
               $$9 = $$7;
               break L57;
               break;
              }
              case 45:  {
               $164 = ((($$7)) + 1|0);
               $165 = HEAP8[$164>>0]|0;
               switch ($165<<24>>24) {
               case 93: case 0:  {
                $$8 = $$7;$176 = 45;
                break L69;
                break;
               }
               default: {
               }
               }
               $166 = ((($$7)) + -1|0);
               $167 = HEAP8[$166>>0]|0;
               $168 = ($167&255)<($165&255);
               if ($168) {
                $169 = $167&255;
                $$0286420 = $169;
                while(1) {
                 $170 = (($$0286420) + 1)|0;
                 $171 = (($4) + ($170)|0);
                 HEAP8[$171>>0] = $$pre$phi516Z2D;
                 $172 = HEAP8[$164>>0]|0;
                 $173 = $172&255;
                 $174 = ($170|0)<($173|0);
                 if ($174) {
                  $$0286420 = $170;
                 } else {
                  $$8 = $164;$176 = $172;
                  break;
                 }
                }
               } else {
                $$8 = $164;$176 = $165;
               }
               break;
              }
              default: {
               $$8 = $$7;$176 = $163;
              }
              }
             } while(0);
             $175 = $176&255;
             $177 = (($175) + 1)|0;
             $178 = (($4) + ($177)|0);
             HEAP8[$178>>0] = $$pre$phi516Z2D;
             $179 = ((($$8)) + 1|0);
             $$7 = $179;
            }
           }
          } while(0);
          $180 = (($$1267) + 1)|0;
          $181 = $150 ? $180 : 31;
          $182 = ($$$0268|0)==(1);
          L77: do {
           if ($182) {
            if ($narrow) {
             $183 = $181 << 2;
             $184 = (_malloc($183)|0);
             $185 = ($184|0)==(0|0);
             if ($185) {
              $$7312 = 0;$309 = 0;$narrow469 = 1;
              label = 137;
              break L6;
             } else {
              $311 = $184;
             }
            } else {
             $311 = $$0293;
            }
            HEAP32[$3>>2] = 0;
            HEAP32[$$sroa$2$0$$sroa_idx13>>2] = 0;
            $$0276$ph = $181;$$0278$ph = 0;$$ph = $311;
            L82: while(1) {
             $186 = ($$ph|0)==(0|0);
             $$0278$ph336 = $$0278$ph;
             while(1) {
              L86: while(1) {
               $187 = HEAP32[$13>>2]|0;
               $188 = HEAP32[$14>>2]|0;
               $189 = ($187>>>0)<($188>>>0);
               if ($189) {
                $190 = ((($187)) + 1|0);
                HEAP32[$13>>2] = $190;
                $191 = HEAP8[$187>>0]|0;
                $192 = $191&255;
                $195 = $192;
               } else {
                $193 = (___shgetc($0)|0);
                $195 = $193;
               }
               $194 = (($195) + 1)|0;
               $196 = (($4) + ($194)|0);
               $197 = HEAP8[$196>>0]|0;
               $198 = ($197<<24>>24)==(0);
               if ($198) {
                break L82;
               }
               $199 = $195&255;
               HEAP8[$6>>0] = $199;
               $200 = (_mbrtowc($5,$6,1,$3)|0);
               switch ($200|0) {
               case -1:  {
                $$7312 = 0;$309 = $$ph;$narrow469 = $narrow;
                label = 137;
                break L6;
                break;
               }
               case -2:  {
                break;
               }
               default: {
                break L86;
               }
               }
              }
              if ($186) {
               $$1279 = $$0278$ph336;
              } else {
               $201 = (($$ph) + ($$0278$ph336<<2)|0);
               $202 = (($$0278$ph336) + 1)|0;
               $203 = HEAP32[$5>>2]|0;
               HEAP32[$201>>2] = $203;
               $$1279 = $202;
              }
              $204 = ($$1279|0)==($$0276$ph|0);
              $or$cond = $narrow & $204;
              if ($or$cond) {
               break;
              } else {
               $$0278$ph336 = $$1279;
              }
             }
             $factor331 = $$0276$ph << 1;
             $205 = $factor331 | 1;
             $206 = $205 << 2;
             $207 = (_realloc($$ph,$206)|0);
             $208 = ($207|0)==(0|0);
             if ($208) {
              $$7312 = 0;$309 = $$ph;$narrow469 = 1;
              label = 137;
              break L6;
             } else {
              $$0278$ph$phi = $$0276$ph;$$0276$ph = $205;$$ph = $207;$$0278$ph = $$0278$ph$phi;
             }
            }
            $209 = (_mbsinit($3)|0);
            $210 = ($209|0)==(0);
            if ($210) {
             $$7312 = 0;$309 = $$ph;$narrow469 = $narrow;
             label = 137;
             break L6;
            } else {
             $$4282 = $$0278$ph336;$$4309 = 0;$$5299 = $$ph;$312 = $$ph;
            }
           } else {
            if ($narrow) {
             $211 = (_malloc($181)|0);
             $212 = ($211|0)==(0|0);
             if ($212) {
              $$7312 = 0;$309 = 0;$narrow469 = 1;
              label = 137;
              break L6;
             } else {
              $$1277$ph = $181;$$2280$ph = 0;$$2307$ph = $211;
             }
             while(1) {
              $$2280 = $$2280$ph;
              while(1) {
               $213 = HEAP32[$13>>2]|0;
               $214 = HEAP32[$14>>2]|0;
               $215 = ($213>>>0)<($214>>>0);
               if ($215) {
                $216 = ((($213)) + 1|0);
                HEAP32[$13>>2] = $216;
                $217 = HEAP8[$213>>0]|0;
                $218 = $217&255;
                $221 = $218;
               } else {
                $219 = (___shgetc($0)|0);
                $221 = $219;
               }
               $220 = (($221) + 1)|0;
               $222 = (($4) + ($220)|0);
               $223 = HEAP8[$222>>0]|0;
               $224 = ($223<<24>>24)==(0);
               if ($224) {
                $$4282 = $$2280;$$4309 = $$2307$ph;$$5299 = 0;$312 = 0;
                break L77;
               }
               $225 = $221&255;
               $226 = (($$2280) + 1)|0;
               $227 = (($$2307$ph) + ($$2280)|0);
               HEAP8[$227>>0] = $225;
               $228 = ($226|0)==($$1277$ph|0);
               if ($228) {
                break;
               } else {
                $$2280 = $226;
               }
              }
              $factor = $$1277$ph << 1;
              $229 = $factor | 1;
              $230 = (_realloc($$2307$ph,$229)|0);
              $231 = ($230|0)==(0|0);
              if ($231) {
               $$7312 = $$2307$ph;$309 = 0;$narrow469 = 1;
               label = 137;
               break L6;
              } else {
               $$2280$ph$phi = $$1277$ph;$$1277$ph = $229;$$2307$ph = $230;$$2280$ph = $$2280$ph$phi;
              }
             }
            }
            $232 = ($$0293|0)==(0|0);
            if ($232) {
             $250 = $147;
             while(1) {
              $248 = HEAP32[$13>>2]|0;
              $249 = ($248>>>0)<($250>>>0);
              if ($249) {
               $251 = ((($248)) + 1|0);
               HEAP32[$13>>2] = $251;
               $252 = HEAP8[$248>>0]|0;
               $253 = $252&255;
               $256 = $253;
              } else {
               $254 = (___shgetc($0)|0);
               $256 = $254;
              }
              $255 = (($256) + 1)|0;
              $257 = (($4) + ($255)|0);
              $258 = HEAP8[$257>>0]|0;
              $259 = ($258<<24>>24)==(0);
              if ($259) {
               $$4282 = 0;$$4309 = 0;$$5299 = 0;$312 = 0;
               break L77;
              }
              $$pre512 = HEAP32[$14>>2]|0;
              $250 = $$pre512;
             }
            } else {
             $$3281 = 0;$235 = $147;
             while(1) {
              $233 = HEAP32[$13>>2]|0;
              $234 = ($233>>>0)<($235>>>0);
              if ($234) {
               $236 = ((($233)) + 1|0);
               HEAP32[$13>>2] = $236;
               $237 = HEAP8[$233>>0]|0;
               $238 = $237&255;
               $241 = $238;
              } else {
               $239 = (___shgetc($0)|0);
               $241 = $239;
              }
              $240 = (($241) + 1)|0;
              $242 = (($4) + ($240)|0);
              $243 = HEAP8[$242>>0]|0;
              $244 = ($243<<24>>24)==(0);
              if ($244) {
               $$4282 = $$3281;$$4309 = $$0293;$$5299 = 0;$312 = 0;
               break L77;
              }
              $245 = $241&255;
              $246 = (($$3281) + 1)|0;
              $247 = (($$0293) + ($$3281)|0);
              HEAP8[$247>>0] = $245;
              $$pre511 = HEAP32[$14>>2]|0;
              $$3281 = $246;$235 = $$pre511;
             }
            }
           }
          } while(0);
          $260 = HEAP32[$14>>2]|0;
          $261 = ($260|0)==(0|0);
          if ($261) {
           $$pre513 = HEAP32[$13>>2]|0;
           $268 = $$pre513;
          } else {
           $262 = HEAP32[$13>>2]|0;
           $263 = ((($262)) + -1|0);
           HEAP32[$13>>2] = $263;
           $264 = $263;
           $268 = $264;
          }
          $265 = HEAP32[$15>>2]|0;
          $266 = HEAP32[$16>>2]|0;
          $267 = (($268) - ($266))|0;
          $269 = (($267) + ($265))|0;
          $270 = ($269|0)==(0);
          if ($270) {
           $$9314$ph = $$4309;$$ph353 = $312;
           label = 139;
           break L6;
          }
          $$not = $150 ^ 1;
          $271 = ($269|0)==($$1267|0);
          $or$cond318 = $271 | $$not;
          if (!($or$cond318)) {
           $$9314$ph = $$4309;$$ph353 = $312;
           label = 139;
           break L6;
          }
          do {
           if ($narrow) {
            if ($182) {
             HEAP32[$$0293>>2] = $$5299;
             break;
            } else {
             HEAP32[$$0293>>2] = $$4309;
             break;
            }
           }
          } while(0);
          if ($150) {
           $$10 = $$9;$$5310 = $$4309;$310 = $312;
          } else {
           $272 = ($$5299|0)==(0|0);
           if (!($272)) {
            $273 = (($$5299) + ($$4282<<2)|0);
            HEAP32[$273>>2] = 0;
           }
           $274 = ($$4309|0)==(0|0);
           if ($274) {
            $$10 = $$9;$$5310 = 0;$310 = $312;
            break L55;
           }
           $275 = (($$4309) + ($$4282)|0);
           HEAP8[$275>>0] = 0;
           $$10 = $$9;$$5310 = $$4309;$310 = $312;
          }
          break;
         }
         case 120: case 88: case 112:  {
          $$0272 = 16;
          label = 125;
          break;
         }
         case 111:  {
          $$0272 = 8;
          label = 125;
          break;
         }
         case 117: case 100:  {
          $$0272 = 10;
          label = 125;
          break;
         }
         case 105:  {
          $$0272 = 0;
          label = 125;
          break;
         }
         case 71: case 103: case 70: case 102: case 69: case 101: case 65: case 97:  {
          $285 = (+___floatscan($0,$$$0268,0));
          $286 = HEAP32[$15>>2]|0;
          $287 = HEAP32[$13>>2]|0;
          $288 = HEAP32[$16>>2]|0;
          $289 = (($288) - ($287))|0;
          $290 = ($286|0)==($289|0);
          if ($290) {
           $$9314$ph = $$$0305;$$ph353 = $$327;
           label = 139;
           break L6;
          }
          $291 = ($$0293|0)==(0|0);
          if ($291) {
           $$10 = $$5;$$5310 = $$$0305;$310 = $$327;
          } else {
           switch ($$$0268|0) {
           case 0:  {
            $292 = $285;
            HEAPF32[$$0293>>2] = $292;
            $$10 = $$5;$$5310 = $$$0305;$310 = $$327;
            break L55;
            break;
           }
           case 1:  {
            HEAPF64[$$0293>>3] = $285;
            $$10 = $$5;$$5310 = $$$0305;$310 = $$327;
            break L55;
            break;
           }
           case 2:  {
            HEAPF64[$$0293>>3] = $285;
            $$10 = $$5;$$5310 = $$$0305;$310 = $$327;
            break L55;
            break;
           }
           default: {
            $$10 = $$5;$$5310 = $$$0305;$310 = $$327;
            break L55;
           }
           }
          }
          break;
         }
         default: {
          $$10 = $$5;$$5310 = $$$0305;$310 = $$327;
         }
         }
        } while(0);
        do {
         if ((label|0) == 125) {
          label = 0;
          $276 = (___intscan($0,$$0272,0,-1,-1)|0);
          $277 = tempRet0;
          $278 = HEAP32[$15>>2]|0;
          $279 = HEAP32[$13>>2]|0;
          $280 = HEAP32[$16>>2]|0;
          $281 = (($280) - ($279))|0;
          $282 = ($278|0)==($281|0);
          if ($282) {
           $$9314$ph = $$$0305;$$ph353 = $$327;
           label = 139;
           break L6;
          }
          $283 = ($$|0)==(112);
          $or$cond3 = $100 & $283;
          if ($or$cond3) {
           $284 = $276;
           HEAP32[$$0293>>2] = $284;
           $$10 = $$5;$$5310 = $$$0305;$310 = $$327;
           break;
          } else {
           _store_int($$0293,$$$0268,$276,$277);
           $$10 = $$5;$$5310 = $$$0305;$310 = $$327;
           break;
          }
         }
        } while(0);
        $293 = HEAP32[$15>>2]|0;
        $294 = HEAP32[$13>>2]|0;
        $295 = HEAP32[$16>>2]|0;
        $296 = (($293) + ($$1284))|0;
        $297 = (($296) + ($294))|0;
        $298 = (($297) - ($295))|0;
        $299 = $100&1;
        $$0288$ = (($299) + ($$0288425))|0;
        $$11 = $$10;$$1289 = $$0288$;$$2285 = $298;$$6311 = $$5310;$307 = $310;
        break L8;
       }
      } while(0);
      $56 = $53&1;
      $57 = (($$0273429) + ($56)|0);
      ___shlim($0,0);
      $58 = HEAP32[$13>>2]|0;
      $59 = HEAP32[$14>>2]|0;
      $60 = ($58>>>0)<($59>>>0);
      if ($60) {
       $61 = ((($58)) + 1|0);
       HEAP32[$13>>2] = $61;
       $62 = HEAP8[$58>>0]|0;
       $63 = $62&255;
       $68 = $63;
      } else {
       $64 = (___shgetc($0)|0);
       $68 = $64;
      }
      $65 = HEAP8[$57>>0]|0;
      $66 = $65&255;
      $67 = ($68|0)==($66|0);
      if (!($67)) {
       label = 22;
       break L6;
      }
      $75 = (($$0283428) + 1)|0;
      $$11 = $57;$$1289 = $$0288425;$$2285 = $75;$$6311 = $$0305423;$307 = $102;
     } else {
      $$1274 = $$0273429;
      while(1) {
       $27 = ((($$1274)) + 1|0);
       $28 = HEAP8[$27>>0]|0;
       $29 = $28&255;
       $30 = (_isspace($29)|0);
       $31 = ($30|0)==(0);
       if ($31) {
        break;
       } else {
        $$1274 = $27;
       }
      }
      ___shlim($0,0);
      while(1) {
       $32 = HEAP32[$13>>2]|0;
       $33 = HEAP32[$14>>2]|0;
       $34 = ($32>>>0)<($33>>>0);
       if ($34) {
        $35 = ((($32)) + 1|0);
        HEAP32[$13>>2] = $35;
        $36 = HEAP8[$32>>0]|0;
        $37 = $36&255;
        $39 = $37;
       } else {
        $38 = (___shgetc($0)|0);
        $39 = $38;
       }
       $40 = (_isspace($39)|0);
       $41 = ($40|0)==(0);
       if ($41) {
        break;
       }
      }
      $42 = HEAP32[$14>>2]|0;
      $43 = ($42|0)==(0|0);
      if ($43) {
       $$pre = HEAP32[$13>>2]|0;
       $51 = $$pre;
      } else {
       $44 = HEAP32[$13>>2]|0;
       $45 = ((($44)) + -1|0);
       HEAP32[$13>>2] = $45;
       $46 = $45;
       $51 = $46;
      }
      $47 = HEAP32[$15>>2]|0;
      $48 = HEAP32[$16>>2]|0;
      $49 = (($47) + ($$0283428))|0;
      $50 = (($49) + ($51))|0;
      $52 = (($50) - ($48))|0;
      $$11 = $$1274;$$1289 = $$0288425;$$2285 = $52;$$6311 = $$0305423;$307 = $102;
     }
    } while(0);
    $300 = ((($$11)) + 1|0);
    $301 = HEAP8[$300>>0]|0;
    $302 = ($301<<24>>24)==(0);
    if ($302) {
     $$3291 = $$1289;
     break L4;
    } else {
     $$0273429 = $300;$$0283428 = $$2285;$$0288425 = $$1289;$$0305423 = $$6311;$102 = $307;$24 = $301;
    }
   }
   if ((label|0) == 22) {
    $69 = HEAP32[$14>>2]|0;
    $70 = ($69|0)==(0|0);
    if (!($70)) {
     $71 = HEAP32[$13>>2]|0;
     $72 = ((($71)) + -1|0);
     HEAP32[$13>>2] = $72;
    }
    $73 = ($68|0)>(-1);
    $74 = ($$0288425|0)!=(0);
    $or$cond5 = $74 | $73;
    if ($or$cond5) {
     $$3291 = $$0288425;
     break;
    } else {
     $$1271 = 0;$$8313 = $$0305423;$308 = $102;
     label = 138;
    }
   }
   else if ((label|0) == 137) {
    $$328$le441 = $narrow469&1;
    $$old4 = ($$0288425|0)==(0);
    if ($$old4) {
     $$1271 = $$328$le441;$$8313 = $$7312;$308 = $309;
     label = 138;
    } else {
     $$2 = $$328$le441;$$2290 = $$0288425;$$9314 = $$7312;$304 = $309;
    }
   }
   else if ((label|0) == 139) {
    $$328$le439 = $narrow&1;
    $$2 = $$328$le439;$$2290 = $$0288425;$$9314 = $$9314$ph;$304 = $$ph353;
   }
   if ((label|0) == 138) {
    $$2 = $$1271;$$2290 = -1;$$9314 = $$8313;$304 = $308;
   }
   $303 = ($$2|0)==(0);
   if ($303) {
    $$3291 = $$2290;
   } else {
    _free($$9314);
    _free($304);
    $$3291 = $$2290;
   }
  }
 } while(0);
 $305 = ($306|0)==(0);
 if (!($305)) {
  ___unlockfile($0);
 }
 STACKTOP = sp;return ($$3291|0);
}
function _arg_n($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$0 = 0, $10 = 0, $11 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $arglist_current = 0, $arglist_next = 0, $expanded = 0, $expanded1 = 0, $expanded3 = 0, $expanded4 = 0, $expanded5 = 0, $vacopy_currentptr = 0, label = 0;
 var sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $2 = sp;
 $vacopy_currentptr = HEAP32[$0>>2]|0;
 HEAP32[$2>>2] = $vacopy_currentptr;
 $$0 = $1;
 while(1) {
  $3 = ($$0>>>0)>(1);
  $arglist_current = HEAP32[$2>>2]|0;
  $4 = $arglist_current;
  $5 = ((0) + 4|0);
  $expanded1 = $5;
  $expanded = (($expanded1) - 1)|0;
  $6 = (($4) + ($expanded))|0;
  $7 = ((0) + 4|0);
  $expanded5 = $7;
  $expanded4 = (($expanded5) - 1)|0;
  $expanded3 = $expanded4 ^ -1;
  $8 = $6 & $expanded3;
  $9 = $8;
  $10 = HEAP32[$9>>2]|0;
  $arglist_next = ((($9)) + 4|0);
  HEAP32[$2>>2] = $arglist_next;
  $11 = (($$0) + -1)|0;
  if ($3) {
   $$0 = $11;
  } else {
   break;
  }
 }
 STACKTOP = sp;return ($10|0);
}
function _store_int($0,$1,$2,$3) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 var $10 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $4 = ($0|0)==(0|0);
 L1: do {
  if (!($4)) {
   switch ($1|0) {
   case -2:  {
    $5 = $2&255;
    HEAP8[$0>>0] = $5;
    break L1;
    break;
   }
   case -1:  {
    $6 = $2&65535;
    HEAP16[$0>>1] = $6;
    break L1;
    break;
   }
   case 0:  {
    HEAP32[$0>>2] = $2;
    break L1;
    break;
   }
   case 1:  {
    HEAP32[$0>>2] = $2;
    break L1;
    break;
   }
   case 3:  {
    $7 = $0;
    $8 = $7;
    HEAP32[$8>>2] = $2;
    $9 = (($7) + 4)|0;
    $10 = $9;
    HEAP32[$10>>2] = $3;
    break L1;
    break;
   }
   default: {
    break L1;
   }
   }
  }
 } while(0);
 return;
}
function _mbsinit($0) {
 $0 = $0|0;
 var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = ($0|0)==(0|0);
 if ($1) {
  $5 = 1;
 } else {
  $2 = HEAP32[$0>>2]|0;
  $3 = ($2|0)==(0);
  $5 = $3;
 }
 $4 = $5&1;
 return ($4|0);
}
function ___string_read($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $$027 = 0, $$027$ = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $3 = ((($0)) + 84|0);
 $4 = HEAP32[$3>>2]|0;
 $5 = (($2) + 256)|0;
 $6 = (_memchr($4,0,$5)|0);
 $7 = ($6|0)==(0|0);
 $8 = $6;
 $9 = $4;
 $10 = (($8) - ($9))|0;
 $$027 = $7 ? $5 : $10;
 $11 = ($$027>>>0)<($2>>>0);
 $$027$ = $11 ? $$027 : $2;
 _memcpy(($1|0),($4|0),($$027$|0))|0;
 $12 = (($4) + ($$027$)|0);
 $13 = ((($0)) + 4|0);
 HEAP32[$13>>2] = $12;
 $14 = (($4) + ($$027)|0);
 $15 = ((($0)) + 8|0);
 HEAP32[$15>>2] = $14;
 HEAP32[$3>>2] = $14;
 return ($$027$|0);
}
function _fseek($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $3 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $3 = (___fseeko($0,$1,$2)|0);
 return ($3|0);
}
function ___fseeko($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $phitmp = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $3 = ((($0)) + 76|0);
 $4 = HEAP32[$3>>2]|0;
 $5 = ($4|0)>(-1);
 if ($5) {
  $7 = (___lockfile($0)|0);
  $phitmp = ($7|0)==(0);
  $8 = (___fseeko_unlocked($0,$1,$2)|0);
  if ($phitmp) {
   $9 = $8;
  } else {
   ___unlockfile($0);
   $9 = $8;
  }
 } else {
  $6 = (___fseeko_unlocked($0,$1,$2)|0);
  $9 = $6;
 }
 return ($9|0);
}
function ___fseeko_unlocked($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $$0 = 0, $$019 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0;
 var $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $3 = ($2|0)==(1);
 if ($3) {
  $4 = ((($0)) + 8|0);
  $5 = HEAP32[$4>>2]|0;
  $6 = ((($0)) + 4|0);
  $7 = HEAP32[$6>>2]|0;
  $8 = (($1) - ($5))|0;
  $9 = (($8) + ($7))|0;
  $$019 = $9;
 } else {
  $$019 = $1;
 }
 $10 = ((($0)) + 20|0);
 $11 = HEAP32[$10>>2]|0;
 $12 = ((($0)) + 28|0);
 $13 = HEAP32[$12>>2]|0;
 $14 = ($11>>>0)>($13>>>0);
 if ($14) {
  $15 = ((($0)) + 36|0);
  $16 = HEAP32[$15>>2]|0;
  (FUNCTION_TABLE_iiii[$16 & 15]($0,0,0)|0);
  $17 = HEAP32[$10>>2]|0;
  $18 = ($17|0)==(0|0);
  if ($18) {
   $$0 = -1;
  } else {
   label = 5;
  }
 } else {
  label = 5;
 }
 if ((label|0) == 5) {
  $19 = ((($0)) + 16|0);
  HEAP32[$19>>2] = 0;
  HEAP32[$12>>2] = 0;
  HEAP32[$10>>2] = 0;
  $20 = ((($0)) + 40|0);
  $21 = HEAP32[$20>>2]|0;
  $22 = (FUNCTION_TABLE_iiii[$21 & 15]($0,$$019,$2)|0);
  $23 = ($22|0)<(0);
  if ($23) {
   $$0 = -1;
  } else {
   $24 = ((($0)) + 8|0);
   HEAP32[$24>>2] = 0;
   $25 = ((($0)) + 4|0);
   HEAP32[$25>>2] = 0;
   $26 = HEAP32[$0>>2]|0;
   $27 = $26 & -17;
   HEAP32[$0>>2] = $27;
   $$0 = 0;
  }
 }
 return ($$0|0);
}
function _strstr($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$0 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0;
 var $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = HEAP8[$1>>0]|0;
 $3 = ($2<<24>>24)==(0);
 do {
  if ($3) {
   $$0 = $0;
  } else {
   $4 = $2 << 24 >> 24;
   $5 = (_strchr($0,$4)|0);
   $6 = ($5|0)==(0|0);
   if ($6) {
    $$0 = 0;
   } else {
    $7 = ((($1)) + 1|0);
    $8 = HEAP8[$7>>0]|0;
    $9 = ($8<<24>>24)==(0);
    if ($9) {
     $$0 = $5;
    } else {
     $10 = ((($5)) + 1|0);
     $11 = HEAP8[$10>>0]|0;
     $12 = ($11<<24>>24)==(0);
     if ($12) {
      $$0 = 0;
     } else {
      $13 = ((($1)) + 2|0);
      $14 = HEAP8[$13>>0]|0;
      $15 = ($14<<24>>24)==(0);
      if ($15) {
       $16 = (_twobyte_strstr($5,$1)|0);
       $$0 = $16;
       break;
      }
      $17 = ((($5)) + 2|0);
      $18 = HEAP8[$17>>0]|0;
      $19 = ($18<<24>>24)==(0);
      if ($19) {
       $$0 = 0;
      } else {
       $20 = ((($1)) + 3|0);
       $21 = HEAP8[$20>>0]|0;
       $22 = ($21<<24>>24)==(0);
       if ($22) {
        $23 = (_threebyte_strstr($5,$1)|0);
        $$0 = $23;
        break;
       }
       $24 = ((($5)) + 3|0);
       $25 = HEAP8[$24>>0]|0;
       $26 = ($25<<24>>24)==(0);
       if ($26) {
        $$0 = 0;
       } else {
        $27 = ((($1)) + 4|0);
        $28 = HEAP8[$27>>0]|0;
        $29 = ($28<<24>>24)==(0);
        if ($29) {
         $30 = (_fourbyte_strstr($5,$1)|0);
         $$0 = $30;
         break;
        } else {
         $31 = (_twoway_strstr($5,$1)|0);
         $$0 = $31;
         break;
        }
       }
      }
     }
    }
   }
  }
 } while(0);
 return ($$0|0);
}
function _twobyte_strstr($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$lcssa = 0, $$sink = 0, $$sink$in = 0, $$sink$masked = 0, $$sink17$sink = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0;
 var label = 0, sp = 0;
 sp = STACKTOP;
 $2 = HEAP8[$1>>0]|0;
 $3 = $2&255;
 $4 = $3 << 8;
 $5 = ((($1)) + 1|0);
 $6 = HEAP8[$5>>0]|0;
 $7 = $6&255;
 $8 = $4 | $7;
 $9 = HEAP8[$0>>0]|0;
 $10 = $9&255;
 $$sink$in = $10;$$sink17$sink = $0;
 while(1) {
  $11 = ((($$sink17$sink)) + 1|0);
  $12 = HEAP8[$11>>0]|0;
  $13 = ($12<<24>>24)==(0);
  if ($13) {
   $$lcssa = 0;
   break;
  }
  $$sink = $$sink$in << 8;
  $14 = $12&255;
  $$sink$masked = $$sink & 65280;
  $15 = $14 | $$sink$masked;
  $16 = ($15|0)==($8|0);
  if ($16) {
   $$lcssa = $$sink17$sink;
   break;
  } else {
   $$sink$in = $15;$$sink17$sink = $11;
  }
 }
 return ($$lcssa|0);
}
function _threebyte_strstr($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$016$lcssa = 0, $$01619 = 0, $$020 = 0, $$lcssa = 0, $$not = 0, $$not17 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0;
 var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $4 = 0, $5 = 0, $6 = 0;
 var $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond18 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = HEAP8[$1>>0]|0;
 $3 = $2&255;
 $4 = $3 << 24;
 $5 = ((($1)) + 1|0);
 $6 = HEAP8[$5>>0]|0;
 $7 = $6&255;
 $8 = $7 << 16;
 $9 = $8 | $4;
 $10 = ((($1)) + 2|0);
 $11 = HEAP8[$10>>0]|0;
 $12 = $11&255;
 $13 = $12 << 8;
 $14 = $9 | $13;
 $15 = HEAP8[$0>>0]|0;
 $16 = $15&255;
 $17 = $16 << 24;
 $18 = ((($0)) + 1|0);
 $19 = HEAP8[$18>>0]|0;
 $20 = $19&255;
 $21 = $20 << 16;
 $22 = $21 | $17;
 $23 = ((($0)) + 2|0);
 $24 = HEAP8[$23>>0]|0;
 $25 = $24&255;
 $26 = $25 << 8;
 $27 = $22 | $26;
 $28 = ($24<<24>>24)!=(0);
 $$not17 = $28 ^ 1;
 $29 = ($27|0)==($14|0);
 $or$cond18 = $29 | $$not17;
 if ($or$cond18) {
  $$016$lcssa = $23;$$lcssa = $28;
 } else {
  $$01619 = $23;$$020 = $27;
  while(1) {
   $30 = ((($$01619)) + 1|0);
   $31 = HEAP8[$30>>0]|0;
   $32 = $31&255;
   $33 = $32 | $$020;
   $34 = $33 << 8;
   $35 = ($31<<24>>24)!=(0);
   $$not = $35 ^ 1;
   $36 = ($34|0)==($14|0);
   $or$cond = $36 | $$not;
   if ($or$cond) {
    $$016$lcssa = $30;$$lcssa = $35;
    break;
   } else {
    $$01619 = $30;$$020 = $34;
   }
  }
 }
 $37 = ((($$016$lcssa)) + -2|0);
 $38 = $$lcssa ? $37 : 0;
 return ($38|0);
}
function _fourbyte_strstr($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$lcssa = 0, $$not = 0, $$not22 = 0, $$sink21$lcssa = 0, $$sink2124 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0;
 var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0;
 var $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond23 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = HEAP8[$1>>0]|0;
 $3 = $2&255;
 $4 = $3 << 24;
 $5 = ((($1)) + 1|0);
 $6 = HEAP8[$5>>0]|0;
 $7 = $6&255;
 $8 = $7 << 16;
 $9 = $8 | $4;
 $10 = ((($1)) + 2|0);
 $11 = HEAP8[$10>>0]|0;
 $12 = $11&255;
 $13 = $12 << 8;
 $14 = $9 | $13;
 $15 = ((($1)) + 3|0);
 $16 = HEAP8[$15>>0]|0;
 $17 = $16&255;
 $18 = $14 | $17;
 $19 = HEAP8[$0>>0]|0;
 $20 = $19&255;
 $21 = $20 << 24;
 $22 = ((($0)) + 1|0);
 $23 = HEAP8[$22>>0]|0;
 $24 = $23&255;
 $25 = $24 << 16;
 $26 = $25 | $21;
 $27 = ((($0)) + 2|0);
 $28 = HEAP8[$27>>0]|0;
 $29 = $28&255;
 $30 = $29 << 8;
 $31 = $26 | $30;
 $32 = ((($0)) + 3|0);
 $33 = HEAP8[$32>>0]|0;
 $34 = $33&255;
 $35 = $34 | $31;
 $36 = ($33<<24>>24)!=(0);
 $$not22 = $36 ^ 1;
 $37 = ($35|0)==($18|0);
 $or$cond23 = $37 | $$not22;
 if ($or$cond23) {
  $$lcssa = $36;$$sink21$lcssa = $32;
 } else {
  $$sink2124 = $32;$39 = $35;
  while(1) {
   $38 = $39 << 8;
   $40 = ((($$sink2124)) + 1|0);
   $41 = HEAP8[$40>>0]|0;
   $42 = $41&255;
   $43 = $42 | $38;
   $44 = ($41<<24>>24)!=(0);
   $$not = $44 ^ 1;
   $45 = ($43|0)==($18|0);
   $or$cond = $45 | $$not;
   if ($or$cond) {
    $$lcssa = $44;$$sink21$lcssa = $40;
    break;
   } else {
    $$sink2124 = $40;$39 = $43;
   }
  }
 }
 $46 = ((($$sink21$lcssa)) + -3|0);
 $47 = $$lcssa ? $46 : 0;
 return ($47|0);
}
function _twoway_strstr($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$0166 = 0, $$0168 = 0, $$0169 = 0, $$0169$be = 0, $$0170 = 0, $$0175$ph$ph$lcssa220 = 0, $$0175$ph$ph$lcssa220323 = 0, $$0175$ph$ph256 = 0, $$0179244 = 0, $$0183$ph200$ph255 = 0, $$0183$ph200250 = 0, $$0183$ph262 = 0, $$0185$ph$lcssa = 0, $$0185$ph$lcssa322 = 0, $$0185$ph261 = 0, $$0187$lcssa320321 = 0, $$0187266 = 0, $$1176$$0175 = 0, $$1176$ph$ph$lcssa211 = 0, $$1176$ph$ph235 = 0;
 var $$1180224 = 0, $$1184$ph196$ph234 = 0, $$1184$ph196229 = 0, $$1184$ph241 = 0, $$1186$$0185 = 0, $$1186$$0185$ = 0, $$1186$ph$lcssa = 0, $$1186$ph240 = 0, $$2181 = 0, $$2181$sink = 0, $$3 = 0, $$3173 = 0, $$3178 = 0, $$3182223 = 0, $$4 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0;
 var $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0;
 var $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0;
 var $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0;
 var $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0;
 var $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0;
 var $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0;
 var $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $cond = 0, $cond191 = 0, $cond191222 = 0, $cond265 = 0, $div = 0, $div188 = 0, $or$cond = 0, $or$cond190 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 1056|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(1056|0);
 $2 = sp + 1024|0;
 $3 = sp;
 ;HEAP32[$2>>2]=0|0;HEAP32[$2+4>>2]=0|0;HEAP32[$2+8>>2]=0|0;HEAP32[$2+12>>2]=0|0;HEAP32[$2+16>>2]=0|0;HEAP32[$2+20>>2]=0|0;HEAP32[$2+24>>2]=0|0;HEAP32[$2+28>>2]=0|0;
 $4 = HEAP8[$1>>0]|0;
 $cond265 = ($4<<24>>24)==(0);
 L1: do {
  if ($cond265) {
   $$0175$ph$ph$lcssa220323 = 1;$$0185$ph$lcssa322 = -1;$$0187$lcssa320321 = 0;$$1176$ph$ph$lcssa211 = 1;$$1186$ph$lcssa = -1;
   label = 27;
  } else {
   $5 = $4&255;
   $$0187266 = 0;$12 = $4;$20 = $5;
   while(1) {
    $8 = (($0) + ($$0187266)|0);
    $9 = HEAP8[$8>>0]|0;
    $10 = ($9<<24>>24)==(0);
    if ($10) {
     $$3 = 0;
     break L1;
    }
    $11 = $12 & 31;
    $13 = $11&255;
    $14 = 1 << $13;
    $div188 = ($12&255) >>> 5;
    $15 = $div188&255;
    $16 = (($2) + ($15<<2)|0);
    $17 = HEAP32[$16>>2]|0;
    $18 = $17 | $14;
    HEAP32[$16>>2] = $18;
    $7 = (($$0187266) + 1)|0;
    $19 = (($3) + ($20<<2)|0);
    HEAP32[$19>>2] = $7;
    $21 = (($1) + ($7)|0);
    $22 = HEAP8[$21>>0]|0;
    $23 = $22&255;
    $cond = ($22<<24>>24)==(0);
    if ($cond) {
     break;
    } else {
     $$0187266 = $7;$12 = $22;$20 = $23;
    }
   }
   $6 = ($7>>>0)>(1);
   if ($6) {
    $$0183$ph262 = 0;$$0185$ph261 = -1;$129 = 1;
    L7: while(1) {
     $$0175$ph$ph256 = 1;$$0183$ph200$ph255 = $$0183$ph262;$132 = $129;
     while(1) {
      $$0183$ph200250 = $$0183$ph200$ph255;$131 = $132;
      L11: while(1) {
       $$0179244 = 1;$31 = $131;
       while(1) {
        $27 = (($$0179244) + ($$0185$ph261))|0;
        $28 = (($1) + ($27)|0);
        $29 = HEAP8[$28>>0]|0;
        $30 = (($1) + ($31)|0);
        $32 = HEAP8[$30>>0]|0;
        $33 = ($29<<24>>24)==($32<<24>>24);
        if (!($33)) {
         break L11;
        }
        $34 = ($$0179244|0)==($$0175$ph$ph256|0);
        $25 = (($$0179244) + 1)|0;
        if ($34) {
         break;
        }
        $24 = (($25) + ($$0183$ph200250))|0;
        $26 = ($24>>>0)<($7>>>0);
        if ($26) {
         $$0179244 = $25;$31 = $24;
        } else {
         $$0175$ph$ph$lcssa220 = $$0175$ph$ph256;$$0185$ph$lcssa = $$0185$ph261;
         break L7;
        }
       }
       $35 = (($$0175$ph$ph256) + ($$0183$ph200250))|0;
       $36 = (($35) + 1)|0;
       $37 = ($36>>>0)<($7>>>0);
       if ($37) {
        $$0183$ph200250 = $35;$131 = $36;
       } else {
        $$0175$ph$ph$lcssa220 = $$0175$ph$ph256;$$0185$ph$lcssa = $$0185$ph261;
        break L7;
       }
      }
      $38 = ($29&255)>($32&255);
      $39 = (($31) - ($$0185$ph261))|0;
      if (!($38)) {
       break;
      }
      $43 = (($31) + 1)|0;
      $44 = ($43>>>0)<($7>>>0);
      if ($44) {
       $$0175$ph$ph256 = $39;$$0183$ph200$ph255 = $31;$132 = $43;
      } else {
       $$0175$ph$ph$lcssa220 = $39;$$0185$ph$lcssa = $$0185$ph261;
       break L7;
      }
     }
     $40 = (($$0183$ph200250) + 1)|0;
     $41 = (($$0183$ph200250) + 2)|0;
     $42 = ($41>>>0)<($7>>>0);
     if ($42) {
      $$0183$ph262 = $40;$$0185$ph261 = $$0183$ph200250;$129 = $41;
     } else {
      $$0175$ph$ph$lcssa220 = 1;$$0185$ph$lcssa = $$0183$ph200250;
      break;
     }
    }
    if ($6) {
     $$1184$ph241 = 0;$$1186$ph240 = -1;$130 = 1;
     while(1) {
      $$1176$ph$ph235 = 1;$$1184$ph196$ph234 = $$1184$ph241;$134 = $130;
      while(1) {
       $$1184$ph196229 = $$1184$ph196$ph234;$133 = $134;
       L26: while(1) {
        $$1180224 = 1;$52 = $133;
        while(1) {
         $48 = (($$1180224) + ($$1186$ph240))|0;
         $49 = (($1) + ($48)|0);
         $50 = HEAP8[$49>>0]|0;
         $51 = (($1) + ($52)|0);
         $53 = HEAP8[$51>>0]|0;
         $54 = ($50<<24>>24)==($53<<24>>24);
         if (!($54)) {
          break L26;
         }
         $55 = ($$1180224|0)==($$1176$ph$ph235|0);
         $46 = (($$1180224) + 1)|0;
         if ($55) {
          break;
         }
         $45 = (($46) + ($$1184$ph196229))|0;
         $47 = ($45>>>0)<($7>>>0);
         if ($47) {
          $$1180224 = $46;$52 = $45;
         } else {
          $$0175$ph$ph$lcssa220323 = $$0175$ph$ph$lcssa220;$$0185$ph$lcssa322 = $$0185$ph$lcssa;$$0187$lcssa320321 = $7;$$1176$ph$ph$lcssa211 = $$1176$ph$ph235;$$1186$ph$lcssa = $$1186$ph240;
          label = 27;
          break L1;
         }
        }
        $56 = (($$1176$ph$ph235) + ($$1184$ph196229))|0;
        $57 = (($56) + 1)|0;
        $58 = ($57>>>0)<($7>>>0);
        if ($58) {
         $$1184$ph196229 = $56;$133 = $57;
        } else {
         $$0175$ph$ph$lcssa220323 = $$0175$ph$ph$lcssa220;$$0185$ph$lcssa322 = $$0185$ph$lcssa;$$0187$lcssa320321 = $7;$$1176$ph$ph$lcssa211 = $$1176$ph$ph235;$$1186$ph$lcssa = $$1186$ph240;
         label = 27;
         break L1;
        }
       }
       $59 = ($50&255)<($53&255);
       $60 = (($52) - ($$1186$ph240))|0;
       if (!($59)) {
        break;
       }
       $64 = (($52) + 1)|0;
       $65 = ($64>>>0)<($7>>>0);
       if ($65) {
        $$1176$ph$ph235 = $60;$$1184$ph196$ph234 = $52;$134 = $64;
       } else {
        $$0175$ph$ph$lcssa220323 = $$0175$ph$ph$lcssa220;$$0185$ph$lcssa322 = $$0185$ph$lcssa;$$0187$lcssa320321 = $7;$$1176$ph$ph$lcssa211 = $60;$$1186$ph$lcssa = $$1186$ph240;
        label = 27;
        break L1;
       }
      }
      $61 = (($$1184$ph196229) + 1)|0;
      $62 = (($$1184$ph196229) + 2)|0;
      $63 = ($62>>>0)<($7>>>0);
      if ($63) {
       $$1184$ph241 = $61;$$1186$ph240 = $$1184$ph196229;$130 = $62;
      } else {
       $$0175$ph$ph$lcssa220323 = $$0175$ph$ph$lcssa220;$$0185$ph$lcssa322 = $$0185$ph$lcssa;$$0187$lcssa320321 = $7;$$1176$ph$ph$lcssa211 = 1;$$1186$ph$lcssa = $$1184$ph196229;
       label = 27;
       break;
      }
     }
    } else {
     $$0175$ph$ph$lcssa220323 = $$0175$ph$ph$lcssa220;$$0185$ph$lcssa322 = $$0185$ph$lcssa;$$0187$lcssa320321 = $7;$$1176$ph$ph$lcssa211 = 1;$$1186$ph$lcssa = -1;
     label = 27;
    }
   } else {
    $$0175$ph$ph$lcssa220323 = 1;$$0185$ph$lcssa322 = -1;$$0187$lcssa320321 = $7;$$1176$ph$ph$lcssa211 = 1;$$1186$ph$lcssa = -1;
    label = 27;
   }
  }
 } while(0);
 L36: do {
  if ((label|0) == 27) {
   $66 = (($$1186$ph$lcssa) + 1)|0;
   $67 = (($$0185$ph$lcssa322) + 1)|0;
   $68 = ($66>>>0)>($67>>>0);
   $$1176$$0175 = $68 ? $$1176$ph$ph$lcssa211 : $$0175$ph$ph$lcssa220323;
   $$1186$$0185 = $68 ? $$1186$ph$lcssa : $$0185$ph$lcssa322;
   $69 = (($1) + ($$1176$$0175)|0);
   $70 = (($$1186$$0185) + 1)|0;
   $71 = (_memcmp($1,$69,$70)|0);
   $72 = ($71|0)==(0);
   if ($72) {
    $77 = (($$0187$lcssa320321) - ($$1176$$0175))|0;
    $$0168 = $77;$$3178 = $$1176$$0175;
   } else {
    $73 = (($$0187$lcssa320321) - ($$1186$$0185))|0;
    $74 = (($73) + -1)|0;
    $75 = ($$1186$$0185>>>0)>($74>>>0);
    $$1186$$0185$ = $75 ? $$1186$$0185 : $74;
    $76 = (($$1186$$0185$) + 1)|0;
    $$0168 = 0;$$3178 = $76;
   }
   $78 = $$0187$lcssa320321 | 63;
   $79 = (($$0187$lcssa320321) + -1)|0;
   $80 = ($$0168|0)!=(0);
   $81 = (($$0187$lcssa320321) - ($$3178))|0;
   $$0166 = $0;$$0169 = 0;$$0170 = $0;
   while(1) {
    $82 = $$0170;
    $83 = $$0166;
    $84 = (($82) - ($83))|0;
    $85 = ($84>>>0)<($$0187$lcssa320321>>>0);
    do {
     if ($85) {
      $86 = (_memchr($$0170,0,$78)|0);
      $87 = ($86|0)==(0|0);
      if ($87) {
       $91 = (($$0170) + ($78)|0);
       $$3173 = $91;
       break;
      } else {
       $88 = $86;
       $89 = (($88) - ($83))|0;
       $90 = ($89>>>0)<($$0187$lcssa320321>>>0);
       if ($90) {
        $$3 = 0;
        break L36;
       } else {
        $$3173 = $86;
        break;
       }
      }
     } else {
      $$3173 = $$0170;
     }
    } while(0);
    $92 = (($$0166) + ($79)|0);
    $93 = HEAP8[$92>>0]|0;
    $div = ($93&255) >>> 5;
    $94 = $div&255;
    $95 = (($2) + ($94<<2)|0);
    $96 = HEAP32[$95>>2]|0;
    $97 = $93 & 31;
    $98 = $97&255;
    $99 = 1 << $98;
    $100 = $99 & $96;
    $101 = ($100|0)==(0);
    L50: do {
     if ($101) {
      $$0169$be = 0;$$2181$sink = $$0187$lcssa320321;
     } else {
      $102 = $93&255;
      $103 = (($3) + ($102<<2)|0);
      $104 = HEAP32[$103>>2]|0;
      $105 = (($$0187$lcssa320321) - ($104))|0;
      $106 = ($105|0)==(0);
      if (!($106)) {
       $107 = ($$0169|0)!=(0);
       $or$cond = $80 & $107;
       $108 = ($105>>>0)<($$3178>>>0);
       $or$cond190 = $or$cond & $108;
       $$2181 = $or$cond190 ? $81 : $105;
       $$0169$be = 0;$$2181$sink = $$2181;
       break;
      }
      $110 = ($70>>>0)>($$0169>>>0);
      $111 = $110 ? $70 : $$0169;
      $112 = (($1) + ($111)|0);
      $113 = HEAP8[$112>>0]|0;
      $cond191222 = ($113<<24>>24)==(0);
      L55: do {
       if ($cond191222) {
        $$4 = $70;
       } else {
        $$3182223 = $111;$117 = $113;
        while(1) {
         $114 = (($$0166) + ($$3182223)|0);
         $115 = HEAP8[$114>>0]|0;
         $116 = ($117<<24>>24)==($115<<24>>24);
         if (!($116)) {
          break;
         }
         $118 = (($$3182223) + 1)|0;
         $119 = (($1) + ($118)|0);
         $120 = HEAP8[$119>>0]|0;
         $cond191 = ($120<<24>>24)==(0);
         if ($cond191) {
          $$4 = $70;
          break L55;
         } else {
          $$3182223 = $118;$117 = $120;
         }
        }
        $121 = (($$3182223) - ($$1186$$0185))|0;
        $$0169$be = 0;$$2181$sink = $121;
        break L50;
       }
      } while(0);
      while(1) {
       $122 = ($$4>>>0)>($$0169>>>0);
       if (!($122)) {
        $$3 = $$0166;
        break L36;
       }
       $123 = (($$4) + -1)|0;
       $124 = (($1) + ($123)|0);
       $125 = HEAP8[$124>>0]|0;
       $126 = (($$0166) + ($123)|0);
       $127 = HEAP8[$126>>0]|0;
       $128 = ($125<<24>>24)==($127<<24>>24);
       if ($128) {
        $$4 = $123;
       } else {
        $$0169$be = $$0168;$$2181$sink = $$3178;
        break;
       }
      }
     }
    } while(0);
    $109 = (($$0166) + ($$2181$sink)|0);
    $$0166 = $109;$$0169 = $$0169$be;$$0170 = $$3173;
   }
  }
 } while(0);
 STACKTOP = sp;return ($$3|0);
}
function _strrchr($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $2 = 0, $3 = 0, $4 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = (_strlen($0)|0);
 $3 = (($2) + 1)|0;
 $4 = (___memrchr($0,$1,$3)|0);
 return ($4|0);
}
function ___memrchr($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $$0 = 0, $$09 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $3 = $1&255;
 $$09 = $2;
 while(1) {
  $4 = (($$09) + -1)|0;
  $5 = ($$09|0)==(0);
  if ($5) {
   $$0 = 0;
   break;
  }
  $6 = (($0) + ($4)|0);
  $7 = HEAP8[$6>>0]|0;
  $8 = ($7<<24>>24)==($3<<24>>24);
  if ($8) {
   $$0 = $6;
   break;
  } else {
   $$09 = $4;
  }
 }
 return ($$0|0);
}
function _strspn($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$0 = 0, $$01925 = 0, $$020 = 0, $$1$lcssa = 0, $$123 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0;
 var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0;
 var $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $div = 0, $div21 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
 $2 = sp;
 ;HEAP32[$2>>2]=0|0;HEAP32[$2+4>>2]=0|0;HEAP32[$2+8>>2]=0|0;HEAP32[$2+12>>2]=0|0;HEAP32[$2+16>>2]=0|0;HEAP32[$2+20>>2]=0|0;HEAP32[$2+24>>2]=0|0;HEAP32[$2+28>>2]=0|0;
 $3 = HEAP8[$1>>0]|0;
 $4 = ($3<<24>>24)==(0);
 do {
  if ($4) {
   $$0 = 0;
  } else {
   $5 = ((($1)) + 1|0);
   $6 = HEAP8[$5>>0]|0;
   $7 = ($6<<24>>24)==(0);
   if ($7) {
    $$020 = $0;
    while(1) {
     $8 = HEAP8[$$020>>0]|0;
     $9 = ($8<<24>>24)==($3<<24>>24);
     $10 = ((($$020)) + 1|0);
     if ($9) {
      $$020 = $10;
     } else {
      break;
     }
    }
    $11 = $$020;
    $12 = $0;
    $13 = (($11) - ($12))|0;
    $$0 = $13;
    break;
   } else {
    $$01925 = $1;$17 = $3;
   }
   while(1) {
    $16 = $17 & 31;
    $18 = $16&255;
    $19 = 1 << $18;
    $div21 = ($17&255) >>> 5;
    $20 = $div21&255;
    $21 = (($2) + ($20<<2)|0);
    $22 = HEAP32[$21>>2]|0;
    $23 = $22 | $19;
    HEAP32[$21>>2] = $23;
    $24 = ((($$01925)) + 1|0);
    $25 = HEAP8[$24>>0]|0;
    $26 = ($25<<24>>24)==(0);
    if ($26) {
     break;
    } else {
     $$01925 = $24;$17 = $25;
    }
   }
   $14 = HEAP8[$0>>0]|0;
   $15 = ($14<<24>>24)==(0);
   L10: do {
    if ($15) {
     $$1$lcssa = $0;
    } else {
     $$123 = $0;$27 = $14;
     while(1) {
      $div = ($27&255) >>> 5;
      $28 = $div&255;
      $29 = (($2) + ($28<<2)|0);
      $30 = HEAP32[$29>>2]|0;
      $31 = $27 & 31;
      $32 = $31&255;
      $33 = 1 << $32;
      $34 = $30 & $33;
      $35 = ($34|0)==(0);
      if ($35) {
       $$1$lcssa = $$123;
       break L10;
      }
      $36 = ((($$123)) + 1|0);
      $37 = HEAP8[$36>>0]|0;
      $38 = ($37<<24>>24)==(0);
      if ($38) {
       $$1$lcssa = $36;
       break;
      } else {
       $$123 = $36;$27 = $37;
      }
     }
    }
   } while(0);
   $39 = $$1$lcssa;
   $40 = $0;
   $41 = (($39) - ($40))|0;
   $$0 = $41;
  }
 } while(0);
 STACKTOP = sp;return ($$0|0);
}
function _srand($0) {
 $0 = $0|0;
 var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = (($0) + -1)|0;
 $2 = 20064;
 $3 = $2;
 HEAP32[$3>>2] = $1;
 $4 = (($2) + 4)|0;
 $5 = $4;
 HEAP32[$5>>2] = 0;
 return;
}
function _fread($0,$1,$2,$3) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 var $$ = 0, $$0 = 0, $$054$ph = 0, $$05460 = 0, $$056$ph = 0, $$05659 = 0, $$57 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0;
 var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0;
 var $42 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $4 = Math_imul($2, $1)|0;
 $5 = ($1|0)==(0);
 $$ = $5 ? 0 : $2;
 $6 = ((($3)) + 76|0);
 $7 = HEAP32[$6>>2]|0;
 $8 = ($7|0)>(-1);
 if ($8) {
  $9 = (___lockfile($3)|0);
  $36 = $9;
 } else {
  $36 = 0;
 }
 $10 = ((($3)) + 74|0);
 $11 = HEAP8[$10>>0]|0;
 $12 = $11 << 24 >> 24;
 $13 = (($12) + 255)|0;
 $14 = $13 | $12;
 $15 = $14&255;
 HEAP8[$10>>0] = $15;
 $16 = ((($3)) + 8|0);
 $17 = HEAP32[$16>>2]|0;
 $18 = ((($3)) + 4|0);
 $19 = HEAP32[$18>>2]|0;
 $20 = $19;
 $21 = (($17) - ($20))|0;
 $22 = ($21|0)>(0);
 $23 = ($21>>>0)<($4>>>0);
 $$57 = $23 ? $21 : $4;
 if ($22) {
  $24 = (($4) - ($$57))|0;
  $25 = (($0) + ($$57)|0);
  _memcpy(($0|0),($19|0),($$57|0))|0;
  $26 = (($19) + ($$57)|0);
  HEAP32[$18>>2] = $26;
  $$054$ph = $24;$$056$ph = $25;
 } else {
  $$054$ph = $4;$$056$ph = $0;
 }
 $27 = ($$054$ph|0)==(0);
 L7: do {
  if ($27) {
   label = 13;
  } else {
   $28 = ((($3)) + 32|0);
   $$05460 = $$054$ph;$$05659 = $$056$ph;
   while(1) {
    $29 = (___toread($3)|0);
    $30 = ($29|0)==(0);
    if (!($30)) {
     break;
    }
    $31 = HEAP32[$28>>2]|0;
    $32 = (FUNCTION_TABLE_iiii[$31 & 15]($3,$$05659,$$05460)|0);
    $33 = (($32) + 1)|0;
    $34 = ($33>>>0)<(2);
    if ($34) {
     break;
    }
    $39 = (($$05460) - ($32))|0;
    $40 = (($$05659) + ($32)|0);
    $41 = ($39|0)==(0);
    if ($41) {
     label = 13;
     break L7;
    } else {
     $$05460 = $39;$$05659 = $40;
    }
   }
   $35 = ($36|0)==(0);
   if (!($35)) {
    ___unlockfile($3);
   }
   $37 = (($4) - ($$05460))|0;
   $38 = (($37>>>0) / ($1>>>0))&-1;
   $$0 = $38;
  }
 } while(0);
 if ((label|0) == 13) {
  $42 = ($36|0)==(0);
  if ($42) {
   $$0 = $$;
  } else {
   ___unlockfile($3);
   $$0 = $$;
  }
 }
 return ($$0|0);
}
function _vprintf($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $2 = 0, $3 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = HEAP32[1025]|0;
 $3 = (_vfprintf($2,$0,$1)|0);
 return ($3|0);
}
function _strcspn($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$01824 = 0, $$019$sink = 0, $$01922 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
 var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $div = 0;
 var $div20 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
 $2 = sp;
 $3 = HEAP8[$1>>0]|0;
 $4 = ($3<<24>>24)==(0);
 L1: do {
  if ($4) {
   label = 3;
  } else {
   $5 = ((($1)) + 1|0);
   $6 = HEAP8[$5>>0]|0;
   $7 = ($6<<24>>24)==(0);
   if ($7) {
    label = 3;
   } else {
    ;HEAP32[$2>>2]=0|0;HEAP32[$2+4>>2]=0|0;HEAP32[$2+8>>2]=0|0;HEAP32[$2+12>>2]=0|0;HEAP32[$2+16>>2]=0|0;HEAP32[$2+20>>2]=0|0;HEAP32[$2+24>>2]=0|0;HEAP32[$2+28>>2]=0|0;
    $$01824 = $1;$13 = $3;
    while(1) {
     $12 = $13 & 31;
     $14 = $12&255;
     $15 = 1 << $14;
     $div20 = ($13&255) >>> 5;
     $16 = $div20&255;
     $17 = (($2) + ($16<<2)|0);
     $18 = HEAP32[$17>>2]|0;
     $19 = $18 | $15;
     HEAP32[$17>>2] = $19;
     $20 = ((($$01824)) + 1|0);
     $21 = HEAP8[$20>>0]|0;
     $22 = ($21<<24>>24)==(0);
     if ($22) {
      break;
     } else {
      $$01824 = $20;$13 = $21;
     }
    }
    $10 = HEAP8[$0>>0]|0;
    $11 = ($10<<24>>24)==(0);
    if ($11) {
     $$019$sink = $0;
    } else {
     $$01922 = $0;$23 = $10;
     while(1) {
      $div = ($23&255) >>> 5;
      $24 = $div&255;
      $25 = (($2) + ($24<<2)|0);
      $26 = HEAP32[$25>>2]|0;
      $27 = $23 & 31;
      $28 = $27&255;
      $29 = 1 << $28;
      $30 = $26 & $29;
      $31 = ($30|0)==(0);
      if (!($31)) {
       $$019$sink = $$01922;
       break L1;
      }
      $32 = ((($$01922)) + 1|0);
      $33 = HEAP8[$32>>0]|0;
      $34 = ($33<<24>>24)==(0);
      if ($34) {
       $$019$sink = $32;
       break;
      } else {
       $$01922 = $32;$23 = $33;
      }
     }
    }
   }
  }
 } while(0);
 if ((label|0) == 3) {
  $8 = $3 << 24 >> 24;
  $9 = (___strchrnul($0,$8)|0);
  $$019$sink = $9;
 }
 $35 = $$019$sink;
 $36 = $0;
 $37 = (($35) - ($36))|0;
 STACKTOP = sp;return ($37|0);
}
function _strcat($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $2 = 0, $3 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = (_strlen($0)|0);
 $3 = (($0) + ($2)|0);
 (_strcpy($3,$1)|0);
 return ($0|0);
}
function _strncat($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $$0$lcssa = 0, $$01013 = 0, $$01112 = 0, $$014 = 0, $10 = 0, $11 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $3 = (_strlen($0)|0);
 $4 = (($0) + ($3)|0);
 $5 = ($2|0)==(0);
 L1: do {
  if ($5) {
   $$0$lcssa = $4;
  } else {
   $$01013 = $2;$$01112 = $1;$$014 = $4;
   while(1) {
    $6 = HEAP8[$$01112>>0]|0;
    $7 = ($6<<24>>24)==(0);
    if ($7) {
     $$0$lcssa = $$014;
     break L1;
    }
    $8 = (($$01013) + -1)|0;
    $9 = ((($$01112)) + 1|0);
    $10 = ((($$014)) + 1|0);
    HEAP8[$$014>>0] = $6;
    $11 = ($8|0)==(0);
    if ($11) {
     $$0$lcssa = $10;
     break;
    } else {
     $$01013 = $8;$$01112 = $9;$$014 = $10;
    }
   }
  }
 } while(0);
 HEAP8[$$0$lcssa>>0] = 0;
 return ($0|0);
}
function _strtok($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$0 = 0, $$010 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = ($0|0)==(0|0);
 if ($2) {
  $3 = HEAP32[5691]|0;
  $4 = ($3|0)==(0|0);
  if ($4) {
   $$0 = 0;
  } else {
   $$010 = $3;
   label = 3;
  }
 } else {
  $$010 = $0;
  label = 3;
 }
 do {
  if ((label|0) == 3) {
   $5 = (_strspn($$010,$1)|0);
   $6 = (($$010) + ($5)|0);
   $7 = HEAP8[$6>>0]|0;
   $8 = ($7<<24>>24)==(0);
   if ($8) {
    HEAP32[5691] = 0;
    $$0 = 0;
    break;
   }
   $9 = (_strcspn($6,$1)|0);
   $10 = (($6) + ($9)|0);
   HEAP32[5691] = $10;
   $11 = HEAP8[$10>>0]|0;
   $12 = ($11<<24>>24)==(0);
   if ($12) {
    HEAP32[5691] = 0;
    $$0 = $6;
    break;
   } else {
    $13 = ((($10)) + 1|0);
    HEAP32[5691] = $13;
    HEAP8[$10>>0] = 0;
    $$0 = $6;
    break;
   }
  }
 } while(0);
 return ($$0|0);
}
function _malloc($0) {
 $0 = $0|0;
 var $$$0192$i = 0, $$$0193$i = 0, $$$4236$i = 0, $$$4351$i = 0, $$$i = 0, $$0 = 0, $$0$i$i = 0, $$0$i$i$i = 0, $$0$i18$i = 0, $$01$i$i = 0, $$0189$i = 0, $$0192$lcssa$i = 0, $$01928$i = 0, $$0193$lcssa$i = 0, $$01937$i = 0, $$0197 = 0, $$0199 = 0, $$0206$i$i = 0, $$0207$i$i = 0, $$0211$i$i = 0;
 var $$0212$i$i = 0, $$024371$i = 0, $$0287$i$i = 0, $$0288$i$i = 0, $$0289$i$i = 0, $$0295$i$i = 0, $$0296$i$i = 0, $$0342$i = 0, $$0344$i = 0, $$0345$i = 0, $$0347$i = 0, $$0353$i = 0, $$0358$i = 0, $$0359$$i = 0, $$0359$i = 0, $$0361$i = 0, $$0362$i = 0, $$0368$i = 0, $$1196$i = 0, $$1198$i = 0;
 var $$124470$i = 0, $$1291$i$i = 0, $$1293$i$i = 0, $$1343$i = 0, $$1348$i = 0, $$1363$i = 0, $$1370$i = 0, $$1374$i = 0, $$2234253237$i = 0, $$2247$ph$i = 0, $$2253$ph$i = 0, $$2355$i = 0, $$3$i = 0, $$3$i$i = 0, $$3$i201 = 0, $$3350$i = 0, $$3372$i = 0, $$4$lcssa$i = 0, $$4$ph$i = 0, $$415$i = 0;
 var $$4236$i = 0, $$4351$lcssa$i = 0, $$435114$i = 0, $$4357$$4$i = 0, $$4357$ph$i = 0, $$435713$i = 0, $$723948$i = 0, $$749$i = 0, $$pre = 0, $$pre$i = 0, $$pre$i$i = 0, $$pre$i19$i = 0, $$pre$i210 = 0, $$pre$i212 = 0, $$pre$phi$i$iZ2D = 0, $$pre$phi$i20$iZ2D = 0, $$pre$phi$i211Z2D = 0, $$pre$phi$iZ2D = 0, $$pre$phi11$i$iZ2D = 0, $$pre$phiZ2D = 0;
 var $$pre10$i$i = 0, $$sink1$i = 0, $$sink1$i$i = 0, $$sink16$i = 0, $$sink2$i = 0, $$sink2$i204 = 0, $$sink3$i = 0, $1 = 0, $10 = 0, $100 = 0, $1000 = 0, $1001 = 0, $1002 = 0, $1003 = 0, $1004 = 0, $1005 = 0, $1006 = 0, $1007 = 0, $1008 = 0, $1009 = 0;
 var $101 = 0, $1010 = 0, $1011 = 0, $1012 = 0, $1013 = 0, $1014 = 0, $1015 = 0, $1016 = 0, $1017 = 0, $1018 = 0, $1019 = 0, $102 = 0, $1020 = 0, $1021 = 0, $1022 = 0, $1023 = 0, $1024 = 0, $1025 = 0, $1026 = 0, $1027 = 0;
 var $1028 = 0, $1029 = 0, $103 = 0, $1030 = 0, $1031 = 0, $1032 = 0, $1033 = 0, $1034 = 0, $1035 = 0, $1036 = 0, $1037 = 0, $1038 = 0, $1039 = 0, $104 = 0, $1040 = 0, $1041 = 0, $1042 = 0, $1043 = 0, $1044 = 0, $1045 = 0;
 var $1046 = 0, $1047 = 0, $1048 = 0, $1049 = 0, $105 = 0, $1050 = 0, $1051 = 0, $1052 = 0, $1053 = 0, $1054 = 0, $1055 = 0, $1056 = 0, $1057 = 0, $1058 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0;
 var $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0;
 var $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0;
 var $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0;
 var $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0;
 var $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0;
 var $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0;
 var $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0;
 var $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0;
 var $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0;
 var $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0;
 var $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0;
 var $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0, $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0, $321 = 0, $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0, $327 = 0;
 var $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0, $332 = 0, $333 = 0, $334 = 0, $335 = 0, $336 = 0, $337 = 0, $338 = 0, $339 = 0, $34 = 0, $340 = 0, $341 = 0, $342 = 0, $343 = 0, $344 = 0, $345 = 0;
 var $346 = 0, $347 = 0, $348 = 0, $349 = 0, $35 = 0, $350 = 0, $351 = 0, $352 = 0, $353 = 0, $354 = 0, $355 = 0, $356 = 0, $357 = 0, $358 = 0, $359 = 0, $36 = 0, $360 = 0, $361 = 0, $362 = 0, $363 = 0;
 var $364 = 0, $365 = 0, $366 = 0, $367 = 0, $368 = 0, $369 = 0, $37 = 0, $370 = 0, $371 = 0, $372 = 0, $373 = 0, $374 = 0, $375 = 0, $376 = 0, $377 = 0, $378 = 0, $379 = 0, $38 = 0, $380 = 0, $381 = 0;
 var $382 = 0, $383 = 0, $384 = 0, $385 = 0, $386 = 0, $387 = 0, $388 = 0, $389 = 0, $39 = 0, $390 = 0, $391 = 0, $392 = 0, $393 = 0, $394 = 0, $395 = 0, $396 = 0, $397 = 0, $398 = 0, $399 = 0, $4 = 0;
 var $40 = 0, $400 = 0, $401 = 0, $402 = 0, $403 = 0, $404 = 0, $405 = 0, $406 = 0, $407 = 0, $408 = 0, $409 = 0, $41 = 0, $410 = 0, $411 = 0, $412 = 0, $413 = 0, $414 = 0, $415 = 0, $416 = 0, $417 = 0;
 var $418 = 0, $419 = 0, $42 = 0, $420 = 0, $421 = 0, $422 = 0, $423 = 0, $424 = 0, $425 = 0, $426 = 0, $427 = 0, $428 = 0, $429 = 0, $43 = 0, $430 = 0, $431 = 0, $432 = 0, $433 = 0, $434 = 0, $435 = 0;
 var $436 = 0, $437 = 0, $438 = 0, $439 = 0, $44 = 0, $440 = 0, $441 = 0, $442 = 0, $443 = 0, $444 = 0, $445 = 0, $446 = 0, $447 = 0, $448 = 0, $449 = 0, $45 = 0, $450 = 0, $451 = 0, $452 = 0, $453 = 0;
 var $454 = 0, $455 = 0, $456 = 0, $457 = 0, $458 = 0, $459 = 0, $46 = 0, $460 = 0, $461 = 0, $462 = 0, $463 = 0, $464 = 0, $465 = 0, $466 = 0, $467 = 0, $468 = 0, $469 = 0, $47 = 0, $470 = 0, $471 = 0;
 var $472 = 0, $473 = 0, $474 = 0, $475 = 0, $476 = 0, $477 = 0, $478 = 0, $479 = 0, $48 = 0, $480 = 0, $481 = 0, $482 = 0, $483 = 0, $484 = 0, $485 = 0, $486 = 0, $487 = 0, $488 = 0, $489 = 0, $49 = 0;
 var $490 = 0, $491 = 0, $492 = 0, $493 = 0, $494 = 0, $495 = 0, $496 = 0, $497 = 0, $498 = 0, $499 = 0, $5 = 0, $50 = 0, $500 = 0, $501 = 0, $502 = 0, $503 = 0, $504 = 0, $505 = 0, $506 = 0, $507 = 0;
 var $508 = 0, $509 = 0, $51 = 0, $510 = 0, $511 = 0, $512 = 0, $513 = 0, $514 = 0, $515 = 0, $516 = 0, $517 = 0, $518 = 0, $519 = 0, $52 = 0, $520 = 0, $521 = 0, $522 = 0, $523 = 0, $524 = 0, $525 = 0;
 var $526 = 0, $527 = 0, $528 = 0, $529 = 0, $53 = 0, $530 = 0, $531 = 0, $532 = 0, $533 = 0, $534 = 0, $535 = 0, $536 = 0, $537 = 0, $538 = 0, $539 = 0, $54 = 0, $540 = 0, $541 = 0, $542 = 0, $543 = 0;
 var $544 = 0, $545 = 0, $546 = 0, $547 = 0, $548 = 0, $549 = 0, $55 = 0, $550 = 0, $551 = 0, $552 = 0, $553 = 0, $554 = 0, $555 = 0, $556 = 0, $557 = 0, $558 = 0, $559 = 0, $56 = 0, $560 = 0, $561 = 0;
 var $562 = 0, $563 = 0, $564 = 0, $565 = 0, $566 = 0, $567 = 0, $568 = 0, $569 = 0, $57 = 0, $570 = 0, $571 = 0, $572 = 0, $573 = 0, $574 = 0, $575 = 0, $576 = 0, $577 = 0, $578 = 0, $579 = 0, $58 = 0;
 var $580 = 0, $581 = 0, $582 = 0, $583 = 0, $584 = 0, $585 = 0, $586 = 0, $587 = 0, $588 = 0, $589 = 0, $59 = 0, $590 = 0, $591 = 0, $592 = 0, $593 = 0, $594 = 0, $595 = 0, $596 = 0, $597 = 0, $598 = 0;
 var $599 = 0, $6 = 0, $60 = 0, $600 = 0, $601 = 0, $602 = 0, $603 = 0, $604 = 0, $605 = 0, $606 = 0, $607 = 0, $608 = 0, $609 = 0, $61 = 0, $610 = 0, $611 = 0, $612 = 0, $613 = 0, $614 = 0, $615 = 0;
 var $616 = 0, $617 = 0, $618 = 0, $619 = 0, $62 = 0, $620 = 0, $621 = 0, $622 = 0, $623 = 0, $624 = 0, $625 = 0, $626 = 0, $627 = 0, $628 = 0, $629 = 0, $63 = 0, $630 = 0, $631 = 0, $632 = 0, $633 = 0;
 var $634 = 0, $635 = 0, $636 = 0, $637 = 0, $638 = 0, $639 = 0, $64 = 0, $640 = 0, $641 = 0, $642 = 0, $643 = 0, $644 = 0, $645 = 0, $646 = 0, $647 = 0, $648 = 0, $649 = 0, $65 = 0, $650 = 0, $651 = 0;
 var $652 = 0, $653 = 0, $654 = 0, $655 = 0, $656 = 0, $657 = 0, $658 = 0, $659 = 0, $66 = 0, $660 = 0, $661 = 0, $662 = 0, $663 = 0, $664 = 0, $665 = 0, $666 = 0, $667 = 0, $668 = 0, $669 = 0, $67 = 0;
 var $670 = 0, $671 = 0, $672 = 0, $673 = 0, $674 = 0, $675 = 0, $676 = 0, $677 = 0, $678 = 0, $679 = 0, $68 = 0, $680 = 0, $681 = 0, $682 = 0, $683 = 0, $684 = 0, $685 = 0, $686 = 0, $687 = 0, $688 = 0;
 var $689 = 0, $69 = 0, $690 = 0, $691 = 0, $692 = 0, $693 = 0, $694 = 0, $695 = 0, $696 = 0, $697 = 0, $698 = 0, $699 = 0, $7 = 0, $70 = 0, $700 = 0, $701 = 0, $702 = 0, $703 = 0, $704 = 0, $705 = 0;
 var $706 = 0, $707 = 0, $708 = 0, $709 = 0, $71 = 0, $710 = 0, $711 = 0, $712 = 0, $713 = 0, $714 = 0, $715 = 0, $716 = 0, $717 = 0, $718 = 0, $719 = 0, $72 = 0, $720 = 0, $721 = 0, $722 = 0, $723 = 0;
 var $724 = 0, $725 = 0, $726 = 0, $727 = 0, $728 = 0, $729 = 0, $73 = 0, $730 = 0, $731 = 0, $732 = 0, $733 = 0, $734 = 0, $735 = 0, $736 = 0, $737 = 0, $738 = 0, $739 = 0, $74 = 0, $740 = 0, $741 = 0;
 var $742 = 0, $743 = 0, $744 = 0, $745 = 0, $746 = 0, $747 = 0, $748 = 0, $749 = 0, $75 = 0, $750 = 0, $751 = 0, $752 = 0, $753 = 0, $754 = 0, $755 = 0, $756 = 0, $757 = 0, $758 = 0, $759 = 0, $76 = 0;
 var $760 = 0, $761 = 0, $762 = 0, $763 = 0, $764 = 0, $765 = 0, $766 = 0, $767 = 0, $768 = 0, $769 = 0, $77 = 0, $770 = 0, $771 = 0, $772 = 0, $773 = 0, $774 = 0, $775 = 0, $776 = 0, $777 = 0, $778 = 0;
 var $779 = 0, $78 = 0, $780 = 0, $781 = 0, $782 = 0, $783 = 0, $784 = 0, $785 = 0, $786 = 0, $787 = 0, $788 = 0, $789 = 0, $79 = 0, $790 = 0, $791 = 0, $792 = 0, $793 = 0, $794 = 0, $795 = 0, $796 = 0;
 var $797 = 0, $798 = 0, $799 = 0, $8 = 0, $80 = 0, $800 = 0, $801 = 0, $802 = 0, $803 = 0, $804 = 0, $805 = 0, $806 = 0, $807 = 0, $808 = 0, $809 = 0, $81 = 0, $810 = 0, $811 = 0, $812 = 0, $813 = 0;
 var $814 = 0, $815 = 0, $816 = 0, $817 = 0, $818 = 0, $819 = 0, $82 = 0, $820 = 0, $821 = 0, $822 = 0, $823 = 0, $824 = 0, $825 = 0, $826 = 0, $827 = 0, $828 = 0, $829 = 0, $83 = 0, $830 = 0, $831 = 0;
 var $832 = 0, $833 = 0, $834 = 0, $835 = 0, $836 = 0, $837 = 0, $838 = 0, $839 = 0, $84 = 0, $840 = 0, $841 = 0, $842 = 0, $843 = 0, $844 = 0, $845 = 0, $846 = 0, $847 = 0, $848 = 0, $849 = 0, $85 = 0;
 var $850 = 0, $851 = 0, $852 = 0, $853 = 0, $854 = 0, $855 = 0, $856 = 0, $857 = 0, $858 = 0, $859 = 0, $86 = 0, $860 = 0, $861 = 0, $862 = 0, $863 = 0, $864 = 0, $865 = 0, $866 = 0, $867 = 0, $868 = 0;
 var $869 = 0, $87 = 0, $870 = 0, $871 = 0, $872 = 0, $873 = 0, $874 = 0, $875 = 0, $876 = 0, $877 = 0, $878 = 0, $879 = 0, $88 = 0, $880 = 0, $881 = 0, $882 = 0, $883 = 0, $884 = 0, $885 = 0, $886 = 0;
 var $887 = 0, $888 = 0, $889 = 0, $89 = 0, $890 = 0, $891 = 0, $892 = 0, $893 = 0, $894 = 0, $895 = 0, $896 = 0, $897 = 0, $898 = 0, $899 = 0, $9 = 0, $90 = 0, $900 = 0, $901 = 0, $902 = 0, $903 = 0;
 var $904 = 0, $905 = 0, $906 = 0, $907 = 0, $908 = 0, $909 = 0, $91 = 0, $910 = 0, $911 = 0, $912 = 0, $913 = 0, $914 = 0, $915 = 0, $916 = 0, $917 = 0, $918 = 0, $919 = 0, $92 = 0, $920 = 0, $921 = 0;
 var $922 = 0, $923 = 0, $924 = 0, $925 = 0, $926 = 0, $927 = 0, $928 = 0, $929 = 0, $93 = 0, $930 = 0, $931 = 0, $932 = 0, $933 = 0, $934 = 0, $935 = 0, $936 = 0, $937 = 0, $938 = 0, $939 = 0, $94 = 0;
 var $940 = 0, $941 = 0, $942 = 0, $943 = 0, $944 = 0, $945 = 0, $946 = 0, $947 = 0, $948 = 0, $949 = 0, $95 = 0, $950 = 0, $951 = 0, $952 = 0, $953 = 0, $954 = 0, $955 = 0, $956 = 0, $957 = 0, $958 = 0;
 var $959 = 0, $96 = 0, $960 = 0, $961 = 0, $962 = 0, $963 = 0, $964 = 0, $965 = 0, $966 = 0, $967 = 0, $968 = 0, $969 = 0, $97 = 0, $970 = 0, $971 = 0, $972 = 0, $973 = 0, $974 = 0, $975 = 0, $976 = 0;
 var $977 = 0, $978 = 0, $979 = 0, $98 = 0, $980 = 0, $981 = 0, $982 = 0, $983 = 0, $984 = 0, $985 = 0, $986 = 0, $987 = 0, $988 = 0, $989 = 0, $99 = 0, $990 = 0, $991 = 0, $992 = 0, $993 = 0, $994 = 0;
 var $995 = 0, $996 = 0, $997 = 0, $998 = 0, $999 = 0, $cond$i = 0, $cond$i$i = 0, $cond$i208 = 0, $exitcond$i$i = 0, $not$$i = 0, $not$$i$i = 0, $not$$i17$i = 0, $not$$i209 = 0, $not$$i216 = 0, $not$1$i = 0, $not$1$i203 = 0, $not$5$i = 0, $not$7$i$i = 0, $not$8$i = 0, $not$9$i = 0;
 var $or$cond$i = 0, $or$cond$i214 = 0, $or$cond1$i = 0, $or$cond10$i = 0, $or$cond11$i = 0, $or$cond11$not$i = 0, $or$cond12$i = 0, $or$cond2$i = 0, $or$cond2$i215 = 0, $or$cond5$i = 0, $or$cond50$i = 0, $or$cond51$i = 0, $or$cond7$i = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $1 = sp;
 $2 = ($0>>>0)<(245);
 do {
  if ($2) {
   $3 = ($0>>>0)<(11);
   $4 = (($0) + 11)|0;
   $5 = $4 & -8;
   $6 = $3 ? 16 : $5;
   $7 = $6 >>> 3;
   $8 = HEAP32[5692]|0;
   $9 = $8 >>> $7;
   $10 = $9 & 3;
   $11 = ($10|0)==(0);
   if (!($11)) {
    $12 = $9 & 1;
    $13 = $12 ^ 1;
    $14 = (($13) + ($7))|0;
    $15 = $14 << 1;
    $16 = (22808 + ($15<<2)|0);
    $17 = ((($16)) + 8|0);
    $18 = HEAP32[$17>>2]|0;
    $19 = ((($18)) + 8|0);
    $20 = HEAP32[$19>>2]|0;
    $21 = ($16|0)==($20|0);
    do {
     if ($21) {
      $22 = 1 << $14;
      $23 = $22 ^ -1;
      $24 = $8 & $23;
      HEAP32[5692] = $24;
     } else {
      $25 = HEAP32[(22784)>>2]|0;
      $26 = ($20>>>0)<($25>>>0);
      if ($26) {
       _abort();
       // unreachable;
      }
      $27 = ((($20)) + 12|0);
      $28 = HEAP32[$27>>2]|0;
      $29 = ($28|0)==($18|0);
      if ($29) {
       HEAP32[$27>>2] = $16;
       HEAP32[$17>>2] = $20;
       break;
      } else {
       _abort();
       // unreachable;
      }
     }
    } while(0);
    $30 = $14 << 3;
    $31 = $30 | 3;
    $32 = ((($18)) + 4|0);
    HEAP32[$32>>2] = $31;
    $33 = (($18) + ($30)|0);
    $34 = ((($33)) + 4|0);
    $35 = HEAP32[$34>>2]|0;
    $36 = $35 | 1;
    HEAP32[$34>>2] = $36;
    $$0 = $19;
    STACKTOP = sp;return ($$0|0);
   }
   $37 = HEAP32[(22776)>>2]|0;
   $38 = ($6>>>0)>($37>>>0);
   if ($38) {
    $39 = ($9|0)==(0);
    if (!($39)) {
     $40 = $9 << $7;
     $41 = 2 << $7;
     $42 = (0 - ($41))|0;
     $43 = $41 | $42;
     $44 = $40 & $43;
     $45 = (0 - ($44))|0;
     $46 = $44 & $45;
     $47 = (($46) + -1)|0;
     $48 = $47 >>> 12;
     $49 = $48 & 16;
     $50 = $47 >>> $49;
     $51 = $50 >>> 5;
     $52 = $51 & 8;
     $53 = $52 | $49;
     $54 = $50 >>> $52;
     $55 = $54 >>> 2;
     $56 = $55 & 4;
     $57 = $53 | $56;
     $58 = $54 >>> $56;
     $59 = $58 >>> 1;
     $60 = $59 & 2;
     $61 = $57 | $60;
     $62 = $58 >>> $60;
     $63 = $62 >>> 1;
     $64 = $63 & 1;
     $65 = $61 | $64;
     $66 = $62 >>> $64;
     $67 = (($65) + ($66))|0;
     $68 = $67 << 1;
     $69 = (22808 + ($68<<2)|0);
     $70 = ((($69)) + 8|0);
     $71 = HEAP32[$70>>2]|0;
     $72 = ((($71)) + 8|0);
     $73 = HEAP32[$72>>2]|0;
     $74 = ($69|0)==($73|0);
     do {
      if ($74) {
       $75 = 1 << $67;
       $76 = $75 ^ -1;
       $77 = $8 & $76;
       HEAP32[5692] = $77;
       $98 = $77;
      } else {
       $78 = HEAP32[(22784)>>2]|0;
       $79 = ($73>>>0)<($78>>>0);
       if ($79) {
        _abort();
        // unreachable;
       }
       $80 = ((($73)) + 12|0);
       $81 = HEAP32[$80>>2]|0;
       $82 = ($81|0)==($71|0);
       if ($82) {
        HEAP32[$80>>2] = $69;
        HEAP32[$70>>2] = $73;
        $98 = $8;
        break;
       } else {
        _abort();
        // unreachable;
       }
      }
     } while(0);
     $83 = $67 << 3;
     $84 = (($83) - ($6))|0;
     $85 = $6 | 3;
     $86 = ((($71)) + 4|0);
     HEAP32[$86>>2] = $85;
     $87 = (($71) + ($6)|0);
     $88 = $84 | 1;
     $89 = ((($87)) + 4|0);
     HEAP32[$89>>2] = $88;
     $90 = (($87) + ($84)|0);
     HEAP32[$90>>2] = $84;
     $91 = ($37|0)==(0);
     if (!($91)) {
      $92 = HEAP32[(22788)>>2]|0;
      $93 = $37 >>> 3;
      $94 = $93 << 1;
      $95 = (22808 + ($94<<2)|0);
      $96 = 1 << $93;
      $97 = $98 & $96;
      $99 = ($97|0)==(0);
      if ($99) {
       $100 = $98 | $96;
       HEAP32[5692] = $100;
       $$pre = ((($95)) + 8|0);
       $$0199 = $95;$$pre$phiZ2D = $$pre;
      } else {
       $101 = ((($95)) + 8|0);
       $102 = HEAP32[$101>>2]|0;
       $103 = HEAP32[(22784)>>2]|0;
       $104 = ($102>>>0)<($103>>>0);
       if ($104) {
        _abort();
        // unreachable;
       } else {
        $$0199 = $102;$$pre$phiZ2D = $101;
       }
      }
      HEAP32[$$pre$phiZ2D>>2] = $92;
      $105 = ((($$0199)) + 12|0);
      HEAP32[$105>>2] = $92;
      $106 = ((($92)) + 8|0);
      HEAP32[$106>>2] = $$0199;
      $107 = ((($92)) + 12|0);
      HEAP32[$107>>2] = $95;
     }
     HEAP32[(22776)>>2] = $84;
     HEAP32[(22788)>>2] = $87;
     $$0 = $72;
     STACKTOP = sp;return ($$0|0);
    }
    $108 = HEAP32[(22772)>>2]|0;
    $109 = ($108|0)==(0);
    if ($109) {
     $$0197 = $6;
    } else {
     $110 = (0 - ($108))|0;
     $111 = $108 & $110;
     $112 = (($111) + -1)|0;
     $113 = $112 >>> 12;
     $114 = $113 & 16;
     $115 = $112 >>> $114;
     $116 = $115 >>> 5;
     $117 = $116 & 8;
     $118 = $117 | $114;
     $119 = $115 >>> $117;
     $120 = $119 >>> 2;
     $121 = $120 & 4;
     $122 = $118 | $121;
     $123 = $119 >>> $121;
     $124 = $123 >>> 1;
     $125 = $124 & 2;
     $126 = $122 | $125;
     $127 = $123 >>> $125;
     $128 = $127 >>> 1;
     $129 = $128 & 1;
     $130 = $126 | $129;
     $131 = $127 >>> $129;
     $132 = (($130) + ($131))|0;
     $133 = (23072 + ($132<<2)|0);
     $134 = HEAP32[$133>>2]|0;
     $135 = ((($134)) + 4|0);
     $136 = HEAP32[$135>>2]|0;
     $137 = $136 & -8;
     $138 = (($137) - ($6))|0;
     $139 = ((($134)) + 16|0);
     $140 = HEAP32[$139>>2]|0;
     $not$5$i = ($140|0)==(0|0);
     $$sink16$i = $not$5$i&1;
     $141 = (((($134)) + 16|0) + ($$sink16$i<<2)|0);
     $142 = HEAP32[$141>>2]|0;
     $143 = ($142|0)==(0|0);
     if ($143) {
      $$0192$lcssa$i = $134;$$0193$lcssa$i = $138;
     } else {
      $$01928$i = $134;$$01937$i = $138;$145 = $142;
      while(1) {
       $144 = ((($145)) + 4|0);
       $146 = HEAP32[$144>>2]|0;
       $147 = $146 & -8;
       $148 = (($147) - ($6))|0;
       $149 = ($148>>>0)<($$01937$i>>>0);
       $$$0193$i = $149 ? $148 : $$01937$i;
       $$$0192$i = $149 ? $145 : $$01928$i;
       $150 = ((($145)) + 16|0);
       $151 = HEAP32[$150>>2]|0;
       $not$$i = ($151|0)==(0|0);
       $$sink1$i = $not$$i&1;
       $152 = (((($145)) + 16|0) + ($$sink1$i<<2)|0);
       $153 = HEAP32[$152>>2]|0;
       $154 = ($153|0)==(0|0);
       if ($154) {
        $$0192$lcssa$i = $$$0192$i;$$0193$lcssa$i = $$$0193$i;
        break;
       } else {
        $$01928$i = $$$0192$i;$$01937$i = $$$0193$i;$145 = $153;
       }
      }
     }
     $155 = HEAP32[(22784)>>2]|0;
     $156 = ($$0192$lcssa$i>>>0)<($155>>>0);
     if ($156) {
      _abort();
      // unreachable;
     }
     $157 = (($$0192$lcssa$i) + ($6)|0);
     $158 = ($$0192$lcssa$i>>>0)<($157>>>0);
     if (!($158)) {
      _abort();
      // unreachable;
     }
     $159 = ((($$0192$lcssa$i)) + 24|0);
     $160 = HEAP32[$159>>2]|0;
     $161 = ((($$0192$lcssa$i)) + 12|0);
     $162 = HEAP32[$161>>2]|0;
     $163 = ($162|0)==($$0192$lcssa$i|0);
     do {
      if ($163) {
       $173 = ((($$0192$lcssa$i)) + 20|0);
       $174 = HEAP32[$173>>2]|0;
       $175 = ($174|0)==(0|0);
       if ($175) {
        $176 = ((($$0192$lcssa$i)) + 16|0);
        $177 = HEAP32[$176>>2]|0;
        $178 = ($177|0)==(0|0);
        if ($178) {
         $$3$i = 0;
         break;
        } else {
         $$1196$i = $177;$$1198$i = $176;
        }
       } else {
        $$1196$i = $174;$$1198$i = $173;
       }
       while(1) {
        $179 = ((($$1196$i)) + 20|0);
        $180 = HEAP32[$179>>2]|0;
        $181 = ($180|0)==(0|0);
        if (!($181)) {
         $$1196$i = $180;$$1198$i = $179;
         continue;
        }
        $182 = ((($$1196$i)) + 16|0);
        $183 = HEAP32[$182>>2]|0;
        $184 = ($183|0)==(0|0);
        if ($184) {
         break;
        } else {
         $$1196$i = $183;$$1198$i = $182;
        }
       }
       $185 = ($$1198$i>>>0)<($155>>>0);
       if ($185) {
        _abort();
        // unreachable;
       } else {
        HEAP32[$$1198$i>>2] = 0;
        $$3$i = $$1196$i;
        break;
       }
      } else {
       $164 = ((($$0192$lcssa$i)) + 8|0);
       $165 = HEAP32[$164>>2]|0;
       $166 = ($165>>>0)<($155>>>0);
       if ($166) {
        _abort();
        // unreachable;
       }
       $167 = ((($165)) + 12|0);
       $168 = HEAP32[$167>>2]|0;
       $169 = ($168|0)==($$0192$lcssa$i|0);
       if (!($169)) {
        _abort();
        // unreachable;
       }
       $170 = ((($162)) + 8|0);
       $171 = HEAP32[$170>>2]|0;
       $172 = ($171|0)==($$0192$lcssa$i|0);
       if ($172) {
        HEAP32[$167>>2] = $162;
        HEAP32[$170>>2] = $165;
        $$3$i = $162;
        break;
       } else {
        _abort();
        // unreachable;
       }
      }
     } while(0);
     $186 = ($160|0)==(0|0);
     L73: do {
      if (!($186)) {
       $187 = ((($$0192$lcssa$i)) + 28|0);
       $188 = HEAP32[$187>>2]|0;
       $189 = (23072 + ($188<<2)|0);
       $190 = HEAP32[$189>>2]|0;
       $191 = ($$0192$lcssa$i|0)==($190|0);
       do {
        if ($191) {
         HEAP32[$189>>2] = $$3$i;
         $cond$i = ($$3$i|0)==(0|0);
         if ($cond$i) {
          $192 = 1 << $188;
          $193 = $192 ^ -1;
          $194 = $108 & $193;
          HEAP32[(22772)>>2] = $194;
          break L73;
         }
        } else {
         $195 = HEAP32[(22784)>>2]|0;
         $196 = ($160>>>0)<($195>>>0);
         if ($196) {
          _abort();
          // unreachable;
         } else {
          $197 = ((($160)) + 16|0);
          $198 = HEAP32[$197>>2]|0;
          $not$1$i = ($198|0)!=($$0192$lcssa$i|0);
          $$sink2$i = $not$1$i&1;
          $199 = (((($160)) + 16|0) + ($$sink2$i<<2)|0);
          HEAP32[$199>>2] = $$3$i;
          $200 = ($$3$i|0)==(0|0);
          if ($200) {
           break L73;
          } else {
           break;
          }
         }
        }
       } while(0);
       $201 = HEAP32[(22784)>>2]|0;
       $202 = ($$3$i>>>0)<($201>>>0);
       if ($202) {
        _abort();
        // unreachable;
       }
       $203 = ((($$3$i)) + 24|0);
       HEAP32[$203>>2] = $160;
       $204 = ((($$0192$lcssa$i)) + 16|0);
       $205 = HEAP32[$204>>2]|0;
       $206 = ($205|0)==(0|0);
       do {
        if (!($206)) {
         $207 = ($205>>>0)<($201>>>0);
         if ($207) {
          _abort();
          // unreachable;
         } else {
          $208 = ((($$3$i)) + 16|0);
          HEAP32[$208>>2] = $205;
          $209 = ((($205)) + 24|0);
          HEAP32[$209>>2] = $$3$i;
          break;
         }
        }
       } while(0);
       $210 = ((($$0192$lcssa$i)) + 20|0);
       $211 = HEAP32[$210>>2]|0;
       $212 = ($211|0)==(0|0);
       if (!($212)) {
        $213 = HEAP32[(22784)>>2]|0;
        $214 = ($211>>>0)<($213>>>0);
        if ($214) {
         _abort();
         // unreachable;
        } else {
         $215 = ((($$3$i)) + 20|0);
         HEAP32[$215>>2] = $211;
         $216 = ((($211)) + 24|0);
         HEAP32[$216>>2] = $$3$i;
         break;
        }
       }
      }
     } while(0);
     $217 = ($$0193$lcssa$i>>>0)<(16);
     if ($217) {
      $218 = (($$0193$lcssa$i) + ($6))|0;
      $219 = $218 | 3;
      $220 = ((($$0192$lcssa$i)) + 4|0);
      HEAP32[$220>>2] = $219;
      $221 = (($$0192$lcssa$i) + ($218)|0);
      $222 = ((($221)) + 4|0);
      $223 = HEAP32[$222>>2]|0;
      $224 = $223 | 1;
      HEAP32[$222>>2] = $224;
     } else {
      $225 = $6 | 3;
      $226 = ((($$0192$lcssa$i)) + 4|0);
      HEAP32[$226>>2] = $225;
      $227 = $$0193$lcssa$i | 1;
      $228 = ((($157)) + 4|0);
      HEAP32[$228>>2] = $227;
      $229 = (($157) + ($$0193$lcssa$i)|0);
      HEAP32[$229>>2] = $$0193$lcssa$i;
      $230 = ($37|0)==(0);
      if (!($230)) {
       $231 = HEAP32[(22788)>>2]|0;
       $232 = $37 >>> 3;
       $233 = $232 << 1;
       $234 = (22808 + ($233<<2)|0);
       $235 = 1 << $232;
       $236 = $8 & $235;
       $237 = ($236|0)==(0);
       if ($237) {
        $238 = $8 | $235;
        HEAP32[5692] = $238;
        $$pre$i = ((($234)) + 8|0);
        $$0189$i = $234;$$pre$phi$iZ2D = $$pre$i;
       } else {
        $239 = ((($234)) + 8|0);
        $240 = HEAP32[$239>>2]|0;
        $241 = HEAP32[(22784)>>2]|0;
        $242 = ($240>>>0)<($241>>>0);
        if ($242) {
         _abort();
         // unreachable;
        } else {
         $$0189$i = $240;$$pre$phi$iZ2D = $239;
        }
       }
       HEAP32[$$pre$phi$iZ2D>>2] = $231;
       $243 = ((($$0189$i)) + 12|0);
       HEAP32[$243>>2] = $231;
       $244 = ((($231)) + 8|0);
       HEAP32[$244>>2] = $$0189$i;
       $245 = ((($231)) + 12|0);
       HEAP32[$245>>2] = $234;
      }
      HEAP32[(22776)>>2] = $$0193$lcssa$i;
      HEAP32[(22788)>>2] = $157;
     }
     $246 = ((($$0192$lcssa$i)) + 8|0);
     $$0 = $246;
     STACKTOP = sp;return ($$0|0);
    }
   } else {
    $$0197 = $6;
   }
  } else {
   $247 = ($0>>>0)>(4294967231);
   if ($247) {
    $$0197 = -1;
   } else {
    $248 = (($0) + 11)|0;
    $249 = $248 & -8;
    $250 = HEAP32[(22772)>>2]|0;
    $251 = ($250|0)==(0);
    if ($251) {
     $$0197 = $249;
    } else {
     $252 = (0 - ($249))|0;
     $253 = $248 >>> 8;
     $254 = ($253|0)==(0);
     if ($254) {
      $$0358$i = 0;
     } else {
      $255 = ($249>>>0)>(16777215);
      if ($255) {
       $$0358$i = 31;
      } else {
       $256 = (($253) + 1048320)|0;
       $257 = $256 >>> 16;
       $258 = $257 & 8;
       $259 = $253 << $258;
       $260 = (($259) + 520192)|0;
       $261 = $260 >>> 16;
       $262 = $261 & 4;
       $263 = $262 | $258;
       $264 = $259 << $262;
       $265 = (($264) + 245760)|0;
       $266 = $265 >>> 16;
       $267 = $266 & 2;
       $268 = $263 | $267;
       $269 = (14 - ($268))|0;
       $270 = $264 << $267;
       $271 = $270 >>> 15;
       $272 = (($269) + ($271))|0;
       $273 = $272 << 1;
       $274 = (($272) + 7)|0;
       $275 = $249 >>> $274;
       $276 = $275 & 1;
       $277 = $276 | $273;
       $$0358$i = $277;
      }
     }
     $278 = (23072 + ($$0358$i<<2)|0);
     $279 = HEAP32[$278>>2]|0;
     $280 = ($279|0)==(0|0);
     L117: do {
      if ($280) {
       $$2355$i = 0;$$3$i201 = 0;$$3350$i = $252;
       label = 81;
      } else {
       $281 = ($$0358$i|0)==(31);
       $282 = $$0358$i >>> 1;
       $283 = (25 - ($282))|0;
       $284 = $281 ? 0 : $283;
       $285 = $249 << $284;
       $$0342$i = 0;$$0347$i = $252;$$0353$i = $279;$$0359$i = $285;$$0362$i = 0;
       while(1) {
        $286 = ((($$0353$i)) + 4|0);
        $287 = HEAP32[$286>>2]|0;
        $288 = $287 & -8;
        $289 = (($288) - ($249))|0;
        $290 = ($289>>>0)<($$0347$i>>>0);
        if ($290) {
         $291 = ($289|0)==(0);
         if ($291) {
          $$415$i = $$0353$i;$$435114$i = 0;$$435713$i = $$0353$i;
          label = 85;
          break L117;
         } else {
          $$1343$i = $$0353$i;$$1348$i = $289;
         }
        } else {
         $$1343$i = $$0342$i;$$1348$i = $$0347$i;
        }
        $292 = ((($$0353$i)) + 20|0);
        $293 = HEAP32[$292>>2]|0;
        $294 = $$0359$i >>> 31;
        $295 = (((($$0353$i)) + 16|0) + ($294<<2)|0);
        $296 = HEAP32[$295>>2]|0;
        $297 = ($293|0)==(0|0);
        $298 = ($293|0)==($296|0);
        $or$cond2$i = $297 | $298;
        $$1363$i = $or$cond2$i ? $$0362$i : $293;
        $299 = ($296|0)==(0|0);
        $not$8$i = $299 ^ 1;
        $300 = $not$8$i&1;
        $$0359$$i = $$0359$i << $300;
        if ($299) {
         $$2355$i = $$1363$i;$$3$i201 = $$1343$i;$$3350$i = $$1348$i;
         label = 81;
         break;
        } else {
         $$0342$i = $$1343$i;$$0347$i = $$1348$i;$$0353$i = $296;$$0359$i = $$0359$$i;$$0362$i = $$1363$i;
        }
       }
      }
     } while(0);
     if ((label|0) == 81) {
      $301 = ($$2355$i|0)==(0|0);
      $302 = ($$3$i201|0)==(0|0);
      $or$cond$i = $301 & $302;
      if ($or$cond$i) {
       $303 = 2 << $$0358$i;
       $304 = (0 - ($303))|0;
       $305 = $303 | $304;
       $306 = $250 & $305;
       $307 = ($306|0)==(0);
       if ($307) {
        $$0197 = $249;
        break;
       }
       $308 = (0 - ($306))|0;
       $309 = $306 & $308;
       $310 = (($309) + -1)|0;
       $311 = $310 >>> 12;
       $312 = $311 & 16;
       $313 = $310 >>> $312;
       $314 = $313 >>> 5;
       $315 = $314 & 8;
       $316 = $315 | $312;
       $317 = $313 >>> $315;
       $318 = $317 >>> 2;
       $319 = $318 & 4;
       $320 = $316 | $319;
       $321 = $317 >>> $319;
       $322 = $321 >>> 1;
       $323 = $322 & 2;
       $324 = $320 | $323;
       $325 = $321 >>> $323;
       $326 = $325 >>> 1;
       $327 = $326 & 1;
       $328 = $324 | $327;
       $329 = $325 >>> $327;
       $330 = (($328) + ($329))|0;
       $331 = (23072 + ($330<<2)|0);
       $332 = HEAP32[$331>>2]|0;
       $$4$ph$i = 0;$$4357$ph$i = $332;
      } else {
       $$4$ph$i = $$3$i201;$$4357$ph$i = $$2355$i;
      }
      $333 = ($$4357$ph$i|0)==(0|0);
      if ($333) {
       $$4$lcssa$i = $$4$ph$i;$$4351$lcssa$i = $$3350$i;
      } else {
       $$415$i = $$4$ph$i;$$435114$i = $$3350$i;$$435713$i = $$4357$ph$i;
       label = 85;
      }
     }
     if ((label|0) == 85) {
      while(1) {
       label = 0;
       $334 = ((($$435713$i)) + 4|0);
       $335 = HEAP32[$334>>2]|0;
       $336 = $335 & -8;
       $337 = (($336) - ($249))|0;
       $338 = ($337>>>0)<($$435114$i>>>0);
       $$$4351$i = $338 ? $337 : $$435114$i;
       $$4357$$4$i = $338 ? $$435713$i : $$415$i;
       $339 = ((($$435713$i)) + 16|0);
       $340 = HEAP32[$339>>2]|0;
       $not$1$i203 = ($340|0)==(0|0);
       $$sink2$i204 = $not$1$i203&1;
       $341 = (((($$435713$i)) + 16|0) + ($$sink2$i204<<2)|0);
       $342 = HEAP32[$341>>2]|0;
       $343 = ($342|0)==(0|0);
       if ($343) {
        $$4$lcssa$i = $$4357$$4$i;$$4351$lcssa$i = $$$4351$i;
        break;
       } else {
        $$415$i = $$4357$$4$i;$$435114$i = $$$4351$i;$$435713$i = $342;
        label = 85;
       }
      }
     }
     $344 = ($$4$lcssa$i|0)==(0|0);
     if ($344) {
      $$0197 = $249;
     } else {
      $345 = HEAP32[(22776)>>2]|0;
      $346 = (($345) - ($249))|0;
      $347 = ($$4351$lcssa$i>>>0)<($346>>>0);
      if ($347) {
       $348 = HEAP32[(22784)>>2]|0;
       $349 = ($$4$lcssa$i>>>0)<($348>>>0);
       if ($349) {
        _abort();
        // unreachable;
       }
       $350 = (($$4$lcssa$i) + ($249)|0);
       $351 = ($$4$lcssa$i>>>0)<($350>>>0);
       if (!($351)) {
        _abort();
        // unreachable;
       }
       $352 = ((($$4$lcssa$i)) + 24|0);
       $353 = HEAP32[$352>>2]|0;
       $354 = ((($$4$lcssa$i)) + 12|0);
       $355 = HEAP32[$354>>2]|0;
       $356 = ($355|0)==($$4$lcssa$i|0);
       do {
        if ($356) {
         $366 = ((($$4$lcssa$i)) + 20|0);
         $367 = HEAP32[$366>>2]|0;
         $368 = ($367|0)==(0|0);
         if ($368) {
          $369 = ((($$4$lcssa$i)) + 16|0);
          $370 = HEAP32[$369>>2]|0;
          $371 = ($370|0)==(0|0);
          if ($371) {
           $$3372$i = 0;
           break;
          } else {
           $$1370$i = $370;$$1374$i = $369;
          }
         } else {
          $$1370$i = $367;$$1374$i = $366;
         }
         while(1) {
          $372 = ((($$1370$i)) + 20|0);
          $373 = HEAP32[$372>>2]|0;
          $374 = ($373|0)==(0|0);
          if (!($374)) {
           $$1370$i = $373;$$1374$i = $372;
           continue;
          }
          $375 = ((($$1370$i)) + 16|0);
          $376 = HEAP32[$375>>2]|0;
          $377 = ($376|0)==(0|0);
          if ($377) {
           break;
          } else {
           $$1370$i = $376;$$1374$i = $375;
          }
         }
         $378 = ($$1374$i>>>0)<($348>>>0);
         if ($378) {
          _abort();
          // unreachable;
         } else {
          HEAP32[$$1374$i>>2] = 0;
          $$3372$i = $$1370$i;
          break;
         }
        } else {
         $357 = ((($$4$lcssa$i)) + 8|0);
         $358 = HEAP32[$357>>2]|0;
         $359 = ($358>>>0)<($348>>>0);
         if ($359) {
          _abort();
          // unreachable;
         }
         $360 = ((($358)) + 12|0);
         $361 = HEAP32[$360>>2]|0;
         $362 = ($361|0)==($$4$lcssa$i|0);
         if (!($362)) {
          _abort();
          // unreachable;
         }
         $363 = ((($355)) + 8|0);
         $364 = HEAP32[$363>>2]|0;
         $365 = ($364|0)==($$4$lcssa$i|0);
         if ($365) {
          HEAP32[$360>>2] = $355;
          HEAP32[$363>>2] = $358;
          $$3372$i = $355;
          break;
         } else {
          _abort();
          // unreachable;
         }
        }
       } while(0);
       $379 = ($353|0)==(0|0);
       L164: do {
        if ($379) {
         $470 = $250;
        } else {
         $380 = ((($$4$lcssa$i)) + 28|0);
         $381 = HEAP32[$380>>2]|0;
         $382 = (23072 + ($381<<2)|0);
         $383 = HEAP32[$382>>2]|0;
         $384 = ($$4$lcssa$i|0)==($383|0);
         do {
          if ($384) {
           HEAP32[$382>>2] = $$3372$i;
           $cond$i208 = ($$3372$i|0)==(0|0);
           if ($cond$i208) {
            $385 = 1 << $381;
            $386 = $385 ^ -1;
            $387 = $250 & $386;
            HEAP32[(22772)>>2] = $387;
            $470 = $387;
            break L164;
           }
          } else {
           $388 = HEAP32[(22784)>>2]|0;
           $389 = ($353>>>0)<($388>>>0);
           if ($389) {
            _abort();
            // unreachable;
           } else {
            $390 = ((($353)) + 16|0);
            $391 = HEAP32[$390>>2]|0;
            $not$$i209 = ($391|0)!=($$4$lcssa$i|0);
            $$sink3$i = $not$$i209&1;
            $392 = (((($353)) + 16|0) + ($$sink3$i<<2)|0);
            HEAP32[$392>>2] = $$3372$i;
            $393 = ($$3372$i|0)==(0|0);
            if ($393) {
             $470 = $250;
             break L164;
            } else {
             break;
            }
           }
          }
         } while(0);
         $394 = HEAP32[(22784)>>2]|0;
         $395 = ($$3372$i>>>0)<($394>>>0);
         if ($395) {
          _abort();
          // unreachable;
         }
         $396 = ((($$3372$i)) + 24|0);
         HEAP32[$396>>2] = $353;
         $397 = ((($$4$lcssa$i)) + 16|0);
         $398 = HEAP32[$397>>2]|0;
         $399 = ($398|0)==(0|0);
         do {
          if (!($399)) {
           $400 = ($398>>>0)<($394>>>0);
           if ($400) {
            _abort();
            // unreachable;
           } else {
            $401 = ((($$3372$i)) + 16|0);
            HEAP32[$401>>2] = $398;
            $402 = ((($398)) + 24|0);
            HEAP32[$402>>2] = $$3372$i;
            break;
           }
          }
         } while(0);
         $403 = ((($$4$lcssa$i)) + 20|0);
         $404 = HEAP32[$403>>2]|0;
         $405 = ($404|0)==(0|0);
         if ($405) {
          $470 = $250;
         } else {
          $406 = HEAP32[(22784)>>2]|0;
          $407 = ($404>>>0)<($406>>>0);
          if ($407) {
           _abort();
           // unreachable;
          } else {
           $408 = ((($$3372$i)) + 20|0);
           HEAP32[$408>>2] = $404;
           $409 = ((($404)) + 24|0);
           HEAP32[$409>>2] = $$3372$i;
           $470 = $250;
           break;
          }
         }
        }
       } while(0);
       $410 = ($$4351$lcssa$i>>>0)<(16);
       do {
        if ($410) {
         $411 = (($$4351$lcssa$i) + ($249))|0;
         $412 = $411 | 3;
         $413 = ((($$4$lcssa$i)) + 4|0);
         HEAP32[$413>>2] = $412;
         $414 = (($$4$lcssa$i) + ($411)|0);
         $415 = ((($414)) + 4|0);
         $416 = HEAP32[$415>>2]|0;
         $417 = $416 | 1;
         HEAP32[$415>>2] = $417;
        } else {
         $418 = $249 | 3;
         $419 = ((($$4$lcssa$i)) + 4|0);
         HEAP32[$419>>2] = $418;
         $420 = $$4351$lcssa$i | 1;
         $421 = ((($350)) + 4|0);
         HEAP32[$421>>2] = $420;
         $422 = (($350) + ($$4351$lcssa$i)|0);
         HEAP32[$422>>2] = $$4351$lcssa$i;
         $423 = $$4351$lcssa$i >>> 3;
         $424 = ($$4351$lcssa$i>>>0)<(256);
         if ($424) {
          $425 = $423 << 1;
          $426 = (22808 + ($425<<2)|0);
          $427 = HEAP32[5692]|0;
          $428 = 1 << $423;
          $429 = $427 & $428;
          $430 = ($429|0)==(0);
          if ($430) {
           $431 = $427 | $428;
           HEAP32[5692] = $431;
           $$pre$i210 = ((($426)) + 8|0);
           $$0368$i = $426;$$pre$phi$i211Z2D = $$pre$i210;
          } else {
           $432 = ((($426)) + 8|0);
           $433 = HEAP32[$432>>2]|0;
           $434 = HEAP32[(22784)>>2]|0;
           $435 = ($433>>>0)<($434>>>0);
           if ($435) {
            _abort();
            // unreachable;
           } else {
            $$0368$i = $433;$$pre$phi$i211Z2D = $432;
           }
          }
          HEAP32[$$pre$phi$i211Z2D>>2] = $350;
          $436 = ((($$0368$i)) + 12|0);
          HEAP32[$436>>2] = $350;
          $437 = ((($350)) + 8|0);
          HEAP32[$437>>2] = $$0368$i;
          $438 = ((($350)) + 12|0);
          HEAP32[$438>>2] = $426;
          break;
         }
         $439 = $$4351$lcssa$i >>> 8;
         $440 = ($439|0)==(0);
         if ($440) {
          $$0361$i = 0;
         } else {
          $441 = ($$4351$lcssa$i>>>0)>(16777215);
          if ($441) {
           $$0361$i = 31;
          } else {
           $442 = (($439) + 1048320)|0;
           $443 = $442 >>> 16;
           $444 = $443 & 8;
           $445 = $439 << $444;
           $446 = (($445) + 520192)|0;
           $447 = $446 >>> 16;
           $448 = $447 & 4;
           $449 = $448 | $444;
           $450 = $445 << $448;
           $451 = (($450) + 245760)|0;
           $452 = $451 >>> 16;
           $453 = $452 & 2;
           $454 = $449 | $453;
           $455 = (14 - ($454))|0;
           $456 = $450 << $453;
           $457 = $456 >>> 15;
           $458 = (($455) + ($457))|0;
           $459 = $458 << 1;
           $460 = (($458) + 7)|0;
           $461 = $$4351$lcssa$i >>> $460;
           $462 = $461 & 1;
           $463 = $462 | $459;
           $$0361$i = $463;
          }
         }
         $464 = (23072 + ($$0361$i<<2)|0);
         $465 = ((($350)) + 28|0);
         HEAP32[$465>>2] = $$0361$i;
         $466 = ((($350)) + 16|0);
         $467 = ((($466)) + 4|0);
         HEAP32[$467>>2] = 0;
         HEAP32[$466>>2] = 0;
         $468 = 1 << $$0361$i;
         $469 = $470 & $468;
         $471 = ($469|0)==(0);
         if ($471) {
          $472 = $470 | $468;
          HEAP32[(22772)>>2] = $472;
          HEAP32[$464>>2] = $350;
          $473 = ((($350)) + 24|0);
          HEAP32[$473>>2] = $464;
          $474 = ((($350)) + 12|0);
          HEAP32[$474>>2] = $350;
          $475 = ((($350)) + 8|0);
          HEAP32[$475>>2] = $350;
          break;
         }
         $476 = HEAP32[$464>>2]|0;
         $477 = ($$0361$i|0)==(31);
         $478 = $$0361$i >>> 1;
         $479 = (25 - ($478))|0;
         $480 = $477 ? 0 : $479;
         $481 = $$4351$lcssa$i << $480;
         $$0344$i = $481;$$0345$i = $476;
         while(1) {
          $482 = ((($$0345$i)) + 4|0);
          $483 = HEAP32[$482>>2]|0;
          $484 = $483 & -8;
          $485 = ($484|0)==($$4351$lcssa$i|0);
          if ($485) {
           label = 139;
           break;
          }
          $486 = $$0344$i >>> 31;
          $487 = (((($$0345$i)) + 16|0) + ($486<<2)|0);
          $488 = $$0344$i << 1;
          $489 = HEAP32[$487>>2]|0;
          $490 = ($489|0)==(0|0);
          if ($490) {
           label = 136;
           break;
          } else {
           $$0344$i = $488;$$0345$i = $489;
          }
         }
         if ((label|0) == 136) {
          $491 = HEAP32[(22784)>>2]|0;
          $492 = ($487>>>0)<($491>>>0);
          if ($492) {
           _abort();
           // unreachable;
          } else {
           HEAP32[$487>>2] = $350;
           $493 = ((($350)) + 24|0);
           HEAP32[$493>>2] = $$0345$i;
           $494 = ((($350)) + 12|0);
           HEAP32[$494>>2] = $350;
           $495 = ((($350)) + 8|0);
           HEAP32[$495>>2] = $350;
           break;
          }
         }
         else if ((label|0) == 139) {
          $496 = ((($$0345$i)) + 8|0);
          $497 = HEAP32[$496>>2]|0;
          $498 = HEAP32[(22784)>>2]|0;
          $499 = ($497>>>0)>=($498>>>0);
          $not$9$i = ($$0345$i>>>0)>=($498>>>0);
          $500 = $499 & $not$9$i;
          if ($500) {
           $501 = ((($497)) + 12|0);
           HEAP32[$501>>2] = $350;
           HEAP32[$496>>2] = $350;
           $502 = ((($350)) + 8|0);
           HEAP32[$502>>2] = $497;
           $503 = ((($350)) + 12|0);
           HEAP32[$503>>2] = $$0345$i;
           $504 = ((($350)) + 24|0);
           HEAP32[$504>>2] = 0;
           break;
          } else {
           _abort();
           // unreachable;
          }
         }
        }
       } while(0);
       $505 = ((($$4$lcssa$i)) + 8|0);
       $$0 = $505;
       STACKTOP = sp;return ($$0|0);
      } else {
       $$0197 = $249;
      }
     }
    }
   }
  }
 } while(0);
 $506 = HEAP32[(22776)>>2]|0;
 $507 = ($506>>>0)<($$0197>>>0);
 if (!($507)) {
  $508 = (($506) - ($$0197))|0;
  $509 = HEAP32[(22788)>>2]|0;
  $510 = ($508>>>0)>(15);
  if ($510) {
   $511 = (($509) + ($$0197)|0);
   HEAP32[(22788)>>2] = $511;
   HEAP32[(22776)>>2] = $508;
   $512 = $508 | 1;
   $513 = ((($511)) + 4|0);
   HEAP32[$513>>2] = $512;
   $514 = (($511) + ($508)|0);
   HEAP32[$514>>2] = $508;
   $515 = $$0197 | 3;
   $516 = ((($509)) + 4|0);
   HEAP32[$516>>2] = $515;
  } else {
   HEAP32[(22776)>>2] = 0;
   HEAP32[(22788)>>2] = 0;
   $517 = $506 | 3;
   $518 = ((($509)) + 4|0);
   HEAP32[$518>>2] = $517;
   $519 = (($509) + ($506)|0);
   $520 = ((($519)) + 4|0);
   $521 = HEAP32[$520>>2]|0;
   $522 = $521 | 1;
   HEAP32[$520>>2] = $522;
  }
  $523 = ((($509)) + 8|0);
  $$0 = $523;
  STACKTOP = sp;return ($$0|0);
 }
 $524 = HEAP32[(22780)>>2]|0;
 $525 = ($524>>>0)>($$0197>>>0);
 if ($525) {
  $526 = (($524) - ($$0197))|0;
  HEAP32[(22780)>>2] = $526;
  $527 = HEAP32[(22792)>>2]|0;
  $528 = (($527) + ($$0197)|0);
  HEAP32[(22792)>>2] = $528;
  $529 = $526 | 1;
  $530 = ((($528)) + 4|0);
  HEAP32[$530>>2] = $529;
  $531 = $$0197 | 3;
  $532 = ((($527)) + 4|0);
  HEAP32[$532>>2] = $531;
  $533 = ((($527)) + 8|0);
  $$0 = $533;
  STACKTOP = sp;return ($$0|0);
 }
 $534 = HEAP32[5810]|0;
 $535 = ($534|0)==(0);
 if ($535) {
  HEAP32[(23248)>>2] = 4096;
  HEAP32[(23244)>>2] = 4096;
  HEAP32[(23252)>>2] = -1;
  HEAP32[(23256)>>2] = -1;
  HEAP32[(23260)>>2] = 0;
  HEAP32[(23212)>>2] = 0;
  $536 = $1;
  $537 = $536 & -16;
  $538 = $537 ^ 1431655768;
  HEAP32[$1>>2] = $538;
  HEAP32[5810] = $538;
  $542 = 4096;
 } else {
  $$pre$i212 = HEAP32[(23248)>>2]|0;
  $542 = $$pre$i212;
 }
 $539 = (($$0197) + 48)|0;
 $540 = (($$0197) + 47)|0;
 $541 = (($542) + ($540))|0;
 $543 = (0 - ($542))|0;
 $544 = $541 & $543;
 $545 = ($544>>>0)>($$0197>>>0);
 if (!($545)) {
  $$0 = 0;
  STACKTOP = sp;return ($$0|0);
 }
 $546 = HEAP32[(23208)>>2]|0;
 $547 = ($546|0)==(0);
 if (!($547)) {
  $548 = HEAP32[(23200)>>2]|0;
  $549 = (($548) + ($544))|0;
  $550 = ($549>>>0)<=($548>>>0);
  $551 = ($549>>>0)>($546>>>0);
  $or$cond1$i = $550 | $551;
  if ($or$cond1$i) {
   $$0 = 0;
   STACKTOP = sp;return ($$0|0);
  }
 }
 $552 = HEAP32[(23212)>>2]|0;
 $553 = $552 & 4;
 $554 = ($553|0)==(0);
 L244: do {
  if ($554) {
   $555 = HEAP32[(22792)>>2]|0;
   $556 = ($555|0)==(0|0);
   L246: do {
    if ($556) {
     label = 163;
    } else {
     $$0$i$i = (23216);
     while(1) {
      $557 = HEAP32[$$0$i$i>>2]|0;
      $558 = ($557>>>0)>($555>>>0);
      if (!($558)) {
       $559 = ((($$0$i$i)) + 4|0);
       $560 = HEAP32[$559>>2]|0;
       $561 = (($557) + ($560)|0);
       $562 = ($561>>>0)>($555>>>0);
       if ($562) {
        break;
       }
      }
      $563 = ((($$0$i$i)) + 8|0);
      $564 = HEAP32[$563>>2]|0;
      $565 = ($564|0)==(0|0);
      if ($565) {
       label = 163;
       break L246;
      } else {
       $$0$i$i = $564;
      }
     }
     $588 = (($541) - ($524))|0;
     $589 = $588 & $543;
     $590 = ($589>>>0)<(2147483647);
     if ($590) {
      $591 = (_sbrk(($589|0))|0);
      $592 = HEAP32[$$0$i$i>>2]|0;
      $593 = HEAP32[$559>>2]|0;
      $594 = (($592) + ($593)|0);
      $595 = ($591|0)==($594|0);
      if ($595) {
       $596 = ($591|0)==((-1)|0);
       if ($596) {
        $$2234253237$i = $589;
       } else {
        $$723948$i = $589;$$749$i = $591;
        label = 180;
        break L244;
       }
      } else {
       $$2247$ph$i = $591;$$2253$ph$i = $589;
       label = 171;
      }
     } else {
      $$2234253237$i = 0;
     }
    }
   } while(0);
   do {
    if ((label|0) == 163) {
     $566 = (_sbrk(0)|0);
     $567 = ($566|0)==((-1)|0);
     if ($567) {
      $$2234253237$i = 0;
     } else {
      $568 = $566;
      $569 = HEAP32[(23244)>>2]|0;
      $570 = (($569) + -1)|0;
      $571 = $570 & $568;
      $572 = ($571|0)==(0);
      $573 = (($570) + ($568))|0;
      $574 = (0 - ($569))|0;
      $575 = $573 & $574;
      $576 = (($575) - ($568))|0;
      $577 = $572 ? 0 : $576;
      $$$i = (($577) + ($544))|0;
      $578 = HEAP32[(23200)>>2]|0;
      $579 = (($$$i) + ($578))|0;
      $580 = ($$$i>>>0)>($$0197>>>0);
      $581 = ($$$i>>>0)<(2147483647);
      $or$cond$i214 = $580 & $581;
      if ($or$cond$i214) {
       $582 = HEAP32[(23208)>>2]|0;
       $583 = ($582|0)==(0);
       if (!($583)) {
        $584 = ($579>>>0)<=($578>>>0);
        $585 = ($579>>>0)>($582>>>0);
        $or$cond2$i215 = $584 | $585;
        if ($or$cond2$i215) {
         $$2234253237$i = 0;
         break;
        }
       }
       $586 = (_sbrk(($$$i|0))|0);
       $587 = ($586|0)==($566|0);
       if ($587) {
        $$723948$i = $$$i;$$749$i = $566;
        label = 180;
        break L244;
       } else {
        $$2247$ph$i = $586;$$2253$ph$i = $$$i;
        label = 171;
       }
      } else {
       $$2234253237$i = 0;
      }
     }
    }
   } while(0);
   do {
    if ((label|0) == 171) {
     $597 = (0 - ($$2253$ph$i))|0;
     $598 = ($$2247$ph$i|0)!=((-1)|0);
     $599 = ($$2253$ph$i>>>0)<(2147483647);
     $or$cond7$i = $599 & $598;
     $600 = ($539>>>0)>($$2253$ph$i>>>0);
     $or$cond10$i = $600 & $or$cond7$i;
     if (!($or$cond10$i)) {
      $610 = ($$2247$ph$i|0)==((-1)|0);
      if ($610) {
       $$2234253237$i = 0;
       break;
      } else {
       $$723948$i = $$2253$ph$i;$$749$i = $$2247$ph$i;
       label = 180;
       break L244;
      }
     }
     $601 = HEAP32[(23248)>>2]|0;
     $602 = (($540) - ($$2253$ph$i))|0;
     $603 = (($602) + ($601))|0;
     $604 = (0 - ($601))|0;
     $605 = $603 & $604;
     $606 = ($605>>>0)<(2147483647);
     if (!($606)) {
      $$723948$i = $$2253$ph$i;$$749$i = $$2247$ph$i;
      label = 180;
      break L244;
     }
     $607 = (_sbrk(($605|0))|0);
     $608 = ($607|0)==((-1)|0);
     if ($608) {
      (_sbrk(($597|0))|0);
      $$2234253237$i = 0;
      break;
     } else {
      $609 = (($605) + ($$2253$ph$i))|0;
      $$723948$i = $609;$$749$i = $$2247$ph$i;
      label = 180;
      break L244;
     }
    }
   } while(0);
   $611 = HEAP32[(23212)>>2]|0;
   $612 = $611 | 4;
   HEAP32[(23212)>>2] = $612;
   $$4236$i = $$2234253237$i;
   label = 178;
  } else {
   $$4236$i = 0;
   label = 178;
  }
 } while(0);
 if ((label|0) == 178) {
  $613 = ($544>>>0)<(2147483647);
  if ($613) {
   $614 = (_sbrk(($544|0))|0);
   $615 = (_sbrk(0)|0);
   $616 = ($614|0)!=((-1)|0);
   $617 = ($615|0)!=((-1)|0);
   $or$cond5$i = $616 & $617;
   $618 = ($614>>>0)<($615>>>0);
   $or$cond11$i = $618 & $or$cond5$i;
   $619 = $615;
   $620 = $614;
   $621 = (($619) - ($620))|0;
   $622 = (($$0197) + 40)|0;
   $623 = ($621>>>0)>($622>>>0);
   $$$4236$i = $623 ? $621 : $$4236$i;
   $or$cond11$not$i = $or$cond11$i ^ 1;
   $624 = ($614|0)==((-1)|0);
   $not$$i216 = $623 ^ 1;
   $625 = $624 | $not$$i216;
   $or$cond50$i = $625 | $or$cond11$not$i;
   if (!($or$cond50$i)) {
    $$723948$i = $$$4236$i;$$749$i = $614;
    label = 180;
   }
  }
 }
 if ((label|0) == 180) {
  $626 = HEAP32[(23200)>>2]|0;
  $627 = (($626) + ($$723948$i))|0;
  HEAP32[(23200)>>2] = $627;
  $628 = HEAP32[(23204)>>2]|0;
  $629 = ($627>>>0)>($628>>>0);
  if ($629) {
   HEAP32[(23204)>>2] = $627;
  }
  $630 = HEAP32[(22792)>>2]|0;
  $631 = ($630|0)==(0|0);
  do {
   if ($631) {
    $632 = HEAP32[(22784)>>2]|0;
    $633 = ($632|0)==(0|0);
    $634 = ($$749$i>>>0)<($632>>>0);
    $or$cond12$i = $633 | $634;
    if ($or$cond12$i) {
     HEAP32[(22784)>>2] = $$749$i;
    }
    HEAP32[(23216)>>2] = $$749$i;
    HEAP32[(23220)>>2] = $$723948$i;
    HEAP32[(23228)>>2] = 0;
    $635 = HEAP32[5810]|0;
    HEAP32[(22804)>>2] = $635;
    HEAP32[(22800)>>2] = -1;
    $$01$i$i = 0;
    while(1) {
     $636 = $$01$i$i << 1;
     $637 = (22808 + ($636<<2)|0);
     $638 = ((($637)) + 12|0);
     HEAP32[$638>>2] = $637;
     $639 = ((($637)) + 8|0);
     HEAP32[$639>>2] = $637;
     $640 = (($$01$i$i) + 1)|0;
     $exitcond$i$i = ($640|0)==(32);
     if ($exitcond$i$i) {
      break;
     } else {
      $$01$i$i = $640;
     }
    }
    $641 = (($$723948$i) + -40)|0;
    $642 = ((($$749$i)) + 8|0);
    $643 = $642;
    $644 = $643 & 7;
    $645 = ($644|0)==(0);
    $646 = (0 - ($643))|0;
    $647 = $646 & 7;
    $648 = $645 ? 0 : $647;
    $649 = (($$749$i) + ($648)|0);
    $650 = (($641) - ($648))|0;
    HEAP32[(22792)>>2] = $649;
    HEAP32[(22780)>>2] = $650;
    $651 = $650 | 1;
    $652 = ((($649)) + 4|0);
    HEAP32[$652>>2] = $651;
    $653 = (($649) + ($650)|0);
    $654 = ((($653)) + 4|0);
    HEAP32[$654>>2] = 40;
    $655 = HEAP32[(23256)>>2]|0;
    HEAP32[(22796)>>2] = $655;
   } else {
    $$024371$i = (23216);
    while(1) {
     $656 = HEAP32[$$024371$i>>2]|0;
     $657 = ((($$024371$i)) + 4|0);
     $658 = HEAP32[$657>>2]|0;
     $659 = (($656) + ($658)|0);
     $660 = ($$749$i|0)==($659|0);
     if ($660) {
      label = 190;
      break;
     }
     $661 = ((($$024371$i)) + 8|0);
     $662 = HEAP32[$661>>2]|0;
     $663 = ($662|0)==(0|0);
     if ($663) {
      break;
     } else {
      $$024371$i = $662;
     }
    }
    if ((label|0) == 190) {
     $664 = ((($$024371$i)) + 12|0);
     $665 = HEAP32[$664>>2]|0;
     $666 = $665 & 8;
     $667 = ($666|0)==(0);
     if ($667) {
      $668 = ($630>>>0)>=($656>>>0);
      $669 = ($630>>>0)<($$749$i>>>0);
      $or$cond51$i = $669 & $668;
      if ($or$cond51$i) {
       $670 = (($658) + ($$723948$i))|0;
       HEAP32[$657>>2] = $670;
       $671 = HEAP32[(22780)>>2]|0;
       $672 = ((($630)) + 8|0);
       $673 = $672;
       $674 = $673 & 7;
       $675 = ($674|0)==(0);
       $676 = (0 - ($673))|0;
       $677 = $676 & 7;
       $678 = $675 ? 0 : $677;
       $679 = (($630) + ($678)|0);
       $680 = (($$723948$i) - ($678))|0;
       $681 = (($671) + ($680))|0;
       HEAP32[(22792)>>2] = $679;
       HEAP32[(22780)>>2] = $681;
       $682 = $681 | 1;
       $683 = ((($679)) + 4|0);
       HEAP32[$683>>2] = $682;
       $684 = (($679) + ($681)|0);
       $685 = ((($684)) + 4|0);
       HEAP32[$685>>2] = 40;
       $686 = HEAP32[(23256)>>2]|0;
       HEAP32[(22796)>>2] = $686;
       break;
      }
     }
    }
    $687 = HEAP32[(22784)>>2]|0;
    $688 = ($$749$i>>>0)<($687>>>0);
    if ($688) {
     HEAP32[(22784)>>2] = $$749$i;
     $752 = $$749$i;
    } else {
     $752 = $687;
    }
    $689 = (($$749$i) + ($$723948$i)|0);
    $$124470$i = (23216);
    while(1) {
     $690 = HEAP32[$$124470$i>>2]|0;
     $691 = ($690|0)==($689|0);
     if ($691) {
      label = 198;
      break;
     }
     $692 = ((($$124470$i)) + 8|0);
     $693 = HEAP32[$692>>2]|0;
     $694 = ($693|0)==(0|0);
     if ($694) {
      break;
     } else {
      $$124470$i = $693;
     }
    }
    if ((label|0) == 198) {
     $695 = ((($$124470$i)) + 12|0);
     $696 = HEAP32[$695>>2]|0;
     $697 = $696 & 8;
     $698 = ($697|0)==(0);
     if ($698) {
      HEAP32[$$124470$i>>2] = $$749$i;
      $699 = ((($$124470$i)) + 4|0);
      $700 = HEAP32[$699>>2]|0;
      $701 = (($700) + ($$723948$i))|0;
      HEAP32[$699>>2] = $701;
      $702 = ((($$749$i)) + 8|0);
      $703 = $702;
      $704 = $703 & 7;
      $705 = ($704|0)==(0);
      $706 = (0 - ($703))|0;
      $707 = $706 & 7;
      $708 = $705 ? 0 : $707;
      $709 = (($$749$i) + ($708)|0);
      $710 = ((($689)) + 8|0);
      $711 = $710;
      $712 = $711 & 7;
      $713 = ($712|0)==(0);
      $714 = (0 - ($711))|0;
      $715 = $714 & 7;
      $716 = $713 ? 0 : $715;
      $717 = (($689) + ($716)|0);
      $718 = $717;
      $719 = $709;
      $720 = (($718) - ($719))|0;
      $721 = (($709) + ($$0197)|0);
      $722 = (($720) - ($$0197))|0;
      $723 = $$0197 | 3;
      $724 = ((($709)) + 4|0);
      HEAP32[$724>>2] = $723;
      $725 = ($717|0)==($630|0);
      do {
       if ($725) {
        $726 = HEAP32[(22780)>>2]|0;
        $727 = (($726) + ($722))|0;
        HEAP32[(22780)>>2] = $727;
        HEAP32[(22792)>>2] = $721;
        $728 = $727 | 1;
        $729 = ((($721)) + 4|0);
        HEAP32[$729>>2] = $728;
       } else {
        $730 = HEAP32[(22788)>>2]|0;
        $731 = ($717|0)==($730|0);
        if ($731) {
         $732 = HEAP32[(22776)>>2]|0;
         $733 = (($732) + ($722))|0;
         HEAP32[(22776)>>2] = $733;
         HEAP32[(22788)>>2] = $721;
         $734 = $733 | 1;
         $735 = ((($721)) + 4|0);
         HEAP32[$735>>2] = $734;
         $736 = (($721) + ($733)|0);
         HEAP32[$736>>2] = $733;
         break;
        }
        $737 = ((($717)) + 4|0);
        $738 = HEAP32[$737>>2]|0;
        $739 = $738 & 3;
        $740 = ($739|0)==(1);
        if ($740) {
         $741 = $738 & -8;
         $742 = $738 >>> 3;
         $743 = ($738>>>0)<(256);
         L314: do {
          if ($743) {
           $744 = ((($717)) + 8|0);
           $745 = HEAP32[$744>>2]|0;
           $746 = ((($717)) + 12|0);
           $747 = HEAP32[$746>>2]|0;
           $748 = $742 << 1;
           $749 = (22808 + ($748<<2)|0);
           $750 = ($745|0)==($749|0);
           do {
            if (!($750)) {
             $751 = ($745>>>0)<($752>>>0);
             if ($751) {
              _abort();
              // unreachable;
             }
             $753 = ((($745)) + 12|0);
             $754 = HEAP32[$753>>2]|0;
             $755 = ($754|0)==($717|0);
             if ($755) {
              break;
             }
             _abort();
             // unreachable;
            }
           } while(0);
           $756 = ($747|0)==($745|0);
           if ($756) {
            $757 = 1 << $742;
            $758 = $757 ^ -1;
            $759 = HEAP32[5692]|0;
            $760 = $759 & $758;
            HEAP32[5692] = $760;
            break;
           }
           $761 = ($747|0)==($749|0);
           do {
            if ($761) {
             $$pre10$i$i = ((($747)) + 8|0);
             $$pre$phi11$i$iZ2D = $$pre10$i$i;
            } else {
             $762 = ($747>>>0)<($752>>>0);
             if ($762) {
              _abort();
              // unreachable;
             }
             $763 = ((($747)) + 8|0);
             $764 = HEAP32[$763>>2]|0;
             $765 = ($764|0)==($717|0);
             if ($765) {
              $$pre$phi11$i$iZ2D = $763;
              break;
             }
             _abort();
             // unreachable;
            }
           } while(0);
           $766 = ((($745)) + 12|0);
           HEAP32[$766>>2] = $747;
           HEAP32[$$pre$phi11$i$iZ2D>>2] = $745;
          } else {
           $767 = ((($717)) + 24|0);
           $768 = HEAP32[$767>>2]|0;
           $769 = ((($717)) + 12|0);
           $770 = HEAP32[$769>>2]|0;
           $771 = ($770|0)==($717|0);
           do {
            if ($771) {
             $781 = ((($717)) + 16|0);
             $782 = ((($781)) + 4|0);
             $783 = HEAP32[$782>>2]|0;
             $784 = ($783|0)==(0|0);
             if ($784) {
              $785 = HEAP32[$781>>2]|0;
              $786 = ($785|0)==(0|0);
              if ($786) {
               $$3$i$i = 0;
               break;
              } else {
               $$1291$i$i = $785;$$1293$i$i = $781;
              }
             } else {
              $$1291$i$i = $783;$$1293$i$i = $782;
             }
             while(1) {
              $787 = ((($$1291$i$i)) + 20|0);
              $788 = HEAP32[$787>>2]|0;
              $789 = ($788|0)==(0|0);
              if (!($789)) {
               $$1291$i$i = $788;$$1293$i$i = $787;
               continue;
              }
              $790 = ((($$1291$i$i)) + 16|0);
              $791 = HEAP32[$790>>2]|0;
              $792 = ($791|0)==(0|0);
              if ($792) {
               break;
              } else {
               $$1291$i$i = $791;$$1293$i$i = $790;
              }
             }
             $793 = ($$1293$i$i>>>0)<($752>>>0);
             if ($793) {
              _abort();
              // unreachable;
             } else {
              HEAP32[$$1293$i$i>>2] = 0;
              $$3$i$i = $$1291$i$i;
              break;
             }
            } else {
             $772 = ((($717)) + 8|0);
             $773 = HEAP32[$772>>2]|0;
             $774 = ($773>>>0)<($752>>>0);
             if ($774) {
              _abort();
              // unreachable;
             }
             $775 = ((($773)) + 12|0);
             $776 = HEAP32[$775>>2]|0;
             $777 = ($776|0)==($717|0);
             if (!($777)) {
              _abort();
              // unreachable;
             }
             $778 = ((($770)) + 8|0);
             $779 = HEAP32[$778>>2]|0;
             $780 = ($779|0)==($717|0);
             if ($780) {
              HEAP32[$775>>2] = $770;
              HEAP32[$778>>2] = $773;
              $$3$i$i = $770;
              break;
             } else {
              _abort();
              // unreachable;
             }
            }
           } while(0);
           $794 = ($768|0)==(0|0);
           if ($794) {
            break;
           }
           $795 = ((($717)) + 28|0);
           $796 = HEAP32[$795>>2]|0;
           $797 = (23072 + ($796<<2)|0);
           $798 = HEAP32[$797>>2]|0;
           $799 = ($717|0)==($798|0);
           do {
            if ($799) {
             HEAP32[$797>>2] = $$3$i$i;
             $cond$i$i = ($$3$i$i|0)==(0|0);
             if (!($cond$i$i)) {
              break;
             }
             $800 = 1 << $796;
             $801 = $800 ^ -1;
             $802 = HEAP32[(22772)>>2]|0;
             $803 = $802 & $801;
             HEAP32[(22772)>>2] = $803;
             break L314;
            } else {
             $804 = HEAP32[(22784)>>2]|0;
             $805 = ($768>>>0)<($804>>>0);
             if ($805) {
              _abort();
              // unreachable;
             } else {
              $806 = ((($768)) + 16|0);
              $807 = HEAP32[$806>>2]|0;
              $not$$i17$i = ($807|0)!=($717|0);
              $$sink1$i$i = $not$$i17$i&1;
              $808 = (((($768)) + 16|0) + ($$sink1$i$i<<2)|0);
              HEAP32[$808>>2] = $$3$i$i;
              $809 = ($$3$i$i|0)==(0|0);
              if ($809) {
               break L314;
              } else {
               break;
              }
             }
            }
           } while(0);
           $810 = HEAP32[(22784)>>2]|0;
           $811 = ($$3$i$i>>>0)<($810>>>0);
           if ($811) {
            _abort();
            // unreachable;
           }
           $812 = ((($$3$i$i)) + 24|0);
           HEAP32[$812>>2] = $768;
           $813 = ((($717)) + 16|0);
           $814 = HEAP32[$813>>2]|0;
           $815 = ($814|0)==(0|0);
           do {
            if (!($815)) {
             $816 = ($814>>>0)<($810>>>0);
             if ($816) {
              _abort();
              // unreachable;
             } else {
              $817 = ((($$3$i$i)) + 16|0);
              HEAP32[$817>>2] = $814;
              $818 = ((($814)) + 24|0);
              HEAP32[$818>>2] = $$3$i$i;
              break;
             }
            }
           } while(0);
           $819 = ((($813)) + 4|0);
           $820 = HEAP32[$819>>2]|0;
           $821 = ($820|0)==(0|0);
           if ($821) {
            break;
           }
           $822 = HEAP32[(22784)>>2]|0;
           $823 = ($820>>>0)<($822>>>0);
           if ($823) {
            _abort();
            // unreachable;
           } else {
            $824 = ((($$3$i$i)) + 20|0);
            HEAP32[$824>>2] = $820;
            $825 = ((($820)) + 24|0);
            HEAP32[$825>>2] = $$3$i$i;
            break;
           }
          }
         } while(0);
         $826 = (($717) + ($741)|0);
         $827 = (($741) + ($722))|0;
         $$0$i18$i = $826;$$0287$i$i = $827;
        } else {
         $$0$i18$i = $717;$$0287$i$i = $722;
        }
        $828 = ((($$0$i18$i)) + 4|0);
        $829 = HEAP32[$828>>2]|0;
        $830 = $829 & -2;
        HEAP32[$828>>2] = $830;
        $831 = $$0287$i$i | 1;
        $832 = ((($721)) + 4|0);
        HEAP32[$832>>2] = $831;
        $833 = (($721) + ($$0287$i$i)|0);
        HEAP32[$833>>2] = $$0287$i$i;
        $834 = $$0287$i$i >>> 3;
        $835 = ($$0287$i$i>>>0)<(256);
        if ($835) {
         $836 = $834 << 1;
         $837 = (22808 + ($836<<2)|0);
         $838 = HEAP32[5692]|0;
         $839 = 1 << $834;
         $840 = $838 & $839;
         $841 = ($840|0)==(0);
         do {
          if ($841) {
           $842 = $838 | $839;
           HEAP32[5692] = $842;
           $$pre$i19$i = ((($837)) + 8|0);
           $$0295$i$i = $837;$$pre$phi$i20$iZ2D = $$pre$i19$i;
          } else {
           $843 = ((($837)) + 8|0);
           $844 = HEAP32[$843>>2]|0;
           $845 = HEAP32[(22784)>>2]|0;
           $846 = ($844>>>0)<($845>>>0);
           if (!($846)) {
            $$0295$i$i = $844;$$pre$phi$i20$iZ2D = $843;
            break;
           }
           _abort();
           // unreachable;
          }
         } while(0);
         HEAP32[$$pre$phi$i20$iZ2D>>2] = $721;
         $847 = ((($$0295$i$i)) + 12|0);
         HEAP32[$847>>2] = $721;
         $848 = ((($721)) + 8|0);
         HEAP32[$848>>2] = $$0295$i$i;
         $849 = ((($721)) + 12|0);
         HEAP32[$849>>2] = $837;
         break;
        }
        $850 = $$0287$i$i >>> 8;
        $851 = ($850|0)==(0);
        do {
         if ($851) {
          $$0296$i$i = 0;
         } else {
          $852 = ($$0287$i$i>>>0)>(16777215);
          if ($852) {
           $$0296$i$i = 31;
           break;
          }
          $853 = (($850) + 1048320)|0;
          $854 = $853 >>> 16;
          $855 = $854 & 8;
          $856 = $850 << $855;
          $857 = (($856) + 520192)|0;
          $858 = $857 >>> 16;
          $859 = $858 & 4;
          $860 = $859 | $855;
          $861 = $856 << $859;
          $862 = (($861) + 245760)|0;
          $863 = $862 >>> 16;
          $864 = $863 & 2;
          $865 = $860 | $864;
          $866 = (14 - ($865))|0;
          $867 = $861 << $864;
          $868 = $867 >>> 15;
          $869 = (($866) + ($868))|0;
          $870 = $869 << 1;
          $871 = (($869) + 7)|0;
          $872 = $$0287$i$i >>> $871;
          $873 = $872 & 1;
          $874 = $873 | $870;
          $$0296$i$i = $874;
         }
        } while(0);
        $875 = (23072 + ($$0296$i$i<<2)|0);
        $876 = ((($721)) + 28|0);
        HEAP32[$876>>2] = $$0296$i$i;
        $877 = ((($721)) + 16|0);
        $878 = ((($877)) + 4|0);
        HEAP32[$878>>2] = 0;
        HEAP32[$877>>2] = 0;
        $879 = HEAP32[(22772)>>2]|0;
        $880 = 1 << $$0296$i$i;
        $881 = $879 & $880;
        $882 = ($881|0)==(0);
        if ($882) {
         $883 = $879 | $880;
         HEAP32[(22772)>>2] = $883;
         HEAP32[$875>>2] = $721;
         $884 = ((($721)) + 24|0);
         HEAP32[$884>>2] = $875;
         $885 = ((($721)) + 12|0);
         HEAP32[$885>>2] = $721;
         $886 = ((($721)) + 8|0);
         HEAP32[$886>>2] = $721;
         break;
        }
        $887 = HEAP32[$875>>2]|0;
        $888 = ($$0296$i$i|0)==(31);
        $889 = $$0296$i$i >>> 1;
        $890 = (25 - ($889))|0;
        $891 = $888 ? 0 : $890;
        $892 = $$0287$i$i << $891;
        $$0288$i$i = $892;$$0289$i$i = $887;
        while(1) {
         $893 = ((($$0289$i$i)) + 4|0);
         $894 = HEAP32[$893>>2]|0;
         $895 = $894 & -8;
         $896 = ($895|0)==($$0287$i$i|0);
         if ($896) {
          label = 265;
          break;
         }
         $897 = $$0288$i$i >>> 31;
         $898 = (((($$0289$i$i)) + 16|0) + ($897<<2)|0);
         $899 = $$0288$i$i << 1;
         $900 = HEAP32[$898>>2]|0;
         $901 = ($900|0)==(0|0);
         if ($901) {
          label = 262;
          break;
         } else {
          $$0288$i$i = $899;$$0289$i$i = $900;
         }
        }
        if ((label|0) == 262) {
         $902 = HEAP32[(22784)>>2]|0;
         $903 = ($898>>>0)<($902>>>0);
         if ($903) {
          _abort();
          // unreachable;
         } else {
          HEAP32[$898>>2] = $721;
          $904 = ((($721)) + 24|0);
          HEAP32[$904>>2] = $$0289$i$i;
          $905 = ((($721)) + 12|0);
          HEAP32[$905>>2] = $721;
          $906 = ((($721)) + 8|0);
          HEAP32[$906>>2] = $721;
          break;
         }
        }
        else if ((label|0) == 265) {
         $907 = ((($$0289$i$i)) + 8|0);
         $908 = HEAP32[$907>>2]|0;
         $909 = HEAP32[(22784)>>2]|0;
         $910 = ($908>>>0)>=($909>>>0);
         $not$7$i$i = ($$0289$i$i>>>0)>=($909>>>0);
         $911 = $910 & $not$7$i$i;
         if ($911) {
          $912 = ((($908)) + 12|0);
          HEAP32[$912>>2] = $721;
          HEAP32[$907>>2] = $721;
          $913 = ((($721)) + 8|0);
          HEAP32[$913>>2] = $908;
          $914 = ((($721)) + 12|0);
          HEAP32[$914>>2] = $$0289$i$i;
          $915 = ((($721)) + 24|0);
          HEAP32[$915>>2] = 0;
          break;
         } else {
          _abort();
          // unreachable;
         }
        }
       }
      } while(0);
      $1047 = ((($709)) + 8|0);
      $$0 = $1047;
      STACKTOP = sp;return ($$0|0);
     }
    }
    $$0$i$i$i = (23216);
    while(1) {
     $916 = HEAP32[$$0$i$i$i>>2]|0;
     $917 = ($916>>>0)>($630>>>0);
     if (!($917)) {
      $918 = ((($$0$i$i$i)) + 4|0);
      $919 = HEAP32[$918>>2]|0;
      $920 = (($916) + ($919)|0);
      $921 = ($920>>>0)>($630>>>0);
      if ($921) {
       break;
      }
     }
     $922 = ((($$0$i$i$i)) + 8|0);
     $923 = HEAP32[$922>>2]|0;
     $$0$i$i$i = $923;
    }
    $924 = ((($920)) + -47|0);
    $925 = ((($924)) + 8|0);
    $926 = $925;
    $927 = $926 & 7;
    $928 = ($927|0)==(0);
    $929 = (0 - ($926))|0;
    $930 = $929 & 7;
    $931 = $928 ? 0 : $930;
    $932 = (($924) + ($931)|0);
    $933 = ((($630)) + 16|0);
    $934 = ($932>>>0)<($933>>>0);
    $935 = $934 ? $630 : $932;
    $936 = ((($935)) + 8|0);
    $937 = ((($935)) + 24|0);
    $938 = (($$723948$i) + -40)|0;
    $939 = ((($$749$i)) + 8|0);
    $940 = $939;
    $941 = $940 & 7;
    $942 = ($941|0)==(0);
    $943 = (0 - ($940))|0;
    $944 = $943 & 7;
    $945 = $942 ? 0 : $944;
    $946 = (($$749$i) + ($945)|0);
    $947 = (($938) - ($945))|0;
    HEAP32[(22792)>>2] = $946;
    HEAP32[(22780)>>2] = $947;
    $948 = $947 | 1;
    $949 = ((($946)) + 4|0);
    HEAP32[$949>>2] = $948;
    $950 = (($946) + ($947)|0);
    $951 = ((($950)) + 4|0);
    HEAP32[$951>>2] = 40;
    $952 = HEAP32[(23256)>>2]|0;
    HEAP32[(22796)>>2] = $952;
    $953 = ((($935)) + 4|0);
    HEAP32[$953>>2] = 27;
    ;HEAP32[$936>>2]=HEAP32[(23216)>>2]|0;HEAP32[$936+4>>2]=HEAP32[(23216)+4>>2]|0;HEAP32[$936+8>>2]=HEAP32[(23216)+8>>2]|0;HEAP32[$936+12>>2]=HEAP32[(23216)+12>>2]|0;
    HEAP32[(23216)>>2] = $$749$i;
    HEAP32[(23220)>>2] = $$723948$i;
    HEAP32[(23228)>>2] = 0;
    HEAP32[(23224)>>2] = $936;
    $955 = $937;
    while(1) {
     $954 = ((($955)) + 4|0);
     HEAP32[$954>>2] = 7;
     $956 = ((($955)) + 8|0);
     $957 = ($956>>>0)<($920>>>0);
     if ($957) {
      $955 = $954;
     } else {
      break;
     }
    }
    $958 = ($935|0)==($630|0);
    if (!($958)) {
     $959 = $935;
     $960 = $630;
     $961 = (($959) - ($960))|0;
     $962 = HEAP32[$953>>2]|0;
     $963 = $962 & -2;
     HEAP32[$953>>2] = $963;
     $964 = $961 | 1;
     $965 = ((($630)) + 4|0);
     HEAP32[$965>>2] = $964;
     HEAP32[$935>>2] = $961;
     $966 = $961 >>> 3;
     $967 = ($961>>>0)<(256);
     if ($967) {
      $968 = $966 << 1;
      $969 = (22808 + ($968<<2)|0);
      $970 = HEAP32[5692]|0;
      $971 = 1 << $966;
      $972 = $970 & $971;
      $973 = ($972|0)==(0);
      if ($973) {
       $974 = $970 | $971;
       HEAP32[5692] = $974;
       $$pre$i$i = ((($969)) + 8|0);
       $$0211$i$i = $969;$$pre$phi$i$iZ2D = $$pre$i$i;
      } else {
       $975 = ((($969)) + 8|0);
       $976 = HEAP32[$975>>2]|0;
       $977 = HEAP32[(22784)>>2]|0;
       $978 = ($976>>>0)<($977>>>0);
       if ($978) {
        _abort();
        // unreachable;
       } else {
        $$0211$i$i = $976;$$pre$phi$i$iZ2D = $975;
       }
      }
      HEAP32[$$pre$phi$i$iZ2D>>2] = $630;
      $979 = ((($$0211$i$i)) + 12|0);
      HEAP32[$979>>2] = $630;
      $980 = ((($630)) + 8|0);
      HEAP32[$980>>2] = $$0211$i$i;
      $981 = ((($630)) + 12|0);
      HEAP32[$981>>2] = $969;
      break;
     }
     $982 = $961 >>> 8;
     $983 = ($982|0)==(0);
     if ($983) {
      $$0212$i$i = 0;
     } else {
      $984 = ($961>>>0)>(16777215);
      if ($984) {
       $$0212$i$i = 31;
      } else {
       $985 = (($982) + 1048320)|0;
       $986 = $985 >>> 16;
       $987 = $986 & 8;
       $988 = $982 << $987;
       $989 = (($988) + 520192)|0;
       $990 = $989 >>> 16;
       $991 = $990 & 4;
       $992 = $991 | $987;
       $993 = $988 << $991;
       $994 = (($993) + 245760)|0;
       $995 = $994 >>> 16;
       $996 = $995 & 2;
       $997 = $992 | $996;
       $998 = (14 - ($997))|0;
       $999 = $993 << $996;
       $1000 = $999 >>> 15;
       $1001 = (($998) + ($1000))|0;
       $1002 = $1001 << 1;
       $1003 = (($1001) + 7)|0;
       $1004 = $961 >>> $1003;
       $1005 = $1004 & 1;
       $1006 = $1005 | $1002;
       $$0212$i$i = $1006;
      }
     }
     $1007 = (23072 + ($$0212$i$i<<2)|0);
     $1008 = ((($630)) + 28|0);
     HEAP32[$1008>>2] = $$0212$i$i;
     $1009 = ((($630)) + 20|0);
     HEAP32[$1009>>2] = 0;
     HEAP32[$933>>2] = 0;
     $1010 = HEAP32[(22772)>>2]|0;
     $1011 = 1 << $$0212$i$i;
     $1012 = $1010 & $1011;
     $1013 = ($1012|0)==(0);
     if ($1013) {
      $1014 = $1010 | $1011;
      HEAP32[(22772)>>2] = $1014;
      HEAP32[$1007>>2] = $630;
      $1015 = ((($630)) + 24|0);
      HEAP32[$1015>>2] = $1007;
      $1016 = ((($630)) + 12|0);
      HEAP32[$1016>>2] = $630;
      $1017 = ((($630)) + 8|0);
      HEAP32[$1017>>2] = $630;
      break;
     }
     $1018 = HEAP32[$1007>>2]|0;
     $1019 = ($$0212$i$i|0)==(31);
     $1020 = $$0212$i$i >>> 1;
     $1021 = (25 - ($1020))|0;
     $1022 = $1019 ? 0 : $1021;
     $1023 = $961 << $1022;
     $$0206$i$i = $1023;$$0207$i$i = $1018;
     while(1) {
      $1024 = ((($$0207$i$i)) + 4|0);
      $1025 = HEAP32[$1024>>2]|0;
      $1026 = $1025 & -8;
      $1027 = ($1026|0)==($961|0);
      if ($1027) {
       label = 292;
       break;
      }
      $1028 = $$0206$i$i >>> 31;
      $1029 = (((($$0207$i$i)) + 16|0) + ($1028<<2)|0);
      $1030 = $$0206$i$i << 1;
      $1031 = HEAP32[$1029>>2]|0;
      $1032 = ($1031|0)==(0|0);
      if ($1032) {
       label = 289;
       break;
      } else {
       $$0206$i$i = $1030;$$0207$i$i = $1031;
      }
     }
     if ((label|0) == 289) {
      $1033 = HEAP32[(22784)>>2]|0;
      $1034 = ($1029>>>0)<($1033>>>0);
      if ($1034) {
       _abort();
       // unreachable;
      } else {
       HEAP32[$1029>>2] = $630;
       $1035 = ((($630)) + 24|0);
       HEAP32[$1035>>2] = $$0207$i$i;
       $1036 = ((($630)) + 12|0);
       HEAP32[$1036>>2] = $630;
       $1037 = ((($630)) + 8|0);
       HEAP32[$1037>>2] = $630;
       break;
      }
     }
     else if ((label|0) == 292) {
      $1038 = ((($$0207$i$i)) + 8|0);
      $1039 = HEAP32[$1038>>2]|0;
      $1040 = HEAP32[(22784)>>2]|0;
      $1041 = ($1039>>>0)>=($1040>>>0);
      $not$$i$i = ($$0207$i$i>>>0)>=($1040>>>0);
      $1042 = $1041 & $not$$i$i;
      if ($1042) {
       $1043 = ((($1039)) + 12|0);
       HEAP32[$1043>>2] = $630;
       HEAP32[$1038>>2] = $630;
       $1044 = ((($630)) + 8|0);
       HEAP32[$1044>>2] = $1039;
       $1045 = ((($630)) + 12|0);
       HEAP32[$1045>>2] = $$0207$i$i;
       $1046 = ((($630)) + 24|0);
       HEAP32[$1046>>2] = 0;
       break;
      } else {
       _abort();
       // unreachable;
      }
     }
    }
   }
  } while(0);
  $1048 = HEAP32[(22780)>>2]|0;
  $1049 = ($1048>>>0)>($$0197>>>0);
  if ($1049) {
   $1050 = (($1048) - ($$0197))|0;
   HEAP32[(22780)>>2] = $1050;
   $1051 = HEAP32[(22792)>>2]|0;
   $1052 = (($1051) + ($$0197)|0);
   HEAP32[(22792)>>2] = $1052;
   $1053 = $1050 | 1;
   $1054 = ((($1052)) + 4|0);
   HEAP32[$1054>>2] = $1053;
   $1055 = $$0197 | 3;
   $1056 = ((($1051)) + 4|0);
   HEAP32[$1056>>2] = $1055;
   $1057 = ((($1051)) + 8|0);
   $$0 = $1057;
   STACKTOP = sp;return ($$0|0);
  }
 }
 $1058 = (___errno_location()|0);
 HEAP32[$1058>>2] = 12;
 $$0 = 0;
 STACKTOP = sp;return ($$0|0);
}
function _free($0) {
 $0 = $0|0;
 var $$0212$i = 0, $$0212$in$i = 0, $$0383 = 0, $$0384 = 0, $$0396 = 0, $$0403 = 0, $$1 = 0, $$1382 = 0, $$1387 = 0, $$1390 = 0, $$1398 = 0, $$1402 = 0, $$2 = 0, $$3 = 0, $$3400 = 0, $$pre = 0, $$pre$phi443Z2D = 0, $$pre$phi445Z2D = 0, $$pre$phiZ2D = 0, $$pre442 = 0;
 var $$pre444 = 0, $$sink3 = 0, $$sink5 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0;
 var $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0;
 var $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0;
 var $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0;
 var $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0;
 var $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0;
 var $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0;
 var $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0;
 var $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0;
 var $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0;
 var $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0;
 var $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0;
 var $312 = 0, $313 = 0, $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0;
 var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0;
 var $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0;
 var $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0;
 var $99 = 0, $cond421 = 0, $cond422 = 0, $not$ = 0, $not$405 = 0, $not$437 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = ($0|0)==(0|0);
 if ($1) {
  return;
 }
 $2 = ((($0)) + -8|0);
 $3 = HEAP32[(22784)>>2]|0;
 $4 = ($2>>>0)<($3>>>0);
 if ($4) {
  _abort();
  // unreachable;
 }
 $5 = ((($0)) + -4|0);
 $6 = HEAP32[$5>>2]|0;
 $7 = $6 & 3;
 $8 = ($7|0)==(1);
 if ($8) {
  _abort();
  // unreachable;
 }
 $9 = $6 & -8;
 $10 = (($2) + ($9)|0);
 $11 = $6 & 1;
 $12 = ($11|0)==(0);
 L10: do {
  if ($12) {
   $13 = HEAP32[$2>>2]|0;
   $14 = ($7|0)==(0);
   if ($14) {
    return;
   }
   $15 = (0 - ($13))|0;
   $16 = (($2) + ($15)|0);
   $17 = (($13) + ($9))|0;
   $18 = ($16>>>0)<($3>>>0);
   if ($18) {
    _abort();
    // unreachable;
   }
   $19 = HEAP32[(22788)>>2]|0;
   $20 = ($16|0)==($19|0);
   if ($20) {
    $104 = ((($10)) + 4|0);
    $105 = HEAP32[$104>>2]|0;
    $106 = $105 & 3;
    $107 = ($106|0)==(3);
    if (!($107)) {
     $$1 = $16;$$1382 = $17;$113 = $16;
     break;
    }
    $108 = (($16) + ($17)|0);
    $109 = ((($16)) + 4|0);
    $110 = $17 | 1;
    $111 = $105 & -2;
    HEAP32[(22776)>>2] = $17;
    HEAP32[$104>>2] = $111;
    HEAP32[$109>>2] = $110;
    HEAP32[$108>>2] = $17;
    return;
   }
   $21 = $13 >>> 3;
   $22 = ($13>>>0)<(256);
   if ($22) {
    $23 = ((($16)) + 8|0);
    $24 = HEAP32[$23>>2]|0;
    $25 = ((($16)) + 12|0);
    $26 = HEAP32[$25>>2]|0;
    $27 = $21 << 1;
    $28 = (22808 + ($27<<2)|0);
    $29 = ($24|0)==($28|0);
    if (!($29)) {
     $30 = ($24>>>0)<($3>>>0);
     if ($30) {
      _abort();
      // unreachable;
     }
     $31 = ((($24)) + 12|0);
     $32 = HEAP32[$31>>2]|0;
     $33 = ($32|0)==($16|0);
     if (!($33)) {
      _abort();
      // unreachable;
     }
    }
    $34 = ($26|0)==($24|0);
    if ($34) {
     $35 = 1 << $21;
     $36 = $35 ^ -1;
     $37 = HEAP32[5692]|0;
     $38 = $37 & $36;
     HEAP32[5692] = $38;
     $$1 = $16;$$1382 = $17;$113 = $16;
     break;
    }
    $39 = ($26|0)==($28|0);
    if ($39) {
     $$pre444 = ((($26)) + 8|0);
     $$pre$phi445Z2D = $$pre444;
    } else {
     $40 = ($26>>>0)<($3>>>0);
     if ($40) {
      _abort();
      // unreachable;
     }
     $41 = ((($26)) + 8|0);
     $42 = HEAP32[$41>>2]|0;
     $43 = ($42|0)==($16|0);
     if ($43) {
      $$pre$phi445Z2D = $41;
     } else {
      _abort();
      // unreachable;
     }
    }
    $44 = ((($24)) + 12|0);
    HEAP32[$44>>2] = $26;
    HEAP32[$$pre$phi445Z2D>>2] = $24;
    $$1 = $16;$$1382 = $17;$113 = $16;
    break;
   }
   $45 = ((($16)) + 24|0);
   $46 = HEAP32[$45>>2]|0;
   $47 = ((($16)) + 12|0);
   $48 = HEAP32[$47>>2]|0;
   $49 = ($48|0)==($16|0);
   do {
    if ($49) {
     $59 = ((($16)) + 16|0);
     $60 = ((($59)) + 4|0);
     $61 = HEAP32[$60>>2]|0;
     $62 = ($61|0)==(0|0);
     if ($62) {
      $63 = HEAP32[$59>>2]|0;
      $64 = ($63|0)==(0|0);
      if ($64) {
       $$3 = 0;
       break;
      } else {
       $$1387 = $63;$$1390 = $59;
      }
     } else {
      $$1387 = $61;$$1390 = $60;
     }
     while(1) {
      $65 = ((($$1387)) + 20|0);
      $66 = HEAP32[$65>>2]|0;
      $67 = ($66|0)==(0|0);
      if (!($67)) {
       $$1387 = $66;$$1390 = $65;
       continue;
      }
      $68 = ((($$1387)) + 16|0);
      $69 = HEAP32[$68>>2]|0;
      $70 = ($69|0)==(0|0);
      if ($70) {
       break;
      } else {
       $$1387 = $69;$$1390 = $68;
      }
     }
     $71 = ($$1390>>>0)<($3>>>0);
     if ($71) {
      _abort();
      // unreachable;
     } else {
      HEAP32[$$1390>>2] = 0;
      $$3 = $$1387;
      break;
     }
    } else {
     $50 = ((($16)) + 8|0);
     $51 = HEAP32[$50>>2]|0;
     $52 = ($51>>>0)<($3>>>0);
     if ($52) {
      _abort();
      // unreachable;
     }
     $53 = ((($51)) + 12|0);
     $54 = HEAP32[$53>>2]|0;
     $55 = ($54|0)==($16|0);
     if (!($55)) {
      _abort();
      // unreachable;
     }
     $56 = ((($48)) + 8|0);
     $57 = HEAP32[$56>>2]|0;
     $58 = ($57|0)==($16|0);
     if ($58) {
      HEAP32[$53>>2] = $48;
      HEAP32[$56>>2] = $51;
      $$3 = $48;
      break;
     } else {
      _abort();
      // unreachable;
     }
    }
   } while(0);
   $72 = ($46|0)==(0|0);
   if ($72) {
    $$1 = $16;$$1382 = $17;$113 = $16;
   } else {
    $73 = ((($16)) + 28|0);
    $74 = HEAP32[$73>>2]|0;
    $75 = (23072 + ($74<<2)|0);
    $76 = HEAP32[$75>>2]|0;
    $77 = ($16|0)==($76|0);
    do {
     if ($77) {
      HEAP32[$75>>2] = $$3;
      $cond421 = ($$3|0)==(0|0);
      if ($cond421) {
       $78 = 1 << $74;
       $79 = $78 ^ -1;
       $80 = HEAP32[(22772)>>2]|0;
       $81 = $80 & $79;
       HEAP32[(22772)>>2] = $81;
       $$1 = $16;$$1382 = $17;$113 = $16;
       break L10;
      }
     } else {
      $82 = HEAP32[(22784)>>2]|0;
      $83 = ($46>>>0)<($82>>>0);
      if ($83) {
       _abort();
       // unreachable;
      } else {
       $84 = ((($46)) + 16|0);
       $85 = HEAP32[$84>>2]|0;
       $not$405 = ($85|0)!=($16|0);
       $$sink3 = $not$405&1;
       $86 = (((($46)) + 16|0) + ($$sink3<<2)|0);
       HEAP32[$86>>2] = $$3;
       $87 = ($$3|0)==(0|0);
       if ($87) {
        $$1 = $16;$$1382 = $17;$113 = $16;
        break L10;
       } else {
        break;
       }
      }
     }
    } while(0);
    $88 = HEAP32[(22784)>>2]|0;
    $89 = ($$3>>>0)<($88>>>0);
    if ($89) {
     _abort();
     // unreachable;
    }
    $90 = ((($$3)) + 24|0);
    HEAP32[$90>>2] = $46;
    $91 = ((($16)) + 16|0);
    $92 = HEAP32[$91>>2]|0;
    $93 = ($92|0)==(0|0);
    do {
     if (!($93)) {
      $94 = ($92>>>0)<($88>>>0);
      if ($94) {
       _abort();
       // unreachable;
      } else {
       $95 = ((($$3)) + 16|0);
       HEAP32[$95>>2] = $92;
       $96 = ((($92)) + 24|0);
       HEAP32[$96>>2] = $$3;
       break;
      }
     }
    } while(0);
    $97 = ((($91)) + 4|0);
    $98 = HEAP32[$97>>2]|0;
    $99 = ($98|0)==(0|0);
    if ($99) {
     $$1 = $16;$$1382 = $17;$113 = $16;
    } else {
     $100 = HEAP32[(22784)>>2]|0;
     $101 = ($98>>>0)<($100>>>0);
     if ($101) {
      _abort();
      // unreachable;
     } else {
      $102 = ((($$3)) + 20|0);
      HEAP32[$102>>2] = $98;
      $103 = ((($98)) + 24|0);
      HEAP32[$103>>2] = $$3;
      $$1 = $16;$$1382 = $17;$113 = $16;
      break;
     }
    }
   }
  } else {
   $$1 = $2;$$1382 = $9;$113 = $2;
  }
 } while(0);
 $112 = ($113>>>0)<($10>>>0);
 if (!($112)) {
  _abort();
  // unreachable;
 }
 $114 = ((($10)) + 4|0);
 $115 = HEAP32[$114>>2]|0;
 $116 = $115 & 1;
 $117 = ($116|0)==(0);
 if ($117) {
  _abort();
  // unreachable;
 }
 $118 = $115 & 2;
 $119 = ($118|0)==(0);
 if ($119) {
  $120 = HEAP32[(22792)>>2]|0;
  $121 = ($10|0)==($120|0);
  $122 = HEAP32[(22788)>>2]|0;
  if ($121) {
   $123 = HEAP32[(22780)>>2]|0;
   $124 = (($123) + ($$1382))|0;
   HEAP32[(22780)>>2] = $124;
   HEAP32[(22792)>>2] = $$1;
   $125 = $124 | 1;
   $126 = ((($$1)) + 4|0);
   HEAP32[$126>>2] = $125;
   $127 = ($$1|0)==($122|0);
   if (!($127)) {
    return;
   }
   HEAP32[(22788)>>2] = 0;
   HEAP32[(22776)>>2] = 0;
   return;
  }
  $128 = ($10|0)==($122|0);
  if ($128) {
   $129 = HEAP32[(22776)>>2]|0;
   $130 = (($129) + ($$1382))|0;
   HEAP32[(22776)>>2] = $130;
   HEAP32[(22788)>>2] = $113;
   $131 = $130 | 1;
   $132 = ((($$1)) + 4|0);
   HEAP32[$132>>2] = $131;
   $133 = (($113) + ($130)|0);
   HEAP32[$133>>2] = $130;
   return;
  }
  $134 = $115 & -8;
  $135 = (($134) + ($$1382))|0;
  $136 = $115 >>> 3;
  $137 = ($115>>>0)<(256);
  L108: do {
   if ($137) {
    $138 = ((($10)) + 8|0);
    $139 = HEAP32[$138>>2]|0;
    $140 = ((($10)) + 12|0);
    $141 = HEAP32[$140>>2]|0;
    $142 = $136 << 1;
    $143 = (22808 + ($142<<2)|0);
    $144 = ($139|0)==($143|0);
    if (!($144)) {
     $145 = HEAP32[(22784)>>2]|0;
     $146 = ($139>>>0)<($145>>>0);
     if ($146) {
      _abort();
      // unreachable;
     }
     $147 = ((($139)) + 12|0);
     $148 = HEAP32[$147>>2]|0;
     $149 = ($148|0)==($10|0);
     if (!($149)) {
      _abort();
      // unreachable;
     }
    }
    $150 = ($141|0)==($139|0);
    if ($150) {
     $151 = 1 << $136;
     $152 = $151 ^ -1;
     $153 = HEAP32[5692]|0;
     $154 = $153 & $152;
     HEAP32[5692] = $154;
     break;
    }
    $155 = ($141|0)==($143|0);
    if ($155) {
     $$pre442 = ((($141)) + 8|0);
     $$pre$phi443Z2D = $$pre442;
    } else {
     $156 = HEAP32[(22784)>>2]|0;
     $157 = ($141>>>0)<($156>>>0);
     if ($157) {
      _abort();
      // unreachable;
     }
     $158 = ((($141)) + 8|0);
     $159 = HEAP32[$158>>2]|0;
     $160 = ($159|0)==($10|0);
     if ($160) {
      $$pre$phi443Z2D = $158;
     } else {
      _abort();
      // unreachable;
     }
    }
    $161 = ((($139)) + 12|0);
    HEAP32[$161>>2] = $141;
    HEAP32[$$pre$phi443Z2D>>2] = $139;
   } else {
    $162 = ((($10)) + 24|0);
    $163 = HEAP32[$162>>2]|0;
    $164 = ((($10)) + 12|0);
    $165 = HEAP32[$164>>2]|0;
    $166 = ($165|0)==($10|0);
    do {
     if ($166) {
      $177 = ((($10)) + 16|0);
      $178 = ((($177)) + 4|0);
      $179 = HEAP32[$178>>2]|0;
      $180 = ($179|0)==(0|0);
      if ($180) {
       $181 = HEAP32[$177>>2]|0;
       $182 = ($181|0)==(0|0);
       if ($182) {
        $$3400 = 0;
        break;
       } else {
        $$1398 = $181;$$1402 = $177;
       }
      } else {
       $$1398 = $179;$$1402 = $178;
      }
      while(1) {
       $183 = ((($$1398)) + 20|0);
       $184 = HEAP32[$183>>2]|0;
       $185 = ($184|0)==(0|0);
       if (!($185)) {
        $$1398 = $184;$$1402 = $183;
        continue;
       }
       $186 = ((($$1398)) + 16|0);
       $187 = HEAP32[$186>>2]|0;
       $188 = ($187|0)==(0|0);
       if ($188) {
        break;
       } else {
        $$1398 = $187;$$1402 = $186;
       }
      }
      $189 = HEAP32[(22784)>>2]|0;
      $190 = ($$1402>>>0)<($189>>>0);
      if ($190) {
       _abort();
       // unreachable;
      } else {
       HEAP32[$$1402>>2] = 0;
       $$3400 = $$1398;
       break;
      }
     } else {
      $167 = ((($10)) + 8|0);
      $168 = HEAP32[$167>>2]|0;
      $169 = HEAP32[(22784)>>2]|0;
      $170 = ($168>>>0)<($169>>>0);
      if ($170) {
       _abort();
       // unreachable;
      }
      $171 = ((($168)) + 12|0);
      $172 = HEAP32[$171>>2]|0;
      $173 = ($172|0)==($10|0);
      if (!($173)) {
       _abort();
       // unreachable;
      }
      $174 = ((($165)) + 8|0);
      $175 = HEAP32[$174>>2]|0;
      $176 = ($175|0)==($10|0);
      if ($176) {
       HEAP32[$171>>2] = $165;
       HEAP32[$174>>2] = $168;
       $$3400 = $165;
       break;
      } else {
       _abort();
       // unreachable;
      }
     }
    } while(0);
    $191 = ($163|0)==(0|0);
    if (!($191)) {
     $192 = ((($10)) + 28|0);
     $193 = HEAP32[$192>>2]|0;
     $194 = (23072 + ($193<<2)|0);
     $195 = HEAP32[$194>>2]|0;
     $196 = ($10|0)==($195|0);
     do {
      if ($196) {
       HEAP32[$194>>2] = $$3400;
       $cond422 = ($$3400|0)==(0|0);
       if ($cond422) {
        $197 = 1 << $193;
        $198 = $197 ^ -1;
        $199 = HEAP32[(22772)>>2]|0;
        $200 = $199 & $198;
        HEAP32[(22772)>>2] = $200;
        break L108;
       }
      } else {
       $201 = HEAP32[(22784)>>2]|0;
       $202 = ($163>>>0)<($201>>>0);
       if ($202) {
        _abort();
        // unreachable;
       } else {
        $203 = ((($163)) + 16|0);
        $204 = HEAP32[$203>>2]|0;
        $not$ = ($204|0)!=($10|0);
        $$sink5 = $not$&1;
        $205 = (((($163)) + 16|0) + ($$sink5<<2)|0);
        HEAP32[$205>>2] = $$3400;
        $206 = ($$3400|0)==(0|0);
        if ($206) {
         break L108;
        } else {
         break;
        }
       }
      }
     } while(0);
     $207 = HEAP32[(22784)>>2]|0;
     $208 = ($$3400>>>0)<($207>>>0);
     if ($208) {
      _abort();
      // unreachable;
     }
     $209 = ((($$3400)) + 24|0);
     HEAP32[$209>>2] = $163;
     $210 = ((($10)) + 16|0);
     $211 = HEAP32[$210>>2]|0;
     $212 = ($211|0)==(0|0);
     do {
      if (!($212)) {
       $213 = ($211>>>0)<($207>>>0);
       if ($213) {
        _abort();
        // unreachable;
       } else {
        $214 = ((($$3400)) + 16|0);
        HEAP32[$214>>2] = $211;
        $215 = ((($211)) + 24|0);
        HEAP32[$215>>2] = $$3400;
        break;
       }
      }
     } while(0);
     $216 = ((($210)) + 4|0);
     $217 = HEAP32[$216>>2]|0;
     $218 = ($217|0)==(0|0);
     if (!($218)) {
      $219 = HEAP32[(22784)>>2]|0;
      $220 = ($217>>>0)<($219>>>0);
      if ($220) {
       _abort();
       // unreachable;
      } else {
       $221 = ((($$3400)) + 20|0);
       HEAP32[$221>>2] = $217;
       $222 = ((($217)) + 24|0);
       HEAP32[$222>>2] = $$3400;
       break;
      }
     }
    }
   }
  } while(0);
  $223 = $135 | 1;
  $224 = ((($$1)) + 4|0);
  HEAP32[$224>>2] = $223;
  $225 = (($113) + ($135)|0);
  HEAP32[$225>>2] = $135;
  $226 = HEAP32[(22788)>>2]|0;
  $227 = ($$1|0)==($226|0);
  if ($227) {
   HEAP32[(22776)>>2] = $135;
   return;
  } else {
   $$2 = $135;
  }
 } else {
  $228 = $115 & -2;
  HEAP32[$114>>2] = $228;
  $229 = $$1382 | 1;
  $230 = ((($$1)) + 4|0);
  HEAP32[$230>>2] = $229;
  $231 = (($113) + ($$1382)|0);
  HEAP32[$231>>2] = $$1382;
  $$2 = $$1382;
 }
 $232 = $$2 >>> 3;
 $233 = ($$2>>>0)<(256);
 if ($233) {
  $234 = $232 << 1;
  $235 = (22808 + ($234<<2)|0);
  $236 = HEAP32[5692]|0;
  $237 = 1 << $232;
  $238 = $236 & $237;
  $239 = ($238|0)==(0);
  if ($239) {
   $240 = $236 | $237;
   HEAP32[5692] = $240;
   $$pre = ((($235)) + 8|0);
   $$0403 = $235;$$pre$phiZ2D = $$pre;
  } else {
   $241 = ((($235)) + 8|0);
   $242 = HEAP32[$241>>2]|0;
   $243 = HEAP32[(22784)>>2]|0;
   $244 = ($242>>>0)<($243>>>0);
   if ($244) {
    _abort();
    // unreachable;
   } else {
    $$0403 = $242;$$pre$phiZ2D = $241;
   }
  }
  HEAP32[$$pre$phiZ2D>>2] = $$1;
  $245 = ((($$0403)) + 12|0);
  HEAP32[$245>>2] = $$1;
  $246 = ((($$1)) + 8|0);
  HEAP32[$246>>2] = $$0403;
  $247 = ((($$1)) + 12|0);
  HEAP32[$247>>2] = $235;
  return;
 }
 $248 = $$2 >>> 8;
 $249 = ($248|0)==(0);
 if ($249) {
  $$0396 = 0;
 } else {
  $250 = ($$2>>>0)>(16777215);
  if ($250) {
   $$0396 = 31;
  } else {
   $251 = (($248) + 1048320)|0;
   $252 = $251 >>> 16;
   $253 = $252 & 8;
   $254 = $248 << $253;
   $255 = (($254) + 520192)|0;
   $256 = $255 >>> 16;
   $257 = $256 & 4;
   $258 = $257 | $253;
   $259 = $254 << $257;
   $260 = (($259) + 245760)|0;
   $261 = $260 >>> 16;
   $262 = $261 & 2;
   $263 = $258 | $262;
   $264 = (14 - ($263))|0;
   $265 = $259 << $262;
   $266 = $265 >>> 15;
   $267 = (($264) + ($266))|0;
   $268 = $267 << 1;
   $269 = (($267) + 7)|0;
   $270 = $$2 >>> $269;
   $271 = $270 & 1;
   $272 = $271 | $268;
   $$0396 = $272;
  }
 }
 $273 = (23072 + ($$0396<<2)|0);
 $274 = ((($$1)) + 28|0);
 HEAP32[$274>>2] = $$0396;
 $275 = ((($$1)) + 16|0);
 $276 = ((($$1)) + 20|0);
 HEAP32[$276>>2] = 0;
 HEAP32[$275>>2] = 0;
 $277 = HEAP32[(22772)>>2]|0;
 $278 = 1 << $$0396;
 $279 = $277 & $278;
 $280 = ($279|0)==(0);
 do {
  if ($280) {
   $281 = $277 | $278;
   HEAP32[(22772)>>2] = $281;
   HEAP32[$273>>2] = $$1;
   $282 = ((($$1)) + 24|0);
   HEAP32[$282>>2] = $273;
   $283 = ((($$1)) + 12|0);
   HEAP32[$283>>2] = $$1;
   $284 = ((($$1)) + 8|0);
   HEAP32[$284>>2] = $$1;
  } else {
   $285 = HEAP32[$273>>2]|0;
   $286 = ($$0396|0)==(31);
   $287 = $$0396 >>> 1;
   $288 = (25 - ($287))|0;
   $289 = $286 ? 0 : $288;
   $290 = $$2 << $289;
   $$0383 = $290;$$0384 = $285;
   while(1) {
    $291 = ((($$0384)) + 4|0);
    $292 = HEAP32[$291>>2]|0;
    $293 = $292 & -8;
    $294 = ($293|0)==($$2|0);
    if ($294) {
     label = 124;
     break;
    }
    $295 = $$0383 >>> 31;
    $296 = (((($$0384)) + 16|0) + ($295<<2)|0);
    $297 = $$0383 << 1;
    $298 = HEAP32[$296>>2]|0;
    $299 = ($298|0)==(0|0);
    if ($299) {
     label = 121;
     break;
    } else {
     $$0383 = $297;$$0384 = $298;
    }
   }
   if ((label|0) == 121) {
    $300 = HEAP32[(22784)>>2]|0;
    $301 = ($296>>>0)<($300>>>0);
    if ($301) {
     _abort();
     // unreachable;
    } else {
     HEAP32[$296>>2] = $$1;
     $302 = ((($$1)) + 24|0);
     HEAP32[$302>>2] = $$0384;
     $303 = ((($$1)) + 12|0);
     HEAP32[$303>>2] = $$1;
     $304 = ((($$1)) + 8|0);
     HEAP32[$304>>2] = $$1;
     break;
    }
   }
   else if ((label|0) == 124) {
    $305 = ((($$0384)) + 8|0);
    $306 = HEAP32[$305>>2]|0;
    $307 = HEAP32[(22784)>>2]|0;
    $308 = ($306>>>0)>=($307>>>0);
    $not$437 = ($$0384>>>0)>=($307>>>0);
    $309 = $308 & $not$437;
    if ($309) {
     $310 = ((($306)) + 12|0);
     HEAP32[$310>>2] = $$1;
     HEAP32[$305>>2] = $$1;
     $311 = ((($$1)) + 8|0);
     HEAP32[$311>>2] = $306;
     $312 = ((($$1)) + 12|0);
     HEAP32[$312>>2] = $$0384;
     $313 = ((($$1)) + 24|0);
     HEAP32[$313>>2] = 0;
     break;
    } else {
     _abort();
     // unreachable;
    }
   }
  }
 } while(0);
 $314 = HEAP32[(22800)>>2]|0;
 $315 = (($314) + -1)|0;
 HEAP32[(22800)>>2] = $315;
 $316 = ($315|0)==(0);
 if ($316) {
  $$0212$in$i = (23224);
 } else {
  return;
 }
 while(1) {
  $$0212$i = HEAP32[$$0212$in$i>>2]|0;
  $317 = ($$0212$i|0)==(0|0);
  $318 = ((($$0212$i)) + 8|0);
  if ($317) {
   break;
  } else {
   $$0212$in$i = $318;
  }
 }
 HEAP32[(22800)>>2] = -1;
 return;
}
function _realloc($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $3 = 0, $4 = 0, $5 = 0;
 var $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = ($0|0)==(0|0);
 if ($2) {
  $3 = (_malloc($1)|0);
  $$1 = $3;
  return ($$1|0);
 }
 $4 = ($1>>>0)>(4294967231);
 if ($4) {
  $5 = (___errno_location()|0);
  HEAP32[$5>>2] = 12;
  $$1 = 0;
  return ($$1|0);
 }
 $6 = ($1>>>0)<(11);
 $7 = (($1) + 11)|0;
 $8 = $7 & -8;
 $9 = $6 ? 16 : $8;
 $10 = ((($0)) + -8|0);
 $11 = (_try_realloc_chunk($10,$9)|0);
 $12 = ($11|0)==(0|0);
 if (!($12)) {
  $13 = ((($11)) + 8|0);
  $$1 = $13;
  return ($$1|0);
 }
 $14 = (_malloc($1)|0);
 $15 = ($14|0)==(0|0);
 if ($15) {
  $$1 = 0;
  return ($$1|0);
 }
 $16 = ((($0)) + -4|0);
 $17 = HEAP32[$16>>2]|0;
 $18 = $17 & -8;
 $19 = $17 & 3;
 $20 = ($19|0)==(0);
 $21 = $20 ? 8 : 4;
 $22 = (($18) - ($21))|0;
 $23 = ($22>>>0)<($1>>>0);
 $24 = $23 ? $22 : $1;
 _memcpy(($14|0),($0|0),($24|0))|0;
 _free($0);
 $$1 = $14;
 return ($$1|0);
}
function _try_realloc_chunk($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$1272 = 0, $$1275 = 0, $$2 = 0, $$3 = 0, $$pre = 0, $$pre$phiZ2D = 0, $$sink1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0;
 var $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0;
 var $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0;
 var $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0;
 var $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
 var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
 var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0;
 var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0;
 var $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0;
 var $cond = 0, $not$ = 0, $notlhs = 0, $notrhs = 0, $or$cond$not = 0, $or$cond3 = 0, $storemerge = 0, $storemerge1 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = ((($0)) + 4|0);
 $3 = HEAP32[$2>>2]|0;
 $4 = $3 & -8;
 $5 = (($0) + ($4)|0);
 $6 = HEAP32[(22784)>>2]|0;
 $7 = $3 & 3;
 $notlhs = ($0>>>0)>=($6>>>0);
 $notrhs = ($7|0)!=(1);
 $or$cond$not = $notrhs & $notlhs;
 $8 = ($0>>>0)<($5>>>0);
 $or$cond3 = $or$cond$not & $8;
 if (!($or$cond3)) {
  _abort();
  // unreachable;
 }
 $9 = ((($5)) + 4|0);
 $10 = HEAP32[$9>>2]|0;
 $11 = $10 & 1;
 $12 = ($11|0)==(0);
 if ($12) {
  _abort();
  // unreachable;
 }
 $13 = ($7|0)==(0);
 if ($13) {
  $14 = ($1>>>0)<(256);
  if ($14) {
   $$2 = 0;
   return ($$2|0);
  }
  $15 = (($1) + 4)|0;
  $16 = ($4>>>0)<($15>>>0);
  if (!($16)) {
   $17 = (($4) - ($1))|0;
   $18 = HEAP32[(23248)>>2]|0;
   $19 = $18 << 1;
   $20 = ($17>>>0)>($19>>>0);
   if (!($20)) {
    $$2 = $0;
    return ($$2|0);
   }
  }
  $$2 = 0;
  return ($$2|0);
 }
 $21 = ($4>>>0)<($1>>>0);
 if (!($21)) {
  $22 = (($4) - ($1))|0;
  $23 = ($22>>>0)>(15);
  if (!($23)) {
   $$2 = $0;
   return ($$2|0);
  }
  $24 = (($0) + ($1)|0);
  $25 = $3 & 1;
  $26 = $25 | $1;
  $27 = $26 | 2;
  HEAP32[$2>>2] = $27;
  $28 = ((($24)) + 4|0);
  $29 = $22 | 3;
  HEAP32[$28>>2] = $29;
  $30 = (($24) + ($22)|0);
  $31 = ((($30)) + 4|0);
  $32 = HEAP32[$31>>2]|0;
  $33 = $32 | 1;
  HEAP32[$31>>2] = $33;
  _dispose_chunk($24,$22);
  $$2 = $0;
  return ($$2|0);
 }
 $34 = HEAP32[(22792)>>2]|0;
 $35 = ($5|0)==($34|0);
 if ($35) {
  $36 = HEAP32[(22780)>>2]|0;
  $37 = (($36) + ($4))|0;
  $38 = ($37>>>0)>($1>>>0);
  $39 = (($37) - ($1))|0;
  $40 = (($0) + ($1)|0);
  if (!($38)) {
   $$2 = 0;
   return ($$2|0);
  }
  $41 = $39 | 1;
  $42 = ((($40)) + 4|0);
  $43 = $3 & 1;
  $44 = $43 | $1;
  $45 = $44 | 2;
  HEAP32[$2>>2] = $45;
  HEAP32[$42>>2] = $41;
  HEAP32[(22792)>>2] = $40;
  HEAP32[(22780)>>2] = $39;
  $$2 = $0;
  return ($$2|0);
 }
 $46 = HEAP32[(22788)>>2]|0;
 $47 = ($5|0)==($46|0);
 if ($47) {
  $48 = HEAP32[(22776)>>2]|0;
  $49 = (($48) + ($4))|0;
  $50 = ($49>>>0)<($1>>>0);
  if ($50) {
   $$2 = 0;
   return ($$2|0);
  }
  $51 = (($49) - ($1))|0;
  $52 = ($51>>>0)>(15);
  $53 = $3 & 1;
  if ($52) {
   $54 = (($0) + ($1)|0);
   $55 = (($54) + ($51)|0);
   $56 = $53 | $1;
   $57 = $56 | 2;
   HEAP32[$2>>2] = $57;
   $58 = ((($54)) + 4|0);
   $59 = $51 | 1;
   HEAP32[$58>>2] = $59;
   HEAP32[$55>>2] = $51;
   $60 = ((($55)) + 4|0);
   $61 = HEAP32[$60>>2]|0;
   $62 = $61 & -2;
   HEAP32[$60>>2] = $62;
   $storemerge = $54;$storemerge1 = $51;
  } else {
   $63 = $53 | $49;
   $64 = $63 | 2;
   HEAP32[$2>>2] = $64;
   $65 = (($0) + ($49)|0);
   $66 = ((($65)) + 4|0);
   $67 = HEAP32[$66>>2]|0;
   $68 = $67 | 1;
   HEAP32[$66>>2] = $68;
   $storemerge = 0;$storemerge1 = 0;
  }
  HEAP32[(22776)>>2] = $storemerge1;
  HEAP32[(22788)>>2] = $storemerge;
  $$2 = $0;
  return ($$2|0);
 }
 $69 = $10 & 2;
 $70 = ($69|0)==(0);
 if (!($70)) {
  $$2 = 0;
  return ($$2|0);
 }
 $71 = $10 & -8;
 $72 = (($71) + ($4))|0;
 $73 = ($72>>>0)<($1>>>0);
 if ($73) {
  $$2 = 0;
  return ($$2|0);
 }
 $74 = (($72) - ($1))|0;
 $75 = $10 >>> 3;
 $76 = ($10>>>0)<(256);
 L49: do {
  if ($76) {
   $77 = ((($5)) + 8|0);
   $78 = HEAP32[$77>>2]|0;
   $79 = ((($5)) + 12|0);
   $80 = HEAP32[$79>>2]|0;
   $81 = $75 << 1;
   $82 = (22808 + ($81<<2)|0);
   $83 = ($78|0)==($82|0);
   if (!($83)) {
    $84 = ($78>>>0)<($6>>>0);
    if ($84) {
     _abort();
     // unreachable;
    }
    $85 = ((($78)) + 12|0);
    $86 = HEAP32[$85>>2]|0;
    $87 = ($86|0)==($5|0);
    if (!($87)) {
     _abort();
     // unreachable;
    }
   }
   $88 = ($80|0)==($78|0);
   if ($88) {
    $89 = 1 << $75;
    $90 = $89 ^ -1;
    $91 = HEAP32[5692]|0;
    $92 = $91 & $90;
    HEAP32[5692] = $92;
    break;
   }
   $93 = ($80|0)==($82|0);
   if ($93) {
    $$pre = ((($80)) + 8|0);
    $$pre$phiZ2D = $$pre;
   } else {
    $94 = ($80>>>0)<($6>>>0);
    if ($94) {
     _abort();
     // unreachable;
    }
    $95 = ((($80)) + 8|0);
    $96 = HEAP32[$95>>2]|0;
    $97 = ($96|0)==($5|0);
    if ($97) {
     $$pre$phiZ2D = $95;
    } else {
     _abort();
     // unreachable;
    }
   }
   $98 = ((($78)) + 12|0);
   HEAP32[$98>>2] = $80;
   HEAP32[$$pre$phiZ2D>>2] = $78;
  } else {
   $99 = ((($5)) + 24|0);
   $100 = HEAP32[$99>>2]|0;
   $101 = ((($5)) + 12|0);
   $102 = HEAP32[$101>>2]|0;
   $103 = ($102|0)==($5|0);
   do {
    if ($103) {
     $113 = ((($5)) + 16|0);
     $114 = ((($113)) + 4|0);
     $115 = HEAP32[$114>>2]|0;
     $116 = ($115|0)==(0|0);
     if ($116) {
      $117 = HEAP32[$113>>2]|0;
      $118 = ($117|0)==(0|0);
      if ($118) {
       $$3 = 0;
       break;
      } else {
       $$1272 = $117;$$1275 = $113;
      }
     } else {
      $$1272 = $115;$$1275 = $114;
     }
     while(1) {
      $119 = ((($$1272)) + 20|0);
      $120 = HEAP32[$119>>2]|0;
      $121 = ($120|0)==(0|0);
      if (!($121)) {
       $$1272 = $120;$$1275 = $119;
       continue;
      }
      $122 = ((($$1272)) + 16|0);
      $123 = HEAP32[$122>>2]|0;
      $124 = ($123|0)==(0|0);
      if ($124) {
       break;
      } else {
       $$1272 = $123;$$1275 = $122;
      }
     }
     $125 = ($$1275>>>0)<($6>>>0);
     if ($125) {
      _abort();
      // unreachable;
     } else {
      HEAP32[$$1275>>2] = 0;
      $$3 = $$1272;
      break;
     }
    } else {
     $104 = ((($5)) + 8|0);
     $105 = HEAP32[$104>>2]|0;
     $106 = ($105>>>0)<($6>>>0);
     if ($106) {
      _abort();
      // unreachable;
     }
     $107 = ((($105)) + 12|0);
     $108 = HEAP32[$107>>2]|0;
     $109 = ($108|0)==($5|0);
     if (!($109)) {
      _abort();
      // unreachable;
     }
     $110 = ((($102)) + 8|0);
     $111 = HEAP32[$110>>2]|0;
     $112 = ($111|0)==($5|0);
     if ($112) {
      HEAP32[$107>>2] = $102;
      HEAP32[$110>>2] = $105;
      $$3 = $102;
      break;
     } else {
      _abort();
      // unreachable;
     }
    }
   } while(0);
   $126 = ($100|0)==(0|0);
   if (!($126)) {
    $127 = ((($5)) + 28|0);
    $128 = HEAP32[$127>>2]|0;
    $129 = (23072 + ($128<<2)|0);
    $130 = HEAP32[$129>>2]|0;
    $131 = ($5|0)==($130|0);
    do {
     if ($131) {
      HEAP32[$129>>2] = $$3;
      $cond = ($$3|0)==(0|0);
      if ($cond) {
       $132 = 1 << $128;
       $133 = $132 ^ -1;
       $134 = HEAP32[(22772)>>2]|0;
       $135 = $134 & $133;
       HEAP32[(22772)>>2] = $135;
       break L49;
      }
     } else {
      $136 = HEAP32[(22784)>>2]|0;
      $137 = ($100>>>0)<($136>>>0);
      if ($137) {
       _abort();
       // unreachable;
      } else {
       $138 = ((($100)) + 16|0);
       $139 = HEAP32[$138>>2]|0;
       $not$ = ($139|0)!=($5|0);
       $$sink1 = $not$&1;
       $140 = (((($100)) + 16|0) + ($$sink1<<2)|0);
       HEAP32[$140>>2] = $$3;
       $141 = ($$3|0)==(0|0);
       if ($141) {
        break L49;
       } else {
        break;
       }
      }
     }
    } while(0);
    $142 = HEAP32[(22784)>>2]|0;
    $143 = ($$3>>>0)<($142>>>0);
    if ($143) {
     _abort();
     // unreachable;
    }
    $144 = ((($$3)) + 24|0);
    HEAP32[$144>>2] = $100;
    $145 = ((($5)) + 16|0);
    $146 = HEAP32[$145>>2]|0;
    $147 = ($146|0)==(0|0);
    do {
     if (!($147)) {
      $148 = ($146>>>0)<($142>>>0);
      if ($148) {
       _abort();
       // unreachable;
      } else {
       $149 = ((($$3)) + 16|0);
       HEAP32[$149>>2] = $146;
       $150 = ((($146)) + 24|0);
       HEAP32[$150>>2] = $$3;
       break;
      }
     }
    } while(0);
    $151 = ((($145)) + 4|0);
    $152 = HEAP32[$151>>2]|0;
    $153 = ($152|0)==(0|0);
    if (!($153)) {
     $154 = HEAP32[(22784)>>2]|0;
     $155 = ($152>>>0)<($154>>>0);
     if ($155) {
      _abort();
      // unreachable;
     } else {
      $156 = ((($$3)) + 20|0);
      HEAP32[$156>>2] = $152;
      $157 = ((($152)) + 24|0);
      HEAP32[$157>>2] = $$3;
      break;
     }
    }
   }
  }
 } while(0);
 $158 = ($74>>>0)<(16);
 $159 = $3 & 1;
 if ($158) {
  $160 = $72 | $159;
  $161 = $160 | 2;
  HEAP32[$2>>2] = $161;
  $162 = (($0) + ($72)|0);
  $163 = ((($162)) + 4|0);
  $164 = HEAP32[$163>>2]|0;
  $165 = $164 | 1;
  HEAP32[$163>>2] = $165;
  $$2 = $0;
  return ($$2|0);
 } else {
  $166 = (($0) + ($1)|0);
  $167 = $159 | $1;
  $168 = $167 | 2;
  HEAP32[$2>>2] = $168;
  $169 = ((($166)) + 4|0);
  $170 = $74 | 3;
  HEAP32[$169>>2] = $170;
  $171 = (($166) + ($74)|0);
  $172 = ((($171)) + 4|0);
  $173 = HEAP32[$172>>2]|0;
  $174 = $173 | 1;
  HEAP32[$172>>2] = $174;
  _dispose_chunk($166,$74);
  $$2 = $0;
  return ($$2|0);
 }
 return (0)|0;
}
function _dispose_chunk($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$0419 = 0, $$0420 = 0, $$0431 = 0, $$0438 = 0, $$1 = 0, $$1418 = 0, $$1426 = 0, $$1429 = 0, $$1433 = 0, $$1437 = 0, $$2 = 0, $$3 = 0, $$3435 = 0, $$pre = 0, $$pre$phi24Z2D = 0, $$pre$phi26Z2D = 0, $$pre$phiZ2D = 0, $$pre23 = 0, $$pre25 = 0, $$sink2 = 0;
 var $$sink4 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0;
 var $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0;
 var $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0;
 var $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0;
 var $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0;
 var $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0;
 var $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0;
 var $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0;
 var $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0;
 var $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0;
 var $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0;
 var $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0;
 var $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0;
 var $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0;
 var $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0;
 var $97 = 0, $98 = 0, $99 = 0, $cond = 0, $cond17 = 0, $not$ = 0, $not$1 = 0, $not$19 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = (($0) + ($1)|0);
 $3 = ((($0)) + 4|0);
 $4 = HEAP32[$3>>2]|0;
 $5 = $4 & 1;
 $6 = ($5|0)==(0);
 L1: do {
  if ($6) {
   $7 = HEAP32[$0>>2]|0;
   $8 = $4 & 3;
   $9 = ($8|0)==(0);
   if ($9) {
    return;
   }
   $10 = (0 - ($7))|0;
   $11 = (($0) + ($10)|0);
   $12 = (($7) + ($1))|0;
   $13 = HEAP32[(22784)>>2]|0;
   $14 = ($11>>>0)<($13>>>0);
   if ($14) {
    _abort();
    // unreachable;
   }
   $15 = HEAP32[(22788)>>2]|0;
   $16 = ($11|0)==($15|0);
   if ($16) {
    $100 = ((($2)) + 4|0);
    $101 = HEAP32[$100>>2]|0;
    $102 = $101 & 3;
    $103 = ($102|0)==(3);
    if (!($103)) {
     $$1 = $11;$$1418 = $12;
     break;
    }
    $104 = (($11) + ($12)|0);
    $105 = ((($11)) + 4|0);
    $106 = $12 | 1;
    $107 = $101 & -2;
    HEAP32[(22776)>>2] = $12;
    HEAP32[$100>>2] = $107;
    HEAP32[$105>>2] = $106;
    HEAP32[$104>>2] = $12;
    return;
   }
   $17 = $7 >>> 3;
   $18 = ($7>>>0)<(256);
   if ($18) {
    $19 = ((($11)) + 8|0);
    $20 = HEAP32[$19>>2]|0;
    $21 = ((($11)) + 12|0);
    $22 = HEAP32[$21>>2]|0;
    $23 = $17 << 1;
    $24 = (22808 + ($23<<2)|0);
    $25 = ($20|0)==($24|0);
    if (!($25)) {
     $26 = ($20>>>0)<($13>>>0);
     if ($26) {
      _abort();
      // unreachable;
     }
     $27 = ((($20)) + 12|0);
     $28 = HEAP32[$27>>2]|0;
     $29 = ($28|0)==($11|0);
     if (!($29)) {
      _abort();
      // unreachable;
     }
    }
    $30 = ($22|0)==($20|0);
    if ($30) {
     $31 = 1 << $17;
     $32 = $31 ^ -1;
     $33 = HEAP32[5692]|0;
     $34 = $33 & $32;
     HEAP32[5692] = $34;
     $$1 = $11;$$1418 = $12;
     break;
    }
    $35 = ($22|0)==($24|0);
    if ($35) {
     $$pre25 = ((($22)) + 8|0);
     $$pre$phi26Z2D = $$pre25;
    } else {
     $36 = ($22>>>0)<($13>>>0);
     if ($36) {
      _abort();
      // unreachable;
     }
     $37 = ((($22)) + 8|0);
     $38 = HEAP32[$37>>2]|0;
     $39 = ($38|0)==($11|0);
     if ($39) {
      $$pre$phi26Z2D = $37;
     } else {
      _abort();
      // unreachable;
     }
    }
    $40 = ((($20)) + 12|0);
    HEAP32[$40>>2] = $22;
    HEAP32[$$pre$phi26Z2D>>2] = $20;
    $$1 = $11;$$1418 = $12;
    break;
   }
   $41 = ((($11)) + 24|0);
   $42 = HEAP32[$41>>2]|0;
   $43 = ((($11)) + 12|0);
   $44 = HEAP32[$43>>2]|0;
   $45 = ($44|0)==($11|0);
   do {
    if ($45) {
     $55 = ((($11)) + 16|0);
     $56 = ((($55)) + 4|0);
     $57 = HEAP32[$56>>2]|0;
     $58 = ($57|0)==(0|0);
     if ($58) {
      $59 = HEAP32[$55>>2]|0;
      $60 = ($59|0)==(0|0);
      if ($60) {
       $$3 = 0;
       break;
      } else {
       $$1426 = $59;$$1429 = $55;
      }
     } else {
      $$1426 = $57;$$1429 = $56;
     }
     while(1) {
      $61 = ((($$1426)) + 20|0);
      $62 = HEAP32[$61>>2]|0;
      $63 = ($62|0)==(0|0);
      if (!($63)) {
       $$1426 = $62;$$1429 = $61;
       continue;
      }
      $64 = ((($$1426)) + 16|0);
      $65 = HEAP32[$64>>2]|0;
      $66 = ($65|0)==(0|0);
      if ($66) {
       break;
      } else {
       $$1426 = $65;$$1429 = $64;
      }
     }
     $67 = ($$1429>>>0)<($13>>>0);
     if ($67) {
      _abort();
      // unreachable;
     } else {
      HEAP32[$$1429>>2] = 0;
      $$3 = $$1426;
      break;
     }
    } else {
     $46 = ((($11)) + 8|0);
     $47 = HEAP32[$46>>2]|0;
     $48 = ($47>>>0)<($13>>>0);
     if ($48) {
      _abort();
      // unreachable;
     }
     $49 = ((($47)) + 12|0);
     $50 = HEAP32[$49>>2]|0;
     $51 = ($50|0)==($11|0);
     if (!($51)) {
      _abort();
      // unreachable;
     }
     $52 = ((($44)) + 8|0);
     $53 = HEAP32[$52>>2]|0;
     $54 = ($53|0)==($11|0);
     if ($54) {
      HEAP32[$49>>2] = $44;
      HEAP32[$52>>2] = $47;
      $$3 = $44;
      break;
     } else {
      _abort();
      // unreachable;
     }
    }
   } while(0);
   $68 = ($42|0)==(0|0);
   if ($68) {
    $$1 = $11;$$1418 = $12;
   } else {
    $69 = ((($11)) + 28|0);
    $70 = HEAP32[$69>>2]|0;
    $71 = (23072 + ($70<<2)|0);
    $72 = HEAP32[$71>>2]|0;
    $73 = ($11|0)==($72|0);
    do {
     if ($73) {
      HEAP32[$71>>2] = $$3;
      $cond = ($$3|0)==(0|0);
      if ($cond) {
       $74 = 1 << $70;
       $75 = $74 ^ -1;
       $76 = HEAP32[(22772)>>2]|0;
       $77 = $76 & $75;
       HEAP32[(22772)>>2] = $77;
       $$1 = $11;$$1418 = $12;
       break L1;
      }
     } else {
      $78 = HEAP32[(22784)>>2]|0;
      $79 = ($42>>>0)<($78>>>0);
      if ($79) {
       _abort();
       // unreachable;
      } else {
       $80 = ((($42)) + 16|0);
       $81 = HEAP32[$80>>2]|0;
       $not$1 = ($81|0)!=($11|0);
       $$sink2 = $not$1&1;
       $82 = (((($42)) + 16|0) + ($$sink2<<2)|0);
       HEAP32[$82>>2] = $$3;
       $83 = ($$3|0)==(0|0);
       if ($83) {
        $$1 = $11;$$1418 = $12;
        break L1;
       } else {
        break;
       }
      }
     }
    } while(0);
    $84 = HEAP32[(22784)>>2]|0;
    $85 = ($$3>>>0)<($84>>>0);
    if ($85) {
     _abort();
     // unreachable;
    }
    $86 = ((($$3)) + 24|0);
    HEAP32[$86>>2] = $42;
    $87 = ((($11)) + 16|0);
    $88 = HEAP32[$87>>2]|0;
    $89 = ($88|0)==(0|0);
    do {
     if (!($89)) {
      $90 = ($88>>>0)<($84>>>0);
      if ($90) {
       _abort();
       // unreachable;
      } else {
       $91 = ((($$3)) + 16|0);
       HEAP32[$91>>2] = $88;
       $92 = ((($88)) + 24|0);
       HEAP32[$92>>2] = $$3;
       break;
      }
     }
    } while(0);
    $93 = ((($87)) + 4|0);
    $94 = HEAP32[$93>>2]|0;
    $95 = ($94|0)==(0|0);
    if ($95) {
     $$1 = $11;$$1418 = $12;
    } else {
     $96 = HEAP32[(22784)>>2]|0;
     $97 = ($94>>>0)<($96>>>0);
     if ($97) {
      _abort();
      // unreachable;
     } else {
      $98 = ((($$3)) + 20|0);
      HEAP32[$98>>2] = $94;
      $99 = ((($94)) + 24|0);
      HEAP32[$99>>2] = $$3;
      $$1 = $11;$$1418 = $12;
      break;
     }
    }
   }
  } else {
   $$1 = $0;$$1418 = $1;
  }
 } while(0);
 $108 = HEAP32[(22784)>>2]|0;
 $109 = ($2>>>0)<($108>>>0);
 if ($109) {
  _abort();
  // unreachable;
 }
 $110 = ((($2)) + 4|0);
 $111 = HEAP32[$110>>2]|0;
 $112 = $111 & 2;
 $113 = ($112|0)==(0);
 if ($113) {
  $114 = HEAP32[(22792)>>2]|0;
  $115 = ($2|0)==($114|0);
  $116 = HEAP32[(22788)>>2]|0;
  if ($115) {
   $117 = HEAP32[(22780)>>2]|0;
   $118 = (($117) + ($$1418))|0;
   HEAP32[(22780)>>2] = $118;
   HEAP32[(22792)>>2] = $$1;
   $119 = $118 | 1;
   $120 = ((($$1)) + 4|0);
   HEAP32[$120>>2] = $119;
   $121 = ($$1|0)==($116|0);
   if (!($121)) {
    return;
   }
   HEAP32[(22788)>>2] = 0;
   HEAP32[(22776)>>2] = 0;
   return;
  }
  $122 = ($2|0)==($116|0);
  if ($122) {
   $123 = HEAP32[(22776)>>2]|0;
   $124 = (($123) + ($$1418))|0;
   HEAP32[(22776)>>2] = $124;
   HEAP32[(22788)>>2] = $$1;
   $125 = $124 | 1;
   $126 = ((($$1)) + 4|0);
   HEAP32[$126>>2] = $125;
   $127 = (($$1) + ($124)|0);
   HEAP32[$127>>2] = $124;
   return;
  }
  $128 = $111 & -8;
  $129 = (($128) + ($$1418))|0;
  $130 = $111 >>> 3;
  $131 = ($111>>>0)<(256);
  L96: do {
   if ($131) {
    $132 = ((($2)) + 8|0);
    $133 = HEAP32[$132>>2]|0;
    $134 = ((($2)) + 12|0);
    $135 = HEAP32[$134>>2]|0;
    $136 = $130 << 1;
    $137 = (22808 + ($136<<2)|0);
    $138 = ($133|0)==($137|0);
    if (!($138)) {
     $139 = ($133>>>0)<($108>>>0);
     if ($139) {
      _abort();
      // unreachable;
     }
     $140 = ((($133)) + 12|0);
     $141 = HEAP32[$140>>2]|0;
     $142 = ($141|0)==($2|0);
     if (!($142)) {
      _abort();
      // unreachable;
     }
    }
    $143 = ($135|0)==($133|0);
    if ($143) {
     $144 = 1 << $130;
     $145 = $144 ^ -1;
     $146 = HEAP32[5692]|0;
     $147 = $146 & $145;
     HEAP32[5692] = $147;
     break;
    }
    $148 = ($135|0)==($137|0);
    if ($148) {
     $$pre23 = ((($135)) + 8|0);
     $$pre$phi24Z2D = $$pre23;
    } else {
     $149 = ($135>>>0)<($108>>>0);
     if ($149) {
      _abort();
      // unreachable;
     }
     $150 = ((($135)) + 8|0);
     $151 = HEAP32[$150>>2]|0;
     $152 = ($151|0)==($2|0);
     if ($152) {
      $$pre$phi24Z2D = $150;
     } else {
      _abort();
      // unreachable;
     }
    }
    $153 = ((($133)) + 12|0);
    HEAP32[$153>>2] = $135;
    HEAP32[$$pre$phi24Z2D>>2] = $133;
   } else {
    $154 = ((($2)) + 24|0);
    $155 = HEAP32[$154>>2]|0;
    $156 = ((($2)) + 12|0);
    $157 = HEAP32[$156>>2]|0;
    $158 = ($157|0)==($2|0);
    do {
     if ($158) {
      $168 = ((($2)) + 16|0);
      $169 = ((($168)) + 4|0);
      $170 = HEAP32[$169>>2]|0;
      $171 = ($170|0)==(0|0);
      if ($171) {
       $172 = HEAP32[$168>>2]|0;
       $173 = ($172|0)==(0|0);
       if ($173) {
        $$3435 = 0;
        break;
       } else {
        $$1433 = $172;$$1437 = $168;
       }
      } else {
       $$1433 = $170;$$1437 = $169;
      }
      while(1) {
       $174 = ((($$1433)) + 20|0);
       $175 = HEAP32[$174>>2]|0;
       $176 = ($175|0)==(0|0);
       if (!($176)) {
        $$1433 = $175;$$1437 = $174;
        continue;
       }
       $177 = ((($$1433)) + 16|0);
       $178 = HEAP32[$177>>2]|0;
       $179 = ($178|0)==(0|0);
       if ($179) {
        break;
       } else {
        $$1433 = $178;$$1437 = $177;
       }
      }
      $180 = ($$1437>>>0)<($108>>>0);
      if ($180) {
       _abort();
       // unreachable;
      } else {
       HEAP32[$$1437>>2] = 0;
       $$3435 = $$1433;
       break;
      }
     } else {
      $159 = ((($2)) + 8|0);
      $160 = HEAP32[$159>>2]|0;
      $161 = ($160>>>0)<($108>>>0);
      if ($161) {
       _abort();
       // unreachable;
      }
      $162 = ((($160)) + 12|0);
      $163 = HEAP32[$162>>2]|0;
      $164 = ($163|0)==($2|0);
      if (!($164)) {
       _abort();
       // unreachable;
      }
      $165 = ((($157)) + 8|0);
      $166 = HEAP32[$165>>2]|0;
      $167 = ($166|0)==($2|0);
      if ($167) {
       HEAP32[$162>>2] = $157;
       HEAP32[$165>>2] = $160;
       $$3435 = $157;
       break;
      } else {
       _abort();
       // unreachable;
      }
     }
    } while(0);
    $181 = ($155|0)==(0|0);
    if (!($181)) {
     $182 = ((($2)) + 28|0);
     $183 = HEAP32[$182>>2]|0;
     $184 = (23072 + ($183<<2)|0);
     $185 = HEAP32[$184>>2]|0;
     $186 = ($2|0)==($185|0);
     do {
      if ($186) {
       HEAP32[$184>>2] = $$3435;
       $cond17 = ($$3435|0)==(0|0);
       if ($cond17) {
        $187 = 1 << $183;
        $188 = $187 ^ -1;
        $189 = HEAP32[(22772)>>2]|0;
        $190 = $189 & $188;
        HEAP32[(22772)>>2] = $190;
        break L96;
       }
      } else {
       $191 = HEAP32[(22784)>>2]|0;
       $192 = ($155>>>0)<($191>>>0);
       if ($192) {
        _abort();
        // unreachable;
       } else {
        $193 = ((($155)) + 16|0);
        $194 = HEAP32[$193>>2]|0;
        $not$ = ($194|0)!=($2|0);
        $$sink4 = $not$&1;
        $195 = (((($155)) + 16|0) + ($$sink4<<2)|0);
        HEAP32[$195>>2] = $$3435;
        $196 = ($$3435|0)==(0|0);
        if ($196) {
         break L96;
        } else {
         break;
        }
       }
      }
     } while(0);
     $197 = HEAP32[(22784)>>2]|0;
     $198 = ($$3435>>>0)<($197>>>0);
     if ($198) {
      _abort();
      // unreachable;
     }
     $199 = ((($$3435)) + 24|0);
     HEAP32[$199>>2] = $155;
     $200 = ((($2)) + 16|0);
     $201 = HEAP32[$200>>2]|0;
     $202 = ($201|0)==(0|0);
     do {
      if (!($202)) {
       $203 = ($201>>>0)<($197>>>0);
       if ($203) {
        _abort();
        // unreachable;
       } else {
        $204 = ((($$3435)) + 16|0);
        HEAP32[$204>>2] = $201;
        $205 = ((($201)) + 24|0);
        HEAP32[$205>>2] = $$3435;
        break;
       }
      }
     } while(0);
     $206 = ((($200)) + 4|0);
     $207 = HEAP32[$206>>2]|0;
     $208 = ($207|0)==(0|0);
     if (!($208)) {
      $209 = HEAP32[(22784)>>2]|0;
      $210 = ($207>>>0)<($209>>>0);
      if ($210) {
       _abort();
       // unreachable;
      } else {
       $211 = ((($$3435)) + 20|0);
       HEAP32[$211>>2] = $207;
       $212 = ((($207)) + 24|0);
       HEAP32[$212>>2] = $$3435;
       break;
      }
     }
    }
   }
  } while(0);
  $213 = $129 | 1;
  $214 = ((($$1)) + 4|0);
  HEAP32[$214>>2] = $213;
  $215 = (($$1) + ($129)|0);
  HEAP32[$215>>2] = $129;
  $216 = HEAP32[(22788)>>2]|0;
  $217 = ($$1|0)==($216|0);
  if ($217) {
   HEAP32[(22776)>>2] = $129;
   return;
  } else {
   $$2 = $129;
  }
 } else {
  $218 = $111 & -2;
  HEAP32[$110>>2] = $218;
  $219 = $$1418 | 1;
  $220 = ((($$1)) + 4|0);
  HEAP32[$220>>2] = $219;
  $221 = (($$1) + ($$1418)|0);
  HEAP32[$221>>2] = $$1418;
  $$2 = $$1418;
 }
 $222 = $$2 >>> 3;
 $223 = ($$2>>>0)<(256);
 if ($223) {
  $224 = $222 << 1;
  $225 = (22808 + ($224<<2)|0);
  $226 = HEAP32[5692]|0;
  $227 = 1 << $222;
  $228 = $226 & $227;
  $229 = ($228|0)==(0);
  if ($229) {
   $230 = $226 | $227;
   HEAP32[5692] = $230;
   $$pre = ((($225)) + 8|0);
   $$0438 = $225;$$pre$phiZ2D = $$pre;
  } else {
   $231 = ((($225)) + 8|0);
   $232 = HEAP32[$231>>2]|0;
   $233 = HEAP32[(22784)>>2]|0;
   $234 = ($232>>>0)<($233>>>0);
   if ($234) {
    _abort();
    // unreachable;
   } else {
    $$0438 = $232;$$pre$phiZ2D = $231;
   }
  }
  HEAP32[$$pre$phiZ2D>>2] = $$1;
  $235 = ((($$0438)) + 12|0);
  HEAP32[$235>>2] = $$1;
  $236 = ((($$1)) + 8|0);
  HEAP32[$236>>2] = $$0438;
  $237 = ((($$1)) + 12|0);
  HEAP32[$237>>2] = $225;
  return;
 }
 $238 = $$2 >>> 8;
 $239 = ($238|0)==(0);
 if ($239) {
  $$0431 = 0;
 } else {
  $240 = ($$2>>>0)>(16777215);
  if ($240) {
   $$0431 = 31;
  } else {
   $241 = (($238) + 1048320)|0;
   $242 = $241 >>> 16;
   $243 = $242 & 8;
   $244 = $238 << $243;
   $245 = (($244) + 520192)|0;
   $246 = $245 >>> 16;
   $247 = $246 & 4;
   $248 = $247 | $243;
   $249 = $244 << $247;
   $250 = (($249) + 245760)|0;
   $251 = $250 >>> 16;
   $252 = $251 & 2;
   $253 = $248 | $252;
   $254 = (14 - ($253))|0;
   $255 = $249 << $252;
   $256 = $255 >>> 15;
   $257 = (($254) + ($256))|0;
   $258 = $257 << 1;
   $259 = (($257) + 7)|0;
   $260 = $$2 >>> $259;
   $261 = $260 & 1;
   $262 = $261 | $258;
   $$0431 = $262;
  }
 }
 $263 = (23072 + ($$0431<<2)|0);
 $264 = ((($$1)) + 28|0);
 HEAP32[$264>>2] = $$0431;
 $265 = ((($$1)) + 16|0);
 $266 = ((($$1)) + 20|0);
 HEAP32[$266>>2] = 0;
 HEAP32[$265>>2] = 0;
 $267 = HEAP32[(22772)>>2]|0;
 $268 = 1 << $$0431;
 $269 = $267 & $268;
 $270 = ($269|0)==(0);
 if ($270) {
  $271 = $267 | $268;
  HEAP32[(22772)>>2] = $271;
  HEAP32[$263>>2] = $$1;
  $272 = ((($$1)) + 24|0);
  HEAP32[$272>>2] = $263;
  $273 = ((($$1)) + 12|0);
  HEAP32[$273>>2] = $$1;
  $274 = ((($$1)) + 8|0);
  HEAP32[$274>>2] = $$1;
  return;
 }
 $275 = HEAP32[$263>>2]|0;
 $276 = ($$0431|0)==(31);
 $277 = $$0431 >>> 1;
 $278 = (25 - ($277))|0;
 $279 = $276 ? 0 : $278;
 $280 = $$2 << $279;
 $$0419 = $280;$$0420 = $275;
 while(1) {
  $281 = ((($$0420)) + 4|0);
  $282 = HEAP32[$281>>2]|0;
  $283 = $282 & -8;
  $284 = ($283|0)==($$2|0);
  if ($284) {
   label = 121;
   break;
  }
  $285 = $$0419 >>> 31;
  $286 = (((($$0420)) + 16|0) + ($285<<2)|0);
  $287 = $$0419 << 1;
  $288 = HEAP32[$286>>2]|0;
  $289 = ($288|0)==(0|0);
  if ($289) {
   label = 118;
   break;
  } else {
   $$0419 = $287;$$0420 = $288;
  }
 }
 if ((label|0) == 118) {
  $290 = HEAP32[(22784)>>2]|0;
  $291 = ($286>>>0)<($290>>>0);
  if ($291) {
   _abort();
   // unreachable;
  }
  HEAP32[$286>>2] = $$1;
  $292 = ((($$1)) + 24|0);
  HEAP32[$292>>2] = $$0420;
  $293 = ((($$1)) + 12|0);
  HEAP32[$293>>2] = $$1;
  $294 = ((($$1)) + 8|0);
  HEAP32[$294>>2] = $$1;
  return;
 }
 else if ((label|0) == 121) {
  $295 = ((($$0420)) + 8|0);
  $296 = HEAP32[$295>>2]|0;
  $297 = HEAP32[(22784)>>2]|0;
  $298 = ($296>>>0)>=($297>>>0);
  $not$19 = ($$0420>>>0)>=($297>>>0);
  $299 = $298 & $not$19;
  if (!($299)) {
   _abort();
   // unreachable;
  }
  $300 = ((($296)) + 12|0);
  HEAP32[$300>>2] = $$1;
  HEAP32[$295>>2] = $$1;
  $301 = ((($$1)) + 8|0);
  HEAP32[$301>>2] = $296;
  $302 = ((($$1)) + 12|0);
  HEAP32[$302>>2] = $$0420;
  $303 = ((($$1)) + 24|0);
  HEAP32[$303>>2] = 0;
  return;
 }
}
function runPostSets() {
}
function _memset(ptr, value, num) {
    ptr = ptr|0; value = value|0; num = num|0;
    var end = 0, aligned_end = 0, block_aligned_end = 0, value4 = 0;
    end = (ptr + num)|0;

    value = value & 0xff;
    if ((num|0) >= 67 /* 64 bytes for an unrolled loop + 3 bytes for unaligned head*/) {
      while ((ptr&3) != 0) {
        HEAP8[((ptr)>>0)]=value;
        ptr = (ptr+1)|0;
      }

      aligned_end = (end & -4)|0;
      block_aligned_end = (aligned_end - 64)|0;
      value4 = value | (value << 8) | (value << 16) | (value << 24);

      while((ptr|0) <= (block_aligned_end|0)) {
        HEAP32[((ptr)>>2)]=value4;
        HEAP32[(((ptr)+(4))>>2)]=value4;
        HEAP32[(((ptr)+(8))>>2)]=value4;
        HEAP32[(((ptr)+(12))>>2)]=value4;
        HEAP32[(((ptr)+(16))>>2)]=value4;
        HEAP32[(((ptr)+(20))>>2)]=value4;
        HEAP32[(((ptr)+(24))>>2)]=value4;
        HEAP32[(((ptr)+(28))>>2)]=value4;
        HEAP32[(((ptr)+(32))>>2)]=value4;
        HEAP32[(((ptr)+(36))>>2)]=value4;
        HEAP32[(((ptr)+(40))>>2)]=value4;
        HEAP32[(((ptr)+(44))>>2)]=value4;
        HEAP32[(((ptr)+(48))>>2)]=value4;
        HEAP32[(((ptr)+(52))>>2)]=value4;
        HEAP32[(((ptr)+(56))>>2)]=value4;
        HEAP32[(((ptr)+(60))>>2)]=value4;
        ptr = (ptr + 64)|0;
      }

      while ((ptr|0) < (aligned_end|0) ) {
        HEAP32[((ptr)>>2)]=value4;
        ptr = (ptr+4)|0;
      }
    }
    // The remaining bytes.
    while ((ptr|0) < (end|0)) {
      HEAP8[((ptr)>>0)]=value;
      ptr = (ptr+1)|0;
    }
    return (end-num)|0;
}
function _i64Subtract(a, b, c, d) {
    a = a|0; b = b|0; c = c|0; d = d|0;
    var l = 0, h = 0;
    l = (a - c)>>>0;
    h = (b - d)>>>0;
    h = (b - d - (((c>>>0) > (a>>>0))|0))>>>0; // Borrow one from high word to low word on underflow.
    return ((tempRet0 = h,l|0)|0);
}
function _i64Add(a, b, c, d) {
    /*
      x = a + b*2^32
      y = c + d*2^32
      result = l + h*2^32
    */
    a = a|0; b = b|0; c = c|0; d = d|0;
    var l = 0, h = 0;
    l = (a + c)>>>0;
    h = (b + d + (((l>>>0) < (a>>>0))|0))>>>0; // Add carry from low word to high word on overflow.
    return ((tempRet0 = h,l|0)|0);
}
function ___muldsi3($a, $b) {
    $a = $a | 0;
    $b = $b | 0;
    var $1 = 0, $2 = 0, $3 = 0, $6 = 0, $8 = 0, $11 = 0, $12 = 0;
    $1 = $a & 65535;
    $2 = $b & 65535;
    $3 = Math_imul($2, $1) | 0;
    $6 = $a >>> 16;
    $8 = ($3 >>> 16) + (Math_imul($2, $6) | 0) | 0;
    $11 = $b >>> 16;
    $12 = Math_imul($11, $1) | 0;
    return (tempRet0 = (($8 >>> 16) + (Math_imul($11, $6) | 0) | 0) + ((($8 & 65535) + $12 | 0) >>> 16) | 0, 0 | ($8 + $12 << 16 | $3 & 65535)) | 0;
}
function ___muldi3($a$0, $a$1, $b$0, $b$1) {
    $a$0 = $a$0 | 0;
    $a$1 = $a$1 | 0;
    $b$0 = $b$0 | 0;
    $b$1 = $b$1 | 0;
    var $x_sroa_0_0_extract_trunc = 0, $y_sroa_0_0_extract_trunc = 0, $1$0 = 0, $1$1 = 0, $2 = 0;
    $x_sroa_0_0_extract_trunc = $a$0;
    $y_sroa_0_0_extract_trunc = $b$0;
    $1$0 = ___muldsi3($x_sroa_0_0_extract_trunc, $y_sroa_0_0_extract_trunc) | 0;
    $1$1 = tempRet0;
    $2 = Math_imul($a$1, $y_sroa_0_0_extract_trunc) | 0;
    return (tempRet0 = ((Math_imul($b$1, $x_sroa_0_0_extract_trunc) | 0) + $2 | 0) + $1$1 | $1$1 & 0, 0 | $1$0 & -1) | 0;
}
function _memcpy(dest, src, num) {
    dest = dest|0; src = src|0; num = num|0;
    var ret = 0;
    var aligned_dest_end = 0;
    var block_aligned_dest_end = 0;
    var dest_end = 0;
    // Test against a benchmarked cutoff limit for when HEAPU8.set() becomes faster to use.
    if ((num|0) >=
      8192
    ) {
      return _emscripten_memcpy_big(dest|0, src|0, num|0)|0;
    }

    ret = dest|0;
    dest_end = (dest + num)|0;
    if ((dest&3) == (src&3)) {
      // The initial unaligned < 4-byte front.
      while (dest & 3) {
        if ((num|0) == 0) return ret|0;
        HEAP8[((dest)>>0)]=((HEAP8[((src)>>0)])|0);
        dest = (dest+1)|0;
        src = (src+1)|0;
        num = (num-1)|0;
      }
      aligned_dest_end = (dest_end & -4)|0;
      block_aligned_dest_end = (aligned_dest_end - 64)|0;
      while ((dest|0) <= (block_aligned_dest_end|0) ) {
        HEAP32[((dest)>>2)]=((HEAP32[((src)>>2)])|0);
        HEAP32[(((dest)+(4))>>2)]=((HEAP32[(((src)+(4))>>2)])|0);
        HEAP32[(((dest)+(8))>>2)]=((HEAP32[(((src)+(8))>>2)])|0);
        HEAP32[(((dest)+(12))>>2)]=((HEAP32[(((src)+(12))>>2)])|0);
        HEAP32[(((dest)+(16))>>2)]=((HEAP32[(((src)+(16))>>2)])|0);
        HEAP32[(((dest)+(20))>>2)]=((HEAP32[(((src)+(20))>>2)])|0);
        HEAP32[(((dest)+(24))>>2)]=((HEAP32[(((src)+(24))>>2)])|0);
        HEAP32[(((dest)+(28))>>2)]=((HEAP32[(((src)+(28))>>2)])|0);
        HEAP32[(((dest)+(32))>>2)]=((HEAP32[(((src)+(32))>>2)])|0);
        HEAP32[(((dest)+(36))>>2)]=((HEAP32[(((src)+(36))>>2)])|0);
        HEAP32[(((dest)+(40))>>2)]=((HEAP32[(((src)+(40))>>2)])|0);
        HEAP32[(((dest)+(44))>>2)]=((HEAP32[(((src)+(44))>>2)])|0);
        HEAP32[(((dest)+(48))>>2)]=((HEAP32[(((src)+(48))>>2)])|0);
        HEAP32[(((dest)+(52))>>2)]=((HEAP32[(((src)+(52))>>2)])|0);
        HEAP32[(((dest)+(56))>>2)]=((HEAP32[(((src)+(56))>>2)])|0);
        HEAP32[(((dest)+(60))>>2)]=((HEAP32[(((src)+(60))>>2)])|0);
        dest = (dest+64)|0;
        src = (src+64)|0;
      }
      while ((dest|0) < (aligned_dest_end|0) ) {
        HEAP32[((dest)>>2)]=((HEAP32[((src)>>2)])|0);
        dest = (dest+4)|0;
        src = (src+4)|0;
      }
    } else {
      // In the unaligned copy case, unroll a bit as well.
      aligned_dest_end = (dest_end - 4)|0;
      while ((dest|0) < (aligned_dest_end|0) ) {
        HEAP8[((dest)>>0)]=((HEAP8[((src)>>0)])|0);
        HEAP8[(((dest)+(1))>>0)]=((HEAP8[(((src)+(1))>>0)])|0);
        HEAP8[(((dest)+(2))>>0)]=((HEAP8[(((src)+(2))>>0)])|0);
        HEAP8[(((dest)+(3))>>0)]=((HEAP8[(((src)+(3))>>0)])|0);
        dest = (dest+4)|0;
        src = (src+4)|0;
      }
    }
    // The remaining unaligned < 4 byte tail.
    while ((dest|0) < (dest_end|0)) {
      HEAP8[((dest)>>0)]=((HEAP8[((src)>>0)])|0);
      dest = (dest+1)|0;
      src = (src+1)|0;
    }
    return ret|0;
}
function _memmove(dest, src, num) {
    dest = dest|0; src = src|0; num = num|0;
    var ret = 0;
    if (((src|0) < (dest|0)) & ((dest|0) < ((src + num)|0))) {
      // Unlikely case: Copy backwards in a safe manner
      ret = dest;
      src = (src + num)|0;
      dest = (dest + num)|0;
      while ((num|0) > 0) {
        dest = (dest - 1)|0;
        src = (src - 1)|0;
        num = (num - 1)|0;
        HEAP8[((dest)>>0)]=((HEAP8[((src)>>0)])|0);
      }
      dest = ret;
    } else {
      _memcpy(dest, src, num) | 0;
    }
    return dest | 0;
}
function _llvm_cttz_i32(x) {
    x = x|0;
    var ret = 0;
    ret = ((HEAP8[(((cttz_i8)+(x & 0xff))>>0)])|0);
    if ((ret|0) < 8) return ret|0;
    ret = ((HEAP8[(((cttz_i8)+((x >> 8)&0xff))>>0)])|0);
    if ((ret|0) < 8) return (ret + 8)|0;
    ret = ((HEAP8[(((cttz_i8)+((x >> 16)&0xff))>>0)])|0);
    if ((ret|0) < 8) return (ret + 16)|0;
    return (((HEAP8[(((cttz_i8)+(x >>> 24))>>0)])|0) + 24)|0;
}
function ___udivmoddi4($a$0, $a$1, $b$0, $b$1, $rem) {
    $a$0 = $a$0 | 0;
    $a$1 = $a$1 | 0;
    $b$0 = $b$0 | 0;
    $b$1 = $b$1 | 0;
    $rem = $rem | 0;
    var $n_sroa_0_0_extract_trunc = 0, $n_sroa_1_4_extract_shift$0 = 0, $n_sroa_1_4_extract_trunc = 0, $d_sroa_0_0_extract_trunc = 0, $d_sroa_1_4_extract_shift$0 = 0, $d_sroa_1_4_extract_trunc = 0, $4 = 0, $17 = 0, $37 = 0, $49 = 0, $51 = 0, $57 = 0, $58 = 0, $66 = 0, $78 = 0, $86 = 0, $88 = 0, $89 = 0, $91 = 0, $92 = 0, $95 = 0, $105 = 0, $117 = 0, $119 = 0, $125 = 0, $126 = 0, $130 = 0, $q_sroa_1_1_ph = 0, $q_sroa_0_1_ph = 0, $r_sroa_1_1_ph = 0, $r_sroa_0_1_ph = 0, $sr_1_ph = 0, $d_sroa_0_0_insert_insert99$0 = 0, $d_sroa_0_0_insert_insert99$1 = 0, $137$0 = 0, $137$1 = 0, $carry_0203 = 0, $sr_1202 = 0, $r_sroa_0_1201 = 0, $r_sroa_1_1200 = 0, $q_sroa_0_1199 = 0, $q_sroa_1_1198 = 0, $147 = 0, $149 = 0, $r_sroa_0_0_insert_insert42$0 = 0, $r_sroa_0_0_insert_insert42$1 = 0, $150$1 = 0, $151$0 = 0, $152 = 0, $154$0 = 0, $r_sroa_0_0_extract_trunc = 0, $r_sroa_1_4_extract_trunc = 0, $155 = 0, $carry_0_lcssa$0 = 0, $carry_0_lcssa$1 = 0, $r_sroa_0_1_lcssa = 0, $r_sroa_1_1_lcssa = 0, $q_sroa_0_1_lcssa = 0, $q_sroa_1_1_lcssa = 0, $q_sroa_0_0_insert_ext75$0 = 0, $q_sroa_0_0_insert_ext75$1 = 0, $q_sroa_0_0_insert_insert77$1 = 0, $_0$0 = 0, $_0$1 = 0;
    $n_sroa_0_0_extract_trunc = $a$0;
    $n_sroa_1_4_extract_shift$0 = $a$1;
    $n_sroa_1_4_extract_trunc = $n_sroa_1_4_extract_shift$0;
    $d_sroa_0_0_extract_trunc = $b$0;
    $d_sroa_1_4_extract_shift$0 = $b$1;
    $d_sroa_1_4_extract_trunc = $d_sroa_1_4_extract_shift$0;
    if (($n_sroa_1_4_extract_trunc | 0) == 0) {
      $4 = ($rem | 0) != 0;
      if (($d_sroa_1_4_extract_trunc | 0) == 0) {
        if ($4) {
          HEAP32[$rem >> 2] = ($n_sroa_0_0_extract_trunc >>> 0) % ($d_sroa_0_0_extract_trunc >>> 0);
          HEAP32[$rem + 4 >> 2] = 0;
        }
        $_0$1 = 0;
        $_0$0 = ($n_sroa_0_0_extract_trunc >>> 0) / ($d_sroa_0_0_extract_trunc >>> 0) >>> 0;
        return (tempRet0 = $_0$1, $_0$0) | 0;
      } else {
        if (!$4) {
          $_0$1 = 0;
          $_0$0 = 0;
          return (tempRet0 = $_0$1, $_0$0) | 0;
        }
        HEAP32[$rem >> 2] = $a$0 & -1;
        HEAP32[$rem + 4 >> 2] = $a$1 & 0;
        $_0$1 = 0;
        $_0$0 = 0;
        return (tempRet0 = $_0$1, $_0$0) | 0;
      }
    }
    $17 = ($d_sroa_1_4_extract_trunc | 0) == 0;
    do {
      if (($d_sroa_0_0_extract_trunc | 0) == 0) {
        if ($17) {
          if (($rem | 0) != 0) {
            HEAP32[$rem >> 2] = ($n_sroa_1_4_extract_trunc >>> 0) % ($d_sroa_0_0_extract_trunc >>> 0);
            HEAP32[$rem + 4 >> 2] = 0;
          }
          $_0$1 = 0;
          $_0$0 = ($n_sroa_1_4_extract_trunc >>> 0) / ($d_sroa_0_0_extract_trunc >>> 0) >>> 0;
          return (tempRet0 = $_0$1, $_0$0) | 0;
        }
        if (($n_sroa_0_0_extract_trunc | 0) == 0) {
          if (($rem | 0) != 0) {
            HEAP32[$rem >> 2] = 0;
            HEAP32[$rem + 4 >> 2] = ($n_sroa_1_4_extract_trunc >>> 0) % ($d_sroa_1_4_extract_trunc >>> 0);
          }
          $_0$1 = 0;
          $_0$0 = ($n_sroa_1_4_extract_trunc >>> 0) / ($d_sroa_1_4_extract_trunc >>> 0) >>> 0;
          return (tempRet0 = $_0$1, $_0$0) | 0;
        }
        $37 = $d_sroa_1_4_extract_trunc - 1 | 0;
        if (($37 & $d_sroa_1_4_extract_trunc | 0) == 0) {
          if (($rem | 0) != 0) {
            HEAP32[$rem >> 2] = 0 | $a$0 & -1;
            HEAP32[$rem + 4 >> 2] = $37 & $n_sroa_1_4_extract_trunc | $a$1 & 0;
          }
          $_0$1 = 0;
          $_0$0 = $n_sroa_1_4_extract_trunc >>> ((_llvm_cttz_i32($d_sroa_1_4_extract_trunc | 0) | 0) >>> 0);
          return (tempRet0 = $_0$1, $_0$0) | 0;
        }
        $49 = Math_clz32($d_sroa_1_4_extract_trunc | 0) | 0;
        $51 = $49 - (Math_clz32($n_sroa_1_4_extract_trunc | 0) | 0) | 0;
        if ($51 >>> 0 <= 30) {
          $57 = $51 + 1 | 0;
          $58 = 31 - $51 | 0;
          $sr_1_ph = $57;
          $r_sroa_0_1_ph = $n_sroa_1_4_extract_trunc << $58 | $n_sroa_0_0_extract_trunc >>> ($57 >>> 0);
          $r_sroa_1_1_ph = $n_sroa_1_4_extract_trunc >>> ($57 >>> 0);
          $q_sroa_0_1_ph = 0;
          $q_sroa_1_1_ph = $n_sroa_0_0_extract_trunc << $58;
          break;
        }
        if (($rem | 0) == 0) {
          $_0$1 = 0;
          $_0$0 = 0;
          return (tempRet0 = $_0$1, $_0$0) | 0;
        }
        HEAP32[$rem >> 2] = 0 | $a$0 & -1;
        HEAP32[$rem + 4 >> 2] = $n_sroa_1_4_extract_shift$0 | $a$1 & 0;
        $_0$1 = 0;
        $_0$0 = 0;
        return (tempRet0 = $_0$1, $_0$0) | 0;
      } else {
        if (!$17) {
          $117 = Math_clz32($d_sroa_1_4_extract_trunc | 0) | 0;
          $119 = $117 - (Math_clz32($n_sroa_1_4_extract_trunc | 0) | 0) | 0;
          if ($119 >>> 0 <= 31) {
            $125 = $119 + 1 | 0;
            $126 = 31 - $119 | 0;
            $130 = $119 - 31 >> 31;
            $sr_1_ph = $125;
            $r_sroa_0_1_ph = $n_sroa_0_0_extract_trunc >>> ($125 >>> 0) & $130 | $n_sroa_1_4_extract_trunc << $126;
            $r_sroa_1_1_ph = $n_sroa_1_4_extract_trunc >>> ($125 >>> 0) & $130;
            $q_sroa_0_1_ph = 0;
            $q_sroa_1_1_ph = $n_sroa_0_0_extract_trunc << $126;
            break;
          }
          if (($rem | 0) == 0) {
            $_0$1 = 0;
            $_0$0 = 0;
            return (tempRet0 = $_0$1, $_0$0) | 0;
          }
          HEAP32[$rem >> 2] = 0 | $a$0 & -1;
          HEAP32[$rem + 4 >> 2] = $n_sroa_1_4_extract_shift$0 | $a$1 & 0;
          $_0$1 = 0;
          $_0$0 = 0;
          return (tempRet0 = $_0$1, $_0$0) | 0;
        }
        $66 = $d_sroa_0_0_extract_trunc - 1 | 0;
        if (($66 & $d_sroa_0_0_extract_trunc | 0) != 0) {
          $86 = (Math_clz32($d_sroa_0_0_extract_trunc | 0) | 0) + 33 | 0;
          $88 = $86 - (Math_clz32($n_sroa_1_4_extract_trunc | 0) | 0) | 0;
          $89 = 64 - $88 | 0;
          $91 = 32 - $88 | 0;
          $92 = $91 >> 31;
          $95 = $88 - 32 | 0;
          $105 = $95 >> 31;
          $sr_1_ph = $88;
          $r_sroa_0_1_ph = $91 - 1 >> 31 & $n_sroa_1_4_extract_trunc >>> ($95 >>> 0) | ($n_sroa_1_4_extract_trunc << $91 | $n_sroa_0_0_extract_trunc >>> ($88 >>> 0)) & $105;
          $r_sroa_1_1_ph = $105 & $n_sroa_1_4_extract_trunc >>> ($88 >>> 0);
          $q_sroa_0_1_ph = $n_sroa_0_0_extract_trunc << $89 & $92;
          $q_sroa_1_1_ph = ($n_sroa_1_4_extract_trunc << $89 | $n_sroa_0_0_extract_trunc >>> ($95 >>> 0)) & $92 | $n_sroa_0_0_extract_trunc << $91 & $88 - 33 >> 31;
          break;
        }
        if (($rem | 0) != 0) {
          HEAP32[$rem >> 2] = $66 & $n_sroa_0_0_extract_trunc;
          HEAP32[$rem + 4 >> 2] = 0;
        }
        if (($d_sroa_0_0_extract_trunc | 0) == 1) {
          $_0$1 = $n_sroa_1_4_extract_shift$0 | $a$1 & 0;
          $_0$0 = 0 | $a$0 & -1;
          return (tempRet0 = $_0$1, $_0$0) | 0;
        } else {
          $78 = _llvm_cttz_i32($d_sroa_0_0_extract_trunc | 0) | 0;
          $_0$1 = 0 | $n_sroa_1_4_extract_trunc >>> ($78 >>> 0);
          $_0$0 = $n_sroa_1_4_extract_trunc << 32 - $78 | $n_sroa_0_0_extract_trunc >>> ($78 >>> 0) | 0;
          return (tempRet0 = $_0$1, $_0$0) | 0;
        }
      }
    } while (0);
    if (($sr_1_ph | 0) == 0) {
      $q_sroa_1_1_lcssa = $q_sroa_1_1_ph;
      $q_sroa_0_1_lcssa = $q_sroa_0_1_ph;
      $r_sroa_1_1_lcssa = $r_sroa_1_1_ph;
      $r_sroa_0_1_lcssa = $r_sroa_0_1_ph;
      $carry_0_lcssa$1 = 0;
      $carry_0_lcssa$0 = 0;
    } else {
      $d_sroa_0_0_insert_insert99$0 = 0 | $b$0 & -1;
      $d_sroa_0_0_insert_insert99$1 = $d_sroa_1_4_extract_shift$0 | $b$1 & 0;
      $137$0 = _i64Add($d_sroa_0_0_insert_insert99$0 | 0, $d_sroa_0_0_insert_insert99$1 | 0, -1, -1) | 0;
      $137$1 = tempRet0;
      $q_sroa_1_1198 = $q_sroa_1_1_ph;
      $q_sroa_0_1199 = $q_sroa_0_1_ph;
      $r_sroa_1_1200 = $r_sroa_1_1_ph;
      $r_sroa_0_1201 = $r_sroa_0_1_ph;
      $sr_1202 = $sr_1_ph;
      $carry_0203 = 0;
      while (1) {
        $147 = $q_sroa_0_1199 >>> 31 | $q_sroa_1_1198 << 1;
        $149 = $carry_0203 | $q_sroa_0_1199 << 1;
        $r_sroa_0_0_insert_insert42$0 = 0 | ($r_sroa_0_1201 << 1 | $q_sroa_1_1198 >>> 31);
        $r_sroa_0_0_insert_insert42$1 = $r_sroa_0_1201 >>> 31 | $r_sroa_1_1200 << 1 | 0;
        _i64Subtract($137$0 | 0, $137$1 | 0, $r_sroa_0_0_insert_insert42$0 | 0, $r_sroa_0_0_insert_insert42$1 | 0) | 0;
        $150$1 = tempRet0;
        $151$0 = $150$1 >> 31 | (($150$1 | 0) < 0 ? -1 : 0) << 1;
        $152 = $151$0 & 1;
        $154$0 = _i64Subtract($r_sroa_0_0_insert_insert42$0 | 0, $r_sroa_0_0_insert_insert42$1 | 0, $151$0 & $d_sroa_0_0_insert_insert99$0 | 0, ((($150$1 | 0) < 0 ? -1 : 0) >> 31 | (($150$1 | 0) < 0 ? -1 : 0) << 1) & $d_sroa_0_0_insert_insert99$1 | 0) | 0;
        $r_sroa_0_0_extract_trunc = $154$0;
        $r_sroa_1_4_extract_trunc = tempRet0;
        $155 = $sr_1202 - 1 | 0;
        if (($155 | 0) == 0) {
          break;
        } else {
          $q_sroa_1_1198 = $147;
          $q_sroa_0_1199 = $149;
          $r_sroa_1_1200 = $r_sroa_1_4_extract_trunc;
          $r_sroa_0_1201 = $r_sroa_0_0_extract_trunc;
          $sr_1202 = $155;
          $carry_0203 = $152;
        }
      }
      $q_sroa_1_1_lcssa = $147;
      $q_sroa_0_1_lcssa = $149;
      $r_sroa_1_1_lcssa = $r_sroa_1_4_extract_trunc;
      $r_sroa_0_1_lcssa = $r_sroa_0_0_extract_trunc;
      $carry_0_lcssa$1 = 0;
      $carry_0_lcssa$0 = $152;
    }
    $q_sroa_0_0_insert_ext75$0 = $q_sroa_0_1_lcssa;
    $q_sroa_0_0_insert_ext75$1 = 0;
    $q_sroa_0_0_insert_insert77$1 = $q_sroa_1_1_lcssa | $q_sroa_0_0_insert_ext75$1;
    if (($rem | 0) != 0) {
      HEAP32[$rem >> 2] = 0 | $r_sroa_0_1_lcssa;
      HEAP32[$rem + 4 >> 2] = $r_sroa_1_1_lcssa | 0;
    }
    $_0$1 = (0 | $q_sroa_0_0_insert_ext75$0) >>> 31 | $q_sroa_0_0_insert_insert77$1 << 1 | ($q_sroa_0_0_insert_ext75$1 << 1 | $q_sroa_0_0_insert_ext75$0 >>> 31) & 0 | $carry_0_lcssa$1;
    $_0$0 = ($q_sroa_0_0_insert_ext75$0 << 1 | 0 >>> 31) & -2 | $carry_0_lcssa$0;
    return (tempRet0 = $_0$1, $_0$0) | 0;
}
function ___uremdi3($a$0, $a$1, $b$0, $b$1) {
    $a$0 = $a$0 | 0;
    $a$1 = $a$1 | 0;
    $b$0 = $b$0 | 0;
    $b$1 = $b$1 | 0;
    var $rem = 0, __stackBase__ = 0;
    __stackBase__ = STACKTOP;
    STACKTOP = STACKTOP + 16 | 0;
    $rem = __stackBase__ | 0;
    ___udivmoddi4($a$0, $a$1, $b$0, $b$1, $rem) | 0;
    STACKTOP = __stackBase__;
    return (tempRet0 = HEAP32[$rem + 4 >> 2] | 0, HEAP32[$rem >> 2] | 0) | 0;
}
function ___udivdi3($a$0, $a$1, $b$0, $b$1) {
    $a$0 = $a$0 | 0;
    $a$1 = $a$1 | 0;
    $b$0 = $b$0 | 0;
    $b$1 = $b$1 | 0;
    var $1$0 = 0;
    $1$0 = ___udivmoddi4($a$0, $a$1, $b$0, $b$1, 0) | 0;
    return $1$0 | 0;
}
function _roundf(f) {
    f = +f;
    return f >= +0 ? +Math_floor(f + +0.5) : +Math_ceil(f - +0.5); // TODO: use fround?
}
function _bitshift64Lshr(low, high, bits) {
    low = low|0; high = high|0; bits = bits|0;
    var ander = 0;
    if ((bits|0) < 32) {
      ander = ((1 << bits) - 1)|0;
      tempRet0 = high >>> bits;
      return (low >>> bits) | ((high&ander) << (32 - bits));
    }
    tempRet0 = 0;
    return (high >>> (bits - 32))|0;
}
function _sbrk(increment) {
    increment = increment|0;
    var oldDynamicTop = 0;
    var oldDynamicTopOnChange = 0;
    var newDynamicTop = 0;
    var totalMemory = 0;
    increment = ((increment + 15) & -16)|0;
    oldDynamicTop = HEAP32[DYNAMICTOP_PTR>>2]|0;
    newDynamicTop = oldDynamicTop + increment | 0;

    if (((increment|0) > 0 & (newDynamicTop|0) < (oldDynamicTop|0)) // Detect and fail if we would wrap around signed 32-bit int.
      | (newDynamicTop|0) < 0) { // Also underflow, sbrk() should be able to be used to subtract.
      abortOnCannotGrowMemory()|0;
      ___setErrNo(12);
      return -1;
    }

    HEAP32[DYNAMICTOP_PTR>>2] = newDynamicTop;
    totalMemory = getTotalMemory()|0;
    if ((newDynamicTop|0) > (totalMemory|0)) {
      if ((enlargeMemory()|0) == 0) {
        ___setErrNo(12);
        HEAP32[DYNAMICTOP_PTR>>2] = oldDynamicTop;
        return -1;
      }
    }
    return oldDynamicTop|0;
}
function _bitshift64Shl(low, high, bits) {
    low = low|0; high = high|0; bits = bits|0;
    var ander = 0;
    if ((bits|0) < 32) {
      ander = ((1 << bits) - 1)|0;
      tempRet0 = (high << bits) | ((low&(ander << (32 - bits))) >>> (32 - bits));
      return low << bits;
    }
    tempRet0 = low << (bits - 32);
    return 0;
}
function _llvm_bswap_i32(x) {
    x = x|0;
    return (((x&0xff)<<24) | (((x>>8)&0xff)<<16) | (((x>>16)&0xff)<<8) | (x>>>24))|0;
}

  
function dynCall_viiiii(index,a1,a2,a3,a4,a5) {
  index = index|0;
  a1=a1|0; a2=a2|0; a3=a3|0; a4=a4|0; a5=a5|0;
  FUNCTION_TABLE_viiiii[index&7](a1|0,a2|0,a3|0,a4|0,a5|0);
}


function dynCall_vd(index,a1) {
  index = index|0;
  a1=+a1;
  FUNCTION_TABLE_vd[index&3](+a1);
}


function dynCall_vid(index,a1,a2) {
  index = index|0;
  a1=a1|0; a2=+a2;
  FUNCTION_TABLE_vid[index&3](a1|0,+a2);
}


function dynCall_vi(index,a1) {
  index = index|0;
  a1=a1|0;
  FUNCTION_TABLE_vi[index&31](a1|0);
}


function dynCall_vii(index,a1,a2) {
  index = index|0;
  a1=a1|0; a2=a2|0;
  FUNCTION_TABLE_vii[index&63](a1|0,a2|0);
}


function dynCall_ii(index,a1) {
  index = index|0;
  a1=a1|0;
  return FUNCTION_TABLE_ii[index&15](a1|0)|0;
}


function dynCall_viddd(index,a1,a2,a3,a4) {
  index = index|0;
  a1=a1|0; a2=+a2; a3=+a3; a4=+a4;
  FUNCTION_TABLE_viddd[index&3](a1|0,+a2,+a3,+a4);
}


function dynCall_vidd(index,a1,a2,a3) {
  index = index|0;
  a1=a1|0; a2=+a2; a3=+a3;
  FUNCTION_TABLE_vidd[index&7](a1|0,+a2,+a3);
}


function dynCall_iiii(index,a1,a2,a3) {
  index = index|0;
  a1=a1|0; a2=a2|0; a3=a3|0;
  return FUNCTION_TABLE_iiii[index&15](a1|0,a2|0,a3|0)|0;
}


function dynCall_viiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8) {
  index = index|0;
  a1=a1|0; a2=a2|0; a3=a3|0; a4=a4|0; a5=a5|0; a6=a6|0; a7=a7|0; a8=a8|0;
  FUNCTION_TABLE_viiiiiiii[index&3](a1|0,a2|0,a3|0,a4|0,a5|0,a6|0,a7|0,a8|0);
}


function dynCall_viiiiii(index,a1,a2,a3,a4,a5,a6) {
  index = index|0;
  a1=a1|0; a2=a2|0; a3=a3|0; a4=a4|0; a5=a5|0; a6=a6|0;
  FUNCTION_TABLE_viiiiii[index&3](a1|0,a2|0,a3|0,a4|0,a5|0,a6|0);
}


function dynCall_viii(index,a1,a2,a3) {
  index = index|0;
  a1=a1|0; a2=a2|0; a3=a3|0;
  FUNCTION_TABLE_viii[index&31](a1|0,a2|0,a3|0);
}


function dynCall_vidddd(index,a1,a2,a3,a4,a5) {
  index = index|0;
  a1=a1|0; a2=+a2; a3=+a3; a4=+a4; a5=+a5;
  FUNCTION_TABLE_vidddd[index&3](a1|0,+a2,+a3,+a4,+a5);
}


function dynCall_vdi(index,a1,a2) {
  index = index|0;
  a1=+a1; a2=a2|0;
  FUNCTION_TABLE_vdi[index&1](+a1,a2|0);
}


function dynCall_viiiiiii(index,a1,a2,a3,a4,a5,a6,a7) {
  index = index|0;
  a1=a1|0; a2=a2|0; a3=a3|0; a4=a4|0; a5=a5|0; a6=a6|0; a7=a7|0;
  FUNCTION_TABLE_viiiiiii[index&3](a1|0,a2|0,a3|0,a4|0,a5|0,a6|0,a7|0);
}


function dynCall_viiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9) {
  index = index|0;
  a1=a1|0; a2=a2|0; a3=a3|0; a4=a4|0; a5=a5|0; a6=a6|0; a7=a7|0; a8=a8|0; a9=a9|0;
  FUNCTION_TABLE_viiiiiiiii[index&3](a1|0,a2|0,a3|0,a4|0,a5|0,a6|0,a7|0,a8|0,a9|0);
}


function dynCall_iii(index,a1,a2) {
  index = index|0;
  a1=a1|0; a2=a2|0;
  return FUNCTION_TABLE_iii[index&3](a1|0,a2|0)|0;
}


function dynCall_i(index) {
  index = index|0;
  
  return FUNCTION_TABLE_i[index&3]()|0;
}


function dynCall_vdddddd(index,a1,a2,a3,a4,a5,a6) {
  index = index|0;
  a1=+a1; a2=+a2; a3=+a3; a4=+a4; a5=+a5; a6=+a6;
  FUNCTION_TABLE_vdddddd[index&1](+a1,+a2,+a3,+a4,+a5,+a6);
}


function dynCall_vdddd(index,a1,a2,a3,a4) {
  index = index|0;
  a1=+a1; a2=+a2; a3=+a3; a4=+a4;
  FUNCTION_TABLE_vdddd[index&3](+a1,+a2,+a3,+a4);
}


function dynCall_vdd(index,a1,a2) {
  index = index|0;
  a1=+a1; a2=+a2;
  FUNCTION_TABLE_vdd[index&3](+a1,+a2);
}


function dynCall_v(index) {
  index = index|0;
  
  FUNCTION_TABLE_v[index&7]();
}


function dynCall_viid(index,a1,a2,a3) {
  index = index|0;
  a1=a1|0; a2=a2|0; a3=+a3;
  FUNCTION_TABLE_viid[index&1](a1|0,a2|0,+a3);
}


function dynCall_viiii(index,a1,a2,a3,a4) {
  index = index|0;
  a1=a1|0; a2=a2|0; a3=a3|0; a4=a4|0;
  FUNCTION_TABLE_viiii[index&31](a1|0,a2|0,a3|0,a4|0);
}

function b0(p0,p1,p2,p3,p4) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0; nullFunc_viiiii(0);
}
function _emscripten_glUniform4i__wrapper(p0,p1,p2,p3,p4) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0; _emscripten_glUniform4i(p0|0,p1|0,p2|0,p3|0,p4|0);
}
function _emscripten_glFramebufferTexture2D__wrapper(p0,p1,p2,p3,p4) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0; _emscripten_glFramebufferTexture2D(p0|0,p1|0,p2|0,p3|0,p4|0);
}
function _emscripten_glShaderBinary__wrapper(p0,p1,p2,p3,p4) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0; _emscripten_glShaderBinary(p0|0,p1|0,p2|0,p3|0,p4|0);
}
function _emscripten_glDrawElementsInstanced__wrapper(p0,p1,p2,p3,p4) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0; _emscripten_glDrawElementsInstanced(p0|0,p1|0,p2|0,p3|0,p4|0);
}
function b1(p0) {
 p0 = +p0; nullFunc_vd(1);
}
function _emscripten_glClearDepth__wrapper(p0) {
 p0 = +p0; _emscripten_glClearDepth(+p0);
}
function _emscripten_glClearDepthf__wrapper(p0) {
 p0 = +p0; _emscripten_glClearDepthf(+p0);
}
function _emscripten_glLineWidth__wrapper(p0) {
 p0 = +p0; _emscripten_glLineWidth(+p0);
}
function b2(p0,p1) {
 p0 = p0|0;p1 = +p1; nullFunc_vid(2);
}
function _emscripten_glUniform1f__wrapper(p0,p1) {
 p0 = p0|0;p1 = +p1; _emscripten_glUniform1f(p0|0,+p1);
}
function _emscripten_glVertexAttrib1f__wrapper(p0,p1) {
 p0 = p0|0;p1 = +p1; _emscripten_glVertexAttrib1f(p0|0,+p1);
}
function b3(p0) {
 p0 = p0|0; nullFunc_vi(3);
}
function _emscripten_glDeleteShader__wrapper(p0) {
 p0 = p0|0; _emscripten_glDeleteShader(p0|0);
}
function _emscripten_glCompileShader__wrapper(p0) {
 p0 = p0|0; _emscripten_glCompileShader(p0|0);
}
function _emscripten_glDeleteProgram__wrapper(p0) {
 p0 = p0|0; _emscripten_glDeleteProgram(p0|0);
}
function _emscripten_glLinkProgram__wrapper(p0) {
 p0 = p0|0; _emscripten_glLinkProgram(p0|0);
}
function _emscripten_glUseProgram__wrapper(p0) {
 p0 = p0|0; _emscripten_glUseProgram(p0|0);
}
function _emscripten_glValidateProgram__wrapper(p0) {
 p0 = p0|0; _emscripten_glValidateProgram(p0|0);
}
function _emscripten_glDeleteObjectARB__wrapper(p0) {
 p0 = p0|0; _emscripten_glDeleteObjectARB(p0|0);
}
function _emscripten_glEnableClientState__wrapper(p0) {
 p0 = p0|0; _emscripten_glEnableClientState(p0|0);
}
function _emscripten_glClientActiveTexture__wrapper(p0) {
 p0 = p0|0; _emscripten_glClientActiveTexture(p0|0);
}
function _emscripten_glBindVertexArray__wrapper(p0) {
 p0 = p0|0; _emscripten_glBindVertexArray(p0|0);
}
function _emscripten_glMatrixMode__wrapper(p0) {
 p0 = p0|0; _emscripten_glMatrixMode(p0|0);
}
function _emscripten_glLoadMatrixf__wrapper(p0) {
 p0 = p0|0; _emscripten_glLoadMatrixf(p0|0);
}
function _emscripten_glEnableVertexAttribArray__wrapper(p0) {
 p0 = p0|0; _emscripten_glEnableVertexAttribArray(p0|0);
}
function _emscripten_glDisableVertexAttribArray__wrapper(p0) {
 p0 = p0|0; _emscripten_glDisableVertexAttribArray(p0|0);
}
function _emscripten_glDepthFunc__wrapper(p0) {
 p0 = p0|0; _emscripten_glDepthFunc(p0|0);
}
function _emscripten_glEnable__wrapper(p0) {
 p0 = p0|0; _emscripten_glEnable(p0|0);
}
function _emscripten_glDisable__wrapper(p0) {
 p0 = p0|0; _emscripten_glDisable(p0|0);
}
function _emscripten_glFrontFace__wrapper(p0) {
 p0 = p0|0; _emscripten_glFrontFace(p0|0);
}
function _emscripten_glCullFace__wrapper(p0) {
 p0 = p0|0; _emscripten_glCullFace(p0|0);
}
function _emscripten_glClear__wrapper(p0) {
 p0 = p0|0; _emscripten_glClear(p0|0);
}
function _emscripten_glClearStencil__wrapper(p0) {
 p0 = p0|0; _emscripten_glClearStencil(p0|0);
}
function _emscripten_glDepthMask__wrapper(p0) {
 p0 = p0|0; _emscripten_glDepthMask(p0|0);
}
function _emscripten_glStencilMask__wrapper(p0) {
 p0 = p0|0; _emscripten_glStencilMask(p0|0);
}
function _emscripten_glGenerateMipmap__wrapper(p0) {
 p0 = p0|0; _emscripten_glGenerateMipmap(p0|0);
}
function _emscripten_glActiveTexture__wrapper(p0) {
 p0 = p0|0; _emscripten_glActiveTexture(p0|0);
}
function _emscripten_glBlendEquation__wrapper(p0) {
 p0 = p0|0; _emscripten_glBlendEquation(p0|0);
}
function b4(p0,p1) {
 p0 = p0|0;p1 = p1|0; nullFunc_vii(4);
}
function _emscripten_glPixelStorei__wrapper(p0,p1) {
 p0 = p0|0;p1 = p1|0; _emscripten_glPixelStorei(p0|0,p1|0);
}
function _emscripten_glGetIntegerv__wrapper(p0,p1) {
 p0 = p0|0;p1 = p1|0; _emscripten_glGetIntegerv(p0|0,p1|0);
}
function _emscripten_glGetFloatv__wrapper(p0,p1) {
 p0 = p0|0;p1 = p1|0; _emscripten_glGetFloatv(p0|0,p1|0);
}
function _emscripten_glGetBooleanv__wrapper(p0,p1) {
 p0 = p0|0;p1 = p1|0; _emscripten_glGetBooleanv(p0|0,p1|0);
}
function _emscripten_glGenTextures__wrapper(p0,p1) {
 p0 = p0|0;p1 = p1|0; _emscripten_glGenTextures(p0|0,p1|0);
}
function _emscripten_glDeleteTextures__wrapper(p0,p1) {
 p0 = p0|0;p1 = p1|0; _emscripten_glDeleteTextures(p0|0,p1|0);
}
function _emscripten_glBindTexture__wrapper(p0,p1) {
 p0 = p0|0;p1 = p1|0; _emscripten_glBindTexture(p0|0,p1|0);
}
function _emscripten_glGenBuffers__wrapper(p0,p1) {
 p0 = p0|0;p1 = p1|0; _emscripten_glGenBuffers(p0|0,p1|0);
}
function _emscripten_glDeleteBuffers__wrapper(p0,p1) {
 p0 = p0|0;p1 = p1|0; _emscripten_glDeleteBuffers(p0|0,p1|0);
}
function _emscripten_glGenRenderbuffers__wrapper(p0,p1) {
 p0 = p0|0;p1 = p1|0; _emscripten_glGenRenderbuffers(p0|0,p1|0);
}
function _emscripten_glDeleteRenderbuffers__wrapper(p0,p1) {
 p0 = p0|0;p1 = p1|0; _emscripten_glDeleteRenderbuffers(p0|0,p1|0);
}
function _emscripten_glBindRenderbuffer__wrapper(p0,p1) {
 p0 = p0|0;p1 = p1|0; _emscripten_glBindRenderbuffer(p0|0,p1|0);
}
function _emscripten_glUniform1i__wrapper(p0,p1) {
 p0 = p0|0;p1 = p1|0; _emscripten_glUniform1i(p0|0,p1|0);
}
function _emscripten_glBindBuffer__wrapper(p0,p1) {
 p0 = p0|0;p1 = p1|0; _emscripten_glBindBuffer(p0|0,p1|0);
}
function _emscripten_glVertexAttrib1fv__wrapper(p0,p1) {
 p0 = p0|0;p1 = p1|0; _emscripten_glVertexAttrib1fv(p0|0,p1|0);
}
function _emscripten_glVertexAttrib2fv__wrapper(p0,p1) {
 p0 = p0|0;p1 = p1|0; _emscripten_glVertexAttrib2fv(p0|0,p1|0);
}
function _emscripten_glVertexAttrib3fv__wrapper(p0,p1) {
 p0 = p0|0;p1 = p1|0; _emscripten_glVertexAttrib3fv(p0|0,p1|0);
}
function _emscripten_glVertexAttrib4fv__wrapper(p0,p1) {
 p0 = p0|0;p1 = p1|0; _emscripten_glVertexAttrib4fv(p0|0,p1|0);
}
function _emscripten_glAttachShader__wrapper(p0,p1) {
 p0 = p0|0;p1 = p1|0; _emscripten_glAttachShader(p0|0,p1|0);
}
function _emscripten_glDetachShader__wrapper(p0,p1) {
 p0 = p0|0;p1 = p1|0; _emscripten_glDetachShader(p0|0,p1|0);
}
function _emscripten_glBindFramebuffer__wrapper(p0,p1) {
 p0 = p0|0;p1 = p1|0; _emscripten_glBindFramebuffer(p0|0,p1|0);
}
function _emscripten_glGenFramebuffers__wrapper(p0,p1) {
 p0 = p0|0;p1 = p1|0; _emscripten_glGenFramebuffers(p0|0,p1|0);
}
function _emscripten_glDeleteFramebuffers__wrapper(p0,p1) {
 p0 = p0|0;p1 = p1|0; _emscripten_glDeleteFramebuffers(p0|0,p1|0);
}
function _emscripten_glBindProgramARB__wrapper(p0,p1) {
 p0 = p0|0;p1 = p1|0; _emscripten_glBindProgramARB(p0|0,p1|0);
}
function _emscripten_glGetPointerv__wrapper(p0,p1) {
 p0 = p0|0;p1 = p1|0; _emscripten_glGetPointerv(p0|0,p1|0);
}
function _emscripten_glGenVertexArrays__wrapper(p0,p1) {
 p0 = p0|0;p1 = p1|0; _emscripten_glGenVertexArrays(p0|0,p1|0);
}
function _emscripten_glDeleteVertexArrays__wrapper(p0,p1) {
 p0 = p0|0;p1 = p1|0; _emscripten_glDeleteVertexArrays(p0|0,p1|0);
}
function _emscripten_glVertexAttribDivisor__wrapper(p0,p1) {
 p0 = p0|0;p1 = p1|0; _emscripten_glVertexAttribDivisor(p0|0,p1|0);
}
function _emscripten_glBlendFunc__wrapper(p0,p1) {
 p0 = p0|0;p1 = p1|0; _emscripten_glBlendFunc(p0|0,p1|0);
}
function _emscripten_glBlendEquationSeparate__wrapper(p0,p1) {
 p0 = p0|0;p1 = p1|0; _emscripten_glBlendEquationSeparate(p0|0,p1|0);
}
function _emscripten_glStencilMaskSeparate__wrapper(p0,p1) {
 p0 = p0|0;p1 = p1|0; _emscripten_glStencilMaskSeparate(p0|0,p1|0);
}
function _emscripten_glHint__wrapper(p0,p1) {
 p0 = p0|0;p1 = p1|0; _emscripten_glHint(p0|0,p1|0);
}
function _emscripten_glDrawBuffers__wrapper(p0,p1) {
 p0 = p0|0;p1 = p1|0; _emscripten_glDrawBuffers(p0|0,p1|0);
}
function b5(p0) {
 p0 = p0|0; nullFunc_ii(5);return 0;
}
function _emscripten_glGetString__wrapper(p0) {
 p0 = p0|0; return _emscripten_glGetString(p0|0)|0;
}
function _emscripten_glIsTexture__wrapper(p0) {
 p0 = p0|0; return _emscripten_glIsTexture(p0|0)|0;
}
function _emscripten_glIsBuffer__wrapper(p0) {
 p0 = p0|0; return _emscripten_glIsBuffer(p0|0)|0;
}
function _emscripten_glIsRenderbuffer__wrapper(p0) {
 p0 = p0|0; return _emscripten_glIsRenderbuffer(p0|0)|0;
}
function _emscripten_glCreateShader__wrapper(p0) {
 p0 = p0|0; return _emscripten_glCreateShader(p0|0)|0;
}
function _emscripten_glIsShader__wrapper(p0) {
 p0 = p0|0; return _emscripten_glIsShader(p0|0)|0;
}
function _emscripten_glIsProgram__wrapper(p0) {
 p0 = p0|0; return _emscripten_glIsProgram(p0|0)|0;
}
function _emscripten_glIsFramebuffer__wrapper(p0) {
 p0 = p0|0; return _emscripten_glIsFramebuffer(p0|0)|0;
}
function _emscripten_glCheckFramebufferStatus__wrapper(p0) {
 p0 = p0|0; return _emscripten_glCheckFramebufferStatus(p0|0)|0;
}
function _emscripten_glIsEnabled__wrapper(p0) {
 p0 = p0|0; return _emscripten_glIsEnabled(p0|0)|0;
}
function b6(p0,p1,p2,p3) {
 p0 = p0|0;p1 = +p1;p2 = +p2;p3 = +p3; nullFunc_viddd(6);
}
function _emscripten_glUniform3f__wrapper(p0,p1,p2,p3) {
 p0 = p0|0;p1 = +p1;p2 = +p2;p3 = +p3; _emscripten_glUniform3f(p0|0,+p1,+p2,+p3);
}
function _emscripten_glVertexAttrib3f__wrapper(p0,p1,p2,p3) {
 p0 = p0|0;p1 = +p1;p2 = +p2;p3 = +p3; _emscripten_glVertexAttrib3f(p0|0,+p1,+p2,+p3);
}
function b7(p0,p1,p2) {
 p0 = p0|0;p1 = +p1;p2 = +p2; nullFunc_vidd(7);
}
function _emscripten_glUniform2f__wrapper(p0,p1,p2) {
 p0 = p0|0;p1 = +p1;p2 = +p2; _emscripten_glUniform2f(p0|0,+p1,+p2);
}
function _emscripten_glVertexAttrib2f__wrapper(p0,p1,p2) {
 p0 = p0|0;p1 = +p1;p2 = +p2; _emscripten_glVertexAttrib2f(p0|0,+p1,+p2);
}
function b8(p0,p1,p2) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0; nullFunc_iiii(8);return 0;
}
function b9(p0,p1,p2,p3,p4,p5,p6,p7) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0; nullFunc_viiiiiiii(9);
}
function _emscripten_glCompressedTexImage2D__wrapper(p0,p1,p2,p3,p4,p5,p6,p7) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0; _emscripten_glCompressedTexImage2D(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0,p7|0);
}
function _emscripten_glCopyTexImage2D__wrapper(p0,p1,p2,p3,p4,p5,p6,p7) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0; _emscripten_glCopyTexImage2D(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0,p7|0);
}
function _emscripten_glCopyTexSubImage2D__wrapper(p0,p1,p2,p3,p4,p5,p6,p7) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0; _emscripten_glCopyTexSubImage2D(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0,p7|0);
}
function b10(p0,p1,p2,p3,p4,p5) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0; nullFunc_viiiiii(10);
}
function _emscripten_glDrawRangeElements__wrapper(p0,p1,p2,p3,p4,p5) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0; _emscripten_glDrawRangeElements(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0);
}
function _emscripten_glVertexAttribPointer__wrapper(p0,p1,p2,p3,p4,p5) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0; _emscripten_glVertexAttribPointer(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0);
}
function b11(p0,p1,p2) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0; nullFunc_viii(11);
}
function _emscripten_glGetTexParameterfv__wrapper(p0,p1,p2) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetTexParameterfv(p0|0,p1|0,p2|0);
}
function _emscripten_glGetTexParameteriv__wrapper(p0,p1,p2) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetTexParameteriv(p0|0,p1|0,p2|0);
}
function _emscripten_glTexParameterfv__wrapper(p0,p1,p2) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glTexParameterfv(p0|0,p1|0,p2|0);
}
function _emscripten_glTexParameteriv__wrapper(p0,p1,p2) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glTexParameteriv(p0|0,p1|0,p2|0);
}
function _emscripten_glGetBufferParameteriv__wrapper(p0,p1,p2) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetBufferParameteriv(p0|0,p1|0,p2|0);
}
function _emscripten_glGetRenderbufferParameteriv__wrapper(p0,p1,p2) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetRenderbufferParameteriv(p0|0,p1|0,p2|0);
}
function _emscripten_glGetUniformfv__wrapper(p0,p1,p2) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetUniformfv(p0|0,p1|0,p2|0);
}
function _emscripten_glGetUniformiv__wrapper(p0,p1,p2) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetUniformiv(p0|0,p1|0,p2|0);
}
function _emscripten_glGetVertexAttribfv__wrapper(p0,p1,p2) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetVertexAttribfv(p0|0,p1|0,p2|0);
}
function _emscripten_glGetVertexAttribiv__wrapper(p0,p1,p2) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetVertexAttribiv(p0|0,p1|0,p2|0);
}
function _emscripten_glGetVertexAttribPointerv__wrapper(p0,p1,p2) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetVertexAttribPointerv(p0|0,p1|0,p2|0);
}
function _emscripten_glUniform2i__wrapper(p0,p1,p2) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform2i(p0|0,p1|0,p2|0);
}
function _emscripten_glUniform1iv__wrapper(p0,p1,p2) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform1iv(p0|0,p1|0,p2|0);
}
function _emscripten_glUniform2iv__wrapper(p0,p1,p2) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform2iv(p0|0,p1|0,p2|0);
}
function _emscripten_glUniform3iv__wrapper(p0,p1,p2) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform3iv(p0|0,p1|0,p2|0);
}
function _emscripten_glUniform4iv__wrapper(p0,p1,p2) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform4iv(p0|0,p1|0,p2|0);
}
function _emscripten_glUniform1fv__wrapper(p0,p1,p2) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform1fv(p0|0,p1|0,p2|0);
}
function _emscripten_glUniform2fv__wrapper(p0,p1,p2) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform2fv(p0|0,p1|0,p2|0);
}
function _emscripten_glUniform3fv__wrapper(p0,p1,p2) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform3fv(p0|0,p1|0,p2|0);
}
function _emscripten_glUniform4fv__wrapper(p0,p1,p2) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform4fv(p0|0,p1|0,p2|0);
}
function _emscripten_glGetShaderiv__wrapper(p0,p1,p2) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetShaderiv(p0|0,p1|0,p2|0);
}
function _emscripten_glGetProgramiv__wrapper(p0,p1,p2) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetProgramiv(p0|0,p1|0,p2|0);
}
function _emscripten_glBindAttribLocation__wrapper(p0,p1,p2) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glBindAttribLocation(p0|0,p1|0,p2|0);
}
function _emscripten_glGetObjectParameterivARB__wrapper(p0,p1,p2) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetObjectParameterivARB(p0|0,p1|0,p2|0);
}
function _emscripten_glNormalPointer__wrapper(p0,p1,p2) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glNormalPointer(p0|0,p1|0,p2|0);
}
function _emscripten_glDrawArrays__wrapper(p0,p1,p2) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glDrawArrays(p0|0,p1|0,p2|0);
}
function _emscripten_glTexParameteri__wrapper(p0,p1,p2) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glTexParameteri(p0|0,p1|0,p2|0);
}
function _emscripten_glStencilFunc__wrapper(p0,p1,p2) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glStencilFunc(p0|0,p1|0,p2|0);
}
function _emscripten_glStencilOp__wrapper(p0,p1,p2) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glStencilOp(p0|0,p1|0,p2|0);
}
function b12(p0,p1,p2,p3,p4) {
 p0 = p0|0;p1 = +p1;p2 = +p2;p3 = +p3;p4 = +p4; nullFunc_vidddd(12);
}
function _emscripten_glUniform4f__wrapper(p0,p1,p2,p3,p4) {
 p0 = p0|0;p1 = +p1;p2 = +p2;p3 = +p3;p4 = +p4; _emscripten_glUniform4f(p0|0,+p1,+p2,+p3,+p4);
}
function _emscripten_glVertexAttrib4f__wrapper(p0,p1,p2,p3,p4) {
 p0 = p0|0;p1 = +p1;p2 = +p2;p3 = +p3;p4 = +p4; _emscripten_glVertexAttrib4f(p0|0,+p1,+p2,+p3,+p4);
}
function b13(p0,p1) {
 p0 = +p0;p1 = p1|0; nullFunc_vdi(13);
}
function _emscripten_glSampleCoverage__wrapper(p0,p1) {
 p0 = +p0;p1 = p1|0; _emscripten_glSampleCoverage(+p0,p1|0);
}
function b14(p0,p1,p2,p3,p4,p5,p6) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0; nullFunc_viiiiiii(14);
}
function _emscripten_glReadPixels__wrapper(p0,p1,p2,p3,p4,p5,p6) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0; _emscripten_glReadPixels(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0);
}
function _emscripten_glGetActiveUniform__wrapper(p0,p1,p2,p3,p4,p5,p6) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0; _emscripten_glGetActiveUniform(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0);
}
function _emscripten_glGetActiveAttrib__wrapper(p0,p1,p2,p3,p4,p5,p6) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0; _emscripten_glGetActiveAttrib(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0);
}
function b15(p0,p1,p2,p3,p4,p5,p6,p7,p8) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0;p8 = p8|0; nullFunc_viiiiiiiii(15);
}
function _emscripten_glCompressedTexSubImage2D__wrapper(p0,p1,p2,p3,p4,p5,p6,p7,p8) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0;p8 = p8|0; _emscripten_glCompressedTexSubImage2D(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0,p7|0,p8|0);
}
function _emscripten_glTexImage2D__wrapper(p0,p1,p2,p3,p4,p5,p6,p7,p8) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0;p8 = p8|0; _emscripten_glTexImage2D(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0,p7|0,p8|0);
}
function _emscripten_glTexSubImage2D__wrapper(p0,p1,p2,p3,p4,p5,p6,p7,p8) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0;p8 = p8|0; _emscripten_glTexSubImage2D(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0,p7|0,p8|0);
}
function b16(p0,p1) {
 p0 = p0|0;p1 = p1|0; nullFunc_iii(16);return 0;
}
function _emscripten_glGetUniformLocation__wrapper(p0,p1) {
 p0 = p0|0;p1 = p1|0; return _emscripten_glGetUniformLocation(p0|0,p1|0)|0;
}
function _emscripten_glGetAttribLocation__wrapper(p0,p1) {
 p0 = p0|0;p1 = p1|0; return _emscripten_glGetAttribLocation(p0|0,p1|0)|0;
}
function b17() {
 ; nullFunc_i(17);return 0;
}
function _emscripten_glCreateProgram__wrapper() {
 ; return _emscripten_glCreateProgram()|0;
}
function _emscripten_glGetError__wrapper() {
 ; return _emscripten_glGetError()|0;
}
function b18(p0,p1,p2,p3,p4,p5) {
 p0 = +p0;p1 = +p1;p2 = +p2;p3 = +p3;p4 = +p4;p5 = +p5; nullFunc_vdddddd(18);
}
function _emscripten_glFrustum__wrapper(p0,p1,p2,p3,p4,p5) {
 p0 = +p0;p1 = +p1;p2 = +p2;p3 = +p3;p4 = +p4;p5 = +p5; _emscripten_glFrustum(+p0,+p1,+p2,+p3,+p4,+p5);
}
function b19(p0,p1,p2,p3) {
 p0 = +p0;p1 = +p1;p2 = +p2;p3 = +p3; nullFunc_vdddd(19);
}
function _emscripten_glRotatef__wrapper(p0,p1,p2,p3) {
 p0 = +p0;p1 = +p1;p2 = +p2;p3 = +p3; _emscripten_glRotatef(+p0,+p1,+p2,+p3);
}
function _emscripten_glClearColor__wrapper(p0,p1,p2,p3) {
 p0 = +p0;p1 = +p1;p2 = +p2;p3 = +p3; _emscripten_glClearColor(+p0,+p1,+p2,+p3);
}
function _emscripten_glBlendColor__wrapper(p0,p1,p2,p3) {
 p0 = +p0;p1 = +p1;p2 = +p2;p3 = +p3; _emscripten_glBlendColor(+p0,+p1,+p2,+p3);
}
function b20(p0,p1) {
 p0 = +p0;p1 = +p1; nullFunc_vdd(20);
}
function _emscripten_glDepthRange__wrapper(p0,p1) {
 p0 = +p0;p1 = +p1; _emscripten_glDepthRange(+p0,+p1);
}
function _emscripten_glDepthRangef__wrapper(p0,p1) {
 p0 = +p0;p1 = +p1; _emscripten_glDepthRangef(+p0,+p1);
}
function _emscripten_glPolygonOffset__wrapper(p0,p1) {
 p0 = +p0;p1 = +p1; _emscripten_glPolygonOffset(+p0,+p1);
}
function b21() {
 ; nullFunc_v(21);
}
function _emscripten_glLoadIdentity__wrapper() {
 ; _emscripten_glLoadIdentity();
}
function _emscripten_glReleaseShaderCompiler__wrapper() {
 ; _emscripten_glReleaseShaderCompiler();
}
function _emscripten_glFinish__wrapper() {
 ; _emscripten_glFinish();
}
function _emscripten_glFlush__wrapper() {
 ; _emscripten_glFlush();
}
function b22(p0,p1,p2) {
 p0 = p0|0;p1 = p1|0;p2 = +p2; nullFunc_viid(22);
}
function _emscripten_glTexParameterf__wrapper(p0,p1,p2) {
 p0 = p0|0;p1 = p1|0;p2 = +p2; _emscripten_glTexParameterf(p0|0,p1|0,+p2);
}
function b23(p0,p1,p2,p3) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; nullFunc_viiii(23);
}
function _emscripten_glBufferData__wrapper(p0,p1,p2,p3) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glBufferData(p0|0,p1|0,p2|0,p3|0);
}
function _emscripten_glBufferSubData__wrapper(p0,p1,p2,p3) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glBufferSubData(p0|0,p1|0,p2|0,p3|0);
}
function _emscripten_glUniform3i__wrapper(p0,p1,p2,p3) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glUniform3i(p0|0,p1|0,p2|0,p3|0);
}
function _emscripten_glUniformMatrix2fv__wrapper(p0,p1,p2,p3) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glUniformMatrix2fv(p0|0,p1|0,p2|0,p3|0);
}
function _emscripten_glUniformMatrix3fv__wrapper(p0,p1,p2,p3) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glUniformMatrix3fv(p0|0,p1|0,p2|0,p3|0);
}
function _emscripten_glUniformMatrix4fv__wrapper(p0,p1,p2,p3) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glUniformMatrix4fv(p0|0,p1|0,p2|0,p3|0);
}
function _emscripten_glGetAttachedShaders__wrapper(p0,p1,p2,p3) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glGetAttachedShaders(p0|0,p1|0,p2|0,p3|0);
}
function _emscripten_glShaderSource__wrapper(p0,p1,p2,p3) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glShaderSource(p0|0,p1|0,p2|0,p3|0);
}
function _emscripten_glGetShaderSource__wrapper(p0,p1,p2,p3) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glGetShaderSource(p0|0,p1|0,p2|0,p3|0);
}
function _emscripten_glGetShaderInfoLog__wrapper(p0,p1,p2,p3) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glGetShaderInfoLog(p0|0,p1|0,p2|0,p3|0);
}
function _emscripten_glGetShaderPrecisionFormat__wrapper(p0,p1,p2,p3) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glGetShaderPrecisionFormat(p0|0,p1|0,p2|0,p3|0);
}
function _emscripten_glGetProgramInfoLog__wrapper(p0,p1,p2,p3) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glGetProgramInfoLog(p0|0,p1|0,p2|0,p3|0);
}
function _emscripten_glFramebufferRenderbuffer__wrapper(p0,p1,p2,p3) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glFramebufferRenderbuffer(p0|0,p1|0,p2|0,p3|0);
}
function _emscripten_glGetFramebufferAttachmentParameteriv__wrapper(p0,p1,p2,p3) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glGetFramebufferAttachmentParameteriv(p0|0,p1|0,p2|0,p3|0);
}
function _emscripten_glGetInfoLogARB__wrapper(p0,p1,p2,p3) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glGetInfoLogARB(p0|0,p1|0,p2|0,p3|0);
}
function _emscripten_glVertexPointer__wrapper(p0,p1,p2,p3) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glVertexPointer(p0|0,p1|0,p2|0,p3|0);
}
function _emscripten_glTexCoordPointer__wrapper(p0,p1,p2,p3) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glTexCoordPointer(p0|0,p1|0,p2|0,p3|0);
}
function _emscripten_glColorPointer__wrapper(p0,p1,p2,p3) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glColorPointer(p0|0,p1|0,p2|0,p3|0);
}
function _emscripten_glDrawElements__wrapper(p0,p1,p2,p3) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glDrawElements(p0|0,p1|0,p2|0,p3|0);
}
function _emscripten_glDrawArraysInstanced__wrapper(p0,p1,p2,p3) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glDrawArraysInstanced(p0|0,p1|0,p2|0,p3|0);
}
function _emscripten_glViewport__wrapper(p0,p1,p2,p3) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glViewport(p0|0,p1|0,p2|0,p3|0);
}
function _emscripten_glScissor__wrapper(p0,p1,p2,p3) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glScissor(p0|0,p1|0,p2|0,p3|0);
}
function _emscripten_glColorMask__wrapper(p0,p1,p2,p3) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glColorMask(p0|0,p1|0,p2|0,p3|0);
}
function _emscripten_glRenderbufferStorage__wrapper(p0,p1,p2,p3) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glRenderbufferStorage(p0|0,p1|0,p2|0,p3|0);
}
function _emscripten_glBlendFuncSeparate__wrapper(p0,p1,p2,p3) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glBlendFuncSeparate(p0|0,p1|0,p2|0,p3|0);
}
function _emscripten_glStencilFuncSeparate__wrapper(p0,p1,p2,p3) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glStencilFuncSeparate(p0|0,p1|0,p2|0,p3|0);
}
function _emscripten_glStencilOpSeparate__wrapper(p0,p1,p2,p3) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glStencilOpSeparate(p0|0,p1|0,p2|0,p3|0);
}

// EMSCRIPTEN_END_FUNCS
var FUNCTION_TABLE_viiiii = [b0,_KeyCallback,_emscripten_glUniform4i__wrapper,_emscripten_glFramebufferTexture2D__wrapper,_emscripten_glShaderBinary__wrapper,_emscripten_glDrawElementsInstanced__wrapper,b0,b0];
var FUNCTION_TABLE_vd = [b1,_emscripten_glClearDepth__wrapper,_emscripten_glClearDepthf__wrapper,_emscripten_glLineWidth__wrapper];
var FUNCTION_TABLE_vid = [b2,_emscripten_glUniform1f__wrapper,_emscripten_glVertexAttrib1f__wrapper,b2];
var FUNCTION_TABLE_vi = [b3,_emscripten_glDeleteShader__wrapper,_emscripten_glCompileShader__wrapper,_emscripten_glDeleteProgram__wrapper,_emscripten_glLinkProgram__wrapper,_emscripten_glUseProgram__wrapper,_emscripten_glValidateProgram__wrapper,_emscripten_glDeleteObjectARB__wrapper,_emscripten_glEnableClientState__wrapper,_emscripten_glClientActiveTexture__wrapper,_emscripten_glBindVertexArray__wrapper,_emscripten_glMatrixMode__wrapper,_emscripten_glLoadMatrixf__wrapper,_emscripten_glEnableVertexAttribArray__wrapper,_emscripten_glDisableVertexAttribArray__wrapper,_emscripten_glDepthFunc__wrapper,_emscripten_glEnable__wrapper,_emscripten_glDisable__wrapper,_emscripten_glFrontFace__wrapper,_emscripten_glCullFace__wrapper,_emscripten_glClear__wrapper,_emscripten_glClearStencil__wrapper,_emscripten_glDepthMask__wrapper,_emscripten_glStencilMask__wrapper,_emscripten_glGenerateMipmap__wrapper,_emscripten_glActiveTexture__wrapper,_emscripten_glBlendEquation__wrapper,b3,b3
,b3,b3,b3];
var FUNCTION_TABLE_vii = [b4,_stbi__stdio_skip,_ErrorCallback,_CursorEnterCallback,_CharCallback,_WindowIconifyCallback,_emscripten_glPixelStorei__wrapper,_emscripten_glGetIntegerv__wrapper,_emscripten_glGetFloatv__wrapper,_emscripten_glGetBooleanv__wrapper,_emscripten_glGenTextures__wrapper,_emscripten_glDeleteTextures__wrapper,_emscripten_glBindTexture__wrapper,_emscripten_glGenBuffers__wrapper,_emscripten_glDeleteBuffers__wrapper,_emscripten_glGenRenderbuffers__wrapper,_emscripten_glDeleteRenderbuffers__wrapper,_emscripten_glBindRenderbuffer__wrapper,_emscripten_glUniform1i__wrapper,_emscripten_glBindBuffer__wrapper,_emscripten_glVertexAttrib1fv__wrapper,_emscripten_glVertexAttrib2fv__wrapper,_emscripten_glVertexAttrib3fv__wrapper,_emscripten_glVertexAttrib4fv__wrapper,_emscripten_glAttachShader__wrapper,_emscripten_glDetachShader__wrapper,_emscripten_glBindFramebuffer__wrapper,_emscripten_glGenFramebuffers__wrapper,_emscripten_glDeleteFramebuffers__wrapper,_emscripten_glBindProgramARB__wrapper,_emscripten_glGetPointerv__wrapper,_emscripten_glGenVertexArrays__wrapper,_emscripten_glDeleteVertexArrays__wrapper,_emscripten_glVertexAttribDivisor__wrapper,_emscripten_glBlendFunc__wrapper,_emscripten_glBlendEquationSeparate__wrapper,_emscripten_glStencilMaskSeparate__wrapper,_emscripten_glHint__wrapper,_emscripten_glDrawBuffers__wrapper,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4
,b4,b4,b4,b4,b4];
var FUNCTION_TABLE_ii = [b5,_stbi__stdio_eof,___stdio_close,_emscripten_glGetString__wrapper,_emscripten_glIsTexture__wrapper,_emscripten_glIsBuffer__wrapper,_emscripten_glIsRenderbuffer__wrapper,_emscripten_glCreateShader__wrapper,_emscripten_glIsShader__wrapper,_emscripten_glIsProgram__wrapper,_emscripten_glIsFramebuffer__wrapper,_emscripten_glCheckFramebufferStatus__wrapper,_emscripten_glIsEnabled__wrapper,b5,b5,b5];
var FUNCTION_TABLE_viddd = [b6,_emscripten_glUniform3f__wrapper,_emscripten_glVertexAttrib3f__wrapper,b6];
var FUNCTION_TABLE_vidd = [b7,_MouseCursorPosCallback,_ScrollCallback,_emscripten_glUniform2f__wrapper,_emscripten_glVertexAttrib2f__wrapper,b7,b7,b7];
var FUNCTION_TABLE_iiii = [b8,_stbi__stdio_read,___stdout_write,___stdio_seek,_EmscriptenFullscreenChangeCallback,_EmscriptenKeyboardCallback,_EmscriptenMouseCallback,_EmscriptenTouchCallback,_EmscriptenGamepadCallback,___stdio_write,___stdio_read,_do_read,b8,b8,b8,b8];
var FUNCTION_TABLE_viiiiiiii = [b9,_emscripten_glCompressedTexImage2D__wrapper,_emscripten_glCopyTexImage2D__wrapper,_emscripten_glCopyTexSubImage2D__wrapper];
var FUNCTION_TABLE_viiiiii = [b10,_emscripten_glDrawRangeElements__wrapper,_emscripten_glVertexAttribPointer__wrapper,b10];
var FUNCTION_TABLE_viii = [b11,_WindowSizeCallback,_emscripten_glGetTexParameterfv__wrapper,_emscripten_glGetTexParameteriv__wrapper,_emscripten_glTexParameterfv__wrapper,_emscripten_glTexParameteriv__wrapper,_emscripten_glGetBufferParameteriv__wrapper,_emscripten_glGetRenderbufferParameteriv__wrapper,_emscripten_glGetUniformfv__wrapper,_emscripten_glGetUniformiv__wrapper,_emscripten_glGetVertexAttribfv__wrapper,_emscripten_glGetVertexAttribiv__wrapper,_emscripten_glGetVertexAttribPointerv__wrapper,_emscripten_glUniform2i__wrapper,_emscripten_glUniform1iv__wrapper,_emscripten_glUniform2iv__wrapper,_emscripten_glUniform3iv__wrapper,_emscripten_glUniform4iv__wrapper,_emscripten_glUniform1fv__wrapper,_emscripten_glUniform2fv__wrapper,_emscripten_glUniform3fv__wrapper,_emscripten_glUniform4fv__wrapper,_emscripten_glGetShaderiv__wrapper,_emscripten_glGetProgramiv__wrapper,_emscripten_glBindAttribLocation__wrapper,_emscripten_glGetObjectParameterivARB__wrapper,_emscripten_glNormalPointer__wrapper,_emscripten_glDrawArrays__wrapper,_emscripten_glTexParameteri__wrapper,_emscripten_glStencilFunc__wrapper,_emscripten_glStencilOp__wrapper,b11];
var FUNCTION_TABLE_vidddd = [b12,_emscripten_glUniform4f__wrapper,_emscripten_glVertexAttrib4f__wrapper,b12];
var FUNCTION_TABLE_vdi = [b13,_emscripten_glSampleCoverage__wrapper];
var FUNCTION_TABLE_viiiiiii = [b14,_emscripten_glReadPixels__wrapper,_emscripten_glGetActiveUniform__wrapper,_emscripten_glGetActiveAttrib__wrapper];
var FUNCTION_TABLE_viiiiiiiii = [b15,_emscripten_glCompressedTexSubImage2D__wrapper,_emscripten_glTexImage2D__wrapper,_emscripten_glTexSubImage2D__wrapper];
var FUNCTION_TABLE_iii = [b16,_emscripten_glGetUniformLocation__wrapper,_emscripten_glGetAttribLocation__wrapper,b16];
var FUNCTION_TABLE_i = [b17,_emscripten_glCreateProgram__wrapper,_emscripten_glGetError__wrapper,b17];
var FUNCTION_TABLE_vdddddd = [b18,_emscripten_glFrustum__wrapper];
var FUNCTION_TABLE_vdddd = [b19,_emscripten_glRotatef__wrapper,_emscripten_glClearColor__wrapper,_emscripten_glBlendColor__wrapper];
var FUNCTION_TABLE_vdd = [b20,_emscripten_glDepthRange__wrapper,_emscripten_glDepthRangef__wrapper,_emscripten_glPolygonOffset__wrapper];
var FUNCTION_TABLE_v = [b21,_UpdateDrawFrame,_emscripten_glLoadIdentity__wrapper,_emscripten_glReleaseShaderCompiler__wrapper,_emscripten_glFinish__wrapper,_emscripten_glFlush__wrapper,b21,b21];
var FUNCTION_TABLE_viid = [b22,_emscripten_glTexParameterf__wrapper];
var FUNCTION_TABLE_viiii = [b23,_MouseButtonCallback,_emscripten_glBufferData__wrapper,_emscripten_glBufferSubData__wrapper,_emscripten_glUniform3i__wrapper,_emscripten_glUniformMatrix2fv__wrapper,_emscripten_glUniformMatrix3fv__wrapper,_emscripten_glUniformMatrix4fv__wrapper,_emscripten_glGetAttachedShaders__wrapper,_emscripten_glShaderSource__wrapper,_emscripten_glGetShaderSource__wrapper,_emscripten_glGetShaderInfoLog__wrapper,_emscripten_glGetShaderPrecisionFormat__wrapper,_emscripten_glGetProgramInfoLog__wrapper,_emscripten_glFramebufferRenderbuffer__wrapper,_emscripten_glGetFramebufferAttachmentParameteriv__wrapper,_emscripten_glGetInfoLogARB__wrapper,_emscripten_glVertexPointer__wrapper,_emscripten_glTexCoordPointer__wrapper,_emscripten_glColorPointer__wrapper,_emscripten_glDrawElements__wrapper,_emscripten_glDrawArraysInstanced__wrapper,_emscripten_glViewport__wrapper,_emscripten_glScissor__wrapper,_emscripten_glColorMask__wrapper,_emscripten_glRenderbufferStorage__wrapper,_emscripten_glBlendFuncSeparate__wrapper,_emscripten_glStencilFuncSeparate__wrapper,_emscripten_glStencilOpSeparate__wrapper,b23,b23,b23];

  return { _roundf: _roundf, _main: _main, _llvm_cttz_i32: _llvm_cttz_i32, _bitshift64Lshr: _bitshift64Lshr, _bitshift64Shl: _bitshift64Shl, _fflush: _fflush, _memset: _memset, _sbrk: _sbrk, _memcpy: _memcpy, _llvm_bswap_i32: _llvm_bswap_i32, ___muldi3: ___muldi3, ___uremdi3: ___uremdi3, _i64Subtract: _i64Subtract, ___udivmoddi4: ___udivmoddi4, _i64Add: _i64Add, _emscripten_get_global_libc: _emscripten_get_global_libc, _emscripten_GetProcAddress: _emscripten_GetProcAddress, ___udivdi3: ___udivdi3, ___errno_location: ___errno_location, ___muldsi3: ___muldsi3, _free: _free, _memmove: _memmove, _strstr: _strstr, _malloc: _malloc, runPostSets: runPostSets, stackAlloc: stackAlloc, stackSave: stackSave, stackRestore: stackRestore, establishStackSpace: establishStackSpace, setTempRet0: setTempRet0, getTempRet0: getTempRet0, setThrew: setThrew, stackAlloc: stackAlloc, stackSave: stackSave, stackRestore: stackRestore, establishStackSpace: establishStackSpace, setThrew: setThrew, setTempRet0: setTempRet0, getTempRet0: getTempRet0, dynCall_viiiii: dynCall_viiiii, dynCall_vd: dynCall_vd, dynCall_vid: dynCall_vid, dynCall_vi: dynCall_vi, dynCall_vii: dynCall_vii, dynCall_ii: dynCall_ii, dynCall_viddd: dynCall_viddd, dynCall_vidd: dynCall_vidd, dynCall_iiii: dynCall_iiii, dynCall_viiiiiiii: dynCall_viiiiiiii, dynCall_viiiiii: dynCall_viiiiii, dynCall_viii: dynCall_viii, dynCall_vidddd: dynCall_vidddd, dynCall_vdi: dynCall_vdi, dynCall_viiiiiii: dynCall_viiiiiii, dynCall_viiiiiiiii: dynCall_viiiiiiiii, dynCall_iii: dynCall_iii, dynCall_i: dynCall_i, dynCall_vdddddd: dynCall_vdddddd, dynCall_vdddd: dynCall_vdddd, dynCall_vdd: dynCall_vdd, dynCall_v: dynCall_v, dynCall_viid: dynCall_viid, dynCall_viiii: dynCall_viiii };
})
// EMSCRIPTEN_END_ASM
(Module.asmGlobalArg, Module.asmLibraryArg, buffer);

var real__roundf = asm["_roundf"]; asm["_roundf"] = function() {
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
return real__roundf.apply(null, arguments);
};

var real__main = asm["_main"]; asm["_main"] = function() {
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
return real__main.apply(null, arguments);
};

var real_stackSave = asm["stackSave"]; asm["stackSave"] = function() {
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
return real_stackSave.apply(null, arguments);
};

var real_getTempRet0 = asm["getTempRet0"]; asm["getTempRet0"] = function() {
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
return real_getTempRet0.apply(null, arguments);
};

var real_setThrew = asm["setThrew"]; asm["setThrew"] = function() {
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
return real_setThrew.apply(null, arguments);
};

var real__bitshift64Lshr = asm["_bitshift64Lshr"]; asm["_bitshift64Lshr"] = function() {
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
return real__bitshift64Lshr.apply(null, arguments);
};

var real__bitshift64Shl = asm["_bitshift64Shl"]; asm["_bitshift64Shl"] = function() {
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
return real__bitshift64Shl.apply(null, arguments);
};

var real__fflush = asm["_fflush"]; asm["_fflush"] = function() {
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
return real__fflush.apply(null, arguments);
};

var real__llvm_cttz_i32 = asm["_llvm_cttz_i32"]; asm["_llvm_cttz_i32"] = function() {
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
return real__llvm_cttz_i32.apply(null, arguments);
};

var real__sbrk = asm["_sbrk"]; asm["_sbrk"] = function() {
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
return real__sbrk.apply(null, arguments);
};

var real__llvm_bswap_i32 = asm["_llvm_bswap_i32"]; asm["_llvm_bswap_i32"] = function() {
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
return real__llvm_bswap_i32.apply(null, arguments);
};

var real____muldi3 = asm["___muldi3"]; asm["___muldi3"] = function() {
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
return real____muldi3.apply(null, arguments);
};

var real____uremdi3 = asm["___uremdi3"]; asm["___uremdi3"] = function() {
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
return real____uremdi3.apply(null, arguments);
};

var real_stackAlloc = asm["stackAlloc"]; asm["stackAlloc"] = function() {
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
return real_stackAlloc.apply(null, arguments);
};

var real__i64Subtract = asm["_i64Subtract"]; asm["_i64Subtract"] = function() {
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
return real__i64Subtract.apply(null, arguments);
};

var real____udivmoddi4 = asm["___udivmoddi4"]; asm["___udivmoddi4"] = function() {
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
return real____udivmoddi4.apply(null, arguments);
};

var real_setTempRet0 = asm["setTempRet0"]; asm["setTempRet0"] = function() {
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
return real_setTempRet0.apply(null, arguments);
};

var real__i64Add = asm["_i64Add"]; asm["_i64Add"] = function() {
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
return real__i64Add.apply(null, arguments);
};

var real__emscripten_get_global_libc = asm["_emscripten_get_global_libc"]; asm["_emscripten_get_global_libc"] = function() {
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
return real__emscripten_get_global_libc.apply(null, arguments);
};

var real__emscripten_GetProcAddress = asm["_emscripten_GetProcAddress"]; asm["_emscripten_GetProcAddress"] = function() {
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
return real__emscripten_GetProcAddress.apply(null, arguments);
};

var real____udivdi3 = asm["___udivdi3"]; asm["___udivdi3"] = function() {
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
return real____udivdi3.apply(null, arguments);
};

var real____errno_location = asm["___errno_location"]; asm["___errno_location"] = function() {
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
return real____errno_location.apply(null, arguments);
};

var real____muldsi3 = asm["___muldsi3"]; asm["___muldsi3"] = function() {
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
return real____muldsi3.apply(null, arguments);
};

var real__free = asm["_free"]; asm["_free"] = function() {
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
return real__free.apply(null, arguments);
};

var real_establishStackSpace = asm["establishStackSpace"]; asm["establishStackSpace"] = function() {
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
return real_establishStackSpace.apply(null, arguments);
};

var real__memmove = asm["_memmove"]; asm["_memmove"] = function() {
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
return real__memmove.apply(null, arguments);
};

var real__strstr = asm["_strstr"]; asm["_strstr"] = function() {
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
return real__strstr.apply(null, arguments);
};

var real_stackRestore = asm["stackRestore"]; asm["stackRestore"] = function() {
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
return real_stackRestore.apply(null, arguments);
};

var real__malloc = asm["_malloc"]; asm["_malloc"] = function() {
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
return real__malloc.apply(null, arguments);
};
var _roundf = Module["_roundf"] = asm["_roundf"];
var _main = Module["_main"] = asm["_main"];
var stackSave = Module["stackSave"] = asm["stackSave"];
var getTempRet0 = Module["getTempRet0"] = asm["getTempRet0"];
var _memset = Module["_memset"] = asm["_memset"];
var setThrew = Module["setThrew"] = asm["setThrew"];
var _bitshift64Lshr = Module["_bitshift64Lshr"] = asm["_bitshift64Lshr"];
var _bitshift64Shl = Module["_bitshift64Shl"] = asm["_bitshift64Shl"];
var _fflush = Module["_fflush"] = asm["_fflush"];
var _llvm_cttz_i32 = Module["_llvm_cttz_i32"] = asm["_llvm_cttz_i32"];
var _sbrk = Module["_sbrk"] = asm["_sbrk"];
var _memcpy = Module["_memcpy"] = asm["_memcpy"];
var _llvm_bswap_i32 = Module["_llvm_bswap_i32"] = asm["_llvm_bswap_i32"];
var ___muldi3 = Module["___muldi3"] = asm["___muldi3"];
var ___uremdi3 = Module["___uremdi3"] = asm["___uremdi3"];
var stackAlloc = Module["stackAlloc"] = asm["stackAlloc"];
var _i64Subtract = Module["_i64Subtract"] = asm["_i64Subtract"];
var ___udivmoddi4 = Module["___udivmoddi4"] = asm["___udivmoddi4"];
var setTempRet0 = Module["setTempRet0"] = asm["setTempRet0"];
var _i64Add = Module["_i64Add"] = asm["_i64Add"];
var _emscripten_get_global_libc = Module["_emscripten_get_global_libc"] = asm["_emscripten_get_global_libc"];
var _emscripten_GetProcAddress = Module["_emscripten_GetProcAddress"] = asm["_emscripten_GetProcAddress"];
var ___udivdi3 = Module["___udivdi3"] = asm["___udivdi3"];
var ___errno_location = Module["___errno_location"] = asm["___errno_location"];
var ___muldsi3 = Module["___muldsi3"] = asm["___muldsi3"];
var _free = Module["_free"] = asm["_free"];
var runPostSets = Module["runPostSets"] = asm["runPostSets"];
var establishStackSpace = Module["establishStackSpace"] = asm["establishStackSpace"];
var _memmove = Module["_memmove"] = asm["_memmove"];
var _strstr = Module["_strstr"] = asm["_strstr"];
var stackRestore = Module["stackRestore"] = asm["stackRestore"];
var _malloc = Module["_malloc"] = asm["_malloc"];
var dynCall_viiiii = Module["dynCall_viiiii"] = asm["dynCall_viiiii"];
var dynCall_vd = Module["dynCall_vd"] = asm["dynCall_vd"];
var dynCall_vid = Module["dynCall_vid"] = asm["dynCall_vid"];
var dynCall_vi = Module["dynCall_vi"] = asm["dynCall_vi"];
var dynCall_vii = Module["dynCall_vii"] = asm["dynCall_vii"];
var dynCall_ii = Module["dynCall_ii"] = asm["dynCall_ii"];
var dynCall_viddd = Module["dynCall_viddd"] = asm["dynCall_viddd"];
var dynCall_vidd = Module["dynCall_vidd"] = asm["dynCall_vidd"];
var dynCall_iiii = Module["dynCall_iiii"] = asm["dynCall_iiii"];
var dynCall_viiiiiiii = Module["dynCall_viiiiiiii"] = asm["dynCall_viiiiiiii"];
var dynCall_viiiiii = Module["dynCall_viiiiii"] = asm["dynCall_viiiiii"];
var dynCall_viii = Module["dynCall_viii"] = asm["dynCall_viii"];
var dynCall_vidddd = Module["dynCall_vidddd"] = asm["dynCall_vidddd"];
var dynCall_vdi = Module["dynCall_vdi"] = asm["dynCall_vdi"];
var dynCall_viiiiiii = Module["dynCall_viiiiiii"] = asm["dynCall_viiiiiii"];
var dynCall_viiiiiiiii = Module["dynCall_viiiiiiiii"] = asm["dynCall_viiiiiiiii"];
var dynCall_iii = Module["dynCall_iii"] = asm["dynCall_iii"];
var dynCall_i = Module["dynCall_i"] = asm["dynCall_i"];
var dynCall_vdddddd = Module["dynCall_vdddddd"] = asm["dynCall_vdddddd"];
var dynCall_vdddd = Module["dynCall_vdddd"] = asm["dynCall_vdddd"];
var dynCall_vdd = Module["dynCall_vdd"] = asm["dynCall_vdd"];
var dynCall_v = Module["dynCall_v"] = asm["dynCall_v"];
var dynCall_viid = Module["dynCall_viid"] = asm["dynCall_viid"];
var dynCall_viiii = Module["dynCall_viiii"] = asm["dynCall_viiii"];
;

Runtime.stackAlloc = Module['stackAlloc'];
Runtime.stackSave = Module['stackSave'];
Runtime.stackRestore = Module['stackRestore'];
Runtime.establishStackSpace = Module['establishStackSpace'];

Runtime.setTempRet0 = Module['setTempRet0'];
Runtime.getTempRet0 = Module['getTempRet0'];



// === Auto-generated postamble setup entry stuff ===

Module['asm'] = asm;





function ExitStatus(status) {
  this.name = "ExitStatus";
  this.message = "Program terminated with exit(" + status + ")";
  this.status = status;
};
ExitStatus.prototype = new Error();
ExitStatus.prototype.constructor = ExitStatus;

var initialStackTop;
var preloadStartTime = null;
var calledMain = false;

dependenciesFulfilled = function runCaller() {
  // If run has never been called, and we should call run (INVOKE_RUN is true, and Module.noInitialRun is not false)
  if (!Module['calledRun']) run();
  if (!Module['calledRun']) dependenciesFulfilled = runCaller; // try this again later, after new deps are fulfilled
}

Module['callMain'] = Module.callMain = function callMain(args) {
  assert(runDependencies == 0, 'cannot call main when async dependencies remain! (listen on __ATMAIN__)');
  assert(__ATPRERUN__.length == 0, 'cannot call main when preRun functions remain to be called');

  args = args || [];

  ensureInitRuntime();

  var argc = args.length+1;
  function pad() {
    for (var i = 0; i < 4-1; i++) {
      argv.push(0);
    }
  }
  var argv = [allocate(intArrayFromString(Module['thisProgram']), 'i8', ALLOC_NORMAL) ];
  pad();
  for (var i = 0; i < argc-1; i = i + 1) {
    argv.push(allocate(intArrayFromString(args[i]), 'i8', ALLOC_NORMAL));
    pad();
  }
  argv.push(0);
  argv = allocate(argv, 'i32', ALLOC_NORMAL);


  try {

    var ret = Module['_main'](argc, argv, 0);


    // if we're not running an evented main loop, it's time to exit
    exit(ret, /* implicit = */ true);
  }
  catch(e) {
    if (e instanceof ExitStatus) {
      // exit() throws this once it's done to make sure execution
      // has been stopped completely
      return;
    } else if (e == 'SimulateInfiniteLoop') {
      // running an evented main loop, don't immediately exit
      Module['noExitRuntime'] = true;
      return;
    } else {
      var toLog = e;
      if (e && typeof e === 'object' && e.stack) {
        toLog = [e, e.stack];
      }
      Module.printErr('exception thrown: ' + toLog);
      Module['quit'](1, e);
    }
  } finally {
    calledMain = true;
  }
}




function run(args) {
  args = args || Module['arguments'];

  if (preloadStartTime === null) preloadStartTime = Date.now();

  if (runDependencies > 0) {
    Module.printErr('run() called, but dependencies remain, so not running');
    return;
  }

  writeStackCookie();

  preRun();

  if (runDependencies > 0) return; // a preRun added a dependency, run will be called later
  if (Module['calledRun']) return; // run may have just been called through dependencies being fulfilled just in this very frame

  function doRun() {
    if (Module['calledRun']) return; // run may have just been called while the async setStatus time below was happening
    Module['calledRun'] = true;

    if (ABORT) return;

    ensureInitRuntime();

    preMain();

    if (ENVIRONMENT_IS_WEB && preloadStartTime !== null) {
      Module.printErr('pre-main prep time: ' + (Date.now() - preloadStartTime) + ' ms');
    }

    if (Module['onRuntimeInitialized']) Module['onRuntimeInitialized']();

    if (Module['_main'] && shouldRunNow) Module['callMain'](args);

    postRun();
  }

  if (Module['setStatus']) {
    Module['setStatus']('Running...');
    setTimeout(function() {
      setTimeout(function() {
        Module['setStatus']('');
      }, 1);
      doRun();
    }, 1);
  } else {
    doRun();
  }
  checkStackCookie();
}
Module['run'] = Module.run = run;

function exit(status, implicit) {
  if (implicit && Module['noExitRuntime']) {
    Module.printErr('exit(' + status + ') implicitly called by end of main(), but noExitRuntime, so not exiting the runtime (you can use emscripten_force_exit, if you want to force a true shutdown)');
    return;
  }

  if (Module['noExitRuntime']) {
    Module.printErr('exit(' + status + ') called, but noExitRuntime, so halting execution but not exiting the runtime or preventing further async execution (you can use emscripten_force_exit, if you want to force a true shutdown)');
  } else {

    ABORT = true;
    EXITSTATUS = status;
    STACKTOP = initialStackTop;

    exitRuntime();

    if (Module['onExit']) Module['onExit'](status);
  }

  if (ENVIRONMENT_IS_NODE) {
    process['exit'](status);
  }
  Module['quit'](status, new ExitStatus(status));
}
Module['exit'] = Module.exit = exit;

var abortDecorators = [];

function abort(what) {
  if (what !== undefined) {
    Module.print(what);
    Module.printErr(what);
    what = JSON.stringify(what)
  } else {
    what = '';
  }

  ABORT = true;
  EXITSTATUS = 1;

  var extra = '';

  var output = 'abort(' + what + ') at ' + stackTrace() + extra;
  if (abortDecorators) {
    abortDecorators.forEach(function(decorator) {
      output = decorator(output, what);
    });
  }
  throw output;
}
Module['abort'] = Module.abort = abort;

// {{PRE_RUN_ADDITIONS}}

if (Module['preInit']) {
  if (typeof Module['preInit'] == 'function') Module['preInit'] = [Module['preInit']];
  while (Module['preInit'].length > 0) {
    Module['preInit'].pop()();
  }
}

// shouldRunNow refers to calling main(), not run().
var shouldRunNow = true;
if (Module['noInitialRun']) {
  shouldRunNow = false;
}


run();

// {{POST_RUN_ADDITIONS}}





// {{MODULE_ADDITIONS}}