models_obj_loading.js 1.5 MB

1234567891011121314151617181920212223242526272829303132333435363738394041424344454647484950515253545556575859606162636465666768697071727374757677787980818283848586878889909192939495969798991001011021031041051061071081091101111121131141151161171181191201211221231241251261271281291301311321331341351361371381391401411421431441451461471481491501511521531541551561571581591601611621631641651661671681691701711721731741751761771781791801811821831841851861871881891901911921931941951961971981992002012022032042052062072082092102112122132142152162172182192202212222232242252262272282292302312322332342352362372382392402412422432442452462472482492502512522532542552562572582592602612622632642652662672682692702712722732742752762772782792802812822832842852862872882892902912922932942952962972982993003013023033043053063073083093103113123133143153163173183193203213223233243253263273283293303313323333343353363373383393403413423433443453463473483493503513523533543553563573583593603613623633643653663673683693703713723733743753763773783793803813823833843853863873883893903913923933943953963973983994004014024034044054064074084094104114124134144154164174184194204214224234244254264274284294304314324334344354364374384394404414424434444454464474484494504514524534544554564574584594604614624634644654664674684694704714724734744754764774784794804814824834844854864874884894904914924934944954964974984995005015025035045055065075085095105115125135145155165175185195205215225235245255265275285295305315325335345355365375385395405415425435445455465475485495505515525535545555565575585595605615625635645655665675685695705715725735745755765775785795805815825835845855865875885895905915925935945955965975985996006016026036046056066076086096106116126136146156166176186196206216226236246256266276286296306316326336346356366376386396406416426436446456466476486496506516526536546556566576586596606616626636646656666676686696706716726736746756766776786796806816826836846856866876886896906916926936946956966976986997007017027037047057067077087097107117127137147157167177187197207217227237247257267277287297307317327337347357367377387397407417427437447457467477487497507517527537547557567577587597607617627637647657667677687697707717727737747757767777787797807817827837847857867877887897907917927937947957967977987998008018028038048058068078088098108118128138148158168178188198208218228238248258268278288298308318328338348358368378388398408418428438448458468478488498508518528538548558568578588598608618628638648658668678688698708718728738748758768778788798808818828838848858868878888898908918928938948958968978988999009019029039049059069079089099109119129139149159169179189199209219229239249259269279289299309319329339349359369379389399409419429439449459469479489499509519529539549559569579589599609619629639649659669679689699709719729739749759769779789799809819829839849859869879889899909919929939949959969979989991000100110021003100410051006100710081009101010111012101310141015101610171018101910201021102210231024102510261027102810291030103110321033103410351036103710381039104010411042104310441045104610471048104910501051105210531054105510561057105810591060106110621063106410651066106710681069107010711072107310741075107610771078107910801081108210831084108510861087108810891090109110921093109410951096109710981099110011011102110311041105110611071108110911101111111211131114111511161117111811191120112111221123112411251126112711281129113011311132113311341135113611371138113911401141114211431144114511461147114811491150115111521153115411551156115711581159116011611162116311641165116611671168116911701171117211731174117511761177117811791180118111821183118411851186118711881189119011911192119311941195119611971198119912001201120212031204120512061207120812091210121112121213121412151216121712181219122012211222122312241225122612271228122912301231123212331234123512361237123812391240124112421243124412451246124712481249125012511252125312541255125612571258125912601261126212631264126512661267126812691270127112721273127412751276127712781279128012811282128312841285128612871288128912901291129212931294129512961297129812991300130113021303130413051306130713081309131013111312131313141315131613171318131913201321132213231324132513261327132813291330133113321333133413351336133713381339134013411342134313441345134613471348134913501351135213531354135513561357135813591360136113621363136413651366136713681369137013711372137313741375137613771378137913801381138213831384138513861387138813891390139113921393139413951396139713981399140014011402140314041405140614071408140914101411141214131414141514161417141814191420142114221423142414251426142714281429143014311432143314341435143614371438143914401441144214431444144514461447144814491450145114521453145414551456145714581459146014611462146314641465146614671468146914701471147214731474147514761477147814791480148114821483148414851486148714881489149014911492149314941495149614971498149915001501150215031504150515061507150815091510151115121513151415151516151715181519152015211522152315241525152615271528152915301531153215331534153515361537153815391540154115421543154415451546154715481549155015511552155315541555155615571558155915601561156215631564156515661567156815691570157115721573157415751576157715781579158015811582158315841585158615871588158915901591159215931594159515961597159815991600160116021603160416051606160716081609161016111612161316141615161616171618161916201621162216231624162516261627162816291630163116321633163416351636163716381639164016411642164316441645164616471648164916501651165216531654165516561657165816591660166116621663166416651666166716681669167016711672167316741675167616771678167916801681168216831684168516861687168816891690169116921693169416951696169716981699170017011702170317041705170617071708170917101711171217131714171517161717171817191720172117221723172417251726172717281729173017311732173317341735173617371738173917401741174217431744174517461747174817491750175117521753175417551756175717581759176017611762176317641765176617671768176917701771177217731774177517761777177817791780178117821783178417851786178717881789179017911792179317941795179617971798179918001801180218031804180518061807180818091810181118121813181418151816181718181819182018211822182318241825182618271828182918301831183218331834183518361837183818391840184118421843184418451846184718481849185018511852185318541855185618571858185918601861186218631864186518661867186818691870187118721873187418751876187718781879188018811882188318841885188618871888188918901891189218931894189518961897189818991900190119021903190419051906190719081909191019111912191319141915191619171918191919201921192219231924192519261927192819291930193119321933193419351936193719381939194019411942194319441945194619471948194919501951195219531954195519561957195819591960196119621963196419651966196719681969197019711972197319741975197619771978197919801981198219831984198519861987198819891990199119921993199419951996199719981999200020012002200320042005200620072008200920102011201220132014201520162017201820192020202120222023202420252026202720282029203020312032203320342035203620372038203920402041204220432044204520462047204820492050205120522053205420552056205720582059206020612062206320642065206620672068206920702071207220732074207520762077207820792080208120822083208420852086208720882089209020912092209320942095209620972098209921002101210221032104210521062107210821092110211121122113211421152116211721182119212021212122212321242125212621272128212921302131213221332134213521362137213821392140214121422143214421452146214721482149215021512152215321542155215621572158215921602161216221632164216521662167216821692170217121722173217421752176217721782179218021812182218321842185218621872188218921902191219221932194219521962197219821992200220122022203220422052206220722082209221022112212221322142215221622172218221922202221222222232224222522262227222822292230223122322233223422352236223722382239224022412242224322442245224622472248224922502251225222532254225522562257225822592260226122622263226422652266226722682269227022712272227322742275227622772278227922802281228222832284228522862287228822892290229122922293229422952296229722982299230023012302230323042305230623072308230923102311231223132314231523162317231823192320232123222323232423252326232723282329233023312332233323342335233623372338233923402341234223432344234523462347234823492350235123522353235423552356235723582359236023612362236323642365236623672368236923702371237223732374237523762377237823792380238123822383238423852386238723882389239023912392239323942395239623972398239924002401240224032404240524062407240824092410241124122413241424152416241724182419242024212422242324242425242624272428242924302431243224332434243524362437243824392440244124422443244424452446244724482449245024512452245324542455245624572458245924602461246224632464246524662467246824692470247124722473247424752476247724782479248024812482248324842485248624872488248924902491249224932494249524962497249824992500250125022503250425052506250725082509251025112512251325142515251625172518251925202521252225232524252525262527252825292530253125322533253425352536253725382539254025412542254325442545254625472548254925502551255225532554255525562557255825592560256125622563256425652566256725682569257025712572257325742575257625772578257925802581258225832584258525862587258825892590259125922593259425952596259725982599260026012602260326042605260626072608260926102611261226132614261526162617261826192620262126222623262426252626262726282629263026312632263326342635263626372638263926402641264226432644264526462647264826492650265126522653265426552656265726582659266026612662266326642665266626672668266926702671267226732674267526762677267826792680268126822683268426852686268726882689269026912692269326942695269626972698269927002701270227032704270527062707270827092710271127122713271427152716271727182719272027212722272327242725272627272728272927302731273227332734273527362737273827392740274127422743274427452746274727482749275027512752275327542755275627572758275927602761276227632764276527662767276827692770277127722773277427752776277727782779278027812782278327842785278627872788278927902791279227932794279527962797279827992800280128022803280428052806280728082809281028112812281328142815281628172818281928202821282228232824282528262827282828292830283128322833283428352836283728382839284028412842284328442845284628472848284928502851285228532854285528562857285828592860286128622863286428652866286728682869287028712872287328742875287628772878287928802881288228832884288528862887288828892890289128922893289428952896289728982899290029012902290329042905290629072908290929102911291229132914291529162917291829192920292129222923292429252926292729282929293029312932293329342935293629372938293929402941294229432944294529462947294829492950295129522953295429552956295729582959296029612962296329642965296629672968296929702971297229732974297529762977297829792980298129822983298429852986298729882989299029912992299329942995299629972998299930003001300230033004300530063007300830093010301130123013301430153016301730183019302030213022302330243025302630273028302930303031303230333034303530363037303830393040304130423043304430453046304730483049305030513052305330543055305630573058305930603061306230633064306530663067306830693070307130723073307430753076307730783079308030813082308330843085308630873088308930903091309230933094309530963097309830993100310131023103310431053106310731083109311031113112311331143115311631173118311931203121312231233124312531263127312831293130313131323133313431353136313731383139314031413142314331443145314631473148314931503151315231533154315531563157315831593160316131623163316431653166316731683169317031713172317331743175317631773178317931803181318231833184318531863187318831893190319131923193319431953196319731983199320032013202320332043205320632073208320932103211321232133214321532163217321832193220322132223223322432253226322732283229323032313232323332343235323632373238323932403241324232433244324532463247324832493250325132523253325432553256325732583259326032613262326332643265326632673268326932703271327232733274327532763277327832793280328132823283328432853286328732883289329032913292329332943295329632973298329933003301330233033304330533063307330833093310331133123313331433153316331733183319332033213322332333243325332633273328332933303331333233333334333533363337333833393340334133423343334433453346334733483349335033513352335333543355335633573358335933603361336233633364336533663367336833693370337133723373337433753376337733783379338033813382338333843385338633873388338933903391339233933394339533963397339833993400340134023403340434053406340734083409341034113412341334143415341634173418341934203421342234233424342534263427342834293430343134323433343434353436343734383439344034413442344334443445344634473448344934503451345234533454345534563457345834593460346134623463346434653466346734683469347034713472347334743475347634773478347934803481348234833484348534863487348834893490349134923493349434953496349734983499350035013502350335043505350635073508350935103511351235133514351535163517351835193520352135223523352435253526352735283529353035313532353335343535353635373538353935403541354235433544354535463547354835493550355135523553355435553556355735583559356035613562356335643565356635673568356935703571357235733574357535763577357835793580358135823583358435853586358735883589359035913592359335943595359635973598359936003601360236033604360536063607360836093610361136123613361436153616361736183619362036213622362336243625362636273628362936303631363236333634363536363637363836393640364136423643364436453646364736483649365036513652365336543655365636573658365936603661366236633664366536663667366836693670367136723673367436753676367736783679368036813682368336843685368636873688368936903691369236933694369536963697369836993700370137023703370437053706370737083709371037113712371337143715371637173718371937203721372237233724372537263727372837293730373137323733373437353736373737383739374037413742374337443745374637473748374937503751375237533754375537563757375837593760376137623763376437653766376737683769377037713772377337743775377637773778377937803781378237833784378537863787378837893790379137923793379437953796379737983799380038013802380338043805380638073808380938103811381238133814381538163817381838193820382138223823382438253826382738283829383038313832383338343835383638373838383938403841384238433844384538463847384838493850385138523853385438553856385738583859386038613862386338643865386638673868386938703871387238733874387538763877387838793880388138823883388438853886388738883889389038913892389338943895389638973898389939003901390239033904390539063907390839093910391139123913391439153916391739183919392039213922392339243925392639273928392939303931393239333934393539363937393839393940394139423943394439453946394739483949395039513952395339543955395639573958395939603961396239633964396539663967396839693970397139723973397439753976397739783979398039813982398339843985398639873988398939903991399239933994399539963997399839994000400140024003400440054006400740084009401040114012401340144015401640174018401940204021402240234024402540264027402840294030403140324033403440354036403740384039404040414042404340444045404640474048404940504051405240534054405540564057405840594060406140624063406440654066406740684069407040714072407340744075407640774078407940804081408240834084408540864087408840894090409140924093409440954096409740984099410041014102410341044105410641074108410941104111411241134114411541164117411841194120412141224123412441254126412741284129413041314132413341344135413641374138413941404141414241434144414541464147414841494150415141524153415441554156415741584159416041614162416341644165416641674168416941704171417241734174417541764177417841794180418141824183418441854186418741884189419041914192419341944195419641974198419942004201420242034204420542064207420842094210421142124213421442154216421742184219422042214222422342244225422642274228422942304231423242334234423542364237423842394240424142424243424442454246424742484249425042514252425342544255425642574258425942604261426242634264426542664267426842694270427142724273427442754276427742784279428042814282428342844285428642874288428942904291429242934294429542964297429842994300430143024303430443054306430743084309431043114312431343144315431643174318431943204321432243234324432543264327432843294330433143324333433443354336433743384339434043414342434343444345434643474348434943504351435243534354435543564357435843594360436143624363436443654366436743684369437043714372437343744375437643774378437943804381438243834384438543864387438843894390439143924393439443954396439743984399440044014402440344044405440644074408440944104411441244134414441544164417441844194420442144224423442444254426442744284429443044314432443344344435443644374438443944404441444244434444444544464447444844494450445144524453445444554456445744584459446044614462446344644465446644674468446944704471447244734474447544764477447844794480448144824483448444854486448744884489449044914492449344944495449644974498449945004501450245034504450545064507450845094510451145124513451445154516451745184519452045214522452345244525452645274528452945304531453245334534453545364537453845394540454145424543454445454546454745484549455045514552455345544555455645574558455945604561456245634564456545664567456845694570457145724573457445754576457745784579458045814582458345844585458645874588458945904591459245934594459545964597459845994600460146024603460446054606460746084609461046114612461346144615461646174618461946204621462246234624462546264627462846294630463146324633463446354636463746384639464046414642464346444645464646474648464946504651465246534654465546564657465846594660466146624663466446654666466746684669467046714672467346744675467646774678467946804681468246834684468546864687468846894690469146924693469446954696469746984699470047014702470347044705470647074708470947104711471247134714471547164717471847194720472147224723472447254726472747284729473047314732473347344735473647374738473947404741474247434744474547464747474847494750475147524753475447554756475747584759476047614762476347644765476647674768476947704771477247734774477547764777477847794780478147824783478447854786478747884789479047914792479347944795479647974798479948004801480248034804480548064807480848094810481148124813481448154816481748184819482048214822482348244825482648274828482948304831483248334834483548364837483848394840484148424843484448454846484748484849485048514852485348544855485648574858485948604861486248634864486548664867486848694870487148724873487448754876487748784879488048814882488348844885488648874888488948904891489248934894489548964897489848994900490149024903490449054906490749084909491049114912491349144915491649174918491949204921492249234924492549264927492849294930493149324933493449354936493749384939494049414942494349444945494649474948494949504951495249534954495549564957495849594960496149624963496449654966496749684969497049714972497349744975497649774978497949804981498249834984498549864987498849894990499149924993499449954996499749984999500050015002500350045005500650075008500950105011501250135014501550165017501850195020502150225023502450255026502750285029503050315032503350345035503650375038503950405041504250435044504550465047504850495050505150525053505450555056505750585059506050615062506350645065506650675068506950705071507250735074507550765077507850795080508150825083508450855086508750885089509050915092509350945095509650975098509951005101510251035104510551065107510851095110511151125113511451155116511751185119512051215122512351245125512651275128512951305131513251335134513551365137513851395140514151425143514451455146514751485149515051515152515351545155515651575158515951605161516251635164516551665167516851695170517151725173517451755176517751785179518051815182518351845185518651875188518951905191519251935194519551965197519851995200520152025203520452055206520752085209521052115212521352145215521652175218521952205221522252235224522552265227522852295230523152325233523452355236523752385239524052415242524352445245524652475248524952505251525252535254525552565257525852595260526152625263526452655266526752685269527052715272527352745275527652775278527952805281528252835284528552865287528852895290529152925293529452955296529752985299530053015302530353045305530653075308530953105311531253135314531553165317531853195320532153225323532453255326532753285329533053315332533353345335533653375338533953405341534253435344534553465347534853495350535153525353535453555356535753585359536053615362536353645365536653675368536953705371537253735374537553765377537853795380538153825383538453855386538753885389539053915392539353945395539653975398539954005401540254035404540554065407540854095410541154125413541454155416541754185419542054215422542354245425542654275428542954305431543254335434543554365437543854395440544154425443544454455446544754485449545054515452545354545455545654575458545954605461546254635464546554665467546854695470547154725473547454755476547754785479548054815482548354845485548654875488548954905491549254935494549554965497549854995500550155025503550455055506550755085509551055115512551355145515551655175518551955205521552255235524552555265527552855295530553155325533553455355536553755385539554055415542554355445545554655475548554955505551555255535554555555565557555855595560556155625563556455655566556755685569557055715572557355745575557655775578557955805581558255835584558555865587558855895590559155925593559455955596559755985599560056015602560356045605560656075608560956105611561256135614561556165617561856195620562156225623562456255626562756285629563056315632563356345635563656375638563956405641564256435644564556465647564856495650565156525653565456555656565756585659566056615662566356645665566656675668566956705671567256735674567556765677567856795680568156825683568456855686568756885689569056915692569356945695569656975698569957005701570257035704570557065707570857095710571157125713571457155716571757185719572057215722572357245725572657275728572957305731573257335734573557365737573857395740574157425743574457455746574757485749575057515752575357545755575657575758575957605761576257635764576557665767576857695770577157725773577457755776577757785779578057815782578357845785578657875788578957905791579257935794579557965797579857995800580158025803580458055806580758085809581058115812581358145815581658175818581958205821582258235824582558265827582858295830583158325833583458355836583758385839584058415842584358445845584658475848584958505851585258535854585558565857585858595860586158625863586458655866586758685869587058715872587358745875587658775878587958805881588258835884588558865887588858895890589158925893589458955896589758985899590059015902590359045905590659075908590959105911591259135914591559165917591859195920592159225923592459255926592759285929593059315932593359345935593659375938593959405941594259435944594559465947594859495950595159525953595459555956595759585959596059615962596359645965596659675968596959705971597259735974597559765977597859795980598159825983598459855986598759885989599059915992599359945995599659975998599960006001600260036004600560066007600860096010601160126013601460156016601760186019602060216022602360246025602660276028602960306031603260336034603560366037603860396040604160426043604460456046604760486049605060516052605360546055605660576058605960606061606260636064606560666067606860696070607160726073607460756076607760786079608060816082608360846085608660876088608960906091609260936094609560966097609860996100610161026103610461056106610761086109611061116112611361146115611661176118611961206121612261236124612561266127612861296130613161326133613461356136613761386139614061416142614361446145614661476148614961506151615261536154615561566157615861596160616161626163616461656166616761686169617061716172617361746175617661776178617961806181618261836184618561866187618861896190619161926193619461956196619761986199620062016202620362046205620662076208620962106211621262136214621562166217621862196220622162226223622462256226622762286229623062316232623362346235623662376238623962406241624262436244624562466247624862496250625162526253625462556256625762586259626062616262626362646265626662676268626962706271627262736274627562766277627862796280628162826283628462856286628762886289629062916292629362946295629662976298629963006301630263036304630563066307630863096310631163126313631463156316631763186319632063216322632363246325632663276328632963306331633263336334633563366337633863396340634163426343634463456346634763486349635063516352635363546355635663576358635963606361636263636364636563666367636863696370637163726373637463756376637763786379638063816382638363846385638663876388638963906391639263936394639563966397639863996400640164026403640464056406640764086409641064116412641364146415641664176418641964206421642264236424642564266427642864296430643164326433643464356436643764386439644064416442644364446445644664476448644964506451645264536454645564566457645864596460646164626463646464656466646764686469647064716472647364746475647664776478647964806481648264836484648564866487648864896490649164926493649464956496649764986499650065016502650365046505650665076508650965106511651265136514651565166517651865196520652165226523652465256526652765286529653065316532653365346535653665376538653965406541654265436544654565466547654865496550655165526553655465556556655765586559656065616562656365646565656665676568656965706571657265736574657565766577657865796580658165826583658465856586658765886589659065916592659365946595659665976598659966006601660266036604660566066607660866096610661166126613661466156616661766186619662066216622662366246625662666276628662966306631663266336634663566366637663866396640664166426643664466456646664766486649665066516652665366546655665666576658665966606661666266636664666566666667666866696670667166726673667466756676667766786679668066816682668366846685668666876688668966906691669266936694669566966697669866996700670167026703670467056706670767086709671067116712671367146715671667176718671967206721672267236724672567266727672867296730673167326733673467356736673767386739674067416742674367446745674667476748674967506751675267536754675567566757675867596760676167626763676467656766676767686769677067716772677367746775677667776778677967806781678267836784678567866787678867896790679167926793679467956796679767986799680068016802680368046805680668076808680968106811681268136814681568166817681868196820682168226823682468256826682768286829683068316832683368346835683668376838683968406841684268436844684568466847684868496850685168526853685468556856685768586859686068616862686368646865686668676868686968706871687268736874687568766877687868796880688168826883688468856886688768886889689068916892689368946895689668976898689969006901690269036904690569066907690869096910691169126913691469156916691769186919692069216922692369246925692669276928692969306931693269336934693569366937693869396940694169426943694469456946694769486949695069516952695369546955695669576958695969606961696269636964696569666967696869696970697169726973697469756976697769786979698069816982698369846985698669876988698969906991699269936994699569966997699869997000700170027003700470057006700770087009701070117012701370147015701670177018701970207021702270237024702570267027702870297030703170327033703470357036703770387039704070417042704370447045704670477048704970507051705270537054705570567057705870597060706170627063706470657066706770687069707070717072707370747075707670777078707970807081708270837084708570867087708870897090709170927093709470957096709770987099710071017102710371047105710671077108710971107111711271137114711571167117711871197120712171227123712471257126712771287129713071317132713371347135713671377138713971407141714271437144714571467147714871497150715171527153715471557156715771587159716071617162716371647165716671677168716971707171717271737174717571767177717871797180718171827183718471857186718771887189719071917192719371947195719671977198719972007201720272037204720572067207720872097210721172127213721472157216721772187219722072217222722372247225722672277228722972307231723272337234723572367237723872397240724172427243724472457246724772487249725072517252725372547255725672577258725972607261726272637264726572667267726872697270727172727273727472757276727772787279728072817282728372847285728672877288728972907291729272937294729572967297729872997300730173027303730473057306730773087309731073117312731373147315731673177318731973207321732273237324732573267327732873297330733173327333733473357336733773387339734073417342734373447345734673477348734973507351735273537354735573567357735873597360736173627363736473657366736773687369737073717372737373747375737673777378737973807381738273837384738573867387738873897390739173927393739473957396739773987399740074017402740374047405740674077408740974107411741274137414741574167417741874197420742174227423742474257426742774287429743074317432743374347435743674377438743974407441744274437444744574467447744874497450745174527453745474557456745774587459746074617462746374647465746674677468746974707471747274737474747574767477747874797480748174827483748474857486748774887489749074917492749374947495749674977498749975007501750275037504750575067507750875097510751175127513751475157516751775187519752075217522752375247525752675277528752975307531753275337534753575367537753875397540754175427543754475457546754775487549755075517552755375547555755675577558755975607561756275637564756575667567756875697570757175727573757475757576757775787579758075817582758375847585758675877588758975907591759275937594759575967597759875997600760176027603760476057606760776087609761076117612761376147615761676177618761976207621762276237624762576267627762876297630763176327633763476357636763776387639764076417642764376447645764676477648764976507651765276537654765576567657765876597660766176627663766476657666766776687669767076717672767376747675767676777678767976807681768276837684768576867687768876897690769176927693769476957696769776987699770077017702770377047705770677077708770977107711771277137714771577167717771877197720772177227723772477257726772777287729773077317732773377347735773677377738773977407741774277437744774577467747774877497750775177527753775477557756775777587759776077617762776377647765776677677768776977707771777277737774777577767777777877797780778177827783778477857786778777887789779077917792779377947795779677977798779978007801780278037804780578067807780878097810781178127813781478157816781778187819782078217822782378247825782678277828782978307831783278337834783578367837783878397840784178427843784478457846784778487849785078517852785378547855785678577858785978607861786278637864786578667867786878697870787178727873787478757876787778787879788078817882788378847885788678877888788978907891789278937894789578967897789878997900790179027903790479057906790779087909791079117912791379147915791679177918791979207921792279237924792579267927792879297930793179327933793479357936793779387939794079417942794379447945794679477948794979507951795279537954795579567957795879597960796179627963796479657966796779687969797079717972797379747975797679777978797979807981798279837984798579867987798879897990799179927993799479957996799779987999800080018002800380048005800680078008800980108011801280138014801580168017801880198020802180228023802480258026802780288029803080318032803380348035803680378038803980408041804280438044804580468047804880498050805180528053805480558056805780588059806080618062806380648065806680678068806980708071807280738074807580768077807880798080808180828083808480858086808780888089809080918092809380948095809680978098809981008101810281038104810581068107810881098110811181128113811481158116811781188119812081218122812381248125812681278128812981308131813281338134813581368137813881398140814181428143814481458146814781488149815081518152815381548155815681578158815981608161816281638164816581668167816881698170817181728173817481758176817781788179818081818182818381848185818681878188818981908191819281938194819581968197819881998200820182028203820482058206820782088209821082118212821382148215821682178218821982208221822282238224822582268227822882298230823182328233823482358236823782388239824082418242824382448245824682478248824982508251825282538254825582568257825882598260826182628263826482658266826782688269827082718272827382748275827682778278827982808281828282838284828582868287828882898290829182928293829482958296829782988299830083018302830383048305830683078308830983108311831283138314831583168317831883198320832183228323832483258326832783288329833083318332833383348335833683378338833983408341834283438344834583468347834883498350835183528353835483558356835783588359836083618362836383648365836683678368836983708371837283738374837583768377837883798380838183828383838483858386838783888389839083918392839383948395839683978398839984008401840284038404840584068407840884098410841184128413841484158416841784188419842084218422842384248425842684278428842984308431843284338434843584368437843884398440844184428443844484458446844784488449845084518452845384548455845684578458845984608461846284638464846584668467846884698470847184728473847484758476847784788479848084818482848384848485848684878488848984908491849284938494849584968497849884998500850185028503850485058506850785088509851085118512851385148515851685178518851985208521852285238524852585268527852885298530853185328533853485358536853785388539854085418542854385448545854685478548854985508551855285538554855585568557855885598560856185628563856485658566856785688569857085718572857385748575857685778578857985808581858285838584858585868587858885898590859185928593859485958596859785988599860086018602860386048605860686078608860986108611861286138614861586168617861886198620862186228623862486258626862786288629863086318632863386348635863686378638863986408641864286438644864586468647864886498650865186528653865486558656865786588659866086618662866386648665866686678668866986708671867286738674867586768677867886798680868186828683868486858686868786888689869086918692869386948695869686978698869987008701870287038704870587068707870887098710871187128713871487158716871787188719872087218722872387248725872687278728872987308731873287338734873587368737873887398740874187428743874487458746874787488749875087518752875387548755875687578758875987608761876287638764876587668767876887698770877187728773877487758776877787788779878087818782878387848785878687878788878987908791879287938794879587968797879887998800880188028803880488058806880788088809881088118812881388148815881688178818881988208821882288238824882588268827882888298830883188328833883488358836883788388839884088418842884388448845884688478848884988508851885288538854885588568857885888598860886188628863886488658866886788688869887088718872887388748875887688778878887988808881888288838884888588868887888888898890889188928893889488958896889788988899890089018902890389048905890689078908890989108911891289138914891589168917891889198920892189228923892489258926892789288929893089318932893389348935893689378938893989408941894289438944894589468947894889498950895189528953895489558956895789588959896089618962896389648965896689678968896989708971897289738974897589768977897889798980898189828983898489858986898789888989899089918992899389948995899689978998899990009001900290039004900590069007900890099010901190129013901490159016901790189019902090219022902390249025902690279028902990309031903290339034903590369037903890399040904190429043904490459046904790489049905090519052905390549055905690579058905990609061906290639064906590669067906890699070907190729073907490759076907790789079908090819082908390849085908690879088908990909091909290939094909590969097909890999100910191029103910491059106910791089109911091119112911391149115911691179118911991209121912291239124912591269127912891299130913191329133913491359136913791389139914091419142914391449145914691479148914991509151915291539154915591569157915891599160916191629163916491659166916791689169917091719172917391749175917691779178917991809181918291839184918591869187918891899190919191929193919491959196919791989199920092019202920392049205920692079208920992109211921292139214921592169217921892199220922192229223922492259226922792289229923092319232923392349235923692379238923992409241924292439244924592469247924892499250925192529253925492559256925792589259926092619262926392649265926692679268926992709271927292739274927592769277927892799280928192829283928492859286928792889289929092919292929392949295929692979298929993009301930293039304930593069307930893099310931193129313931493159316931793189319932093219322932393249325932693279328932993309331933293339334933593369337933893399340934193429343934493459346934793489349935093519352935393549355935693579358935993609361936293639364936593669367936893699370937193729373937493759376937793789379938093819382938393849385938693879388938993909391939293939394939593969397939893999400940194029403940494059406940794089409941094119412941394149415941694179418941994209421942294239424942594269427942894299430943194329433943494359436943794389439944094419442944394449445944694479448944994509451945294539454945594569457945894599460946194629463946494659466946794689469947094719472947394749475947694779478947994809481948294839484948594869487948894899490949194929493949494959496949794989499950095019502950395049505950695079508950995109511951295139514951595169517951895199520952195229523952495259526952795289529953095319532953395349535953695379538953995409541954295439544954595469547954895499550955195529553955495559556955795589559956095619562956395649565956695679568956995709571957295739574957595769577957895799580958195829583958495859586958795889589959095919592959395949595959695979598959996009601960296039604960596069607960896099610961196129613961496159616961796189619962096219622962396249625962696279628962996309631963296339634963596369637963896399640964196429643964496459646964796489649965096519652965396549655965696579658965996609661966296639664966596669667966896699670967196729673967496759676967796789679968096819682968396849685968696879688968996909691969296939694969596969697969896999700970197029703970497059706970797089709971097119712971397149715971697179718971997209721972297239724972597269727972897299730973197329733973497359736973797389739974097419742974397449745974697479748974997509751975297539754975597569757975897599760976197629763976497659766976797689769977097719772977397749775977697779778977997809781978297839784978597869787978897899790979197929793979497959796979797989799980098019802980398049805980698079808980998109811981298139814981598169817981898199820982198229823982498259826982798289829983098319832983398349835983698379838983998409841984298439844984598469847984898499850985198529853985498559856985798589859986098619862986398649865986698679868986998709871987298739874987598769877987898799880988198829883988498859886988798889889989098919892989398949895989698979898989999009901990299039904990599069907990899099910991199129913991499159916991799189919992099219922992399249925992699279928992999309931993299339934993599369937993899399940994199429943994499459946994799489949995099519952995399549955995699579958995999609961996299639964996599669967996899699970997199729973997499759976997799789979998099819982998399849985998699879988998999909991999299939994999599969997999899991000010001100021000310004100051000610007100081000910010100111001210013100141001510016100171001810019100201002110022100231002410025100261002710028100291003010031100321003310034100351003610037100381003910040100411004210043100441004510046100471004810049100501005110052100531005410055100561005710058100591006010061100621006310064100651006610067100681006910070100711007210073100741007510076100771007810079100801008110082100831008410085100861008710088100891009010091100921009310094100951009610097100981009910100101011010210103101041010510106101071010810109101101011110112101131011410115101161011710118101191012010121101221012310124101251012610127101281012910130101311013210133101341013510136101371013810139101401014110142101431014410145101461014710148101491015010151101521015310154101551015610157101581015910160101611016210163101641016510166101671016810169101701017110172101731017410175101761017710178101791018010181101821018310184101851018610187101881018910190101911019210193101941019510196101971019810199102001020110202102031020410205102061020710208102091021010211102121021310214102151021610217102181021910220102211022210223102241022510226102271022810229102301023110232102331023410235102361023710238102391024010241102421024310244102451024610247102481024910250102511025210253102541025510256102571025810259102601026110262102631026410265102661026710268102691027010271102721027310274102751027610277102781027910280102811028210283102841028510286102871028810289102901029110292102931029410295102961029710298102991030010301103021030310304103051030610307103081030910310103111031210313103141031510316103171031810319103201032110322103231032410325103261032710328103291033010331103321033310334103351033610337103381033910340103411034210343103441034510346103471034810349103501035110352103531035410355103561035710358103591036010361103621036310364103651036610367103681036910370103711037210373103741037510376103771037810379103801038110382103831038410385103861038710388103891039010391103921039310394103951039610397103981039910400104011040210403104041040510406104071040810409104101041110412104131041410415104161041710418104191042010421104221042310424104251042610427104281042910430104311043210433104341043510436104371043810439104401044110442104431044410445104461044710448104491045010451104521045310454104551045610457104581045910460104611046210463104641046510466104671046810469104701047110472104731047410475104761047710478104791048010481104821048310484104851048610487104881048910490104911049210493104941049510496104971049810499105001050110502105031050410505105061050710508105091051010511105121051310514105151051610517105181051910520105211052210523105241052510526105271052810529105301053110532105331053410535105361053710538105391054010541105421054310544105451054610547105481054910550105511055210553105541055510556105571055810559105601056110562105631056410565105661056710568105691057010571105721057310574105751057610577105781057910580105811058210583105841058510586105871058810589105901059110592105931059410595105961059710598105991060010601106021060310604106051060610607106081060910610106111061210613106141061510616106171061810619106201062110622106231062410625106261062710628106291063010631106321063310634106351063610637106381063910640106411064210643106441064510646106471064810649106501065110652106531065410655106561065710658106591066010661106621066310664106651066610667106681066910670106711067210673106741067510676106771067810679106801068110682106831068410685106861068710688106891069010691106921069310694106951069610697106981069910700107011070210703107041070510706107071070810709107101071110712107131071410715107161071710718107191072010721107221072310724107251072610727107281072910730107311073210733107341073510736107371073810739107401074110742107431074410745107461074710748107491075010751107521075310754107551075610757107581075910760107611076210763107641076510766107671076810769107701077110772107731077410775107761077710778107791078010781107821078310784107851078610787107881078910790107911079210793107941079510796107971079810799108001080110802108031080410805108061080710808108091081010811108121081310814108151081610817108181081910820108211082210823108241082510826108271082810829108301083110832108331083410835108361083710838108391084010841108421084310844108451084610847108481084910850108511085210853108541085510856108571085810859108601086110862108631086410865108661086710868108691087010871108721087310874108751087610877108781087910880108811088210883108841088510886108871088810889108901089110892108931089410895108961089710898108991090010901109021090310904109051090610907109081090910910109111091210913109141091510916109171091810919109201092110922109231092410925109261092710928109291093010931109321093310934109351093610937109381093910940109411094210943109441094510946109471094810949109501095110952109531095410955109561095710958109591096010961109621096310964109651096610967109681096910970109711097210973109741097510976109771097810979109801098110982109831098410985109861098710988109891099010991109921099310994109951099610997109981099911000110011100211003110041100511006110071100811009110101101111012110131101411015110161101711018110191102011021110221102311024110251102611027110281102911030110311103211033110341103511036110371103811039110401104111042110431104411045110461104711048110491105011051110521105311054110551105611057110581105911060110611106211063110641106511066110671106811069110701107111072110731107411075110761107711078110791108011081110821108311084110851108611087110881108911090110911109211093110941109511096110971109811099111001110111102111031110411105111061110711108111091111011111111121111311114111151111611117111181111911120111211112211123111241112511126111271112811129111301113111132111331113411135111361113711138111391114011141111421114311144111451114611147111481114911150111511115211153111541115511156111571115811159111601116111162111631116411165111661116711168111691117011171111721117311174111751117611177111781117911180111811118211183111841118511186111871118811189111901119111192111931119411195111961119711198111991120011201112021120311204112051120611207112081120911210112111121211213112141121511216112171121811219112201122111222112231122411225112261122711228112291123011231112321123311234112351123611237112381123911240112411124211243112441124511246112471124811249112501125111252112531125411255112561125711258112591126011261112621126311264112651126611267112681126911270112711127211273112741127511276112771127811279112801128111282112831128411285112861128711288112891129011291112921129311294112951129611297112981129911300113011130211303113041130511306113071130811309113101131111312113131131411315113161131711318113191132011321113221132311324113251132611327113281132911330113311133211333113341133511336113371133811339113401134111342113431134411345113461134711348113491135011351113521135311354113551135611357113581135911360113611136211363113641136511366113671136811369113701137111372113731137411375113761137711378113791138011381113821138311384113851138611387113881138911390113911139211393113941139511396113971139811399114001140111402114031140411405114061140711408114091141011411114121141311414114151141611417114181141911420114211142211423114241142511426114271142811429114301143111432114331143411435114361143711438114391144011441114421144311444114451144611447114481144911450114511145211453114541145511456114571145811459114601146111462114631146411465114661146711468114691147011471114721147311474114751147611477114781147911480114811148211483114841148511486114871148811489114901149111492114931149411495114961149711498114991150011501115021150311504115051150611507115081150911510115111151211513115141151511516115171151811519115201152111522115231152411525115261152711528115291153011531115321153311534115351153611537115381153911540115411154211543115441154511546115471154811549115501155111552115531155411555115561155711558115591156011561115621156311564115651156611567115681156911570115711157211573115741157511576115771157811579115801158111582115831158411585115861158711588115891159011591115921159311594115951159611597115981159911600116011160211603116041160511606116071160811609116101161111612116131161411615116161161711618116191162011621116221162311624116251162611627116281162911630116311163211633116341163511636116371163811639116401164111642116431164411645116461164711648116491165011651116521165311654116551165611657116581165911660116611166211663116641166511666116671166811669116701167111672116731167411675116761167711678116791168011681116821168311684116851168611687116881168911690116911169211693116941169511696116971169811699117001170111702117031170411705117061170711708117091171011711117121171311714117151171611717117181171911720117211172211723117241172511726117271172811729117301173111732117331173411735117361173711738117391174011741117421174311744117451174611747117481174911750117511175211753117541175511756117571175811759117601176111762117631176411765117661176711768117691177011771117721177311774117751177611777117781177911780117811178211783117841178511786117871178811789117901179111792117931179411795117961179711798117991180011801118021180311804118051180611807118081180911810118111181211813118141181511816118171181811819118201182111822118231182411825118261182711828118291183011831118321183311834118351183611837118381183911840118411184211843118441184511846118471184811849118501185111852118531185411855118561185711858118591186011861118621186311864118651186611867118681186911870118711187211873118741187511876118771187811879118801188111882118831188411885118861188711888118891189011891118921189311894118951189611897118981189911900119011190211903119041190511906119071190811909119101191111912119131191411915119161191711918119191192011921119221192311924119251192611927119281192911930119311193211933119341193511936119371193811939119401194111942119431194411945119461194711948119491195011951119521195311954119551195611957119581195911960119611196211963119641196511966119671196811969119701197111972119731197411975119761197711978119791198011981119821198311984119851198611987119881198911990119911199211993119941199511996119971199811999120001200112002120031200412005120061200712008120091201012011120121201312014120151201612017120181201912020120211202212023120241202512026120271202812029120301203112032120331203412035120361203712038120391204012041120421204312044120451204612047120481204912050120511205212053120541205512056120571205812059120601206112062120631206412065120661206712068120691207012071120721207312074120751207612077120781207912080120811208212083120841208512086120871208812089120901209112092120931209412095120961209712098120991210012101121021210312104121051210612107121081210912110121111211212113121141211512116121171211812119121201212112122121231212412125121261212712128121291213012131121321213312134121351213612137121381213912140121411214212143121441214512146121471214812149121501215112152121531215412155121561215712158121591216012161121621216312164121651216612167121681216912170121711217212173121741217512176121771217812179121801218112182121831218412185121861218712188121891219012191121921219312194121951219612197121981219912200122011220212203122041220512206122071220812209122101221112212122131221412215122161221712218122191222012221122221222312224122251222612227122281222912230122311223212233122341223512236122371223812239122401224112242122431224412245122461224712248122491225012251122521225312254122551225612257122581225912260122611226212263122641226512266122671226812269122701227112272122731227412275122761227712278122791228012281122821228312284122851228612287122881228912290122911229212293122941229512296122971229812299123001230112302123031230412305123061230712308123091231012311123121231312314123151231612317123181231912320123211232212323123241232512326123271232812329123301233112332123331233412335123361233712338123391234012341123421234312344123451234612347123481234912350123511235212353123541235512356123571235812359123601236112362123631236412365123661236712368123691237012371123721237312374123751237612377123781237912380123811238212383123841238512386123871238812389123901239112392123931239412395123961239712398123991240012401124021240312404124051240612407124081240912410124111241212413124141241512416124171241812419124201242112422124231242412425124261242712428124291243012431124321243312434124351243612437124381243912440124411244212443124441244512446124471244812449124501245112452124531245412455124561245712458124591246012461124621246312464124651246612467124681246912470124711247212473124741247512476124771247812479124801248112482124831248412485124861248712488124891249012491124921249312494124951249612497124981249912500125011250212503125041250512506125071250812509125101251112512125131251412515125161251712518125191252012521125221252312524125251252612527125281252912530125311253212533125341253512536125371253812539125401254112542125431254412545125461254712548125491255012551125521255312554125551255612557125581255912560125611256212563125641256512566125671256812569125701257112572125731257412575125761257712578125791258012581125821258312584125851258612587125881258912590125911259212593125941259512596125971259812599126001260112602126031260412605126061260712608126091261012611126121261312614126151261612617126181261912620126211262212623126241262512626126271262812629126301263112632126331263412635126361263712638126391264012641126421264312644126451264612647126481264912650126511265212653126541265512656126571265812659126601266112662126631266412665126661266712668126691267012671126721267312674126751267612677126781267912680126811268212683126841268512686126871268812689126901269112692126931269412695126961269712698126991270012701127021270312704127051270612707127081270912710127111271212713127141271512716127171271812719127201272112722127231272412725127261272712728127291273012731127321273312734127351273612737127381273912740127411274212743127441274512746127471274812749127501275112752127531275412755127561275712758127591276012761127621276312764127651276612767127681276912770127711277212773127741277512776127771277812779127801278112782127831278412785127861278712788127891279012791127921279312794127951279612797127981279912800128011280212803128041280512806128071280812809128101281112812128131281412815128161281712818128191282012821128221282312824128251282612827128281282912830128311283212833128341283512836128371283812839128401284112842128431284412845128461284712848128491285012851128521285312854128551285612857128581285912860128611286212863128641286512866128671286812869128701287112872128731287412875128761287712878128791288012881128821288312884128851288612887128881288912890128911289212893128941289512896128971289812899129001290112902129031290412905129061290712908129091291012911129121291312914129151291612917129181291912920129211292212923129241292512926129271292812929129301293112932129331293412935129361293712938129391294012941129421294312944129451294612947129481294912950129511295212953129541295512956129571295812959129601296112962129631296412965129661296712968129691297012971129721297312974129751297612977129781297912980129811298212983129841298512986129871298812989129901299112992129931299412995129961299712998129991300013001130021300313004130051300613007130081300913010130111301213013130141301513016130171301813019130201302113022130231302413025130261302713028130291303013031130321303313034130351303613037130381303913040130411304213043130441304513046130471304813049130501305113052130531305413055130561305713058130591306013061130621306313064130651306613067130681306913070130711307213073130741307513076130771307813079130801308113082130831308413085130861308713088130891309013091130921309313094130951309613097130981309913100131011310213103131041310513106131071310813109131101311113112131131311413115131161311713118131191312013121131221312313124131251312613127131281312913130131311313213133131341313513136131371313813139131401314113142131431314413145131461314713148131491315013151131521315313154131551315613157131581315913160131611316213163131641316513166131671316813169131701317113172131731317413175131761317713178131791318013181131821318313184131851318613187131881318913190131911319213193131941319513196131971319813199132001320113202132031320413205132061320713208132091321013211132121321313214132151321613217132181321913220132211322213223132241322513226132271322813229132301323113232132331323413235132361323713238132391324013241132421324313244132451324613247132481324913250132511325213253132541325513256132571325813259132601326113262132631326413265132661326713268132691327013271132721327313274132751327613277132781327913280132811328213283132841328513286132871328813289132901329113292132931329413295132961329713298132991330013301133021330313304133051330613307133081330913310133111331213313133141331513316133171331813319133201332113322133231332413325133261332713328133291333013331133321333313334133351333613337133381333913340133411334213343133441334513346133471334813349133501335113352133531335413355133561335713358133591336013361133621336313364133651336613367133681336913370133711337213373133741337513376133771337813379133801338113382133831338413385133861338713388133891339013391133921339313394133951339613397133981339913400134011340213403134041340513406134071340813409134101341113412134131341413415134161341713418134191342013421134221342313424134251342613427134281342913430134311343213433134341343513436134371343813439134401344113442134431344413445134461344713448134491345013451134521345313454134551345613457134581345913460134611346213463134641346513466134671346813469134701347113472134731347413475134761347713478134791348013481134821348313484134851348613487134881348913490134911349213493134941349513496134971349813499135001350113502135031350413505135061350713508135091351013511135121351313514135151351613517135181351913520135211352213523135241352513526135271352813529135301353113532135331353413535135361353713538135391354013541135421354313544135451354613547135481354913550135511355213553135541355513556135571355813559135601356113562135631356413565135661356713568135691357013571135721357313574135751357613577135781357913580135811358213583135841358513586135871358813589135901359113592135931359413595135961359713598135991360013601136021360313604136051360613607136081360913610136111361213613136141361513616136171361813619136201362113622136231362413625136261362713628136291363013631136321363313634136351363613637136381363913640136411364213643136441364513646136471364813649136501365113652136531365413655136561365713658136591366013661136621366313664136651366613667136681366913670136711367213673136741367513676136771367813679136801368113682136831368413685136861368713688136891369013691136921369313694136951369613697136981369913700137011370213703137041370513706137071370813709137101371113712137131371413715137161371713718137191372013721137221372313724137251372613727137281372913730137311373213733137341373513736137371373813739137401374113742137431374413745137461374713748137491375013751137521375313754137551375613757137581375913760137611376213763137641376513766137671376813769137701377113772137731377413775137761377713778137791378013781137821378313784137851378613787137881378913790137911379213793137941379513796137971379813799138001380113802138031380413805138061380713808138091381013811138121381313814138151381613817138181381913820138211382213823138241382513826138271382813829138301383113832138331383413835138361383713838138391384013841138421384313844138451384613847138481384913850138511385213853138541385513856138571385813859138601386113862138631386413865138661386713868138691387013871138721387313874138751387613877138781387913880138811388213883138841388513886138871388813889138901389113892138931389413895138961389713898138991390013901139021390313904139051390613907139081390913910139111391213913139141391513916139171391813919139201392113922139231392413925139261392713928139291393013931139321393313934139351393613937139381393913940139411394213943139441394513946139471394813949139501395113952139531395413955139561395713958139591396013961139621396313964139651396613967139681396913970139711397213973139741397513976139771397813979139801398113982139831398413985139861398713988139891399013991139921399313994139951399613997139981399914000140011400214003140041400514006140071400814009140101401114012140131401414015140161401714018140191402014021140221402314024140251402614027140281402914030140311403214033140341403514036140371403814039140401404114042140431404414045140461404714048140491405014051140521405314054140551405614057140581405914060140611406214063140641406514066140671406814069140701407114072140731407414075140761407714078140791408014081140821408314084140851408614087140881408914090140911409214093140941409514096140971409814099141001410114102141031410414105141061410714108141091411014111141121411314114141151411614117141181411914120141211412214123141241412514126141271412814129141301413114132141331413414135141361413714138141391414014141141421414314144141451414614147141481414914150141511415214153141541415514156141571415814159141601416114162141631416414165141661416714168141691417014171141721417314174141751417614177141781417914180141811418214183141841418514186141871418814189141901419114192141931419414195141961419714198141991420014201142021420314204142051420614207142081420914210142111421214213142141421514216142171421814219142201422114222142231422414225142261422714228142291423014231142321423314234142351423614237142381423914240142411424214243142441424514246142471424814249142501425114252142531425414255142561425714258142591426014261142621426314264142651426614267142681426914270142711427214273142741427514276142771427814279142801428114282142831428414285142861428714288142891429014291142921429314294142951429614297142981429914300143011430214303143041430514306143071430814309143101431114312143131431414315143161431714318143191432014321143221432314324143251432614327143281432914330143311433214333143341433514336143371433814339143401434114342143431434414345143461434714348143491435014351143521435314354143551435614357143581435914360143611436214363143641436514366143671436814369143701437114372143731437414375143761437714378143791438014381143821438314384143851438614387143881438914390143911439214393143941439514396143971439814399144001440114402144031440414405144061440714408144091441014411144121441314414144151441614417144181441914420144211442214423144241442514426144271442814429144301443114432144331443414435144361443714438144391444014441144421444314444144451444614447144481444914450144511445214453144541445514456144571445814459144601446114462144631446414465144661446714468144691447014471144721447314474144751447614477144781447914480144811448214483144841448514486144871448814489144901449114492144931449414495144961449714498144991450014501145021450314504145051450614507145081450914510145111451214513145141451514516145171451814519145201452114522145231452414525145261452714528145291453014531145321453314534145351453614537145381453914540145411454214543145441454514546145471454814549145501455114552145531455414555145561455714558145591456014561145621456314564145651456614567145681456914570145711457214573145741457514576145771457814579145801458114582145831458414585145861458714588145891459014591145921459314594145951459614597145981459914600146011460214603146041460514606146071460814609146101461114612146131461414615146161461714618146191462014621146221462314624146251462614627146281462914630146311463214633146341463514636146371463814639146401464114642146431464414645146461464714648146491465014651146521465314654146551465614657146581465914660146611466214663146641466514666146671466814669146701467114672146731467414675146761467714678146791468014681146821468314684146851468614687146881468914690146911469214693146941469514696146971469814699147001470114702147031470414705147061470714708147091471014711147121471314714147151471614717147181471914720147211472214723147241472514726147271472814729147301473114732147331473414735147361473714738147391474014741147421474314744147451474614747147481474914750147511475214753147541475514756147571475814759147601476114762147631476414765147661476714768147691477014771147721477314774147751477614777147781477914780147811478214783147841478514786147871478814789147901479114792147931479414795147961479714798147991480014801148021480314804148051480614807148081480914810148111481214813148141481514816148171481814819148201482114822148231482414825148261482714828148291483014831148321483314834148351483614837148381483914840148411484214843148441484514846148471484814849148501485114852148531485414855148561485714858148591486014861148621486314864148651486614867148681486914870148711487214873148741487514876148771487814879148801488114882148831488414885148861488714888148891489014891148921489314894148951489614897148981489914900149011490214903149041490514906149071490814909149101491114912149131491414915149161491714918149191492014921149221492314924149251492614927149281492914930149311493214933149341493514936149371493814939149401494114942149431494414945149461494714948149491495014951149521495314954149551495614957149581495914960149611496214963149641496514966149671496814969149701497114972149731497414975149761497714978149791498014981149821498314984149851498614987149881498914990149911499214993149941499514996149971499814999150001500115002150031500415005150061500715008150091501015011150121501315014150151501615017150181501915020150211502215023150241502515026150271502815029150301503115032150331503415035150361503715038150391504015041150421504315044150451504615047150481504915050150511505215053150541505515056150571505815059150601506115062150631506415065150661506715068150691507015071150721507315074150751507615077150781507915080150811508215083150841508515086150871508815089150901509115092150931509415095150961509715098150991510015101151021510315104151051510615107151081510915110151111511215113151141511515116151171511815119151201512115122151231512415125151261512715128151291513015131151321513315134151351513615137151381513915140151411514215143151441514515146151471514815149151501515115152151531515415155151561515715158151591516015161151621516315164151651516615167151681516915170151711517215173151741517515176151771517815179151801518115182151831518415185151861518715188151891519015191151921519315194151951519615197151981519915200152011520215203152041520515206152071520815209152101521115212152131521415215152161521715218152191522015221152221522315224152251522615227152281522915230152311523215233152341523515236152371523815239152401524115242152431524415245152461524715248152491525015251152521525315254152551525615257152581525915260152611526215263152641526515266152671526815269152701527115272152731527415275152761527715278152791528015281152821528315284152851528615287152881528915290152911529215293152941529515296152971529815299153001530115302153031530415305153061530715308153091531015311153121531315314153151531615317153181531915320153211532215323153241532515326153271532815329153301533115332153331533415335153361533715338153391534015341153421534315344153451534615347153481534915350153511535215353153541535515356153571535815359153601536115362153631536415365153661536715368153691537015371153721537315374153751537615377153781537915380153811538215383153841538515386153871538815389153901539115392153931539415395153961539715398153991540015401154021540315404154051540615407154081540915410154111541215413154141541515416154171541815419154201542115422154231542415425154261542715428154291543015431154321543315434154351543615437154381543915440154411544215443154441544515446154471544815449154501545115452154531545415455154561545715458154591546015461154621546315464154651546615467154681546915470154711547215473154741547515476154771547815479154801548115482154831548415485154861548715488154891549015491154921549315494154951549615497154981549915500155011550215503155041550515506155071550815509155101551115512155131551415515155161551715518155191552015521155221552315524155251552615527155281552915530155311553215533155341553515536155371553815539155401554115542155431554415545155461554715548155491555015551155521555315554155551555615557155581555915560155611556215563155641556515566155671556815569155701557115572155731557415575155761557715578155791558015581155821558315584155851558615587155881558915590155911559215593155941559515596155971559815599156001560115602156031560415605156061560715608156091561015611156121561315614156151561615617156181561915620156211562215623156241562515626156271562815629156301563115632156331563415635156361563715638156391564015641156421564315644156451564615647156481564915650156511565215653156541565515656156571565815659156601566115662156631566415665156661566715668156691567015671156721567315674156751567615677156781567915680156811568215683156841568515686156871568815689156901569115692156931569415695156961569715698156991570015701157021570315704157051570615707157081570915710157111571215713157141571515716157171571815719157201572115722157231572415725157261572715728157291573015731157321573315734157351573615737157381573915740157411574215743157441574515746157471574815749157501575115752157531575415755157561575715758157591576015761157621576315764157651576615767157681576915770157711577215773157741577515776157771577815779157801578115782157831578415785157861578715788157891579015791157921579315794157951579615797157981579915800158011580215803158041580515806158071580815809158101581115812158131581415815158161581715818158191582015821158221582315824158251582615827158281582915830158311583215833158341583515836158371583815839158401584115842158431584415845158461584715848158491585015851158521585315854158551585615857158581585915860158611586215863158641586515866158671586815869158701587115872158731587415875158761587715878158791588015881158821588315884158851588615887158881588915890158911589215893158941589515896158971589815899159001590115902159031590415905159061590715908159091591015911159121591315914159151591615917159181591915920159211592215923159241592515926159271592815929159301593115932159331593415935159361593715938159391594015941159421594315944159451594615947159481594915950159511595215953159541595515956159571595815959159601596115962159631596415965159661596715968159691597015971159721597315974159751597615977159781597915980159811598215983159841598515986159871598815989159901599115992159931599415995159961599715998159991600016001160021600316004160051600616007160081600916010160111601216013160141601516016160171601816019160201602116022160231602416025160261602716028160291603016031160321603316034160351603616037160381603916040160411604216043160441604516046160471604816049160501605116052160531605416055160561605716058160591606016061160621606316064160651606616067160681606916070160711607216073160741607516076160771607816079160801608116082160831608416085160861608716088160891609016091160921609316094160951609616097160981609916100161011610216103161041610516106161071610816109161101611116112161131611416115161161611716118161191612016121161221612316124161251612616127161281612916130161311613216133161341613516136161371613816139161401614116142161431614416145161461614716148161491615016151161521615316154161551615616157161581615916160161611616216163161641616516166161671616816169161701617116172161731617416175161761617716178161791618016181161821618316184161851618616187161881618916190161911619216193161941619516196161971619816199162001620116202162031620416205162061620716208162091621016211162121621316214162151621616217162181621916220162211622216223162241622516226162271622816229162301623116232162331623416235162361623716238162391624016241162421624316244162451624616247162481624916250162511625216253162541625516256162571625816259162601626116262162631626416265162661626716268162691627016271162721627316274162751627616277162781627916280162811628216283162841628516286162871628816289162901629116292162931629416295162961629716298162991630016301163021630316304163051630616307163081630916310163111631216313163141631516316163171631816319163201632116322163231632416325163261632716328163291633016331163321633316334163351633616337163381633916340163411634216343163441634516346163471634816349163501635116352163531635416355163561635716358163591636016361163621636316364163651636616367163681636916370163711637216373163741637516376163771637816379163801638116382163831638416385163861638716388163891639016391163921639316394163951639616397163981639916400164011640216403164041640516406164071640816409164101641116412164131641416415164161641716418164191642016421164221642316424164251642616427164281642916430164311643216433164341643516436164371643816439164401644116442164431644416445164461644716448164491645016451164521645316454164551645616457164581645916460164611646216463164641646516466164671646816469164701647116472164731647416475164761647716478164791648016481164821648316484164851648616487164881648916490164911649216493164941649516496164971649816499165001650116502165031650416505165061650716508165091651016511165121651316514165151651616517165181651916520165211652216523165241652516526165271652816529165301653116532165331653416535165361653716538165391654016541165421654316544165451654616547165481654916550165511655216553165541655516556165571655816559165601656116562165631656416565165661656716568165691657016571165721657316574165751657616577165781657916580165811658216583165841658516586165871658816589165901659116592165931659416595165961659716598165991660016601166021660316604166051660616607166081660916610166111661216613166141661516616166171661816619166201662116622166231662416625166261662716628166291663016631166321663316634166351663616637166381663916640166411664216643166441664516646166471664816649166501665116652166531665416655166561665716658166591666016661166621666316664166651666616667166681666916670166711667216673166741667516676166771667816679166801668116682166831668416685166861668716688166891669016691166921669316694166951669616697166981669916700167011670216703167041670516706167071670816709167101671116712167131671416715167161671716718167191672016721167221672316724167251672616727167281672916730167311673216733167341673516736167371673816739167401674116742167431674416745167461674716748167491675016751167521675316754167551675616757167581675916760167611676216763167641676516766167671676816769167701677116772167731677416775167761677716778167791678016781167821678316784167851678616787167881678916790167911679216793167941679516796167971679816799168001680116802168031680416805168061680716808168091681016811168121681316814168151681616817168181681916820168211682216823168241682516826168271682816829168301683116832168331683416835168361683716838168391684016841168421684316844168451684616847168481684916850168511685216853168541685516856168571685816859168601686116862168631686416865168661686716868168691687016871168721687316874168751687616877168781687916880168811688216883168841688516886168871688816889168901689116892168931689416895168961689716898168991690016901169021690316904169051690616907169081690916910169111691216913169141691516916169171691816919169201692116922169231692416925169261692716928169291693016931169321693316934169351693616937169381693916940169411694216943169441694516946169471694816949169501695116952169531695416955169561695716958169591696016961169621696316964169651696616967169681696916970169711697216973169741697516976169771697816979169801698116982169831698416985169861698716988169891699016991169921699316994169951699616997169981699917000170011700217003170041700517006170071700817009170101701117012170131701417015170161701717018170191702017021170221702317024170251702617027170281702917030170311703217033170341703517036170371703817039170401704117042170431704417045170461704717048170491705017051170521705317054170551705617057170581705917060170611706217063170641706517066170671706817069170701707117072170731707417075170761707717078170791708017081170821708317084170851708617087170881708917090170911709217093170941709517096170971709817099171001710117102171031710417105171061710717108171091711017111171121711317114171151711617117171181711917120171211712217123171241712517126171271712817129171301713117132171331713417135171361713717138171391714017141171421714317144171451714617147171481714917150171511715217153171541715517156171571715817159171601716117162171631716417165171661716717168171691717017171171721717317174171751717617177171781717917180171811718217183171841718517186171871718817189171901719117192171931719417195171961719717198171991720017201172021720317204172051720617207172081720917210172111721217213172141721517216172171721817219172201722117222172231722417225172261722717228172291723017231172321723317234172351723617237172381723917240172411724217243172441724517246172471724817249172501725117252172531725417255172561725717258172591726017261172621726317264172651726617267172681726917270172711727217273172741727517276172771727817279172801728117282172831728417285172861728717288172891729017291172921729317294172951729617297172981729917300173011730217303173041730517306173071730817309173101731117312173131731417315173161731717318173191732017321173221732317324173251732617327173281732917330173311733217333173341733517336173371733817339173401734117342173431734417345173461734717348173491735017351173521735317354173551735617357173581735917360173611736217363173641736517366173671736817369173701737117372173731737417375173761737717378173791738017381173821738317384173851738617387173881738917390173911739217393173941739517396173971739817399174001740117402174031740417405174061740717408174091741017411174121741317414174151741617417174181741917420174211742217423174241742517426174271742817429174301743117432174331743417435174361743717438174391744017441174421744317444174451744617447174481744917450174511745217453174541745517456174571745817459174601746117462174631746417465174661746717468174691747017471174721747317474174751747617477174781747917480174811748217483174841748517486174871748817489174901749117492174931749417495174961749717498174991750017501175021750317504175051750617507175081750917510175111751217513175141751517516175171751817519175201752117522175231752417525175261752717528175291753017531175321753317534175351753617537175381753917540175411754217543175441754517546175471754817549175501755117552175531755417555175561755717558175591756017561175621756317564175651756617567175681756917570175711757217573175741757517576175771757817579175801758117582175831758417585175861758717588175891759017591175921759317594175951759617597175981759917600176011760217603176041760517606176071760817609176101761117612176131761417615176161761717618176191762017621176221762317624176251762617627176281762917630176311763217633176341763517636176371763817639176401764117642176431764417645176461764717648176491765017651176521765317654176551765617657176581765917660176611766217663176641766517666176671766817669176701767117672176731767417675176761767717678176791768017681176821768317684176851768617687176881768917690176911769217693176941769517696176971769817699177001770117702177031770417705177061770717708177091771017711177121771317714177151771617717177181771917720177211772217723177241772517726177271772817729177301773117732177331773417735177361773717738177391774017741177421774317744177451774617747177481774917750177511775217753177541775517756177571775817759177601776117762177631776417765177661776717768177691777017771177721777317774177751777617777177781777917780177811778217783177841778517786177871778817789177901779117792177931779417795177961779717798177991780017801178021780317804178051780617807178081780917810178111781217813178141781517816178171781817819178201782117822178231782417825178261782717828178291783017831178321783317834178351783617837178381783917840178411784217843178441784517846178471784817849178501785117852178531785417855178561785717858178591786017861178621786317864178651786617867178681786917870178711787217873178741787517876178771787817879178801788117882178831788417885178861788717888178891789017891178921789317894178951789617897178981789917900179011790217903179041790517906179071790817909179101791117912179131791417915179161791717918179191792017921179221792317924179251792617927179281792917930179311793217933179341793517936179371793817939179401794117942179431794417945179461794717948179491795017951179521795317954179551795617957179581795917960179611796217963179641796517966179671796817969179701797117972179731797417975179761797717978179791798017981179821798317984179851798617987179881798917990179911799217993179941799517996179971799817999180001800118002180031800418005180061800718008180091801018011180121801318014180151801618017180181801918020180211802218023180241802518026180271802818029180301803118032180331803418035180361803718038180391804018041180421804318044180451804618047180481804918050180511805218053180541805518056180571805818059180601806118062180631806418065180661806718068180691807018071180721807318074180751807618077180781807918080180811808218083180841808518086180871808818089180901809118092180931809418095180961809718098180991810018101181021810318104181051810618107181081810918110181111811218113181141811518116181171811818119181201812118122181231812418125181261812718128181291813018131181321813318134181351813618137181381813918140181411814218143181441814518146181471814818149181501815118152181531815418155181561815718158181591816018161181621816318164181651816618167181681816918170181711817218173181741817518176181771817818179181801818118182181831818418185181861818718188181891819018191181921819318194181951819618197181981819918200182011820218203182041820518206182071820818209182101821118212182131821418215182161821718218182191822018221182221822318224182251822618227182281822918230182311823218233182341823518236182371823818239182401824118242182431824418245182461824718248182491825018251182521825318254182551825618257182581825918260182611826218263182641826518266182671826818269182701827118272182731827418275182761827718278182791828018281182821828318284182851828618287182881828918290182911829218293182941829518296182971829818299183001830118302183031830418305183061830718308183091831018311183121831318314183151831618317183181831918320183211832218323183241832518326183271832818329183301833118332183331833418335183361833718338183391834018341183421834318344183451834618347183481834918350183511835218353183541835518356183571835818359183601836118362183631836418365183661836718368183691837018371183721837318374183751837618377183781837918380183811838218383183841838518386183871838818389183901839118392183931839418395183961839718398183991840018401184021840318404184051840618407184081840918410184111841218413184141841518416184171841818419184201842118422184231842418425184261842718428184291843018431184321843318434184351843618437184381843918440184411844218443184441844518446184471844818449184501845118452184531845418455184561845718458184591846018461184621846318464184651846618467184681846918470184711847218473184741847518476184771847818479184801848118482184831848418485184861848718488184891849018491184921849318494184951849618497184981849918500185011850218503185041850518506185071850818509185101851118512185131851418515185161851718518185191852018521185221852318524185251852618527185281852918530185311853218533185341853518536185371853818539185401854118542185431854418545185461854718548185491855018551185521855318554185551855618557185581855918560185611856218563185641856518566185671856818569185701857118572185731857418575185761857718578185791858018581185821858318584185851858618587185881858918590185911859218593185941859518596185971859818599186001860118602186031860418605186061860718608186091861018611186121861318614186151861618617186181861918620186211862218623186241862518626186271862818629186301863118632186331863418635186361863718638186391864018641186421864318644186451864618647186481864918650186511865218653186541865518656186571865818659186601866118662186631866418665186661866718668186691867018671186721867318674186751867618677186781867918680186811868218683186841868518686186871868818689186901869118692186931869418695186961869718698186991870018701187021870318704187051870618707187081870918710187111871218713187141871518716187171871818719187201872118722187231872418725187261872718728187291873018731187321873318734187351873618737187381873918740187411874218743187441874518746187471874818749187501875118752187531875418755187561875718758187591876018761187621876318764187651876618767187681876918770187711877218773187741877518776187771877818779187801878118782187831878418785187861878718788187891879018791187921879318794187951879618797187981879918800188011880218803188041880518806188071880818809188101881118812188131881418815188161881718818188191882018821188221882318824188251882618827188281882918830188311883218833188341883518836188371883818839188401884118842188431884418845188461884718848188491885018851188521885318854188551885618857188581885918860188611886218863188641886518866188671886818869188701887118872188731887418875188761887718878188791888018881188821888318884188851888618887188881888918890188911889218893188941889518896188971889818899189001890118902189031890418905189061890718908189091891018911189121891318914189151891618917189181891918920189211892218923189241892518926189271892818929189301893118932189331893418935189361893718938189391894018941189421894318944189451894618947189481894918950189511895218953189541895518956189571895818959189601896118962189631896418965189661896718968189691897018971189721897318974189751897618977189781897918980189811898218983189841898518986189871898818989189901899118992189931899418995189961899718998189991900019001190021900319004190051900619007190081900919010190111901219013190141901519016190171901819019190201902119022190231902419025190261902719028190291903019031190321903319034190351903619037190381903919040190411904219043190441904519046190471904819049190501905119052190531905419055190561905719058190591906019061190621906319064190651906619067190681906919070190711907219073190741907519076190771907819079190801908119082190831908419085190861908719088190891909019091190921909319094190951909619097190981909919100191011910219103191041910519106191071910819109191101911119112191131911419115191161911719118191191912019121191221912319124191251912619127191281912919130191311913219133191341913519136191371913819139191401914119142191431914419145191461914719148191491915019151191521915319154191551915619157191581915919160191611916219163191641916519166191671916819169191701917119172191731917419175191761917719178191791918019181191821918319184191851918619187191881918919190191911919219193191941919519196191971919819199192001920119202192031920419205192061920719208192091921019211192121921319214192151921619217192181921919220192211922219223192241922519226192271922819229192301923119232192331923419235192361923719238192391924019241192421924319244192451924619247192481924919250192511925219253192541925519256192571925819259192601926119262192631926419265192661926719268192691927019271192721927319274192751927619277192781927919280192811928219283192841928519286192871928819289192901929119292192931929419295192961929719298192991930019301193021930319304193051930619307193081930919310193111931219313193141931519316193171931819319193201932119322193231932419325193261932719328193291933019331193321933319334193351933619337193381933919340193411934219343193441934519346193471934819349193501935119352193531935419355193561935719358193591936019361193621936319364193651936619367193681936919370193711937219373193741937519376193771937819379193801938119382193831938419385193861938719388193891939019391193921939319394193951939619397193981939919400194011940219403194041940519406194071940819409194101941119412194131941419415194161941719418194191942019421194221942319424194251942619427194281942919430194311943219433194341943519436194371943819439194401944119442194431944419445194461944719448194491945019451194521945319454194551945619457194581945919460194611946219463194641946519466194671946819469194701947119472194731947419475194761947719478194791948019481194821948319484194851948619487194881948919490194911949219493194941949519496194971949819499195001950119502195031950419505195061950719508195091951019511195121951319514195151951619517195181951919520195211952219523195241952519526195271952819529195301953119532195331953419535195361953719538195391954019541195421954319544195451954619547195481954919550195511955219553195541955519556195571955819559195601956119562195631956419565195661956719568195691957019571195721957319574195751957619577195781957919580195811958219583195841958519586195871958819589195901959119592195931959419595195961959719598195991960019601196021960319604196051960619607196081960919610196111961219613196141961519616196171961819619196201962119622196231962419625196261962719628196291963019631196321963319634196351963619637196381963919640196411964219643196441964519646196471964819649196501965119652196531965419655196561965719658196591966019661196621966319664196651966619667196681966919670196711967219673196741967519676196771967819679196801968119682196831968419685196861968719688196891969019691196921969319694196951969619697196981969919700197011970219703197041970519706197071970819709197101971119712197131971419715197161971719718197191972019721197221972319724197251972619727197281972919730197311973219733197341973519736197371973819739197401974119742197431974419745197461974719748197491975019751197521975319754197551975619757197581975919760197611976219763197641976519766197671976819769197701977119772197731977419775197761977719778197791978019781197821978319784197851978619787197881978919790197911979219793197941979519796197971979819799198001980119802198031980419805198061980719808198091981019811198121981319814198151981619817198181981919820198211982219823198241982519826198271982819829198301983119832198331983419835198361983719838198391984019841198421984319844198451984619847198481984919850198511985219853198541985519856198571985819859198601986119862198631986419865198661986719868198691987019871198721987319874198751987619877198781987919880198811988219883198841988519886198871988819889198901989119892198931989419895198961989719898198991990019901199021990319904199051990619907199081990919910199111991219913199141991519916199171991819919199201992119922199231992419925199261992719928199291993019931199321993319934199351993619937199381993919940199411994219943199441994519946199471994819949199501995119952199531995419955199561995719958199591996019961199621996319964199651996619967199681996919970199711997219973199741997519976199771997819979199801998119982199831998419985199861998719988199891999019991199921999319994199951999619997199981999920000200012000220003200042000520006200072000820009200102001120012200132001420015200162001720018200192002020021200222002320024200252002620027200282002920030200312003220033200342003520036200372003820039200402004120042200432004420045200462004720048200492005020051200522005320054200552005620057200582005920060200612006220063200642006520066200672006820069200702007120072200732007420075200762007720078200792008020081200822008320084200852008620087200882008920090200912009220093200942009520096200972009820099201002010120102201032010420105201062010720108201092011020111201122011320114201152011620117201182011920120201212012220123201242012520126201272012820129201302013120132201332013420135201362013720138201392014020141201422014320144201452014620147201482014920150201512015220153201542015520156201572015820159201602016120162201632016420165201662016720168201692017020171201722017320174201752017620177201782017920180201812018220183201842018520186201872018820189201902019120192201932019420195201962019720198201992020020201202022020320204202052020620207202082020920210202112021220213202142021520216202172021820219202202022120222202232022420225202262022720228202292023020231202322023320234202352023620237202382023920240202412024220243202442024520246202472024820249202502025120252202532025420255202562025720258202592026020261202622026320264202652026620267202682026920270202712027220273202742027520276202772027820279202802028120282202832028420285202862028720288202892029020291202922029320294202952029620297202982029920300203012030220303203042030520306203072030820309203102031120312203132031420315203162031720318203192032020321203222032320324203252032620327203282032920330203312033220333203342033520336203372033820339203402034120342203432034420345203462034720348203492035020351203522035320354203552035620357203582035920360203612036220363203642036520366203672036820369203702037120372203732037420375203762037720378203792038020381203822038320384203852038620387203882038920390203912039220393203942039520396203972039820399204002040120402204032040420405204062040720408204092041020411204122041320414204152041620417204182041920420204212042220423204242042520426204272042820429204302043120432204332043420435204362043720438204392044020441204422044320444204452044620447204482044920450204512045220453204542045520456204572045820459204602046120462204632046420465204662046720468204692047020471204722047320474204752047620477204782047920480204812048220483204842048520486204872048820489204902049120492204932049420495204962049720498204992050020501205022050320504205052050620507205082050920510205112051220513205142051520516205172051820519205202052120522205232052420525205262052720528205292053020531205322053320534205352053620537205382053920540205412054220543205442054520546205472054820549205502055120552205532055420555205562055720558205592056020561205622056320564205652056620567205682056920570205712057220573205742057520576205772057820579205802058120582205832058420585205862058720588205892059020591205922059320594205952059620597205982059920600206012060220603206042060520606206072060820609206102061120612206132061420615206162061720618206192062020621206222062320624206252062620627206282062920630206312063220633206342063520636206372063820639206402064120642206432064420645206462064720648206492065020651206522065320654206552065620657206582065920660206612066220663206642066520666206672066820669206702067120672206732067420675206762067720678206792068020681206822068320684206852068620687206882068920690206912069220693206942069520696206972069820699207002070120702207032070420705207062070720708207092071020711207122071320714207152071620717207182071920720207212072220723207242072520726207272072820729207302073120732207332073420735207362073720738207392074020741207422074320744207452074620747207482074920750207512075220753207542075520756207572075820759207602076120762207632076420765207662076720768207692077020771207722077320774207752077620777207782077920780207812078220783207842078520786207872078820789207902079120792207932079420795207962079720798207992080020801208022080320804208052080620807208082080920810208112081220813208142081520816208172081820819208202082120822208232082420825208262082720828208292083020831208322083320834208352083620837208382083920840208412084220843208442084520846208472084820849208502085120852208532085420855208562085720858208592086020861208622086320864208652086620867208682086920870208712087220873208742087520876208772087820879208802088120882208832088420885208862088720888208892089020891208922089320894208952089620897208982089920900209012090220903209042090520906209072090820909209102091120912209132091420915209162091720918209192092020921209222092320924209252092620927209282092920930209312093220933209342093520936209372093820939209402094120942209432094420945209462094720948209492095020951209522095320954209552095620957209582095920960209612096220963209642096520966209672096820969209702097120972209732097420975209762097720978209792098020981209822098320984209852098620987209882098920990209912099220993209942099520996209972099820999210002100121002210032100421005210062100721008210092101021011210122101321014210152101621017210182101921020210212102221023210242102521026210272102821029210302103121032210332103421035210362103721038210392104021041210422104321044210452104621047210482104921050210512105221053210542105521056210572105821059210602106121062210632106421065210662106721068210692107021071210722107321074210752107621077210782107921080210812108221083210842108521086210872108821089210902109121092210932109421095210962109721098210992110021101211022110321104211052110621107211082110921110211112111221113211142111521116211172111821119211202112121122211232112421125211262112721128211292113021131211322113321134211352113621137211382113921140211412114221143211442114521146211472114821149211502115121152211532115421155211562115721158211592116021161211622116321164211652116621167211682116921170211712117221173211742117521176211772117821179211802118121182211832118421185211862118721188211892119021191211922119321194211952119621197211982119921200212012120221203212042120521206212072120821209212102121121212212132121421215212162121721218212192122021221212222122321224212252122621227212282122921230212312123221233212342123521236212372123821239212402124121242212432124421245212462124721248212492125021251212522125321254212552125621257212582125921260212612126221263212642126521266212672126821269212702127121272212732127421275212762127721278212792128021281212822128321284212852128621287212882128921290212912129221293212942129521296212972129821299213002130121302213032130421305213062130721308213092131021311213122131321314213152131621317213182131921320213212132221323213242132521326213272132821329213302133121332213332133421335213362133721338213392134021341213422134321344213452134621347213482134921350213512135221353213542135521356213572135821359213602136121362213632136421365213662136721368213692137021371213722137321374213752137621377213782137921380213812138221383213842138521386213872138821389213902139121392213932139421395213962139721398213992140021401214022140321404214052140621407214082140921410214112141221413214142141521416214172141821419214202142121422214232142421425214262142721428214292143021431214322143321434214352143621437214382143921440214412144221443214442144521446214472144821449214502145121452214532145421455214562145721458214592146021461214622146321464214652146621467214682146921470214712147221473214742147521476214772147821479214802148121482214832148421485214862148721488214892149021491214922149321494214952149621497214982149921500215012150221503215042150521506215072150821509215102151121512215132151421515215162151721518215192152021521215222152321524215252152621527215282152921530215312153221533215342153521536215372153821539215402154121542215432154421545215462154721548215492155021551215522155321554215552155621557215582155921560215612156221563215642156521566215672156821569215702157121572215732157421575215762157721578215792158021581215822158321584215852158621587215882158921590215912159221593215942159521596215972159821599216002160121602216032160421605216062160721608216092161021611216122161321614216152161621617216182161921620216212162221623216242162521626216272162821629216302163121632216332163421635216362163721638216392164021641216422164321644216452164621647216482164921650216512165221653216542165521656216572165821659216602166121662216632166421665216662166721668216692167021671216722167321674216752167621677216782167921680216812168221683216842168521686216872168821689216902169121692216932169421695216962169721698216992170021701217022170321704217052170621707217082170921710217112171221713217142171521716217172171821719217202172121722217232172421725217262172721728217292173021731217322173321734217352173621737217382173921740217412174221743217442174521746217472174821749217502175121752217532175421755217562175721758217592176021761217622176321764217652176621767217682176921770217712177221773217742177521776217772177821779217802178121782217832178421785217862178721788217892179021791217922179321794217952179621797217982179921800218012180221803218042180521806218072180821809218102181121812218132181421815218162181721818218192182021821218222182321824218252182621827218282182921830218312183221833218342183521836218372183821839218402184121842218432184421845218462184721848218492185021851218522185321854218552185621857218582185921860218612186221863218642186521866218672186821869218702187121872218732187421875218762187721878218792188021881218822188321884218852188621887218882188921890218912189221893218942189521896218972189821899219002190121902219032190421905219062190721908219092191021911219122191321914219152191621917219182191921920219212192221923219242192521926219272192821929219302193121932219332193421935219362193721938219392194021941219422194321944219452194621947219482194921950219512195221953219542195521956219572195821959219602196121962219632196421965219662196721968219692197021971219722197321974219752197621977219782197921980219812198221983219842198521986219872198821989219902199121992219932199421995219962199721998219992200022001220022200322004220052200622007220082200922010220112201222013220142201522016220172201822019220202202122022220232202422025220262202722028220292203022031220322203322034220352203622037220382203922040220412204222043220442204522046220472204822049220502205122052220532205422055220562205722058220592206022061220622206322064220652206622067220682206922070220712207222073220742207522076220772207822079220802208122082220832208422085220862208722088220892209022091220922209322094220952209622097220982209922100221012210222103221042210522106221072210822109221102211122112221132211422115221162211722118221192212022121221222212322124221252212622127221282212922130221312213222133221342213522136221372213822139221402214122142221432214422145221462214722148221492215022151221522215322154221552215622157221582215922160221612216222163221642216522166221672216822169221702217122172221732217422175221762217722178221792218022181221822218322184221852218622187221882218922190221912219222193221942219522196221972219822199222002220122202222032220422205222062220722208222092221022211222122221322214222152221622217222182221922220222212222222223222242222522226222272222822229222302223122232222332223422235222362223722238222392224022241222422224322244222452224622247222482224922250222512225222253222542225522256222572225822259222602226122262222632226422265222662226722268222692227022271222722227322274222752227622277222782227922280222812228222283222842228522286222872228822289222902229122292222932229422295222962229722298222992230022301223022230322304223052230622307223082230922310223112231222313223142231522316223172231822319223202232122322223232232422325223262232722328223292233022331223322233322334223352233622337223382233922340223412234222343223442234522346223472234822349223502235122352223532235422355223562235722358223592236022361223622236322364223652236622367223682236922370223712237222373223742237522376223772237822379223802238122382223832238422385223862238722388223892239022391223922239322394223952239622397223982239922400224012240222403224042240522406224072240822409224102241122412224132241422415224162241722418224192242022421224222242322424224252242622427224282242922430224312243222433224342243522436224372243822439224402244122442224432244422445224462244722448224492245022451224522245322454224552245622457224582245922460224612246222463224642246522466224672246822469224702247122472224732247422475224762247722478224792248022481224822248322484224852248622487224882248922490224912249222493224942249522496224972249822499225002250122502225032250422505225062250722508225092251022511225122251322514225152251622517225182251922520225212252222523225242252522526225272252822529225302253122532225332253422535225362253722538225392254022541225422254322544225452254622547225482254922550225512255222553225542255522556225572255822559225602256122562225632256422565225662256722568225692257022571225722257322574225752257622577225782257922580225812258222583225842258522586225872258822589225902259122592225932259422595225962259722598225992260022601226022260322604226052260622607226082260922610226112261222613226142261522616226172261822619226202262122622226232262422625226262262722628226292263022631226322263322634226352263622637226382263922640226412264222643226442264522646226472264822649226502265122652226532265422655226562265722658226592266022661226622266322664226652266622667226682266922670226712267222673226742267522676226772267822679226802268122682226832268422685226862268722688226892269022691226922269322694226952269622697226982269922700227012270222703227042270522706227072270822709227102271122712227132271422715227162271722718227192272022721227222272322724227252272622727227282272922730227312273222733227342273522736227372273822739227402274122742227432274422745227462274722748227492275022751227522275322754227552275622757227582275922760227612276222763227642276522766227672276822769227702277122772227732277422775227762277722778227792278022781227822278322784227852278622787227882278922790227912279222793227942279522796227972279822799228002280122802228032280422805228062280722808228092281022811228122281322814228152281622817228182281922820228212282222823228242282522826228272282822829228302283122832228332283422835228362283722838228392284022841228422284322844228452284622847228482284922850228512285222853228542285522856228572285822859228602286122862228632286422865228662286722868228692287022871228722287322874228752287622877228782287922880228812288222883228842288522886228872288822889228902289122892228932289422895228962289722898228992290022901229022290322904229052290622907229082290922910229112291222913229142291522916229172291822919229202292122922229232292422925229262292722928229292293022931229322293322934229352293622937229382293922940229412294222943229442294522946229472294822949229502295122952229532295422955229562295722958229592296022961229622296322964229652296622967229682296922970229712297222973229742297522976229772297822979229802298122982229832298422985229862298722988229892299022991229922299322994229952299622997229982299923000230012300223003230042300523006230072300823009230102301123012230132301423015230162301723018230192302023021230222302323024230252302623027230282302923030230312303223033230342303523036230372303823039230402304123042230432304423045230462304723048230492305023051230522305323054230552305623057230582305923060230612306223063230642306523066230672306823069230702307123072230732307423075230762307723078230792308023081230822308323084230852308623087230882308923090230912309223093230942309523096230972309823099231002310123102231032310423105231062310723108231092311023111231122311323114231152311623117231182311923120231212312223123231242312523126231272312823129231302313123132231332313423135231362313723138231392314023141231422314323144231452314623147231482314923150231512315223153231542315523156231572315823159231602316123162231632316423165231662316723168231692317023171231722317323174231752317623177231782317923180231812318223183231842318523186231872318823189231902319123192231932319423195231962319723198231992320023201232022320323204232052320623207232082320923210232112321223213232142321523216232172321823219232202322123222232232322423225232262322723228232292323023231232322323323234232352323623237232382323923240232412324223243232442324523246232472324823249232502325123252232532325423255232562325723258232592326023261232622326323264232652326623267232682326923270232712327223273232742327523276232772327823279232802328123282232832328423285232862328723288232892329023291232922329323294232952329623297232982329923300233012330223303233042330523306233072330823309233102331123312233132331423315233162331723318233192332023321233222332323324233252332623327233282332923330233312333223333233342333523336233372333823339233402334123342233432334423345233462334723348233492335023351233522335323354233552335623357233582335923360233612336223363233642336523366233672336823369233702337123372233732337423375233762337723378233792338023381233822338323384233852338623387233882338923390233912339223393233942339523396233972339823399234002340123402234032340423405234062340723408234092341023411234122341323414234152341623417234182341923420234212342223423234242342523426234272342823429234302343123432234332343423435234362343723438234392344023441234422344323444234452344623447234482344923450234512345223453234542345523456234572345823459234602346123462234632346423465234662346723468234692347023471234722347323474234752347623477234782347923480234812348223483234842348523486234872348823489234902349123492234932349423495234962349723498234992350023501235022350323504235052350623507235082350923510235112351223513235142351523516235172351823519235202352123522235232352423525235262352723528235292353023531235322353323534235352353623537235382353923540235412354223543235442354523546235472354823549235502355123552235532355423555235562355723558235592356023561235622356323564235652356623567235682356923570235712357223573235742357523576235772357823579235802358123582235832358423585235862358723588235892359023591235922359323594235952359623597235982359923600236012360223603236042360523606236072360823609236102361123612236132361423615236162361723618236192362023621236222362323624236252362623627236282362923630236312363223633236342363523636236372363823639236402364123642236432364423645236462364723648236492365023651236522365323654236552365623657236582365923660236612366223663236642366523666236672366823669236702367123672236732367423675236762367723678236792368023681236822368323684236852368623687236882368923690236912369223693236942369523696236972369823699237002370123702237032370423705237062370723708237092371023711237122371323714237152371623717237182371923720237212372223723237242372523726237272372823729237302373123732237332373423735237362373723738237392374023741237422374323744237452374623747237482374923750237512375223753237542375523756237572375823759237602376123762237632376423765237662376723768237692377023771237722377323774237752377623777237782377923780237812378223783237842378523786237872378823789237902379123792237932379423795237962379723798237992380023801238022380323804238052380623807238082380923810238112381223813238142381523816238172381823819238202382123822238232382423825238262382723828238292383023831238322383323834238352383623837238382383923840238412384223843238442384523846238472384823849238502385123852238532385423855238562385723858238592386023861238622386323864238652386623867238682386923870238712387223873238742387523876238772387823879238802388123882238832388423885238862388723888238892389023891238922389323894238952389623897238982389923900239012390223903239042390523906239072390823909239102391123912239132391423915239162391723918239192392023921239222392323924239252392623927239282392923930239312393223933239342393523936239372393823939239402394123942239432394423945239462394723948239492395023951239522395323954239552395623957239582395923960239612396223963239642396523966239672396823969239702397123972239732397423975239762397723978239792398023981239822398323984239852398623987239882398923990239912399223993239942399523996239972399823999240002400124002240032400424005240062400724008240092401024011240122401324014240152401624017240182401924020240212402224023240242402524026240272402824029240302403124032240332403424035240362403724038240392404024041240422404324044240452404624047240482404924050240512405224053240542405524056240572405824059240602406124062240632406424065240662406724068240692407024071240722407324074240752407624077240782407924080240812408224083240842408524086240872408824089240902409124092240932409424095240962409724098240992410024101241022410324104241052410624107241082410924110241112411224113241142411524116241172411824119241202412124122241232412424125241262412724128241292413024131241322413324134241352413624137241382413924140241412414224143241442414524146241472414824149241502415124152241532415424155241562415724158241592416024161241622416324164241652416624167241682416924170241712417224173241742417524176241772417824179241802418124182241832418424185241862418724188241892419024191241922419324194241952419624197241982419924200242012420224203242042420524206242072420824209242102421124212242132421424215242162421724218242192422024221242222422324224242252422624227242282422924230242312423224233242342423524236242372423824239242402424124242242432424424245242462424724248242492425024251242522425324254242552425624257242582425924260242612426224263242642426524266242672426824269242702427124272242732427424275242762427724278242792428024281242822428324284242852428624287242882428924290242912429224293242942429524296242972429824299243002430124302243032430424305243062430724308243092431024311243122431324314243152431624317243182431924320243212432224323243242432524326243272432824329243302433124332243332433424335243362433724338243392434024341243422434324344243452434624347243482434924350243512435224353243542435524356243572435824359243602436124362243632436424365243662436724368243692437024371243722437324374243752437624377243782437924380243812438224383243842438524386243872438824389243902439124392243932439424395243962439724398243992440024401244022440324404244052440624407244082440924410244112441224413244142441524416244172441824419244202442124422244232442424425244262442724428244292443024431244322443324434244352443624437244382443924440244412444224443244442444524446244472444824449244502445124452244532445424455244562445724458244592446024461244622446324464244652446624467244682446924470244712447224473244742447524476244772447824479244802448124482244832448424485244862448724488244892449024491244922449324494244952449624497244982449924500245012450224503245042450524506245072450824509245102451124512245132451424515245162451724518245192452024521245222452324524245252452624527245282452924530245312453224533245342453524536245372453824539245402454124542245432454424545245462454724548245492455024551245522455324554245552455624557245582455924560245612456224563245642456524566245672456824569245702457124572245732457424575245762457724578245792458024581245822458324584245852458624587245882458924590245912459224593245942459524596245972459824599246002460124602246032460424605246062460724608246092461024611246122461324614246152461624617246182461924620246212462224623246242462524626246272462824629246302463124632246332463424635246362463724638246392464024641246422464324644246452464624647246482464924650246512465224653246542465524656246572465824659246602466124662246632466424665246662466724668246692467024671246722467324674246752467624677246782467924680246812468224683246842468524686246872468824689246902469124692246932469424695246962469724698246992470024701247022470324704247052470624707247082470924710247112471224713247142471524716247172471824719247202472124722247232472424725247262472724728247292473024731247322473324734247352473624737247382473924740247412474224743247442474524746247472474824749247502475124752247532475424755247562475724758247592476024761247622476324764247652476624767247682476924770247712477224773247742477524776247772477824779247802478124782247832478424785247862478724788247892479024791247922479324794247952479624797247982479924800248012480224803248042480524806248072480824809248102481124812248132481424815248162481724818248192482024821248222482324824248252482624827248282482924830248312483224833248342483524836248372483824839248402484124842248432484424845248462484724848248492485024851248522485324854248552485624857248582485924860248612486224863248642486524866248672486824869248702487124872248732487424875248762487724878248792488024881248822488324884248852488624887248882488924890248912489224893248942489524896248972489824899249002490124902249032490424905249062490724908249092491024911249122491324914249152491624917249182491924920249212492224923249242492524926249272492824929249302493124932249332493424935249362493724938249392494024941249422494324944249452494624947249482494924950249512495224953249542495524956249572495824959249602496124962249632496424965249662496724968249692497024971249722497324974249752497624977249782497924980249812498224983249842498524986249872498824989249902499124992249932499424995249962499724998249992500025001250022500325004250052500625007250082500925010250112501225013250142501525016250172501825019250202502125022250232502425025250262502725028250292503025031250322503325034250352503625037250382503925040250412504225043250442504525046250472504825049250502505125052250532505425055250562505725058250592506025061250622506325064250652506625067250682506925070250712507225073250742507525076250772507825079250802508125082250832508425085250862508725088250892509025091250922509325094250952509625097250982509925100251012510225103251042510525106251072510825109251102511125112251132511425115251162511725118251192512025121251222512325124251252512625127251282512925130251312513225133251342513525136251372513825139251402514125142251432514425145251462514725148251492515025151251522515325154251552515625157251582515925160251612516225163251642516525166251672516825169251702517125172251732517425175251762517725178251792518025181251822518325184251852518625187251882518925190251912519225193251942519525196251972519825199252002520125202252032520425205252062520725208252092521025211252122521325214252152521625217252182521925220252212522225223252242522525226252272522825229252302523125232252332523425235252362523725238252392524025241252422524325244252452524625247252482524925250252512525225253252542525525256252572525825259252602526125262252632526425265252662526725268252692527025271252722527325274252752527625277252782527925280252812528225283252842528525286252872528825289252902529125292252932529425295252962529725298252992530025301253022530325304253052530625307253082530925310253112531225313253142531525316253172531825319253202532125322253232532425325253262532725328253292533025331253322533325334253352533625337253382533925340253412534225343253442534525346253472534825349253502535125352253532535425355253562535725358253592536025361253622536325364253652536625367253682536925370253712537225373253742537525376253772537825379253802538125382253832538425385253862538725388253892539025391253922539325394253952539625397253982539925400254012540225403254042540525406254072540825409254102541125412254132541425415254162541725418254192542025421254222542325424254252542625427254282542925430254312543225433254342543525436254372543825439254402544125442254432544425445254462544725448254492545025451254522545325454254552545625457254582545925460254612546225463254642546525466254672546825469254702547125472254732547425475254762547725478254792548025481254822548325484254852548625487254882548925490254912549225493254942549525496254972549825499255002550125502255032550425505255062550725508255092551025511255122551325514255152551625517255182551925520255212552225523255242552525526255272552825529255302553125532255332553425535255362553725538255392554025541255422554325544255452554625547255482554925550255512555225553255542555525556255572555825559255602556125562255632556425565255662556725568255692557025571255722557325574255752557625577255782557925580255812558225583255842558525586255872558825589255902559125592255932559425595255962559725598255992560025601256022560325604256052560625607256082560925610256112561225613256142561525616256172561825619256202562125622256232562425625256262562725628256292563025631256322563325634256352563625637256382563925640256412564225643256442564525646256472564825649256502565125652256532565425655256562565725658256592566025661256622566325664256652566625667256682566925670256712567225673256742567525676256772567825679256802568125682256832568425685256862568725688256892569025691256922569325694256952569625697256982569925700257012570225703257042570525706257072570825709257102571125712257132571425715257162571725718257192572025721257222572325724257252572625727257282572925730257312573225733257342573525736257372573825739257402574125742257432574425745257462574725748257492575025751257522575325754257552575625757257582575925760257612576225763257642576525766257672576825769257702577125772257732577425775257762577725778257792578025781257822578325784257852578625787257882578925790257912579225793257942579525796257972579825799258002580125802258032580425805258062580725808258092581025811258122581325814258152581625817258182581925820258212582225823258242582525826258272582825829258302583125832258332583425835258362583725838258392584025841258422584325844258452584625847258482584925850258512585225853258542585525856258572585825859258602586125862258632586425865258662586725868258692587025871258722587325874258752587625877258782587925880258812588225883258842588525886258872588825889258902589125892258932589425895258962589725898258992590025901259022590325904259052590625907259082590925910259112591225913259142591525916259172591825919259202592125922259232592425925259262592725928259292593025931259322593325934259352593625937259382593925940259412594225943259442594525946259472594825949259502595125952259532595425955259562595725958259592596025961259622596325964259652596625967259682596925970259712597225973259742597525976259772597825979259802598125982259832598425985259862598725988259892599025991259922599325994259952599625997259982599926000260012600226003260042600526006260072600826009260102601126012260132601426015260162601726018260192602026021260222602326024260252602626027260282602926030260312603226033260342603526036260372603826039260402604126042260432604426045260462604726048260492605026051260522605326054260552605626057260582605926060260612606226063260642606526066260672606826069260702607126072260732607426075260762607726078260792608026081260822608326084260852608626087260882608926090260912609226093260942609526096260972609826099261002610126102261032610426105261062610726108261092611026111261122611326114261152611626117261182611926120261212612226123261242612526126261272612826129261302613126132261332613426135261362613726138261392614026141261422614326144261452614626147261482614926150261512615226153261542615526156261572615826159261602616126162261632616426165261662616726168261692617026171261722617326174261752617626177261782617926180261812618226183261842618526186261872618826189261902619126192261932619426195261962619726198261992620026201262022620326204262052620626207262082620926210262112621226213262142621526216262172621826219262202622126222262232622426225262262622726228262292623026231262322623326234262352623626237262382623926240262412624226243262442624526246262472624826249262502625126252262532625426255262562625726258262592626026261262622626326264262652626626267262682626926270262712627226273262742627526276262772627826279262802628126282262832628426285262862628726288262892629026291262922629326294262952629626297262982629926300263012630226303263042630526306263072630826309263102631126312263132631426315263162631726318263192632026321263222632326324263252632626327263282632926330263312633226333263342633526336263372633826339263402634126342263432634426345263462634726348263492635026351263522635326354263552635626357263582635926360263612636226363263642636526366263672636826369263702637126372263732637426375263762637726378263792638026381263822638326384263852638626387263882638926390263912639226393263942639526396263972639826399264002640126402264032640426405264062640726408264092641026411264122641326414264152641626417264182641926420264212642226423264242642526426264272642826429264302643126432264332643426435264362643726438264392644026441264422644326444264452644626447264482644926450264512645226453264542645526456264572645826459264602646126462264632646426465264662646726468264692647026471264722647326474264752647626477264782647926480264812648226483264842648526486264872648826489264902649126492264932649426495264962649726498264992650026501265022650326504265052650626507265082650926510265112651226513265142651526516265172651826519265202652126522265232652426525265262652726528265292653026531265322653326534265352653626537265382653926540265412654226543265442654526546265472654826549265502655126552265532655426555265562655726558265592656026561265622656326564265652656626567265682656926570265712657226573265742657526576265772657826579265802658126582265832658426585265862658726588265892659026591265922659326594265952659626597265982659926600266012660226603266042660526606266072660826609266102661126612266132661426615266162661726618266192662026621266222662326624266252662626627266282662926630266312663226633266342663526636266372663826639266402664126642266432664426645266462664726648266492665026651266522665326654266552665626657266582665926660266612666226663266642666526666266672666826669266702667126672266732667426675266762667726678266792668026681266822668326684266852668626687266882668926690266912669226693266942669526696266972669826699267002670126702267032670426705267062670726708267092671026711267122671326714267152671626717267182671926720267212672226723267242672526726267272672826729267302673126732267332673426735267362673726738267392674026741267422674326744267452674626747267482674926750267512675226753267542675526756267572675826759267602676126762267632676426765267662676726768267692677026771267722677326774267752677626777267782677926780267812678226783267842678526786267872678826789267902679126792267932679426795267962679726798267992680026801268022680326804268052680626807268082680926810268112681226813268142681526816268172681826819268202682126822268232682426825268262682726828268292683026831268322683326834268352683626837268382683926840268412684226843268442684526846268472684826849268502685126852268532685426855268562685726858268592686026861268622686326864268652686626867268682686926870268712687226873268742687526876268772687826879268802688126882268832688426885268862688726888268892689026891268922689326894268952689626897268982689926900269012690226903269042690526906269072690826909269102691126912269132691426915269162691726918269192692026921269222692326924269252692626927269282692926930269312693226933269342693526936269372693826939269402694126942269432694426945269462694726948269492695026951269522695326954269552695626957269582695926960269612696226963269642696526966269672696826969269702697126972269732697426975269762697726978269792698026981269822698326984269852698626987269882698926990269912699226993269942699526996269972699826999270002700127002270032700427005270062700727008270092701027011270122701327014270152701627017270182701927020270212702227023270242702527026270272702827029270302703127032270332703427035270362703727038270392704027041270422704327044270452704627047270482704927050270512705227053270542705527056270572705827059270602706127062270632706427065270662706727068270692707027071270722707327074270752707627077270782707927080270812708227083270842708527086270872708827089270902709127092270932709427095270962709727098270992710027101271022710327104271052710627107271082710927110271112711227113271142711527116271172711827119271202712127122271232712427125271262712727128271292713027131271322713327134271352713627137271382713927140271412714227143271442714527146271472714827149271502715127152271532715427155271562715727158271592716027161271622716327164271652716627167271682716927170271712717227173271742717527176271772717827179271802718127182271832718427185271862718727188271892719027191271922719327194271952719627197271982719927200272012720227203272042720527206272072720827209272102721127212272132721427215272162721727218272192722027221272222722327224272252722627227272282722927230272312723227233272342723527236272372723827239272402724127242272432724427245272462724727248272492725027251272522725327254272552725627257272582725927260272612726227263272642726527266272672726827269272702727127272272732727427275272762727727278272792728027281272822728327284272852728627287272882728927290272912729227293272942729527296272972729827299273002730127302273032730427305273062730727308273092731027311273122731327314273152731627317273182731927320273212732227323273242732527326273272732827329273302733127332273332733427335273362733727338273392734027341273422734327344273452734627347273482734927350273512735227353273542735527356273572735827359273602736127362273632736427365273662736727368273692737027371273722737327374273752737627377273782737927380273812738227383273842738527386273872738827389273902739127392273932739427395273962739727398273992740027401274022740327404274052740627407274082740927410274112741227413274142741527416274172741827419274202742127422274232742427425274262742727428274292743027431274322743327434274352743627437274382743927440274412744227443274442744527446274472744827449274502745127452274532745427455274562745727458274592746027461274622746327464274652746627467274682746927470274712747227473274742747527476274772747827479274802748127482274832748427485274862748727488274892749027491274922749327494274952749627497274982749927500275012750227503275042750527506275072750827509275102751127512275132751427515275162751727518275192752027521275222752327524275252752627527275282752927530275312753227533275342753527536275372753827539275402754127542275432754427545275462754727548275492755027551275522755327554275552755627557275582755927560275612756227563275642756527566275672756827569275702757127572275732757427575275762757727578275792758027581275822758327584275852758627587275882758927590275912759227593275942759527596275972759827599276002760127602276032760427605276062760727608276092761027611276122761327614276152761627617276182761927620276212762227623276242762527626276272762827629276302763127632276332763427635276362763727638276392764027641276422764327644276452764627647276482764927650276512765227653276542765527656276572765827659276602766127662276632766427665276662766727668276692767027671276722767327674276752767627677276782767927680276812768227683276842768527686276872768827689276902769127692276932769427695276962769727698276992770027701277022770327704277052770627707277082770927710277112771227713277142771527716277172771827719277202772127722277232772427725277262772727728277292773027731277322773327734277352773627737277382773927740277412774227743277442774527746277472774827749277502775127752277532775427755277562775727758277592776027761277622776327764277652776627767277682776927770277712777227773277742777527776277772777827779277802778127782277832778427785277862778727788277892779027791277922779327794277952779627797277982779927800278012780227803278042780527806278072780827809278102781127812278132781427815278162781727818278192782027821278222782327824278252782627827278282782927830278312783227833278342783527836278372783827839278402784127842278432784427845278462784727848278492785027851278522785327854278552785627857278582785927860278612786227863278642786527866278672786827869278702787127872278732787427875278762787727878278792788027881278822788327884278852788627887278882788927890278912789227893278942789527896278972789827899279002790127902279032790427905279062790727908279092791027911279122791327914279152791627917279182791927920279212792227923279242792527926279272792827929279302793127932279332793427935279362793727938279392794027941279422794327944279452794627947279482794927950279512795227953279542795527956279572795827959279602796127962279632796427965279662796727968279692797027971279722797327974279752797627977279782797927980279812798227983279842798527986279872798827989279902799127992279932799427995279962799727998279992800028001280022800328004280052800628007280082800928010280112801228013280142801528016280172801828019280202802128022280232802428025280262802728028280292803028031280322803328034280352803628037280382803928040280412804228043280442804528046280472804828049280502805128052280532805428055280562805728058280592806028061280622806328064280652806628067280682806928070280712807228073280742807528076280772807828079280802808128082280832808428085280862808728088280892809028091280922809328094280952809628097280982809928100281012810228103281042810528106281072810828109281102811128112281132811428115281162811728118281192812028121281222812328124281252812628127281282812928130281312813228133281342813528136281372813828139281402814128142281432814428145281462814728148281492815028151281522815328154281552815628157281582815928160281612816228163281642816528166281672816828169281702817128172281732817428175281762817728178281792818028181281822818328184281852818628187281882818928190281912819228193281942819528196281972819828199282002820128202282032820428205282062820728208282092821028211282122821328214282152821628217282182821928220282212822228223282242822528226282272822828229282302823128232282332823428235282362823728238282392824028241282422824328244282452824628247282482824928250282512825228253282542825528256282572825828259282602826128262282632826428265282662826728268282692827028271282722827328274282752827628277282782827928280282812828228283282842828528286282872828828289282902829128292282932829428295282962829728298282992830028301283022830328304283052830628307283082830928310283112831228313283142831528316283172831828319283202832128322283232832428325283262832728328283292833028331283322833328334283352833628337283382833928340283412834228343283442834528346283472834828349283502835128352283532835428355283562835728358283592836028361283622836328364283652836628367283682836928370283712837228373283742837528376283772837828379283802838128382283832838428385283862838728388283892839028391283922839328394283952839628397283982839928400284012840228403284042840528406284072840828409284102841128412284132841428415284162841728418284192842028421284222842328424284252842628427284282842928430284312843228433284342843528436284372843828439284402844128442284432844428445284462844728448284492845028451284522845328454284552845628457284582845928460284612846228463284642846528466284672846828469284702847128472284732847428475284762847728478284792848028481284822848328484284852848628487284882848928490284912849228493284942849528496284972849828499285002850128502285032850428505285062850728508285092851028511285122851328514285152851628517285182851928520285212852228523285242852528526285272852828529285302853128532285332853428535285362853728538285392854028541285422854328544285452854628547285482854928550285512855228553285542855528556285572855828559285602856128562285632856428565285662856728568285692857028571285722857328574285752857628577285782857928580285812858228583285842858528586285872858828589285902859128592285932859428595285962859728598285992860028601286022860328604286052860628607286082860928610286112861228613286142861528616286172861828619286202862128622286232862428625286262862728628286292863028631286322863328634286352863628637286382863928640286412864228643286442864528646286472864828649286502865128652286532865428655286562865728658286592866028661286622866328664286652866628667286682866928670286712867228673286742867528676286772867828679286802868128682286832868428685286862868728688286892869028691286922869328694286952869628697286982869928700287012870228703287042870528706287072870828709287102871128712287132871428715287162871728718287192872028721287222872328724287252872628727287282872928730287312873228733287342873528736287372873828739287402874128742287432874428745287462874728748287492875028751287522875328754287552875628757287582875928760287612876228763287642876528766287672876828769287702877128772287732877428775287762877728778287792878028781287822878328784287852878628787287882878928790287912879228793287942879528796287972879828799288002880128802288032880428805288062880728808288092881028811288122881328814288152881628817288182881928820288212882228823288242882528826288272882828829288302883128832288332883428835288362883728838288392884028841288422884328844288452884628847288482884928850288512885228853288542885528856288572885828859288602886128862288632886428865288662886728868288692887028871288722887328874288752887628877288782887928880288812888228883288842888528886288872888828889288902889128892288932889428895288962889728898288992890028901289022890328904289052890628907289082890928910289112891228913289142891528916289172891828919289202892128922289232892428925289262892728928289292893028931289322893328934289352893628937289382893928940289412894228943289442894528946289472894828949289502895128952289532895428955289562895728958289592896028961289622896328964289652896628967289682896928970289712897228973289742897528976289772897828979289802898128982289832898428985289862898728988289892899028991289922899328994289952899628997289982899929000290012900229003290042900529006290072900829009290102901129012290132901429015290162901729018290192902029021290222902329024290252902629027290282902929030290312903229033290342903529036290372903829039290402904129042290432904429045290462904729048290492905029051290522905329054290552905629057290582905929060290612906229063290642906529066290672906829069290702907129072290732907429075290762907729078290792908029081290822908329084290852908629087290882908929090290912909229093290942909529096290972909829099291002910129102291032910429105291062910729108291092911029111291122911329114291152911629117291182911929120291212912229123291242912529126291272912829129291302913129132291332913429135291362913729138291392914029141291422914329144291452914629147291482914929150291512915229153291542915529156291572915829159291602916129162291632916429165291662916729168291692917029171291722917329174291752917629177291782917929180291812918229183291842918529186291872918829189291902919129192291932919429195291962919729198291992920029201292022920329204292052920629207292082920929210292112921229213292142921529216292172921829219292202922129222292232922429225292262922729228292292923029231292322923329234292352923629237292382923929240292412924229243292442924529246292472924829249292502925129252292532925429255292562925729258292592926029261292622926329264292652926629267292682926929270292712927229273292742927529276292772927829279292802928129282292832928429285292862928729288292892929029291292922929329294292952929629297292982929929300293012930229303293042930529306293072930829309293102931129312293132931429315293162931729318293192932029321293222932329324293252932629327293282932929330293312933229333293342933529336293372933829339293402934129342293432934429345293462934729348293492935029351293522935329354293552935629357293582935929360293612936229363293642936529366293672936829369293702937129372293732937429375293762937729378293792938029381293822938329384293852938629387293882938929390293912939229393293942939529396293972939829399294002940129402294032940429405294062940729408294092941029411294122941329414294152941629417294182941929420294212942229423294242942529426294272942829429294302943129432294332943429435294362943729438294392944029441294422944329444294452944629447294482944929450294512945229453294542945529456294572945829459294602946129462294632946429465294662946729468294692947029471294722947329474294752947629477294782947929480294812948229483294842948529486294872948829489294902949129492294932949429495294962949729498294992950029501295022950329504295052950629507295082950929510295112951229513295142951529516295172951829519295202952129522295232952429525295262952729528295292953029531295322953329534295352953629537295382953929540295412954229543295442954529546295472954829549295502955129552295532955429555295562955729558295592956029561295622956329564295652956629567295682956929570295712957229573295742957529576295772957829579295802958129582295832958429585295862958729588295892959029591295922959329594295952959629597295982959929600296012960229603296042960529606296072960829609296102961129612296132961429615296162961729618296192962029621296222962329624296252962629627296282962929630296312963229633296342963529636296372963829639296402964129642296432964429645296462964729648296492965029651296522965329654296552965629657296582965929660296612966229663296642966529666296672966829669296702967129672296732967429675296762967729678296792968029681296822968329684296852968629687296882968929690296912969229693296942969529696296972969829699297002970129702297032970429705297062970729708297092971029711297122971329714297152971629717297182971929720297212972229723297242972529726297272972829729297302973129732297332973429735297362973729738297392974029741297422974329744297452974629747297482974929750297512975229753297542975529756297572975829759297602976129762297632976429765297662976729768297692977029771297722977329774297752977629777297782977929780297812978229783297842978529786297872978829789297902979129792297932979429795297962979729798297992980029801298022980329804298052980629807298082980929810298112981229813298142981529816298172981829819298202982129822298232982429825298262982729828298292983029831298322983329834298352983629837298382983929840298412984229843298442984529846298472984829849298502985129852298532985429855298562985729858298592986029861298622986329864298652986629867298682986929870298712987229873298742987529876298772987829879298802988129882298832988429885298862988729888298892989029891298922989329894298952989629897298982989929900299012990229903299042990529906299072990829909299102991129912299132991429915299162991729918299192992029921299222992329924299252992629927299282992929930299312993229933299342993529936299372993829939299402994129942299432994429945299462994729948299492995029951299522995329954299552995629957299582995929960299612996229963299642996529966299672996829969299702997129972299732997429975299762997729978299792998029981299822998329984299852998629987299882998929990299912999229993299942999529996299972999829999300003000130002300033000430005300063000730008300093001030011300123001330014300153001630017300183001930020300213002230023300243002530026300273002830029300303003130032300333003430035300363003730038300393004030041300423004330044300453004630047300483004930050300513005230053300543005530056300573005830059300603006130062300633006430065300663006730068300693007030071300723007330074300753007630077300783007930080300813008230083300843008530086300873008830089300903009130092300933009430095300963009730098300993010030101301023010330104301053010630107301083010930110301113011230113301143011530116301173011830119301203012130122301233012430125301263012730128301293013030131301323013330134301353013630137301383013930140301413014230143301443014530146301473014830149301503015130152301533015430155301563015730158301593016030161301623016330164301653016630167301683016930170301713017230173301743017530176301773017830179301803018130182301833018430185301863018730188301893019030191301923019330194301953019630197301983019930200302013020230203302043020530206302073020830209302103021130212302133021430215302163021730218302193022030221302223022330224302253022630227302283022930230302313023230233302343023530236302373023830239302403024130242302433024430245302463024730248302493025030251302523025330254302553025630257302583025930260302613026230263302643026530266302673026830269302703027130272302733027430275302763027730278302793028030281302823028330284302853028630287302883028930290302913029230293302943029530296302973029830299303003030130302303033030430305303063030730308303093031030311303123031330314303153031630317303183031930320303213032230323303243032530326303273032830329303303033130332303333033430335303363033730338303393034030341303423034330344303453034630347303483034930350303513035230353303543035530356303573035830359303603036130362303633036430365303663036730368303693037030371303723037330374303753037630377303783037930380303813038230383303843038530386303873038830389303903039130392303933039430395303963039730398303993040030401304023040330404304053040630407304083040930410304113041230413304143041530416304173041830419304203042130422304233042430425304263042730428304293043030431304323043330434304353043630437304383043930440304413044230443304443044530446304473044830449304503045130452304533045430455304563045730458304593046030461304623046330464304653046630467304683046930470304713047230473304743047530476304773047830479304803048130482304833048430485304863048730488304893049030491304923049330494304953049630497304983049930500305013050230503305043050530506305073050830509305103051130512305133051430515305163051730518305193052030521305223052330524305253052630527305283052930530305313053230533305343053530536305373053830539305403054130542305433054430545305463054730548305493055030551305523055330554305553055630557305583055930560305613056230563305643056530566305673056830569305703057130572305733057430575305763057730578305793058030581305823058330584305853058630587305883058930590305913059230593305943059530596305973059830599306003060130602306033060430605306063060730608306093061030611306123061330614306153061630617306183061930620306213062230623306243062530626306273062830629306303063130632306333063430635306363063730638306393064030641306423064330644306453064630647306483064930650306513065230653306543065530656306573065830659306603066130662306633066430665306663066730668306693067030671306723067330674306753067630677306783067930680306813068230683306843068530686306873068830689306903069130692306933069430695306963069730698306993070030701307023070330704307053070630707307083070930710307113071230713307143071530716307173071830719307203072130722307233072430725307263072730728307293073030731307323073330734307353073630737307383073930740307413074230743307443074530746307473074830749307503075130752307533075430755307563075730758307593076030761307623076330764307653076630767307683076930770307713077230773307743077530776307773077830779307803078130782307833078430785307863078730788307893079030791307923079330794307953079630797307983079930800308013080230803308043080530806308073080830809308103081130812308133081430815308163081730818308193082030821308223082330824308253082630827308283082930830308313083230833308343083530836308373083830839308403084130842308433084430845308463084730848308493085030851308523085330854308553085630857308583085930860308613086230863308643086530866308673086830869308703087130872308733087430875308763087730878308793088030881308823088330884308853088630887308883088930890308913089230893308943089530896308973089830899309003090130902309033090430905309063090730908309093091030911309123091330914309153091630917309183091930920309213092230923309243092530926309273092830929309303093130932309333093430935309363093730938309393094030941309423094330944309453094630947309483094930950309513095230953309543095530956309573095830959309603096130962309633096430965309663096730968309693097030971309723097330974309753097630977309783097930980309813098230983309843098530986309873098830989309903099130992309933099430995309963099730998309993100031001310023100331004310053100631007310083100931010310113101231013310143101531016310173101831019310203102131022310233102431025310263102731028310293103031031310323103331034310353103631037310383103931040310413104231043310443104531046310473104831049310503105131052310533105431055310563105731058310593106031061310623106331064310653106631067310683106931070310713107231073310743107531076310773107831079310803108131082310833108431085310863108731088310893109031091310923109331094310953109631097310983109931100311013110231103311043110531106311073110831109311103111131112311133111431115311163111731118311193112031121311223112331124311253112631127311283112931130311313113231133311343113531136311373113831139311403114131142311433114431145311463114731148311493115031151311523115331154311553115631157311583115931160311613116231163311643116531166311673116831169311703117131172311733117431175311763117731178311793118031181311823118331184311853118631187311883118931190311913119231193311943119531196311973119831199312003120131202312033120431205312063120731208312093121031211312123121331214312153121631217312183121931220312213122231223312243122531226312273122831229312303123131232312333123431235312363123731238312393124031241312423124331244312453124631247312483124931250312513125231253312543125531256312573125831259312603126131262312633126431265312663126731268312693127031271312723127331274312753127631277312783127931280312813128231283312843128531286312873128831289312903129131292312933129431295312963129731298312993130031301313023130331304313053130631307313083130931310313113131231313313143131531316313173131831319313203132131322313233132431325313263132731328313293133031331313323133331334313353133631337313383133931340313413134231343313443134531346313473134831349313503135131352313533135431355313563135731358313593136031361313623136331364313653136631367313683136931370313713137231373313743137531376313773137831379313803138131382313833138431385313863138731388313893139031391313923139331394313953139631397313983139931400314013140231403314043140531406314073140831409314103141131412314133141431415314163141731418314193142031421314223142331424314253142631427314283142931430314313143231433314343143531436314373143831439314403144131442314433144431445314463144731448314493145031451314523145331454314553145631457314583145931460314613146231463314643146531466314673146831469314703147131472314733147431475314763147731478314793148031481314823148331484314853148631487314883148931490314913149231493314943149531496314973149831499315003150131502315033150431505315063150731508315093151031511315123151331514315153151631517315183151931520315213152231523315243152531526315273152831529315303153131532315333153431535315363153731538315393154031541315423154331544315453154631547315483154931550315513155231553315543155531556315573155831559315603156131562315633156431565315663156731568315693157031571315723157331574315753157631577315783157931580315813158231583315843158531586315873158831589315903159131592315933159431595315963159731598315993160031601316023160331604316053160631607316083160931610316113161231613316143161531616316173161831619316203162131622316233162431625316263162731628316293163031631316323163331634316353163631637316383163931640316413164231643316443164531646316473164831649316503165131652316533165431655316563165731658316593166031661316623166331664316653166631667316683166931670316713167231673316743167531676316773167831679316803168131682316833168431685316863168731688316893169031691316923169331694316953169631697316983169931700317013170231703317043170531706317073170831709317103171131712317133171431715317163171731718317193172031721317223172331724317253172631727317283172931730317313173231733317343173531736317373173831739317403174131742317433174431745317463174731748317493175031751317523175331754317553175631757317583175931760317613176231763317643176531766317673176831769317703177131772317733177431775317763177731778317793178031781317823178331784317853178631787317883178931790317913179231793317943179531796317973179831799318003180131802318033180431805318063180731808318093181031811318123181331814318153181631817318183181931820318213182231823318243182531826318273182831829318303183131832318333183431835318363183731838318393184031841318423184331844318453184631847318483184931850318513185231853318543185531856318573185831859318603186131862318633186431865318663186731868318693187031871318723187331874318753187631877318783187931880318813188231883318843188531886318873188831889318903189131892318933189431895318963189731898318993190031901319023190331904319053190631907319083190931910319113191231913319143191531916319173191831919319203192131922319233192431925319263192731928319293193031931319323193331934319353193631937319383193931940319413194231943319443194531946319473194831949319503195131952319533195431955319563195731958319593196031961319623196331964319653196631967319683196931970319713197231973319743197531976319773197831979319803198131982319833198431985319863198731988319893199031991319923199331994319953199631997319983199932000320013200232003320043200532006320073200832009320103201132012320133201432015320163201732018320193202032021320223202332024320253202632027320283202932030320313203232033320343203532036320373203832039320403204132042320433204432045320463204732048320493205032051320523205332054320553205632057320583205932060320613206232063320643206532066320673206832069320703207132072320733207432075320763207732078320793208032081320823208332084320853208632087320883208932090320913209232093320943209532096320973209832099321003210132102321033210432105321063210732108321093211032111321123211332114321153211632117321183211932120321213212232123321243212532126321273212832129321303213132132321333213432135321363213732138321393214032141321423214332144321453214632147321483214932150321513215232153321543215532156321573215832159321603216132162321633216432165321663216732168321693217032171321723217332174321753217632177321783217932180321813218232183321843218532186321873218832189321903219132192321933219432195321963219732198321993220032201322023220332204322053220632207322083220932210322113221232213322143221532216322173221832219322203222132222322233222432225322263222732228322293223032231322323223332234322353223632237322383223932240322413224232243322443224532246322473224832249322503225132252322533225432255322563225732258322593226032261322623226332264322653226632267322683226932270322713227232273322743227532276322773227832279322803228132282322833228432285322863228732288322893229032291322923229332294322953229632297322983229932300323013230232303323043230532306323073230832309323103231132312323133231432315323163231732318323193232032321323223232332324323253232632327323283232932330323313233232333323343233532336323373233832339323403234132342323433234432345323463234732348323493235032351323523235332354323553235632357323583235932360323613236232363323643236532366323673236832369323703237132372323733237432375323763237732378323793238032381323823238332384323853238632387323883238932390323913239232393323943239532396323973239832399324003240132402324033240432405324063240732408324093241032411324123241332414324153241632417324183241932420324213242232423324243242532426324273242832429324303243132432324333243432435324363243732438324393244032441324423244332444324453244632447324483244932450324513245232453324543245532456324573245832459324603246132462324633246432465324663246732468324693247032471324723247332474324753247632477324783247932480324813248232483324843248532486324873248832489324903249132492324933249432495324963249732498324993250032501325023250332504325053250632507325083250932510325113251232513325143251532516325173251832519325203252132522325233252432525325263252732528325293253032531325323253332534325353253632537325383253932540325413254232543325443254532546325473254832549325503255132552325533255432555325563255732558325593256032561325623256332564325653256632567325683256932570325713257232573325743257532576325773257832579325803258132582325833258432585325863258732588325893259032591325923259332594325953259632597325983259932600326013260232603326043260532606326073260832609326103261132612326133261432615326163261732618326193262032621326223262332624326253262632627326283262932630326313263232633326343263532636326373263832639326403264132642326433264432645326463264732648326493265032651326523265332654326553265632657326583265932660326613266232663326643266532666326673266832669326703267132672326733267432675326763267732678326793268032681326823268332684326853268632687326883268932690326913269232693326943269532696326973269832699327003270132702327033270432705327063270732708327093271032711327123271332714327153271632717327183271932720327213272232723327243272532726327273272832729327303273132732327333273432735327363273732738327393274032741327423274332744327453274632747327483274932750327513275232753327543275532756327573275832759327603276132762327633276432765327663276732768327693277032771327723277332774327753277632777327783277932780327813278232783327843278532786327873278832789327903279132792327933279432795327963279732798327993280032801328023280332804328053280632807328083280932810328113281232813328143281532816328173281832819328203282132822328233282432825328263282732828328293283032831328323283332834328353283632837328383283932840328413284232843328443284532846328473284832849328503285132852328533285432855328563285732858328593286032861328623286332864328653286632867328683286932870328713287232873328743287532876328773287832879328803288132882328833288432885328863288732888328893289032891328923289332894328953289632897328983289932900329013290232903329043290532906329073290832909329103291132912329133291432915329163291732918329193292032921329223292332924329253292632927329283292932930329313293232933329343293532936329373293832939329403294132942329433294432945329463294732948329493295032951329523295332954329553295632957329583295932960329613296232963329643296532966329673296832969329703297132972329733297432975329763297732978329793298032981329823298332984329853298632987329883298932990329913299232993329943299532996329973299832999330003300133002330033300433005330063300733008330093301033011330123301333014330153301633017330183301933020330213302233023330243302533026330273302833029330303303133032330333303433035330363303733038330393304033041330423304333044330453304633047330483304933050330513305233053330543305533056330573305833059330603306133062330633306433065330663306733068330693307033071330723307333074330753307633077330783307933080330813308233083330843308533086330873308833089330903309133092330933309433095330963309733098330993310033101331023310333104331053310633107331083310933110331113311233113331143311533116331173311833119331203312133122331233312433125331263312733128331293313033131331323313333134331353313633137331383313933140331413314233143331443314533146331473314833149331503315133152331533315433155331563315733158331593316033161331623316333164331653316633167331683316933170331713317233173331743317533176331773317833179331803318133182331833318433185331863318733188331893319033191331923319333194331953319633197331983319933200332013320233203332043320533206332073320833209332103321133212332133321433215332163321733218332193322033221332223322333224332253322633227332283322933230332313323233233332343323533236332373323833239332403324133242332433324433245332463324733248332493325033251332523325333254332553325633257332583325933260332613326233263332643326533266332673326833269332703327133272332733327433275332763327733278332793328033281332823328333284332853328633287332883328933290332913329233293332943329533296332973329833299333003330133302333033330433305333063330733308333093331033311333123331333314333153331633317333183331933320333213332233323333243332533326333273332833329333303333133332333333333433335333363333733338333393334033341333423334333344333453334633347333483334933350333513335233353333543335533356333573335833359333603336133362333633336433365333663336733368333693337033371333723337333374333753337633377333783337933380333813338233383333843338533386333873338833389333903339133392333933339433395333963339733398333993340033401334023340333404334053340633407334083340933410334113341233413334143341533416334173341833419334203342133422334233342433425334263342733428334293343033431334323343333434334353343633437334383343933440334413344233443334443344533446334473344833449334503345133452334533345433455334563345733458334593346033461334623346333464334653346633467334683346933470334713347233473334743347533476334773347833479334803348133482334833348433485334863348733488334893349033491334923349333494334953349633497334983349933500335013350233503335043350533506335073350833509335103351133512335133351433515335163351733518335193352033521335223352333524335253352633527335283352933530335313353233533335343353533536335373353833539335403354133542335433354433545335463354733548335493355033551335523355333554335553355633557335583355933560335613356233563335643356533566335673356833569335703357133572335733357433575335763357733578335793358033581335823358333584335853358633587335883358933590335913359233593335943359533596335973359833599336003360133602336033360433605336063360733608336093361033611336123361333614336153361633617336183361933620336213362233623336243362533626336273362833629336303363133632336333363433635336363363733638336393364033641336423364333644336453364633647336483364933650336513365233653336543365533656336573365833659336603366133662336633366433665336663366733668336693367033671336723367333674336753367633677336783367933680336813368233683336843368533686336873368833689336903369133692336933369433695336963369733698336993370033701337023370333704337053370633707337083370933710337113371233713337143371533716337173371833719337203372133722337233372433725337263372733728337293373033731337323373333734337353373633737337383373933740337413374233743337443374533746337473374833749337503375133752337533375433755337563375733758337593376033761337623376333764337653376633767337683376933770337713377233773337743377533776337773377833779337803378133782337833378433785337863378733788337893379033791337923379333794337953379633797337983379933800338013380233803338043380533806338073380833809338103381133812338133381433815338163381733818338193382033821338223382333824338253382633827338283382933830338313383233833338343383533836338373383833839338403384133842338433384433845338463384733848338493385033851338523385333854338553385633857338583385933860338613386233863338643386533866338673386833869338703387133872338733387433875338763387733878338793388033881338823388333884338853388633887338883388933890338913389233893338943389533896338973389833899339003390133902339033390433905339063390733908339093391033911339123391333914339153391633917339183391933920339213392233923339243392533926339273392833929339303393133932339333393433935339363393733938339393394033941339423394333944339453394633947339483394933950339513395233953339543395533956339573395833959339603396133962339633396433965339663396733968339693397033971339723397333974339753397633977339783397933980339813398233983339843398533986339873398833989339903399133992339933399433995339963399733998339993400034001340023400334004340053400634007340083400934010340113401234013340143401534016340173401834019340203402134022340233402434025340263402734028340293403034031340323403334034340353403634037340383403934040340413404234043340443404534046340473404834049340503405134052340533405434055340563405734058340593406034061340623406334064340653406634067340683406934070340713407234073340743407534076340773407834079340803408134082340833408434085340863408734088340893409034091340923409334094340953409634097340983409934100341013410234103341043410534106341073410834109341103411134112341133411434115341163411734118341193412034121341223412334124341253412634127341283412934130341313413234133341343413534136341373413834139341403414134142341433414434145341463414734148341493415034151341523415334154341553415634157341583415934160341613416234163341643416534166341673416834169341703417134172341733417434175341763417734178341793418034181341823418334184341853418634187341883418934190341913419234193341943419534196341973419834199342003420134202342033420434205342063420734208342093421034211342123421334214342153421634217342183421934220342213422234223342243422534226342273422834229342303423134232342333423434235342363423734238342393424034241342423424334244342453424634247342483424934250342513425234253342543425534256342573425834259342603426134262342633426434265342663426734268342693427034271342723427334274342753427634277342783427934280342813428234283342843428534286342873428834289342903429134292342933429434295342963429734298342993430034301343023430334304343053430634307343083430934310343113431234313343143431534316343173431834319343203432134322343233432434325343263432734328343293433034331343323433334334343353433634337343383433934340343413434234343343443434534346343473434834349343503435134352343533435434355343563435734358343593436034361343623436334364343653436634367343683436934370343713437234373343743437534376343773437834379343803438134382343833438434385343863438734388343893439034391343923439334394343953439634397343983439934400344013440234403344043440534406344073440834409344103441134412344133441434415344163441734418344193442034421344223442334424344253442634427344283442934430344313443234433344343443534436344373443834439344403444134442344433444434445344463444734448344493445034451344523445334454344553445634457344583445934460344613446234463344643446534466344673446834469344703447134472344733447434475344763447734478344793448034481344823448334484344853448634487344883448934490344913449234493344943449534496344973449834499345003450134502345033450434505345063450734508345093451034511345123451334514345153451634517345183451934520345213452234523345243452534526345273452834529345303453134532345333453434535345363453734538345393454034541345423454334544345453454634547345483454934550345513455234553345543455534556345573455834559345603456134562345633456434565345663456734568345693457034571345723457334574345753457634577345783457934580345813458234583345843458534586345873458834589345903459134592345933459434595345963459734598345993460034601346023460334604346053460634607346083460934610346113461234613346143461534616346173461834619346203462134622346233462434625346263462734628346293463034631346323463334634346353463634637346383463934640346413464234643346443464534646346473464834649346503465134652346533465434655346563465734658346593466034661346623466334664346653466634667346683466934670346713467234673346743467534676346773467834679346803468134682346833468434685346863468734688346893469034691346923469334694346953469634697346983469934700347013470234703347043470534706347073470834709347103471134712347133471434715347163471734718347193472034721347223472334724347253472634727347283472934730347313473234733347343473534736347373473834739347403474134742347433474434745347463474734748347493475034751347523475334754347553475634757347583475934760347613476234763347643476534766347673476834769347703477134772347733477434775347763477734778347793478034781347823478334784347853478634787347883478934790347913479234793347943479534796347973479834799348003480134802348033480434805348063480734808348093481034811348123481334814348153481634817348183481934820348213482234823348243482534826348273482834829348303483134832348333483434835348363483734838348393484034841348423484334844348453484634847348483484934850348513485234853348543485534856348573485834859348603486134862348633486434865348663486734868348693487034871348723487334874348753487634877348783487934880348813488234883348843488534886348873488834889348903489134892348933489434895348963489734898348993490034901349023490334904349053490634907349083490934910349113491234913349143491534916349173491834919349203492134922349233492434925349263492734928349293493034931349323493334934349353493634937349383493934940349413494234943349443494534946349473494834949349503495134952349533495434955349563495734958349593496034961349623496334964349653496634967349683496934970349713497234973349743497534976349773497834979349803498134982349833498434985349863498734988349893499034991349923499334994349953499634997349983499935000350013500235003350043500535006350073500835009350103501135012350133501435015350163501735018350193502035021350223502335024350253502635027350283502935030350313503235033350343503535036350373503835039350403504135042350433504435045350463504735048350493505035051350523505335054350553505635057350583505935060350613506235063350643506535066350673506835069350703507135072350733507435075350763507735078350793508035081350823508335084350853508635087350883508935090350913509235093350943509535096350973509835099351003510135102351033510435105351063510735108351093511035111351123511335114351153511635117351183511935120351213512235123351243512535126351273512835129351303513135132351333513435135351363513735138351393514035141351423514335144351453514635147351483514935150351513515235153351543515535156351573515835159351603516135162351633516435165351663516735168351693517035171351723517335174351753517635177351783517935180351813518235183351843518535186351873518835189351903519135192351933519435195351963519735198351993520035201352023520335204352053520635207352083520935210352113521235213352143521535216352173521835219352203522135222352233522435225352263522735228352293523035231352323523335234352353523635237352383523935240352413524235243352443524535246352473524835249352503525135252352533525435255352563525735258352593526035261352623526335264352653526635267352683526935270352713527235273352743527535276352773527835279352803528135282352833528435285352863528735288352893529035291352923529335294352953529635297352983529935300353013530235303353043530535306353073530835309353103531135312353133531435315353163531735318353193532035321353223532335324353253532635327353283532935330353313533235333353343533535336353373533835339353403534135342353433534435345353463534735348353493535035351353523535335354353553535635357353583535935360353613536235363353643536535366353673536835369353703537135372353733537435375353763537735378353793538035381353823538335384353853538635387353883538935390353913539235393353943539535396353973539835399354003540135402354033540435405354063540735408354093541035411354123541335414354153541635417354183541935420354213542235423354243542535426354273542835429354303543135432354333543435435354363543735438354393544035441354423544335444354453544635447354483544935450354513545235453354543545535456354573545835459354603546135462354633546435465354663546735468354693547035471354723547335474354753547635477354783547935480354813548235483354843548535486354873548835489354903549135492354933549435495354963549735498354993550035501355023550335504355053550635507355083550935510355113551235513355143551535516355173551835519355203552135522355233552435525355263552735528355293553035531355323553335534355353553635537355383553935540355413554235543355443554535546355473554835549355503555135552355533555435555355563555735558355593556035561355623556335564355653556635567355683556935570355713557235573355743557535576355773557835579355803558135582355833558435585355863558735588355893559035591355923559335594355953559635597355983559935600356013560235603356043560535606356073560835609356103561135612356133561435615356163561735618356193562035621356223562335624356253562635627356283562935630356313563235633356343563535636356373563835639356403564135642356433564435645356463564735648356493565035651356523565335654356553565635657356583565935660356613566235663356643566535666356673566835669356703567135672356733567435675356763567735678356793568035681356823568335684356853568635687356883568935690356913569235693356943569535696356973569835699357003570135702357033570435705357063570735708357093571035711357123571335714357153571635717357183571935720357213572235723357243572535726357273572835729357303573135732357333573435735357363573735738357393574035741357423574335744357453574635747357483574935750357513575235753357543575535756357573575835759357603576135762357633576435765357663576735768357693577035771357723577335774357753577635777357783577935780357813578235783357843578535786357873578835789357903579135792357933579435795357963579735798357993580035801358023580335804358053580635807358083580935810358113581235813358143581535816358173581835819358203582135822358233582435825358263582735828358293583035831358323583335834358353583635837358383583935840358413584235843358443584535846358473584835849358503585135852358533585435855358563585735858358593586035861358623586335864358653586635867358683586935870358713587235873358743587535876358773587835879358803588135882358833588435885358863588735888358893589035891358923589335894358953589635897358983589935900359013590235903359043590535906359073590835909359103591135912359133591435915359163591735918359193592035921359223592335924359253592635927359283592935930359313593235933359343593535936359373593835939359403594135942359433594435945359463594735948359493595035951359523595335954359553595635957359583595935960359613596235963359643596535966359673596835969359703597135972359733597435975359763597735978359793598035981359823598335984359853598635987359883598935990359913599235993359943599535996359973599835999360003600136002360033600436005360063600736008360093601036011360123601336014360153601636017360183601936020360213602236023360243602536026360273602836029360303603136032360333603436035360363603736038360393604036041360423604336044360453604636047360483604936050360513605236053360543605536056360573605836059360603606136062360633606436065360663606736068360693607036071360723607336074360753607636077360783607936080360813608236083360843608536086360873608836089360903609136092360933609436095360963609736098360993610036101361023610336104361053610636107361083610936110361113611236113361143611536116361173611836119361203612136122361233612436125361263612736128361293613036131361323613336134361353613636137361383613936140361413614236143361443614536146361473614836149361503615136152361533615436155361563615736158361593616036161361623616336164361653616636167361683616936170361713617236173361743617536176361773617836179361803618136182361833618436185361863618736188361893619036191361923619336194361953619636197361983619936200362013620236203362043620536206362073620836209362103621136212362133621436215362163621736218362193622036221362223622336224362253622636227362283622936230362313623236233362343623536236362373623836239362403624136242362433624436245362463624736248362493625036251362523625336254362553625636257362583625936260362613626236263362643626536266362673626836269362703627136272362733627436275362763627736278362793628036281362823628336284362853628636287362883628936290362913629236293362943629536296362973629836299363003630136302363033630436305363063630736308363093631036311363123631336314363153631636317363183631936320363213632236323363243632536326363273632836329363303633136332363333633436335363363633736338363393634036341363423634336344363453634636347363483634936350363513635236353363543635536356363573635836359363603636136362363633636436365363663636736368363693637036371363723637336374363753637636377363783637936380363813638236383363843638536386363873638836389363903639136392363933639436395363963639736398363993640036401364023640336404364053640636407364083640936410364113641236413364143641536416364173641836419364203642136422364233642436425364263642736428364293643036431364323643336434364353643636437364383643936440364413644236443364443644536446364473644836449364503645136452364533645436455364563645736458364593646036461364623646336464364653646636467364683646936470364713647236473364743647536476364773647836479364803648136482364833648436485364863648736488364893649036491364923649336494364953649636497364983649936500365013650236503365043650536506365073650836509365103651136512365133651436515365163651736518365193652036521365223652336524365253652636527365283652936530365313653236533365343653536536365373653836539365403654136542365433654436545365463654736548365493655036551365523655336554365553655636557365583655936560365613656236563365643656536566365673656836569365703657136572365733657436575365763657736578365793658036581365823658336584365853658636587365883658936590365913659236593365943659536596365973659836599366003660136602366033660436605366063660736608366093661036611366123661336614366153661636617366183661936620366213662236623366243662536626366273662836629366303663136632366333663436635366363663736638366393664036641366423664336644366453664636647366483664936650366513665236653366543665536656366573665836659366603666136662366633666436665366663666736668366693667036671366723667336674366753667636677366783667936680366813668236683366843668536686366873668836689366903669136692366933669436695366963669736698366993670036701367023670336704367053670636707367083670936710367113671236713367143671536716367173671836719367203672136722367233672436725367263672736728367293673036731367323673336734367353673636737367383673936740367413674236743367443674536746367473674836749367503675136752367533675436755367563675736758367593676036761367623676336764367653676636767367683676936770367713677236773367743677536776367773677836779367803678136782367833678436785367863678736788367893679036791367923679336794367953679636797367983679936800368013680236803368043680536806368073680836809368103681136812368133681436815368163681736818368193682036821368223682336824368253682636827368283682936830368313683236833368343683536836368373683836839368403684136842368433684436845368463684736848368493685036851368523685336854368553685636857368583685936860368613686236863368643686536866368673686836869368703687136872368733687436875368763687736878368793688036881368823688336884368853688636887368883688936890368913689236893368943689536896368973689836899369003690136902369033690436905369063690736908369093691036911369123691336914369153691636917369183691936920369213692236923369243692536926369273692836929369303693136932369333693436935369363693736938369393694036941369423694336944369453694636947369483694936950369513695236953369543695536956369573695836959369603696136962369633696436965369663696736968369693697036971369723697336974369753697636977369783697936980369813698236983369843698536986369873698836989369903699136992369933699436995369963699736998369993700037001370023700337004370053700637007370083700937010370113701237013370143701537016370173701837019370203702137022370233702437025370263702737028370293703037031370323703337034370353703637037370383703937040370413704237043370443704537046370473704837049370503705137052370533705437055370563705737058370593706037061370623706337064370653706637067370683706937070370713707237073370743707537076370773707837079370803708137082370833708437085370863708737088370893709037091370923709337094370953709637097370983709937100371013710237103371043710537106371073710837109371103711137112371133711437115371163711737118371193712037121371223712337124371253712637127371283712937130371313713237133371343713537136371373713837139371403714137142371433714437145371463714737148371493715037151371523715337154371553715637157371583715937160371613716237163371643716537166371673716837169371703717137172371733717437175371763717737178371793718037181371823718337184371853718637187371883718937190371913719237193371943719537196371973719837199372003720137202372033720437205372063720737208372093721037211372123721337214372153721637217372183721937220372213722237223372243722537226372273722837229372303723137232372333723437235372363723737238372393724037241372423724337244372453724637247372483724937250372513725237253372543725537256372573725837259372603726137262372633726437265372663726737268372693727037271372723727337274372753727637277372783727937280372813728237283372843728537286372873728837289372903729137292372933729437295372963729737298372993730037301373023730337304373053730637307373083730937310373113731237313373143731537316373173731837319373203732137322373233732437325373263732737328373293733037331373323733337334373353733637337373383733937340373413734237343373443734537346373473734837349373503735137352373533735437355373563735737358373593736037361373623736337364373653736637367373683736937370373713737237373373743737537376373773737837379373803738137382373833738437385373863738737388373893739037391373923739337394373953739637397373983739937400374013740237403374043740537406374073740837409374103741137412374133741437415374163741737418374193742037421374223742337424374253742637427374283742937430374313743237433374343743537436374373743837439374403744137442374433744437445374463744737448374493745037451374523745337454374553745637457374583745937460374613746237463374643746537466374673746837469374703747137472374733747437475374763747737478374793748037481374823748337484374853748637487374883748937490374913749237493374943749537496374973749837499375003750137502375033750437505375063750737508375093751037511375123751337514375153751637517375183751937520375213752237523375243752537526375273752837529375303753137532375333753437535375363753737538375393754037541375423754337544375453754637547375483754937550375513755237553375543755537556375573755837559375603756137562375633756437565375663756737568375693757037571375723757337574375753757637577375783757937580375813758237583375843758537586375873758837589375903759137592375933759437595375963759737598375993760037601376023760337604376053760637607376083760937610376113761237613376143761537616376173761837619376203762137622376233762437625376263762737628376293763037631376323763337634376353763637637376383763937640376413764237643376443764537646376473764837649376503765137652376533765437655376563765737658376593766037661376623766337664376653766637667376683766937670376713767237673376743767537676376773767837679376803768137682376833768437685376863768737688376893769037691376923769337694376953769637697376983769937700377013770237703377043770537706377073770837709377103771137712377133771437715377163771737718377193772037721377223772337724377253772637727377283772937730377313773237733377343773537736377373773837739377403774137742377433774437745377463774737748377493775037751377523775337754377553775637757377583775937760377613776237763377643776537766377673776837769377703777137772377733777437775377763777737778377793778037781377823778337784377853778637787377883778937790377913779237793377943779537796377973779837799378003780137802378033780437805378063780737808378093781037811378123781337814378153781637817378183781937820378213782237823378243782537826378273782837829378303783137832378333783437835378363783737838378393784037841378423784337844378453784637847378483784937850378513785237853378543785537856378573785837859378603786137862378633786437865378663786737868378693787037871378723787337874378753787637877378783787937880378813788237883378843788537886378873788837889378903789137892378933789437895378963789737898378993790037901379023790337904379053790637907379083790937910379113791237913379143791537916379173791837919379203792137922379233792437925379263792737928379293793037931379323793337934379353793637937379383793937940379413794237943379443794537946379473794837949379503795137952379533795437955379563795737958379593796037961379623796337964379653796637967379683796937970379713797237973379743797537976379773797837979379803798137982379833798437985379863798737988379893799037991379923799337994379953799637997379983799938000380013800238003380043800538006380073800838009380103801138012380133801438015380163801738018380193802038021380223802338024380253802638027380283802938030380313803238033380343803538036380373803838039380403804138042380433804438045380463804738048380493805038051380523805338054380553805638057380583805938060380613806238063380643806538066380673806838069380703807138072380733807438075380763807738078380793808038081380823808338084380853808638087380883808938090380913809238093380943809538096380973809838099381003810138102381033810438105381063810738108381093811038111381123811338114381153811638117381183811938120381213812238123381243812538126381273812838129381303813138132381333813438135381363813738138381393814038141381423814338144381453814638147381483814938150381513815238153381543815538156381573815838159381603816138162381633816438165381663816738168381693817038171381723817338174381753817638177381783817938180381813818238183381843818538186381873818838189381903819138192381933819438195381963819738198381993820038201382023820338204382053820638207382083820938210382113821238213382143821538216382173821838219382203822138222382233822438225382263822738228382293823038231382323823338234382353823638237382383823938240382413824238243382443824538246382473824838249382503825138252382533825438255382563825738258382593826038261382623826338264382653826638267382683826938270382713827238273382743827538276382773827838279382803828138282382833828438285382863828738288382893829038291382923829338294382953829638297382983829938300383013830238303383043830538306383073830838309383103831138312383133831438315383163831738318383193832038321383223832338324383253832638327383283832938330383313833238333383343833538336383373833838339383403834138342383433834438345383463834738348383493835038351383523835338354383553835638357383583835938360383613836238363383643836538366383673836838369383703837138372383733837438375383763837738378383793838038381383823838338384383853838638387383883838938390383913839238393383943839538396383973839838399384003840138402384033840438405384063840738408384093841038411384123841338414384153841638417384183841938420384213842238423384243842538426384273842838429384303843138432384333843438435384363843738438384393844038441384423844338444384453844638447384483844938450384513845238453384543845538456384573845838459384603846138462384633846438465384663846738468384693847038471384723847338474384753847638477384783847938480384813848238483384843848538486384873848838489384903849138492384933849438495384963849738498384993850038501385023850338504385053850638507385083850938510385113851238513385143851538516385173851838519385203852138522385233852438525385263852738528385293853038531385323853338534385353853638537385383853938540385413854238543385443854538546385473854838549385503855138552385533855438555385563855738558385593856038561385623856338564385653856638567385683856938570385713857238573385743857538576385773857838579385803858138582385833858438585385863858738588385893859038591385923859338594385953859638597385983859938600386013860238603386043860538606386073860838609386103861138612386133861438615386163861738618386193862038621386223862338624386253862638627386283862938630386313863238633386343863538636386373863838639386403864138642386433864438645386463864738648386493865038651386523865338654386553865638657386583865938660386613866238663386643866538666386673866838669386703867138672386733867438675386763867738678386793868038681386823868338684386853868638687386883868938690386913869238693386943869538696386973869838699387003870138702387033870438705387063870738708387093871038711387123871338714387153871638717387183871938720387213872238723387243872538726387273872838729387303873138732387333873438735387363873738738387393874038741387423874338744387453874638747387483874938750387513875238753387543875538756387573875838759387603876138762387633876438765387663876738768387693877038771387723877338774387753877638777387783877938780387813878238783387843878538786387873878838789387903879138792387933879438795387963879738798387993880038801388023880338804388053880638807388083880938810388113881238813388143881538816388173881838819388203882138822388233882438825388263882738828388293883038831388323883338834388353883638837388383883938840388413884238843388443884538846388473884838849388503885138852388533885438855388563885738858388593886038861388623886338864388653886638867388683886938870388713887238873388743887538876388773887838879388803888138882388833888438885388863888738888388893889038891388923889338894388953889638897388983889938900389013890238903389043890538906389073890838909389103891138912389133891438915389163891738918389193892038921389223892338924389253892638927389283892938930389313893238933389343893538936389373893838939389403894138942389433894438945389463894738948389493895038951389523895338954389553895638957389583895938960389613896238963389643896538966389673896838969389703897138972389733897438975389763897738978389793898038981389823898338984389853898638987389883898938990389913899238993389943899538996389973899838999390003900139002390033900439005390063900739008390093901039011390123901339014390153901639017390183901939020390213902239023390243902539026390273902839029390303903139032390333903439035390363903739038390393904039041390423904339044390453904639047390483904939050390513905239053390543905539056390573905839059390603906139062390633906439065390663906739068390693907039071390723907339074390753907639077390783907939080390813908239083390843908539086390873908839089390903909139092390933909439095390963909739098390993910039101391023910339104391053910639107391083910939110391113911239113391143911539116391173911839119391203912139122391233912439125391263912739128391293913039131391323913339134391353913639137391383913939140391413914239143391443914539146391473914839149391503915139152391533915439155391563915739158391593916039161391623916339164391653916639167391683916939170391713917239173391743917539176391773917839179391803918139182391833918439185391863918739188391893919039191391923919339194391953919639197391983919939200392013920239203392043920539206392073920839209392103921139212392133921439215392163921739218392193922039221392223922339224392253922639227392283922939230392313923239233392343923539236392373923839239392403924139242392433924439245392463924739248392493925039251392523925339254392553925639257392583925939260392613926239263392643926539266392673926839269392703927139272392733927439275392763927739278392793928039281392823928339284392853928639287392883928939290392913929239293392943929539296392973929839299393003930139302393033930439305393063930739308393093931039311393123931339314393153931639317393183931939320393213932239323393243932539326393273932839329393303933139332393333933439335393363933739338393393934039341393423934339344393453934639347393483934939350393513935239353393543935539356393573935839359393603936139362393633936439365393663936739368393693937039371393723937339374393753937639377393783937939380393813938239383393843938539386393873938839389393903939139392393933939439395393963939739398393993940039401394023940339404394053940639407394083940939410394113941239413394143941539416394173941839419394203942139422394233942439425394263942739428394293943039431394323943339434394353943639437394383943939440394413944239443394443944539446394473944839449394503945139452394533945439455394563945739458394593946039461394623946339464394653946639467394683946939470394713947239473394743947539476394773947839479394803948139482394833948439485394863948739488394893949039491394923949339494394953949639497394983949939500395013950239503395043950539506395073950839509395103951139512395133951439515395163951739518395193952039521395223952339524395253952639527395283952939530395313953239533395343953539536395373953839539395403954139542395433954439545395463954739548395493955039551395523955339554395553955639557395583955939560395613956239563395643956539566395673956839569395703957139572395733957439575395763957739578395793958039581395823958339584395853958639587395883958939590395913959239593395943959539596395973959839599396003960139602396033960439605396063960739608396093961039611396123961339614396153961639617396183961939620396213962239623396243962539626396273962839629396303963139632396333963439635396363963739638396393964039641396423964339644396453964639647396483964939650396513965239653396543965539656396573965839659396603966139662396633966439665396663966739668396693967039671396723967339674396753967639677396783967939680396813968239683396843968539686396873968839689396903969139692396933969439695396963969739698396993970039701397023970339704397053970639707397083970939710397113971239713397143971539716397173971839719397203972139722397233972439725397263972739728397293973039731397323973339734397353973639737397383973939740397413974239743397443974539746397473974839749397503975139752397533975439755397563975739758397593976039761397623976339764397653976639767397683976939770397713977239773397743977539776397773977839779397803978139782397833978439785397863978739788397893979039791397923979339794397953979639797397983979939800398013980239803398043980539806398073980839809398103981139812398133981439815398163981739818398193982039821398223982339824398253982639827398283982939830398313983239833398343983539836398373983839839398403984139842398433984439845398463984739848398493985039851398523985339854398553985639857398583985939860398613986239863398643986539866398673986839869398703987139872398733987439875398763987739878398793988039881398823988339884398853988639887398883988939890398913989239893398943989539896398973989839899399003990139902399033990439905399063990739908399093991039911399123991339914399153991639917399183991939920399213992239923399243992539926399273992839929399303993139932399333993439935399363993739938399393994039941399423994339944399453994639947399483994939950399513995239953399543995539956399573995839959399603996139962399633996439965399663996739968399693997039971399723997339974399753997639977399783997939980399813998239983399843998539986399873998839989399903999139992399933999439995399963999739998399994000040001400024000340004400054000640007400084000940010400114001240013400144001540016400174001840019400204002140022400234002440025400264002740028400294003040031400324003340034400354003640037400384003940040400414004240043400444004540046400474004840049400504005140052400534005440055400564005740058400594006040061400624006340064400654006640067400684006940070400714007240073400744007540076400774007840079400804008140082400834008440085400864008740088400894009040091400924009340094400954009640097400984009940100401014010240103401044010540106401074010840109401104011140112401134011440115401164011740118401194012040121401224012340124401254012640127401284012940130401314013240133401344013540136401374013840139401404014140142401434014440145401464014740148401494015040151401524015340154401554015640157401584015940160401614016240163401644016540166401674016840169401704017140172401734017440175401764017740178401794018040181401824018340184401854018640187401884018940190401914019240193401944019540196401974019840199402004020140202402034020440205402064020740208402094021040211402124021340214402154021640217402184021940220402214022240223402244022540226402274022840229402304023140232402334023440235402364023740238402394024040241402424024340244402454024640247402484024940250402514025240253402544025540256402574025840259402604026140262402634026440265402664026740268402694027040271402724027340274402754027640277402784027940280402814028240283402844028540286402874028840289402904029140292402934029440295402964029740298402994030040301403024030340304403054030640307403084030940310403114031240313403144031540316403174031840319403204032140322403234032440325403264032740328403294033040331403324033340334403354033640337403384033940340403414034240343403444034540346403474034840349403504035140352403534035440355403564035740358403594036040361403624036340364403654036640367403684036940370403714037240373403744037540376403774037840379403804038140382403834038440385403864038740388403894039040391403924039340394403954039640397403984039940400404014040240403404044040540406404074040840409404104041140412404134041440415404164041740418404194042040421404224042340424404254042640427404284042940430404314043240433404344043540436404374043840439404404044140442404434044440445404464044740448404494045040451404524045340454404554045640457404584045940460404614046240463404644046540466404674046840469404704047140472404734047440475404764047740478404794048040481404824048340484404854048640487404884048940490404914049240493404944049540496404974049840499405004050140502405034050440505405064050740508405094051040511405124051340514405154051640517405184051940520405214052240523405244052540526405274052840529405304053140532405334053440535405364053740538405394054040541405424054340544405454054640547405484054940550405514055240553405544055540556405574055840559405604056140562405634056440565405664056740568405694057040571405724057340574405754057640577405784057940580405814058240583405844058540586405874058840589405904059140592405934059440595405964059740598405994060040601406024060340604406054060640607406084060940610406114061240613406144061540616406174061840619406204062140622406234062440625406264062740628406294063040631406324063340634406354063640637406384063940640406414064240643406444064540646406474064840649406504065140652406534065440655406564065740658406594066040661406624066340664406654066640667406684066940670406714067240673406744067540676406774067840679406804068140682406834068440685406864068740688406894069040691406924069340694406954069640697406984069940700407014070240703407044070540706407074070840709407104071140712407134071440715407164071740718407194072040721407224072340724407254072640727407284072940730407314073240733407344073540736407374073840739407404074140742407434074440745407464074740748407494075040751407524075340754407554075640757407584075940760407614076240763407644076540766407674076840769407704077140772407734077440775407764077740778407794078040781407824078340784407854078640787407884078940790407914079240793407944079540796407974079840799408004080140802408034080440805408064080740808408094081040811408124081340814408154081640817408184081940820408214082240823408244082540826408274082840829408304083140832408334083440835408364083740838408394084040841408424084340844408454084640847408484084940850408514085240853408544085540856408574085840859408604086140862408634086440865408664086740868408694087040871408724087340874408754087640877408784087940880408814088240883408844088540886408874088840889408904089140892408934089440895408964089740898408994090040901409024090340904409054090640907409084090940910409114091240913409144091540916409174091840919409204092140922409234092440925409264092740928409294093040931409324093340934409354093640937409384093940940409414094240943409444094540946409474094840949409504095140952409534095440955409564095740958409594096040961409624096340964409654096640967409684096940970409714097240973409744097540976409774097840979409804098140982409834098440985409864098740988409894099040991409924099340994409954099640997409984099941000410014100241003410044100541006410074100841009410104101141012410134101441015410164101741018410194102041021410224102341024410254102641027410284102941030410314103241033410344103541036410374103841039410404104141042410434104441045410464104741048410494105041051410524105341054410554105641057410584105941060410614106241063410644106541066410674106841069410704107141072410734107441075410764107741078410794108041081410824108341084410854108641087410884108941090410914109241093410944109541096410974109841099411004110141102411034110441105411064110741108411094111041111411124111341114411154111641117411184111941120411214112241123411244112541126411274112841129411304113141132411334113441135411364113741138411394114041141411424114341144411454114641147411484114941150411514115241153411544115541156411574115841159411604116141162411634116441165411664116741168411694117041171411724117341174411754117641177411784117941180411814118241183411844118541186411874118841189411904119141192411934119441195411964119741198411994120041201412024120341204412054120641207412084120941210412114121241213412144121541216412174121841219412204122141222412234122441225412264122741228412294123041231412324123341234412354123641237412384123941240412414124241243412444124541246412474124841249412504125141252412534125441255412564125741258412594126041261412624126341264412654126641267412684126941270412714127241273412744127541276412774127841279412804128141282412834128441285412864128741288412894129041291412924129341294412954129641297412984129941300413014130241303413044130541306413074130841309413104131141312413134131441315413164131741318413194132041321413224132341324413254132641327413284132941330413314133241333413344133541336413374133841339413404134141342413434134441345413464134741348413494135041351413524135341354413554135641357413584135941360413614136241363413644136541366413674136841369413704137141372413734137441375413764137741378413794138041381413824138341384413854138641387413884138941390413914139241393413944139541396413974139841399414004140141402414034140441405414064140741408414094141041411414124141341414414154141641417414184141941420414214142241423414244142541426414274142841429414304143141432414334143441435414364143741438414394144041441414424144341444414454144641447414484144941450414514145241453414544145541456414574145841459414604146141462414634146441465414664146741468414694147041471414724147341474414754147641477414784147941480414814148241483414844148541486414874148841489414904149141492414934149441495414964149741498414994150041501415024150341504415054150641507415084150941510415114151241513415144151541516415174151841519415204152141522415234152441525415264152741528415294153041531415324153341534415354153641537415384153941540415414154241543415444154541546415474154841549415504155141552415534155441555415564155741558415594156041561415624156341564415654156641567415684156941570415714157241573415744157541576415774157841579415804158141582415834158441585415864158741588415894159041591415924159341594415954159641597415984159941600416014160241603416044160541606416074160841609416104161141612416134161441615416164161741618416194162041621416224162341624416254162641627416284162941630416314163241633416344163541636416374163841639416404164141642416434164441645416464164741648416494165041651416524165341654416554165641657416584165941660416614166241663416644166541666416674166841669416704167141672416734167441675416764167741678416794168041681416824168341684416854168641687416884168941690416914169241693416944169541696416974169841699417004170141702417034170441705417064170741708417094171041711417124171341714417154171641717417184171941720417214172241723417244172541726417274172841729417304173141732417334173441735417364173741738417394174041741417424174341744417454174641747417484174941750417514175241753417544175541756417574175841759417604176141762417634176441765417664176741768417694177041771417724177341774417754177641777417784177941780417814178241783417844178541786417874178841789417904179141792417934179441795417964179741798417994180041801418024180341804418054180641807418084180941810418114181241813418144181541816418174181841819418204182141822418234182441825418264182741828418294183041831418324183341834418354183641837418384183941840418414184241843418444184541846418474184841849418504185141852418534185441855418564185741858418594186041861418624186341864418654186641867418684186941870418714187241873418744187541876418774187841879418804188141882418834188441885418864188741888418894189041891418924189341894418954189641897418984189941900419014190241903419044190541906419074190841909419104191141912419134191441915419164191741918419194192041921419224192341924419254192641927419284192941930419314193241933419344193541936419374193841939419404194141942419434194441945419464194741948419494195041951419524195341954419554195641957419584195941960419614196241963419644196541966419674196841969419704197141972419734197441975419764197741978419794198041981419824198341984419854198641987419884198941990419914199241993419944199541996419974199841999420004200142002420034200442005420064200742008420094201042011420124201342014420154201642017420184201942020420214202242023420244202542026420274202842029420304203142032420334203442035420364203742038420394204042041420424204342044420454204642047420484204942050420514205242053420544205542056420574205842059420604206142062420634206442065420664206742068420694207042071420724207342074420754207642077420784207942080420814208242083420844208542086420874208842089420904209142092420934209442095420964209742098420994210042101421024210342104421054210642107421084210942110421114211242113421144211542116421174211842119421204212142122421234212442125421264212742128421294213042131421324213342134421354213642137421384213942140421414214242143421444214542146421474214842149421504215142152421534215442155421564215742158421594216042161421624216342164421654216642167421684216942170421714217242173421744217542176421774217842179421804218142182421834218442185421864218742188421894219042191421924219342194421954219642197421984219942200422014220242203422044220542206422074220842209422104221142212422134221442215422164221742218422194222042221422224222342224422254222642227422284222942230422314223242233422344223542236422374223842239422404224142242422434224442245422464224742248422494225042251422524225342254422554225642257422584225942260422614226242263422644226542266422674226842269422704227142272422734227442275422764227742278422794228042281422824228342284422854228642287422884228942290422914229242293422944229542296422974229842299423004230142302423034230442305423064230742308423094231042311423124231342314423154231642317423184231942320423214232242323423244232542326423274232842329423304233142332423334233442335423364233742338423394234042341423424234342344423454234642347423484234942350423514235242353423544235542356423574235842359423604236142362423634236442365423664236742368423694237042371423724237342374423754237642377423784237942380423814238242383423844238542386423874238842389423904239142392423934239442395423964239742398423994240042401424024240342404424054240642407424084240942410424114241242413424144241542416424174241842419424204242142422424234242442425424264242742428424294243042431424324243342434424354243642437424384243942440424414244242443424444244542446424474244842449424504245142452424534245442455424564245742458424594246042461424624246342464424654246642467424684246942470424714247242473424744247542476424774247842479424804248142482424834248442485424864248742488424894249042491424924249342494424954249642497424984249942500425014250242503425044250542506425074250842509425104251142512425134251442515425164251742518425194252042521425224252342524425254252642527425284252942530425314253242533425344253542536425374253842539425404254142542425434254442545425464254742548425494255042551425524255342554425554255642557425584255942560425614256242563425644256542566425674256842569425704257142572425734257442575425764257742578425794258042581425824258342584425854258642587425884258942590425914259242593425944259542596425974259842599426004260142602426034260442605426064260742608426094261042611426124261342614426154261642617426184261942620426214262242623426244262542626426274262842629426304263142632426334263442635426364263742638426394264042641426424264342644426454264642647426484264942650426514265242653426544265542656426574265842659426604266142662426634266442665426664266742668426694267042671426724267342674426754267642677426784267942680426814268242683426844268542686426874268842689426904269142692426934269442695426964269742698426994270042701427024270342704427054270642707427084270942710427114271242713427144271542716427174271842719427204272142722427234272442725427264272742728427294273042731427324273342734427354273642737427384273942740427414274242743427444274542746427474274842749427504275142752427534275442755427564275742758427594276042761427624276342764427654276642767427684276942770427714277242773427744277542776427774277842779427804278142782427834278442785427864278742788427894279042791427924279342794427954279642797427984279942800428014280242803428044280542806428074280842809428104281142812428134281442815428164281742818428194282042821428224282342824428254282642827428284282942830428314283242833428344283542836428374283842839428404284142842428434284442845428464284742848428494285042851428524285342854428554285642857428584285942860428614286242863428644286542866428674286842869428704287142872428734287442875428764287742878428794288042881428824288342884428854288642887428884288942890428914289242893428944289542896428974289842899429004290142902429034290442905429064290742908429094291042911429124291342914429154291642917429184291942920429214292242923429244292542926429274292842929429304293142932429334293442935429364293742938429394294042941429424294342944429454294642947429484294942950429514295242953429544295542956429574295842959429604296142962429634296442965429664296742968429694297042971429724297342974429754297642977429784297942980429814298242983429844298542986429874298842989429904299142992429934299442995429964299742998429994300043001430024300343004430054300643007430084300943010430114301243013430144301543016430174301843019430204302143022430234302443025430264302743028430294303043031430324303343034430354303643037430384303943040430414304243043430444304543046430474304843049430504305143052430534305443055430564305743058430594306043061430624306343064430654306643067430684306943070430714307243073430744307543076430774307843079430804308143082430834308443085430864308743088430894309043091430924309343094430954309643097430984309943100431014310243103431044310543106431074310843109431104311143112431134311443115431164311743118431194312043121431224312343124431254312643127431284312943130431314313243133431344313543136431374313843139431404314143142431434314443145431464314743148431494315043151431524315343154431554315643157431584315943160431614316243163431644316543166431674316843169431704317143172431734317443175431764317743178431794318043181431824318343184431854318643187431884318943190431914319243193431944319543196431974319843199432004320143202432034320443205432064320743208432094321043211432124321343214432154321643217432184321943220432214322243223432244322543226432274322843229432304323143232432334323443235432364323743238432394324043241432424324343244432454324643247432484324943250432514325243253432544325543256432574325843259432604326143262432634326443265432664326743268432694327043271432724327343274432754327643277432784327943280432814328243283432844328543286432874328843289432904329143292432934329443295432964329743298432994330043301433024330343304433054330643307433084330943310433114331243313433144331543316433174331843319433204332143322433234332443325433264332743328433294333043331433324333343334433354333643337433384333943340433414334243343433444334543346433474334843349433504335143352433534335443355433564335743358433594336043361433624336343364433654336643367433684336943370433714337243373433744337543376433774337843379433804338143382433834338443385433864338743388433894339043391433924339343394433954339643397433984339943400434014340243403434044340543406434074340843409434104341143412434134341443415434164341743418434194342043421434224342343424434254342643427434284342943430434314343243433434344343543436434374343843439434404344143442434434344443445434464344743448434494345043451434524345343454434554345643457434584345943460434614346243463434644346543466434674346843469434704347143472434734347443475434764347743478434794348043481434824348343484434854348643487434884348943490434914349243493434944349543496434974349843499435004350143502435034350443505435064350743508435094351043511435124351343514435154351643517435184351943520435214352243523435244352543526435274352843529435304353143532435334353443535435364353743538435394354043541435424354343544435454354643547435484354943550435514355243553435544355543556435574355843559435604356143562435634356443565435664356743568435694357043571435724357343574435754357643577435784357943580435814358243583435844358543586435874358843589435904359143592435934359443595435964359743598435994360043601436024360343604436054360643607436084360943610436114361243613436144361543616436174361843619436204362143622436234362443625436264362743628436294363043631436324363343634436354363643637436384363943640436414364243643436444364543646436474364843649436504365143652436534365443655436564365743658436594366043661436624366343664436654366643667436684366943670436714367243673436744367543676436774367843679436804368143682436834368443685436864368743688436894369043691436924369343694436954369643697436984369943700437014370243703437044370543706437074370843709437104371143712437134371443715437164371743718437194372043721437224372343724437254372643727437284372943730437314373243733437344373543736437374373843739437404374143742437434374443745437464374743748437494375043751437524375343754437554375643757437584375943760437614376243763437644376543766437674376843769437704377143772437734377443775437764377743778437794378043781437824378343784437854378643787437884378943790437914379243793437944379543796437974379843799438004380143802438034380443805438064380743808438094381043811438124381343814438154381643817438184381943820438214382243823438244382543826438274382843829438304383143832438334383443835438364383743838438394384043841438424384343844438454384643847438484384943850438514385243853438544385543856438574385843859438604386143862438634386443865438664386743868438694387043871438724387343874438754387643877438784387943880438814388243883438844388543886438874388843889438904389143892438934389443895438964389743898438994390043901439024390343904439054390643907439084390943910439114391243913439144391543916439174391843919439204392143922439234392443925439264392743928439294393043931439324393343934439354393643937439384393943940439414394243943439444394543946439474394843949439504395143952439534395443955439564395743958439594396043961439624396343964439654396643967439684396943970439714397243973439744397543976439774397843979439804398143982439834398443985439864398743988439894399043991439924399343994439954399643997439984399944000440014400244003440044400544006440074400844009440104401144012440134401444015440164401744018440194402044021440224402344024440254402644027440284402944030440314403244033440344403544036440374403844039440404404144042440434404444045440464404744048440494405044051440524405344054440554405644057440584405944060440614406244063440644406544066440674406844069440704407144072440734407444075440764407744078440794408044081440824408344084440854408644087440884408944090440914409244093440944409544096440974409844099441004410144102441034410444105441064410744108441094411044111441124411344114441154411644117441184411944120441214412244123441244412544126441274412844129441304413144132441334413444135441364413744138441394414044141441424414344144441454414644147441484414944150441514415244153441544415544156441574415844159441604416144162441634416444165441664416744168441694417044171441724417344174441754417644177441784417944180441814418244183441844418544186441874418844189441904419144192441934419444195441964419744198441994420044201442024420344204442054420644207442084420944210442114421244213442144421544216442174421844219442204422144222442234422444225442264422744228442294423044231442324423344234442354423644237442384423944240442414424244243442444424544246442474424844249442504425144252442534425444255442564425744258442594426044261442624426344264442654426644267442684426944270442714427244273442744427544276442774427844279442804428144282442834428444285442864428744288442894429044291442924429344294442954429644297442984429944300443014430244303443044430544306443074430844309443104431144312443134431444315443164431744318443194432044321443224432344324443254432644327443284432944330443314433244333443344433544336443374433844339443404434144342443434434444345443464434744348443494435044351443524435344354443554435644357443584435944360443614436244363443644436544366443674436844369443704437144372443734437444375443764437744378443794438044381443824438344384443854438644387443884438944390443914439244393443944439544396443974439844399444004440144402444034440444405444064440744408444094441044411444124441344414444154441644417444184441944420444214442244423444244442544426444274442844429444304443144432444334443444435444364443744438444394444044441444424444344444444454444644447444484444944450444514445244453444544445544456444574445844459444604446144462444634446444465444664446744468444694447044471444724447344474444754447644477444784447944480444814448244483444844448544486444874448844489444904449144492444934449444495444964449744498444994450044501445024450344504445054450644507445084450944510445114451244513445144451544516445174451844519445204452144522445234452444525445264452744528445294453044531445324453344534445354453644537445384453944540445414454244543445444454544546445474454844549445504455144552445534455444555445564455744558445594456044561445624456344564445654456644567445684456944570445714457244573445744457544576445774457844579445804458144582445834458444585445864458744588445894459044591445924459344594445954459644597445984459944600446014460244603446044460544606446074460844609446104461144612446134461444615446164461744618446194462044621446224462344624446254462644627446284462944630446314463244633446344463544636446374463844639446404464144642446434464444645446464464744648446494465044651446524465344654446554465644657446584465944660446614466244663446644466544666446674466844669446704467144672446734467444675446764467744678446794468044681446824468344684446854468644687446884468944690446914469244693446944469544696446974469844699447004470144702447034470444705447064470744708447094471044711447124471344714447154471644717447184471944720447214472244723447244472544726447274472844729447304473144732447334473444735447364473744738447394474044741447424474344744447454474644747447484474944750447514475244753447544475544756447574475844759447604476144762447634476444765447664476744768447694477044771447724477344774447754477644777447784477944780447814478244783447844478544786447874478844789447904479144792447934479444795447964479744798447994480044801448024480344804448054480644807448084480944810448114481244813448144481544816448174481844819448204482144822448234482444825448264482744828448294483044831448324483344834448354483644837448384483944840448414484244843448444484544846448474484844849448504485144852448534485444855448564485744858448594486044861448624486344864448654486644867448684486944870448714487244873448744487544876448774487844879448804488144882448834488444885448864488744888448894489044891448924489344894448954489644897448984489944900449014490244903449044490544906449074490844909449104491144912449134491444915449164491744918449194492044921449224492344924449254492644927449284492944930449314493244933449344493544936449374493844939449404494144942449434494444945449464494744948449494495044951449524495344954449554495644957449584495944960449614496244963449644496544966449674496844969449704497144972449734497444975449764497744978449794498044981449824498344984449854498644987449884498944990449914499244993449944499544996449974499844999450004500145002450034500445005450064500745008450094501045011450124501345014450154501645017450184501945020450214502245023450244502545026450274502845029450304503145032450334503445035450364503745038450394504045041450424504345044450454504645047450484504945050450514505245053450544505545056450574505845059450604506145062450634506445065450664506745068450694507045071450724507345074450754507645077450784507945080450814508245083450844508545086450874508845089450904509145092450934509445095450964509745098450994510045101451024510345104451054510645107451084510945110451114511245113451144511545116451174511845119451204512145122451234512445125451264512745128451294513045131451324513345134451354513645137451384513945140451414514245143451444514545146451474514845149451504515145152451534515445155451564515745158451594516045161451624516345164451654516645167451684516945170451714517245173451744517545176451774517845179451804518145182451834518445185451864518745188451894519045191451924519345194451954519645197451984519945200452014520245203452044520545206452074520845209452104521145212
  1. var Module;
  2. if (typeof Module === 'undefined') Module = {};
  3. if (!Module.expectedDataFileDownloads) {
  4. Module.expectedDataFileDownloads = 0;
  5. Module.finishedDataFileDownloads = 0;
  6. }
  7. Module.expectedDataFileDownloads++;
  8. (function() {
  9. var loadPackage = function(metadata) {
  10. var PACKAGE_PATH;
  11. if (typeof window === 'object') {
  12. PACKAGE_PATH = window['encodeURIComponent'](window.location.pathname.toString().substring(0, window.location.pathname.toString().lastIndexOf('/')) + '/');
  13. } else if (typeof location !== 'undefined') {
  14. // worker
  15. PACKAGE_PATH = encodeURIComponent(location.pathname.toString().substring(0, location.pathname.toString().lastIndexOf('/')) + '/');
  16. } else {
  17. throw 'using preloaded data can only be done on a web page or in a web worker';
  18. }
  19. var PACKAGE_NAME = 'models/models_obj_loading.data';
  20. var REMOTE_PACKAGE_BASE = 'models_obj_loading.data';
  21. if (typeof Module['locateFilePackage'] === 'function' && !Module['locateFile']) {
  22. Module['locateFile'] = Module['locateFilePackage'];
  23. Module.printErr('warning: you defined Module.locateFilePackage, that has been renamed to Module.locateFile (using your locateFilePackage for now)');
  24. }
  25. var REMOTE_PACKAGE_NAME = typeof Module['locateFile'] === 'function' ?
  26. Module['locateFile'](REMOTE_PACKAGE_BASE) :
  27. ((Module['filePackagePrefixURL'] || '') + REMOTE_PACKAGE_BASE);
  28. var REMOTE_PACKAGE_SIZE = metadata.remote_package_size;
  29. var PACKAGE_UUID = metadata.package_uuid;
  30. function fetchRemotePackage(packageName, packageSize, callback, errback) {
  31. var xhr = new XMLHttpRequest();
  32. xhr.open('GET', packageName, true);
  33. xhr.responseType = 'arraybuffer';
  34. xhr.onprogress = function(event) {
  35. var url = packageName;
  36. var size = packageSize;
  37. if (event.total) size = event.total;
  38. if (event.loaded) {
  39. if (!xhr.addedTotal) {
  40. xhr.addedTotal = true;
  41. if (!Module.dataFileDownloads) Module.dataFileDownloads = {};
  42. Module.dataFileDownloads[url] = {
  43. loaded: event.loaded,
  44. total: size
  45. };
  46. } else {
  47. Module.dataFileDownloads[url].loaded = event.loaded;
  48. }
  49. var total = 0;
  50. var loaded = 0;
  51. var num = 0;
  52. for (var download in Module.dataFileDownloads) {
  53. var data = Module.dataFileDownloads[download];
  54. total += data.total;
  55. loaded += data.loaded;
  56. num++;
  57. }
  58. total = Math.ceil(total * Module.expectedDataFileDownloads/num);
  59. if (Module['setStatus']) Module['setStatus']('Downloading data... (' + loaded + '/' + total + ')');
  60. } else if (!Module.dataFileDownloads) {
  61. if (Module['setStatus']) Module['setStatus']('Downloading data...');
  62. }
  63. };
  64. xhr.onerror = function(event) {
  65. throw new Error("NetworkError for: " + packageName);
  66. }
  67. xhr.onload = function(event) {
  68. if (xhr.status == 200 || xhr.status == 304 || xhr.status == 206 || (xhr.status == 0 && xhr.response)) { // file URLs can return 0
  69. var packageData = xhr.response;
  70. callback(packageData);
  71. } else {
  72. throw new Error(xhr.statusText + " : " + xhr.responseURL);
  73. }
  74. };
  75. xhr.send(null);
  76. };
  77. function handleError(error) {
  78. console.error('package error:', error);
  79. };
  80. var fetchedCallback = null;
  81. var fetched = Module['getPreloadedPackage'] ? Module['getPreloadedPackage'](REMOTE_PACKAGE_NAME, REMOTE_PACKAGE_SIZE) : null;
  82. if (!fetched) fetchRemotePackage(REMOTE_PACKAGE_NAME, REMOTE_PACKAGE_SIZE, function(data) {
  83. if (fetchedCallback) {
  84. fetchedCallback(data);
  85. fetchedCallback = null;
  86. } else {
  87. fetched = data;
  88. }
  89. }, handleError);
  90. function runWithFS() {
  91. function assert(check, msg) {
  92. if (!check) throw msg + new Error().stack;
  93. }
  94. Module['FS_createPath']('/', 'resources', true, true);
  95. Module['FS_createPath']('/resources', 'model', true, true);
  96. function DataRequest(start, end, crunched, audio) {
  97. this.start = start;
  98. this.end = end;
  99. this.crunched = crunched;
  100. this.audio = audio;
  101. }
  102. DataRequest.prototype = {
  103. requests: {},
  104. open: function(mode, name) {
  105. this.name = name;
  106. this.requests[name] = this;
  107. Module['addRunDependency']('fp ' + this.name);
  108. },
  109. send: function() {},
  110. onload: function() {
  111. var byteArray = this.byteArray.subarray(this.start, this.end);
  112. this.finish(byteArray);
  113. },
  114. finish: function(byteArray) {
  115. var that = this;
  116. Module['FS_createDataFile'](this.name, null, byteArray, true, true, true); // canOwn this data in the filesystem, it is a slide into the heap that will never change
  117. Module['removeRunDependency']('fp ' + that.name);
  118. this.requests[this.name] = null;
  119. }
  120. };
  121. var files = metadata.files;
  122. for (i = 0; i < files.length; ++i) {
  123. new DataRequest(files[i].start, files[i].end, files[i].crunched, files[i].audio).open('GET', files[i].filename);
  124. }
  125. function processPackageData(arrayBuffer) {
  126. Module.finishedDataFileDownloads++;
  127. assert(arrayBuffer, 'Loading data file failed.');
  128. assert(arrayBuffer instanceof ArrayBuffer, 'bad input to processPackageData');
  129. var byteArray = new Uint8Array(arrayBuffer);
  130. var curr;
  131. // copy the entire loaded file into a spot in the heap. Files will refer to slices in that. They cannot be freed though
  132. // (we may be allocating before malloc is ready, during startup).
  133. if (Module['SPLIT_MEMORY']) Module.printErr('warning: you should run the file packager with --no-heap-copy when SPLIT_MEMORY is used, otherwise copying into the heap may fail due to the splitting');
  134. var ptr = Module['getMemory'](byteArray.length);
  135. Module['HEAPU8'].set(byteArray, ptr);
  136. DataRequest.prototype.byteArray = Module['HEAPU8'].subarray(ptr, ptr+byteArray.length);
  137. var files = metadata.files;
  138. for (i = 0; i < files.length; ++i) {
  139. DataRequest.prototype.requests[files[i].filename].onload();
  140. }
  141. Module['removeRunDependency']('datafile_models/models_obj_loading.data');
  142. };
  143. Module['addRunDependency']('datafile_models/models_obj_loading.data');
  144. if (!Module.preloadResults) Module.preloadResults = {};
  145. Module.preloadResults[PACKAGE_NAME] = {fromCache: false};
  146. if (fetched) {
  147. processPackageData(fetched);
  148. fetched = null;
  149. } else {
  150. fetchedCallback = processPackageData;
  151. }
  152. }
  153. if (Module['calledRun']) {
  154. runWithFS();
  155. } else {
  156. if (!Module['preRun']) Module['preRun'] = [];
  157. Module["preRun"].push(runWithFS); // FS is not initialized yet, wait for it
  158. }
  159. }
  160. loadPackage({"files": [{"audio": 0, "start": 0, "crunched": 0, "end": 2748249, "filename": "/resources/model/dwarf.obj"}, {"audio": 0, "start": 2748249, "crunched": 0, "end": 4022872, "filename": "/resources/model/dwarf_diffuse.png"}], "remote_package_size": 4022872, "package_uuid": "8916150a-89d4-4b0a-884f-4bcfc1694720"});
  161. })();
  162. // The Module object: Our interface to the outside world. We import
  163. // and export values on it, and do the work to get that through
  164. // closure compiler if necessary. There are various ways Module can be used:
  165. // 1. Not defined. We create it here
  166. // 2. A function parameter, function(Module) { ..generated code.. }
  167. // 3. pre-run appended it, var Module = {}; ..generated code..
  168. // 4. External script tag defines var Module.
  169. // We need to do an eval in order to handle the closure compiler
  170. // case, where this code here is minified but Module was defined
  171. // elsewhere (e.g. case 4 above). We also need to check if Module
  172. // already exists (e.g. case 3 above).
  173. // Note that if you want to run closure, and also to use Module
  174. // after the generated code, you will need to define var Module = {};
  175. // before the code. Then that object will be used in the code, and you
  176. // can continue to use Module afterwards as well.
  177. var Module;
  178. if (!Module) Module = (typeof Module !== 'undefined' ? Module : null) || {};
  179. // Sometimes an existing Module object exists with properties
  180. // meant to overwrite the default module functionality. Here
  181. // we collect those properties and reapply _after_ we configure
  182. // the current environment's defaults to avoid having to be so
  183. // defensive during initialization.
  184. var moduleOverrides = {};
  185. for (var key in Module) {
  186. if (Module.hasOwnProperty(key)) {
  187. moduleOverrides[key] = Module[key];
  188. }
  189. }
  190. // The environment setup code below is customized to use Module.
  191. // *** Environment setup code ***
  192. var ENVIRONMENT_IS_WEB = false;
  193. var ENVIRONMENT_IS_WORKER = false;
  194. var ENVIRONMENT_IS_NODE = false;
  195. var ENVIRONMENT_IS_SHELL = false;
  196. // Three configurations we can be running in:
  197. // 1) We could be the application main() thread running in the main JS UI thread. (ENVIRONMENT_IS_WORKER == false and ENVIRONMENT_IS_PTHREAD == false)
  198. // 2) We could be the application main() thread proxied to worker. (with Emscripten -s PROXY_TO_WORKER=1) (ENVIRONMENT_IS_WORKER == true, ENVIRONMENT_IS_PTHREAD == false)
  199. // 3) We could be an application pthread running in a worker. (ENVIRONMENT_IS_WORKER == true and ENVIRONMENT_IS_PTHREAD == true)
  200. if (Module['ENVIRONMENT']) {
  201. if (Module['ENVIRONMENT'] === 'WEB') {
  202. ENVIRONMENT_IS_WEB = true;
  203. } else if (Module['ENVIRONMENT'] === 'WORKER') {
  204. ENVIRONMENT_IS_WORKER = true;
  205. } else if (Module['ENVIRONMENT'] === 'NODE') {
  206. ENVIRONMENT_IS_NODE = true;
  207. } else if (Module['ENVIRONMENT'] === 'SHELL') {
  208. ENVIRONMENT_IS_SHELL = true;
  209. } else {
  210. throw new Error('The provided Module[\'ENVIRONMENT\'] value is not valid. It must be one of: WEB|WORKER|NODE|SHELL.');
  211. }
  212. } else {
  213. ENVIRONMENT_IS_WEB = typeof window === 'object';
  214. ENVIRONMENT_IS_WORKER = typeof importScripts === 'function';
  215. ENVIRONMENT_IS_NODE = typeof process === 'object' && typeof require === 'function' && !ENVIRONMENT_IS_WEB && !ENVIRONMENT_IS_WORKER;
  216. ENVIRONMENT_IS_SHELL = !ENVIRONMENT_IS_WEB && !ENVIRONMENT_IS_NODE && !ENVIRONMENT_IS_WORKER;
  217. }
  218. if (ENVIRONMENT_IS_NODE) {
  219. // Expose functionality in the same simple way that the shells work
  220. // Note that we pollute the global namespace here, otherwise we break in node
  221. if (!Module['print']) Module['print'] = console.log;
  222. if (!Module['printErr']) Module['printErr'] = console.warn;
  223. var nodeFS;
  224. var nodePath;
  225. Module['read'] = function read(filename, binary) {
  226. if (!nodeFS) nodeFS = require('fs');
  227. if (!nodePath) nodePath = require('path');
  228. filename = nodePath['normalize'](filename);
  229. var ret = nodeFS['readFileSync'](filename);
  230. return binary ? ret : ret.toString();
  231. };
  232. Module['readBinary'] = function readBinary(filename) {
  233. var ret = Module['read'](filename, true);
  234. if (!ret.buffer) {
  235. ret = new Uint8Array(ret);
  236. }
  237. assert(ret.buffer);
  238. return ret;
  239. };
  240. Module['load'] = function load(f) {
  241. globalEval(read(f));
  242. };
  243. if (!Module['thisProgram']) {
  244. if (process['argv'].length > 1) {
  245. Module['thisProgram'] = process['argv'][1].replace(/\\/g, '/');
  246. } else {
  247. Module['thisProgram'] = 'unknown-program';
  248. }
  249. }
  250. Module['arguments'] = process['argv'].slice(2);
  251. if (typeof module !== 'undefined') {
  252. module['exports'] = Module;
  253. }
  254. process['on']('uncaughtException', function(ex) {
  255. // suppress ExitStatus exceptions from showing an error
  256. if (!(ex instanceof ExitStatus)) {
  257. throw ex;
  258. }
  259. });
  260. Module['inspect'] = function () { return '[Emscripten Module object]'; };
  261. }
  262. else if (ENVIRONMENT_IS_SHELL) {
  263. if (!Module['print']) Module['print'] = print;
  264. if (typeof printErr != 'undefined') Module['printErr'] = printErr; // not present in v8 or older sm
  265. if (typeof read != 'undefined') {
  266. Module['read'] = read;
  267. } else {
  268. Module['read'] = function read() { throw 'no read() available' };
  269. }
  270. Module['readBinary'] = function readBinary(f) {
  271. if (typeof readbuffer === 'function') {
  272. return new Uint8Array(readbuffer(f));
  273. }
  274. var data = read(f, 'binary');
  275. assert(typeof data === 'object');
  276. return data;
  277. };
  278. if (typeof scriptArgs != 'undefined') {
  279. Module['arguments'] = scriptArgs;
  280. } else if (typeof arguments != 'undefined') {
  281. Module['arguments'] = arguments;
  282. }
  283. if (typeof quit === 'function') {
  284. Module['quit'] = function(status, toThrow) {
  285. quit(status);
  286. }
  287. }
  288. }
  289. else if (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) {
  290. Module['read'] = function read(url) {
  291. var xhr = new XMLHttpRequest();
  292. xhr.open('GET', url, false);
  293. xhr.send(null);
  294. return xhr.responseText;
  295. };
  296. if (ENVIRONMENT_IS_WORKER) {
  297. Module['readBinary'] = function read(url) {
  298. var xhr = new XMLHttpRequest();
  299. xhr.open('GET', url, false);
  300. xhr.responseType = 'arraybuffer';
  301. xhr.send(null);
  302. return xhr.response;
  303. };
  304. }
  305. Module['readAsync'] = function readAsync(url, onload, onerror) {
  306. var xhr = new XMLHttpRequest();
  307. xhr.open('GET', url, true);
  308. xhr.responseType = 'arraybuffer';
  309. xhr.onload = function xhr_onload() {
  310. if (xhr.status == 200 || (xhr.status == 0 && xhr.response)) { // file URLs can return 0
  311. onload(xhr.response);
  312. } else {
  313. onerror();
  314. }
  315. };
  316. xhr.onerror = onerror;
  317. xhr.send(null);
  318. };
  319. if (typeof arguments != 'undefined') {
  320. Module['arguments'] = arguments;
  321. }
  322. if (typeof console !== 'undefined') {
  323. if (!Module['print']) Module['print'] = function print(x) {
  324. console.log(x);
  325. };
  326. if (!Module['printErr']) Module['printErr'] = function printErr(x) {
  327. console.warn(x);
  328. };
  329. } else {
  330. // Probably a worker, and without console.log. We can do very little here...
  331. var TRY_USE_DUMP = false;
  332. if (!Module['print']) Module['print'] = (TRY_USE_DUMP && (typeof(dump) !== "undefined") ? (function(x) {
  333. dump(x);
  334. }) : (function(x) {
  335. // self.postMessage(x); // enable this if you want stdout to be sent as messages
  336. }));
  337. }
  338. if (ENVIRONMENT_IS_WORKER) {
  339. Module['load'] = importScripts;
  340. }
  341. if (typeof Module['setWindowTitle'] === 'undefined') {
  342. Module['setWindowTitle'] = function(title) { document.title = title };
  343. }
  344. }
  345. else {
  346. // Unreachable because SHELL is dependant on the others
  347. throw 'Unknown runtime environment. Where are we?';
  348. }
  349. function globalEval(x) {
  350. eval.call(null, x);
  351. }
  352. if (!Module['load'] && Module['read']) {
  353. Module['load'] = function load(f) {
  354. globalEval(Module['read'](f));
  355. };
  356. }
  357. if (!Module['print']) {
  358. Module['print'] = function(){};
  359. }
  360. if (!Module['printErr']) {
  361. Module['printErr'] = Module['print'];
  362. }
  363. if (!Module['arguments']) {
  364. Module['arguments'] = [];
  365. }
  366. if (!Module['thisProgram']) {
  367. Module['thisProgram'] = './this.program';
  368. }
  369. if (!Module['quit']) {
  370. Module['quit'] = function(status, toThrow) {
  371. throw toThrow;
  372. }
  373. }
  374. // *** Environment setup code ***
  375. // Closure helpers
  376. Module.print = Module['print'];
  377. Module.printErr = Module['printErr'];
  378. // Callbacks
  379. Module['preRun'] = [];
  380. Module['postRun'] = [];
  381. // Merge back in the overrides
  382. for (var key in moduleOverrides) {
  383. if (moduleOverrides.hasOwnProperty(key)) {
  384. Module[key] = moduleOverrides[key];
  385. }
  386. }
  387. // Free the object hierarchy contained in the overrides, this lets the GC
  388. // reclaim data used e.g. in memoryInitializerRequest, which is a large typed array.
  389. moduleOverrides = undefined;
  390. // {{PREAMBLE_ADDITIONS}}
  391. // === Preamble library stuff ===
  392. // Documentation for the public APIs defined in this file must be updated in:
  393. // site/source/docs/api_reference/preamble.js.rst
  394. // A prebuilt local version of the documentation is available at:
  395. // site/build/text/docs/api_reference/preamble.js.txt
  396. // You can also build docs locally as HTML or other formats in site/
  397. // An online HTML version (which may be of a different version of Emscripten)
  398. // is up at http://kripken.github.io/emscripten-site/docs/api_reference/preamble.js.html
  399. //========================================
  400. // Runtime code shared with compiler
  401. //========================================
  402. var Runtime = {
  403. setTempRet0: function (value) {
  404. tempRet0 = value;
  405. return value;
  406. },
  407. getTempRet0: function () {
  408. return tempRet0;
  409. },
  410. stackSave: function () {
  411. return STACKTOP;
  412. },
  413. stackRestore: function (stackTop) {
  414. STACKTOP = stackTop;
  415. },
  416. getNativeTypeSize: function (type) {
  417. switch (type) {
  418. case 'i1': case 'i8': return 1;
  419. case 'i16': return 2;
  420. case 'i32': return 4;
  421. case 'i64': return 8;
  422. case 'float': return 4;
  423. case 'double': return 8;
  424. default: {
  425. if (type[type.length-1] === '*') {
  426. return Runtime.QUANTUM_SIZE; // A pointer
  427. } else if (type[0] === 'i') {
  428. var bits = parseInt(type.substr(1));
  429. assert(bits % 8 === 0);
  430. return bits/8;
  431. } else {
  432. return 0;
  433. }
  434. }
  435. }
  436. },
  437. getNativeFieldSize: function (type) {
  438. return Math.max(Runtime.getNativeTypeSize(type), Runtime.QUANTUM_SIZE);
  439. },
  440. STACK_ALIGN: 16,
  441. prepVararg: function (ptr, type) {
  442. if (type === 'double' || type === 'i64') {
  443. // move so the load is aligned
  444. if (ptr & 7) {
  445. assert((ptr & 7) === 4);
  446. ptr += 4;
  447. }
  448. } else {
  449. assert((ptr & 3) === 0);
  450. }
  451. return ptr;
  452. },
  453. getAlignSize: function (type, size, vararg) {
  454. // we align i64s and doubles on 64-bit boundaries, unlike x86
  455. if (!vararg && (type == 'i64' || type == 'double')) return 8;
  456. if (!type) return Math.min(size, 8); // align structures internally to 64 bits
  457. return Math.min(size || (type ? Runtime.getNativeFieldSize(type) : 0), Runtime.QUANTUM_SIZE);
  458. },
  459. dynCall: function (sig, ptr, args) {
  460. if (args && args.length) {
  461. assert(args.length == sig.length-1);
  462. assert(('dynCall_' + sig) in Module, 'bad function pointer type - no table for sig \'' + sig + '\'');
  463. return Module['dynCall_' + sig].apply(null, [ptr].concat(args));
  464. } else {
  465. assert(sig.length == 1);
  466. assert(('dynCall_' + sig) in Module, 'bad function pointer type - no table for sig \'' + sig + '\'');
  467. return Module['dynCall_' + sig].call(null, ptr);
  468. }
  469. },
  470. functionPointers: [],
  471. addFunction: function (func) {
  472. for (var i = 0; i < Runtime.functionPointers.length; i++) {
  473. if (!Runtime.functionPointers[i]) {
  474. Runtime.functionPointers[i] = func;
  475. return 2*(1 + i);
  476. }
  477. }
  478. throw 'Finished up all reserved function pointers. Use a higher value for RESERVED_FUNCTION_POINTERS.';
  479. },
  480. removeFunction: function (index) {
  481. Runtime.functionPointers[(index-2)/2] = null;
  482. },
  483. warnOnce: function (text) {
  484. if (!Runtime.warnOnce.shown) Runtime.warnOnce.shown = {};
  485. if (!Runtime.warnOnce.shown[text]) {
  486. Runtime.warnOnce.shown[text] = 1;
  487. Module.printErr(text);
  488. }
  489. },
  490. funcWrappers: {},
  491. getFuncWrapper: function (func, sig) {
  492. assert(sig);
  493. if (!Runtime.funcWrappers[sig]) {
  494. Runtime.funcWrappers[sig] = {};
  495. }
  496. var sigCache = Runtime.funcWrappers[sig];
  497. if (!sigCache[func]) {
  498. // optimize away arguments usage in common cases
  499. if (sig.length === 1) {
  500. sigCache[func] = function dynCall_wrapper() {
  501. return Runtime.dynCall(sig, func);
  502. };
  503. } else if (sig.length === 2) {
  504. sigCache[func] = function dynCall_wrapper(arg) {
  505. return Runtime.dynCall(sig, func, [arg]);
  506. };
  507. } else {
  508. // general case
  509. sigCache[func] = function dynCall_wrapper() {
  510. return Runtime.dynCall(sig, func, Array.prototype.slice.call(arguments));
  511. };
  512. }
  513. }
  514. return sigCache[func];
  515. },
  516. getCompilerSetting: function (name) {
  517. throw 'You must build with -s RETAIN_COMPILER_SETTINGS=1 for Runtime.getCompilerSetting or emscripten_get_compiler_setting to work';
  518. },
  519. stackAlloc: function (size) { var ret = STACKTOP;STACKTOP = (STACKTOP + size)|0;STACKTOP = (((STACKTOP)+15)&-16);(assert((((STACKTOP|0) < (STACK_MAX|0))|0))|0); return ret; },
  520. staticAlloc: function (size) { var ret = STATICTOP;STATICTOP = (STATICTOP + (assert(!staticSealed),size))|0;STATICTOP = (((STATICTOP)+15)&-16); return ret; },
  521. dynamicAlloc: function (size) { assert(DYNAMICTOP_PTR);var ret = HEAP32[DYNAMICTOP_PTR>>2];var end = (((ret + size + 15)|0) & -16);HEAP32[DYNAMICTOP_PTR>>2] = end;if (end >= TOTAL_MEMORY) {var success = enlargeMemory();if (!success) {HEAP32[DYNAMICTOP_PTR>>2] = ret;return 0;}}return ret;},
  522. alignMemory: function (size,quantum) { var ret = size = Math.ceil((size)/(quantum ? quantum : 16))*(quantum ? quantum : 16); return ret; },
  523. makeBigInt: function (low,high,unsigned) { var ret = (unsigned ? ((+((low>>>0)))+((+((high>>>0)))*4294967296.0)) : ((+((low>>>0)))+((+((high|0)))*4294967296.0))); return ret; },
  524. GLOBAL_BASE: 8,
  525. QUANTUM_SIZE: 4,
  526. __dummy__: 0
  527. }
  528. Module["Runtime"] = Runtime;
  529. //========================================
  530. // Runtime essentials
  531. //========================================
  532. var ABORT = 0; // whether we are quitting the application. no code should run after this. set in exit() and abort()
  533. var EXITSTATUS = 0;
  534. function assert(condition, text) {
  535. if (!condition) {
  536. abort('Assertion failed: ' + text);
  537. }
  538. }
  539. var globalScope = this;
  540. // Returns the C function with a specified identifier (for C++, you need to do manual name mangling)
  541. function getCFunc(ident) {
  542. var func = Module['_' + ident]; // closure exported function
  543. if (!func) {
  544. try { func = eval('_' + ident); } catch(e) {}
  545. }
  546. assert(func, 'Cannot call unknown function ' + ident + ' (perhaps LLVM optimizations or closure removed it?)');
  547. return func;
  548. }
  549. var cwrap, ccall;
  550. (function(){
  551. var JSfuncs = {
  552. // Helpers for cwrap -- it can't refer to Runtime directly because it might
  553. // be renamed by closure, instead it calls JSfuncs['stackSave'].body to find
  554. // out what the minified function name is.
  555. 'stackSave': function() {
  556. Runtime.stackSave()
  557. },
  558. 'stackRestore': function() {
  559. Runtime.stackRestore()
  560. },
  561. // type conversion from js to c
  562. 'arrayToC' : function(arr) {
  563. var ret = Runtime.stackAlloc(arr.length);
  564. writeArrayToMemory(arr, ret);
  565. return ret;
  566. },
  567. 'stringToC' : function(str) {
  568. var ret = 0;
  569. if (str !== null && str !== undefined && str !== 0) { // null string
  570. // at most 4 bytes per UTF-8 code point, +1 for the trailing '\0'
  571. var len = (str.length << 2) + 1;
  572. ret = Runtime.stackAlloc(len);
  573. stringToUTF8(str, ret, len);
  574. }
  575. return ret;
  576. }
  577. };
  578. // For fast lookup of conversion functions
  579. var toC = {'string' : JSfuncs['stringToC'], 'array' : JSfuncs['arrayToC']};
  580. // C calling interface.
  581. ccall = function ccallFunc(ident, returnType, argTypes, args, opts) {
  582. var func = getCFunc(ident);
  583. var cArgs = [];
  584. var stack = 0;
  585. assert(returnType !== 'array', 'Return type should not be "array".');
  586. if (args) {
  587. for (var i = 0; i < args.length; i++) {
  588. var converter = toC[argTypes[i]];
  589. if (converter) {
  590. if (stack === 0) stack = Runtime.stackSave();
  591. cArgs[i] = converter(args[i]);
  592. } else {
  593. cArgs[i] = args[i];
  594. }
  595. }
  596. }
  597. var ret = func.apply(null, cArgs);
  598. if ((!opts || !opts.async) && typeof EmterpreterAsync === 'object') {
  599. assert(!EmterpreterAsync.state, 'cannot start async op with normal JS calling ccall');
  600. }
  601. if (opts && opts.async) assert(!returnType, 'async ccalls cannot return values');
  602. if (returnType === 'string') ret = Pointer_stringify(ret);
  603. if (stack !== 0) {
  604. if (opts && opts.async) {
  605. EmterpreterAsync.asyncFinalizers.push(function() {
  606. Runtime.stackRestore(stack);
  607. });
  608. return;
  609. }
  610. Runtime.stackRestore(stack);
  611. }
  612. return ret;
  613. }
  614. var sourceRegex = /^function\s*[a-zA-Z$_0-9]*\s*\(([^)]*)\)\s*{\s*([^*]*?)[\s;]*(?:return\s*(.*?)[;\s]*)?}$/;
  615. function parseJSFunc(jsfunc) {
  616. // Match the body and the return value of a javascript function source
  617. var parsed = jsfunc.toString().match(sourceRegex).slice(1);
  618. return {arguments : parsed[0], body : parsed[1], returnValue: parsed[2]}
  619. }
  620. // sources of useful functions. we create this lazily as it can trigger a source decompression on this entire file
  621. var JSsource = null;
  622. function ensureJSsource() {
  623. if (!JSsource) {
  624. JSsource = {};
  625. for (var fun in JSfuncs) {
  626. if (JSfuncs.hasOwnProperty(fun)) {
  627. // Elements of toCsource are arrays of three items:
  628. // the code, and the return value
  629. JSsource[fun] = parseJSFunc(JSfuncs[fun]);
  630. }
  631. }
  632. }
  633. }
  634. cwrap = function cwrap(ident, returnType, argTypes) {
  635. argTypes = argTypes || [];
  636. var cfunc = getCFunc(ident);
  637. // When the function takes numbers and returns a number, we can just return
  638. // the original function
  639. var numericArgs = argTypes.every(function(type){ return type === 'number'});
  640. var numericRet = (returnType !== 'string');
  641. if ( numericRet && numericArgs) {
  642. return cfunc;
  643. }
  644. // Creation of the arguments list (["$1","$2",...,"$nargs"])
  645. var argNames = argTypes.map(function(x,i){return '$'+i});
  646. var funcstr = "(function(" + argNames.join(',') + ") {";
  647. var nargs = argTypes.length;
  648. if (!numericArgs) {
  649. // Generate the code needed to convert the arguments from javascript
  650. // values to pointers
  651. ensureJSsource();
  652. funcstr += 'var stack = ' + JSsource['stackSave'].body + ';';
  653. for (var i = 0; i < nargs; i++) {
  654. var arg = argNames[i], type = argTypes[i];
  655. if (type === 'number') continue;
  656. var convertCode = JSsource[type + 'ToC']; // [code, return]
  657. funcstr += 'var ' + convertCode.arguments + ' = ' + arg + ';';
  658. funcstr += convertCode.body + ';';
  659. funcstr += arg + '=(' + convertCode.returnValue + ');';
  660. }
  661. }
  662. // When the code is compressed, the name of cfunc is not literally 'cfunc' anymore
  663. var cfuncname = parseJSFunc(function(){return cfunc}).returnValue;
  664. // Call the function
  665. funcstr += 'var ret = ' + cfuncname + '(' + argNames.join(',') + ');';
  666. if (!numericRet) { // Return type can only by 'string' or 'number'
  667. // Convert the result to a string
  668. var strgfy = parseJSFunc(function(){return Pointer_stringify}).returnValue;
  669. funcstr += 'ret = ' + strgfy + '(ret);';
  670. }
  671. funcstr += "if (typeof EmterpreterAsync === 'object') { assert(!EmterpreterAsync.state, 'cannot start async op with normal JS calling cwrap') }";
  672. if (!numericArgs) {
  673. // If we had a stack, restore it
  674. ensureJSsource();
  675. funcstr += JSsource['stackRestore'].body.replace('()', '(stack)') + ';';
  676. }
  677. funcstr += 'return ret})';
  678. return eval(funcstr);
  679. };
  680. })();
  681. Module["ccall"] = ccall;
  682. Module["cwrap"] = cwrap;
  683. function setValue(ptr, value, type, noSafe) {
  684. type = type || 'i8';
  685. if (type.charAt(type.length-1) === '*') type = 'i32'; // pointers are 32-bit
  686. switch(type) {
  687. case 'i1': HEAP8[((ptr)>>0)]=value; break;
  688. case 'i8': HEAP8[((ptr)>>0)]=value; break;
  689. case 'i16': HEAP16[((ptr)>>1)]=value; break;
  690. case 'i32': HEAP32[((ptr)>>2)]=value; break;
  691. case 'i64': (tempI64 = [value>>>0,(tempDouble=value,(+(Math_abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math_min((+(Math_floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math_ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[((ptr)>>2)]=tempI64[0],HEAP32[(((ptr)+(4))>>2)]=tempI64[1]); break;
  692. case 'float': HEAPF32[((ptr)>>2)]=value; break;
  693. case 'double': HEAPF64[((ptr)>>3)]=value; break;
  694. default: abort('invalid type for setValue: ' + type);
  695. }
  696. }
  697. Module["setValue"] = setValue;
  698. function getValue(ptr, type, noSafe) {
  699. type = type || 'i8';
  700. if (type.charAt(type.length-1) === '*') type = 'i32'; // pointers are 32-bit
  701. switch(type) {
  702. case 'i1': return HEAP8[((ptr)>>0)];
  703. case 'i8': return HEAP8[((ptr)>>0)];
  704. case 'i16': return HEAP16[((ptr)>>1)];
  705. case 'i32': return HEAP32[((ptr)>>2)];
  706. case 'i64': return HEAP32[((ptr)>>2)];
  707. case 'float': return HEAPF32[((ptr)>>2)];
  708. case 'double': return HEAPF64[((ptr)>>3)];
  709. default: abort('invalid type for setValue: ' + type);
  710. }
  711. return null;
  712. }
  713. Module["getValue"] = getValue;
  714. var ALLOC_NORMAL = 0; // Tries to use _malloc()
  715. var ALLOC_STACK = 1; // Lives for the duration of the current function call
  716. var ALLOC_STATIC = 2; // Cannot be freed
  717. var ALLOC_DYNAMIC = 3; // Cannot be freed except through sbrk
  718. var ALLOC_NONE = 4; // Do not allocate
  719. Module["ALLOC_NORMAL"] = ALLOC_NORMAL;
  720. Module["ALLOC_STACK"] = ALLOC_STACK;
  721. Module["ALLOC_STATIC"] = ALLOC_STATIC;
  722. Module["ALLOC_DYNAMIC"] = ALLOC_DYNAMIC;
  723. Module["ALLOC_NONE"] = ALLOC_NONE;
  724. // allocate(): This is for internal use. You can use it yourself as well, but the interface
  725. // is a little tricky (see docs right below). The reason is that it is optimized
  726. // for multiple syntaxes to save space in generated code. So you should
  727. // normally not use allocate(), and instead allocate memory using _malloc(),
  728. // initialize it with setValue(), and so forth.
  729. // @slab: An array of data, or a number. If a number, then the size of the block to allocate,
  730. // in *bytes* (note that this is sometimes confusing: the next parameter does not
  731. // affect this!)
  732. // @types: Either an array of types, one for each byte (or 0 if no type at that position),
  733. // or a single type which is used for the entire block. This only matters if there
  734. // is initial data - if @slab is a number, then this does not matter at all and is
  735. // ignored.
  736. // @allocator: How to allocate memory, see ALLOC_*
  737. function allocate(slab, types, allocator, ptr) {
  738. var zeroinit, size;
  739. if (typeof slab === 'number') {
  740. zeroinit = true;
  741. size = slab;
  742. } else {
  743. zeroinit = false;
  744. size = slab.length;
  745. }
  746. var singleType = typeof types === 'string' ? types : null;
  747. var ret;
  748. if (allocator == ALLOC_NONE) {
  749. ret = ptr;
  750. } else {
  751. ret = [typeof _malloc === 'function' ? _malloc : Runtime.staticAlloc, Runtime.stackAlloc, Runtime.staticAlloc, Runtime.dynamicAlloc][allocator === undefined ? ALLOC_STATIC : allocator](Math.max(size, singleType ? 1 : types.length));
  752. }
  753. if (zeroinit) {
  754. var ptr = ret, stop;
  755. assert((ret & 3) == 0);
  756. stop = ret + (size & ~3);
  757. for (; ptr < stop; ptr += 4) {
  758. HEAP32[((ptr)>>2)]=0;
  759. }
  760. stop = ret + size;
  761. while (ptr < stop) {
  762. HEAP8[((ptr++)>>0)]=0;
  763. }
  764. return ret;
  765. }
  766. if (singleType === 'i8') {
  767. if (slab.subarray || slab.slice) {
  768. HEAPU8.set(slab, ret);
  769. } else {
  770. HEAPU8.set(new Uint8Array(slab), ret);
  771. }
  772. return ret;
  773. }
  774. var i = 0, type, typeSize, previousType;
  775. while (i < size) {
  776. var curr = slab[i];
  777. if (typeof curr === 'function') {
  778. curr = Runtime.getFunctionIndex(curr);
  779. }
  780. type = singleType || types[i];
  781. if (type === 0) {
  782. i++;
  783. continue;
  784. }
  785. assert(type, 'Must know what type to store in allocate!');
  786. if (type == 'i64') type = 'i32'; // special case: we have one i32 here, and one i32 later
  787. setValue(ret+i, curr, type);
  788. // no need to look up size unless type changes, so cache it
  789. if (previousType !== type) {
  790. typeSize = Runtime.getNativeTypeSize(type);
  791. previousType = type;
  792. }
  793. i += typeSize;
  794. }
  795. return ret;
  796. }
  797. Module["allocate"] = allocate;
  798. // Allocate memory during any stage of startup - static memory early on, dynamic memory later, malloc when ready
  799. function getMemory(size) {
  800. if (!staticSealed) return Runtime.staticAlloc(size);
  801. if (!runtimeInitialized) return Runtime.dynamicAlloc(size);
  802. return _malloc(size);
  803. }
  804. Module["getMemory"] = getMemory;
  805. function Pointer_stringify(ptr, /* optional */ length) {
  806. if (length === 0 || !ptr) return '';
  807. // TODO: use TextDecoder
  808. // Find the length, and check for UTF while doing so
  809. var hasUtf = 0;
  810. var t;
  811. var i = 0;
  812. while (1) {
  813. assert(ptr + i < TOTAL_MEMORY);
  814. t = HEAPU8[(((ptr)+(i))>>0)];
  815. hasUtf |= t;
  816. if (t == 0 && !length) break;
  817. i++;
  818. if (length && i == length) break;
  819. }
  820. if (!length) length = i;
  821. var ret = '';
  822. if (hasUtf < 128) {
  823. var MAX_CHUNK = 1024; // split up into chunks, because .apply on a huge string can overflow the stack
  824. var curr;
  825. while (length > 0) {
  826. curr = String.fromCharCode.apply(String, HEAPU8.subarray(ptr, ptr + Math.min(length, MAX_CHUNK)));
  827. ret = ret ? ret + curr : curr;
  828. ptr += MAX_CHUNK;
  829. length -= MAX_CHUNK;
  830. }
  831. return ret;
  832. }
  833. return Module['UTF8ToString'](ptr);
  834. }
  835. Module["Pointer_stringify"] = Pointer_stringify;
  836. // Given a pointer 'ptr' to a null-terminated ASCII-encoded string in the emscripten HEAP, returns
  837. // a copy of that string as a Javascript String object.
  838. function AsciiToString(ptr) {
  839. var str = '';
  840. while (1) {
  841. var ch = HEAP8[((ptr++)>>0)];
  842. if (!ch) return str;
  843. str += String.fromCharCode(ch);
  844. }
  845. }
  846. Module["AsciiToString"] = AsciiToString;
  847. // Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr',
  848. // null-terminated and encoded in ASCII form. The copy will require at most str.length+1 bytes of space in the HEAP.
  849. function stringToAscii(str, outPtr) {
  850. return writeAsciiToMemory(str, outPtr, false);
  851. }
  852. Module["stringToAscii"] = stringToAscii;
  853. // Given a pointer 'ptr' to a null-terminated UTF8-encoded string in the given array that contains uint8 values, returns
  854. // a copy of that string as a Javascript String object.
  855. var UTF8Decoder = typeof TextDecoder !== 'undefined' ? new TextDecoder('utf8') : undefined;
  856. function UTF8ArrayToString(u8Array, idx) {
  857. var endPtr = idx;
  858. // TextDecoder needs to know the byte length in advance, it doesn't stop on null terminator by itself.
  859. // Also, use the length info to avoid running tiny strings through TextDecoder, since .subarray() allocates garbage.
  860. while (u8Array[endPtr]) ++endPtr;
  861. if (endPtr - idx > 16 && u8Array.subarray && UTF8Decoder) {
  862. return UTF8Decoder.decode(u8Array.subarray(idx, endPtr));
  863. } else {
  864. var u0, u1, u2, u3, u4, u5;
  865. var str = '';
  866. while (1) {
  867. // For UTF8 byte structure, see http://en.wikipedia.org/wiki/UTF-8#Description and https://www.ietf.org/rfc/rfc2279.txt and https://tools.ietf.org/html/rfc3629
  868. u0 = u8Array[idx++];
  869. if (!u0) return str;
  870. if (!(u0 & 0x80)) { str += String.fromCharCode(u0); continue; }
  871. u1 = u8Array[idx++] & 63;
  872. if ((u0 & 0xE0) == 0xC0) { str += String.fromCharCode(((u0 & 31) << 6) | u1); continue; }
  873. u2 = u8Array[idx++] & 63;
  874. if ((u0 & 0xF0) == 0xE0) {
  875. u0 = ((u0 & 15) << 12) | (u1 << 6) | u2;
  876. } else {
  877. u3 = u8Array[idx++] & 63;
  878. if ((u0 & 0xF8) == 0xF0) {
  879. u0 = ((u0 & 7) << 18) | (u1 << 12) | (u2 << 6) | u3;
  880. } else {
  881. u4 = u8Array[idx++] & 63;
  882. if ((u0 & 0xFC) == 0xF8) {
  883. u0 = ((u0 & 3) << 24) | (u1 << 18) | (u2 << 12) | (u3 << 6) | u4;
  884. } else {
  885. u5 = u8Array[idx++] & 63;
  886. u0 = ((u0 & 1) << 30) | (u1 << 24) | (u2 << 18) | (u3 << 12) | (u4 << 6) | u5;
  887. }
  888. }
  889. }
  890. if (u0 < 0x10000) {
  891. str += String.fromCharCode(u0);
  892. } else {
  893. var ch = u0 - 0x10000;
  894. str += String.fromCharCode(0xD800 | (ch >> 10), 0xDC00 | (ch & 0x3FF));
  895. }
  896. }
  897. }
  898. }
  899. Module["UTF8ArrayToString"] = UTF8ArrayToString;
  900. // Given a pointer 'ptr' to a null-terminated UTF8-encoded string in the emscripten HEAP, returns
  901. // a copy of that string as a Javascript String object.
  902. function UTF8ToString(ptr) {
  903. return UTF8ArrayToString(HEAPU8,ptr);
  904. }
  905. Module["UTF8ToString"] = UTF8ToString;
  906. // Copies the given Javascript String object 'str' to the given byte array at address 'outIdx',
  907. // encoded in UTF8 form and null-terminated. The copy will require at most str.length*4+1 bytes of space in the HEAP.
  908. // Use the function lengthBytesUTF8 to compute the exact number of bytes (excluding null terminator) that this function will write.
  909. // Parameters:
  910. // str: the Javascript string to copy.
  911. // outU8Array: the array to copy to. Each index in this array is assumed to be one 8-byte element.
  912. // outIdx: The starting offset in the array to begin the copying.
  913. // maxBytesToWrite: The maximum number of bytes this function can write to the array. This count should include the null
  914. // terminator, i.e. if maxBytesToWrite=1, only the null terminator will be written and nothing else.
  915. // maxBytesToWrite=0 does not write any bytes to the output, not even the null terminator.
  916. // Returns the number of bytes written, EXCLUDING the null terminator.
  917. function stringToUTF8Array(str, outU8Array, outIdx, maxBytesToWrite) {
  918. if (!(maxBytesToWrite > 0)) // Parameter maxBytesToWrite is not optional. Negative values, 0, null, undefined and false each don't write out any bytes.
  919. return 0;
  920. var startIdx = outIdx;
  921. var endIdx = outIdx + maxBytesToWrite - 1; // -1 for string null terminator.
  922. for (var i = 0; i < str.length; ++i) {
  923. // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! So decode UTF16->UTF32->UTF8.
  924. // See http://unicode.org/faq/utf_bom.html#utf16-3
  925. // For UTF8 byte structure, see http://en.wikipedia.org/wiki/UTF-8#Description and https://www.ietf.org/rfc/rfc2279.txt and https://tools.ietf.org/html/rfc3629
  926. var u = str.charCodeAt(i); // possibly a lead surrogate
  927. if (u >= 0xD800 && u <= 0xDFFF) u = 0x10000 + ((u & 0x3FF) << 10) | (str.charCodeAt(++i) & 0x3FF);
  928. if (u <= 0x7F) {
  929. if (outIdx >= endIdx) break;
  930. outU8Array[outIdx++] = u;
  931. } else if (u <= 0x7FF) {
  932. if (outIdx + 1 >= endIdx) break;
  933. outU8Array[outIdx++] = 0xC0 | (u >> 6);
  934. outU8Array[outIdx++] = 0x80 | (u & 63);
  935. } else if (u <= 0xFFFF) {
  936. if (outIdx + 2 >= endIdx) break;
  937. outU8Array[outIdx++] = 0xE0 | (u >> 12);
  938. outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63);
  939. outU8Array[outIdx++] = 0x80 | (u & 63);
  940. } else if (u <= 0x1FFFFF) {
  941. if (outIdx + 3 >= endIdx) break;
  942. outU8Array[outIdx++] = 0xF0 | (u >> 18);
  943. outU8Array[outIdx++] = 0x80 | ((u >> 12) & 63);
  944. outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63);
  945. outU8Array[outIdx++] = 0x80 | (u & 63);
  946. } else if (u <= 0x3FFFFFF) {
  947. if (outIdx + 4 >= endIdx) break;
  948. outU8Array[outIdx++] = 0xF8 | (u >> 24);
  949. outU8Array[outIdx++] = 0x80 | ((u >> 18) & 63);
  950. outU8Array[outIdx++] = 0x80 | ((u >> 12) & 63);
  951. outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63);
  952. outU8Array[outIdx++] = 0x80 | (u & 63);
  953. } else {
  954. if (outIdx + 5 >= endIdx) break;
  955. outU8Array[outIdx++] = 0xFC | (u >> 30);
  956. outU8Array[outIdx++] = 0x80 | ((u >> 24) & 63);
  957. outU8Array[outIdx++] = 0x80 | ((u >> 18) & 63);
  958. outU8Array[outIdx++] = 0x80 | ((u >> 12) & 63);
  959. outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63);
  960. outU8Array[outIdx++] = 0x80 | (u & 63);
  961. }
  962. }
  963. // Null-terminate the pointer to the buffer.
  964. outU8Array[outIdx] = 0;
  965. return outIdx - startIdx;
  966. }
  967. Module["stringToUTF8Array"] = stringToUTF8Array;
  968. // Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr',
  969. // null-terminated and encoded in UTF8 form. The copy will require at most str.length*4+1 bytes of space in the HEAP.
  970. // Use the function lengthBytesUTF8 to compute the exact number of bytes (excluding null terminator) that this function will write.
  971. // Returns the number of bytes written, EXCLUDING the null terminator.
  972. function stringToUTF8(str, outPtr, maxBytesToWrite) {
  973. assert(typeof maxBytesToWrite == 'number', 'stringToUTF8(str, outPtr, maxBytesToWrite) is missing the third parameter that specifies the length of the output buffer!');
  974. return stringToUTF8Array(str, HEAPU8,outPtr, maxBytesToWrite);
  975. }
  976. Module["stringToUTF8"] = stringToUTF8;
  977. // Returns the number of bytes the given Javascript string takes if encoded as a UTF8 byte array, EXCLUDING the null terminator byte.
  978. function lengthBytesUTF8(str) {
  979. var len = 0;
  980. for (var i = 0; i < str.length; ++i) {
  981. // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! So decode UTF16->UTF32->UTF8.
  982. // See http://unicode.org/faq/utf_bom.html#utf16-3
  983. var u = str.charCodeAt(i); // possibly a lead surrogate
  984. if (u >= 0xD800 && u <= 0xDFFF) u = 0x10000 + ((u & 0x3FF) << 10) | (str.charCodeAt(++i) & 0x3FF);
  985. if (u <= 0x7F) {
  986. ++len;
  987. } else if (u <= 0x7FF) {
  988. len += 2;
  989. } else if (u <= 0xFFFF) {
  990. len += 3;
  991. } else if (u <= 0x1FFFFF) {
  992. len += 4;
  993. } else if (u <= 0x3FFFFFF) {
  994. len += 5;
  995. } else {
  996. len += 6;
  997. }
  998. }
  999. return len;
  1000. }
  1001. Module["lengthBytesUTF8"] = lengthBytesUTF8;
  1002. // Given a pointer 'ptr' to a null-terminated UTF16LE-encoded string in the emscripten HEAP, returns
  1003. // a copy of that string as a Javascript String object.
  1004. var UTF16Decoder = typeof TextDecoder !== 'undefined' ? new TextDecoder('utf-16le') : undefined;
  1005. function UTF16ToString(ptr) {
  1006. assert(ptr % 2 == 0, 'Pointer passed to UTF16ToString must be aligned to two bytes!');
  1007. var endPtr = ptr;
  1008. // TextDecoder needs to know the byte length in advance, it doesn't stop on null terminator by itself.
  1009. // Also, use the length info to avoid running tiny strings through TextDecoder, since .subarray() allocates garbage.
  1010. var idx = endPtr >> 1;
  1011. while (HEAP16[idx]) ++idx;
  1012. endPtr = idx << 1;
  1013. if (endPtr - ptr > 32 && UTF16Decoder) {
  1014. return UTF16Decoder.decode(HEAPU8.subarray(ptr, endPtr));
  1015. } else {
  1016. var i = 0;
  1017. var str = '';
  1018. while (1) {
  1019. var codeUnit = HEAP16[(((ptr)+(i*2))>>1)];
  1020. if (codeUnit == 0) return str;
  1021. ++i;
  1022. // fromCharCode constructs a character from a UTF-16 code unit, so we can pass the UTF16 string right through.
  1023. str += String.fromCharCode(codeUnit);
  1024. }
  1025. }
  1026. }
  1027. // Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr',
  1028. // null-terminated and encoded in UTF16 form. The copy will require at most str.length*4+2 bytes of space in the HEAP.
  1029. // Use the function lengthBytesUTF16() to compute the exact number of bytes (excluding null terminator) that this function will write.
  1030. // Parameters:
  1031. // str: the Javascript string to copy.
  1032. // outPtr: Byte address in Emscripten HEAP where to write the string to.
  1033. // maxBytesToWrite: The maximum number of bytes this function can write to the array. This count should include the null
  1034. // terminator, i.e. if maxBytesToWrite=2, only the null terminator will be written and nothing else.
  1035. // maxBytesToWrite<2 does not write any bytes to the output, not even the null terminator.
  1036. // Returns the number of bytes written, EXCLUDING the null terminator.
  1037. function stringToUTF16(str, outPtr, maxBytesToWrite) {
  1038. assert(outPtr % 2 == 0, 'Pointer passed to stringToUTF16 must be aligned to two bytes!');
  1039. assert(typeof maxBytesToWrite == 'number', 'stringToUTF16(str, outPtr, maxBytesToWrite) is missing the third parameter that specifies the length of the output buffer!');
  1040. // Backwards compatibility: if max bytes is not specified, assume unsafe unbounded write is allowed.
  1041. if (maxBytesToWrite === undefined) {
  1042. maxBytesToWrite = 0x7FFFFFFF;
  1043. }
  1044. if (maxBytesToWrite < 2) return 0;
  1045. maxBytesToWrite -= 2; // Null terminator.
  1046. var startPtr = outPtr;
  1047. var numCharsToWrite = (maxBytesToWrite < str.length*2) ? (maxBytesToWrite / 2) : str.length;
  1048. for (var i = 0; i < numCharsToWrite; ++i) {
  1049. // charCodeAt returns a UTF-16 encoded code unit, so it can be directly written to the HEAP.
  1050. var codeUnit = str.charCodeAt(i); // possibly a lead surrogate
  1051. HEAP16[((outPtr)>>1)]=codeUnit;
  1052. outPtr += 2;
  1053. }
  1054. // Null-terminate the pointer to the HEAP.
  1055. HEAP16[((outPtr)>>1)]=0;
  1056. return outPtr - startPtr;
  1057. }
  1058. // Returns the number of bytes the given Javascript string takes if encoded as a UTF16 byte array, EXCLUDING the null terminator byte.
  1059. function lengthBytesUTF16(str) {
  1060. return str.length*2;
  1061. }
  1062. function UTF32ToString(ptr) {
  1063. assert(ptr % 4 == 0, 'Pointer passed to UTF32ToString must be aligned to four bytes!');
  1064. var i = 0;
  1065. var str = '';
  1066. while (1) {
  1067. var utf32 = HEAP32[(((ptr)+(i*4))>>2)];
  1068. if (utf32 == 0)
  1069. return str;
  1070. ++i;
  1071. // Gotcha: fromCharCode constructs a character from a UTF-16 encoded code (pair), not from a Unicode code point! So encode the code point to UTF-16 for constructing.
  1072. // See http://unicode.org/faq/utf_bom.html#utf16-3
  1073. if (utf32 >= 0x10000) {
  1074. var ch = utf32 - 0x10000;
  1075. str += String.fromCharCode(0xD800 | (ch >> 10), 0xDC00 | (ch & 0x3FF));
  1076. } else {
  1077. str += String.fromCharCode(utf32);
  1078. }
  1079. }
  1080. }
  1081. // Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr',
  1082. // null-terminated and encoded in UTF32 form. The copy will require at most str.length*4+4 bytes of space in the HEAP.
  1083. // Use the function lengthBytesUTF32() to compute the exact number of bytes (excluding null terminator) that this function will write.
  1084. // Parameters:
  1085. // str: the Javascript string to copy.
  1086. // outPtr: Byte address in Emscripten HEAP where to write the string to.
  1087. // maxBytesToWrite: The maximum number of bytes this function can write to the array. This count should include the null
  1088. // terminator, i.e. if maxBytesToWrite=4, only the null terminator will be written and nothing else.
  1089. // maxBytesToWrite<4 does not write any bytes to the output, not even the null terminator.
  1090. // Returns the number of bytes written, EXCLUDING the null terminator.
  1091. function stringToUTF32(str, outPtr, maxBytesToWrite) {
  1092. assert(outPtr % 4 == 0, 'Pointer passed to stringToUTF32 must be aligned to four bytes!');
  1093. assert(typeof maxBytesToWrite == 'number', 'stringToUTF32(str, outPtr, maxBytesToWrite) is missing the third parameter that specifies the length of the output buffer!');
  1094. // Backwards compatibility: if max bytes is not specified, assume unsafe unbounded write is allowed.
  1095. if (maxBytesToWrite === undefined) {
  1096. maxBytesToWrite = 0x7FFFFFFF;
  1097. }
  1098. if (maxBytesToWrite < 4) return 0;
  1099. var startPtr = outPtr;
  1100. var endPtr = startPtr + maxBytesToWrite - 4;
  1101. for (var i = 0; i < str.length; ++i) {
  1102. // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! We must decode the string to UTF-32 to the heap.
  1103. // See http://unicode.org/faq/utf_bom.html#utf16-3
  1104. var codeUnit = str.charCodeAt(i); // possibly a lead surrogate
  1105. if (codeUnit >= 0xD800 && codeUnit <= 0xDFFF) {
  1106. var trailSurrogate = str.charCodeAt(++i);
  1107. codeUnit = 0x10000 + ((codeUnit & 0x3FF) << 10) | (trailSurrogate & 0x3FF);
  1108. }
  1109. HEAP32[((outPtr)>>2)]=codeUnit;
  1110. outPtr += 4;
  1111. if (outPtr + 4 > endPtr) break;
  1112. }
  1113. // Null-terminate the pointer to the HEAP.
  1114. HEAP32[((outPtr)>>2)]=0;
  1115. return outPtr - startPtr;
  1116. }
  1117. // Returns the number of bytes the given Javascript string takes if encoded as a UTF16 byte array, EXCLUDING the null terminator byte.
  1118. function lengthBytesUTF32(str) {
  1119. var len = 0;
  1120. for (var i = 0; i < str.length; ++i) {
  1121. // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! We must decode the string to UTF-32 to the heap.
  1122. // See http://unicode.org/faq/utf_bom.html#utf16-3
  1123. var codeUnit = str.charCodeAt(i);
  1124. if (codeUnit >= 0xD800 && codeUnit <= 0xDFFF) ++i; // possibly a lead surrogate, so skip over the tail surrogate.
  1125. len += 4;
  1126. }
  1127. return len;
  1128. }
  1129. function demangle(func) {
  1130. var __cxa_demangle_func = Module['___cxa_demangle'] || Module['__cxa_demangle'];
  1131. if (__cxa_demangle_func) {
  1132. try {
  1133. var s =
  1134. func.substr(1);
  1135. var len = lengthBytesUTF8(s)+1;
  1136. var buf = _malloc(len);
  1137. stringToUTF8(s, buf, len);
  1138. var status = _malloc(4);
  1139. var ret = __cxa_demangle_func(buf, 0, 0, status);
  1140. if (getValue(status, 'i32') === 0 && ret) {
  1141. return Pointer_stringify(ret);
  1142. }
  1143. // otherwise, libcxxabi failed
  1144. } catch(e) {
  1145. // ignore problems here
  1146. } finally {
  1147. if (buf) _free(buf);
  1148. if (status) _free(status);
  1149. if (ret) _free(ret);
  1150. }
  1151. // failure when using libcxxabi, don't demangle
  1152. return func;
  1153. }
  1154. Runtime.warnOnce('warning: build with -s DEMANGLE_SUPPORT=1 to link in libcxxabi demangling');
  1155. return func;
  1156. }
  1157. function demangleAll(text) {
  1158. var regex =
  1159. /__Z[\w\d_]+/g;
  1160. return text.replace(regex,
  1161. function(x) {
  1162. var y = demangle(x);
  1163. return x === y ? x : (x + ' [' + y + ']');
  1164. });
  1165. }
  1166. function jsStackTrace() {
  1167. var err = new Error();
  1168. if (!err.stack) {
  1169. // IE10+ special cases: It does have callstack info, but it is only populated if an Error object is thrown,
  1170. // so try that as a special-case.
  1171. try {
  1172. throw new Error(0);
  1173. } catch(e) {
  1174. err = e;
  1175. }
  1176. if (!err.stack) {
  1177. return '(no stack trace available)';
  1178. }
  1179. }
  1180. return err.stack.toString();
  1181. }
  1182. function stackTrace() {
  1183. var js = jsStackTrace();
  1184. if (Module['extraStackTrace']) js += '\n' + Module['extraStackTrace']();
  1185. return demangleAll(js);
  1186. }
  1187. Module["stackTrace"] = stackTrace;
  1188. // Memory management
  1189. var PAGE_SIZE = 16384;
  1190. var WASM_PAGE_SIZE = 65536;
  1191. var ASMJS_PAGE_SIZE = 16777216;
  1192. var MIN_TOTAL_MEMORY = 16777216;
  1193. function alignUp(x, multiple) {
  1194. if (x % multiple > 0) {
  1195. x += multiple - (x % multiple);
  1196. }
  1197. return x;
  1198. }
  1199. var HEAP;
  1200. var buffer;
  1201. var HEAP8, HEAPU8, HEAP16, HEAPU16, HEAP32, HEAPU32, HEAPF32, HEAPF64;
  1202. function updateGlobalBuffer(buf) {
  1203. Module['buffer'] = buffer = buf;
  1204. }
  1205. function updateGlobalBufferViews() {
  1206. Module['HEAP8'] = HEAP8 = new Int8Array(buffer);
  1207. Module['HEAP16'] = HEAP16 = new Int16Array(buffer);
  1208. Module['HEAP32'] = HEAP32 = new Int32Array(buffer);
  1209. Module['HEAPU8'] = HEAPU8 = new Uint8Array(buffer);
  1210. Module['HEAPU16'] = HEAPU16 = new Uint16Array(buffer);
  1211. Module['HEAPU32'] = HEAPU32 = new Uint32Array(buffer);
  1212. Module['HEAPF32'] = HEAPF32 = new Float32Array(buffer);
  1213. Module['HEAPF64'] = HEAPF64 = new Float64Array(buffer);
  1214. }
  1215. var STATIC_BASE, STATICTOP, staticSealed; // static area
  1216. var STACK_BASE, STACKTOP, STACK_MAX; // stack area
  1217. var DYNAMIC_BASE, DYNAMICTOP_PTR; // dynamic area handled by sbrk
  1218. STATIC_BASE = STATICTOP = STACK_BASE = STACKTOP = STACK_MAX = DYNAMIC_BASE = DYNAMICTOP_PTR = 0;
  1219. staticSealed = false;
  1220. // Initializes the stack cookie. Called at the startup of main and at the startup of each thread in pthreads mode.
  1221. function writeStackCookie() {
  1222. assert((STACK_MAX & 3) == 0);
  1223. HEAPU32[(STACK_MAX >> 2)-1] = 0x02135467;
  1224. HEAPU32[(STACK_MAX >> 2)-2] = 0x89BACDFE;
  1225. }
  1226. function checkStackCookie() {
  1227. if (HEAPU32[(STACK_MAX >> 2)-1] != 0x02135467 || HEAPU32[(STACK_MAX >> 2)-2] != 0x89BACDFE) {
  1228. abort('Stack overflow! Stack cookie has been overwritten, expected hex dwords 0x89BACDFE and 0x02135467, but received 0x' + HEAPU32[(STACK_MAX >> 2)-2].toString(16) + ' ' + HEAPU32[(STACK_MAX >> 2)-1].toString(16));
  1229. }
  1230. // Also test the global address 0 for integrity. This check is not compatible with SAFE_SPLIT_MEMORY though, since that mode already tests all address 0 accesses on its own.
  1231. if (HEAP32[0] !== 0x63736d65 /* 'emsc' */) throw 'Runtime error: The application has corrupted its heap memory area (address zero)!';
  1232. }
  1233. function abortStackOverflow(allocSize) {
  1234. abort('Stack overflow! Attempted to allocate ' + allocSize + ' bytes on the stack, but stack has only ' + (STACK_MAX - asm.stackSave() + allocSize) + ' bytes available!');
  1235. }
  1236. function abortOnCannotGrowMemory() {
  1237. abort('Cannot enlarge memory arrays. Either (1) compile with -s TOTAL_MEMORY=X with X higher than the current value ' + TOTAL_MEMORY + ', (2) compile with -s ALLOW_MEMORY_GROWTH=1 which adjusts the size at runtime but prevents some optimizations, (3) set Module.TOTAL_MEMORY to a higher value before the program runs, or if you want malloc to return NULL (0) instead of this abort, compile with -s ABORTING_MALLOC=0 ');
  1238. }
  1239. function enlargeMemory() {
  1240. abortOnCannotGrowMemory();
  1241. }
  1242. var TOTAL_STACK = Module['TOTAL_STACK'] || 5242880;
  1243. var TOTAL_MEMORY = Module['TOTAL_MEMORY'] || 67108864;
  1244. if (TOTAL_MEMORY < TOTAL_STACK) Module.printErr('TOTAL_MEMORY should be larger than TOTAL_STACK, was ' + TOTAL_MEMORY + '! (TOTAL_STACK=' + TOTAL_STACK + ')');
  1245. // Initialize the runtime's memory
  1246. // check for full engine support (use string 'subarray' to avoid closure compiler confusion)
  1247. assert(typeof Int32Array !== 'undefined' && typeof Float64Array !== 'undefined' && !!(new Int32Array(1)['subarray']) && !!(new Int32Array(1)['set']),
  1248. 'JS engine does not provide full typed array support');
  1249. // Use a provided buffer, if there is one, or else allocate a new one
  1250. if (Module['buffer']) {
  1251. buffer = Module['buffer'];
  1252. assert(buffer.byteLength === TOTAL_MEMORY, 'provided buffer should be ' + TOTAL_MEMORY + ' bytes, but it is ' + buffer.byteLength);
  1253. } else {
  1254. // Use a WebAssembly memory where available
  1255. {
  1256. buffer = new ArrayBuffer(TOTAL_MEMORY);
  1257. }
  1258. assert(buffer.byteLength === TOTAL_MEMORY);
  1259. }
  1260. updateGlobalBufferViews();
  1261. function getTotalMemory() {
  1262. return TOTAL_MEMORY;
  1263. }
  1264. // Endianness check (note: assumes compiler arch was little-endian)
  1265. HEAP32[0] = 0x63736d65; /* 'emsc' */
  1266. HEAP16[1] = 0x6373;
  1267. if (HEAPU8[2] !== 0x73 || HEAPU8[3] !== 0x63) throw 'Runtime error: expected the system to be little-endian!';
  1268. Module['HEAP'] = HEAP;
  1269. Module['buffer'] = buffer;
  1270. Module['HEAP8'] = HEAP8;
  1271. Module['HEAP16'] = HEAP16;
  1272. Module['HEAP32'] = HEAP32;
  1273. Module['HEAPU8'] = HEAPU8;
  1274. Module['HEAPU16'] = HEAPU16;
  1275. Module['HEAPU32'] = HEAPU32;
  1276. Module['HEAPF32'] = HEAPF32;
  1277. Module['HEAPF64'] = HEAPF64;
  1278. function callRuntimeCallbacks(callbacks) {
  1279. while(callbacks.length > 0) {
  1280. var callback = callbacks.shift();
  1281. if (typeof callback == 'function') {
  1282. callback();
  1283. continue;
  1284. }
  1285. var func = callback.func;
  1286. if (typeof func === 'number') {
  1287. if (callback.arg === undefined) {
  1288. Module['dynCall_v'](func);
  1289. } else {
  1290. Module['dynCall_vi'](func, callback.arg);
  1291. }
  1292. } else {
  1293. func(callback.arg === undefined ? null : callback.arg);
  1294. }
  1295. }
  1296. }
  1297. var __ATPRERUN__ = []; // functions called before the runtime is initialized
  1298. var __ATINIT__ = []; // functions called during startup
  1299. var __ATMAIN__ = []; // functions called when main() is to be run
  1300. var __ATEXIT__ = []; // functions called during shutdown
  1301. var __ATPOSTRUN__ = []; // functions called after the runtime has exited
  1302. var runtimeInitialized = false;
  1303. var runtimeExited = false;
  1304. function preRun() {
  1305. // compatibility - merge in anything from Module['preRun'] at this time
  1306. if (Module['preRun']) {
  1307. if (typeof Module['preRun'] == 'function') Module['preRun'] = [Module['preRun']];
  1308. while (Module['preRun'].length) {
  1309. addOnPreRun(Module['preRun'].shift());
  1310. }
  1311. }
  1312. callRuntimeCallbacks(__ATPRERUN__);
  1313. }
  1314. function ensureInitRuntime() {
  1315. checkStackCookie();
  1316. if (runtimeInitialized) return;
  1317. runtimeInitialized = true;
  1318. callRuntimeCallbacks(__ATINIT__);
  1319. }
  1320. function preMain() {
  1321. checkStackCookie();
  1322. callRuntimeCallbacks(__ATMAIN__);
  1323. }
  1324. function exitRuntime() {
  1325. checkStackCookie();
  1326. callRuntimeCallbacks(__ATEXIT__);
  1327. runtimeExited = true;
  1328. }
  1329. function postRun() {
  1330. checkStackCookie();
  1331. // compatibility - merge in anything from Module['postRun'] at this time
  1332. if (Module['postRun']) {
  1333. if (typeof Module['postRun'] == 'function') Module['postRun'] = [Module['postRun']];
  1334. while (Module['postRun'].length) {
  1335. addOnPostRun(Module['postRun'].shift());
  1336. }
  1337. }
  1338. callRuntimeCallbacks(__ATPOSTRUN__);
  1339. }
  1340. function addOnPreRun(cb) {
  1341. __ATPRERUN__.unshift(cb);
  1342. }
  1343. Module["addOnPreRun"] = addOnPreRun;
  1344. function addOnInit(cb) {
  1345. __ATINIT__.unshift(cb);
  1346. }
  1347. Module["addOnInit"] = addOnInit;
  1348. function addOnPreMain(cb) {
  1349. __ATMAIN__.unshift(cb);
  1350. }
  1351. Module["addOnPreMain"] = addOnPreMain;
  1352. function addOnExit(cb) {
  1353. __ATEXIT__.unshift(cb);
  1354. }
  1355. Module["addOnExit"] = addOnExit;
  1356. function addOnPostRun(cb) {
  1357. __ATPOSTRUN__.unshift(cb);
  1358. }
  1359. Module["addOnPostRun"] = addOnPostRun;
  1360. // Tools
  1361. function intArrayFromString(stringy, dontAddNull, length /* optional */) {
  1362. var len = length > 0 ? length : lengthBytesUTF8(stringy)+1;
  1363. var u8array = new Array(len);
  1364. var numBytesWritten = stringToUTF8Array(stringy, u8array, 0, u8array.length);
  1365. if (dontAddNull) u8array.length = numBytesWritten;
  1366. return u8array;
  1367. }
  1368. Module["intArrayFromString"] = intArrayFromString;
  1369. function intArrayToString(array) {
  1370. var ret = [];
  1371. for (var i = 0; i < array.length; i++) {
  1372. var chr = array[i];
  1373. if (chr > 0xFF) {
  1374. assert(false, 'Character code ' + chr + ' (' + String.fromCharCode(chr) + ') at offset ' + i + ' not in 0x00-0xFF.');
  1375. chr &= 0xFF;
  1376. }
  1377. ret.push(String.fromCharCode(chr));
  1378. }
  1379. return ret.join('');
  1380. }
  1381. Module["intArrayToString"] = intArrayToString;
  1382. // Deprecated: This function should not be called because it is unsafe and does not provide
  1383. // a maximum length limit of how many bytes it is allowed to write. Prefer calling the
  1384. // function stringToUTF8Array() instead, which takes in a maximum length that can be used
  1385. // to be secure from out of bounds writes.
  1386. function writeStringToMemory(string, buffer, dontAddNull) {
  1387. Runtime.warnOnce('writeStringToMemory is deprecated and should not be called! Use stringToUTF8() instead!');
  1388. var lastChar, end;
  1389. if (dontAddNull) {
  1390. // stringToUTF8Array always appends null. If we don't want to do that, remember the
  1391. // character that existed at the location where the null will be placed, and restore
  1392. // that after the write (below).
  1393. end = buffer + lengthBytesUTF8(string);
  1394. lastChar = HEAP8[end];
  1395. }
  1396. stringToUTF8(string, buffer, Infinity);
  1397. if (dontAddNull) HEAP8[end] = lastChar; // Restore the value under the null character.
  1398. }
  1399. Module["writeStringToMemory"] = writeStringToMemory;
  1400. function writeArrayToMemory(array, buffer) {
  1401. assert(array.length >= 0, 'writeArrayToMemory array must have a length (should be an array or typed array)')
  1402. HEAP8.set(array, buffer);
  1403. }
  1404. Module["writeArrayToMemory"] = writeArrayToMemory;
  1405. function writeAsciiToMemory(str, buffer, dontAddNull) {
  1406. for (var i = 0; i < str.length; ++i) {
  1407. assert(str.charCodeAt(i) === str.charCodeAt(i)&0xff);
  1408. HEAP8[((buffer++)>>0)]=str.charCodeAt(i);
  1409. }
  1410. // Null-terminate the pointer to the HEAP.
  1411. if (!dontAddNull) HEAP8[((buffer)>>0)]=0;
  1412. }
  1413. Module["writeAsciiToMemory"] = writeAsciiToMemory;
  1414. function unSign(value, bits, ignore) {
  1415. if (value >= 0) {
  1416. return value;
  1417. }
  1418. return bits <= 32 ? 2*Math.abs(1 << (bits-1)) + value // Need some trickery, since if bits == 32, we are right at the limit of the bits JS uses in bitshifts
  1419. : Math.pow(2, bits) + value;
  1420. }
  1421. function reSign(value, bits, ignore) {
  1422. if (value <= 0) {
  1423. return value;
  1424. }
  1425. var half = bits <= 32 ? Math.abs(1 << (bits-1)) // abs is needed if bits == 32
  1426. : Math.pow(2, bits-1);
  1427. if (value >= half && (bits <= 32 || value > half)) { // for huge values, we can hit the precision limit and always get true here. so don't do that
  1428. // but, in general there is no perfect solution here. With 64-bit ints, we get rounding and errors
  1429. // TODO: In i64 mode 1, resign the two parts separately and safely
  1430. value = -2*half + value; // Cannot bitshift half, as it may be at the limit of the bits JS uses in bitshifts
  1431. }
  1432. return value;
  1433. }
  1434. // check for imul support, and also for correctness ( https://bugs.webkit.org/show_bug.cgi?id=126345 )
  1435. if (!Math['imul'] || Math['imul'](0xffffffff, 5) !== -5) Math['imul'] = function imul(a, b) {
  1436. var ah = a >>> 16;
  1437. var al = a & 0xffff;
  1438. var bh = b >>> 16;
  1439. var bl = b & 0xffff;
  1440. return (al*bl + ((ah*bl + al*bh) << 16))|0;
  1441. };
  1442. Math.imul = Math['imul'];
  1443. if (!Math['clz32']) Math['clz32'] = function(x) {
  1444. x = x >>> 0;
  1445. for (var i = 0; i < 32; i++) {
  1446. if (x & (1 << (31 - i))) return i;
  1447. }
  1448. return 32;
  1449. };
  1450. Math.clz32 = Math['clz32']
  1451. if (!Math['trunc']) Math['trunc'] = function(x) {
  1452. return x < 0 ? Math.ceil(x) : Math.floor(x);
  1453. };
  1454. Math.trunc = Math['trunc'];
  1455. var Math_abs = Math.abs;
  1456. var Math_cos = Math.cos;
  1457. var Math_sin = Math.sin;
  1458. var Math_tan = Math.tan;
  1459. var Math_acos = Math.acos;
  1460. var Math_asin = Math.asin;
  1461. var Math_atan = Math.atan;
  1462. var Math_atan2 = Math.atan2;
  1463. var Math_exp = Math.exp;
  1464. var Math_log = Math.log;
  1465. var Math_sqrt = Math.sqrt;
  1466. var Math_ceil = Math.ceil;
  1467. var Math_floor = Math.floor;
  1468. var Math_pow = Math.pow;
  1469. var Math_imul = Math.imul;
  1470. var Math_fround = Math.fround;
  1471. var Math_round = Math.round;
  1472. var Math_min = Math.min;
  1473. var Math_clz32 = Math.clz32;
  1474. var Math_trunc = Math.trunc;
  1475. // A counter of dependencies for calling run(). If we need to
  1476. // do asynchronous work before running, increment this and
  1477. // decrement it. Incrementing must happen in a place like
  1478. // PRE_RUN_ADDITIONS (used by emcc to add file preloading).
  1479. // Note that you can add dependencies in preRun, even though
  1480. // it happens right before run - run will be postponed until
  1481. // the dependencies are met.
  1482. var runDependencies = 0;
  1483. var runDependencyWatcher = null;
  1484. var dependenciesFulfilled = null; // overridden to take different actions when all run dependencies are fulfilled
  1485. var runDependencyTracking = {};
  1486. function getUniqueRunDependency(id) {
  1487. var orig = id;
  1488. while (1) {
  1489. if (!runDependencyTracking[id]) return id;
  1490. id = orig + Math.random();
  1491. }
  1492. return id;
  1493. }
  1494. function addRunDependency(id) {
  1495. runDependencies++;
  1496. if (Module['monitorRunDependencies']) {
  1497. Module['monitorRunDependencies'](runDependencies);
  1498. }
  1499. if (id) {
  1500. assert(!runDependencyTracking[id]);
  1501. runDependencyTracking[id] = 1;
  1502. if (runDependencyWatcher === null && typeof setInterval !== 'undefined') {
  1503. // Check for missing dependencies every few seconds
  1504. runDependencyWatcher = setInterval(function() {
  1505. if (ABORT) {
  1506. clearInterval(runDependencyWatcher);
  1507. runDependencyWatcher = null;
  1508. return;
  1509. }
  1510. var shown = false;
  1511. for (var dep in runDependencyTracking) {
  1512. if (!shown) {
  1513. shown = true;
  1514. Module.printErr('still waiting on run dependencies:');
  1515. }
  1516. Module.printErr('dependency: ' + dep);
  1517. }
  1518. if (shown) {
  1519. Module.printErr('(end of list)');
  1520. }
  1521. }, 10000);
  1522. }
  1523. } else {
  1524. Module.printErr('warning: run dependency added without ID');
  1525. }
  1526. }
  1527. Module["addRunDependency"] = addRunDependency;
  1528. function removeRunDependency(id) {
  1529. runDependencies--;
  1530. if (Module['monitorRunDependencies']) {
  1531. Module['monitorRunDependencies'](runDependencies);
  1532. }
  1533. if (id) {
  1534. assert(runDependencyTracking[id]);
  1535. delete runDependencyTracking[id];
  1536. } else {
  1537. Module.printErr('warning: run dependency removed without ID');
  1538. }
  1539. if (runDependencies == 0) {
  1540. if (runDependencyWatcher !== null) {
  1541. clearInterval(runDependencyWatcher);
  1542. runDependencyWatcher = null;
  1543. }
  1544. if (dependenciesFulfilled) {
  1545. var callback = dependenciesFulfilled;
  1546. dependenciesFulfilled = null;
  1547. callback(); // can add another dependenciesFulfilled
  1548. }
  1549. }
  1550. }
  1551. Module["removeRunDependency"] = removeRunDependency;
  1552. Module["preloadedImages"] = {}; // maps url to image data
  1553. Module["preloadedAudios"] = {}; // maps url to audio data
  1554. var memoryInitializer = null;
  1555. // === Body ===
  1556. var ASM_CONSTS = [function($0, $1) { { Module.printErr('bad name in getProcAddress: ' + [Pointer_stringify($0), Pointer_stringify($1)]); } }];
  1557. function _emscripten_asm_const_iii(code, a0, a1) {
  1558. return ASM_CONSTS[code](a0, a1);
  1559. }
  1560. STATIC_BASE = 8;
  1561. STATICTOP = STATIC_BASE + 23760;
  1562. /* global initializers */ __ATINIT__.push();
  1563. /* memory initializer */ allocate([32,3,0,0,194,1,0,0,0,0,64,64,0,0,64,64,0,0,64,64,0,0,0,0,0,0,192,63,0,0,0,0,0,0,0,0,0,0,128,63,0,0,0,0,0,0,52,66,255,255,255,255,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,32,0,32,0,0,176,1,0,0,0,0,0,0,0,0,0,32,37,249,142,0,10,2,0,0,128,190,125,95,244,125,31,160,242,43,74,30,9,82,8,0,64,34,65,80,20,4,16,32,32,41,46,18,8,34,8,0,32,34,65,80,20,4,16,32,32,249,16,76,8,250,62,60,16,34,125,222,247,125,16,32,32,161,232,50,8,34,8,0,8,34,5,16,4,69,16,0,240,163,164,50,8,82,8,0,4,34,5,16,4,69,16,32,32,249,226,94,8,2,0,129,2,62,125,31,244,125,16,0,0,32,0,0,176,1,128,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,190,15,0,192,15,224,247,251,125,126,191,95,232,190,80,0,162,8,8,68,232,47,20,10,133,2,129,80,72,160,80,0,162,40,228,73,40,40,20,10,132,2,129,64,72,160,72,0,190,15,2,16,175,235,247,9,132,62,159,216,79,160,71,0,34,136,228,9,161,42,20,10,132,2,129,80,72,160,72,0,34,40,8,4,160,47,20,10,133,2,129,80,72,162,80,0,190,143,0,0,33,32,244,251,125,126,129,95,232,156,208,7,0,128,0,0,224,15,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,128,1,12,0,130,66,191,223,239,247,251,11,5,5,133,66,191,4,72,0,198,66,161,80,40,20,64,8,5,37,133,66,160,8,168,0,170,70,161,80,40,20,64,8,5,37,133,66,144,16,8,0,146,74,161,95,232,247,67,8,5,37,121,126,136,32,8,0,130,82,161,64,40,1,66,8,137,36,133,64,132,64,8,0,130,98,161,64,42,2,66,8,81,36,133,64,130,128,8,0,130,66,191,192,47,244,67,248,33,252,133,126,191,0,9,62,0,0,0,0,4,0,0,0,0,0,0,0,128,1,12,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,4,0,4,0,32,72,65,0,0,0,0,0,8,0,0,4,4,0,4,60,32,0,65,0,0,0,0,0,8,0,0,240,125,223,247,133,239,75,81,190,239,251,190,239,59,81,4,0,69,65,20,133,40,74,73,170,40,138,162,32,8,81,4,240,69,65,244,157,40,74,71,170,40,138,162,224,11,81,4,16,69,65,20,132,40,74,73,170,40,138,162,0,10,145,2,240,125,223,247,133,47,74,209,170,232,251,190,224,123,31,1,0,0,0,0,4,8,64,0,0,0,8,32,0,0,0,0,0,0,0,0,132,15,96,0,0,0,8,32,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,172,1,15,0,0,0,0,0,0,0,0,0,0,0,0,0,36,1,9,0,0,0,0,0,0,0,0,0,6,0,0,0,36,1,9,0,0,0,0,0,0,0,128,16,9,162,40,250,36,1,9,0,0,0,0,0,0,0,0,62,1,42,37,66,34,82,9,0,0,0,0,0,0,0,128,138,3,42,34,34,36,41,9,0,0,0,0,0,0,0,128,10,1,42,37,18,36,1,9,0,0,0,0,0,0,0,128,10,1,190,232,251,36,1,9,0,0,0,0,0,0,0,128,190,14,0,0,2,172,1,15,0,0,0,0,0,0,0,128,4,0,0,224,3,0,0,0,0,0,0,0,0,0,0,128,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,56,0,0,0,14,184,67,132,3,58,32,0,128,160,190,2,32,0,0,240,138,32,82,196,2,43,32,4,34,145,2,248,59,0,240,7,142,56,75,228,2,58,32,2,28,138,30,8,42,233,17,4,224,11,66,244,2,130,36,1,20,4,20,232,186,4,209,5,128,184,195,231,10,58,137,0,28,14,60,40,2,9,80,4,128,0,64,196,2,128,68,0,34,132,32,232,2,0,80,4,0,0,64,128,2,0,32,5,0,142,62,8,2,0,16,4,224,3,64,128,66,0,0,7,0,132,0,248,3,0,240,7,0,0,64,128,34,0,0,4,0,0,0,0,0,0,0,0,0,0,64,128,2,0,0,4,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,7,128,0,194,160,72,24,0,0,1,132,33,9,146,2,66,38,4,1,33,81,0,0,127,63,2,66,2,16,41,0,34,20,192,239,247,251,253,126,9,161,223,239,247,187,187,3,18,15,68,40,20,10,133,66,9,129,64,32,16,16,17,1,8,4,68,40,20,10,133,66,127,129,64,32,16,16,17,1,4,130,199,239,247,251,253,126,9,129,207,231,243,17,17,1,50,169,80,40,20,10,133,66,9,161,64,32,16,16,17,1,64,184,80,40,20,10,133,66,121,191,223,239,247,187,187,3,32,160,31,0,0,0,0,0,0,16,0,0,0,0,0,0,112,32,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,40,2,8,131,34,1,0,2,8,67,2,1,0,1,1,124,20,4,132,68,1,0,32,4,132,4,128,8,63,130,0,132,66,191,223,239,247,3,126,161,80,40,20,10,33,0,0,132,70,161,80,40,20,138,82,161,80,40,20,122,161,239,3,158,74,161,80,40,20,82,82,161,80,40,20,74,31,8,2,132,82,161,80,40,20,34,74,161,80,40,244,75,161,239,3,132,98,161,80,40,20,82,74,161,80,40,4,122,161,40,2,124,66,191,223,239,247,139,126,191,223,239,247,11,189,239,3,0,0,0,0,0,0,0,4,0,0,0,0,8,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,8,5,32,0,0,4,132,0,34,129,69,17,16,66,1,0,148,66,81,0,0,8,66,81,148,42,162,32,8,165,80,0,0,0,32,0,0,0,0,0,0,0,5,0,0,0,0,8,190,239,251,254,251,190,239,251,20,145,235,251,190,239,251,0,32,8,130,32,10,162,40,138,20,145,40,138,162,40,138,62,190,239,251,254,11,190,239,251,20,145,40,138,162,40,138,0,162,40,138,34,8,130,32,8,20,145,40,138,162,40,138,8,190,239,251,254,251,190,239,251,20,145,47,250,190,239,251,0,0,0,0,0,64,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,32,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,33,0,4,0,0,0,0,0,0,0,0,0,0,0,0,130,80,20,2,20,0,0,0,0,0,0,0,0,0,0,16,0,0,0,32,0,0,0,0,0,0,0,0,0,0,0,190,40,138,162,40,34,0,0,0,0,0,0,0,0,0,0,170,40,138,162,232,34,0,0,0,0,0,0,0,0,0,0,170,40,138,162,168,34,0,0,0,0,0,0,0,0,0,0,170,40,138,162,232,34,0,0,0,0,0,0,0,0,0,0,190,239,251,190,47,62,0,0,0,0,0,0,0,0,0,0,4,0,0,0,40,32,0,0,0,0,0,0,0,0,0,0,0,0,0,128,15,62,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,3,0,0,0,1,0,0,0,4,0,0,0,6,0,0,0,5,0,0,0,7,0,0,0,6,0,0,0,2,0,0,0,3,0,0,0,3,0,0,0,5,0,0,0,5,0,0,0,2,0,0,0,4,0,0,0,1,0,0,0,7,0,0,0,5,0,0,0,2,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,1,0,0,0,1,0,0,0,3,0,0,0,4,0,0,0,3,0,0,0,6,0,0,0,7,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,3,0,0,0,5,0,0,0,6,0,0,0,5,0,0,0,7,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,7,0,0,0,6,0,0,0,7,0,0,0,7,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,2,0,0,0,7,0,0,0,2,0,0,0,3,0,0,0,5,0,0,0,2,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,4,0,0,0,5,0,0,0,5,0,0,0,1,0,0,0,2,0,0,0,5,0,0,0,2,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,4,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,3,0,0,0,1,0,0,0,3,0,0,0,4,0,0,0,4,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,7,0,0,0,1,0,0,0,5,0,0,0,3,0,0,0,7,0,0,0,3,0,0,0,5,0,0,0,4,0,0,0,1,0,0,0,7,0,0,0,4,0,0,0,3,0,0,0,5,0,0,0,3,0,0,0,3,0,0,0,2,0,0,0,5,0,0,0,6,0,0,0,1,0,0,0,2,0,0,0,2,0,0,0,3,0,0,0,5,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,7,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,3,0,0,0,3,0,0,0,3,0,0,0,3,0,0,0,7,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,5,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,4,0,0,0,6,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,9,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,2,0,0,0,2,0,0,0,3,0,0,0,3,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,3,0,0,0,5,0,0,0,255,255,255,255,0,1,0,0,255,255,255,255,0,0,128,191,0,0,0,0,4,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,8,0,0,0,8,0,0,0,4,0,0,0,4,0,0,0,2,0,0,0,2,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,4,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,1,0,0,0,8,0,0,0,8,0,0,0,8,0,0,0,4,0,0,0,4,0,0,0,2,0,0,0,2,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,1,0,0,1,0,0,0,4,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,2,0,0,0,2,0,0,0,2,0,0,0,2,0,0,0,3,0,0,0,3,0,0,0,3,0,0,0,3,0,0,0,4,0,0,0,4,0,0,0,4,0,0,0,4,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,3,0,0,0,4,0,0,0,5,0,0,0,6,0,0,0,7,0,0,0,8,0,0,0,9,0,0,0,10,0,0,0,11,0,0,0,13,0,0,0,15,0,0,0,17,0,0,0,19,0,0,0,23,0,0,0,27,0,0,0,31,0,0,0,35,0,0,0,43,0,0,0,51,0,0,0,59,0,0,0,67,0,0,0,83,0,0,0,99,0,0,0,115,0,0,0,131,0,0,0,163,0,0,0,195,0,0,0,227,0,0,0,2,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,1,0,0,0,2,0,0,0,2,0,0,0,3,0,0,0,3,0,0,0,4,0,0,0,4,0,0,0,5,0,0,0,5,0,0,0,6,0,0,0,6,0,0,0,7,0,0,0,7,0,0,0,8,0,0,0,8,0,0,0,9,0,0,0,9,0,0,0,10,0,0,0,10,0,0,0,11,0,0,0,11,0,0,0,12,0,0,0,12,0,0,0,13,0,0,0,13,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,2,0,0,0,3,0,0,0,4,0,0,0,5,0,0,0,7,0,0,0,9,0,0,0,13,0,0,0,17,0,0,0,25,0,0,0,33,0,0,0,49,0,0,0,65,0,0,0,97,0,0,0,129,0,0,0,193,0,0,0,1,1,0,0,129,1,0,0,1,2,0,0,1,3,0,0,1,4,0,0,1,6,0,0,1,8,0,0,1,12,0,0,1,16,0,0,1,24,0,0,1,32,0,0,1,48,0,0,1,64,0,0,1,96,0,0,0,0,0,0,0,0,0,0,20,0,0,0,2,0,0,192,3,0,0,192,4,0,0,192,5,0,0,192,6,0,0,192,7,0,0,192,8,0,0,192,9,0,0,192,10,0,0,192,11,0,0,192,12,0,0,192,13,0,0,192,14,0,0,192,15,0,0,192,16,0,0,192,17,0,0,192,18,0,0,192,19,0,0,192,20,0,0,192,21,0,0,192,22,0,0,192,23,0,0,192,24,0,0,192,25,0,0,192,26,0,0,192,27,0,0,192,28,0,0,192,29,0,0,192,30,0,0,192,31,0,0,192,0,0,0,179,1,0,0,195,2,0,0,195,3,0,0,195,4,0,0,195,5,0,0,195,6,0,0,195,7,0,0,195,8,0,0,195,9,0,0,195,10,0,0,195,11,0,0,195,12,0,0,195,13,0,0,211,14,0,0,195,15,0,0,195,0,0,12,187,1,0,12,195,2,0,12,195,3,0,12,195,4,0,12,211,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,92,81,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,20,16,0,0,5,0,0,0,0,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,0,0,0,3,0,0,0,199,88,0,0,0,4,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,10,255,255,255,255,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,20,16,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,4,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,255,255,255,255,255,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,10,0,0,0,100,0,0,0,232,3,0,0,16,39,0,0,160,134,1,0,64,66,15,0,128,150,152,0,0,225,245,5,95,112,137,0,255,9,47,15,114,97,121,108,105,98,32,91,109,111,100,101,108,115,93,32,101,120,97,109,112,108,101,32,45,32,111,98,106,32,109,111,100,101,108,32,108,111,97,100,105,110,103,0,114,101,115,111,117,114,99,101,115,47,109,111,100,101,108,47,100,119,97,114,102,46,111,98,106,0,114,101,115,111,117,114,99,101,115,47,109,111,100,101,108,47,100,119,97,114,102,95,100,105,102,102,117,115,101,46,112,110,103,0,40,99,41,32,68,119,97,114,102,32,51,68,32,109,111,100,101,108,32,98,121,32,68,97,118,105,100,32,77,111,114,101,110,111,0,73,110,105,116,105,97,108,105,122,105,110,103,32,114,97,121,108,105,98,32,40,118,49,46,55,46,48,41,0,35,99,97,110,118,97,115,0,84,97,114,103,101,116,32,116,105,109,101,32,112,101,114,32,102,114,97,109,101,58,32,37,48,50,46,48,51,102,32,109,105,108,108,105,115,101,99,111,110,100,115,0,69,115,99,97,112,101,0,67,97,110,118,97,115,32,115,99,97,108,101,100,32,116,111,32,102,117,108,108,115,99,114,101,101,110,46,32,69,108,101,109,101,110,116,83,105,122,101,58,32,40,37,105,120,37,105,41,44,32,83,99,114,101,101,110,83,105,122,101,40,37,105,120,37,105,41,0,67,97,110,118,97,115,32,115,99,97,108,101,100,32,116,111,32,119,105,110,100,111,119,101,100,46,32,69,108,101,109,101,110,116,83,105,122,101,58,32,40,37,105,120,37,105,41,44,32,83,99,114,101,101,110,83,105,122,101,40,37,105,120,37,105,41,0,91,84,69,88,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,102,111,110,116,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,68,88,84,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,32,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,69,84,67,49,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,32,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,69,84,67,50,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,32,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,80,86,82,84,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,32,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,65,83,84,67,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,32,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,84,101,120,116,117,114,101,32,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,91,84,69,88,32,73,68,32,37,105,93,32,84,101,120,116,117,114,101,32,99,114,101,97,116,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,37,105,120,37,105,41,0,73,109,97,103,101,32,100,97,116,97,32,102,111,114,109,97,116,32,105,115,32,99,111,109,112,114,101,115,115,101,100,44,32,99,97,110,32,110,111,116,32,98,101,32,99,111,110,118,101,114,116,101,100,0,70,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,32,102,111,114,32,112,105,120,101,108,32,100,97,116,97,32,114,101,116,114,105,101,118,97,108,0,70,97,105,108,101,100,32,116,111,32,105,110,105,116,105,97,108,105,122,101,32,71,76,70,87,0,84,114,121,105,110,103,32,116,111,32,101,110,97,98,108,101,32,77,83,65,65,32,120,52,0,67,108,111,115,101,115,116,32,102,117,108,108,115,99,114,101,101,110,32,118,105,100,101,111,109,111,100,101,58,32,37,105,32,120,32,37,105,0,71,76,70,87,32,70,97,105,108,101,100,32,116,111,32,105,110,105,116,105,97,108,105,122,101,32,87,105,110,100,111,119,0,68,105,115,112,108,97,121,32,100,101,118,105,99,101,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,82,101,110,100,101,114,32,115,105,122,101,58,32,37,105,32,120,32,37,105,0,83,99,114,101,101,110,32,115,105,122,101,58,32,37,105,32,120,32,37,105,0,86,105,101,119,112,111,114,116,32,111,102,102,115,101,116,115,58,32,37,105,44,32,37,105,0,84,114,121,105,110,103,32,116,111,32,101,110,97,98,108,101,32,86,83,89,78,67,0,71,80,85,58,32,86,101,110,100,111,114,58,32,32,32,37,115,0,71,80,85,58,32,82,101,110,100,101,114,101,114,58,32,37,115,0,71,80,85,58,32,86,101,114,115,105,111,110,58,32,32,37,115,0,71,80,85,58,32,71,76,83,76,58,32,32,32,32,32,37,115,0,32,0,78,117,109,98,101,114,32,111,102,32,115,117,112,112,111,114,116,101,100,32,101,120,116,101,110,115,105,111,110,115,58,32,37,105,0,71,76,95,79,69,83,95,118,101,114,116,101,120,95,97,114,114,97,121,95,111,98,106,101,99,116,0,103,108,71,101,110,86,101,114,116,101,120,65,114,114,97,121,115,79,69,83,0,103,108,66,105,110,100,86,101,114,116,101,120,65,114,114,97,121,79,69,83,0,103,108,68,101,108,101,116,101,86,101,114,116,101,120,65,114,114,97,121,115,79,69,83,0,71,76,95,79,69,83,95,116,101,120,116,117,114,101,95,110,112,111,116,0,71,76,95,69,88,84,95,116,101,120,116,117,114,101,95,99,111,109,112,114,101,115,115,105,111,110,95,115,51,116,99,0,71,76,95,87,69,66,71,76,95,99,111,109,112,114,101,115,115,101,100,95,116,101,120,116,117,114,101,95,115,51,116,99,0,71,76,95,87,69,66,75,73,84,95,87,69,66,71,76,95,99,111,109,112,114,101,115,115,101,100,95,116,101,120,116,117,114,101,95,115,51,116,99,0,71,76,95,79,69,83,95,99,111,109,112,114,101,115,115,101,100,95,69,84,67,49,95,82,71,66,56,95,116,101,120,116,117,114,101,0,71,76,95,87,69,66,71,76,95,99,111,109,112,114,101,115,115,101,100,95,116,101,120,116,117,114,101,95,101,116,99,49,0,71,76,95,65,82,66,95,69,83,51,95,99,111,109,112,97,116,105,98,105,108,105,116,121,0,71,76,95,73,77,71,95,116,101,120,116,117,114,101,95,99,111,109,112,114,101,115,115,105,111,110,95,112,118,114,116,99,0,71,76,95,75,72,82,95,116,101,120,116,117,114,101,95,99,111,109,112,114,101,115,115,105,111,110,95,97,115,116,99,95,104,100,114,0,71,76,95,69,88,84,95,116,101,120,116,117,114,101,95,102,105,108,116,101,114,95,97,110,105,115,111,116,114,111,112,105,99,0,71,76,95,69,88,84,95,116,101,120,116,117,114,101,95,109,105,114,114,111,114,95,99,108,97,109,112,0,91,69,88,84,69,78,83,73,79,78,93,32,86,65,79,32,101,120,116,101,110,115,105,111,110,32,100,101,116,101,99,116,101,100,44,32,86,65,79,32,102,117,110,99,116,105,111,110,115,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,69,88,84,69,78,83,73,79,78,93,32,86,65,79,32,101,120,116,101,110,115,105,111,110,32,110,111,116,32,102,111,117,110,100,44,32,86,65,79,32,117,115,97,103,101,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,91,69,88,84,69,78,83,73,79,78,93,32,78,80,79,84,32,116,101,120,116,117,114,101,115,32,101,120,116,101,110,115,105,111,110,32,100,101,116,101,99,116,101,100,44,32,102,117,108,108,32,78,80,79,84,32,116,101,120,116,117,114,101,115,32,115,117,112,112,111,114,116,101,100,0,91,69,88,84,69,78,83,73,79,78,93,32,78,80,79,84,32,116,101,120,116,117,114,101,115,32,101,120,116,101,110,115,105,111,110,32,110,111,116,32,102,111,117,110,100,44,32,108,105,109,105,116,101,100,32,78,80,79,84,32,115,117,112,112,111,114,116,32,40,110,111,45,109,105,112,109,97,112,115,44,32,110,111,45,114,101,112,101,97,116,41,0,91,69,88,84,69,78,83,73,79,78,93,32,68,88,84,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,115,32,115,117,112,112,111,114,116,101,100,0,91,69,88,84,69,78,83,73,79,78,93,32,69,84,67,49,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,115,32,115,117,112,112,111,114,116,101,100,0,91,69,88,84,69,78,83,73,79,78,93,32,69,84,67,50,47,69,65,67,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,115,32,115,117,112,112,111,114,116,101,100,0,91,69,88,84,69,78,83,73,79,78,93,32,80,86,82,84,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,115,32,115,117,112,112,111,114,116,101,100,0,91,69,88,84,69,78,83,73,79,78,93,32,65,83,84,67,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,115,32,115,117,112,112,111,114,116,101,100,0,91,69,88,84,69,78,83,73,79,78,93,32,65,110,105,115,111,116,114,111,112,105,99,32,116,101,120,116,117,114,101,115,32,102,105,108,116,101,114,105,110,103,32,115,117,112,112,111,114,116,101,100,32,40,109,97,120,58,32,37,46,48,102,88,41,0,91,69,88,84,69,78,83,73,79,78,93,32,67,108,97,109,112,32,109,105,114,114,111,114,32,119,114,97,112,32,116,101,120,116,117,114,101,32,109,111,100,101,32,115,117,112,112,111,114,116,101,100,0,91,84,69,88,32,73,68,32,37,105,93,32,66,97,115,101,32,119,104,105,116,101,32,116,101,120,116,117,114,101,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,66,97,115,101,32,119,104,105,116,101,32,116,101,120,116,117,114,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,108,111,97,100,101,100,0,79,112,101,110,71,76,32,100,101,102,97,117,108,116,32,115,116,97,116,101,115,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,67,80,85,93,32,68,101,102,97,117,108,116,32,98,117,102,102,101,114,115,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,108,105,110,101,115,44,32,116,114,105,97,110,103,108,101,115,44,32,113,117,97,100,115,41,0,91,86,65,79,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,98,117,102,102,101,114,115,32,86,65,79,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,108,105,110,101,115,41,0,91,86,66,79,32,73,68,32,37,105,93,91,86,66,79,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,98,117,102,102,101,114,115,32,86,66,79,115,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,108,105,110,101,115,41,0,91,86,65,79,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,98,117,102,102,101,114,115,32,86,65,79,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,116,114,105,97,110,103,108,101,115,41,0,91,86,66,79,32,73,68,32,37,105,93,91,86,66,79,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,98,117,102,102,101,114,115,32,86,66,79,115,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,116,114,105,97,110,103,108,101,115,41,0,91,86,65,79,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,98,117,102,102,101,114,115,32,86,65,79,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,113,117,97,100,115,41,0,91,86,66,79,32,73,68,32,37,105,93,91,86,66,79,32,73,68,32,37,105,93,91,86,66,79,32,73,68,32,37,105,93,91,86,66,79,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,98,117,102,102,101,114,115,32,86,66,79,115,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,113,117,97,100,115,41,0,35,118,101,114,115,105,111,110,32,49,48,48,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,97,116,116,114,105,98,117,116,101,32,118,101,99,51,32,118,101,114,116,101,120,80,111,115,105,116,105,111,110,59,32,32,32,32,32,10,97,116,116,114,105,98,117,116,101,32,118,101,99,50,32,118,101,114,116,101,120,84,101,120,67,111,111,114,100,59,32,32,32,32,32,10,97,116,116,114,105,98,117,116,101,32,118,101,99,52,32,118,101,114,116,101,120,67,111,108,111,114,59,32,32,32,32,32,32,32,32,10,118,97,114,121,105,110,103,32,118,101,99,50,32,102,114,97,103,84,101,120,67,111,111,114,100,59,32,32,32,32,32,32,32,32,32,10,118,97,114,121,105,110,103,32,118,101,99,52,32,102,114,97,103,67,111,108,111,114,59,32,32,32,32,32,32,32,32,32,32,32,32,10,117,110,105,102,111,114,109,32,109,97,116,52,32,109,118,112,77,97,116,114,105,120,59,32,32,32,32,32,32,32,32,32,32,32,32,10,118,111,105,100,32,109,97,105,110,40,41,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,123,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,32,32,32,32,102,114,97,103,84,101,120,67,111,111,114,100,32,61,32,118,101,114,116,101,120,84,101,120,67,111,111,114,100,59,32,10,32,32,32,32,102,114,97,103,67,111,108,111,114,32,61,32,118,101,114,116,101,120,67,111,108,111,114,59,32,32,32,32,32,32,32,10,32,32,32,32,103,108,95,80,111,115,105,116,105,111,110,32,61,32,109,118,112,77,97,116,114,105,120,42,118,101,99,52,40,118,101,114,116,101,120,80,111,115,105,116,105,111,110,44,32,49,46,48,41,59,32,10,125,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,0,35,118,101,114,115,105,111,110,32,49,48,48,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,112,114,101,99,105,115,105,111,110,32,109,101,100,105,117,109,112,32,102,108,111,97,116,59,32,32,32,32,32,32,32,32,32,32,32,10,118,97,114,121,105,110,103,32,118,101,99,50,32,102,114,97,103,84,101,120,67,111,111,114,100,59,32,32,32,32,32,32,32,32,32,10,118,97,114,121,105,110,103,32,118,101,99,52,32,102,114,97,103,67,111,108,111,114,59,32,32,32,32,32,32,32,32,32,32,32,32,10,117,110,105,102,111,114,109,32,115,97,109,112,108,101,114,50,68,32,116,101,120,116,117,114,101,48,59,32,32,32,32,32,32,32,32,10,117,110,105,102,111,114,109,32,118,101,99,52,32,99,111,108,68,105,102,102,117,115,101,59,32,32,32,32,32,32,32,32,32,32,32,10,118,111,105,100,32,109,97,105,110,40,41,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,123,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,32,32,32,32,118,101,99,52,32,116,101,120,101,108,67,111,108,111,114,32,61,32,116,101,120,116,117,114,101,50,68,40,116,101,120,116,117,114,101,48,44,32,102,114,97,103,84,101,120,67,111,111,114,100,41,59,32,10,32,32,32,32,103,108,95,70,114,97,103,67,111,108,111,114,32,61,32,116,101,120,101,108,67,111,108,111,114,42,99,111,108,68,105,102,102,117,115,101,42,102,114,97,103,67,111,108,111,114,59,32,32,32,32,32,32,10,125,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,0,91,83,72,68,82,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,115,104,97,100,101,114,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,83,72,68,82,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,115,104,97,100,101,114,32,99,111,117,108,100,32,110,111,116,32,98,101,32,108,111,97,100,101,100,0,118,101,114,116,101,120,80,111,115,105,116,105,111,110,0,118,101,114,116,101,120,84,101,120,67,111,111,114,100,0,118,101,114,116,101,120,84,101,120,67,111,111,114,100,50,0,118,101,114,116,101,120,78,111,114,109,97,108,0,118,101,114,116,101,120,84,97,110,103,101,110,116,0,118,101,114,116,101,120,67,111,108,111,114,0,109,118,112,77,97,116,114,105,120,0,99,111,108,68,105,102,102,117,115,101,0,99,111,108,65,109,98,105,101,110,116,0,99,111,108,83,112,101,99,117,108,97,114,0,116,101,120,116,117,114,101,48,0,116,101,120,116,117,114,101,49,0,116,101,120,116,117,114,101,50,0,91,86,83,72,68,82,32,73,68,32,37,105,93,32,70,97,105,108,101,100,32,116,111,32,99,111,109,112,105,108,101,32,118,101,114,116,101,120,32,115,104,97,100,101,114,46,46,46,0,37,115,0,91,86,83,72,68,82,32,73,68,32,37,105,93,32,86,101,114,116,101,120,32,115,104,97,100,101,114,32,99,111,109,112,105,108,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,70,83,72,68,82,32,73,68,32,37,105,93,32,70,97,105,108,101,100,32,116,111,32,99,111,109,112,105,108,101,32,102,114,97,103,109,101,110,116,32,115,104,97,100,101,114,46,46,46,0,91,70,83,72,68,82,32,73,68,32,37,105,93,32,70,114,97,103,109,101,110,116,32,115,104,97,100,101,114,32,99,111,109,112,105,108,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,83,72,68,82,32,73,68,32,37,105,93,32,70,97,105,108,101,100,32,116,111,32,108,105,110,107,32,115,104,97,100,101,114,32,112,114,111,103,114,97,109,46,46,46,0,91,83,72,68,82,32,73,68,32,37,105,93,32,83,104,97,100,101,114,32,112,114,111,103,114,97,109,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,68,79,87,78,83,67,65,76,73,78,71,58,32,82,101,113,117,105,114,101,100,32,115,99,114,101,101,110,32,115,105,122,101,32,40,37,105,120,37,105,41,32,105,115,32,98,105,103,103,101,114,32,116,104,97,110,32,100,105,115,112,108,97,121,32,115,105,122,101,32,40,37,105,120,37,105,41,0,68,111,119,110,115,99,97,108,101,32,109,97,116,114,105,120,32,103,101,110,101,114,97,116,101,100,44,32,99,111,110,116,101,110,116,32,119,105,108,108,32,98,101,32,114,101,110,100,101,114,101,100,32,97,116,58,32,37,105,32,120,32,37,105,0,85,80,83,67,65,76,73,78,71,58,32,82,101,113,117,105,114,101,100,32,115,99,114,101,101,110,32,115,105,122,101,58,32,37,105,32,120,32,37,105,32,45,62,32,68,105,115,112,108,97,121,32,115,105,122,101,58,32,37,105,32,120,32,37,105,0,91,71,76,70,87,51,32,69,114,114,111,114,93,32,67,111,100,101,58,32,37,105,32,68,101,99,114,105,112,116,105,111,110,58,32,37,115,0,73,78,70,79,58,32,0,87,65,82,78,73,78,71,58,32,0,87,105,110,100,111,119,32,99,108,111,115,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,84,69,88,32,73,68,32,37,105,93,32,85,110,108,111,97,100,101,100,32,116,101,120,116,117,114,101,32,100,97,116,97,32,40,98,97,115,101,32,119,104,105,116,101,32,116,101,120,116,117,114,101,41,32,102,114,111,109,32,86,82,65,77,0,91,84,69,88,32,73,68,32,37,105,93,32,85,110,108,111,97,100,101,100,32,116,101,120,116,117,114,101,32,100,97,116,97,32,102,114,111,109,32,86,82,65,77,32,40,71,80,85,41,0,83,116,97,99,107,32,66,117,102,102,101,114,32,79,118,101,114,102,108,111,119,32,40,77,65,88,32,37,105,32,77,97,116,114,105,120,41,0,77,65,88,95,76,73,78,69,83,95,66,65,84,67,72,32,111,118,101,114,102,108,111,119,0,77,65,88,95,84,82,73,65,78,71,76,69,83,95,66,65,84,67,72,32,111,118,101,114,102,108,111,119,0,77,65,88,95,81,85,65,68,83,95,66,65,84,67,72,32,111,118,101,114,102,108,111,119,0,91,86,65,79,32,73,68,32,37,105,93,32,85,110,108,111,97,100,101,100,32,109,111,100,101,108,32,100,97,116,97,32,102,114,111,109,32,86,82,65,77,32,40,71,80,85,41,0,91,86,66,79,32,73,68,32,37,105,93,32,85,110,108,111,97,100,101,100,32,109,111,100,101,108,32,118,101,114,116,101,120,32,100,97,116,97,32,102,114,111,109,32,86,82,65,77,32,40,71,80,85,41,0,91,86,65,79,32,73,68,32,37,105,93,32,77,101,115,104,32,117,112,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,116,111,32,86,82,65,77,32,40,71,80,85,41,0,77,101,115,104,32,99,111,117,108,100,32,110,111,116,32,98,101,32,117,112,108,111,97,100,101,100,32,116,111,32,86,82,65,77,32,40,71,80,85,41,0,91,86,66,79,115,93,32,77,101,115,104,32,117,112,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,116,111,32,86,82,65,77,32,40,71,80,85,41,0,109,111,100,101,108,77,97,116,114,105,120,0,118,105,101,119,68,105,114,0,103,108,111,115,115,105,110,101,115,115,0,117,115,101,78,111,114,109,97,108,0,117,115,101,83,112,101,99,117,108,97,114,0,114,105,46,98,105,116,115,95,112,101,114,95,99,104,97,110,110,101,108,32,61,61,32,49,54,0,46,47,101,120,116,101,114,110,97,108,47,115,116,98,95,105,109,97,103,101,46,104,0,115,116,98,105,95,95,108,111,97,100,95,97,110,100,95,112,111,115,116,112,114,111,99,101,115,115,95,56,98,105,116,0,111,117,116,111,102,109,101,109,0,117,110,107,110,111,119,110,32,105,109,97,103,101,32,116,121,112,101,0,98,97,100,32,114,101,113,95,99,111,109,112,0,114,101,113,95,99,111,109,112,32,62,61,32,49,32,38,38,32,114,101,113,95,99,111,109,112,32,60,61,32,52,0,115,116,98,105,95,95,99,111,110,118,101,114,116,95,102,111,114,109,97,116,49,54,0,48,0,115,116,98,105,95,95,99,111,110,118,101,114,116,95,102,111,114,109,97,116,0,109,117,108,116,105,112,108,101,32,73,72,68,82,0,98,97,100,32,73,72,68,82,32,108,101,110,0,116,111,111,32,108,97,114,103,101,0,49,47,50,47,52,47,56,47,49,54,45,98,105,116,32,111,110,108,121,0,98,97,100,32,99,116,121,112,101,0,98,97,100,32,99,111,109,112,32,109,101,116,104,111,100,0,98,97,100,32,102,105,108,116,101,114,32,109,101,116,104,111,100,0,98,97,100,32,105,110,116,101,114,108,97,99,101,32,109,101,116,104,111,100,0,48,45,112,105,120,101,108,32,105,109,97,103,101,0,102,105,114,115,116,32,110,111,116,32,73,72,68,82,0,105,110,118,97,108,105,100,32,80,76,84,69,0,116,82,78,83,32,97,102,116,101,114,32,73,68,65,84,0,116,82,78,83,32,98,101,102,111,114,101,32,80,76,84,69,0,98,97,100,32,116,82,78,83,32,108,101,110,0,116,82,78,83,32,119,105,116,104,32,97,108,112,104,97,0,0,255,85,0,17,0,0,0,1,110,111,32,80,76,84,69,0,111,117,116,111,102,100,97,116,97,0,110,111,32,73,68,65,84,0,88,88,88,88,32,80,78,71,32,99,104,117,110,107,32,110,111,116,32,107,110,111,119,110,0,115,45,62,105,109,103,95,111,117,116,95,110,32,61,61,32,52,0,115,116,98,105,95,95,100,101,95,105,112,104,111,110,101,0,111,117,116,95,110,32,61,61,32,50,32,124,124,32,111,117,116,95,110,32,61,61,32,52,0,115,116,98,105,95,95,99,111,109,112,117,116,101,95,116,114,97,110,115,112,97,114,101,110,99,121,0,115,116,98,105,95,95,99,111,109,112,117,116,101,95,116,114,97,110,115,112,97,114,101,110,99,121,49], "i8", ALLOC_NONE, Runtime.GLOBAL_BASE);
  1564. /* memory initializer */ allocate([54,0,111,117,116,95,110,32,61,61,32,115,45,62,105,109,103,95,110,32,124,124,32,111,117,116,95,110,32,61,61,32,115,45,62,105,109,103,95,110,43,49,0,115,116,98,105,95,95,99,114,101,97,116,101,95,112,110,103,95,105,109,97,103,101,95,114,97,119,0,110,111,116,32,101,110,111,117,103,104,32,112,105,120,101,108,115,0,105,109,103,95,119,105,100,116,104,95,98,121,116,101,115,32,60,61,32,120,0,0,1,0,5,6,105,109,103,95,110,43,49,32,61,61,32,111,117,116,95,110,0,105,110,118,97,108,105,100,32,102,105,108,116,101,114,0,105,109,103,95,110,32,61,61,32,51,0,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,7,7,7,7,7,7,7,7,7,7,7,7,7,7,7,7,7,7,7,7,7,7,7,7,8,8,8,8,8,8,8,8,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,98,97,100,32,104,117,102,102,109,97,110,32,99,111,100,101,0,98,97,100,32,100,105,115,116,0,111,117,116,112,117,116,32,98,117,102,102,101,114,32,108,105,109,105,116,0,122,45,62,115,105,122,101,91,98,93,32,61,61,32,115,0,115,116,98,105,95,95,122,104,117,102,102,109,97,110,95,100,101,99,111,100,101,95,115,108,111,119,112,97,116,104,0,98,105,116,115,32,60,61,32,49,54,0,115,116,98,105,95,95,98,105,116,95,114,101,118,101,114,115,101,0,122,45,62,99,111,100,101,95,98,117,102,102,101,114,32,60,32,40,49,85,32,60,60,32,122,45,62,110,117,109,95,98,105,116,115,41,0,115,116,98,105,95,95,102,105,108,108,95,98,105,116,115,0,98,97,100,32,99,111,100,101,108,101,110,103,116,104,115,0,99,32,61,61,32,49,56,0,115,116,98,105,95,95,99,111,109,112,117,116,101,95,104,117,102,102,109,97,110,95,99,111,100,101,115,0,98,97,100,32,115,105,122,101,115,0,97,45,62,110,117,109,95,98,105,116,115,32,61,61,32,48,0,115,116,98,105,95,95,112,97,114,115,101,95,117,110,99,111,109,112,114,101,115,115,101,100,95,98,108,111,99,107,0,122,108,105,98,32,99,111,114,114,117,112,116,0,114,101,97,100,32,112,97,115,116,32,98,117,102,102,101,114,0,98,97,100,32,122,108,105,98,32,104,101,97,100,101,114,0,110,111,32,112,114,101,115,101,116,32,100,105,99,116,0,98,97,100,32,99,111,109,112,114,101,115,115,105,111,110,0,98,97,100,32,112,110,103,32,115,105,103,0,46,114,114,101,115,0,91,37,115,93,32,82,101,115,111,117,114,99,101,32,102,105,108,101,32,100,111,101,115,32,110,111,116,32,99,111,110,116,97,105,110,32,105,109,97,103,101,32,100,97,116,97,0,46,112,110,103,0,91,37,115,93,32,73,109,97,103,101,32,102,105,108,101,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,91,37,115,93,32,73,109,97,103,101,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,37,105,120,37,105,41,0,91,37,115,93,32,73,109,97,103,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,108,111,97,100,101,100,0,73,109,97,103,101,32,102,111,114,109,97,116,32,110,111,116,32,114,101,99,111,103,110,105,122,101,100,0,114,98,0,91,37,115,93,32,114,82,69,83,32,114,97,121,108,105,98,32,114,101,115,111,117,114,99,101,32,102,105,108,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,111,112,101,110,101,100,0,91,37,115,93,32,84,104,105,115,32,105,115,32,110,111,116,32,97,32,118,97,108,105,100,32,114,97,121,108,105,98,32,114,101,115,111,117,114,99,101,32,102,105,108,101,0,91,37,115,93,91,73,68,32,37,105,93,32,82,101,115,111,117,114,99,101,32,100,97,116,97,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,37,115,93,91,73,68,32,37,105,93,32,82,101,113,117,101,115,116,101,100,32,114,101,115,111,117,114,99,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,102,111,117,110,100,0,79,117,116,32,111,102,32,109,101,109,111,114,121,32,119,104,105,108,101,32,100,101,99,111,109,112,114,101,115,115,105,110,103,32,100,97,116,97,0,68,97,116,97,32,100,101,99,111,109,112,114,101,115,115,105,111,110,32,102,97,105,108,101,100,0,69,120,112,101,99,116,101,100,32,117,110,99,111,109,112,114,101,115,115,101,100,32,115,105,122,101,32,100,111,32,110,111,116,32,109,97,116,99,104,44,32,100,97,116,97,32,109,97,121,32,98,101,32,99,111,114,114,117,112,116,101,100,0,32,45,45,32,69,120,112,101,99,116,101,100,32,117,110,99,111,109,112,114,101,115,115,101,100,32,115,105,122,101,58,32,37,105,0,32,45,45,32,82,101,116,117,114,110,101,100,32,117,110,99,111,109,112,114,101,115,115,101,100,32,115,105,122,101,58,32,37,105,0,68,97,116,97,32,100,101,99,111,109,112,114,101,115,115,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,102,114,111,109,32,37,117,32,98,121,116,101,115,32,116,111,32,37,117,32,98,121,116,101,115,0,5,5,4,0,16,17,18,0,8,7,9,6,10,5,11,4,12,3,13,2,14,1,15,2,3,7,0,3,3,11,0,84,101,120,116,117,114,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,99,114,101,97,116,101,100,0,37,50,105,32,70,80,83,0,46,111,98,106,0,77,101,115,104,32,99,111,117,108,100,32,110,111,116,32,98,101,32,108,111,97,100,101,100,0,114,116,0,91,37,115,93,32,79,66,74,32,102,105,108,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,111,112,101,110,101,100,0,37,99,0,91,37,115,93,32,77,111,100,101,108,32,110,117,109,32,118,101,114,116,105,99,101,115,58,32,37,105,0,91,37,115,93,32,77,111,100,101,108,32,110,117,109,32,116,101,120,99,111,111,114,100,115,58,32,37,105,0,91,37,115,93,32,77,111,100,101,108,32,110,117,109,32,110,111,114,109,97,108,115,58,32,37,105,0,91,37,115,93,32,77,111,100,101,108,32,110,117,109,32,116,114,105,97,110,103,108,101,115,58,32,37,105,0,37,102,32,37,102,37,42,91,94,10,93,115,10,0,37,102,32,37,102,32,37,102,0,91,37,115,93,32,78,111,32,110,111,114,109,97,108,115,32,100,97,116,97,32,111,110,32,79,66,74,44,32,110,111,114,109,97,108,115,32,119,105,108,108,32,98,101,32,103,101,110,101,114,97,116,101,100,32,102,114,111,109,32,102,97,99,101,115,32,100,97,116,97,0,37,105,32,37,105,32,37,105,0,37,105,47,37,105,32,37,105,47,37,105,32,37,105,47,37,105,0,37,105,47,47,37,105,32,37,105,47,47,37,105,32,37,105,47,47,37,105,0,37,105,47,37,105,47,37,105,32,37,105,47,37,105,47,37,105,32,37,105,47,37,105,47,37,105,0,91,37,115,93,32,77,111,100,101,108,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,105,110,32,82,65,77,32,40,67,80,85,41,0,85,110,108,111,97,100,101,100,32,109,111,100,101,108,32,100,97,116,97,32,40,109,101,115,104,32,97,110,100,32,109,97,116,101,114,105,97,108,41,32,102,114,111,109,32,82,65,77,32,97,110,100,32,86,82,65,77,0,69,88,84,0,65,82,66,0,79,69,83,0,65,78,71,76,69,0,103,108,67,114,101,97,116,101,80,114,111,103,114,97,109,79,98,106,101,99,116,0,103,108,67,114,101,97,116,101,80,114,111,103,114,97,109,0,103,108,85,115,101,80,114,111,103,114,97,109,79,98,106,101,99,116,0,103,108,85,115,101,80,114,111,103,114,97,109,0,103,108,67,114,101,97,116,101,83,104,97,100,101,114,79,98,106,101,99,116,0,103,108,67,114,101,97,116,101,83,104,97,100,101,114,0,103,108,65,116,116,97,99,104,79,98,106,101,99,116,0,103,108,65,116,116,97,99,104,83,104,97,100,101,114,0,103,108,68,101,116,97,99,104,79,98,106,101,99,116,0,103,108,68,101,116,97,99,104,83,104,97,100,101,114,0,103,108,80,105,120,101,108,83,116,111,114,101,105,0,103,108,71,101,116,83,116,114,105,110,103,0,103,108,71,101,116,73,110,116,101,103,101,114,118,0,103,108,71,101,116,70,108,111,97,116,118,0,103,108,71,101,116,66,111,111,108,101,97,110,118,0,103,108,71,101,110,84,101,120,116,117,114,101,115,0,103,108,68,101,108,101,116,101,84,101,120,116,117,114,101,115,0,103,108,67,111,109,112,114,101,115,115,101,100,84,101,120,73,109,97,103,101,50,68,0,103,108,67,111,109,112,114,101,115,115,101,100,84,101,120,83,117,98,73,109,97,103,101,50,68,0,103,108,84,101,120,73,109,97,103,101,50,68,0,103,108,84,101,120,83,117,98,73,109,97,103,101,50,68,0,103,108,82,101,97,100,80,105,120,101,108,115,0,103,108,66,105,110,100,84,101,120,116,117,114,101,0,103,108,71,101,116,84,101,120,80,97,114,97,109,101,116,101,114,102,118,0,103,108,71,101,116,84,101,120,80,97,114,97,109,101,116,101,114,105,118,0,103,108,84,101,120,80,97,114,97,109,101,116,101,114,102,118,0,103,108,84,101,120,80,97,114,97,109,101,116,101,114,105,118,0,103,108,73,115,84,101,120,116,117,114,101,0,103,108,71,101,110,66,117,102,102,101,114,115,0,103,108,68,101,108,101,116,101,66,117,102,102,101,114,115,0,103,108,71,101,116,66,117,102,102,101,114,80,97,114,97,109,101,116,101,114,105,118,0,103,108,66,117,102,102,101,114,68,97,116,97,0,103,108,66,117,102,102,101,114,83,117,98,68,97,116,97,0,103,108,73,115,66,117,102,102,101,114,0,103,108,71,101,110,82,101,110,100,101,114,98,117,102,102,101,114,115,0,103,108,68,101,108,101,116,101,82,101,110,100,101,114,98,117,102,102,101,114,115,0,103,108,66,105,110,100,82,101,110,100,101,114,98,117,102,102,101,114,0,103,108,71,101,116,82,101,110,100,101,114,98,117,102,102,101,114,80,97,114,97,109,101,116,101,114,105,118,0,103,108,73,115,82,101,110,100,101,114,98,117,102,102,101,114,0,103,108,71,101,116,85,110,105,102,111,114,109,102,118,0,103,108,71,101,116,85,110,105,102,111,114,109,105,118,0,103,108,71,101,116,85,110,105,102,111,114,109,76,111,99,97,116,105,111,110,0,103,108,71,101,116,86,101,114,116,101,120,65,116,116,114,105,98,102,118,0,103,108,71,101,116,86,101,114,116,101,120,65,116,116,114,105,98,105,118,0,103,108,71,101,116,86,101,114,116,101,120,65,116,116,114,105,98,80,111,105,110,116,101,114,118,0,103,108,71,101,116,65,99,116,105,118,101,85,110,105,102,111,114,109,0,103,108,85,110,105,102,111,114,109,49,102,0,103,108,85,110,105,102,111,114,109,50,102,0,103,108,85,110,105,102,111,114,109,51,102,0,103,108,85,110,105,102,111,114,109,52,102,0,103,108,85,110,105,102,111,114,109,49,105,0,103,108,85,110,105,102,111,114,109,50,105,0,103,108,85,110,105,102,111,114,109,51,105,0,103,108,85,110,105,102,111,114,109,52,105,0,103,108,85,110,105,102,111,114,109,49,105,118,0,103,108,85,110,105,102,111,114,109,50,105,118,0,103,108,85,110,105,102,111,114,109,51,105,118,0,103,108,85,110,105,102,111,114,109,52,105,118,0,103,108,85,110,105,102,111,114,109,49,102,118,0,103,108,85,110,105,102,111,114,109,50,102,118,0,103,108,85,110,105,102,111,114,109,51,102,118,0,103,108,85,110,105,102,111,114,109,52,102,118,0,103,108,85,110,105,102,111,114,109,77,97,116,114,105,120,50,102,118,0,103,108,85,110,105,102,111,114,109,77,97,116,114,105,120,51,102,118,0,103,108,85,110,105,102,111,114,109,77,97,116,114,105,120,52,102,118,0,103,108,66,105,110,100,66,117,102,102,101,114,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,49,102,118,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,50,102,118,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,51,102,118,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,52,102,118,0,103,108,71,101,116,65,116,116,114,105,98,76,111,99,97,116,105,111,110,0,103,108,71,101,116,65,99,116,105,118,101,65,116,116,114,105,98,0,103,108,68,101,108,101,116,101,83,104,97,100,101,114,0,103,108,71,101,116,65,116,116,97,99,104,101,100,83,104,97,100,101,114,115,0,103,108,83,104,97,100,101,114,83,111,117,114,99,101,0,103,108,71,101,116,83,104,97,100,101,114,83,111,117,114,99,101,0,103,108,67,111,109,112,105,108,101,83,104,97,100,101,114,0,103,108,71,101,116,83,104,97,100,101,114,73,110,102,111,76,111,103,0,103,108,71,101,116,83,104,97,100,101,114,105,118,0,103,108,71,101,116,80,114,111,103,114,97,109,105,118,0,103,108,73,115,83,104,97,100,101,114,0,103,108,68,101,108,101,116,101,80,114,111,103,114,97,109,0,103,108,71,101,116,83,104,97,100,101,114,80,114,101,99,105,115,105,111,110,70,111,114,109,97,116,0,103,108,76,105,110,107,80,114,111,103,114,97,109,0,103,108,71,101,116,80,114,111,103,114,97,109,73,110,102,111,76,111,103,0,103,108,86,97,108,105,100,97,116,101,80,114,111,103,114,97,109,0,103,108,73,115,80,114,111,103,114,97,109,0,103,108,66,105,110,100,65,116,116,114,105,98,76,111,99,97,116,105,111,110,0,103,108,66,105,110,100,70,114,97,109,101,98,117,102,102,101,114,0,103,108,71,101,110,70,114,97,109,101,98,117,102,102,101,114,115,0,103,108,68,101,108,101,116,101,70,114,97,109,101,98,117,102,102,101,114,115,0,103,108,70,114,97,109,101,98,117,102,102,101,114,82,101,110,100,101,114,98,117,102,102,101,114,0,103,108,70,114,97,109,101,98,117,102,102,101,114,84,101,120,116,117,114,101,50,68,0,103,108,71,101,116,70,114,97,109,101,98,117,102,102,101,114,65,116,116,97,99,104,109,101,110,116,80,97,114,97,109,101,116,101,114,105,118,0,103,108,73,115,70,114,97,109,101,98,117,102,102,101,114,0,103,108,68,101,108,101,116,101,79,98,106,101,99,116,0,103,108,71,101,116,79,98,106,101,99,116,80,97,114,97,109,101,116,101,114,105,118,0,103,108,71,101,116,73,110,102,111,76,111,103,0,103,108,66,105,110,100,80,114,111,103,114,97,109,0,103,108,71,101,116,80,111,105,110,116,101,114,118,0,103,108,68,114,97,119,82,97,110,103,101,69,108,101,109,101,110,116,115,0,103,108,69,110,97,98,108,101,67,108,105,101,110,116,83,116,97,116,101,0,103,108,86,101,114,116,101,120,80,111,105,110,116,101,114,0,103,108,84,101,120,67,111,111,114,100,80,111,105,110,116,101,114,0,103,108,78,111,114,109,97,108,80,111,105,110,116,101,114,0,103,108,67,111,108,111,114,80,111,105,110,116,101,114,0,103,108,67,108,105,101,110,116,65,99,116,105,118,101,84,101,120,116,117,114,101,0,103,108,71,101,110,86,101,114,116,101,120,65,114,114,97,121,115,0,103,108,68,101,108,101,116,101,86,101,114,116,101,120,65,114,114,97,121,115,0,103,108,66,105,110,100,86,101,114,116,101,120,65,114,114,97,121,0,103,108,77,97,116,114,105,120,77,111,100,101,0,103,108,76,111,97,100,73,100,101,110,116,105,116,121,0,103,108,76,111,97,100,77,97,116,114,105,120,102,0,103,108,70,114,117,115,116,117,109,0,103,108,82,111,116,97,116,101,102,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,80,111,105,110,116,101,114,0,103,108,69,110,97,98,108,101,86,101,114,116,101,120,65,116,116,114,105,98,65,114,114,97,121,0,103,108,68,105,115,97,98,108,101,86,101,114,116,101,120,65,116,116,114,105,98,65,114,114,97,121,0,103,108,68,114,97,119,65,114,114,97,121,115,0,103,108,68,114,97,119,69,108,101,109,101,110,116,115,0,103,108,83,104,97,100,101,114,66,105,110,97,114,121,0,103,108,82,101,108,101,97,115,101,83,104,97,100,101,114,67,111,109,112,105,108,101,114,0,103,108,71,101,116,69,114,114,111,114,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,68,105,118,105,115,111,114,0,103,108,68,114,97,119,65,114,114,97,121,115,73,110,115,116,97,110,99,101,100,0,103,108,68,114,97,119,69,108,101,109,101,110,116,115,73,110,115,116,97,110,99,101,100,0,103,108,70,105,110,105,115,104,0,103,108,70,108,117,115,104,0,103,108,67,108,101,97,114,68,101,112,116,104,0,103,108,67,108,101,97,114,68,101,112,116,104,102,0,103,108,68,101,112,116,104,70,117,110,99,0,103,108,69,110,97,98,108,101,0,103,108,68,105,115,97,98,108,101,0,103,108,70,114,111,110,116,70,97,99,101,0,103,108,67,117,108,108,70,97,99,101,0,103,108,67,108,101,97,114,0,103,108,76,105,110,101,87,105,100,116,104,0,103,108,67,108,101,97,114,83,116,101,110,99,105,108,0,103,108,68,101,112,116,104,77,97,115,107,0,103,108,83,116,101,110,99,105,108,77,97,115,107,0,103,108,67,104,101,99,107,70,114,97,109,101,98,117,102,102,101,114,83,116,97,116,117,115,0,103,108,71,101,110,101,114,97,116,101,77,105,112,109,97,112,0,103,108,65,99,116,105,118,101,84,101,120,116,117,114,101,0,103,108,66,108,101,110,100,69,113,117,97,116,105,111,110,0,103,108,73,115,69,110,97,98,108,101,100,0,103,108,66,108,101,110,100,70,117,110,99,0,103,108,66,108,101,110,100,69,113,117,97,116,105,111,110,83,101,112,97,114,97,116,101,0,103,108,68,101,112,116,104,82,97,110,103,101,0,103,108,68,101,112,116,104,82,97,110,103,101,102,0,103,108,83,116,101,110,99,105,108,77,97,115,107,83,101,112,97,114,97,116,101,0,103,108,72,105,110,116,0,103,108,80,111,108,121,103,111,110,79,102,102,115,101,116,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,49,102,0,103,108,83,97,109,112,108,101,67,111,118,101,114,97,103,101,0,103,108,84,101,120,80,97,114,97,109,101,116,101,114,105,0,103,108,84,101,120,80,97,114,97,109,101,116,101,114,102,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,50,102,0,103,108,83,116,101,110,99,105,108,70,117,110,99,0,103,108,83,116,101,110,99,105,108,79,112,0,103,108,86,105,101,119,112,111,114,116,0,103,108,67,108,101,97,114,67,111,108,111,114,0,103,108,83,99,105,115,115,111,114,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,51,102,0,103,108,67,111,108,111,114,77,97,115,107,0,103,108,82,101,110,100,101,114,98,117,102,102,101,114,83,116,111,114,97,103,101,0,103,108,66,108,101,110,100,70,117,110,99,83,101,112,97,114,97,116,101,0,103,108,66,108,101,110,100,67,111,108,111,114,0,103,108,83,116,101,110,99,105,108,70,117,110,99,83,101,112,97,114,97,116,101,0,103,108,83,116,101,110,99,105,108,79,112,83,101,112,97,114,97,116,101,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,52,102,0,103,108,67,111,112,121,84,101,120,73,109,97,103,101,50,68,0,103,108,67,111,112,121,84,101,120,83,117,98,73,109,97,103,101,50,68,0,103,108,68,114,97,119,66,117,102,102,101,114,115,0,123,32,77,111,100,117,108,101,46,112,114,105,110,116,69,114,114,40,39,98,97,100,32,110,97,109,101,32,105,110,32,103,101,116,80,114,111,99,65,100,100,114,101,115,115,58,32,39,32,43,32,91,80,111,105,110,116,101,114,95,115,116,114,105,110,103,105,102,121,40,36,48,41,44,32,80,111,105,110,116,101,114,95,115,116,114,105,110,103,105,102,121,40,36,49,41,93,41,59,32,125,0,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,0,1,2,3,4,5,6,7,8,9,255,255,255,255,255,255,255,10,11,12,13,14,15,16,17,18,19,20,21,22,23,24,25,26,27,28,29,30,31,32,33,34,35,255,255,255,255,255,255,10,11,12,13,14,15,16,17,18,19,20,21,22,23,24,25,26,27,28,29,30,31,32,33,34,35,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,0,1,2,4,7,3,6,5,0,17,0,10,0,17,17,17,0,0,0,0,5,0,0,0,0,0,0,9,0,0,0,0,11,0,0,0,0,0,0,0,0,17,0,15,10,17,17,17,3,10,7,0,1,19,9,11,11,0,0,9,6,11,0,0,11,0,6,17,0,0,0,17,17,17,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,11,0,0,0,0,0,0,0,0,17,0,10,10,17,17,17,0,10,0,0,2,0,9,11,0,0,0,9,0,11,0,0,11,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,12,0,0,0,0,0,0,0,0,0,0,0,12,0,0,0,0,12,0,0,0,0,9,12,0,0,0,0,0,12,0,0,12,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,14,0,0,0,0,0,0,0,0,0,0,0,13,0,0,0,4,13,0,0,0,0,9,14,0,0,0,0,0,14,0,0,14,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,16,0,0,0,0,0,0,0,0,0,0,0,15,0,0,0,0,15,0,0,0,0,9,16,0,0,0,0,0,16,0,0,16,0,0,18,0,0,0,18,18,18,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,18,0,0,0,18,18,18,0,0,0,0,0,0,9,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,11,0,0,0,0,0,0,0,0,0,0,0,10,0,0,0,0,10,0,0,0,0,9,11,0,0,0,0,0,11,0,0,11,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,12,0,0,0,0,0,0,0,0,0,0,0,12,0,0,0,0,12,0,0,0,0,9,12,0,0,0,0,0,12,0,0,12,0,0,45,43,32,32,32,48,88,48,120,0,40,110,117,108,108,41,0,45,48,88,43,48,88,32,48,88,45,48,120,43,48,120,32,48,120,0,105,110,102,0,73,78,70,0,78,65,78,0,48,49,50,51,52,53,54,55,56,57,65,66,67,68,69,70,46,0,84,33,34,25,13,1,2,3,17,75,28,12,16,4,11,29,18,30,39,104,110,111,112,113,98,32,5,6,15,19,20,21,26,8,22,7,40,36,23,24,9,10,14,27,31,37,35,131,130,125,38,42,43,60,61,62,63,67,71,74,77,88,89,90,91,92,93,94,95,96,97,99,100,101,102,103,105,106,107,108,114,115,116,121,122,123,124,0,73,108,108,101,103,97,108,32,98,121,116,101,32,115,101,113,117,101,110,99,101,0,68,111,109,97,105,110,32,101,114,114,111,114,0,82,101,115,117,108,116,32,110,111,116,32,114,101,112,114,101,115,101,110,116,97,98,108,101,0,78,111,116,32,97,32,116,116,121,0,80,101,114,109,105,115,115,105,111,110,32,100,101,110,105,101,100,0,79,112,101,114,97,116,105,111,110,32,110,111,116,32,112,101,114,109,105,116,116,101,100,0,78,111,32,115,117,99,104,32,102,105,108,101,32,111,114,32,100,105,114,101,99,116,111,114,121,0,78,111,32,115,117,99,104,32,112,114,111,99,101,115,115,0,70,105,108,101,32,101,120,105,115,116,115,0,86,97,108,117,101,32,116,111,111,32,108,97,114,103,101,32,102,111,114,32,100,97,116,97,32,116,121,112,101,0,78,111,32,115,112,97,99,101,32,108,101,102,116,32,111,110,32,100,101,118,105,99,101,0,79,117,116,32,111,102,32,109,101,109,111,114,121,0,82,101,115,111,117,114,99,101,32,98,117,115,121,0,73,110,116,101,114,114,117,112,116,101,100,32,115,121,115,116,101,109,32,99,97,108,108,0,82,101,115,111,117,114,99,101,32,116,101,109,112,111,114,97,114,105,108,121,32,117,110,97,118,97,105,108,97,98,108,101,0,73,110,118,97,108,105,100,32,115,101,101,107,0,67,114,111,115,115,45,100,101,118,105,99,101,32,108,105,110,107,0,82,101,97,100,45,111,110,108,121,32,102,105,108,101,32,115,121,115,116,101,109,0,68,105,114,101,99,116,111,114,121,32,110,111,116,32,101,109,112,116,121,0,67,111,110,110,101,99,116,105,111,110,32,114,101,115,101,116,32,98,121,32,112,101,101,114,0,79,112,101,114,97,116,105,111,110,32,116,105,109,101,100,32,111,117,116,0,67,111,110,110,101,99,116,105,111,110,32,114,101,102,117,115,101,100,0,72,111,115,116,32,105,115,32,100,111,119,110,0,72,111,115,116,32,105,115,32,117,110,114,101,97,99,104,97,98,108,101,0,65,100,100,114,101,115,115,32,105,110,32,117,115,101,0,66,114,111,107,101,110,32,112,105,112,101,0,73,47,79,32,101,114,114,111,114,0,78,111,32,115,117,99,104,32,100,101,118,105,99,101,32,111,114,32,97,100,100,114,101,115,115,0,66,108,111,99,107,32,100,101,118,105,99,101,32,114,101,113,117,105,114,101,100,0,78,111,32,115,117,99,104,32,100,101,118,105,99,101,0,78,111,116,32,97,32,100,105,114,101,99,116,111,114,121,0,73,115,32,97,32,100,105,114,101,99,116,111,114,121,0,84,101,120,116,32,102,105,108,101,32,98,117,115,121,0,69,120,101,99,32,102,111,114,109,97,116,32,101,114,114,111,114,0,73,110,118,97,108,105,100,32,97,114,103,117,109,101,110,116,0,65,114,103,117,109,101,110,116,32,108,105,115,116,32,116,111,111,32,108,111,110,103,0,83,121,109,98,111,108,105,99,32,108,105,110,107,32,108,111,111,112,0,70,105,108,101,110,97,109,101,32,116,111,111,32,108,111,110,103,0,84,111,111,32,109,97,110,121,32,111,112,101,110,32,102,105,108,101,115,32,105,110,32,115,121,115,116,101,109,0,78,111,32,102,105,108,101,32,100,101,115,99,114,105,112,116,111,114,115,32,97,118,97,105,108,97,98,108,101,0,66,97,100,32,102,105,108,101,32,100,101,115,99,114,105,112,116,111,114,0,78,111,32,99,104,105,108,100,32,112,114,111,99,101,115,115,0,66,97,100,32,97,100,100,114,101,115,115,0,70,105,108,101,32,116,111,111,32,108,97,114,103,101,0,84,111,111,32,109,97,110,121,32,108,105,110,107,115,0,78,111,32,108,111,99,107,115,32,97,118,97,105,108,97,98,108,101,0,82,101,115,111,117,114,99,101,32,100,101,97,100,108,111,99,107,32,119,111,117,108,100,32,111,99,99,117,114,0,83,116,97,116,101,32,110,111,116,32,114,101,99,111,118,101,114,97,98,108,101,0,80,114,101,118,105,111,117,115,32,111,119,110,101,114,32,100,105,101,100,0,79,112,101,114,97,116,105,111,110,32,99,97,110,99,101,108,101,100,0,70,117,110,99,116,105,111,110,32,110,111,116,32,105,109,112,108,101,109,101,110,116,101,100,0,78,111,32,109,101,115,115,97,103,101,32,111,102,32,100,101,115,105,114,101,100,32,116,121,112,101,0,73,100,101,110,116,105,102,105,101,114,32,114,101,109,111,118,101,100,0,68,101,118,105,99,101,32,110,111,116,32,97,32,115,116,114,101,97,109,0,78,111,32,100,97,116,97,32,97,118,97,105,108,97,98,108,101,0,68,101,118,105,99,101,32,116,105,109,101,111,117,116,0,79,117,116,32,111,102,32,115,116,114,101,97,109,115,32,114,101,115,111,117,114,99,101,115,0,76,105,110,107,32,104,97,115,32,98,101,101,110,32,115,101,118,101,114,101,100,0,80,114,111,116,111,99,111,108,32,101,114,114,111,114,0,66,97,100,32,109,101,115,115,97,103,101,0,70,105,108,101,32,100,101,115,99,114,105,112,116,111,114,32,105,110,32,98,97,100,32,115,116,97,116,101,0,78,111,116,32,97,32,115,111,99,107,101,116,0,68,101,115,116,105,110,97,116,105,111,110,32,97,100,100,114,101,115,115,32,114,101,113,117,105,114,101,100,0,77,101,115,115,97,103,101,32,116,111,111,32,108,97,114,103,101,0,80,114,111,116,111,99,111,108,32,119,114,111,110,103,32,116,121,112,101,32,102,111,114,32,115,111,99,107,101,116,0,80,114,111,116,111,99,111,108,32,110,111,116,32,97,118,97,105,108,97,98,108,101,0,80,114,111,116,111,99,111,108,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,83,111,99,107,101,116,32,116,121,112,101,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,78,111,116,32,115,117,112,112,111,114,116,101,100,0,80,114,111,116,111,99,111,108,32,102,97,109,105,108,121,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,65,100,100,114,101,115,115,32,102,97,109,105,108,121,32,110,111,116,32,115,117,112,112,111,114,116,101,100,32,98,121,32,112,114,111,116,111,99,111,108,0,65,100,100,114,101,115,115,32,110,111,116,32,97,118,97,105,108,97,98,108,101,0,78,101,116,119,111,114,107,32,105,115,32,100,111,119,110,0,78,101,116,119,111,114,107,32,117,110,114,101,97,99,104,97,98,108,101,0,67,111,110,110,101,99,116,105,111,110,32,114,101,115,101,116,32,98,121,32,110,101,116,119,111,114,107,0,67,111,110,110,101,99,116,105,111,110,32,97,98,111,114,116,101,100,0,78,111,32,98,117,102,102,101,114,32,115,112,97,99,101,32,97,118,97,105,108,97,98,108,101,0,83,111,99,107,101,116,32,105,115,32,99,111,110,110,101,99,116,101,100,0,83,111,99,107,101,116,32,110,111,116,32,99,111,110,110,101,99,116,101,100,0,67,97,110,110,111,116,32,115,101,110,100,32,97,102,116,101,114,32,115,111,99,107,101,116,32,115,104,117,116,100,111,119,110,0,79,112,101,114,97,116,105,111,110,32,97,108,114,101,97,100,121,32,105,110,32,112,114,111,103,114,101,115,115,0,79,112,101,114,97,116,105,111,110,32,105,110,32,112,114,111,103,114,101,115,115,0,83,116,97,108,101,32,102,105,108,101,32,104,97,110,100,108,101,0,82,101,109,111,116,101,32,73,47,79,32,101,114,114,111,114,0,81,117,111,116,97,32,101,120,99,101,101,100,101,100,0,78,111,32,109,101,100,105,117,109,32,102,111,117,110,100,0,87,114,111,110,103,32,109,101,100,105,117,109,32,116,121,112,101,0,78,111,32,101,114,114,111,114,32,105,110,102,111,114,109,97,116,105,111,110,0,0,105,110,102,105,110,105,116,121,0,110,97,110,0,114,119,97,0], "i8", ALLOC_NONE, Runtime.GLOBAL_BASE+10240);
  1565. /* no memory initializer */
  1566. var tempDoublePtr = STATICTOP; STATICTOP += 16;
  1567. assert(tempDoublePtr % 8 == 0);
  1568. function copyTempFloat(ptr) { // functions, because inlining this code increases code size too much
  1569. HEAP8[tempDoublePtr] = HEAP8[ptr];
  1570. HEAP8[tempDoublePtr+1] = HEAP8[ptr+1];
  1571. HEAP8[tempDoublePtr+2] = HEAP8[ptr+2];
  1572. HEAP8[tempDoublePtr+3] = HEAP8[ptr+3];
  1573. }
  1574. function copyTempDouble(ptr) {
  1575. HEAP8[tempDoublePtr] = HEAP8[ptr];
  1576. HEAP8[tempDoublePtr+1] = HEAP8[ptr+1];
  1577. HEAP8[tempDoublePtr+2] = HEAP8[ptr+2];
  1578. HEAP8[tempDoublePtr+3] = HEAP8[ptr+3];
  1579. HEAP8[tempDoublePtr+4] = HEAP8[ptr+4];
  1580. HEAP8[tempDoublePtr+5] = HEAP8[ptr+5];
  1581. HEAP8[tempDoublePtr+6] = HEAP8[ptr+6];
  1582. HEAP8[tempDoublePtr+7] = HEAP8[ptr+7];
  1583. }
  1584. // {{PRE_LIBRARY}}
  1585. var GL={counter:1,lastError:0,buffers:[],mappedBuffers:{},programs:[],framebuffers:[],renderbuffers:[],textures:[],uniforms:[],shaders:[],vaos:[],contexts:[],currentContext:null,offscreenCanvases:{},timerQueriesEXT:[],byteSizeByTypeRoot:5120,byteSizeByType:[1,1,2,2,4,4,4,2,3,4,8],programInfos:{},stringCache:{},tempFixedLengthArray:[],packAlignment:4,unpackAlignment:4,init:function () {
  1586. GL.miniTempBuffer = new Float32Array(GL.MINI_TEMP_BUFFER_SIZE);
  1587. for (var i = 0; i < GL.MINI_TEMP_BUFFER_SIZE; i++) {
  1588. GL.miniTempBufferViews[i] = GL.miniTempBuffer.subarray(0, i+1);
  1589. }
  1590. // For functions such as glDrawBuffers, glInvalidateFramebuffer and glInvalidateSubFramebuffer that need to pass a short array to the WebGL API,
  1591. // create a set of short fixed-length arrays to avoid having to generate any garbage when calling those functions.
  1592. for (var i = 0; i < 32; i++) {
  1593. GL.tempFixedLengthArray.push(new Array(i));
  1594. }
  1595. },recordError:function recordError(errorCode) {
  1596. if (!GL.lastError) {
  1597. GL.lastError = errorCode;
  1598. }
  1599. },getNewId:function (table) {
  1600. var ret = GL.counter++;
  1601. for (var i = table.length; i < ret; i++) {
  1602. table[i] = null;
  1603. }
  1604. return ret;
  1605. },MINI_TEMP_BUFFER_SIZE:256,miniTempBuffer:null,miniTempBufferViews:[0],getSource:function (shader, count, string, length) {
  1606. var source = '';
  1607. for (var i = 0; i < count; ++i) {
  1608. var frag;
  1609. if (length) {
  1610. var len = HEAP32[(((length)+(i*4))>>2)];
  1611. if (len < 0) {
  1612. frag = Pointer_stringify(HEAP32[(((string)+(i*4))>>2)]);
  1613. } else {
  1614. frag = Pointer_stringify(HEAP32[(((string)+(i*4))>>2)], len);
  1615. }
  1616. } else {
  1617. frag = Pointer_stringify(HEAP32[(((string)+(i*4))>>2)]);
  1618. }
  1619. source += frag;
  1620. }
  1621. return source;
  1622. },createContext:function (canvas, webGLContextAttributes) {
  1623. if (typeof webGLContextAttributes['majorVersion'] === 'undefined' && typeof webGLContextAttributes['minorVersion'] === 'undefined') {
  1624. webGLContextAttributes['majorVersion'] = 1;
  1625. webGLContextAttributes['minorVersion'] = 0;
  1626. }
  1627. var ctx;
  1628. var errorInfo = '?';
  1629. function onContextCreationError(event) {
  1630. errorInfo = event.statusMessage || errorInfo;
  1631. }
  1632. try {
  1633. canvas.addEventListener('webglcontextcreationerror', onContextCreationError, false);
  1634. try {
  1635. if (webGLContextAttributes['majorVersion'] == 1 && webGLContextAttributes['minorVersion'] == 0) {
  1636. ctx = canvas.getContext("webgl", webGLContextAttributes) || canvas.getContext("experimental-webgl", webGLContextAttributes);
  1637. } else if (webGLContextAttributes['majorVersion'] == 2 && webGLContextAttributes['minorVersion'] == 0) {
  1638. ctx = canvas.getContext("webgl2", webGLContextAttributes) || canvas.getContext("experimental-webgl2", webGLContextAttributes);
  1639. } else {
  1640. throw 'Unsupported WebGL context version ' + majorVersion + '.' + minorVersion + '!'
  1641. }
  1642. } finally {
  1643. canvas.removeEventListener('webglcontextcreationerror', onContextCreationError, false);
  1644. }
  1645. if (!ctx) throw ':(';
  1646. } catch (e) {
  1647. Module.print('Could not create canvas: ' + [errorInfo, e, JSON.stringify(webGLContextAttributes)]);
  1648. return 0;
  1649. }
  1650. // possible GL_DEBUG entry point: ctx = wrapDebugGL(ctx);
  1651. if (!ctx) return 0;
  1652. return GL.registerContext(ctx, webGLContextAttributes);
  1653. },registerContext:function (ctx, webGLContextAttributes) {
  1654. var handle = GL.getNewId(GL.contexts);
  1655. var context = {
  1656. handle: handle,
  1657. attributes: webGLContextAttributes,
  1658. version: webGLContextAttributes['majorVersion'],
  1659. GLctx: ctx
  1660. };
  1661. // Store the created context object so that we can access the context given a canvas without having to pass the parameters again.
  1662. if (ctx.canvas) ctx.canvas.GLctxObject = context;
  1663. GL.contexts[handle] = context;
  1664. if (typeof webGLContextAttributes['enableExtensionsByDefault'] === 'undefined' || webGLContextAttributes['enableExtensionsByDefault']) {
  1665. GL.initExtensions(context);
  1666. }
  1667. return handle;
  1668. },makeContextCurrent:function (contextHandle) {
  1669. var context = GL.contexts[contextHandle];
  1670. if (!context) return false;
  1671. GLctx = Module.ctx = context.GLctx; // Active WebGL context object.
  1672. GL.currentContext = context; // Active Emscripten GL layer context object.
  1673. return true;
  1674. },getContext:function (contextHandle) {
  1675. return GL.contexts[contextHandle];
  1676. },deleteContext:function (contextHandle) {
  1677. if (GL.currentContext === GL.contexts[contextHandle]) GL.currentContext = null;
  1678. if (typeof JSEvents === 'object') JSEvents.removeAllHandlersOnTarget(GL.contexts[contextHandle].GLctx.canvas); // Release all JS event handlers on the DOM element that the GL context is associated with since the context is now deleted.
  1679. if (GL.contexts[contextHandle] && GL.contexts[contextHandle].GLctx.canvas) GL.contexts[contextHandle].GLctx.canvas.GLctxObject = undefined; // Make sure the canvas object no longer refers to the context object so there are no GC surprises.
  1680. GL.contexts[contextHandle] = null;
  1681. },initExtensions:function (context) {
  1682. // If this function is called without a specific context object, init the extensions of the currently active context.
  1683. if (!context) context = GL.currentContext;
  1684. if (context.initExtensionsDone) return;
  1685. context.initExtensionsDone = true;
  1686. var GLctx = context.GLctx;
  1687. context.maxVertexAttribs = GLctx.getParameter(GLctx.MAX_VERTEX_ATTRIBS);
  1688. // Detect the presence of a few extensions manually, this GL interop layer itself will need to know if they exist.
  1689. if (context.version < 2) {
  1690. // Extension available from Firefox 26 and Google Chrome 30
  1691. var instancedArraysExt = GLctx.getExtension('ANGLE_instanced_arrays');
  1692. if (instancedArraysExt) {
  1693. GLctx['vertexAttribDivisor'] = function(index, divisor) { instancedArraysExt['vertexAttribDivisorANGLE'](index, divisor); };
  1694. GLctx['drawArraysInstanced'] = function(mode, first, count, primcount) { instancedArraysExt['drawArraysInstancedANGLE'](mode, first, count, primcount); };
  1695. GLctx['drawElementsInstanced'] = function(mode, count, type, indices, primcount) { instancedArraysExt['drawElementsInstancedANGLE'](mode, count, type, indices, primcount); };
  1696. }
  1697. // Extension available from Firefox 25 and WebKit
  1698. var vaoExt = GLctx.getExtension('OES_vertex_array_object');
  1699. if (vaoExt) {
  1700. GLctx['createVertexArray'] = function() { return vaoExt['createVertexArrayOES'](); };
  1701. GLctx['deleteVertexArray'] = function(vao) { vaoExt['deleteVertexArrayOES'](vao); };
  1702. GLctx['bindVertexArray'] = function(vao) { vaoExt['bindVertexArrayOES'](vao); };
  1703. GLctx['isVertexArray'] = function(vao) { return vaoExt['isVertexArrayOES'](vao); };
  1704. }
  1705. var drawBuffersExt = GLctx.getExtension('WEBGL_draw_buffers');
  1706. if (drawBuffersExt) {
  1707. GLctx['drawBuffers'] = function(n, bufs) { drawBuffersExt['drawBuffersWEBGL'](n, bufs); };
  1708. }
  1709. }
  1710. GLctx.disjointTimerQueryExt = GLctx.getExtension("EXT_disjoint_timer_query");
  1711. // These are the 'safe' feature-enabling extensions that don't add any performance impact related to e.g. debugging, and
  1712. // should be enabled by default so that client GLES2/GL code will not need to go through extra hoops to get its stuff working.
  1713. // As new extensions are ratified at http://www.khronos.org/registry/webgl/extensions/ , feel free to add your new extensions
  1714. // here, as long as they don't produce a performance impact for users that might not be using those extensions.
  1715. // E.g. debugging-related extensions should probably be off by default.
  1716. var automaticallyEnabledExtensions = [ "OES_texture_float", "OES_texture_half_float", "OES_standard_derivatives",
  1717. "OES_vertex_array_object", "WEBGL_compressed_texture_s3tc", "WEBGL_depth_texture",
  1718. "OES_element_index_uint", "EXT_texture_filter_anisotropic", "ANGLE_instanced_arrays",
  1719. "OES_texture_float_linear", "OES_texture_half_float_linear", "WEBGL_compressed_texture_atc",
  1720. "WEBGL_compressed_texture_pvrtc", "EXT_color_buffer_half_float", "WEBGL_color_buffer_float",
  1721. "EXT_frag_depth", "EXT_sRGB", "WEBGL_draw_buffers", "WEBGL_shared_resources",
  1722. "EXT_shader_texture_lod", "EXT_color_buffer_float"];
  1723. function shouldEnableAutomatically(extension) {
  1724. var ret = false;
  1725. automaticallyEnabledExtensions.forEach(function(include) {
  1726. if (ext.indexOf(include) != -1) {
  1727. ret = true;
  1728. }
  1729. });
  1730. return ret;
  1731. }
  1732. var exts = GLctx.getSupportedExtensions();
  1733. if (exts && exts.length > 0) {
  1734. GLctx.getSupportedExtensions().forEach(function(ext) {
  1735. if (automaticallyEnabledExtensions.indexOf(ext) != -1) {
  1736. GLctx.getExtension(ext); // Calling .getExtension enables that extension permanently, no need to store the return value to be enabled.
  1737. }
  1738. });
  1739. }
  1740. },populateUniformTable:function (program) {
  1741. var p = GL.programs[program];
  1742. GL.programInfos[program] = {
  1743. uniforms: {},
  1744. maxUniformLength: 0, // This is eagerly computed below, since we already enumerate all uniforms anyway.
  1745. maxAttributeLength: -1, // This is lazily computed and cached, computed when/if first asked, "-1" meaning not computed yet.
  1746. maxUniformBlockNameLength: -1 // Lazily computed as well
  1747. };
  1748. var ptable = GL.programInfos[program];
  1749. var utable = ptable.uniforms;
  1750. // A program's uniform table maps the string name of an uniform to an integer location of that uniform.
  1751. // The global GL.uniforms map maps integer locations to WebGLUniformLocations.
  1752. var numUniforms = GLctx.getProgramParameter(p, GLctx.ACTIVE_UNIFORMS);
  1753. for (var i = 0; i < numUniforms; ++i) {
  1754. var u = GLctx.getActiveUniform(p, i);
  1755. var name = u.name;
  1756. ptable.maxUniformLength = Math.max(ptable.maxUniformLength, name.length+1);
  1757. // Strip off any trailing array specifier we might have got, e.g. "[0]".
  1758. if (name.indexOf(']', name.length-1) !== -1) {
  1759. var ls = name.lastIndexOf('[');
  1760. name = name.slice(0, ls);
  1761. }
  1762. // Optimize memory usage slightly: If we have an array of uniforms, e.g. 'vec3 colors[3];', then
  1763. // only store the string 'colors' in utable, and 'colors[0]', 'colors[1]' and 'colors[2]' will be parsed as 'colors'+i.
  1764. // Note that for the GL.uniforms table, we still need to fetch the all WebGLUniformLocations for all the indices.
  1765. var loc = GLctx.getUniformLocation(p, name);
  1766. if (loc != null)
  1767. {
  1768. var id = GL.getNewId(GL.uniforms);
  1769. utable[name] = [u.size, id];
  1770. GL.uniforms[id] = loc;
  1771. for (var j = 1; j < u.size; ++j) {
  1772. var n = name + '['+j+']';
  1773. loc = GLctx.getUniformLocation(p, n);
  1774. id = GL.getNewId(GL.uniforms);
  1775. GL.uniforms[id] = loc;
  1776. }
  1777. }
  1778. }
  1779. }};function _emscripten_glIsRenderbuffer(renderbuffer) {
  1780. var rb = GL.renderbuffers[renderbuffer];
  1781. if (!rb) return 0;
  1782. return GLctx.isRenderbuffer(rb);
  1783. }
  1784. function _emscripten_glStencilMaskSeparate(x0, x1) { GLctx['stencilMaskSeparate'](x0, x1) }
  1785. function _emscripten_get_now() { abort() }
  1786. function _emscripten_set_main_loop_timing(mode, value) {
  1787. Browser.mainLoop.timingMode = mode;
  1788. Browser.mainLoop.timingValue = value;
  1789. if (!Browser.mainLoop.func) {
  1790. console.error('emscripten_set_main_loop_timing: Cannot set timing mode for main loop since a main loop does not exist! Call emscripten_set_main_loop first to set one up.');
  1791. return 1; // Return non-zero on failure, can't set timing mode when there is no main loop.
  1792. }
  1793. if (mode == 0 /*EM_TIMING_SETTIMEOUT*/) {
  1794. Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_setTimeout() {
  1795. var timeUntilNextTick = Math.max(0, Browser.mainLoop.tickStartTime + value - _emscripten_get_now())|0;
  1796. setTimeout(Browser.mainLoop.runner, timeUntilNextTick); // doing this each time means that on exception, we stop
  1797. };
  1798. Browser.mainLoop.method = 'timeout';
  1799. } else if (mode == 1 /*EM_TIMING_RAF*/) {
  1800. Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_rAF() {
  1801. Browser.requestAnimationFrame(Browser.mainLoop.runner);
  1802. };
  1803. Browser.mainLoop.method = 'rAF';
  1804. } else if (mode == 2 /*EM_TIMING_SETIMMEDIATE*/) {
  1805. if (!window['setImmediate']) {
  1806. // Emulate setImmediate. (note: not a complete polyfill, we don't emulate clearImmediate() to keep code size to minimum, since not needed)
  1807. var setImmediates = [];
  1808. var emscriptenMainLoopMessageId = 'setimmediate';
  1809. function Browser_setImmediate_messageHandler(event) {
  1810. if (event.source === window && event.data === emscriptenMainLoopMessageId) {
  1811. event.stopPropagation();
  1812. setImmediates.shift()();
  1813. }
  1814. }
  1815. window.addEventListener("message", Browser_setImmediate_messageHandler, true);
  1816. window['setImmediate'] = function Browser_emulated_setImmediate(func) {
  1817. setImmediates.push(func);
  1818. if (ENVIRONMENT_IS_WORKER) {
  1819. if (Module['setImmediates'] === undefined) Module['setImmediates'] = [];
  1820. Module['setImmediates'].push(func);
  1821. window.postMessage({target: emscriptenMainLoopMessageId}); // In --proxy-to-worker, route the message via proxyClient.js
  1822. } else window.postMessage(emscriptenMainLoopMessageId, "*"); // On the main thread, can just send the message to itself.
  1823. }
  1824. }
  1825. Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_setImmediate() {
  1826. window['setImmediate'](Browser.mainLoop.runner);
  1827. };
  1828. Browser.mainLoop.method = 'immediate';
  1829. }
  1830. return 0;
  1831. }function _emscripten_set_main_loop(func, fps, simulateInfiniteLoop, arg, noSetTiming) {
  1832. Module['noExitRuntime'] = true;
  1833. assert(!Browser.mainLoop.func, 'emscripten_set_main_loop: there can only be one main loop function at once: call emscripten_cancel_main_loop to cancel the previous one before setting a new one with different parameters.');
  1834. Browser.mainLoop.func = func;
  1835. Browser.mainLoop.arg = arg;
  1836. var browserIterationFunc;
  1837. if (typeof arg !== 'undefined') {
  1838. browserIterationFunc = function() {
  1839. Module['dynCall_vi'](func, arg);
  1840. };
  1841. } else {
  1842. browserIterationFunc = function() {
  1843. Module['dynCall_v'](func);
  1844. };
  1845. }
  1846. var thisMainLoopId = Browser.mainLoop.currentlyRunningMainloop;
  1847. Browser.mainLoop.runner = function Browser_mainLoop_runner() {
  1848. if (ABORT) return;
  1849. if (Browser.mainLoop.queue.length > 0) {
  1850. var start = Date.now();
  1851. var blocker = Browser.mainLoop.queue.shift();
  1852. blocker.func(blocker.arg);
  1853. if (Browser.mainLoop.remainingBlockers) {
  1854. var remaining = Browser.mainLoop.remainingBlockers;
  1855. var next = remaining%1 == 0 ? remaining-1 : Math.floor(remaining);
  1856. if (blocker.counted) {
  1857. Browser.mainLoop.remainingBlockers = next;
  1858. } else {
  1859. // not counted, but move the progress along a tiny bit
  1860. next = next + 0.5; // do not steal all the next one's progress
  1861. Browser.mainLoop.remainingBlockers = (8*remaining + next)/9;
  1862. }
  1863. }
  1864. console.log('main loop blocker "' + blocker.name + '" took ' + (Date.now() - start) + ' ms'); //, left: ' + Browser.mainLoop.remainingBlockers);
  1865. Browser.mainLoop.updateStatus();
  1866. // catches pause/resume main loop from blocker execution
  1867. if (thisMainLoopId < Browser.mainLoop.currentlyRunningMainloop) return;
  1868. setTimeout(Browser.mainLoop.runner, 0);
  1869. return;
  1870. }
  1871. // catch pauses from non-main loop sources
  1872. if (thisMainLoopId < Browser.mainLoop.currentlyRunningMainloop) return;
  1873. // Implement very basic swap interval control
  1874. Browser.mainLoop.currentFrameNumber = Browser.mainLoop.currentFrameNumber + 1 | 0;
  1875. if (Browser.mainLoop.timingMode == 1/*EM_TIMING_RAF*/ && Browser.mainLoop.timingValue > 1 && Browser.mainLoop.currentFrameNumber % Browser.mainLoop.timingValue != 0) {
  1876. // Not the scheduled time to render this frame - skip.
  1877. Browser.mainLoop.scheduler();
  1878. return;
  1879. } else if (Browser.mainLoop.timingMode == 0/*EM_TIMING_SETTIMEOUT*/) {
  1880. Browser.mainLoop.tickStartTime = _emscripten_get_now();
  1881. }
  1882. // Signal GL rendering layer that processing of a new frame is about to start. This helps it optimize
  1883. // VBO double-buffering and reduce GPU stalls.
  1884. if (Browser.mainLoop.method === 'timeout' && Module.ctx) {
  1885. Module.printErr('Looks like you are rendering without using requestAnimationFrame for the main loop. You should use 0 for the frame rate in emscripten_set_main_loop in order to use requestAnimationFrame, as that can greatly improve your frame rates!');
  1886. Browser.mainLoop.method = ''; // just warn once per call to set main loop
  1887. }
  1888. Browser.mainLoop.runIter(browserIterationFunc);
  1889. checkStackCookie();
  1890. // catch pauses from the main loop itself
  1891. if (thisMainLoopId < Browser.mainLoop.currentlyRunningMainloop) return;
  1892. // Queue new audio data. This is important to be right after the main loop invocation, so that we will immediately be able
  1893. // to queue the newest produced audio samples.
  1894. // TODO: Consider adding pre- and post- rAF callbacks so that GL.newRenderingFrameStarted() and SDL.audio.queueNewAudioData()
  1895. // do not need to be hardcoded into this function, but can be more generic.
  1896. if (typeof SDL === 'object' && SDL.audio && SDL.audio.queueNewAudioData) SDL.audio.queueNewAudioData();
  1897. Browser.mainLoop.scheduler();
  1898. }
  1899. if (!noSetTiming) {
  1900. if (fps && fps > 0) _emscripten_set_main_loop_timing(0/*EM_TIMING_SETTIMEOUT*/, 1000.0 / fps);
  1901. else _emscripten_set_main_loop_timing(1/*EM_TIMING_RAF*/, 1); // Do rAF by rendering each frame (no decimating)
  1902. Browser.mainLoop.scheduler();
  1903. }
  1904. if (simulateInfiniteLoop) {
  1905. throw 'SimulateInfiniteLoop';
  1906. }
  1907. }var Browser={mainLoop:{scheduler:null,method:"",currentlyRunningMainloop:0,func:null,arg:0,timingMode:0,timingValue:0,currentFrameNumber:0,queue:[],pause:function () {
  1908. Browser.mainLoop.scheduler = null;
  1909. Browser.mainLoop.currentlyRunningMainloop++; // Incrementing this signals the previous main loop that it's now become old, and it must return.
  1910. },resume:function () {
  1911. Browser.mainLoop.currentlyRunningMainloop++;
  1912. var timingMode = Browser.mainLoop.timingMode;
  1913. var timingValue = Browser.mainLoop.timingValue;
  1914. var func = Browser.mainLoop.func;
  1915. Browser.mainLoop.func = null;
  1916. _emscripten_set_main_loop(func, 0, false, Browser.mainLoop.arg, true /* do not set timing and call scheduler, we will do it on the next lines */);
  1917. _emscripten_set_main_loop_timing(timingMode, timingValue);
  1918. Browser.mainLoop.scheduler();
  1919. },updateStatus:function () {
  1920. if (Module['setStatus']) {
  1921. var message = Module['statusMessage'] || 'Please wait...';
  1922. var remaining = Browser.mainLoop.remainingBlockers;
  1923. var expected = Browser.mainLoop.expectedBlockers;
  1924. if (remaining) {
  1925. if (remaining < expected) {
  1926. Module['setStatus'](message + ' (' + (expected - remaining) + '/' + expected + ')');
  1927. } else {
  1928. Module['setStatus'](message);
  1929. }
  1930. } else {
  1931. Module['setStatus']('');
  1932. }
  1933. }
  1934. },runIter:function (func) {
  1935. if (ABORT) return;
  1936. if (Module['preMainLoop']) {
  1937. var preRet = Module['preMainLoop']();
  1938. if (preRet === false) {
  1939. return; // |return false| skips a frame
  1940. }
  1941. }
  1942. try {
  1943. func();
  1944. } catch (e) {
  1945. if (e instanceof ExitStatus) {
  1946. return;
  1947. } else {
  1948. if (e && typeof e === 'object' && e.stack) Module.printErr('exception thrown: ' + [e, e.stack]);
  1949. throw e;
  1950. }
  1951. }
  1952. if (Module['postMainLoop']) Module['postMainLoop']();
  1953. }},isFullscreen:false,pointerLock:false,moduleContextCreatedCallbacks:[],workers:[],init:function () {
  1954. if (!Module["preloadPlugins"]) Module["preloadPlugins"] = []; // needs to exist even in workers
  1955. if (Browser.initted) return;
  1956. Browser.initted = true;
  1957. try {
  1958. new Blob();
  1959. Browser.hasBlobConstructor = true;
  1960. } catch(e) {
  1961. Browser.hasBlobConstructor = false;
  1962. console.log("warning: no blob constructor, cannot create blobs with mimetypes");
  1963. }
  1964. Browser.BlobBuilder = typeof MozBlobBuilder != "undefined" ? MozBlobBuilder : (typeof WebKitBlobBuilder != "undefined" ? WebKitBlobBuilder : (!Browser.hasBlobConstructor ? console.log("warning: no BlobBuilder") : null));
  1965. Browser.URLObject = typeof window != "undefined" ? (window.URL ? window.URL : window.webkitURL) : undefined;
  1966. if (!Module.noImageDecoding && typeof Browser.URLObject === 'undefined') {
  1967. console.log("warning: Browser does not support creating object URLs. Built-in browser image decoding will not be available.");
  1968. Module.noImageDecoding = true;
  1969. }
  1970. // Support for plugins that can process preloaded files. You can add more of these to
  1971. // your app by creating and appending to Module.preloadPlugins.
  1972. //
  1973. // Each plugin is asked if it can handle a file based on the file's name. If it can,
  1974. // it is given the file's raw data. When it is done, it calls a callback with the file's
  1975. // (possibly modified) data. For example, a plugin might decompress a file, or it
  1976. // might create some side data structure for use later (like an Image element, etc.).
  1977. var imagePlugin = {};
  1978. imagePlugin['canHandle'] = function imagePlugin_canHandle(name) {
  1979. return !Module.noImageDecoding && /\.(jpg|jpeg|png|bmp)$/i.test(name);
  1980. };
  1981. imagePlugin['handle'] = function imagePlugin_handle(byteArray, name, onload, onerror) {
  1982. var b = null;
  1983. if (Browser.hasBlobConstructor) {
  1984. try {
  1985. b = new Blob([byteArray], { type: Browser.getMimetype(name) });
  1986. if (b.size !== byteArray.length) { // Safari bug #118630
  1987. // Safari's Blob can only take an ArrayBuffer
  1988. b = new Blob([(new Uint8Array(byteArray)).buffer], { type: Browser.getMimetype(name) });
  1989. }
  1990. } catch(e) {
  1991. Runtime.warnOnce('Blob constructor present but fails: ' + e + '; falling back to blob builder');
  1992. }
  1993. }
  1994. if (!b) {
  1995. var bb = new Browser.BlobBuilder();
  1996. bb.append((new Uint8Array(byteArray)).buffer); // we need to pass a buffer, and must copy the array to get the right data range
  1997. b = bb.getBlob();
  1998. }
  1999. var url = Browser.URLObject.createObjectURL(b);
  2000. assert(typeof url == 'string', 'createObjectURL must return a url as a string');
  2001. var img = new Image();
  2002. img.onload = function img_onload() {
  2003. assert(img.complete, 'Image ' + name + ' could not be decoded');
  2004. var canvas = document.createElement('canvas');
  2005. canvas.width = img.width;
  2006. canvas.height = img.height;
  2007. var ctx = canvas.getContext('2d');
  2008. ctx.drawImage(img, 0, 0);
  2009. Module["preloadedImages"][name] = canvas;
  2010. Browser.URLObject.revokeObjectURL(url);
  2011. if (onload) onload(byteArray);
  2012. };
  2013. img.onerror = function img_onerror(event) {
  2014. console.log('Image ' + url + ' could not be decoded');
  2015. if (onerror) onerror();
  2016. };
  2017. img.src = url;
  2018. };
  2019. Module['preloadPlugins'].push(imagePlugin);
  2020. var audioPlugin = {};
  2021. audioPlugin['canHandle'] = function audioPlugin_canHandle(name) {
  2022. return !Module.noAudioDecoding && name.substr(-4) in { '.ogg': 1, '.wav': 1, '.mp3': 1 };
  2023. };
  2024. audioPlugin['handle'] = function audioPlugin_handle(byteArray, name, onload, onerror) {
  2025. var done = false;
  2026. function finish(audio) {
  2027. if (done) return;
  2028. done = true;
  2029. Module["preloadedAudios"][name] = audio;
  2030. if (onload) onload(byteArray);
  2031. }
  2032. function fail() {
  2033. if (done) return;
  2034. done = true;
  2035. Module["preloadedAudios"][name] = new Audio(); // empty shim
  2036. if (onerror) onerror();
  2037. }
  2038. if (Browser.hasBlobConstructor) {
  2039. try {
  2040. var b = new Blob([byteArray], { type: Browser.getMimetype(name) });
  2041. } catch(e) {
  2042. return fail();
  2043. }
  2044. var url = Browser.URLObject.createObjectURL(b); // XXX we never revoke this!
  2045. assert(typeof url == 'string', 'createObjectURL must return a url as a string');
  2046. var audio = new Audio();
  2047. audio.addEventListener('canplaythrough', function() { finish(audio) }, false); // use addEventListener due to chromium bug 124926
  2048. audio.onerror = function audio_onerror(event) {
  2049. if (done) return;
  2050. console.log('warning: browser could not fully decode audio ' + name + ', trying slower base64 approach');
  2051. function encode64(data) {
  2052. var BASE = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/';
  2053. var PAD = '=';
  2054. var ret = '';
  2055. var leftchar = 0;
  2056. var leftbits = 0;
  2057. for (var i = 0; i < data.length; i++) {
  2058. leftchar = (leftchar << 8) | data[i];
  2059. leftbits += 8;
  2060. while (leftbits >= 6) {
  2061. var curr = (leftchar >> (leftbits-6)) & 0x3f;
  2062. leftbits -= 6;
  2063. ret += BASE[curr];
  2064. }
  2065. }
  2066. if (leftbits == 2) {
  2067. ret += BASE[(leftchar&3) << 4];
  2068. ret += PAD + PAD;
  2069. } else if (leftbits == 4) {
  2070. ret += BASE[(leftchar&0xf) << 2];
  2071. ret += PAD;
  2072. }
  2073. return ret;
  2074. }
  2075. audio.src = 'data:audio/x-' + name.substr(-3) + ';base64,' + encode64(byteArray);
  2076. finish(audio); // we don't wait for confirmation this worked - but it's worth trying
  2077. };
  2078. audio.src = url;
  2079. // workaround for chrome bug 124926 - we do not always get oncanplaythrough or onerror
  2080. Browser.safeSetTimeout(function() {
  2081. finish(audio); // try to use it even though it is not necessarily ready to play
  2082. }, 10000);
  2083. } else {
  2084. return fail();
  2085. }
  2086. };
  2087. Module['preloadPlugins'].push(audioPlugin);
  2088. // Canvas event setup
  2089. function pointerLockChange() {
  2090. Browser.pointerLock = document['pointerLockElement'] === Module['canvas'] ||
  2091. document['mozPointerLockElement'] === Module['canvas'] ||
  2092. document['webkitPointerLockElement'] === Module['canvas'] ||
  2093. document['msPointerLockElement'] === Module['canvas'];
  2094. }
  2095. var canvas = Module['canvas'];
  2096. if (canvas) {
  2097. // forced aspect ratio can be enabled by defining 'forcedAspectRatio' on Module
  2098. // Module['forcedAspectRatio'] = 4 / 3;
  2099. canvas.requestPointerLock = canvas['requestPointerLock'] ||
  2100. canvas['mozRequestPointerLock'] ||
  2101. canvas['webkitRequestPointerLock'] ||
  2102. canvas['msRequestPointerLock'] ||
  2103. function(){};
  2104. canvas.exitPointerLock = document['exitPointerLock'] ||
  2105. document['mozExitPointerLock'] ||
  2106. document['webkitExitPointerLock'] ||
  2107. document['msExitPointerLock'] ||
  2108. function(){}; // no-op if function does not exist
  2109. canvas.exitPointerLock = canvas.exitPointerLock.bind(document);
  2110. document.addEventListener('pointerlockchange', pointerLockChange, false);
  2111. document.addEventListener('mozpointerlockchange', pointerLockChange, false);
  2112. document.addEventListener('webkitpointerlockchange', pointerLockChange, false);
  2113. document.addEventListener('mspointerlockchange', pointerLockChange, false);
  2114. if (Module['elementPointerLock']) {
  2115. canvas.addEventListener("click", function(ev) {
  2116. if (!Browser.pointerLock && Module['canvas'].requestPointerLock) {
  2117. Module['canvas'].requestPointerLock();
  2118. ev.preventDefault();
  2119. }
  2120. }, false);
  2121. }
  2122. }
  2123. },createContext:function (canvas, useWebGL, setInModule, webGLContextAttributes) {
  2124. if (useWebGL && Module.ctx && canvas == Module.canvas) return Module.ctx; // no need to recreate GL context if it's already been created for this canvas.
  2125. var ctx;
  2126. var contextHandle;
  2127. if (useWebGL) {
  2128. // For GLES2/desktop GL compatibility, adjust a few defaults to be different to WebGL defaults, so that they align better with the desktop defaults.
  2129. var contextAttributes = {
  2130. antialias: false,
  2131. alpha: false
  2132. };
  2133. if (webGLContextAttributes) {
  2134. for (var attribute in webGLContextAttributes) {
  2135. contextAttributes[attribute] = webGLContextAttributes[attribute];
  2136. }
  2137. }
  2138. contextHandle = GL.createContext(canvas, contextAttributes);
  2139. if (contextHandle) {
  2140. ctx = GL.getContext(contextHandle).GLctx;
  2141. }
  2142. } else {
  2143. ctx = canvas.getContext('2d');
  2144. }
  2145. if (!ctx) return null;
  2146. if (setInModule) {
  2147. if (!useWebGL) assert(typeof GLctx === 'undefined', 'cannot set in module if GLctx is used, but we are a non-GL context that would replace it');
  2148. Module.ctx = ctx;
  2149. if (useWebGL) GL.makeContextCurrent(contextHandle);
  2150. Module.useWebGL = useWebGL;
  2151. Browser.moduleContextCreatedCallbacks.forEach(function(callback) { callback() });
  2152. Browser.init();
  2153. }
  2154. return ctx;
  2155. },destroyContext:function (canvas, useWebGL, setInModule) {},fullscreenHandlersInstalled:false,lockPointer:undefined,resizeCanvas:undefined,requestFullscreen:function (lockPointer, resizeCanvas, vrDevice) {
  2156. Browser.lockPointer = lockPointer;
  2157. Browser.resizeCanvas = resizeCanvas;
  2158. Browser.vrDevice = vrDevice;
  2159. if (typeof Browser.lockPointer === 'undefined') Browser.lockPointer = true;
  2160. if (typeof Browser.resizeCanvas === 'undefined') Browser.resizeCanvas = false;
  2161. if (typeof Browser.vrDevice === 'undefined') Browser.vrDevice = null;
  2162. var canvas = Module['canvas'];
  2163. function fullscreenChange() {
  2164. Browser.isFullscreen = false;
  2165. var canvasContainer = canvas.parentNode;
  2166. if ((document['fullscreenElement'] || document['mozFullScreenElement'] ||
  2167. document['msFullscreenElement'] || document['webkitFullscreenElement'] ||
  2168. document['webkitCurrentFullScreenElement']) === canvasContainer) {
  2169. canvas.exitFullscreen = document['exitFullscreen'] ||
  2170. document['cancelFullScreen'] ||
  2171. document['mozCancelFullScreen'] ||
  2172. document['msExitFullscreen'] ||
  2173. document['webkitCancelFullScreen'] ||
  2174. function() {};
  2175. canvas.exitFullscreen = canvas.exitFullscreen.bind(document);
  2176. if (Browser.lockPointer) canvas.requestPointerLock();
  2177. Browser.isFullscreen = true;
  2178. if (Browser.resizeCanvas) Browser.setFullscreenCanvasSize();
  2179. } else {
  2180. // remove the full screen specific parent of the canvas again to restore the HTML structure from before going full screen
  2181. canvasContainer.parentNode.insertBefore(canvas, canvasContainer);
  2182. canvasContainer.parentNode.removeChild(canvasContainer);
  2183. if (Browser.resizeCanvas) Browser.setWindowedCanvasSize();
  2184. }
  2185. if (Module['onFullScreen']) Module['onFullScreen'](Browser.isFullscreen);
  2186. if (Module['onFullscreen']) Module['onFullscreen'](Browser.isFullscreen);
  2187. Browser.updateCanvasDimensions(canvas);
  2188. }
  2189. if (!Browser.fullscreenHandlersInstalled) {
  2190. Browser.fullscreenHandlersInstalled = true;
  2191. document.addEventListener('fullscreenchange', fullscreenChange, false);
  2192. document.addEventListener('mozfullscreenchange', fullscreenChange, false);
  2193. document.addEventListener('webkitfullscreenchange', fullscreenChange, false);
  2194. document.addEventListener('MSFullscreenChange', fullscreenChange, false);
  2195. }
  2196. // create a new parent to ensure the canvas has no siblings. this allows browsers to optimize full screen performance when its parent is the full screen root
  2197. var canvasContainer = document.createElement("div");
  2198. canvas.parentNode.insertBefore(canvasContainer, canvas);
  2199. canvasContainer.appendChild(canvas);
  2200. // use parent of canvas as full screen root to allow aspect ratio correction (Firefox stretches the root to screen size)
  2201. canvasContainer.requestFullscreen = canvasContainer['requestFullscreen'] ||
  2202. canvasContainer['mozRequestFullScreen'] ||
  2203. canvasContainer['msRequestFullscreen'] ||
  2204. (canvasContainer['webkitRequestFullscreen'] ? function() { canvasContainer['webkitRequestFullscreen'](Element['ALLOW_KEYBOARD_INPUT']) } : null) ||
  2205. (canvasContainer['webkitRequestFullScreen'] ? function() { canvasContainer['webkitRequestFullScreen'](Element['ALLOW_KEYBOARD_INPUT']) } : null);
  2206. if (vrDevice) {
  2207. canvasContainer.requestFullscreen({ vrDisplay: vrDevice });
  2208. } else {
  2209. canvasContainer.requestFullscreen();
  2210. }
  2211. },requestFullScreen:function (lockPointer, resizeCanvas, vrDevice) {
  2212. Module.printErr('Browser.requestFullScreen() is deprecated. Please call Browser.requestFullscreen instead.');
  2213. Browser.requestFullScreen = function(lockPointer, resizeCanvas, vrDevice) {
  2214. return Browser.requestFullscreen(lockPointer, resizeCanvas, vrDevice);
  2215. }
  2216. return Browser.requestFullscreen(lockPointer, resizeCanvas, vrDevice);
  2217. },nextRAF:0,fakeRequestAnimationFrame:function (func) {
  2218. // try to keep 60fps between calls to here
  2219. var now = Date.now();
  2220. if (Browser.nextRAF === 0) {
  2221. Browser.nextRAF = now + 1000/60;
  2222. } else {
  2223. while (now + 2 >= Browser.nextRAF) { // fudge a little, to avoid timer jitter causing us to do lots of delay:0
  2224. Browser.nextRAF += 1000/60;
  2225. }
  2226. }
  2227. var delay = Math.max(Browser.nextRAF - now, 0);
  2228. setTimeout(func, delay);
  2229. },requestAnimationFrame:function requestAnimationFrame(func) {
  2230. if (typeof window === 'undefined') { // Provide fallback to setTimeout if window is undefined (e.g. in Node.js)
  2231. Browser.fakeRequestAnimationFrame(func);
  2232. } else {
  2233. if (!window.requestAnimationFrame) {
  2234. window.requestAnimationFrame = window['requestAnimationFrame'] ||
  2235. window['mozRequestAnimationFrame'] ||
  2236. window['webkitRequestAnimationFrame'] ||
  2237. window['msRequestAnimationFrame'] ||
  2238. window['oRequestAnimationFrame'] ||
  2239. Browser.fakeRequestAnimationFrame;
  2240. }
  2241. window.requestAnimationFrame(func);
  2242. }
  2243. },safeCallback:function (func) {
  2244. return function() {
  2245. if (!ABORT) return func.apply(null, arguments);
  2246. };
  2247. },allowAsyncCallbacks:true,queuedAsyncCallbacks:[],pauseAsyncCallbacks:function () {
  2248. Browser.allowAsyncCallbacks = false;
  2249. },resumeAsyncCallbacks:function () { // marks future callbacks as ok to execute, and synchronously runs any remaining ones right now
  2250. Browser.allowAsyncCallbacks = true;
  2251. if (Browser.queuedAsyncCallbacks.length > 0) {
  2252. var callbacks = Browser.queuedAsyncCallbacks;
  2253. Browser.queuedAsyncCallbacks = [];
  2254. callbacks.forEach(function(func) {
  2255. func();
  2256. });
  2257. }
  2258. },safeRequestAnimationFrame:function (func) {
  2259. return Browser.requestAnimationFrame(function() {
  2260. if (ABORT) return;
  2261. if (Browser.allowAsyncCallbacks) {
  2262. func();
  2263. } else {
  2264. Browser.queuedAsyncCallbacks.push(func);
  2265. }
  2266. });
  2267. },safeSetTimeout:function (func, timeout) {
  2268. Module['noExitRuntime'] = true;
  2269. return setTimeout(function() {
  2270. if (ABORT) return;
  2271. if (Browser.allowAsyncCallbacks) {
  2272. func();
  2273. } else {
  2274. Browser.queuedAsyncCallbacks.push(func);
  2275. }
  2276. }, timeout);
  2277. },safeSetInterval:function (func, timeout) {
  2278. Module['noExitRuntime'] = true;
  2279. return setInterval(function() {
  2280. if (ABORT) return;
  2281. if (Browser.allowAsyncCallbacks) {
  2282. func();
  2283. } // drop it on the floor otherwise, next interval will kick in
  2284. }, timeout);
  2285. },getMimetype:function (name) {
  2286. return {
  2287. 'jpg': 'image/jpeg',
  2288. 'jpeg': 'image/jpeg',
  2289. 'png': 'image/png',
  2290. 'bmp': 'image/bmp',
  2291. 'ogg': 'audio/ogg',
  2292. 'wav': 'audio/wav',
  2293. 'mp3': 'audio/mpeg'
  2294. }[name.substr(name.lastIndexOf('.')+1)];
  2295. },getUserMedia:function (func) {
  2296. if(!window.getUserMedia) {
  2297. window.getUserMedia = navigator['getUserMedia'] ||
  2298. navigator['mozGetUserMedia'];
  2299. }
  2300. window.getUserMedia(func);
  2301. },getMovementX:function (event) {
  2302. return event['movementX'] ||
  2303. event['mozMovementX'] ||
  2304. event['webkitMovementX'] ||
  2305. 0;
  2306. },getMovementY:function (event) {
  2307. return event['movementY'] ||
  2308. event['mozMovementY'] ||
  2309. event['webkitMovementY'] ||
  2310. 0;
  2311. },getMouseWheelDelta:function (event) {
  2312. var delta = 0;
  2313. switch (event.type) {
  2314. case 'DOMMouseScroll':
  2315. delta = event.detail;
  2316. break;
  2317. case 'mousewheel':
  2318. delta = event.wheelDelta;
  2319. break;
  2320. case 'wheel':
  2321. delta = event['deltaY'];
  2322. break;
  2323. default:
  2324. throw 'unrecognized mouse wheel event: ' + event.type;
  2325. }
  2326. return delta;
  2327. },mouseX:0,mouseY:0,mouseMovementX:0,mouseMovementY:0,touches:{},lastTouches:{},calculateMouseEvent:function (event) { // event should be mousemove, mousedown or mouseup
  2328. if (Browser.pointerLock) {
  2329. // When the pointer is locked, calculate the coordinates
  2330. // based on the movement of the mouse.
  2331. // Workaround for Firefox bug 764498
  2332. if (event.type != 'mousemove' &&
  2333. ('mozMovementX' in event)) {
  2334. Browser.mouseMovementX = Browser.mouseMovementY = 0;
  2335. } else {
  2336. Browser.mouseMovementX = Browser.getMovementX(event);
  2337. Browser.mouseMovementY = Browser.getMovementY(event);
  2338. }
  2339. // check if SDL is available
  2340. if (typeof SDL != "undefined") {
  2341. Browser.mouseX = SDL.mouseX + Browser.mouseMovementX;
  2342. Browser.mouseY = SDL.mouseY + Browser.mouseMovementY;
  2343. } else {
  2344. // just add the mouse delta to the current absolut mouse position
  2345. // FIXME: ideally this should be clamped against the canvas size and zero
  2346. Browser.mouseX += Browser.mouseMovementX;
  2347. Browser.mouseY += Browser.mouseMovementY;
  2348. }
  2349. } else {
  2350. // Otherwise, calculate the movement based on the changes
  2351. // in the coordinates.
  2352. var rect = Module["canvas"].getBoundingClientRect();
  2353. var cw = Module["canvas"].width;
  2354. var ch = Module["canvas"].height;
  2355. // Neither .scrollX or .pageXOffset are defined in a spec, but
  2356. // we prefer .scrollX because it is currently in a spec draft.
  2357. // (see: http://www.w3.org/TR/2013/WD-cssom-view-20131217/)
  2358. var scrollX = ((typeof window.scrollX !== 'undefined') ? window.scrollX : window.pageXOffset);
  2359. var scrollY = ((typeof window.scrollY !== 'undefined') ? window.scrollY : window.pageYOffset);
  2360. // If this assert lands, it's likely because the browser doesn't support scrollX or pageXOffset
  2361. // and we have no viable fallback.
  2362. assert((typeof scrollX !== 'undefined') && (typeof scrollY !== 'undefined'), 'Unable to retrieve scroll position, mouse positions likely broken.');
  2363. if (event.type === 'touchstart' || event.type === 'touchend' || event.type === 'touchmove') {
  2364. var touch = event.touch;
  2365. if (touch === undefined) {
  2366. return; // the "touch" property is only defined in SDL
  2367. }
  2368. var adjustedX = touch.pageX - (scrollX + rect.left);
  2369. var adjustedY = touch.pageY - (scrollY + rect.top);
  2370. adjustedX = adjustedX * (cw / rect.width);
  2371. adjustedY = adjustedY * (ch / rect.height);
  2372. var coords = { x: adjustedX, y: adjustedY };
  2373. if (event.type === 'touchstart') {
  2374. Browser.lastTouches[touch.identifier] = coords;
  2375. Browser.touches[touch.identifier] = coords;
  2376. } else if (event.type === 'touchend' || event.type === 'touchmove') {
  2377. var last = Browser.touches[touch.identifier];
  2378. if (!last) last = coords;
  2379. Browser.lastTouches[touch.identifier] = last;
  2380. Browser.touches[touch.identifier] = coords;
  2381. }
  2382. return;
  2383. }
  2384. var x = event.pageX - (scrollX + rect.left);
  2385. var y = event.pageY - (scrollY + rect.top);
  2386. // the canvas might be CSS-scaled compared to its backbuffer;
  2387. // SDL-using content will want mouse coordinates in terms
  2388. // of backbuffer units.
  2389. x = x * (cw / rect.width);
  2390. y = y * (ch / rect.height);
  2391. Browser.mouseMovementX = x - Browser.mouseX;
  2392. Browser.mouseMovementY = y - Browser.mouseY;
  2393. Browser.mouseX = x;
  2394. Browser.mouseY = y;
  2395. }
  2396. },asyncLoad:function (url, onload, onerror, noRunDep) {
  2397. var dep = !noRunDep ? getUniqueRunDependency('al ' + url) : '';
  2398. Module['readAsync'](url, function(arrayBuffer) {
  2399. assert(arrayBuffer, 'Loading data file "' + url + '" failed (no arrayBuffer).');
  2400. onload(new Uint8Array(arrayBuffer));
  2401. if (dep) removeRunDependency(dep);
  2402. }, function(event) {
  2403. if (onerror) {
  2404. onerror();
  2405. } else {
  2406. throw 'Loading data file "' + url + '" failed.';
  2407. }
  2408. });
  2409. if (dep) addRunDependency(dep);
  2410. },resizeListeners:[],updateResizeListeners:function () {
  2411. var canvas = Module['canvas'];
  2412. Browser.resizeListeners.forEach(function(listener) {
  2413. listener(canvas.width, canvas.height);
  2414. });
  2415. },setCanvasSize:function (width, height, noUpdates) {
  2416. var canvas = Module['canvas'];
  2417. Browser.updateCanvasDimensions(canvas, width, height);
  2418. if (!noUpdates) Browser.updateResizeListeners();
  2419. },windowedWidth:0,windowedHeight:0,setFullscreenCanvasSize:function () {
  2420. // check if SDL is available
  2421. if (typeof SDL != "undefined") {
  2422. var flags = HEAPU32[((SDL.screen+Runtime.QUANTUM_SIZE*0)>>2)];
  2423. flags = flags | 0x00800000; // set SDL_FULLSCREEN flag
  2424. HEAP32[((SDL.screen+Runtime.QUANTUM_SIZE*0)>>2)]=flags
  2425. }
  2426. Browser.updateResizeListeners();
  2427. },setWindowedCanvasSize:function () {
  2428. // check if SDL is available
  2429. if (typeof SDL != "undefined") {
  2430. var flags = HEAPU32[((SDL.screen+Runtime.QUANTUM_SIZE*0)>>2)];
  2431. flags = flags & ~0x00800000; // clear SDL_FULLSCREEN flag
  2432. HEAP32[((SDL.screen+Runtime.QUANTUM_SIZE*0)>>2)]=flags
  2433. }
  2434. Browser.updateResizeListeners();
  2435. },updateCanvasDimensions:function (canvas, wNative, hNative) {
  2436. if (wNative && hNative) {
  2437. canvas.widthNative = wNative;
  2438. canvas.heightNative = hNative;
  2439. } else {
  2440. wNative = canvas.widthNative;
  2441. hNative = canvas.heightNative;
  2442. }
  2443. var w = wNative;
  2444. var h = hNative;
  2445. if (Module['forcedAspectRatio'] && Module['forcedAspectRatio'] > 0) {
  2446. if (w/h < Module['forcedAspectRatio']) {
  2447. w = Math.round(h * Module['forcedAspectRatio']);
  2448. } else {
  2449. h = Math.round(w / Module['forcedAspectRatio']);
  2450. }
  2451. }
  2452. if (((document['fullscreenElement'] || document['mozFullScreenElement'] ||
  2453. document['msFullscreenElement'] || document['webkitFullscreenElement'] ||
  2454. document['webkitCurrentFullScreenElement']) === canvas.parentNode) && (typeof screen != 'undefined')) {
  2455. var factor = Math.min(screen.width / w, screen.height / h);
  2456. w = Math.round(w * factor);
  2457. h = Math.round(h * factor);
  2458. }
  2459. if (Browser.resizeCanvas) {
  2460. if (canvas.width != w) canvas.width = w;
  2461. if (canvas.height != h) canvas.height = h;
  2462. if (typeof canvas.style != 'undefined') {
  2463. canvas.style.removeProperty( "width");
  2464. canvas.style.removeProperty("height");
  2465. }
  2466. } else {
  2467. if (canvas.width != wNative) canvas.width = wNative;
  2468. if (canvas.height != hNative) canvas.height = hNative;
  2469. if (typeof canvas.style != 'undefined') {
  2470. if (w != wNative || h != hNative) {
  2471. canvas.style.setProperty( "width", w + "px", "important");
  2472. canvas.style.setProperty("height", h + "px", "important");
  2473. } else {
  2474. canvas.style.removeProperty( "width");
  2475. canvas.style.removeProperty("height");
  2476. }
  2477. }
  2478. }
  2479. },wgetRequests:{},nextWgetRequestHandle:0,getNextWgetRequestHandle:function () {
  2480. var handle = Browser.nextWgetRequestHandle;
  2481. Browser.nextWgetRequestHandle++;
  2482. return handle;
  2483. }};var GLFW={Window:function (id, width, height, title, monitor, share) {
  2484. this.id = id;
  2485. this.x = 0;
  2486. this.y = 0;
  2487. this.fullscreen = false; // Used to determine if app in fullscreen mode
  2488. this.storedX = 0; // Used to store X before fullscreen
  2489. this.storedY = 0; // Used to store Y before fullscreen
  2490. this.width = width;
  2491. this.height = height;
  2492. this.storedWidth = width; // Used to store width before fullscreen
  2493. this.storedHeight = height; // Used to store height before fullscreen
  2494. this.title = title;
  2495. this.monitor = monitor;
  2496. this.share = share;
  2497. this.attributes = GLFW.hints;
  2498. this.inputModes = {
  2499. 0x00033001:0x00034001, // GLFW_CURSOR (GLFW_CURSOR_NORMAL)
  2500. 0x00033002:0, // GLFW_STICKY_KEYS
  2501. 0x00033003:0, // GLFW_STICKY_MOUSE_BUTTONS
  2502. };
  2503. this.buttons = 0;
  2504. this.keys = new Array();
  2505. this.shouldClose = 0;
  2506. this.title = null;
  2507. this.windowPosFunc = null; // GLFWwindowposfun
  2508. this.windowSizeFunc = null; // GLFWwindowsizefun
  2509. this.windowCloseFunc = null; // GLFWwindowclosefun
  2510. this.windowRefreshFunc = null; // GLFWwindowrefreshfun
  2511. this.windowFocusFunc = null; // GLFWwindowfocusfun
  2512. this.windowIconifyFunc = null; // GLFWwindowiconifyfun
  2513. this.framebufferSizeFunc = null; // GLFWframebuffersizefun
  2514. this.mouseButtonFunc = null; // GLFWmousebuttonfun
  2515. this.cursorPosFunc = null; // GLFWcursorposfun
  2516. this.cursorEnterFunc = null; // GLFWcursorenterfun
  2517. this.scrollFunc = null; // GLFWscrollfun
  2518. this.keyFunc = null; // GLFWkeyfun
  2519. this.charFunc = null; // GLFWcharfun
  2520. this.userptr = null;
  2521. },WindowFromId:function (id) {
  2522. if (id <= 0 || !GLFW.windows) return null;
  2523. return GLFW.windows[id - 1];
  2524. },errorFunc:null,monitorFunc:null,active:null,windows:null,monitors:null,monitorString:null,versionString:null,initialTime:null,extensions:null,hints:null,defaultHints:{131073:0,131074:0,131075:1,131076:1,131077:1,135169:8,135170:8,135171:8,135172:8,135173:24,135174:8,135175:0,135176:0,135177:0,135178:0,135179:0,135180:0,135181:0,135182:0,135183:0,139265:196609,139266:1,139267:0,139268:0,139269:0,139270:0,139271:0,139272:0},DOMToGLFWKeyCode:function (keycode) {
  2525. switch (keycode) {
  2526. // these keycodes are only defined for GLFW3, assume they are the same for GLFW2
  2527. case 0x20:return 32; // DOM_VK_SPACE -> GLFW_KEY_SPACE
  2528. case 0xDE:return 39; // DOM_VK_QUOTE -> GLFW_KEY_APOSTROPHE
  2529. case 0xBC:return 44; // DOM_VK_COMMA -> GLFW_KEY_COMMA
  2530. case 0xAD:return 45; // DOM_VK_HYPHEN_MINUS -> GLFW_KEY_MINUS
  2531. case 0xBD:return 45; // DOM_VK_MINUS -> GLFW_KEY_MINUS
  2532. case 0xBE:return 46; // DOM_VK_PERIOD -> GLFW_KEY_PERIOD
  2533. case 0xBF:return 47; // DOM_VK_SLASH -> GLFW_KEY_SLASH
  2534. case 0x30:return 48; // DOM_VK_0 -> GLFW_KEY_0
  2535. case 0x31:return 49; // DOM_VK_1 -> GLFW_KEY_1
  2536. case 0x32:return 50; // DOM_VK_2 -> GLFW_KEY_2
  2537. case 0x33:return 51; // DOM_VK_3 -> GLFW_KEY_3
  2538. case 0x34:return 52; // DOM_VK_4 -> GLFW_KEY_4
  2539. case 0x35:return 53; // DOM_VK_5 -> GLFW_KEY_5
  2540. case 0x36:return 54; // DOM_VK_6 -> GLFW_KEY_6
  2541. case 0x37:return 55; // DOM_VK_7 -> GLFW_KEY_7
  2542. case 0x38:return 56; // DOM_VK_8 -> GLFW_KEY_8
  2543. case 0x39:return 57; // DOM_VK_9 -> GLFW_KEY_9
  2544. case 0x3B:return 59; // DOM_VK_SEMICOLON -> GLFW_KEY_SEMICOLON
  2545. case 0x3D:return 61; // DOM_VK_EQUALS -> GLFW_KEY_EQUAL
  2546. case 0xBB:return 61; // DOM_VK_EQUALS -> GLFW_KEY_EQUAL
  2547. case 0x41:return 65; // DOM_VK_A -> GLFW_KEY_A
  2548. case 0x42:return 66; // DOM_VK_B -> GLFW_KEY_B
  2549. case 0x43:return 67; // DOM_VK_C -> GLFW_KEY_C
  2550. case 0x44:return 68; // DOM_VK_D -> GLFW_KEY_D
  2551. case 0x45:return 69; // DOM_VK_E -> GLFW_KEY_E
  2552. case 0x46:return 70; // DOM_VK_F -> GLFW_KEY_F
  2553. case 0x47:return 71; // DOM_VK_G -> GLFW_KEY_G
  2554. case 0x48:return 72; // DOM_VK_H -> GLFW_KEY_H
  2555. case 0x49:return 73; // DOM_VK_I -> GLFW_KEY_I
  2556. case 0x4A:return 74; // DOM_VK_J -> GLFW_KEY_J
  2557. case 0x4B:return 75; // DOM_VK_K -> GLFW_KEY_K
  2558. case 0x4C:return 76; // DOM_VK_L -> GLFW_KEY_L
  2559. case 0x4D:return 77; // DOM_VK_M -> GLFW_KEY_M
  2560. case 0x4E:return 78; // DOM_VK_N -> GLFW_KEY_N
  2561. case 0x4F:return 79; // DOM_VK_O -> GLFW_KEY_O
  2562. case 0x50:return 80; // DOM_VK_P -> GLFW_KEY_P
  2563. case 0x51:return 81; // DOM_VK_Q -> GLFW_KEY_Q
  2564. case 0x52:return 82; // DOM_VK_R -> GLFW_KEY_R
  2565. case 0x53:return 83; // DOM_VK_S -> GLFW_KEY_S
  2566. case 0x54:return 84; // DOM_VK_T -> GLFW_KEY_T
  2567. case 0x55:return 85; // DOM_VK_U -> GLFW_KEY_U
  2568. case 0x56:return 86; // DOM_VK_V -> GLFW_KEY_V
  2569. case 0x57:return 87; // DOM_VK_W -> GLFW_KEY_W
  2570. case 0x58:return 88; // DOM_VK_X -> GLFW_KEY_X
  2571. case 0x59:return 89; // DOM_VK_Y -> GLFW_KEY_Y
  2572. case 0x5a:return 90; // DOM_VK_Z -> GLFW_KEY_Z
  2573. case 0xDB:return 91; // DOM_VK_OPEN_BRACKET -> GLFW_KEY_LEFT_BRACKET
  2574. case 0xDC:return 92; // DOM_VK_BACKSLASH -> GLFW_KEY_BACKSLASH
  2575. case 0xDD:return 93; // DOM_VK_CLOSE_BRACKET -> GLFW_KEY_RIGHT_BRACKET
  2576. case 0xC0:return 94; // DOM_VK_BACK_QUOTE -> GLFW_KEY_GRAVE_ACCENT
  2577. case 0x1B:return 256; // DOM_VK_ESCAPE -> GLFW_KEY_ESCAPE
  2578. case 0x0D:return 257; // DOM_VK_RETURN -> GLFW_KEY_ENTER
  2579. case 0x09:return 258; // DOM_VK_TAB -> GLFW_KEY_TAB
  2580. case 0x08:return 259; // DOM_VK_BACK -> GLFW_KEY_BACKSPACE
  2581. case 0x2D:return 260; // DOM_VK_INSERT -> GLFW_KEY_INSERT
  2582. case 0x2E:return 261; // DOM_VK_DELETE -> GLFW_KEY_DELETE
  2583. case 0x27:return 262; // DOM_VK_RIGHT -> GLFW_KEY_RIGHT
  2584. case 0x25:return 263; // DOM_VK_LEFT -> GLFW_KEY_LEFT
  2585. case 0x28:return 264; // DOM_VK_DOWN -> GLFW_KEY_DOWN
  2586. case 0x26:return 265; // DOM_VK_UP -> GLFW_KEY_UP
  2587. case 0x21:return 266; // DOM_VK_PAGE_UP -> GLFW_KEY_PAGE_UP
  2588. case 0x22:return 267; // DOM_VK_PAGE_DOWN -> GLFW_KEY_PAGE_DOWN
  2589. case 0x24:return 268; // DOM_VK_HOME -> GLFW_KEY_HOME
  2590. case 0x23:return 269; // DOM_VK_END -> GLFW_KEY_END
  2591. case 0x14:return 280; // DOM_VK_CAPS_LOCK -> GLFW_KEY_CAPS_LOCK
  2592. case 0x91:return 281; // DOM_VK_SCROLL_LOCK -> GLFW_KEY_SCROLL_LOCK
  2593. case 0x90:return 282; // DOM_VK_NUM_LOCK -> GLFW_KEY_NUM_LOCK
  2594. case 0x2C:return 283; // DOM_VK_SNAPSHOT -> GLFW_KEY_PRINT_SCREEN
  2595. case 0x13:return 284; // DOM_VK_PAUSE -> GLFW_KEY_PAUSE
  2596. case 0x70:return 290; // DOM_VK_F1 -> GLFW_KEY_F1
  2597. case 0x71:return 291; // DOM_VK_F2 -> GLFW_KEY_F2
  2598. case 0x72:return 292; // DOM_VK_F3 -> GLFW_KEY_F3
  2599. case 0x73:return 293; // DOM_VK_F4 -> GLFW_KEY_F4
  2600. case 0x74:return 294; // DOM_VK_F5 -> GLFW_KEY_F5
  2601. case 0x75:return 295; // DOM_VK_F6 -> GLFW_KEY_F6
  2602. case 0x76:return 296; // DOM_VK_F7 -> GLFW_KEY_F7
  2603. case 0x77:return 297; // DOM_VK_F8 -> GLFW_KEY_F8
  2604. case 0x78:return 298; // DOM_VK_F9 -> GLFW_KEY_F9
  2605. case 0x79:return 299; // DOM_VK_F10 -> GLFW_KEY_F10
  2606. case 0x7A:return 300; // DOM_VK_F11 -> GLFW_KEY_F11
  2607. case 0x7B:return 301; // DOM_VK_F12 -> GLFW_KEY_F12
  2608. case 0x7C:return 302; // DOM_VK_F13 -> GLFW_KEY_F13
  2609. case 0x7D:return 303; // DOM_VK_F14 -> GLFW_KEY_F14
  2610. case 0x7E:return 304; // DOM_VK_F15 -> GLFW_KEY_F15
  2611. case 0x7F:return 305; // DOM_VK_F16 -> GLFW_KEY_F16
  2612. case 0x80:return 306; // DOM_VK_F17 -> GLFW_KEY_F17
  2613. case 0x81:return 307; // DOM_VK_F18 -> GLFW_KEY_F18
  2614. case 0x82:return 308; // DOM_VK_F19 -> GLFW_KEY_F19
  2615. case 0x83:return 309; // DOM_VK_F20 -> GLFW_KEY_F20
  2616. case 0x84:return 310; // DOM_VK_F21 -> GLFW_KEY_F21
  2617. case 0x85:return 311; // DOM_VK_F22 -> GLFW_KEY_F22
  2618. case 0x86:return 312; // DOM_VK_F23 -> GLFW_KEY_F23
  2619. case 0x87:return 313; // DOM_VK_F24 -> GLFW_KEY_F24
  2620. case 0x88:return 314; // 0x88 (not used?) -> GLFW_KEY_F25
  2621. case 0x60:return 320; // DOM_VK_NUMPAD0 -> GLFW_KEY_KP_0
  2622. case 0x61:return 321; // DOM_VK_NUMPAD1 -> GLFW_KEY_KP_1
  2623. case 0x62:return 322; // DOM_VK_NUMPAD2 -> GLFW_KEY_KP_2
  2624. case 0x63:return 323; // DOM_VK_NUMPAD3 -> GLFW_KEY_KP_3
  2625. case 0x64:return 324; // DOM_VK_NUMPAD4 -> GLFW_KEY_KP_4
  2626. case 0x65:return 325; // DOM_VK_NUMPAD5 -> GLFW_KEY_KP_5
  2627. case 0x66:return 326; // DOM_VK_NUMPAD6 -> GLFW_KEY_KP_6
  2628. case 0x67:return 327; // DOM_VK_NUMPAD7 -> GLFW_KEY_KP_7
  2629. case 0x68:return 328; // DOM_VK_NUMPAD8 -> GLFW_KEY_KP_8
  2630. case 0x69:return 329; // DOM_VK_NUMPAD9 -> GLFW_KEY_KP_9
  2631. case 0x6E:return 330; // DOM_VK_DECIMAL -> GLFW_KEY_KP_DECIMAL
  2632. case 0x6F:return 331; // DOM_VK_DIVIDE -> GLFW_KEY_KP_DIVIDE
  2633. case 0x6A:return 332; // DOM_VK_MULTIPLY -> GLFW_KEY_KP_MULTIPLY
  2634. case 0x6D:return 333; // DOM_VK_SUBTRACT -> GLFW_KEY_KP_SUBTRACT
  2635. case 0x6B:return 334; // DOM_VK_ADD -> GLFW_KEY_KP_ADD
  2636. // case 0x0D:return 335; // DOM_VK_RETURN -> GLFW_KEY_KP_ENTER (DOM_KEY_LOCATION_RIGHT)
  2637. // case 0x61:return 336; // DOM_VK_EQUALS -> GLFW_KEY_KP_EQUAL (DOM_KEY_LOCATION_RIGHT)
  2638. case 0x10:return 340; // DOM_VK_SHIFT -> GLFW_KEY_LEFT_SHIFT
  2639. case 0x11:return 341; // DOM_VK_CONTROL -> GLFW_KEY_LEFT_CONTROL
  2640. case 0x12:return 342; // DOM_VK_ALT -> GLFW_KEY_LEFT_ALT
  2641. case 0x5B:return 343; // DOM_VK_WIN -> GLFW_KEY_LEFT_SUPER
  2642. // case 0x10:return 344; // DOM_VK_SHIFT -> GLFW_KEY_RIGHT_SHIFT (DOM_KEY_LOCATION_RIGHT)
  2643. // case 0x11:return 345; // DOM_VK_CONTROL -> GLFW_KEY_RIGHT_CONTROL (DOM_KEY_LOCATION_RIGHT)
  2644. // case 0x12:return 346; // DOM_VK_ALT -> GLFW_KEY_RIGHT_ALT (DOM_KEY_LOCATION_RIGHT)
  2645. // case 0x5B:return 347; // DOM_VK_WIN -> GLFW_KEY_RIGHT_SUPER (DOM_KEY_LOCATION_RIGHT)
  2646. case 0x5D:return 348; // DOM_VK_CONTEXT_MENU -> GLFW_KEY_MENU
  2647. // XXX: GLFW_KEY_WORLD_1, GLFW_KEY_WORLD_2 what are these?
  2648. default:return -1; // GLFW_KEY_UNKNOWN
  2649. };
  2650. },getModBits:function (win) {
  2651. var mod = 0;
  2652. if (win.keys[340]) mod |= 0x0001; // GLFW_MOD_SHIFT
  2653. if (win.keys[341]) mod |= 0x0002; // GLFW_MOD_CONTROL
  2654. if (win.keys[342]) mod |= 0x0004; // GLFW_MOD_ALT
  2655. if (win.keys[343]) mod |= 0x0008; // GLFW_MOD_SUPER
  2656. return mod;
  2657. },onKeyPress:function (event) {
  2658. if (!GLFW.active || !GLFW.active.charFunc) return;
  2659. // correct unicode charCode is only available with onKeyPress event
  2660. var charCode = event.charCode;
  2661. if (charCode == 0 || (charCode >= 0x00 && charCode <= 0x1F)) return;
  2662. Module['dynCall_vii'](GLFW.active.charFunc, GLFW.active.id, charCode);
  2663. },onKeyChanged:function (event, status) {
  2664. if (!GLFW.active) return;
  2665. var key = GLFW.DOMToGLFWKeyCode(event.keyCode);
  2666. if (key == -1) return;
  2667. var repeat = status && GLFW.active.keys[key];
  2668. GLFW.active.keys[key] = status;
  2669. if (!GLFW.active.keyFunc) return;
  2670. if (repeat) status = 2; // GLFW_REPEAT
  2671. Module['dynCall_viiiii'](GLFW.active.keyFunc, GLFW.active.id, key, event.keyCode, status, GLFW.getModBits(GLFW.active));
  2672. },onKeydown:function (event) {
  2673. GLFW.onKeyChanged(event, 1); // GLFW_PRESS or GLFW_REPEAT
  2674. // This logic comes directly from the sdl implementation. We cannot
  2675. // call preventDefault on all keydown events otherwise onKeyPress will
  2676. // not get called
  2677. if (event.keyCode === 8 /* backspace */ || event.keyCode === 9 /* tab */) {
  2678. event.preventDefault();
  2679. }
  2680. },onKeyup:function (event) {
  2681. GLFW.onKeyChanged(event, 0); // GLFW_RELEASE
  2682. },onMousemove:function (event) {
  2683. if (!GLFW.active) return;
  2684. Browser.calculateMouseEvent(event);
  2685. if (event.target != Module["canvas"] || !GLFW.active.cursorPosFunc) return;
  2686. Module['dynCall_vidd'](GLFW.active.cursorPosFunc, GLFW.active.id, Browser.mouseX, Browser.mouseY);
  2687. },DOMToGLFWMouseButton:function (event) {
  2688. // DOM and glfw have different button codes.
  2689. // See http://www.w3schools.com/jsref/event_button.asp.
  2690. var eventButton = event['button'];
  2691. if (eventButton > 0) {
  2692. if (eventButton == 1) {
  2693. eventButton = 2;
  2694. } else {
  2695. eventButton = 1;
  2696. }
  2697. }
  2698. return eventButton;
  2699. },onMouseenter:function (event) {
  2700. if (!GLFW.active) return;
  2701. if (event.target != Module["canvas"] || !GLFW.active.cursorEnterFunc) return;
  2702. Module['dynCall_vii'](GLFW.active.cursorEnterFunc, GLFW.active.id, 1);
  2703. },onMouseleave:function (event) {
  2704. if (!GLFW.active) return;
  2705. if (event.target != Module["canvas"] || !GLFW.active.cursorEnterFunc) return;
  2706. Module['dynCall_vii'](GLFW.active.cursorEnterFunc, GLFW.active.id, 0);
  2707. },onMouseButtonChanged:function (event, status) {
  2708. if (!GLFW.active) return;
  2709. Browser.calculateMouseEvent(event);
  2710. if (event.target != Module["canvas"]) return;
  2711. eventButton = GLFW.DOMToGLFWMouseButton(event);
  2712. if (status == 1) { // GLFW_PRESS
  2713. GLFW.active.buttons |= (1 << eventButton);
  2714. try {
  2715. event.target.setCapture();
  2716. } catch (e) {}
  2717. } else { // GLFW_RELEASE
  2718. GLFW.active.buttons &= ~(1 << eventButton);
  2719. }
  2720. if (!GLFW.active.mouseButtonFunc) return;
  2721. Module['dynCall_viiii'](GLFW.active.mouseButtonFunc, GLFW.active.id, eventButton, status, GLFW.getModBits(GLFW.active));
  2722. },onMouseButtonDown:function (event) {
  2723. if (!GLFW.active) return;
  2724. GLFW.onMouseButtonChanged(event, 1); // GLFW_PRESS
  2725. },onMouseButtonUp:function (event) {
  2726. if (!GLFW.active) return;
  2727. GLFW.onMouseButtonChanged(event, 0); // GLFW_RELEASE
  2728. },onMouseWheel:function (event) {
  2729. // Note the minus sign that flips browser wheel direction (positive direction scrolls page down) to native wheel direction (positive direction is mouse wheel up)
  2730. var delta = -Browser.getMouseWheelDelta(event);
  2731. delta = (delta == 0) ? 0 : (delta > 0 ? Math.max(delta, 1) : Math.min(delta, -1)); // Quantize to integer so that minimum scroll is at least +/- 1.
  2732. GLFW.wheelPos += delta;
  2733. if (!GLFW.active || !GLFW.active.scrollFunc || event.target != Module['canvas']) return;
  2734. var sx = 0;
  2735. var sy = 0;
  2736. if (event.type == 'mousewheel') {
  2737. sx = event.wheelDeltaX;
  2738. sy = event.wheelDeltaY;
  2739. } else {
  2740. sx = event.deltaX;
  2741. sy = event.deltaY;
  2742. }
  2743. Module['dynCall_vidd'](GLFW.active.scrollFunc, GLFW.active.id, sx, sy);
  2744. event.preventDefault();
  2745. },onCanvasResize:function (width, height) {
  2746. if (!GLFW.active) return;
  2747. var resizeNeeded = true;
  2748. // If the client is requestiong fullscreen mode
  2749. if (document["fullscreen"] || document["fullScreen"] || document["mozFullScreen"] || document["webkitIsFullScreen"]) {
  2750. GLFW.active.storedX = GLFW.active.x;
  2751. GLFW.active.storedY = GLFW.active.y;
  2752. GLFW.active.storedWidth = GLFW.active.width;
  2753. GLFW.active.storedHeight = GLFW.active.height;
  2754. GLFW.active.x = GLFW.active.y = 0;
  2755. GLFW.active.width = screen.width;
  2756. GLFW.active.height = screen.height;
  2757. GLFW.active.fullscreen = true;
  2758. // If the client is reverting from fullscreen mode
  2759. } else if (GLFW.active.fullscreen == true) {
  2760. GLFW.active.x = GLFW.active.storedX;
  2761. GLFW.active.y = GLFW.active.storedY;
  2762. GLFW.active.width = GLFW.active.storedWidth;
  2763. GLFW.active.height = GLFW.active.storedHeight;
  2764. GLFW.active.fullscreen = false;
  2765. // If the width/height values do not match current active window sizes
  2766. } else if (GLFW.active.width != width || GLFW.active.height != height) {
  2767. GLFW.active.width = width;
  2768. GLFW.active.height = height;
  2769. } else {
  2770. resizeNeeded = false;
  2771. }
  2772. // If any of the above conditions were true, we need to resize the canvas
  2773. if (resizeNeeded) {
  2774. // resets the canvas size to counter the aspect preservation of Browser.updateCanvasDimensions
  2775. Browser.setCanvasSize(GLFW.active.width, GLFW.active.height, true);
  2776. // TODO: Client dimensions (clientWidth/clientHeight) vs pixel dimensions (width/height) of
  2777. // the canvas should drive window and framebuffer size respectfully.
  2778. GLFW.onWindowSizeChanged();
  2779. GLFW.onFramebufferSizeChanged();
  2780. }
  2781. },onWindowSizeChanged:function () {
  2782. if (!GLFW.active) return;
  2783. if (!GLFW.active.windowSizeFunc) return;
  2784. Module['dynCall_viii'](GLFW.active.windowSizeFunc, GLFW.active.id, GLFW.active.width, GLFW.active.height);
  2785. },onFramebufferSizeChanged:function () {
  2786. if (!GLFW.active) return;
  2787. if (!GLFW.active.framebufferSizeFunc) return;
  2788. Module['dynCall_viii'](GLFW.active.framebufferSizeFunc, GLFW.active.id, GLFW.active.width, GLFW.active.height);
  2789. },requestFullscreen:function () {
  2790. var RFS = Module["canvas"]['requestFullscreen'] ||
  2791. Module["canvas"]['mozRequestFullScreen'] ||
  2792. Module["canvas"]['webkitRequestFullScreen'] ||
  2793. (function() {});
  2794. RFS.apply(Module["canvas"], []);
  2795. },requestFullScreen:function () {
  2796. Module.printErr('GLFW.requestFullScreen() is deprecated. Please call GLFW.requestFullscreen instead.');
  2797. GLFW.requestFullScreen = function() {
  2798. return GLFW.requestFullscreen();
  2799. }
  2800. return GLFW.requestFullscreen();
  2801. },exitFullscreen:function () {
  2802. var CFS = document['exitFullscreen'] ||
  2803. document['cancelFullScreen'] ||
  2804. document['mozCancelFullScreen'] ||
  2805. document['webkitCancelFullScreen'] ||
  2806. (function() {});
  2807. CFS.apply(document, []);
  2808. },cancelFullScreen:function () {
  2809. Module.printErr('GLFW.cancelFullScreen() is deprecated. Please call GLFW.exitFullscreen instead.');
  2810. GLFW.cancelFullScreen = function() {
  2811. return GLFW.exitFullscreen();
  2812. }
  2813. return GLFW.exitFullscreen();
  2814. },getTime:function () {
  2815. return _emscripten_get_now() / 1000;
  2816. },setWindowTitle:function (winid, title) {
  2817. var win = GLFW.WindowFromId(winid);
  2818. if (!win) return;
  2819. win.title = Pointer_stringify(title);
  2820. if (GLFW.active.id == win.id) {
  2821. document.title = win.title;
  2822. }
  2823. },setKeyCallback:function (winid, cbfun) {
  2824. var win = GLFW.WindowFromId(winid);
  2825. if (!win) return;
  2826. win.keyFunc = cbfun;
  2827. },setCharCallback:function (winid, cbfun) {
  2828. var win = GLFW.WindowFromId(winid);
  2829. if (!win) return;
  2830. win.charFunc = cbfun;
  2831. },setMouseButtonCallback:function (winid, cbfun) {
  2832. var win = GLFW.WindowFromId(winid);
  2833. if (!win) return;
  2834. win.mouseButtonFunc = cbfun;
  2835. },setCursorPosCallback:function (winid, cbfun) {
  2836. var win = GLFW.WindowFromId(winid);
  2837. if (!win) return;
  2838. win.cursorPosFunc = cbfun;
  2839. },setScrollCallback:function (winid, cbfun) {
  2840. var win = GLFW.WindowFromId(winid);
  2841. if (!win) return;
  2842. win.scrollFunc = cbfun;
  2843. },setWindowSizeCallback:function (winid, cbfun) {
  2844. var win = GLFW.WindowFromId(winid);
  2845. if (!win) return;
  2846. win.windowSizeFunc = cbfun;
  2847. },setWindowCloseCallback:function (winid, cbfun) {
  2848. var win = GLFW.WindowFromId(winid);
  2849. if (!win) return;
  2850. win.windowCloseFunc = cbfun;
  2851. },setWindowRefreshCallback:function (winid, cbfun) {
  2852. var win = GLFW.WindowFromId(winid);
  2853. if (!win) return;
  2854. win.windowRefreshFunc = cbfun;
  2855. },onClickRequestPointerLock:function (e) {
  2856. if (!Browser.pointerLock && Module['canvas'].requestPointerLock) {
  2857. Module['canvas'].requestPointerLock();
  2858. e.preventDefault();
  2859. }
  2860. },setInputMode:function (winid, mode, value) {
  2861. var win = GLFW.WindowFromId(winid);
  2862. if (!win) return;
  2863. switch(mode) {
  2864. case 0x00033001: { // GLFW_CURSOR
  2865. switch(value) {
  2866. case 0x00034001: { // GLFW_CURSOR_NORMAL
  2867. win.inputModes[mode] = value;
  2868. Module['canvas'].removeEventListener('click', GLFW.onClickRequestPointerLock, true);
  2869. Module['canvas'].exitPointerLock();
  2870. break;
  2871. }
  2872. case 0x00034002: { // GLFW_CURSOR_HIDDEN
  2873. console.log("glfwSetInputMode called with GLFW_CURSOR_HIDDEN value not implemented.");
  2874. break;
  2875. }
  2876. case 0x00034003: { // GLFW_CURSOR_DISABLED
  2877. win.inputModes[mode] = value;
  2878. Module['canvas'].addEventListener('click', GLFW.onClickRequestPointerLock, true);
  2879. Module['canvas'].requestPointerLock();
  2880. break;
  2881. }
  2882. default: {
  2883. console.log("glfwSetInputMode called with unknown value parameter value: " + value + ".");
  2884. break;
  2885. }
  2886. }
  2887. break;
  2888. }
  2889. case 0x00033002: { // GLFW_STICKY_KEYS
  2890. console.log("glfwSetInputMode called with GLFW_STICKY_KEYS mode not implemented.");
  2891. break;
  2892. }
  2893. case 0x00033003: { // GLFW_STICKY_MOUSE_BUTTONS
  2894. console.log("glfwSetInputMode called with GLFW_STICKY_MOUSE_BUTTONS mode not implemented.");
  2895. break;
  2896. }
  2897. default: {
  2898. console.log("glfwSetInputMode called with unknown mode parameter value: " + mode + ".");
  2899. break;
  2900. }
  2901. }
  2902. },getKey:function (winid, key) {
  2903. var win = GLFW.WindowFromId(winid);
  2904. if (!win) return 0;
  2905. return win.keys[key];
  2906. },getMouseButton:function (winid, button) {
  2907. var win = GLFW.WindowFromId(winid);
  2908. if (!win) return 0;
  2909. return (win.buttons & (1 << button)) > 0;
  2910. },getCursorPos:function (winid, x, y) {
  2911. setValue(x, Browser.mouseX, 'double');
  2912. setValue(y, Browser.mouseY, 'double');
  2913. },getMousePos:function (winid, x, y) {
  2914. setValue(x, Browser.mouseX, 'i32');
  2915. setValue(y, Browser.mouseY, 'i32');
  2916. },setCursorPos:function (winid, x, y) {
  2917. },getWindowPos:function (winid, x, y) {
  2918. var wx = 0;
  2919. var wy = 0;
  2920. var win = GLFW.WindowFromId(winid);
  2921. if (win) {
  2922. wx = win.x;
  2923. wy = win.y;
  2924. }
  2925. setValue(x, wx, 'i32');
  2926. setValue(y, wy, 'i32');
  2927. },setWindowPos:function (winid, x, y) {
  2928. var win = GLFW.WindowFromId(winid);
  2929. if (!win) return;
  2930. win.x = x;
  2931. win.y = y;
  2932. },getWindowSize:function (winid, width, height) {
  2933. var ww = 0;
  2934. var wh = 0;
  2935. var win = GLFW.WindowFromId(winid);
  2936. if (win) {
  2937. ww = win.width;
  2938. wh = win.height;
  2939. }
  2940. setValue(width, ww, 'i32');
  2941. setValue(height, wh, 'i32');
  2942. },setWindowSize:function (winid, width, height) {
  2943. var win = GLFW.WindowFromId(winid);
  2944. if (!win) return;
  2945. if (GLFW.active.id == win.id) {
  2946. if (width == screen.width && height == screen.height) {
  2947. GLFW.requestFullscreen();
  2948. } else {
  2949. GLFW.exitFullscreen();
  2950. Browser.setCanvasSize(width, height);
  2951. win.width = width;
  2952. win.height = height;
  2953. }
  2954. }
  2955. if (!win.windowSizeFunc) return;
  2956. Module['dynCall_viii'](win.windowSizeFunc, win.id, width, height);
  2957. },createWindow:function (width, height, title, monitor, share) {
  2958. var i, id;
  2959. for (i = 0; i < GLFW.windows.length && GLFW.windows[i] !== null; i++);
  2960. if (i > 0) throw "glfwCreateWindow only supports one window at time currently";
  2961. // id for window
  2962. id = i + 1;
  2963. // not valid
  2964. if (width <= 0 || height <= 0) return 0;
  2965. if (monitor) {
  2966. GLFW.requestFullscreen();
  2967. } else {
  2968. Browser.setCanvasSize(width, height);
  2969. }
  2970. // Create context when there are no existing alive windows
  2971. for (i = 0; i < GLFW.windows.length && GLFW.windows[i] == null; i++);
  2972. if (i == GLFW.windows.length) {
  2973. var contextAttributes = {
  2974. antialias: (GLFW.hints[0x0002100D] > 1), // GLFW_SAMPLES
  2975. depth: (GLFW.hints[0x00021005] > 0), // GLFW_DEPTH_BITS
  2976. stencil: (GLFW.hints[0x00021006] > 0), // GLFW_STENCIL_BITS
  2977. alpha: (GLFW.hints[0x00021004] > 0) // GLFW_ALPHA_BITS
  2978. }
  2979. Module.ctx = Browser.createContext(Module['canvas'], true, true, contextAttributes);
  2980. }
  2981. // If context creation failed, do not return a valid window
  2982. if (!Module.ctx) return 0;
  2983. // Get non alive id
  2984. var win = new GLFW.Window(id, width, height, title, monitor, share);
  2985. // Set window to array
  2986. if (id - 1 == GLFW.windows.length) {
  2987. GLFW.windows.push(win);
  2988. } else {
  2989. GLFW.windows[id - 1] = win;
  2990. }
  2991. GLFW.active = win;
  2992. return win.id;
  2993. },destroyWindow:function (winid) {
  2994. var win = GLFW.WindowFromId(winid);
  2995. if (!win) return;
  2996. if (win.windowCloseFunc)
  2997. Module['dynCall_vi'](win.windowCloseFunc, win.id);
  2998. GLFW.windows[win.id - 1] = null;
  2999. if (GLFW.active.id == win.id)
  3000. GLFW.active = null;
  3001. // Destroy context when no alive windows
  3002. for (var i = 0; i < GLFW.windows.length; i++)
  3003. if (GLFW.windows[i] !== null) return;
  3004. Module.ctx = Browser.destroyContext(Module['canvas'], true, true);
  3005. },swapBuffers:function (winid) {
  3006. },GLFW2ParamToGLFW3Param:function (param) {
  3007. table = {
  3008. 0x00030001:0, // GLFW_MOUSE_CURSOR
  3009. 0x00030002:0, // GLFW_STICKY_KEYS
  3010. 0x00030003:0, // GLFW_STICKY_MOUSE_BUTTONS
  3011. 0x00030004:0, // GLFW_SYSTEM_KEYS
  3012. 0x00030005:0, // GLFW_KEY_REPEAT
  3013. 0x00030006:0, // GLFW_AUTO_POLL_EVENTS
  3014. 0x00020001:0, // GLFW_OPENED
  3015. 0x00020002:0, // GLFW_ACTIVE
  3016. 0x00020003:0, // GLFW_ICONIFIED
  3017. 0x00020004:0, // GLFW_ACCELERATED
  3018. 0x00020005:0x00021001, // GLFW_RED_BITS
  3019. 0x00020006:0x00021002, // GLFW_GREEN_BITS
  3020. 0x00020007:0x00021003, // GLFW_BLUE_BITS
  3021. 0x00020008:0x00021004, // GLFW_ALPHA_BITS
  3022. 0x00020009:0x00021005, // GLFW_DEPTH_BITS
  3023. 0x0002000A:0x00021006, // GLFW_STENCIL_BITS
  3024. 0x0002000B:0x0002100F, // GLFW_REFRESH_RATE
  3025. 0x0002000C:0x00021007, // GLFW_ACCUM_RED_BITS
  3026. 0x0002000D:0x00021008, // GLFW_ACCUM_GREEN_BITS
  3027. 0x0002000E:0x00021009, // GLFW_ACCUM_BLUE_BITS
  3028. 0x0002000F:0x0002100A, // GLFW_ACCUM_ALPHA_BITS
  3029. 0x00020010:0x0002100B, // GLFW_AUX_BUFFERS
  3030. 0x00020011:0x0002100C, // GLFW_STEREO
  3031. 0x00020012:0, // GLFW_WINDOW_NO_RESIZE
  3032. 0x00020013:0x0002100D, // GLFW_FSAA_SAMPLES
  3033. 0x00020014:0x00022002, // GLFW_OPENGL_VERSION_MAJOR
  3034. 0x00020015:0x00022003, // GLFW_OPENGL_VERSION_MINOR
  3035. 0x00020016:0x00022006, // GLFW_OPENGL_FORWARD_COMPAT
  3036. 0x00020017:0x00022007, // GLFW_OPENGL_DEBUG_CONTEXT
  3037. 0x00020018:0x00022008, // GLFW_OPENGL_PROFILE
  3038. };
  3039. return table[param];
  3040. }};function _glfwGetVideoModes(monitor, count) {
  3041. setValue(count, 0, 'i32');
  3042. return 0;
  3043. }
  3044. function _glLinkProgram(program) {
  3045. GLctx.linkProgram(GL.programs[program]);
  3046. GL.programInfos[program] = null; // uniforms no longer keep the same names after linking
  3047. GL.populateUniformTable(program);
  3048. }
  3049. function _glBindTexture(target, texture) {
  3050. GLctx.bindTexture(target, texture ? GL.textures[texture] : null);
  3051. }
  3052. function _emscripten_glStencilFunc(x0, x1, x2) { GLctx['stencilFunc'](x0, x1, x2) }
  3053. function _glGetString(name_) {
  3054. if (GL.stringCache[name_]) return GL.stringCache[name_];
  3055. var ret;
  3056. switch(name_) {
  3057. case 0x1F00 /* GL_VENDOR */:
  3058. case 0x1F01 /* GL_RENDERER */:
  3059. case 0x9245 /* UNMASKED_VENDOR_WEBGL */:
  3060. case 0x9246 /* UNMASKED_RENDERER_WEBGL */:
  3061. ret = allocate(intArrayFromString(GLctx.getParameter(name_)), 'i8', ALLOC_NORMAL);
  3062. break;
  3063. case 0x1F02 /* GL_VERSION */:
  3064. var glVersion = GLctx.getParameter(GLctx.VERSION);
  3065. // return GLES version string corresponding to the version of the WebGL context
  3066. {
  3067. glVersion = 'OpenGL ES 2.0 (' + glVersion + ')';
  3068. }
  3069. ret = allocate(intArrayFromString(glVersion), 'i8', ALLOC_NORMAL);
  3070. break;
  3071. case 0x1F03 /* GL_EXTENSIONS */:
  3072. var exts = GLctx.getSupportedExtensions();
  3073. var gl_exts = [];
  3074. for (var i = 0; i < exts.length; ++i) {
  3075. gl_exts.push(exts[i]);
  3076. gl_exts.push("GL_" + exts[i]);
  3077. }
  3078. ret = allocate(intArrayFromString(gl_exts.join(' ')), 'i8', ALLOC_NORMAL);
  3079. break;
  3080. case 0x8B8C /* GL_SHADING_LANGUAGE_VERSION */:
  3081. var glslVersion = GLctx.getParameter(GLctx.SHADING_LANGUAGE_VERSION);
  3082. // extract the version number 'N.M' from the string 'WebGL GLSL ES N.M ...'
  3083. var ver_re = /^WebGL GLSL ES ([0-9]\.[0-9][0-9]?)(?:$| .*)/;
  3084. var ver_num = glslVersion.match(ver_re);
  3085. if (ver_num !== null) {
  3086. if (ver_num[1].length == 3) ver_num[1] = ver_num[1] + '0'; // ensure minor version has 2 digits
  3087. glslVersion = 'OpenGL ES GLSL ES ' + ver_num[1] + ' (' + glslVersion + ')';
  3088. }
  3089. ret = allocate(intArrayFromString(glslVersion), 'i8', ALLOC_NORMAL);
  3090. break;
  3091. default:
  3092. GL.recordError(0x0500/*GL_INVALID_ENUM*/);
  3093. return 0;
  3094. }
  3095. GL.stringCache[name_] = ret;
  3096. return ret;
  3097. }
  3098. function _emscripten_glUniform3iv(location, count, value) {
  3099. GLctx.uniform3iv(GL.uniforms[location], HEAP32.subarray((value)>>2,(value+count*12)>>2));
  3100. }
  3101. function _emscripten_glShaderSource(shader, count, string, length) {
  3102. var source = GL.getSource(shader, count, string, length);
  3103. GLctx.shaderSource(GL.shaders[shader], source);
  3104. }
  3105. function _emscripten_glReleaseShaderCompiler() {
  3106. // NOP (as allowed by GLES 2.0 spec)
  3107. }
  3108. function _glfwSetScrollCallback(winid, cbfun) {
  3109. GLFW.setScrollCallback(winid, cbfun);
  3110. }
  3111. function _emscripten_glTexParameterf(x0, x1, x2) { GLctx['texParameterf'](x0, x1, x2) }
  3112. function _emscripten_glTexParameteri(x0, x1, x2) { GLctx['texParameteri'](x0, x1, x2) }
  3113. function _glCompileShader(shader) {
  3114. GLctx.compileShader(GL.shaders[shader]);
  3115. }
  3116. var ERRNO_CODES={EPERM:1,ENOENT:2,ESRCH:3,EINTR:4,EIO:5,ENXIO:6,E2BIG:7,ENOEXEC:8,EBADF:9,ECHILD:10,EAGAIN:11,EWOULDBLOCK:11,ENOMEM:12,EACCES:13,EFAULT:14,ENOTBLK:15,EBUSY:16,EEXIST:17,EXDEV:18,ENODEV:19,ENOTDIR:20,EISDIR:21,EINVAL:22,ENFILE:23,EMFILE:24,ENOTTY:25,ETXTBSY:26,EFBIG:27,ENOSPC:28,ESPIPE:29,EROFS:30,EMLINK:31,EPIPE:32,EDOM:33,ERANGE:34,ENOMSG:42,EIDRM:43,ECHRNG:44,EL2NSYNC:45,EL3HLT:46,EL3RST:47,ELNRNG:48,EUNATCH:49,ENOCSI:50,EL2HLT:51,EDEADLK:35,ENOLCK:37,EBADE:52,EBADR:53,EXFULL:54,ENOANO:55,EBADRQC:56,EBADSLT:57,EDEADLOCK:35,EBFONT:59,ENOSTR:60,ENODATA:61,ETIME:62,ENOSR:63,ENONET:64,ENOPKG:65,EREMOTE:66,ENOLINK:67,EADV:68,ESRMNT:69,ECOMM:70,EPROTO:71,EMULTIHOP:72,EDOTDOT:73,EBADMSG:74,ENOTUNIQ:76,EBADFD:77,EREMCHG:78,ELIBACC:79,ELIBBAD:80,ELIBSCN:81,ELIBMAX:82,ELIBEXEC:83,ENOSYS:38,ENOTEMPTY:39,ENAMETOOLONG:36,ELOOP:40,EOPNOTSUPP:95,EPFNOSUPPORT:96,ECONNRESET:104,ENOBUFS:105,EAFNOSUPPORT:97,EPROTOTYPE:91,ENOTSOCK:88,ENOPROTOOPT:92,ESHUTDOWN:108,ECONNREFUSED:111,EADDRINUSE:98,ECONNABORTED:103,ENETUNREACH:101,ENETDOWN:100,ETIMEDOUT:110,EHOSTDOWN:112,EHOSTUNREACH:113,EINPROGRESS:115,EALREADY:114,EDESTADDRREQ:89,EMSGSIZE:90,EPROTONOSUPPORT:93,ESOCKTNOSUPPORT:94,EADDRNOTAVAIL:99,ENETRESET:102,EISCONN:106,ENOTCONN:107,ETOOMANYREFS:109,EUSERS:87,EDQUOT:122,ESTALE:116,ENOTSUP:95,ENOMEDIUM:123,EILSEQ:84,EOVERFLOW:75,ECANCELED:125,ENOTRECOVERABLE:131,EOWNERDEAD:130,ESTRPIPE:86};
  3117. var ERRNO_MESSAGES={0:"Success",1:"Not super-user",2:"No such file or directory",3:"No such process",4:"Interrupted system call",5:"I/O error",6:"No such device or address",7:"Arg list too long",8:"Exec format error",9:"Bad file number",10:"No children",11:"No more processes",12:"Not enough core",13:"Permission denied",14:"Bad address",15:"Block device required",16:"Mount device busy",17:"File exists",18:"Cross-device link",19:"No such device",20:"Not a directory",21:"Is a directory",22:"Invalid argument",23:"Too many open files in system",24:"Too many open files",25:"Not a typewriter",26:"Text file busy",27:"File too large",28:"No space left on device",29:"Illegal seek",30:"Read only file system",31:"Too many links",32:"Broken pipe",33:"Math arg out of domain of func",34:"Math result not representable",35:"File locking deadlock error",36:"File or path name too long",37:"No record locks available",38:"Function not implemented",39:"Directory not empty",40:"Too many symbolic links",42:"No message of desired type",43:"Identifier removed",44:"Channel number out of range",45:"Level 2 not synchronized",46:"Level 3 halted",47:"Level 3 reset",48:"Link number out of range",49:"Protocol driver not attached",50:"No CSI structure available",51:"Level 2 halted",52:"Invalid exchange",53:"Invalid request descriptor",54:"Exchange full",55:"No anode",56:"Invalid request code",57:"Invalid slot",59:"Bad font file fmt",60:"Device not a stream",61:"No data (for no delay io)",62:"Timer expired",63:"Out of streams resources",64:"Machine is not on the network",65:"Package not installed",66:"The object is remote",67:"The link has been severed",68:"Advertise error",69:"Srmount error",70:"Communication error on send",71:"Protocol error",72:"Multihop attempted",73:"Cross mount point (not really error)",74:"Trying to read unreadable message",75:"Value too large for defined data type",76:"Given log. name not unique",77:"f.d. invalid for this operation",78:"Remote address changed",79:"Can access a needed shared lib",80:"Accessing a corrupted shared lib",81:".lib section in a.out corrupted",82:"Attempting to link in too many libs",83:"Attempting to exec a shared library",84:"Illegal byte sequence",86:"Streams pipe error",87:"Too many users",88:"Socket operation on non-socket",89:"Destination address required",90:"Message too long",91:"Protocol wrong type for socket",92:"Protocol not available",93:"Unknown protocol",94:"Socket type not supported",95:"Not supported",96:"Protocol family not supported",97:"Address family not supported by protocol family",98:"Address already in use",99:"Address not available",100:"Network interface is not configured",101:"Network is unreachable",102:"Connection reset by network",103:"Connection aborted",104:"Connection reset by peer",105:"No buffer space available",106:"Socket is already connected",107:"Socket is not connected",108:"Can't send after socket shutdown",109:"Too many references",110:"Connection timed out",111:"Connection refused",112:"Host is down",113:"Host is unreachable",114:"Socket already connected",115:"Connection already in progress",116:"Stale file handle",122:"Quota exceeded",123:"No medium (in tape drive)",125:"Operation canceled",130:"Previous owner died",131:"State not recoverable"};
  3118. function ___setErrNo(value) {
  3119. if (Module['___errno_location']) HEAP32[((Module['___errno_location']())>>2)]=value;
  3120. else Module.printErr('failed to set errno from JS');
  3121. return value;
  3122. }
  3123. var PATH={splitPath:function (filename) {
  3124. var splitPathRe = /^(\/?|)([\s\S]*?)((?:\.{1,2}|[^\/]+?|)(\.[^.\/]*|))(?:[\/]*)$/;
  3125. return splitPathRe.exec(filename).slice(1);
  3126. },normalizeArray:function (parts, allowAboveRoot) {
  3127. // if the path tries to go above the root, `up` ends up > 0
  3128. var up = 0;
  3129. for (var i = parts.length - 1; i >= 0; i--) {
  3130. var last = parts[i];
  3131. if (last === '.') {
  3132. parts.splice(i, 1);
  3133. } else if (last === '..') {
  3134. parts.splice(i, 1);
  3135. up++;
  3136. } else if (up) {
  3137. parts.splice(i, 1);
  3138. up--;
  3139. }
  3140. }
  3141. // if the path is allowed to go above the root, restore leading ..s
  3142. if (allowAboveRoot) {
  3143. for (; up--; up) {
  3144. parts.unshift('..');
  3145. }
  3146. }
  3147. return parts;
  3148. },normalize:function (path) {
  3149. var isAbsolute = path.charAt(0) === '/',
  3150. trailingSlash = path.substr(-1) === '/';
  3151. // Normalize the path
  3152. path = PATH.normalizeArray(path.split('/').filter(function(p) {
  3153. return !!p;
  3154. }), !isAbsolute).join('/');
  3155. if (!path && !isAbsolute) {
  3156. path = '.';
  3157. }
  3158. if (path && trailingSlash) {
  3159. path += '/';
  3160. }
  3161. return (isAbsolute ? '/' : '') + path;
  3162. },dirname:function (path) {
  3163. var result = PATH.splitPath(path),
  3164. root = result[0],
  3165. dir = result[1];
  3166. if (!root && !dir) {
  3167. // No dirname whatsoever
  3168. return '.';
  3169. }
  3170. if (dir) {
  3171. // It has a dirname, strip trailing slash
  3172. dir = dir.substr(0, dir.length - 1);
  3173. }
  3174. return root + dir;
  3175. },basename:function (path) {
  3176. // EMSCRIPTEN return '/'' for '/', not an empty string
  3177. if (path === '/') return '/';
  3178. var lastSlash = path.lastIndexOf('/');
  3179. if (lastSlash === -1) return path;
  3180. return path.substr(lastSlash+1);
  3181. },extname:function (path) {
  3182. return PATH.splitPath(path)[3];
  3183. },join:function () {
  3184. var paths = Array.prototype.slice.call(arguments, 0);
  3185. return PATH.normalize(paths.join('/'));
  3186. },join2:function (l, r) {
  3187. return PATH.normalize(l + '/' + r);
  3188. },resolve:function () {
  3189. var resolvedPath = '',
  3190. resolvedAbsolute = false;
  3191. for (var i = arguments.length - 1; i >= -1 && !resolvedAbsolute; i--) {
  3192. var path = (i >= 0) ? arguments[i] : FS.cwd();
  3193. // Skip empty and invalid entries
  3194. if (typeof path !== 'string') {
  3195. throw new TypeError('Arguments to path.resolve must be strings');
  3196. } else if (!path) {
  3197. return ''; // an invalid portion invalidates the whole thing
  3198. }
  3199. resolvedPath = path + '/' + resolvedPath;
  3200. resolvedAbsolute = path.charAt(0) === '/';
  3201. }
  3202. // At this point the path should be resolved to a full absolute path, but
  3203. // handle relative paths to be safe (might happen when process.cwd() fails)
  3204. resolvedPath = PATH.normalizeArray(resolvedPath.split('/').filter(function(p) {
  3205. return !!p;
  3206. }), !resolvedAbsolute).join('/');
  3207. return ((resolvedAbsolute ? '/' : '') + resolvedPath) || '.';
  3208. },relative:function (from, to) {
  3209. from = PATH.resolve(from).substr(1);
  3210. to = PATH.resolve(to).substr(1);
  3211. function trim(arr) {
  3212. var start = 0;
  3213. for (; start < arr.length; start++) {
  3214. if (arr[start] !== '') break;
  3215. }
  3216. var end = arr.length - 1;
  3217. for (; end >= 0; end--) {
  3218. if (arr[end] !== '') break;
  3219. }
  3220. if (start > end) return [];
  3221. return arr.slice(start, end - start + 1);
  3222. }
  3223. var fromParts = trim(from.split('/'));
  3224. var toParts = trim(to.split('/'));
  3225. var length = Math.min(fromParts.length, toParts.length);
  3226. var samePartsLength = length;
  3227. for (var i = 0; i < length; i++) {
  3228. if (fromParts[i] !== toParts[i]) {
  3229. samePartsLength = i;
  3230. break;
  3231. }
  3232. }
  3233. var outputParts = [];
  3234. for (var i = samePartsLength; i < fromParts.length; i++) {
  3235. outputParts.push('..');
  3236. }
  3237. outputParts = outputParts.concat(toParts.slice(samePartsLength));
  3238. return outputParts.join('/');
  3239. }};
  3240. var TTY={ttys:[],init:function () {
  3241. // https://github.com/kripken/emscripten/pull/1555
  3242. // if (ENVIRONMENT_IS_NODE) {
  3243. // // currently, FS.init does not distinguish if process.stdin is a file or TTY
  3244. // // device, it always assumes it's a TTY device. because of this, we're forcing
  3245. // // process.stdin to UTF8 encoding to at least make stdin reading compatible
  3246. // // with text files until FS.init can be refactored.
  3247. // process['stdin']['setEncoding']('utf8');
  3248. // }
  3249. },shutdown:function () {
  3250. // https://github.com/kripken/emscripten/pull/1555
  3251. // if (ENVIRONMENT_IS_NODE) {
  3252. // // inolen: any idea as to why node -e 'process.stdin.read()' wouldn't exit immediately (with process.stdin being a tty)?
  3253. // // isaacs: because now it's reading from the stream, you've expressed interest in it, so that read() kicks off a _read() which creates a ReadReq operation
  3254. // // inolen: I thought read() in that case was a synchronous operation that just grabbed some amount of buffered data if it exists?
  3255. // // isaacs: it is. but it also triggers a _read() call, which calls readStart() on the handle
  3256. // // isaacs: do process.stdin.pause() and i'd think it'd probably close the pending call
  3257. // process['stdin']['pause']();
  3258. // }
  3259. },register:function (dev, ops) {
  3260. TTY.ttys[dev] = { input: [], output: [], ops: ops };
  3261. FS.registerDevice(dev, TTY.stream_ops);
  3262. },stream_ops:{open:function (stream) {
  3263. var tty = TTY.ttys[stream.node.rdev];
  3264. if (!tty) {
  3265. throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
  3266. }
  3267. stream.tty = tty;
  3268. stream.seekable = false;
  3269. },close:function (stream) {
  3270. // flush any pending line data
  3271. stream.tty.ops.flush(stream.tty);
  3272. },flush:function (stream) {
  3273. stream.tty.ops.flush(stream.tty);
  3274. },read:function (stream, buffer, offset, length, pos /* ignored */) {
  3275. if (!stream.tty || !stream.tty.ops.get_char) {
  3276. throw new FS.ErrnoError(ERRNO_CODES.ENXIO);
  3277. }
  3278. var bytesRead = 0;
  3279. for (var i = 0; i < length; i++) {
  3280. var result;
  3281. try {
  3282. result = stream.tty.ops.get_char(stream.tty);
  3283. } catch (e) {
  3284. throw new FS.ErrnoError(ERRNO_CODES.EIO);
  3285. }
  3286. if (result === undefined && bytesRead === 0) {
  3287. throw new FS.ErrnoError(ERRNO_CODES.EAGAIN);
  3288. }
  3289. if (result === null || result === undefined) break;
  3290. bytesRead++;
  3291. buffer[offset+i] = result;
  3292. }
  3293. if (bytesRead) {
  3294. stream.node.timestamp = Date.now();
  3295. }
  3296. return bytesRead;
  3297. },write:function (stream, buffer, offset, length, pos) {
  3298. if (!stream.tty || !stream.tty.ops.put_char) {
  3299. throw new FS.ErrnoError(ERRNO_CODES.ENXIO);
  3300. }
  3301. for (var i = 0; i < length; i++) {
  3302. try {
  3303. stream.tty.ops.put_char(stream.tty, buffer[offset+i]);
  3304. } catch (e) {
  3305. throw new FS.ErrnoError(ERRNO_CODES.EIO);
  3306. }
  3307. }
  3308. if (length) {
  3309. stream.node.timestamp = Date.now();
  3310. }
  3311. return i;
  3312. }},default_tty_ops:{get_char:function (tty) {
  3313. if (!tty.input.length) {
  3314. var result = null;
  3315. if (ENVIRONMENT_IS_NODE) {
  3316. // we will read data by chunks of BUFSIZE
  3317. var BUFSIZE = 256;
  3318. var buf = new Buffer(BUFSIZE);
  3319. var bytesRead = 0;
  3320. var isPosixPlatform = (process.platform != 'win32'); // Node doesn't offer a direct check, so test by exclusion
  3321. var fd = process.stdin.fd;
  3322. if (isPosixPlatform) {
  3323. // Linux and Mac cannot use process.stdin.fd (which isn't set up as sync)
  3324. var usingDevice = false;
  3325. try {
  3326. fd = fs.openSync('/dev/stdin', 'r');
  3327. usingDevice = true;
  3328. } catch (e) {}
  3329. }
  3330. try {
  3331. bytesRead = fs.readSync(fd, buf, 0, BUFSIZE, null);
  3332. } catch(e) {
  3333. // Cross-platform differences: on Windows, reading EOF throws an exception, but on other OSes,
  3334. // reading EOF returns 0. Uniformize behavior by treating the EOF exception to return 0.
  3335. if (e.toString().indexOf('EOF') != -1) bytesRead = 0;
  3336. else throw e;
  3337. }
  3338. if (usingDevice) { fs.closeSync(fd); }
  3339. if (bytesRead > 0) {
  3340. result = buf.slice(0, bytesRead).toString('utf-8');
  3341. } else {
  3342. result = null;
  3343. }
  3344. } else if (typeof window != 'undefined' &&
  3345. typeof window.prompt == 'function') {
  3346. // Browser.
  3347. result = window.prompt('Input: '); // returns null on cancel
  3348. if (result !== null) {
  3349. result += '\n';
  3350. }
  3351. } else if (typeof readline == 'function') {
  3352. // Command line.
  3353. result = readline();
  3354. if (result !== null) {
  3355. result += '\n';
  3356. }
  3357. }
  3358. if (!result) {
  3359. return null;
  3360. }
  3361. tty.input = intArrayFromString(result, true);
  3362. }
  3363. return tty.input.shift();
  3364. },put_char:function (tty, val) {
  3365. if (val === null || val === 10) {
  3366. Module['print'](UTF8ArrayToString(tty.output, 0));
  3367. tty.output = [];
  3368. } else {
  3369. if (val != 0) tty.output.push(val); // val == 0 would cut text output off in the middle.
  3370. }
  3371. },flush:function (tty) {
  3372. if (tty.output && tty.output.length > 0) {
  3373. Module['print'](UTF8ArrayToString(tty.output, 0));
  3374. tty.output = [];
  3375. }
  3376. }},default_tty1_ops:{put_char:function (tty, val) {
  3377. if (val === null || val === 10) {
  3378. Module['printErr'](UTF8ArrayToString(tty.output, 0));
  3379. tty.output = [];
  3380. } else {
  3381. if (val != 0) tty.output.push(val);
  3382. }
  3383. },flush:function (tty) {
  3384. if (tty.output && tty.output.length > 0) {
  3385. Module['printErr'](UTF8ArrayToString(tty.output, 0));
  3386. tty.output = [];
  3387. }
  3388. }}};
  3389. var MEMFS={ops_table:null,mount:function (mount) {
  3390. return MEMFS.createNode(null, '/', 16384 | 511 /* 0777 */, 0);
  3391. },createNode:function (parent, name, mode, dev) {
  3392. if (FS.isBlkdev(mode) || FS.isFIFO(mode)) {
  3393. // no supported
  3394. throw new FS.ErrnoError(ERRNO_CODES.EPERM);
  3395. }
  3396. if (!MEMFS.ops_table) {
  3397. MEMFS.ops_table = {
  3398. dir: {
  3399. node: {
  3400. getattr: MEMFS.node_ops.getattr,
  3401. setattr: MEMFS.node_ops.setattr,
  3402. lookup: MEMFS.node_ops.lookup,
  3403. mknod: MEMFS.node_ops.mknod,
  3404. rename: MEMFS.node_ops.rename,
  3405. unlink: MEMFS.node_ops.unlink,
  3406. rmdir: MEMFS.node_ops.rmdir,
  3407. readdir: MEMFS.node_ops.readdir,
  3408. symlink: MEMFS.node_ops.symlink
  3409. },
  3410. stream: {
  3411. llseek: MEMFS.stream_ops.llseek
  3412. }
  3413. },
  3414. file: {
  3415. node: {
  3416. getattr: MEMFS.node_ops.getattr,
  3417. setattr: MEMFS.node_ops.setattr
  3418. },
  3419. stream: {
  3420. llseek: MEMFS.stream_ops.llseek,
  3421. read: MEMFS.stream_ops.read,
  3422. write: MEMFS.stream_ops.write,
  3423. allocate: MEMFS.stream_ops.allocate,
  3424. mmap: MEMFS.stream_ops.mmap,
  3425. msync: MEMFS.stream_ops.msync
  3426. }
  3427. },
  3428. link: {
  3429. node: {
  3430. getattr: MEMFS.node_ops.getattr,
  3431. setattr: MEMFS.node_ops.setattr,
  3432. readlink: MEMFS.node_ops.readlink
  3433. },
  3434. stream: {}
  3435. },
  3436. chrdev: {
  3437. node: {
  3438. getattr: MEMFS.node_ops.getattr,
  3439. setattr: MEMFS.node_ops.setattr
  3440. },
  3441. stream: FS.chrdev_stream_ops
  3442. }
  3443. };
  3444. }
  3445. var node = FS.createNode(parent, name, mode, dev);
  3446. if (FS.isDir(node.mode)) {
  3447. node.node_ops = MEMFS.ops_table.dir.node;
  3448. node.stream_ops = MEMFS.ops_table.dir.stream;
  3449. node.contents = {};
  3450. } else if (FS.isFile(node.mode)) {
  3451. node.node_ops = MEMFS.ops_table.file.node;
  3452. node.stream_ops = MEMFS.ops_table.file.stream;
  3453. node.usedBytes = 0; // The actual number of bytes used in the typed array, as opposed to contents.length which gives the whole capacity.
  3454. // When the byte data of the file is populated, this will point to either a typed array, or a normal JS array. Typed arrays are preferred
  3455. // for performance, and used by default. However, typed arrays are not resizable like normal JS arrays are, so there is a small disk size
  3456. // penalty involved for appending file writes that continuously grow a file similar to std::vector capacity vs used -scheme.
  3457. node.contents = null;
  3458. } else if (FS.isLink(node.mode)) {
  3459. node.node_ops = MEMFS.ops_table.link.node;
  3460. node.stream_ops = MEMFS.ops_table.link.stream;
  3461. } else if (FS.isChrdev(node.mode)) {
  3462. node.node_ops = MEMFS.ops_table.chrdev.node;
  3463. node.stream_ops = MEMFS.ops_table.chrdev.stream;
  3464. }
  3465. node.timestamp = Date.now();
  3466. // add the new node to the parent
  3467. if (parent) {
  3468. parent.contents[name] = node;
  3469. }
  3470. return node;
  3471. },getFileDataAsRegularArray:function (node) {
  3472. if (node.contents && node.contents.subarray) {
  3473. var arr = [];
  3474. for (var i = 0; i < node.usedBytes; ++i) arr.push(node.contents[i]);
  3475. return arr; // Returns a copy of the original data.
  3476. }
  3477. return node.contents; // No-op, the file contents are already in a JS array. Return as-is.
  3478. },getFileDataAsTypedArray:function (node) {
  3479. if (!node.contents) return new Uint8Array;
  3480. if (node.contents.subarray) return node.contents.subarray(0, node.usedBytes); // Make sure to not return excess unused bytes.
  3481. return new Uint8Array(node.contents);
  3482. },expandFileStorage:function (node, newCapacity) {
  3483. // If we are asked to expand the size of a file that already exists, revert to using a standard JS array to store the file
  3484. // instead of a typed array. This makes resizing the array more flexible because we can just .push() elements at the back to
  3485. // increase the size.
  3486. if (node.contents && node.contents.subarray && newCapacity > node.contents.length) {
  3487. node.contents = MEMFS.getFileDataAsRegularArray(node);
  3488. node.usedBytes = node.contents.length; // We might be writing to a lazy-loaded file which had overridden this property, so force-reset it.
  3489. }
  3490. if (!node.contents || node.contents.subarray) { // Keep using a typed array if creating a new storage, or if old one was a typed array as well.
  3491. var prevCapacity = node.contents ? node.contents.length : 0;
  3492. if (prevCapacity >= newCapacity) return; // No need to expand, the storage was already large enough.
  3493. // Don't expand strictly to the given requested limit if it's only a very small increase, but instead geometrically grow capacity.
  3494. // For small filesizes (<1MB), perform size*2 geometric increase, but for large sizes, do a much more conservative size*1.125 increase to
  3495. // avoid overshooting the allocation cap by a very large margin.
  3496. var CAPACITY_DOUBLING_MAX = 1024 * 1024;
  3497. newCapacity = Math.max(newCapacity, (prevCapacity * (prevCapacity < CAPACITY_DOUBLING_MAX ? 2.0 : 1.125)) | 0);
  3498. if (prevCapacity != 0) newCapacity = Math.max(newCapacity, 256); // At minimum allocate 256b for each file when expanding.
  3499. var oldContents = node.contents;
  3500. node.contents = new Uint8Array(newCapacity); // Allocate new storage.
  3501. if (node.usedBytes > 0) node.contents.set(oldContents.subarray(0, node.usedBytes), 0); // Copy old data over to the new storage.
  3502. return;
  3503. }
  3504. // Not using a typed array to back the file storage. Use a standard JS array instead.
  3505. if (!node.contents && newCapacity > 0) node.contents = [];
  3506. while (node.contents.length < newCapacity) node.contents.push(0);
  3507. },resizeFileStorage:function (node, newSize) {
  3508. if (node.usedBytes == newSize) return;
  3509. if (newSize == 0) {
  3510. node.contents = null; // Fully decommit when requesting a resize to zero.
  3511. node.usedBytes = 0;
  3512. return;
  3513. }
  3514. if (!node.contents || node.contents.subarray) { // Resize a typed array if that is being used as the backing store.
  3515. var oldContents = node.contents;
  3516. node.contents = new Uint8Array(new ArrayBuffer(newSize)); // Allocate new storage.
  3517. if (oldContents) {
  3518. node.contents.set(oldContents.subarray(0, Math.min(newSize, node.usedBytes))); // Copy old data over to the new storage.
  3519. }
  3520. node.usedBytes = newSize;
  3521. return;
  3522. }
  3523. // Backing with a JS array.
  3524. if (!node.contents) node.contents = [];
  3525. if (node.contents.length > newSize) node.contents.length = newSize;
  3526. else while (node.contents.length < newSize) node.contents.push(0);
  3527. node.usedBytes = newSize;
  3528. },node_ops:{getattr:function (node) {
  3529. var attr = {};
  3530. // device numbers reuse inode numbers.
  3531. attr.dev = FS.isChrdev(node.mode) ? node.id : 1;
  3532. attr.ino = node.id;
  3533. attr.mode = node.mode;
  3534. attr.nlink = 1;
  3535. attr.uid = 0;
  3536. attr.gid = 0;
  3537. attr.rdev = node.rdev;
  3538. if (FS.isDir(node.mode)) {
  3539. attr.size = 4096;
  3540. } else if (FS.isFile(node.mode)) {
  3541. attr.size = node.usedBytes;
  3542. } else if (FS.isLink(node.mode)) {
  3543. attr.size = node.link.length;
  3544. } else {
  3545. attr.size = 0;
  3546. }
  3547. attr.atime = new Date(node.timestamp);
  3548. attr.mtime = new Date(node.timestamp);
  3549. attr.ctime = new Date(node.timestamp);
  3550. // NOTE: In our implementation, st_blocks = Math.ceil(st_size/st_blksize),
  3551. // but this is not required by the standard.
  3552. attr.blksize = 4096;
  3553. attr.blocks = Math.ceil(attr.size / attr.blksize);
  3554. return attr;
  3555. },setattr:function (node, attr) {
  3556. if (attr.mode !== undefined) {
  3557. node.mode = attr.mode;
  3558. }
  3559. if (attr.timestamp !== undefined) {
  3560. node.timestamp = attr.timestamp;
  3561. }
  3562. if (attr.size !== undefined) {
  3563. MEMFS.resizeFileStorage(node, attr.size);
  3564. }
  3565. },lookup:function (parent, name) {
  3566. throw FS.genericErrors[ERRNO_CODES.ENOENT];
  3567. },mknod:function (parent, name, mode, dev) {
  3568. return MEMFS.createNode(parent, name, mode, dev);
  3569. },rename:function (old_node, new_dir, new_name) {
  3570. // if we're overwriting a directory at new_name, make sure it's empty.
  3571. if (FS.isDir(old_node.mode)) {
  3572. var new_node;
  3573. try {
  3574. new_node = FS.lookupNode(new_dir, new_name);
  3575. } catch (e) {
  3576. }
  3577. if (new_node) {
  3578. for (var i in new_node.contents) {
  3579. throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY);
  3580. }
  3581. }
  3582. }
  3583. // do the internal rewiring
  3584. delete old_node.parent.contents[old_node.name];
  3585. old_node.name = new_name;
  3586. new_dir.contents[new_name] = old_node;
  3587. old_node.parent = new_dir;
  3588. },unlink:function (parent, name) {
  3589. delete parent.contents[name];
  3590. },rmdir:function (parent, name) {
  3591. var node = FS.lookupNode(parent, name);
  3592. for (var i in node.contents) {
  3593. throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY);
  3594. }
  3595. delete parent.contents[name];
  3596. },readdir:function (node) {
  3597. var entries = ['.', '..']
  3598. for (var key in node.contents) {
  3599. if (!node.contents.hasOwnProperty(key)) {
  3600. continue;
  3601. }
  3602. entries.push(key);
  3603. }
  3604. return entries;
  3605. },symlink:function (parent, newname, oldpath) {
  3606. var node = MEMFS.createNode(parent, newname, 511 /* 0777 */ | 40960, 0);
  3607. node.link = oldpath;
  3608. return node;
  3609. },readlink:function (node) {
  3610. if (!FS.isLink(node.mode)) {
  3611. throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
  3612. }
  3613. return node.link;
  3614. }},stream_ops:{read:function (stream, buffer, offset, length, position) {
  3615. var contents = stream.node.contents;
  3616. if (position >= stream.node.usedBytes) return 0;
  3617. var size = Math.min(stream.node.usedBytes - position, length);
  3618. assert(size >= 0);
  3619. if (size > 8 && contents.subarray) { // non-trivial, and typed array
  3620. buffer.set(contents.subarray(position, position + size), offset);
  3621. } else {
  3622. for (var i = 0; i < size; i++) buffer[offset + i] = contents[position + i];
  3623. }
  3624. return size;
  3625. },write:function (stream, buffer, offset, length, position, canOwn) {
  3626. if (!length) return 0;
  3627. var node = stream.node;
  3628. node.timestamp = Date.now();
  3629. if (buffer.subarray && (!node.contents || node.contents.subarray)) { // This write is from a typed array to a typed array?
  3630. if (canOwn) {
  3631. assert(position === 0, 'canOwn must imply no weird position inside the file');
  3632. node.contents = buffer.subarray(offset, offset + length);
  3633. node.usedBytes = length;
  3634. return length;
  3635. } else if (node.usedBytes === 0 && position === 0) { // If this is a simple first write to an empty file, do a fast set since we don't need to care about old data.
  3636. node.contents = new Uint8Array(buffer.subarray(offset, offset + length));
  3637. node.usedBytes = length;
  3638. return length;
  3639. } else if (position + length <= node.usedBytes) { // Writing to an already allocated and used subrange of the file?
  3640. node.contents.set(buffer.subarray(offset, offset + length), position);
  3641. return length;
  3642. }
  3643. }
  3644. // Appending to an existing file and we need to reallocate, or source data did not come as a typed array.
  3645. MEMFS.expandFileStorage(node, position+length);
  3646. if (node.contents.subarray && buffer.subarray) node.contents.set(buffer.subarray(offset, offset + length), position); // Use typed array write if available.
  3647. else {
  3648. for (var i = 0; i < length; i++) {
  3649. node.contents[position + i] = buffer[offset + i]; // Or fall back to manual write if not.
  3650. }
  3651. }
  3652. node.usedBytes = Math.max(node.usedBytes, position+length);
  3653. return length;
  3654. },llseek:function (stream, offset, whence) {
  3655. var position = offset;
  3656. if (whence === 1) { // SEEK_CUR.
  3657. position += stream.position;
  3658. } else if (whence === 2) { // SEEK_END.
  3659. if (FS.isFile(stream.node.mode)) {
  3660. position += stream.node.usedBytes;
  3661. }
  3662. }
  3663. if (position < 0) {
  3664. throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
  3665. }
  3666. return position;
  3667. },allocate:function (stream, offset, length) {
  3668. MEMFS.expandFileStorage(stream.node, offset + length);
  3669. stream.node.usedBytes = Math.max(stream.node.usedBytes, offset + length);
  3670. },mmap:function (stream, buffer, offset, length, position, prot, flags) {
  3671. if (!FS.isFile(stream.node.mode)) {
  3672. throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
  3673. }
  3674. var ptr;
  3675. var allocated;
  3676. var contents = stream.node.contents;
  3677. // Only make a new copy when MAP_PRIVATE is specified.
  3678. if ( !(flags & 2) &&
  3679. (contents.buffer === buffer || contents.buffer === buffer.buffer) ) {
  3680. // We can't emulate MAP_SHARED when the file is not backed by the buffer
  3681. // we're mapping to (e.g. the HEAP buffer).
  3682. allocated = false;
  3683. ptr = contents.byteOffset;
  3684. } else {
  3685. // Try to avoid unnecessary slices.
  3686. if (position > 0 || position + length < stream.node.usedBytes) {
  3687. if (contents.subarray) {
  3688. contents = contents.subarray(position, position + length);
  3689. } else {
  3690. contents = Array.prototype.slice.call(contents, position, position + length);
  3691. }
  3692. }
  3693. allocated = true;
  3694. ptr = _malloc(length);
  3695. if (!ptr) {
  3696. throw new FS.ErrnoError(ERRNO_CODES.ENOMEM);
  3697. }
  3698. buffer.set(contents, ptr);
  3699. }
  3700. return { ptr: ptr, allocated: allocated };
  3701. },msync:function (stream, buffer, offset, length, mmapFlags) {
  3702. if (!FS.isFile(stream.node.mode)) {
  3703. throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
  3704. }
  3705. if (mmapFlags & 2) {
  3706. // MAP_PRIVATE calls need not to be synced back to underlying fs
  3707. return 0;
  3708. }
  3709. var bytesWritten = MEMFS.stream_ops.write(stream, buffer, 0, length, offset, false);
  3710. // should we check if bytesWritten and length are the same?
  3711. return 0;
  3712. }}};
  3713. var IDBFS={dbs:{},indexedDB:function () {
  3714. if (typeof indexedDB !== 'undefined') return indexedDB;
  3715. var ret = null;
  3716. if (typeof window === 'object') ret = window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB;
  3717. assert(ret, 'IDBFS used, but indexedDB not supported');
  3718. return ret;
  3719. },DB_VERSION:21,DB_STORE_NAME:"FILE_DATA",mount:function (mount) {
  3720. // reuse all of the core MEMFS functionality
  3721. return MEMFS.mount.apply(null, arguments);
  3722. },syncfs:function (mount, populate, callback) {
  3723. IDBFS.getLocalSet(mount, function(err, local) {
  3724. if (err) return callback(err);
  3725. IDBFS.getRemoteSet(mount, function(err, remote) {
  3726. if (err) return callback(err);
  3727. var src = populate ? remote : local;
  3728. var dst = populate ? local : remote;
  3729. IDBFS.reconcile(src, dst, callback);
  3730. });
  3731. });
  3732. },getDB:function (name, callback) {
  3733. // check the cache first
  3734. var db = IDBFS.dbs[name];
  3735. if (db) {
  3736. return callback(null, db);
  3737. }
  3738. var req;
  3739. try {
  3740. req = IDBFS.indexedDB().open(name, IDBFS.DB_VERSION);
  3741. } catch (e) {
  3742. return callback(e);
  3743. }
  3744. if (!req) {
  3745. return callback("Unable to connect to IndexedDB");
  3746. }
  3747. req.onupgradeneeded = function(e) {
  3748. var db = e.target.result;
  3749. var transaction = e.target.transaction;
  3750. var fileStore;
  3751. if (db.objectStoreNames.contains(IDBFS.DB_STORE_NAME)) {
  3752. fileStore = transaction.objectStore(IDBFS.DB_STORE_NAME);
  3753. } else {
  3754. fileStore = db.createObjectStore(IDBFS.DB_STORE_NAME);
  3755. }
  3756. if (!fileStore.indexNames.contains('timestamp')) {
  3757. fileStore.createIndex('timestamp', 'timestamp', { unique: false });
  3758. }
  3759. };
  3760. req.onsuccess = function() {
  3761. db = req.result;
  3762. // add to the cache
  3763. IDBFS.dbs[name] = db;
  3764. callback(null, db);
  3765. };
  3766. req.onerror = function(e) {
  3767. callback(this.error);
  3768. e.preventDefault();
  3769. };
  3770. },getLocalSet:function (mount, callback) {
  3771. var entries = {};
  3772. function isRealDir(p) {
  3773. return p !== '.' && p !== '..';
  3774. };
  3775. function toAbsolute(root) {
  3776. return function(p) {
  3777. return PATH.join2(root, p);
  3778. }
  3779. };
  3780. var check = FS.readdir(mount.mountpoint).filter(isRealDir).map(toAbsolute(mount.mountpoint));
  3781. while (check.length) {
  3782. var path = check.pop();
  3783. var stat;
  3784. try {
  3785. stat = FS.stat(path);
  3786. } catch (e) {
  3787. return callback(e);
  3788. }
  3789. if (FS.isDir(stat.mode)) {
  3790. check.push.apply(check, FS.readdir(path).filter(isRealDir).map(toAbsolute(path)));
  3791. }
  3792. entries[path] = { timestamp: stat.mtime };
  3793. }
  3794. return callback(null, { type: 'local', entries: entries });
  3795. },getRemoteSet:function (mount, callback) {
  3796. var entries = {};
  3797. IDBFS.getDB(mount.mountpoint, function(err, db) {
  3798. if (err) return callback(err);
  3799. var transaction = db.transaction([IDBFS.DB_STORE_NAME], 'readonly');
  3800. transaction.onerror = function(e) {
  3801. callback(this.error);
  3802. e.preventDefault();
  3803. };
  3804. var store = transaction.objectStore(IDBFS.DB_STORE_NAME);
  3805. var index = store.index('timestamp');
  3806. index.openKeyCursor().onsuccess = function(event) {
  3807. var cursor = event.target.result;
  3808. if (!cursor) {
  3809. return callback(null, { type: 'remote', db: db, entries: entries });
  3810. }
  3811. entries[cursor.primaryKey] = { timestamp: cursor.key };
  3812. cursor.continue();
  3813. };
  3814. });
  3815. },loadLocalEntry:function (path, callback) {
  3816. var stat, node;
  3817. try {
  3818. var lookup = FS.lookupPath(path);
  3819. node = lookup.node;
  3820. stat = FS.stat(path);
  3821. } catch (e) {
  3822. return callback(e);
  3823. }
  3824. if (FS.isDir(stat.mode)) {
  3825. return callback(null, { timestamp: stat.mtime, mode: stat.mode });
  3826. } else if (FS.isFile(stat.mode)) {
  3827. // Performance consideration: storing a normal JavaScript array to a IndexedDB is much slower than storing a typed array.
  3828. // Therefore always convert the file contents to a typed array first before writing the data to IndexedDB.
  3829. node.contents = MEMFS.getFileDataAsTypedArray(node);
  3830. return callback(null, { timestamp: stat.mtime, mode: stat.mode, contents: node.contents });
  3831. } else {
  3832. return callback(new Error('node type not supported'));
  3833. }
  3834. },storeLocalEntry:function (path, entry, callback) {
  3835. try {
  3836. if (FS.isDir(entry.mode)) {
  3837. FS.mkdir(path, entry.mode);
  3838. } else if (FS.isFile(entry.mode)) {
  3839. FS.writeFile(path, entry.contents, { encoding: 'binary', canOwn: true });
  3840. } else {
  3841. return callback(new Error('node type not supported'));
  3842. }
  3843. FS.chmod(path, entry.mode);
  3844. FS.utime(path, entry.timestamp, entry.timestamp);
  3845. } catch (e) {
  3846. return callback(e);
  3847. }
  3848. callback(null);
  3849. },removeLocalEntry:function (path, callback) {
  3850. try {
  3851. var lookup = FS.lookupPath(path);
  3852. var stat = FS.stat(path);
  3853. if (FS.isDir(stat.mode)) {
  3854. FS.rmdir(path);
  3855. } else if (FS.isFile(stat.mode)) {
  3856. FS.unlink(path);
  3857. }
  3858. } catch (e) {
  3859. return callback(e);
  3860. }
  3861. callback(null);
  3862. },loadRemoteEntry:function (store, path, callback) {
  3863. var req = store.get(path);
  3864. req.onsuccess = function(event) { callback(null, event.target.result); };
  3865. req.onerror = function(e) {
  3866. callback(this.error);
  3867. e.preventDefault();
  3868. };
  3869. },storeRemoteEntry:function (store, path, entry, callback) {
  3870. var req = store.put(entry, path);
  3871. req.onsuccess = function() { callback(null); };
  3872. req.onerror = function(e) {
  3873. callback(this.error);
  3874. e.preventDefault();
  3875. };
  3876. },removeRemoteEntry:function (store, path, callback) {
  3877. var req = store.delete(path);
  3878. req.onsuccess = function() { callback(null); };
  3879. req.onerror = function(e) {
  3880. callback(this.error);
  3881. e.preventDefault();
  3882. };
  3883. },reconcile:function (src, dst, callback) {
  3884. var total = 0;
  3885. var create = [];
  3886. Object.keys(src.entries).forEach(function (key) {
  3887. var e = src.entries[key];
  3888. var e2 = dst.entries[key];
  3889. if (!e2 || e.timestamp > e2.timestamp) {
  3890. create.push(key);
  3891. total++;
  3892. }
  3893. });
  3894. var remove = [];
  3895. Object.keys(dst.entries).forEach(function (key) {
  3896. var e = dst.entries[key];
  3897. var e2 = src.entries[key];
  3898. if (!e2) {
  3899. remove.push(key);
  3900. total++;
  3901. }
  3902. });
  3903. if (!total) {
  3904. return callback(null);
  3905. }
  3906. var errored = false;
  3907. var completed = 0;
  3908. var db = src.type === 'remote' ? src.db : dst.db;
  3909. var transaction = db.transaction([IDBFS.DB_STORE_NAME], 'readwrite');
  3910. var store = transaction.objectStore(IDBFS.DB_STORE_NAME);
  3911. function done(err) {
  3912. if (err) {
  3913. if (!done.errored) {
  3914. done.errored = true;
  3915. return callback(err);
  3916. }
  3917. return;
  3918. }
  3919. if (++completed >= total) {
  3920. return callback(null);
  3921. }
  3922. };
  3923. transaction.onerror = function(e) {
  3924. done(this.error);
  3925. e.preventDefault();
  3926. };
  3927. // sort paths in ascending order so directory entries are created
  3928. // before the files inside them
  3929. create.sort().forEach(function (path) {
  3930. if (dst.type === 'local') {
  3931. IDBFS.loadRemoteEntry(store, path, function (err, entry) {
  3932. if (err) return done(err);
  3933. IDBFS.storeLocalEntry(path, entry, done);
  3934. });
  3935. } else {
  3936. IDBFS.loadLocalEntry(path, function (err, entry) {
  3937. if (err) return done(err);
  3938. IDBFS.storeRemoteEntry(store, path, entry, done);
  3939. });
  3940. }
  3941. });
  3942. // sort paths in descending order so files are deleted before their
  3943. // parent directories
  3944. remove.sort().reverse().forEach(function(path) {
  3945. if (dst.type === 'local') {
  3946. IDBFS.removeLocalEntry(path, done);
  3947. } else {
  3948. IDBFS.removeRemoteEntry(store, path, done);
  3949. }
  3950. });
  3951. }};
  3952. var NODEFS={isWindows:false,staticInit:function () {
  3953. NODEFS.isWindows = !!process.platform.match(/^win/);
  3954. },mount:function (mount) {
  3955. assert(ENVIRONMENT_IS_NODE);
  3956. return NODEFS.createNode(null, '/', NODEFS.getMode(mount.opts.root), 0);
  3957. },createNode:function (parent, name, mode, dev) {
  3958. if (!FS.isDir(mode) && !FS.isFile(mode) && !FS.isLink(mode)) {
  3959. throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
  3960. }
  3961. var node = FS.createNode(parent, name, mode);
  3962. node.node_ops = NODEFS.node_ops;
  3963. node.stream_ops = NODEFS.stream_ops;
  3964. return node;
  3965. },getMode:function (path) {
  3966. var stat;
  3967. try {
  3968. stat = fs.lstatSync(path);
  3969. if (NODEFS.isWindows) {
  3970. // On Windows, directories return permission bits 'rw-rw-rw-', even though they have 'rwxrwxrwx', so
  3971. // propagate write bits to execute bits.
  3972. stat.mode = stat.mode | ((stat.mode & 146) >> 1);
  3973. }
  3974. } catch (e) {
  3975. if (!e.code) throw e;
  3976. throw new FS.ErrnoError(ERRNO_CODES[e.code]);
  3977. }
  3978. return stat.mode;
  3979. },realPath:function (node) {
  3980. var parts = [];
  3981. while (node.parent !== node) {
  3982. parts.push(node.name);
  3983. node = node.parent;
  3984. }
  3985. parts.push(node.mount.opts.root);
  3986. parts.reverse();
  3987. return PATH.join.apply(null, parts);
  3988. },flagsToPermissionStringMap:{0:"r",1:"r+",2:"r+",64:"r",65:"r+",66:"r+",129:"rx+",193:"rx+",514:"w+",577:"w",578:"w+",705:"wx",706:"wx+",1024:"a",1025:"a",1026:"a+",1089:"a",1090:"a+",1153:"ax",1154:"ax+",1217:"ax",1218:"ax+",4096:"rs",4098:"rs+"},flagsToPermissionString:function (flags) {
  3989. flags &= ~0x200000 /*O_PATH*/; // Ignore this flag from musl, otherwise node.js fails to open the file.
  3990. flags &= ~0x800 /*O_NONBLOCK*/; // Ignore this flag from musl, otherwise node.js fails to open the file.
  3991. flags &= ~0x8000 /*O_LARGEFILE*/; // Ignore this flag from musl, otherwise node.js fails to open the file.
  3992. flags &= ~0x80000 /*O_CLOEXEC*/; // Some applications may pass it; it makes no sense for a single process.
  3993. if (flags in NODEFS.flagsToPermissionStringMap) {
  3994. return NODEFS.flagsToPermissionStringMap[flags];
  3995. } else {
  3996. throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
  3997. }
  3998. },node_ops:{getattr:function (node) {
  3999. var path = NODEFS.realPath(node);
  4000. var stat;
  4001. try {
  4002. stat = fs.lstatSync(path);
  4003. } catch (e) {
  4004. if (!e.code) throw e;
  4005. throw new FS.ErrnoError(ERRNO_CODES[e.code]);
  4006. }
  4007. // node.js v0.10.20 doesn't report blksize and blocks on Windows. Fake them with default blksize of 4096.
  4008. // See http://support.microsoft.com/kb/140365
  4009. if (NODEFS.isWindows && !stat.blksize) {
  4010. stat.blksize = 4096;
  4011. }
  4012. if (NODEFS.isWindows && !stat.blocks) {
  4013. stat.blocks = (stat.size+stat.blksize-1)/stat.blksize|0;
  4014. }
  4015. return {
  4016. dev: stat.dev,
  4017. ino: stat.ino,
  4018. mode: stat.mode,
  4019. nlink: stat.nlink,
  4020. uid: stat.uid,
  4021. gid: stat.gid,
  4022. rdev: stat.rdev,
  4023. size: stat.size,
  4024. atime: stat.atime,
  4025. mtime: stat.mtime,
  4026. ctime: stat.ctime,
  4027. blksize: stat.blksize,
  4028. blocks: stat.blocks
  4029. };
  4030. },setattr:function (node, attr) {
  4031. var path = NODEFS.realPath(node);
  4032. try {
  4033. if (attr.mode !== undefined) {
  4034. fs.chmodSync(path, attr.mode);
  4035. // update the common node structure mode as well
  4036. node.mode = attr.mode;
  4037. }
  4038. if (attr.timestamp !== undefined) {
  4039. var date = new Date(attr.timestamp);
  4040. fs.utimesSync(path, date, date);
  4041. }
  4042. if (attr.size !== undefined) {
  4043. fs.truncateSync(path, attr.size);
  4044. }
  4045. } catch (e) {
  4046. if (!e.code) throw e;
  4047. throw new FS.ErrnoError(ERRNO_CODES[e.code]);
  4048. }
  4049. },lookup:function (parent, name) {
  4050. var path = PATH.join2(NODEFS.realPath(parent), name);
  4051. var mode = NODEFS.getMode(path);
  4052. return NODEFS.createNode(parent, name, mode);
  4053. },mknod:function (parent, name, mode, dev) {
  4054. var node = NODEFS.createNode(parent, name, mode, dev);
  4055. // create the backing node for this in the fs root as well
  4056. var path = NODEFS.realPath(node);
  4057. try {
  4058. if (FS.isDir(node.mode)) {
  4059. fs.mkdirSync(path, node.mode);
  4060. } else {
  4061. fs.writeFileSync(path, '', { mode: node.mode });
  4062. }
  4063. } catch (e) {
  4064. if (!e.code) throw e;
  4065. throw new FS.ErrnoError(ERRNO_CODES[e.code]);
  4066. }
  4067. return node;
  4068. },rename:function (oldNode, newDir, newName) {
  4069. var oldPath = NODEFS.realPath(oldNode);
  4070. var newPath = PATH.join2(NODEFS.realPath(newDir), newName);
  4071. try {
  4072. fs.renameSync(oldPath, newPath);
  4073. } catch (e) {
  4074. if (!e.code) throw e;
  4075. throw new FS.ErrnoError(ERRNO_CODES[e.code]);
  4076. }
  4077. },unlink:function (parent, name) {
  4078. var path = PATH.join2(NODEFS.realPath(parent), name);
  4079. try {
  4080. fs.unlinkSync(path);
  4081. } catch (e) {
  4082. if (!e.code) throw e;
  4083. throw new FS.ErrnoError(ERRNO_CODES[e.code]);
  4084. }
  4085. },rmdir:function (parent, name) {
  4086. var path = PATH.join2(NODEFS.realPath(parent), name);
  4087. try {
  4088. fs.rmdirSync(path);
  4089. } catch (e) {
  4090. if (!e.code) throw e;
  4091. throw new FS.ErrnoError(ERRNO_CODES[e.code]);
  4092. }
  4093. },readdir:function (node) {
  4094. var path = NODEFS.realPath(node);
  4095. try {
  4096. return fs.readdirSync(path);
  4097. } catch (e) {
  4098. if (!e.code) throw e;
  4099. throw new FS.ErrnoError(ERRNO_CODES[e.code]);
  4100. }
  4101. },symlink:function (parent, newName, oldPath) {
  4102. var newPath = PATH.join2(NODEFS.realPath(parent), newName);
  4103. try {
  4104. fs.symlinkSync(oldPath, newPath);
  4105. } catch (e) {
  4106. if (!e.code) throw e;
  4107. throw new FS.ErrnoError(ERRNO_CODES[e.code]);
  4108. }
  4109. },readlink:function (node) {
  4110. var path = NODEFS.realPath(node);
  4111. try {
  4112. path = fs.readlinkSync(path);
  4113. path = NODEJS_PATH.relative(NODEJS_PATH.resolve(node.mount.opts.root), path);
  4114. return path;
  4115. } catch (e) {
  4116. if (!e.code) throw e;
  4117. throw new FS.ErrnoError(ERRNO_CODES[e.code]);
  4118. }
  4119. }},stream_ops:{open:function (stream) {
  4120. var path = NODEFS.realPath(stream.node);
  4121. try {
  4122. if (FS.isFile(stream.node.mode)) {
  4123. stream.nfd = fs.openSync(path, NODEFS.flagsToPermissionString(stream.flags));
  4124. }
  4125. } catch (e) {
  4126. if (!e.code) throw e;
  4127. throw new FS.ErrnoError(ERRNO_CODES[e.code]);
  4128. }
  4129. },close:function (stream) {
  4130. try {
  4131. if (FS.isFile(stream.node.mode) && stream.nfd) {
  4132. fs.closeSync(stream.nfd);
  4133. }
  4134. } catch (e) {
  4135. if (!e.code) throw e;
  4136. throw new FS.ErrnoError(ERRNO_CODES[e.code]);
  4137. }
  4138. },read:function (stream, buffer, offset, length, position) {
  4139. if (length === 0) return 0; // node errors on 0 length reads
  4140. // FIXME this is terrible.
  4141. var nbuffer = new Buffer(length);
  4142. var res;
  4143. try {
  4144. res = fs.readSync(stream.nfd, nbuffer, 0, length, position);
  4145. } catch (e) {
  4146. throw new FS.ErrnoError(ERRNO_CODES[e.code]);
  4147. }
  4148. if (res > 0) {
  4149. for (var i = 0; i < res; i++) {
  4150. buffer[offset + i] = nbuffer[i];
  4151. }
  4152. }
  4153. return res;
  4154. },write:function (stream, buffer, offset, length, position) {
  4155. // FIXME this is terrible.
  4156. var nbuffer = new Buffer(buffer.subarray(offset, offset + length));
  4157. var res;
  4158. try {
  4159. res = fs.writeSync(stream.nfd, nbuffer, 0, length, position);
  4160. } catch (e) {
  4161. throw new FS.ErrnoError(ERRNO_CODES[e.code]);
  4162. }
  4163. return res;
  4164. },llseek:function (stream, offset, whence) {
  4165. var position = offset;
  4166. if (whence === 1) { // SEEK_CUR.
  4167. position += stream.position;
  4168. } else if (whence === 2) { // SEEK_END.
  4169. if (FS.isFile(stream.node.mode)) {
  4170. try {
  4171. var stat = fs.fstatSync(stream.nfd);
  4172. position += stat.size;
  4173. } catch (e) {
  4174. throw new FS.ErrnoError(ERRNO_CODES[e.code]);
  4175. }
  4176. }
  4177. }
  4178. if (position < 0) {
  4179. throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
  4180. }
  4181. return position;
  4182. }}};
  4183. var WORKERFS={DIR_MODE:16895,FILE_MODE:33279,reader:null,mount:function (mount) {
  4184. assert(ENVIRONMENT_IS_WORKER);
  4185. if (!WORKERFS.reader) WORKERFS.reader = new FileReaderSync();
  4186. var root = WORKERFS.createNode(null, '/', WORKERFS.DIR_MODE, 0);
  4187. var createdParents = {};
  4188. function ensureParent(path) {
  4189. // return the parent node, creating subdirs as necessary
  4190. var parts = path.split('/');
  4191. var parent = root;
  4192. for (var i = 0; i < parts.length-1; i++) {
  4193. var curr = parts.slice(0, i+1).join('/');
  4194. // Issue 4254: Using curr as a node name will prevent the node
  4195. // from being found in FS.nameTable when FS.open is called on
  4196. // a path which holds a child of this node,
  4197. // given that all FS functions assume node names
  4198. // are just their corresponding parts within their given path,
  4199. // rather than incremental aggregates which include their parent's
  4200. // directories.
  4201. if (!createdParents[curr]) {
  4202. createdParents[curr] = WORKERFS.createNode(parent, parts[i], WORKERFS.DIR_MODE, 0);
  4203. }
  4204. parent = createdParents[curr];
  4205. }
  4206. return parent;
  4207. }
  4208. function base(path) {
  4209. var parts = path.split('/');
  4210. return parts[parts.length-1];
  4211. }
  4212. // We also accept FileList here, by using Array.prototype
  4213. Array.prototype.forEach.call(mount.opts["files"] || [], function(file) {
  4214. WORKERFS.createNode(ensureParent(file.name), base(file.name), WORKERFS.FILE_MODE, 0, file, file.lastModifiedDate);
  4215. });
  4216. (mount.opts["blobs"] || []).forEach(function(obj) {
  4217. WORKERFS.createNode(ensureParent(obj["name"]), base(obj["name"]), WORKERFS.FILE_MODE, 0, obj["data"]);
  4218. });
  4219. (mount.opts["packages"] || []).forEach(function(pack) {
  4220. pack['metadata'].files.forEach(function(file) {
  4221. var name = file.filename.substr(1); // remove initial slash
  4222. WORKERFS.createNode(ensureParent(name), base(name), WORKERFS.FILE_MODE, 0, pack['blob'].slice(file.start, file.end));
  4223. });
  4224. });
  4225. return root;
  4226. },createNode:function (parent, name, mode, dev, contents, mtime) {
  4227. var node = FS.createNode(parent, name, mode);
  4228. node.mode = mode;
  4229. node.node_ops = WORKERFS.node_ops;
  4230. node.stream_ops = WORKERFS.stream_ops;
  4231. node.timestamp = (mtime || new Date).getTime();
  4232. assert(WORKERFS.FILE_MODE !== WORKERFS.DIR_MODE);
  4233. if (mode === WORKERFS.FILE_MODE) {
  4234. node.size = contents.size;
  4235. node.contents = contents;
  4236. } else {
  4237. node.size = 4096;
  4238. node.contents = {};
  4239. }
  4240. if (parent) {
  4241. parent.contents[name] = node;
  4242. }
  4243. return node;
  4244. },node_ops:{getattr:function (node) {
  4245. return {
  4246. dev: 1,
  4247. ino: undefined,
  4248. mode: node.mode,
  4249. nlink: 1,
  4250. uid: 0,
  4251. gid: 0,
  4252. rdev: undefined,
  4253. size: node.size,
  4254. atime: new Date(node.timestamp),
  4255. mtime: new Date(node.timestamp),
  4256. ctime: new Date(node.timestamp),
  4257. blksize: 4096,
  4258. blocks: Math.ceil(node.size / 4096),
  4259. };
  4260. },setattr:function (node, attr) {
  4261. if (attr.mode !== undefined) {
  4262. node.mode = attr.mode;
  4263. }
  4264. if (attr.timestamp !== undefined) {
  4265. node.timestamp = attr.timestamp;
  4266. }
  4267. },lookup:function (parent, name) {
  4268. throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
  4269. },mknod:function (parent, name, mode, dev) {
  4270. throw new FS.ErrnoError(ERRNO_CODES.EPERM);
  4271. },rename:function (oldNode, newDir, newName) {
  4272. throw new FS.ErrnoError(ERRNO_CODES.EPERM);
  4273. },unlink:function (parent, name) {
  4274. throw new FS.ErrnoError(ERRNO_CODES.EPERM);
  4275. },rmdir:function (parent, name) {
  4276. throw new FS.ErrnoError(ERRNO_CODES.EPERM);
  4277. },readdir:function (node) {
  4278. var entries = ['.', '..'];
  4279. for (var key in node.contents) {
  4280. if (!node.contents.hasOwnProperty(key)) {
  4281. continue;
  4282. }
  4283. entries.push(key);
  4284. }
  4285. return entries;
  4286. },symlink:function (parent, newName, oldPath) {
  4287. throw new FS.ErrnoError(ERRNO_CODES.EPERM);
  4288. },readlink:function (node) {
  4289. throw new FS.ErrnoError(ERRNO_CODES.EPERM);
  4290. }},stream_ops:{read:function (stream, buffer, offset, length, position) {
  4291. if (position >= stream.node.size) return 0;
  4292. var chunk = stream.node.contents.slice(position, position + length);
  4293. var ab = WORKERFS.reader.readAsArrayBuffer(chunk);
  4294. buffer.set(new Uint8Array(ab), offset);
  4295. return chunk.size;
  4296. },write:function (stream, buffer, offset, length, position) {
  4297. throw new FS.ErrnoError(ERRNO_CODES.EIO);
  4298. },llseek:function (stream, offset, whence) {
  4299. var position = offset;
  4300. if (whence === 1) { // SEEK_CUR.
  4301. position += stream.position;
  4302. } else if (whence === 2) { // SEEK_END.
  4303. if (FS.isFile(stream.node.mode)) {
  4304. position += stream.node.size;
  4305. }
  4306. }
  4307. if (position < 0) {
  4308. throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
  4309. }
  4310. return position;
  4311. }}};
  4312. var _stdin=STATICTOP; STATICTOP += 16;;
  4313. var _stdout=STATICTOP; STATICTOP += 16;;
  4314. var _stderr=STATICTOP; STATICTOP += 16;;var FS={root:null,mounts:[],devices:[null],streams:[],nextInode:1,nameTable:null,currentPath:"/",initialized:false,ignorePermissions:true,trackingDelegate:{},tracking:{openFlags:{READ:1,WRITE:2}},ErrnoError:null,genericErrors:{},filesystems:null,syncFSRequests:0,handleFSError:function (e) {
  4315. if (!(e instanceof FS.ErrnoError)) throw e + ' : ' + stackTrace();
  4316. return ___setErrNo(e.errno);
  4317. },lookupPath:function (path, opts) {
  4318. path = PATH.resolve(FS.cwd(), path);
  4319. opts = opts || {};
  4320. if (!path) return { path: '', node: null };
  4321. var defaults = {
  4322. follow_mount: true,
  4323. recurse_count: 0
  4324. };
  4325. for (var key in defaults) {
  4326. if (opts[key] === undefined) {
  4327. opts[key] = defaults[key];
  4328. }
  4329. }
  4330. if (opts.recurse_count > 8) { // max recursive lookup of 8
  4331. throw new FS.ErrnoError(ERRNO_CODES.ELOOP);
  4332. }
  4333. // split the path
  4334. var parts = PATH.normalizeArray(path.split('/').filter(function(p) {
  4335. return !!p;
  4336. }), false);
  4337. // start at the root
  4338. var current = FS.root;
  4339. var current_path = '/';
  4340. for (var i = 0; i < parts.length; i++) {
  4341. var islast = (i === parts.length-1);
  4342. if (islast && opts.parent) {
  4343. // stop resolving
  4344. break;
  4345. }
  4346. current = FS.lookupNode(current, parts[i]);
  4347. current_path = PATH.join2(current_path, parts[i]);
  4348. // jump to the mount's root node if this is a mountpoint
  4349. if (FS.isMountpoint(current)) {
  4350. if (!islast || (islast && opts.follow_mount)) {
  4351. current = current.mounted.root;
  4352. }
  4353. }
  4354. // by default, lookupPath will not follow a symlink if it is the final path component.
  4355. // setting opts.follow = true will override this behavior.
  4356. if (!islast || opts.follow) {
  4357. var count = 0;
  4358. while (FS.isLink(current.mode)) {
  4359. var link = FS.readlink(current_path);
  4360. current_path = PATH.resolve(PATH.dirname(current_path), link);
  4361. var lookup = FS.lookupPath(current_path, { recurse_count: opts.recurse_count });
  4362. current = lookup.node;
  4363. if (count++ > 40) { // limit max consecutive symlinks to 40 (SYMLOOP_MAX).
  4364. throw new FS.ErrnoError(ERRNO_CODES.ELOOP);
  4365. }
  4366. }
  4367. }
  4368. }
  4369. return { path: current_path, node: current };
  4370. },getPath:function (node) {
  4371. var path;
  4372. while (true) {
  4373. if (FS.isRoot(node)) {
  4374. var mount = node.mount.mountpoint;
  4375. if (!path) return mount;
  4376. return mount[mount.length-1] !== '/' ? mount + '/' + path : mount + path;
  4377. }
  4378. path = path ? node.name + '/' + path : node.name;
  4379. node = node.parent;
  4380. }
  4381. },hashName:function (parentid, name) {
  4382. var hash = 0;
  4383. for (var i = 0; i < name.length; i++) {
  4384. hash = ((hash << 5) - hash + name.charCodeAt(i)) | 0;
  4385. }
  4386. return ((parentid + hash) >>> 0) % FS.nameTable.length;
  4387. },hashAddNode:function (node) {
  4388. var hash = FS.hashName(node.parent.id, node.name);
  4389. node.name_next = FS.nameTable[hash];
  4390. FS.nameTable[hash] = node;
  4391. },hashRemoveNode:function (node) {
  4392. var hash = FS.hashName(node.parent.id, node.name);
  4393. if (FS.nameTable[hash] === node) {
  4394. FS.nameTable[hash] = node.name_next;
  4395. } else {
  4396. var current = FS.nameTable[hash];
  4397. while (current) {
  4398. if (current.name_next === node) {
  4399. current.name_next = node.name_next;
  4400. break;
  4401. }
  4402. current = current.name_next;
  4403. }
  4404. }
  4405. },lookupNode:function (parent, name) {
  4406. var err = FS.mayLookup(parent);
  4407. if (err) {
  4408. throw new FS.ErrnoError(err, parent);
  4409. }
  4410. var hash = FS.hashName(parent.id, name);
  4411. for (var node = FS.nameTable[hash]; node; node = node.name_next) {
  4412. var nodeName = node.name;
  4413. if (node.parent.id === parent.id && nodeName === name) {
  4414. return node;
  4415. }
  4416. }
  4417. // if we failed to find it in the cache, call into the VFS
  4418. return FS.lookup(parent, name);
  4419. },createNode:function (parent, name, mode, rdev) {
  4420. if (!FS.FSNode) {
  4421. FS.FSNode = function(parent, name, mode, rdev) {
  4422. if (!parent) {
  4423. parent = this; // root node sets parent to itself
  4424. }
  4425. this.parent = parent;
  4426. this.mount = parent.mount;
  4427. this.mounted = null;
  4428. this.id = FS.nextInode++;
  4429. this.name = name;
  4430. this.mode = mode;
  4431. this.node_ops = {};
  4432. this.stream_ops = {};
  4433. this.rdev = rdev;
  4434. };
  4435. FS.FSNode.prototype = {};
  4436. // compatibility
  4437. var readMode = 292 | 73;
  4438. var writeMode = 146;
  4439. // NOTE we must use Object.defineProperties instead of individual calls to
  4440. // Object.defineProperty in order to make closure compiler happy
  4441. Object.defineProperties(FS.FSNode.prototype, {
  4442. read: {
  4443. get: function() { return (this.mode & readMode) === readMode; },
  4444. set: function(val) { val ? this.mode |= readMode : this.mode &= ~readMode; }
  4445. },
  4446. write: {
  4447. get: function() { return (this.mode & writeMode) === writeMode; },
  4448. set: function(val) { val ? this.mode |= writeMode : this.mode &= ~writeMode; }
  4449. },
  4450. isFolder: {
  4451. get: function() { return FS.isDir(this.mode); }
  4452. },
  4453. isDevice: {
  4454. get: function() { return FS.isChrdev(this.mode); }
  4455. }
  4456. });
  4457. }
  4458. var node = new FS.FSNode(parent, name, mode, rdev);
  4459. FS.hashAddNode(node);
  4460. return node;
  4461. },destroyNode:function (node) {
  4462. FS.hashRemoveNode(node);
  4463. },isRoot:function (node) {
  4464. return node === node.parent;
  4465. },isMountpoint:function (node) {
  4466. return !!node.mounted;
  4467. },isFile:function (mode) {
  4468. return (mode & 61440) === 32768;
  4469. },isDir:function (mode) {
  4470. return (mode & 61440) === 16384;
  4471. },isLink:function (mode) {
  4472. return (mode & 61440) === 40960;
  4473. },isChrdev:function (mode) {
  4474. return (mode & 61440) === 8192;
  4475. },isBlkdev:function (mode) {
  4476. return (mode & 61440) === 24576;
  4477. },isFIFO:function (mode) {
  4478. return (mode & 61440) === 4096;
  4479. },isSocket:function (mode) {
  4480. return (mode & 49152) === 49152;
  4481. },flagModes:{"r":0,"rs":1052672,"r+":2,"w":577,"wx":705,"xw":705,"w+":578,"wx+":706,"xw+":706,"a":1089,"ax":1217,"xa":1217,"a+":1090,"ax+":1218,"xa+":1218},modeStringToFlags:function (str) {
  4482. var flags = FS.flagModes[str];
  4483. if (typeof flags === 'undefined') {
  4484. throw new Error('Unknown file open mode: ' + str);
  4485. }
  4486. return flags;
  4487. },flagsToPermissionString:function (flag) {
  4488. var perms = ['r', 'w', 'rw'][flag & 3];
  4489. if ((flag & 512)) {
  4490. perms += 'w';
  4491. }
  4492. return perms;
  4493. },nodePermissions:function (node, perms) {
  4494. if (FS.ignorePermissions) {
  4495. return 0;
  4496. }
  4497. // return 0 if any user, group or owner bits are set.
  4498. if (perms.indexOf('r') !== -1 && !(node.mode & 292)) {
  4499. return ERRNO_CODES.EACCES;
  4500. } else if (perms.indexOf('w') !== -1 && !(node.mode & 146)) {
  4501. return ERRNO_CODES.EACCES;
  4502. } else if (perms.indexOf('x') !== -1 && !(node.mode & 73)) {
  4503. return ERRNO_CODES.EACCES;
  4504. }
  4505. return 0;
  4506. },mayLookup:function (dir) {
  4507. var err = FS.nodePermissions(dir, 'x');
  4508. if (err) return err;
  4509. if (!dir.node_ops.lookup) return ERRNO_CODES.EACCES;
  4510. return 0;
  4511. },mayCreate:function (dir, name) {
  4512. try {
  4513. var node = FS.lookupNode(dir, name);
  4514. return ERRNO_CODES.EEXIST;
  4515. } catch (e) {
  4516. }
  4517. return FS.nodePermissions(dir, 'wx');
  4518. },mayDelete:function (dir, name, isdir) {
  4519. var node;
  4520. try {
  4521. node = FS.lookupNode(dir, name);
  4522. } catch (e) {
  4523. return e.errno;
  4524. }
  4525. var err = FS.nodePermissions(dir, 'wx');
  4526. if (err) {
  4527. return err;
  4528. }
  4529. if (isdir) {
  4530. if (!FS.isDir(node.mode)) {
  4531. return ERRNO_CODES.ENOTDIR;
  4532. }
  4533. if (FS.isRoot(node) || FS.getPath(node) === FS.cwd()) {
  4534. return ERRNO_CODES.EBUSY;
  4535. }
  4536. } else {
  4537. if (FS.isDir(node.mode)) {
  4538. return ERRNO_CODES.EISDIR;
  4539. }
  4540. }
  4541. return 0;
  4542. },mayOpen:function (node, flags) {
  4543. if (!node) {
  4544. return ERRNO_CODES.ENOENT;
  4545. }
  4546. if (FS.isLink(node.mode)) {
  4547. return ERRNO_CODES.ELOOP;
  4548. } else if (FS.isDir(node.mode)) {
  4549. if (FS.flagsToPermissionString(flags) !== 'r' || // opening for write
  4550. (flags & 512)) { // TODO: check for O_SEARCH? (== search for dir only)
  4551. return ERRNO_CODES.EISDIR;
  4552. }
  4553. }
  4554. return FS.nodePermissions(node, FS.flagsToPermissionString(flags));
  4555. },MAX_OPEN_FDS:4096,nextfd:function (fd_start, fd_end) {
  4556. fd_start = fd_start || 0;
  4557. fd_end = fd_end || FS.MAX_OPEN_FDS;
  4558. for (var fd = fd_start; fd <= fd_end; fd++) {
  4559. if (!FS.streams[fd]) {
  4560. return fd;
  4561. }
  4562. }
  4563. throw new FS.ErrnoError(ERRNO_CODES.EMFILE);
  4564. },getStream:function (fd) {
  4565. return FS.streams[fd];
  4566. },createStream:function (stream, fd_start, fd_end) {
  4567. if (!FS.FSStream) {
  4568. FS.FSStream = function(){};
  4569. FS.FSStream.prototype = {};
  4570. // compatibility
  4571. Object.defineProperties(FS.FSStream.prototype, {
  4572. object: {
  4573. get: function() { return this.node; },
  4574. set: function(val) { this.node = val; }
  4575. },
  4576. isRead: {
  4577. get: function() { return (this.flags & 2097155) !== 1; }
  4578. },
  4579. isWrite: {
  4580. get: function() { return (this.flags & 2097155) !== 0; }
  4581. },
  4582. isAppend: {
  4583. get: function() { return (this.flags & 1024); }
  4584. }
  4585. });
  4586. }
  4587. // clone it, so we can return an instance of FSStream
  4588. var newStream = new FS.FSStream();
  4589. for (var p in stream) {
  4590. newStream[p] = stream[p];
  4591. }
  4592. stream = newStream;
  4593. var fd = FS.nextfd(fd_start, fd_end);
  4594. stream.fd = fd;
  4595. FS.streams[fd] = stream;
  4596. return stream;
  4597. },closeStream:function (fd) {
  4598. FS.streams[fd] = null;
  4599. },chrdev_stream_ops:{open:function (stream) {
  4600. var device = FS.getDevice(stream.node.rdev);
  4601. // override node's stream ops with the device's
  4602. stream.stream_ops = device.stream_ops;
  4603. // forward the open call
  4604. if (stream.stream_ops.open) {
  4605. stream.stream_ops.open(stream);
  4606. }
  4607. },llseek:function () {
  4608. throw new FS.ErrnoError(ERRNO_CODES.ESPIPE);
  4609. }},major:function (dev) {
  4610. return ((dev) >> 8);
  4611. },minor:function (dev) {
  4612. return ((dev) & 0xff);
  4613. },makedev:function (ma, mi) {
  4614. return ((ma) << 8 | (mi));
  4615. },registerDevice:function (dev, ops) {
  4616. FS.devices[dev] = { stream_ops: ops };
  4617. },getDevice:function (dev) {
  4618. return FS.devices[dev];
  4619. },getMounts:function (mount) {
  4620. var mounts = [];
  4621. var check = [mount];
  4622. while (check.length) {
  4623. var m = check.pop();
  4624. mounts.push(m);
  4625. check.push.apply(check, m.mounts);
  4626. }
  4627. return mounts;
  4628. },syncfs:function (populate, callback) {
  4629. if (typeof(populate) === 'function') {
  4630. callback = populate;
  4631. populate = false;
  4632. }
  4633. FS.syncFSRequests++;
  4634. if (FS.syncFSRequests > 1) {
  4635. console.log('warning: ' + FS.syncFSRequests + ' FS.syncfs operations in flight at once, probably just doing extra work');
  4636. }
  4637. var mounts = FS.getMounts(FS.root.mount);
  4638. var completed = 0;
  4639. function doCallback(err) {
  4640. assert(FS.syncFSRequests > 0);
  4641. FS.syncFSRequests--;
  4642. return callback(err);
  4643. }
  4644. function done(err) {
  4645. if (err) {
  4646. if (!done.errored) {
  4647. done.errored = true;
  4648. return doCallback(err);
  4649. }
  4650. return;
  4651. }
  4652. if (++completed >= mounts.length) {
  4653. doCallback(null);
  4654. }
  4655. };
  4656. // sync all mounts
  4657. mounts.forEach(function (mount) {
  4658. if (!mount.type.syncfs) {
  4659. return done(null);
  4660. }
  4661. mount.type.syncfs(mount, populate, done);
  4662. });
  4663. },mount:function (type, opts, mountpoint) {
  4664. var root = mountpoint === '/';
  4665. var pseudo = !mountpoint;
  4666. var node;
  4667. if (root && FS.root) {
  4668. throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
  4669. } else if (!root && !pseudo) {
  4670. var lookup = FS.lookupPath(mountpoint, { follow_mount: false });
  4671. mountpoint = lookup.path; // use the absolute path
  4672. node = lookup.node;
  4673. if (FS.isMountpoint(node)) {
  4674. throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
  4675. }
  4676. if (!FS.isDir(node.mode)) {
  4677. throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR);
  4678. }
  4679. }
  4680. var mount = {
  4681. type: type,
  4682. opts: opts,
  4683. mountpoint: mountpoint,
  4684. mounts: []
  4685. };
  4686. // create a root node for the fs
  4687. var mountRoot = type.mount(mount);
  4688. mountRoot.mount = mount;
  4689. mount.root = mountRoot;
  4690. if (root) {
  4691. FS.root = mountRoot;
  4692. } else if (node) {
  4693. // set as a mountpoint
  4694. node.mounted = mount;
  4695. // add the new mount to the current mount's children
  4696. if (node.mount) {
  4697. node.mount.mounts.push(mount);
  4698. }
  4699. }
  4700. return mountRoot;
  4701. },unmount:function (mountpoint) {
  4702. var lookup = FS.lookupPath(mountpoint, { follow_mount: false });
  4703. if (!FS.isMountpoint(lookup.node)) {
  4704. throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
  4705. }
  4706. // destroy the nodes for this mount, and all its child mounts
  4707. var node = lookup.node;
  4708. var mount = node.mounted;
  4709. var mounts = FS.getMounts(mount);
  4710. Object.keys(FS.nameTable).forEach(function (hash) {
  4711. var current = FS.nameTable[hash];
  4712. while (current) {
  4713. var next = current.name_next;
  4714. if (mounts.indexOf(current.mount) !== -1) {
  4715. FS.destroyNode(current);
  4716. }
  4717. current = next;
  4718. }
  4719. });
  4720. // no longer a mountpoint
  4721. node.mounted = null;
  4722. // remove this mount from the child mounts
  4723. var idx = node.mount.mounts.indexOf(mount);
  4724. assert(idx !== -1);
  4725. node.mount.mounts.splice(idx, 1);
  4726. },lookup:function (parent, name) {
  4727. return parent.node_ops.lookup(parent, name);
  4728. },mknod:function (path, mode, dev) {
  4729. var lookup = FS.lookupPath(path, { parent: true });
  4730. var parent = lookup.node;
  4731. var name = PATH.basename(path);
  4732. if (!name || name === '.' || name === '..') {
  4733. throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
  4734. }
  4735. var err = FS.mayCreate(parent, name);
  4736. if (err) {
  4737. throw new FS.ErrnoError(err);
  4738. }
  4739. if (!parent.node_ops.mknod) {
  4740. throw new FS.ErrnoError(ERRNO_CODES.EPERM);
  4741. }
  4742. return parent.node_ops.mknod(parent, name, mode, dev);
  4743. },create:function (path, mode) {
  4744. mode = mode !== undefined ? mode : 438 /* 0666 */;
  4745. mode &= 4095;
  4746. mode |= 32768;
  4747. return FS.mknod(path, mode, 0);
  4748. },mkdir:function (path, mode) {
  4749. mode = mode !== undefined ? mode : 511 /* 0777 */;
  4750. mode &= 511 | 512;
  4751. mode |= 16384;
  4752. return FS.mknod(path, mode, 0);
  4753. },mkdirTree:function (path, mode) {
  4754. var dirs = path.split('/');
  4755. var d = '';
  4756. for (var i = 0; i < dirs.length; ++i) {
  4757. if (!dirs[i]) continue;
  4758. d += '/' + dirs[i];
  4759. try {
  4760. FS.mkdir(d, mode);
  4761. } catch(e) {
  4762. if (e.errno != ERRNO_CODES.EEXIST) throw e;
  4763. }
  4764. }
  4765. },mkdev:function (path, mode, dev) {
  4766. if (typeof(dev) === 'undefined') {
  4767. dev = mode;
  4768. mode = 438 /* 0666 */;
  4769. }
  4770. mode |= 8192;
  4771. return FS.mknod(path, mode, dev);
  4772. },symlink:function (oldpath, newpath) {
  4773. if (!PATH.resolve(oldpath)) {
  4774. throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
  4775. }
  4776. var lookup = FS.lookupPath(newpath, { parent: true });
  4777. var parent = lookup.node;
  4778. if (!parent) {
  4779. throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
  4780. }
  4781. var newname = PATH.basename(newpath);
  4782. var err = FS.mayCreate(parent, newname);
  4783. if (err) {
  4784. throw new FS.ErrnoError(err);
  4785. }
  4786. if (!parent.node_ops.symlink) {
  4787. throw new FS.ErrnoError(ERRNO_CODES.EPERM);
  4788. }
  4789. return parent.node_ops.symlink(parent, newname, oldpath);
  4790. },rename:function (old_path, new_path) {
  4791. var old_dirname = PATH.dirname(old_path);
  4792. var new_dirname = PATH.dirname(new_path);
  4793. var old_name = PATH.basename(old_path);
  4794. var new_name = PATH.basename(new_path);
  4795. // parents must exist
  4796. var lookup, old_dir, new_dir;
  4797. try {
  4798. lookup = FS.lookupPath(old_path, { parent: true });
  4799. old_dir = lookup.node;
  4800. lookup = FS.lookupPath(new_path, { parent: true });
  4801. new_dir = lookup.node;
  4802. } catch (e) {
  4803. throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
  4804. }
  4805. if (!old_dir || !new_dir) throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
  4806. // need to be part of the same mount
  4807. if (old_dir.mount !== new_dir.mount) {
  4808. throw new FS.ErrnoError(ERRNO_CODES.EXDEV);
  4809. }
  4810. // source must exist
  4811. var old_node = FS.lookupNode(old_dir, old_name);
  4812. // old path should not be an ancestor of the new path
  4813. var relative = PATH.relative(old_path, new_dirname);
  4814. if (relative.charAt(0) !== '.') {
  4815. throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
  4816. }
  4817. // new path should not be an ancestor of the old path
  4818. relative = PATH.relative(new_path, old_dirname);
  4819. if (relative.charAt(0) !== '.') {
  4820. throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY);
  4821. }
  4822. // see if the new path already exists
  4823. var new_node;
  4824. try {
  4825. new_node = FS.lookupNode(new_dir, new_name);
  4826. } catch (e) {
  4827. // not fatal
  4828. }
  4829. // early out if nothing needs to change
  4830. if (old_node === new_node) {
  4831. return;
  4832. }
  4833. // we'll need to delete the old entry
  4834. var isdir = FS.isDir(old_node.mode);
  4835. var err = FS.mayDelete(old_dir, old_name, isdir);
  4836. if (err) {
  4837. throw new FS.ErrnoError(err);
  4838. }
  4839. // need delete permissions if we'll be overwriting.
  4840. // need create permissions if new doesn't already exist.
  4841. err = new_node ?
  4842. FS.mayDelete(new_dir, new_name, isdir) :
  4843. FS.mayCreate(new_dir, new_name);
  4844. if (err) {
  4845. throw new FS.ErrnoError(err);
  4846. }
  4847. if (!old_dir.node_ops.rename) {
  4848. throw new FS.ErrnoError(ERRNO_CODES.EPERM);
  4849. }
  4850. if (FS.isMountpoint(old_node) || (new_node && FS.isMountpoint(new_node))) {
  4851. throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
  4852. }
  4853. // if we are going to change the parent, check write permissions
  4854. if (new_dir !== old_dir) {
  4855. err = FS.nodePermissions(old_dir, 'w');
  4856. if (err) {
  4857. throw new FS.ErrnoError(err);
  4858. }
  4859. }
  4860. try {
  4861. if (FS.trackingDelegate['willMovePath']) {
  4862. FS.trackingDelegate['willMovePath'](old_path, new_path);
  4863. }
  4864. } catch(e) {
  4865. console.log("FS.trackingDelegate['willMovePath']('"+old_path+"', '"+new_path+"') threw an exception: " + e.message);
  4866. }
  4867. // remove the node from the lookup hash
  4868. FS.hashRemoveNode(old_node);
  4869. // do the underlying fs rename
  4870. try {
  4871. old_dir.node_ops.rename(old_node, new_dir, new_name);
  4872. } catch (e) {
  4873. throw e;
  4874. } finally {
  4875. // add the node back to the hash (in case node_ops.rename
  4876. // changed its name)
  4877. FS.hashAddNode(old_node);
  4878. }
  4879. try {
  4880. if (FS.trackingDelegate['onMovePath']) FS.trackingDelegate['onMovePath'](old_path, new_path);
  4881. } catch(e) {
  4882. console.log("FS.trackingDelegate['onMovePath']('"+old_path+"', '"+new_path+"') threw an exception: " + e.message);
  4883. }
  4884. },rmdir:function (path) {
  4885. var lookup = FS.lookupPath(path, { parent: true });
  4886. var parent = lookup.node;
  4887. var name = PATH.basename(path);
  4888. var node = FS.lookupNode(parent, name);
  4889. var err = FS.mayDelete(parent, name, true);
  4890. if (err) {
  4891. throw new FS.ErrnoError(err);
  4892. }
  4893. if (!parent.node_ops.rmdir) {
  4894. throw new FS.ErrnoError(ERRNO_CODES.EPERM);
  4895. }
  4896. if (FS.isMountpoint(node)) {
  4897. throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
  4898. }
  4899. try {
  4900. if (FS.trackingDelegate['willDeletePath']) {
  4901. FS.trackingDelegate['willDeletePath'](path);
  4902. }
  4903. } catch(e) {
  4904. console.log("FS.trackingDelegate['willDeletePath']('"+path+"') threw an exception: " + e.message);
  4905. }
  4906. parent.node_ops.rmdir(parent, name);
  4907. FS.destroyNode(node);
  4908. try {
  4909. if (FS.trackingDelegate['onDeletePath']) FS.trackingDelegate['onDeletePath'](path);
  4910. } catch(e) {
  4911. console.log("FS.trackingDelegate['onDeletePath']('"+path+"') threw an exception: " + e.message);
  4912. }
  4913. },readdir:function (path) {
  4914. var lookup = FS.lookupPath(path, { follow: true });
  4915. var node = lookup.node;
  4916. if (!node.node_ops.readdir) {
  4917. throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR);
  4918. }
  4919. return node.node_ops.readdir(node);
  4920. },unlink:function (path) {
  4921. var lookup = FS.lookupPath(path, { parent: true });
  4922. var parent = lookup.node;
  4923. var name = PATH.basename(path);
  4924. var node = FS.lookupNode(parent, name);
  4925. var err = FS.mayDelete(parent, name, false);
  4926. if (err) {
  4927. // According to POSIX, we should map EISDIR to EPERM, but
  4928. // we instead do what Linux does (and we must, as we use
  4929. // the musl linux libc).
  4930. throw new FS.ErrnoError(err);
  4931. }
  4932. if (!parent.node_ops.unlink) {
  4933. throw new FS.ErrnoError(ERRNO_CODES.EPERM);
  4934. }
  4935. if (FS.isMountpoint(node)) {
  4936. throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
  4937. }
  4938. try {
  4939. if (FS.trackingDelegate['willDeletePath']) {
  4940. FS.trackingDelegate['willDeletePath'](path);
  4941. }
  4942. } catch(e) {
  4943. console.log("FS.trackingDelegate['willDeletePath']('"+path+"') threw an exception: " + e.message);
  4944. }
  4945. parent.node_ops.unlink(parent, name);
  4946. FS.destroyNode(node);
  4947. try {
  4948. if (FS.trackingDelegate['onDeletePath']) FS.trackingDelegate['onDeletePath'](path);
  4949. } catch(e) {
  4950. console.log("FS.trackingDelegate['onDeletePath']('"+path+"') threw an exception: " + e.message);
  4951. }
  4952. },readlink:function (path) {
  4953. var lookup = FS.lookupPath(path);
  4954. var link = lookup.node;
  4955. if (!link) {
  4956. throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
  4957. }
  4958. if (!link.node_ops.readlink) {
  4959. throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
  4960. }
  4961. return PATH.resolve(FS.getPath(link.parent), link.node_ops.readlink(link));
  4962. },stat:function (path, dontFollow) {
  4963. var lookup = FS.lookupPath(path, { follow: !dontFollow });
  4964. var node = lookup.node;
  4965. if (!node) {
  4966. throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
  4967. }
  4968. if (!node.node_ops.getattr) {
  4969. throw new FS.ErrnoError(ERRNO_CODES.EPERM);
  4970. }
  4971. return node.node_ops.getattr(node);
  4972. },lstat:function (path) {
  4973. return FS.stat(path, true);
  4974. },chmod:function (path, mode, dontFollow) {
  4975. var node;
  4976. if (typeof path === 'string') {
  4977. var lookup = FS.lookupPath(path, { follow: !dontFollow });
  4978. node = lookup.node;
  4979. } else {
  4980. node = path;
  4981. }
  4982. if (!node.node_ops.setattr) {
  4983. throw new FS.ErrnoError(ERRNO_CODES.EPERM);
  4984. }
  4985. node.node_ops.setattr(node, {
  4986. mode: (mode & 4095) | (node.mode & ~4095),
  4987. timestamp: Date.now()
  4988. });
  4989. },lchmod:function (path, mode) {
  4990. FS.chmod(path, mode, true);
  4991. },fchmod:function (fd, mode) {
  4992. var stream = FS.getStream(fd);
  4993. if (!stream) {
  4994. throw new FS.ErrnoError(ERRNO_CODES.EBADF);
  4995. }
  4996. FS.chmod(stream.node, mode);
  4997. },chown:function (path, uid, gid, dontFollow) {
  4998. var node;
  4999. if (typeof path === 'string') {
  5000. var lookup = FS.lookupPath(path, { follow: !dontFollow });
  5001. node = lookup.node;
  5002. } else {
  5003. node = path;
  5004. }
  5005. if (!node.node_ops.setattr) {
  5006. throw new FS.ErrnoError(ERRNO_CODES.EPERM);
  5007. }
  5008. node.node_ops.setattr(node, {
  5009. timestamp: Date.now()
  5010. // we ignore the uid / gid for now
  5011. });
  5012. },lchown:function (path, uid, gid) {
  5013. FS.chown(path, uid, gid, true);
  5014. },fchown:function (fd, uid, gid) {
  5015. var stream = FS.getStream(fd);
  5016. if (!stream) {
  5017. throw new FS.ErrnoError(ERRNO_CODES.EBADF);
  5018. }
  5019. FS.chown(stream.node, uid, gid);
  5020. },truncate:function (path, len) {
  5021. if (len < 0) {
  5022. throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
  5023. }
  5024. var node;
  5025. if (typeof path === 'string') {
  5026. var lookup = FS.lookupPath(path, { follow: true });
  5027. node = lookup.node;
  5028. } else {
  5029. node = path;
  5030. }
  5031. if (!node.node_ops.setattr) {
  5032. throw new FS.ErrnoError(ERRNO_CODES.EPERM);
  5033. }
  5034. if (FS.isDir(node.mode)) {
  5035. throw new FS.ErrnoError(ERRNO_CODES.EISDIR);
  5036. }
  5037. if (!FS.isFile(node.mode)) {
  5038. throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
  5039. }
  5040. var err = FS.nodePermissions(node, 'w');
  5041. if (err) {
  5042. throw new FS.ErrnoError(err);
  5043. }
  5044. node.node_ops.setattr(node, {
  5045. size: len,
  5046. timestamp: Date.now()
  5047. });
  5048. },ftruncate:function (fd, len) {
  5049. var stream = FS.getStream(fd);
  5050. if (!stream) {
  5051. throw new FS.ErrnoError(ERRNO_CODES.EBADF);
  5052. }
  5053. if ((stream.flags & 2097155) === 0) {
  5054. throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
  5055. }
  5056. FS.truncate(stream.node, len);
  5057. },utime:function (path, atime, mtime) {
  5058. var lookup = FS.lookupPath(path, { follow: true });
  5059. var node = lookup.node;
  5060. node.node_ops.setattr(node, {
  5061. timestamp: Math.max(atime, mtime)
  5062. });
  5063. },open:function (path, flags, mode, fd_start, fd_end) {
  5064. if (path === "") {
  5065. throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
  5066. }
  5067. flags = typeof flags === 'string' ? FS.modeStringToFlags(flags) : flags;
  5068. mode = typeof mode === 'undefined' ? 438 /* 0666 */ : mode;
  5069. if ((flags & 64)) {
  5070. mode = (mode & 4095) | 32768;
  5071. } else {
  5072. mode = 0;
  5073. }
  5074. var node;
  5075. if (typeof path === 'object') {
  5076. node = path;
  5077. } else {
  5078. path = PATH.normalize(path);
  5079. try {
  5080. var lookup = FS.lookupPath(path, {
  5081. follow: !(flags & 131072)
  5082. });
  5083. node = lookup.node;
  5084. } catch (e) {
  5085. // ignore
  5086. }
  5087. }
  5088. // perhaps we need to create the node
  5089. var created = false;
  5090. if ((flags & 64)) {
  5091. if (node) {
  5092. // if O_CREAT and O_EXCL are set, error out if the node already exists
  5093. if ((flags & 128)) {
  5094. throw new FS.ErrnoError(ERRNO_CODES.EEXIST);
  5095. }
  5096. } else {
  5097. // node doesn't exist, try to create it
  5098. node = FS.mknod(path, mode, 0);
  5099. created = true;
  5100. }
  5101. }
  5102. if (!node) {
  5103. throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
  5104. }
  5105. // can't truncate a device
  5106. if (FS.isChrdev(node.mode)) {
  5107. flags &= ~512;
  5108. }
  5109. // if asked only for a directory, then this must be one
  5110. if ((flags & 65536) && !FS.isDir(node.mode)) {
  5111. throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR);
  5112. }
  5113. // check permissions, if this is not a file we just created now (it is ok to
  5114. // create and write to a file with read-only permissions; it is read-only
  5115. // for later use)
  5116. if (!created) {
  5117. var err = FS.mayOpen(node, flags);
  5118. if (err) {
  5119. throw new FS.ErrnoError(err);
  5120. }
  5121. }
  5122. // do truncation if necessary
  5123. if ((flags & 512)) {
  5124. FS.truncate(node, 0);
  5125. }
  5126. // we've already handled these, don't pass down to the underlying vfs
  5127. flags &= ~(128 | 512);
  5128. // register the stream with the filesystem
  5129. var stream = FS.createStream({
  5130. node: node,
  5131. path: FS.getPath(node), // we want the absolute path to the node
  5132. flags: flags,
  5133. seekable: true,
  5134. position: 0,
  5135. stream_ops: node.stream_ops,
  5136. // used by the file family libc calls (fopen, fwrite, ferror, etc.)
  5137. ungotten: [],
  5138. error: false
  5139. }, fd_start, fd_end);
  5140. // call the new stream's open function
  5141. if (stream.stream_ops.open) {
  5142. stream.stream_ops.open(stream);
  5143. }
  5144. if (Module['logReadFiles'] && !(flags & 1)) {
  5145. if (!FS.readFiles) FS.readFiles = {};
  5146. if (!(path in FS.readFiles)) {
  5147. FS.readFiles[path] = 1;
  5148. Module['printErr']('read file: ' + path);
  5149. }
  5150. }
  5151. try {
  5152. if (FS.trackingDelegate['onOpenFile']) {
  5153. var trackingFlags = 0;
  5154. if ((flags & 2097155) !== 1) {
  5155. trackingFlags |= FS.tracking.openFlags.READ;
  5156. }
  5157. if ((flags & 2097155) !== 0) {
  5158. trackingFlags |= FS.tracking.openFlags.WRITE;
  5159. }
  5160. FS.trackingDelegate['onOpenFile'](path, trackingFlags);
  5161. }
  5162. } catch(e) {
  5163. console.log("FS.trackingDelegate['onOpenFile']('"+path+"', flags) threw an exception: " + e.message);
  5164. }
  5165. return stream;
  5166. },close:function (stream) {
  5167. if (stream.getdents) stream.getdents = null; // free readdir state
  5168. try {
  5169. if (stream.stream_ops.close) {
  5170. stream.stream_ops.close(stream);
  5171. }
  5172. } catch (e) {
  5173. throw e;
  5174. } finally {
  5175. FS.closeStream(stream.fd);
  5176. }
  5177. },llseek:function (stream, offset, whence) {
  5178. if (!stream.seekable || !stream.stream_ops.llseek) {
  5179. throw new FS.ErrnoError(ERRNO_CODES.ESPIPE);
  5180. }
  5181. stream.position = stream.stream_ops.llseek(stream, offset, whence);
  5182. stream.ungotten = [];
  5183. return stream.position;
  5184. },read:function (stream, buffer, offset, length, position) {
  5185. if (length < 0 || position < 0) {
  5186. throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
  5187. }
  5188. if ((stream.flags & 2097155) === 1) {
  5189. throw new FS.ErrnoError(ERRNO_CODES.EBADF);
  5190. }
  5191. if (FS.isDir(stream.node.mode)) {
  5192. throw new FS.ErrnoError(ERRNO_CODES.EISDIR);
  5193. }
  5194. if (!stream.stream_ops.read) {
  5195. throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
  5196. }
  5197. var seeking = true;
  5198. if (typeof position === 'undefined') {
  5199. position = stream.position;
  5200. seeking = false;
  5201. } else if (!stream.seekable) {
  5202. throw new FS.ErrnoError(ERRNO_CODES.ESPIPE);
  5203. }
  5204. var bytesRead = stream.stream_ops.read(stream, buffer, offset, length, position);
  5205. if (!seeking) stream.position += bytesRead;
  5206. return bytesRead;
  5207. },write:function (stream, buffer, offset, length, position, canOwn) {
  5208. if (length < 0 || position < 0) {
  5209. throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
  5210. }
  5211. if ((stream.flags & 2097155) === 0) {
  5212. throw new FS.ErrnoError(ERRNO_CODES.EBADF);
  5213. }
  5214. if (FS.isDir(stream.node.mode)) {
  5215. throw new FS.ErrnoError(ERRNO_CODES.EISDIR);
  5216. }
  5217. if (!stream.stream_ops.write) {
  5218. throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
  5219. }
  5220. if (stream.flags & 1024) {
  5221. // seek to the end before writing in append mode
  5222. FS.llseek(stream, 0, 2);
  5223. }
  5224. var seeking = true;
  5225. if (typeof position === 'undefined') {
  5226. position = stream.position;
  5227. seeking = false;
  5228. } else if (!stream.seekable) {
  5229. throw new FS.ErrnoError(ERRNO_CODES.ESPIPE);
  5230. }
  5231. var bytesWritten = stream.stream_ops.write(stream, buffer, offset, length, position, canOwn);
  5232. if (!seeking) stream.position += bytesWritten;
  5233. try {
  5234. if (stream.path && FS.trackingDelegate['onWriteToFile']) FS.trackingDelegate['onWriteToFile'](stream.path);
  5235. } catch(e) {
  5236. console.log("FS.trackingDelegate['onWriteToFile']('"+path+"') threw an exception: " + e.message);
  5237. }
  5238. return bytesWritten;
  5239. },allocate:function (stream, offset, length) {
  5240. if (offset < 0 || length <= 0) {
  5241. throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
  5242. }
  5243. if ((stream.flags & 2097155) === 0) {
  5244. throw new FS.ErrnoError(ERRNO_CODES.EBADF);
  5245. }
  5246. if (!FS.isFile(stream.node.mode) && !FS.isDir(node.mode)) {
  5247. throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
  5248. }
  5249. if (!stream.stream_ops.allocate) {
  5250. throw new FS.ErrnoError(ERRNO_CODES.EOPNOTSUPP);
  5251. }
  5252. stream.stream_ops.allocate(stream, offset, length);
  5253. },mmap:function (stream, buffer, offset, length, position, prot, flags) {
  5254. // TODO if PROT is PROT_WRITE, make sure we have write access
  5255. if ((stream.flags & 2097155) === 1) {
  5256. throw new FS.ErrnoError(ERRNO_CODES.EACCES);
  5257. }
  5258. if (!stream.stream_ops.mmap) {
  5259. throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
  5260. }
  5261. return stream.stream_ops.mmap(stream, buffer, offset, length, position, prot, flags);
  5262. },msync:function (stream, buffer, offset, length, mmapFlags) {
  5263. if (!stream || !stream.stream_ops.msync) {
  5264. return 0;
  5265. }
  5266. return stream.stream_ops.msync(stream, buffer, offset, length, mmapFlags);
  5267. },munmap:function (stream) {
  5268. return 0;
  5269. },ioctl:function (stream, cmd, arg) {
  5270. if (!stream.stream_ops.ioctl) {
  5271. throw new FS.ErrnoError(ERRNO_CODES.ENOTTY);
  5272. }
  5273. return stream.stream_ops.ioctl(stream, cmd, arg);
  5274. },readFile:function (path, opts) {
  5275. opts = opts || {};
  5276. opts.flags = opts.flags || 'r';
  5277. opts.encoding = opts.encoding || 'binary';
  5278. if (opts.encoding !== 'utf8' && opts.encoding !== 'binary') {
  5279. throw new Error('Invalid encoding type "' + opts.encoding + '"');
  5280. }
  5281. var ret;
  5282. var stream = FS.open(path, opts.flags);
  5283. var stat = FS.stat(path);
  5284. var length = stat.size;
  5285. var buf = new Uint8Array(length);
  5286. FS.read(stream, buf, 0, length, 0);
  5287. if (opts.encoding === 'utf8') {
  5288. ret = UTF8ArrayToString(buf, 0);
  5289. } else if (opts.encoding === 'binary') {
  5290. ret = buf;
  5291. }
  5292. FS.close(stream);
  5293. return ret;
  5294. },writeFile:function (path, data, opts) {
  5295. opts = opts || {};
  5296. opts.flags = opts.flags || 'w';
  5297. opts.encoding = opts.encoding || 'utf8';
  5298. if (opts.encoding !== 'utf8' && opts.encoding !== 'binary') {
  5299. throw new Error('Invalid encoding type "' + opts.encoding + '"');
  5300. }
  5301. var stream = FS.open(path, opts.flags, opts.mode);
  5302. if (opts.encoding === 'utf8') {
  5303. var buf = new Uint8Array(lengthBytesUTF8(data)+1);
  5304. var actualNumBytes = stringToUTF8Array(data, buf, 0, buf.length);
  5305. FS.write(stream, buf, 0, actualNumBytes, 0, opts.canOwn);
  5306. } else if (opts.encoding === 'binary') {
  5307. FS.write(stream, data, 0, data.length, 0, opts.canOwn);
  5308. }
  5309. FS.close(stream);
  5310. },cwd:function () {
  5311. return FS.currentPath;
  5312. },chdir:function (path) {
  5313. var lookup = FS.lookupPath(path, { follow: true });
  5314. if (lookup.node === null) {
  5315. throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
  5316. }
  5317. if (!FS.isDir(lookup.node.mode)) {
  5318. throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR);
  5319. }
  5320. var err = FS.nodePermissions(lookup.node, 'x');
  5321. if (err) {
  5322. throw new FS.ErrnoError(err);
  5323. }
  5324. FS.currentPath = lookup.path;
  5325. },createDefaultDirectories:function () {
  5326. FS.mkdir('/tmp');
  5327. FS.mkdir('/home');
  5328. FS.mkdir('/home/web_user');
  5329. },createDefaultDevices:function () {
  5330. // create /dev
  5331. FS.mkdir('/dev');
  5332. // setup /dev/null
  5333. FS.registerDevice(FS.makedev(1, 3), {
  5334. read: function() { return 0; },
  5335. write: function(stream, buffer, offset, length, pos) { return length; }
  5336. });
  5337. FS.mkdev('/dev/null', FS.makedev(1, 3));
  5338. // setup /dev/tty and /dev/tty1
  5339. // stderr needs to print output using Module['printErr']
  5340. // so we register a second tty just for it.
  5341. TTY.register(FS.makedev(5, 0), TTY.default_tty_ops);
  5342. TTY.register(FS.makedev(6, 0), TTY.default_tty1_ops);
  5343. FS.mkdev('/dev/tty', FS.makedev(5, 0));
  5344. FS.mkdev('/dev/tty1', FS.makedev(6, 0));
  5345. // setup /dev/[u]random
  5346. var random_device;
  5347. if (typeof crypto !== 'undefined') {
  5348. // for modern web browsers
  5349. var randomBuffer = new Uint8Array(1);
  5350. random_device = function() { crypto.getRandomValues(randomBuffer); return randomBuffer[0]; };
  5351. } else if (ENVIRONMENT_IS_NODE) {
  5352. // for nodejs
  5353. random_device = function() { return require('crypto').randomBytes(1)[0]; };
  5354. } else {
  5355. // default for ES5 platforms
  5356. random_device = function() { return (Math.random()*256)|0; };
  5357. }
  5358. FS.createDevice('/dev', 'random', random_device);
  5359. FS.createDevice('/dev', 'urandom', random_device);
  5360. // we're not going to emulate the actual shm device,
  5361. // just create the tmp dirs that reside in it commonly
  5362. FS.mkdir('/dev/shm');
  5363. FS.mkdir('/dev/shm/tmp');
  5364. },createSpecialDirectories:function () {
  5365. // create /proc/self/fd which allows /proc/self/fd/6 => readlink gives the name of the stream for fd 6 (see test_unistd_ttyname)
  5366. FS.mkdir('/proc');
  5367. FS.mkdir('/proc/self');
  5368. FS.mkdir('/proc/self/fd');
  5369. FS.mount({
  5370. mount: function() {
  5371. var node = FS.createNode('/proc/self', 'fd', 16384 | 511 /* 0777 */, 73);
  5372. node.node_ops = {
  5373. lookup: function(parent, name) {
  5374. var fd = +name;
  5375. var stream = FS.getStream(fd);
  5376. if (!stream) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
  5377. var ret = {
  5378. parent: null,
  5379. mount: { mountpoint: 'fake' },
  5380. node_ops: { readlink: function() { return stream.path } }
  5381. };
  5382. ret.parent = ret; // make it look like a simple root node
  5383. return ret;
  5384. }
  5385. };
  5386. return node;
  5387. }
  5388. }, {}, '/proc/self/fd');
  5389. },createStandardStreams:function () {
  5390. // TODO deprecate the old functionality of a single
  5391. // input / output callback and that utilizes FS.createDevice
  5392. // and instead require a unique set of stream ops
  5393. // by default, we symlink the standard streams to the
  5394. // default tty devices. however, if the standard streams
  5395. // have been overwritten we create a unique device for
  5396. // them instead.
  5397. if (Module['stdin']) {
  5398. FS.createDevice('/dev', 'stdin', Module['stdin']);
  5399. } else {
  5400. FS.symlink('/dev/tty', '/dev/stdin');
  5401. }
  5402. if (Module['stdout']) {
  5403. FS.createDevice('/dev', 'stdout', null, Module['stdout']);
  5404. } else {
  5405. FS.symlink('/dev/tty', '/dev/stdout');
  5406. }
  5407. if (Module['stderr']) {
  5408. FS.createDevice('/dev', 'stderr', null, Module['stderr']);
  5409. } else {
  5410. FS.symlink('/dev/tty1', '/dev/stderr');
  5411. }
  5412. // open default streams for the stdin, stdout and stderr devices
  5413. var stdin = FS.open('/dev/stdin', 'r');
  5414. assert(stdin.fd === 0, 'invalid handle for stdin (' + stdin.fd + ')');
  5415. var stdout = FS.open('/dev/stdout', 'w');
  5416. assert(stdout.fd === 1, 'invalid handle for stdout (' + stdout.fd + ')');
  5417. var stderr = FS.open('/dev/stderr', 'w');
  5418. assert(stderr.fd === 2, 'invalid handle for stderr (' + stderr.fd + ')');
  5419. },ensureErrnoError:function () {
  5420. if (FS.ErrnoError) return;
  5421. FS.ErrnoError = function ErrnoError(errno, node) {
  5422. //Module.printErr(stackTrace()); // useful for debugging
  5423. this.node = node;
  5424. this.setErrno = function(errno) {
  5425. this.errno = errno;
  5426. for (var key in ERRNO_CODES) {
  5427. if (ERRNO_CODES[key] === errno) {
  5428. this.code = key;
  5429. break;
  5430. }
  5431. }
  5432. };
  5433. this.setErrno(errno);
  5434. this.message = ERRNO_MESSAGES[errno];
  5435. if (this.stack) this.stack = demangleAll(this.stack);
  5436. };
  5437. FS.ErrnoError.prototype = new Error();
  5438. FS.ErrnoError.prototype.constructor = FS.ErrnoError;
  5439. // Some errors may happen quite a bit, to avoid overhead we reuse them (and suffer a lack of stack info)
  5440. [ERRNO_CODES.ENOENT].forEach(function(code) {
  5441. FS.genericErrors[code] = new FS.ErrnoError(code);
  5442. FS.genericErrors[code].stack = '<generic error, no stack>';
  5443. });
  5444. },staticInit:function () {
  5445. FS.ensureErrnoError();
  5446. FS.nameTable = new Array(4096);
  5447. FS.mount(MEMFS, {}, '/');
  5448. FS.createDefaultDirectories();
  5449. FS.createDefaultDevices();
  5450. FS.createSpecialDirectories();
  5451. FS.filesystems = {
  5452. 'MEMFS': MEMFS,
  5453. 'IDBFS': IDBFS,
  5454. 'NODEFS': NODEFS,
  5455. 'WORKERFS': WORKERFS,
  5456. };
  5457. },init:function (input, output, error) {
  5458. assert(!FS.init.initialized, 'FS.init was previously called. If you want to initialize later with custom parameters, remove any earlier calls (note that one is automatically added to the generated code)');
  5459. FS.init.initialized = true;
  5460. FS.ensureErrnoError();
  5461. // Allow Module.stdin etc. to provide defaults, if none explicitly passed to us here
  5462. Module['stdin'] = input || Module['stdin'];
  5463. Module['stdout'] = output || Module['stdout'];
  5464. Module['stderr'] = error || Module['stderr'];
  5465. FS.createStandardStreams();
  5466. },quit:function () {
  5467. FS.init.initialized = false;
  5468. // force-flush all streams, so we get musl std streams printed out
  5469. var fflush = Module['_fflush'];
  5470. if (fflush) fflush(0);
  5471. // close all of our streams
  5472. for (var i = 0; i < FS.streams.length; i++) {
  5473. var stream = FS.streams[i];
  5474. if (!stream) {
  5475. continue;
  5476. }
  5477. FS.close(stream);
  5478. }
  5479. },getMode:function (canRead, canWrite) {
  5480. var mode = 0;
  5481. if (canRead) mode |= 292 | 73;
  5482. if (canWrite) mode |= 146;
  5483. return mode;
  5484. },joinPath:function (parts, forceRelative) {
  5485. var path = PATH.join.apply(null, parts);
  5486. if (forceRelative && path[0] == '/') path = path.substr(1);
  5487. return path;
  5488. },absolutePath:function (relative, base) {
  5489. return PATH.resolve(base, relative);
  5490. },standardizePath:function (path) {
  5491. return PATH.normalize(path);
  5492. },findObject:function (path, dontResolveLastLink) {
  5493. var ret = FS.analyzePath(path, dontResolveLastLink);
  5494. if (ret.exists) {
  5495. return ret.object;
  5496. } else {
  5497. ___setErrNo(ret.error);
  5498. return null;
  5499. }
  5500. },analyzePath:function (path, dontResolveLastLink) {
  5501. // operate from within the context of the symlink's target
  5502. try {
  5503. var lookup = FS.lookupPath(path, { follow: !dontResolveLastLink });
  5504. path = lookup.path;
  5505. } catch (e) {
  5506. }
  5507. var ret = {
  5508. isRoot: false, exists: false, error: 0, name: null, path: null, object: null,
  5509. parentExists: false, parentPath: null, parentObject: null
  5510. };
  5511. try {
  5512. var lookup = FS.lookupPath(path, { parent: true });
  5513. ret.parentExists = true;
  5514. ret.parentPath = lookup.path;
  5515. ret.parentObject = lookup.node;
  5516. ret.name = PATH.basename(path);
  5517. lookup = FS.lookupPath(path, { follow: !dontResolveLastLink });
  5518. ret.exists = true;
  5519. ret.path = lookup.path;
  5520. ret.object = lookup.node;
  5521. ret.name = lookup.node.name;
  5522. ret.isRoot = lookup.path === '/';
  5523. } catch (e) {
  5524. ret.error = e.errno;
  5525. };
  5526. return ret;
  5527. },createFolder:function (parent, name, canRead, canWrite) {
  5528. var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name);
  5529. var mode = FS.getMode(canRead, canWrite);
  5530. return FS.mkdir(path, mode);
  5531. },createPath:function (parent, path, canRead, canWrite) {
  5532. parent = typeof parent === 'string' ? parent : FS.getPath(parent);
  5533. var parts = path.split('/').reverse();
  5534. while (parts.length) {
  5535. var part = parts.pop();
  5536. if (!part) continue;
  5537. var current = PATH.join2(parent, part);
  5538. try {
  5539. FS.mkdir(current);
  5540. } catch (e) {
  5541. // ignore EEXIST
  5542. }
  5543. parent = current;
  5544. }
  5545. return current;
  5546. },createFile:function (parent, name, properties, canRead, canWrite) {
  5547. var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name);
  5548. var mode = FS.getMode(canRead, canWrite);
  5549. return FS.create(path, mode);
  5550. },createDataFile:function (parent, name, data, canRead, canWrite, canOwn) {
  5551. var path = name ? PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name) : parent;
  5552. var mode = FS.getMode(canRead, canWrite);
  5553. var node = FS.create(path, mode);
  5554. if (data) {
  5555. if (typeof data === 'string') {
  5556. var arr = new Array(data.length);
  5557. for (var i = 0, len = data.length; i < len; ++i) arr[i] = data.charCodeAt(i);
  5558. data = arr;
  5559. }
  5560. // make sure we can write to the file
  5561. FS.chmod(node, mode | 146);
  5562. var stream = FS.open(node, 'w');
  5563. FS.write(stream, data, 0, data.length, 0, canOwn);
  5564. FS.close(stream);
  5565. FS.chmod(node, mode);
  5566. }
  5567. return node;
  5568. },createDevice:function (parent, name, input, output) {
  5569. var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name);
  5570. var mode = FS.getMode(!!input, !!output);
  5571. if (!FS.createDevice.major) FS.createDevice.major = 64;
  5572. var dev = FS.makedev(FS.createDevice.major++, 0);
  5573. // Create a fake device that a set of stream ops to emulate
  5574. // the old behavior.
  5575. FS.registerDevice(dev, {
  5576. open: function(stream) {
  5577. stream.seekable = false;
  5578. },
  5579. close: function(stream) {
  5580. // flush any pending line data
  5581. if (output && output.buffer && output.buffer.length) {
  5582. output(10);
  5583. }
  5584. },
  5585. read: function(stream, buffer, offset, length, pos /* ignored */) {
  5586. var bytesRead = 0;
  5587. for (var i = 0; i < length; i++) {
  5588. var result;
  5589. try {
  5590. result = input();
  5591. } catch (e) {
  5592. throw new FS.ErrnoError(ERRNO_CODES.EIO);
  5593. }
  5594. if (result === undefined && bytesRead === 0) {
  5595. throw new FS.ErrnoError(ERRNO_CODES.EAGAIN);
  5596. }
  5597. if (result === null || result === undefined) break;
  5598. bytesRead++;
  5599. buffer[offset+i] = result;
  5600. }
  5601. if (bytesRead) {
  5602. stream.node.timestamp = Date.now();
  5603. }
  5604. return bytesRead;
  5605. },
  5606. write: function(stream, buffer, offset, length, pos) {
  5607. for (var i = 0; i < length; i++) {
  5608. try {
  5609. output(buffer[offset+i]);
  5610. } catch (e) {
  5611. throw new FS.ErrnoError(ERRNO_CODES.EIO);
  5612. }
  5613. }
  5614. if (length) {
  5615. stream.node.timestamp = Date.now();
  5616. }
  5617. return i;
  5618. }
  5619. });
  5620. return FS.mkdev(path, mode, dev);
  5621. },createLink:function (parent, name, target, canRead, canWrite) {
  5622. var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name);
  5623. return FS.symlink(target, path);
  5624. },forceLoadFile:function (obj) {
  5625. if (obj.isDevice || obj.isFolder || obj.link || obj.contents) return true;
  5626. var success = true;
  5627. if (typeof XMLHttpRequest !== 'undefined') {
  5628. throw new Error("Lazy loading should have been performed (contents set) in createLazyFile, but it was not. Lazy loading only works in web workers. Use --embed-file or --preload-file in emcc on the main thread.");
  5629. } else if (Module['read']) {
  5630. // Command-line.
  5631. try {
  5632. // WARNING: Can't read binary files in V8's d8 or tracemonkey's js, as
  5633. // read() will try to parse UTF8.
  5634. obj.contents = intArrayFromString(Module['read'](obj.url), true);
  5635. obj.usedBytes = obj.contents.length;
  5636. } catch (e) {
  5637. success = false;
  5638. }
  5639. } else {
  5640. throw new Error('Cannot load without read() or XMLHttpRequest.');
  5641. }
  5642. if (!success) ___setErrNo(ERRNO_CODES.EIO);
  5643. return success;
  5644. },createLazyFile:function (parent, name, url, canRead, canWrite) {
  5645. // Lazy chunked Uint8Array (implements get and length from Uint8Array). Actual getting is abstracted away for eventual reuse.
  5646. function LazyUint8Array() {
  5647. this.lengthKnown = false;
  5648. this.chunks = []; // Loaded chunks. Index is the chunk number
  5649. }
  5650. LazyUint8Array.prototype.get = function LazyUint8Array_get(idx) {
  5651. if (idx > this.length-1 || idx < 0) {
  5652. return undefined;
  5653. }
  5654. var chunkOffset = idx % this.chunkSize;
  5655. var chunkNum = (idx / this.chunkSize)|0;
  5656. return this.getter(chunkNum)[chunkOffset];
  5657. }
  5658. LazyUint8Array.prototype.setDataGetter = function LazyUint8Array_setDataGetter(getter) {
  5659. this.getter = getter;
  5660. }
  5661. LazyUint8Array.prototype.cacheLength = function LazyUint8Array_cacheLength() {
  5662. // Find length
  5663. var xhr = new XMLHttpRequest();
  5664. xhr.open('HEAD', url, false);
  5665. xhr.send(null);
  5666. if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status);
  5667. var datalength = Number(xhr.getResponseHeader("Content-length"));
  5668. var header;
  5669. var hasByteServing = (header = xhr.getResponseHeader("Accept-Ranges")) && header === "bytes";
  5670. var usesGzip = (header = xhr.getResponseHeader("Content-Encoding")) && header === "gzip";
  5671. var chunkSize = 1024*1024; // Chunk size in bytes
  5672. if (!hasByteServing) chunkSize = datalength;
  5673. // Function to get a range from the remote URL.
  5674. var doXHR = (function(from, to) {
  5675. if (from > to) throw new Error("invalid range (" + from + ", " + to + ") or no bytes requested!");
  5676. if (to > datalength-1) throw new Error("only " + datalength + " bytes available! programmer error!");
  5677. // TODO: Use mozResponseArrayBuffer, responseStream, etc. if available.
  5678. var xhr = new XMLHttpRequest();
  5679. xhr.open('GET', url, false);
  5680. if (datalength !== chunkSize) xhr.setRequestHeader("Range", "bytes=" + from + "-" + to);
  5681. // Some hints to the browser that we want binary data.
  5682. if (typeof Uint8Array != 'undefined') xhr.responseType = 'arraybuffer';
  5683. if (xhr.overrideMimeType) {
  5684. xhr.overrideMimeType('text/plain; charset=x-user-defined');
  5685. }
  5686. xhr.send(null);
  5687. if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status);
  5688. if (xhr.response !== undefined) {
  5689. return new Uint8Array(xhr.response || []);
  5690. } else {
  5691. return intArrayFromString(xhr.responseText || '', true);
  5692. }
  5693. });
  5694. var lazyArray = this;
  5695. lazyArray.setDataGetter(function(chunkNum) {
  5696. var start = chunkNum * chunkSize;
  5697. var end = (chunkNum+1) * chunkSize - 1; // including this byte
  5698. end = Math.min(end, datalength-1); // if datalength-1 is selected, this is the last block
  5699. if (typeof(lazyArray.chunks[chunkNum]) === "undefined") {
  5700. lazyArray.chunks[chunkNum] = doXHR(start, end);
  5701. }
  5702. if (typeof(lazyArray.chunks[chunkNum]) === "undefined") throw new Error("doXHR failed!");
  5703. return lazyArray.chunks[chunkNum];
  5704. });
  5705. if (usesGzip || !datalength) {
  5706. // if the server uses gzip or doesn't supply the length, we have to download the whole file to get the (uncompressed) length
  5707. chunkSize = datalength = 1; // this will force getter(0)/doXHR do download the whole file
  5708. datalength = this.getter(0).length;
  5709. chunkSize = datalength;
  5710. console.log("LazyFiles on gzip forces download of the whole file when length is accessed");
  5711. }
  5712. this._length = datalength;
  5713. this._chunkSize = chunkSize;
  5714. this.lengthKnown = true;
  5715. }
  5716. if (typeof XMLHttpRequest !== 'undefined') {
  5717. if (!ENVIRONMENT_IS_WORKER) throw 'Cannot do synchronous binary XHRs outside webworkers in modern browsers. Use --embed-file or --preload-file in emcc';
  5718. var lazyArray = new LazyUint8Array();
  5719. Object.defineProperties(lazyArray, {
  5720. length: {
  5721. get: function() {
  5722. if(!this.lengthKnown) {
  5723. this.cacheLength();
  5724. }
  5725. return this._length;
  5726. }
  5727. },
  5728. chunkSize: {
  5729. get: function() {
  5730. if(!this.lengthKnown) {
  5731. this.cacheLength();
  5732. }
  5733. return this._chunkSize;
  5734. }
  5735. }
  5736. });
  5737. var properties = { isDevice: false, contents: lazyArray };
  5738. } else {
  5739. var properties = { isDevice: false, url: url };
  5740. }
  5741. var node = FS.createFile(parent, name, properties, canRead, canWrite);
  5742. // This is a total hack, but I want to get this lazy file code out of the
  5743. // core of MEMFS. If we want to keep this lazy file concept I feel it should
  5744. // be its own thin LAZYFS proxying calls to MEMFS.
  5745. if (properties.contents) {
  5746. node.contents = properties.contents;
  5747. } else if (properties.url) {
  5748. node.contents = null;
  5749. node.url = properties.url;
  5750. }
  5751. // Add a function that defers querying the file size until it is asked the first time.
  5752. Object.defineProperties(node, {
  5753. usedBytes: {
  5754. get: function() { return this.contents.length; }
  5755. }
  5756. });
  5757. // override each stream op with one that tries to force load the lazy file first
  5758. var stream_ops = {};
  5759. var keys = Object.keys(node.stream_ops);
  5760. keys.forEach(function(key) {
  5761. var fn = node.stream_ops[key];
  5762. stream_ops[key] = function forceLoadLazyFile() {
  5763. if (!FS.forceLoadFile(node)) {
  5764. throw new FS.ErrnoError(ERRNO_CODES.EIO);
  5765. }
  5766. return fn.apply(null, arguments);
  5767. };
  5768. });
  5769. // use a custom read function
  5770. stream_ops.read = function stream_ops_read(stream, buffer, offset, length, position) {
  5771. if (!FS.forceLoadFile(node)) {
  5772. throw new FS.ErrnoError(ERRNO_CODES.EIO);
  5773. }
  5774. var contents = stream.node.contents;
  5775. if (position >= contents.length)
  5776. return 0;
  5777. var size = Math.min(contents.length - position, length);
  5778. assert(size >= 0);
  5779. if (contents.slice) { // normal array
  5780. for (var i = 0; i < size; i++) {
  5781. buffer[offset + i] = contents[position + i];
  5782. }
  5783. } else {
  5784. for (var i = 0; i < size; i++) { // LazyUint8Array from sync binary XHR
  5785. buffer[offset + i] = contents.get(position + i);
  5786. }
  5787. }
  5788. return size;
  5789. };
  5790. node.stream_ops = stream_ops;
  5791. return node;
  5792. },createPreloadedFile:function (parent, name, url, canRead, canWrite, onload, onerror, dontCreateFile, canOwn, preFinish) {
  5793. Browser.init(); // XXX perhaps this method should move onto Browser?
  5794. // TODO we should allow people to just pass in a complete filename instead
  5795. // of parent and name being that we just join them anyways
  5796. var fullname = name ? PATH.resolve(PATH.join2(parent, name)) : parent;
  5797. var dep = getUniqueRunDependency('cp ' + fullname); // might have several active requests for the same fullname
  5798. function processData(byteArray) {
  5799. function finish(byteArray) {
  5800. if (preFinish) preFinish();
  5801. if (!dontCreateFile) {
  5802. FS.createDataFile(parent, name, byteArray, canRead, canWrite, canOwn);
  5803. }
  5804. if (onload) onload();
  5805. removeRunDependency(dep);
  5806. }
  5807. var handled = false;
  5808. Module['preloadPlugins'].forEach(function(plugin) {
  5809. if (handled) return;
  5810. if (plugin['canHandle'](fullname)) {
  5811. plugin['handle'](byteArray, fullname, finish, function() {
  5812. if (onerror) onerror();
  5813. removeRunDependency(dep);
  5814. });
  5815. handled = true;
  5816. }
  5817. });
  5818. if (!handled) finish(byteArray);
  5819. }
  5820. addRunDependency(dep);
  5821. if (typeof url == 'string') {
  5822. Browser.asyncLoad(url, function(byteArray) {
  5823. processData(byteArray);
  5824. }, onerror);
  5825. } else {
  5826. processData(url);
  5827. }
  5828. },indexedDB:function () {
  5829. return window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB;
  5830. },DB_NAME:function () {
  5831. return 'EM_FS_' + window.location.pathname;
  5832. },DB_VERSION:20,DB_STORE_NAME:"FILE_DATA",saveFilesToDB:function (paths, onload, onerror) {
  5833. onload = onload || function(){};
  5834. onerror = onerror || function(){};
  5835. var indexedDB = FS.indexedDB();
  5836. try {
  5837. var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION);
  5838. } catch (e) {
  5839. return onerror(e);
  5840. }
  5841. openRequest.onupgradeneeded = function openRequest_onupgradeneeded() {
  5842. console.log('creating db');
  5843. var db = openRequest.result;
  5844. db.createObjectStore(FS.DB_STORE_NAME);
  5845. };
  5846. openRequest.onsuccess = function openRequest_onsuccess() {
  5847. var db = openRequest.result;
  5848. var transaction = db.transaction([FS.DB_STORE_NAME], 'readwrite');
  5849. var files = transaction.objectStore(FS.DB_STORE_NAME);
  5850. var ok = 0, fail = 0, total = paths.length;
  5851. function finish() {
  5852. if (fail == 0) onload(); else onerror();
  5853. }
  5854. paths.forEach(function(path) {
  5855. var putRequest = files.put(FS.analyzePath(path).object.contents, path);
  5856. putRequest.onsuccess = function putRequest_onsuccess() { ok++; if (ok + fail == total) finish() };
  5857. putRequest.onerror = function putRequest_onerror() { fail++; if (ok + fail == total) finish() };
  5858. });
  5859. transaction.onerror = onerror;
  5860. };
  5861. openRequest.onerror = onerror;
  5862. },loadFilesFromDB:function (paths, onload, onerror) {
  5863. onload = onload || function(){};
  5864. onerror = onerror || function(){};
  5865. var indexedDB = FS.indexedDB();
  5866. try {
  5867. var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION);
  5868. } catch (e) {
  5869. return onerror(e);
  5870. }
  5871. openRequest.onupgradeneeded = onerror; // no database to load from
  5872. openRequest.onsuccess = function openRequest_onsuccess() {
  5873. var db = openRequest.result;
  5874. try {
  5875. var transaction = db.transaction([FS.DB_STORE_NAME], 'readonly');
  5876. } catch(e) {
  5877. onerror(e);
  5878. return;
  5879. }
  5880. var files = transaction.objectStore(FS.DB_STORE_NAME);
  5881. var ok = 0, fail = 0, total = paths.length;
  5882. function finish() {
  5883. if (fail == 0) onload(); else onerror();
  5884. }
  5885. paths.forEach(function(path) {
  5886. var getRequest = files.get(path);
  5887. getRequest.onsuccess = function getRequest_onsuccess() {
  5888. if (FS.analyzePath(path).exists) {
  5889. FS.unlink(path);
  5890. }
  5891. FS.createDataFile(PATH.dirname(path), PATH.basename(path), getRequest.result, true, true, true);
  5892. ok++;
  5893. if (ok + fail == total) finish();
  5894. };
  5895. getRequest.onerror = function getRequest_onerror() { fail++; if (ok + fail == total) finish() };
  5896. });
  5897. transaction.onerror = onerror;
  5898. };
  5899. openRequest.onerror = onerror;
  5900. }};var SYSCALLS={DEFAULT_POLLMASK:5,mappings:{},umask:511,calculateAt:function (dirfd, path) {
  5901. if (path[0] !== '/') {
  5902. // relative path
  5903. var dir;
  5904. if (dirfd === -100) {
  5905. dir = FS.cwd();
  5906. } else {
  5907. var dirstream = FS.getStream(dirfd);
  5908. if (!dirstream) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
  5909. dir = dirstream.path;
  5910. }
  5911. path = PATH.join2(dir, path);
  5912. }
  5913. return path;
  5914. },doStat:function (func, path, buf) {
  5915. try {
  5916. var stat = func(path);
  5917. } catch (e) {
  5918. if (e && e.node && PATH.normalize(path) !== PATH.normalize(FS.getPath(e.node))) {
  5919. // an error occurred while trying to look up the path; we should just report ENOTDIR
  5920. return -ERRNO_CODES.ENOTDIR;
  5921. }
  5922. throw e;
  5923. }
  5924. HEAP32[((buf)>>2)]=stat.dev;
  5925. HEAP32[(((buf)+(4))>>2)]=0;
  5926. HEAP32[(((buf)+(8))>>2)]=stat.ino;
  5927. HEAP32[(((buf)+(12))>>2)]=stat.mode;
  5928. HEAP32[(((buf)+(16))>>2)]=stat.nlink;
  5929. HEAP32[(((buf)+(20))>>2)]=stat.uid;
  5930. HEAP32[(((buf)+(24))>>2)]=stat.gid;
  5931. HEAP32[(((buf)+(28))>>2)]=stat.rdev;
  5932. HEAP32[(((buf)+(32))>>2)]=0;
  5933. HEAP32[(((buf)+(36))>>2)]=stat.size;
  5934. HEAP32[(((buf)+(40))>>2)]=4096;
  5935. HEAP32[(((buf)+(44))>>2)]=stat.blocks;
  5936. HEAP32[(((buf)+(48))>>2)]=(stat.atime.getTime() / 1000)|0;
  5937. HEAP32[(((buf)+(52))>>2)]=0;
  5938. HEAP32[(((buf)+(56))>>2)]=(stat.mtime.getTime() / 1000)|0;
  5939. HEAP32[(((buf)+(60))>>2)]=0;
  5940. HEAP32[(((buf)+(64))>>2)]=(stat.ctime.getTime() / 1000)|0;
  5941. HEAP32[(((buf)+(68))>>2)]=0;
  5942. HEAP32[(((buf)+(72))>>2)]=stat.ino;
  5943. return 0;
  5944. },doMsync:function (addr, stream, len, flags) {
  5945. var buffer = new Uint8Array(HEAPU8.subarray(addr, addr + len));
  5946. FS.msync(stream, buffer, 0, len, flags);
  5947. },doMkdir:function (path, mode) {
  5948. // remove a trailing slash, if one - /a/b/ has basename of '', but
  5949. // we want to create b in the context of this function
  5950. path = PATH.normalize(path);
  5951. if (path[path.length-1] === '/') path = path.substr(0, path.length-1);
  5952. FS.mkdir(path, mode, 0);
  5953. return 0;
  5954. },doMknod:function (path, mode, dev) {
  5955. // we don't want this in the JS API as it uses mknod to create all nodes.
  5956. switch (mode & 61440) {
  5957. case 32768:
  5958. case 8192:
  5959. case 24576:
  5960. case 4096:
  5961. case 49152:
  5962. break;
  5963. default: return -ERRNO_CODES.EINVAL;
  5964. }
  5965. FS.mknod(path, mode, dev);
  5966. return 0;
  5967. },doReadlink:function (path, buf, bufsize) {
  5968. if (bufsize <= 0) return -ERRNO_CODES.EINVAL;
  5969. var ret = FS.readlink(path);
  5970. var len = Math.min(bufsize, lengthBytesUTF8(ret));
  5971. var endChar = HEAP8[buf+len];
  5972. stringToUTF8(ret, buf, bufsize+1);
  5973. // readlink is one of the rare functions that write out a C string, but does never append a null to the output buffer(!)
  5974. // stringToUTF8() always appends a null byte, so restore the character under the null byte after the write.
  5975. HEAP8[buf+len] = endChar;
  5976. return len;
  5977. },doAccess:function (path, amode) {
  5978. if (amode & ~7) {
  5979. // need a valid mode
  5980. return -ERRNO_CODES.EINVAL;
  5981. }
  5982. var node;
  5983. var lookup = FS.lookupPath(path, { follow: true });
  5984. node = lookup.node;
  5985. var perms = '';
  5986. if (amode & 4) perms += 'r';
  5987. if (amode & 2) perms += 'w';
  5988. if (amode & 1) perms += 'x';
  5989. if (perms /* otherwise, they've just passed F_OK */ && FS.nodePermissions(node, perms)) {
  5990. return -ERRNO_CODES.EACCES;
  5991. }
  5992. return 0;
  5993. },doDup:function (path, flags, suggestFD) {
  5994. var suggest = FS.getStream(suggestFD);
  5995. if (suggest) FS.close(suggest);
  5996. return FS.open(path, flags, 0, suggestFD, suggestFD).fd;
  5997. },doReadv:function (stream, iov, iovcnt, offset) {
  5998. var ret = 0;
  5999. for (var i = 0; i < iovcnt; i++) {
  6000. var ptr = HEAP32[(((iov)+(i*8))>>2)];
  6001. var len = HEAP32[(((iov)+(i*8 + 4))>>2)];
  6002. var curr = FS.read(stream, HEAP8,ptr, len, offset);
  6003. if (curr < 0) return -1;
  6004. ret += curr;
  6005. if (curr < len) break; // nothing more to read
  6006. }
  6007. return ret;
  6008. },doWritev:function (stream, iov, iovcnt, offset) {
  6009. var ret = 0;
  6010. for (var i = 0; i < iovcnt; i++) {
  6011. var ptr = HEAP32[(((iov)+(i*8))>>2)];
  6012. var len = HEAP32[(((iov)+(i*8 + 4))>>2)];
  6013. var curr = FS.write(stream, HEAP8,ptr, len, offset);
  6014. if (curr < 0) return -1;
  6015. ret += curr;
  6016. }
  6017. return ret;
  6018. },varargs:0,get:function (varargs) {
  6019. SYSCALLS.varargs += 4;
  6020. var ret = HEAP32[(((SYSCALLS.varargs)-(4))>>2)];
  6021. return ret;
  6022. },getStr:function () {
  6023. var ret = Pointer_stringify(SYSCALLS.get());
  6024. return ret;
  6025. },getStreamFromFD:function () {
  6026. var stream = FS.getStream(SYSCALLS.get());
  6027. if (!stream) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
  6028. return stream;
  6029. },getSocketFromFD:function () {
  6030. var socket = SOCKFS.getSocket(SYSCALLS.get());
  6031. if (!socket) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
  6032. return socket;
  6033. },getSocketAddress:function (allowNull) {
  6034. var addrp = SYSCALLS.get(), addrlen = SYSCALLS.get();
  6035. if (allowNull && addrp === 0) return null;
  6036. var info = __read_sockaddr(addrp, addrlen);
  6037. if (info.errno) throw new FS.ErrnoError(info.errno);
  6038. info.addr = DNS.lookup_addr(info.addr) || info.addr;
  6039. return info;
  6040. },get64:function () {
  6041. var low = SYSCALLS.get(), high = SYSCALLS.get();
  6042. if (low >= 0) assert(high === 0);
  6043. else assert(high === -1);
  6044. return low;
  6045. },getZero:function () {
  6046. assert(SYSCALLS.get() === 0);
  6047. }};function ___syscall54(which, varargs) {SYSCALLS.varargs = varargs;
  6048. try {
  6049. // ioctl
  6050. var stream = SYSCALLS.getStreamFromFD(), op = SYSCALLS.get();
  6051. switch (op) {
  6052. case 21505: {
  6053. if (!stream.tty) return -ERRNO_CODES.ENOTTY;
  6054. return 0;
  6055. }
  6056. case 21506: {
  6057. if (!stream.tty) return -ERRNO_CODES.ENOTTY;
  6058. return 0; // no-op, not actually adjusting terminal settings
  6059. }
  6060. case 21519: {
  6061. if (!stream.tty) return -ERRNO_CODES.ENOTTY;
  6062. var argp = SYSCALLS.get();
  6063. HEAP32[((argp)>>2)]=0;
  6064. return 0;
  6065. }
  6066. case 21520: {
  6067. if (!stream.tty) return -ERRNO_CODES.ENOTTY;
  6068. return -ERRNO_CODES.EINVAL; // not supported
  6069. }
  6070. case 21531: {
  6071. var argp = SYSCALLS.get();
  6072. return FS.ioctl(stream, op, argp);
  6073. }
  6074. case 21523: {
  6075. // TODO: in theory we should write to the winsize struct that gets
  6076. // passed in, but for now musl doesn't read anything on it
  6077. if (!stream.tty) return -ERRNO_CODES.ENOTTY;
  6078. return 0;
  6079. }
  6080. default: abort('bad ioctl syscall ' + op);
  6081. }
  6082. } catch (e) {
  6083. if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
  6084. return -e.errno;
  6085. }
  6086. }
  6087. function _emscripten_glSampleCoverage(value, invert) {
  6088. GLctx.sampleCoverage(value, !!invert);
  6089. }
  6090. function _glDeleteTextures(n, textures) {
  6091. for (var i = 0; i < n; i++) {
  6092. var id = HEAP32[(((textures)+(i*4))>>2)];
  6093. var texture = GL.textures[id];
  6094. if (!texture) continue; // GL spec: "glDeleteTextures silently ignores 0s and names that do not correspond to existing textures".
  6095. GLctx.deleteTexture(texture);
  6096. texture.name = 0;
  6097. GL.textures[id] = null;
  6098. }
  6099. }
  6100. function _emscripten_glFrustum() {
  6101. Module['printErr']('missing function: emscripten_glFrustum'); abort(-1);
  6102. }
  6103. function _glVertexAttrib4f(x0, x1, x2, x3, x4) { GLctx['vertexAttrib4f'](x0, x1, x2, x3, x4) }
  6104. function _glfwSetWindowSizeCallback(winid, cbfun) {
  6105. GLFW.setWindowSizeCallback(winid, cbfun);
  6106. }
  6107. function _emscripten_glGetTexParameterfv(target, pname, params) {
  6108. if (!params) {
  6109. // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
  6110. // if p == null, issue a GL error to notify user about it.
  6111. GL.recordError(0x0501 /* GL_INVALID_VALUE */);
  6112. return;
  6113. }
  6114. HEAPF32[((params)>>2)]=GLctx.getTexParameter(target, pname);
  6115. }
  6116. function _emscripten_glUniform4i(location, v0, v1, v2, v3) {
  6117. GLctx.uniform4i(GL.uniforms[location], v0, v1, v2, v3);
  6118. }
  6119. function _emscripten_glBindRenderbuffer(target, renderbuffer) {
  6120. GLctx.bindRenderbuffer(target, renderbuffer ? GL.renderbuffers[renderbuffer] : null);
  6121. }
  6122. function _emscripten_glViewport(x0, x1, x2, x3) { GLctx['viewport'](x0, x1, x2, x3) }
  6123. var JSEvents={keyEvent:0,mouseEvent:0,wheelEvent:0,uiEvent:0,focusEvent:0,deviceOrientationEvent:0,deviceMotionEvent:0,fullscreenChangeEvent:0,pointerlockChangeEvent:0,visibilityChangeEvent:0,touchEvent:0,lastGamepadState:null,lastGamepadStateFrame:null,numGamepadsConnected:0,previousFullscreenElement:null,previousScreenX:null,previousScreenY:null,removeEventListenersRegistered:false,staticInit:function () {
  6124. if (typeof window !== 'undefined') {
  6125. window.addEventListener("gamepadconnected", function() { ++JSEvents.numGamepadsConnected; });
  6126. window.addEventListener("gamepaddisconnected", function() { --JSEvents.numGamepadsConnected; });
  6127. }
  6128. },registerRemoveEventListeners:function () {
  6129. if (!JSEvents.removeEventListenersRegistered) {
  6130. __ATEXIT__.push(function() {
  6131. for(var i = JSEvents.eventHandlers.length-1; i >= 0; --i) {
  6132. JSEvents._removeHandler(i);
  6133. }
  6134. });
  6135. JSEvents.removeEventListenersRegistered = true;
  6136. }
  6137. },findEventTarget:function (target) {
  6138. if (target) {
  6139. if (typeof target == "number") {
  6140. target = Pointer_stringify(target);
  6141. }
  6142. if (target == '#window') return window;
  6143. else if (target == '#document') return document;
  6144. else if (target == '#screen') return window.screen;
  6145. else if (target == '#canvas') return Module['canvas'];
  6146. if (typeof target == 'string') return document.getElementById(target);
  6147. else return target;
  6148. } else {
  6149. // The sensible target varies between events, but use window as the default
  6150. // since DOM events mostly can default to that. Specific callback registrations
  6151. // override their own defaults.
  6152. return window;
  6153. }
  6154. },deferredCalls:[],deferCall:function (targetFunction, precedence, argsList) {
  6155. function arraysHaveEqualContent(arrA, arrB) {
  6156. if (arrA.length != arrB.length) return false;
  6157. for(var i in arrA) {
  6158. if (arrA[i] != arrB[i]) return false;
  6159. }
  6160. return true;
  6161. }
  6162. // Test if the given call was already queued, and if so, don't add it again.
  6163. for(var i in JSEvents.deferredCalls) {
  6164. var call = JSEvents.deferredCalls[i];
  6165. if (call.targetFunction == targetFunction && arraysHaveEqualContent(call.argsList, argsList)) {
  6166. return;
  6167. }
  6168. }
  6169. JSEvents.deferredCalls.push({
  6170. targetFunction: targetFunction,
  6171. precedence: precedence,
  6172. argsList: argsList
  6173. });
  6174. JSEvents.deferredCalls.sort(function(x,y) { return x.precedence < y.precedence; });
  6175. },removeDeferredCalls:function (targetFunction) {
  6176. for(var i = 0; i < JSEvents.deferredCalls.length; ++i) {
  6177. if (JSEvents.deferredCalls[i].targetFunction == targetFunction) {
  6178. JSEvents.deferredCalls.splice(i, 1);
  6179. --i;
  6180. }
  6181. }
  6182. },canPerformEventHandlerRequests:function () {
  6183. return JSEvents.inEventHandler && JSEvents.currentEventHandler.allowsDeferredCalls;
  6184. },runDeferredCalls:function () {
  6185. if (!JSEvents.canPerformEventHandlerRequests()) {
  6186. return;
  6187. }
  6188. for(var i = 0; i < JSEvents.deferredCalls.length; ++i) {
  6189. var call = JSEvents.deferredCalls[i];
  6190. JSEvents.deferredCalls.splice(i, 1);
  6191. --i;
  6192. call.targetFunction.apply(this, call.argsList);
  6193. }
  6194. },inEventHandler:0,currentEventHandler:null,eventHandlers:[],isInternetExplorer:function () { return navigator.userAgent.indexOf('MSIE') !== -1 || navigator.appVersion.indexOf('Trident/') > 0; },removeAllHandlersOnTarget:function (target, eventTypeString) {
  6195. for(var i = 0; i < JSEvents.eventHandlers.length; ++i) {
  6196. if (JSEvents.eventHandlers[i].target == target &&
  6197. (!eventTypeString || eventTypeString == JSEvents.eventHandlers[i].eventTypeString)) {
  6198. JSEvents._removeHandler(i--);
  6199. }
  6200. }
  6201. },_removeHandler:function (i) {
  6202. var h = JSEvents.eventHandlers[i];
  6203. h.target.removeEventListener(h.eventTypeString, h.eventListenerFunc, h.useCapture);
  6204. JSEvents.eventHandlers.splice(i, 1);
  6205. },registerOrRemoveHandler:function (eventHandler) {
  6206. var jsEventHandler = function jsEventHandler(event) {
  6207. // Increment nesting count for the event handler.
  6208. ++JSEvents.inEventHandler;
  6209. JSEvents.currentEventHandler = eventHandler;
  6210. // Process any old deferred calls the user has placed.
  6211. JSEvents.runDeferredCalls();
  6212. // Process the actual event, calls back to user C code handler.
  6213. eventHandler.handlerFunc(event);
  6214. // Process any new deferred calls that were placed right now from this event handler.
  6215. JSEvents.runDeferredCalls();
  6216. // Out of event handler - restore nesting count.
  6217. --JSEvents.inEventHandler;
  6218. }
  6219. if (eventHandler.callbackfunc) {
  6220. eventHandler.eventListenerFunc = jsEventHandler;
  6221. eventHandler.target.addEventListener(eventHandler.eventTypeString, jsEventHandler, eventHandler.useCapture);
  6222. JSEvents.eventHandlers.push(eventHandler);
  6223. JSEvents.registerRemoveEventListeners();
  6224. } else {
  6225. for(var i = 0; i < JSEvents.eventHandlers.length; ++i) {
  6226. if (JSEvents.eventHandlers[i].target == eventHandler.target
  6227. && JSEvents.eventHandlers[i].eventTypeString == eventHandler.eventTypeString) {
  6228. JSEvents._removeHandler(i--);
  6229. }
  6230. }
  6231. }
  6232. },registerKeyEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
  6233. if (!JSEvents.keyEvent) {
  6234. JSEvents.keyEvent = _malloc( 164 );
  6235. }
  6236. var handlerFunc = function(event) {
  6237. var e = event || window.event;
  6238. stringToUTF8(e.key ? e.key : "", JSEvents.keyEvent + 0, 32);
  6239. stringToUTF8(e.code ? e.code : "", JSEvents.keyEvent + 32, 32);
  6240. HEAP32[(((JSEvents.keyEvent)+(64))>>2)]=e.location;
  6241. HEAP32[(((JSEvents.keyEvent)+(68))>>2)]=e.ctrlKey;
  6242. HEAP32[(((JSEvents.keyEvent)+(72))>>2)]=e.shiftKey;
  6243. HEAP32[(((JSEvents.keyEvent)+(76))>>2)]=e.altKey;
  6244. HEAP32[(((JSEvents.keyEvent)+(80))>>2)]=e.metaKey;
  6245. HEAP32[(((JSEvents.keyEvent)+(84))>>2)]=e.repeat;
  6246. stringToUTF8(e.locale ? e.locale : "", JSEvents.keyEvent + 88, 32);
  6247. stringToUTF8(e.char ? e.char : "", JSEvents.keyEvent + 120, 32);
  6248. HEAP32[(((JSEvents.keyEvent)+(152))>>2)]=e.charCode;
  6249. HEAP32[(((JSEvents.keyEvent)+(156))>>2)]=e.keyCode;
  6250. HEAP32[(((JSEvents.keyEvent)+(160))>>2)]=e.which;
  6251. var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.keyEvent, userData);
  6252. if (shouldCancel) {
  6253. e.preventDefault();
  6254. }
  6255. };
  6256. var eventHandler = {
  6257. target: JSEvents.findEventTarget(target),
  6258. allowsDeferredCalls: JSEvents.isInternetExplorer() ? false : true, // MSIE doesn't allow fullscreen and pointerlock requests from key handlers, others do.
  6259. eventTypeString: eventTypeString,
  6260. callbackfunc: callbackfunc,
  6261. handlerFunc: handlerFunc,
  6262. useCapture: useCapture
  6263. };
  6264. JSEvents.registerOrRemoveHandler(eventHandler);
  6265. },getBoundingClientRectOrZeros:function (target) {
  6266. return target.getBoundingClientRect ? target.getBoundingClientRect() : { left: 0, top: 0 };
  6267. },fillMouseEventData:function (eventStruct, e, target) {
  6268. HEAPF64[((eventStruct)>>3)]=JSEvents.tick();
  6269. HEAP32[(((eventStruct)+(8))>>2)]=e.screenX;
  6270. HEAP32[(((eventStruct)+(12))>>2)]=e.screenY;
  6271. HEAP32[(((eventStruct)+(16))>>2)]=e.clientX;
  6272. HEAP32[(((eventStruct)+(20))>>2)]=e.clientY;
  6273. HEAP32[(((eventStruct)+(24))>>2)]=e.ctrlKey;
  6274. HEAP32[(((eventStruct)+(28))>>2)]=e.shiftKey;
  6275. HEAP32[(((eventStruct)+(32))>>2)]=e.altKey;
  6276. HEAP32[(((eventStruct)+(36))>>2)]=e.metaKey;
  6277. HEAP16[(((eventStruct)+(40))>>1)]=e.button;
  6278. HEAP16[(((eventStruct)+(42))>>1)]=e.buttons;
  6279. HEAP32[(((eventStruct)+(44))>>2)]=e["movementX"] || e["mozMovementX"] || e["webkitMovementX"] || (e.screenX-JSEvents.previousScreenX);
  6280. HEAP32[(((eventStruct)+(48))>>2)]=e["movementY"] || e["mozMovementY"] || e["webkitMovementY"] || (e.screenY-JSEvents.previousScreenY);
  6281. if (Module['canvas']) {
  6282. var rect = Module['canvas'].getBoundingClientRect();
  6283. HEAP32[(((eventStruct)+(60))>>2)]=e.clientX - rect.left;
  6284. HEAP32[(((eventStruct)+(64))>>2)]=e.clientY - rect.top;
  6285. } else { // Canvas is not initialized, return 0.
  6286. HEAP32[(((eventStruct)+(60))>>2)]=0;
  6287. HEAP32[(((eventStruct)+(64))>>2)]=0;
  6288. }
  6289. if (target) {
  6290. var rect = JSEvents.getBoundingClientRectOrZeros(target);
  6291. HEAP32[(((eventStruct)+(52))>>2)]=e.clientX - rect.left;
  6292. HEAP32[(((eventStruct)+(56))>>2)]=e.clientY - rect.top;
  6293. } else { // No specific target passed, return 0.
  6294. HEAP32[(((eventStruct)+(52))>>2)]=0;
  6295. HEAP32[(((eventStruct)+(56))>>2)]=0;
  6296. }
  6297. // wheel and mousewheel events contain wrong screenX/screenY on chrome/opera
  6298. // https://github.com/kripken/emscripten/pull/4997
  6299. // https://bugs.chromium.org/p/chromium/issues/detail?id=699956
  6300. if (e.type !== 'wheel' && e.type !== 'mousewheel') {
  6301. JSEvents.previousScreenX = e.screenX;
  6302. JSEvents.previousScreenY = e.screenY;
  6303. }
  6304. },registerMouseEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
  6305. if (!JSEvents.mouseEvent) {
  6306. JSEvents.mouseEvent = _malloc( 72 );
  6307. }
  6308. target = JSEvents.findEventTarget(target);
  6309. var handlerFunc = function(event) {
  6310. var e = event || window.event;
  6311. JSEvents.fillMouseEventData(JSEvents.mouseEvent, e, target);
  6312. var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.mouseEvent, userData);
  6313. if (shouldCancel) {
  6314. e.preventDefault();
  6315. }
  6316. };
  6317. var eventHandler = {
  6318. target: target,
  6319. allowsDeferredCalls: eventTypeString != 'mousemove' && eventTypeString != 'mouseenter' && eventTypeString != 'mouseleave', // Mouse move events do not allow fullscreen/pointer lock requests to be handled in them!
  6320. eventTypeString: eventTypeString,
  6321. callbackfunc: callbackfunc,
  6322. handlerFunc: handlerFunc,
  6323. useCapture: useCapture
  6324. };
  6325. // In IE, mousedown events don't either allow deferred calls to be run!
  6326. if (JSEvents.isInternetExplorer() && eventTypeString == 'mousedown') eventHandler.allowsDeferredCalls = false;
  6327. JSEvents.registerOrRemoveHandler(eventHandler);
  6328. },registerWheelEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
  6329. if (!JSEvents.wheelEvent) {
  6330. JSEvents.wheelEvent = _malloc( 104 );
  6331. }
  6332. target = JSEvents.findEventTarget(target);
  6333. // The DOM Level 3 events spec event 'wheel'
  6334. var wheelHandlerFunc = function(event) {
  6335. var e = event || window.event;
  6336. JSEvents.fillMouseEventData(JSEvents.wheelEvent, e, target);
  6337. HEAPF64[(((JSEvents.wheelEvent)+(72))>>3)]=e["deltaX"];
  6338. HEAPF64[(((JSEvents.wheelEvent)+(80))>>3)]=e["deltaY"];
  6339. HEAPF64[(((JSEvents.wheelEvent)+(88))>>3)]=e["deltaZ"];
  6340. HEAP32[(((JSEvents.wheelEvent)+(96))>>2)]=e["deltaMode"];
  6341. var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.wheelEvent, userData);
  6342. if (shouldCancel) {
  6343. e.preventDefault();
  6344. }
  6345. };
  6346. // The 'mousewheel' event as implemented in Safari 6.0.5
  6347. var mouseWheelHandlerFunc = function(event) {
  6348. var e = event || window.event;
  6349. JSEvents.fillMouseEventData(JSEvents.wheelEvent, e, target);
  6350. HEAPF64[(((JSEvents.wheelEvent)+(72))>>3)]=e["wheelDeltaX"] || 0;
  6351. HEAPF64[(((JSEvents.wheelEvent)+(80))>>3)]=-(e["wheelDeltaY"] ? e["wheelDeltaY"] : e["wheelDelta"]) /* 1. Invert to unify direction with the DOM Level 3 wheel event. 2. MSIE does not provide wheelDeltaY, so wheelDelta is used as a fallback. */;
  6352. HEAPF64[(((JSEvents.wheelEvent)+(88))>>3)]=0 /* Not available */;
  6353. HEAP32[(((JSEvents.wheelEvent)+(96))>>2)]=0 /* DOM_DELTA_PIXEL */;
  6354. var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.wheelEvent, userData);
  6355. if (shouldCancel) {
  6356. e.preventDefault();
  6357. }
  6358. };
  6359. var eventHandler = {
  6360. target: target,
  6361. allowsDeferredCalls: true,
  6362. eventTypeString: eventTypeString,
  6363. callbackfunc: callbackfunc,
  6364. handlerFunc: (eventTypeString == 'wheel') ? wheelHandlerFunc : mouseWheelHandlerFunc,
  6365. useCapture: useCapture
  6366. };
  6367. JSEvents.registerOrRemoveHandler(eventHandler);
  6368. },pageScrollPos:function () {
  6369. if (window.pageXOffset > 0 || window.pageYOffset > 0) {
  6370. return [window.pageXOffset, window.pageYOffset];
  6371. }
  6372. if (typeof document.documentElement.scrollLeft !== 'undefined' || typeof document.documentElement.scrollTop !== 'undefined') {
  6373. return [document.documentElement.scrollLeft, document.documentElement.scrollTop];
  6374. }
  6375. return [document.body.scrollLeft|0, document.body.scrollTop|0];
  6376. },registerUiEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
  6377. if (!JSEvents.uiEvent) {
  6378. JSEvents.uiEvent = _malloc( 36 );
  6379. }
  6380. if (eventTypeString == "scroll" && !target) {
  6381. target = document; // By default read scroll events on document rather than window.
  6382. } else {
  6383. target = JSEvents.findEventTarget(target);
  6384. }
  6385. var handlerFunc = function(event) {
  6386. var e = event || window.event;
  6387. if (e.target != target) {
  6388. // Never take ui events such as scroll via a 'bubbled' route, but always from the direct element that
  6389. // was targeted. Otherwise e.g. if app logs a message in response to a page scroll, the Emscripten log
  6390. // message box could cause to scroll, generating a new (bubbled) scroll message, causing a new log print,
  6391. // causing a new scroll, etc..
  6392. return;
  6393. }
  6394. var scrollPos = JSEvents.pageScrollPos();
  6395. HEAP32[((JSEvents.uiEvent)>>2)]=e.detail;
  6396. HEAP32[(((JSEvents.uiEvent)+(4))>>2)]=document.body.clientWidth;
  6397. HEAP32[(((JSEvents.uiEvent)+(8))>>2)]=document.body.clientHeight;
  6398. HEAP32[(((JSEvents.uiEvent)+(12))>>2)]=window.innerWidth;
  6399. HEAP32[(((JSEvents.uiEvent)+(16))>>2)]=window.innerHeight;
  6400. HEAP32[(((JSEvents.uiEvent)+(20))>>2)]=window.outerWidth;
  6401. HEAP32[(((JSEvents.uiEvent)+(24))>>2)]=window.outerHeight;
  6402. HEAP32[(((JSEvents.uiEvent)+(28))>>2)]=scrollPos[0];
  6403. HEAP32[(((JSEvents.uiEvent)+(32))>>2)]=scrollPos[1];
  6404. var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.uiEvent, userData);
  6405. if (shouldCancel) {
  6406. e.preventDefault();
  6407. }
  6408. };
  6409. var eventHandler = {
  6410. target: target,
  6411. allowsDeferredCalls: false, // Neither scroll or resize events allow running requests inside them.
  6412. eventTypeString: eventTypeString,
  6413. callbackfunc: callbackfunc,
  6414. handlerFunc: handlerFunc,
  6415. useCapture: useCapture
  6416. };
  6417. JSEvents.registerOrRemoveHandler(eventHandler);
  6418. },getNodeNameForTarget:function (target) {
  6419. if (!target) return '';
  6420. if (target == window) return '#window';
  6421. if (target == window.screen) return '#screen';
  6422. return (target && target.nodeName) ? target.nodeName : '';
  6423. },registerFocusEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
  6424. if (!JSEvents.focusEvent) {
  6425. JSEvents.focusEvent = _malloc( 256 );
  6426. }
  6427. var handlerFunc = function(event) {
  6428. var e = event || window.event;
  6429. var nodeName = JSEvents.getNodeNameForTarget(e.target);
  6430. var id = e.target.id ? e.target.id : '';
  6431. stringToUTF8(nodeName, JSEvents.focusEvent + 0, 128);
  6432. stringToUTF8(id, JSEvents.focusEvent + 128, 128);
  6433. var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.focusEvent, userData);
  6434. if (shouldCancel) {
  6435. e.preventDefault();
  6436. }
  6437. };
  6438. var eventHandler = {
  6439. target: JSEvents.findEventTarget(target),
  6440. allowsDeferredCalls: false,
  6441. eventTypeString: eventTypeString,
  6442. callbackfunc: callbackfunc,
  6443. handlerFunc: handlerFunc,
  6444. useCapture: useCapture
  6445. };
  6446. JSEvents.registerOrRemoveHandler(eventHandler);
  6447. },tick:function () {
  6448. if (window['performance'] && window['performance']['now']) return window['performance']['now']();
  6449. else return Date.now();
  6450. },registerDeviceOrientationEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
  6451. if (!JSEvents.deviceOrientationEvent) {
  6452. JSEvents.deviceOrientationEvent = _malloc( 40 );
  6453. }
  6454. var handlerFunc = function(event) {
  6455. var e = event || window.event;
  6456. HEAPF64[((JSEvents.deviceOrientationEvent)>>3)]=JSEvents.tick();
  6457. HEAPF64[(((JSEvents.deviceOrientationEvent)+(8))>>3)]=e.alpha;
  6458. HEAPF64[(((JSEvents.deviceOrientationEvent)+(16))>>3)]=e.beta;
  6459. HEAPF64[(((JSEvents.deviceOrientationEvent)+(24))>>3)]=e.gamma;
  6460. HEAP32[(((JSEvents.deviceOrientationEvent)+(32))>>2)]=e.absolute;
  6461. var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.deviceOrientationEvent, userData);
  6462. if (shouldCancel) {
  6463. e.preventDefault();
  6464. }
  6465. };
  6466. var eventHandler = {
  6467. target: JSEvents.findEventTarget(target),
  6468. allowsDeferredCalls: false,
  6469. eventTypeString: eventTypeString,
  6470. callbackfunc: callbackfunc,
  6471. handlerFunc: handlerFunc,
  6472. useCapture: useCapture
  6473. };
  6474. JSEvents.registerOrRemoveHandler(eventHandler);
  6475. },registerDeviceMotionEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
  6476. if (!JSEvents.deviceMotionEvent) {
  6477. JSEvents.deviceMotionEvent = _malloc( 80 );
  6478. }
  6479. var handlerFunc = function(event) {
  6480. var e = event || window.event;
  6481. HEAPF64[((JSEvents.deviceOrientationEvent)>>3)]=JSEvents.tick();
  6482. HEAPF64[(((JSEvents.deviceMotionEvent)+(8))>>3)]=e.acceleration.x;
  6483. HEAPF64[(((JSEvents.deviceMotionEvent)+(16))>>3)]=e.acceleration.y;
  6484. HEAPF64[(((JSEvents.deviceMotionEvent)+(24))>>3)]=e.acceleration.z;
  6485. HEAPF64[(((JSEvents.deviceMotionEvent)+(32))>>3)]=e.accelerationIncludingGravity.x;
  6486. HEAPF64[(((JSEvents.deviceMotionEvent)+(40))>>3)]=e.accelerationIncludingGravity.y;
  6487. HEAPF64[(((JSEvents.deviceMotionEvent)+(48))>>3)]=e.accelerationIncludingGravity.z;
  6488. HEAPF64[(((JSEvents.deviceMotionEvent)+(56))>>3)]=e.rotationRate.alpha;
  6489. HEAPF64[(((JSEvents.deviceMotionEvent)+(64))>>3)]=e.rotationRate.beta;
  6490. HEAPF64[(((JSEvents.deviceMotionEvent)+(72))>>3)]=e.rotationRate.gamma;
  6491. var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.deviceMotionEvent, userData);
  6492. if (shouldCancel) {
  6493. e.preventDefault();
  6494. }
  6495. };
  6496. var eventHandler = {
  6497. target: JSEvents.findEventTarget(target),
  6498. allowsDeferredCalls: false,
  6499. eventTypeString: eventTypeString,
  6500. callbackfunc: callbackfunc,
  6501. handlerFunc: handlerFunc,
  6502. useCapture: useCapture
  6503. };
  6504. JSEvents.registerOrRemoveHandler(eventHandler);
  6505. },screenOrientation:function () {
  6506. if (!window.screen) return undefined;
  6507. return window.screen.orientation || window.screen.mozOrientation || window.screen.webkitOrientation || window.screen.msOrientation;
  6508. },fillOrientationChangeEventData:function (eventStruct, e) {
  6509. var orientations = ["portrait-primary", "portrait-secondary", "landscape-primary", "landscape-secondary"];
  6510. var orientations2 = ["portrait", "portrait", "landscape", "landscape"];
  6511. var orientationString = JSEvents.screenOrientation();
  6512. var orientation = orientations.indexOf(orientationString);
  6513. if (orientation == -1) {
  6514. orientation = orientations2.indexOf(orientationString);
  6515. }
  6516. HEAP32[((eventStruct)>>2)]=1 << orientation;
  6517. HEAP32[(((eventStruct)+(4))>>2)]=window.orientation;
  6518. },registerOrientationChangeEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
  6519. if (!JSEvents.orientationChangeEvent) {
  6520. JSEvents.orientationChangeEvent = _malloc( 8 );
  6521. }
  6522. if (!target) {
  6523. target = window.screen; // Orientation events need to be captured from 'window.screen' instead of 'window'
  6524. } else {
  6525. target = JSEvents.findEventTarget(target);
  6526. }
  6527. var handlerFunc = function(event) {
  6528. var e = event || window.event;
  6529. JSEvents.fillOrientationChangeEventData(JSEvents.orientationChangeEvent, e);
  6530. var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.orientationChangeEvent, userData);
  6531. if (shouldCancel) {
  6532. e.preventDefault();
  6533. }
  6534. };
  6535. if (eventTypeString == "orientationchange" && window.screen.mozOrientation !== undefined) {
  6536. eventTypeString = "mozorientationchange";
  6537. }
  6538. var eventHandler = {
  6539. target: target,
  6540. allowsDeferredCalls: false,
  6541. eventTypeString: eventTypeString,
  6542. callbackfunc: callbackfunc,
  6543. handlerFunc: handlerFunc,
  6544. useCapture: useCapture
  6545. };
  6546. JSEvents.registerOrRemoveHandler(eventHandler);
  6547. },fullscreenEnabled:function () {
  6548. return document.fullscreenEnabled || document.mozFullScreenEnabled || document.webkitFullscreenEnabled || document.msFullscreenEnabled;
  6549. },fillFullscreenChangeEventData:function (eventStruct, e) {
  6550. var fullscreenElement = document.fullscreenElement || document.mozFullScreenElement || document.webkitFullscreenElement || document.msFullscreenElement;
  6551. var isFullscreen = !!fullscreenElement;
  6552. HEAP32[((eventStruct)>>2)]=isFullscreen;
  6553. HEAP32[(((eventStruct)+(4))>>2)]=JSEvents.fullscreenEnabled();
  6554. // If transitioning to fullscreen, report info about the element that is now fullscreen.
  6555. // If transitioning to windowed mode, report info about the element that just was fullscreen.
  6556. var reportedElement = isFullscreen ? fullscreenElement : JSEvents.previousFullscreenElement;
  6557. var nodeName = JSEvents.getNodeNameForTarget(reportedElement);
  6558. var id = (reportedElement && reportedElement.id) ? reportedElement.id : '';
  6559. stringToUTF8(nodeName, eventStruct + 8, 128);
  6560. stringToUTF8(id, eventStruct + 136, 128);
  6561. HEAP32[(((eventStruct)+(264))>>2)]=reportedElement ? reportedElement.clientWidth : 0;
  6562. HEAP32[(((eventStruct)+(268))>>2)]=reportedElement ? reportedElement.clientHeight : 0;
  6563. HEAP32[(((eventStruct)+(272))>>2)]=screen.width;
  6564. HEAP32[(((eventStruct)+(276))>>2)]=screen.height;
  6565. if (isFullscreen) {
  6566. JSEvents.previousFullscreenElement = fullscreenElement;
  6567. }
  6568. },registerFullscreenChangeEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
  6569. if (!JSEvents.fullscreenChangeEvent) {
  6570. JSEvents.fullscreenChangeEvent = _malloc( 280 );
  6571. }
  6572. if (!target) {
  6573. target = document; // Fullscreen change events need to be captured from 'document' by default instead of 'window'
  6574. } else {
  6575. target = JSEvents.findEventTarget(target);
  6576. }
  6577. var handlerFunc = function(event) {
  6578. var e = event || window.event;
  6579. JSEvents.fillFullscreenChangeEventData(JSEvents.fullscreenChangeEvent, e);
  6580. var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.fullscreenChangeEvent, userData);
  6581. if (shouldCancel) {
  6582. e.preventDefault();
  6583. }
  6584. };
  6585. var eventHandler = {
  6586. target: target,
  6587. allowsDeferredCalls: false,
  6588. eventTypeString: eventTypeString,
  6589. callbackfunc: callbackfunc,
  6590. handlerFunc: handlerFunc,
  6591. useCapture: useCapture
  6592. };
  6593. JSEvents.registerOrRemoveHandler(eventHandler);
  6594. },resizeCanvasForFullscreen:function (target, strategy) {
  6595. var restoreOldStyle = __registerRestoreOldStyle(target);
  6596. var cssWidth = strategy.softFullscreen ? window.innerWidth : screen.width;
  6597. var cssHeight = strategy.softFullscreen ? window.innerHeight : screen.height;
  6598. var rect = target.getBoundingClientRect();
  6599. var windowedCssWidth = rect.right - rect.left;
  6600. var windowedCssHeight = rect.bottom - rect.top;
  6601. var windowedRttWidth = target.width;
  6602. var windowedRttHeight = target.height;
  6603. if (strategy.scaleMode == 3) {
  6604. __setLetterbox(target, (cssHeight - windowedCssHeight) / 2, (cssWidth - windowedCssWidth) / 2);
  6605. cssWidth = windowedCssWidth;
  6606. cssHeight = windowedCssHeight;
  6607. } else if (strategy.scaleMode == 2) {
  6608. if (cssWidth*windowedRttHeight < windowedRttWidth*cssHeight) {
  6609. var desiredCssHeight = windowedRttHeight * cssWidth / windowedRttWidth;
  6610. __setLetterbox(target, (cssHeight - desiredCssHeight) / 2, 0);
  6611. cssHeight = desiredCssHeight;
  6612. } else {
  6613. var desiredCssWidth = windowedRttWidth * cssHeight / windowedRttHeight;
  6614. __setLetterbox(target, 0, (cssWidth - desiredCssWidth) / 2);
  6615. cssWidth = desiredCssWidth;
  6616. }
  6617. }
  6618. // If we are adding padding, must choose a background color or otherwise Chrome will give the
  6619. // padding a default white color. Do it only if user has not customized their own background color.
  6620. if (!target.style.backgroundColor) target.style.backgroundColor = 'black';
  6621. // IE11 does the same, but requires the color to be set in the document body.
  6622. if (!document.body.style.backgroundColor) document.body.style.backgroundColor = 'black'; // IE11
  6623. // Firefox always shows black letterboxes independent of style color.
  6624. target.style.width = cssWidth + 'px';
  6625. target.style.height = cssHeight + 'px';
  6626. if (strategy.filteringMode == 1) {
  6627. target.style.imageRendering = 'optimizeSpeed';
  6628. target.style.imageRendering = '-moz-crisp-edges';
  6629. target.style.imageRendering = '-o-crisp-edges';
  6630. target.style.imageRendering = '-webkit-optimize-contrast';
  6631. target.style.imageRendering = 'optimize-contrast';
  6632. target.style.imageRendering = 'crisp-edges';
  6633. target.style.imageRendering = 'pixelated';
  6634. }
  6635. var dpiScale = (strategy.canvasResolutionScaleMode == 2) ? window.devicePixelRatio : 1;
  6636. if (strategy.canvasResolutionScaleMode != 0) {
  6637. target.width = cssWidth * dpiScale;
  6638. target.height = cssHeight * dpiScale;
  6639. if (target.GLctxObject) target.GLctxObject.GLctx.viewport(0, 0, target.width, target.height);
  6640. }
  6641. return restoreOldStyle;
  6642. },requestFullscreen:function (target, strategy) {
  6643. // EMSCRIPTEN_FULLSCREEN_SCALE_DEFAULT + EMSCRIPTEN_FULLSCREEN_CANVAS_SCALE_NONE is a mode where no extra logic is performed to the DOM elements.
  6644. if (strategy.scaleMode != 0 || strategy.canvasResolutionScaleMode != 0) {
  6645. JSEvents.resizeCanvasForFullscreen(target, strategy);
  6646. }
  6647. if (target.requestFullscreen) {
  6648. target.requestFullscreen();
  6649. } else if (target.msRequestFullscreen) {
  6650. target.msRequestFullscreen();
  6651. } else if (target.mozRequestFullScreen) {
  6652. target.mozRequestFullScreen();
  6653. } else if (target.mozRequestFullscreen) {
  6654. target.mozRequestFullscreen();
  6655. } else if (target.webkitRequestFullscreen) {
  6656. target.webkitRequestFullscreen(Element.ALLOW_KEYBOARD_INPUT);
  6657. } else {
  6658. if (typeof JSEvents.fullscreenEnabled() === 'undefined') {
  6659. return -1;
  6660. } else {
  6661. return -3;
  6662. }
  6663. }
  6664. if (strategy.canvasResizedCallback) {
  6665. Module['dynCall_iiii'](strategy.canvasResizedCallback, 37, 0, strategy.canvasResizedCallbackUserData);
  6666. }
  6667. return 0;
  6668. },fillPointerlockChangeEventData:function (eventStruct, e) {
  6669. var pointerLockElement = document.pointerLockElement || document.mozPointerLockElement || document.webkitPointerLockElement || document.msPointerLockElement;
  6670. var isPointerlocked = !!pointerLockElement;
  6671. HEAP32[((eventStruct)>>2)]=isPointerlocked;
  6672. var nodeName = JSEvents.getNodeNameForTarget(pointerLockElement);
  6673. var id = (pointerLockElement && pointerLockElement.id) ? pointerLockElement.id : '';
  6674. stringToUTF8(nodeName, eventStruct + 4, 128);
  6675. stringToUTF8(id, eventStruct + 132, 128);
  6676. },registerPointerlockChangeEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
  6677. if (!JSEvents.pointerlockChangeEvent) {
  6678. JSEvents.pointerlockChangeEvent = _malloc( 260 );
  6679. }
  6680. if (!target) {
  6681. target = document; // Pointer lock change events need to be captured from 'document' by default instead of 'window'
  6682. } else {
  6683. target = JSEvents.findEventTarget(target);
  6684. }
  6685. var handlerFunc = function(event) {
  6686. var e = event || window.event;
  6687. JSEvents.fillPointerlockChangeEventData(JSEvents.pointerlockChangeEvent, e);
  6688. var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.pointerlockChangeEvent, userData);
  6689. if (shouldCancel) {
  6690. e.preventDefault();
  6691. }
  6692. };
  6693. var eventHandler = {
  6694. target: target,
  6695. allowsDeferredCalls: false,
  6696. eventTypeString: eventTypeString,
  6697. callbackfunc: callbackfunc,
  6698. handlerFunc: handlerFunc,
  6699. useCapture: useCapture
  6700. };
  6701. JSEvents.registerOrRemoveHandler(eventHandler);
  6702. },registerPointerlockErrorEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
  6703. if (!target) {
  6704. target = document; // Pointer lock events need to be captured from 'document' by default instead of 'window'
  6705. } else {
  6706. target = JSEvents.findEventTarget(target);
  6707. }
  6708. var handlerFunc = function(event) {
  6709. var e = event || window.event;
  6710. var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, 0, userData);
  6711. if (shouldCancel) {
  6712. e.preventDefault();
  6713. }
  6714. };
  6715. var eventHandler = {
  6716. target: target,
  6717. allowsDeferredCalls: false,
  6718. eventTypeString: eventTypeString,
  6719. callbackfunc: callbackfunc,
  6720. handlerFunc: handlerFunc,
  6721. useCapture: useCapture
  6722. };
  6723. JSEvents.registerOrRemoveHandler(eventHandler);
  6724. },requestPointerLock:function (target) {
  6725. if (target.requestPointerLock) {
  6726. target.requestPointerLock();
  6727. } else if (target.mozRequestPointerLock) {
  6728. target.mozRequestPointerLock();
  6729. } else if (target.webkitRequestPointerLock) {
  6730. target.webkitRequestPointerLock();
  6731. } else if (target.msRequestPointerLock) {
  6732. target.msRequestPointerLock();
  6733. } else {
  6734. // document.body is known to accept pointer lock, so use that to differentiate if the user passed a bad element,
  6735. // or if the whole browser just doesn't support the feature.
  6736. if (document.body.requestPointerLock || document.body.mozRequestPointerLock || document.body.webkitRequestPointerLock || document.body.msRequestPointerLock) {
  6737. return -3;
  6738. } else {
  6739. return -1;
  6740. }
  6741. }
  6742. return 0;
  6743. },fillVisibilityChangeEventData:function (eventStruct, e) {
  6744. var visibilityStates = [ "hidden", "visible", "prerender", "unloaded" ];
  6745. var visibilityState = visibilityStates.indexOf(document.visibilityState);
  6746. HEAP32[((eventStruct)>>2)]=document.hidden;
  6747. HEAP32[(((eventStruct)+(4))>>2)]=visibilityState;
  6748. },registerVisibilityChangeEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
  6749. if (!JSEvents.visibilityChangeEvent) {
  6750. JSEvents.visibilityChangeEvent = _malloc( 8 );
  6751. }
  6752. if (!target) {
  6753. target = document; // Visibility change events need to be captured from 'document' by default instead of 'window'
  6754. } else {
  6755. target = JSEvents.findEventTarget(target);
  6756. }
  6757. var handlerFunc = function(event) {
  6758. var e = event || window.event;
  6759. JSEvents.fillVisibilityChangeEventData(JSEvents.visibilityChangeEvent, e);
  6760. var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.visibilityChangeEvent, userData);
  6761. if (shouldCancel) {
  6762. e.preventDefault();
  6763. }
  6764. };
  6765. var eventHandler = {
  6766. target: target,
  6767. allowsDeferredCalls: false,
  6768. eventTypeString: eventTypeString,
  6769. callbackfunc: callbackfunc,
  6770. handlerFunc: handlerFunc,
  6771. useCapture: useCapture
  6772. };
  6773. JSEvents.registerOrRemoveHandler(eventHandler);
  6774. },registerTouchEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
  6775. if (!JSEvents.touchEvent) {
  6776. JSEvents.touchEvent = _malloc( 1684 );
  6777. }
  6778. target = JSEvents.findEventTarget(target);
  6779. var handlerFunc = function(event) {
  6780. var e = event || window.event;
  6781. var touches = {};
  6782. for(var i = 0; i < e.touches.length; ++i) {
  6783. var touch = e.touches[i];
  6784. touches[touch.identifier] = touch;
  6785. }
  6786. for(var i = 0; i < e.changedTouches.length; ++i) {
  6787. var touch = e.changedTouches[i];
  6788. touches[touch.identifier] = touch;
  6789. touch.changed = true;
  6790. }
  6791. for(var i = 0; i < e.targetTouches.length; ++i) {
  6792. var touch = e.targetTouches[i];
  6793. touches[touch.identifier].onTarget = true;
  6794. }
  6795. var ptr = JSEvents.touchEvent;
  6796. HEAP32[(((ptr)+(4))>>2)]=e.ctrlKey;
  6797. HEAP32[(((ptr)+(8))>>2)]=e.shiftKey;
  6798. HEAP32[(((ptr)+(12))>>2)]=e.altKey;
  6799. HEAP32[(((ptr)+(16))>>2)]=e.metaKey;
  6800. ptr += 20; // Advance to the start of the touch array.
  6801. var canvasRect = Module['canvas'] ? Module['canvas'].getBoundingClientRect() : undefined;
  6802. var targetRect = JSEvents.getBoundingClientRectOrZeros(target);
  6803. var numTouches = 0;
  6804. for(var i in touches) {
  6805. var t = touches[i];
  6806. HEAP32[((ptr)>>2)]=t.identifier;
  6807. HEAP32[(((ptr)+(4))>>2)]=t.screenX;
  6808. HEAP32[(((ptr)+(8))>>2)]=t.screenY;
  6809. HEAP32[(((ptr)+(12))>>2)]=t.clientX;
  6810. HEAP32[(((ptr)+(16))>>2)]=t.clientY;
  6811. HEAP32[(((ptr)+(20))>>2)]=t.pageX;
  6812. HEAP32[(((ptr)+(24))>>2)]=t.pageY;
  6813. HEAP32[(((ptr)+(28))>>2)]=t.changed;
  6814. HEAP32[(((ptr)+(32))>>2)]=t.onTarget;
  6815. if (canvasRect) {
  6816. HEAP32[(((ptr)+(44))>>2)]=t.clientX - canvasRect.left;
  6817. HEAP32[(((ptr)+(48))>>2)]=t.clientY - canvasRect.top;
  6818. } else {
  6819. HEAP32[(((ptr)+(44))>>2)]=0;
  6820. HEAP32[(((ptr)+(48))>>2)]=0;
  6821. }
  6822. HEAP32[(((ptr)+(36))>>2)]=t.clientX - targetRect.left;
  6823. HEAP32[(((ptr)+(40))>>2)]=t.clientY - targetRect.top;
  6824. ptr += 52;
  6825. if (++numTouches >= 32) {
  6826. break;
  6827. }
  6828. }
  6829. HEAP32[((JSEvents.touchEvent)>>2)]=numTouches;
  6830. var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.touchEvent, userData);
  6831. if (shouldCancel) {
  6832. e.preventDefault();
  6833. }
  6834. };
  6835. var eventHandler = {
  6836. target: target,
  6837. allowsDeferredCalls: false, // XXX Currently disabled, see bug https://bugzilla.mozilla.org/show_bug.cgi?id=966493
  6838. // Once the above bug is resolved, enable the following condition if possible:
  6839. // allowsDeferredCalls: eventTypeString == 'touchstart',
  6840. eventTypeString: eventTypeString,
  6841. callbackfunc: callbackfunc,
  6842. handlerFunc: handlerFunc,
  6843. useCapture: useCapture
  6844. };
  6845. JSEvents.registerOrRemoveHandler(eventHandler);
  6846. },fillGamepadEventData:function (eventStruct, e) {
  6847. HEAPF64[((eventStruct)>>3)]=e.timestamp;
  6848. for(var i = 0; i < e.axes.length; ++i) {
  6849. HEAPF64[(((eventStruct+i*8)+(16))>>3)]=e.axes[i];
  6850. }
  6851. for(var i = 0; i < e.buttons.length; ++i) {
  6852. if (typeof(e.buttons[i]) === 'object') {
  6853. HEAPF64[(((eventStruct+i*8)+(528))>>3)]=e.buttons[i].value;
  6854. } else {
  6855. HEAPF64[(((eventStruct+i*8)+(528))>>3)]=e.buttons[i];
  6856. }
  6857. }
  6858. for(var i = 0; i < e.buttons.length; ++i) {
  6859. if (typeof(e.buttons[i]) === 'object') {
  6860. HEAP32[(((eventStruct+i*4)+(1040))>>2)]=e.buttons[i].pressed;
  6861. } else {
  6862. HEAP32[(((eventStruct+i*4)+(1040))>>2)]=e.buttons[i] == 1.0;
  6863. }
  6864. }
  6865. HEAP32[(((eventStruct)+(1296))>>2)]=e.connected;
  6866. HEAP32[(((eventStruct)+(1300))>>2)]=e.index;
  6867. HEAP32[(((eventStruct)+(8))>>2)]=e.axes.length;
  6868. HEAP32[(((eventStruct)+(12))>>2)]=e.buttons.length;
  6869. stringToUTF8(e.id, eventStruct + 1304, 64);
  6870. stringToUTF8(e.mapping, eventStruct + 1368, 64);
  6871. },registerGamepadEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
  6872. if (!JSEvents.gamepadEvent) {
  6873. JSEvents.gamepadEvent = _malloc( 1432 );
  6874. }
  6875. var handlerFunc = function(event) {
  6876. var e = event || window.event;
  6877. JSEvents.fillGamepadEventData(JSEvents.gamepadEvent, e.gamepad);
  6878. var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.gamepadEvent, userData);
  6879. if (shouldCancel) {
  6880. e.preventDefault();
  6881. }
  6882. };
  6883. var eventHandler = {
  6884. target: JSEvents.findEventTarget(target),
  6885. allowsDeferredCalls: true,
  6886. eventTypeString: eventTypeString,
  6887. callbackfunc: callbackfunc,
  6888. handlerFunc: handlerFunc,
  6889. useCapture: useCapture
  6890. };
  6891. JSEvents.registerOrRemoveHandler(eventHandler);
  6892. },registerBeforeUnloadEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
  6893. var handlerFunc = function(event) {
  6894. var e = event || window.event;
  6895. var confirmationMessage = Module['dynCall_iiii'](callbackfunc, eventTypeId, 0, userData);
  6896. if (confirmationMessage) {
  6897. confirmationMessage = Pointer_stringify(confirmationMessage);
  6898. }
  6899. if (confirmationMessage) {
  6900. e.preventDefault();
  6901. e.returnValue = confirmationMessage;
  6902. return confirmationMessage;
  6903. }
  6904. };
  6905. var eventHandler = {
  6906. target: JSEvents.findEventTarget(target),
  6907. allowsDeferredCalls: false,
  6908. eventTypeString: eventTypeString,
  6909. callbackfunc: callbackfunc,
  6910. handlerFunc: handlerFunc,
  6911. useCapture: useCapture
  6912. };
  6913. JSEvents.registerOrRemoveHandler(eventHandler);
  6914. },battery:function () { return navigator.battery || navigator.mozBattery || navigator.webkitBattery; },fillBatteryEventData:function (eventStruct, e) {
  6915. HEAPF64[((eventStruct)>>3)]=e.chargingTime;
  6916. HEAPF64[(((eventStruct)+(8))>>3)]=e.dischargingTime;
  6917. HEAPF64[(((eventStruct)+(16))>>3)]=e.level;
  6918. HEAP32[(((eventStruct)+(24))>>2)]=e.charging;
  6919. },registerBatteryEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
  6920. if (!JSEvents.batteryEvent) {
  6921. JSEvents.batteryEvent = _malloc( 32 );
  6922. }
  6923. var handlerFunc = function(event) {
  6924. var e = event || window.event;
  6925. JSEvents.fillBatteryEventData(JSEvents.batteryEvent, JSEvents.battery());
  6926. var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.batteryEvent, userData);
  6927. if (shouldCancel) {
  6928. e.preventDefault();
  6929. }
  6930. };
  6931. var eventHandler = {
  6932. target: JSEvents.findEventTarget(target),
  6933. allowsDeferredCalls: false,
  6934. eventTypeString: eventTypeString,
  6935. callbackfunc: callbackfunc,
  6936. handlerFunc: handlerFunc,
  6937. useCapture: useCapture
  6938. };
  6939. JSEvents.registerOrRemoveHandler(eventHandler);
  6940. },registerWebGlEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
  6941. if (!target) {
  6942. target = Module['canvas'];
  6943. }
  6944. var handlerFunc = function(event) {
  6945. var e = event || window.event;
  6946. var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, 0, userData);
  6947. if (shouldCancel) {
  6948. e.preventDefault();
  6949. }
  6950. };
  6951. var eventHandler = {
  6952. target: JSEvents.findEventTarget(target),
  6953. allowsDeferredCalls: false,
  6954. eventTypeString: eventTypeString,
  6955. callbackfunc: callbackfunc,
  6956. handlerFunc: handlerFunc,
  6957. useCapture: useCapture
  6958. };
  6959. JSEvents.registerOrRemoveHandler(eventHandler);
  6960. }};function __emscripten_sample_gamepad_data() {
  6961. // Polling gamepads generates garbage, so don't do it when we know there are no gamepads connected.
  6962. if (!JSEvents.numGamepadsConnected) return;
  6963. // Produce a new Gamepad API sample if we are ticking a new game frame, or if not using emscripten_set_main_loop() at all to drive animation.
  6964. if (Browser.mainLoop.currentFrameNumber !== JSEvents.lastGamepadStateFrame || !Browser.mainLoop.currentFrameNumber) {
  6965. JSEvents.lastGamepadState = navigator.getGamepads ? navigator.getGamepads() : (navigator.webkitGetGamepads ? navigator.webkitGetGamepads : null);
  6966. JSEvents.lastGamepadStateFrame = Browser.mainLoop.currentFrameNumber;
  6967. }
  6968. }function _emscripten_get_gamepad_status(index, gamepadState) {
  6969. __emscripten_sample_gamepad_data();
  6970. if (!JSEvents.lastGamepadState) return -1;
  6971. // INVALID_PARAM is returned on a Gamepad index that never was there.
  6972. if (index < 0 || index >= JSEvents.lastGamepadState.length) return -5;
  6973. // NO_DATA is returned on a Gamepad index that was removed.
  6974. // For previously disconnected gamepads there should be an empty slot (null/undefined/false) at the index.
  6975. // This is because gamepads must keep their original position in the array.
  6976. // For example, removing the first of two gamepads produces [null/undefined/false, gamepad].
  6977. if (!JSEvents.lastGamepadState[index]) return -7;
  6978. JSEvents.fillGamepadEventData(gamepadState, JSEvents.lastGamepadState[index]);
  6979. return 0;
  6980. }
  6981. function _emscripten_glCopyTexImage2D(x0, x1, x2, x3, x4, x5, x6, x7) { GLctx['copyTexImage2D'](x0, x1, x2, x3, x4, x5, x6, x7) }
  6982. function _emscripten_glTexParameterfv(target, pname, params) {
  6983. var param = HEAPF32[((params)>>2)];
  6984. GLctx.texParameterf(target, pname, param);
  6985. }
  6986. function _emscripten_glLinkProgram(program) {
  6987. GLctx.linkProgram(GL.programs[program]);
  6988. GL.programInfos[program] = null; // uniforms no longer keep the same names after linking
  6989. GL.populateUniformTable(program);
  6990. }
  6991. function _glUniform1f(location, v0) {
  6992. GLctx.uniform1f(GL.uniforms[location], v0);
  6993. }
  6994. function _emscripten_glUniform3f(location, v0, v1, v2) {
  6995. GLctx.uniform3f(GL.uniforms[location], v0, v1, v2);
  6996. }
  6997. function _emscripten_glGetObjectParameterivARB() {
  6998. Module['printErr']('missing function: emscripten_glGetObjectParameterivARB'); abort(-1);
  6999. }
  7000. function _emscripten_glBlendFunc(x0, x1) { GLctx['blendFunc'](x0, x1) }
  7001. function _emscripten_glUniform3i(location, v0, v1, v2) {
  7002. GLctx.uniform3i(GL.uniforms[location], v0, v1, v2);
  7003. }
  7004. function _emscripten_glStencilOp(x0, x1, x2) { GLctx['stencilOp'](x0, x1, x2) }
  7005. function _glCreateShader(shaderType) {
  7006. var id = GL.getNewId(GL.shaders);
  7007. GL.shaders[id] = GLctx.createShader(shaderType);
  7008. return id;
  7009. }
  7010. function _glUniform1i(location, v0) {
  7011. GLctx.uniform1i(GL.uniforms[location], v0);
  7012. }
  7013. function _emscripten_glBindAttribLocation(program, index, name) {
  7014. name = Pointer_stringify(name);
  7015. GLctx.bindAttribLocation(GL.programs[program], index, name);
  7016. }
  7017. function _glCompressedTexImage2D(target, level, internalFormat, width, height, border, imageSize, data) {
  7018. GLctx['compressedTexImage2D'](target, level, internalFormat, width, height, border, data ? HEAPU8.subarray((data),(data+imageSize)) : null);
  7019. }
  7020. function _glDisable(x0) { GLctx['disable'](x0) }
  7021. function _emscripten_glEnableVertexAttribArray(index) {
  7022. GLctx.enableVertexAttribArray(index);
  7023. }
  7024. Module["_memset"] = _memset;
  7025. function _glfwMakeContextCurrent(winid) {}
  7026. function _emscripten_set_touchcancel_callback(target, userData, useCapture, callbackfunc) {
  7027. JSEvents.registerTouchEventCallback(target, userData, useCapture, callbackfunc, 25, "touchcancel");
  7028. return 0;
  7029. }
  7030. function ___lock() {}
  7031. function _emscripten_glBlendFuncSeparate(x0, x1, x2, x3) { GLctx['blendFuncSeparate'](x0, x1, x2, x3) }
  7032. function _glCullFace(x0) { GLctx['cullFace'](x0) }
  7033. function _emscripten_glGetVertexAttribPointerv(index, pname, pointer) {
  7034. if (!pointer) {
  7035. // GLES2 specification does not specify how to behave if pointer is a null pointer. Since calling this function does not make sense
  7036. // if pointer == null, issue a GL error to notify user about it.
  7037. GL.recordError(0x0501 /* GL_INVALID_VALUE */);
  7038. return;
  7039. }
  7040. HEAP32[((pointer)>>2)]=GLctx.getVertexAttribOffset(index, pname);
  7041. }
  7042. function _emscripten_glVertexAttrib3f(x0, x1, x2, x3) { GLctx['vertexAttrib3f'](x0, x1, x2, x3) }
  7043. function _emscripten_glEnable(x0) { GLctx['enable'](x0) }
  7044. function _emscripten_glNormalPointer() {
  7045. Module['printErr']('missing function: emscripten_glNormalPointer'); abort(-1);
  7046. }
  7047. var _emscripten_GetProcAddress=undefined;
  7048. Module["_emscripten_GetProcAddress"] = _emscripten_GetProcAddress;
  7049. var EGL={errorCode:12288,defaultDisplayInitialized:false,currentContext:0,currentReadSurface:0,currentDrawSurface:0,stringCache:{},setErrorCode:function (code) {
  7050. EGL.errorCode = code;
  7051. },chooseConfig:function (display, attribList, config, config_size, numConfigs) {
  7052. if (display != 62000 /* Magic ID for Emscripten 'default display' */) {
  7053. EGL.setErrorCode(0x3008 /* EGL_BAD_DISPLAY */);
  7054. return 0;
  7055. }
  7056. // TODO: read attribList.
  7057. if ((!config || !config_size) && !numConfigs) {
  7058. EGL.setErrorCode(0x300C /* EGL_BAD_PARAMETER */);
  7059. return 0;
  7060. }
  7061. if (numConfigs) {
  7062. HEAP32[((numConfigs)>>2)]=1; // Total number of supported configs: 1.
  7063. }
  7064. if (config && config_size > 0) {
  7065. HEAP32[((config)>>2)]=62002;
  7066. }
  7067. EGL.setErrorCode(0x3000 /* EGL_SUCCESS */);
  7068. return 1;
  7069. }};function _eglGetProcAddress(name_) {
  7070. return _emscripten_GetProcAddress(name_);
  7071. }
  7072. function _glDeleteProgram(id) {
  7073. if (!id) return;
  7074. var program = GL.programs[id];
  7075. if (!program) { // glDeleteProgram actually signals an error when deleting a nonexisting object, unlike some other GL delete functions.
  7076. GL.recordError(0x0501 /* GL_INVALID_VALUE */);
  7077. return;
  7078. }
  7079. GLctx.deleteProgram(program);
  7080. program.name = 0;
  7081. GL.programs[id] = null;
  7082. GL.programInfos[id] = null;
  7083. }
  7084. function _emscripten_get_pointerlock_status(pointerlockStatus) {
  7085. if (pointerlockStatus) JSEvents.fillPointerlockChangeEventData(pointerlockStatus);
  7086. if (!document.body || (!document.body.requestPointerLock && !document.body.mozRequestPointerLock && !document.body.webkitRequestPointerLock && !document.body.msRequestPointerLock)) {
  7087. return -1;
  7088. }
  7089. return 0;
  7090. }
  7091. function _glAttachShader(program, shader) {
  7092. GLctx.attachShader(GL.programs[program],
  7093. GL.shaders[shader]);
  7094. }
  7095. function _glfwGetPrimaryMonitor() {
  7096. return 1;
  7097. }
  7098. function emscriptenWebGLGetVertexAttrib(index, pname, params, type) {
  7099. if (!params) {
  7100. // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
  7101. // if params == null, issue a GL error to notify user about it.
  7102. GL.recordError(0x0501 /* GL_INVALID_VALUE */);
  7103. return;
  7104. }
  7105. var data = GLctx.getVertexAttrib(index, pname);
  7106. if (pname == 0x889F/*VERTEX_ATTRIB_ARRAY_BUFFER_BINDING*/) {
  7107. HEAP32[((params)>>2)]=data["name"];
  7108. } else if (typeof data == 'number' || typeof data == 'boolean') {
  7109. switch (type) {
  7110. case 'Integer': HEAP32[((params)>>2)]=data; break;
  7111. case 'Float': HEAPF32[((params)>>2)]=data; break;
  7112. case 'FloatToInteger': HEAP32[((params)>>2)]=Math.fround(data); break;
  7113. default: throw 'internal emscriptenWebGLGetVertexAttrib() error, bad type: ' + type;
  7114. }
  7115. } else {
  7116. for (var i = 0; i < data.length; i++) {
  7117. switch (type) {
  7118. case 'Integer': HEAP32[(((params)+(i))>>2)]=data[i]; break;
  7119. case 'Float': HEAPF32[(((params)+(i))>>2)]=data[i]; break;
  7120. case 'FloatToInteger': HEAP32[(((params)+(i))>>2)]=Math.fround(data[i]); break;
  7121. default: throw 'internal emscriptenWebGLGetVertexAttrib() error, bad type: ' + type;
  7122. }
  7123. }
  7124. }
  7125. }function _emscripten_glGetVertexAttribfv(index, pname, params) {
  7126. // N.B. This function may only be called if the vertex attribute was specified using the function glVertexAttrib*f(),
  7127. // otherwise the results are undefined. (GLES3 spec 6.1.12)
  7128. emscriptenWebGLGetVertexAttrib(index, pname, params, 'Float');
  7129. }
  7130. function _emscripten_set_touchstart_callback(target, userData, useCapture, callbackfunc) {
  7131. JSEvents.registerTouchEventCallback(target, userData, useCapture, callbackfunc, 22, "touchstart");
  7132. return 0;
  7133. }
  7134. function _glUniform3f(location, v0, v1, v2) {
  7135. GLctx.uniform3f(GL.uniforms[location], v0, v1, v2);
  7136. }
  7137. function _emscripten_glVertexPointer(){ throw 'Legacy GL function (glVertexPointer) called. If you want legacy GL emulation, you need to compile with -s LEGACY_GL_EMULATION=1 to enable legacy GL emulation.'; }
  7138. function _emscripten_glDeleteBuffers(n, buffers) {
  7139. for (var i = 0; i < n; i++) {
  7140. var id = HEAP32[(((buffers)+(i*4))>>2)];
  7141. var buffer = GL.buffers[id];
  7142. // From spec: "glDeleteBuffers silently ignores 0's and names that do not
  7143. // correspond to existing buffer objects."
  7144. if (!buffer) continue;
  7145. GLctx.deleteBuffer(buffer);
  7146. buffer.name = 0;
  7147. GL.buffers[id] = null;
  7148. if (id == GL.currArrayBuffer) GL.currArrayBuffer = 0;
  7149. if (id == GL.currElementArrayBuffer) GL.currElementArrayBuffer = 0;
  7150. }
  7151. }
  7152. function _emscripten_glTexParameteriv(target, pname, params) {
  7153. var param = HEAP32[((params)>>2)];
  7154. GLctx.texParameteri(target, pname, param);
  7155. }
  7156. function _glDrawElements(mode, count, type, indices) {
  7157. GLctx.drawElements(mode, count, type, indices);
  7158. }
  7159. function _glfwTerminate() {
  7160. window.removeEventListener("keydown", GLFW.onKeydown, true);
  7161. window.removeEventListener("keypress", GLFW.onKeyPress, true);
  7162. window.removeEventListener("keyup", GLFW.onKeyup, true);
  7163. Module["canvas"].removeEventListener("mousemove", GLFW.onMousemove, true);
  7164. Module["canvas"].removeEventListener("mousedown", GLFW.onMouseButtonDown, true);
  7165. Module["canvas"].removeEventListener("mouseup", GLFW.onMouseButtonUp, true);
  7166. Module["canvas"].removeEventListener('wheel', GLFW.onMouseWheel, true);
  7167. Module["canvas"].removeEventListener('mousewheel', GLFW.onMouseWheel, true);
  7168. Module["canvas"].removeEventListener('mouseenter', GLFW.onMouseenter, true);
  7169. Module["canvas"].removeEventListener('mouseleave', GLFW.onMouseleave, true);
  7170. Module["canvas"].width = Module["canvas"].height = 1;
  7171. GLFW.windows = null;
  7172. GLFW.active = null;
  7173. }
  7174. function _emscripten_glUniformMatrix2fv(location, count, transpose, value) {
  7175. var view;
  7176. if (4*count <= GL.MINI_TEMP_BUFFER_SIZE) {
  7177. // avoid allocation when uploading few enough uniforms
  7178. view = GL.miniTempBufferViews[4*count-1];
  7179. for (var i = 0; i < 4*count; i += 4) {
  7180. view[i] = HEAPF32[(((value)+(4*i))>>2)];
  7181. view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)];
  7182. view[i+2] = HEAPF32[(((value)+(4*i+8))>>2)];
  7183. view[i+3] = HEAPF32[(((value)+(4*i+12))>>2)];
  7184. }
  7185. } else {
  7186. view = HEAPF32.subarray((value)>>2,(value+count*16)>>2);
  7187. }
  7188. GLctx.uniformMatrix2fv(GL.uniforms[location], !!transpose, view);
  7189. }
  7190. function _emscripten_glDeleteShader(id) {
  7191. if (!id) return;
  7192. var shader = GL.shaders[id];
  7193. if (!shader) { // glDeleteShader actually signals an error when deleting a nonexisting object, unlike some other GL delete functions.
  7194. GL.recordError(0x0501 /* GL_INVALID_VALUE */);
  7195. return;
  7196. }
  7197. GLctx.deleteShader(shader);
  7198. GL.shaders[id] = null;
  7199. }
  7200. function ___syscall5(which, varargs) {SYSCALLS.varargs = varargs;
  7201. try {
  7202. // open
  7203. var pathname = SYSCALLS.getStr(), flags = SYSCALLS.get(), mode = SYSCALLS.get() // optional TODO
  7204. var stream = FS.open(pathname, flags, mode);
  7205. return stream.fd;
  7206. } catch (e) {
  7207. if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
  7208. return -e.errno;
  7209. }
  7210. }
  7211. function ___syscall6(which, varargs) {SYSCALLS.varargs = varargs;
  7212. try {
  7213. // close
  7214. var stream = SYSCALLS.getStreamFromFD();
  7215. FS.close(stream);
  7216. return 0;
  7217. } catch (e) {
  7218. if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
  7219. return -e.errno;
  7220. }
  7221. }
  7222. function _llvm_stacksave() {
  7223. var self = _llvm_stacksave;
  7224. if (!self.LLVM_SAVEDSTACKS) {
  7225. self.LLVM_SAVEDSTACKS = [];
  7226. }
  7227. self.LLVM_SAVEDSTACKS.push(Runtime.stackSave());
  7228. return self.LLVM_SAVEDSTACKS.length-1;
  7229. }
  7230. function _emscripten_glGetVertexAttribiv(index, pname, params) {
  7231. // N.B. This function may only be called if the vertex attribute was specified using the function glVertexAttrib*f(),
  7232. // otherwise the results are undefined. (GLES3 spec 6.1.12)
  7233. emscriptenWebGLGetVertexAttrib(index, pname, params, 'FloatToInteger');
  7234. }
  7235. function _emscripten_glUniformMatrix4fv(location, count, transpose, value) {
  7236. var view;
  7237. if (16*count <= GL.MINI_TEMP_BUFFER_SIZE) {
  7238. // avoid allocation when uploading few enough uniforms
  7239. view = GL.miniTempBufferViews[16*count-1];
  7240. for (var i = 0; i < 16*count; i += 16) {
  7241. view[i] = HEAPF32[(((value)+(4*i))>>2)];
  7242. view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)];
  7243. view[i+2] = HEAPF32[(((value)+(4*i+8))>>2)];
  7244. view[i+3] = HEAPF32[(((value)+(4*i+12))>>2)];
  7245. view[i+4] = HEAPF32[(((value)+(4*i+16))>>2)];
  7246. view[i+5] = HEAPF32[(((value)+(4*i+20))>>2)];
  7247. view[i+6] = HEAPF32[(((value)+(4*i+24))>>2)];
  7248. view[i+7] = HEAPF32[(((value)+(4*i+28))>>2)];
  7249. view[i+8] = HEAPF32[(((value)+(4*i+32))>>2)];
  7250. view[i+9] = HEAPF32[(((value)+(4*i+36))>>2)];
  7251. view[i+10] = HEAPF32[(((value)+(4*i+40))>>2)];
  7252. view[i+11] = HEAPF32[(((value)+(4*i+44))>>2)];
  7253. view[i+12] = HEAPF32[(((value)+(4*i+48))>>2)];
  7254. view[i+13] = HEAPF32[(((value)+(4*i+52))>>2)];
  7255. view[i+14] = HEAPF32[(((value)+(4*i+56))>>2)];
  7256. view[i+15] = HEAPF32[(((value)+(4*i+60))>>2)];
  7257. }
  7258. } else {
  7259. view = HEAPF32.subarray((value)>>2,(value+count*64)>>2);
  7260. }
  7261. GLctx.uniformMatrix4fv(GL.uniforms[location], !!transpose, view);
  7262. }
  7263. function _glVertexAttrib3f(x0, x1, x2, x3) { GLctx['vertexAttrib3f'](x0, x1, x2, x3) }
  7264. function _emscripten_glDrawArraysInstanced(mode, first, count, primcount) {
  7265. GLctx['drawArraysInstanced'](mode, first, count, primcount);
  7266. }
  7267. function _emscripten_glEnableClientState() {
  7268. Module['printErr']('missing function: emscripten_glEnableClientState'); abort(-1);
  7269. }
  7270. function _emscripten_glGetPointerv() {
  7271. Module['printErr']('missing function: emscripten_glGetPointerv'); abort(-1);
  7272. }
  7273. function ___syscall140(which, varargs) {SYSCALLS.varargs = varargs;
  7274. try {
  7275. // llseek
  7276. var stream = SYSCALLS.getStreamFromFD(), offset_high = SYSCALLS.get(), offset_low = SYSCALLS.get(), result = SYSCALLS.get(), whence = SYSCALLS.get();
  7277. var offset = offset_low;
  7278. assert(offset_high === 0);
  7279. FS.llseek(stream, offset, whence);
  7280. HEAP32[((result)>>2)]=stream.position;
  7281. if (stream.getdents && offset === 0 && whence === 0) stream.getdents = null; // reset readdir state
  7282. return 0;
  7283. } catch (e) {
  7284. if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
  7285. return -e.errno;
  7286. }
  7287. }
  7288. function ___syscall146(which, varargs) {SYSCALLS.varargs = varargs;
  7289. try {
  7290. // writev
  7291. var stream = SYSCALLS.getStreamFromFD(), iov = SYSCALLS.get(), iovcnt = SYSCALLS.get();
  7292. return SYSCALLS.doWritev(stream, iov, iovcnt);
  7293. } catch (e) {
  7294. if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
  7295. return -e.errno;
  7296. }
  7297. }
  7298. function ___syscall145(which, varargs) {SYSCALLS.varargs = varargs;
  7299. try {
  7300. // readv
  7301. var stream = SYSCALLS.getStreamFromFD(), iov = SYSCALLS.get(), iovcnt = SYSCALLS.get();
  7302. return SYSCALLS.doReadv(stream, iov, iovcnt);
  7303. } catch (e) {
  7304. if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
  7305. return -e.errno;
  7306. }
  7307. }
  7308. function _emscripten_glStencilMask(x0) { GLctx['stencilMask'](x0) }
  7309. function _emscripten_glStencilFuncSeparate(x0, x1, x2, x3) { GLctx['stencilFuncSeparate'](x0, x1, x2, x3) }
  7310. Module["_i64Subtract"] = _i64Subtract;
  7311. Module["_i64Add"] = _i64Add;
  7312. function _emscripten_set_touchend_callback(target, userData, useCapture, callbackfunc) {
  7313. JSEvents.registerTouchEventCallback(target, userData, useCapture, callbackfunc, 23, "touchend");
  7314. return 0;
  7315. }
  7316. function _glUseProgram(program) {
  7317. GLctx.useProgram(program ? GL.programs[program] : null);
  7318. }
  7319. function _emscripten_glDisableVertexAttribArray(index) {
  7320. GLctx.disableVertexAttribArray(index);
  7321. }
  7322. function _emscripten_glVertexAttrib1f(x0, x1) { GLctx['vertexAttrib1f'](x0, x1) }
  7323. function _emscripten_glFinish() { GLctx['finish']() }
  7324. function _glDrawArrays(mode, first, count) {
  7325. GLctx.drawArrays(mode, first, count);
  7326. }
  7327. function _emscripten_glDepthFunc(x0) { GLctx['depthFunc'](x0) }
  7328. function _emscripten_get_num_gamepads() {
  7329. // Polling gamepads generates garbage, so don't do it when we know there are no gamepads connected.
  7330. if (!JSEvents.numGamepadsConnected) return 0;
  7331. __emscripten_sample_gamepad_data();
  7332. if (!JSEvents.lastGamepadState) return -1;
  7333. return JSEvents.lastGamepadState.length;
  7334. }
  7335. function _glGetProgramInfoLog(program, maxLength, length, infoLog) {
  7336. var log = GLctx.getProgramInfoLog(GL.programs[program]);
  7337. if (log === null) log = '(unknown error)';
  7338. if (maxLength > 0 && infoLog) {
  7339. var numBytesWrittenExclNull = stringToUTF8(log, infoLog, maxLength);
  7340. if (length) HEAP32[((length)>>2)]=numBytesWrittenExclNull;
  7341. } else {
  7342. if (length) HEAP32[((length)>>2)]=0;
  7343. }
  7344. }
  7345. function _emscripten_glUniform4iv(location, count, value) {
  7346. GLctx.uniform4iv(GL.uniforms[location], HEAP32.subarray((value)>>2,(value+count*16)>>2));
  7347. }
  7348. function _glClear(x0) { GLctx['clear'](x0) }
  7349. function _emscripten_glLoadIdentity(){ throw 'Legacy GL function (glLoadIdentity) called. If you want legacy GL emulation, you need to compile with -s LEGACY_GL_EMULATION=1 to enable legacy GL emulation.'; }
  7350. function _emscripten_glUniform3fv(location, count, value) {
  7351. var view;
  7352. if (3*count <= GL.MINI_TEMP_BUFFER_SIZE) {
  7353. // avoid allocation when uploading few enough uniforms
  7354. view = GL.miniTempBufferViews[3*count-1];
  7355. for (var i = 0; i < 3*count; i += 3) {
  7356. view[i] = HEAPF32[(((value)+(4*i))>>2)];
  7357. view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)];
  7358. view[i+2] = HEAPF32[(((value)+(4*i+8))>>2)];
  7359. }
  7360. } else {
  7361. view = HEAPF32.subarray((value)>>2,(value+count*12)>>2);
  7362. }
  7363. GLctx.uniform3fv(GL.uniforms[location], view);
  7364. }
  7365. function _emscripten_glIsTexture(texture) {
  7366. var texture = GL.textures[texture];
  7367. if (!texture) return 0;
  7368. return GLctx.isTexture(texture);
  7369. }
  7370. function _glEnableVertexAttribArray(index) {
  7371. GLctx.enableVertexAttribArray(index);
  7372. }
  7373. function _emscripten_glAttachShader(program, shader) {
  7374. GLctx.attachShader(GL.programs[program],
  7375. GL.shaders[shader]);
  7376. }
  7377. function _glUniform4f(location, v0, v1, v2, v3) {
  7378. GLctx.uniform4f(GL.uniforms[location], v0, v1, v2, v3);
  7379. }
  7380. function _emscripten_request_pointerlock(target, deferUntilInEventHandler) {
  7381. if (!target) target = '#canvas';
  7382. target = JSEvents.findEventTarget(target);
  7383. if (!target) return -4;
  7384. if (!target.requestPointerLock && !target.mozRequestPointerLock && !target.webkitRequestPointerLock && !target.msRequestPointerLock) {
  7385. return -1;
  7386. }
  7387. var canPerformRequests = JSEvents.canPerformEventHandlerRequests();
  7388. // Queue this function call if we're not currently in an event handler and the user saw it appropriate to do so.
  7389. if (!canPerformRequests) {
  7390. if (deferUntilInEventHandler) {
  7391. JSEvents.deferCall(JSEvents.requestPointerLock, 2 /* priority below fullscreen */, [target]);
  7392. return 1;
  7393. } else {
  7394. return -2;
  7395. }
  7396. }
  7397. return JSEvents.requestPointerLock(target);
  7398. }
  7399. var cttz_i8 = allocate([8,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,5,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,6,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,5,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,7,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,5,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,6,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,5,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0], "i8", ALLOC_STATIC);
  7400. Module["_llvm_cttz_i32"] = _llvm_cttz_i32;
  7401. Module["___udivmoddi4"] = ___udivmoddi4;
  7402. Module["___udivdi3"] = ___udivdi3;
  7403. function _glfwCreateWindow(width, height, title, monitor, share) {
  7404. return GLFW.createWindow(width, height, title, monitor, share);
  7405. }
  7406. function _glfwDefaultWindowHints() {
  7407. GLFW.hints = GLFW.defaultHints;
  7408. }
  7409. function _emscripten_glClearStencil(x0) { GLctx['clearStencil'](x0) }
  7410. function _emscripten_glDetachShader(program, shader) {
  7411. GLctx.detachShader(GL.programs[program],
  7412. GL.shaders[shader]);
  7413. }
  7414. function _emscripten_glDeleteVertexArrays(n, vaos) {
  7415. for (var i = 0; i < n; i++) {
  7416. var id = HEAP32[(((vaos)+(i*4))>>2)];
  7417. GLctx['deleteVertexArray'](GL.vaos[id]);
  7418. GL.vaos[id] = null;
  7419. }
  7420. }
  7421. function _glfwInit() {
  7422. if (GLFW.windows) return 1; // GL_TRUE
  7423. GLFW.initialTime = GLFW.getTime();
  7424. GLFW.hints = GLFW.defaultHints;
  7425. GLFW.windows = new Array()
  7426. GLFW.active = null;
  7427. window.addEventListener("keydown", GLFW.onKeydown, true);
  7428. window.addEventListener("keypress", GLFW.onKeyPress, true);
  7429. window.addEventListener("keyup", GLFW.onKeyup, true);
  7430. Module["canvas"].addEventListener("mousemove", GLFW.onMousemove, true);
  7431. Module["canvas"].addEventListener("mousedown", GLFW.onMouseButtonDown, true);
  7432. Module["canvas"].addEventListener("mouseup", GLFW.onMouseButtonUp, true);
  7433. Module["canvas"].addEventListener('wheel', GLFW.onMouseWheel, true);
  7434. Module["canvas"].addEventListener('mousewheel', GLFW.onMouseWheel, true);
  7435. Module["canvas"].addEventListener('mouseenter', GLFW.onMouseenter, true);
  7436. Module["canvas"].addEventListener('mouseleave', GLFW.onMouseleave, true);
  7437. Browser.resizeListeners.push(function(width, height) {
  7438. GLFW.onCanvasResize(width, height);
  7439. });
  7440. return 1; // GL_TRUE
  7441. }
  7442. function _emscripten_glGetTexParameteriv(target, pname, params) {
  7443. if (!params) {
  7444. // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
  7445. // if p == null, issue a GL error to notify user about it.
  7446. GL.recordError(0x0501 /* GL_INVALID_VALUE */);
  7447. return;
  7448. }
  7449. HEAP32[((params)>>2)]=GLctx.getTexParameter(target, pname);
  7450. }
  7451. function _glfwSwapBuffers(winid) {
  7452. GLFW.swapBuffers(winid);
  7453. }
  7454. function _emscripten_glGenerateMipmap(x0) { GLctx['generateMipmap'](x0) }
  7455. function _emscripten_glCullFace(x0) { GLctx['cullFace'](x0) }
  7456. function _emscripten_glUniform4f(location, v0, v1, v2, v3) {
  7457. GLctx.uniform4f(GL.uniforms[location], v0, v1, v2, v3);
  7458. }
  7459. function _glDisableVertexAttribArray(index) {
  7460. GLctx.disableVertexAttribArray(index);
  7461. }
  7462. function _emscripten_glUseProgram(program) {
  7463. GLctx.useProgram(program ? GL.programs[program] : null);
  7464. }
  7465. function _emscripten_glHint(x0, x1) { GLctx['hint'](x0, x1) }
  7466. function _emscripten_glUniform2fv(location, count, value) {
  7467. var view;
  7468. if (2*count <= GL.MINI_TEMP_BUFFER_SIZE) {
  7469. // avoid allocation when uploading few enough uniforms
  7470. view = GL.miniTempBufferViews[2*count-1];
  7471. for (var i = 0; i < 2*count; i += 2) {
  7472. view[i] = HEAPF32[(((value)+(4*i))>>2)];
  7473. view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)];
  7474. }
  7475. } else {
  7476. view = HEAPF32.subarray((value)>>2,(value+count*8)>>2);
  7477. }
  7478. GLctx.uniform2fv(GL.uniforms[location], view);
  7479. }
  7480. function _glfwSwapInterval(interval) {
  7481. interval = Math.abs(interval); // GLFW uses negative values to enable GLX_EXT_swap_control_tear, which we don't have, so just treat negative and positive the same.
  7482. if (interval == 0) _emscripten_set_main_loop_timing(0/*EM_TIMING_SETTIMEOUT*/, 0);
  7483. else _emscripten_set_main_loop_timing(1/*EM_TIMING_RAF*/, interval);
  7484. }
  7485. function _glGetShaderInfoLog(shader, maxLength, length, infoLog) {
  7486. var log = GLctx.getShaderInfoLog(GL.shaders[shader]);
  7487. if (log === null) log = '(unknown error)';
  7488. if (maxLength > 0 && infoLog) {
  7489. var numBytesWrittenExclNull = stringToUTF8(log, infoLog, maxLength);
  7490. if (length) HEAP32[((length)>>2)]=numBytesWrittenExclNull;
  7491. } else {
  7492. if (length) HEAP32[((length)>>2)]=0;
  7493. }
  7494. }
  7495. function _emscripten_glMatrixMode(){ throw 'Legacy GL function (glMatrixMode) called. If you want legacy GL emulation, you need to compile with -s LEGACY_GL_EMULATION=1 to enable legacy GL emulation.'; }
  7496. function _abort() {
  7497. Module['abort']();
  7498. }
  7499. function _emscripten_glFramebufferRenderbuffer(target, attachment, renderbuffertarget, renderbuffer) {
  7500. GLctx.framebufferRenderbuffer(target, attachment, renderbuffertarget,
  7501. GL.renderbuffers[renderbuffer]);
  7502. }
  7503. function _emscripten_glDeleteFramebuffers(n, framebuffers) {
  7504. for (var i = 0; i < n; ++i) {
  7505. var id = HEAP32[(((framebuffers)+(i*4))>>2)];
  7506. var framebuffer = GL.framebuffers[id];
  7507. if (!framebuffer) continue; // GL spec: "glDeleteFramebuffers silently ignores 0s and names that do not correspond to existing framebuffer objects".
  7508. GLctx.deleteFramebuffer(framebuffer);
  7509. framebuffer.name = 0;
  7510. GL.framebuffers[id] = null;
  7511. }
  7512. }
  7513. function _emscripten_glIsBuffer(buffer) {
  7514. var b = GL.buffers[buffer];
  7515. if (!b) return 0;
  7516. return GLctx.isBuffer(b);
  7517. }
  7518. function _emscripten_glUniform2iv(location, count, value) {
  7519. GLctx.uniform2iv(GL.uniforms[location], HEAP32.subarray((value)>>2,(value+count*8)>>2));
  7520. }
  7521. function _emscripten_glVertexAttrib1fv(index, v) {
  7522. GLctx.vertexAttrib1f(index, HEAPF32[v>>2]);
  7523. }
  7524. function _glEnable(x0) { GLctx['enable'](x0) }
  7525. function emscriptenWebGLComputeImageSize(width, height, sizePerPixel, alignment) {
  7526. function roundedToNextMultipleOf(x, y) {
  7527. return Math.floor((x + y - 1) / y) * y
  7528. }
  7529. var plainRowSize = width * sizePerPixel;
  7530. var alignedRowSize = roundedToNextMultipleOf(plainRowSize, alignment);
  7531. return (height <= 0) ? 0 :
  7532. ((height - 1) * alignedRowSize + plainRowSize);
  7533. }function emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat) {
  7534. var sizePerPixel;
  7535. var numChannels;
  7536. switch(format) {
  7537. case 0x1906 /* GL_ALPHA */:
  7538. case 0x1909 /* GL_LUMINANCE */:
  7539. case 0x1902 /* GL_DEPTH_COMPONENT */:
  7540. numChannels = 1;
  7541. break;
  7542. case 0x190A /* GL_LUMINANCE_ALPHA */:
  7543. numChannels = 2;
  7544. break;
  7545. case 0x1907 /* GL_RGB */:
  7546. case 0x8C40 /* GL_SRGB_EXT */:
  7547. numChannels = 3;
  7548. break;
  7549. case 0x1908 /* GL_RGBA */:
  7550. case 0x8C42 /* GL_SRGB_ALPHA_EXT */:
  7551. numChannels = 4;
  7552. break;
  7553. default:
  7554. GL.recordError(0x0500); // GL_INVALID_ENUM
  7555. return null;
  7556. }
  7557. switch (type) {
  7558. case 0x1401 /* GL_UNSIGNED_BYTE */:
  7559. sizePerPixel = numChannels*1;
  7560. break;
  7561. case 0x1403 /* GL_UNSIGNED_SHORT */:
  7562. case 0x8D61 /* GL_HALF_FLOAT_OES */:
  7563. sizePerPixel = numChannels*2;
  7564. break;
  7565. case 0x1405 /* GL_UNSIGNED_INT */:
  7566. case 0x1406 /* GL_FLOAT */:
  7567. sizePerPixel = numChannels*4;
  7568. break;
  7569. case 0x84FA /* GL_UNSIGNED_INT_24_8_WEBGL/GL_UNSIGNED_INT_24_8 */:
  7570. sizePerPixel = 4;
  7571. break;
  7572. case 0x8363 /* GL_UNSIGNED_SHORT_5_6_5 */:
  7573. case 0x8033 /* GL_UNSIGNED_SHORT_4_4_4_4 */:
  7574. case 0x8034 /* GL_UNSIGNED_SHORT_5_5_5_1 */:
  7575. sizePerPixel = 2;
  7576. break;
  7577. default:
  7578. GL.recordError(0x0500); // GL_INVALID_ENUM
  7579. return null;
  7580. }
  7581. var bytes = emscriptenWebGLComputeImageSize(width, height, sizePerPixel, GL.unpackAlignment);
  7582. switch(type) {
  7583. case 0x1401 /* GL_UNSIGNED_BYTE */:
  7584. return HEAPU8.subarray((pixels),(pixels+bytes));
  7585. case 0x1406 /* GL_FLOAT */:
  7586. return HEAPF32.subarray((pixels)>>2,(pixels+bytes)>>2);
  7587. case 0x1405 /* GL_UNSIGNED_INT */:
  7588. case 0x84FA /* GL_UNSIGNED_INT_24_8_WEBGL/GL_UNSIGNED_INT_24_8 */:
  7589. return HEAPU32.subarray((pixels)>>2,(pixels+bytes)>>2);
  7590. case 0x1403 /* GL_UNSIGNED_SHORT */:
  7591. case 0x8363 /* GL_UNSIGNED_SHORT_5_6_5 */:
  7592. case 0x8033 /* GL_UNSIGNED_SHORT_4_4_4_4 */:
  7593. case 0x8034 /* GL_UNSIGNED_SHORT_5_5_5_1 */:
  7594. case 0x8D61 /* GL_HALF_FLOAT_OES */:
  7595. return HEAPU16.subarray((pixels)>>1,(pixels+bytes)>>1);
  7596. default:
  7597. GL.recordError(0x0500); // GL_INVALID_ENUM
  7598. return null;
  7599. }
  7600. }function _emscripten_glTexSubImage2D(target, level, xoffset, yoffset, width, height, format, type, pixels) {
  7601. var pixelData = null;
  7602. if (pixels) pixelData = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, 0);
  7603. GLctx.texSubImage2D(target, level, xoffset, yoffset, width, height, format, type, pixelData);
  7604. }
  7605. function _emscripten_glPolygonOffset(x0, x1) { GLctx['polygonOffset'](x0, x1) }
  7606. var _emscripten_asm_const_int=true;
  7607. function _emscripten_glUniform2f(location, v0, v1) {
  7608. GLctx.uniform2f(GL.uniforms[location], v0, v1);
  7609. }
  7610. function _glGetAttribLocation(program, name) {
  7611. program = GL.programs[program];
  7612. name = Pointer_stringify(name);
  7613. return GLctx.getAttribLocation(program, name);
  7614. }
  7615. function _glfwWindowHint(target, hint) {
  7616. GLFW.hints[target] = hint;
  7617. }
  7618. function _emscripten_glUniform2i(location, v0, v1) {
  7619. GLctx.uniform2i(GL.uniforms[location], v0, v1);
  7620. }
  7621. function _glBlendFunc(x0, x1) { GLctx['blendFunc'](x0, x1) }
  7622. function _glCreateProgram() {
  7623. var id = GL.getNewId(GL.programs);
  7624. var program = GLctx.createProgram();
  7625. program.name = id;
  7626. GL.programs[id] = program;
  7627. return id;
  7628. }
  7629. function _emscripten_glDeleteRenderbuffers(n, renderbuffers) {
  7630. for (var i = 0; i < n; i++) {
  7631. var id = HEAP32[(((renderbuffers)+(i*4))>>2)];
  7632. var renderbuffer = GL.renderbuffers[id];
  7633. if (!renderbuffer) continue; // GL spec: "glDeleteRenderbuffers silently ignores 0s and names that do not correspond to existing renderbuffer objects".
  7634. GLctx.deleteRenderbuffer(renderbuffer);
  7635. renderbuffer.name = 0;
  7636. GL.renderbuffers[id] = null;
  7637. }
  7638. }
  7639. function _emscripten_glGetBufferParameteriv(target, value, data) {
  7640. if (!data) {
  7641. // GLES2 specification does not specify how to behave if data is a null pointer. Since calling this function does not make sense
  7642. // if data == null, issue a GL error to notify user about it.
  7643. GL.recordError(0x0501 /* GL_INVALID_VALUE */);
  7644. return;
  7645. }
  7646. HEAP32[((data)>>2)]=GLctx.getBufferParameter(target, value);
  7647. }
  7648. function emscriptenWebGLGetUniform(program, location, params, type) {
  7649. if (!params) {
  7650. // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
  7651. // if params == null, issue a GL error to notify user about it.
  7652. GL.recordError(0x0501 /* GL_INVALID_VALUE */);
  7653. return;
  7654. }
  7655. var data = GLctx.getUniform(GL.programs[program], GL.uniforms[location]);
  7656. if (typeof data == 'number' || typeof data == 'boolean') {
  7657. switch (type) {
  7658. case 'Integer': HEAP32[((params)>>2)]=data; break;
  7659. case 'Float': HEAPF32[((params)>>2)]=data; break;
  7660. default: throw 'internal emscriptenWebGLGetUniform() error, bad type: ' + type;
  7661. }
  7662. } else {
  7663. for (var i = 0; i < data.length; i++) {
  7664. switch (type) {
  7665. case 'Integer': HEAP32[(((params)+(i))>>2)]=data[i]; break;
  7666. case 'Float': HEAPF32[(((params)+(i))>>2)]=data[i]; break;
  7667. default: throw 'internal emscriptenWebGLGetUniform() error, bad type: ' + type;
  7668. }
  7669. }
  7670. }
  7671. }function _emscripten_glGetUniformiv(program, location, params) {
  7672. emscriptenWebGLGetUniform(program, location, params, 'Integer');
  7673. }
  7674. function _emscripten_glDepthMask(flag) {
  7675. GLctx.depthMask(!!flag);
  7676. }
  7677. function _emscripten_glDepthRangef(x0, x1) { GLctx['depthRange'](x0, x1) }
  7678. function _emscripten_glDepthRange(x0, x1) { GLctx['depthRange'](x0, x1) }
  7679. function _emscripten_set_fullscreenchange_callback(target, userData, useCapture, callbackfunc) {
  7680. if (typeof JSEvents.fullscreenEnabled() === 'undefined') return -1;
  7681. if (!target) target = document;
  7682. else {
  7683. target = JSEvents.findEventTarget(target);
  7684. if (!target) return -4;
  7685. }
  7686. JSEvents.registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, 19, "fullscreenchange");
  7687. JSEvents.registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, 19, "mozfullscreenchange");
  7688. JSEvents.registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, 19, "webkitfullscreenchange");
  7689. JSEvents.registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, 19, "msfullscreenchange");
  7690. return 0;
  7691. }
  7692. Module["___muldsi3"] = ___muldsi3;
  7693. Module["___muldi3"] = ___muldi3;
  7694. function _emscripten_glGetShaderPrecisionFormat(shaderType, precisionType, range, precision) {
  7695. var result = GLctx.getShaderPrecisionFormat(shaderType, precisionType);
  7696. HEAP32[((range)>>2)]=result.rangeMin;
  7697. HEAP32[(((range)+(4))>>2)]=result.rangeMax;
  7698. HEAP32[((precision)>>2)]=result.precision;
  7699. }
  7700. function _emscripten_glUniform1fv(location, count, value) {
  7701. var view;
  7702. if (count <= GL.MINI_TEMP_BUFFER_SIZE) {
  7703. // avoid allocation when uploading few enough uniforms
  7704. view = GL.miniTempBufferViews[count-1];
  7705. for (var i = 0; i < count; ++i) {
  7706. view[i] = HEAPF32[(((value)+(4*i))>>2)];
  7707. }
  7708. } else {
  7709. view = HEAPF32.subarray((value)>>2,(value+count*4)>>2);
  7710. }
  7711. GLctx.uniform1fv(GL.uniforms[location], view);
  7712. }
  7713. function _glDeleteBuffers(n, buffers) {
  7714. for (var i = 0; i < n; i++) {
  7715. var id = HEAP32[(((buffers)+(i*4))>>2)];
  7716. var buffer = GL.buffers[id];
  7717. // From spec: "glDeleteBuffers silently ignores 0's and names that do not
  7718. // correspond to existing buffer objects."
  7719. if (!buffer) continue;
  7720. GLctx.deleteBuffer(buffer);
  7721. buffer.name = 0;
  7722. GL.buffers[id] = null;
  7723. if (id == GL.currArrayBuffer) GL.currArrayBuffer = 0;
  7724. if (id == GL.currElementArrayBuffer) GL.currElementArrayBuffer = 0;
  7725. }
  7726. }
  7727. function _emscripten_set_gamepaddisconnected_callback(userData, useCapture, callbackfunc) {
  7728. if (!navigator.getGamepads && !navigator.webkitGetGamepads) return -1;
  7729. JSEvents.registerGamepadEventCallback(window, userData, useCapture, callbackfunc, 27, "gamepaddisconnected");
  7730. return 0;
  7731. }
  7732. function _emscripten_glBindProgramARB() {
  7733. Module['printErr']('missing function: emscripten_glBindProgramARB'); abort(-1);
  7734. }
  7735. function _emscripten_glBindTexture(target, texture) {
  7736. GLctx.bindTexture(target, texture ? GL.textures[texture] : null);
  7737. }
  7738. function _emscripten_glCheckFramebufferStatus(x0) { return GLctx['checkFramebufferStatus'](x0) }
  7739. function _emscripten_glDeleteProgram(id) {
  7740. if (!id) return;
  7741. var program = GL.programs[id];
  7742. if (!program) { // glDeleteProgram actually signals an error when deleting a nonexisting object, unlike some other GL delete functions.
  7743. GL.recordError(0x0501 /* GL_INVALID_VALUE */);
  7744. return;
  7745. }
  7746. GLctx.deleteProgram(program);
  7747. program.name = 0;
  7748. GL.programs[id] = null;
  7749. GL.programInfos[id] = null;
  7750. }
  7751. function _emscripten_glDisable(x0) { GLctx['disable'](x0) }
  7752. function _emscripten_glVertexAttrib3fv(index, v) {
  7753. GLctx.vertexAttrib3f(index, HEAPF32[v>>2], HEAPF32[v+4>>2], HEAPF32[v+8>>2]);
  7754. }
  7755. function _glClearColor(x0, x1, x2, x3) { GLctx['clearColor'](x0, x1, x2, x3) }
  7756. function _emscripten_glGetActiveAttrib(program, index, bufSize, length, size, type, name) {
  7757. program = GL.programs[program];
  7758. var info = GLctx.getActiveAttrib(program, index);
  7759. if (!info) return; // If an error occurs, nothing will be written to length, size and type and name.
  7760. if (bufSize > 0 && name) {
  7761. var numBytesWrittenExclNull = stringToUTF8(info.name, name, bufSize);
  7762. if (length) HEAP32[((length)>>2)]=numBytesWrittenExclNull;
  7763. } else {
  7764. if (length) HEAP32[((length)>>2)]=0;
  7765. }
  7766. if (size) HEAP32[((size)>>2)]=info.size;
  7767. if (type) HEAP32[((type)>>2)]=info.type;
  7768. }
  7769. function _emscripten_glIsFramebuffer(framebuffer) {
  7770. var fb = GL.framebuffers[framebuffer];
  7771. if (!fb) return 0;
  7772. return GLctx.isFramebuffer(fb);
  7773. }
  7774. function _emscripten_glLineWidth(x0) { GLctx['lineWidth'](x0) }
  7775. function _glfwGetCursorPos(winid, x, y) {
  7776. GLFW.getCursorPos(winid, x, y);
  7777. }
  7778. function _emscripten_glGetString(name_) {
  7779. if (GL.stringCache[name_]) return GL.stringCache[name_];
  7780. var ret;
  7781. switch(name_) {
  7782. case 0x1F00 /* GL_VENDOR */:
  7783. case 0x1F01 /* GL_RENDERER */:
  7784. case 0x9245 /* UNMASKED_VENDOR_WEBGL */:
  7785. case 0x9246 /* UNMASKED_RENDERER_WEBGL */:
  7786. ret = allocate(intArrayFromString(GLctx.getParameter(name_)), 'i8', ALLOC_NORMAL);
  7787. break;
  7788. case 0x1F02 /* GL_VERSION */:
  7789. var glVersion = GLctx.getParameter(GLctx.VERSION);
  7790. // return GLES version string corresponding to the version of the WebGL context
  7791. {
  7792. glVersion = 'OpenGL ES 2.0 (' + glVersion + ')';
  7793. }
  7794. ret = allocate(intArrayFromString(glVersion), 'i8', ALLOC_NORMAL);
  7795. break;
  7796. case 0x1F03 /* GL_EXTENSIONS */:
  7797. var exts = GLctx.getSupportedExtensions();
  7798. var gl_exts = [];
  7799. for (var i = 0; i < exts.length; ++i) {
  7800. gl_exts.push(exts[i]);
  7801. gl_exts.push("GL_" + exts[i]);
  7802. }
  7803. ret = allocate(intArrayFromString(gl_exts.join(' ')), 'i8', ALLOC_NORMAL);
  7804. break;
  7805. case 0x8B8C /* GL_SHADING_LANGUAGE_VERSION */:
  7806. var glslVersion = GLctx.getParameter(GLctx.SHADING_LANGUAGE_VERSION);
  7807. // extract the version number 'N.M' from the string 'WebGL GLSL ES N.M ...'
  7808. var ver_re = /^WebGL GLSL ES ([0-9]\.[0-9][0-9]?)(?:$| .*)/;
  7809. var ver_num = glslVersion.match(ver_re);
  7810. if (ver_num !== null) {
  7811. if (ver_num[1].length == 3) ver_num[1] = ver_num[1] + '0'; // ensure minor version has 2 digits
  7812. glslVersion = 'OpenGL ES GLSL ES ' + ver_num[1] + ' (' + glslVersion + ')';
  7813. }
  7814. ret = allocate(intArrayFromString(glslVersion), 'i8', ALLOC_NORMAL);
  7815. break;
  7816. default:
  7817. GL.recordError(0x0500/*GL_INVALID_ENUM*/);
  7818. return 0;
  7819. }
  7820. GL.stringCache[name_] = ret;
  7821. return ret;
  7822. }
  7823. function _emscripten_glGetAttribLocation(program, name) {
  7824. program = GL.programs[program];
  7825. name = Pointer_stringify(name);
  7826. return GLctx.getAttribLocation(program, name);
  7827. }
  7828. function _emscripten_glRotatef() {
  7829. Module['printErr']('missing function: emscripten_glRotatef'); abort(-1);
  7830. }
  7831. function emscriptenWebGLGet(name_, p, type) {
  7832. // Guard against user passing a null pointer.
  7833. // Note that GLES2 spec does not say anything about how passing a null pointer should be treated.
  7834. // Testing on desktop core GL 3, the application crashes on glGetIntegerv to a null pointer, but
  7835. // better to report an error instead of doing anything random.
  7836. if (!p) {
  7837. GL.recordError(0x0501 /* GL_INVALID_VALUE */);
  7838. return;
  7839. }
  7840. var ret = undefined;
  7841. switch(name_) { // Handle a few trivial GLES values
  7842. case 0x8DFA: // GL_SHADER_COMPILER
  7843. ret = 1;
  7844. break;
  7845. case 0x8DF8: // GL_SHADER_BINARY_FORMATS
  7846. if (type !== 'Integer' && type !== 'Integer64') {
  7847. GL.recordError(0x0500); // GL_INVALID_ENUM
  7848. }
  7849. return; // Do not write anything to the out pointer, since no binary formats are supported.
  7850. case 0x8DF9: // GL_NUM_SHADER_BINARY_FORMATS
  7851. ret = 0;
  7852. break;
  7853. case 0x86A2: // GL_NUM_COMPRESSED_TEXTURE_FORMATS
  7854. // WebGL doesn't have GL_NUM_COMPRESSED_TEXTURE_FORMATS (it's obsolete since GL_COMPRESSED_TEXTURE_FORMATS returns a JS array that can be queried for length),
  7855. // so implement it ourselves to allow C++ GLES2 code get the length.
  7856. var formats = GLctx.getParameter(0x86A3 /*GL_COMPRESSED_TEXTURE_FORMATS*/);
  7857. ret = formats.length;
  7858. break;
  7859. }
  7860. if (ret === undefined) {
  7861. var result = GLctx.getParameter(name_);
  7862. switch (typeof(result)) {
  7863. case "number":
  7864. ret = result;
  7865. break;
  7866. case "boolean":
  7867. ret = result ? 1 : 0;
  7868. break;
  7869. case "string":
  7870. GL.recordError(0x0500); // GL_INVALID_ENUM
  7871. return;
  7872. case "object":
  7873. if (result === null) {
  7874. // null is a valid result for some (e.g., which buffer is bound - perhaps nothing is bound), but otherwise
  7875. // can mean an invalid name_, which we need to report as an error
  7876. switch(name_) {
  7877. case 0x8894: // ARRAY_BUFFER_BINDING
  7878. case 0x8B8D: // CURRENT_PROGRAM
  7879. case 0x8895: // ELEMENT_ARRAY_BUFFER_BINDING
  7880. case 0x8CA6: // FRAMEBUFFER_BINDING
  7881. case 0x8CA7: // RENDERBUFFER_BINDING
  7882. case 0x8069: // TEXTURE_BINDING_2D
  7883. case 0x8514: { // TEXTURE_BINDING_CUBE_MAP
  7884. ret = 0;
  7885. break;
  7886. }
  7887. default: {
  7888. GL.recordError(0x0500); // GL_INVALID_ENUM
  7889. return;
  7890. }
  7891. }
  7892. } else if (result instanceof Float32Array ||
  7893. result instanceof Uint32Array ||
  7894. result instanceof Int32Array ||
  7895. result instanceof Array) {
  7896. for (var i = 0; i < result.length; ++i) {
  7897. switch (type) {
  7898. case 'Integer': HEAP32[(((p)+(i*4))>>2)]=result[i]; break;
  7899. case 'Float': HEAPF32[(((p)+(i*4))>>2)]=result[i]; break;
  7900. case 'Boolean': HEAP8[(((p)+(i))>>0)]=result[i] ? 1 : 0; break;
  7901. default: throw 'internal glGet error, bad type: ' + type;
  7902. }
  7903. }
  7904. return;
  7905. } else if (result instanceof WebGLBuffer ||
  7906. result instanceof WebGLProgram ||
  7907. result instanceof WebGLFramebuffer ||
  7908. result instanceof WebGLRenderbuffer ||
  7909. result instanceof WebGLTexture) {
  7910. ret = result.name | 0;
  7911. } else {
  7912. GL.recordError(0x0500); // GL_INVALID_ENUM
  7913. return;
  7914. }
  7915. break;
  7916. default:
  7917. GL.recordError(0x0500); // GL_INVALID_ENUM
  7918. return;
  7919. }
  7920. }
  7921. switch (type) {
  7922. case 'Integer64': (tempI64 = [ret>>>0,(tempDouble=ret,(+(Math_abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math_min((+(Math_floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math_ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[((p)>>2)]=tempI64[0],HEAP32[(((p)+(4))>>2)]=tempI64[1]); break;
  7923. case 'Integer': HEAP32[((p)>>2)]=ret; break;
  7924. case 'Float': HEAPF32[((p)>>2)]=ret; break;
  7925. case 'Boolean': HEAP8[((p)>>0)]=ret ? 1 : 0; break;
  7926. default: throw 'internal glGet error, bad type: ' + type;
  7927. }
  7928. }function _emscripten_glGetIntegerv(name_, p) {
  7929. emscriptenWebGLGet(name_, p, 'Integer');
  7930. }
  7931. function _emscripten_glGetFramebufferAttachmentParameteriv(target, attachment, pname, params) {
  7932. var result = GLctx.getFramebufferAttachmentParameter(target, attachment, pname);
  7933. HEAP32[((params)>>2)]=result;
  7934. }
  7935. function _llvm_stackrestore(p) {
  7936. var self = _llvm_stacksave;
  7937. var ret = self.LLVM_SAVEDSTACKS[p];
  7938. self.LLVM_SAVEDSTACKS.splice(p, 1);
  7939. Runtime.stackRestore(ret);
  7940. }
  7941. function _glfwSetWindowShouldClose(winid, value) {
  7942. var win = GLFW.WindowFromId(winid);
  7943. if (!win) return;
  7944. win.shouldClose = value;
  7945. }
  7946. function _emscripten_glClientActiveTexture() {
  7947. Module['printErr']('missing function: emscripten_glClientActiveTexture'); abort(-1);
  7948. }
  7949. function _glGenBuffers(n, buffers) {
  7950. for (var i = 0; i < n; i++) {
  7951. var buffer = GLctx.createBuffer();
  7952. if (!buffer) {
  7953. GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
  7954. while(i < n) HEAP32[(((buffers)+(i++*4))>>2)]=0;
  7955. return;
  7956. }
  7957. var id = GL.getNewId(GL.buffers);
  7958. buffer.name = id;
  7959. GL.buffers[id] = buffer;
  7960. HEAP32[(((buffers)+(i*4))>>2)]=id;
  7961. }
  7962. }
  7963. function _emscripten_memcpy_big(dest, src, num) {
  7964. HEAPU8.set(HEAPU8.subarray(src, src+num), dest);
  7965. return dest;
  7966. }
  7967. Module["_memcpy"] = _memcpy;
  7968. function _emscripten_glGetShaderInfoLog(shader, maxLength, length, infoLog) {
  7969. var log = GLctx.getShaderInfoLog(GL.shaders[shader]);
  7970. if (log === null) log = '(unknown error)';
  7971. if (maxLength > 0 && infoLog) {
  7972. var numBytesWrittenExclNull = stringToUTF8(log, infoLog, maxLength);
  7973. if (length) HEAP32[((length)>>2)]=numBytesWrittenExclNull;
  7974. } else {
  7975. if (length) HEAP32[((length)>>2)]=0;
  7976. }
  7977. }
  7978. function _glfwGetTime() {
  7979. return GLFW.getTime() - GLFW.initialTime;
  7980. }
  7981. function _emscripten_glGetRenderbufferParameteriv(target, pname, params) {
  7982. if (!params) {
  7983. // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
  7984. // if params == null, issue a GL error to notify user about it.
  7985. GL.recordError(0x0501 /* GL_INVALID_VALUE */);
  7986. return;
  7987. }
  7988. HEAP32[((params)>>2)]=GLctx.getRenderbufferParameter(target, pname);
  7989. }
  7990. function _emscripten_glStencilOpSeparate(x0, x1, x2, x3) { GLctx['stencilOpSeparate'](x0, x1, x2, x3) }
  7991. function _emscripten_glReadPixels(x, y, width, height, format, type, pixels) {
  7992. var pixelData = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, format);
  7993. if (!pixelData) {
  7994. GL.recordError(0x0500/*GL_INVALID_ENUM*/);
  7995. return;
  7996. }
  7997. GLctx.readPixels(x, y, width, height, format, type, pixelData);
  7998. }
  7999. function _emscripten_glCompressedTexSubImage2D(target, level, xoffset, yoffset, width, height, format, imageSize, data) {
  8000. GLctx['compressedTexSubImage2D'](target, level, xoffset, yoffset, width, height, format, data ? HEAPU8.subarray((data),(data+imageSize)) : null);
  8001. }
  8002. function _emscripten_glGetError() {
  8003. // First return any GL error generated by the emscripten library_gl.js interop layer.
  8004. if (GL.lastError) {
  8005. var error = GL.lastError;
  8006. GL.lastError = 0/*GL_NO_ERROR*/;
  8007. return error;
  8008. } else { // If there were none, return the GL error from the browser GL context.
  8009. return GLctx.getError();
  8010. }
  8011. }
  8012. function _emscripten_glFramebufferTexture2D(target, attachment, textarget, texture, level) {
  8013. GLctx.framebufferTexture2D(target, attachment, textarget,
  8014. GL.textures[texture], level);
  8015. }
  8016. function _emscripten_glIsEnabled(x0) { return GLctx['isEnabled'](x0) }
  8017. function _glClearDepthf(x0) { GLctx['clearDepth'](x0) }
  8018. Module["_memmove"] = _memmove;
  8019. function _glGenTextures(n, textures) {
  8020. for (var i = 0; i < n; i++) {
  8021. var texture = GLctx.createTexture();
  8022. if (!texture) {
  8023. GL.recordError(0x0502 /* GL_INVALID_OPERATION */); // GLES + EGL specs don't specify what should happen here, so best to issue an error and create IDs with 0.
  8024. while(i < n) HEAP32[(((textures)+(i++*4))>>2)]=0;
  8025. return;
  8026. }
  8027. var id = GL.getNewId(GL.textures);
  8028. texture.name = id;
  8029. GL.textures[id] = texture;
  8030. HEAP32[(((textures)+(i*4))>>2)]=id;
  8031. }
  8032. }
  8033. function _emscripten_glVertexAttrib4f(x0, x1, x2, x3, x4) { GLctx['vertexAttrib4f'](x0, x1, x2, x3, x4) }
  8034. function _glDepthFunc(x0) { GLctx['depthFunc'](x0) }
  8035. Module["___uremdi3"] = ___uremdi3;
  8036. function _emscripten_glClearDepthf(x0) { GLctx['clearDepth'](x0) }
  8037. function _emscripten_glClear(x0) { GLctx['clear'](x0) }
  8038. function _emscripten_glBindBuffer(target, buffer) {
  8039. var bufferObj = buffer ? GL.buffers[buffer] : null;
  8040. GLctx.bindBuffer(target, bufferObj);
  8041. }
  8042. function _emscripten_glGetUniformfv(program, location, params) {
  8043. emscriptenWebGLGetUniform(program, location, params, 'Float');
  8044. }
  8045. function _glGetProgramiv(program, pname, p) {
  8046. if (!p) {
  8047. // GLES2 specification does not specify how to behave if p is a null pointer. Since calling this function does not make sense
  8048. // if p == null, issue a GL error to notify user about it.
  8049. GL.recordError(0x0501 /* GL_INVALID_VALUE */);
  8050. return;
  8051. }
  8052. if (program >= GL.counter) {
  8053. GL.recordError(0x0501 /* GL_INVALID_VALUE */);
  8054. return;
  8055. }
  8056. var ptable = GL.programInfos[program];
  8057. if (!ptable) {
  8058. GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
  8059. return;
  8060. }
  8061. if (pname == 0x8B84) { // GL_INFO_LOG_LENGTH
  8062. var log = GLctx.getProgramInfoLog(GL.programs[program]);
  8063. if (log === null) log = '(unknown error)';
  8064. HEAP32[((p)>>2)]=log.length + 1;
  8065. } else if (pname == 0x8B87 /* GL_ACTIVE_UNIFORM_MAX_LENGTH */) {
  8066. HEAP32[((p)>>2)]=ptable.maxUniformLength;
  8067. } else if (pname == 0x8B8A /* GL_ACTIVE_ATTRIBUTE_MAX_LENGTH */) {
  8068. if (ptable.maxAttributeLength == -1) {
  8069. var program = GL.programs[program];
  8070. var numAttribs = GLctx.getProgramParameter(program, GLctx.ACTIVE_ATTRIBUTES);
  8071. ptable.maxAttributeLength = 0; // Spec says if there are no active attribs, 0 must be returned.
  8072. for (var i = 0; i < numAttribs; ++i) {
  8073. var activeAttrib = GLctx.getActiveAttrib(program, i);
  8074. ptable.maxAttributeLength = Math.max(ptable.maxAttributeLength, activeAttrib.name.length+1);
  8075. }
  8076. }
  8077. HEAP32[((p)>>2)]=ptable.maxAttributeLength;
  8078. } else if (pname == 0x8A35 /* GL_ACTIVE_UNIFORM_BLOCK_MAX_NAME_LENGTH */) {
  8079. if (ptable.maxUniformBlockNameLength == -1) {
  8080. var program = GL.programs[program];
  8081. var numBlocks = GLctx.getProgramParameter(program, GLctx.ACTIVE_UNIFORM_BLOCKS);
  8082. ptable.maxUniformBlockNameLength = 0;
  8083. for (var i = 0; i < numBlocks; ++i) {
  8084. var activeBlockName = GLctx.getActiveUniformBlockName(program, i);
  8085. ptable.maxUniformBlockNameLength = Math.max(ptable.maxUniformBlockNameLength, activeBlockName.length+1);
  8086. }
  8087. }
  8088. HEAP32[((p)>>2)]=ptable.maxUniformBlockNameLength;
  8089. } else {
  8090. HEAP32[((p)>>2)]=GLctx.getProgramParameter(GL.programs[program], pname);
  8091. }
  8092. }
  8093. function _glVertexAttribPointer(index, size, type, normalized, stride, ptr) {
  8094. GLctx.vertexAttribPointer(index, size, type, !!normalized, stride, ptr);
  8095. }
  8096. function _emscripten_exit_pointerlock() {
  8097. // Make sure no queued up calls will fire after this.
  8098. JSEvents.removeDeferredCalls(JSEvents.requestPointerLock);
  8099. if (document.exitPointerLock) {
  8100. document.exitPointerLock();
  8101. } else if (document.msExitPointerLock) {
  8102. document.msExitPointerLock();
  8103. } else if (document.mozExitPointerLock) {
  8104. document.mozExitPointerLock();
  8105. } else if (document.webkitExitPointerLock) {
  8106. document.webkitExitPointerLock();
  8107. } else {
  8108. return -1;
  8109. }
  8110. return 0;
  8111. }
  8112. function _emscripten_glDrawRangeElements() {
  8113. Module['printErr']('missing function: emscripten_glDrawRangeElements'); abort(-1);
  8114. }
  8115. function _glGetUniformLocation(program, name) {
  8116. name = Pointer_stringify(name);
  8117. var arrayOffset = 0;
  8118. // If user passed an array accessor "[index]", parse the array index off the accessor.
  8119. if (name.indexOf(']', name.length-1) !== -1) {
  8120. var ls = name.lastIndexOf('[');
  8121. var arrayIndex = name.slice(ls+1, -1);
  8122. if (arrayIndex.length > 0) {
  8123. arrayOffset = parseInt(arrayIndex);
  8124. if (arrayOffset < 0) {
  8125. return -1;
  8126. }
  8127. }
  8128. name = name.slice(0, ls);
  8129. }
  8130. var ptable = GL.programInfos[program];
  8131. if (!ptable) {
  8132. return -1;
  8133. }
  8134. var utable = ptable.uniforms;
  8135. var uniformInfo = utable[name]; // returns pair [ dimension_of_uniform_array, uniform_location ]
  8136. if (uniformInfo && arrayOffset < uniformInfo[0]) { // Check if user asked for an out-of-bounds element, i.e. for 'vec4 colors[3];' user could ask for 'colors[10]' which should return -1.
  8137. return uniformInfo[1]+arrayOffset;
  8138. } else {
  8139. return -1;
  8140. }
  8141. }
  8142. function _emscripten_glGetAttachedShaders(program, maxCount, count, shaders) {
  8143. var result = GLctx.getAttachedShaders(GL.programs[program]);
  8144. var len = result.length;
  8145. if (len > maxCount) {
  8146. len = maxCount;
  8147. }
  8148. HEAP32[((count)>>2)]=len;
  8149. for (var i = 0; i < len; ++i) {
  8150. var id = GL.shaders.indexOf(result[i]);
  8151. assert(id !== -1, 'shader not bound to local id');
  8152. HEAP32[(((shaders)+(i*4))>>2)]=id;
  8153. }
  8154. }
  8155. function _emscripten_glGenRenderbuffers(n, renderbuffers) {
  8156. for (var i = 0; i < n; i++) {
  8157. var renderbuffer = GLctx.createRenderbuffer();
  8158. if (!renderbuffer) {
  8159. GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
  8160. while(i < n) HEAP32[(((renderbuffers)+(i++*4))>>2)]=0;
  8161. return;
  8162. }
  8163. var id = GL.getNewId(GL.renderbuffers);
  8164. renderbuffer.name = id;
  8165. GL.renderbuffers[id] = renderbuffer;
  8166. HEAP32[(((renderbuffers)+(i*4))>>2)]=id;
  8167. }
  8168. }
  8169. function _emscripten_glFrontFace(x0) { GLctx['frontFace'](x0) }
  8170. function _emscripten_glActiveTexture(x0) { GLctx['activeTexture'](x0) }
  8171. function _emscripten_glUniform1iv(location, count, value) {
  8172. GLctx.uniform1iv(GL.uniforms[location], HEAP32.subarray((value)>>2,(value+count*4)>>2));
  8173. }
  8174. function _emscripten_glTexCoordPointer() {
  8175. Module['printErr']('missing function: emscripten_glTexCoordPointer'); abort(-1);
  8176. }
  8177. function _emscripten_glGetInfoLogARB() {
  8178. Module['printErr']('missing function: emscripten_glGetInfoLogARB'); abort(-1);
  8179. }
  8180. function __exit(status) {
  8181. // void _exit(int status);
  8182. // http://pubs.opengroup.org/onlinepubs/000095399/functions/exit.html
  8183. Module['exit'](status);
  8184. }function _exit(status) {
  8185. __exit(status);
  8186. }
  8187. function _emscripten_glRenderbufferStorage(x0, x1, x2, x3) { GLctx['renderbufferStorage'](x0, x1, x2, x3) }
  8188. function _emscripten_glCopyTexSubImage2D(x0, x1, x2, x3, x4, x5, x6, x7) { GLctx['copyTexSubImage2D'](x0, x1, x2, x3, x4, x5, x6, x7) }
  8189. function _glfwSetCursorPosCallback(winid, cbfun) {
  8190. GLFW.setCursorPosCallback(winid, cbfun);
  8191. }
  8192. function _glBindAttribLocation(program, index, name) {
  8193. name = Pointer_stringify(name);
  8194. GLctx.bindAttribLocation(GL.programs[program], index, name);
  8195. }
  8196. function _emscripten_glShaderBinary() {
  8197. GL.recordError(0x0500/*GL_INVALID_ENUM*/);
  8198. }
  8199. function _emscripten_glIsProgram(program) {
  8200. var program = GL.programs[program];
  8201. if (!program) return 0;
  8202. return GLctx.isProgram(program);
  8203. }
  8204. function _emscripten_glBlendColor(x0, x1, x2, x3) { GLctx['blendColor'](x0, x1, x2, x3) }
  8205. function _emscripten_glGetShaderiv(shader, pname, p) {
  8206. if (!p) {
  8207. // GLES2 specification does not specify how to behave if p is a null pointer. Since calling this function does not make sense
  8208. // if p == null, issue a GL error to notify user about it.
  8209. GL.recordError(0x0501 /* GL_INVALID_VALUE */);
  8210. return;
  8211. }
  8212. if (pname == 0x8B84) { // GL_INFO_LOG_LENGTH
  8213. var log = GLctx.getShaderInfoLog(GL.shaders[shader]);
  8214. if (log === null) log = '(unknown error)';
  8215. HEAP32[((p)>>2)]=log.length + 1;
  8216. } else {
  8217. HEAP32[((p)>>2)]=GLctx.getShaderParameter(GL.shaders[shader], pname);
  8218. }
  8219. }
  8220. function _emscripten_glUniformMatrix3fv(location, count, transpose, value) {
  8221. var view;
  8222. if (9*count <= GL.MINI_TEMP_BUFFER_SIZE) {
  8223. // avoid allocation when uploading few enough uniforms
  8224. view = GL.miniTempBufferViews[9*count-1];
  8225. for (var i = 0; i < 9*count; i += 9) {
  8226. view[i] = HEAPF32[(((value)+(4*i))>>2)];
  8227. view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)];
  8228. view[i+2] = HEAPF32[(((value)+(4*i+8))>>2)];
  8229. view[i+3] = HEAPF32[(((value)+(4*i+12))>>2)];
  8230. view[i+4] = HEAPF32[(((value)+(4*i+16))>>2)];
  8231. view[i+5] = HEAPF32[(((value)+(4*i+20))>>2)];
  8232. view[i+6] = HEAPF32[(((value)+(4*i+24))>>2)];
  8233. view[i+7] = HEAPF32[(((value)+(4*i+28))>>2)];
  8234. view[i+8] = HEAPF32[(((value)+(4*i+32))>>2)];
  8235. }
  8236. } else {
  8237. view = HEAPF32.subarray((value)>>2,(value+count*36)>>2);
  8238. }
  8239. GLctx.uniformMatrix3fv(GL.uniforms[location], !!transpose, view);
  8240. }
  8241. function _emscripten_glVertexAttrib2f(x0, x1, x2) { GLctx['vertexAttrib2f'](x0, x1, x2) }
  8242. function _emscripten_glUniform4fv(location, count, value) {
  8243. var view;
  8244. if (4*count <= GL.MINI_TEMP_BUFFER_SIZE) {
  8245. // avoid allocation when uploading few enough uniforms
  8246. view = GL.miniTempBufferViews[4*count-1];
  8247. for (var i = 0; i < 4*count; i += 4) {
  8248. view[i] = HEAPF32[(((value)+(4*i))>>2)];
  8249. view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)];
  8250. view[i+2] = HEAPF32[(((value)+(4*i+8))>>2)];
  8251. view[i+3] = HEAPF32[(((value)+(4*i+12))>>2)];
  8252. }
  8253. } else {
  8254. view = HEAPF32.subarray((value)>>2,(value+count*16)>>2);
  8255. }
  8256. GLctx.uniform4fv(GL.uniforms[location], view);
  8257. }
  8258. function _glBufferSubData(target, offset, size, data) {
  8259. GLctx.bufferSubData(target, offset, HEAPU8.subarray(data, data+size));
  8260. }
  8261. function _emscripten_glGenFramebuffers(n, ids) {
  8262. for (var i = 0; i < n; ++i) {
  8263. var framebuffer = GLctx.createFramebuffer();
  8264. if (!framebuffer) {
  8265. GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
  8266. while(i < n) HEAP32[(((ids)+(i++*4))>>2)]=0;
  8267. return;
  8268. }
  8269. var id = GL.getNewId(GL.framebuffers);
  8270. framebuffer.name = id;
  8271. GL.framebuffers[id] = framebuffer;
  8272. HEAP32[(((ids)+(i*4))>>2)]=id;
  8273. }
  8274. }
  8275. function _glGetShaderiv(shader, pname, p) {
  8276. if (!p) {
  8277. // GLES2 specification does not specify how to behave if p is a null pointer. Since calling this function does not make sense
  8278. // if p == null, issue a GL error to notify user about it.
  8279. GL.recordError(0x0501 /* GL_INVALID_VALUE */);
  8280. return;
  8281. }
  8282. if (pname == 0x8B84) { // GL_INFO_LOG_LENGTH
  8283. var log = GLctx.getShaderInfoLog(GL.shaders[shader]);
  8284. if (log === null) log = '(unknown error)';
  8285. HEAP32[((p)>>2)]=log.length + 1;
  8286. } else {
  8287. HEAP32[((p)>>2)]=GLctx.getShaderParameter(GL.shaders[shader], pname);
  8288. }
  8289. }
  8290. function _emscripten_glBlendEquationSeparate(x0, x1) { GLctx['blendEquationSeparate'](x0, x1) }
  8291. function _glfwSetWindowIconifyCallback(winid, cbfun) {
  8292. var win = GLFW.WindowFromId(winid);
  8293. if (!win) return;
  8294. win.windowIconifyFunc = cbfun;
  8295. }
  8296. function _emscripten_glUniform1i(location, v0) {
  8297. GLctx.uniform1i(GL.uniforms[location], v0);
  8298. }
  8299. function _emscripten_glGenTextures(n, textures) {
  8300. for (var i = 0; i < n; i++) {
  8301. var texture = GLctx.createTexture();
  8302. if (!texture) {
  8303. GL.recordError(0x0502 /* GL_INVALID_OPERATION */); // GLES + EGL specs don't specify what should happen here, so best to issue an error and create IDs with 0.
  8304. while(i < n) HEAP32[(((textures)+(i++*4))>>2)]=0;
  8305. return;
  8306. }
  8307. var id = GL.getNewId(GL.textures);
  8308. texture.name = id;
  8309. GL.textures[id] = texture;
  8310. HEAP32[(((textures)+(i*4))>>2)]=id;
  8311. }
  8312. }
  8313. function _emscripten_glVertexAttrib2fv(index, v) {
  8314. GLctx.vertexAttrib2f(index, HEAPF32[v>>2], HEAPF32[v+4>>2]);
  8315. }
  8316. function _emscripten_glGetActiveUniform(program, index, bufSize, length, size, type, name) {
  8317. program = GL.programs[program];
  8318. var info = GLctx.getActiveUniform(program, index);
  8319. if (!info) return; // If an error occurs, nothing will be written to length, size, type and name.
  8320. if (bufSize > 0 && name) {
  8321. var numBytesWrittenExclNull = stringToUTF8(info.name, name, bufSize);
  8322. if (length) HEAP32[((length)>>2)]=numBytesWrittenExclNull;
  8323. } else {
  8324. if (length) HEAP32[((length)>>2)]=0;
  8325. }
  8326. if (size) HEAP32[((size)>>2)]=info.size;
  8327. if (type) HEAP32[((type)>>2)]=info.type;
  8328. }
  8329. Module["_roundf"] = _roundf;
  8330. function _emscripten_glDeleteObjectARB() {
  8331. Module['printErr']('missing function: emscripten_glDeleteObjectARB'); abort(-1);
  8332. }
  8333. function _emscripten_set_touchmove_callback(target, userData, useCapture, callbackfunc) {
  8334. JSEvents.registerTouchEventCallback(target, userData, useCapture, callbackfunc, 24, "touchmove");
  8335. return 0;
  8336. }
  8337. function _emscripten_glUniform1f(location, v0) {
  8338. GLctx.uniform1f(GL.uniforms[location], v0);
  8339. }
  8340. function _emscripten_glVertexAttribPointer(index, size, type, normalized, stride, ptr) {
  8341. GLctx.vertexAttribPointer(index, size, type, !!normalized, stride, ptr);
  8342. }
  8343. function _glShaderSource(shader, count, string, length) {
  8344. var source = GL.getSource(shader, count, string, length);
  8345. GLctx.shaderSource(GL.shaders[shader], source);
  8346. }
  8347. function _emscripten_glDrawArrays(mode, first, count) {
  8348. GLctx.drawArrays(mode, first, count);
  8349. }
  8350. function _emscripten_glGenBuffers(n, buffers) {
  8351. for (var i = 0; i < n; i++) {
  8352. var buffer = GLctx.createBuffer();
  8353. if (!buffer) {
  8354. GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
  8355. while(i < n) HEAP32[(((buffers)+(i++*4))>>2)]=0;
  8356. return;
  8357. }
  8358. var id = GL.getNewId(GL.buffers);
  8359. buffer.name = id;
  8360. GL.buffers[id] = buffer;
  8361. HEAP32[(((buffers)+(i*4))>>2)]=id;
  8362. }
  8363. }
  8364. function _emscripten_glClearDepth(x0) { GLctx['clearDepth'](x0) }
  8365. function _emscripten_set_keypress_callback(target, userData, useCapture, callbackfunc) {
  8366. JSEvents.registerKeyEventCallback(target, userData, useCapture, callbackfunc, 1, "keypress");
  8367. return 0;
  8368. }
  8369. function _glfwSetCharCallback(winid, cbfun) {
  8370. GLFW.setCharCallback(winid, cbfun);
  8371. }
  8372. function _emscripten_glGetUniformLocation(program, name) {
  8373. name = Pointer_stringify(name);
  8374. var arrayOffset = 0;
  8375. // If user passed an array accessor "[index]", parse the array index off the accessor.
  8376. if (name.indexOf(']', name.length-1) !== -1) {
  8377. var ls = name.lastIndexOf('[');
  8378. var arrayIndex = name.slice(ls+1, -1);
  8379. if (arrayIndex.length > 0) {
  8380. arrayOffset = parseInt(arrayIndex);
  8381. if (arrayOffset < 0) {
  8382. return -1;
  8383. }
  8384. }
  8385. name = name.slice(0, ls);
  8386. }
  8387. var ptable = GL.programInfos[program];
  8388. if (!ptable) {
  8389. return -1;
  8390. }
  8391. var utable = ptable.uniforms;
  8392. var uniformInfo = utable[name]; // returns pair [ dimension_of_uniform_array, uniform_location ]
  8393. if (uniformInfo && arrayOffset < uniformInfo[0]) { // Check if user asked for an out-of-bounds element, i.e. for 'vec4 colors[3];' user could ask for 'colors[10]' which should return -1.
  8394. return uniformInfo[1]+arrayOffset;
  8395. } else {
  8396. return -1;
  8397. }
  8398. }
  8399. function _glActiveTexture(x0) { GLctx['activeTexture'](x0) }
  8400. function _glBindBuffer(target, buffer) {
  8401. var bufferObj = buffer ? GL.buffers[buffer] : null;
  8402. GLctx.bindBuffer(target, bufferObj);
  8403. }
  8404. function _emscripten_glVertexAttrib4fv(index, v) {
  8405. GLctx.vertexAttrib4f(index, HEAPF32[v>>2], HEAPF32[v+4>>2], HEAPF32[v+8>>2], HEAPF32[v+12>>2]);
  8406. }
  8407. function _emscripten_glScissor(x0, x1, x2, x3) { GLctx['scissor'](x0, x1, x2, x3) }
  8408. function _glfwSetCursorEnterCallback(winid, cbfun) {
  8409. var win = GLFW.WindowFromId(winid);
  8410. if (!win) return;
  8411. win.cursorEnterFunc = cbfun;
  8412. }
  8413. Module["_bitshift64Lshr"] = _bitshift64Lshr;
  8414. function _glBufferData(target, size, data, usage) {
  8415. if (!data) {
  8416. GLctx.bufferData(target, size, usage);
  8417. } else {
  8418. GLctx.bufferData(target, HEAPU8.subarray(data, data+size), usage);
  8419. }
  8420. }
  8421. function _emscripten_glIsShader(shader) {
  8422. var s = GL.shaders[shader];
  8423. if (!s) return 0;
  8424. return GLctx.isShader(s);
  8425. }
  8426. function _emscripten_glDrawBuffers(n, bufs) {
  8427. var bufArray = GL.tempFixedLengthArray[n];
  8428. for (var i = 0; i < n; i++) {
  8429. bufArray[i] = HEAP32[(((bufs)+(i*4))>>2)];
  8430. }
  8431. GLctx['drawBuffers'](bufArray);
  8432. }
  8433. function _glGetFloatv(name_, p) {
  8434. emscriptenWebGLGet(name_, p, 'Float');
  8435. }
  8436. function _emscripten_glBindFramebuffer(target, framebuffer) {
  8437. GLctx.bindFramebuffer(target, framebuffer ? GL.framebuffers[framebuffer] : null);
  8438. }
  8439. function _emscripten_glBlendEquation(x0) { GLctx['blendEquation'](x0) }
  8440. function _emscripten_glBufferSubData(target, offset, size, data) {
  8441. GLctx.bufferSubData(target, offset, HEAPU8.subarray(data, data+size));
  8442. }
  8443. function _emscripten_glBufferData(target, size, data, usage) {
  8444. if (!data) {
  8445. GLctx.bufferData(target, size, usage);
  8446. } else {
  8447. GLctx.bufferData(target, HEAPU8.subarray(data, data+size), usage);
  8448. }
  8449. }
  8450. Module["_sbrk"] = _sbrk;
  8451. Module["_bitshift64Shl"] = _bitshift64Shl;
  8452. function _emscripten_glGetShaderSource(shader, bufSize, length, source) {
  8453. var result = GLctx.getShaderSource(GL.shaders[shader]);
  8454. if (!result) return; // If an error occurs, nothing will be written to length or source.
  8455. if (bufSize > 0 && source) {
  8456. var numBytesWrittenExclNull = stringToUTF8(result, source, bufSize);
  8457. if (length) HEAP32[((length)>>2)]=numBytesWrittenExclNull;
  8458. } else {
  8459. if (length) HEAP32[((length)>>2)]=0;
  8460. }
  8461. }
  8462. Module["_llvm_bswap_i32"] = _llvm_bswap_i32;
  8463. function _emscripten_set_click_callback(target, userData, useCapture, callbackfunc) {
  8464. JSEvents.registerMouseEventCallback(target, userData, useCapture, callbackfunc, 4, "click");
  8465. return 0;
  8466. }
  8467. function _glfwSetKeyCallback(winid, cbfun) {
  8468. GLFW.setKeyCallback(winid, cbfun);
  8469. }
  8470. function _emscripten_set_gamepadconnected_callback(userData, useCapture, callbackfunc) {
  8471. if (!navigator.getGamepads && !navigator.webkitGetGamepads) return -1;
  8472. JSEvents.registerGamepadEventCallback(window, userData, useCapture, callbackfunc, 26, "gamepadconnected");
  8473. return 0;
  8474. }
  8475. function _emscripten_glGetFloatv(name_, p) {
  8476. emscriptenWebGLGet(name_, p, 'Float');
  8477. }
  8478. function _glTexImage2D(target, level, internalFormat, width, height, border, format, type, pixels) {
  8479. var pixelData = null;
  8480. if (pixels) pixelData = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat);
  8481. GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, pixelData);
  8482. }
  8483. function ___assert_fail(condition, filename, line, func) {
  8484. ABORT = true;
  8485. throw 'Assertion failed: ' + Pointer_stringify(condition) + ', at: ' + [filename ? Pointer_stringify(filename) : 'unknown filename', line, func ? Pointer_stringify(func) : 'unknown function'] + ' at ' + stackTrace();
  8486. }
  8487. function _emscripten_glVertexAttribDivisor(index, divisor) {
  8488. GLctx['vertexAttribDivisor'](index, divisor);
  8489. }
  8490. function _emscripten_glDrawElementsInstanced(mode, count, type, indices, primcount) {
  8491. GLctx['drawElementsInstanced'](mode, count, type, indices, primcount);
  8492. }
  8493. function _emscripten_glDrawElements(mode, count, type, indices) {
  8494. GLctx.drawElements(mode, count, type, indices);
  8495. }
  8496. function _glfwSetMouseButtonCallback(winid, cbfun) {
  8497. GLFW.setMouseButtonCallback(winid, cbfun);
  8498. }
  8499. function _emscripten_glCreateProgram() {
  8500. var id = GL.getNewId(GL.programs);
  8501. var program = GLctx.createProgram();
  8502. program.name = id;
  8503. GL.programs[id] = program;
  8504. return id;
  8505. }
  8506. function _emscripten_glCompressedTexImage2D(target, level, internalFormat, width, height, border, imageSize, data) {
  8507. GLctx['compressedTexImage2D'](target, level, internalFormat, width, height, border, data ? HEAPU8.subarray((data),(data+imageSize)) : null);
  8508. }
  8509. function _emscripten_glClearColor(x0, x1, x2, x3) { GLctx['clearColor'](x0, x1, x2, x3) }
  8510. function _emscripten_glBindVertexArray(vao) {
  8511. GLctx['bindVertexArray'](GL.vaos[vao]);
  8512. }
  8513. function _emscripten_glLoadMatrixf() {
  8514. Module['printErr']('missing function: emscripten_glLoadMatrixf'); abort(-1);
  8515. }
  8516. function _glDeleteShader(id) {
  8517. if (!id) return;
  8518. var shader = GL.shaders[id];
  8519. if (!shader) { // glDeleteShader actually signals an error when deleting a nonexisting object, unlike some other GL delete functions.
  8520. GL.recordError(0x0501 /* GL_INVALID_VALUE */);
  8521. return;
  8522. }
  8523. GLctx.deleteShader(shader);
  8524. GL.shaders[id] = null;
  8525. }
  8526. function _emscripten_glGetProgramiv(program, pname, p) {
  8527. if (!p) {
  8528. // GLES2 specification does not specify how to behave if p is a null pointer. Since calling this function does not make sense
  8529. // if p == null, issue a GL error to notify user about it.
  8530. GL.recordError(0x0501 /* GL_INVALID_VALUE */);
  8531. return;
  8532. }
  8533. if (program >= GL.counter) {
  8534. GL.recordError(0x0501 /* GL_INVALID_VALUE */);
  8535. return;
  8536. }
  8537. var ptable = GL.programInfos[program];
  8538. if (!ptable) {
  8539. GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
  8540. return;
  8541. }
  8542. if (pname == 0x8B84) { // GL_INFO_LOG_LENGTH
  8543. var log = GLctx.getProgramInfoLog(GL.programs[program]);
  8544. if (log === null) log = '(unknown error)';
  8545. HEAP32[((p)>>2)]=log.length + 1;
  8546. } else if (pname == 0x8B87 /* GL_ACTIVE_UNIFORM_MAX_LENGTH */) {
  8547. HEAP32[((p)>>2)]=ptable.maxUniformLength;
  8548. } else if (pname == 0x8B8A /* GL_ACTIVE_ATTRIBUTE_MAX_LENGTH */) {
  8549. if (ptable.maxAttributeLength == -1) {
  8550. var program = GL.programs[program];
  8551. var numAttribs = GLctx.getProgramParameter(program, GLctx.ACTIVE_ATTRIBUTES);
  8552. ptable.maxAttributeLength = 0; // Spec says if there are no active attribs, 0 must be returned.
  8553. for (var i = 0; i < numAttribs; ++i) {
  8554. var activeAttrib = GLctx.getActiveAttrib(program, i);
  8555. ptable.maxAttributeLength = Math.max(ptable.maxAttributeLength, activeAttrib.name.length+1);
  8556. }
  8557. }
  8558. HEAP32[((p)>>2)]=ptable.maxAttributeLength;
  8559. } else if (pname == 0x8A35 /* GL_ACTIVE_UNIFORM_BLOCK_MAX_NAME_LENGTH */) {
  8560. if (ptable.maxUniformBlockNameLength == -1) {
  8561. var program = GL.programs[program];
  8562. var numBlocks = GLctx.getProgramParameter(program, GLctx.ACTIVE_UNIFORM_BLOCKS);
  8563. ptable.maxUniformBlockNameLength = 0;
  8564. for (var i = 0; i < numBlocks; ++i) {
  8565. var activeBlockName = GLctx.getActiveUniformBlockName(program, i);
  8566. ptable.maxUniformBlockNameLength = Math.max(ptable.maxUniformBlockNameLength, activeBlockName.length+1);
  8567. }
  8568. }
  8569. HEAP32[((p)>>2)]=ptable.maxUniformBlockNameLength;
  8570. } else {
  8571. HEAP32[((p)>>2)]=GLctx.getProgramParameter(GL.programs[program], pname);
  8572. }
  8573. }
  8574. function _emscripten_glGetProgramInfoLog(program, maxLength, length, infoLog) {
  8575. var log = GLctx.getProgramInfoLog(GL.programs[program]);
  8576. if (log === null) log = '(unknown error)';
  8577. if (maxLength > 0 && infoLog) {
  8578. var numBytesWrittenExclNull = stringToUTF8(log, infoLog, maxLength);
  8579. if (length) HEAP32[((length)>>2)]=numBytesWrittenExclNull;
  8580. } else {
  8581. if (length) HEAP32[((length)>>2)]=0;
  8582. }
  8583. }
  8584. function _emscripten_glTexImage2D(target, level, internalFormat, width, height, border, format, type, pixels) {
  8585. var pixelData = null;
  8586. if (pixels) pixelData = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat);
  8587. GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, pixelData);
  8588. }
  8589. function _glPixelStorei(pname, param) {
  8590. if (pname == 0x0D05 /* GL_PACK_ALIGNMENT */) {
  8591. GL.packAlignment = param;
  8592. } else if (pname == 0x0cf5 /* GL_UNPACK_ALIGNMENT */) {
  8593. GL.unpackAlignment = param;
  8594. }
  8595. GLctx.pixelStorei(pname, param);
  8596. }
  8597. function ___unlock() {}
  8598. function _emscripten_glColorPointer() {
  8599. Module['printErr']('missing function: emscripten_glColorPointer'); abort(-1);
  8600. }
  8601. function _glViewport(x0, x1, x2, x3) { GLctx['viewport'](x0, x1, x2, x3) }
  8602. function _glVertexAttrib2f(x0, x1, x2) { GLctx['vertexAttrib2f'](x0, x1, x2) }
  8603. function _glfwDestroyWindow(winid) {
  8604. return GLFW.destroyWindow(winid);
  8605. }
  8606. function _emscripten_glFlush() { GLctx['flush']() }
  8607. function _glfwSetErrorCallback(cbfun) {
  8608. GLFW.errorFunc = cbfun;
  8609. }
  8610. function _emscripten_glCreateShader(shaderType) {
  8611. var id = GL.getNewId(GL.shaders);
  8612. GL.shaders[id] = GLctx.createShader(shaderType);
  8613. return id;
  8614. }
  8615. function _glUniformMatrix4fv(location, count, transpose, value) {
  8616. var view;
  8617. if (16*count <= GL.MINI_TEMP_BUFFER_SIZE) {
  8618. // avoid allocation when uploading few enough uniforms
  8619. view = GL.miniTempBufferViews[16*count-1];
  8620. for (var i = 0; i < 16*count; i += 16) {
  8621. view[i] = HEAPF32[(((value)+(4*i))>>2)];
  8622. view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)];
  8623. view[i+2] = HEAPF32[(((value)+(4*i+8))>>2)];
  8624. view[i+3] = HEAPF32[(((value)+(4*i+12))>>2)];
  8625. view[i+4] = HEAPF32[(((value)+(4*i+16))>>2)];
  8626. view[i+5] = HEAPF32[(((value)+(4*i+20))>>2)];
  8627. view[i+6] = HEAPF32[(((value)+(4*i+24))>>2)];
  8628. view[i+7] = HEAPF32[(((value)+(4*i+28))>>2)];
  8629. view[i+8] = HEAPF32[(((value)+(4*i+32))>>2)];
  8630. view[i+9] = HEAPF32[(((value)+(4*i+36))>>2)];
  8631. view[i+10] = HEAPF32[(((value)+(4*i+40))>>2)];
  8632. view[i+11] = HEAPF32[(((value)+(4*i+44))>>2)];
  8633. view[i+12] = HEAPF32[(((value)+(4*i+48))>>2)];
  8634. view[i+13] = HEAPF32[(((value)+(4*i+52))>>2)];
  8635. view[i+14] = HEAPF32[(((value)+(4*i+56))>>2)];
  8636. view[i+15] = HEAPF32[(((value)+(4*i+60))>>2)];
  8637. }
  8638. } else {
  8639. view = HEAPF32.subarray((value)>>2,(value+count*64)>>2);
  8640. }
  8641. GLctx.uniformMatrix4fv(GL.uniforms[location], !!transpose, view);
  8642. }
  8643. function _emscripten_glValidateProgram(program) {
  8644. GLctx.validateProgram(GL.programs[program]);
  8645. }
  8646. function _glTexParameteri(x0, x1, x2) { GLctx['texParameteri'](x0, x1, x2) }
  8647. function _glFrontFace(x0) { GLctx['frontFace'](x0) }
  8648. function _emscripten_glColorMask(red, green, blue, alpha) {
  8649. GLctx.colorMask(!!red, !!green, !!blue, !!alpha);
  8650. }
  8651. function _emscripten_glPixelStorei(pname, param) {
  8652. if (pname == 0x0D05 /* GL_PACK_ALIGNMENT */) {
  8653. GL.packAlignment = param;
  8654. } else if (pname == 0x0cf5 /* GL_UNPACK_ALIGNMENT */) {
  8655. GL.unpackAlignment = param;
  8656. }
  8657. GLctx.pixelStorei(pname, param);
  8658. }
  8659. function _emscripten_glDeleteTextures(n, textures) {
  8660. for (var i = 0; i < n; i++) {
  8661. var id = HEAP32[(((textures)+(i*4))>>2)];
  8662. var texture = GL.textures[id];
  8663. if (!texture) continue; // GL spec: "glDeleteTextures silently ignores 0s and names that do not correspond to existing textures".
  8664. GLctx.deleteTexture(texture);
  8665. texture.name = 0;
  8666. GL.textures[id] = null;
  8667. }
  8668. }
  8669. function _emscripten_glCompileShader(shader) {
  8670. GLctx.compileShader(GL.shaders[shader]);
  8671. }
  8672. function _emscripten_glGenVertexArrays(n, arrays) {
  8673. for (var i = 0; i < n; i++) {
  8674. var vao = GLctx['createVertexArray']();
  8675. if (!vao) {
  8676. GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
  8677. while(i < n) HEAP32[(((arrays)+(i++*4))>>2)]=0;
  8678. return;
  8679. }
  8680. var id = GL.getNewId(GL.vaos);
  8681. vao.name = id;
  8682. GL.vaos[id] = vao;
  8683. HEAP32[(((arrays)+(i*4))>>2)]=id;
  8684. }
  8685. }
  8686. function _time(ptr) {
  8687. var ret = (Date.now()/1000)|0;
  8688. if (ptr) {
  8689. HEAP32[((ptr)>>2)]=ret;
  8690. }
  8691. return ret;
  8692. }
  8693. function _emscripten_glGetBooleanv(name_, p) {
  8694. emscriptenWebGLGet(name_, p, 'Boolean');
  8695. }
  8696. function ___syscall221(which, varargs) {SYSCALLS.varargs = varargs;
  8697. try {
  8698. // fcntl64
  8699. var stream = SYSCALLS.getStreamFromFD(), cmd = SYSCALLS.get();
  8700. switch (cmd) {
  8701. case 0: {
  8702. var arg = SYSCALLS.get();
  8703. if (arg < 0) {
  8704. return -ERRNO_CODES.EINVAL;
  8705. }
  8706. var newStream;
  8707. newStream = FS.open(stream.path, stream.flags, 0, arg);
  8708. return newStream.fd;
  8709. }
  8710. case 1:
  8711. case 2:
  8712. return 0; // FD_CLOEXEC makes no sense for a single process.
  8713. case 3:
  8714. return stream.flags;
  8715. case 4: {
  8716. var arg = SYSCALLS.get();
  8717. stream.flags |= arg;
  8718. return 0;
  8719. }
  8720. case 12:
  8721. case 12: {
  8722. var arg = SYSCALLS.get();
  8723. var offset = 0;
  8724. // We're always unlocked.
  8725. HEAP16[(((arg)+(offset))>>1)]=2;
  8726. return 0;
  8727. }
  8728. case 13:
  8729. case 14:
  8730. case 13:
  8731. case 14:
  8732. return 0; // Pretend that the locking is successful.
  8733. case 16:
  8734. case 8:
  8735. return -ERRNO_CODES.EINVAL; // These are for sockets. We don't have them fully implemented yet.
  8736. case 9:
  8737. // musl trusts getown return values, due to a bug where they must be, as they overlap with errors. just return -1 here, so fnctl() returns that, and we set errno ourselves.
  8738. ___setErrNo(ERRNO_CODES.EINVAL);
  8739. return -1;
  8740. default: {
  8741. return -ERRNO_CODES.EINVAL;
  8742. }
  8743. }
  8744. } catch (e) {
  8745. if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
  8746. return -e.errno;
  8747. }
  8748. }
  8749. var GLctx; GL.init();
  8750. if (ENVIRONMENT_IS_NODE) {
  8751. _emscripten_get_now = function _emscripten_get_now_actual() {
  8752. var t = process['hrtime']();
  8753. return t[0] * 1e3 + t[1] / 1e6;
  8754. };
  8755. } else if (typeof dateNow !== 'undefined') {
  8756. _emscripten_get_now = dateNow;
  8757. } else if (typeof self === 'object' && self['performance'] && typeof self['performance']['now'] === 'function') {
  8758. _emscripten_get_now = function() { return self['performance']['now'](); };
  8759. } else if (typeof performance === 'object' && typeof performance['now'] === 'function') {
  8760. _emscripten_get_now = function() { return performance['now'](); };
  8761. } else {
  8762. _emscripten_get_now = Date.now;
  8763. };
  8764. Module["requestFullScreen"] = function Module_requestFullScreen(lockPointer, resizeCanvas, vrDevice) { Module.printErr("Module.requestFullScreen is deprecated. Please call Module.requestFullscreen instead."); Module["requestFullScreen"] = Module["requestFullscreen"]; Browser.requestFullScreen(lockPointer, resizeCanvas, vrDevice) };
  8765. Module["requestFullscreen"] = function Module_requestFullscreen(lockPointer, resizeCanvas, vrDevice) { Browser.requestFullscreen(lockPointer, resizeCanvas, vrDevice) };
  8766. Module["requestAnimationFrame"] = function Module_requestAnimationFrame(func) { Browser.requestAnimationFrame(func) };
  8767. Module["setCanvasSize"] = function Module_setCanvasSize(width, height, noUpdates) { Browser.setCanvasSize(width, height, noUpdates) };
  8768. Module["pauseMainLoop"] = function Module_pauseMainLoop() { Browser.mainLoop.pause() };
  8769. Module["resumeMainLoop"] = function Module_resumeMainLoop() { Browser.mainLoop.resume() };
  8770. Module["getUserMedia"] = function Module_getUserMedia() { Browser.getUserMedia() }
  8771. Module["createContext"] = function Module_createContext(canvas, useWebGL, setInModule, webGLContextAttributes) { return Browser.createContext(canvas, useWebGL, setInModule, webGLContextAttributes) };
  8772. FS.staticInit();__ATINIT__.unshift(function() { if (!Module["noFSInit"] && !FS.init.initialized) FS.init() });__ATMAIN__.push(function() { FS.ignorePermissions = false });__ATEXIT__.push(function() { FS.quit() });Module["FS_createFolder"] = FS.createFolder;Module["FS_createPath"] = FS.createPath;Module["FS_createDataFile"] = FS.createDataFile;Module["FS_createPreloadedFile"] = FS.createPreloadedFile;Module["FS_createLazyFile"] = FS.createLazyFile;Module["FS_createLink"] = FS.createLink;Module["FS_createDevice"] = FS.createDevice;Module["FS_unlink"] = FS.unlink;;
  8773. __ATINIT__.unshift(function() { TTY.init() });__ATEXIT__.push(function() { TTY.shutdown() });;
  8774. if (ENVIRONMENT_IS_NODE) { var fs = require("fs"); var NODEJS_PATH = require("path"); NODEFS.staticInit(); };
  8775. JSEvents.staticInit();;
  8776. DYNAMICTOP_PTR = allocate(1, "i32", ALLOC_STATIC);
  8777. STACK_BASE = STACKTOP = Runtime.alignMemory(STATICTOP);
  8778. STACK_MAX = STACK_BASE + TOTAL_STACK;
  8779. DYNAMIC_BASE = Runtime.alignMemory(STACK_MAX);
  8780. HEAP32[DYNAMICTOP_PTR>>2] = DYNAMIC_BASE;
  8781. staticSealed = true; // seal the static portion of memory
  8782. assert(DYNAMIC_BASE < TOTAL_MEMORY, "TOTAL_MEMORY not big enough for stack");
  8783. function nullFunc_viiiii(x) { Module["printErr"]("Invalid function pointer called with signature 'viiiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
  8784. function nullFunc_vd(x) { Module["printErr"]("Invalid function pointer called with signature 'vd'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
  8785. function nullFunc_vid(x) { Module["printErr"]("Invalid function pointer called with signature 'vid'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
  8786. function nullFunc_vi(x) { Module["printErr"]("Invalid function pointer called with signature 'vi'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
  8787. function nullFunc_vii(x) { Module["printErr"]("Invalid function pointer called with signature 'vii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
  8788. function nullFunc_ii(x) { Module["printErr"]("Invalid function pointer called with signature 'ii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
  8789. function nullFunc_viddd(x) { Module["printErr"]("Invalid function pointer called with signature 'viddd'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
  8790. function nullFunc_vidd(x) { Module["printErr"]("Invalid function pointer called with signature 'vidd'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
  8791. function nullFunc_iiii(x) { Module["printErr"]("Invalid function pointer called with signature 'iiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
  8792. function nullFunc_viiiiiiii(x) { Module["printErr"]("Invalid function pointer called with signature 'viiiiiiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
  8793. function nullFunc_viiiiii(x) { Module["printErr"]("Invalid function pointer called with signature 'viiiiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
  8794. function nullFunc_viii(x) { Module["printErr"]("Invalid function pointer called with signature 'viii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
  8795. function nullFunc_vidddd(x) { Module["printErr"]("Invalid function pointer called with signature 'vidddd'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
  8796. function nullFunc_vdi(x) { Module["printErr"]("Invalid function pointer called with signature 'vdi'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
  8797. function nullFunc_viiiiiii(x) { Module["printErr"]("Invalid function pointer called with signature 'viiiiiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
  8798. function nullFunc_viiiiiiiii(x) { Module["printErr"]("Invalid function pointer called with signature 'viiiiiiiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
  8799. function nullFunc_iii(x) { Module["printErr"]("Invalid function pointer called with signature 'iii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
  8800. function nullFunc_i(x) { Module["printErr"]("Invalid function pointer called with signature 'i'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
  8801. function nullFunc_vdddddd(x) { Module["printErr"]("Invalid function pointer called with signature 'vdddddd'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
  8802. function nullFunc_vdddd(x) { Module["printErr"]("Invalid function pointer called with signature 'vdddd'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
  8803. function nullFunc_vdd(x) { Module["printErr"]("Invalid function pointer called with signature 'vdd'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
  8804. function nullFunc_v(x) { Module["printErr"]("Invalid function pointer called with signature 'v'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
  8805. function nullFunc_viid(x) { Module["printErr"]("Invalid function pointer called with signature 'viid'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
  8806. function nullFunc_viiii(x) { Module["printErr"]("Invalid function pointer called with signature 'viiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
  8807. function invoke_viiiii(index,a1,a2,a3,a4,a5) {
  8808. try {
  8809. Module["dynCall_viiiii"](index,a1,a2,a3,a4,a5);
  8810. } catch(e) {
  8811. if (typeof e !== 'number' && e !== 'longjmp') throw e;
  8812. Module["setThrew"](1, 0);
  8813. }
  8814. }
  8815. function invoke_vd(index,a1) {
  8816. try {
  8817. Module["dynCall_vd"](index,a1);
  8818. } catch(e) {
  8819. if (typeof e !== 'number' && e !== 'longjmp') throw e;
  8820. Module["setThrew"](1, 0);
  8821. }
  8822. }
  8823. function invoke_vid(index,a1,a2) {
  8824. try {
  8825. Module["dynCall_vid"](index,a1,a2);
  8826. } catch(e) {
  8827. if (typeof e !== 'number' && e !== 'longjmp') throw e;
  8828. Module["setThrew"](1, 0);
  8829. }
  8830. }
  8831. function invoke_vi(index,a1) {
  8832. try {
  8833. Module["dynCall_vi"](index,a1);
  8834. } catch(e) {
  8835. if (typeof e !== 'number' && e !== 'longjmp') throw e;
  8836. Module["setThrew"](1, 0);
  8837. }
  8838. }
  8839. function invoke_vii(index,a1,a2) {
  8840. try {
  8841. Module["dynCall_vii"](index,a1,a2);
  8842. } catch(e) {
  8843. if (typeof e !== 'number' && e !== 'longjmp') throw e;
  8844. Module["setThrew"](1, 0);
  8845. }
  8846. }
  8847. function invoke_ii(index,a1) {
  8848. try {
  8849. return Module["dynCall_ii"](index,a1);
  8850. } catch(e) {
  8851. if (typeof e !== 'number' && e !== 'longjmp') throw e;
  8852. Module["setThrew"](1, 0);
  8853. }
  8854. }
  8855. function invoke_viddd(index,a1,a2,a3,a4) {
  8856. try {
  8857. Module["dynCall_viddd"](index,a1,a2,a3,a4);
  8858. } catch(e) {
  8859. if (typeof e !== 'number' && e !== 'longjmp') throw e;
  8860. Module["setThrew"](1, 0);
  8861. }
  8862. }
  8863. function invoke_vidd(index,a1,a2,a3) {
  8864. try {
  8865. Module["dynCall_vidd"](index,a1,a2,a3);
  8866. } catch(e) {
  8867. if (typeof e !== 'number' && e !== 'longjmp') throw e;
  8868. Module["setThrew"](1, 0);
  8869. }
  8870. }
  8871. function invoke_iiii(index,a1,a2,a3) {
  8872. try {
  8873. return Module["dynCall_iiii"](index,a1,a2,a3);
  8874. } catch(e) {
  8875. if (typeof e !== 'number' && e !== 'longjmp') throw e;
  8876. Module["setThrew"](1, 0);
  8877. }
  8878. }
  8879. function invoke_viiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8) {
  8880. try {
  8881. Module["dynCall_viiiiiiii"](index,a1,a2,a3,a4,a5,a6,a7,a8);
  8882. } catch(e) {
  8883. if (typeof e !== 'number' && e !== 'longjmp') throw e;
  8884. Module["setThrew"](1, 0);
  8885. }
  8886. }
  8887. function invoke_viiiiii(index,a1,a2,a3,a4,a5,a6) {
  8888. try {
  8889. Module["dynCall_viiiiii"](index,a1,a2,a3,a4,a5,a6);
  8890. } catch(e) {
  8891. if (typeof e !== 'number' && e !== 'longjmp') throw e;
  8892. Module["setThrew"](1, 0);
  8893. }
  8894. }
  8895. function invoke_viii(index,a1,a2,a3) {
  8896. try {
  8897. Module["dynCall_viii"](index,a1,a2,a3);
  8898. } catch(e) {
  8899. if (typeof e !== 'number' && e !== 'longjmp') throw e;
  8900. Module["setThrew"](1, 0);
  8901. }
  8902. }
  8903. function invoke_vidddd(index,a1,a2,a3,a4,a5) {
  8904. try {
  8905. Module["dynCall_vidddd"](index,a1,a2,a3,a4,a5);
  8906. } catch(e) {
  8907. if (typeof e !== 'number' && e !== 'longjmp') throw e;
  8908. Module["setThrew"](1, 0);
  8909. }
  8910. }
  8911. function invoke_vdi(index,a1,a2) {
  8912. try {
  8913. Module["dynCall_vdi"](index,a1,a2);
  8914. } catch(e) {
  8915. if (typeof e !== 'number' && e !== 'longjmp') throw e;
  8916. Module["setThrew"](1, 0);
  8917. }
  8918. }
  8919. function invoke_viiiiiii(index,a1,a2,a3,a4,a5,a6,a7) {
  8920. try {
  8921. Module["dynCall_viiiiiii"](index,a1,a2,a3,a4,a5,a6,a7);
  8922. } catch(e) {
  8923. if (typeof e !== 'number' && e !== 'longjmp') throw e;
  8924. Module["setThrew"](1, 0);
  8925. }
  8926. }
  8927. function invoke_viiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9) {
  8928. try {
  8929. Module["dynCall_viiiiiiiii"](index,a1,a2,a3,a4,a5,a6,a7,a8,a9);
  8930. } catch(e) {
  8931. if (typeof e !== 'number' && e !== 'longjmp') throw e;
  8932. Module["setThrew"](1, 0);
  8933. }
  8934. }
  8935. function invoke_iii(index,a1,a2) {
  8936. try {
  8937. return Module["dynCall_iii"](index,a1,a2);
  8938. } catch(e) {
  8939. if (typeof e !== 'number' && e !== 'longjmp') throw e;
  8940. Module["setThrew"](1, 0);
  8941. }
  8942. }
  8943. function invoke_i(index) {
  8944. try {
  8945. return Module["dynCall_i"](index);
  8946. } catch(e) {
  8947. if (typeof e !== 'number' && e !== 'longjmp') throw e;
  8948. Module["setThrew"](1, 0);
  8949. }
  8950. }
  8951. function invoke_vdddddd(index,a1,a2,a3,a4,a5,a6) {
  8952. try {
  8953. Module["dynCall_vdddddd"](index,a1,a2,a3,a4,a5,a6);
  8954. } catch(e) {
  8955. if (typeof e !== 'number' && e !== 'longjmp') throw e;
  8956. Module["setThrew"](1, 0);
  8957. }
  8958. }
  8959. function invoke_vdddd(index,a1,a2,a3,a4) {
  8960. try {
  8961. Module["dynCall_vdddd"](index,a1,a2,a3,a4);
  8962. } catch(e) {
  8963. if (typeof e !== 'number' && e !== 'longjmp') throw e;
  8964. Module["setThrew"](1, 0);
  8965. }
  8966. }
  8967. function invoke_vdd(index,a1,a2) {
  8968. try {
  8969. Module["dynCall_vdd"](index,a1,a2);
  8970. } catch(e) {
  8971. if (typeof e !== 'number' && e !== 'longjmp') throw e;
  8972. Module["setThrew"](1, 0);
  8973. }
  8974. }
  8975. function invoke_v(index) {
  8976. try {
  8977. Module["dynCall_v"](index);
  8978. } catch(e) {
  8979. if (typeof e !== 'number' && e !== 'longjmp') throw e;
  8980. Module["setThrew"](1, 0);
  8981. }
  8982. }
  8983. function invoke_viid(index,a1,a2,a3) {
  8984. try {
  8985. Module["dynCall_viid"](index,a1,a2,a3);
  8986. } catch(e) {
  8987. if (typeof e !== 'number' && e !== 'longjmp') throw e;
  8988. Module["setThrew"](1, 0);
  8989. }
  8990. }
  8991. function invoke_viiii(index,a1,a2,a3,a4) {
  8992. try {
  8993. Module["dynCall_viiii"](index,a1,a2,a3,a4);
  8994. } catch(e) {
  8995. if (typeof e !== 'number' && e !== 'longjmp') throw e;
  8996. Module["setThrew"](1, 0);
  8997. }
  8998. }
  8999. Module.asmGlobalArg = { "Math": Math, "Int8Array": Int8Array, "Int16Array": Int16Array, "Int32Array": Int32Array, "Uint8Array": Uint8Array, "Uint16Array": Uint16Array, "Uint32Array": Uint32Array, "Float32Array": Float32Array, "Float64Array": Float64Array, "NaN": NaN, "Infinity": Infinity };
  9000. Module.asmLibraryArg = { "abort": abort, "assert": assert, "enlargeMemory": enlargeMemory, "getTotalMemory": getTotalMemory, "abortOnCannotGrowMemory": abortOnCannotGrowMemory, "abortStackOverflow": abortStackOverflow, "nullFunc_viiiii": nullFunc_viiiii, "nullFunc_vd": nullFunc_vd, "nullFunc_vid": nullFunc_vid, "nullFunc_vi": nullFunc_vi, "nullFunc_vii": nullFunc_vii, "nullFunc_ii": nullFunc_ii, "nullFunc_viddd": nullFunc_viddd, "nullFunc_vidd": nullFunc_vidd, "nullFunc_iiii": nullFunc_iiii, "nullFunc_viiiiiiii": nullFunc_viiiiiiii, "nullFunc_viiiiii": nullFunc_viiiiii, "nullFunc_viii": nullFunc_viii, "nullFunc_vidddd": nullFunc_vidddd, "nullFunc_vdi": nullFunc_vdi, "nullFunc_viiiiiii": nullFunc_viiiiiii, "nullFunc_viiiiiiiii": nullFunc_viiiiiiiii, "nullFunc_iii": nullFunc_iii, "nullFunc_i": nullFunc_i, "nullFunc_vdddddd": nullFunc_vdddddd, "nullFunc_vdddd": nullFunc_vdddd, "nullFunc_vdd": nullFunc_vdd, "nullFunc_v": nullFunc_v, "nullFunc_viid": nullFunc_viid, "nullFunc_viiii": nullFunc_viiii, "invoke_viiiii": invoke_viiiii, "invoke_vd": invoke_vd, "invoke_vid": invoke_vid, "invoke_vi": invoke_vi, "invoke_vii": invoke_vii, "invoke_ii": invoke_ii, "invoke_viddd": invoke_viddd, "invoke_vidd": invoke_vidd, "invoke_iiii": invoke_iiii, "invoke_viiiiiiii": invoke_viiiiiiii, "invoke_viiiiii": invoke_viiiiii, "invoke_viii": invoke_viii, "invoke_vidddd": invoke_vidddd, "invoke_vdi": invoke_vdi, "invoke_viiiiiii": invoke_viiiiiii, "invoke_viiiiiiiii": invoke_viiiiiiiii, "invoke_iii": invoke_iii, "invoke_i": invoke_i, "invoke_vdddddd": invoke_vdddddd, "invoke_vdddd": invoke_vdddd, "invoke_vdd": invoke_vdd, "invoke_v": invoke_v, "invoke_viid": invoke_viid, "invoke_viiii": invoke_viiii, "_emscripten_glGetTexParameterfv": _emscripten_glGetTexParameterfv, "_glUseProgram": _glUseProgram, "_emscripten_glShaderSource": _emscripten_glShaderSource, "_glfwCreateWindow": _glfwCreateWindow, "_emscripten_glReleaseShaderCompiler": _emscripten_glReleaseShaderCompiler, "_emscripten_glBlendFuncSeparate": _emscripten_glBlendFuncSeparate, "_emscripten_glVertexAttribPointer": _emscripten_glVertexAttribPointer, "_emscripten_glGetIntegerv": _emscripten_glGetIntegerv, "_emscripten_glCullFace": _emscripten_glCullFace, "_emscripten_glIsProgram": _emscripten_glIsProgram, "_emscripten_glStencilMaskSeparate": _emscripten_glStencilMaskSeparate, "_emscripten_glViewport": _emscripten_glViewport, "_emscripten_glFrontFace": _emscripten_glFrontFace, "___assert_fail": ___assert_fail, "_glDeleteProgram": _glDeleteProgram, "_emscripten_glUniform3fv": _emscripten_glUniform3fv, "_emscripten_glPolygonOffset": _emscripten_glPolygonOffset, "_emscripten_glUseProgram": _emscripten_glUseProgram, "_glVertexAttrib4f": _glVertexAttrib4f, "_glBindBuffer": _glBindBuffer, "_emscripten_glDepthFunc": _emscripten_glDepthFunc, "_glGetShaderInfoLog": _glGetShaderInfoLog, "_emscripten_set_fullscreenchange_callback": _emscripten_set_fullscreenchange_callback, "_emscripten_set_touchmove_callback": _emscripten_set_touchmove_callback, "_emscripten_set_main_loop_timing": _emscripten_set_main_loop_timing, "_emscripten_set_gamepaddisconnected_callback": _emscripten_set_gamepaddisconnected_callback, "_glDisable": _glDisable, "_glBlendFunc": _glBlendFunc, "_emscripten_glDisableVertexAttribArray": _emscripten_glDisableVertexAttribArray, "_glGetAttribLocation": _glGetAttribLocation, "_glDisableVertexAttribArray": _glDisableVertexAttribArray, "_glCreateShader": _glCreateShader, "_emscripten_glSampleCoverage": _emscripten_glSampleCoverage, "_emscripten_glVertexPointer": _emscripten_glVertexPointer, "_emscripten_set_touchstart_callback": _emscripten_set_touchstart_callback, "emscriptenWebGLComputeImageSize": emscriptenWebGLComputeImageSize, "_emscripten_glGetBooleanv": _emscripten_glGetBooleanv, "_emscripten_glGetShaderSource": _emscripten_glGetShaderSource, "_glUniform4f": _glUniform4f, "_llvm_stacksave": _llvm_stacksave, "_emscripten_glUniform1i": _emscripten_glUniform1i, "_emscripten_glStencilFuncSeparate": _emscripten_glStencilFuncSeparate, "_emscripten_glFrustum": _emscripten_glFrustum, "_emscripten_glGenBuffers": _emscripten_glGenBuffers, "_emscripten_glDeleteObjectARB": _emscripten_glDeleteObjectARB, "_glfwSetWindowSizeCallback": _glfwSetWindowSizeCallback, "_emscripten_glGetShaderPrecisionFormat": _emscripten_glGetShaderPrecisionFormat, "_glfwInit": _glfwInit, "_glGenBuffers": _glGenBuffers, "_glShaderSource": _glShaderSource, "_emscripten_glGetString": _emscripten_glGetString, "_emscripten_glIsFramebuffer": _emscripten_glIsFramebuffer, "_glVertexAttrib3f": _glVertexAttrib3f, "_emscripten_glIsEnabled": _emscripten_glIsEnabled, "_emscripten_glScissor": _emscripten_glScissor, "_emscripten_glVertexAttrib4fv": _emscripten_glVertexAttrib4fv, "_emscripten_glFramebufferTexture2D": _emscripten_glFramebufferTexture2D, "_emscripten_glTexParameteriv": _emscripten_glTexParameteriv, "___syscall145": ___syscall145, "_emscripten_glBindProgramARB": _emscripten_glBindProgramARB, "_emscripten_glStencilOpSeparate": _emscripten_glStencilOpSeparate, "_emscripten_glFramebufferRenderbuffer": _emscripten_glFramebufferRenderbuffer, "___syscall140": ___syscall140, "_glfwSetErrorCallback": _glfwSetErrorCallback, "_glfwDefaultWindowHints": _glfwDefaultWindowHints, "_glfwDestroyWindow": _glfwDestroyWindow, "___syscall146": ___syscall146, "_emscripten_glGetActiveAttrib": _emscripten_glGetActiveAttrib, "_emscripten_glAttachShader": _emscripten_glAttachShader, "_glVertexAttribPointer": _glVertexAttribPointer, "_emscripten_glUniform2i": _emscripten_glUniform2i, "_emscripten_glUniform2f": _emscripten_glUniform2f, "_emscripten_glTexParameterfv": _emscripten_glTexParameterfv, "_emscripten_glUniformMatrix2fv": _emscripten_glUniformMatrix2fv, "_glGetProgramInfoLog": _glGetProgramInfoLog, "_glfwSetScrollCallback": _glfwSetScrollCallback, "_emscripten_glTexParameterf": _emscripten_glTexParameterf, "_emscripten_glGetAttachedShaders": _emscripten_glGetAttachedShaders, "_emscripten_glGenTextures": _emscripten_glGenTextures, "_emscripten_glTexParameteri": _emscripten_glTexParameteri, "_llvm_stackrestore": _llvm_stackrestore, "_glfwMakeContextCurrent": _glfwMakeContextCurrent, "_emscripten_glClear": _emscripten_glClear, "_glDrawElements": _glDrawElements, "_glBufferSubData": _glBufferSubData, "_emscripten_glValidateProgram": _emscripten_glValidateProgram, "_emscripten_glVertexAttrib2fv": _emscripten_glVertexAttrib2fv, "_glViewport": _glViewport, "_emscripten_glUniform4iv": _emscripten_glUniform4iv, "_emscripten_glGetTexParameteriv": _emscripten_glGetTexParameteriv, "___setErrNo": ___setErrNo, "_eglGetProcAddress": _eglGetProcAddress, "_emscripten_glBindAttribLocation": _emscripten_glBindAttribLocation, "_glDeleteTextures": _glDeleteTextures, "_glDepthFunc": _glDepthFunc, "_emscripten_glClientActiveTexture": _emscripten_glClientActiveTexture, "_emscripten_glVertexAttrib2f": _emscripten_glVertexAttrib2f, "_glUniform3f": _glUniform3f, "_emscripten_glFlush": _emscripten_glFlush, "_emscripten_glCheckFramebufferStatus": _emscripten_glCheckFramebufferStatus, "_emscripten_glGenerateMipmap": _emscripten_glGenerateMipmap, "_emscripten_glGetError": _emscripten_glGetError, "_emscripten_glClearDepthf": _emscripten_glClearDepthf, "_emscripten_glBufferData": _emscripten_glBufferData, "_emscripten_glUniform3i": _emscripten_glUniform3i, "_emscripten_glRotatef": _emscripten_glRotatef, "_emscripten_glDeleteShader": _emscripten_glDeleteShader, "_glEnable": _glEnable, "_glVertexAttrib2f": _glVertexAttrib2f, "_emscripten_glReadPixels": _emscripten_glReadPixels, "_emscripten_glMatrixMode": _emscripten_glMatrixMode, "_glGetString": _glGetString, "_emscripten_glClearStencil": _emscripten_glClearStencil, "_emscripten_glGetUniformLocation": _emscripten_glGetUniformLocation, "emscriptenWebGLGet": emscriptenWebGLGet, "_emscripten_glEnableVertexAttribArray": _emscripten_glEnableVertexAttribArray, "_emscripten_glGetAttribLocation": _emscripten_glGetAttribLocation, "_emscripten_get_now": _emscripten_get_now, "_emscripten_glNormalPointer": _emscripten_glNormalPointer, "_glAttachShader": _glAttachShader, "_emscripten_glTexCoordPointer": _emscripten_glTexCoordPointer, "_emscripten_glEnable": _emscripten_glEnable, "_glCreateProgram": _glCreateProgram, "_glUniformMatrix4fv": _glUniformMatrix4fv, "_emscripten_glClearDepth": _emscripten_glClearDepth, "___lock": ___lock, "emscriptenWebGLGetTexPixelData": emscriptenWebGLGetTexPixelData, "___syscall6": ___syscall6, "___syscall5": ___syscall5, "_emscripten_glIsBuffer": _emscripten_glIsBuffer, "_emscripten_glVertexAttrib3f": _emscripten_glVertexAttrib3f, "_time": _time, "_emscripten_glVertexAttrib1f": _emscripten_glVertexAttrib1f, "_emscripten_glGetFramebufferAttachmentParameteriv": _emscripten_glGetFramebufferAttachmentParameteriv, "_emscripten_glBlendEquationSeparate": _emscripten_glBlendEquationSeparate, "_exit": _exit, "_emscripten_glEnableClientState": _emscripten_glEnableClientState, "_emscripten_glUniform4i": _emscripten_glUniform4i, "_emscripten_glDrawRangeElements": _emscripten_glDrawRangeElements, "_glCullFace": _glCullFace, "_emscripten_glGetPointerv": _emscripten_glGetPointerv, "_emscripten_set_keypress_callback": _emscripten_set_keypress_callback, "__emscripten_sample_gamepad_data": __emscripten_sample_gamepad_data, "_emscripten_get_gamepad_status": _emscripten_get_gamepad_status, "_emscripten_glUniform4f": _emscripten_glUniform4f, "_emscripten_glUniform2fv": _emscripten_glUniform2fv, "_glfwGetVideoModes": _glfwGetVideoModes, "_emscripten_set_click_callback": _emscripten_set_click_callback, "_emscripten_glFinish": _emscripten_glFinish, "_emscripten_glShaderBinary": _emscripten_glShaderBinary, "_emscripten_glDrawElements": _emscripten_glDrawElements, "_emscripten_glBlendFunc": _emscripten_glBlendFunc, "_emscripten_get_num_gamepads": _emscripten_get_num_gamepads, "___syscall221": ___syscall221, "_glCompressedTexImage2D": _glCompressedTexImage2D, "_emscripten_glUniform1iv": _emscripten_glUniform1iv, "_emscripten_glGetVertexAttribPointerv": _emscripten_glGetVertexAttribPointerv, "_glClearDepthf": _glClearDepthf, "_emscripten_glCompressedTexSubImage2D": _emscripten_glCompressedTexSubImage2D, "emscriptenWebGLGetUniform": emscriptenWebGLGetUniform, "_emscripten_glGenRenderbuffers": _emscripten_glGenRenderbuffers, "_emscripten_glDeleteVertexArrays": _emscripten_glDeleteVertexArrays, "_glfwSetWindowShouldClose": _glfwSetWindowShouldClose, "_emscripten_glUniform1fv": _emscripten_glUniform1fv, "_emscripten_glGetActiveUniform": _emscripten_glGetActiveUniform, "_glBindTexture": _glBindTexture, "_emscripten_glUniform3iv": _emscripten_glUniform3iv, "_emscripten_glUniform2iv": _emscripten_glUniform2iv, "_emscripten_glHint": _emscripten_glHint, "_glfwSetCharCallback": _glfwSetCharCallback, "emscriptenWebGLGetVertexAttrib": emscriptenWebGLGetVertexAttrib, "_emscripten_glLoadMatrixf": _emscripten_glLoadMatrixf, "_emscripten_glDeleteProgram": _emscripten_glDeleteProgram, "_emscripten_glDeleteRenderbuffers": _emscripten_glDeleteRenderbuffers, "_emscripten_glDrawElementsInstanced": _emscripten_glDrawElementsInstanced, "_emscripten_glVertexAttrib4f": _emscripten_glVertexAttrib4f, "_glDrawArrays": _glDrawArrays, "_emscripten_glTexSubImage2D": _emscripten_glTexSubImage2D, "_emscripten_memcpy_big": _emscripten_memcpy_big, "_emscripten_glPixelStorei": _emscripten_glPixelStorei, "_glCompileShader": _glCompileShader, "_emscripten_get_pointerlock_status": _emscripten_get_pointerlock_status, "_emscripten_glUniformMatrix3fv": _emscripten_glUniformMatrix3fv, "_emscripten_glColorPointer": _emscripten_glColorPointer, "_emscripten_glGetBufferParameteriv": _emscripten_glGetBufferParameteriv, "_glActiveTexture": _glActiveTexture, "_emscripten_request_pointerlock": _emscripten_request_pointerlock, "_glGetFloatv": _glGetFloatv, "_emscripten_asm_const_iii": _emscripten_asm_const_iii, "_emscripten_glDepthMask": _emscripten_glDepthMask, "_glfwSetWindowIconifyCallback": _glfwSetWindowIconifyCallback, "_emscripten_glDrawBuffers": _emscripten_glDrawBuffers, "_glfwTerminate": _glfwTerminate, "_glFrontFace": _glFrontFace, "_emscripten_glGetObjectParameterivARB": _emscripten_glGetObjectParameterivARB, "_emscripten_exit_pointerlock": _emscripten_exit_pointerlock, "_glfwSwapInterval": _glfwSwapInterval, "_glUniform1i": _glUniform1i, "_glEnableVertexAttribArray": _glEnableVertexAttribArray, "_emscripten_glStencilFunc": _emscripten_glStencilFunc, "_abort": _abort, "_emscripten_glGetUniformiv": _emscripten_glGetUniformiv, "_glDeleteBuffers": _glDeleteBuffers, "_glBufferData": _glBufferData, "_glTexImage2D": _glTexImage2D, "_emscripten_glGetShaderiv": _emscripten_glGetShaderiv, "_glfwSetKeyCallback": _glfwSetKeyCallback, "_emscripten_glGenFramebuffers": _emscripten_glGenFramebuffers, "_glUniform1f": _glUniform1f, "_emscripten_glUniformMatrix4fv": _emscripten_glUniformMatrix4fv, "_emscripten_glLoadIdentity": _emscripten_glLoadIdentity, "_glDeleteShader": _glDeleteShader, "_emscripten_glUniform1f": _emscripten_glUniform1f, "_glGetProgramiv": _glGetProgramiv, "_emscripten_glBindFramebuffer": _emscripten_glBindFramebuffer, "_emscripten_glIsRenderbuffer": _emscripten_glIsRenderbuffer, "_glfwGetTime": _glfwGetTime, "_emscripten_glRenderbufferStorage": _emscripten_glRenderbufferStorage, "_emscripten_set_gamepadconnected_callback": _emscripten_set_gamepadconnected_callback, "_emscripten_glBlendColor": _emscripten_glBlendColor, "_emscripten_glGetVertexAttribiv": _emscripten_glGetVertexAttribiv, "_emscripten_glBindVertexArray": _emscripten_glBindVertexArray, "_emscripten_glDrawArraysInstanced": _emscripten_glDrawArraysInstanced, "_emscripten_set_touchcancel_callback": _emscripten_set_touchcancel_callback, "_emscripten_glCreateShader": _emscripten_glCreateShader, "_emscripten_glStencilMask": _emscripten_glStencilMask, "_emscripten_glDeleteTextures": _emscripten_glDeleteTextures, "_emscripten_glBindRenderbuffer": _emscripten_glBindRenderbuffer, "_glfwGetPrimaryMonitor": _glfwGetPrimaryMonitor, "_glLinkProgram": _glLinkProgram, "_emscripten_glVertexAttribDivisor": _emscripten_glVertexAttribDivisor, "_emscripten_set_touchend_callback": _emscripten_set_touchend_callback, "_emscripten_glGetUniformfv": _emscripten_glGetUniformfv, "_emscripten_glGetVertexAttribfv": _emscripten_glGetVertexAttribfv, "_emscripten_glGetRenderbufferParameteriv": _emscripten_glGetRenderbufferParameteriv, "_emscripten_glDeleteFramebuffers": _emscripten_glDeleteFramebuffers, "_glGetShaderiv": _glGetShaderiv, "_emscripten_glVertexAttrib3fv": _emscripten_glVertexAttrib3fv, "_glGetUniformLocation": _glGetUniformLocation, "_emscripten_glGetInfoLogARB": _emscripten_glGetInfoLogARB, "_emscripten_glCompileShader": _emscripten_glCompileShader, "_glClear": _glClear, "_glGenTextures": _glGenTextures, "_emscripten_glDisable": _emscripten_glDisable, "_emscripten_glDepthRangef": _emscripten_glDepthRangef, "__exit": __exit, "_emscripten_glLineWidth": _emscripten_glLineWidth, "_emscripten_glUniform3f": _emscripten_glUniform3f, "_emscripten_glGetShaderInfoLog": _emscripten_glGetShaderInfoLog, "_emscripten_glStencilOp": _emscripten_glStencilOp, "_glBindAttribLocation": _glBindAttribLocation, "_glPixelStorei": _glPixelStorei, "_emscripten_glColorMask": _emscripten_glColorMask, "_emscripten_glLinkProgram": _emscripten_glLinkProgram, "_emscripten_glBlendEquation": _emscripten_glBlendEquation, "_emscripten_glIsTexture": _emscripten_glIsTexture, "_emscripten_glGetProgramiv": _emscripten_glGetProgramiv, "_emscripten_glVertexAttrib1fv": _emscripten_glVertexAttrib1fv, "_emscripten_glBindTexture": _emscripten_glBindTexture, "_glfwSetMouseButtonCallback": _glfwSetMouseButtonCallback, "_glfwGetCursorPos": _glfwGetCursorPos, "_emscripten_glActiveTexture": _emscripten_glActiveTexture, "_emscripten_glDeleteBuffers": _emscripten_glDeleteBuffers, "___syscall54": ___syscall54, "___unlock": ___unlock, "_emscripten_glBufferSubData": _emscripten_glBufferSubData, "_glfwSwapBuffers": _glfwSwapBuffers, "_emscripten_glDepthRange": _emscripten_glDepthRange, "_emscripten_set_main_loop": _emscripten_set_main_loop, "_emscripten_glGetProgramInfoLog": _emscripten_glGetProgramInfoLog, "_glfwWindowHint": _glfwWindowHint, "_emscripten_glIsShader": _emscripten_glIsShader, "_emscripten_glUniform4fv": _emscripten_glUniform4fv, "_emscripten_glGenVertexArrays": _emscripten_glGenVertexArrays, "_emscripten_glDrawArrays": _emscripten_glDrawArrays, "_emscripten_glCompressedTexImage2D": _emscripten_glCompressedTexImage2D, "_emscripten_glClearColor": _emscripten_glClearColor, "_emscripten_glCreateProgram": _emscripten_glCreateProgram, "_emscripten_glCopyTexSubImage2D": _emscripten_glCopyTexSubImage2D, "_glTexParameteri": _glTexParameteri, "_emscripten_glBindBuffer": _emscripten_glBindBuffer, "_emscripten_glGetFloatv": _emscripten_glGetFloatv, "_emscripten_glDetachShader": _emscripten_glDetachShader, "_glClearColor": _glClearColor, "_glfwSetCursorPosCallback": _glfwSetCursorPosCallback, "_glfwSetCursorEnterCallback": _glfwSetCursorEnterCallback, "_emscripten_glCopyTexImage2D": _emscripten_glCopyTexImage2D, "_emscripten_glTexImage2D": _emscripten_glTexImage2D, "DYNAMICTOP_PTR": DYNAMICTOP_PTR, "tempDoublePtr": tempDoublePtr, "ABORT": ABORT, "STACKTOP": STACKTOP, "STACK_MAX": STACK_MAX, "cttz_i8": cttz_i8 };
  9001. // EMSCRIPTEN_START_ASM
  9002. var asm = (function(global, env, buffer) {
  9003. 'use asm';
  9004. var HEAP8 = new global.Int8Array(buffer);
  9005. var HEAP16 = new global.Int16Array(buffer);
  9006. var HEAP32 = new global.Int32Array(buffer);
  9007. var HEAPU8 = new global.Uint8Array(buffer);
  9008. var HEAPU16 = new global.Uint16Array(buffer);
  9009. var HEAPU32 = new global.Uint32Array(buffer);
  9010. var HEAPF32 = new global.Float32Array(buffer);
  9011. var HEAPF64 = new global.Float64Array(buffer);
  9012. var DYNAMICTOP_PTR=env.DYNAMICTOP_PTR|0;
  9013. var tempDoublePtr=env.tempDoublePtr|0;
  9014. var ABORT=env.ABORT|0;
  9015. var STACKTOP=env.STACKTOP|0;
  9016. var STACK_MAX=env.STACK_MAX|0;
  9017. var cttz_i8=env.cttz_i8|0;
  9018. var __THREW__ = 0;
  9019. var threwValue = 0;
  9020. var setjmpId = 0;
  9021. var undef = 0;
  9022. var nan = global.NaN, inf = global.Infinity;
  9023. var tempInt = 0, tempBigInt = 0, tempBigIntP = 0, tempBigIntS = 0, tempBigIntR = 0.0, tempBigIntI = 0, tempBigIntD = 0, tempValue = 0, tempDouble = 0.0;
  9024. var tempRet0 = 0;
  9025. var Math_floor=global.Math.floor;
  9026. var Math_abs=global.Math.abs;
  9027. var Math_sqrt=global.Math.sqrt;
  9028. var Math_pow=global.Math.pow;
  9029. var Math_cos=global.Math.cos;
  9030. var Math_sin=global.Math.sin;
  9031. var Math_tan=global.Math.tan;
  9032. var Math_acos=global.Math.acos;
  9033. var Math_asin=global.Math.asin;
  9034. var Math_atan=global.Math.atan;
  9035. var Math_atan2=global.Math.atan2;
  9036. var Math_exp=global.Math.exp;
  9037. var Math_log=global.Math.log;
  9038. var Math_ceil=global.Math.ceil;
  9039. var Math_imul=global.Math.imul;
  9040. var Math_min=global.Math.min;
  9041. var Math_max=global.Math.max;
  9042. var Math_clz32=global.Math.clz32;
  9043. var abort=env.abort;
  9044. var assert=env.assert;
  9045. var enlargeMemory=env.enlargeMemory;
  9046. var getTotalMemory=env.getTotalMemory;
  9047. var abortOnCannotGrowMemory=env.abortOnCannotGrowMemory;
  9048. var abortStackOverflow=env.abortStackOverflow;
  9049. var nullFunc_viiiii=env.nullFunc_viiiii;
  9050. var nullFunc_vd=env.nullFunc_vd;
  9051. var nullFunc_vid=env.nullFunc_vid;
  9052. var nullFunc_vi=env.nullFunc_vi;
  9053. var nullFunc_vii=env.nullFunc_vii;
  9054. var nullFunc_ii=env.nullFunc_ii;
  9055. var nullFunc_viddd=env.nullFunc_viddd;
  9056. var nullFunc_vidd=env.nullFunc_vidd;
  9057. var nullFunc_iiii=env.nullFunc_iiii;
  9058. var nullFunc_viiiiiiii=env.nullFunc_viiiiiiii;
  9059. var nullFunc_viiiiii=env.nullFunc_viiiiii;
  9060. var nullFunc_viii=env.nullFunc_viii;
  9061. var nullFunc_vidddd=env.nullFunc_vidddd;
  9062. var nullFunc_vdi=env.nullFunc_vdi;
  9063. var nullFunc_viiiiiii=env.nullFunc_viiiiiii;
  9064. var nullFunc_viiiiiiiii=env.nullFunc_viiiiiiiii;
  9065. var nullFunc_iii=env.nullFunc_iii;
  9066. var nullFunc_i=env.nullFunc_i;
  9067. var nullFunc_vdddddd=env.nullFunc_vdddddd;
  9068. var nullFunc_vdddd=env.nullFunc_vdddd;
  9069. var nullFunc_vdd=env.nullFunc_vdd;
  9070. var nullFunc_v=env.nullFunc_v;
  9071. var nullFunc_viid=env.nullFunc_viid;
  9072. var nullFunc_viiii=env.nullFunc_viiii;
  9073. var invoke_viiiii=env.invoke_viiiii;
  9074. var invoke_vd=env.invoke_vd;
  9075. var invoke_vid=env.invoke_vid;
  9076. var invoke_vi=env.invoke_vi;
  9077. var invoke_vii=env.invoke_vii;
  9078. var invoke_ii=env.invoke_ii;
  9079. var invoke_viddd=env.invoke_viddd;
  9080. var invoke_vidd=env.invoke_vidd;
  9081. var invoke_iiii=env.invoke_iiii;
  9082. var invoke_viiiiiiii=env.invoke_viiiiiiii;
  9083. var invoke_viiiiii=env.invoke_viiiiii;
  9084. var invoke_viii=env.invoke_viii;
  9085. var invoke_vidddd=env.invoke_vidddd;
  9086. var invoke_vdi=env.invoke_vdi;
  9087. var invoke_viiiiiii=env.invoke_viiiiiii;
  9088. var invoke_viiiiiiiii=env.invoke_viiiiiiiii;
  9089. var invoke_iii=env.invoke_iii;
  9090. var invoke_i=env.invoke_i;
  9091. var invoke_vdddddd=env.invoke_vdddddd;
  9092. var invoke_vdddd=env.invoke_vdddd;
  9093. var invoke_vdd=env.invoke_vdd;
  9094. var invoke_v=env.invoke_v;
  9095. var invoke_viid=env.invoke_viid;
  9096. var invoke_viiii=env.invoke_viiii;
  9097. var _emscripten_glGetTexParameterfv=env._emscripten_glGetTexParameterfv;
  9098. var _glUseProgram=env._glUseProgram;
  9099. var _emscripten_glShaderSource=env._emscripten_glShaderSource;
  9100. var _glfwCreateWindow=env._glfwCreateWindow;
  9101. var _emscripten_glReleaseShaderCompiler=env._emscripten_glReleaseShaderCompiler;
  9102. var _emscripten_glBlendFuncSeparate=env._emscripten_glBlendFuncSeparate;
  9103. var _emscripten_glVertexAttribPointer=env._emscripten_glVertexAttribPointer;
  9104. var _emscripten_glGetIntegerv=env._emscripten_glGetIntegerv;
  9105. var _emscripten_glCullFace=env._emscripten_glCullFace;
  9106. var _emscripten_glIsProgram=env._emscripten_glIsProgram;
  9107. var _emscripten_glStencilMaskSeparate=env._emscripten_glStencilMaskSeparate;
  9108. var _emscripten_glViewport=env._emscripten_glViewport;
  9109. var _emscripten_glFrontFace=env._emscripten_glFrontFace;
  9110. var ___assert_fail=env.___assert_fail;
  9111. var _glDeleteProgram=env._glDeleteProgram;
  9112. var _emscripten_glUniform3fv=env._emscripten_glUniform3fv;
  9113. var _emscripten_glPolygonOffset=env._emscripten_glPolygonOffset;
  9114. var _emscripten_glUseProgram=env._emscripten_glUseProgram;
  9115. var _glVertexAttrib4f=env._glVertexAttrib4f;
  9116. var _glBindBuffer=env._glBindBuffer;
  9117. var _emscripten_glDepthFunc=env._emscripten_glDepthFunc;
  9118. var _glGetShaderInfoLog=env._glGetShaderInfoLog;
  9119. var _emscripten_set_fullscreenchange_callback=env._emscripten_set_fullscreenchange_callback;
  9120. var _emscripten_set_touchmove_callback=env._emscripten_set_touchmove_callback;
  9121. var _emscripten_set_main_loop_timing=env._emscripten_set_main_loop_timing;
  9122. var _emscripten_set_gamepaddisconnected_callback=env._emscripten_set_gamepaddisconnected_callback;
  9123. var _glDisable=env._glDisable;
  9124. var _glBlendFunc=env._glBlendFunc;
  9125. var _emscripten_glDisableVertexAttribArray=env._emscripten_glDisableVertexAttribArray;
  9126. var _glGetAttribLocation=env._glGetAttribLocation;
  9127. var _glDisableVertexAttribArray=env._glDisableVertexAttribArray;
  9128. var _glCreateShader=env._glCreateShader;
  9129. var _emscripten_glSampleCoverage=env._emscripten_glSampleCoverage;
  9130. var _emscripten_glVertexPointer=env._emscripten_glVertexPointer;
  9131. var _emscripten_set_touchstart_callback=env._emscripten_set_touchstart_callback;
  9132. var emscriptenWebGLComputeImageSize=env.emscriptenWebGLComputeImageSize;
  9133. var _emscripten_glGetBooleanv=env._emscripten_glGetBooleanv;
  9134. var _emscripten_glGetShaderSource=env._emscripten_glGetShaderSource;
  9135. var _glUniform4f=env._glUniform4f;
  9136. var _llvm_stacksave=env._llvm_stacksave;
  9137. var _emscripten_glUniform1i=env._emscripten_glUniform1i;
  9138. var _emscripten_glStencilFuncSeparate=env._emscripten_glStencilFuncSeparate;
  9139. var _emscripten_glFrustum=env._emscripten_glFrustum;
  9140. var _emscripten_glGenBuffers=env._emscripten_glGenBuffers;
  9141. var _emscripten_glDeleteObjectARB=env._emscripten_glDeleteObjectARB;
  9142. var _glfwSetWindowSizeCallback=env._glfwSetWindowSizeCallback;
  9143. var _emscripten_glGetShaderPrecisionFormat=env._emscripten_glGetShaderPrecisionFormat;
  9144. var _glfwInit=env._glfwInit;
  9145. var _glGenBuffers=env._glGenBuffers;
  9146. var _glShaderSource=env._glShaderSource;
  9147. var _emscripten_glGetString=env._emscripten_glGetString;
  9148. var _emscripten_glIsFramebuffer=env._emscripten_glIsFramebuffer;
  9149. var _glVertexAttrib3f=env._glVertexAttrib3f;
  9150. var _emscripten_glIsEnabled=env._emscripten_glIsEnabled;
  9151. var _emscripten_glScissor=env._emscripten_glScissor;
  9152. var _emscripten_glVertexAttrib4fv=env._emscripten_glVertexAttrib4fv;
  9153. var _emscripten_glFramebufferTexture2D=env._emscripten_glFramebufferTexture2D;
  9154. var _emscripten_glTexParameteriv=env._emscripten_glTexParameteriv;
  9155. var ___syscall145=env.___syscall145;
  9156. var _emscripten_glBindProgramARB=env._emscripten_glBindProgramARB;
  9157. var _emscripten_glStencilOpSeparate=env._emscripten_glStencilOpSeparate;
  9158. var _emscripten_glFramebufferRenderbuffer=env._emscripten_glFramebufferRenderbuffer;
  9159. var ___syscall140=env.___syscall140;
  9160. var _glfwSetErrorCallback=env._glfwSetErrorCallback;
  9161. var _glfwDefaultWindowHints=env._glfwDefaultWindowHints;
  9162. var _glfwDestroyWindow=env._glfwDestroyWindow;
  9163. var ___syscall146=env.___syscall146;
  9164. var _emscripten_glGetActiveAttrib=env._emscripten_glGetActiveAttrib;
  9165. var _emscripten_glAttachShader=env._emscripten_glAttachShader;
  9166. var _glVertexAttribPointer=env._glVertexAttribPointer;
  9167. var _emscripten_glUniform2i=env._emscripten_glUniform2i;
  9168. var _emscripten_glUniform2f=env._emscripten_glUniform2f;
  9169. var _emscripten_glTexParameterfv=env._emscripten_glTexParameterfv;
  9170. var _emscripten_glUniformMatrix2fv=env._emscripten_glUniformMatrix2fv;
  9171. var _glGetProgramInfoLog=env._glGetProgramInfoLog;
  9172. var _glfwSetScrollCallback=env._glfwSetScrollCallback;
  9173. var _emscripten_glTexParameterf=env._emscripten_glTexParameterf;
  9174. var _emscripten_glGetAttachedShaders=env._emscripten_glGetAttachedShaders;
  9175. var _emscripten_glGenTextures=env._emscripten_glGenTextures;
  9176. var _emscripten_glTexParameteri=env._emscripten_glTexParameteri;
  9177. var _llvm_stackrestore=env._llvm_stackrestore;
  9178. var _glfwMakeContextCurrent=env._glfwMakeContextCurrent;
  9179. var _emscripten_glClear=env._emscripten_glClear;
  9180. var _glDrawElements=env._glDrawElements;
  9181. var _glBufferSubData=env._glBufferSubData;
  9182. var _emscripten_glValidateProgram=env._emscripten_glValidateProgram;
  9183. var _emscripten_glVertexAttrib2fv=env._emscripten_glVertexAttrib2fv;
  9184. var _glViewport=env._glViewport;
  9185. var _emscripten_glUniform4iv=env._emscripten_glUniform4iv;
  9186. var _emscripten_glGetTexParameteriv=env._emscripten_glGetTexParameteriv;
  9187. var ___setErrNo=env.___setErrNo;
  9188. var _eglGetProcAddress=env._eglGetProcAddress;
  9189. var _emscripten_glBindAttribLocation=env._emscripten_glBindAttribLocation;
  9190. var _glDeleteTextures=env._glDeleteTextures;
  9191. var _glDepthFunc=env._glDepthFunc;
  9192. var _emscripten_glClientActiveTexture=env._emscripten_glClientActiveTexture;
  9193. var _emscripten_glVertexAttrib2f=env._emscripten_glVertexAttrib2f;
  9194. var _glUniform3f=env._glUniform3f;
  9195. var _emscripten_glFlush=env._emscripten_glFlush;
  9196. var _emscripten_glCheckFramebufferStatus=env._emscripten_glCheckFramebufferStatus;
  9197. var _emscripten_glGenerateMipmap=env._emscripten_glGenerateMipmap;
  9198. var _emscripten_glGetError=env._emscripten_glGetError;
  9199. var _emscripten_glClearDepthf=env._emscripten_glClearDepthf;
  9200. var _emscripten_glBufferData=env._emscripten_glBufferData;
  9201. var _emscripten_glUniform3i=env._emscripten_glUniform3i;
  9202. var _emscripten_glRotatef=env._emscripten_glRotatef;
  9203. var _emscripten_glDeleteShader=env._emscripten_glDeleteShader;
  9204. var _glEnable=env._glEnable;
  9205. var _glVertexAttrib2f=env._glVertexAttrib2f;
  9206. var _emscripten_glReadPixels=env._emscripten_glReadPixels;
  9207. var _emscripten_glMatrixMode=env._emscripten_glMatrixMode;
  9208. var _glGetString=env._glGetString;
  9209. var _emscripten_glClearStencil=env._emscripten_glClearStencil;
  9210. var _emscripten_glGetUniformLocation=env._emscripten_glGetUniformLocation;
  9211. var emscriptenWebGLGet=env.emscriptenWebGLGet;
  9212. var _emscripten_glEnableVertexAttribArray=env._emscripten_glEnableVertexAttribArray;
  9213. var _emscripten_glGetAttribLocation=env._emscripten_glGetAttribLocation;
  9214. var _emscripten_get_now=env._emscripten_get_now;
  9215. var _emscripten_glNormalPointer=env._emscripten_glNormalPointer;
  9216. var _glAttachShader=env._glAttachShader;
  9217. var _emscripten_glTexCoordPointer=env._emscripten_glTexCoordPointer;
  9218. var _emscripten_glEnable=env._emscripten_glEnable;
  9219. var _glCreateProgram=env._glCreateProgram;
  9220. var _glUniformMatrix4fv=env._glUniformMatrix4fv;
  9221. var _emscripten_glClearDepth=env._emscripten_glClearDepth;
  9222. var ___lock=env.___lock;
  9223. var emscriptenWebGLGetTexPixelData=env.emscriptenWebGLGetTexPixelData;
  9224. var ___syscall6=env.___syscall6;
  9225. var ___syscall5=env.___syscall5;
  9226. var _emscripten_glIsBuffer=env._emscripten_glIsBuffer;
  9227. var _emscripten_glVertexAttrib3f=env._emscripten_glVertexAttrib3f;
  9228. var _time=env._time;
  9229. var _emscripten_glVertexAttrib1f=env._emscripten_glVertexAttrib1f;
  9230. var _emscripten_glGetFramebufferAttachmentParameteriv=env._emscripten_glGetFramebufferAttachmentParameteriv;
  9231. var _emscripten_glBlendEquationSeparate=env._emscripten_glBlendEquationSeparate;
  9232. var _exit=env._exit;
  9233. var _emscripten_glEnableClientState=env._emscripten_glEnableClientState;
  9234. var _emscripten_glUniform4i=env._emscripten_glUniform4i;
  9235. var _emscripten_glDrawRangeElements=env._emscripten_glDrawRangeElements;
  9236. var _glCullFace=env._glCullFace;
  9237. var _emscripten_glGetPointerv=env._emscripten_glGetPointerv;
  9238. var _emscripten_set_keypress_callback=env._emscripten_set_keypress_callback;
  9239. var __emscripten_sample_gamepad_data=env.__emscripten_sample_gamepad_data;
  9240. var _emscripten_get_gamepad_status=env._emscripten_get_gamepad_status;
  9241. var _emscripten_glUniform4f=env._emscripten_glUniform4f;
  9242. var _emscripten_glUniform2fv=env._emscripten_glUniform2fv;
  9243. var _glfwGetVideoModes=env._glfwGetVideoModes;
  9244. var _emscripten_set_click_callback=env._emscripten_set_click_callback;
  9245. var _emscripten_glFinish=env._emscripten_glFinish;
  9246. var _emscripten_glShaderBinary=env._emscripten_glShaderBinary;
  9247. var _emscripten_glDrawElements=env._emscripten_glDrawElements;
  9248. var _emscripten_glBlendFunc=env._emscripten_glBlendFunc;
  9249. var _emscripten_get_num_gamepads=env._emscripten_get_num_gamepads;
  9250. var ___syscall221=env.___syscall221;
  9251. var _glCompressedTexImage2D=env._glCompressedTexImage2D;
  9252. var _emscripten_glUniform1iv=env._emscripten_glUniform1iv;
  9253. var _emscripten_glGetVertexAttribPointerv=env._emscripten_glGetVertexAttribPointerv;
  9254. var _glClearDepthf=env._glClearDepthf;
  9255. var _emscripten_glCompressedTexSubImage2D=env._emscripten_glCompressedTexSubImage2D;
  9256. var emscriptenWebGLGetUniform=env.emscriptenWebGLGetUniform;
  9257. var _emscripten_glGenRenderbuffers=env._emscripten_glGenRenderbuffers;
  9258. var _emscripten_glDeleteVertexArrays=env._emscripten_glDeleteVertexArrays;
  9259. var _glfwSetWindowShouldClose=env._glfwSetWindowShouldClose;
  9260. var _emscripten_glUniform1fv=env._emscripten_glUniform1fv;
  9261. var _emscripten_glGetActiveUniform=env._emscripten_glGetActiveUniform;
  9262. var _glBindTexture=env._glBindTexture;
  9263. var _emscripten_glUniform3iv=env._emscripten_glUniform3iv;
  9264. var _emscripten_glUniform2iv=env._emscripten_glUniform2iv;
  9265. var _emscripten_glHint=env._emscripten_glHint;
  9266. var _glfwSetCharCallback=env._glfwSetCharCallback;
  9267. var emscriptenWebGLGetVertexAttrib=env.emscriptenWebGLGetVertexAttrib;
  9268. var _emscripten_glLoadMatrixf=env._emscripten_glLoadMatrixf;
  9269. var _emscripten_glDeleteProgram=env._emscripten_glDeleteProgram;
  9270. var _emscripten_glDeleteRenderbuffers=env._emscripten_glDeleteRenderbuffers;
  9271. var _emscripten_glDrawElementsInstanced=env._emscripten_glDrawElementsInstanced;
  9272. var _emscripten_glVertexAttrib4f=env._emscripten_glVertexAttrib4f;
  9273. var _glDrawArrays=env._glDrawArrays;
  9274. var _emscripten_glTexSubImage2D=env._emscripten_glTexSubImage2D;
  9275. var _emscripten_memcpy_big=env._emscripten_memcpy_big;
  9276. var _emscripten_glPixelStorei=env._emscripten_glPixelStorei;
  9277. var _glCompileShader=env._glCompileShader;
  9278. var _emscripten_get_pointerlock_status=env._emscripten_get_pointerlock_status;
  9279. var _emscripten_glUniformMatrix3fv=env._emscripten_glUniformMatrix3fv;
  9280. var _emscripten_glColorPointer=env._emscripten_glColorPointer;
  9281. var _emscripten_glGetBufferParameteriv=env._emscripten_glGetBufferParameteriv;
  9282. var _glActiveTexture=env._glActiveTexture;
  9283. var _emscripten_request_pointerlock=env._emscripten_request_pointerlock;
  9284. var _glGetFloatv=env._glGetFloatv;
  9285. var _emscripten_asm_const_iii=env._emscripten_asm_const_iii;
  9286. var _emscripten_glDepthMask=env._emscripten_glDepthMask;
  9287. var _glfwSetWindowIconifyCallback=env._glfwSetWindowIconifyCallback;
  9288. var _emscripten_glDrawBuffers=env._emscripten_glDrawBuffers;
  9289. var _glfwTerminate=env._glfwTerminate;
  9290. var _glFrontFace=env._glFrontFace;
  9291. var _emscripten_glGetObjectParameterivARB=env._emscripten_glGetObjectParameterivARB;
  9292. var _emscripten_exit_pointerlock=env._emscripten_exit_pointerlock;
  9293. var _glfwSwapInterval=env._glfwSwapInterval;
  9294. var _glUniform1i=env._glUniform1i;
  9295. var _glEnableVertexAttribArray=env._glEnableVertexAttribArray;
  9296. var _emscripten_glStencilFunc=env._emscripten_glStencilFunc;
  9297. var _abort=env._abort;
  9298. var _emscripten_glGetUniformiv=env._emscripten_glGetUniformiv;
  9299. var _glDeleteBuffers=env._glDeleteBuffers;
  9300. var _glBufferData=env._glBufferData;
  9301. var _glTexImage2D=env._glTexImage2D;
  9302. var _emscripten_glGetShaderiv=env._emscripten_glGetShaderiv;
  9303. var _glfwSetKeyCallback=env._glfwSetKeyCallback;
  9304. var _emscripten_glGenFramebuffers=env._emscripten_glGenFramebuffers;
  9305. var _glUniform1f=env._glUniform1f;
  9306. var _emscripten_glUniformMatrix4fv=env._emscripten_glUniformMatrix4fv;
  9307. var _emscripten_glLoadIdentity=env._emscripten_glLoadIdentity;
  9308. var _glDeleteShader=env._glDeleteShader;
  9309. var _emscripten_glUniform1f=env._emscripten_glUniform1f;
  9310. var _glGetProgramiv=env._glGetProgramiv;
  9311. var _emscripten_glBindFramebuffer=env._emscripten_glBindFramebuffer;
  9312. var _emscripten_glIsRenderbuffer=env._emscripten_glIsRenderbuffer;
  9313. var _glfwGetTime=env._glfwGetTime;
  9314. var _emscripten_glRenderbufferStorage=env._emscripten_glRenderbufferStorage;
  9315. var _emscripten_set_gamepadconnected_callback=env._emscripten_set_gamepadconnected_callback;
  9316. var _emscripten_glBlendColor=env._emscripten_glBlendColor;
  9317. var _emscripten_glGetVertexAttribiv=env._emscripten_glGetVertexAttribiv;
  9318. var _emscripten_glBindVertexArray=env._emscripten_glBindVertexArray;
  9319. var _emscripten_glDrawArraysInstanced=env._emscripten_glDrawArraysInstanced;
  9320. var _emscripten_set_touchcancel_callback=env._emscripten_set_touchcancel_callback;
  9321. var _emscripten_glCreateShader=env._emscripten_glCreateShader;
  9322. var _emscripten_glStencilMask=env._emscripten_glStencilMask;
  9323. var _emscripten_glDeleteTextures=env._emscripten_glDeleteTextures;
  9324. var _emscripten_glBindRenderbuffer=env._emscripten_glBindRenderbuffer;
  9325. var _glfwGetPrimaryMonitor=env._glfwGetPrimaryMonitor;
  9326. var _glLinkProgram=env._glLinkProgram;
  9327. var _emscripten_glVertexAttribDivisor=env._emscripten_glVertexAttribDivisor;
  9328. var _emscripten_set_touchend_callback=env._emscripten_set_touchend_callback;
  9329. var _emscripten_glGetUniformfv=env._emscripten_glGetUniformfv;
  9330. var _emscripten_glGetVertexAttribfv=env._emscripten_glGetVertexAttribfv;
  9331. var _emscripten_glGetRenderbufferParameteriv=env._emscripten_glGetRenderbufferParameteriv;
  9332. var _emscripten_glDeleteFramebuffers=env._emscripten_glDeleteFramebuffers;
  9333. var _glGetShaderiv=env._glGetShaderiv;
  9334. var _emscripten_glVertexAttrib3fv=env._emscripten_glVertexAttrib3fv;
  9335. var _glGetUniformLocation=env._glGetUniformLocation;
  9336. var _emscripten_glGetInfoLogARB=env._emscripten_glGetInfoLogARB;
  9337. var _emscripten_glCompileShader=env._emscripten_glCompileShader;
  9338. var _glClear=env._glClear;
  9339. var _glGenTextures=env._glGenTextures;
  9340. var _emscripten_glDisable=env._emscripten_glDisable;
  9341. var _emscripten_glDepthRangef=env._emscripten_glDepthRangef;
  9342. var __exit=env.__exit;
  9343. var _emscripten_glLineWidth=env._emscripten_glLineWidth;
  9344. var _emscripten_glUniform3f=env._emscripten_glUniform3f;
  9345. var _emscripten_glGetShaderInfoLog=env._emscripten_glGetShaderInfoLog;
  9346. var _emscripten_glStencilOp=env._emscripten_glStencilOp;
  9347. var _glBindAttribLocation=env._glBindAttribLocation;
  9348. var _glPixelStorei=env._glPixelStorei;
  9349. var _emscripten_glColorMask=env._emscripten_glColorMask;
  9350. var _emscripten_glLinkProgram=env._emscripten_glLinkProgram;
  9351. var _emscripten_glBlendEquation=env._emscripten_glBlendEquation;
  9352. var _emscripten_glIsTexture=env._emscripten_glIsTexture;
  9353. var _emscripten_glGetProgramiv=env._emscripten_glGetProgramiv;
  9354. var _emscripten_glVertexAttrib1fv=env._emscripten_glVertexAttrib1fv;
  9355. var _emscripten_glBindTexture=env._emscripten_glBindTexture;
  9356. var _glfwSetMouseButtonCallback=env._glfwSetMouseButtonCallback;
  9357. var _glfwGetCursorPos=env._glfwGetCursorPos;
  9358. var _emscripten_glActiveTexture=env._emscripten_glActiveTexture;
  9359. var _emscripten_glDeleteBuffers=env._emscripten_glDeleteBuffers;
  9360. var ___syscall54=env.___syscall54;
  9361. var ___unlock=env.___unlock;
  9362. var _emscripten_glBufferSubData=env._emscripten_glBufferSubData;
  9363. var _glfwSwapBuffers=env._glfwSwapBuffers;
  9364. var _emscripten_glDepthRange=env._emscripten_glDepthRange;
  9365. var _emscripten_set_main_loop=env._emscripten_set_main_loop;
  9366. var _emscripten_glGetProgramInfoLog=env._emscripten_glGetProgramInfoLog;
  9367. var _glfwWindowHint=env._glfwWindowHint;
  9368. var _emscripten_glIsShader=env._emscripten_glIsShader;
  9369. var _emscripten_glUniform4fv=env._emscripten_glUniform4fv;
  9370. var _emscripten_glGenVertexArrays=env._emscripten_glGenVertexArrays;
  9371. var _emscripten_glDrawArrays=env._emscripten_glDrawArrays;
  9372. var _emscripten_glCompressedTexImage2D=env._emscripten_glCompressedTexImage2D;
  9373. var _emscripten_glClearColor=env._emscripten_glClearColor;
  9374. var _emscripten_glCreateProgram=env._emscripten_glCreateProgram;
  9375. var _emscripten_glCopyTexSubImage2D=env._emscripten_glCopyTexSubImage2D;
  9376. var _glTexParameteri=env._glTexParameteri;
  9377. var _emscripten_glBindBuffer=env._emscripten_glBindBuffer;
  9378. var _emscripten_glGetFloatv=env._emscripten_glGetFloatv;
  9379. var _emscripten_glDetachShader=env._emscripten_glDetachShader;
  9380. var _glClearColor=env._glClearColor;
  9381. var _glfwSetCursorPosCallback=env._glfwSetCursorPosCallback;
  9382. var _glfwSetCursorEnterCallback=env._glfwSetCursorEnterCallback;
  9383. var _emscripten_glCopyTexImage2D=env._emscripten_glCopyTexImage2D;
  9384. var _emscripten_glTexImage2D=env._emscripten_glTexImage2D;
  9385. var tempFloat = 0.0;
  9386. // EMSCRIPTEN_START_FUNCS
  9387. function stackAlloc(size) {
  9388. size = size|0;
  9389. var ret = 0;
  9390. ret = STACKTOP;
  9391. STACKTOP = (STACKTOP + size)|0;
  9392. STACKTOP = (STACKTOP + 15)&-16;
  9393. if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(size|0);
  9394. return ret|0;
  9395. }
  9396. function stackSave() {
  9397. return STACKTOP|0;
  9398. }
  9399. function stackRestore(top) {
  9400. top = top|0;
  9401. STACKTOP = top;
  9402. }
  9403. function establishStackSpace(stackBase, stackMax) {
  9404. stackBase = stackBase|0;
  9405. stackMax = stackMax|0;
  9406. STACKTOP = stackBase;
  9407. STACK_MAX = stackMax;
  9408. }
  9409. function setThrew(threw, value) {
  9410. threw = threw|0;
  9411. value = value|0;
  9412. if ((__THREW__|0) == 0) {
  9413. __THREW__ = threw;
  9414. threwValue = value;
  9415. }
  9416. }
  9417. function setTempRet0(value) {
  9418. value = value|0;
  9419. tempRet0 = value;
  9420. }
  9421. function getTempRet0() {
  9422. return tempRet0|0;
  9423. }
  9424. function _main() {
  9425. var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $dwarf$byval_copy = 0, label = 0, sp = 0;
  9426. sp = STACKTOP;
  9427. STACKTOP = STACKTOP + 560|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(560|0);
  9428. $dwarf$byval_copy = sp + 288|0;
  9429. $0 = sp + 24|0;
  9430. $1 = sp;
  9431. $2 = HEAP32[2]|0;
  9432. $3 = HEAP32[3]|0;
  9433. _InitWindow($2,$3,4408);
  9434. _LoadModel($0,4452);
  9435. _memcpy((18212|0),($0|0),264)|0;
  9436. _LoadTexture($1,4478);
  9437. ;HEAP32[18476>>2]=HEAP32[$1>>2]|0;HEAP32[18476+4>>2]=HEAP32[$1+4>>2]|0;HEAP32[18476+8>>2]=HEAP32[$1+8>>2]|0;HEAP32[18476+12>>2]=HEAP32[$1+12>>2]|0;HEAP32[18476+16>>2]=HEAP32[$1+16>>2]|0;
  9438. ;HEAP32[(18400)>>2]=HEAP32[$1>>2]|0;HEAP32[(18400)+4>>2]=HEAP32[$1+4>>2]|0;HEAP32[(18400)+8>>2]=HEAP32[$1+8>>2]|0;HEAP32[(18400)+12>>2]=HEAP32[$1+12>>2]|0;HEAP32[(18400)+16>>2]=HEAP32[$1+16>>2]|0;
  9439. _emscripten_set_main_loop((1|0),0,1);
  9440. ;HEAP32[$dwarf$byval_copy>>2]=HEAP32[18476>>2]|0;HEAP32[$dwarf$byval_copy+4>>2]=HEAP32[18476+4>>2]|0;HEAP32[$dwarf$byval_copy+8>>2]=HEAP32[18476+8>>2]|0;HEAP32[$dwarf$byval_copy+12>>2]=HEAP32[18476+12>>2]|0;HEAP32[$dwarf$byval_copy+16>>2]=HEAP32[18476+16>>2]|0;
  9441. _UnloadTexture($dwarf$byval_copy);
  9442. _memcpy(($dwarf$byval_copy|0),(18212|0),264)|0;
  9443. _UnloadModel($dwarf$byval_copy);
  9444. _CloseWindow();
  9445. STACKTOP = sp;return 0;
  9446. }
  9447. function _UpdateDrawFrame() {
  9448. var $$byval_copy2 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $dwarf$byval_copy = 0, $position$byval_copy = 0, dest = 0, label = 0, sp = 0, src = 0;
  9449. var stop = 0;
  9450. sp = STACKTOP;
  9451. STACKTOP = STACKTOP + 336|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(336|0);
  9452. $$byval_copy2 = sp + 280|0;
  9453. $position$byval_copy = sp + 268|0;
  9454. $dwarf$byval_copy = sp;
  9455. $0 = sp + 324|0;
  9456. $1 = sp + 264|0;
  9457. $2 = sp + 320|0;
  9458. _BeginDrawing();
  9459. HEAP8[$0>>0] = -11;
  9460. $3 = ((($0)) + 1|0);
  9461. HEAP8[$3>>0] = -11;
  9462. $4 = ((($0)) + 2|0);
  9463. HEAP8[$4>>0] = -11;
  9464. $5 = ((($0)) + 3|0);
  9465. HEAP8[$5>>0] = -1;
  9466. ;HEAP8[$$byval_copy2>>0]=HEAP8[$0>>0]|0;HEAP8[$$byval_copy2+1>>0]=HEAP8[$0+1>>0]|0;HEAP8[$$byval_copy2+2>>0]=HEAP8[$0+2>>0]|0;HEAP8[$$byval_copy2+3>>0]=HEAP8[$0+3>>0]|0;
  9467. _ClearBackground($$byval_copy2);
  9468. dest=$$byval_copy2; src=16; stop=dest+40|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  9469. _Begin3dMode($$byval_copy2);
  9470. HEAP32[$1>>2] = -1;
  9471. _memcpy(($dwarf$byval_copy|0),(18212|0),264)|0;
  9472. ;HEAP32[$position$byval_copy>>2]=HEAP32[18200>>2]|0;HEAP32[$position$byval_copy+4>>2]=HEAP32[18200+4>>2]|0;HEAP32[$position$byval_copy+8>>2]=HEAP32[18200+8>>2]|0;
  9473. ;HEAP8[$$byval_copy2>>0]=HEAP8[$1>>0]|0;HEAP8[$$byval_copy2+1>>0]=HEAP8[$1+1>>0]|0;HEAP8[$$byval_copy2+2>>0]=HEAP8[$1+2>>0]|0;HEAP8[$$byval_copy2+3>>0]=HEAP8[$1+3>>0]|0;
  9474. _DrawModel($dwarf$byval_copy,$position$byval_copy,2.0,$$byval_copy2);
  9475. _DrawGrid(10,1.0);
  9476. ;HEAP32[$$byval_copy2>>2]=HEAP32[18200>>2]|0;HEAP32[$$byval_copy2+4>>2]=HEAP32[18200+4>>2]|0;HEAP32[$$byval_copy2+8>>2]=HEAP32[18200+8>>2]|0;
  9477. _DrawGizmo($$byval_copy2);
  9478. _End3dMode();
  9479. $6 = HEAP32[2]|0;
  9480. $7 = (($6) + -200)|0;
  9481. $8 = HEAP32[3]|0;
  9482. $9 = (($8) + -20)|0;
  9483. HEAP8[$2>>0] = -126;
  9484. $10 = ((($2)) + 1|0);
  9485. HEAP8[$10>>0] = -126;
  9486. $11 = ((($2)) + 2|0);
  9487. HEAP8[$11>>0] = -126;
  9488. $12 = ((($2)) + 3|0);
  9489. HEAP8[$12>>0] = -1;
  9490. ;HEAP8[$$byval_copy2>>0]=HEAP8[$2>>0]|0;HEAP8[$$byval_copy2+1>>0]=HEAP8[$2+1>>0]|0;HEAP8[$$byval_copy2+2>>0]=HEAP8[$2+2>>0]|0;HEAP8[$$byval_copy2+3>>0]=HEAP8[$2+3>>0]|0;
  9491. _DrawText(4512,$7,$9,10,$$byval_copy2);
  9492. _DrawFPS(10,10);
  9493. _EndDrawing();
  9494. STACKTOP = sp;return;
  9495. }
  9496. function _Vector2Distance($0,$1) {
  9497. $0 = $0|0;
  9498. $1 = $1|0;
  9499. var $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $2 = 0.0, $3 = 0.0, $4 = 0.0, $5 = 0.0, $6 = 0, $7 = 0.0, $8 = 0, $9 = 0.0, label = 0, sp = 0;
  9500. sp = STACKTOP;
  9501. $2 = +HEAPF32[$0>>2];
  9502. $3 = +HEAPF32[$1>>2];
  9503. $4 = $2 - $3;
  9504. $5 = $4 * $4;
  9505. $6 = ((($0)) + 4|0);
  9506. $7 = +HEAPF32[$6>>2];
  9507. $8 = ((($1)) + 4|0);
  9508. $9 = +HEAPF32[$8>>2];
  9509. $10 = $7 - $9;
  9510. $11 = $10 * $10;
  9511. $12 = $5 + $11;
  9512. $13 = (+Math_sqrt((+$12)));
  9513. return (+$13);
  9514. }
  9515. function _Vector2Angle($0,$1) {
  9516. $0 = $0|0;
  9517. $1 = $1|0;
  9518. var $$0 = 0.0, $10 = 0.0, $11 = 0.0, $12 = 0, $13 = 0.0, $2 = 0, $3 = 0.0, $4 = 0, $5 = 0.0, $6 = 0.0, $7 = 0.0, $8 = 0.0, $9 = 0.0, label = 0, sp = 0;
  9519. sp = STACKTOP;
  9520. $2 = ((($1)) + 4|0);
  9521. $3 = +HEAPF32[$2>>2];
  9522. $4 = ((($0)) + 4|0);
  9523. $5 = +HEAPF32[$4>>2];
  9524. $6 = $3 - $5;
  9525. $7 = +HEAPF32[$1>>2];
  9526. $8 = +HEAPF32[$0>>2];
  9527. $9 = $7 - $8;
  9528. $10 = (+Math_atan2((+$6),(+$9)));
  9529. $11 = $10 * 57.2957763671875;
  9530. $12 = $11 < 0.0;
  9531. $13 = $11 + 360.0;
  9532. $$0 = $12 ? $13 : $11;
  9533. return (+$$0);
  9534. }
  9535. function _VectorZero($0) {
  9536. $0 = $0|0;
  9537. var $1 = 0, $2 = 0, label = 0, sp = 0;
  9538. sp = STACKTOP;
  9539. HEAPF32[$0>>2] = 0.0;
  9540. $1 = ((($0)) + 4|0);
  9541. HEAPF32[$1>>2] = 0.0;
  9542. $2 = ((($0)) + 8|0);
  9543. HEAPF32[$2>>2] = 0.0;
  9544. return;
  9545. }
  9546. function _VectorSubtract($0,$1,$2) {
  9547. $0 = $0|0;
  9548. $1 = $1|0;
  9549. $2 = $2|0;
  9550. var $10 = 0.0, $11 = 0.0, $12 = 0, $13 = 0, $14 = 0.0, $15 = 0, $16 = 0.0, $17 = 0.0, $3 = 0.0, $4 = 0.0, $5 = 0.0, $6 = 0, $7 = 0, $8 = 0.0, $9 = 0, label = 0, sp = 0;
  9551. sp = STACKTOP;
  9552. $3 = +HEAPF32[$1>>2];
  9553. $4 = +HEAPF32[$2>>2];
  9554. $5 = $3 - $4;
  9555. HEAPF32[$0>>2] = $5;
  9556. $6 = ((($0)) + 4|0);
  9557. $7 = ((($1)) + 4|0);
  9558. $8 = +HEAPF32[$7>>2];
  9559. $9 = ((($2)) + 4|0);
  9560. $10 = +HEAPF32[$9>>2];
  9561. $11 = $8 - $10;
  9562. HEAPF32[$6>>2] = $11;
  9563. $12 = ((($0)) + 8|0);
  9564. $13 = ((($1)) + 8|0);
  9565. $14 = +HEAPF32[$13>>2];
  9566. $15 = ((($2)) + 8|0);
  9567. $16 = +HEAPF32[$15>>2];
  9568. $17 = $14 - $16;
  9569. HEAPF32[$12>>2] = $17;
  9570. return;
  9571. }
  9572. function _VectorCrossProduct($0,$1,$2) {
  9573. $0 = $0|0;
  9574. $1 = $1|0;
  9575. $2 = $2|0;
  9576. var $$sroa$4$0$$sroa_idx2 = 0, $$sroa$5$0$$sroa_idx4 = 0, $10 = 0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $15 = 0.0, $16 = 0.0, $17 = 0.0, $18 = 0.0, $19 = 0.0, $20 = 0.0, $21 = 0.0, $3 = 0, $4 = 0.0, $5 = 0, $6 = 0.0, $7 = 0.0, $8 = 0;
  9577. var $9 = 0.0, label = 0, sp = 0;
  9578. sp = STACKTOP;
  9579. $3 = ((($1)) + 4|0);
  9580. $4 = +HEAPF32[$3>>2];
  9581. $5 = ((($2)) + 8|0);
  9582. $6 = +HEAPF32[$5>>2];
  9583. $7 = $4 * $6;
  9584. $8 = ((($1)) + 8|0);
  9585. $9 = +HEAPF32[$8>>2];
  9586. $10 = ((($2)) + 4|0);
  9587. $11 = +HEAPF32[$10>>2];
  9588. $12 = $9 * $11;
  9589. $13 = $7 - $12;
  9590. $14 = +HEAPF32[$2>>2];
  9591. $15 = $9 * $14;
  9592. $16 = +HEAPF32[$1>>2];
  9593. $17 = $6 * $16;
  9594. $18 = $15 - $17;
  9595. $19 = $11 * $16;
  9596. $20 = $4 * $14;
  9597. $21 = $19 - $20;
  9598. HEAPF32[$0>>2] = $13;
  9599. $$sroa$4$0$$sroa_idx2 = ((($0)) + 4|0);
  9600. HEAPF32[$$sroa$4$0$$sroa_idx2>>2] = $18;
  9601. $$sroa$5$0$$sroa_idx4 = ((($0)) + 8|0);
  9602. HEAPF32[$$sroa$5$0$$sroa_idx4>>2] = $21;
  9603. return;
  9604. }
  9605. function _VectorLength($0) {
  9606. $0 = $0|0;
  9607. var $1 = 0.0, $10 = 0.0, $11 = 0.0, $2 = 0.0, $3 = 0, $4 = 0.0, $5 = 0.0, $6 = 0.0, $7 = 0, $8 = 0.0, $9 = 0.0, label = 0, sp = 0;
  9608. sp = STACKTOP;
  9609. $1 = +HEAPF32[$0>>2];
  9610. $2 = $1 * $1;
  9611. $3 = ((($0)) + 4|0);
  9612. $4 = +HEAPF32[$3>>2];
  9613. $5 = $4 * $4;
  9614. $6 = $2 + $5;
  9615. $7 = ((($0)) + 8|0);
  9616. $8 = +HEAPF32[$7>>2];
  9617. $9 = $8 * $8;
  9618. $10 = $6 + $9;
  9619. $11 = (+Math_sqrt((+$10)));
  9620. return (+$11);
  9621. }
  9622. function _VectorScale($0,$1) {
  9623. $0 = $0|0;
  9624. $1 = +$1;
  9625. var $2 = 0.0, $3 = 0.0, $4 = 0, $5 = 0.0, $6 = 0.0, $7 = 0, $8 = 0.0, $9 = 0.0, label = 0, sp = 0;
  9626. sp = STACKTOP;
  9627. $2 = +HEAPF32[$0>>2];
  9628. $3 = $2 * $1;
  9629. HEAPF32[$0>>2] = $3;
  9630. $4 = ((($0)) + 4|0);
  9631. $5 = +HEAPF32[$4>>2];
  9632. $6 = $5 * $1;
  9633. HEAPF32[$4>>2] = $6;
  9634. $7 = ((($0)) + 8|0);
  9635. $8 = +HEAPF32[$7>>2];
  9636. $9 = $8 * $1;
  9637. HEAPF32[$7>>2] = $9;
  9638. return;
  9639. }
  9640. function _VectorNormalize($0) {
  9641. $0 = $0|0;
  9642. var $$byval_copy = 0, $$op = 0.0, $1 = 0.0, $10 = 0.0, $11 = 0.0, $2 = 0, $3 = 0.0, $4 = 0.0, $5 = 0.0, $6 = 0, $7 = 0.0, $8 = 0.0, $9 = 0, label = 0, sp = 0;
  9643. sp = STACKTOP;
  9644. STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
  9645. $$byval_copy = sp;
  9646. ;HEAP32[$$byval_copy>>2]=HEAP32[$0>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$0+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[$0+8>>2]|0;
  9647. $1 = (+_VectorLength($$byval_copy));
  9648. $2 = $1 == 0.0;
  9649. $$op = 1.0 / $1;
  9650. $3 = $2 ? 1.0 : $$op;
  9651. $4 = +HEAPF32[$0>>2];
  9652. $5 = $4 * $3;
  9653. HEAPF32[$0>>2] = $5;
  9654. $6 = ((($0)) + 4|0);
  9655. $7 = +HEAPF32[$6>>2];
  9656. $8 = $3 * $7;
  9657. HEAPF32[$6>>2] = $8;
  9658. $9 = ((($0)) + 8|0);
  9659. $10 = +HEAPF32[$9>>2];
  9660. $11 = $3 * $10;
  9661. HEAPF32[$9>>2] = $11;
  9662. STACKTOP = sp;return;
  9663. }
  9664. function _VectorTransform($0,$1) {
  9665. $0 = $0|0;
  9666. $1 = $1|0;
  9667. var $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0, $14 = 0.0, $15 = 0.0, $16 = 0.0, $17 = 0, $18 = 0.0, $19 = 0.0, $2 = 0.0, $20 = 0, $21 = 0.0, $22 = 0.0, $23 = 0, $24 = 0.0, $25 = 0.0, $26 = 0.0, $27 = 0, $28 = 0.0;
  9668. var $29 = 0.0, $3 = 0, $30 = 0.0, $31 = 0, $32 = 0.0, $33 = 0.0, $34 = 0, $35 = 0.0, $36 = 0.0, $37 = 0, $38 = 0.0, $39 = 0.0, $4 = 0.0, $40 = 0.0, $41 = 0, $42 = 0.0, $43 = 0.0, $44 = 0.0, $45 = 0, $46 = 0.0;
  9669. var $47 = 0.0, $5 = 0, $6 = 0.0, $7 = 0.0, $8 = 0.0, $9 = 0, label = 0, sp = 0;
  9670. sp = STACKTOP;
  9671. $2 = +HEAPF32[$0>>2];
  9672. $3 = ((($0)) + 4|0);
  9673. $4 = +HEAPF32[$3>>2];
  9674. $5 = ((($0)) + 8|0);
  9675. $6 = +HEAPF32[$5>>2];
  9676. $7 = +HEAPF32[$1>>2];
  9677. $8 = $2 * $7;
  9678. $9 = ((($1)) + 4|0);
  9679. $10 = +HEAPF32[$9>>2];
  9680. $11 = $4 * $10;
  9681. $12 = $8 + $11;
  9682. $13 = ((($1)) + 8|0);
  9683. $14 = +HEAPF32[$13>>2];
  9684. $15 = $6 * $14;
  9685. $16 = $12 + $15;
  9686. $17 = ((($1)) + 12|0);
  9687. $18 = +HEAPF32[$17>>2];
  9688. $19 = $18 + $16;
  9689. HEAPF32[$0>>2] = $19;
  9690. $20 = ((($1)) + 16|0);
  9691. $21 = +HEAPF32[$20>>2];
  9692. $22 = $2 * $21;
  9693. $23 = ((($1)) + 20|0);
  9694. $24 = +HEAPF32[$23>>2];
  9695. $25 = $4 * $24;
  9696. $26 = $22 + $25;
  9697. $27 = ((($1)) + 24|0);
  9698. $28 = +HEAPF32[$27>>2];
  9699. $29 = $6 * $28;
  9700. $30 = $26 + $29;
  9701. $31 = ((($1)) + 28|0);
  9702. $32 = +HEAPF32[$31>>2];
  9703. $33 = $32 + $30;
  9704. HEAPF32[$3>>2] = $33;
  9705. $34 = ((($1)) + 32|0);
  9706. $35 = +HEAPF32[$34>>2];
  9707. $36 = $2 * $35;
  9708. $37 = ((($1)) + 36|0);
  9709. $38 = +HEAPF32[$37>>2];
  9710. $39 = $4 * $38;
  9711. $40 = $36 + $39;
  9712. $41 = ((($1)) + 40|0);
  9713. $42 = +HEAPF32[$41>>2];
  9714. $43 = $6 * $42;
  9715. $44 = $40 + $43;
  9716. $45 = ((($1)) + 44|0);
  9717. $46 = +HEAPF32[$45>>2];
  9718. $47 = $46 + $44;
  9719. HEAPF32[$5>>2] = $47;
  9720. return;
  9721. }
  9722. function _MatrixTranspose($0) {
  9723. $0 = $0|0;
  9724. var $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $3 = 0, $4 = 0, $5 = 0;
  9725. var $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
  9726. sp = STACKTOP;
  9727. $1 = ((($0)) + 4|0);
  9728. $2 = HEAP32[$1>>2]|0;
  9729. $3 = ((($0)) + 8|0);
  9730. $4 = HEAP32[$3>>2]|0;
  9731. $5 = ((($0)) + 12|0);
  9732. $6 = HEAP32[$5>>2]|0;
  9733. $7 = ((($0)) + 16|0);
  9734. $8 = HEAP32[$7>>2]|0;
  9735. $9 = ((($0)) + 24|0);
  9736. $10 = HEAP32[$9>>2]|0;
  9737. $11 = ((($0)) + 28|0);
  9738. $12 = HEAP32[$11>>2]|0;
  9739. $13 = ((($0)) + 32|0);
  9740. $14 = HEAP32[$13>>2]|0;
  9741. $15 = ((($0)) + 36|0);
  9742. $16 = HEAP32[$15>>2]|0;
  9743. $17 = ((($0)) + 44|0);
  9744. $18 = HEAP32[$17>>2]|0;
  9745. $19 = ((($0)) + 48|0);
  9746. $20 = HEAP32[$19>>2]|0;
  9747. $21 = ((($0)) + 52|0);
  9748. $22 = HEAP32[$21>>2]|0;
  9749. $23 = ((($0)) + 56|0);
  9750. $24 = HEAP32[$23>>2]|0;
  9751. HEAP32[$1>>2] = $8;
  9752. HEAP32[$3>>2] = $14;
  9753. HEAP32[$5>>2] = $20;
  9754. HEAP32[$7>>2] = $2;
  9755. HEAP32[$9>>2] = $16;
  9756. HEAP32[$11>>2] = $22;
  9757. HEAP32[$13>>2] = $4;
  9758. HEAP32[$15>>2] = $10;
  9759. HEAP32[$17>>2] = $24;
  9760. HEAP32[$19>>2] = $6;
  9761. HEAP32[$21>>2] = $12;
  9762. HEAP32[$23>>2] = $18;
  9763. return;
  9764. }
  9765. function _MatrixInvert($0) {
  9766. $0 = $0|0;
  9767. var $1 = 0.0, $10 = 0, $100 = 0.0, $101 = 0.0, $102 = 0.0, $103 = 0.0, $104 = 0.0, $105 = 0.0, $106 = 0.0, $107 = 0.0, $108 = 0.0, $109 = 0.0, $11 = 0.0, $110 = 0.0, $111 = 0.0, $112 = 0.0, $113 = 0.0, $114 = 0.0, $115 = 0.0, $116 = 0.0;
  9768. var $117 = 0.0, $118 = 0.0, $119 = 0.0, $12 = 0, $120 = 0.0, $121 = 0.0, $122 = 0.0, $123 = 0.0, $124 = 0.0, $125 = 0.0, $126 = 0.0, $127 = 0.0, $128 = 0.0, $129 = 0.0, $13 = 0.0, $130 = 0.0, $131 = 0.0, $132 = 0.0, $133 = 0.0, $134 = 0.0;
  9769. var $135 = 0.0, $136 = 0.0, $137 = 0.0, $138 = 0.0, $139 = 0.0, $14 = 0, $140 = 0.0, $141 = 0.0, $142 = 0.0, $143 = 0.0, $144 = 0.0, $145 = 0.0, $146 = 0.0, $147 = 0.0, $148 = 0.0, $149 = 0.0, $15 = 0.0, $150 = 0.0, $151 = 0.0, $152 = 0.0;
  9770. var $153 = 0.0, $154 = 0.0, $155 = 0.0, $156 = 0.0, $157 = 0.0, $158 = 0.0, $159 = 0.0, $16 = 0, $160 = 0.0, $161 = 0.0, $162 = 0.0, $163 = 0.0, $164 = 0.0, $165 = 0.0, $166 = 0.0, $167 = 0.0, $168 = 0.0, $169 = 0.0, $17 = 0.0, $170 = 0.0;
  9771. var $171 = 0.0, $172 = 0.0, $173 = 0.0, $174 = 0.0, $175 = 0.0, $176 = 0.0, $177 = 0.0, $18 = 0, $19 = 0.0, $2 = 0, $20 = 0, $21 = 0.0, $22 = 0, $23 = 0.0, $24 = 0, $25 = 0.0, $26 = 0, $27 = 0.0, $28 = 0, $29 = 0.0;
  9772. var $3 = 0.0, $30 = 0, $31 = 0.0, $32 = 0.0, $33 = 0.0, $34 = 0.0, $35 = 0.0, $36 = 0.0, $37 = 0.0, $38 = 0.0, $39 = 0.0, $4 = 0, $40 = 0.0, $41 = 0.0, $42 = 0.0, $43 = 0.0, $44 = 0.0, $45 = 0.0, $46 = 0.0, $47 = 0.0;
  9773. var $48 = 0.0, $49 = 0.0, $5 = 0.0, $50 = 0.0, $51 = 0.0, $52 = 0.0, $53 = 0.0, $54 = 0.0, $55 = 0.0, $56 = 0.0, $57 = 0.0, $58 = 0.0, $59 = 0.0, $6 = 0, $60 = 0.0, $61 = 0.0, $62 = 0.0, $63 = 0.0, $64 = 0.0, $65 = 0.0;
  9774. var $66 = 0.0, $67 = 0.0, $68 = 0.0, $69 = 0.0, $7 = 0.0, $70 = 0.0, $71 = 0.0, $72 = 0.0, $73 = 0.0, $74 = 0.0, $75 = 0.0, $76 = 0.0, $77 = 0.0, $78 = 0.0, $79 = 0.0, $8 = 0, $80 = 0.0, $81 = 0.0, $82 = 0.0, $83 = 0.0;
  9775. var $84 = 0.0, $85 = 0.0, $86 = 0.0, $87 = 0.0, $88 = 0.0, $89 = 0.0, $9 = 0.0, $90 = 0.0, $91 = 0.0, $92 = 0.0, $93 = 0.0, $94 = 0.0, $95 = 0.0, $96 = 0.0, $97 = 0.0, $98 = 0.0, $99 = 0.0, label = 0, sp = 0;
  9776. sp = STACKTOP;
  9777. $1 = +HEAPF32[$0>>2];
  9778. $2 = ((($0)) + 16|0);
  9779. $3 = +HEAPF32[$2>>2];
  9780. $4 = ((($0)) + 32|0);
  9781. $5 = +HEAPF32[$4>>2];
  9782. $6 = ((($0)) + 48|0);
  9783. $7 = +HEAPF32[$6>>2];
  9784. $8 = ((($0)) + 4|0);
  9785. $9 = +HEAPF32[$8>>2];
  9786. $10 = ((($0)) + 20|0);
  9787. $11 = +HEAPF32[$10>>2];
  9788. $12 = ((($0)) + 36|0);
  9789. $13 = +HEAPF32[$12>>2];
  9790. $14 = ((($0)) + 52|0);
  9791. $15 = +HEAPF32[$14>>2];
  9792. $16 = ((($0)) + 8|0);
  9793. $17 = +HEAPF32[$16>>2];
  9794. $18 = ((($0)) + 24|0);
  9795. $19 = +HEAPF32[$18>>2];
  9796. $20 = ((($0)) + 40|0);
  9797. $21 = +HEAPF32[$20>>2];
  9798. $22 = ((($0)) + 56|0);
  9799. $23 = +HEAPF32[$22>>2];
  9800. $24 = ((($0)) + 12|0);
  9801. $25 = +HEAPF32[$24>>2];
  9802. $26 = ((($0)) + 28|0);
  9803. $27 = +HEAPF32[$26>>2];
  9804. $28 = ((($0)) + 44|0);
  9805. $29 = +HEAPF32[$28>>2];
  9806. $30 = ((($0)) + 60|0);
  9807. $31 = +HEAPF32[$30>>2];
  9808. $32 = $1 * $11;
  9809. $33 = $3 * $9;
  9810. $34 = $32 - $33;
  9811. $35 = $1 * $13;
  9812. $36 = $5 * $9;
  9813. $37 = $35 - $36;
  9814. $38 = $1 * $15;
  9815. $39 = $7 * $9;
  9816. $40 = $38 - $39;
  9817. $41 = $3 * $13;
  9818. $42 = $5 * $11;
  9819. $43 = $41 - $42;
  9820. $44 = $3 * $15;
  9821. $45 = $7 * $11;
  9822. $46 = $44 - $45;
  9823. $47 = $5 * $15;
  9824. $48 = $7 * $13;
  9825. $49 = $47 - $48;
  9826. $50 = $17 * $27;
  9827. $51 = $19 * $25;
  9828. $52 = $50 - $51;
  9829. $53 = $17 * $29;
  9830. $54 = $21 * $25;
  9831. $55 = $53 - $54;
  9832. $56 = $17 * $31;
  9833. $57 = $23 * $25;
  9834. $58 = $56 - $57;
  9835. $59 = $19 * $29;
  9836. $60 = $21 * $27;
  9837. $61 = $59 - $60;
  9838. $62 = $19 * $31;
  9839. $63 = $23 * $27;
  9840. $64 = $62 - $63;
  9841. $65 = $21 * $31;
  9842. $66 = $23 * $29;
  9843. $67 = $65 - $66;
  9844. $68 = $34 * $67;
  9845. $69 = $37 * $64;
  9846. $70 = $68 - $69;
  9847. $71 = $40 * $61;
  9848. $72 = $71 + $70;
  9849. $73 = $43 * $58;
  9850. $74 = $73 + $72;
  9851. $75 = $46 * $55;
  9852. $76 = $74 - $75;
  9853. $77 = $49 * $52;
  9854. $78 = $77 + $76;
  9855. $79 = 1.0 / $78;
  9856. $80 = $11 * $67;
  9857. $81 = $13 * $64;
  9858. $82 = $80 - $81;
  9859. $83 = $15 * $61;
  9860. $84 = $83 + $82;
  9861. $85 = $84 * $79;
  9862. $86 = $3 * $67;
  9863. $87 = $5 * $64;
  9864. $88 = $87 - $86;
  9865. $89 = $7 * $61;
  9866. $90 = $88 - $89;
  9867. $91 = $90 * $79;
  9868. $92 = $49 * $27;
  9869. $93 = $46 * $29;
  9870. $94 = $92 - $93;
  9871. $95 = $43 * $31;
  9872. $96 = $94 + $95;
  9873. $97 = $96 * $79;
  9874. $98 = $19 * $49;
  9875. $99 = $46 * $21;
  9876. $100 = $99 - $98;
  9877. $101 = $43 * $23;
  9878. $102 = $100 - $101;
  9879. $103 = $102 * $79;
  9880. $104 = -$9;
  9881. $105 = $67 * $104;
  9882. $106 = $13 * $58;
  9883. $107 = $105 + $106;
  9884. $108 = $15 * $55;
  9885. $109 = $107 - $108;
  9886. $110 = $109 * $79;
  9887. $111 = $1 * $67;
  9888. $112 = $5 * $58;
  9889. $113 = $111 - $112;
  9890. $114 = $7 * $55;
  9891. $115 = $114 + $113;
  9892. $116 = $115 * $79;
  9893. $117 = -$25;
  9894. $118 = $49 * $117;
  9895. $119 = $40 * $29;
  9896. $120 = $118 + $119;
  9897. $121 = $37 * $31;
  9898. $122 = $120 - $121;
  9899. $123 = $122 * $79;
  9900. $124 = $17 * $49;
  9901. $125 = $40 * $21;
  9902. $126 = $124 - $125;
  9903. $127 = $37 * $23;
  9904. $128 = $126 + $127;
  9905. $129 = $128 * $79;
  9906. $130 = $9 * $64;
  9907. $131 = $11 * $58;
  9908. $132 = $130 - $131;
  9909. $133 = $15 * $52;
  9910. $134 = $133 + $132;
  9911. $135 = $134 * $79;
  9912. $136 = $1 * $64;
  9913. $137 = $3 * $58;
  9914. $138 = $137 - $136;
  9915. $139 = $7 * $52;
  9916. $140 = $138 - $139;
  9917. $141 = $140 * $79;
  9918. $142 = $46 * $25;
  9919. $143 = $40 * $27;
  9920. $144 = $142 - $143;
  9921. $145 = $34 * $31;
  9922. $146 = $144 + $145;
  9923. $147 = $146 * $79;
  9924. $148 = $17 * $46;
  9925. $149 = $19 * $40;
  9926. $150 = $149 - $148;
  9927. $151 = $34 * $23;
  9928. $152 = $150 - $151;
  9929. $153 = $152 * $79;
  9930. $154 = $61 * $104;
  9931. $155 = $11 * $55;
  9932. $156 = $154 + $155;
  9933. $157 = $13 * $52;
  9934. $158 = $156 - $157;
  9935. $159 = $158 * $79;
  9936. $160 = $1 * $61;
  9937. $161 = $3 * $55;
  9938. $162 = $160 - $161;
  9939. $163 = $5 * $52;
  9940. $164 = $163 + $162;
  9941. $165 = $164 * $79;
  9942. $166 = $43 * $117;
  9943. $167 = $37 * $27;
  9944. $168 = $166 + $167;
  9945. $169 = $34 * $29;
  9946. $170 = $168 - $169;
  9947. $171 = $170 * $79;
  9948. $172 = $17 * $43;
  9949. $173 = $37 * $19;
  9950. $174 = $172 - $173;
  9951. $175 = $34 * $21;
  9952. $176 = $174 + $175;
  9953. $177 = $176 * $79;
  9954. HEAPF32[$0>>2] = $85;
  9955. HEAPF32[$8>>2] = $110;
  9956. HEAPF32[$16>>2] = $135;
  9957. HEAPF32[$24>>2] = $159;
  9958. HEAPF32[$2>>2] = $91;
  9959. HEAPF32[$10>>2] = $116;
  9960. HEAPF32[$18>>2] = $141;
  9961. HEAPF32[$26>>2] = $165;
  9962. HEAPF32[$4>>2] = $97;
  9963. HEAPF32[$12>>2] = $123;
  9964. HEAPF32[$20>>2] = $147;
  9965. HEAPF32[$28>>2] = $171;
  9966. HEAPF32[$6>>2] = $103;
  9967. HEAPF32[$14>>2] = $129;
  9968. HEAPF32[$22>>2] = $153;
  9969. HEAPF32[$30>>2] = $177;
  9970. return;
  9971. }
  9972. function _MatrixIdentity($0) {
  9973. $0 = $0|0;
  9974. var $$sroa$5$0$$sroa_idx = 0, $$sroa$55$0$$sroa_idx6 = 0, $$sroa$6$0$$sroa_idx = 0, $$sroa$611$0$$sroa_idx12 = 0, $$sroa$7$0$$sroa_idx = 0, $$sroa$717$0$$sroa_idx18 = 0, label = 0, sp = 0;
  9975. sp = STACKTOP;
  9976. HEAPF32[$0>>2] = 1.0;
  9977. $$sroa$5$0$$sroa_idx = ((($0)) + 4|0);
  9978. ;HEAP32[$$sroa$5$0$$sroa_idx>>2]=0|0;HEAP32[$$sroa$5$0$$sroa_idx+4>>2]=0|0;HEAP32[$$sroa$5$0$$sroa_idx+8>>2]=0|0;HEAP32[$$sroa$5$0$$sroa_idx+12>>2]=0|0;
  9979. $$sroa$55$0$$sroa_idx6 = ((($0)) + 20|0);
  9980. HEAPF32[$$sroa$55$0$$sroa_idx6>>2] = 1.0;
  9981. $$sroa$6$0$$sroa_idx = ((($0)) + 24|0);
  9982. ;HEAP32[$$sroa$6$0$$sroa_idx>>2]=0|0;HEAP32[$$sroa$6$0$$sroa_idx+4>>2]=0|0;HEAP32[$$sroa$6$0$$sroa_idx+8>>2]=0|0;HEAP32[$$sroa$6$0$$sroa_idx+12>>2]=0|0;
  9983. $$sroa$611$0$$sroa_idx12 = ((($0)) + 40|0);
  9984. HEAPF32[$$sroa$611$0$$sroa_idx12>>2] = 1.0;
  9985. $$sroa$7$0$$sroa_idx = ((($0)) + 44|0);
  9986. ;HEAP32[$$sroa$7$0$$sroa_idx>>2]=0|0;HEAP32[$$sroa$7$0$$sroa_idx+4>>2]=0|0;HEAP32[$$sroa$7$0$$sroa_idx+8>>2]=0|0;HEAP32[$$sroa$7$0$$sroa_idx+12>>2]=0|0;
  9987. $$sroa$717$0$$sroa_idx18 = ((($0)) + 60|0);
  9988. HEAPF32[$$sroa$717$0$$sroa_idx18>>2] = 1.0;
  9989. return;
  9990. }
  9991. function _MatrixTranslate($0,$1,$2,$3) {
  9992. $0 = $0|0;
  9993. $1 = +$1;
  9994. $2 = +$2;
  9995. $3 = +$3;
  9996. var $$sroa$13$0$$sroa_idx20 = 0, $$sroa$14$0$$sroa_idx22 = 0, $$sroa$15$0$$sroa_idx24 = 0, $$sroa$16$0$$sroa_idx26 = 0, $$sroa$17$0$$sroa_idx28 = 0, $$sroa$18$0$$sroa_idx30 = 0, $$sroa$4$0$$sroa_idx2 = 0, $$sroa$8$0$$sroa_idx10 = 0, $$sroa$9$0$$sroa_idx12 = 0, label = 0, sp = 0;
  9997. sp = STACKTOP;
  9998. HEAPF32[$0>>2] = 1.0;
  9999. $$sroa$4$0$$sroa_idx2 = ((($0)) + 4|0);
  10000. $$sroa$8$0$$sroa_idx10 = ((($0)) + 20|0);
  10001. ;HEAP32[$$sroa$4$0$$sroa_idx2>>2]=0|0;HEAP32[$$sroa$4$0$$sroa_idx2+4>>2]=0|0;HEAP32[$$sroa$4$0$$sroa_idx2+8>>2]=0|0;HEAP32[$$sroa$4$0$$sroa_idx2+12>>2]=0|0;
  10002. HEAPF32[$$sroa$8$0$$sroa_idx10>>2] = 1.0;
  10003. $$sroa$9$0$$sroa_idx12 = ((($0)) + 24|0);
  10004. $$sroa$13$0$$sroa_idx20 = ((($0)) + 40|0);
  10005. ;HEAP32[$$sroa$9$0$$sroa_idx12>>2]=0|0;HEAP32[$$sroa$9$0$$sroa_idx12+4>>2]=0|0;HEAP32[$$sroa$9$0$$sroa_idx12+8>>2]=0|0;HEAP32[$$sroa$9$0$$sroa_idx12+12>>2]=0|0;
  10006. HEAPF32[$$sroa$13$0$$sroa_idx20>>2] = 1.0;
  10007. $$sroa$14$0$$sroa_idx22 = ((($0)) + 44|0);
  10008. HEAPF32[$$sroa$14$0$$sroa_idx22>>2] = 0.0;
  10009. $$sroa$15$0$$sroa_idx24 = ((($0)) + 48|0);
  10010. HEAPF32[$$sroa$15$0$$sroa_idx24>>2] = $1;
  10011. $$sroa$16$0$$sroa_idx26 = ((($0)) + 52|0);
  10012. HEAPF32[$$sroa$16$0$$sroa_idx26>>2] = $2;
  10013. $$sroa$17$0$$sroa_idx28 = ((($0)) + 56|0);
  10014. HEAPF32[$$sroa$17$0$$sroa_idx28>>2] = $3;
  10015. $$sroa$18$0$$sroa_idx30 = ((($0)) + 60|0);
  10016. HEAPF32[$$sroa$18$0$$sroa_idx30>>2] = 1.0;
  10017. return;
  10018. }
  10019. function _MatrixRotate($0,$1,$2) {
  10020. $0 = $0|0;
  10021. $1 = $1|0;
  10022. $2 = +$2;
  10023. var $$ = 0.0, $$221 = 0.0, $$222 = 0.0, $$sroa$10$0$$sroa_idx199 = 0, $$sroa$11$0$$sroa_idx201 = 0, $$sroa$12$0$$sroa_idx203 = 0, $$sroa$13$0$$sroa_idx205 = 0, $$sroa$14$0$$sroa_idx207 = 0, $$sroa$15$0$$sroa_idx209 = 0, $$sroa$16$0$$sroa_idx211 = 0, $$sroa$17$0$$sroa_idx213 = 0, $$sroa$18$0$$sroa_idx215 = 0, $$sroa$4$0$$sroa_idx187 = 0, $$sroa$5$0$$sroa_idx189 = 0, $$sroa$6$0$$sroa_idx191 = 0, $$sroa$7$0$$sroa_idx193 = 0, $$sroa$8$0$$sroa_idx195 = 0, $$sroa$9$0$$sroa_idx197 = 0, $10 = 0.0, $100 = 0.0;
  10024. var $101 = 0.0, $102 = 0.0, $103 = 0.0, $104 = 0.0, $105 = 0.0, $106 = 0.0, $107 = 0.0, $108 = 0.0, $109 = 0.0, $11 = 0.0, $110 = 0.0, $111 = 0.0, $112 = 0.0, $113 = 0.0, $114 = 0.0, $115 = 0.0, $116 = 0.0, $117 = 0.0, $118 = 0.0, $119 = 0.0;
  10025. var $12 = 0.0, $120 = 0.0, $121 = 0.0, $122 = 0.0, $123 = 0.0, $124 = 0.0, $125 = 0.0, $126 = 0.0, $127 = 0.0, $128 = 0.0, $129 = 0.0, $13 = 0.0, $130 = 0.0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0;
  10026. var $138 = 0, $14 = 0.0, $15 = 0, $16 = 0, $17 = 0.0, $18 = 0.0, $19 = 0.0, $20 = 0.0, $21 = 0.0, $22 = 0.0, $23 = 0.0, $24 = 0.0, $25 = 0, $26 = 0.0, $27 = 0, $28 = 0.0, $29 = 0, $3 = 0, $30 = 0.0, $31 = 0;
  10027. var $32 = 0.0, $33 = 0, $34 = 0.0, $35 = 0, $36 = 0.0, $37 = 0, $38 = 0.0, $39 = 0, $4 = 0.0, $40 = 0.0, $41 = 0, $42 = 0.0, $43 = 0, $44 = 0.0, $45 = 0, $46 = 0.0, $47 = 0.0, $48 = 0.0, $49 = 0.0, $5 = 0;
  10028. var $50 = 0.0, $51 = 0.0, $52 = 0.0, $53 = 0.0, $54 = 0.0, $55 = 0.0, $56 = 0.0, $57 = 0.0, $58 = 0.0, $59 = 0.0, $6 = 0.0, $60 = 0.0, $61 = 0.0, $62 = 0.0, $63 = 0.0, $64 = 0.0, $65 = 0.0, $66 = 0.0, $67 = 0.0, $68 = 0.0;
  10029. var $69 = 0.0, $7 = 0, $70 = 0.0, $71 = 0.0, $72 = 0.0, $73 = 0.0, $74 = 0.0, $75 = 0.0, $76 = 0.0, $77 = 0.0, $78 = 0.0, $79 = 0.0, $8 = 0.0, $80 = 0.0, $81 = 0.0, $82 = 0.0, $83 = 0.0, $84 = 0.0, $85 = 0.0, $86 = 0.0;
  10030. var $87 = 0.0, $88 = 0.0, $89 = 0.0, $9 = 0.0, $90 = 0.0, $91 = 0.0, $92 = 0.0, $93 = 0.0, $94 = 0.0, $95 = 0.0, $96 = 0.0, $97 = 0.0, $98 = 0.0, $99 = 0.0, $or$cond = 0, label = 0, sp = 0;
  10031. sp = STACKTOP;
  10032. STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(64|0);
  10033. $3 = sp;
  10034. _MatrixIdentity($3);
  10035. $4 = +HEAPF32[$1>>2];
  10036. $5 = ((($1)) + 4|0);
  10037. $6 = +HEAPF32[$5>>2];
  10038. $7 = ((($1)) + 8|0);
  10039. $8 = +HEAPF32[$7>>2];
  10040. $9 = $4 * $4;
  10041. $10 = $6 * $6;
  10042. $11 = $9 + $10;
  10043. $12 = $8 * $8;
  10044. $13 = $11 + $12;
  10045. $14 = (+Math_sqrt((+$13)));
  10046. $15 = $14 != 1.0;
  10047. $16 = $14 != 0.0;
  10048. $or$cond = $15 & $16;
  10049. $17 = 1.0 / $14;
  10050. $18 = $4 * $17;
  10051. $19 = $6 * $17;
  10052. $20 = $8 * $17;
  10053. $$ = $or$cond ? $20 : $8;
  10054. $$221 = $or$cond ? $19 : $6;
  10055. $$222 = $or$cond ? $18 : $4;
  10056. $21 = (+Math_sin((+$2)));
  10057. $22 = (+Math_cos((+$2)));
  10058. $23 = 1.0 - $22;
  10059. $24 = +HEAPF32[$3>>2];
  10060. $25 = ((($3)) + 16|0);
  10061. $26 = +HEAPF32[$25>>2];
  10062. $27 = ((($3)) + 32|0);
  10063. $28 = +HEAPF32[$27>>2];
  10064. $29 = ((($3)) + 48|0);
  10065. $30 = +HEAPF32[$29>>2];
  10066. $31 = ((($3)) + 4|0);
  10067. $32 = +HEAPF32[$31>>2];
  10068. $33 = ((($3)) + 20|0);
  10069. $34 = +HEAPF32[$33>>2];
  10070. $35 = ((($3)) + 36|0);
  10071. $36 = +HEAPF32[$35>>2];
  10072. $37 = ((($3)) + 52|0);
  10073. $38 = +HEAPF32[$37>>2];
  10074. $39 = ((($3)) + 8|0);
  10075. $40 = +HEAPF32[$39>>2];
  10076. $41 = ((($3)) + 24|0);
  10077. $42 = +HEAPF32[$41>>2];
  10078. $43 = ((($3)) + 40|0);
  10079. $44 = +HEAPF32[$43>>2];
  10080. $45 = ((($3)) + 56|0);
  10081. $46 = +HEAPF32[$45>>2];
  10082. $47 = $$222 * $$222;
  10083. $48 = $23 * $47;
  10084. $49 = $22 + $48;
  10085. $50 = $$221 * $$222;
  10086. $51 = $23 * $50;
  10087. $52 = $21 * $$;
  10088. $53 = $52 + $51;
  10089. $54 = $$ * $$222;
  10090. $55 = $23 * $54;
  10091. $56 = $21 * $$221;
  10092. $57 = $55 - $56;
  10093. $58 = $51 - $52;
  10094. $59 = $$221 * $$221;
  10095. $60 = $23 * $59;
  10096. $61 = $22 + $60;
  10097. $62 = $$ * $$221;
  10098. $63 = $23 * $62;
  10099. $64 = $21 * $$222;
  10100. $65 = $64 + $63;
  10101. $66 = $56 + $55;
  10102. $67 = $63 - $64;
  10103. $68 = $$ * $$;
  10104. $69 = $23 * $68;
  10105. $70 = $22 + $69;
  10106. $71 = $24 * $49;
  10107. $72 = $53 * $32;
  10108. $73 = $71 + $72;
  10109. $74 = $57 * $40;
  10110. $75 = $73 + $74;
  10111. $76 = $26 * $49;
  10112. $77 = $53 * $34;
  10113. $78 = $76 + $77;
  10114. $79 = $57 * $42;
  10115. $80 = $78 + $79;
  10116. $81 = $28 * $49;
  10117. $82 = $53 * $36;
  10118. $83 = $81 + $82;
  10119. $84 = $57 * $44;
  10120. $85 = $83 + $84;
  10121. $86 = $30 * $49;
  10122. $87 = $53 * $38;
  10123. $88 = $86 + $87;
  10124. $89 = $57 * $46;
  10125. $90 = $88 + $89;
  10126. $91 = $24 * $58;
  10127. $92 = $61 * $32;
  10128. $93 = $91 + $92;
  10129. $94 = $65 * $40;
  10130. $95 = $93 + $94;
  10131. $96 = $26 * $58;
  10132. $97 = $61 * $34;
  10133. $98 = $96 + $97;
  10134. $99 = $65 * $42;
  10135. $100 = $98 + $99;
  10136. $101 = $28 * $58;
  10137. $102 = $61 * $36;
  10138. $103 = $101 + $102;
  10139. $104 = $65 * $44;
  10140. $105 = $103 + $104;
  10141. $106 = $30 * $58;
  10142. $107 = $61 * $38;
  10143. $108 = $106 + $107;
  10144. $109 = $65 * $46;
  10145. $110 = $108 + $109;
  10146. $111 = $24 * $66;
  10147. $112 = $67 * $32;
  10148. $113 = $111 + $112;
  10149. $114 = $70 * $40;
  10150. $115 = $113 + $114;
  10151. $116 = $26 * $66;
  10152. $117 = $67 * $34;
  10153. $118 = $116 + $117;
  10154. $119 = $70 * $42;
  10155. $120 = $118 + $119;
  10156. $121 = $28 * $66;
  10157. $122 = $67 * $36;
  10158. $123 = $121 + $122;
  10159. $124 = $70 * $44;
  10160. $125 = $123 + $124;
  10161. $126 = $30 * $66;
  10162. $127 = $67 * $38;
  10163. $128 = $126 + $127;
  10164. $129 = $70 * $46;
  10165. $130 = $128 + $129;
  10166. $131 = ((($3)) + 12|0);
  10167. $132 = HEAP32[$131>>2]|0;
  10168. $133 = ((($3)) + 28|0);
  10169. $134 = HEAP32[$133>>2]|0;
  10170. $135 = ((($3)) + 44|0);
  10171. $136 = HEAP32[$135>>2]|0;
  10172. $137 = ((($3)) + 60|0);
  10173. $138 = HEAP32[$137>>2]|0;
  10174. HEAPF32[$0>>2] = $75;
  10175. $$sroa$4$0$$sroa_idx187 = ((($0)) + 4|0);
  10176. HEAPF32[$$sroa$4$0$$sroa_idx187>>2] = $95;
  10177. $$sroa$5$0$$sroa_idx189 = ((($0)) + 8|0);
  10178. HEAPF32[$$sroa$5$0$$sroa_idx189>>2] = $115;
  10179. $$sroa$6$0$$sroa_idx191 = ((($0)) + 12|0);
  10180. HEAP32[$$sroa$6$0$$sroa_idx191>>2] = $132;
  10181. $$sroa$7$0$$sroa_idx193 = ((($0)) + 16|0);
  10182. HEAPF32[$$sroa$7$0$$sroa_idx193>>2] = $80;
  10183. $$sroa$8$0$$sroa_idx195 = ((($0)) + 20|0);
  10184. HEAPF32[$$sroa$8$0$$sroa_idx195>>2] = $100;
  10185. $$sroa$9$0$$sroa_idx197 = ((($0)) + 24|0);
  10186. HEAPF32[$$sroa$9$0$$sroa_idx197>>2] = $120;
  10187. $$sroa$10$0$$sroa_idx199 = ((($0)) + 28|0);
  10188. HEAP32[$$sroa$10$0$$sroa_idx199>>2] = $134;
  10189. $$sroa$11$0$$sroa_idx201 = ((($0)) + 32|0);
  10190. HEAPF32[$$sroa$11$0$$sroa_idx201>>2] = $85;
  10191. $$sroa$12$0$$sroa_idx203 = ((($0)) + 36|0);
  10192. HEAPF32[$$sroa$12$0$$sroa_idx203>>2] = $105;
  10193. $$sroa$13$0$$sroa_idx205 = ((($0)) + 40|0);
  10194. HEAPF32[$$sroa$13$0$$sroa_idx205>>2] = $125;
  10195. $$sroa$14$0$$sroa_idx207 = ((($0)) + 44|0);
  10196. HEAP32[$$sroa$14$0$$sroa_idx207>>2] = $136;
  10197. $$sroa$15$0$$sroa_idx209 = ((($0)) + 48|0);
  10198. HEAPF32[$$sroa$15$0$$sroa_idx209>>2] = $90;
  10199. $$sroa$16$0$$sroa_idx211 = ((($0)) + 52|0);
  10200. HEAPF32[$$sroa$16$0$$sroa_idx211>>2] = $110;
  10201. $$sroa$17$0$$sroa_idx213 = ((($0)) + 56|0);
  10202. HEAPF32[$$sroa$17$0$$sroa_idx213>>2] = $130;
  10203. $$sroa$18$0$$sroa_idx215 = ((($0)) + 60|0);
  10204. HEAP32[$$sroa$18$0$$sroa_idx215>>2] = $138;
  10205. STACKTOP = sp;return;
  10206. }
  10207. function _MatrixScale($0,$1,$2,$3) {
  10208. $0 = $0|0;
  10209. $1 = +$1;
  10210. $2 = +$2;
  10211. $3 = +$3;
  10212. var $$sroa$5$0$$sroa_idx = 0, $$sroa$55$0$$sroa_idx6 = 0, $$sroa$6$0$$sroa_idx = 0, $$sroa$611$0$$sroa_idx12 = 0, $$sroa$7$0$$sroa_idx = 0, $$sroa$717$0$$sroa_idx18 = 0, label = 0, sp = 0;
  10213. sp = STACKTOP;
  10214. HEAPF32[$0>>2] = $1;
  10215. $$sroa$5$0$$sroa_idx = ((($0)) + 4|0);
  10216. ;HEAP32[$$sroa$5$0$$sroa_idx>>2]=0|0;HEAP32[$$sroa$5$0$$sroa_idx+4>>2]=0|0;HEAP32[$$sroa$5$0$$sroa_idx+8>>2]=0|0;HEAP32[$$sroa$5$0$$sroa_idx+12>>2]=0|0;
  10217. $$sroa$55$0$$sroa_idx6 = ((($0)) + 20|0);
  10218. HEAPF32[$$sroa$55$0$$sroa_idx6>>2] = $2;
  10219. $$sroa$6$0$$sroa_idx = ((($0)) + 24|0);
  10220. ;HEAP32[$$sroa$6$0$$sroa_idx>>2]=0|0;HEAP32[$$sroa$6$0$$sroa_idx+4>>2]=0|0;HEAP32[$$sroa$6$0$$sroa_idx+8>>2]=0|0;HEAP32[$$sroa$6$0$$sroa_idx+12>>2]=0|0;
  10221. $$sroa$611$0$$sroa_idx12 = ((($0)) + 40|0);
  10222. HEAPF32[$$sroa$611$0$$sroa_idx12>>2] = $3;
  10223. $$sroa$7$0$$sroa_idx = ((($0)) + 44|0);
  10224. ;HEAP32[$$sroa$7$0$$sroa_idx>>2]=0|0;HEAP32[$$sroa$7$0$$sroa_idx+4>>2]=0|0;HEAP32[$$sroa$7$0$$sroa_idx+8>>2]=0|0;HEAP32[$$sroa$7$0$$sroa_idx+12>>2]=0|0;
  10225. $$sroa$717$0$$sroa_idx18 = ((($0)) + 60|0);
  10226. HEAPF32[$$sroa$717$0$$sroa_idx18>>2] = 1.0;
  10227. return;
  10228. }
  10229. function _MatrixMultiply($0,$1,$2) {
  10230. $0 = $0|0;
  10231. $1 = $1|0;
  10232. $2 = $2|0;
  10233. var $$sroa$10$0$$sroa_idx14 = 0, $$sroa$11$0$$sroa_idx16 = 0, $$sroa$12$0$$sroa_idx18 = 0, $$sroa$13$0$$sroa_idx20 = 0, $$sroa$14$0$$sroa_idx22 = 0, $$sroa$15$0$$sroa_idx24 = 0, $$sroa$16$0$$sroa_idx26 = 0, $$sroa$17$0$$sroa_idx28 = 0, $$sroa$18$0$$sroa_idx30 = 0, $$sroa$4$0$$sroa_idx2 = 0, $$sroa$5$0$$sroa_idx4 = 0, $$sroa$6$0$$sroa_idx6 = 0, $$sroa$7$0$$sroa_idx8 = 0, $$sroa$8$0$$sroa_idx10 = 0, $$sroa$9$0$$sroa_idx12 = 0, $10 = 0.0, $100 = 0.0, $101 = 0.0, $102 = 0.0, $103 = 0.0;
  10234. var $104 = 0.0, $105 = 0, $106 = 0.0, $107 = 0.0, $108 = 0, $109 = 0.0, $11 = 0.0, $110 = 0.0, $111 = 0.0, $112 = 0, $113 = 0.0, $114 = 0.0, $115 = 0.0, $116 = 0, $117 = 0.0, $118 = 0.0, $119 = 0.0, $12 = 0, $120 = 0.0, $121 = 0.0;
  10235. var $122 = 0.0, $123 = 0.0, $124 = 0.0, $125 = 0.0, $126 = 0.0, $127 = 0.0, $128 = 0.0, $129 = 0.0, $13 = 0.0, $130 = 0.0, $131 = 0.0, $132 = 0.0, $133 = 0.0, $134 = 0.0, $135 = 0.0, $136 = 0.0, $137 = 0.0, $138 = 0.0, $139 = 0.0, $14 = 0;
  10236. var $140 = 0.0, $141 = 0, $142 = 0.0, $143 = 0.0, $144 = 0, $145 = 0.0, $146 = 0.0, $147 = 0.0, $148 = 0, $149 = 0.0, $15 = 0.0, $150 = 0.0, $151 = 0.0, $152 = 0, $153 = 0.0, $154 = 0.0, $155 = 0.0, $156 = 0.0, $157 = 0.0, $158 = 0.0;
  10237. var $159 = 0.0, $16 = 0.0, $160 = 0.0, $161 = 0.0, $162 = 0.0, $163 = 0.0, $164 = 0.0, $165 = 0.0, $166 = 0.0, $167 = 0.0, $168 = 0.0, $169 = 0.0, $17 = 0.0, $170 = 0.0, $171 = 0.0, $172 = 0.0, $173 = 0.0, $174 = 0.0, $175 = 0.0, $176 = 0.0;
  10238. var $18 = 0, $19 = 0.0, $20 = 0, $21 = 0.0, $22 = 0.0, $23 = 0.0, $24 = 0, $25 = 0.0, $26 = 0.0, $27 = 0, $28 = 0.0, $29 = 0.0, $3 = 0.0, $30 = 0.0, $31 = 0, $32 = 0.0, $33 = 0.0, $34 = 0.0, $35 = 0, $36 = 0.0;
  10239. var $37 = 0.0, $38 = 0.0, $39 = 0, $4 = 0.0, $40 = 0.0, $41 = 0.0, $42 = 0, $43 = 0.0, $44 = 0.0, $45 = 0.0, $46 = 0, $47 = 0.0, $48 = 0.0, $49 = 0.0, $5 = 0.0, $50 = 0, $51 = 0.0, $52 = 0.0, $53 = 0.0, $54 = 0;
  10240. var $55 = 0.0, $56 = 0.0, $57 = 0, $58 = 0.0, $59 = 0.0, $6 = 0, $60 = 0.0, $61 = 0, $62 = 0.0, $63 = 0.0, $64 = 0.0, $65 = 0, $66 = 0.0, $67 = 0.0, $68 = 0.0, $69 = 0, $7 = 0.0, $70 = 0.0, $71 = 0.0, $72 = 0;
  10241. var $73 = 0.0, $74 = 0.0, $75 = 0.0, $76 = 0, $77 = 0.0, $78 = 0.0, $79 = 0.0, $8 = 0, $80 = 0, $81 = 0.0, $82 = 0.0, $83 = 0.0, $84 = 0.0, $85 = 0.0, $86 = 0.0, $87 = 0.0, $88 = 0.0, $89 = 0.0, $9 = 0.0, $90 = 0.0;
  10242. var $91 = 0.0, $92 = 0.0, $93 = 0.0, $94 = 0.0, $95 = 0.0, $96 = 0.0, $97 = 0.0, $98 = 0.0, $99 = 0.0, label = 0, sp = 0;
  10243. sp = STACKTOP;
  10244. $3 = +HEAPF32[$2>>2];
  10245. $4 = +HEAPF32[$1>>2];
  10246. $5 = $3 * $4;
  10247. $6 = ((($2)) + 16|0);
  10248. $7 = +HEAPF32[$6>>2];
  10249. $8 = ((($1)) + 4|0);
  10250. $9 = +HEAPF32[$8>>2];
  10251. $10 = $7 * $9;
  10252. $11 = $5 + $10;
  10253. $12 = ((($2)) + 32|0);
  10254. $13 = +HEAPF32[$12>>2];
  10255. $14 = ((($1)) + 8|0);
  10256. $15 = +HEAPF32[$14>>2];
  10257. $16 = $13 * $15;
  10258. $17 = $11 + $16;
  10259. $18 = ((($2)) + 48|0);
  10260. $19 = +HEAPF32[$18>>2];
  10261. $20 = ((($1)) + 12|0);
  10262. $21 = +HEAPF32[$20>>2];
  10263. $22 = $19 * $21;
  10264. $23 = $17 + $22;
  10265. $24 = ((($1)) + 16|0);
  10266. $25 = +HEAPF32[$24>>2];
  10267. $26 = $3 * $25;
  10268. $27 = ((($1)) + 20|0);
  10269. $28 = +HEAPF32[$27>>2];
  10270. $29 = $7 * $28;
  10271. $30 = $26 + $29;
  10272. $31 = ((($1)) + 24|0);
  10273. $32 = +HEAPF32[$31>>2];
  10274. $33 = $13 * $32;
  10275. $34 = $30 + $33;
  10276. $35 = ((($1)) + 28|0);
  10277. $36 = +HEAPF32[$35>>2];
  10278. $37 = $19 * $36;
  10279. $38 = $34 + $37;
  10280. $39 = ((($1)) + 32|0);
  10281. $40 = +HEAPF32[$39>>2];
  10282. $41 = $3 * $40;
  10283. $42 = ((($1)) + 36|0);
  10284. $43 = +HEAPF32[$42>>2];
  10285. $44 = $7 * $43;
  10286. $45 = $41 + $44;
  10287. $46 = ((($1)) + 40|0);
  10288. $47 = +HEAPF32[$46>>2];
  10289. $48 = $13 * $47;
  10290. $49 = $45 + $48;
  10291. $50 = ((($1)) + 44|0);
  10292. $51 = +HEAPF32[$50>>2];
  10293. $52 = $19 * $51;
  10294. $53 = $49 + $52;
  10295. $54 = ((($1)) + 48|0);
  10296. $55 = +HEAPF32[$54>>2];
  10297. $56 = $3 * $55;
  10298. $57 = ((($1)) + 52|0);
  10299. $58 = +HEAPF32[$57>>2];
  10300. $59 = $7 * $58;
  10301. $60 = $56 + $59;
  10302. $61 = ((($1)) + 56|0);
  10303. $62 = +HEAPF32[$61>>2];
  10304. $63 = $13 * $62;
  10305. $64 = $60 + $63;
  10306. $65 = ((($1)) + 60|0);
  10307. $66 = +HEAPF32[$65>>2];
  10308. $67 = $19 * $66;
  10309. $68 = $64 + $67;
  10310. $69 = ((($2)) + 4|0);
  10311. $70 = +HEAPF32[$69>>2];
  10312. $71 = $4 * $70;
  10313. $72 = ((($2)) + 20|0);
  10314. $73 = +HEAPF32[$72>>2];
  10315. $74 = $9 * $73;
  10316. $75 = $71 + $74;
  10317. $76 = ((($2)) + 36|0);
  10318. $77 = +HEAPF32[$76>>2];
  10319. $78 = $15 * $77;
  10320. $79 = $75 + $78;
  10321. $80 = ((($2)) + 52|0);
  10322. $81 = +HEAPF32[$80>>2];
  10323. $82 = $21 * $81;
  10324. $83 = $79 + $82;
  10325. $84 = $25 * $70;
  10326. $85 = $28 * $73;
  10327. $86 = $84 + $85;
  10328. $87 = $32 * $77;
  10329. $88 = $86 + $87;
  10330. $89 = $36 * $81;
  10331. $90 = $88 + $89;
  10332. $91 = $40 * $70;
  10333. $92 = $43 * $73;
  10334. $93 = $91 + $92;
  10335. $94 = $47 * $77;
  10336. $95 = $93 + $94;
  10337. $96 = $51 * $81;
  10338. $97 = $95 + $96;
  10339. $98 = $55 * $70;
  10340. $99 = $58 * $73;
  10341. $100 = $98 + $99;
  10342. $101 = $62 * $77;
  10343. $102 = $100 + $101;
  10344. $103 = $66 * $81;
  10345. $104 = $102 + $103;
  10346. $105 = ((($2)) + 8|0);
  10347. $106 = +HEAPF32[$105>>2];
  10348. $107 = $4 * $106;
  10349. $108 = ((($2)) + 24|0);
  10350. $109 = +HEAPF32[$108>>2];
  10351. $110 = $9 * $109;
  10352. $111 = $107 + $110;
  10353. $112 = ((($2)) + 40|0);
  10354. $113 = +HEAPF32[$112>>2];
  10355. $114 = $15 * $113;
  10356. $115 = $111 + $114;
  10357. $116 = ((($2)) + 56|0);
  10358. $117 = +HEAPF32[$116>>2];
  10359. $118 = $21 * $117;
  10360. $119 = $115 + $118;
  10361. $120 = $25 * $106;
  10362. $121 = $28 * $109;
  10363. $122 = $120 + $121;
  10364. $123 = $32 * $113;
  10365. $124 = $122 + $123;
  10366. $125 = $36 * $117;
  10367. $126 = $124 + $125;
  10368. $127 = $40 * $106;
  10369. $128 = $43 * $109;
  10370. $129 = $127 + $128;
  10371. $130 = $47 * $113;
  10372. $131 = $129 + $130;
  10373. $132 = $51 * $117;
  10374. $133 = $131 + $132;
  10375. $134 = $55 * $106;
  10376. $135 = $58 * $109;
  10377. $136 = $134 + $135;
  10378. $137 = $62 * $113;
  10379. $138 = $136 + $137;
  10380. $139 = $66 * $117;
  10381. $140 = $138 + $139;
  10382. $141 = ((($2)) + 12|0);
  10383. $142 = +HEAPF32[$141>>2];
  10384. $143 = $4 * $142;
  10385. $144 = ((($2)) + 28|0);
  10386. $145 = +HEAPF32[$144>>2];
  10387. $146 = $9 * $145;
  10388. $147 = $143 + $146;
  10389. $148 = ((($2)) + 44|0);
  10390. $149 = +HEAPF32[$148>>2];
  10391. $150 = $15 * $149;
  10392. $151 = $147 + $150;
  10393. $152 = ((($2)) + 60|0);
  10394. $153 = +HEAPF32[$152>>2];
  10395. $154 = $21 * $153;
  10396. $155 = $151 + $154;
  10397. $156 = $25 * $142;
  10398. $157 = $28 * $145;
  10399. $158 = $156 + $157;
  10400. $159 = $32 * $149;
  10401. $160 = $158 + $159;
  10402. $161 = $36 * $153;
  10403. $162 = $160 + $161;
  10404. $163 = $40 * $142;
  10405. $164 = $43 * $145;
  10406. $165 = $163 + $164;
  10407. $166 = $47 * $149;
  10408. $167 = $165 + $166;
  10409. $168 = $51 * $153;
  10410. $169 = $167 + $168;
  10411. $170 = $55 * $142;
  10412. $171 = $58 * $145;
  10413. $172 = $170 + $171;
  10414. $173 = $62 * $149;
  10415. $174 = $172 + $173;
  10416. $175 = $66 * $153;
  10417. $176 = $174 + $175;
  10418. HEAPF32[$0>>2] = $23;
  10419. $$sroa$4$0$$sroa_idx2 = ((($0)) + 4|0);
  10420. HEAPF32[$$sroa$4$0$$sroa_idx2>>2] = $83;
  10421. $$sroa$5$0$$sroa_idx4 = ((($0)) + 8|0);
  10422. HEAPF32[$$sroa$5$0$$sroa_idx4>>2] = $119;
  10423. $$sroa$6$0$$sroa_idx6 = ((($0)) + 12|0);
  10424. HEAPF32[$$sroa$6$0$$sroa_idx6>>2] = $155;
  10425. $$sroa$7$0$$sroa_idx8 = ((($0)) + 16|0);
  10426. HEAPF32[$$sroa$7$0$$sroa_idx8>>2] = $38;
  10427. $$sroa$8$0$$sroa_idx10 = ((($0)) + 20|0);
  10428. HEAPF32[$$sroa$8$0$$sroa_idx10>>2] = $90;
  10429. $$sroa$9$0$$sroa_idx12 = ((($0)) + 24|0);
  10430. HEAPF32[$$sroa$9$0$$sroa_idx12>>2] = $126;
  10431. $$sroa$10$0$$sroa_idx14 = ((($0)) + 28|0);
  10432. HEAPF32[$$sroa$10$0$$sroa_idx14>>2] = $162;
  10433. $$sroa$11$0$$sroa_idx16 = ((($0)) + 32|0);
  10434. HEAPF32[$$sroa$11$0$$sroa_idx16>>2] = $53;
  10435. $$sroa$12$0$$sroa_idx18 = ((($0)) + 36|0);
  10436. HEAPF32[$$sroa$12$0$$sroa_idx18>>2] = $97;
  10437. $$sroa$13$0$$sroa_idx20 = ((($0)) + 40|0);
  10438. HEAPF32[$$sroa$13$0$$sroa_idx20>>2] = $133;
  10439. $$sroa$14$0$$sroa_idx22 = ((($0)) + 44|0);
  10440. HEAPF32[$$sroa$14$0$$sroa_idx22>>2] = $169;
  10441. $$sroa$15$0$$sroa_idx24 = ((($0)) + 48|0);
  10442. HEAPF32[$$sroa$15$0$$sroa_idx24>>2] = $68;
  10443. $$sroa$16$0$$sroa_idx26 = ((($0)) + 52|0);
  10444. HEAPF32[$$sroa$16$0$$sroa_idx26>>2] = $104;
  10445. $$sroa$17$0$$sroa_idx28 = ((($0)) + 56|0);
  10446. HEAPF32[$$sroa$17$0$$sroa_idx28>>2] = $140;
  10447. $$sroa$18$0$$sroa_idx30 = ((($0)) + 60|0);
  10448. HEAPF32[$$sroa$18$0$$sroa_idx30>>2] = $176;
  10449. return;
  10450. }
  10451. function _MatrixFrustum($0,$1,$2,$3,$4,$5,$6) {
  10452. $0 = $0|0;
  10453. $1 = +$1;
  10454. $2 = +$2;
  10455. $3 = +$3;
  10456. $4 = +$4;
  10457. $5 = +$5;
  10458. $6 = +$6;
  10459. var $$sroa$10$0$$sroa_idx24 = 0, $$sroa$11$0$$sroa_idx26 = 0, $$sroa$12$0$$sroa_idx28 = 0, $$sroa$13$0$$sroa_idx30 = 0, $$sroa$14$0$$sroa_idx32 = 0, $$sroa$15$0$$sroa_idx34 = 0, $$sroa$16$0$$sroa_idx36 = 0, $$sroa$17$0$$sroa_idx38 = 0, $$sroa$18$0$$sroa_idx40 = 0, $$sroa$4$0$$sroa_idx12 = 0, $$sroa$5$0$$sroa_idx14 = 0, $$sroa$6$0$$sroa_idx16 = 0, $$sroa$7$0$$sroa_idx18 = 0, $$sroa$8$0$$sroa_idx20 = 0, $$sroa$9$0$$sroa_idx22 = 0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0.0;
  10460. var $15 = 0.0, $16 = 0.0, $17 = 0.0, $18 = 0.0, $19 = 0.0, $20 = 0.0, $21 = 0.0, $22 = 0.0, $23 = 0.0, $24 = 0.0, $25 = 0.0, $26 = 0.0, $27 = 0.0, $28 = 0.0, $29 = 0.0, $30 = 0.0, $31 = 0.0, $32 = 0.0, $33 = 0.0, $34 = 0.0;
  10461. var $35 = 0.0, $7 = 0.0, $8 = 0.0, $9 = 0.0, label = 0, sp = 0;
  10462. sp = STACKTOP;
  10463. $7 = $2 - $1;
  10464. $8 = $7;
  10465. $9 = $4 - $3;
  10466. $10 = $9;
  10467. $11 = $6 - $5;
  10468. $12 = $11;
  10469. $13 = $5 * 2.0;
  10470. $14 = $8;
  10471. $15 = $13 / $14;
  10472. $16 = $15;
  10473. $17 = $10;
  10474. $18 = $13 / $17;
  10475. $19 = $18;
  10476. $20 = $1 + $2;
  10477. $21 = $20 / $14;
  10478. $22 = $21;
  10479. $23 = $3 + $4;
  10480. $24 = $23 / $17;
  10481. $25 = $24;
  10482. $26 = $5 + $6;
  10483. $27 = -$26;
  10484. $28 = $12;
  10485. $29 = $27 / $28;
  10486. $30 = $29;
  10487. $31 = $5 * $6;
  10488. $32 = $31 * 2.0;
  10489. $33 = -$32;
  10490. $34 = $33 / $28;
  10491. $35 = $34;
  10492. HEAPF32[$0>>2] = $16;
  10493. $$sroa$4$0$$sroa_idx12 = ((($0)) + 4|0);
  10494. HEAPF32[$$sroa$4$0$$sroa_idx12>>2] = 0.0;
  10495. $$sroa$5$0$$sroa_idx14 = ((($0)) + 8|0);
  10496. HEAPF32[$$sroa$5$0$$sroa_idx14>>2] = $22;
  10497. $$sroa$6$0$$sroa_idx16 = ((($0)) + 12|0);
  10498. HEAPF32[$$sroa$6$0$$sroa_idx16>>2] = 0.0;
  10499. $$sroa$7$0$$sroa_idx18 = ((($0)) + 16|0);
  10500. HEAPF32[$$sroa$7$0$$sroa_idx18>>2] = 0.0;
  10501. $$sroa$8$0$$sroa_idx20 = ((($0)) + 20|0);
  10502. HEAPF32[$$sroa$8$0$$sroa_idx20>>2] = $19;
  10503. $$sroa$9$0$$sroa_idx22 = ((($0)) + 24|0);
  10504. HEAPF32[$$sroa$9$0$$sroa_idx22>>2] = $25;
  10505. $$sroa$10$0$$sroa_idx24 = ((($0)) + 28|0);
  10506. HEAPF32[$$sroa$10$0$$sroa_idx24>>2] = 0.0;
  10507. $$sroa$11$0$$sroa_idx26 = ((($0)) + 32|0);
  10508. HEAPF32[$$sroa$11$0$$sroa_idx26>>2] = 0.0;
  10509. $$sroa$12$0$$sroa_idx28 = ((($0)) + 36|0);
  10510. HEAPF32[$$sroa$12$0$$sroa_idx28>>2] = 0.0;
  10511. $$sroa$13$0$$sroa_idx30 = ((($0)) + 40|0);
  10512. HEAPF32[$$sroa$13$0$$sroa_idx30>>2] = $30;
  10513. $$sroa$14$0$$sroa_idx32 = ((($0)) + 44|0);
  10514. HEAPF32[$$sroa$14$0$$sroa_idx32>>2] = $35;
  10515. $$sroa$15$0$$sroa_idx34 = ((($0)) + 48|0);
  10516. HEAPF32[$$sroa$15$0$$sroa_idx34>>2] = 0.0;
  10517. $$sroa$16$0$$sroa_idx36 = ((($0)) + 52|0);
  10518. HEAPF32[$$sroa$16$0$$sroa_idx36>>2] = 0.0;
  10519. $$sroa$17$0$$sroa_idx38 = ((($0)) + 56|0);
  10520. HEAPF32[$$sroa$17$0$$sroa_idx38>>2] = -1.0;
  10521. $$sroa$18$0$$sroa_idx40 = ((($0)) + 60|0);
  10522. HEAPF32[$$sroa$18$0$$sroa_idx40>>2] = 0.0;
  10523. return;
  10524. }
  10525. function _MatrixOrtho($0,$1,$2,$3,$4,$5,$6) {
  10526. $0 = $0|0;
  10527. $1 = +$1;
  10528. $2 = +$2;
  10529. $3 = +$3;
  10530. $4 = +$4;
  10531. $5 = +$5;
  10532. $6 = +$6;
  10533. var $$sroa$10$0$$sroa_idx24 = 0, $$sroa$11$0$$sroa_idx26 = 0, $$sroa$12$0$$sroa_idx28 = 0, $$sroa$13$0$$sroa_idx30 = 0, $$sroa$14$0$$sroa_idx32 = 0, $$sroa$15$0$$sroa_idx34 = 0, $$sroa$16$0$$sroa_idx36 = 0, $$sroa$17$0$$sroa_idx38 = 0, $$sroa$18$0$$sroa_idx40 = 0, $$sroa$4$0$$sroa_idx12 = 0, $$sroa$5$0$$sroa_idx14 = 0, $$sroa$6$0$$sroa_idx16 = 0, $$sroa$7$0$$sroa_idx18 = 0, $$sroa$8$0$$sroa_idx20 = 0, $$sroa$9$0$$sroa_idx22 = 0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0.0;
  10534. var $15 = 0.0, $16 = 0.0, $17 = 0.0, $18 = 0.0, $19 = 0.0, $20 = 0.0, $21 = 0.0, $22 = 0.0, $23 = 0.0, $24 = 0.0, $25 = 0.0, $26 = 0.0, $27 = 0.0, $28 = 0.0, $29 = 0.0, $30 = 0.0, $7 = 0.0, $8 = 0.0, $9 = 0.0, label = 0;
  10535. var sp = 0;
  10536. sp = STACKTOP;
  10537. $7 = $2 - $1;
  10538. $8 = $7;
  10539. $9 = $4 - $3;
  10540. $10 = $9;
  10541. $11 = $6 - $5;
  10542. $12 = $11;
  10543. $13 = 2.0 / $8;
  10544. $14 = 2.0 / $10;
  10545. $15 = -2.0 / $12;
  10546. $16 = $1 + $2;
  10547. $17 = -$16;
  10548. $18 = $8;
  10549. $19 = $17 / $18;
  10550. $20 = $19;
  10551. $21 = $3 + $4;
  10552. $22 = -$21;
  10553. $23 = $10;
  10554. $24 = $22 / $23;
  10555. $25 = $24;
  10556. $26 = $5 + $6;
  10557. $27 = -$26;
  10558. $28 = $12;
  10559. $29 = $27 / $28;
  10560. $30 = $29;
  10561. HEAPF32[$0>>2] = $13;
  10562. $$sroa$4$0$$sroa_idx12 = ((($0)) + 4|0);
  10563. HEAPF32[$$sroa$4$0$$sroa_idx12>>2] = 0.0;
  10564. $$sroa$5$0$$sroa_idx14 = ((($0)) + 8|0);
  10565. HEAPF32[$$sroa$5$0$$sroa_idx14>>2] = 0.0;
  10566. $$sroa$6$0$$sroa_idx16 = ((($0)) + 12|0);
  10567. HEAPF32[$$sroa$6$0$$sroa_idx16>>2] = $20;
  10568. $$sroa$7$0$$sroa_idx18 = ((($0)) + 16|0);
  10569. HEAPF32[$$sroa$7$0$$sroa_idx18>>2] = 0.0;
  10570. $$sroa$8$0$$sroa_idx20 = ((($0)) + 20|0);
  10571. HEAPF32[$$sroa$8$0$$sroa_idx20>>2] = $14;
  10572. $$sroa$9$0$$sroa_idx22 = ((($0)) + 24|0);
  10573. HEAPF32[$$sroa$9$0$$sroa_idx22>>2] = 0.0;
  10574. $$sroa$10$0$$sroa_idx24 = ((($0)) + 28|0);
  10575. HEAPF32[$$sroa$10$0$$sroa_idx24>>2] = $25;
  10576. $$sroa$11$0$$sroa_idx26 = ((($0)) + 32|0);
  10577. HEAPF32[$$sroa$11$0$$sroa_idx26>>2] = 0.0;
  10578. $$sroa$12$0$$sroa_idx28 = ((($0)) + 36|0);
  10579. HEAPF32[$$sroa$12$0$$sroa_idx28>>2] = 0.0;
  10580. $$sroa$13$0$$sroa_idx30 = ((($0)) + 40|0);
  10581. HEAPF32[$$sroa$13$0$$sroa_idx30>>2] = $15;
  10582. $$sroa$14$0$$sroa_idx32 = ((($0)) + 44|0);
  10583. HEAPF32[$$sroa$14$0$$sroa_idx32>>2] = $30;
  10584. $$sroa$15$0$$sroa_idx34 = ((($0)) + 48|0);
  10585. HEAPF32[$$sroa$15$0$$sroa_idx34>>2] = 0.0;
  10586. $$sroa$16$0$$sroa_idx36 = ((($0)) + 52|0);
  10587. HEAPF32[$$sroa$16$0$$sroa_idx36>>2] = 0.0;
  10588. $$sroa$17$0$$sroa_idx38 = ((($0)) + 56|0);
  10589. HEAPF32[$$sroa$17$0$$sroa_idx38>>2] = 0.0;
  10590. $$sroa$18$0$$sroa_idx40 = ((($0)) + 60|0);
  10591. HEAPF32[$$sroa$18$0$$sroa_idx40>>2] = 1.0;
  10592. return;
  10593. }
  10594. function _MatrixLookAt($0,$1,$2,$3) {
  10595. $0 = $0|0;
  10596. $1 = $1|0;
  10597. $2 = $2|0;
  10598. $3 = $3|0;
  10599. var $$byval_copy4 = 0, $$byval_copy5 = 0, $$sroa$10$0$$sroa_idx14 = 0, $$sroa$11$0$$sroa_idx16 = 0, $$sroa$12$0$$sroa_idx18 = 0, $$sroa$13$0$$sroa_idx20 = 0, $$sroa$14$0$$sroa_idx22 = 0, $$sroa$15$0$$sroa_idx24 = 0, $$sroa$16$0$$sroa_idx26 = 0, $$sroa$17$0$$sroa_idx28 = 0, $$sroa$18$0$$sroa_idx30 = 0, $$sroa$4$0$$sroa_idx2 = 0, $$sroa$5$0$$sroa_idx4 = 0, $$sroa$6$0$$sroa_idx6 = 0, $$sroa$7$0$$sroa_idx8 = 0, $$sroa$8$0$$sroa_idx10 = 0, $$sroa$9$0$$sroa_idx12 = 0, $10 = 0, $11 = 0.0, $12 = 0.0;
  10600. var $13 = 0.0, $14 = 0, $15 = 0.0, $16 = 0.0, $17 = 0.0, $18 = 0, $19 = 0.0, $20 = 0.0, $21 = 0.0, $22 = 0.0, $23 = 0.0, $24 = 0, $25 = 0.0, $26 = 0, $27 = 0.0, $28 = 0.0, $29 = 0.0, $30 = 0.0, $31 = 0.0, $32 = 0.0;
  10601. var $33 = 0.0, $34 = 0.0, $35 = 0, $36 = 0.0, $37 = 0, $38 = 0.0, $39 = 0.0, $4 = 0, $40 = 0.0, $41 = 0.0, $42 = 0.0, $43 = 0.0, $44 = 0.0, $5 = 0, $6 = 0, $7 = 0.0, $8 = 0, $9 = 0.0, label = 0, sp = 0;
  10602. sp = STACKTOP;
  10603. STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(64|0);
  10604. $$byval_copy5 = sp + 48|0;
  10605. $$byval_copy4 = sp + 36|0;
  10606. $4 = sp + 24|0;
  10607. $5 = sp + 12|0;
  10608. $6 = sp;
  10609. ;HEAP32[$$byval_copy4>>2]=HEAP32[$1>>2]|0;HEAP32[$$byval_copy4+4>>2]=HEAP32[$1+4>>2]|0;HEAP32[$$byval_copy4+8>>2]=HEAP32[$1+8>>2]|0;
  10610. ;HEAP32[$$byval_copy5>>2]=HEAP32[$2>>2]|0;HEAP32[$$byval_copy5+4>>2]=HEAP32[$2+4>>2]|0;HEAP32[$$byval_copy5+8>>2]=HEAP32[$2+8>>2]|0;
  10611. _VectorSubtract($4,$$byval_copy4,$$byval_copy5);
  10612. _VectorNormalize($4);
  10613. ;HEAP32[$$byval_copy4>>2]=HEAP32[$3>>2]|0;HEAP32[$$byval_copy4+4>>2]=HEAP32[$3+4>>2]|0;HEAP32[$$byval_copy4+8>>2]=HEAP32[$3+8>>2]|0;
  10614. ;HEAP32[$$byval_copy5>>2]=HEAP32[$4>>2]|0;HEAP32[$$byval_copy5+4>>2]=HEAP32[$4+4>>2]|0;HEAP32[$$byval_copy5+8>>2]=HEAP32[$4+8>>2]|0;
  10615. _VectorCrossProduct($5,$$byval_copy4,$$byval_copy5);
  10616. _VectorNormalize($5);
  10617. ;HEAP32[$$byval_copy4>>2]=HEAP32[$4>>2]|0;HEAP32[$$byval_copy4+4>>2]=HEAP32[$4+4>>2]|0;HEAP32[$$byval_copy4+8>>2]=HEAP32[$4+8>>2]|0;
  10618. ;HEAP32[$$byval_copy5>>2]=HEAP32[$5>>2]|0;HEAP32[$$byval_copy5+4>>2]=HEAP32[$5+4>>2]|0;HEAP32[$$byval_copy5+8>>2]=HEAP32[$5+8>>2]|0;
  10619. _VectorCrossProduct($6,$$byval_copy4,$$byval_copy5);
  10620. _VectorNormalize($6);
  10621. $7 = +HEAPF32[$5>>2];
  10622. $8 = ((($5)) + 4|0);
  10623. $9 = +HEAPF32[$8>>2];
  10624. $10 = ((($5)) + 8|0);
  10625. $11 = +HEAPF32[$10>>2];
  10626. $12 = +HEAPF32[$1>>2];
  10627. $13 = $7 * $12;
  10628. $14 = ((($1)) + 4|0);
  10629. $15 = +HEAPF32[$14>>2];
  10630. $16 = $9 * $15;
  10631. $17 = $13 + $16;
  10632. $18 = ((($1)) + 8|0);
  10633. $19 = +HEAPF32[$18>>2];
  10634. $20 = $11 * $19;
  10635. $21 = $17 + $20;
  10636. $22 = -$21;
  10637. $23 = +HEAPF32[$6>>2];
  10638. $24 = ((($6)) + 4|0);
  10639. $25 = +HEAPF32[$24>>2];
  10640. $26 = ((($6)) + 8|0);
  10641. $27 = +HEAPF32[$26>>2];
  10642. $28 = $12 * $23;
  10643. $29 = $15 * $25;
  10644. $30 = $28 + $29;
  10645. $31 = $19 * $27;
  10646. $32 = $30 + $31;
  10647. $33 = -$32;
  10648. $34 = +HEAPF32[$4>>2];
  10649. $35 = ((($4)) + 4|0);
  10650. $36 = +HEAPF32[$35>>2];
  10651. $37 = ((($4)) + 8|0);
  10652. $38 = +HEAPF32[$37>>2];
  10653. $39 = $12 * $34;
  10654. $40 = $15 * $36;
  10655. $41 = $39 + $40;
  10656. $42 = $19 * $38;
  10657. $43 = $41 + $42;
  10658. $44 = -$43;
  10659. HEAPF32[$0>>2] = $7;
  10660. $$sroa$4$0$$sroa_idx2 = ((($0)) + 4|0);
  10661. HEAPF32[$$sroa$4$0$$sroa_idx2>>2] = $23;
  10662. $$sroa$5$0$$sroa_idx4 = ((($0)) + 8|0);
  10663. HEAPF32[$$sroa$5$0$$sroa_idx4>>2] = $34;
  10664. $$sroa$6$0$$sroa_idx6 = ((($0)) + 12|0);
  10665. HEAPF32[$$sroa$6$0$$sroa_idx6>>2] = 0.0;
  10666. $$sroa$7$0$$sroa_idx8 = ((($0)) + 16|0);
  10667. HEAPF32[$$sroa$7$0$$sroa_idx8>>2] = $9;
  10668. $$sroa$8$0$$sroa_idx10 = ((($0)) + 20|0);
  10669. HEAPF32[$$sroa$8$0$$sroa_idx10>>2] = $25;
  10670. $$sroa$9$0$$sroa_idx12 = ((($0)) + 24|0);
  10671. HEAPF32[$$sroa$9$0$$sroa_idx12>>2] = $36;
  10672. $$sroa$10$0$$sroa_idx14 = ((($0)) + 28|0);
  10673. HEAPF32[$$sroa$10$0$$sroa_idx14>>2] = 0.0;
  10674. $$sroa$11$0$$sroa_idx16 = ((($0)) + 32|0);
  10675. HEAPF32[$$sroa$11$0$$sroa_idx16>>2] = $11;
  10676. $$sroa$12$0$$sroa_idx18 = ((($0)) + 36|0);
  10677. HEAPF32[$$sroa$12$0$$sroa_idx18>>2] = $27;
  10678. $$sroa$13$0$$sroa_idx20 = ((($0)) + 40|0);
  10679. HEAPF32[$$sroa$13$0$$sroa_idx20>>2] = $38;
  10680. $$sroa$14$0$$sroa_idx22 = ((($0)) + 44|0);
  10681. HEAPF32[$$sroa$14$0$$sroa_idx22>>2] = 0.0;
  10682. $$sroa$15$0$$sroa_idx24 = ((($0)) + 48|0);
  10683. HEAPF32[$$sroa$15$0$$sroa_idx24>>2] = $22;
  10684. $$sroa$16$0$$sroa_idx26 = ((($0)) + 52|0);
  10685. HEAPF32[$$sroa$16$0$$sroa_idx26>>2] = $33;
  10686. $$sroa$17$0$$sroa_idx28 = ((($0)) + 56|0);
  10687. HEAPF32[$$sroa$17$0$$sroa_idx28>>2] = $44;
  10688. $$sroa$18$0$$sroa_idx30 = ((($0)) + 60|0);
  10689. HEAPF32[$$sroa$18$0$$sroa_idx30>>2] = 1.0;
  10690. STACKTOP = sp;return;
  10691. }
  10692. function _ProcessGestureEvent($0) {
  10693. $0 = $0|0;
  10694. var $$$sink = 0, $$sink = 0, $$sink10 = 0, $$sink11 = 0, $$sink16 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0.0, $111 = 0.0;
  10695. var $112 = 0.0, $113 = 0.0, $114 = 0.0, $115 = 0.0, $116 = 0.0, $117 = 0, $118 = 0, $119 = 0, $12 = 0.0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0;
  10696. var $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0;
  10697. var $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0.0, $16 = 0, $160 = 0.0, $161 = 0.0, $162 = 0.0, $163 = 0.0, $164 = 0.0, $165 = 0.0, $166 = 0;
  10698. var $167 = 0.0, $168 = 0, $169 = 0.0, $17 = 0, $170 = 0.0, $171 = 0.0, $172 = 0, $173 = 0.0, $174 = 0.0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0;
  10699. var $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0;
  10700. var $46 = 0, $47 = 0, $48 = 0.0, $49 = 0.0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0.0, $56 = 0.0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0;
  10701. var $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0.0, $81 = 0;
  10702. var $82 = 0.0, $83 = 0.0, $84 = 0.0, $85 = 0.0, $86 = 0.0, $87 = 0.0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $moveDownPosition$byval_copy11 = 0;
  10703. var $moveDownPosition2$byval_copy12 = 0, $or$cond = 0, $or$cond3 = 0, $or$cond5 = 0, $or$cond7 = 0, $or$cond9 = 0, label = 0, sp = 0;
  10704. sp = STACKTOP;
  10705. STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
  10706. $moveDownPosition2$byval_copy12 = sp + 8|0;
  10707. $moveDownPosition$byval_copy11 = sp;
  10708. $1 = ((($0)) + 4|0);
  10709. $2 = HEAP32[$1>>2]|0;
  10710. HEAP32[4625] = $2;
  10711. $3 = ($2|0)<(2);
  10712. $4 = HEAP32[$0>>2]|0;
  10713. $5 = ($4|0)==(1);
  10714. if (!($3)) {
  10715. if ($5) {
  10716. $88 = ((($0)) + 24|0);
  10717. $89 = $88;
  10718. $90 = $89;
  10719. $91 = HEAP32[$90>>2]|0;
  10720. $92 = (($89) + 4)|0;
  10721. $93 = $92;
  10722. $94 = HEAP32[$93>>2]|0;
  10723. $95 = 17928;
  10724. $96 = $95;
  10725. HEAP32[$96>>2] = $91;
  10726. $97 = (($95) + 4)|0;
  10727. $98 = $97;
  10728. HEAP32[$98>>2] = $94;
  10729. $99 = ((($0)) + 32|0);
  10730. $100 = $99;
  10731. $101 = $100;
  10732. $102 = HEAP32[$101>>2]|0;
  10733. $103 = (($100) + 4)|0;
  10734. $104 = $103;
  10735. $105 = HEAP32[$104>>2]|0;
  10736. $106 = 17968;
  10737. $107 = $106;
  10738. HEAP32[$107>>2] = $102;
  10739. $108 = (($106) + 4)|0;
  10740. $109 = $108;
  10741. HEAP32[$109>>2] = $105;
  10742. $110 = +HEAPF32[4492];
  10743. $111 = +HEAPF32[4482];
  10744. $112 = $110 - $111;
  10745. HEAPF32[4494] = $112;
  10746. $113 = +HEAPF32[(17972)>>2];
  10747. $114 = +HEAPF32[(17932)>>2];
  10748. $115 = $113 - $114;
  10749. HEAPF32[(17980)>>2] = $115;
  10750. HEAP32[4624] = 4;
  10751. STACKTOP = sp;return;
  10752. }
  10753. switch ($4|0) {
  10754. case 2: {
  10755. ;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[17960>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[17960+4>>2]|0;
  10756. ;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[17984>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[17984+4>>2]|0;
  10757. $116 = (+_Vector2Distance($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12));
  10758. HEAPF32[4630] = $116;
  10759. $117 = 17960;
  10760. $118 = $117;
  10761. $119 = HEAP32[$118>>2]|0;
  10762. $120 = (($117) + 4)|0;
  10763. $121 = $120;
  10764. $122 = HEAP32[$121>>2]|0;
  10765. $123 = 17928;
  10766. $124 = $123;
  10767. HEAP32[$124>>2] = $119;
  10768. $125 = (($123) + 4)|0;
  10769. $126 = $125;
  10770. HEAP32[$126>>2] = $122;
  10771. $127 = 17984;
  10772. $128 = $127;
  10773. $129 = HEAP32[$128>>2]|0;
  10774. $130 = (($127) + 4)|0;
  10775. $131 = $130;
  10776. $132 = HEAP32[$131>>2]|0;
  10777. $133 = 17968;
  10778. $134 = $133;
  10779. HEAP32[$134>>2] = $129;
  10780. $135 = (($133) + 4)|0;
  10781. $136 = $135;
  10782. HEAP32[$136>>2] = $132;
  10783. $137 = ((($0)) + 24|0);
  10784. $138 = $137;
  10785. $139 = $138;
  10786. $140 = HEAP32[$139>>2]|0;
  10787. $141 = (($138) + 4)|0;
  10788. $142 = $141;
  10789. $143 = HEAP32[$142>>2]|0;
  10790. $144 = 17960;
  10791. $145 = $144;
  10792. HEAP32[$145>>2] = $140;
  10793. $146 = (($144) + 4)|0;
  10794. $147 = $146;
  10795. HEAP32[$147>>2] = $143;
  10796. $148 = ((($0)) + 32|0);
  10797. $149 = $148;
  10798. $150 = $149;
  10799. $151 = HEAP32[$150>>2]|0;
  10800. $152 = (($149) + 4)|0;
  10801. $153 = $152;
  10802. $154 = HEAP32[$153>>2]|0;
  10803. $155 = 17984;
  10804. $156 = $155;
  10805. HEAP32[$156>>2] = $151;
  10806. $157 = (($155) + 4)|0;
  10807. $158 = $157;
  10808. HEAP32[$158>>2] = $154;
  10809. $159 = +HEAPF32[4496];
  10810. $160 = +HEAPF32[4490];
  10811. $161 = $159 - $160;
  10812. HEAPF32[4494] = $161;
  10813. $162 = +HEAPF32[(17988)>>2];
  10814. $163 = +HEAPF32[(17964)>>2];
  10815. $164 = $162 - $163;
  10816. HEAPF32[(17980)>>2] = $164;
  10817. ;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[17928>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[17928+4>>2]|0;
  10818. ;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[17960>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[17960+4>>2]|0;
  10819. $165 = (+_Vector2Distance($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12));
  10820. $166 = !($165 >= 0.004999999888241291);
  10821. if ($166) {
  10822. ;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[17968>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[17968+4>>2]|0;
  10823. ;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[17984>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[17984+4>>2]|0;
  10824. $167 = (+_Vector2Distance($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12));
  10825. $168 = !($167 >= 0.004999999888241291);
  10826. if ($168) {
  10827. $$sink16 = 4;
  10828. } else {
  10829. label = 29;
  10830. }
  10831. } else {
  10832. label = 29;
  10833. }
  10834. if ((label|0) == 29) {
  10835. ;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[17960>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[17960+4>>2]|0;
  10836. ;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[17984>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[17984+4>>2]|0;
  10837. $169 = (+_Vector2Distance($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12));
  10838. $170 = +HEAPF32[4630];
  10839. $171 = $169 - $170;
  10840. $172 = $171 < 0.0;
  10841. $$sink11 = $172 ? 256 : 512;
  10842. $$sink16 = $$sink11;
  10843. }
  10844. HEAP32[4624] = $$sink16;
  10845. ;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[17960>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[17960+4>>2]|0;
  10846. ;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[17984>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[17984+4>>2]|0;
  10847. $173 = (+_Vector2Angle($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12));
  10848. $174 = 360.0 - $173;
  10849. HEAPF32[4631] = $174;
  10850. STACKTOP = sp;return;
  10851. break;
  10852. }
  10853. case 0: {
  10854. HEAPF32[4630] = 0.0;
  10855. HEAPF32[4631] = 0.0;
  10856. HEAPF32[4494] = 0.0;
  10857. HEAPF32[(17980)>>2] = 0.0;
  10858. HEAP32[4625] = 0;
  10859. HEAP32[4624] = 0;
  10860. STACKTOP = sp;return;
  10861. break;
  10862. }
  10863. default: {
  10864. STACKTOP = sp;return;
  10865. }
  10866. }
  10867. }
  10868. if ($5) {
  10869. $6 = HEAP32[4626]|0;
  10870. $7 = (($6) + 1)|0;
  10871. HEAP32[4626] = $7;
  10872. $8 = HEAP32[4624]|0;
  10873. $9 = ($8|0)==(0);
  10874. $10 = ($6|0)>(0);
  10875. $or$cond = $10 & $9;
  10876. if ($or$cond) {
  10877. $11 = ((($0)) + 24|0);
  10878. ;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[17928>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[17928+4>>2]|0;
  10879. ;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[$11>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[$11+4>>2]|0;
  10880. $12 = (+_Vector2Distance($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12));
  10881. $13 = $12 < 0.029999999329447746;
  10882. if ($13) {
  10883. HEAP32[4624] = 2;
  10884. HEAP32[4626] = 0;
  10885. } else {
  10886. label = 6;
  10887. }
  10888. } else {
  10889. label = 6;
  10890. }
  10891. if ((label|0) == 6) {
  10892. HEAP32[4626] = 1;
  10893. HEAP32[4624] = 1;
  10894. }
  10895. $14 = ((($0)) + 24|0);
  10896. $15 = $14;
  10897. $16 = $15;
  10898. $17 = HEAP32[$16>>2]|0;
  10899. $18 = (($15) + 4)|0;
  10900. $19 = $18;
  10901. $20 = HEAP32[$19>>2]|0;
  10902. $21 = 17928;
  10903. $22 = $21;
  10904. HEAP32[$22>>2] = $17;
  10905. $23 = (($21) + 4)|0;
  10906. $24 = $23;
  10907. HEAP32[$24>>2] = $20;
  10908. $25 = 17936;
  10909. $26 = $25;
  10910. HEAP32[$26>>2] = $17;
  10911. $27 = (($25) + 4)|0;
  10912. $28 = $27;
  10913. HEAP32[$28>>2] = $20;
  10914. $29 = 17944;
  10915. $30 = $29;
  10916. HEAP32[$30>>2] = $17;
  10917. $31 = (($29) + 4)|0;
  10918. $32 = $31;
  10919. HEAP32[$32>>2] = $20;
  10920. $33 = ((($0)) + 8|0);
  10921. $34 = HEAP32[$33>>2]|0;
  10922. HEAP32[14] = $34;
  10923. HEAPF32[4488] = 0.0;
  10924. HEAPF32[(17956)>>2] = 0.0;
  10925. STACKTOP = sp;return;
  10926. }
  10927. switch ($4|0) {
  10928. case 0: {
  10929. $35 = HEAP32[4624]|0;
  10930. $36 = ($35|0)==(8);
  10931. if ($36) {
  10932. $37 = ((($0)) + 24|0);
  10933. $38 = $37;
  10934. $39 = $38;
  10935. $40 = HEAP32[$39>>2]|0;
  10936. $41 = (($38) + 4)|0;
  10937. $42 = $41;
  10938. $43 = HEAP32[$42>>2]|0;
  10939. $44 = 17944;
  10940. $45 = $44;
  10941. HEAP32[$45>>2] = $40;
  10942. $46 = (($44) + 4)|0;
  10943. $47 = $46;
  10944. HEAP32[$47>>2] = $43;
  10945. }
  10946. ;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[17928>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[17928+4>>2]|0;
  10947. ;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[17944>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[17944+4>>2]|0;
  10948. $48 = (+_Vector2Distance($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12));
  10949. $49 = $48 / 0.0;
  10950. HEAPF32[4627] = $49;
  10951. HEAP32[4628] = 0;
  10952. $50 = $49 > 5.0000002374872565E-4;
  10953. if ($50) {
  10954. $51 = HEAP32[14]|0;
  10955. $52 = ((($0)) + 8|0);
  10956. $53 = HEAP32[$52>>2]|0;
  10957. $54 = ($51|0)==($53|0);
  10958. if ($54) {
  10959. ;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[17928>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[17928+4>>2]|0;
  10960. ;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[17944>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[17944+4>>2]|0;
  10961. $55 = (+_Vector2Angle($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12));
  10962. $56 = 360.0 - $55;
  10963. HEAPF32[4629] = $56;
  10964. $57 = $56 < 30.0;
  10965. $58 = $56 > 330.0;
  10966. $or$cond3 = $57 | $58;
  10967. if ($or$cond3) {
  10968. $$sink10 = 16;
  10969. } else {
  10970. $59 = $56 > 30.0;
  10971. $60 = $56 < 120.0;
  10972. $or$cond5 = $59 & $60;
  10973. if ($or$cond5) {
  10974. $$sink10 = 64;
  10975. } else {
  10976. $61 = $56 > 120.0;
  10977. $62 = $56 < 210.0;
  10978. $or$cond7 = $61 & $62;
  10979. $63 = $56 > 210.0;
  10980. $64 = $56 < 300.0;
  10981. $or$cond9 = $63 & $64;
  10982. $$sink = $or$cond9 ? 128 : 0;
  10983. $$$sink = $or$cond7 ? 32 : $$sink;
  10984. $$sink10 = $$$sink;
  10985. }
  10986. }
  10987. } else {
  10988. label = 16;
  10989. }
  10990. } else {
  10991. label = 16;
  10992. }
  10993. if ((label|0) == 16) {
  10994. HEAPF32[4627] = 0.0;
  10995. HEAPF32[4629] = 0.0;
  10996. $$sink10 = 0;
  10997. }
  10998. HEAP32[4624] = $$sink10;
  10999. HEAPF32[4484] = 0.0;
  11000. HEAPF32[(17940)>>2] = 0.0;
  11001. HEAP32[4625] = 0;
  11002. STACKTOP = sp;return;
  11003. break;
  11004. }
  11005. case 2: {
  11006. $65 = HEAP32[4628]|0;
  11007. $66 = ($65|0)==(0);
  11008. if ($66) {
  11009. HEAP32[4628] = 1;
  11010. }
  11011. $67 = ((($0)) + 24|0);
  11012. $68 = $67;
  11013. $69 = $68;
  11014. $70 = HEAP32[$69>>2]|0;
  11015. $71 = (($68) + 4)|0;
  11016. $72 = $71;
  11017. $73 = HEAP32[$72>>2]|0;
  11018. $74 = 17960;
  11019. $75 = $74;
  11020. HEAP32[$75>>2] = $70;
  11021. $76 = (($74) + 4)|0;
  11022. $77 = $76;
  11023. HEAP32[$77>>2] = $73;
  11024. $78 = HEAP32[4624]|0;
  11025. $79 = ($78|0)==(4);
  11026. if ($79) {
  11027. ;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[17928>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[17928+4>>2]|0;
  11028. ;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[17960>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[17960+4>>2]|0;
  11029. $80 = (+_Vector2Distance($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12));
  11030. $81 = !($80 >= 0.014999999664723873);
  11031. if (!($81)) {
  11032. HEAP32[4624] = 8;
  11033. }
  11034. }
  11035. $82 = +HEAPF32[4490];
  11036. $83 = +HEAPF32[4484];
  11037. $84 = $82 - $83;
  11038. HEAPF32[4488] = $84;
  11039. $85 = +HEAPF32[(17964)>>2];
  11040. $86 = +HEAPF32[(17940)>>2];
  11041. $87 = $85 - $86;
  11042. HEAPF32[(17956)>>2] = $87;
  11043. STACKTOP = sp;return;
  11044. break;
  11045. }
  11046. default: {
  11047. STACKTOP = sp;return;
  11048. }
  11049. }
  11050. }
  11051. function _UpdateGestures() {
  11052. var $$off = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $or$cond3 = 0, label = 0, sp = 0;
  11053. sp = STACKTOP;
  11054. $0 = HEAP32[4624]|0;
  11055. $$off = (($0) + -1)|0;
  11056. $1 = ($$off>>>0)<(2);
  11057. $2 = HEAP32[4625]|0;
  11058. $3 = ($2|0)<(2);
  11059. $or$cond3 = $1 & $3;
  11060. if ($or$cond3) {
  11061. HEAP32[4624] = 4;
  11062. }
  11063. $4 = HEAP32[4624]|0;
  11064. $5 = (($4) + -16)|0;
  11065. $6 = $5 >>> 4;
  11066. $7 = $5 << 28;
  11067. $8 = $6 | $7;
  11068. switch ($8|0) {
  11069. case 0: case 1: case 3: case 7: {
  11070. break;
  11071. }
  11072. default: {
  11073. return;
  11074. }
  11075. }
  11076. HEAP32[4624] = 0;
  11077. return;
  11078. }
  11079. function _GetMousePosition($0) {
  11080. $0 = $0|0;
  11081. var $1 = 0, $10 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
  11082. sp = STACKTOP;
  11083. $1 = 17992;
  11084. $2 = $1;
  11085. $3 = HEAP32[$2>>2]|0;
  11086. $4 = (($1) + 4)|0;
  11087. $5 = $4;
  11088. $6 = HEAP32[$5>>2]|0;
  11089. $7 = $0;
  11090. $8 = $7;
  11091. HEAP32[$8>>2] = $3;
  11092. $9 = (($7) + 4)|0;
  11093. $10 = $9;
  11094. HEAP32[$10>>2] = $6;
  11095. return;
  11096. }
  11097. function _GetScreenWidth() {
  11098. var $0 = 0, label = 0, sp = 0;
  11099. sp = STACKTOP;
  11100. $0 = HEAP32[4634]|0;
  11101. return ($0|0);
  11102. }
  11103. function _GetScreenHeight() {
  11104. var $0 = 0, label = 0, sp = 0;
  11105. sp = STACKTOP;
  11106. $0 = HEAP32[4633]|0;
  11107. return ($0|0);
  11108. }
  11109. function _InitWindow($0,$1,$2) {
  11110. $0 = $0|0;
  11111. $1 = $1|0;
  11112. $2 = $2|0;
  11113. var $10 = 0, $3 = 0, $4 = 0.0, $5 = 0.0, $6 = 0, $7 = 0.0, $8 = 0.0, $9 = 0, $vararg_buffer = 0, label = 0, sp = 0;
  11114. sp = STACKTOP;
  11115. STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
  11116. $vararg_buffer = sp;
  11117. _TraceLog(0,4547,$vararg_buffer);
  11118. HEAP32[4636] = $2;
  11119. _InitGraphicsDevice($0,$1);
  11120. _LoadDefaultFont();
  11121. _InitTimer();
  11122. (_emscripten_set_fullscreenchange_callback((0|0),(0|0),1,(5|0))|0);
  11123. (_emscripten_set_keypress_callback((4576|0),(0|0),1,(6|0))|0);
  11124. (_emscripten_set_click_callback((4576|0),(0|0),1,(7|0))|0);
  11125. (_emscripten_set_touchstart_callback((4576|0),(0|0),1,(8|0))|0);
  11126. (_emscripten_set_touchend_callback((4576|0),(0|0),1,(8|0))|0);
  11127. (_emscripten_set_touchmove_callback((4576|0),(0|0),1,(8|0))|0);
  11128. (_emscripten_set_touchcancel_callback((4576|0),(0|0),1,(8|0))|0);
  11129. (_emscripten_set_gamepadconnected_callback((0|0),1,(9|0))|0);
  11130. (_emscripten_set_gamepaddisconnected_callback((0|0),1,(9|0))|0);
  11131. $3 = HEAP32[4634]|0;
  11132. $4 = (+($3|0));
  11133. $5 = $4 * 0.5;
  11134. HEAPF32[4498] = $5;
  11135. $6 = HEAP32[4633]|0;
  11136. $7 = (+($6|0));
  11137. $8 = $7 * 0.5;
  11138. HEAPF32[(17996)>>2] = $8;
  11139. $9 = HEAP32[4637]|0;
  11140. $10 = ($9|0)==(0);
  11141. if ($10) {
  11142. STACKTOP = sp;return;
  11143. }
  11144. _SetTargetFPS(60);
  11145. _LogoAnimation();
  11146. STACKTOP = sp;return;
  11147. }
  11148. function _TraceLog($0,$1,$varargs) {
  11149. $0 = $0|0;
  11150. $1 = $1|0;
  11151. $varargs = $varargs|0;
  11152. var $10 = 0, $11 = 0, $12 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $endptr = 0, $strlen = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
  11153. sp = STACKTOP;
  11154. STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
  11155. $2 = sp;
  11156. switch ($0|0) {
  11157. case 0: {
  11158. ;HEAP8[18032>>0]=HEAP8[9076>>0]|0;HEAP8[18032+1>>0]=HEAP8[9076+1>>0]|0;HEAP8[18032+2>>0]=HEAP8[9076+2>>0]|0;HEAP8[18032+3>>0]=HEAP8[9076+3>>0]|0;HEAP8[18032+4>>0]=HEAP8[9076+4>>0]|0;HEAP8[18032+5>>0]=HEAP8[9076+5>>0]|0;HEAP8[18032+6>>0]=HEAP8[9076+6>>0]|0;
  11159. break;
  11160. }
  11161. case 1: {
  11162. $3 = 18032;
  11163. $4 = $3;
  11164. HEAP32[$4>>2] = 1330795077;
  11165. $5 = (($3) + 4)|0;
  11166. $6 = $5;
  11167. HEAP32[$6>>2] = 2112082;
  11168. break;
  11169. }
  11170. case 2: {
  11171. dest=18032; src=9083; stop=dest+10|0; do { HEAP8[dest>>0]=HEAP8[src>>0]|0; dest=dest+1|0; src=src+1|0; } while ((dest|0) < (stop|0));
  11172. break;
  11173. }
  11174. case 3: {
  11175. $7 = 18032;
  11176. $8 = $7;
  11177. HEAP32[$8>>2] = 1430406468;
  11178. $9 = (($7) + 4)|0;
  11179. $10 = $9;
  11180. HEAP32[$10>>2] = 2112071;
  11181. break;
  11182. }
  11183. default: {
  11184. }
  11185. }
  11186. (_strcat(18032,$1)|0);
  11187. $strlen = (_strlen(18032)|0);
  11188. $endptr = (18032 + ($strlen)|0);
  11189. HEAP8[$endptr>>0]=10&255;HEAP8[$endptr+1>>0]=10>>8;
  11190. HEAP32[$2>>2] = $varargs;
  11191. $11 = ($0|0)==(3);
  11192. if ($11) {
  11193. STACKTOP = sp;return;
  11194. }
  11195. (_vprintf(18032,$2)|0);
  11196. $12 = ($0|0)==(1);
  11197. if ($12) {
  11198. _exit(1);
  11199. // unreachable;
  11200. } else {
  11201. STACKTOP = sp;return;
  11202. }
  11203. }
  11204. function _InitGraphicsDevice($0,$1) {
  11205. $0 = $0|0;
  11206. $1 = $1|0;
  11207. var $$015 = 0, $$byval_copy = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
  11208. var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
  11209. var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0;
  11210. var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0.0, $79 = 0, $8 = 0, $80 = 0;
  11211. var $81 = 0, $82 = 0.0, $83 = 0, $84 = 0, $85 = 0, $9 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer10 = 0, $vararg_buffer14 = 0, $vararg_buffer18 = 0, $vararg_buffer22 = 0, $vararg_buffer3 = 0, $vararg_buffer6 = 0, $vararg_buffer8 = 0, $vararg_ptr13 = 0, $vararg_ptr17 = 0, $vararg_ptr21 = 0, $vararg_ptr5 = 0, dest = 0;
  11212. var label = 0, sp = 0, src = 0, stop = 0;
  11213. sp = STACKTOP;
  11214. STACKTOP = STACKTOP + 144|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(144|0);
  11215. $$byval_copy = sp + 136|0;
  11216. $vararg_buffer22 = sp + 64|0;
  11217. $vararg_buffer18 = sp + 56|0;
  11218. $vararg_buffer14 = sp + 48|0;
  11219. $vararg_buffer10 = sp + 40|0;
  11220. $vararg_buffer8 = sp + 32|0;
  11221. $vararg_buffer6 = sp + 24|0;
  11222. $vararg_buffer3 = sp + 16|0;
  11223. $vararg_buffer1 = sp + 8|0;
  11224. $vararg_buffer = sp;
  11225. $2 = sp + 72|0;
  11226. $3 = sp + 140|0;
  11227. HEAP32[4634] = $0;
  11228. HEAP32[4633] = $1;
  11229. _MatrixIdentity($2);
  11230. dest=18624; src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  11231. (_glfwSetErrorCallback((2|0))|0);
  11232. $4 = (_glfwInit()|0);
  11233. $5 = ($4|0)==(0);
  11234. if ($5) {
  11235. _TraceLog(1,5218,$vararg_buffer);
  11236. }
  11237. $6 = HEAP32[4634]|0;
  11238. HEAP32[4672] = $6;
  11239. $7 = HEAP32[4633]|0;
  11240. HEAP32[4673] = $7;
  11241. _glfwDefaultWindowHints();
  11242. $8 = HEAP8[21368]|0;
  11243. $9 = $8 & 4;
  11244. $10 = ($9<<24>>24)==(0);
  11245. if ($10) {
  11246. _glfwWindowHint(131075,0);
  11247. } else {
  11248. _glfwWindowHint(131075,1);
  11249. }
  11250. $11 = HEAP8[21368]|0;
  11251. $12 = $11 & 8;
  11252. $13 = ($12<<24>>24)==(0);
  11253. if (!($13)) {
  11254. _glfwWindowHint(131077,1);
  11255. }
  11256. $14 = HEAP8[21368]|0;
  11257. $15 = $14 & 32;
  11258. $16 = ($15<<24>>24)==(0);
  11259. if (!($16)) {
  11260. _glfwWindowHint(135181,4);
  11261. _TraceLog(0,5244,$vararg_buffer1);
  11262. }
  11263. $17 = (_rlGetVersion()|0);
  11264. $18 = ($17|0)==(2);
  11265. if ($18) {
  11266. _glfwWindowHint(139266,2);
  11267. _glfwWindowHint(139267,1);
  11268. } else {
  11269. $19 = (_rlGetVersion()|0);
  11270. $20 = ($19|0)==(3);
  11271. if ($20) {
  11272. _glfwWindowHint(139266,3);
  11273. _glfwWindowHint(139267,3);
  11274. _glfwWindowHint(139272,204801);
  11275. _glfwWindowHint(139270,0);
  11276. }
  11277. }
  11278. $21 = HEAP32[4674]|0;
  11279. $22 = ($21|0)==(0);
  11280. if ($22) {
  11281. $47 = HEAP32[4634]|0;
  11282. $48 = HEAP32[4633]|0;
  11283. $49 = HEAP32[4636]|0;
  11284. $50 = (_glfwCreateWindow(($47|0),($48|0),($49|0),(0|0),(0|0))|0);
  11285. HEAP32[4632] = $50;
  11286. $51 = HEAP32[4634]|0;
  11287. HEAP32[4675] = $51;
  11288. $52 = HEAP32[4633]|0;
  11289. HEAP32[4676] = $52;
  11290. $54 = $50;
  11291. } else {
  11292. $23 = (_glfwGetPrimaryMonitor()|0);
  11293. $24 = (_glfwGetVideoModes(($23|0),($$byval_copy|0))|0);
  11294. $25 = HEAP32[$$byval_copy>>2]|0;
  11295. $26 = ($25|0)>(0);
  11296. L22: do {
  11297. if ($26) {
  11298. $27 = HEAP32[4634]|0;
  11299. $28 = HEAP32[$$byval_copy>>2]|0;
  11300. $29 = HEAP32[4633]|0;
  11301. $$015 = 0;
  11302. while(1) {
  11303. $30 = (($24) + (($$015*24)|0)|0);
  11304. $31 = HEAP32[$30>>2]|0;
  11305. $32 = ($31|0)<($27|0);
  11306. if (!($32)) {
  11307. $33 = (((($24) + (($$015*24)|0)|0)) + 4|0);
  11308. $34 = HEAP32[$33>>2]|0;
  11309. $35 = ($34|0)<($29|0);
  11310. if (!($35)) {
  11311. break;
  11312. }
  11313. }
  11314. $36 = (($$015) + 1)|0;
  11315. $37 = ($36|0)<($28|0);
  11316. if ($37) {
  11317. $$015 = $36;
  11318. } else {
  11319. break L22;
  11320. }
  11321. }
  11322. HEAP32[4672] = $31;
  11323. HEAP32[4673] = $34;
  11324. }
  11325. } while(0);
  11326. $38 = HEAP32[4672]|0;
  11327. $39 = HEAP32[4673]|0;
  11328. HEAP32[$vararg_buffer3>>2] = $38;
  11329. $vararg_ptr5 = ((($vararg_buffer3)) + 4|0);
  11330. HEAP32[$vararg_ptr5>>2] = $39;
  11331. _TraceLog(2,5269,$vararg_buffer3);
  11332. $40 = HEAP32[4672]|0;
  11333. $41 = HEAP32[4673]|0;
  11334. _SetupFramebufferSize($40,$41);
  11335. $42 = HEAP32[4672]|0;
  11336. $43 = HEAP32[4673]|0;
  11337. $44 = HEAP32[4636]|0;
  11338. $45 = (_glfwGetPrimaryMonitor()|0);
  11339. $46 = (_glfwCreateWindow(($42|0),($43|0),($44|0),($45|0),(0|0))|0);
  11340. HEAP32[4632] = $46;
  11341. $54 = $46;
  11342. }
  11343. $53 = ($54|0)==(0|0);
  11344. if ($53) {
  11345. _glfwTerminate();
  11346. _TraceLog(1,5307,$vararg_buffer6);
  11347. } else {
  11348. _TraceLog(0,5340,$vararg_buffer8);
  11349. $55 = HEAP32[4675]|0;
  11350. $56 = HEAP32[4676]|0;
  11351. HEAP32[$vararg_buffer10>>2] = $55;
  11352. $vararg_ptr13 = ((($vararg_buffer10)) + 4|0);
  11353. HEAP32[$vararg_ptr13>>2] = $56;
  11354. _TraceLog(0,5380,$vararg_buffer10);
  11355. $57 = HEAP32[4634]|0;
  11356. $58 = HEAP32[4633]|0;
  11357. HEAP32[$vararg_buffer14>>2] = $57;
  11358. $vararg_ptr17 = ((($vararg_buffer14)) + 4|0);
  11359. HEAP32[$vararg_ptr17>>2] = $58;
  11360. _TraceLog(0,5401,$vararg_buffer14);
  11361. $59 = HEAP32[4677]|0;
  11362. $60 = HEAP32[4678]|0;
  11363. HEAP32[$vararg_buffer18>>2] = $59;
  11364. $vararg_ptr21 = ((($vararg_buffer18)) + 4|0);
  11365. HEAP32[$vararg_ptr21>>2] = $60;
  11366. _TraceLog(0,5422,$vararg_buffer18);
  11367. }
  11368. $61 = HEAP32[4632]|0;
  11369. (_glfwSetWindowSizeCallback(($61|0),(1|0))|0);
  11370. $62 = HEAP32[4632]|0;
  11371. (_glfwSetCursorEnterCallback(($62|0),(3|0))|0);
  11372. $63 = HEAP32[4632]|0;
  11373. (_glfwSetKeyCallback(($63|0),(1|0))|0);
  11374. $64 = HEAP32[4632]|0;
  11375. (_glfwSetMouseButtonCallback(($64|0),(1|0))|0);
  11376. $65 = HEAP32[4632]|0;
  11377. (_glfwSetCursorPosCallback(($65|0),(1|0))|0);
  11378. $66 = HEAP32[4632]|0;
  11379. (_glfwSetCharCallback(($66|0),(4|0))|0);
  11380. $67 = HEAP32[4632]|0;
  11381. (_glfwSetScrollCallback(($67|0),(2|0))|0);
  11382. $68 = HEAP32[4632]|0;
  11383. (_glfwSetWindowIconifyCallback(($68|0),(5|0))|0);
  11384. $69 = HEAP32[4632]|0;
  11385. _glfwMakeContextCurrent(($69|0));
  11386. _glfwSwapInterval(0);
  11387. $70 = HEAP8[21368]|0;
  11388. $71 = $70 & 64;
  11389. $72 = ($71<<24>>24)==(0);
  11390. if ($72) {
  11391. $73 = HEAP32[4634]|0;
  11392. $74 = HEAP32[4633]|0;
  11393. _rlglInit($73,$74);
  11394. _SetupViewport();
  11395. _rlMatrixMode(5889);
  11396. _rlLoadIdentity();
  11397. $75 = HEAP32[4675]|0;
  11398. $76 = HEAP32[4677]|0;
  11399. $77 = (($75) - ($76))|0;
  11400. $78 = (+($77|0));
  11401. $79 = HEAP32[4676]|0;
  11402. $80 = HEAP32[4678]|0;
  11403. $81 = (($79) - ($80))|0;
  11404. $82 = (+($81|0));
  11405. _rlOrtho(0.0,$78,$82,0.0,0.0,1.0);
  11406. _rlMatrixMode(5888);
  11407. _rlLoadIdentity();
  11408. HEAP8[$3>>0] = -11;
  11409. $83 = ((($3)) + 1|0);
  11410. HEAP8[$83>>0] = -11;
  11411. $84 = ((($3)) + 2|0);
  11412. HEAP8[$84>>0] = -11;
  11413. $85 = ((($3)) + 3|0);
  11414. HEAP8[$85>>0] = -1;
  11415. ;HEAP8[$$byval_copy>>0]=HEAP8[$3>>0]|0;HEAP8[$$byval_copy+1>>0]=HEAP8[$3+1>>0]|0;HEAP8[$$byval_copy+2>>0]=HEAP8[$3+2>>0]|0;HEAP8[$$byval_copy+3>>0]=HEAP8[$3+3>>0]|0;
  11416. _ClearBackground($$byval_copy);
  11417. STACKTOP = sp;return;
  11418. }
  11419. _glfwSwapInterval(1);
  11420. _TraceLog(0,5447,$vararg_buffer22);
  11421. $73 = HEAP32[4634]|0;
  11422. $74 = HEAP32[4633]|0;
  11423. _rlglInit($73,$74);
  11424. _SetupViewport();
  11425. _rlMatrixMode(5889);
  11426. _rlLoadIdentity();
  11427. $75 = HEAP32[4675]|0;
  11428. $76 = HEAP32[4677]|0;
  11429. $77 = (($75) - ($76))|0;
  11430. $78 = (+($77|0));
  11431. $79 = HEAP32[4676]|0;
  11432. $80 = HEAP32[4678]|0;
  11433. $81 = (($79) - ($80))|0;
  11434. $82 = (+($81|0));
  11435. _rlOrtho(0.0,$78,$82,0.0,0.0,1.0);
  11436. _rlMatrixMode(5888);
  11437. _rlLoadIdentity();
  11438. HEAP8[$3>>0] = -11;
  11439. $83 = ((($3)) + 1|0);
  11440. HEAP8[$83>>0] = -11;
  11441. $84 = ((($3)) + 2|0);
  11442. HEAP8[$84>>0] = -11;
  11443. $85 = ((($3)) + 3|0);
  11444. HEAP8[$85>>0] = -1;
  11445. ;HEAP8[$$byval_copy>>0]=HEAP8[$3>>0]|0;HEAP8[$$byval_copy+1>>0]=HEAP8[$3+1>>0]|0;HEAP8[$$byval_copy+2>>0]=HEAP8[$3+2>>0]|0;HEAP8[$$byval_copy+3>>0]=HEAP8[$3+3>>0]|0;
  11446. _ClearBackground($$byval_copy);
  11447. STACKTOP = sp;return;
  11448. }
  11449. function _LoadDefaultFont() {
  11450. var $$ = 0, $$0101 = 0, $$090100 = 0, $$09299 = 0, $$095104 = 0, $$096103 = 0, $$097102 = 0, $$191 = 0, $$193 = 0, $$byval_copy1 = 0, $$lcssa = 0, $$sroa$0$0$$sroa_idx = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0;
  11451. var $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0;
  11452. var $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0;
  11453. var $vararg_buffer = 0, label = 0, sp = 0;
  11454. sp = STACKTOP;
  11455. STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(64|0);
  11456. $$byval_copy1 = sp + 44|0;
  11457. $vararg_buffer = sp;
  11458. $0 = sp + 4|0;
  11459. $1 = sp + 24|0;
  11460. HEAP32[(18592)>>2] = 224;
  11461. $2 = (_malloc(65536)|0);
  11462. _memset(($2|0),0,65536)|0;
  11463. $$095104 = 0;$$096103 = 0;
  11464. while(1) {
  11465. $3 = (60 + ($$095104<<2)|0);
  11466. $4 = HEAP32[$3>>2]|0;
  11467. $$097102 = 31;
  11468. while(1) {
  11469. $16 = 1 << $$097102;
  11470. $17 = $4 & $16;
  11471. $18 = ($17|0)==(0);
  11472. if (!($18)) {
  11473. $19 = (($$097102) + ($$096103))|0;
  11474. $$sroa$0$0$$sroa_idx = (($2) + ($19<<2)|0);
  11475. HEAP8[$$sroa$0$0$$sroa_idx>>0]=-1&255;HEAP8[$$sroa$0$0$$sroa_idx+1>>0]=(-1>>8)&255;HEAP8[$$sroa$0$0$$sroa_idx+2>>0]=(-1>>16)&255;HEAP8[$$sroa$0$0$$sroa_idx+3>>0]=-1>>24;
  11476. }
  11477. $20 = (($$097102) + -1)|0;
  11478. $21 = ($$097102|0)>(0);
  11479. if ($21) {
  11480. $$097102 = $20;
  11481. } else {
  11482. break;
  11483. }
  11484. }
  11485. $12 = (($$095104) + 1)|0;
  11486. $13 = ($$095104|0)>(511);
  11487. $$ = $13 ? 0 : $12;
  11488. $14 = (($$096103) + 32)|0;
  11489. $15 = ($14|0)<(16384);
  11490. if ($15) {
  11491. $$095104 = $$;$$096103 = $14;
  11492. } else {
  11493. break;
  11494. }
  11495. }
  11496. _LoadImageEx($0,$2,128,128);
  11497. _ImageFormat($0,2);
  11498. _free($2);
  11499. ;HEAP32[$$byval_copy1>>2]=HEAP32[$0>>2]|0;HEAP32[$$byval_copy1+4>>2]=HEAP32[$0+4>>2]|0;HEAP32[$$byval_copy1+8>>2]=HEAP32[$0+8>>2]|0;HEAP32[$$byval_copy1+12>>2]=HEAP32[$0+12>>2]|0;HEAP32[$$byval_copy1+16>>2]=HEAP32[$0+16>>2]|0;
  11500. _LoadTextureFromImage($1,$$byval_copy1);
  11501. ;HEAP32[18568>>2]=HEAP32[$1>>2]|0;HEAP32[18568+4>>2]=HEAP32[$1+4>>2]|0;HEAP32[18568+8>>2]=HEAP32[$1+8>>2]|0;HEAP32[18568+12>>2]=HEAP32[$1+12>>2]|0;HEAP32[18568+16>>2]=HEAP32[$1+16>>2]|0;
  11502. ;HEAP32[$$byval_copy1>>2]=HEAP32[$0>>2]|0;HEAP32[$$byval_copy1+4>>2]=HEAP32[$0+4>>2]|0;HEAP32[$$byval_copy1+8>>2]=HEAP32[$0+8>>2]|0;HEAP32[$$byval_copy1+12>>2]=HEAP32[$0+12>>2]|0;HEAP32[$$byval_copy1+16>>2]=HEAP32[$0+16>>2]|0;
  11503. _UnloadImage($$byval_copy1);
  11504. $5 = HEAP32[(18592)>>2]|0;
  11505. $6 = $5 << 5;
  11506. $7 = (_malloc($6)|0);
  11507. HEAP32[(18596)>>2] = $7;
  11508. $8 = ($5|0)>(0);
  11509. if (!($8)) {
  11510. $$lcssa = $7;
  11511. $22 = ((($$lcssa)) + 16|0);
  11512. $23 = HEAP32[$22>>2]|0;
  11513. HEAP32[(18588)>>2] = $23;
  11514. $24 = HEAP32[4642]|0;
  11515. HEAP32[$vararg_buffer>>2] = $24;
  11516. _TraceLog(0,4771,$vararg_buffer);
  11517. STACKTOP = sp;return;
  11518. }
  11519. $9 = HEAP32[(18572)>>2]|0;
  11520. $10 = HEAP32[(18592)>>2]|0;
  11521. $11 = HEAP32[(18596)>>2]|0;
  11522. $$0101 = 0;$$090100 = 1;$$09299 = 0;$27 = $7;
  11523. while(1) {
  11524. $25 = (($$0101) + 32)|0;
  11525. $26 = (($27) + ($$0101<<5)|0);
  11526. HEAP32[$26>>2] = $25;
  11527. $28 = (((($27) + ($$0101<<5)|0)) + 4|0);
  11528. HEAP32[$28>>2] = $$090100;
  11529. $29 = ($$09299*11)|0;
  11530. $30 = (($29) + 1)|0;
  11531. $31 = (((($27) + ($$0101<<5)|0)) + 8|0);
  11532. HEAP32[$31>>2] = $30;
  11533. $32 = (2108 + ($$0101<<2)|0);
  11534. $33 = HEAP32[$32>>2]|0;
  11535. $34 = (((($27) + ($$0101<<5)|0)) + 12|0);
  11536. HEAP32[$34>>2] = $33;
  11537. $35 = (((($27) + ($$0101<<5)|0)) + 16|0);
  11538. HEAP32[$35>>2] = 10;
  11539. $36 = (($$090100) + 1)|0;
  11540. $37 = (($36) + ($33))|0;
  11541. $38 = ($37|0)<($9|0);
  11542. $39 = (($$09299) + 1)|0;
  11543. if ($38) {
  11544. $$191 = $37;$$193 = $$09299;
  11545. } else {
  11546. $40 = ($39*11)|0;
  11547. $41 = (($40) + 1)|0;
  11548. $42 = (($33) + 2)|0;
  11549. HEAP32[$28>>2] = 1;
  11550. HEAP32[$31>>2] = $41;
  11551. $$191 = $42;$$193 = $39;
  11552. }
  11553. $43 = (((($27) + ($$0101<<5)|0)) + 20|0);
  11554. HEAP32[$43>>2] = 0;
  11555. $44 = (((($27) + ($$0101<<5)|0)) + 24|0);
  11556. HEAP32[$44>>2] = 0;
  11557. $45 = (((($27) + ($$0101<<5)|0)) + 28|0);
  11558. HEAP32[$45>>2] = 0;
  11559. $46 = (($$0101) + 1)|0;
  11560. $47 = ($46|0)<($10|0);
  11561. if ($47) {
  11562. $$0101 = $46;$$090100 = $$191;$$09299 = $$193;$27 = $11;
  11563. } else {
  11564. $$lcssa = $11;
  11565. break;
  11566. }
  11567. }
  11568. $22 = ((($$lcssa)) + 16|0);
  11569. $23 = HEAP32[$22>>2]|0;
  11570. HEAP32[(18588)>>2] = $23;
  11571. $24 = HEAP32[4642]|0;
  11572. HEAP32[$vararg_buffer>>2] = $24;
  11573. _TraceLog(0,4771,$vararg_buffer);
  11574. STACKTOP = sp;return;
  11575. }
  11576. function _InitTimer() {
  11577. var $0 = 0, $1 = 0.0, label = 0, sp = 0;
  11578. sp = STACKTOP;
  11579. $0 = (_time((0|0))|0);
  11580. _srand($0);
  11581. $1 = (+_GetTime());
  11582. HEAPF64[2253] = $1;
  11583. return;
  11584. }
  11585. function _EmscriptenFullscreenChangeCallback($0,$1,$2) {
  11586. $0 = $0|0;
  11587. $1 = $1|0;
  11588. $2 = $2|0;
  11589. var $10 = 0, $11 = 0, $12 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_buffer4 = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, $vararg_ptr3 = 0, $vararg_ptr7 = 0, $vararg_ptr8 = 0, $vararg_ptr9 = 0, label = 0, sp = 0;
  11590. sp = STACKTOP;
  11591. STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
  11592. $vararg_buffer4 = sp + 16|0;
  11593. $vararg_buffer = sp;
  11594. $3 = HEAP32[$1>>2]|0;
  11595. $4 = ($3|0)==(0);
  11596. $5 = ((($1)) + 264|0);
  11597. $6 = HEAP32[$5>>2]|0;
  11598. $7 = ((($1)) + 268|0);
  11599. $8 = HEAP32[$7>>2]|0;
  11600. $9 = ((($1)) + 272|0);
  11601. $10 = HEAP32[$9>>2]|0;
  11602. $11 = ((($1)) + 276|0);
  11603. $12 = HEAP32[$11>>2]|0;
  11604. if ($4) {
  11605. HEAP32[$vararg_buffer4>>2] = $6;
  11606. $vararg_ptr7 = ((($vararg_buffer4)) + 4|0);
  11607. HEAP32[$vararg_ptr7>>2] = $8;
  11608. $vararg_ptr8 = ((($vararg_buffer4)) + 8|0);
  11609. HEAP32[$vararg_ptr8>>2] = $10;
  11610. $vararg_ptr9 = ((($vararg_buffer4)) + 12|0);
  11611. HEAP32[$vararg_ptr9>>2] = $12;
  11612. _TraceLog(0,4704,$vararg_buffer4);
  11613. STACKTOP = sp;return 0;
  11614. } else {
  11615. HEAP32[$vararg_buffer>>2] = $6;
  11616. $vararg_ptr1 = ((($vararg_buffer)) + 4|0);
  11617. HEAP32[$vararg_ptr1>>2] = $8;
  11618. $vararg_ptr2 = ((($vararg_buffer)) + 8|0);
  11619. HEAP32[$vararg_ptr2>>2] = $10;
  11620. $vararg_ptr3 = ((($vararg_buffer)) + 12|0);
  11621. HEAP32[$vararg_ptr3>>2] = $12;
  11622. _TraceLog(0,4635,$vararg_buffer);
  11623. STACKTOP = sp;return 0;
  11624. }
  11625. return (0)|0;
  11626. }
  11627. function _EmscriptenKeyboardCallback($0,$1,$2) {
  11628. $0 = $0|0;
  11629. $1 = $1|0;
  11630. $2 = $2|0;
  11631. var $3 = 0, $4 = 0, $5 = 0, $6 = 0, label = 0, sp = 0;
  11632. sp = STACKTOP;
  11633. $3 = ($0|0)==(1);
  11634. if (!($3)) {
  11635. return 0;
  11636. }
  11637. $4 = ((($1)) + 32|0);
  11638. $5 = (_strcmp($4,4628)|0);
  11639. $6 = ($5|0)==(0);
  11640. if (!($6)) {
  11641. return 0;
  11642. }
  11643. (_emscripten_exit_pointerlock()|0);
  11644. return 0;
  11645. }
  11646. function _EmscriptenMouseCallback($0,$1,$2) {
  11647. $0 = $0|0;
  11648. $1 = $1|0;
  11649. $2 = $2|0;
  11650. var $3 = 0, $4 = 0, $5 = 0, $6 = 0, label = 0, sp = 0;
  11651. sp = STACKTOP;
  11652. STACKTOP = STACKTOP + 272|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(272|0);
  11653. $3 = sp;
  11654. $4 = ($0|0)==(4);
  11655. if (!($4)) {
  11656. STACKTOP = sp;return 0;
  11657. }
  11658. (_emscripten_get_pointerlock_status(($3|0))|0);
  11659. $5 = HEAP32[$3>>2]|0;
  11660. $6 = ($5|0)==(0);
  11661. if ($6) {
  11662. (_emscripten_request_pointerlock((0|0),1)|0);
  11663. } else {
  11664. (_emscripten_exit_pointerlock()|0);
  11665. (_emscripten_get_pointerlock_status(($3|0))|0);
  11666. }
  11667. STACKTOP = sp;return 0;
  11668. }
  11669. function _EmscriptenTouchCallback($0,$1,$2) {
  11670. $0 = $0|0;
  11671. $1 = $1|0;
  11672. $2 = $2|0;
  11673. var $$byval_copy = 0, $$sink = 0, $$sroa$0$0$$sroa_idx = 0, $$sroa$03$0$$sroa_idx = 0, $$sroa$2$0$$sroa_idx2 = 0, $$sroa$24$0$$sroa_idx5 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0.0, $15 = 0, $16 = 0, $17 = 0.0, $18 = 0, $19 = 0, $20 = 0.0, $21 = 0, $22 = 0, $23 = 0.0;
  11674. var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0;
  11675. var $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0.0, $48 = 0.0, $49 = 0.0, $5 = 0, $50 = 0, $51 = 0.0, $52 = 0.0, $53 = 0.0, $54 = 0, $55 = 0.0, $56 = 0.0, $57 = 0.0, $58 = 0, $59 = 0.0, $6 = 0;
  11676. var $60 = 0.0, $61 = 0.0, $7 = 0, $8 = 0, $9 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
  11677. sp = STACKTOP;
  11678. STACKTOP = STACKTOP + 112|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(112|0);
  11679. $$byval_copy = sp + 56|0;
  11680. $3 = sp;
  11681. switch ($0|0) {
  11682. case 22: {
  11683. $$sink = 1;
  11684. label = 4;
  11685. break;
  11686. }
  11687. case 23: {
  11688. $$sink = 0;
  11689. label = 4;
  11690. break;
  11691. }
  11692. case 24: {
  11693. $$sink = 2;
  11694. label = 4;
  11695. break;
  11696. }
  11697. default: {
  11698. }
  11699. }
  11700. if ((label|0) == 4) {
  11701. HEAP32[$3>>2] = $$sink;
  11702. }
  11703. $4 = HEAP32[$1>>2]|0;
  11704. $5 = ((($3)) + 4|0);
  11705. HEAP32[$5>>2] = $4;
  11706. $6 = ((($1)) + 20|0);
  11707. $7 = HEAP32[$6>>2]|0;
  11708. $8 = ((($3)) + 8|0);
  11709. HEAP32[$8>>2] = $7;
  11710. $9 = ((($1)) + 72|0);
  11711. $10 = HEAP32[$9>>2]|0;
  11712. $11 = ((($3)) + 12|0);
  11713. HEAP32[$11>>2] = $10;
  11714. $12 = ((($1)) + 56|0);
  11715. $13 = HEAP32[$12>>2]|0;
  11716. $14 = (+($13|0));
  11717. $15 = ((($1)) + 60|0);
  11718. $16 = HEAP32[$15>>2]|0;
  11719. $17 = (+($16|0));
  11720. $$sroa$03$0$$sroa_idx = ((($3)) + 24|0);
  11721. HEAPF32[$$sroa$03$0$$sroa_idx>>2] = $14;
  11722. $$sroa$24$0$$sroa_idx5 = ((($3)) + 28|0);
  11723. HEAPF32[$$sroa$24$0$$sroa_idx5>>2] = $17;
  11724. $18 = ((($1)) + 108|0);
  11725. $19 = HEAP32[$18>>2]|0;
  11726. $20 = (+($19|0));
  11727. $21 = ((($1)) + 112|0);
  11728. $22 = HEAP32[$21>>2]|0;
  11729. $23 = (+($22|0));
  11730. $$sroa$0$0$$sroa_idx = ((($3)) + 32|0);
  11731. HEAPF32[$$sroa$0$0$$sroa_idx>>2] = $20;
  11732. $$sroa$2$0$$sroa_idx2 = ((($3)) + 36|0);
  11733. HEAPF32[$$sroa$2$0$$sroa_idx2>>2] = $23;
  11734. $24 = ((($3)) + 24|0);
  11735. $25 = $24;
  11736. $26 = $25;
  11737. $27 = HEAP32[$26>>2]|0;
  11738. $28 = (($25) + 4)|0;
  11739. $29 = $28;
  11740. $30 = HEAP32[$29>>2]|0;
  11741. $31 = 18008;
  11742. $32 = $31;
  11743. HEAP32[$32>>2] = $27;
  11744. $33 = (($31) + 4)|0;
  11745. $34 = $33;
  11746. HEAP32[$34>>2] = $30;
  11747. $35 = ((($3)) + 32|0);
  11748. $36 = $35;
  11749. $37 = $36;
  11750. $38 = HEAP32[$37>>2]|0;
  11751. $39 = (($36) + 4)|0;
  11752. $40 = $39;
  11753. $41 = HEAP32[$40>>2]|0;
  11754. $42 = (18016);
  11755. $43 = $42;
  11756. HEAP32[$43>>2] = $38;
  11757. $44 = (($42) + 4)|0;
  11758. $45 = $44;
  11759. HEAP32[$45>>2] = $41;
  11760. $46 = (_GetScreenWidth()|0);
  11761. $47 = (+($46|0));
  11762. $48 = +HEAPF32[$24>>2];
  11763. $49 = $48 / $47;
  11764. HEAPF32[$24>>2] = $49;
  11765. $50 = (_GetScreenHeight()|0);
  11766. $51 = (+($50|0));
  11767. $52 = +HEAPF32[$$sroa$24$0$$sroa_idx5>>2];
  11768. $53 = $52 / $51;
  11769. HEAPF32[$$sroa$24$0$$sroa_idx5>>2] = $53;
  11770. $54 = (_GetScreenWidth()|0);
  11771. $55 = (+($54|0));
  11772. $56 = +HEAPF32[$35>>2];
  11773. $57 = $56 / $55;
  11774. HEAPF32[$35>>2] = $57;
  11775. $58 = (_GetScreenHeight()|0);
  11776. $59 = (+($58|0));
  11777. $60 = +HEAPF32[$$sroa$2$0$$sroa_idx2>>2];
  11778. $61 = $60 / $59;
  11779. HEAPF32[$$sroa$2$0$$sroa_idx2>>2] = $61;
  11780. dest=$$byval_copy; src=$3; stop=dest+56|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  11781. _ProcessGestureEvent($$byval_copy);
  11782. STACKTOP = sp;return 1;
  11783. }
  11784. function _EmscriptenGamepadCallback($0,$1,$2) {
  11785. $0 = $0|0;
  11786. $1 = $1|0;
  11787. $2 = $2|0;
  11788. var $$sink = 0, $10 = 0, $11 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
  11789. sp = STACKTOP;
  11790. $3 = ((($1)) + 1296|0);
  11791. $4 = HEAP32[$3>>2]|0;
  11792. $5 = ($4|0)==(0);
  11793. if ($5) {
  11794. label = 3;
  11795. } else {
  11796. $6 = ((($1)) + 1300|0);
  11797. $7 = HEAP32[$6>>2]|0;
  11798. $8 = ($7|0)<(4);
  11799. if ($8) {
  11800. $$sink = 1;
  11801. } else {
  11802. label = 3;
  11803. }
  11804. }
  11805. if ((label|0) == 3) {
  11806. $$sink = 0;
  11807. }
  11808. $9 = ((($1)) + 1300|0);
  11809. $10 = HEAP32[$9>>2]|0;
  11810. $11 = (18552 + ($10<<2)|0);
  11811. HEAP32[$11>>2] = $$sink;
  11812. return 0;
  11813. }
  11814. function _SetTargetFPS($0) {
  11815. $0 = $0|0;
  11816. var $$ = 0.0, $$op = 0.0, $1 = 0, $2 = 0.0, $3 = 0.0, $4 = 0.0, $5 = 0.0, $6 = 0.0, $vararg_buffer = 0, label = 0, sp = 0;
  11817. sp = STACKTOP;
  11818. STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
  11819. $vararg_buffer = sp;
  11820. $1 = ($0|0)<(1);
  11821. $2 = (+($0|0));
  11822. $3 = 1.0 / $2;
  11823. $$ = $1 ? 0.0 : $3;
  11824. HEAPF64[2250] = $$;
  11825. $4 = $3;
  11826. $$op = $4 * 1000.0;
  11827. $5 = $$op;
  11828. $6 = $1 ? 0.0 : $5;
  11829. HEAPF64[$vararg_buffer>>3] = $6;
  11830. _TraceLog(0,4584,$vararg_buffer);
  11831. STACKTOP = sp;return;
  11832. }
  11833. function _LogoAnimation() {
  11834. var label = 0, sp = 0;
  11835. sp = STACKTOP;
  11836. HEAP32[4637] = 0;
  11837. return;
  11838. }
  11839. function _GetTime() {
  11840. var $0 = 0.0, label = 0, sp = 0;
  11841. sp = STACKTOP;
  11842. $0 = (+_glfwGetTime());
  11843. return (+$0);
  11844. }
  11845. function _LoadImageEx($0,$1,$2,$3) {
  11846. $0 = $0|0;
  11847. $1 = $1|0;
  11848. $2 = $2|0;
  11849. $3 = $3|0;
  11850. var $$03334 = 0, $$035 = 0, $$sroa$12$0$$sroa_idx21 = 0, $$sroa$15$0$$sroa_idx24 = 0, $$sroa$16$0$$sroa_idx26 = 0, $$sroa$9$0$$sroa_idx18 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0;
  11851. var $24 = 0, $25 = 0, $26 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, label = 0, sp = 0;
  11852. sp = STACKTOP;
  11853. $4 = $2 << 2;
  11854. $5 = Math_imul($4, $3)|0;
  11855. $6 = (_malloc($5)|0);
  11856. $7 = ($5|0)>(0);
  11857. if ($7) {
  11858. $8 = (($5) + -1)|0;
  11859. $9 = $8 >>> 2;
  11860. $$03334 = 0;$$035 = 0;
  11861. while(1) {
  11862. $10 = (($1) + ($$03334<<2)|0);
  11863. $11 = HEAP8[$10>>0]|0;
  11864. $12 = (($6) + ($$035)|0);
  11865. HEAP8[$12>>0] = $11;
  11866. $13 = (((($1) + ($$03334<<2)|0)) + 1|0);
  11867. $14 = HEAP8[$13>>0]|0;
  11868. $15 = $$035 | 1;
  11869. $16 = (($6) + ($15)|0);
  11870. HEAP8[$16>>0] = $14;
  11871. $17 = (((($1) + ($$03334<<2)|0)) + 2|0);
  11872. $18 = HEAP8[$17>>0]|0;
  11873. $19 = $$035 | 2;
  11874. $20 = (($6) + ($19)|0);
  11875. HEAP8[$20>>0] = $18;
  11876. $21 = (((($1) + ($$03334<<2)|0)) + 3|0);
  11877. $22 = HEAP8[$21>>0]|0;
  11878. $23 = $$035 | 3;
  11879. $24 = (($6) + ($23)|0);
  11880. HEAP8[$24>>0] = $22;
  11881. $25 = (($$03334) + 1)|0;
  11882. $26 = (($$035) + 4)|0;
  11883. $exitcond = ($$03334|0)==($9|0);
  11884. if ($exitcond) {
  11885. break;
  11886. } else {
  11887. $$03334 = $25;$$035 = $26;
  11888. }
  11889. }
  11890. }
  11891. HEAP32[$0>>2] = $6;
  11892. $$sroa$9$0$$sroa_idx18 = ((($0)) + 4|0);
  11893. HEAP32[$$sroa$9$0$$sroa_idx18>>2] = $2;
  11894. $$sroa$12$0$$sroa_idx21 = ((($0)) + 8|0);
  11895. HEAP32[$$sroa$12$0$$sroa_idx21>>2] = $3;
  11896. $$sroa$15$0$$sroa_idx24 = ((($0)) + 12|0);
  11897. HEAP32[$$sroa$15$0$$sroa_idx24>>2] = 1;
  11898. $$sroa$16$0$$sroa_idx26 = ((($0)) + 16|0);
  11899. HEAP32[$$sroa$16$0$$sroa_idx26>>2] = 7;
  11900. return;
  11901. }
  11902. function _ImageFormat($0,$1) {
  11903. $0 = $0|0;
  11904. $1 = $1|0;
  11905. var $$0166199 = 0, $$0167197 = 0, $$0168195 = 0, $$0169192 = 0, $$0170190 = 0, $$0171188 = 0, $$0172189 = 0, $$0202 = 0, $$1194 = 0, $$2201 = 0, $$byval_copy = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0.0, $103 = 0.0, $104 = 0.0, $105 = 0, $106 = 0, $107 = 0;
  11906. var $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0;
  11907. var $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0;
  11908. var $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0;
  11909. var $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0.0, $17 = 0, $170 = 0.0, $171 = 0.0, $172 = 0, $173 = 0, $174 = 0, $175 = 0.0, $176 = 0.0, $177 = 0.0, $178 = 0, $179 = 0, $18 = 0;
  11910. var $180 = 0, $181 = 0.0, $182 = 0.0, $183 = 0.0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0.0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0;
  11911. var $199 = 0, $2 = 0, $20 = 0.0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0;
  11912. var $216 = 0, $217 = 0, $218 = 0.0, $219 = 0.0, $22 = 0, $220 = 0.0, $221 = 0, $222 = 0, $223 = 0, $224 = 0.0, $225 = 0.0, $226 = 0.0, $227 = 0, $228 = 0, $229 = 0, $23 = 0.0, $230 = 0.0, $231 = 0.0, $232 = 0.0, $233 = 0;
  11913. var $234 = 0, $235 = 0, $236 = 0.0, $237 = 0.0, $238 = 0.0, $239 = 0, $24 = 0.0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0.0, $250 = 0, $251 = 0;
  11914. var $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0;
  11915. var $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0.0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0;
  11916. var $289 = 0, $29 = 0.0, $290 = 0, $3 = 0, $30 = 0.0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
  11917. var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0.0, $53 = 0.0, $54 = 0, $55 = 0, $56 = 0.0, $57 = 0.0, $58 = 0.0, $59 = 0, $6 = 0, $60 = 0, $61 = 0.0, $62 = 0.0;
  11918. var $63 = 0.0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0;
  11919. var $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0.0, $91 = 0.0, $92 = 0.0, $93 = 0, $94 = 0, $95 = 0, $96 = 0.0, $97 = 0.0, $98 = 0.0, $99 = 0;
  11920. var $or$cond = 0, $roundf = 0.0, $roundf173 = 0.0, $roundf174 = 0.0, $roundf175 = 0.0, $roundf176 = 0.0, $roundf177 = 0.0, $roundf178 = 0.0, $roundf179 = 0.0, $roundf180 = 0.0, $roundf181 = 0.0, $vararg_buffer = 0, label = 0, sp = 0;
  11921. sp = STACKTOP;
  11922. STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
  11923. $$byval_copy = sp + 4|0;
  11924. $vararg_buffer = sp;
  11925. $2 = ((($0)) + 16|0);
  11926. $3 = HEAP32[$2>>2]|0;
  11927. $4 = ($3|0)==($1|0);
  11928. if ($4) {
  11929. STACKTOP = sp;return;
  11930. }
  11931. $5 = ($3|0)<(8);
  11932. $6 = ($1|0)<(8);
  11933. $or$cond = $6 & $5;
  11934. if (!($or$cond)) {
  11935. _TraceLog(2,5118,$vararg_buffer);
  11936. STACKTOP = sp;return;
  11937. }
  11938. ;HEAP32[$$byval_copy>>2]=HEAP32[$0>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$0+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[$0+8>>2]|0;HEAP32[$$byval_copy+12>>2]=HEAP32[$0+12>>2]|0;HEAP32[$$byval_copy+16>>2]=HEAP32[$0+16>>2]|0;
  11939. $7 = (_GetImageData($$byval_copy)|0);
  11940. $8 = HEAP32[$0>>2]|0;
  11941. _free($8);
  11942. HEAP32[$2>>2] = $1;
  11943. switch ($1|0) {
  11944. case 1: {
  11945. $9 = ((($0)) + 4|0);
  11946. $10 = HEAP32[$9>>2]|0;
  11947. $11 = ((($0)) + 8|0);
  11948. $12 = HEAP32[$11>>2]|0;
  11949. $13 = Math_imul($12, $10)|0;
  11950. $14 = (_malloc($13)|0);
  11951. HEAP32[$0>>2] = $14;
  11952. $15 = Math_imul($12, $10)|0;
  11953. $16 = ($15|0)>(0);
  11954. if ($16) {
  11955. $$0171188 = 0;
  11956. while(1) {
  11957. $17 = (($7) + ($$0171188<<2)|0);
  11958. $18 = HEAP8[$17>>0]|0;
  11959. $19 = (+($18&255));
  11960. $20 = $19 * 0.29899999499320984;
  11961. $21 = (((($7) + ($$0171188<<2)|0)) + 1|0);
  11962. $22 = HEAP8[$21>>0]|0;
  11963. $23 = (+($22&255));
  11964. $24 = $23 * 0.58700001239776611;
  11965. $25 = $20 + $24;
  11966. $26 = (((($7) + ($$0171188<<2)|0)) + 2|0);
  11967. $27 = HEAP8[$26>>0]|0;
  11968. $28 = (+($27&255));
  11969. $29 = $28 * 0.11400000005960464;
  11970. $30 = $25 + $29;
  11971. $31 = (~~(($30))&255);
  11972. $32 = HEAP32[$0>>2]|0;
  11973. $33 = (($32) + ($$0171188)|0);
  11974. HEAP8[$33>>0] = $31;
  11975. $34 = (($$0171188) + 1)|0;
  11976. $35 = HEAP32[$9>>2]|0;
  11977. $36 = HEAP32[$11>>2]|0;
  11978. $37 = Math_imul($36, $35)|0;
  11979. $38 = ($34|0)<($37|0);
  11980. if ($38) {
  11981. $$0171188 = $34;
  11982. } else {
  11983. break;
  11984. }
  11985. }
  11986. }
  11987. break;
  11988. }
  11989. case 2: {
  11990. $39 = ((($0)) + 4|0);
  11991. $40 = HEAP32[$39>>2]|0;
  11992. $41 = ((($0)) + 8|0);
  11993. $42 = HEAP32[$41>>2]|0;
  11994. $43 = $40 << 1;
  11995. $44 = Math_imul($43, $42)|0;
  11996. $45 = (_malloc($44)|0);
  11997. HEAP32[$0>>2] = $45;
  11998. $46 = HEAP32[$39>>2]|0;
  11999. $47 = $46 << 1;
  12000. $48 = Math_imul($47, $42)|0;
  12001. $49 = ($48|0)>(0);
  12002. if ($49) {
  12003. $$0170190 = 0;$$0172189 = 0;
  12004. while(1) {
  12005. $50 = (($7) + ($$0172189<<2)|0);
  12006. $51 = HEAP8[$50>>0]|0;
  12007. $52 = (+($51&255));
  12008. $53 = $52 * 0.29899999499320984;
  12009. $54 = (((($7) + ($$0172189<<2)|0)) + 1|0);
  12010. $55 = HEAP8[$54>>0]|0;
  12011. $56 = (+($55&255));
  12012. $57 = $56 * 0.58700001239776611;
  12013. $58 = $53 + $57;
  12014. $59 = (((($7) + ($$0172189<<2)|0)) + 2|0);
  12015. $60 = HEAP8[$59>>0]|0;
  12016. $61 = (+($60&255));
  12017. $62 = $61 * 0.11400000005960464;
  12018. $63 = $58 + $62;
  12019. $64 = (~~(($63))&255);
  12020. $65 = HEAP32[$0>>2]|0;
  12021. $66 = (($65) + ($$0170190)|0);
  12022. HEAP8[$66>>0] = $64;
  12023. $67 = (((($7) + ($$0172189<<2)|0)) + 3|0);
  12024. $68 = HEAP8[$67>>0]|0;
  12025. $69 = HEAP32[$0>>2]|0;
  12026. $70 = $$0170190 | 1;
  12027. $71 = (($69) + ($70)|0);
  12028. HEAP8[$71>>0] = $68;
  12029. $72 = (($$0172189) + 1)|0;
  12030. $73 = (($$0170190) + 2)|0;
  12031. $74 = HEAP32[$39>>2]|0;
  12032. $75 = HEAP32[$41>>2]|0;
  12033. $76 = $74 << 1;
  12034. $77 = Math_imul($76, $75)|0;
  12035. $78 = ($73|0)<($77|0);
  12036. if ($78) {
  12037. $$0170190 = $73;$$0172189 = $72;
  12038. } else {
  12039. break;
  12040. }
  12041. }
  12042. }
  12043. break;
  12044. }
  12045. case 3: {
  12046. $79 = ((($0)) + 4|0);
  12047. $80 = HEAP32[$79>>2]|0;
  12048. $81 = ((($0)) + 8|0);
  12049. $82 = HEAP32[$81>>2]|0;
  12050. $83 = $80 << 1;
  12051. $84 = Math_imul($83, $82)|0;
  12052. $85 = (_malloc($84)|0);
  12053. HEAP32[$0>>2] = $85;
  12054. $86 = HEAP32[$79>>2]|0;
  12055. $87 = Math_imul($82, $86)|0;
  12056. $88 = ($87|0)>(0);
  12057. if ($88) {
  12058. $89 = HEAP8[$7>>0]|0;
  12059. $90 = (+($89&255));
  12060. $91 = $90 * 31.0;
  12061. $92 = $91 / 255.0;
  12062. $roundf179 = (+_roundf((+$92)));
  12063. $93 = (~~(($roundf179))&255);
  12064. $94 = ((($7)) + 1|0);
  12065. $95 = HEAP8[$94>>0]|0;
  12066. $96 = (+($95&255));
  12067. $97 = $96 * 63.0;
  12068. $98 = $97 / 255.0;
  12069. $roundf180 = (+_roundf((+$98)));
  12070. $99 = (~~(($roundf180))&255);
  12071. $100 = ((($7)) + 2|0);
  12072. $101 = HEAP8[$100>>0]|0;
  12073. $102 = (+($101&255));
  12074. $103 = $102 * 31.0;
  12075. $104 = $103 / 255.0;
  12076. $roundf181 = (+_roundf((+$104)));
  12077. $105 = (~~(($roundf181))&255);
  12078. $106 = $93&255;
  12079. $107 = $106 << 11;
  12080. $108 = $99&255;
  12081. $109 = $108 << 5;
  12082. $110 = $109 | $107;
  12083. $111 = $105&255;
  12084. $112 = $110 | $111;
  12085. $113 = $112&65535;
  12086. $114 = HEAP32[$0>>2]|0;
  12087. $115 = HEAP32[$79>>2]|0;
  12088. $116 = HEAP32[$81>>2]|0;
  12089. $117 = Math_imul($116, $115)|0;
  12090. $$0169192 = 0;
  12091. while(1) {
  12092. $118 = (($114) + ($$0169192<<1)|0);
  12093. HEAP16[$118>>1] = $113;
  12094. $119 = (($$0169192) + 1)|0;
  12095. $120 = ($119|0)<($117|0);
  12096. if ($120) {
  12097. $$0169192 = $119;
  12098. } else {
  12099. break;
  12100. }
  12101. }
  12102. }
  12103. break;
  12104. }
  12105. case 4: {
  12106. $121 = ((($0)) + 4|0);
  12107. $122 = HEAP32[$121>>2]|0;
  12108. $123 = ((($0)) + 8|0);
  12109. $124 = HEAP32[$123>>2]|0;
  12110. $125 = ($122*3)|0;
  12111. $126 = Math_imul($125, $124)|0;
  12112. $127 = (_malloc($126)|0);
  12113. HEAP32[$0>>2] = $127;
  12114. $128 = HEAP32[$121>>2]|0;
  12115. $129 = ($128*3)|0;
  12116. $130 = Math_imul($129, $124)|0;
  12117. $131 = ($130|0)>(0);
  12118. if ($131) {
  12119. $$0168195 = 0;$$1194 = 0;
  12120. while(1) {
  12121. $132 = (($7) + ($$1194<<2)|0);
  12122. $133 = HEAP8[$132>>0]|0;
  12123. $134 = HEAP32[$0>>2]|0;
  12124. $135 = (($134) + ($$0168195)|0);
  12125. HEAP8[$135>>0] = $133;
  12126. $136 = (((($7) + ($$1194<<2)|0)) + 1|0);
  12127. $137 = HEAP8[$136>>0]|0;
  12128. $138 = HEAP32[$0>>2]|0;
  12129. $139 = (($$0168195) + 1)|0;
  12130. $140 = (($138) + ($139)|0);
  12131. HEAP8[$140>>0] = $137;
  12132. $141 = (((($7) + ($$1194<<2)|0)) + 2|0);
  12133. $142 = HEAP8[$141>>0]|0;
  12134. $143 = HEAP32[$0>>2]|0;
  12135. $144 = (($$0168195) + 2)|0;
  12136. $145 = (($143) + ($144)|0);
  12137. HEAP8[$145>>0] = $142;
  12138. $146 = (($$1194) + 1)|0;
  12139. $147 = (($$0168195) + 3)|0;
  12140. $148 = HEAP32[$121>>2]|0;
  12141. $149 = HEAP32[$123>>2]|0;
  12142. $150 = ($148*3)|0;
  12143. $151 = Math_imul($150, $149)|0;
  12144. $152 = ($147|0)<($151|0);
  12145. if ($152) {
  12146. $$0168195 = $147;$$1194 = $146;
  12147. } else {
  12148. break;
  12149. }
  12150. }
  12151. }
  12152. break;
  12153. }
  12154. case 5: {
  12155. $153 = ((($0)) + 4|0);
  12156. $154 = HEAP32[$153>>2]|0;
  12157. $155 = ((($0)) + 8|0);
  12158. $156 = HEAP32[$155>>2]|0;
  12159. $157 = $154 << 1;
  12160. $158 = Math_imul($157, $156)|0;
  12161. $159 = (_malloc($158)|0);
  12162. HEAP32[$0>>2] = $159;
  12163. $160 = HEAP32[$153>>2]|0;
  12164. $161 = Math_imul($156, $160)|0;
  12165. $162 = ($161|0)>(0);
  12166. if ($162) {
  12167. $163 = HEAP32[$0>>2]|0;
  12168. $164 = HEAP32[$153>>2]|0;
  12169. $165 = HEAP32[$155>>2]|0;
  12170. $166 = Math_imul($165, $164)|0;
  12171. $$0167197 = 0;
  12172. while(1) {
  12173. $167 = (($7) + ($$0167197<<2)|0);
  12174. $168 = HEAP8[$167>>0]|0;
  12175. $169 = (+($168&255));
  12176. $170 = $169 * 31.0;
  12177. $171 = $170 / 255.0;
  12178. $roundf176 = (+_roundf((+$171)));
  12179. $172 = (~~(($roundf176))&255);
  12180. $173 = (((($7) + ($$0167197<<2)|0)) + 1|0);
  12181. $174 = HEAP8[$173>>0]|0;
  12182. $175 = (+($174&255));
  12183. $176 = $175 * 31.0;
  12184. $177 = $176 / 255.0;
  12185. $roundf177 = (+_roundf((+$177)));
  12186. $178 = (~~(($roundf177))&255);
  12187. $179 = (((($7) + ($$0167197<<2)|0)) + 2|0);
  12188. $180 = HEAP8[$179>>0]|0;
  12189. $181 = (+($180&255));
  12190. $182 = $181 * 31.0;
  12191. $183 = $182 / 255.0;
  12192. $roundf178 = (+_roundf((+$183)));
  12193. $184 = (~~(($roundf178))&255);
  12194. $185 = (((($7) + ($$0167197<<2)|0)) + 3|0);
  12195. $186 = HEAP8[$185>>0]|0;
  12196. $187 = ($186&255)>(50);
  12197. $188 = $172&255;
  12198. $189 = $188 << 11;
  12199. $190 = $178&255;
  12200. $191 = $190 << 6;
  12201. $192 = $191 | $189;
  12202. $193 = $184&255;
  12203. $194 = $193 << 1;
  12204. $195 = $192 | $194;
  12205. $196 = $187&1;
  12206. $197 = $195 | $196;
  12207. $198 = $197&65535;
  12208. $199 = (($163) + ($$0167197<<1)|0);
  12209. HEAP16[$199>>1] = $198;
  12210. $200 = (($$0167197) + 1)|0;
  12211. $201 = ($200|0)<($166|0);
  12212. if ($201) {
  12213. $$0167197 = $200;
  12214. } else {
  12215. break;
  12216. }
  12217. }
  12218. }
  12219. break;
  12220. }
  12221. case 6: {
  12222. $202 = ((($0)) + 4|0);
  12223. $203 = HEAP32[$202>>2]|0;
  12224. $204 = ((($0)) + 8|0);
  12225. $205 = HEAP32[$204>>2]|0;
  12226. $206 = $203 << 1;
  12227. $207 = Math_imul($206, $205)|0;
  12228. $208 = (_malloc($207)|0);
  12229. HEAP32[$0>>2] = $208;
  12230. $209 = HEAP32[$202>>2]|0;
  12231. $210 = Math_imul($205, $209)|0;
  12232. $211 = ($210|0)>(0);
  12233. if ($211) {
  12234. $212 = HEAP32[$0>>2]|0;
  12235. $213 = HEAP32[$202>>2]|0;
  12236. $214 = HEAP32[$204>>2]|0;
  12237. $215 = Math_imul($214, $213)|0;
  12238. $$0166199 = 0;
  12239. while(1) {
  12240. $216 = (($7) + ($$0166199<<2)|0);
  12241. $217 = HEAP8[$216>>0]|0;
  12242. $218 = (+($217&255));
  12243. $219 = $218 * 15.0;
  12244. $220 = $219 / 255.0;
  12245. $roundf = (+_roundf((+$220)));
  12246. $221 = (~~(($roundf))&255);
  12247. $222 = (((($7) + ($$0166199<<2)|0)) + 1|0);
  12248. $223 = HEAP8[$222>>0]|0;
  12249. $224 = (+($223&255));
  12250. $225 = $224 * 15.0;
  12251. $226 = $225 / 255.0;
  12252. $roundf173 = (+_roundf((+$226)));
  12253. $227 = (~~(($roundf173))&255);
  12254. $228 = (((($7) + ($$0166199<<2)|0)) + 2|0);
  12255. $229 = HEAP8[$228>>0]|0;
  12256. $230 = (+($229&255));
  12257. $231 = $230 * 15.0;
  12258. $232 = $231 / 255.0;
  12259. $roundf174 = (+_roundf((+$232)));
  12260. $233 = (~~(($roundf174))&255);
  12261. $234 = (((($7) + ($$0166199<<2)|0)) + 3|0);
  12262. $235 = HEAP8[$234>>0]|0;
  12263. $236 = (+($235&255));
  12264. $237 = $236 * 15.0;
  12265. $238 = $237 / 255.0;
  12266. $roundf175 = (+_roundf((+$238)));
  12267. $239 = (~~(($roundf175))&255);
  12268. $240 = $221&255;
  12269. $241 = $240 << 12;
  12270. $242 = $227&255;
  12271. $243 = $242 << 8;
  12272. $244 = $243 | $241;
  12273. $245 = $233&255;
  12274. $246 = $245 << 4;
  12275. $247 = $244 | $246;
  12276. $248 = $239&255;
  12277. $249 = $247 | $248;
  12278. $250 = $249&65535;
  12279. $251 = (($212) + ($$0166199<<1)|0);
  12280. HEAP16[$251>>1] = $250;
  12281. $252 = (($$0166199) + 1)|0;
  12282. $253 = ($252|0)<($215|0);
  12283. if ($253) {
  12284. $$0166199 = $252;
  12285. } else {
  12286. break;
  12287. }
  12288. }
  12289. }
  12290. break;
  12291. }
  12292. case 7: {
  12293. $254 = ((($0)) + 4|0);
  12294. $255 = HEAP32[$254>>2]|0;
  12295. $256 = ((($0)) + 8|0);
  12296. $257 = HEAP32[$256>>2]|0;
  12297. $258 = $255 << 2;
  12298. $259 = Math_imul($258, $257)|0;
  12299. $260 = (_malloc($259)|0);
  12300. HEAP32[$0>>2] = $260;
  12301. $261 = HEAP32[$254>>2]|0;
  12302. $262 = $261 << 2;
  12303. $263 = Math_imul($262, $257)|0;
  12304. $264 = ($263|0)>(0);
  12305. if ($264) {
  12306. $$0202 = 0;$$2201 = 0;
  12307. while(1) {
  12308. $265 = (($7) + ($$2201<<2)|0);
  12309. $266 = HEAP8[$265>>0]|0;
  12310. $267 = HEAP32[$0>>2]|0;
  12311. $268 = (($267) + ($$0202)|0);
  12312. HEAP8[$268>>0] = $266;
  12313. $269 = (((($7) + ($$2201<<2)|0)) + 1|0);
  12314. $270 = HEAP8[$269>>0]|0;
  12315. $271 = HEAP32[$0>>2]|0;
  12316. $272 = $$0202 | 1;
  12317. $273 = (($271) + ($272)|0);
  12318. HEAP8[$273>>0] = $270;
  12319. $274 = (((($7) + ($$2201<<2)|0)) + 2|0);
  12320. $275 = HEAP8[$274>>0]|0;
  12321. $276 = HEAP32[$0>>2]|0;
  12322. $277 = $$0202 | 2;
  12323. $278 = (($276) + ($277)|0);
  12324. HEAP8[$278>>0] = $275;
  12325. $279 = (((($7) + ($$2201<<2)|0)) + 3|0);
  12326. $280 = HEAP8[$279>>0]|0;
  12327. $281 = HEAP32[$0>>2]|0;
  12328. $282 = $$0202 | 3;
  12329. $283 = (($281) + ($282)|0);
  12330. HEAP8[$283>>0] = $280;
  12331. $284 = (($$2201) + 1)|0;
  12332. $285 = (($$0202) + 4)|0;
  12333. $286 = HEAP32[$254>>2]|0;
  12334. $287 = HEAP32[$256>>2]|0;
  12335. $288 = $286 << 2;
  12336. $289 = Math_imul($288, $287)|0;
  12337. $290 = ($285|0)<($289|0);
  12338. if ($290) {
  12339. $$0202 = $285;$$2201 = $284;
  12340. } else {
  12341. break;
  12342. }
  12343. }
  12344. }
  12345. break;
  12346. }
  12347. default: {
  12348. }
  12349. }
  12350. _free($7);
  12351. STACKTOP = sp;return;
  12352. }
  12353. function _LoadTextureFromImage($0,$1) {
  12354. $0 = $0|0;
  12355. $1 = $1|0;
  12356. var $$sroa$11$0$$sroa_idx8 = 0, $$sroa$5$0$$sroa_idx2 = 0, $$sroa$7$0$$sroa_idx4 = 0, $$sroa$9$0$$sroa_idx6 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
  12357. sp = STACKTOP;
  12358. $2 = HEAP32[$1>>2]|0;
  12359. $3 = ((($1)) + 4|0);
  12360. $4 = HEAP32[$3>>2]|0;
  12361. $5 = ((($1)) + 8|0);
  12362. $6 = HEAP32[$5>>2]|0;
  12363. $7 = ((($1)) + 16|0);
  12364. $8 = HEAP32[$7>>2]|0;
  12365. $9 = ((($1)) + 12|0);
  12366. $10 = HEAP32[$9>>2]|0;
  12367. $11 = (_rlglLoadTexture($2,$4,$6,$8,$10)|0);
  12368. $12 = HEAP32[$3>>2]|0;
  12369. $13 = HEAP32[$5>>2]|0;
  12370. HEAP32[$0>>2] = $11;
  12371. $$sroa$5$0$$sroa_idx2 = ((($0)) + 4|0);
  12372. HEAP32[$$sroa$5$0$$sroa_idx2>>2] = $12;
  12373. $$sroa$7$0$$sroa_idx4 = ((($0)) + 8|0);
  12374. HEAP32[$$sroa$7$0$$sroa_idx4>>2] = $13;
  12375. $$sroa$9$0$$sroa_idx6 = ((($0)) + 12|0);
  12376. HEAP32[$$sroa$9$0$$sroa_idx6>>2] = $10;
  12377. $$sroa$11$0$$sroa_idx8 = ((($0)) + 16|0);
  12378. HEAP32[$$sroa$11$0$$sroa_idx8>>2] = $8;
  12379. return;
  12380. }
  12381. function _UnloadImage($0) {
  12382. $0 = $0|0;
  12383. var $1 = 0, label = 0, sp = 0;
  12384. sp = STACKTOP;
  12385. $1 = HEAP32[$0>>2]|0;
  12386. _free($1);
  12387. return;
  12388. }
  12389. function _rlglLoadTexture($0,$1,$2,$3,$4) {
  12390. $0 = $0|0;
  12391. $1 = $1|0;
  12392. $2 = $2|0;
  12393. $3 = $3|0;
  12394. $4 = $4|0;
  12395. var $$0 = 0, $$off = 0, $$off92 = 0, $$off93 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
  12396. var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0;
  12397. var $46 = 0, $47 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond100 = 0, $or$cond7 = 0, $or$cond96 = 0, $or$cond98 = 0, $switch = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer11 = 0, $vararg_buffer15 = 0, $vararg_buffer3 = 0, $vararg_buffer5 = 0, $vararg_buffer7 = 0;
  12398. var $vararg_buffer9 = 0, $vararg_ptr13 = 0, $vararg_ptr14 = 0, label = 0, sp = 0;
  12399. sp = STACKTOP;
  12400. STACKTOP = STACKTOP + 80|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(80|0);
  12401. $vararg_buffer15 = sp + 64|0;
  12402. $vararg_buffer11 = sp + 48|0;
  12403. $vararg_buffer9 = sp + 40|0;
  12404. $vararg_buffer7 = sp + 32|0;
  12405. $vararg_buffer5 = sp + 24|0;
  12406. $vararg_buffer3 = sp + 16|0;
  12407. $vararg_buffer1 = sp + 8|0;
  12408. $vararg_buffer = sp;
  12409. $5 = sp + 68|0;
  12410. _glBindTexture(3553,0);
  12411. HEAP32[$5>>2] = 0;
  12412. $6 = HEAP32[4650]|0;
  12413. $7 = ($6|0)==(0);
  12414. $8 = $3 & -4;
  12415. $switch = ($8|0)==(8);
  12416. $or$cond100 = $switch & $7;
  12417. if ($or$cond100) {
  12418. _TraceLog(2,4816,$vararg_buffer);
  12419. $$0 = HEAP32[$5>>2]|0;
  12420. STACKTOP = sp;return ($$0|0);
  12421. }
  12422. $9 = HEAP32[4651]|0;
  12423. $10 = ($9|0)==(0);
  12424. $11 = ($3|0)==(12);
  12425. $or$cond7 = $11 & $10;
  12426. if ($or$cond7) {
  12427. _TraceLog(2,4860,$vararg_buffer1);
  12428. $$0 = HEAP32[$5>>2]|0;
  12429. STACKTOP = sp;return ($$0|0);
  12430. }
  12431. $12 = HEAP32[4652]|0;
  12432. $13 = ($12|0)==(0);
  12433. $$off = (($3) + -13)|0;
  12434. $14 = ($$off>>>0)<(2);
  12435. $or$cond = $14 & $13;
  12436. if ($or$cond) {
  12437. _TraceLog(2,4905,$vararg_buffer3);
  12438. $$0 = HEAP32[$5>>2]|0;
  12439. STACKTOP = sp;return ($$0|0);
  12440. }
  12441. $15 = HEAP32[4653]|0;
  12442. $16 = ($15|0)==(0);
  12443. $$off92 = (($3) + -15)|0;
  12444. $17 = ($$off92>>>0)<(2);
  12445. $or$cond96 = $17 & $16;
  12446. if ($or$cond96) {
  12447. _TraceLog(2,4950,$vararg_buffer5);
  12448. $$0 = HEAP32[$5>>2]|0;
  12449. STACKTOP = sp;return ($$0|0);
  12450. }
  12451. $18 = HEAP32[4654]|0;
  12452. $19 = ($18|0)==(0);
  12453. $$off93 = (($3) + -17)|0;
  12454. $20 = ($$off93>>>0)<(2);
  12455. $or$cond98 = $20 & $19;
  12456. if ($or$cond98) {
  12457. _TraceLog(2,4995,$vararg_buffer7);
  12458. $$0 = HEAP32[$5>>2]|0;
  12459. STACKTOP = sp;return ($$0|0);
  12460. }
  12461. _glGenTextures(1,($5|0));
  12462. $21 = HEAP32[$5>>2]|0;
  12463. _glBindTexture(3553,($21|0));
  12464. do {
  12465. switch ($3|0) {
  12466. case 1: {
  12467. _glTexImage2D(3553,0,6409,($1|0),($2|0),0,6409,5121,($0|0));
  12468. break;
  12469. }
  12470. case 2: {
  12471. _glTexImage2D(3553,0,6410,($1|0),($2|0),0,6410,5121,($0|0));
  12472. break;
  12473. }
  12474. case 3: {
  12475. _glTexImage2D(3553,0,6407,($1|0),($2|0),0,6407,33635,($0|0));
  12476. break;
  12477. }
  12478. case 4: {
  12479. _glTexImage2D(3553,0,6407,($1|0),($2|0),0,6407,5121,($0|0));
  12480. break;
  12481. }
  12482. case 5: {
  12483. _glTexImage2D(3553,0,6408,($1|0),($2|0),0,6408,32820,($0|0));
  12484. break;
  12485. }
  12486. case 6: {
  12487. _glTexImage2D(3553,0,6408,($1|0),($2|0),0,6408,32819,($0|0));
  12488. break;
  12489. }
  12490. case 7: {
  12491. _glTexImage2D(3553,0,6408,($1|0),($2|0),0,6408,5121,($0|0));
  12492. break;
  12493. }
  12494. case 8: {
  12495. $22 = HEAP32[4650]|0;
  12496. $23 = ($22|0)==(0);
  12497. if (!($23)) {
  12498. _LoadCompressedTexture($0,$1,$2,$4,33776);
  12499. }
  12500. break;
  12501. }
  12502. case 9: {
  12503. $24 = HEAP32[4650]|0;
  12504. $25 = ($24|0)==(0);
  12505. if (!($25)) {
  12506. _LoadCompressedTexture($0,$1,$2,$4,33777);
  12507. }
  12508. break;
  12509. }
  12510. case 10: {
  12511. $26 = HEAP32[4650]|0;
  12512. $27 = ($26|0)==(0);
  12513. if (!($27)) {
  12514. _LoadCompressedTexture($0,$1,$2,$4,33778);
  12515. }
  12516. break;
  12517. }
  12518. case 11: {
  12519. $28 = HEAP32[4650]|0;
  12520. $29 = ($28|0)==(0);
  12521. if (!($29)) {
  12522. _LoadCompressedTexture($0,$1,$2,$4,33779);
  12523. }
  12524. break;
  12525. }
  12526. case 12: {
  12527. $30 = HEAP32[4651]|0;
  12528. $31 = ($30|0)==(0);
  12529. if (!($31)) {
  12530. _LoadCompressedTexture($0,$1,$2,$4,36196);
  12531. }
  12532. break;
  12533. }
  12534. case 13: {
  12535. $32 = HEAP32[4652]|0;
  12536. $33 = ($32|0)==(0);
  12537. if (!($33)) {
  12538. _LoadCompressedTexture($0,$1,$2,$4,37492);
  12539. }
  12540. break;
  12541. }
  12542. case 14: {
  12543. $34 = HEAP32[4652]|0;
  12544. $35 = ($34|0)==(0);
  12545. if (!($35)) {
  12546. _LoadCompressedTexture($0,$1,$2,$4,37496);
  12547. }
  12548. break;
  12549. }
  12550. case 15: {
  12551. $36 = HEAP32[4653]|0;
  12552. $37 = ($36|0)==(0);
  12553. if (!($37)) {
  12554. _LoadCompressedTexture($0,$1,$2,$4,35840);
  12555. }
  12556. break;
  12557. }
  12558. case 16: {
  12559. $38 = HEAP32[4653]|0;
  12560. $39 = ($38|0)==(0);
  12561. if (!($39)) {
  12562. _LoadCompressedTexture($0,$1,$2,$4,35842);
  12563. }
  12564. break;
  12565. }
  12566. case 17: {
  12567. $40 = HEAP32[4654]|0;
  12568. $41 = ($40|0)==(0);
  12569. if (!($41)) {
  12570. _LoadCompressedTexture($0,$1,$2,$4,37808);
  12571. }
  12572. break;
  12573. }
  12574. case 18: {
  12575. $42 = HEAP32[4654]|0;
  12576. $43 = ($42|0)==(0);
  12577. if (!($43)) {
  12578. _LoadCompressedTexture($0,$1,$2,$4,37815);
  12579. }
  12580. break;
  12581. }
  12582. default: {
  12583. _TraceLog(2,5040,$vararg_buffer9);
  12584. }
  12585. }
  12586. } while(0);
  12587. $44 = HEAP32[4655]|0;
  12588. $45 = ($44|0)==(0);
  12589. if ($45) {
  12590. _glTexParameteri(3553,10242,33071);
  12591. _glTexParameteri(3553,10243,33071);
  12592. } else {
  12593. _glTexParameteri(3553,10242,10497);
  12594. _glTexParameteri(3553,10243,10497);
  12595. }
  12596. _glTexParameteri(3553,10240,9728);
  12597. _glTexParameteri(3553,10241,9728);
  12598. _glBindTexture(3553,0);
  12599. $46 = HEAP32[$5>>2]|0;
  12600. $47 = ($46|0)==(0);
  12601. if ($47) {
  12602. _TraceLog(2,11773,$vararg_buffer15);
  12603. $$0 = HEAP32[$5>>2]|0;
  12604. STACKTOP = sp;return ($$0|0);
  12605. } else {
  12606. HEAP32[$vararg_buffer11>>2] = $46;
  12607. $vararg_ptr13 = ((($vararg_buffer11)) + 4|0);
  12608. HEAP32[$vararg_ptr13>>2] = $1;
  12609. $vararg_ptr14 = ((($vararg_buffer11)) + 8|0);
  12610. HEAP32[$vararg_ptr14>>2] = $2;
  12611. _TraceLog(0,5069,$vararg_buffer11);
  12612. $$0 = HEAP32[$5>>2]|0;
  12613. STACKTOP = sp;return ($$0|0);
  12614. }
  12615. return (0)|0;
  12616. }
  12617. function _LoadCompressedTexture($0,$1,$2,$3,$4) {
  12618. $0 = $0|0;
  12619. $1 = $1|0;
  12620. $2 = $2|0;
  12621. $3 = $3|0;
  12622. $4 = $4|0;
  12623. var $$ = 0, $$03645 = 0, $$03744 = 0, $$038 = 0, $$03943 = 0, $$046 = 0, $$140 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0;
  12624. var $23 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond42 = 0, label = 0, sp = 0;
  12625. sp = STACKTOP;
  12626. _glPixelStorei(3317,1);
  12627. switch ($4|0) {
  12628. case 33776: case 33777: case 36196: case 37492: {
  12629. $$038 = 8;
  12630. break;
  12631. }
  12632. default: {
  12633. $$038 = 16;
  12634. }
  12635. }
  12636. $5 = ($3|0)<(1);
  12637. $6 = $1 | $2;
  12638. $7 = ($6|0)==(0);
  12639. $or$cond42 = $5 | $7;
  12640. if ($or$cond42) {
  12641. return;
  12642. } else {
  12643. $$03645 = 0;$$03744 = 0;$$03943 = $2;$$046 = $1;
  12644. }
  12645. while(1) {
  12646. $8 = (($$046) + 3)|0;
  12647. $9 = (($8|0) / 4)&-1;
  12648. $10 = (($$03943) + 3)|0;
  12649. $11 = (($10|0) / 4)&-1;
  12650. $12 = Math_imul($11, $$038)|0;
  12651. $13 = Math_imul($12, $9)|0;
  12652. $14 = (($0) + ($$03744)|0);
  12653. _glCompressedTexImage2D(3553,($$03645|0),($4|0),($$046|0),($$03943|0),0,($13|0),($14|0));
  12654. $15 = (($13) + ($$03744))|0;
  12655. $16 = (($$046|0) / 2)&-1;
  12656. $17 = (($$03943|0) / 2)&-1;
  12657. $18 = ($$046|0)<(2);
  12658. $$ = $18 ? 1 : $16;
  12659. $19 = ($$03943|0)<(2);
  12660. $$140 = $19 ? 1 : $17;
  12661. $20 = (($$03645) + 1)|0;
  12662. $21 = ($20|0)>=($3|0);
  12663. $22 = $$ | $$140;
  12664. $23 = ($22|0)==(0);
  12665. $or$cond = $21 | $23;
  12666. if ($or$cond) {
  12667. break;
  12668. } else {
  12669. $$03645 = $20;$$03744 = $15;$$03943 = $$140;$$046 = $$;
  12670. }
  12671. }
  12672. return;
  12673. }
  12674. function _GetImageData($0) {
  12675. $0 = $0|0;
  12676. var $$0104105 = 0, $$0106 = 0, $$1 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0.0, $103 = 0.0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0;
  12677. var $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0;
  12678. var $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0;
  12679. var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0.0, $4 = 0, $40 = 0.0, $41 = 0;
  12680. var $42 = 0, $43 = 0, $44 = 0, $45 = 0.0, $46 = 0.0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0.0, $52 = 0.0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0;
  12681. var $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0.0, $65 = 0.0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0.0, $71 = 0.0, $72 = 0, $73 = 0, $74 = 0, $75 = 0.0, $76 = 0.0, $77 = 0, $78 = 0;
  12682. var $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0.0, $86 = 0.0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0.0, $92 = 0.0, $93 = 0, $94 = 0, $95 = 0, $96 = 0;
  12683. var $97 = 0.0, $98 = 0.0, $99 = 0, $vararg_buffer = 0, label = 0, sp = 0;
  12684. sp = STACKTOP;
  12685. STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
  12686. $vararg_buffer = sp;
  12687. $1 = ((($0)) + 4|0);
  12688. $2 = HEAP32[$1>>2]|0;
  12689. $3 = ((($0)) + 8|0);
  12690. $4 = HEAP32[$3>>2]|0;
  12691. $5 = $2 << 2;
  12692. $6 = Math_imul($5, $4)|0;
  12693. $7 = (_malloc($6)|0);
  12694. $8 = HEAP32[$1>>2]|0;
  12695. $9 = Math_imul($4, $8)|0;
  12696. $10 = ($9|0)>(0);
  12697. if (!($10)) {
  12698. STACKTOP = sp;return ($7|0);
  12699. }
  12700. $11 = ((($0)) + 16|0);
  12701. $12 = HEAP32[$11>>2]|0;
  12702. $13 = HEAP32[$0>>2]|0;
  12703. $$0104105 = 0;$$0106 = 0;
  12704. while(1) {
  12705. switch ($12|0) {
  12706. case 1: {
  12707. $14 = (($13) + ($$0106)|0);
  12708. $15 = HEAP8[$14>>0]|0;
  12709. $16 = (($7) + ($$0104105<<2)|0);
  12710. HEAP8[$16>>0] = $15;
  12711. $17 = HEAP8[$14>>0]|0;
  12712. $18 = (((($7) + ($$0104105<<2)|0)) + 1|0);
  12713. HEAP8[$18>>0] = $17;
  12714. $19 = HEAP8[$14>>0]|0;
  12715. $20 = (((($7) + ($$0104105<<2)|0)) + 2|0);
  12716. HEAP8[$20>>0] = $19;
  12717. $21 = (((($7) + ($$0104105<<2)|0)) + 3|0);
  12718. HEAP8[$21>>0] = -1;
  12719. $22 = (($$0106) + 1)|0;
  12720. $$1 = $22;
  12721. break;
  12722. }
  12723. case 2: {
  12724. $23 = (($13) + ($$0106)|0);
  12725. $24 = HEAP8[$23>>0]|0;
  12726. $25 = (($7) + ($$0104105<<2)|0);
  12727. HEAP8[$25>>0] = $24;
  12728. $26 = HEAP8[$23>>0]|0;
  12729. $27 = (((($7) + ($$0104105<<2)|0)) + 1|0);
  12730. HEAP8[$27>>0] = $26;
  12731. $28 = HEAP8[$23>>0]|0;
  12732. $29 = (((($7) + ($$0104105<<2)|0)) + 2|0);
  12733. HEAP8[$29>>0] = $28;
  12734. $30 = (($$0106) + 1)|0;
  12735. $31 = (($13) + ($30)|0);
  12736. $32 = HEAP8[$31>>0]|0;
  12737. $33 = (((($7) + ($$0104105<<2)|0)) + 3|0);
  12738. HEAP8[$33>>0] = $32;
  12739. $34 = (($$0106) + 2)|0;
  12740. $$1 = $34;
  12741. break;
  12742. }
  12743. case 5: {
  12744. $35 = (($13) + ($$0106<<1)|0);
  12745. $36 = HEAP16[$35>>1]|0;
  12746. $37 = $36&65535;
  12747. $38 = $37 >>> 11;
  12748. $39 = (+($38|0));
  12749. $40 = $39 * 8.0;
  12750. $41 = (~~(($40))&255);
  12751. $42 = (($7) + ($$0104105<<2)|0);
  12752. HEAP8[$42>>0] = $41;
  12753. $43 = $37 >>> 6;
  12754. $44 = $43 & 31;
  12755. $45 = (+($44|0));
  12756. $46 = $45 * 8.0;
  12757. $47 = (~~(($46))&255);
  12758. $48 = (((($7) + ($$0104105<<2)|0)) + 1|0);
  12759. HEAP8[$48>>0] = $47;
  12760. $49 = $37 >>> 1;
  12761. $50 = $49 & 31;
  12762. $51 = (+($50|0));
  12763. $52 = $51 * 8.0;
  12764. $53 = (~~(($52))&255);
  12765. $54 = (((($7) + ($$0104105<<2)|0)) + 2|0);
  12766. HEAP8[$54>>0] = $53;
  12767. $55 = $37 & 1;
  12768. $56 = (0 - ($55))|0;
  12769. $57 = $56&255;
  12770. $58 = (((($7) + ($$0104105<<2)|0)) + 3|0);
  12771. HEAP8[$58>>0] = $57;
  12772. $59 = (($$0106) + 1)|0;
  12773. $$1 = $59;
  12774. break;
  12775. }
  12776. case 3: {
  12777. $60 = (($13) + ($$0106<<1)|0);
  12778. $61 = HEAP16[$60>>1]|0;
  12779. $62 = $61&65535;
  12780. $63 = $62 >>> 11;
  12781. $64 = (+($63|0));
  12782. $65 = $64 * 8.0;
  12783. $66 = (~~(($65))&255);
  12784. $67 = (($7) + ($$0104105<<2)|0);
  12785. HEAP8[$67>>0] = $66;
  12786. $68 = $62 >>> 5;
  12787. $69 = $68 & 63;
  12788. $70 = (+($69|0));
  12789. $71 = $70 * 4.0;
  12790. $72 = (~~(($71))&255);
  12791. $73 = (((($7) + ($$0104105<<2)|0)) + 1|0);
  12792. HEAP8[$73>>0] = $72;
  12793. $74 = $62 & 31;
  12794. $75 = (+($74|0));
  12795. $76 = $75 * 8.0;
  12796. $77 = (~~(($76))&255);
  12797. $78 = (((($7) + ($$0104105<<2)|0)) + 2|0);
  12798. HEAP8[$78>>0] = $77;
  12799. $79 = (((($7) + ($$0104105<<2)|0)) + 3|0);
  12800. HEAP8[$79>>0] = -1;
  12801. $80 = (($$0106) + 1)|0;
  12802. $$1 = $80;
  12803. break;
  12804. }
  12805. case 6: {
  12806. $81 = (($13) + ($$0106<<1)|0);
  12807. $82 = HEAP16[$81>>1]|0;
  12808. $83 = $82&65535;
  12809. $84 = $83 >>> 12;
  12810. $85 = (+($84|0));
  12811. $86 = $85 * 17.0;
  12812. $87 = (~~(($86))&255);
  12813. $88 = (($7) + ($$0104105<<2)|0);
  12814. HEAP8[$88>>0] = $87;
  12815. $89 = $83 >>> 8;
  12816. $90 = $89 & 15;
  12817. $91 = (+($90|0));
  12818. $92 = $91 * 17.0;
  12819. $93 = (~~(($92))&255);
  12820. $94 = (((($7) + ($$0104105<<2)|0)) + 1|0);
  12821. HEAP8[$94>>0] = $93;
  12822. $95 = $83 >>> 4;
  12823. $96 = $95 & 15;
  12824. $97 = (+($96|0));
  12825. $98 = $97 * 17.0;
  12826. $99 = (~~(($98))&255);
  12827. $100 = (((($7) + ($$0104105<<2)|0)) + 2|0);
  12828. HEAP8[$100>>0] = $99;
  12829. $101 = $83 & 15;
  12830. $102 = (+($101|0));
  12831. $103 = $102 * 17.0;
  12832. $104 = (~~(($103))&255);
  12833. $105 = (((($7) + ($$0104105<<2)|0)) + 3|0);
  12834. HEAP8[$105>>0] = $104;
  12835. $106 = (($$0106) + 1)|0;
  12836. $$1 = $106;
  12837. break;
  12838. }
  12839. case 7: {
  12840. $107 = (($13) + ($$0106)|0);
  12841. $108 = HEAP8[$107>>0]|0;
  12842. $109 = (($7) + ($$0104105<<2)|0);
  12843. HEAP8[$109>>0] = $108;
  12844. $110 = (($$0106) + 1)|0;
  12845. $111 = (($13) + ($110)|0);
  12846. $112 = HEAP8[$111>>0]|0;
  12847. $113 = (((($7) + ($$0104105<<2)|0)) + 1|0);
  12848. HEAP8[$113>>0] = $112;
  12849. $114 = (($$0106) + 2)|0;
  12850. $115 = (($13) + ($114)|0);
  12851. $116 = HEAP8[$115>>0]|0;
  12852. $117 = (((($7) + ($$0104105<<2)|0)) + 2|0);
  12853. HEAP8[$117>>0] = $116;
  12854. $118 = (($$0106) + 3)|0;
  12855. $119 = (($13) + ($118)|0);
  12856. $120 = HEAP8[$119>>0]|0;
  12857. $121 = (((($7) + ($$0104105<<2)|0)) + 3|0);
  12858. HEAP8[$121>>0] = $120;
  12859. $122 = (($$0106) + 4)|0;
  12860. $$1 = $122;
  12861. break;
  12862. }
  12863. case 4: {
  12864. $123 = (($13) + ($$0106)|0);
  12865. $124 = HEAP8[$123>>0]|0;
  12866. $125 = (($7) + ($$0104105<<2)|0);
  12867. HEAP8[$125>>0] = $124;
  12868. $126 = (($$0106) + 1)|0;
  12869. $127 = (($13) + ($126)|0);
  12870. $128 = HEAP8[$127>>0]|0;
  12871. $129 = (((($7) + ($$0104105<<2)|0)) + 1|0);
  12872. HEAP8[$129>>0] = $128;
  12873. $130 = (($$0106) + 2)|0;
  12874. $131 = (($13) + ($130)|0);
  12875. $132 = HEAP8[$131>>0]|0;
  12876. $133 = (((($7) + ($$0104105<<2)|0)) + 2|0);
  12877. HEAP8[$133>>0] = $132;
  12878. $134 = (((($7) + ($$0104105<<2)|0)) + 3|0);
  12879. HEAP8[$134>>0] = -1;
  12880. $135 = (($$0106) + 3)|0;
  12881. $$1 = $135;
  12882. break;
  12883. }
  12884. default: {
  12885. _TraceLog(2,5172,$vararg_buffer);
  12886. $$1 = $$0106;
  12887. }
  12888. }
  12889. $136 = (($$0104105) + 1)|0;
  12890. $137 = HEAP32[$1>>2]|0;
  12891. $138 = HEAP32[$3>>2]|0;
  12892. $139 = Math_imul($138, $137)|0;
  12893. $140 = ($136|0)<($139|0);
  12894. if ($140) {
  12895. $$0104105 = $136;$$0106 = $$1;
  12896. } else {
  12897. break;
  12898. }
  12899. }
  12900. STACKTOP = sp;return ($7|0);
  12901. }
  12902. function _ErrorCallback($0,$1) {
  12903. $0 = $0|0;
  12904. $1 = $1|0;
  12905. var $vararg_buffer = 0, $vararg_ptr1 = 0, label = 0, sp = 0;
  12906. sp = STACKTOP;
  12907. STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
  12908. $vararg_buffer = sp;
  12909. HEAP32[$vararg_buffer>>2] = $0;
  12910. $vararg_ptr1 = ((($vararg_buffer)) + 4|0);
  12911. HEAP32[$vararg_ptr1>>2] = $1;
  12912. _TraceLog(2,9038,$vararg_buffer);
  12913. STACKTOP = sp;return;
  12914. }
  12915. function _rlGetVersion() {
  12916. var label = 0, sp = 0;
  12917. sp = STACKTOP;
  12918. return 4;
  12919. }
  12920. function _SetupFramebufferSize($0,$1) {
  12921. $0 = $0|0;
  12922. $1 = $1|0;
  12923. var $$sink = 0, $$sink1 = 0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0, $14 = 0.0, $15 = 0.0, $16 = 0, $17 = 0, $18 = 0.0, $19 = 0.0, $2 = 0, $20 = 0, $21 = 0, $22 = 0.0, $23 = 0, $24 = 0, $25 = 0, $26 = 0.0;
  12924. var $27 = 0, $28 = 0.0, $29 = 0.0, $3 = 0, $30 = 0, $31 = 0, $32 = 0.0, $33 = 0.0, $34 = 0.0, $35 = 0, $36 = 0.0, $37 = 0, $38 = 0.0, $39 = 0.0, $4 = 0, $40 = 0, $41 = 0.0, $42 = 0, $43 = 0, $44 = 0.0;
  12925. var $45 = 0, $46 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0.0, $9 = 0, $or$cond = 0, $roundf = 0.0, $roundf38 = 0.0, $roundf39 = 0.0, $roundf40 = 0.0, $vararg_buffer = 0, $vararg_buffer4 = 0, $vararg_buffer8 = 0, $vararg_ptr1 = 0, $vararg_ptr11 = 0, $vararg_ptr12 = 0, $vararg_ptr13 = 0, $vararg_ptr2 = 0;
  12926. var $vararg_ptr3 = 0, $vararg_ptr7 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
  12927. sp = STACKTOP;
  12928. STACKTOP = STACKTOP + 112|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(112|0);
  12929. $vararg_buffer8 = sp + 24|0;
  12930. $vararg_buffer4 = sp + 16|0;
  12931. $vararg_buffer = sp;
  12932. $2 = sp + 40|0;
  12933. $3 = HEAP32[4634]|0;
  12934. $4 = ($3|0)>($0|0);
  12935. if (!($4)) {
  12936. $5 = HEAP32[4633]|0;
  12937. $6 = ($5|0)>($1|0);
  12938. if (!($6)) {
  12939. $30 = ($3|0)<($0|0);
  12940. $31 = ($5|0)<($1|0);
  12941. $or$cond = $30 | $31;
  12942. if (!($or$cond)) {
  12943. HEAP32[4675] = $3;
  12944. HEAP32[4676] = $5;
  12945. HEAP32[4677] = 0;
  12946. HEAP32[4678] = 0;
  12947. STACKTOP = sp;return;
  12948. }
  12949. HEAP32[$vararg_buffer8>>2] = $3;
  12950. $vararg_ptr11 = ((($vararg_buffer8)) + 4|0);
  12951. HEAP32[$vararg_ptr11>>2] = $5;
  12952. $vararg_ptr12 = ((($vararg_buffer8)) + 8|0);
  12953. HEAP32[$vararg_ptr12>>2] = $0;
  12954. $vararg_ptr13 = ((($vararg_buffer8)) + 12|0);
  12955. HEAP32[$vararg_ptr13>>2] = $1;
  12956. _TraceLog(0,8972,$vararg_buffer8);
  12957. $32 = (+($0|0));
  12958. $33 = (+($1|0));
  12959. $34 = $32 / $33;
  12960. $35 = HEAP32[4634]|0;
  12961. $36 = (+($35|0));
  12962. $37 = HEAP32[4633]|0;
  12963. $38 = (+($37|0));
  12964. $39 = $36 / $38;
  12965. $40 = !($34 <= $39);
  12966. if ($40) {
  12967. $44 = $34 * $38;
  12968. $roundf = (+_roundf((+$44)));
  12969. $45 = (~~(($roundf)));
  12970. HEAP32[4675] = $45;
  12971. HEAP32[4676] = $37;
  12972. $46 = (($45) - ($35))|0;
  12973. HEAP32[4677] = $46;
  12974. $$sink1 = 0;
  12975. } else {
  12976. HEAP32[4675] = $35;
  12977. $41 = $36 / $34;
  12978. $roundf38 = (+_roundf((+$41)));
  12979. $42 = (~~(($roundf38)));
  12980. HEAP32[4676] = $42;
  12981. HEAP32[4677] = 0;
  12982. $43 = (($42) - ($37))|0;
  12983. $$sink1 = $43;
  12984. }
  12985. HEAP32[4678] = $$sink1;
  12986. STACKTOP = sp;return;
  12987. }
  12988. }
  12989. $7 = HEAP32[4633]|0;
  12990. HEAP32[$vararg_buffer>>2] = $3;
  12991. $vararg_ptr1 = ((($vararg_buffer)) + 4|0);
  12992. HEAP32[$vararg_ptr1>>2] = $7;
  12993. $vararg_ptr2 = ((($vararg_buffer)) + 8|0);
  12994. HEAP32[$vararg_ptr2>>2] = $0;
  12995. $vararg_ptr3 = ((($vararg_buffer)) + 12|0);
  12996. HEAP32[$vararg_ptr3>>2] = $1;
  12997. _TraceLog(2,8829,$vararg_buffer);
  12998. $8 = (+($0|0));
  12999. $9 = HEAP32[4634]|0;
  13000. $10 = (+($9|0));
  13001. $11 = $8 / $10;
  13002. $12 = (+($1|0));
  13003. $13 = HEAP32[4633]|0;
  13004. $14 = (+($13|0));
  13005. $15 = $12 / $14;
  13006. $16 = !($11 <= $15);
  13007. if ($16) {
  13008. $22 = $10 * $15;
  13009. $roundf39 = (+_roundf((+$22)));
  13010. $23 = (~~(($roundf39)));
  13011. HEAP32[4675] = $23;
  13012. HEAP32[4676] = $1;
  13013. $24 = (($0) - ($23))|0;
  13014. HEAP32[4677] = $24;
  13015. $$sink = 0;
  13016. } else {
  13017. HEAP32[4675] = $0;
  13018. $17 = HEAP32[4633]|0;
  13019. $18 = (+($17|0));
  13020. $19 = $11 * $18;
  13021. $roundf40 = (+_roundf((+$19)));
  13022. $20 = (~~(($roundf40)));
  13023. HEAP32[4676] = $20;
  13024. HEAP32[4677] = 0;
  13025. $21 = (($1) - ($20))|0;
  13026. $$sink = $21;
  13027. }
  13028. HEAP32[4678] = $$sink;
  13029. $25 = HEAP32[4675]|0;
  13030. $26 = (+($25|0));
  13031. $27 = HEAP32[4634]|0;
  13032. $28 = (+($27|0));
  13033. $29 = $26 / $28;
  13034. _MatrixScale($2,$29,$29,$29);
  13035. dest=18624; src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  13036. HEAP32[4675] = $0;
  13037. HEAP32[4676] = $1;
  13038. HEAP32[$vararg_buffer4>>2] = $0;
  13039. $vararg_ptr7 = ((($vararg_buffer4)) + 4|0);
  13040. HEAP32[$vararg_ptr7>>2] = $1;
  13041. _TraceLog(2,8907,$vararg_buffer4);
  13042. STACKTOP = sp;return;
  13043. }
  13044. function _WindowSizeCallback($0,$1,$2) {
  13045. $0 = $0|0;
  13046. $1 = $1|0;
  13047. $2 = $2|0;
  13048. var $3 = 0.0, $4 = 0.0, label = 0, sp = 0;
  13049. sp = STACKTOP;
  13050. _rlViewport(0,0,$1,$2);
  13051. _rlMatrixMode(5889);
  13052. _rlLoadIdentity();
  13053. $3 = (+($1|0));
  13054. $4 = (+($2|0));
  13055. _rlOrtho(0.0,$3,$4,0.0,0.0,1.0);
  13056. _rlMatrixMode(5888);
  13057. _rlLoadIdentity();
  13058. _rlClearScreenBuffers();
  13059. HEAP32[4634] = $1;
  13060. HEAP32[4633] = $2;
  13061. HEAP32[4675] = $1;
  13062. HEAP32[4676] = $2;
  13063. return;
  13064. }
  13065. function _CursorEnterCallback($0,$1) {
  13066. $0 = $0|0;
  13067. $1 = $1|0;
  13068. var label = 0, sp = 0;
  13069. sp = STACKTOP;
  13070. return;
  13071. }
  13072. function _KeyCallback($0,$1,$2,$3,$4) {
  13073. $0 = $0|0;
  13074. $1 = $1|0;
  13075. $2 = $2|0;
  13076. $3 = $3|0;
  13077. $4 = $4|0;
  13078. var $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, label = 0, sp = 0;
  13079. sp = STACKTOP;
  13080. $5 = HEAP32[752]|0;
  13081. $6 = ($5|0)==($1|0);
  13082. $7 = ($3|0)==(1);
  13083. $or$cond = $7 & $6;
  13084. if ($or$cond) {
  13085. _glfwSetWindowShouldClose(($0|0),1);
  13086. return;
  13087. }
  13088. $8 = $3&255;
  13089. $9 = (21375 + ($1)|0);
  13090. HEAP8[$9>>0] = $8;
  13091. if (!($7)) {
  13092. return;
  13093. }
  13094. HEAP32[751] = $1;
  13095. return;
  13096. }
  13097. function _MouseButtonCallback($0,$1,$2,$3) {
  13098. $0 = $0|0;
  13099. $1 = $1|0;
  13100. $2 = $2|0;
  13101. $3 = $3|0;
  13102. var $$byval_copy = 0, $$sink = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0.0, $27 = 0.0;
  13103. var $28 = 0.0, $29 = 0, $30 = 0.0, $31 = 0, $32 = 0.0, $33 = 0.0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
  13104. sp = STACKTOP;
  13105. STACKTOP = STACKTOP + 128|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(128|0);
  13106. $$byval_copy = sp + 64|0;
  13107. $4 = sp + 8|0;
  13108. $5 = sp;
  13109. $6 = $2&255;
  13110. $7 = (21369 + ($1)|0);
  13111. HEAP8[$7>>0] = $6;
  13112. $8 = (_IsMouseButtonPressed(0)|0);
  13113. $9 = ($8|0)==(0);
  13114. if ($9) {
  13115. $10 = (_IsMouseButtonReleased(0)|0);
  13116. $11 = ($10|0)==(0);
  13117. if (!($11)) {
  13118. $$sink = 0;
  13119. label = 3;
  13120. }
  13121. } else {
  13122. $$sink = 1;
  13123. label = 3;
  13124. }
  13125. if ((label|0) == 3) {
  13126. HEAP32[$4>>2] = $$sink;
  13127. }
  13128. $12 = ((($4)) + 8|0);
  13129. HEAP32[$12>>2] = 0;
  13130. $13 = ((($4)) + 4|0);
  13131. HEAP32[$13>>2] = 1;
  13132. $14 = ((($4)) + 24|0);
  13133. _GetMousePosition($5);
  13134. $15 = $5;
  13135. $16 = $15;
  13136. $17 = HEAP32[$16>>2]|0;
  13137. $18 = (($15) + 4)|0;
  13138. $19 = $18;
  13139. $20 = HEAP32[$19>>2]|0;
  13140. $21 = $14;
  13141. $22 = $21;
  13142. HEAP32[$22>>2] = $17;
  13143. $23 = (($21) + 4)|0;
  13144. $24 = $23;
  13145. HEAP32[$24>>2] = $20;
  13146. $25 = (_GetScreenWidth()|0);
  13147. $26 = (+($25|0));
  13148. $27 = +HEAPF32[$14>>2];
  13149. $28 = $27 / $26;
  13150. HEAPF32[$14>>2] = $28;
  13151. $29 = (_GetScreenHeight()|0);
  13152. $30 = (+($29|0));
  13153. $31 = ((($4)) + 28|0);
  13154. $32 = +HEAPF32[$31>>2];
  13155. $33 = $32 / $30;
  13156. HEAPF32[$31>>2] = $33;
  13157. dest=$$byval_copy; src=$4; stop=dest+56|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  13158. _ProcessGestureEvent($$byval_copy);
  13159. STACKTOP = sp;return;
  13160. }
  13161. function _MouseCursorPosCallback($0,$1,$2) {
  13162. $0 = $0|0;
  13163. $1 = +$1;
  13164. $2 = +$2;
  13165. var $$byval_copy = 0, $$sroa$0$0$$sroa_idx = 0, $$sroa$2$0$$sroa_idx1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0.0, $21 = 0.0, $22 = 0.0, $23 = 0, $24 = 0.0, $25 = 0.0, $26 = 0.0;
  13166. var $3 = 0, $4 = 0, $5 = 0, $6 = 0.0, $7 = 0.0, $8 = 0, $9 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
  13167. sp = STACKTOP;
  13168. STACKTOP = STACKTOP + 112|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(112|0);
  13169. $$byval_copy = sp + 56|0;
  13170. $3 = sp;
  13171. HEAP32[$3>>2] = 2;
  13172. $4 = ((($3)) + 8|0);
  13173. HEAP32[$4>>2] = 0;
  13174. $5 = ((($3)) + 4|0);
  13175. HEAP32[$5>>2] = 1;
  13176. $6 = $1;
  13177. $7 = $2;
  13178. $$sroa$0$0$$sroa_idx = ((($3)) + 24|0);
  13179. HEAPF32[$$sroa$0$0$$sroa_idx>>2] = $6;
  13180. $$sroa$2$0$$sroa_idx1 = ((($3)) + 28|0);
  13181. HEAPF32[$$sroa$2$0$$sroa_idx1>>2] = $7;
  13182. $8 = ((($3)) + 24|0);
  13183. $9 = $8;
  13184. $10 = $9;
  13185. $11 = HEAP32[$10>>2]|0;
  13186. $12 = (($9) + 4)|0;
  13187. $13 = $12;
  13188. $14 = HEAP32[$13>>2]|0;
  13189. $15 = 18008;
  13190. $16 = $15;
  13191. HEAP32[$16>>2] = $11;
  13192. $17 = (($15) + 4)|0;
  13193. $18 = $17;
  13194. HEAP32[$18>>2] = $14;
  13195. $19 = (_GetScreenWidth()|0);
  13196. $20 = (+($19|0));
  13197. $21 = +HEAPF32[$8>>2];
  13198. $22 = $21 / $20;
  13199. HEAPF32[$8>>2] = $22;
  13200. $23 = (_GetScreenHeight()|0);
  13201. $24 = (+($23|0));
  13202. $25 = +HEAPF32[$$sroa$2$0$$sroa_idx1>>2];
  13203. $26 = $25 / $24;
  13204. HEAPF32[$$sroa$2$0$$sroa_idx1>>2] = $26;
  13205. dest=$$byval_copy; src=$3; stop=dest+56|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  13206. _ProcessGestureEvent($$byval_copy);
  13207. STACKTOP = sp;return;
  13208. }
  13209. function _CharCallback($0,$1) {
  13210. $0 = $0|0;
  13211. $1 = $1|0;
  13212. var label = 0, sp = 0;
  13213. sp = STACKTOP;
  13214. HEAP32[751] = $1;
  13215. return;
  13216. }
  13217. function _ScrollCallback($0,$1,$2) {
  13218. $0 = $0|0;
  13219. $1 = +$1;
  13220. $2 = +$2;
  13221. var $3 = 0, label = 0, sp = 0;
  13222. sp = STACKTOP;
  13223. $3 = (~~(($2)));
  13224. HEAP32[5048] = $3;
  13225. return;
  13226. }
  13227. function _WindowIconifyCallback($0,$1) {
  13228. $0 = $0|0;
  13229. $1 = $1|0;
  13230. var $$sink = 0, $2 = 0, label = 0, sp = 0;
  13231. sp = STACKTOP;
  13232. $2 = ($1|0)!=(0);
  13233. $$sink = $2&1;
  13234. HEAP32[5047] = $$sink;
  13235. return;
  13236. }
  13237. function _rlglInit($0,$1) {
  13238. $0 = $0|0;
  13239. $1 = $1|0;
  13240. var $$05965 = 0, $$06066 = 0, $$06167 = 0, $$062 = 0, $$sink63 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0;
  13241. var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0;
  13242. var $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0;
  13243. var $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0.0, $72 = 0.0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0;
  13244. var $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $9 = 0, $exitcond = 0, $exitcond69 = 0, $exitcond70 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer10 = 0, $vararg_buffer13 = 0, $vararg_buffer15 = 0, $vararg_buffer17 = 0, $vararg_buffer19 = 0;
  13245. var $vararg_buffer21 = 0, $vararg_buffer23 = 0, $vararg_buffer25 = 0, $vararg_buffer27 = 0, $vararg_buffer29 = 0, $vararg_buffer31 = 0, $vararg_buffer34 = 0, $vararg_buffer36 = 0, $vararg_buffer39 = 0, $vararg_buffer4 = 0, $vararg_buffer41 = 0, $vararg_buffer7 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
  13246. sp = STACKTOP;
  13247. STACKTOP = STACKTOP + 2464|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(2464|0);
  13248. $vararg_buffer41 = sp + 2184|0;
  13249. $vararg_buffer39 = sp + 2176|0;
  13250. $vararg_buffer36 = sp + 2168|0;
  13251. $vararg_buffer34 = sp + 2160|0;
  13252. $vararg_buffer31 = sp + 2152|0;
  13253. $vararg_buffer29 = sp + 2144|0;
  13254. $vararg_buffer27 = sp + 2136|0;
  13255. $vararg_buffer25 = sp + 2128|0;
  13256. $vararg_buffer23 = sp + 2120|0;
  13257. $vararg_buffer21 = sp + 2112|0;
  13258. $vararg_buffer19 = sp + 2104|0;
  13259. $vararg_buffer17 = sp + 2096|0;
  13260. $vararg_buffer15 = sp + 2088|0;
  13261. $vararg_buffer13 = sp + 2080|0;
  13262. $vararg_buffer10 = sp + 2072|0;
  13263. $vararg_buffer7 = sp + 24|0;
  13264. $vararg_buffer4 = sp + 16|0;
  13265. $vararg_buffer1 = sp + 8|0;
  13266. $vararg_buffer = sp;
  13267. $2 = sp + 2400|0;
  13268. $3 = sp + 2384|0;
  13269. $4 = sp + 2320|0;
  13270. $5 = sp + 2256|0;
  13271. $6 = sp + 2192|0;
  13272. $7 = (_glGetString(7936)|0);
  13273. HEAP32[$vararg_buffer>>2] = $7;
  13274. _TraceLog(0,5470,$vararg_buffer);
  13275. $8 = (_glGetString(7937)|0);
  13276. HEAP32[$vararg_buffer1>>2] = $8;
  13277. _TraceLog(0,5488,$vararg_buffer1);
  13278. $9 = (_glGetString(7938)|0);
  13279. HEAP32[$vararg_buffer4>>2] = $9;
  13280. _TraceLog(0,5506,$vararg_buffer4);
  13281. $10 = (_glGetString(35724)|0);
  13282. HEAP32[$vararg_buffer7>>2] = $10;
  13283. _TraceLog(0,5524,$vararg_buffer7);
  13284. $11 = (_glGetString(7939)|0);
  13285. $12 = (_strlen($11)|0);
  13286. $13 = (($12) + 1)|0;
  13287. $14 = (_malloc($13)|0);
  13288. _memcpy(($14|0),($11|0),($13|0))|0;
  13289. $$062 = 0;$$sink63 = $14;
  13290. while(1) {
  13291. $15 = (_strtok($$sink63,5542)|0);
  13292. $16 = (($vararg_buffer7) + ($$062<<2)|0);
  13293. HEAP32[$16>>2] = $15;
  13294. $17 = ($15|0)==(0|0);
  13295. $18 = (($$062) + 1)|0;
  13296. if ($17) {
  13297. break;
  13298. } else {
  13299. $$062 = $18;$$sink63 = 0;
  13300. }
  13301. }
  13302. _free($14);
  13303. $19 = (($$062) + -1)|0;
  13304. HEAP32[$vararg_buffer10>>2] = $19;
  13305. _TraceLog(0,5544,$vararg_buffer10);
  13306. $20 = ($$062|0)>(1);
  13307. if ($20) {
  13308. $$06167 = 0;
  13309. while(1) {
  13310. $23 = (($vararg_buffer7) + ($$06167<<2)|0);
  13311. $24 = HEAP32[$23>>2]|0;
  13312. $25 = (_strcmp($24,5579)|0);
  13313. $26 = ($25|0)==(0);
  13314. if ($26) {
  13315. HEAP32[4713] = 1;
  13316. $27 = (_eglGetProcAddress((5606|0))|0);
  13317. HEAP32[4714] = $27;
  13318. $28 = (_eglGetProcAddress((5627|0))|0);
  13319. HEAP32[4715] = $28;
  13320. $29 = (_eglGetProcAddress((5648|0))|0);
  13321. HEAP32[4716] = $29;
  13322. }
  13323. $30 = (_strcmp($24,5672)|0);
  13324. $31 = ($30|0)==(0);
  13325. if ($31) {
  13326. HEAP32[4655] = 1;
  13327. }
  13328. $32 = (_strcmp($24,5692)|0);
  13329. $33 = ($32|0)==(0);
  13330. if ($33) {
  13331. label = 12;
  13332. } else {
  13333. $34 = HEAP32[$23>>2]|0;
  13334. $35 = (_strcmp($34,5724)|0);
  13335. $36 = ($35|0)==(0);
  13336. if ($36) {
  13337. label = 12;
  13338. } else {
  13339. $37 = (_strcmp($34,5757)|0);
  13340. $38 = ($37|0)==(0);
  13341. if ($38) {
  13342. label = 12;
  13343. }
  13344. }
  13345. }
  13346. if ((label|0) == 12) {
  13347. label = 0;
  13348. HEAP32[4650] = 1;
  13349. }
  13350. $39 = (_strcmp($24,5797)|0);
  13351. $40 = ($39|0)==(0);
  13352. if ($40) {
  13353. label = 15;
  13354. } else {
  13355. $41 = HEAP32[$23>>2]|0;
  13356. $42 = (_strcmp($41,5833)|0);
  13357. $43 = ($42|0)==(0);
  13358. if ($43) {
  13359. label = 15;
  13360. }
  13361. }
  13362. if ((label|0) == 15) {
  13363. label = 0;
  13364. HEAP32[4651] = 1;
  13365. }
  13366. $44 = HEAP32[$23>>2]|0;
  13367. $45 = (_strcmp($44,5866)|0);
  13368. $46 = ($45|0)==(0);
  13369. if ($46) {
  13370. HEAP32[4652] = 1;
  13371. }
  13372. $47 = (_strcmp($44,5891)|0);
  13373. $48 = ($47|0)==(0);
  13374. if ($48) {
  13375. HEAP32[4653] = 1;
  13376. }
  13377. $49 = (_strcmp($44,5924)|0);
  13378. $50 = ($49|0)==(0);
  13379. if ($50) {
  13380. HEAP32[4654] = 1;
  13381. }
  13382. $51 = (_strcmp($44,5960)|0);
  13383. $52 = ($51|0)==(0);
  13384. if ($52) {
  13385. HEAP32[4717] = 1;
  13386. _glGetFloatv(34047,(18872|0));
  13387. }
  13388. $53 = HEAP32[$23>>2]|0;
  13389. $54 = (_strcmp($53,5994)|0);
  13390. $55 = ($54|0)==(0);
  13391. if ($55) {
  13392. HEAP32[4719] = 1;
  13393. }
  13394. $56 = (($$06167) + 1)|0;
  13395. $exitcond70 = ($56|0)==($19|0);
  13396. if ($exitcond70) {
  13397. break;
  13398. } else {
  13399. $$06167 = $56;
  13400. }
  13401. }
  13402. }
  13403. $21 = HEAP32[4713]|0;
  13404. $22 = ($21|0)==(0);
  13405. if ($22) {
  13406. _TraceLog(2,6097,$vararg_buffer15);
  13407. } else {
  13408. _TraceLog(0,6022,$vararg_buffer13);
  13409. }
  13410. $57 = HEAP32[4655]|0;
  13411. $58 = ($57|0)==(0);
  13412. if ($58) {
  13413. _TraceLog(2,6233,$vararg_buffer19);
  13414. } else {
  13415. _TraceLog(0,6158,$vararg_buffer17);
  13416. }
  13417. $59 = HEAP32[4650]|0;
  13418. $60 = ($59|0)==(0);
  13419. if (!($60)) {
  13420. _TraceLog(0,6325,$vararg_buffer21);
  13421. }
  13422. $61 = HEAP32[4651]|0;
  13423. $62 = ($61|0)==(0);
  13424. if (!($62)) {
  13425. _TraceLog(0,6371,$vararg_buffer23);
  13426. }
  13427. $63 = HEAP32[4652]|0;
  13428. $64 = ($63|0)==(0);
  13429. if (!($64)) {
  13430. _TraceLog(0,6418,$vararg_buffer25);
  13431. }
  13432. $65 = HEAP32[4653]|0;
  13433. $66 = ($65|0)==(0);
  13434. if (!($66)) {
  13435. _TraceLog(0,6469,$vararg_buffer27);
  13436. }
  13437. $67 = HEAP32[4654]|0;
  13438. $68 = ($67|0)==(0);
  13439. if (!($68)) {
  13440. _TraceLog(0,6516,$vararg_buffer29);
  13441. }
  13442. $69 = HEAP32[4717]|0;
  13443. $70 = ($69|0)==(0);
  13444. if (!($70)) {
  13445. $71 = +HEAPF32[4718];
  13446. $72 = $71;
  13447. HEAPF64[$vararg_buffer31>>3] = $72;
  13448. _TraceLog(0,6563,$vararg_buffer31);
  13449. }
  13450. $73 = HEAP32[4719]|0;
  13451. $74 = ($73|0)==(0);
  13452. if (!($74)) {
  13453. _TraceLog(0,6629,$vararg_buffer34);
  13454. }
  13455. HEAP32[$vararg_buffer10>>2] = -1;
  13456. $75 = (_rlglLoadTexture($vararg_buffer10,1,1,7,1)|0);
  13457. HEAP32[4720] = $75;
  13458. $76 = ($75|0)==(0);
  13459. if ($76) {
  13460. _TraceLog(2,6733,$vararg_buffer39);
  13461. } else {
  13462. HEAP32[$vararg_buffer36>>2] = $75;
  13463. _TraceLog(0,6682,$vararg_buffer36);
  13464. }
  13465. _LoadDefaultShader($2);
  13466. dest=18884; src=$2; stop=dest+56|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  13467. dest=18940; src=$2; stop=dest+56|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  13468. _LoadDefaultBuffers();
  13469. $77 = (_malloc(49152)|0);
  13470. HEAP32[4749] = $77;
  13471. $$06066 = 0;
  13472. while(1) {
  13473. $79 = HEAP32[4749]|0;
  13474. $80 = (($79) + (($$06066*12)|0)|0);
  13475. _VectorZero($3);
  13476. ;HEAP32[$80>>2]=HEAP32[$3>>2]|0;HEAP32[$80+4>>2]=HEAP32[$3+4>>2]|0;HEAP32[$80+8>>2]=HEAP32[$3+8>>2]|0;
  13477. $81 = (($$06066) + 1)|0;
  13478. $exitcond69 = ($81|0)==(4096);
  13479. if ($exitcond69) {
  13480. break;
  13481. } else {
  13482. $$06066 = $81;
  13483. }
  13484. }
  13485. $78 = (_malloc(36864)|0);
  13486. HEAP32[4750] = $78;
  13487. $$05965 = 0;
  13488. while(1) {
  13489. $82 = (((($78) + (($$05965*144)|0)|0)) + 8|0);
  13490. HEAP32[$82>>2] = 0;
  13491. $83 = (($78) + (($$05965*144)|0)|0);
  13492. HEAP32[$83>>2] = 0;
  13493. $84 = (($$05965) + 1)|0;
  13494. $exitcond = ($84|0)==(256);
  13495. if ($exitcond) {
  13496. break;
  13497. } else {
  13498. $$05965 = $84;
  13499. }
  13500. }
  13501. HEAP32[4751] = 1;
  13502. $85 = HEAP32[4720]|0;
  13503. $86 = ((($78)) + 8|0);
  13504. HEAP32[$86>>2] = $85;
  13505. HEAP32[4752] = 4;
  13506. _MatrixIdentity($4);
  13507. dest=19012; src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  13508. _MatrixIdentity($4);
  13509. dest=(19076); src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  13510. _MatrixIdentity($4);
  13511. dest=(19140); src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  13512. _MatrixIdentity($4);
  13513. dest=(19204); src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  13514. _MatrixIdentity($4);
  13515. dest=(19268); src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  13516. _MatrixIdentity($4);
  13517. dest=(19332); src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  13518. _MatrixIdentity($4);
  13519. dest=(19396); src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  13520. _MatrixIdentity($4);
  13521. dest=(19460); src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  13522. _MatrixIdentity($4);
  13523. dest=(19524); src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  13524. _MatrixIdentity($4);
  13525. dest=(19588); src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  13526. _MatrixIdentity($4);
  13527. dest=(19652); src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  13528. _MatrixIdentity($4);
  13529. dest=(19716); src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  13530. _MatrixIdentity($4);
  13531. dest=(19780); src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  13532. _MatrixIdentity($4);
  13533. dest=(19844); src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  13534. _MatrixIdentity($4);
  13535. dest=(19908); src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  13536. _MatrixIdentity($4);
  13537. dest=(19972); src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  13538. _MatrixIdentity($5);
  13539. dest=18720; src=$5; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  13540. _MatrixIdentity($6);
  13541. dest=18784; src=$6; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  13542. HEAP32[4679] = 18784;
  13543. _glDepthFunc(515);
  13544. _glDisable(2929);
  13545. _glBlendFunc(770,771);
  13546. _glEnable(3042);
  13547. _glCullFace(1029);
  13548. _glFrontFace(2305);
  13549. _glEnable(2884);
  13550. _glClearColor(0.0,0.0,0.0,1.0);
  13551. _glClearDepthf(1.0);
  13552. _glClear(16640);
  13553. HEAP32[5009] = $0;
  13554. HEAP32[5010] = $1;
  13555. _TraceLog(0,6772,$vararg_buffer41);
  13556. STACKTOP = sp;return;
  13557. }
  13558. function _SetupViewport() {
  13559. var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, label = 0, sp = 0;
  13560. sp = STACKTOP;
  13561. $0 = HEAP32[4677]|0;
  13562. $1 = (($0|0) / 2)&-1;
  13563. $2 = HEAP32[4678]|0;
  13564. $3 = (($2|0) / 2)&-1;
  13565. $4 = HEAP32[4675]|0;
  13566. $5 = (($4) - ($0))|0;
  13567. $6 = HEAP32[4676]|0;
  13568. $7 = (($6) - ($2))|0;
  13569. _rlViewport($1,$3,$5,$7);
  13570. return;
  13571. }
  13572. function _rlMatrixMode($0) {
  13573. $0 = $0|0;
  13574. var $modelview$sink = 0, label = 0, sp = 0;
  13575. sp = STACKTOP;
  13576. switch ($0|0) {
  13577. case 5889: {
  13578. $modelview$sink = 18720;
  13579. label = 3;
  13580. break;
  13581. }
  13582. case 5888: {
  13583. $modelview$sink = 18784;
  13584. label = 3;
  13585. break;
  13586. }
  13587. default: {
  13588. }
  13589. }
  13590. if ((label|0) == 3) {
  13591. HEAP32[4679] = $modelview$sink;
  13592. }
  13593. HEAP32[4712] = $0;
  13594. return;
  13595. }
  13596. function _rlLoadIdentity() {
  13597. var $0 = 0, $1 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
  13598. sp = STACKTOP;
  13599. STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(64|0);
  13600. $0 = sp;
  13601. $1 = HEAP32[4679]|0;
  13602. _MatrixIdentity($0);
  13603. dest=$1; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  13604. STACKTOP = sp;return;
  13605. }
  13606. function _rlOrtho($0,$1,$2,$3,$4,$5) {
  13607. $0 = +$0;
  13608. $1 = +$1;
  13609. $2 = +$2;
  13610. $3 = +$3;
  13611. $4 = +$4;
  13612. $5 = +$5;
  13613. var $$byval_copy = 0, $$byval_copy1 = 0, $6 = 0, $7 = 0, $8 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
  13614. sp = STACKTOP;
  13615. STACKTOP = STACKTOP + 256|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(256|0);
  13616. $$byval_copy1 = sp + 192|0;
  13617. $$byval_copy = sp + 128|0;
  13618. $6 = sp + 64|0;
  13619. $7 = sp;
  13620. _MatrixOrtho($6,$0,$1,$2,$3,$4,$5);
  13621. _MatrixTranspose($6);
  13622. $8 = HEAP32[4679]|0;
  13623. dest=$$byval_copy; src=$8; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  13624. dest=$$byval_copy1; src=$6; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  13625. _MatrixMultiply($7,$$byval_copy,$$byval_copy1);
  13626. dest=$8; src=$7; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  13627. STACKTOP = sp;return;
  13628. }
  13629. function _ClearBackground($0) {
  13630. $0 = $0|0;
  13631. var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, label = 0, sp = 0;
  13632. sp = STACKTOP;
  13633. $1 = HEAP8[$0>>0]|0;
  13634. $2 = ((($0)) + 1|0);
  13635. $3 = HEAP8[$2>>0]|0;
  13636. $4 = ((($0)) + 2|0);
  13637. $5 = HEAP8[$4>>0]|0;
  13638. $6 = ((($0)) + 3|0);
  13639. $7 = HEAP8[$6>>0]|0;
  13640. _rlClearColor($1,$3,$5,$7);
  13641. return;
  13642. }
  13643. function _rlClearColor($0,$1,$2,$3) {
  13644. $0 = $0|0;
  13645. $1 = $1|0;
  13646. $2 = $2|0;
  13647. $3 = $3|0;
  13648. var $10 = 0.0, $11 = 0.0, $4 = 0.0, $5 = 0.0, $6 = 0.0, $7 = 0.0, $8 = 0.0, $9 = 0.0, label = 0, sp = 0;
  13649. sp = STACKTOP;
  13650. $4 = (+($0&255));
  13651. $5 = $4 / 255.0;
  13652. $6 = (+($1&255));
  13653. $7 = $6 / 255.0;
  13654. $8 = (+($2&255));
  13655. $9 = $8 / 255.0;
  13656. $10 = (+($3&255));
  13657. $11 = $10 / 255.0;
  13658. _glClearColor((+$5),(+$7),(+$9),(+$11));
  13659. return;
  13660. }
  13661. function _rlViewport($0,$1,$2,$3) {
  13662. $0 = $0|0;
  13663. $1 = $1|0;
  13664. $2 = $2|0;
  13665. $3 = $3|0;
  13666. var label = 0, sp = 0;
  13667. sp = STACKTOP;
  13668. _glViewport(($0|0),($1|0),($2|0),($3|0));
  13669. return;
  13670. }
  13671. function _LoadDefaultShader($0) {
  13672. $0 = $0|0;
  13673. var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
  13674. sp = STACKTOP;
  13675. STACKTOP = STACKTOP + 1008|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(1008|0);
  13676. $vararg_buffer1 = sp + 8|0;
  13677. $vararg_buffer = sp;
  13678. $1 = sp + 16|0;
  13679. $2 = sp + 513|0;
  13680. $3 = sp + 72|0;
  13681. _memcpy(($2|0),(7348|0),489)|0;
  13682. _memcpy(($3|0),(7837|0),441)|0;
  13683. $4 = (_LoadShaderProgram($2,$3)|0);
  13684. HEAP32[$1>>2] = $4;
  13685. $5 = ($4|0)==(0);
  13686. if ($5) {
  13687. HEAP32[$vararg_buffer1>>2] = $4;
  13688. _TraceLog(2,8326,$vararg_buffer1);
  13689. } else {
  13690. HEAP32[$vararg_buffer>>2] = $4;
  13691. _TraceLog(0,8278,$vararg_buffer);
  13692. }
  13693. $6 = HEAP32[$1>>2]|0;
  13694. $7 = ($6|0)==(0);
  13695. if (!($7)) {
  13696. _LoadDefaultShaderLocations($1);
  13697. }
  13698. dest=$0; src=$1; stop=dest+56|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  13699. STACKTOP = sp;return;
  13700. }
  13701. function _LoadDefaultBuffers() {
  13702. var $$05365 = 0, $$05467 = 0, $$05770 = 0, $$05972 = 0, $$066 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0;
  13703. var $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0;
  13704. var $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0;
  13705. var $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0;
  13706. var $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0;
  13707. var $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $exitcond = 0, $exitcond75 = 0, $exitcond78 = 0, $exitcond80 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer10 = 0, $vararg_buffer14 = 0, $vararg_buffer17 = 0;
  13708. var $vararg_buffer3 = 0, $vararg_buffer7 = 0, $vararg_ptr13 = 0, $vararg_ptr20 = 0, $vararg_ptr21 = 0, $vararg_ptr22 = 0, $vararg_ptr6 = 0, label = 0, sp = 0;
  13709. sp = STACKTOP;
  13710. STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(64|0);
  13711. $vararg_buffer17 = sp + 48|0;
  13712. $vararg_buffer14 = sp + 40|0;
  13713. $vararg_buffer10 = sp + 32|0;
  13714. $vararg_buffer7 = sp + 24|0;
  13715. $vararg_buffer3 = sp + 16|0;
  13716. $vararg_buffer1 = sp + 8|0;
  13717. $vararg_buffer = sp;
  13718. $0 = (_malloc(24576)|0);
  13719. HEAP32[(20056)>>2] = $0;
  13720. $1 = (_malloc(8192)|0);
  13721. HEAP32[(20064)>>2] = $1;
  13722. HEAP32[(20060)>>2] = 0;
  13723. HEAP32[(20068)>>2] = 0;
  13724. _memset(($0|0),0,24576)|0;
  13725. $$05972 = 0;
  13726. while(1) {
  13727. $2 = HEAP32[(20064)>>2]|0;
  13728. $3 = (($2) + ($$05972)|0);
  13729. HEAP8[$3>>0] = 0;
  13730. $4 = (($$05972) + 1)|0;
  13731. $exitcond80 = ($4|0)==(8192);
  13732. if ($exitcond80) {
  13733. break;
  13734. } else {
  13735. $$05972 = $4;
  13736. }
  13737. }
  13738. HEAP32[5011] = 0;
  13739. HEAP32[(20052)>>2] = 0;
  13740. HEAP32[(20048)>>2] = 0;
  13741. $5 = (_malloc(73728)|0);
  13742. HEAP32[(20104)>>2] = $5;
  13743. $6 = (_malloc(24576)|0);
  13744. HEAP32[(20112)>>2] = $6;
  13745. HEAP32[(20108)>>2] = 0;
  13746. HEAP32[(20116)>>2] = 0;
  13747. _memset(($5|0),0,73728)|0;
  13748. $$05770 = 0;
  13749. while(1) {
  13750. $7 = HEAP32[(20112)>>2]|0;
  13751. $8 = (($7) + ($$05770)|0);
  13752. HEAP8[$8>>0] = 0;
  13753. $9 = (($$05770) + 1)|0;
  13754. $exitcond78 = ($9|0)==(24576);
  13755. if ($exitcond78) {
  13756. break;
  13757. } else {
  13758. $$05770 = $9;
  13759. }
  13760. }
  13761. HEAP32[5023] = 0;
  13762. HEAP32[(20100)>>2] = 0;
  13763. HEAP32[(20096)>>2] = 0;
  13764. $10 = (_malloc(49152)|0);
  13765. HEAP32[(20152)>>2] = $10;
  13766. $11 = (_malloc(32768)|0);
  13767. HEAP32[(20156)>>2] = $11;
  13768. $12 = (_malloc(16384)|0);
  13769. HEAP32[(20160)>>2] = $12;
  13770. $13 = (_malloc(12288)|0);
  13771. HEAP32[(20164)>>2] = $13;
  13772. $14 = HEAP32[(20152)>>2]|0;
  13773. _memset(($14|0),0,49152)|0;
  13774. $15 = HEAP32[(20156)>>2]|0;
  13775. _memset(($15|0),0,32768)|0;
  13776. $$05467 = 0;
  13777. while(1) {
  13778. $17 = HEAP32[(20160)>>2]|0;
  13779. $18 = (($17) + ($$05467)|0);
  13780. HEAP8[$18>>0] = 0;
  13781. $19 = (($$05467) + 1)|0;
  13782. $exitcond75 = ($19|0)==(16384);
  13783. if ($exitcond75) {
  13784. break;
  13785. } else {
  13786. $$05467 = $19;
  13787. }
  13788. }
  13789. $16 = HEAP32[(20164)>>2]|0;
  13790. $$05365 = 0;$$066 = 0;
  13791. while(1) {
  13792. $22 = $$05365 << 2;
  13793. $23 = $22&65535;
  13794. $24 = (($16) + ($$066<<1)|0);
  13795. HEAP16[$24>>1] = $23;
  13796. $25 = $22 | 1;
  13797. $26 = $25&65535;
  13798. $27 = $$066 | 1;
  13799. $28 = (($16) + ($27<<1)|0);
  13800. HEAP16[$28>>1] = $26;
  13801. $29 = $22 | 2;
  13802. $30 = $29&65535;
  13803. $31 = (($$066) + 2)|0;
  13804. $32 = (($16) + ($31<<1)|0);
  13805. HEAP16[$32>>1] = $30;
  13806. $33 = (($$066) + 3)|0;
  13807. $34 = (($16) + ($33<<1)|0);
  13808. HEAP16[$34>>1] = $23;
  13809. $35 = (($$066) + 4)|0;
  13810. $36 = (($16) + ($35<<1)|0);
  13811. HEAP16[$36>>1] = $30;
  13812. $37 = $22 | 3;
  13813. $38 = $37&65535;
  13814. $39 = (($$066) + 5)|0;
  13815. $40 = (($16) + ($39<<1)|0);
  13816. HEAP16[$40>>1] = $38;
  13817. $41 = (($$05365) + 1)|0;
  13818. $42 = (($$066) + 6)|0;
  13819. $exitcond = ($41|0)==(1024);
  13820. if ($exitcond) {
  13821. break;
  13822. } else {
  13823. $$05365 = $41;$$066 = $42;
  13824. }
  13825. }
  13826. HEAP32[5035] = 0;
  13827. HEAP32[(20144)>>2] = 0;
  13828. HEAP32[(20148)>>2] = 0;
  13829. _TraceLog(0,6819,$vararg_buffer);
  13830. $20 = HEAP32[4713]|0;
  13831. $21 = ($20|0)==(0);
  13832. if (!($21)) {
  13833. $43 = HEAP32[4714]|0;
  13834. FUNCTION_TABLE_vii[$43 & 63](1,(20072));
  13835. $44 = HEAP32[4715]|0;
  13836. $45 = HEAP32[(20072)>>2]|0;
  13837. FUNCTION_TABLE_vi[$44 & 31]($45);
  13838. }
  13839. _glGenBuffers(2,((20076)|0));
  13840. $46 = HEAP32[(20076)>>2]|0;
  13841. _glBindBuffer(34962,($46|0));
  13842. $47 = HEAP32[(20056)>>2]|0;
  13843. _glBufferData(34962,24576,($47|0),35048);
  13844. $48 = HEAP32[(18944)>>2]|0;
  13845. _glEnableVertexAttribArray(($48|0));
  13846. $49 = HEAP32[(18944)>>2]|0;
  13847. _glVertexAttribPointer(($49|0),3,5126,0,0,(0|0));
  13848. _glGenBuffers(2,((20080)|0));
  13849. $50 = HEAP32[(20080)>>2]|0;
  13850. _glBindBuffer(34962,($50|0));
  13851. $51 = HEAP32[(20064)>>2]|0;
  13852. _glBufferData(34962,8192,($51|0),35048);
  13853. $52 = HEAP32[(18964)>>2]|0;
  13854. _glEnableVertexAttribArray(($52|0));
  13855. $53 = HEAP32[(18964)>>2]|0;
  13856. _glVertexAttribPointer(($53|0),4,5121,1,0,(0|0));
  13857. $54 = HEAP32[4713]|0;
  13858. $55 = ($54|0)==(0);
  13859. if ($55) {
  13860. $57 = HEAP32[(20076)>>2]|0;
  13861. $58 = HEAP32[(20080)>>2]|0;
  13862. HEAP32[$vararg_buffer3>>2] = $57;
  13863. $vararg_ptr6 = ((($vararg_buffer3)) + 4|0);
  13864. HEAP32[$vararg_ptr6>>2] = $58;
  13865. _TraceLog(0,6957,$vararg_buffer3);
  13866. } else {
  13867. $56 = HEAP32[(20072)>>2]|0;
  13868. HEAP32[$vararg_buffer1>>2] = $56;
  13869. _TraceLog(0,6892,$vararg_buffer1);
  13870. }
  13871. $59 = HEAP32[4713]|0;
  13872. $60 = ($59|0)==(0);
  13873. if (!($60)) {
  13874. $61 = HEAP32[4714]|0;
  13875. FUNCTION_TABLE_vii[$61 & 63](1,(20120));
  13876. $62 = HEAP32[4715]|0;
  13877. $63 = HEAP32[(20120)>>2]|0;
  13878. FUNCTION_TABLE_vi[$62 & 31]($63);
  13879. }
  13880. _glGenBuffers(1,((20124)|0));
  13881. $64 = HEAP32[(20124)>>2]|0;
  13882. _glBindBuffer(34962,($64|0));
  13883. $65 = HEAP32[(20104)>>2]|0;
  13884. _glBufferData(34962,73728,($65|0),35048);
  13885. $66 = HEAP32[(18944)>>2]|0;
  13886. _glEnableVertexAttribArray(($66|0));
  13887. $67 = HEAP32[(18944)>>2]|0;
  13888. _glVertexAttribPointer(($67|0),3,5126,0,0,(0|0));
  13889. _glGenBuffers(1,((20128)|0));
  13890. $68 = HEAP32[(20128)>>2]|0;
  13891. _glBindBuffer(34962,($68|0));
  13892. $69 = HEAP32[(20112)>>2]|0;
  13893. _glBufferData(34962,24576,($69|0),35048);
  13894. $70 = HEAP32[(18964)>>2]|0;
  13895. _glEnableVertexAttribArray(($70|0));
  13896. $71 = HEAP32[(18964)>>2]|0;
  13897. _glVertexAttribPointer(($71|0),4,5121,1,0,(0|0));
  13898. $72 = HEAP32[4713]|0;
  13899. $73 = ($72|0)==(0);
  13900. if ($73) {
  13901. $75 = HEAP32[(20124)>>2]|0;
  13902. $76 = HEAP32[(20128)>>2]|0;
  13903. HEAP32[$vararg_buffer10>>2] = $75;
  13904. $vararg_ptr13 = ((($vararg_buffer10)) + 4|0);
  13905. HEAP32[$vararg_ptr13>>2] = $76;
  13906. _TraceLog(0,7103,$vararg_buffer10);
  13907. } else {
  13908. $74 = HEAP32[(20120)>>2]|0;
  13909. HEAP32[$vararg_buffer7>>2] = $74;
  13910. _TraceLog(0,7034,$vararg_buffer7);
  13911. }
  13912. $77 = HEAP32[4713]|0;
  13913. $78 = ($77|0)==(0);
  13914. if (!($78)) {
  13915. $79 = HEAP32[4714]|0;
  13916. FUNCTION_TABLE_vii[$79 & 63](1,(20168));
  13917. $80 = HEAP32[4715]|0;
  13918. $81 = HEAP32[(20168)>>2]|0;
  13919. FUNCTION_TABLE_vi[$80 & 31]($81);
  13920. }
  13921. _glGenBuffers(1,((20172)|0));
  13922. $82 = HEAP32[(20172)>>2]|0;
  13923. _glBindBuffer(34962,($82|0));
  13924. $83 = HEAP32[(20152)>>2]|0;
  13925. _glBufferData(34962,49152,($83|0),35048);
  13926. $84 = HEAP32[(18944)>>2]|0;
  13927. _glEnableVertexAttribArray(($84|0));
  13928. $85 = HEAP32[(18944)>>2]|0;
  13929. _glVertexAttribPointer(($85|0),3,5126,0,0,(0|0));
  13930. _glGenBuffers(1,((20176)|0));
  13931. $86 = HEAP32[(20176)>>2]|0;
  13932. _glBindBuffer(34962,($86|0));
  13933. $87 = HEAP32[(20156)>>2]|0;
  13934. _glBufferData(34962,32768,($87|0),35048);
  13935. $88 = HEAP32[(18948)>>2]|0;
  13936. _glEnableVertexAttribArray(($88|0));
  13937. $89 = HEAP32[(18948)>>2]|0;
  13938. _glVertexAttribPointer(($89|0),2,5126,0,0,(0|0));
  13939. _glGenBuffers(1,((20180)|0));
  13940. $90 = HEAP32[(20180)>>2]|0;
  13941. _glBindBuffer(34962,($90|0));
  13942. $91 = HEAP32[(20160)>>2]|0;
  13943. _glBufferData(34962,16384,($91|0),35048);
  13944. $92 = HEAP32[(18964)>>2]|0;
  13945. _glEnableVertexAttribArray(($92|0));
  13946. $93 = HEAP32[(18964)>>2]|0;
  13947. _glVertexAttribPointer(($93|0),4,5121,1,0,(0|0));
  13948. _glGenBuffers(1,((20184)|0));
  13949. $94 = HEAP32[(20184)>>2]|0;
  13950. _glBindBuffer(34963,($94|0));
  13951. $95 = HEAP32[(20164)>>2]|0;
  13952. _glBufferData(34963,12288,($95|0),35044);
  13953. $96 = HEAP32[4713]|0;
  13954. $97 = ($96|0)==(0);
  13955. if ($97) {
  13956. $99 = HEAP32[(20172)>>2]|0;
  13957. $100 = HEAP32[(20176)>>2]|0;
  13958. $101 = HEAP32[(20180)>>2]|0;
  13959. $102 = HEAP32[(20184)>>2]|0;
  13960. HEAP32[$vararg_buffer17>>2] = $99;
  13961. $vararg_ptr20 = ((($vararg_buffer17)) + 4|0);
  13962. HEAP32[$vararg_ptr20>>2] = $100;
  13963. $vararg_ptr21 = ((($vararg_buffer17)) + 8|0);
  13964. HEAP32[$vararg_ptr21>>2] = $101;
  13965. $vararg_ptr22 = ((($vararg_buffer17)) + 12|0);
  13966. HEAP32[$vararg_ptr22>>2] = $102;
  13967. _TraceLog(0,7249,$vararg_buffer17);
  13968. } else {
  13969. $98 = HEAP32[(20168)>>2]|0;
  13970. HEAP32[$vararg_buffer14>>2] = $98;
  13971. _TraceLog(0,7184,$vararg_buffer14);
  13972. }
  13973. $103 = HEAP32[4713]|0;
  13974. $104 = ($103|0)==(0);
  13975. if ($104) {
  13976. STACKTOP = sp;return;
  13977. }
  13978. $105 = HEAP32[4715]|0;
  13979. FUNCTION_TABLE_vi[$105 & 31](0);
  13980. STACKTOP = sp;return;
  13981. }
  13982. function _LoadShaderProgram($0,$1) {
  13983. $0 = $0|0;
  13984. $1 = $1|0;
  13985. var $$0 = 0, $$alloca_mul = 0, $$alloca_mul34 = 0, $$alloca_mul36 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0;
  13986. var $25 = 0, $26 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer10 = 0, $vararg_buffer13 = 0, $vararg_buffer16 = 0, $vararg_buffer19 = 0, $vararg_buffer22 = 0, $vararg_buffer4 = 0, $vararg_buffer7 = 0, label = 0, sp = 0;
  13987. sp = STACKTOP;
  13988. STACKTOP = STACKTOP + 96|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(96|0);
  13989. $vararg_buffer22 = sp + 64|0;
  13990. $vararg_buffer19 = sp + 56|0;
  13991. $vararg_buffer16 = sp + 48|0;
  13992. $vararg_buffer13 = sp + 40|0;
  13993. $vararg_buffer10 = sp + 32|0;
  13994. $vararg_buffer7 = sp + 24|0;
  13995. $vararg_buffer4 = sp + 16|0;
  13996. $vararg_buffer1 = sp + 8|0;
  13997. $vararg_buffer = sp;
  13998. $2 = sp + 80|0;
  13999. $3 = sp + 76|0;
  14000. $4 = sp + 72|0;
  14001. $5 = sp + 68|0;
  14002. $6 = (_glCreateShader(35633)|0);
  14003. $7 = (_glCreateShader(35632)|0);
  14004. HEAP32[$2>>2] = $0;
  14005. HEAP32[$3>>2] = $1;
  14006. _glShaderSource(($6|0),1,($2|0),(0|0));
  14007. _glShaderSource(($7|0),1,($3|0),(0|0));
  14008. HEAP32[$4>>2] = 0;
  14009. _glCompileShader(($6|0));
  14010. _glGetShaderiv(($6|0),35713,($4|0));
  14011. $8 = HEAP32[$4>>2]|0;
  14012. $9 = ($8|0)==(1);
  14013. if ($9) {
  14014. HEAP32[$vararg_buffer4>>2] = $6;
  14015. _TraceLog(0,8582,$vararg_buffer4);
  14016. } else {
  14017. HEAP32[$vararg_buffer>>2] = $6;
  14018. _TraceLog(2,8530,$vararg_buffer);
  14019. HEAP32[$vararg_buffer>>2] = 0;
  14020. _glGetShaderiv(($6|0),35716,($vararg_buffer|0));
  14021. $10 = HEAP32[$vararg_buffer>>2]|0;
  14022. $11 = (_llvm_stacksave()|0);
  14023. $$alloca_mul = $10;
  14024. $12 = STACKTOP; STACKTOP = STACKTOP + ((((1*$$alloca_mul)|0)+15)&-16)|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(((((1*$$alloca_mul)|0)+15)&-16)|0);;
  14025. $13 = HEAP32[$vararg_buffer>>2]|0;
  14026. _glGetShaderInfoLog(($6|0),($13|0),($5|0),($12|0));
  14027. HEAP32[$vararg_buffer1>>2] = $12;
  14028. _TraceLog(0,8579,$vararg_buffer1);
  14029. _llvm_stackrestore(($11|0));
  14030. }
  14031. _glCompileShader(($7|0));
  14032. _glGetShaderiv(($7|0),35713,($4|0));
  14033. $14 = HEAP32[$4>>2]|0;
  14034. $15 = ($14|0)==(1);
  14035. if ($15) {
  14036. HEAP32[$vararg_buffer13>>2] = $7;
  14037. _TraceLog(0,8683,$vararg_buffer13);
  14038. } else {
  14039. HEAP32[$vararg_buffer7>>2] = $7;
  14040. _TraceLog(2,8632,$vararg_buffer7);
  14041. HEAP32[$vararg_buffer7>>2] = 0;
  14042. _glGetShaderiv(($7|0),35716,($vararg_buffer7|0));
  14043. $16 = HEAP32[$vararg_buffer7>>2]|0;
  14044. $17 = (_llvm_stacksave()|0);
  14045. $$alloca_mul34 = $16;
  14046. $18 = STACKTOP; STACKTOP = STACKTOP + ((((1*$$alloca_mul34)|0)+15)&-16)|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(((((1*$$alloca_mul34)|0)+15)&-16)|0);;
  14047. $19 = HEAP32[$vararg_buffer7>>2]|0;
  14048. _glGetShaderInfoLog(($7|0),($19|0),($5|0),($18|0));
  14049. HEAP32[$vararg_buffer10>>2] = $18;
  14050. _TraceLog(0,8579,$vararg_buffer10);
  14051. _llvm_stackrestore(($17|0));
  14052. }
  14053. $20 = (_glCreateProgram()|0);
  14054. _glAttachShader(($20|0),($6|0));
  14055. _glAttachShader(($20|0),($7|0));
  14056. _glBindAttribLocation(($20|0),0,(8374|0));
  14057. _glBindAttribLocation(($20|0),1,(8389|0));
  14058. _glBindAttribLocation(($20|0),2,(8420|0));
  14059. _glBindAttribLocation(($20|0),3,(8447|0));
  14060. _glBindAttribLocation(($20|0),4,(8433|0));
  14061. _glBindAttribLocation(($20|0),5,(8404|0));
  14062. _glLinkProgram(($20|0));
  14063. _glGetProgramiv(($20|0),35714,($4|0));
  14064. $21 = HEAP32[$4>>2]|0;
  14065. $22 = ($21|0)==(0);
  14066. if ($22) {
  14067. HEAP32[$vararg_buffer16>>2] = $20;
  14068. _TraceLog(2,8735,$vararg_buffer16);
  14069. HEAP32[$vararg_buffer16>>2] = 0;
  14070. _glGetProgramiv(($20|0),35716,($vararg_buffer16|0));
  14071. $23 = HEAP32[$vararg_buffer16>>2]|0;
  14072. $24 = (_llvm_stacksave()|0);
  14073. $$alloca_mul36 = $23;
  14074. $25 = STACKTOP; STACKTOP = STACKTOP + ((((1*$$alloca_mul36)|0)+15)&-16)|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(((((1*$$alloca_mul36)|0)+15)&-16)|0);;
  14075. $26 = HEAP32[$vararg_buffer16>>2]|0;
  14076. _glGetProgramInfoLog(($20|0),($26|0),($5|0),($25|0));
  14077. HEAP32[$vararg_buffer19>>2] = $25;
  14078. _TraceLog(0,8579,$vararg_buffer19);
  14079. _glDeleteProgram(($20|0));
  14080. _llvm_stackrestore(($24|0));
  14081. $$0 = 0;
  14082. _glDeleteShader(($6|0));
  14083. _glDeleteShader(($7|0));
  14084. STACKTOP = sp;return ($$0|0);
  14085. } else {
  14086. HEAP32[$vararg_buffer22>>2] = $20;
  14087. _TraceLog(0,8781,$vararg_buffer22);
  14088. $$0 = $20;
  14089. _glDeleteShader(($6|0));
  14090. _glDeleteShader(($7|0));
  14091. STACKTOP = sp;return ($$0|0);
  14092. }
  14093. return (0)|0;
  14094. }
  14095. function _LoadDefaultShaderLocations($0) {
  14096. $0 = $0|0;
  14097. var $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0;
  14098. var $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0;
  14099. var sp = 0;
  14100. sp = STACKTOP;
  14101. $1 = HEAP32[$0>>2]|0;
  14102. $2 = (_glGetAttribLocation(($1|0),(8374|0))|0);
  14103. $3 = ((($0)) + 4|0);
  14104. HEAP32[$3>>2] = $2;
  14105. $4 = HEAP32[$0>>2]|0;
  14106. $5 = (_glGetAttribLocation(($4|0),(8389|0))|0);
  14107. $6 = ((($0)) + 8|0);
  14108. HEAP32[$6>>2] = $5;
  14109. $7 = HEAP32[$0>>2]|0;
  14110. $8 = (_glGetAttribLocation(($7|0),(8404|0))|0);
  14111. $9 = ((($0)) + 12|0);
  14112. HEAP32[$9>>2] = $8;
  14113. $10 = HEAP32[$0>>2]|0;
  14114. $11 = (_glGetAttribLocation(($10|0),(8420|0))|0);
  14115. $12 = ((($0)) + 16|0);
  14116. HEAP32[$12>>2] = $11;
  14117. $13 = HEAP32[$0>>2]|0;
  14118. $14 = (_glGetAttribLocation(($13|0),(8433|0))|0);
  14119. $15 = ((($0)) + 20|0);
  14120. HEAP32[$15>>2] = $14;
  14121. $16 = HEAP32[$0>>2]|0;
  14122. $17 = (_glGetAttribLocation(($16|0),(8447|0))|0);
  14123. $18 = ((($0)) + 24|0);
  14124. HEAP32[$18>>2] = $17;
  14125. $19 = HEAP32[$0>>2]|0;
  14126. $20 = (_glGetUniformLocation(($19|0),(8459|0))|0);
  14127. $21 = ((($0)) + 28|0);
  14128. HEAP32[$21>>2] = $20;
  14129. $22 = HEAP32[$0>>2]|0;
  14130. $23 = (_glGetUniformLocation(($22|0),(8469|0))|0);
  14131. $24 = ((($0)) + 32|0);
  14132. HEAP32[$24>>2] = $23;
  14133. $25 = HEAP32[$0>>2]|0;
  14134. $26 = (_glGetUniformLocation(($25|0),(8480|0))|0);
  14135. $27 = ((($0)) + 36|0);
  14136. HEAP32[$27>>2] = $26;
  14137. $28 = HEAP32[$0>>2]|0;
  14138. $29 = (_glGetUniformLocation(($28|0),(8491|0))|0);
  14139. $30 = ((($0)) + 40|0);
  14140. HEAP32[$30>>2] = $29;
  14141. $31 = HEAP32[$0>>2]|0;
  14142. $32 = (_glGetUniformLocation(($31|0),(8503|0))|0);
  14143. $33 = ((($0)) + 44|0);
  14144. HEAP32[$33>>2] = $32;
  14145. $34 = HEAP32[$0>>2]|0;
  14146. $35 = (_glGetUniformLocation(($34|0),(8512|0))|0);
  14147. $36 = ((($0)) + 48|0);
  14148. HEAP32[$36>>2] = $35;
  14149. $37 = HEAP32[$0>>2]|0;
  14150. $38 = (_glGetUniformLocation(($37|0),(8521|0))|0);
  14151. $39 = ((($0)) + 52|0);
  14152. HEAP32[$39>>2] = $38;
  14153. return;
  14154. }
  14155. function _IsMouseButtonPressed($0) {
  14156. $0 = $0|0;
  14157. var $$0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $or$cond = 0, label = 0, sp = 0;
  14158. sp = STACKTOP;
  14159. $1 = (21369 + ($0)|0);
  14160. $2 = HEAP8[$1>>0]|0;
  14161. $3 = (21372 + ($0)|0);
  14162. $4 = HEAP8[$3>>0]|0;
  14163. $5 = ($2<<24>>24)!=($4<<24>>24);
  14164. $6 = ($2<<24>>24)==(1);
  14165. $or$cond = $6 & $5;
  14166. $$0 = $or$cond&1;
  14167. return ($$0|0);
  14168. }
  14169. function _IsMouseButtonReleased($0) {
  14170. $0 = $0|0;
  14171. var $$0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $or$cond = 0, label = 0, sp = 0;
  14172. sp = STACKTOP;
  14173. $1 = (21369 + ($0)|0);
  14174. $2 = HEAP8[$1>>0]|0;
  14175. $3 = (21372 + ($0)|0);
  14176. $4 = HEAP8[$3>>0]|0;
  14177. $5 = ($2<<24>>24)!=($4<<24>>24);
  14178. $6 = ($2<<24>>24)==(0);
  14179. $or$cond = $6 & $5;
  14180. $$0 = $or$cond&1;
  14181. return ($$0|0);
  14182. }
  14183. function _rlClearScreenBuffers() {
  14184. var label = 0, sp = 0;
  14185. sp = STACKTOP;
  14186. _glClear(16640);
  14187. return;
  14188. }
  14189. function _CloseWindow() {
  14190. var $0 = 0, $vararg_buffer = 0, label = 0, sp = 0;
  14191. sp = STACKTOP;
  14192. STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
  14193. $vararg_buffer = sp;
  14194. _UnloadDefaultFont();
  14195. _rlglClose();
  14196. $0 = HEAP32[4632]|0;
  14197. _glfwDestroyWindow(($0|0));
  14198. _glfwTerminate();
  14199. _TraceLog(0,9093,$vararg_buffer);
  14200. STACKTOP = sp;return;
  14201. }
  14202. function _UnloadDefaultFont() {
  14203. var $$byval_copy = 0, $0 = 0, label = 0, sp = 0;
  14204. sp = STACKTOP;
  14205. STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
  14206. $$byval_copy = sp;
  14207. ;HEAP32[$$byval_copy>>2]=HEAP32[18568>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[18568+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[18568+8>>2]|0;HEAP32[$$byval_copy+12>>2]=HEAP32[18568+12>>2]|0;HEAP32[$$byval_copy+16>>2]=HEAP32[18568+16>>2]|0;
  14208. _UnloadTexture($$byval_copy);
  14209. $0 = HEAP32[(18596)>>2]|0;
  14210. _free($0);
  14211. STACKTOP = sp;return;
  14212. }
  14213. function _rlglClose() {
  14214. var $0 = 0, $1 = 0, $vararg_buffer = 0, label = 0, sp = 0;
  14215. sp = STACKTOP;
  14216. STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
  14217. $vararg_buffer = sp;
  14218. _UnloadDefaultShader();
  14219. _UnloadDefaultBuffers();
  14220. _glDeleteTextures(1,(18880|0));
  14221. $0 = HEAP32[4720]|0;
  14222. HEAP32[$vararg_buffer>>2] = $0;
  14223. _TraceLog(0,9120,$vararg_buffer);
  14224. $1 = HEAP32[4750]|0;
  14225. _free($1);
  14226. STACKTOP = sp;return;
  14227. }
  14228. function _UnloadDefaultShader() {
  14229. var $0 = 0, label = 0, sp = 0;
  14230. sp = STACKTOP;
  14231. _glUseProgram(0);
  14232. $0 = HEAP32[4721]|0;
  14233. _glDeleteProgram(($0|0));
  14234. return;
  14235. }
  14236. function _UnloadDefaultBuffers() {
  14237. var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
  14238. sp = STACKTOP;
  14239. $0 = HEAP32[4713]|0;
  14240. $1 = ($0|0)==(0);
  14241. if (!($1)) {
  14242. $2 = HEAP32[4715]|0;
  14243. FUNCTION_TABLE_vi[$2 & 31](0);
  14244. }
  14245. _glDisableVertexAttribArray(0);
  14246. _glDisableVertexAttribArray(1);
  14247. _glDisableVertexAttribArray(2);
  14248. _glDisableVertexAttribArray(3);
  14249. _glBindBuffer(34962,0);
  14250. _glBindBuffer(34963,0);
  14251. _glDeleteBuffers(1,((20076)|0));
  14252. _glDeleteBuffers(1,((20080)|0));
  14253. _glDeleteBuffers(1,((20124)|0));
  14254. _glDeleteBuffers(1,((20128)|0));
  14255. _glDeleteBuffers(1,((20172)|0));
  14256. _glDeleteBuffers(1,((20176)|0));
  14257. _glDeleteBuffers(1,((20180)|0));
  14258. _glDeleteBuffers(1,((20184)|0));
  14259. $3 = HEAP32[4713]|0;
  14260. $4 = ($3|0)==(0);
  14261. if (!($4)) {
  14262. $5 = HEAP32[4716]|0;
  14263. FUNCTION_TABLE_vii[$5 & 63](1,(20072));
  14264. $6 = HEAP32[4716]|0;
  14265. FUNCTION_TABLE_vii[$6 & 63](1,(20120));
  14266. $7 = HEAP32[4716]|0;
  14267. FUNCTION_TABLE_vii[$7 & 63](1,(20168));
  14268. }
  14269. $8 = HEAP32[(20056)>>2]|0;
  14270. _free($8);
  14271. $9 = HEAP32[(20064)>>2]|0;
  14272. _free($9);
  14273. $10 = HEAP32[(20104)>>2]|0;
  14274. _free($10);
  14275. $11 = HEAP32[(20112)>>2]|0;
  14276. _free($11);
  14277. $12 = HEAP32[(20152)>>2]|0;
  14278. _free($12);
  14279. $13 = HEAP32[(20156)>>2]|0;
  14280. _free($13);
  14281. $14 = HEAP32[(20160)>>2]|0;
  14282. _free($14);
  14283. $15 = HEAP32[(20164)>>2]|0;
  14284. _free($15);
  14285. return;
  14286. }
  14287. function _UnloadTexture($0) {
  14288. $0 = $0|0;
  14289. var $1 = 0, $2 = 0, $3 = 0, $vararg_buffer = 0, label = 0, sp = 0;
  14290. sp = STACKTOP;
  14291. STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
  14292. $vararg_buffer = sp;
  14293. $1 = HEAP32[$0>>2]|0;
  14294. $2 = ($1|0)==(0);
  14295. if ($2) {
  14296. STACKTOP = sp;return;
  14297. }
  14298. _rlDeleteTextures($1);
  14299. $3 = HEAP32[$0>>2]|0;
  14300. HEAP32[$vararg_buffer>>2] = $3;
  14301. _TraceLog(0,9185,$vararg_buffer);
  14302. STACKTOP = sp;return;
  14303. }
  14304. function _rlDeleteTextures($0) {
  14305. $0 = $0|0;
  14306. var $1 = 0, $2 = 0, label = 0, sp = 0;
  14307. sp = STACKTOP;
  14308. STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
  14309. $1 = sp;
  14310. HEAP32[$1>>2] = $0;
  14311. $2 = ($0|0)==(0);
  14312. if (!($2)) {
  14313. _glDeleteTextures(1,($1|0));
  14314. }
  14315. STACKTOP = sp;return;
  14316. }
  14317. function _BeginDrawing() {
  14318. var $0 = 0.0, $1 = 0.0, $2 = 0.0, $downscaleView$byval_copy = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
  14319. sp = STACKTOP;
  14320. STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(64|0);
  14321. $downscaleView$byval_copy = sp;
  14322. $0 = (+_GetTime());
  14323. HEAPF64[2270] = $0;
  14324. $1 = +HEAPF64[2253];
  14325. $2 = $0 - $1;
  14326. HEAPF64[2271] = $2;
  14327. HEAPF64[2253] = $0;
  14328. _rlClearScreenBuffers();
  14329. _rlLoadIdentity();
  14330. dest=$downscaleView$byval_copy; src=18624; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  14331. (_MatrixToFloat($downscaleView$byval_copy)|0);
  14332. _rlMultMatrixf(20196);
  14333. STACKTOP = sp;return;
  14334. }
  14335. function _MatrixToFloat($0) {
  14336. $0 = $0|0;
  14337. var $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0;
  14338. var $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
  14339. sp = STACKTOP;
  14340. $1 = HEAP32[$0>>2]|0;
  14341. HEAP32[5049] = $1;
  14342. $2 = ((($0)) + 4|0);
  14343. $3 = HEAP32[$2>>2]|0;
  14344. HEAP32[(20200)>>2] = $3;
  14345. $4 = ((($0)) + 8|0);
  14346. $5 = HEAP32[$4>>2]|0;
  14347. HEAP32[(20204)>>2] = $5;
  14348. $6 = ((($0)) + 12|0);
  14349. $7 = HEAP32[$6>>2]|0;
  14350. HEAP32[(20208)>>2] = $7;
  14351. $8 = ((($0)) + 16|0);
  14352. $9 = HEAP32[$8>>2]|0;
  14353. HEAP32[(20212)>>2] = $9;
  14354. $10 = ((($0)) + 20|0);
  14355. $11 = HEAP32[$10>>2]|0;
  14356. HEAP32[(20216)>>2] = $11;
  14357. $12 = ((($0)) + 24|0);
  14358. $13 = HEAP32[$12>>2]|0;
  14359. HEAP32[(20220)>>2] = $13;
  14360. $14 = ((($0)) + 28|0);
  14361. $15 = HEAP32[$14>>2]|0;
  14362. HEAP32[(20224)>>2] = $15;
  14363. $16 = ((($0)) + 32|0);
  14364. $17 = HEAP32[$16>>2]|0;
  14365. HEAP32[(20228)>>2] = $17;
  14366. $18 = ((($0)) + 36|0);
  14367. $19 = HEAP32[$18>>2]|0;
  14368. HEAP32[(20232)>>2] = $19;
  14369. $20 = ((($0)) + 40|0);
  14370. $21 = HEAP32[$20>>2]|0;
  14371. HEAP32[(20236)>>2] = $21;
  14372. $22 = ((($0)) + 44|0);
  14373. $23 = HEAP32[$22>>2]|0;
  14374. HEAP32[(20240)>>2] = $23;
  14375. $24 = ((($0)) + 48|0);
  14376. $25 = HEAP32[$24>>2]|0;
  14377. HEAP32[(20244)>>2] = $25;
  14378. $26 = ((($0)) + 52|0);
  14379. $27 = HEAP32[$26>>2]|0;
  14380. HEAP32[(20248)>>2] = $27;
  14381. $28 = ((($0)) + 56|0);
  14382. $29 = HEAP32[$28>>2]|0;
  14383. HEAP32[(20252)>>2] = $29;
  14384. $30 = ((($0)) + 60|0);
  14385. $31 = HEAP32[$30>>2]|0;
  14386. HEAP32[(20256)>>2] = $31;
  14387. return (20196|0);
  14388. }
  14389. function _rlMultMatrixf($0) {
  14390. $0 = $0|0;
  14391. var $$byval_copy = 0, $$byval_copy1 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
  14392. var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0;
  14393. var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
  14394. sp = STACKTOP;
  14395. STACKTOP = STACKTOP + 256|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(256|0);
  14396. $$byval_copy1 = sp + 192|0;
  14397. $$byval_copy = sp + 128|0;
  14398. $1 = sp + 64|0;
  14399. $2 = sp;
  14400. $3 = HEAP32[$0>>2]|0;
  14401. HEAP32[$1>>2] = $3;
  14402. $4 = ((($1)) + 4|0);
  14403. $5 = ((($0)) + 4|0);
  14404. $6 = HEAP32[$5>>2]|0;
  14405. HEAP32[$4>>2] = $6;
  14406. $7 = ((($1)) + 8|0);
  14407. $8 = ((($0)) + 8|0);
  14408. $9 = HEAP32[$8>>2]|0;
  14409. HEAP32[$7>>2] = $9;
  14410. $10 = ((($1)) + 12|0);
  14411. $11 = ((($0)) + 12|0);
  14412. $12 = HEAP32[$11>>2]|0;
  14413. HEAP32[$10>>2] = $12;
  14414. $13 = ((($1)) + 16|0);
  14415. $14 = ((($0)) + 16|0);
  14416. $15 = HEAP32[$14>>2]|0;
  14417. HEAP32[$13>>2] = $15;
  14418. $16 = ((($1)) + 20|0);
  14419. $17 = ((($0)) + 20|0);
  14420. $18 = HEAP32[$17>>2]|0;
  14421. HEAP32[$16>>2] = $18;
  14422. $19 = ((($1)) + 24|0);
  14423. $20 = ((($0)) + 24|0);
  14424. $21 = HEAP32[$20>>2]|0;
  14425. HEAP32[$19>>2] = $21;
  14426. $22 = ((($1)) + 28|0);
  14427. $23 = ((($0)) + 28|0);
  14428. $24 = HEAP32[$23>>2]|0;
  14429. HEAP32[$22>>2] = $24;
  14430. $25 = ((($1)) + 32|0);
  14431. $26 = ((($0)) + 32|0);
  14432. $27 = HEAP32[$26>>2]|0;
  14433. HEAP32[$25>>2] = $27;
  14434. $28 = ((($1)) + 36|0);
  14435. $29 = ((($0)) + 36|0);
  14436. $30 = HEAP32[$29>>2]|0;
  14437. HEAP32[$28>>2] = $30;
  14438. $31 = ((($1)) + 40|0);
  14439. $32 = ((($0)) + 40|0);
  14440. $33 = HEAP32[$32>>2]|0;
  14441. HEAP32[$31>>2] = $33;
  14442. $34 = ((($1)) + 44|0);
  14443. $35 = ((($0)) + 44|0);
  14444. $36 = HEAP32[$35>>2]|0;
  14445. HEAP32[$34>>2] = $36;
  14446. $37 = ((($1)) + 48|0);
  14447. $38 = ((($0)) + 48|0);
  14448. $39 = HEAP32[$38>>2]|0;
  14449. HEAP32[$37>>2] = $39;
  14450. $40 = ((($1)) + 52|0);
  14451. $41 = ((($0)) + 52|0);
  14452. $42 = HEAP32[$41>>2]|0;
  14453. HEAP32[$40>>2] = $42;
  14454. $43 = ((($1)) + 56|0);
  14455. $44 = ((($0)) + 56|0);
  14456. $45 = HEAP32[$44>>2]|0;
  14457. HEAP32[$43>>2] = $45;
  14458. $46 = ((($1)) + 60|0);
  14459. $47 = ((($0)) + 60|0);
  14460. $48 = HEAP32[$47>>2]|0;
  14461. HEAP32[$46>>2] = $48;
  14462. $49 = HEAP32[4679]|0;
  14463. dest=$$byval_copy; src=$49; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  14464. dest=$$byval_copy1; src=$1; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  14465. _MatrixMultiply($2,$$byval_copy,$$byval_copy1);
  14466. dest=$49; src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  14467. STACKTOP = sp;return;
  14468. }
  14469. function _EndDrawing() {
  14470. var $0 = 0.0, $1 = 0.0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $2 = 0.0, $3 = 0.0, $4 = 0.0, $5 = 0.0, $6 = 0, $7 = 0.0, $8 = 0.0, $9 = 0.0, label = 0, sp = 0;
  14471. sp = STACKTOP;
  14472. _rlglDraw();
  14473. _SwapBuffers();
  14474. _PollInputEvents();
  14475. $0 = (+_GetTime());
  14476. HEAPF64[2270] = $0;
  14477. $1 = +HEAPF64[2253];
  14478. $2 = $0 - $1;
  14479. HEAPF64[2272] = $2;
  14480. HEAPF64[2253] = $0;
  14481. $3 = +HEAPF64[2271];
  14482. $4 = $2 + $3;
  14483. HEAPF64[2273] = $4;
  14484. $5 = +HEAPF64[2250];
  14485. $6 = $4 < $5;
  14486. if (!($6)) {
  14487. return;
  14488. }
  14489. $7 = $5 - $4;
  14490. $8 = $7 * 1000.0;
  14491. $9 = $8;
  14492. _Wait($9);
  14493. $10 = (+_GetTime());
  14494. HEAPF64[2270] = $10;
  14495. $11 = +HEAPF64[2253];
  14496. $12 = $10 - $11;
  14497. HEAPF64[2253] = $10;
  14498. $13 = +HEAPF64[2273];
  14499. $14 = $12 + $13;
  14500. HEAPF64[2273] = $14;
  14501. return;
  14502. }
  14503. function _rlglDraw() {
  14504. var label = 0, sp = 0;
  14505. sp = STACKTOP;
  14506. _UpdateDefaultBuffers();
  14507. _DrawDefaultBuffers();
  14508. return;
  14509. }
  14510. function _SwapBuffers() {
  14511. var $0 = 0, label = 0, sp = 0;
  14512. sp = STACKTOP;
  14513. $0 = HEAP32[4632]|0;
  14514. _glfwSwapBuffers(($0|0));
  14515. return;
  14516. }
  14517. function _PollInputEvents() {
  14518. var $$04857 = 0, $$05160 = 0, $$058 = 0, $$lcssa = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0;
  14519. var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0.0, $31 = 0.0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0.0, $40 = 0;
  14520. var $5 = 0.0, $6 = 0.0, $7 = 0.0, $8 = 0, $9 = 0, $scevgep = 0, $scevgep67 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
  14521. sp = STACKTOP;
  14522. STACKTOP = STACKTOP + 1456|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(1456|0);
  14523. $0 = sp + 1440|0;
  14524. $1 = sp + 1432|0;
  14525. $2 = sp;
  14526. _UpdateGestures();
  14527. HEAP32[751] = -1;
  14528. HEAP32[753] = -1;
  14529. HEAP32[5065] = 0;
  14530. $3 = HEAP32[4632]|0;
  14531. _glfwGetCursorPos(($3|0),($0|0),($1|0));
  14532. $4 = +HEAPF64[$0>>3];
  14533. $5 = $4;
  14534. HEAPF32[4498] = $5;
  14535. $6 = +HEAPF64[$1>>3];
  14536. $7 = $6;
  14537. HEAPF32[(17996)>>2] = $7;
  14538. _memcpy((21887|0),(21375|0),512)|0;
  14539. ;HEAP8[21372>>0]=HEAP8[21369>>0]|0;HEAP8[21372+1>>0]=HEAP8[21369+1>>0]|0;HEAP8[21372+2>>0]=HEAP8[21369+2>>0]|0;
  14540. $8 = HEAP32[5048]|0;
  14541. HEAP32[4635] = $8;
  14542. HEAP32[5048] = 0;
  14543. $9 = (_emscripten_get_num_gamepads()|0);
  14544. $10 = ($9|0)>(0);
  14545. if (!($10)) {
  14546. STACKTOP = sp;return;
  14547. }
  14548. $11 = ((($2)) + 12|0);
  14549. $12 = ((($2)) + 8|0);
  14550. $$05160 = 0;
  14551. while(1) {
  14552. $scevgep = (22399 + ($$05160<<5)|0);
  14553. $scevgep67 = (22527 + ($$05160<<5)|0);
  14554. dest=$scevgep; src=$scevgep67; stop=dest+32|0; do { HEAP8[dest>>0]=HEAP8[src>>0]|0; dest=dest+1|0; src=src+1|0; } while ((dest|0) < (stop|0));
  14555. $13 = (_emscripten_get_gamepad_status(($$05160|0),($2|0))|0);
  14556. $14 = ($13|0)==(0);
  14557. if ($14) {
  14558. $15 = HEAP32[$11>>2]|0;
  14559. $16 = ($15|0)>(0);
  14560. if ($16) {
  14561. $17 = HEAP32[$11>>2]|0;
  14562. $$04857 = 0;
  14563. while(1) {
  14564. $21 = (((($2)) + 1040|0) + ($$04857<<2)|0);
  14565. $22 = HEAP32[$21>>2]|0;
  14566. $23 = ($22|0)==(1);
  14567. $24 = ((22527 + ($$05160<<5)|0) + ($$04857)|0);
  14568. if ($23) {
  14569. HEAP8[$24>>0] = 1;
  14570. HEAP32[753] = $$04857;
  14571. } else {
  14572. HEAP8[$24>>0] = 0;
  14573. }
  14574. $25 = (($$04857) + 1)|0;
  14575. $26 = ($25|0)<($17|0);
  14576. $27 = ($25|0)<(32);
  14577. $28 = $27 & $26;
  14578. if ($28) {
  14579. $$04857 = $25;
  14580. } else {
  14581. break;
  14582. }
  14583. }
  14584. }
  14585. $18 = HEAP32[$12>>2]|0;
  14586. $19 = ($18|0)>(0);
  14587. if ($19) {
  14588. $20 = HEAP32[$12>>2]|0;
  14589. $$058 = 0;
  14590. while(1) {
  14591. $29 = (((($2)) + 16|0) + ($$058<<3)|0);
  14592. $30 = +HEAPF64[$29>>3];
  14593. $31 = $30;
  14594. $32 = ((20264 + ($$05160<<5)|0) + ($$058<<2)|0);
  14595. HEAPF32[$32>>2] = $31;
  14596. $33 = (($$058) + 1)|0;
  14597. $34 = ($33|0)<($20|0);
  14598. $35 = ($33|0)<(8);
  14599. $36 = $35 & $34;
  14600. if ($36) {
  14601. $$058 = $33;
  14602. } else {
  14603. $$lcssa = $20;
  14604. break;
  14605. }
  14606. }
  14607. } else {
  14608. $$lcssa = $18;
  14609. }
  14610. HEAP32[5065] = $$lcssa;
  14611. }
  14612. $37 = (($$05160) + 1)|0;
  14613. $38 = ($37|0)<($9|0);
  14614. $39 = ($37|0)<(4);
  14615. $40 = $38 & $39;
  14616. if ($40) {
  14617. $$05160 = $37;
  14618. } else {
  14619. break;
  14620. }
  14621. }
  14622. STACKTOP = sp;return;
  14623. }
  14624. function _Wait($0) {
  14625. $0 = +$0;
  14626. var $1 = 0.0, $2 = 0.0, $3 = 0.0, $4 = 0.0, $5 = 0, $6 = 0.0, $7 = 0.0, $8 = 0, label = 0, sp = 0;
  14627. sp = STACKTOP;
  14628. $1 = (+_GetTime());
  14629. $2 = 0.0 - $1;
  14630. $3 = $0 / 1000.0;
  14631. $4 = $3;
  14632. $5 = $2 < $4;
  14633. if (!($5)) {
  14634. return;
  14635. }
  14636. while(1) {
  14637. $6 = (+_GetTime());
  14638. $7 = $6 - $1;
  14639. $8 = $7 < $4;
  14640. if (!($8)) {
  14641. break;
  14642. }
  14643. }
  14644. return;
  14645. }
  14646. function _UpdateDefaultBuffers() {
  14647. var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
  14648. var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
  14649. var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
  14650. sp = STACKTOP;
  14651. $0 = HEAP32[5011]|0;
  14652. $1 = ($0|0)>(0);
  14653. if ($1) {
  14654. $2 = HEAP32[4713]|0;
  14655. $3 = ($2|0)==(0);
  14656. if (!($3)) {
  14657. $4 = HEAP32[4715]|0;
  14658. $5 = HEAP32[(20072)>>2]|0;
  14659. FUNCTION_TABLE_vi[$4 & 31]($5);
  14660. }
  14661. $6 = HEAP32[(20076)>>2]|0;
  14662. _glBindBuffer(34962,($6|0));
  14663. $7 = HEAP32[5011]|0;
  14664. $8 = ($7*12)|0;
  14665. $9 = HEAP32[(20056)>>2]|0;
  14666. _glBufferSubData(34962,0,($8|0),($9|0));
  14667. $10 = HEAP32[(20080)>>2]|0;
  14668. _glBindBuffer(34962,($10|0));
  14669. $11 = HEAP32[(20052)>>2]|0;
  14670. $12 = $11 << 2;
  14671. $13 = HEAP32[(20064)>>2]|0;
  14672. _glBufferSubData(34962,0,($12|0),($13|0));
  14673. }
  14674. $14 = HEAP32[5023]|0;
  14675. $15 = ($14|0)>(0);
  14676. if ($15) {
  14677. $16 = HEAP32[4713]|0;
  14678. $17 = ($16|0)==(0);
  14679. if (!($17)) {
  14680. $18 = HEAP32[4715]|0;
  14681. $19 = HEAP32[(20120)>>2]|0;
  14682. FUNCTION_TABLE_vi[$18 & 31]($19);
  14683. }
  14684. $20 = HEAP32[(20124)>>2]|0;
  14685. _glBindBuffer(34962,($20|0));
  14686. $21 = HEAP32[5023]|0;
  14687. $22 = ($21*12)|0;
  14688. $23 = HEAP32[(20104)>>2]|0;
  14689. _glBufferSubData(34962,0,($22|0),($23|0));
  14690. $24 = HEAP32[(20128)>>2]|0;
  14691. _glBindBuffer(34962,($24|0));
  14692. $25 = HEAP32[(20100)>>2]|0;
  14693. $26 = $25 << 2;
  14694. $27 = HEAP32[(20112)>>2]|0;
  14695. _glBufferSubData(34962,0,($26|0),($27|0));
  14696. }
  14697. $28 = HEAP32[5035]|0;
  14698. $29 = ($28|0)>(0);
  14699. if ($29) {
  14700. $30 = HEAP32[4713]|0;
  14701. $31 = ($30|0)==(0);
  14702. if (!($31)) {
  14703. $32 = HEAP32[4715]|0;
  14704. $33 = HEAP32[(20168)>>2]|0;
  14705. FUNCTION_TABLE_vi[$32 & 31]($33);
  14706. }
  14707. $34 = HEAP32[(20172)>>2]|0;
  14708. _glBindBuffer(34962,($34|0));
  14709. $35 = HEAP32[5035]|0;
  14710. $36 = ($35*12)|0;
  14711. $37 = HEAP32[(20152)>>2]|0;
  14712. _glBufferSubData(34962,0,($36|0),($37|0));
  14713. $38 = HEAP32[(20176)>>2]|0;
  14714. _glBindBuffer(34962,($38|0));
  14715. $39 = HEAP32[5035]|0;
  14716. $40 = $39 << 3;
  14717. $41 = HEAP32[(20156)>>2]|0;
  14718. _glBufferSubData(34962,0,($40|0),($41|0));
  14719. $42 = HEAP32[(20180)>>2]|0;
  14720. _glBindBuffer(34962,($42|0));
  14721. $43 = HEAP32[5035]|0;
  14722. $44 = $43 << 2;
  14723. $45 = HEAP32[(20160)>>2]|0;
  14724. _glBufferSubData(34962,0,($44|0),($45|0));
  14725. }
  14726. $46 = HEAP32[4713]|0;
  14727. $47 = ($46|0)==(0);
  14728. if ($47) {
  14729. return;
  14730. }
  14731. $48 = HEAP32[4715]|0;
  14732. FUNCTION_TABLE_vi[$48 & 31](0);
  14733. return;
  14734. }
  14735. function _DrawDefaultBuffers() {
  14736. var $$ = 0, $$02830 = 0, $$02932 = 0, $$031 = 0, $$byval_copy2 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0;
  14737. var $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0;
  14738. var $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0;
  14739. var $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0;
  14740. var $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $modelview$byval_copy = 0;
  14741. var $or$cond = 0, $or$cond3 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
  14742. sp = STACKTOP;
  14743. STACKTOP = STACKTOP + 320|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(320|0);
  14744. $$byval_copy2 = sp + 256|0;
  14745. $modelview$byval_copy = sp + 192|0;
  14746. $0 = sp + 128|0;
  14747. $1 = sp + 64|0;
  14748. $2 = sp;
  14749. dest=$0; src=18720; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  14750. dest=$1; src=18784; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  14751. $3 = HEAP32[5098]|0;
  14752. $4 = ($3|0)!=(0);
  14753. $$ = $4 ? 2 : 1;
  14754. $$02932 = 0;
  14755. while(1) {
  14756. if ($4) {
  14757. dest=$modelview$byval_copy; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  14758. dest=$$byval_copy2; src=$1; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  14759. _SetStereoView($$02932,$modelview$byval_copy,$$byval_copy2);
  14760. }
  14761. $8 = HEAP32[5011]|0;
  14762. $9 = ($8|0)>(0);
  14763. $10 = HEAP32[5023]|0;
  14764. $11 = ($10|0)>(0);
  14765. $or$cond = $9 | $11;
  14766. $12 = HEAP32[5035]|0;
  14767. $13 = ($12|0)>(0);
  14768. $or$cond3 = $or$cond | $13;
  14769. if ($or$cond3) {
  14770. $14 = HEAP32[4735]|0;
  14771. _glUseProgram(($14|0));
  14772. dest=$modelview$byval_copy; src=18784; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  14773. dest=$$byval_copy2; src=18720; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  14774. _MatrixMultiply($2,$modelview$byval_copy,$$byval_copy2);
  14775. $15 = HEAP32[(18968)>>2]|0;
  14776. dest=$$byval_copy2; src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  14777. $16 = (_MatrixToFloat($$byval_copy2)|0);
  14778. _glUniformMatrix4fv(($15|0),1,0,($16|0));
  14779. $17 = HEAP32[(18972)>>2]|0;
  14780. _glUniform4f(($17|0),1.0,1.0,1.0,1.0);
  14781. $18 = HEAP32[(18984)>>2]|0;
  14782. _glUniform1i(($18|0),0);
  14783. }
  14784. $19 = HEAP32[5011]|0;
  14785. $20 = ($19|0)>(0);
  14786. if ($20) {
  14787. $21 = HEAP32[4720]|0;
  14788. _glBindTexture(3553,($21|0));
  14789. $22 = HEAP32[4713]|0;
  14790. $23 = ($22|0)==(0);
  14791. if ($23) {
  14792. $26 = HEAP32[(20076)>>2]|0;
  14793. _glBindBuffer(34962,($26|0));
  14794. $27 = HEAP32[(18944)>>2]|0;
  14795. _glVertexAttribPointer(($27|0),3,5126,0,0,(0|0));
  14796. $28 = HEAP32[(18944)>>2]|0;
  14797. _glEnableVertexAttribArray(($28|0));
  14798. $29 = HEAP32[(20080)>>2]|0;
  14799. _glBindBuffer(34962,($29|0));
  14800. $30 = HEAP32[(18964)>>2]|0;
  14801. _glVertexAttribPointer(($30|0),4,5121,1,0,(0|0));
  14802. $31 = HEAP32[(18964)>>2]|0;
  14803. _glEnableVertexAttribArray(($31|0));
  14804. } else {
  14805. $24 = HEAP32[4715]|0;
  14806. $25 = HEAP32[(20072)>>2]|0;
  14807. FUNCTION_TABLE_vi[$24 & 31]($25);
  14808. }
  14809. $32 = HEAP32[5011]|0;
  14810. _glDrawArrays(1,0,($32|0));
  14811. $33 = HEAP32[4713]|0;
  14812. $34 = ($33|0)==(0);
  14813. if ($34) {
  14814. _glBindBuffer(34962,0);
  14815. }
  14816. _glBindTexture(3553,0);
  14817. }
  14818. $35 = HEAP32[5023]|0;
  14819. $36 = ($35|0)>(0);
  14820. if ($36) {
  14821. $37 = HEAP32[4720]|0;
  14822. _glBindTexture(3553,($37|0));
  14823. $38 = HEAP32[4713]|0;
  14824. $39 = ($38|0)==(0);
  14825. if ($39) {
  14826. $42 = HEAP32[(20124)>>2]|0;
  14827. _glBindBuffer(34962,($42|0));
  14828. $43 = HEAP32[(18944)>>2]|0;
  14829. _glVertexAttribPointer(($43|0),3,5126,0,0,(0|0));
  14830. $44 = HEAP32[(18944)>>2]|0;
  14831. _glEnableVertexAttribArray(($44|0));
  14832. $45 = HEAP32[(20128)>>2]|0;
  14833. _glBindBuffer(34962,($45|0));
  14834. $46 = HEAP32[(18964)>>2]|0;
  14835. _glVertexAttribPointer(($46|0),4,5121,1,0,(0|0));
  14836. $47 = HEAP32[(18964)>>2]|0;
  14837. _glEnableVertexAttribArray(($47|0));
  14838. } else {
  14839. $40 = HEAP32[4715]|0;
  14840. $41 = HEAP32[(20120)>>2]|0;
  14841. FUNCTION_TABLE_vi[$40 & 31]($41);
  14842. }
  14843. $48 = HEAP32[5023]|0;
  14844. _glDrawArrays(4,0,($48|0));
  14845. $49 = HEAP32[4713]|0;
  14846. $50 = ($49|0)==(0);
  14847. if ($50) {
  14848. _glBindBuffer(34962,0);
  14849. }
  14850. _glBindTexture(3553,0);
  14851. }
  14852. $51 = HEAP32[5035]|0;
  14853. $52 = ($51|0)>(0);
  14854. if ($52) {
  14855. $53 = HEAP32[4713]|0;
  14856. $54 = ($53|0)==(0);
  14857. if ($54) {
  14858. $57 = HEAP32[(20172)>>2]|0;
  14859. _glBindBuffer(34962,($57|0));
  14860. $58 = HEAP32[(18944)>>2]|0;
  14861. _glVertexAttribPointer(($58|0),3,5126,0,0,(0|0));
  14862. $59 = HEAP32[(18944)>>2]|0;
  14863. _glEnableVertexAttribArray(($59|0));
  14864. $60 = HEAP32[(20176)>>2]|0;
  14865. _glBindBuffer(34962,($60|0));
  14866. $61 = HEAP32[(18948)>>2]|0;
  14867. _glVertexAttribPointer(($61|0),2,5126,0,0,(0|0));
  14868. $62 = HEAP32[(18948)>>2]|0;
  14869. _glEnableVertexAttribArray(($62|0));
  14870. $63 = HEAP32[(20180)>>2]|0;
  14871. _glBindBuffer(34962,($63|0));
  14872. $64 = HEAP32[(18964)>>2]|0;
  14873. _glVertexAttribPointer(($64|0),4,5121,1,0,(0|0));
  14874. $65 = HEAP32[(18964)>>2]|0;
  14875. _glEnableVertexAttribArray(($65|0));
  14876. $66 = HEAP32[(20184)>>2]|0;
  14877. _glBindBuffer(34963,($66|0));
  14878. } else {
  14879. $55 = HEAP32[4715]|0;
  14880. $56 = HEAP32[(20168)>>2]|0;
  14881. FUNCTION_TABLE_vi[$55 & 31]($56);
  14882. }
  14883. $67 = HEAP32[4751]|0;
  14884. $68 = ($67|0)>(0);
  14885. if ($68) {
  14886. $$02830 = 0;$$031 = 0;
  14887. while(1) {
  14888. $71 = HEAP32[4750]|0;
  14889. $72 = (($71) + (($$031*144)|0)|0);
  14890. $73 = HEAP32[$72>>2]|0;
  14891. $74 = (($73|0) / 4)&-1;
  14892. $75 = ($74*6)|0;
  14893. $76 = (((($71) + (($$031*144)|0)|0)) + 8|0);
  14894. $77 = HEAP32[$76>>2]|0;
  14895. _glBindTexture(3553,($77|0));
  14896. $78 = $$02830 << 1;
  14897. $79 = $78;
  14898. _glDrawElements(4,($75|0),5123,($79|0));
  14899. $80 = HEAP32[4750]|0;
  14900. $81 = (($80) + (($$031*144)|0)|0);
  14901. $82 = HEAP32[$81>>2]|0;
  14902. $83 = (($82|0) / 4)&-1;
  14903. $84 = ($83*6)|0;
  14904. $85 = (($84) + ($$02830))|0;
  14905. $86 = (($$031) + 1)|0;
  14906. $87 = HEAP32[4751]|0;
  14907. $88 = ($86|0)<($87|0);
  14908. if ($88) {
  14909. $$02830 = $85;$$031 = $86;
  14910. } else {
  14911. break;
  14912. }
  14913. }
  14914. }
  14915. $69 = HEAP32[4713]|0;
  14916. $70 = ($69|0)==(0);
  14917. if ($70) {
  14918. _glBindBuffer(34962,0);
  14919. _glBindBuffer(34963,0);
  14920. }
  14921. _glBindTexture(3553,0);
  14922. }
  14923. $89 = HEAP32[4713]|0;
  14924. $90 = ($89|0)==(0);
  14925. if (!($90)) {
  14926. $91 = HEAP32[4715]|0;
  14927. FUNCTION_TABLE_vi[$91 & 31](0);
  14928. }
  14929. _glUseProgram(0);
  14930. $92 = (($$02932) + 1)|0;
  14931. $93 = ($92|0)<($$|0);
  14932. if ($93) {
  14933. $$02932 = $92;
  14934. } else {
  14935. break;
  14936. }
  14937. }
  14938. HEAP32[4751] = 1;
  14939. $5 = HEAP32[4720]|0;
  14940. $6 = HEAP32[4750]|0;
  14941. $7 = ((($6)) + 8|0);
  14942. HEAP32[$7>>2] = $5;
  14943. HEAP32[$6>>2] = 0;
  14944. HEAP32[5011] = 0;
  14945. HEAP32[(20052)>>2] = 0;
  14946. HEAP32[5023] = 0;
  14947. HEAP32[(20100)>>2] = 0;
  14948. HEAP32[5035] = 0;
  14949. HEAP32[(20144)>>2] = 0;
  14950. HEAP32[(20148)>>2] = 0;
  14951. HEAPF32[754] = -1.0;
  14952. dest=18720; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  14953. dest=18784; src=$1; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  14954. STACKTOP = sp;return;
  14955. }
  14956. function _SetStereoView($0,$1,$2) {
  14957. $0 = $0|0;
  14958. $1 = $1|0;
  14959. $2 = $2|0;
  14960. var $$byval_copy = 0, $$byval_copy3 = 0, $10 = 0, $11 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
  14961. sp = STACKTOP;
  14962. STACKTOP = STACKTOP + 256|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(256|0);
  14963. $$byval_copy3 = sp + 192|0;
  14964. $$byval_copy = sp + 64|0;
  14965. $3 = sp;
  14966. $4 = sp + 128|0;
  14967. dest=$3; src=$1; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  14968. $5 = HEAP32[5009]|0;
  14969. $6 = Math_imul($5, $0)|0;
  14970. $7 = (($6|0) / 2)&-1;
  14971. $8 = (($5|0) / 2)&-1;
  14972. $9 = HEAP32[5010]|0;
  14973. _rlViewport($7,0,$8,$9);
  14974. $10 = (20624 + ($0<<6)|0);
  14975. dest=$$byval_copy; src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  14976. dest=$$byval_copy3; src=$10; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  14977. _MatrixMultiply($4,$$byval_copy,$$byval_copy3);
  14978. $11 = (20496 + ($0<<6)|0);
  14979. dest=$3; src=$11; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  14980. dest=$$byval_copy3; src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  14981. _SetMatrixModelview($$byval_copy3);
  14982. dest=$$byval_copy3; src=$3; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  14983. _SetMatrixProjection($$byval_copy3);
  14984. STACKTOP = sp;return;
  14985. }
  14986. function _SetMatrixModelview($0) {
  14987. $0 = $0|0;
  14988. var dest = 0, label = 0, sp = 0, src = 0, stop = 0;
  14989. sp = STACKTOP;
  14990. dest=18784; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  14991. return;
  14992. }
  14993. function _SetMatrixProjection($0) {
  14994. $0 = $0|0;
  14995. var dest = 0, label = 0, sp = 0, src = 0, stop = 0;
  14996. sp = STACKTOP;
  14997. dest=18720; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  14998. return;
  14999. }
  15000. function _Begin3dMode($0) {
  15001. $0 = $0|0;
  15002. var $$byval_copy = 0, $$byval_copy1 = 0, $$byval_copy3 = 0, $1 = 0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $15 = 0.0, $16 = 0.0, $17 = 0.0, $18 = 0, $19 = 0, $2 = 0, $3 = 0.0, $4 = 0, $5 = 0.0, $6 = 0.0, $7 = 0;
  15003. var $8 = 0.0, $9 = 0.0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
  15004. sp = STACKTOP;
  15005. STACKTOP = STACKTOP + 160|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(160|0);
  15006. $$byval_copy3 = sp + 88|0;
  15007. $$byval_copy1 = sp + 76|0;
  15008. $$byval_copy = sp + 64|0;
  15009. $1 = sp;
  15010. _rlglDraw();
  15011. _rlMatrixMode(5889);
  15012. _rlPushMatrix();
  15013. _rlLoadIdentity();
  15014. $2 = HEAP32[4634]|0;
  15015. $3 = (+($2|0));
  15016. $4 = HEAP32[4633]|0;
  15017. $5 = (+($4|0));
  15018. $6 = $3 / $5;
  15019. $7 = ((($0)) + 36|0);
  15020. $8 = +HEAPF32[$7>>2];
  15021. $9 = $8 * 3.1415927410125732;
  15022. $10 = $9;
  15023. $11 = $10 / 360.0;
  15024. $12 = (+Math_tan((+$11)));
  15025. $13 = $12 * 0.01;
  15026. $14 = $6;
  15027. $15 = $13 * $14;
  15028. $16 = -$15;
  15029. $17 = -$13;
  15030. _rlFrustum($16,$15,$17,$13,0.01,1000.0);
  15031. _rlMatrixMode(5888);
  15032. _rlLoadIdentity();
  15033. $18 = ((($0)) + 12|0);
  15034. $19 = ((($0)) + 24|0);
  15035. ;HEAP32[$$byval_copy>>2]=HEAP32[$0>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$0+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[$0+8>>2]|0;
  15036. ;HEAP32[$$byval_copy1>>2]=HEAP32[$18>>2]|0;HEAP32[$$byval_copy1+4>>2]=HEAP32[$18+4>>2]|0;HEAP32[$$byval_copy1+8>>2]=HEAP32[$18+8>>2]|0;
  15037. ;HEAP32[$$byval_copy3>>2]=HEAP32[$19>>2]|0;HEAP32[$$byval_copy3+4>>2]=HEAP32[$19+4>>2]|0;HEAP32[$$byval_copy3+8>>2]=HEAP32[$19+8>>2]|0;
  15038. _MatrixLookAt($1,$$byval_copy,$$byval_copy1,$$byval_copy3);
  15039. dest=$$byval_copy3; src=$1; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  15040. (_MatrixToFloat($$byval_copy3)|0);
  15041. _rlMultMatrixf(20196);
  15042. _rlEnableDepthTest();
  15043. STACKTOP = sp;return;
  15044. }
  15045. function _rlPushMatrix() {
  15046. var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $vararg_buffer = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
  15047. sp = STACKTOP;
  15048. STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
  15049. $vararg_buffer = sp;
  15050. $0 = HEAP32[5188]|0;
  15051. $1 = ($0|0)==(15);
  15052. if ($1) {
  15053. HEAP32[$vararg_buffer>>2] = 16;
  15054. _TraceLog(1,9235,$vararg_buffer);
  15055. }
  15056. $2 = HEAP32[5188]|0;
  15057. $3 = (19012 + ($2<<6)|0);
  15058. $4 = HEAP32[4679]|0;
  15059. dest=$3; src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  15060. _rlLoadIdentity();
  15061. $5 = HEAP32[5188]|0;
  15062. $6 = (($5) + 1)|0;
  15063. HEAP32[5188] = $6;
  15064. $7 = HEAP32[4712]|0;
  15065. $8 = ($7|0)==(5888);
  15066. if (!($8)) {
  15067. STACKTOP = sp;return;
  15068. }
  15069. HEAP32[5189] = 1;
  15070. STACKTOP = sp;return;
  15071. }
  15072. function _rlFrustum($0,$1,$2,$3,$4,$5) {
  15073. $0 = +$0;
  15074. $1 = +$1;
  15075. $2 = +$2;
  15076. $3 = +$3;
  15077. $4 = +$4;
  15078. $5 = +$5;
  15079. var $$byval_copy = 0, $$byval_copy1 = 0, $6 = 0, $7 = 0, $8 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
  15080. sp = STACKTOP;
  15081. STACKTOP = STACKTOP + 256|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(256|0);
  15082. $$byval_copy1 = sp + 192|0;
  15083. $$byval_copy = sp + 128|0;
  15084. $6 = sp + 64|0;
  15085. $7 = sp;
  15086. _MatrixFrustum($6,$0,$1,$2,$3,$4,$5);
  15087. _MatrixTranspose($6);
  15088. $8 = HEAP32[4679]|0;
  15089. dest=$$byval_copy; src=$8; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  15090. dest=$$byval_copy1; src=$6; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  15091. _MatrixMultiply($7,$$byval_copy,$$byval_copy1);
  15092. dest=$8; src=$7; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  15093. STACKTOP = sp;return;
  15094. }
  15095. function _rlEnableDepthTest() {
  15096. var label = 0, sp = 0;
  15097. sp = STACKTOP;
  15098. _glEnable(2929);
  15099. return;
  15100. }
  15101. function _End3dMode() {
  15102. var label = 0, sp = 0;
  15103. sp = STACKTOP;
  15104. _rlglDraw();
  15105. _rlMatrixMode(5889);
  15106. _rlPopMatrix();
  15107. _rlMatrixMode(5888);
  15108. _rlLoadIdentity();
  15109. _rlDisableDepthTest();
  15110. return;
  15111. }
  15112. function _rlPopMatrix() {
  15113. var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, label = 0, sp = 0;
  15114. sp = STACKTOP;
  15115. $0 = HEAP32[5188]|0;
  15116. $1 = ($0|0)>(0);
  15117. if (!($1)) {
  15118. return;
  15119. }
  15120. $2 = HEAP32[5188]|0;
  15121. $3 = (($2) + -1)|0;
  15122. $4 = (19012 + ($3<<6)|0);
  15123. $5 = HEAP32[4679]|0;
  15124. _memmove(($5|0),($4|0),64)|0;
  15125. $6 = (($2) + -1)|0;
  15126. HEAP32[5188] = $6;
  15127. return;
  15128. }
  15129. function _rlDisableDepthTest() {
  15130. var label = 0, sp = 0;
  15131. sp = STACKTOP;
  15132. _glDisable(2929);
  15133. return;
  15134. }
  15135. function _GetFPS() {
  15136. var $0 = 0.0, $1 = 0.0, $2 = 0, label = 0, sp = 0;
  15137. sp = STACKTOP;
  15138. $0 = (+_GetFrameTime());
  15139. $1 = 1.0 / $0;
  15140. $2 = (~~(($1)));
  15141. return ($2|0);
  15142. }
  15143. function _GetFrameTime() {
  15144. var $0 = 0.0, $1 = 0.0, label = 0, sp = 0;
  15145. sp = STACKTOP;
  15146. $0 = +HEAPF64[2273];
  15147. $1 = $0;
  15148. return (+$1);
  15149. }
  15150. function _IsFileExtension($0,$1) {
  15151. $0 = $0|0;
  15152. $1 = $1|0;
  15153. var $$ = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0;
  15154. sp = STACKTOP;
  15155. $2 = (_strrchr($0,46)|0);
  15156. $3 = ($2|0)==(0|0);
  15157. if ($3) {
  15158. return 0;
  15159. } else {
  15160. $4 = (_strcmp($2,$1)|0);
  15161. $5 = ($4|0)==(0);
  15162. $$ = $5&1;
  15163. return ($$|0);
  15164. }
  15165. return (0)|0;
  15166. }
  15167. function _rlTranslatef($0,$1,$2) {
  15168. $0 = +$0;
  15169. $1 = +$1;
  15170. $2 = +$2;
  15171. var $$byval_copy = 0, $$byval_copy1 = 0, $3 = 0, $4 = 0, $5 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
  15172. sp = STACKTOP;
  15173. STACKTOP = STACKTOP + 256|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(256|0);
  15174. $$byval_copy1 = sp + 192|0;
  15175. $$byval_copy = sp + 128|0;
  15176. $3 = sp + 64|0;
  15177. $4 = sp;
  15178. _MatrixTranslate($3,$0,$1,$2);
  15179. _MatrixTranspose($3);
  15180. $5 = HEAP32[4679]|0;
  15181. dest=$$byval_copy; src=$5; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  15182. dest=$$byval_copy1; src=$3; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  15183. _MatrixMultiply($4,$$byval_copy,$$byval_copy1);
  15184. dest=$5; src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  15185. STACKTOP = sp;return;
  15186. }
  15187. function _rlRotatef($0,$1,$2,$3) {
  15188. $0 = +$0;
  15189. $1 = +$1;
  15190. $2 = +$2;
  15191. $3 = +$3;
  15192. var $$byval_copy1 = 0, $$byval_copy2 = 0, $10 = 0.0, $11 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
  15193. sp = STACKTOP;
  15194. STACKTOP = STACKTOP + 336|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(336|0);
  15195. $$byval_copy2 = sp + 272|0;
  15196. $$byval_copy1 = sp + 208|0;
  15197. $4 = sp + 144|0;
  15198. $5 = sp + 64|0;
  15199. $6 = sp + 80|0;
  15200. $7 = sp;
  15201. _MatrixIdentity($4);
  15202. HEAPF32[$5>>2] = $1;
  15203. $8 = ((($5)) + 4|0);
  15204. HEAPF32[$8>>2] = $2;
  15205. $9 = ((($5)) + 8|0);
  15206. HEAPF32[$9>>2] = $3;
  15207. _VectorNormalize($5);
  15208. $10 = $0 * 0.01745329238474369;
  15209. ;HEAP32[$$byval_copy2>>2]=HEAP32[$5>>2]|0;HEAP32[$$byval_copy2+4>>2]=HEAP32[$5+4>>2]|0;HEAP32[$$byval_copy2+8>>2]=HEAP32[$5+8>>2]|0;
  15210. _MatrixRotate($6,$$byval_copy2,$10);
  15211. dest=$4; src=$6; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  15212. _MatrixTranspose($4);
  15213. $11 = HEAP32[4679]|0;
  15214. dest=$$byval_copy1; src=$11; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  15215. dest=$$byval_copy2; src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  15216. _MatrixMultiply($7,$$byval_copy1,$$byval_copy2);
  15217. dest=$11; src=$7; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  15218. STACKTOP = sp;return;
  15219. }
  15220. function _rlScalef($0,$1,$2) {
  15221. $0 = +$0;
  15222. $1 = +$1;
  15223. $2 = +$2;
  15224. var $$byval_copy = 0, $$byval_copy1 = 0, $3 = 0, $4 = 0, $5 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
  15225. sp = STACKTOP;
  15226. STACKTOP = STACKTOP + 256|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(256|0);
  15227. $$byval_copy1 = sp + 192|0;
  15228. $$byval_copy = sp + 128|0;
  15229. $3 = sp + 64|0;
  15230. $4 = sp;
  15231. _MatrixScale($3,$0,$1,$2);
  15232. _MatrixTranspose($3);
  15233. $5 = HEAP32[4679]|0;
  15234. dest=$$byval_copy; src=$5; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  15235. dest=$$byval_copy1; src=$3; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  15236. _MatrixMultiply($4,$$byval_copy,$$byval_copy1);
  15237. dest=$5; src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  15238. STACKTOP = sp;return;
  15239. }
  15240. function _rlBegin($0) {
  15241. $0 = $0|0;
  15242. var label = 0, sp = 0;
  15243. sp = STACKTOP;
  15244. HEAP32[4752] = $0;
  15245. return;
  15246. }
  15247. function _rlEnd() {
  15248. var $$03956 = 0, $$04052 = 0, $$04154 = 0, $$04248 = 0, $$04347 = 0, $$byval_copy = 0, $$promoted = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0;
  15249. var $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0;
  15250. var $128 = 0, $129 = 0, $13 = 0.0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0;
  15251. var $146 = 0, $147 = 0, $148 = 0.0, $149 = 0.0, $15 = 0.0, $16 = 0, $17 = 0.0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0;
  15252. var $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0;
  15253. var $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0;
  15254. var $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0;
  15255. var $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $exitcond = 0, $exitcond60 = 0, $exitcond63 = 0;
  15256. var $scevgep = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
  15257. sp = STACKTOP;
  15258. STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(64|0);
  15259. $$byval_copy = sp;
  15260. $0 = HEAP32[5189]|0;
  15261. $1 = ($0|0)==(0);
  15262. if (!($1)) {
  15263. $2 = HEAP32[5190]|0;
  15264. $3 = ($2|0)>(0);
  15265. if ($3) {
  15266. $$03956 = 0;
  15267. while(1) {
  15268. $6 = HEAP32[4749]|0;
  15269. $7 = (($6) + (($$03956*12)|0)|0);
  15270. $8 = HEAP32[4679]|0;
  15271. dest=$$byval_copy; src=$8; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  15272. _VectorTransform($7,$$byval_copy);
  15273. $9 = (($$03956) + 1)|0;
  15274. $5 = HEAP32[5190]|0;
  15275. $10 = ($9|0)<($5|0);
  15276. if ($10) {
  15277. $$03956 = $9;
  15278. } else {
  15279. break;
  15280. }
  15281. }
  15282. HEAP32[5189] = 0;
  15283. $4 = ($5|0)>(0);
  15284. if ($4) {
  15285. $$04154 = 0;
  15286. while(1) {
  15287. $11 = HEAP32[4749]|0;
  15288. $12 = (($11) + (($$04154*12)|0)|0);
  15289. $13 = +HEAPF32[$12>>2];
  15290. $14 = (((($11) + (($$04154*12)|0)|0)) + 4|0);
  15291. $15 = +HEAPF32[$14>>2];
  15292. $16 = (((($11) + (($$04154*12)|0)|0)) + 8|0);
  15293. $17 = +HEAPF32[$16>>2];
  15294. _rlVertex3f($13,$15,$17);
  15295. $18 = (($$04154) + 1)|0;
  15296. $19 = HEAP32[5190]|0;
  15297. $20 = ($18|0)<($19|0);
  15298. if ($20) {
  15299. $$04154 = $18;
  15300. } else {
  15301. break;
  15302. }
  15303. }
  15304. }
  15305. } else {
  15306. HEAP32[5189] = 0;
  15307. }
  15308. HEAP32[5190] = 0;
  15309. }
  15310. $21 = HEAP32[4752]|0;
  15311. switch ($21|0) {
  15312. case 1: {
  15313. $22 = HEAP32[5011]|0;
  15314. $23 = HEAP32[(20052)>>2]|0;
  15315. $24 = ($22|0)==($23|0);
  15316. if ($24) {
  15317. $148 = +HEAPF32[754];
  15318. $149 = $148 + 4.9999998736893758E-5;
  15319. HEAPF32[754] = $149;
  15320. STACKTOP = sp;return;
  15321. }
  15322. $25 = (($22) - ($23))|0;
  15323. $26 = ($25|0)>(0);
  15324. if ($26) {
  15325. $$04347 = 0;
  15326. } else {
  15327. $148 = +HEAPF32[754];
  15328. $149 = $148 + 4.9999998736893758E-5;
  15329. HEAPF32[754] = $149;
  15330. STACKTOP = sp;return;
  15331. }
  15332. while(1) {
  15333. $27 = HEAP32[(20064)>>2]|0;
  15334. $28 = HEAP32[(20052)>>2]|0;
  15335. $29 = $28 << 2;
  15336. $30 = (($29) + -4)|0;
  15337. $31 = (($27) + ($30)|0);
  15338. $32 = HEAP8[$31>>0]|0;
  15339. $33 = (($27) + ($29)|0);
  15340. HEAP8[$33>>0] = $32;
  15341. $34 = HEAP32[(20064)>>2]|0;
  15342. $35 = HEAP32[(20052)>>2]|0;
  15343. $36 = $35 << 2;
  15344. $37 = (($36) + -3)|0;
  15345. $38 = (($34) + ($37)|0);
  15346. $39 = HEAP8[$38>>0]|0;
  15347. $40 = $36 | 1;
  15348. $41 = (($34) + ($40)|0);
  15349. HEAP8[$41>>0] = $39;
  15350. $42 = HEAP32[(20064)>>2]|0;
  15351. $43 = HEAP32[(20052)>>2]|0;
  15352. $44 = $43 << 2;
  15353. $45 = (($44) + -2)|0;
  15354. $46 = (($42) + ($45)|0);
  15355. $47 = HEAP8[$46>>0]|0;
  15356. $48 = $44 | 2;
  15357. $49 = (($42) + ($48)|0);
  15358. HEAP8[$49>>0] = $47;
  15359. $50 = HEAP32[(20064)>>2]|0;
  15360. $51 = HEAP32[(20052)>>2]|0;
  15361. $52 = $51 << 2;
  15362. $53 = (($52) + -1)|0;
  15363. $54 = (($50) + ($53)|0);
  15364. $55 = HEAP8[$54>>0]|0;
  15365. $56 = $52 | 3;
  15366. $57 = (($50) + ($56)|0);
  15367. HEAP8[$57>>0] = $55;
  15368. $58 = HEAP32[(20052)>>2]|0;
  15369. $59 = (($58) + 1)|0;
  15370. HEAP32[(20052)>>2] = $59;
  15371. $60 = (($$04347) + 1)|0;
  15372. $exitcond = ($60|0)==($25|0);
  15373. if ($exitcond) {
  15374. break;
  15375. } else {
  15376. $$04347 = $60;
  15377. }
  15378. }
  15379. $148 = +HEAPF32[754];
  15380. $149 = $148 + 4.9999998736893758E-5;
  15381. HEAPF32[754] = $149;
  15382. STACKTOP = sp;return;
  15383. break;
  15384. }
  15385. case 4: {
  15386. $61 = HEAP32[5023]|0;
  15387. $62 = HEAP32[(20100)>>2]|0;
  15388. $63 = ($61|0)==($62|0);
  15389. if ($63) {
  15390. $148 = +HEAPF32[754];
  15391. $149 = $148 + 4.9999998736893758E-5;
  15392. HEAPF32[754] = $149;
  15393. STACKTOP = sp;return;
  15394. }
  15395. $64 = (($61) - ($62))|0;
  15396. $65 = ($64|0)>(0);
  15397. if ($65) {
  15398. $$04248 = 0;
  15399. } else {
  15400. $148 = +HEAPF32[754];
  15401. $149 = $148 + 4.9999998736893758E-5;
  15402. HEAPF32[754] = $149;
  15403. STACKTOP = sp;return;
  15404. }
  15405. while(1) {
  15406. $66 = HEAP32[(20112)>>2]|0;
  15407. $67 = HEAP32[(20100)>>2]|0;
  15408. $68 = $67 << 2;
  15409. $69 = (($68) + -4)|0;
  15410. $70 = (($66) + ($69)|0);
  15411. $71 = HEAP8[$70>>0]|0;
  15412. $72 = (($66) + ($68)|0);
  15413. HEAP8[$72>>0] = $71;
  15414. $73 = HEAP32[(20112)>>2]|0;
  15415. $74 = HEAP32[(20100)>>2]|0;
  15416. $75 = $74 << 2;
  15417. $76 = (($75) + -3)|0;
  15418. $77 = (($73) + ($76)|0);
  15419. $78 = HEAP8[$77>>0]|0;
  15420. $79 = $75 | 1;
  15421. $80 = (($73) + ($79)|0);
  15422. HEAP8[$80>>0] = $78;
  15423. $81 = HEAP32[(20112)>>2]|0;
  15424. $82 = HEAP32[(20100)>>2]|0;
  15425. $83 = $82 << 2;
  15426. $84 = (($83) + -2)|0;
  15427. $85 = (($81) + ($84)|0);
  15428. $86 = HEAP8[$85>>0]|0;
  15429. $87 = $83 | 2;
  15430. $88 = (($81) + ($87)|0);
  15431. HEAP8[$88>>0] = $86;
  15432. $89 = HEAP32[(20112)>>2]|0;
  15433. $90 = HEAP32[(20100)>>2]|0;
  15434. $91 = $90 << 2;
  15435. $92 = (($91) + -1)|0;
  15436. $93 = (($89) + ($92)|0);
  15437. $94 = HEAP8[$93>>0]|0;
  15438. $95 = $91 | 3;
  15439. $96 = (($89) + ($95)|0);
  15440. HEAP8[$96>>0] = $94;
  15441. $97 = HEAP32[(20100)>>2]|0;
  15442. $98 = (($97) + 1)|0;
  15443. HEAP32[(20100)>>2] = $98;
  15444. $99 = (($$04248) + 1)|0;
  15445. $exitcond60 = ($99|0)==($64|0);
  15446. if ($exitcond60) {
  15447. break;
  15448. } else {
  15449. $$04248 = $99;
  15450. }
  15451. }
  15452. $148 = +HEAPF32[754];
  15453. $149 = $148 + 4.9999998736893758E-5;
  15454. HEAPF32[754] = $149;
  15455. STACKTOP = sp;return;
  15456. break;
  15457. }
  15458. case 7: {
  15459. $100 = HEAP32[5035]|0;
  15460. $101 = HEAP32[(20148)>>2]|0;
  15461. $102 = ($100|0)==($101|0);
  15462. if (!($102)) {
  15463. $103 = (($100) - ($101))|0;
  15464. $104 = ($103|0)>(0);
  15465. if ($104) {
  15466. $$04052 = 0;
  15467. while(1) {
  15468. $105 = HEAP32[(20160)>>2]|0;
  15469. $106 = HEAP32[(20148)>>2]|0;
  15470. $107 = $106 << 2;
  15471. $108 = (($107) + -4)|0;
  15472. $109 = (($105) + ($108)|0);
  15473. $110 = HEAP8[$109>>0]|0;
  15474. $111 = (($105) + ($107)|0);
  15475. HEAP8[$111>>0] = $110;
  15476. $112 = HEAP32[(20160)>>2]|0;
  15477. $113 = HEAP32[(20148)>>2]|0;
  15478. $114 = $113 << 2;
  15479. $115 = (($114) + -3)|0;
  15480. $116 = (($112) + ($115)|0);
  15481. $117 = HEAP8[$116>>0]|0;
  15482. $118 = $114 | 1;
  15483. $119 = (($112) + ($118)|0);
  15484. HEAP8[$119>>0] = $117;
  15485. $120 = HEAP32[(20160)>>2]|0;
  15486. $121 = HEAP32[(20148)>>2]|0;
  15487. $122 = $121 << 2;
  15488. $123 = (($122) + -2)|0;
  15489. $124 = (($120) + ($123)|0);
  15490. $125 = HEAP8[$124>>0]|0;
  15491. $126 = $122 | 2;
  15492. $127 = (($120) + ($126)|0);
  15493. HEAP8[$127>>0] = $125;
  15494. $128 = HEAP32[(20160)>>2]|0;
  15495. $129 = HEAP32[(20148)>>2]|0;
  15496. $130 = $129 << 2;
  15497. $131 = (($130) + -1)|0;
  15498. $132 = (($128) + ($131)|0);
  15499. $133 = HEAP8[$132>>0]|0;
  15500. $134 = $130 | 3;
  15501. $135 = (($128) + ($134)|0);
  15502. HEAP8[$135>>0] = $133;
  15503. $136 = HEAP32[(20148)>>2]|0;
  15504. $137 = (($136) + 1)|0;
  15505. HEAP32[(20148)>>2] = $137;
  15506. $138 = (($$04052) + 1)|0;
  15507. $exitcond63 = ($138|0)==($103|0);
  15508. if ($exitcond63) {
  15509. break;
  15510. } else {
  15511. $$04052 = $138;
  15512. }
  15513. }
  15514. }
  15515. }
  15516. $139 = HEAP32[5035]|0;
  15517. $140 = HEAP32[(20144)>>2]|0;
  15518. $141 = ($139|0)>($140|0);
  15519. if (!($141)) {
  15520. $148 = +HEAPF32[754];
  15521. $149 = $148 + 4.9999998736893758E-5;
  15522. HEAPF32[754] = $149;
  15523. STACKTOP = sp;return;
  15524. }
  15525. $142 = HEAP32[(20156)>>2]|0;
  15526. $$promoted = HEAP32[(20144)>>2]|0;
  15527. $143 = $$promoted << 1;
  15528. $scevgep = (($142) + ($143<<2)|0);
  15529. $144 = (($139) - ($140))|0;
  15530. $145 = $144 << 3;
  15531. _memset(($scevgep|0),0,($145|0))|0;
  15532. $146 = (($139) + ($$promoted))|0;
  15533. $147 = (($146) - ($140))|0;
  15534. HEAP32[(20144)>>2] = $147;
  15535. $148 = +HEAPF32[754];
  15536. $149 = $148 + 4.9999998736893758E-5;
  15537. HEAPF32[754] = $149;
  15538. STACKTOP = sp;return;
  15539. break;
  15540. }
  15541. default: {
  15542. $148 = +HEAPF32[754];
  15543. $149 = $148 + 4.9999998736893758E-5;
  15544. HEAPF32[754] = $149;
  15545. STACKTOP = sp;return;
  15546. }
  15547. }
  15548. }
  15549. function _rlVertex3f($0,$1,$2) {
  15550. $0 = +$0;
  15551. $1 = +$1;
  15552. $2 = +$2;
  15553. var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0;
  15554. var $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0;
  15555. var $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer3 = 0, label = 0, sp = 0;
  15556. sp = STACKTOP;
  15557. STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
  15558. $vararg_buffer3 = sp + 16|0;
  15559. $vararg_buffer1 = sp + 8|0;
  15560. $vararg_buffer = sp;
  15561. $3 = HEAP32[5189]|0;
  15562. $4 = ($3|0)==(0);
  15563. if (!($4)) {
  15564. $5 = HEAP32[4749]|0;
  15565. $6 = HEAP32[5190]|0;
  15566. $7 = (($5) + (($6*12)|0)|0);
  15567. HEAPF32[$7>>2] = $0;
  15568. $8 = (((($5) + (($6*12)|0)|0)) + 4|0);
  15569. HEAPF32[$8>>2] = $1;
  15570. $9 = (((($5) + (($6*12)|0)|0)) + 8|0);
  15571. HEAPF32[$9>>2] = $2;
  15572. $10 = (($6) + 1)|0;
  15573. HEAP32[5190] = $10;
  15574. STACKTOP = sp;return;
  15575. }
  15576. $11 = HEAP32[4752]|0;
  15577. switch ($11|0) {
  15578. case 1: {
  15579. $12 = HEAP32[5011]|0;
  15580. $13 = ($12|0)<(2048);
  15581. if ($13) {
  15582. $14 = HEAP32[(20056)>>2]|0;
  15583. $15 = ($12*3)|0;
  15584. $16 = (($14) + ($15<<2)|0);
  15585. HEAPF32[$16>>2] = $0;
  15586. $17 = (($15) + 1)|0;
  15587. $18 = (($14) + ($17<<2)|0);
  15588. HEAPF32[$18>>2] = $1;
  15589. $19 = (($15) + 2)|0;
  15590. $20 = (($14) + ($19<<2)|0);
  15591. HEAPF32[$20>>2] = $2;
  15592. $21 = (($12) + 1)|0;
  15593. HEAP32[5011] = $21;
  15594. STACKTOP = sp;return;
  15595. } else {
  15596. _TraceLog(1,9273,$vararg_buffer);
  15597. STACKTOP = sp;return;
  15598. }
  15599. break;
  15600. }
  15601. case 4: {
  15602. $22 = HEAP32[5023]|0;
  15603. $23 = ($22|0)<(6144);
  15604. if ($23) {
  15605. $24 = HEAP32[(20104)>>2]|0;
  15606. $25 = ($22*3)|0;
  15607. $26 = (($24) + ($25<<2)|0);
  15608. HEAPF32[$26>>2] = $0;
  15609. $27 = (($25) + 1)|0;
  15610. $28 = (($24) + ($27<<2)|0);
  15611. HEAPF32[$28>>2] = $1;
  15612. $29 = (($25) + 2)|0;
  15613. $30 = (($24) + ($29<<2)|0);
  15614. HEAPF32[$30>>2] = $2;
  15615. $31 = (($22) + 1)|0;
  15616. HEAP32[5023] = $31;
  15617. STACKTOP = sp;return;
  15618. } else {
  15619. _TraceLog(1,9298,$vararg_buffer1);
  15620. STACKTOP = sp;return;
  15621. }
  15622. break;
  15623. }
  15624. case 7: {
  15625. $32 = HEAP32[5035]|0;
  15626. $33 = ($32|0)<(4096);
  15627. if ($33) {
  15628. $34 = HEAP32[(20152)>>2]|0;
  15629. $35 = ($32*3)|0;
  15630. $36 = (($34) + ($35<<2)|0);
  15631. HEAPF32[$36>>2] = $0;
  15632. $37 = (($35) + 1)|0;
  15633. $38 = (($34) + ($37<<2)|0);
  15634. HEAPF32[$38>>2] = $1;
  15635. $39 = (($35) + 2)|0;
  15636. $40 = (($34) + ($39<<2)|0);
  15637. HEAPF32[$40>>2] = $2;
  15638. $41 = (($32) + 1)|0;
  15639. HEAP32[5035] = $41;
  15640. $42 = HEAP32[4750]|0;
  15641. $43 = HEAP32[4751]|0;
  15642. $44 = (($43) + -1)|0;
  15643. $45 = (($42) + (($44*144)|0)|0);
  15644. $46 = HEAP32[$45>>2]|0;
  15645. $47 = (($46) + 1)|0;
  15646. HEAP32[$45>>2] = $47;
  15647. STACKTOP = sp;return;
  15648. } else {
  15649. _TraceLog(1,9327,$vararg_buffer3);
  15650. STACKTOP = sp;return;
  15651. }
  15652. break;
  15653. }
  15654. default: {
  15655. STACKTOP = sp;return;
  15656. }
  15657. }
  15658. }
  15659. function _rlVertex2f($0,$1) {
  15660. $0 = +$0;
  15661. $1 = +$1;
  15662. var $2 = 0.0, label = 0, sp = 0;
  15663. sp = STACKTOP;
  15664. $2 = +HEAPF32[754];
  15665. _rlVertex3f($0,$1,$2);
  15666. return;
  15667. }
  15668. function _rlTexCoord2f($0,$1) {
  15669. $0 = +$0;
  15670. $1 = +$1;
  15671. var $10 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
  15672. sp = STACKTOP;
  15673. $2 = HEAP32[4752]|0;
  15674. $3 = ($2|0)==(7);
  15675. if (!($3)) {
  15676. return;
  15677. }
  15678. $4 = HEAP32[(20156)>>2]|0;
  15679. $5 = HEAP32[(20144)>>2]|0;
  15680. $6 = $5 << 1;
  15681. $7 = (($4) + ($6<<2)|0);
  15682. HEAPF32[$7>>2] = $0;
  15683. $8 = $6 | 1;
  15684. $9 = (($4) + ($8<<2)|0);
  15685. HEAPF32[$9>>2] = $1;
  15686. $10 = (($5) + 1)|0;
  15687. HEAP32[(20144)>>2] = $10;
  15688. return;
  15689. }
  15690. function _rlNormal3f($0,$1,$2) {
  15691. $0 = +$0;
  15692. $1 = +$1;
  15693. $2 = +$2;
  15694. var label = 0, sp = 0;
  15695. sp = STACKTOP;
  15696. return;
  15697. }
  15698. function _rlColor4ub($0,$1,$2,$3) {
  15699. $0 = $0|0;
  15700. $1 = $1|0;
  15701. $2 = $2|0;
  15702. $3 = $3|0;
  15703. var $$sink37 = 0, $$sink38 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $4 = 0, $5 = 0;
  15704. var $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
  15705. sp = STACKTOP;
  15706. $4 = HEAP32[4752]|0;
  15707. switch ($4|0) {
  15708. case 1: {
  15709. $$sink37 = (20052);$$sink38 = (20064);
  15710. break;
  15711. }
  15712. case 4: {
  15713. $$sink37 = (20100);$$sink38 = (20112);
  15714. break;
  15715. }
  15716. case 7: {
  15717. $$sink37 = (20148);$$sink38 = (20160);
  15718. break;
  15719. }
  15720. default: {
  15721. return;
  15722. }
  15723. }
  15724. $5 = HEAP32[$$sink38>>2]|0;
  15725. $6 = HEAP32[$$sink37>>2]|0;
  15726. $7 = $6 << 2;
  15727. $8 = (($5) + ($7)|0);
  15728. HEAP8[$8>>0] = $0;
  15729. $9 = HEAP32[$$sink38>>2]|0;
  15730. $10 = HEAP32[$$sink37>>2]|0;
  15731. $11 = $10 << 2;
  15732. $12 = $11 | 1;
  15733. $13 = (($9) + ($12)|0);
  15734. HEAP8[$13>>0] = $1;
  15735. $14 = HEAP32[$$sink38>>2]|0;
  15736. $15 = HEAP32[$$sink37>>2]|0;
  15737. $16 = $15 << 2;
  15738. $17 = $16 | 2;
  15739. $18 = (($14) + ($17)|0);
  15740. HEAP8[$18>>0] = $2;
  15741. $19 = HEAP32[$$sink38>>2]|0;
  15742. $20 = HEAP32[$$sink37>>2]|0;
  15743. $21 = $20 << 2;
  15744. $22 = $21 | 3;
  15745. $23 = (($19) + ($22)|0);
  15746. HEAP8[$23>>0] = $3;
  15747. $24 = HEAP32[$$sink37>>2]|0;
  15748. $25 = (($24) + 1)|0;
  15749. HEAP32[$$sink37>>2] = $25;
  15750. return;
  15751. }
  15752. function _rlColor3f($0,$1,$2) {
  15753. $0 = +$0;
  15754. $1 = +$1;
  15755. $2 = +$2;
  15756. var $3 = 0.0, $4 = 0, $5 = 0.0, $6 = 0, $7 = 0.0, $8 = 0, label = 0, sp = 0;
  15757. sp = STACKTOP;
  15758. $3 = $0 * 255.0;
  15759. $4 = (~~(($3))&255);
  15760. $5 = $1 * 255.0;
  15761. $6 = (~~(($5))&255);
  15762. $7 = $2 * 255.0;
  15763. $8 = (~~(($7))&255);
  15764. _rlColor4ub($4,$6,$8,-1);
  15765. return;
  15766. }
  15767. function _rlEnableTexture($0) {
  15768. $0 = $0|0;
  15769. var $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
  15770. sp = STACKTOP;
  15771. $1 = HEAP32[4750]|0;
  15772. $2 = HEAP32[4751]|0;
  15773. $3 = (($2) + -1)|0;
  15774. $4 = (((($1) + (($3*144)|0)|0)) + 8|0);
  15775. $5 = HEAP32[$4>>2]|0;
  15776. $6 = ($5|0)==($0|0);
  15777. if ($6) {
  15778. return;
  15779. }
  15780. $7 = (($1) + (($3*144)|0)|0);
  15781. $8 = HEAP32[$7>>2]|0;
  15782. $9 = ($8|0)>(0);
  15783. if ($9) {
  15784. $10 = (($2) + 1)|0;
  15785. HEAP32[4751] = $10;
  15786. }
  15787. $11 = HEAP32[4751]|0;
  15788. $12 = (($11) + -1)|0;
  15789. $13 = (((($1) + (($12*144)|0)|0)) + 8|0);
  15790. HEAP32[$13>>2] = $0;
  15791. $14 = (($1) + (($12*144)|0)|0);
  15792. HEAP32[$14>>2] = 0;
  15793. return;
  15794. }
  15795. function _rlDisableTexture() {
  15796. var $0 = 0, $1 = 0, label = 0, sp = 0;
  15797. sp = STACKTOP;
  15798. $0 = HEAP32[5035]|0;
  15799. $1 = ($0|0)>(4095);
  15800. if (!($1)) {
  15801. return;
  15802. }
  15803. _rlglDraw();
  15804. return;
  15805. }
  15806. function _rlDeleteVertexArrays($0) {
  15807. $0 = $0|0;
  15808. var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $vararg_buffer = 0, label = 0, sp = 0;
  15809. sp = STACKTOP;
  15810. STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
  15811. $vararg_buffer = sp;
  15812. $1 = sp + 4|0;
  15813. HEAP32[$1>>2] = $0;
  15814. $2 = HEAP32[4713]|0;
  15815. $3 = ($2|0)==(0);
  15816. if ($3) {
  15817. STACKTOP = sp;return;
  15818. }
  15819. $4 = ($0|0)==(0);
  15820. if (!($4)) {
  15821. $5 = HEAP32[4716]|0;
  15822. FUNCTION_TABLE_vii[$5 & 63](1,$1);
  15823. }
  15824. $6 = HEAP32[$1>>2]|0;
  15825. HEAP32[$vararg_buffer>>2] = $6;
  15826. _TraceLog(0,9352,$vararg_buffer);
  15827. STACKTOP = sp;return;
  15828. }
  15829. function _rlDeleteBuffers($0) {
  15830. $0 = $0|0;
  15831. var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $vararg_buffer = 0, label = 0, sp = 0;
  15832. sp = STACKTOP;
  15833. STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
  15834. $vararg_buffer = sp;
  15835. $1 = sp + 4|0;
  15836. HEAP32[$1>>2] = $0;
  15837. $2 = ($0|0)==(0);
  15838. if ($2) {
  15839. STACKTOP = sp;return;
  15840. }
  15841. _glDeleteBuffers(1,($1|0));
  15842. $3 = HEAP32[4713]|0;
  15843. $4 = ($3|0)==(0);
  15844. if (!($4)) {
  15845. STACKTOP = sp;return;
  15846. }
  15847. $5 = HEAP32[$1>>2]|0;
  15848. HEAP32[$vararg_buffer>>2] = $5;
  15849. _TraceLog(0,9400,$vararg_buffer);
  15850. STACKTOP = sp;return;
  15851. }
  15852. function _rlglLoadMesh($0,$1) {
  15853. $0 = $0|0;
  15854. $1 = $1|0;
  15855. var $$ = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0;
  15856. var $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0;
  15857. var $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0;
  15858. var $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0;
  15859. var $82 = 0, $83 = 0, $84 = 0, $85 = 0, $9 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer3 = 0, label = 0, sp = 0;
  15860. sp = STACKTOP;
  15861. STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(64|0);
  15862. $vararg_buffer3 = sp + 16|0;
  15863. $vararg_buffer1 = sp + 8|0;
  15864. $vararg_buffer = sp;
  15865. $2 = sp + 48|0;
  15866. $3 = sp + 20|0;
  15867. $4 = ((($0)) + 36|0);
  15868. $5 = ((($0)) + 40|0);
  15869. $6 = ((($0)) + 44|0);
  15870. $7 = ((($0)) + 48|0);
  15871. $8 = ((($0)) + 52|0);
  15872. $9 = ((($0)) + 56|0);
  15873. $10 = ((($0)) + 60|0);
  15874. $11 = ((($0)) + 64|0);
  15875. $12 = ($1|0)!=(0);
  15876. $$ = $12 ? 35048 : 35044;
  15877. ;HEAP32[$4>>2]=0|0;HEAP32[$4+4>>2]=0|0;HEAP32[$4+8>>2]=0|0;HEAP32[$4+12>>2]=0|0;HEAP32[$4+16>>2]=0|0;HEAP32[$4+20>>2]=0|0;HEAP32[$4+24>>2]=0|0;HEAP32[$4+28>>2]=0|0;
  15878. HEAP32[$2>>2] = 0;
  15879. ;HEAP32[$3>>2]=0|0;HEAP32[$3+4>>2]=0|0;HEAP32[$3+8>>2]=0|0;HEAP32[$3+12>>2]=0|0;HEAP32[$3+16>>2]=0|0;HEAP32[$3+20>>2]=0|0;HEAP32[$3+24>>2]=0|0;
  15880. $13 = HEAP32[4713]|0;
  15881. $14 = ($13|0)==(0);
  15882. if (!($14)) {
  15883. $15 = HEAP32[4714]|0;
  15884. FUNCTION_TABLE_vii[$15 & 63](1,$2);
  15885. $16 = HEAP32[4715]|0;
  15886. $17 = HEAP32[$2>>2]|0;
  15887. FUNCTION_TABLE_vi[$16 & 31]($17);
  15888. }
  15889. _glGenBuffers(1,($3|0));
  15890. $18 = HEAP32[$3>>2]|0;
  15891. _glBindBuffer(34962,($18|0));
  15892. $19 = HEAP32[$0>>2]|0;
  15893. $20 = ($19*12)|0;
  15894. $21 = ((($0)) + 8|0);
  15895. $22 = HEAP32[$21>>2]|0;
  15896. _glBufferData(34962,($20|0),($22|0),($$|0));
  15897. _glVertexAttribPointer(0,3,5126,0,0,(0|0));
  15898. _glEnableVertexAttribArray(0);
  15899. $23 = ((($3)) + 4|0);
  15900. _glGenBuffers(1,($23|0));
  15901. $24 = HEAP32[$23>>2]|0;
  15902. _glBindBuffer(34962,($24|0));
  15903. $25 = HEAP32[$0>>2]|0;
  15904. $26 = $25 << 3;
  15905. $27 = ((($0)) + 12|0);
  15906. $28 = HEAP32[$27>>2]|0;
  15907. _glBufferData(34962,($26|0),($28|0),($$|0));
  15908. _glVertexAttribPointer(1,2,5126,0,0,(0|0));
  15909. _glEnableVertexAttribArray(1);
  15910. $29 = ((($0)) + 20|0);
  15911. $30 = HEAP32[$29>>2]|0;
  15912. $31 = ($30|0)==(0|0);
  15913. if ($31) {
  15914. _glVertexAttrib3f(2,1.0,1.0,1.0);
  15915. _glDisableVertexAttribArray(2);
  15916. } else {
  15917. $32 = ((($3)) + 8|0);
  15918. _glGenBuffers(1,($32|0));
  15919. $33 = HEAP32[$32>>2]|0;
  15920. _glBindBuffer(34962,($33|0));
  15921. $34 = HEAP32[$0>>2]|0;
  15922. $35 = ($34*12)|0;
  15923. $36 = HEAP32[$29>>2]|0;
  15924. _glBufferData(34962,($35|0),($36|0),($$|0));
  15925. _glVertexAttribPointer(2,3,5126,0,0,(0|0));
  15926. _glEnableVertexAttribArray(2);
  15927. }
  15928. $37 = ((($0)) + 28|0);
  15929. $38 = HEAP32[$37>>2]|0;
  15930. $39 = ($38|0)==(0|0);
  15931. if ($39) {
  15932. _glVertexAttrib4f(3,1.0,1.0,1.0,1.0);
  15933. _glDisableVertexAttribArray(3);
  15934. } else {
  15935. $40 = ((($3)) + 12|0);
  15936. _glGenBuffers(1,($40|0));
  15937. $41 = HEAP32[$40>>2]|0;
  15938. _glBindBuffer(34962,($41|0));
  15939. $42 = HEAP32[$0>>2]|0;
  15940. $43 = $42 << 2;
  15941. $44 = HEAP32[$37>>2]|0;
  15942. _glBufferData(34962,($43|0),($44|0),($$|0));
  15943. _glVertexAttribPointer(3,4,5121,1,0,(0|0));
  15944. _glEnableVertexAttribArray(3);
  15945. }
  15946. $45 = ((($0)) + 24|0);
  15947. $46 = HEAP32[$45>>2]|0;
  15948. $47 = ($46|0)==(0|0);
  15949. if ($47) {
  15950. _glVertexAttrib3f(4,0.0,0.0,0.0);
  15951. _glDisableVertexAttribArray(4);
  15952. } else {
  15953. $48 = ((($3)) + 16|0);
  15954. _glGenBuffers(1,($48|0));
  15955. $49 = HEAP32[$48>>2]|0;
  15956. _glBindBuffer(34962,($49|0));
  15957. $50 = HEAP32[$0>>2]|0;
  15958. $51 = ($50*12)|0;
  15959. $52 = HEAP32[$45>>2]|0;
  15960. _glBufferData(34962,($51|0),($52|0),($$|0));
  15961. _glVertexAttribPointer(4,3,5126,0,0,(0|0));
  15962. _glEnableVertexAttribArray(4);
  15963. }
  15964. $53 = ((($0)) + 16|0);
  15965. $54 = HEAP32[$53>>2]|0;
  15966. $55 = ($54|0)==(0|0);
  15967. if ($55) {
  15968. _glVertexAttrib2f(5,0.0,0.0);
  15969. _glDisableVertexAttribArray(5);
  15970. } else {
  15971. $56 = ((($3)) + 20|0);
  15972. _glGenBuffers(1,($56|0));
  15973. $57 = HEAP32[$56>>2]|0;
  15974. _glBindBuffer(34962,($57|0));
  15975. $58 = HEAP32[$0>>2]|0;
  15976. $59 = $58 << 3;
  15977. $60 = HEAP32[$53>>2]|0;
  15978. _glBufferData(34962,($59|0),($60|0),($$|0));
  15979. _glVertexAttribPointer(5,2,5126,0,0,(0|0));
  15980. _glEnableVertexAttribArray(5);
  15981. }
  15982. $61 = ((($0)) + 32|0);
  15983. $62 = HEAP32[$61>>2]|0;
  15984. $63 = ($62|0)==(0|0);
  15985. if (!($63)) {
  15986. $64 = ((($3)) + 24|0);
  15987. _glGenBuffers(1,($64|0));
  15988. $65 = HEAP32[$64>>2]|0;
  15989. _glBindBuffer(34963,($65|0));
  15990. $66 = ((($0)) + 4|0);
  15991. $67 = HEAP32[$66>>2]|0;
  15992. $68 = ($67*6)|0;
  15993. $69 = HEAP32[$61>>2]|0;
  15994. _glBufferData(34963,($68|0),($69|0),35044);
  15995. }
  15996. $70 = HEAP32[$3>>2]|0;
  15997. HEAP32[$5>>2] = $70;
  15998. $71 = HEAP32[$23>>2]|0;
  15999. HEAP32[$6>>2] = $71;
  16000. $72 = ((($3)) + 8|0);
  16001. $73 = HEAP32[$72>>2]|0;
  16002. HEAP32[$7>>2] = $73;
  16003. $74 = ((($3)) + 12|0);
  16004. $75 = HEAP32[$74>>2]|0;
  16005. HEAP32[$8>>2] = $75;
  16006. $76 = ((($3)) + 16|0);
  16007. $77 = HEAP32[$76>>2]|0;
  16008. HEAP32[$9>>2] = $77;
  16009. $78 = ((($3)) + 20|0);
  16010. $79 = HEAP32[$78>>2]|0;
  16011. HEAP32[$10>>2] = $79;
  16012. $80 = ((($3)) + 24|0);
  16013. $81 = HEAP32[$80>>2]|0;
  16014. HEAP32[$11>>2] = $81;
  16015. $82 = HEAP32[4713]|0;
  16016. $83 = ($82|0)==(0);
  16017. if ($83) {
  16018. _TraceLog(0,9549,$vararg_buffer3);
  16019. STACKTOP = sp;return;
  16020. }
  16021. $84 = HEAP32[$2>>2]|0;
  16022. $85 = ($84|0)==(0);
  16023. if ($85) {
  16024. _TraceLog(2,9508,$vararg_buffer1);
  16025. STACKTOP = sp;return;
  16026. } else {
  16027. HEAP32[$4>>2] = $84;
  16028. HEAP32[$vararg_buffer>>2] = $84;
  16029. _TraceLog(0,9455,$vararg_buffer);
  16030. STACKTOP = sp;return;
  16031. }
  16032. }
  16033. function _rlglDrawMesh($0,$1,$2) {
  16034. $0 = $0|0;
  16035. $1 = $1|0;
  16036. $2 = $2|0;
  16037. var $$ = 0, $$020 = 0, $$byval_copy5 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0;
  16038. var $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0.0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0.0, $130 = 0, $131 = 0, $132 = 0;
  16039. var $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0;
  16040. var $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0.0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0;
  16041. var $17 = 0.0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $18 = 0, $19 = 0, $20 = 0.0, $21 = 0.0, $22 = 0, $23 = 0, $24 = 0.0, $25 = 0.0, $26 = 0, $27 = 0, $28 = 0;
  16042. var $29 = 0, $3 = 0, $30 = 0, $31 = 0.0, $32 = 0.0, $33 = 0, $34 = 0, $35 = 0.0, $36 = 0.0, $37 = 0, $38 = 0, $39 = 0.0, $4 = 0, $40 = 0.0, $41 = 0, $42 = 0, $43 = 0.0, $44 = 0.0, $45 = 0, $46 = 0;
  16043. var $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0.0, $51 = 0.0, $52 = 0, $53 = 0, $54 = 0.0, $55 = 0.0, $56 = 0, $57 = 0, $58 = 0.0, $59 = 0.0, $6 = 0, $60 = 0, $61 = 0, $62 = 0.0, $63 = 0.0, $64 = 0;
  16044. var $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0.0, $75 = 0, $76 = 0.0, $77 = 0, $78 = 0.0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0.0;
  16045. var $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $modelview$byval_copy4 = 0, dest = 0;
  16046. var label = 0, sp = 0, src = 0, stop = 0;
  16047. sp = STACKTOP;
  16048. STACKTOP = STACKTOP + 384|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(384|0);
  16049. $$byval_copy5 = sp + 320|0;
  16050. $modelview$byval_copy4 = sp + 256|0;
  16051. $3 = sp + 192|0;
  16052. $4 = sp + 128|0;
  16053. $5 = sp + 64|0;
  16054. $6 = sp;
  16055. $7 = HEAP32[$1>>2]|0;
  16056. _glUseProgram(($7|0));
  16057. $8 = ((($1)) + 32|0);
  16058. $9 = HEAP32[$8>>2]|0;
  16059. $10 = ((($1)) + 116|0);
  16060. $11 = HEAP8[$10>>0]|0;
  16061. $12 = (+($11&255));
  16062. $13 = $12 / 255.0;
  16063. $14 = ((($1)) + 117|0);
  16064. $15 = HEAP8[$14>>0]|0;
  16065. $16 = (+($15&255));
  16066. $17 = $16 / 255.0;
  16067. $18 = ((($1)) + 118|0);
  16068. $19 = HEAP8[$18>>0]|0;
  16069. $20 = (+($19&255));
  16070. $21 = $20 / 255.0;
  16071. $22 = ((($1)) + 119|0);
  16072. $23 = HEAP8[$22>>0]|0;
  16073. $24 = (+($23&255));
  16074. $25 = $24 / 255.0;
  16075. _glUniform4f(($9|0),(+$13),(+$17),(+$21),(+$25));
  16076. $26 = ((($1)) + 36|0);
  16077. $27 = HEAP32[$26>>2]|0;
  16078. $28 = ($27|0)==(-1);
  16079. if (!($28)) {
  16080. $29 = ((($1)) + 120|0);
  16081. $30 = HEAP8[$29>>0]|0;
  16082. $31 = (+($30&255));
  16083. $32 = $31 / 255.0;
  16084. $33 = ((($1)) + 121|0);
  16085. $34 = HEAP8[$33>>0]|0;
  16086. $35 = (+($34&255));
  16087. $36 = $35 / 255.0;
  16088. $37 = ((($1)) + 122|0);
  16089. $38 = HEAP8[$37>>0]|0;
  16090. $39 = (+($38&255));
  16091. $40 = $39 / 255.0;
  16092. $41 = ((($1)) + 123|0);
  16093. $42 = HEAP8[$41>>0]|0;
  16094. $43 = (+($42&255));
  16095. $44 = $43 / 255.0;
  16096. _glUniform4f(($27|0),(+$32),(+$36),(+$40),(+$44));
  16097. }
  16098. $45 = ((($1)) + 40|0);
  16099. $46 = HEAP32[$45>>2]|0;
  16100. $47 = ($46|0)==(-1);
  16101. if (!($47)) {
  16102. $48 = ((($1)) + 124|0);
  16103. $49 = HEAP8[$48>>0]|0;
  16104. $50 = (+($49&255));
  16105. $51 = $50 / 255.0;
  16106. $52 = ((($1)) + 125|0);
  16107. $53 = HEAP8[$52>>0]|0;
  16108. $54 = (+($53&255));
  16109. $55 = $54 / 255.0;
  16110. $56 = ((($1)) + 126|0);
  16111. $57 = HEAP8[$56>>0]|0;
  16112. $58 = (+($57&255));
  16113. $59 = $58 / 255.0;
  16114. $60 = ((($1)) + 127|0);
  16115. $61 = HEAP8[$60>>0]|0;
  16116. $62 = (+($61&255));
  16117. $63 = $62 / 255.0;
  16118. _glUniform4f(($46|0),(+$51),(+$55),(+$59),(+$63));
  16119. }
  16120. dest=$3; src=18784; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  16121. dest=$4; src=18720; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  16122. dest=$modelview$byval_copy4; src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  16123. dest=$$byval_copy5; src=18784; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  16124. _MatrixMultiply($5,$modelview$byval_copy4,$$byval_copy5);
  16125. $64 = HEAP32[$1>>2]|0;
  16126. $65 = HEAP32[4721]|0;
  16127. $66 = ($64|0)==($65|0);
  16128. if (!($66)) {
  16129. $67 = (_glGetUniformLocation(($64|0),(9597|0))|0);
  16130. $68 = ($67|0)==(-1);
  16131. if (!($68)) {
  16132. dest=$modelview$byval_copy4; src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  16133. _MatrixTranspose($modelview$byval_copy4);
  16134. _MatrixInvert($modelview$byval_copy4);
  16135. dest=$$byval_copy5; src=$modelview$byval_copy4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  16136. $69 = (_MatrixToFloat($$byval_copy5)|0);
  16137. _glUniformMatrix4fv(($67|0),1,0,($69|0));
  16138. }
  16139. $70 = HEAP32[$1>>2]|0;
  16140. $71 = (_glGetUniformLocation(($70|0),(9609|0))|0);
  16141. $72 = ($71|0)==(-1);
  16142. if (!($72)) {
  16143. $73 = ((($3)) + 8|0);
  16144. $74 = +HEAPF32[$73>>2];
  16145. $75 = ((($3)) + 24|0);
  16146. $76 = +HEAPF32[$75>>2];
  16147. $77 = ((($3)) + 40|0);
  16148. $78 = +HEAPF32[$77>>2];
  16149. _glUniform3f(($71|0),(+$74),(+$76),(+$78));
  16150. }
  16151. $79 = (_glGetUniformLocation(($70|0),(9617|0))|0);
  16152. $80 = ($79|0)==(-1);
  16153. if (!($80)) {
  16154. $81 = ((($1)) + 128|0);
  16155. $82 = +HEAPF32[$81>>2];
  16156. _glUniform1f(($79|0),(+$82));
  16157. }
  16158. }
  16159. _glActiveTexture(33984);
  16160. $83 = ((($1)) + 56|0);
  16161. $84 = HEAP32[$83>>2]|0;
  16162. _glBindTexture(3553,($84|0));
  16163. $85 = ((($1)) + 44|0);
  16164. $86 = HEAP32[$85>>2]|0;
  16165. _glUniform1i(($86|0),0);
  16166. $87 = ((($1)) + 76|0);
  16167. $88 = HEAP32[$87>>2]|0;
  16168. $89 = ($88|0)==(0);
  16169. if (!($89)) {
  16170. $90 = ((($1)) + 48|0);
  16171. $91 = HEAP32[$90>>2]|0;
  16172. $92 = ($91|0)==(-1);
  16173. if (!($92)) {
  16174. $93 = HEAP32[$1>>2]|0;
  16175. $94 = (_glGetUniformLocation(($93|0),(9628|0))|0);
  16176. _glUniform1i(($94|0),1);
  16177. _glActiveTexture(33985);
  16178. $95 = HEAP32[$87>>2]|0;
  16179. _glBindTexture(3553,($95|0));
  16180. $96 = HEAP32[$90>>2]|0;
  16181. _glUniform1i(($96|0),1);
  16182. }
  16183. }
  16184. $97 = ((($1)) + 96|0);
  16185. $98 = HEAP32[$97>>2]|0;
  16186. $99 = ($98|0)==(0);
  16187. if (!($99)) {
  16188. $100 = ((($1)) + 52|0);
  16189. $101 = HEAP32[$100>>2]|0;
  16190. $102 = ($101|0)==(-1);
  16191. if (!($102)) {
  16192. $103 = HEAP32[$1>>2]|0;
  16193. $104 = (_glGetUniformLocation(($103|0),(9638|0))|0);
  16194. _glUniform1i(($104|0),1);
  16195. _glActiveTexture(33986);
  16196. $105 = HEAP32[$97>>2]|0;
  16197. _glBindTexture(3553,($105|0));
  16198. $106 = HEAP32[$100>>2]|0;
  16199. _glUniform1i(($106|0),2);
  16200. }
  16201. }
  16202. $107 = HEAP32[4713]|0;
  16203. $108 = ($107|0)==(0);
  16204. if ($108) {
  16205. $112 = ((($0)) + 40|0);
  16206. $113 = HEAP32[$112>>2]|0;
  16207. _glBindBuffer(34962,($113|0));
  16208. $114 = ((($1)) + 4|0);
  16209. $115 = HEAP32[$114>>2]|0;
  16210. _glVertexAttribPointer(($115|0),3,5126,0,0,(0|0));
  16211. _glEnableVertexAttribArray(($115|0));
  16212. $116 = ((($0)) + 44|0);
  16213. $117 = HEAP32[$116>>2]|0;
  16214. _glBindBuffer(34962,($117|0));
  16215. $118 = ((($1)) + 8|0);
  16216. $119 = HEAP32[$118>>2]|0;
  16217. _glVertexAttribPointer(($119|0),2,5126,0,0,(0|0));
  16218. _glEnableVertexAttribArray(($119|0));
  16219. $120 = ((($1)) + 16|0);
  16220. $121 = HEAP32[$120>>2]|0;
  16221. $122 = ($121|0)==(-1);
  16222. if (!($122)) {
  16223. $123 = ((($0)) + 48|0);
  16224. $124 = HEAP32[$123>>2]|0;
  16225. _glBindBuffer(34962,($124|0));
  16226. $125 = HEAP32[$120>>2]|0;
  16227. _glVertexAttribPointer(($125|0),3,5126,0,0,(0|0));
  16228. $126 = HEAP32[$120>>2]|0;
  16229. _glEnableVertexAttribArray(($126|0));
  16230. }
  16231. $127 = ((($1)) + 24|0);
  16232. $128 = HEAP32[$127>>2]|0;
  16233. $129 = ($128|0)==(-1);
  16234. do {
  16235. if (!($129)) {
  16236. $130 = ((($0)) + 52|0);
  16237. $131 = HEAP32[$130>>2]|0;
  16238. $132 = ($131|0)==(0);
  16239. if ($132) {
  16240. _glVertexAttrib4f(($128|0),1.0,1.0,1.0,1.0);
  16241. $135 = HEAP32[$127>>2]|0;
  16242. _glDisableVertexAttribArray(($135|0));
  16243. break;
  16244. } else {
  16245. _glBindBuffer(34962,($131|0));
  16246. $133 = HEAP32[$127>>2]|0;
  16247. _glVertexAttribPointer(($133|0),4,5121,1,0,(0|0));
  16248. $134 = HEAP32[$127>>2]|0;
  16249. _glEnableVertexAttribArray(($134|0));
  16250. break;
  16251. }
  16252. }
  16253. } while(0);
  16254. $136 = ((($1)) + 20|0);
  16255. $137 = HEAP32[$136>>2]|0;
  16256. $138 = ($137|0)==(-1);
  16257. if (!($138)) {
  16258. $139 = ((($0)) + 56|0);
  16259. $140 = HEAP32[$139>>2]|0;
  16260. _glBindBuffer(34962,($140|0));
  16261. $141 = HEAP32[$136>>2]|0;
  16262. _glVertexAttribPointer(($141|0),3,5126,0,0,(0|0));
  16263. $142 = HEAP32[$136>>2]|0;
  16264. _glEnableVertexAttribArray(($142|0));
  16265. }
  16266. $143 = ((($1)) + 12|0);
  16267. $144 = HEAP32[$143>>2]|0;
  16268. $145 = ($144|0)==(-1);
  16269. if (!($145)) {
  16270. $146 = ((($0)) + 60|0);
  16271. $147 = HEAP32[$146>>2]|0;
  16272. _glBindBuffer(34962,($147|0));
  16273. $148 = HEAP32[$143>>2]|0;
  16274. _glVertexAttribPointer(($148|0),2,5126,0,0,(0|0));
  16275. $149 = HEAP32[$143>>2]|0;
  16276. _glEnableVertexAttribArray(($149|0));
  16277. }
  16278. $150 = ((($0)) + 32|0);
  16279. $151 = HEAP32[$150>>2]|0;
  16280. $152 = ($151|0)==(0|0);
  16281. if (!($152)) {
  16282. $153 = HEAP32[(20184)>>2]|0;
  16283. _glBindBuffer(34963,($153|0));
  16284. }
  16285. } else {
  16286. $109 = HEAP32[4715]|0;
  16287. $110 = ((($0)) + 36|0);
  16288. $111 = HEAP32[$110>>2]|0;
  16289. FUNCTION_TABLE_vi[$109 & 31]($111);
  16290. }
  16291. $154 = HEAP32[5098]|0;
  16292. $155 = ($154|0)!=(0);
  16293. $$ = $155 ? 2 : 1;
  16294. $156 = ((($1)) + 28|0);
  16295. $157 = ((($0)) + 32|0);
  16296. $158 = HEAP32[$0>>2]|0;
  16297. $159 = ((($0)) + 4|0);
  16298. $$020 = 0;
  16299. while(1) {
  16300. if ($155) {
  16301. dest=$modelview$byval_copy4; src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  16302. dest=$$byval_copy5; src=$5; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  16303. _SetStereoView($$020,$modelview$byval_copy4,$$byval_copy5);
  16304. } else {
  16305. dest=18784; src=$5; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  16306. }
  16307. dest=$modelview$byval_copy4; src=18784; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  16308. dest=$$byval_copy5; src=18720; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  16309. _MatrixMultiply($6,$modelview$byval_copy4,$$byval_copy5);
  16310. $162 = HEAP32[$156>>2]|0;
  16311. dest=$$byval_copy5; src=$6; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  16312. $163 = (_MatrixToFloat($$byval_copy5)|0);
  16313. _glUniformMatrix4fv(($162|0),1,0,($163|0));
  16314. $164 = HEAP32[$157>>2]|0;
  16315. $165 = ($164|0)==(0|0);
  16316. if ($165) {
  16317. _glDrawArrays(4,0,($158|0));
  16318. } else {
  16319. $166 = HEAP32[$159>>2]|0;
  16320. $167 = ($166*3)|0;
  16321. _glDrawElements(4,($167|0),5123,(0|0));
  16322. }
  16323. $168 = (($$020) + 1)|0;
  16324. $169 = ($168|0)<($$|0);
  16325. if ($169) {
  16326. $$020 = $168;
  16327. } else {
  16328. break;
  16329. }
  16330. }
  16331. $160 = HEAP32[$87>>2]|0;
  16332. $161 = ($160|0)==(0);
  16333. if (!($161)) {
  16334. _glActiveTexture(33985);
  16335. _glBindTexture(3553,0);
  16336. }
  16337. $170 = HEAP32[$97>>2]|0;
  16338. $171 = ($170|0)==(0);
  16339. if (!($171)) {
  16340. _glActiveTexture(33986);
  16341. _glBindTexture(3553,0);
  16342. }
  16343. _glActiveTexture(33984);
  16344. _glBindTexture(3553,0);
  16345. $172 = HEAP32[4713]|0;
  16346. $173 = ($172|0)==(0);
  16347. if (!($173)) {
  16348. $174 = HEAP32[4715]|0;
  16349. FUNCTION_TABLE_vi[$174 & 31](0);
  16350. _glUseProgram(0);
  16351. dest=18720; src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  16352. dest=18784; src=$3; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  16353. STACKTOP = sp;return;
  16354. }
  16355. _glBindBuffer(34962,0);
  16356. $175 = ((($0)) + 32|0);
  16357. $176 = HEAP32[$175>>2]|0;
  16358. $177 = ($176|0)==(0|0);
  16359. if ($177) {
  16360. _glUseProgram(0);
  16361. dest=18720; src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  16362. dest=18784; src=$3; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  16363. STACKTOP = sp;return;
  16364. }
  16365. _glBindBuffer(34963,0);
  16366. _glUseProgram(0);
  16367. dest=18720; src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  16368. dest=18784; src=$3; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  16369. STACKTOP = sp;return;
  16370. }
  16371. function _rlglUnloadMesh($0) {
  16372. $0 = $0|0;
  16373. var $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0;
  16374. var $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
  16375. sp = STACKTOP;
  16376. $1 = ((($0)) + 8|0);
  16377. $2 = HEAP32[$1>>2]|0;
  16378. $3 = ($2|0)==(0|0);
  16379. if (!($3)) {
  16380. _free($2);
  16381. }
  16382. $4 = ((($0)) + 12|0);
  16383. $5 = HEAP32[$4>>2]|0;
  16384. $6 = ($5|0)==(0|0);
  16385. if (!($6)) {
  16386. _free($5);
  16387. }
  16388. $7 = ((($0)) + 20|0);
  16389. $8 = HEAP32[$7>>2]|0;
  16390. $9 = ($8|0)==(0|0);
  16391. if (!($9)) {
  16392. _free($8);
  16393. }
  16394. $10 = ((($0)) + 28|0);
  16395. $11 = HEAP32[$10>>2]|0;
  16396. $12 = ($11|0)==(0|0);
  16397. if (!($12)) {
  16398. _free($11);
  16399. }
  16400. $13 = ((($0)) + 24|0);
  16401. $14 = HEAP32[$13>>2]|0;
  16402. $15 = ($14|0)==(0|0);
  16403. if (!($15)) {
  16404. _free($14);
  16405. }
  16406. $16 = ((($0)) + 16|0);
  16407. $17 = HEAP32[$16>>2]|0;
  16408. $18 = ($17|0)==(0|0);
  16409. if (!($18)) {
  16410. _free($17);
  16411. }
  16412. $19 = ((($0)) + 32|0);
  16413. $20 = HEAP32[$19>>2]|0;
  16414. $21 = ($20|0)==(0|0);
  16415. if (!($21)) {
  16416. _free($20);
  16417. }
  16418. $22 = ((($0)) + 40|0);
  16419. $23 = HEAP32[$22>>2]|0;
  16420. _rlDeleteBuffers($23);
  16421. $24 = ((($0)) + 44|0);
  16422. $25 = HEAP32[$24>>2]|0;
  16423. _rlDeleteBuffers($25);
  16424. $26 = ((($0)) + 48|0);
  16425. $27 = HEAP32[$26>>2]|0;
  16426. _rlDeleteBuffers($27);
  16427. $28 = ((($0)) + 52|0);
  16428. $29 = HEAP32[$28>>2]|0;
  16429. _rlDeleteBuffers($29);
  16430. $30 = ((($0)) + 56|0);
  16431. $31 = HEAP32[$30>>2]|0;
  16432. _rlDeleteBuffers($31);
  16433. $32 = ((($0)) + 60|0);
  16434. $33 = HEAP32[$32>>2]|0;
  16435. _rlDeleteBuffers($33);
  16436. $34 = ((($0)) + 64|0);
  16437. $35 = HEAP32[$34>>2]|0;
  16438. _rlDeleteBuffers($35);
  16439. $36 = ((($0)) + 36|0);
  16440. $37 = HEAP32[$36>>2]|0;
  16441. _rlDeleteVertexArrays($37);
  16442. return;
  16443. }
  16444. function _GetDefaultTexture($0) {
  16445. $0 = $0|0;
  16446. var $$sroa$4$0$$sroa_idx2 = 0, $$sroa$5$0$$sroa_idx4 = 0, $$sroa$6$0$$sroa_idx6 = 0, $$sroa$7$0$$sroa_idx8 = 0, $1 = 0, label = 0, sp = 0;
  16447. sp = STACKTOP;
  16448. $1 = HEAP32[4720]|0;
  16449. HEAP32[$0>>2] = $1;
  16450. $$sroa$4$0$$sroa_idx2 = ((($0)) + 4|0);
  16451. HEAP32[$$sroa$4$0$$sroa_idx2>>2] = 1;
  16452. $$sroa$5$0$$sroa_idx4 = ((($0)) + 8|0);
  16453. HEAP32[$$sroa$5$0$$sroa_idx4>>2] = 1;
  16454. $$sroa$6$0$$sroa_idx6 = ((($0)) + 12|0);
  16455. HEAP32[$$sroa$6$0$$sroa_idx6>>2] = 1;
  16456. $$sroa$7$0$$sroa_idx8 = ((($0)) + 16|0);
  16457. HEAP32[$$sroa$7$0$$sroa_idx8>>2] = 7;
  16458. return;
  16459. }
  16460. function _GetDefaultShader($0) {
  16461. $0 = $0|0;
  16462. var dest = 0, label = 0, sp = 0, src = 0, stop = 0;
  16463. sp = STACKTOP;
  16464. dest=$0; src=18884; stop=dest+56|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  16465. return;
  16466. }
  16467. function _stbi__err($0) {
  16468. $0 = $0|0;
  16469. var label = 0, sp = 0;
  16470. sp = STACKTOP;
  16471. HEAP32[5191] = $0;
  16472. return;
  16473. }
  16474. function _stbi_load_from_file($0,$1,$2,$3,$4) {
  16475. $0 = $0|0;
  16476. $1 = $1|0;
  16477. $2 = $2|0;
  16478. $3 = $3|0;
  16479. $4 = $4|0;
  16480. var $10 = 0, $11 = 0, $12 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
  16481. sp = STACKTOP;
  16482. STACKTOP = STACKTOP + 192|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(192|0);
  16483. $5 = sp;
  16484. _stbi__start_file($5,$0);
  16485. $6 = (_stbi__load_and_postprocess_8bit($5,$1,$2,$3,$4)|0);
  16486. $7 = ($6|0)==(0|0);
  16487. if ($7) {
  16488. STACKTOP = sp;return ($6|0);
  16489. }
  16490. $8 = ((($5)) + 172|0);
  16491. $9 = HEAP32[$8>>2]|0;
  16492. $10 = ((($5)) + 168|0);
  16493. $11 = HEAP32[$10>>2]|0;
  16494. $12 = (($11) - ($9))|0;
  16495. (_fseek($0,$12,1)|0);
  16496. STACKTOP = sp;return ($6|0);
  16497. }
  16498. function _stbi__start_file($0,$1) {
  16499. $0 = $0|0;
  16500. $1 = $1|0;
  16501. var label = 0, sp = 0;
  16502. sp = STACKTOP;
  16503. _stbi__start_callbacks($0,3132,$1);
  16504. return;
  16505. }
  16506. function _stbi__load_and_postprocess_8bit($0,$1,$2,$3,$4) {
  16507. $0 = $0|0;
  16508. $1 = $1|0;
  16509. $2 = $2|0;
  16510. $3 = $3|0;
  16511. $4 = $4|0;
  16512. var $$0 = 0, $$070 = 0, $$07175 = 0, $$07276 = 0, $$07378 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0;
  16513. var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $40 = 0, $41 = 0, $42 = 0, $5 = 0, $6 = 0;
  16514. var $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $exitcond79 = 0, $exitcond80 = 0, label = 0, sp = 0;
  16515. sp = STACKTOP;
  16516. STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
  16517. $5 = sp;
  16518. $6 = (_stbi__load_main($0,$1,$2,$3,$4,$5)|0);
  16519. $7 = ($6|0)==(0|0);
  16520. if ($7) {
  16521. $$0 = 0;
  16522. STACKTOP = sp;return ($$0|0);
  16523. }
  16524. $8 = HEAP32[$5>>2]|0;
  16525. switch ($8|0) {
  16526. case 8: {
  16527. $$070 = $6;
  16528. break;
  16529. }
  16530. case 16: {
  16531. label = 4;
  16532. break;
  16533. }
  16534. default: {
  16535. ___assert_fail((9650|0),(9676|0),1041,(9699|0));
  16536. // unreachable;
  16537. }
  16538. }
  16539. if ((label|0) == 4) {
  16540. $9 = HEAP32[$1>>2]|0;
  16541. $10 = HEAP32[$2>>2]|0;
  16542. $11 = ($4|0)==(0);
  16543. if ($11) {
  16544. $12 = HEAP32[$3>>2]|0;
  16545. $13 = $12;
  16546. } else {
  16547. $13 = $4;
  16548. }
  16549. $14 = (_stbi__convert_16_to_8($6,$9,$10,$13)|0);
  16550. HEAP32[$5>>2] = 8;
  16551. $$070 = $14;
  16552. }
  16553. $15 = HEAP32[5192]|0;
  16554. $16 = ($15|0)==(0);
  16555. if ($16) {
  16556. $$0 = $$070;
  16557. STACKTOP = sp;return ($$0|0);
  16558. }
  16559. $17 = HEAP32[$1>>2]|0;
  16560. $18 = HEAP32[$2>>2]|0;
  16561. $19 = ($4|0)==(0);
  16562. if ($19) {
  16563. $20 = HEAP32[$3>>2]|0;
  16564. $25 = $20;
  16565. } else {
  16566. $25 = $4;
  16567. }
  16568. $21 = $18 >> 1;
  16569. $22 = ($21|0)>(0);
  16570. if (!($22)) {
  16571. $$0 = $$070;
  16572. STACKTOP = sp;return ($$0|0);
  16573. }
  16574. $23 = ($17|0)>(0);
  16575. $24 = ($25|0)>(0);
  16576. $26 = (($18) + -1)|0;
  16577. $$07378 = 0;
  16578. while(1) {
  16579. if ($23) {
  16580. $27 = Math_imul($$07378, $17)|0;
  16581. $28 = (($26) - ($$07378))|0;
  16582. $29 = Math_imul($28, $17)|0;
  16583. $$07276 = 0;
  16584. while(1) {
  16585. if ($24) {
  16586. $30 = (($$07276) + ($27))|0;
  16587. $31 = Math_imul($30, $25)|0;
  16588. $32 = (($$07276) + ($29))|0;
  16589. $33 = Math_imul($32, $25)|0;
  16590. $$07175 = 0;
  16591. while(1) {
  16592. $34 = (($$07175) + ($31))|0;
  16593. $35 = (($$070) + ($34)|0);
  16594. $36 = HEAP8[$35>>0]|0;
  16595. $37 = (($$07175) + ($33))|0;
  16596. $38 = (($$070) + ($37)|0);
  16597. $39 = HEAP8[$38>>0]|0;
  16598. HEAP8[$35>>0] = $39;
  16599. HEAP8[$38>>0] = $36;
  16600. $40 = (($$07175) + 1)|0;
  16601. $exitcond = ($40|0)==($25|0);
  16602. if ($exitcond) {
  16603. break;
  16604. } else {
  16605. $$07175 = $40;
  16606. }
  16607. }
  16608. }
  16609. $41 = (($$07276) + 1)|0;
  16610. $exitcond79 = ($41|0)==($17|0);
  16611. if ($exitcond79) {
  16612. break;
  16613. } else {
  16614. $$07276 = $41;
  16615. }
  16616. }
  16617. }
  16618. $42 = (($$07378) + 1)|0;
  16619. $exitcond80 = ($42|0)==($21|0);
  16620. if ($exitcond80) {
  16621. $$0 = $$070;
  16622. break;
  16623. } else {
  16624. $$07378 = $42;
  16625. }
  16626. }
  16627. STACKTOP = sp;return ($$0|0);
  16628. }
  16629. function _stbi__load_main($0,$1,$2,$3,$4,$5) {
  16630. $0 = $0|0;
  16631. $1 = $1|0;
  16632. $2 = $2|0;
  16633. $3 = $3|0;
  16634. $4 = $4|0;
  16635. $5 = $5|0;
  16636. var $$0 = 0, $10 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
  16637. sp = STACKTOP;
  16638. HEAP32[$5>>2] = 8;
  16639. $6 = ((($5)) + 8|0);
  16640. HEAP32[$6>>2] = 0;
  16641. $7 = ((($5)) + 4|0);
  16642. HEAP32[$7>>2] = 0;
  16643. $8 = (_stbi__png_test($0)|0);
  16644. $9 = ($8|0)==(0);
  16645. if ($9) {
  16646. _stbi__err(9740);
  16647. $$0 = 0;
  16648. return ($$0|0);
  16649. } else {
  16650. $10 = (_stbi__png_load($0,$1,$2,$3,$4,$5)|0);
  16651. $$0 = $10;
  16652. return ($$0|0);
  16653. }
  16654. return (0)|0;
  16655. }
  16656. function _stbi__convert_16_to_8($0,$1,$2,$3) {
  16657. $0 = $0|0;
  16658. $1 = $1|0;
  16659. $2 = $2|0;
  16660. $3 = $3|0;
  16661. var $$0 = 0, $$01819 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, label = 0, sp = 0;
  16662. sp = STACKTOP;
  16663. $4 = Math_imul($2, $1)|0;
  16664. $5 = Math_imul($4, $3)|0;
  16665. $6 = (_stbi__malloc($5)|0);
  16666. $7 = ($6|0)==(0|0);
  16667. if ($7) {
  16668. _stbi__err(9731);
  16669. $$0 = 0;
  16670. return ($$0|0);
  16671. }
  16672. $8 = ($5|0)>(0);
  16673. if ($8) {
  16674. $$01819 = 0;
  16675. while(1) {
  16676. $9 = (($0) + ($$01819<<1)|0);
  16677. $10 = HEAP16[$9>>1]|0;
  16678. $11 = ($10&65535) >>> 8;
  16679. $12 = $11&255;
  16680. $13 = (($6) + ($$01819)|0);
  16681. HEAP8[$13>>0] = $12;
  16682. $14 = (($$01819) + 1)|0;
  16683. $exitcond = ($14|0)==($5|0);
  16684. if ($exitcond) {
  16685. break;
  16686. } else {
  16687. $$01819 = $14;
  16688. }
  16689. }
  16690. }
  16691. _free($0);
  16692. $$0 = $6;
  16693. return ($$0|0);
  16694. }
  16695. function _stbi__malloc($0) {
  16696. $0 = $0|0;
  16697. var $1 = 0, label = 0, sp = 0;
  16698. sp = STACKTOP;
  16699. $1 = (_malloc($0)|0);
  16700. return ($1|0);
  16701. }
  16702. function _stbi__png_test($0) {
  16703. $0 = $0|0;
  16704. var $1 = 0, label = 0, sp = 0;
  16705. sp = STACKTOP;
  16706. $1 = (_stbi__check_png_header($0)|0);
  16707. _stbi__rewind($0);
  16708. return ($1|0);
  16709. }
  16710. function _stbi__png_load($0,$1,$2,$3,$4,$5) {
  16711. $0 = $0|0;
  16712. $1 = $1|0;
  16713. $2 = $2|0;
  16714. $3 = $3|0;
  16715. $4 = $4|0;
  16716. $5 = $5|0;
  16717. var $6 = 0, $7 = 0, label = 0, sp = 0;
  16718. sp = STACKTOP;
  16719. STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
  16720. $6 = sp;
  16721. HEAP32[$6>>2] = $0;
  16722. $7 = (_stbi__do_png($6,$1,$2,$3,$4,$5)|0);
  16723. STACKTOP = sp;return ($7|0);
  16724. }
  16725. function _stbi__do_png($0,$1,$2,$3,$4,$5) {
  16726. $0 = $0|0;
  16727. $1 = $1|0;
  16728. $2 = $2|0;
  16729. $3 = $3|0;
  16730. $4 = $4|0;
  16731. $5 = $5|0;
  16732. var $$ = 0, $$0 = 0, $$045 = 0, $$1 = 0, $$2 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0;
  16733. var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $40 = 0, $41 = 0, $6 = 0, $7 = 0, $8 = 0;
  16734. var $9 = 0, label = 0, sp = 0;
  16735. sp = STACKTOP;
  16736. $6 = ($4>>>0)>(4);
  16737. if ($6) {
  16738. _stbi__err(9759);
  16739. $$045 = 0;
  16740. return ($$045|0);
  16741. }
  16742. $7 = (_stbi__parse_png_file($0,0,$4)|0);
  16743. $8 = ($7|0)==(0);
  16744. if ($8) {
  16745. $$2 = 0;
  16746. } else {
  16747. $9 = ((($0)) + 16|0);
  16748. $10 = HEAP32[$9>>2]|0;
  16749. $11 = ($10|0)>(8);
  16750. $$ = $11 ? $10 : 8;
  16751. HEAP32[$5>>2] = $$;
  16752. $12 = ((($0)) + 12|0);
  16753. $13 = HEAP32[$12>>2]|0;
  16754. HEAP32[$12>>2] = 0;
  16755. $14 = ($4|0)==(0);
  16756. if ($14) {
  16757. $$1 = $13;
  16758. } else {
  16759. $15 = HEAP32[$0>>2]|0;
  16760. $16 = ((($15)) + 12|0);
  16761. $17 = HEAP32[$16>>2]|0;
  16762. $18 = ($17|0)==($4|0);
  16763. if ($18) {
  16764. $$1 = $13;
  16765. } else {
  16766. $19 = HEAP32[$5>>2]|0;
  16767. $20 = ($19|0)==(8);
  16768. $21 = ((($15)) + 4|0);
  16769. $22 = HEAP32[$21>>2]|0;
  16770. $23 = HEAP32[$15>>2]|0;
  16771. if ($20) {
  16772. $24 = (_stbi__convert_format($13,$17,$4,$23,$22)|0);
  16773. $$0 = $24;
  16774. } else {
  16775. $25 = (_stbi__convert_format16($13,$17,$4,$23,$22)|0);
  16776. $$0 = $25;
  16777. }
  16778. $26 = HEAP32[$0>>2]|0;
  16779. $27 = ((($26)) + 12|0);
  16780. HEAP32[$27>>2] = $4;
  16781. $28 = ($$0|0)==(0|0);
  16782. if ($28) {
  16783. $$045 = 0;
  16784. return ($$045|0);
  16785. } else {
  16786. $$1 = $$0;
  16787. }
  16788. }
  16789. }
  16790. $29 = HEAP32[$0>>2]|0;
  16791. $30 = HEAP32[$29>>2]|0;
  16792. HEAP32[$1>>2] = $30;
  16793. $31 = ((($29)) + 4|0);
  16794. $32 = HEAP32[$31>>2]|0;
  16795. HEAP32[$2>>2] = $32;
  16796. $33 = ($3|0)==(0|0);
  16797. if ($33) {
  16798. $$2 = $$1;
  16799. } else {
  16800. $34 = ((($29)) + 8|0);
  16801. $35 = HEAP32[$34>>2]|0;
  16802. HEAP32[$3>>2] = $35;
  16803. $$2 = $$1;
  16804. }
  16805. }
  16806. $36 = ((($0)) + 12|0);
  16807. $37 = HEAP32[$36>>2]|0;
  16808. _free($37);
  16809. HEAP32[$36>>2] = 0;
  16810. $38 = ((($0)) + 8|0);
  16811. $39 = HEAP32[$38>>2]|0;
  16812. _free($39);
  16813. HEAP32[$38>>2] = 0;
  16814. $40 = ((($0)) + 4|0);
  16815. $41 = HEAP32[$40>>2]|0;
  16816. _free($41);
  16817. HEAP32[$40>>2] = 0;
  16818. $$045 = $$2;
  16819. return ($$045|0);
  16820. }
  16821. function _stbi__parse_png_file($0,$1,$2) {
  16822. $0 = $0|0;
  16823. $1 = $1|0;
  16824. $2 = $2|0;
  16825. var $$ = 0, $$$0217 = 0, $$0206 = 0, $$0211 = 0, $$0214 = 0, $$0217 = 0, $$0226593 = 0, $$0228 = 0, $$0231 = 0, $$0235 = 0, $$0239591 = 0, $$0241 = 0, $$0245 = 0, $$1207 = 0, $$1212 = 0, $$1215 = 0, $$1218 = 0, $$1227588 = 0, $$1229 = 0, $$1240589 = 0;
  16826. var $$1246 = 0, $$2219 = 0, $$2233 = 0, $$2237 = 0, $$2243 = 0, $$254 = 0, $$3209 = 0, $$3220 = 0, $$4 = 0, $$6$ph = 0, $$7 = 0, $$lobit = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0;
  16827. var $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0;
  16828. var $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0;
  16829. var $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0;
  16830. var $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0;
  16831. var $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0;
  16832. var $198 = 0, $199 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $22 = 0, $23 = 0;
  16833. var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0;
  16834. var $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0;
  16835. var $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0;
  16836. var $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0;
  16837. var $97 = 0, $98 = 0, $99 = 0, $notlhs = 0, $notrhs = 0, $or$cond = 0, $or$cond11 = 0, $or$cond248 = 0, $or$cond5$not = 0, $or$cond7 = 0, $switch$split112D = 0, $switch$split142D = 0, $switch$split2D = 0, $switch$split52D = 0, $switch$split82D = 0, label = 0, sp = 0;
  16838. sp = STACKTOP;
  16839. STACKTOP = STACKTOP + 1056|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(1056|0);
  16840. $3 = sp + 32|0;
  16841. $4 = sp + 22|0;
  16842. $5 = sp + 16|0;
  16843. $6 = sp + 8|0;
  16844. $7 = sp;
  16845. $8 = HEAP32[$0>>2]|0;
  16846. $9 = ((($0)) + 8|0);
  16847. HEAP32[$9>>2] = 0;
  16848. $10 = ((($0)) + 4|0);
  16849. HEAP32[$10>>2] = 0;
  16850. $11 = ((($0)) + 12|0);
  16851. HEAP32[$11>>2] = 0;
  16852. $12 = (_stbi__check_png_header($8)|0);
  16853. $13 = ($12|0)==(0);
  16854. if ($13) {
  16855. $$7 = 0;
  16856. STACKTOP = sp;return ($$7|0);
  16857. }
  16858. $14 = ($1|0)==(1);
  16859. if ($14) {
  16860. $$7 = 1;
  16861. STACKTOP = sp;return ($$7|0);
  16862. }
  16863. $15 = ((($6)) + 4|0);
  16864. $16 = ((($8)) + 4|0);
  16865. $17 = ((($0)) + 16|0);
  16866. $18 = ((($8)) + 8|0);
  16867. $19 = ($1|0)==(2);
  16868. $20 = ((($8)) + 8|0);
  16869. $21 = ((($8)) + 8|0);
  16870. $22 = ((($0)) + 16|0);
  16871. $23 = ($1|0)==(2);
  16872. $24 = ($1|0)==(2);
  16873. $$0206 = 0;$$0211 = 0;$$0214 = 0;$$0217 = 0;$$0228 = 0;$$0231 = 0;$$0235 = 0;$$0241 = 1;$$0245 = 0;
  16874. L7: while(1) {
  16875. _stbi__get_chunk_header($6,$8);
  16876. $25 = HEAP32[$15>>2]|0;
  16877. $switch$split2D = ($25|0)<(1229472850);
  16878. L9: do {
  16879. if ($switch$split2D) {
  16880. $switch$split52D = ($25|0)<(1229209940);
  16881. if ($switch$split52D) {
  16882. switch ($25|0) {
  16883. case 1130840649: {
  16884. break;
  16885. }
  16886. default: {
  16887. label = 103;
  16888. break L9;
  16889. }
  16890. }
  16891. $26 = HEAP32[$6>>2]|0;
  16892. _stbi__skip($8,$26);
  16893. $$1212 = $$0211;$$1215 = $$0214;$$1229 = 1;$$1246 = $$0245;$$2233 = $$0231;$$2237 = $$0235;$$2243 = $$0241;$$3209 = $$0206;$$3220 = $$0217;
  16894. break;
  16895. }
  16896. $switch$split112D = ($25|0)<(1229278788);
  16897. if (!($switch$split112D)) {
  16898. switch ($25|0) {
  16899. case 1229278788: {
  16900. label = 85;
  16901. break L7;
  16902. break;
  16903. }
  16904. default: {
  16905. label = 103;
  16906. break L9;
  16907. }
  16908. }
  16909. }
  16910. switch ($25|0) {
  16911. case 1229209940: {
  16912. break;
  16913. }
  16914. default: {
  16915. label = 103;
  16916. break L9;
  16917. }
  16918. }
  16919. $130 = ($$0241|0)==(0);
  16920. if (!($130)) {
  16921. label = 70;
  16922. break L7;
  16923. }
  16924. $131 = ($$0206<<24>>24)==(0);
  16925. $132 = ($$0245|0)!=(0);
  16926. $or$cond = $132 | $131;
  16927. if (!($or$cond)) {
  16928. label = 72;
  16929. break L7;
  16930. }
  16931. if ($24) {
  16932. label = 74;
  16933. break L7;
  16934. }
  16935. $135 = HEAP32[$6>>2]|0;
  16936. $136 = (($135) + ($$0214))|0;
  16937. $137 = ($136|0)<($$0214|0);
  16938. if ($137) {
  16939. $$6$ph = 0;
  16940. break L7;
  16941. }
  16942. $138 = ($136>>>0)>($$0217>>>0);
  16943. if ($138) {
  16944. $139 = ($$0217|0)==(0);
  16945. $140 = ($135>>>0)>(4096);
  16946. $141 = $140 ? $135 : 4096;
  16947. $$$0217 = $139 ? $141 : $$0217;
  16948. $142 = HEAP32[$6>>2]|0;
  16949. $143 = (($142) + ($$0214))|0;
  16950. $$1218 = $$$0217;
  16951. while(1) {
  16952. $144 = ($143>>>0)>($$1218>>>0);
  16953. $145 = $$1218 << 1;
  16954. if ($144) {
  16955. $$1218 = $145;
  16956. } else {
  16957. break;
  16958. }
  16959. }
  16960. $146 = HEAP32[$10>>2]|0;
  16961. $147 = (_realloc($146,$$1218)|0);
  16962. $148 = ($147|0)==(0|0);
  16963. if ($148) {
  16964. label = 81;
  16965. break L7;
  16966. }
  16967. HEAP32[$10>>2] = $147;
  16968. $$2219 = $$1218;
  16969. } else {
  16970. $$2219 = $$0217;
  16971. }
  16972. $149 = HEAP32[$10>>2]|0;
  16973. $150 = (($149) + ($$0214)|0);
  16974. $151 = HEAP32[$6>>2]|0;
  16975. $152 = (_stbi__getn($8,$150,$151)|0);
  16976. $153 = ($152|0)==(0);
  16977. if ($153) {
  16978. label = 83;
  16979. break L7;
  16980. }
  16981. $154 = HEAP32[$6>>2]|0;
  16982. $155 = (($154) + ($$0214))|0;
  16983. $$1212 = $$0211;$$1215 = $155;$$1229 = $$0228;$$1246 = $$0245;$$2233 = $$0231;$$2237 = $$0235;$$2243 = $$0241;$$3209 = $$0206;$$3220 = $$2219;
  16984. } else {
  16985. $switch$split82D = ($25|0)<(1347179589);
  16986. if ($switch$split82D) {
  16987. switch ($25|0) {
  16988. case 1229472850: {
  16989. break;
  16990. }
  16991. default: {
  16992. label = 103;
  16993. break L9;
  16994. }
  16995. }
  16996. $27 = ($$0241|0)==(0);
  16997. if ($27) {
  16998. label = 7;
  16999. break L7;
  17000. }
  17001. $28 = HEAP32[$6>>2]|0;
  17002. $29 = ($28|0)==(13);
  17003. if (!($29)) {
  17004. label = 9;
  17005. break L7;
  17006. }
  17007. $30 = (_stbi__get32be($8)|0);
  17008. HEAP32[$8>>2] = $30;
  17009. $31 = ($30>>>0)>(16777216);
  17010. if ($31) {
  17011. label = 11;
  17012. break L7;
  17013. }
  17014. $32 = (_stbi__get32be($8)|0);
  17015. HEAP32[$16>>2] = $32;
  17016. $33 = ($32>>>0)>(16777216);
  17017. if ($33) {
  17018. label = 13;
  17019. break L7;
  17020. }
  17021. $34 = (_stbi__get8($8)|0);
  17022. $35 = $34&255;
  17023. HEAP32[$17>>2] = $35;
  17024. switch ($34<<24>>24) {
  17025. case 16: case 8: case 4: case 2: case 1: {
  17026. break;
  17027. }
  17028. default: {
  17029. label = 15;
  17030. break L7;
  17031. }
  17032. }
  17033. $36 = (_stbi__get8($8)|0);
  17034. $37 = $36&255;
  17035. $38 = ($36&255)>(6);
  17036. if ($38) {
  17037. label = 17;
  17038. break L7;
  17039. }
  17040. $39 = ($36<<24>>24)==(3);
  17041. if ($39) {
  17042. $40 = HEAP32[$17>>2]|0;
  17043. $41 = ($40|0)==(16);
  17044. if ($41) {
  17045. label = 20;
  17046. break L7;
  17047. } else {
  17048. $$1207 = 3;
  17049. }
  17050. } else {
  17051. $42 = $37 & 1;
  17052. $43 = ($42|0)==(0);
  17053. if ($43) {
  17054. $$1207 = $$0206;
  17055. } else {
  17056. label = 22;
  17057. break L7;
  17058. }
  17059. }
  17060. $44 = (_stbi__get8($8)|0);
  17061. $45 = ($44<<24>>24)==(0);
  17062. if (!($45)) {
  17063. label = 24;
  17064. break L7;
  17065. }
  17066. $46 = (_stbi__get8($8)|0);
  17067. $47 = ($46<<24>>24)==(0);
  17068. if (!($47)) {
  17069. label = 26;
  17070. break L7;
  17071. }
  17072. $48 = (_stbi__get8($8)|0);
  17073. $49 = $48&255;
  17074. $50 = ($48&255)>(1);
  17075. if ($50) {
  17076. label = 28;
  17077. break L7;
  17078. }
  17079. $51 = HEAP32[$8>>2]|0;
  17080. $52 = ($51|0)==(0);
  17081. if ($52) {
  17082. label = 31;
  17083. break L7;
  17084. }
  17085. $53 = HEAP32[$16>>2]|0;
  17086. $54 = ($53|0)==(0);
  17087. if ($54) {
  17088. label = 31;
  17089. break L7;
  17090. }
  17091. $55 = ($$1207<<24>>24)==(0);
  17092. $56 = (1073741824 / ($51>>>0))&-1;
  17093. if (!($55)) {
  17094. HEAP32[$20>>2] = 1;
  17095. $63 = $56 >>> 2;
  17096. $64 = ($63>>>0)<($53>>>0);
  17097. if ($64) {
  17098. label = 37;
  17099. break L7;
  17100. } else {
  17101. $$1212 = $$0211;$$1215 = $$0214;$$1229 = $$0228;$$1246 = $$0245;$$2233 = $37;$$2237 = $49;$$2243 = 0;$$3209 = $$1207;$$3220 = $$0217;
  17102. break;
  17103. }
  17104. }
  17105. $57 = $37 & 2;
  17106. $58 = $57 | 1;
  17107. $59 = $37 >>> 2;
  17108. $$lobit = $59 & 1;
  17109. $60 = (($58) + ($$lobit))|0;
  17110. HEAP32[$18>>2] = $60;
  17111. $61 = (($56>>>0) / ($60>>>0))&-1;
  17112. $62 = ($61>>>0)<($53>>>0);
  17113. if ($62) {
  17114. label = 34;
  17115. break L7;
  17116. }
  17117. if ($19) {
  17118. $$6$ph = 1;
  17119. break L7;
  17120. } else {
  17121. $$1212 = $$0211;$$1215 = $$0214;$$1229 = $$0228;$$1246 = $$0245;$$2233 = $37;$$2237 = $49;$$2243 = 0;$$3209 = 0;$$3220 = $$0217;
  17122. break;
  17123. }
  17124. }
  17125. $switch$split142D = ($25|0)<(1951551059);
  17126. if ($switch$split142D) {
  17127. switch ($25|0) {
  17128. case 1347179589: {
  17129. break;
  17130. }
  17131. default: {
  17132. label = 103;
  17133. break L9;
  17134. }
  17135. }
  17136. $65 = ($$0241|0)==(0);
  17137. if (!($65)) {
  17138. label = 39;
  17139. break L7;
  17140. }
  17141. $66 = HEAP32[$6>>2]|0;
  17142. $67 = ($66>>>0)>(768);
  17143. if ($67) {
  17144. label = 41;
  17145. break L7;
  17146. }
  17147. $68 = (($66>>>0) / 3)&-1;
  17148. $69 = ($68*3)|0;
  17149. $70 = ($69|0)==($66|0);
  17150. if (!($70)) {
  17151. label = 44;
  17152. break L7;
  17153. }
  17154. $71 = ($66>>>0)>(2);
  17155. if ($71) {
  17156. $$0226593 = 0;
  17157. } else {
  17158. $$1212 = $$0211;$$1215 = $$0214;$$1229 = $$0228;$$1246 = $68;$$2233 = $$0231;$$2237 = $$0235;$$2243 = 0;$$3209 = $$0206;$$3220 = $$0217;
  17159. break;
  17160. }
  17161. while(1) {
  17162. $72 = (_stbi__get8($8)|0);
  17163. $73 = $$0226593 << 2;
  17164. $74 = (($3) + ($73)|0);
  17165. HEAP8[$74>>0] = $72;
  17166. $75 = (_stbi__get8($8)|0);
  17167. $76 = $73 | 1;
  17168. $77 = (($3) + ($76)|0);
  17169. HEAP8[$77>>0] = $75;
  17170. $78 = (_stbi__get8($8)|0);
  17171. $79 = $73 | 2;
  17172. $80 = (($3) + ($79)|0);
  17173. HEAP8[$80>>0] = $78;
  17174. $81 = $73 | 3;
  17175. $82 = (($3) + ($81)|0);
  17176. HEAP8[$82>>0] = -1;
  17177. $83 = (($$0226593) + 1)|0;
  17178. $84 = ($83>>>0)<($68>>>0);
  17179. if ($84) {
  17180. $$0226593 = $83;
  17181. } else {
  17182. $$1212 = $$0211;$$1215 = $$0214;$$1229 = $$0228;$$1246 = $68;$$2233 = $$0231;$$2237 = $$0235;$$2243 = $$0241;$$3209 = $$0206;$$3220 = $$0217;
  17183. break L9;
  17184. }
  17185. }
  17186. }
  17187. switch ($25|0) {
  17188. case 1951551059: {
  17189. break;
  17190. }
  17191. default: {
  17192. label = 103;
  17193. break L9;
  17194. }
  17195. }
  17196. $85 = ($$0241|0)==(0);
  17197. if (!($85)) {
  17198. label = 47;
  17199. break L7;
  17200. }
  17201. $86 = HEAP32[$10>>2]|0;
  17202. $87 = ($86|0)==(0|0);
  17203. if (!($87)) {
  17204. label = 49;
  17205. break L7;
  17206. }
  17207. $88 = ($$0206<<24>>24)==(0);
  17208. if (!($88)) {
  17209. if ($23) {
  17210. label = 52;
  17211. break L7;
  17212. }
  17213. $90 = ($$0245|0)==(0);
  17214. if ($90) {
  17215. label = 54;
  17216. break L7;
  17217. }
  17218. $91 = HEAP32[$6>>2]|0;
  17219. $92 = ($91>>>0)>($$0245>>>0);
  17220. if ($92) {
  17221. label = 58;
  17222. break L7;
  17223. }
  17224. $93 = HEAP32[$6>>2]|0;
  17225. $94 = ($93|0)==(0);
  17226. if ($94) {
  17227. $$1212 = $$0211;$$1215 = $$0214;$$1229 = $$0228;$$1246 = $$0245;$$2233 = $$0231;$$2237 = $$0235;$$2243 = 0;$$3209 = 4;$$3220 = $$0217;
  17228. break;
  17229. }
  17230. $95 = HEAP32[$6>>2]|0;
  17231. $$1227588 = 0;
  17232. while(1) {
  17233. $96 = (_stbi__get8($8)|0);
  17234. $97 = $$1227588 << 2;
  17235. $98 = $97 | 3;
  17236. $99 = (($3) + ($98)|0);
  17237. HEAP8[$99>>0] = $96;
  17238. $100 = (($$1227588) + 1)|0;
  17239. $101 = ($100>>>0)<($95>>>0);
  17240. if ($101) {
  17241. $$1227588 = $100;
  17242. } else {
  17243. $$1212 = $$0211;$$1215 = $$0214;$$1229 = $$0228;$$1246 = $$0245;$$2233 = $$0231;$$2237 = $$0235;$$2243 = $$0241;$$3209 = 4;$$3220 = $$0217;
  17244. break L9;
  17245. }
  17246. }
  17247. }
  17248. $102 = HEAP32[$21>>2]|0;
  17249. $103 = $102 & 1;
  17250. $104 = ($103|0)==(0);
  17251. if ($104) {
  17252. label = 61;
  17253. break L7;
  17254. }
  17255. $105 = HEAP32[$6>>2]|0;
  17256. $106 = $102 << 1;
  17257. $107 = ($105|0)==($106|0);
  17258. if (!($107)) {
  17259. label = 63;
  17260. break L7;
  17261. }
  17262. $108 = HEAP32[$22>>2]|0;
  17263. $109 = ($108|0)==(16);
  17264. $110 = HEAP32[$21>>2]|0;
  17265. $111 = ($110|0)>(0);
  17266. if ($109) {
  17267. if ($111) {
  17268. $$0239591 = 0;
  17269. } else {
  17270. $$1212 = 1;$$1215 = $$0214;$$1229 = $$0228;$$1246 = $$0245;$$2233 = $$0231;$$2237 = $$0235;$$2243 = 0;$$3209 = 0;$$3220 = $$0217;
  17271. break;
  17272. }
  17273. while(1) {
  17274. $112 = (_stbi__get16be($8)|0);
  17275. $113 = $112&65535;
  17276. $114 = (($5) + ($$0239591<<1)|0);
  17277. HEAP16[$114>>1] = $113;
  17278. $115 = (($$0239591) + 1)|0;
  17279. $116 = HEAP32[$21>>2]|0;
  17280. $117 = ($115|0)<($116|0);
  17281. if ($117) {
  17282. $$0239591 = $115;
  17283. } else {
  17284. $$1212 = 1;$$1215 = $$0214;$$1229 = $$0228;$$1246 = $$0245;$$2233 = $$0231;$$2237 = $$0235;$$2243 = $$0241;$$3209 = $$0206;$$3220 = $$0217;
  17285. break;
  17286. }
  17287. }
  17288. } else {
  17289. if ($111) {
  17290. $$1240589 = 0;
  17291. } else {
  17292. $$1212 = 1;$$1215 = $$0214;$$1229 = $$0228;$$1246 = $$0245;$$2233 = $$0231;$$2237 = $$0235;$$2243 = 0;$$3209 = 0;$$3220 = $$0217;
  17293. break;
  17294. }
  17295. while(1) {
  17296. $118 = (_stbi__get16be($8)|0);
  17297. $119 = $118 & 255;
  17298. $120 = HEAP32[$22>>2]|0;
  17299. $121 = (10075 + ($120)|0);
  17300. $122 = HEAP8[$121>>0]|0;
  17301. $123 = $122&255;
  17302. $124 = Math_imul($123, $119)|0;
  17303. $125 = $124&255;
  17304. $126 = (($4) + ($$1240589)|0);
  17305. HEAP8[$126>>0] = $125;
  17306. $127 = (($$1240589) + 1)|0;
  17307. $128 = HEAP32[$21>>2]|0;
  17308. $129 = ($127|0)<($128|0);
  17309. if ($129) {
  17310. $$1240589 = $127;
  17311. } else {
  17312. $$1212 = 1;$$1215 = $$0214;$$1229 = $$0228;$$1246 = $$0245;$$2233 = $$0231;$$2237 = $$0235;$$2243 = $$0241;$$3209 = $$0206;$$3220 = $$0217;
  17313. break;
  17314. }
  17315. }
  17316. }
  17317. }
  17318. } while(0);
  17319. if ((label|0) == 103) {
  17320. label = 0;
  17321. $202 = ($$0241|0)==(0);
  17322. if (!($202)) {
  17323. label = 104;
  17324. break;
  17325. }
  17326. $203 = $25 & 536870912;
  17327. $204 = ($203|0)==(0);
  17328. if ($204) {
  17329. label = 106;
  17330. break;
  17331. }
  17332. $213 = HEAP32[$6>>2]|0;
  17333. _stbi__skip($8,$213);
  17334. $$1212 = $$0211;$$1215 = $$0214;$$1229 = $$0228;$$1246 = $$0245;$$2233 = $$0231;$$2237 = $$0235;$$2243 = 0;$$3209 = $$0206;$$3220 = $$0217;
  17335. }
  17336. (_stbi__get32be($8)|0);
  17337. $$0206 = $$3209;$$0211 = $$1212;$$0214 = $$1215;$$0217 = $$3220;$$0228 = $$1229;$$0231 = $$2233;$$0235 = $$2237;$$0241 = $$2243;$$0245 = $$1246;
  17338. }
  17339. switch (label|0) {
  17340. case 7: {
  17341. _stbi__err(9849);
  17342. $$6$ph = 0;
  17343. break;
  17344. }
  17345. case 9: {
  17346. _stbi__err(9863);
  17347. $$6$ph = 0;
  17348. break;
  17349. }
  17350. case 11: {
  17351. _stbi__err(9876);
  17352. $$6$ph = 0;
  17353. break;
  17354. }
  17355. case 13: {
  17356. _stbi__err(9876);
  17357. $$6$ph = 0;
  17358. break;
  17359. }
  17360. case 15: {
  17361. _stbi__err(9886);
  17362. $$6$ph = 0;
  17363. break;
  17364. }
  17365. case 17: {
  17366. _stbi__err(9906);
  17367. $$6$ph = 0;
  17368. break;
  17369. }
  17370. case 20: {
  17371. _stbi__err(9906);
  17372. $$6$ph = 0;
  17373. break;
  17374. }
  17375. case 22: {
  17376. _stbi__err(9906);
  17377. $$6$ph = 0;
  17378. break;
  17379. }
  17380. case 24: {
  17381. _stbi__err(9916);
  17382. $$6$ph = 0;
  17383. break;
  17384. }
  17385. case 26: {
  17386. _stbi__err(9932);
  17387. $$6$ph = 0;
  17388. break;
  17389. }
  17390. case 28: {
  17391. _stbi__err(9950);
  17392. $$6$ph = 0;
  17393. break;
  17394. }
  17395. case 31: {
  17396. _stbi__err(9971);
  17397. $$6$ph = 0;
  17398. break;
  17399. }
  17400. case 34: {
  17401. _stbi__err(9876);
  17402. $$6$ph = 0;
  17403. break;
  17404. }
  17405. case 37: {
  17406. _stbi__err(9876);
  17407. $$6$ph = 0;
  17408. break;
  17409. }
  17410. case 39: {
  17411. _stbi__err(9985);
  17412. $$6$ph = 0;
  17413. break;
  17414. }
  17415. case 41: {
  17416. _stbi__err(10000);
  17417. $$6$ph = 0;
  17418. break;
  17419. }
  17420. case 44: {
  17421. _stbi__err(10000);
  17422. $$6$ph = 0;
  17423. break;
  17424. }
  17425. case 47: {
  17426. _stbi__err(9985);
  17427. $$6$ph = 0;
  17428. break;
  17429. }
  17430. case 49: {
  17431. _stbi__err(10013);
  17432. $$6$ph = 0;
  17433. break;
  17434. }
  17435. case 52: {
  17436. $89 = ((($8)) + 8|0);
  17437. HEAP32[$89>>2] = 4;
  17438. $$6$ph = 1;
  17439. break;
  17440. }
  17441. case 54: {
  17442. _stbi__err(10029);
  17443. $$6$ph = 0;
  17444. break;
  17445. }
  17446. case 58: {
  17447. _stbi__err(10046);
  17448. $$6$ph = 0;
  17449. break;
  17450. }
  17451. case 61: {
  17452. _stbi__err(10059);
  17453. $$6$ph = 0;
  17454. break;
  17455. }
  17456. case 63: {
  17457. _stbi__err(10046);
  17458. $$6$ph = 0;
  17459. break;
  17460. }
  17461. case 70: {
  17462. _stbi__err(9985);
  17463. $$6$ph = 0;
  17464. break;
  17465. }
  17466. case 72: {
  17467. _stbi__err(10084);
  17468. $$6$ph = 0;
  17469. break;
  17470. }
  17471. case 74: {
  17472. $133 = $$0206&255;
  17473. $134 = ((($8)) + 8|0);
  17474. HEAP32[$134>>2] = $133;
  17475. $$6$ph = 1;
  17476. break;
  17477. }
  17478. case 81: {
  17479. _stbi__err(9731);
  17480. $$6$ph = 0;
  17481. break;
  17482. }
  17483. case 83: {
  17484. _stbi__err(10092);
  17485. $$6$ph = 0;
  17486. break;
  17487. }
  17488. case 85: {
  17489. $156 = ($$0241|0)==(0);
  17490. do {
  17491. if ($156) {
  17492. $157 = ($1|0)==(0);
  17493. if ($157) {
  17494. $158 = HEAP32[$10>>2]|0;
  17495. $159 = ($158|0)==(0|0);
  17496. if ($159) {
  17497. _stbi__err(10102);
  17498. $$4 = 0;
  17499. break;
  17500. }
  17501. $160 = HEAP32[$8>>2]|0;
  17502. $161 = ((($0)) + 16|0);
  17503. $162 = HEAP32[$161>>2]|0;
  17504. $163 = Math_imul($162, $160)|0;
  17505. $164 = (($163) + 7)|0;
  17506. $165 = $164 >>> 3;
  17507. $166 = ((($8)) + 4|0);
  17508. $167 = HEAP32[$166>>2]|0;
  17509. $168 = ((($8)) + 8|0);
  17510. $169 = HEAP32[$168>>2]|0;
  17511. $170 = Math_imul($169, $167)|0;
  17512. $171 = Math_imul($170, $165)|0;
  17513. $172 = (($171) + ($167))|0;
  17514. HEAP32[$7>>2] = $172;
  17515. $173 = ($$0228|0)!=(0);
  17516. $174 = $173 ^ 1;
  17517. $175 = $174&1;
  17518. $176 = (_stbi_zlib_decode_malloc_guesssize_headerflag($158,$$0214,$172,$7,$175)|0);
  17519. HEAP32[$9>>2] = $176;
  17520. $177 = ($176|0)==(0|0);
  17521. if ($177) {
  17522. $$4 = 0;
  17523. } else {
  17524. $178 = HEAP32[$10>>2]|0;
  17525. _free($178);
  17526. HEAP32[$10>>2] = 0;
  17527. $179 = HEAP32[$168>>2]|0;
  17528. $180 = (($179) + 1)|0;
  17529. $notlhs = ($180|0)!=($2|0);
  17530. $notrhs = ($2|0)==(3);
  17531. $or$cond5$not = $notrhs | $notlhs;
  17532. $181 = ($$0206<<24>>24)!=(0);
  17533. $or$cond7 = $181 | $or$cond5$not;
  17534. $182 = ($$0211<<24>>24)==(0);
  17535. $or$cond248 = $182 & $or$cond7;
  17536. $$254 = $or$cond248 ? $179 : $180;
  17537. $183 = ((($8)) + 12|0);
  17538. HEAP32[$183>>2] = $$254;
  17539. $184 = HEAP32[$9>>2]|0;
  17540. $185 = HEAP32[$7>>2]|0;
  17541. $186 = HEAP32[$161>>2]|0;
  17542. $187 = (_stbi__create_png_image($0,$184,$185,$$254,$186,$$0231,$$0235)|0);
  17543. $188 = ($187|0)==(0);
  17544. if ($188) {
  17545. $$4 = 0;
  17546. } else {
  17547. do {
  17548. if (!($182)) {
  17549. $189 = HEAP32[$161>>2]|0;
  17550. $190 = ($189|0)==(16);
  17551. if ($190) {
  17552. $191 = HEAP32[$183>>2]|0;
  17553. _stbi__compute_transparency16($0,$5,$191);
  17554. break;
  17555. } else {
  17556. $192 = HEAP32[$183>>2]|0;
  17557. _stbi__compute_transparency($0,$4,$192);
  17558. break;
  17559. }
  17560. }
  17561. } while(0);
  17562. $193 = HEAP32[5193]|0;
  17563. $194 = ($193|0)!=(0);
  17564. $or$cond11 = $173 & $194;
  17565. if ($or$cond11) {
  17566. $195 = HEAP32[$183>>2]|0;
  17567. $196 = ($195|0)>(2);
  17568. if ($196) {
  17569. _stbi__de_iphone($0);
  17570. }
  17571. }
  17572. if ($181) {
  17573. $197 = $$0206&255;
  17574. HEAP32[$168>>2] = $197;
  17575. $198 = ($2|0)>(2);
  17576. $$ = $198 ? $2 : $197;
  17577. HEAP32[$183>>2] = $$;
  17578. $199 = (_stbi__expand_png_palette($0,$3,$$)|0);
  17579. $200 = ($199|0)==(0);
  17580. if ($200) {
  17581. $$4 = 0;
  17582. break;
  17583. }
  17584. }
  17585. $201 = HEAP32[$9>>2]|0;
  17586. _free($201);
  17587. HEAP32[$9>>2] = 0;
  17588. $$4 = 1;
  17589. }
  17590. }
  17591. } else {
  17592. $$4 = 1;
  17593. }
  17594. } else {
  17595. _stbi__err(9985);
  17596. $$4 = 0;
  17597. }
  17598. } while(0);
  17599. $$6$ph = $$4;
  17600. break;
  17601. }
  17602. case 104: {
  17603. _stbi__err(9985);
  17604. $$6$ph = 0;
  17605. break;
  17606. }
  17607. case 106: {
  17608. $205 = $25 >>> 24;
  17609. $206 = $205&255;
  17610. HEAP8[10110] = $206;
  17611. $207 = HEAP32[$15>>2]|0;
  17612. $208 = $207 >>> 16;
  17613. $209 = $208&255;
  17614. HEAP8[(10111)>>0] = $209;
  17615. $210 = $207 >>> 8;
  17616. $211 = $210&255;
  17617. HEAP8[(10112)>>0] = $211;
  17618. $212 = $207&255;
  17619. HEAP8[(10113)>>0] = $212;
  17620. _stbi__err(10110);
  17621. $$6$ph = 0;
  17622. break;
  17623. }
  17624. }
  17625. $$7 = $$6$ph;
  17626. STACKTOP = sp;return ($$7|0);
  17627. }
  17628. function _stbi__convert_format($0,$1,$2,$3,$4) {
  17629. $0 = $0|0;
  17630. $1 = $1|0;
  17631. $2 = $2|0;
  17632. $3 = $3|0;
  17633. $4 = $4|0;
  17634. var $$0151255 = 0, $$0163 = 0, $$0164259 = 0, $$0165 = 0, $$0165254 = 0, $$0165257 = 0, $$0256 = 0, $$10161205 = 0, $$10175 = 0, $$10175204 = 0, $$10175207 = 0, $$10206 = 0, $$11162201 = 0, $$11176 = 0, $$11176200 = 0, $$11176203 = 0, $$11202 = 0, $$1152250 = 0, $$1166 = 0, $$1166249 = 0;
  17635. var $$1166252 = 0, $$1251 = 0, $$2153245 = 0, $$2167 = 0, $$2167244 = 0, $$2167247 = 0, $$2246 = 0, $$3154240 = 0, $$3168 = 0, $$3168239 = 0, $$3168242 = 0, $$3241 = 0, $$4155235 = 0, $$4169 = 0, $$4169234 = 0, $$4169237 = 0, $$4236 = 0, $$5156230 = 0, $$5170 = 0, $$5170229 = 0;
  17636. var $$5170232 = 0, $$5231 = 0, $$6157225 = 0, $$6171 = 0, $$6171224 = 0, $$6171227 = 0, $$6226 = 0, $$7158220 = 0, $$7172 = 0, $$7172219 = 0, $$7172222 = 0, $$7221 = 0, $$8159215 = 0, $$8173 = 0, $$8173214 = 0, $$8173217 = 0, $$8216 = 0, $$9160210 = 0, $$9174 = 0, $$9174209 = 0;
  17637. var $$9174212 = 0, $$9211 = 0, $$off = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0;
  17638. var $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0;
  17639. var $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
  17640. var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0;
  17641. var $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0;
  17642. var $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0;
  17643. var $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, label = 0;
  17644. var sp = 0;
  17645. sp = STACKTOP;
  17646. $5 = ($2|0)==($1|0);
  17647. if ($5) {
  17648. $$0163 = $0;
  17649. return ($$0163|0);
  17650. }
  17651. $$off = (($2) + -1)|0;
  17652. $6 = ($$off>>>0)<(4);
  17653. if (!($6)) {
  17654. ___assert_fail((9772|0),(9676|0),1477,(9828|0));
  17655. // unreachable;
  17656. }
  17657. $7 = (_stbi__malloc_mad3($2,$3,$4)|0);
  17658. $8 = ($7|0)==(0|0);
  17659. if ($8) {
  17660. _free($0);
  17661. _stbi__err(9731);
  17662. $$0163 = 0;
  17663. return ($$0163|0);
  17664. }
  17665. $9 = ($4|0)>(0);
  17666. L11: do {
  17667. if ($9) {
  17668. $10 = $1 << 3;
  17669. $11 = (($10) + ($2))|0;
  17670. $$0165254 = (($3) + -1)|0;
  17671. $12 = ($$0165254|0)>(-1);
  17672. $$1166249 = (($3) + -1)|0;
  17673. $13 = ($$1166249|0)>(-1);
  17674. $$2167244 = (($3) + -1)|0;
  17675. $14 = ($$2167244|0)>(-1);
  17676. $$3168239 = (($3) + -1)|0;
  17677. $15 = ($$3168239|0)>(-1);
  17678. $$4169234 = (($3) + -1)|0;
  17679. $16 = ($$4169234|0)>(-1);
  17680. $$5170229 = (($3) + -1)|0;
  17681. $17 = ($$5170229|0)>(-1);
  17682. $$6171224 = (($3) + -1)|0;
  17683. $18 = ($$6171224|0)>(-1);
  17684. $$7172219 = (($3) + -1)|0;
  17685. $19 = ($$7172219|0)>(-1);
  17686. $$8173214 = (($3) + -1)|0;
  17687. $20 = ($$8173214|0)>(-1);
  17688. $$9174209 = (($3) + -1)|0;
  17689. $21 = ($$9174209|0)>(-1);
  17690. $$10175204 = (($3) + -1)|0;
  17691. $22 = ($$10175204|0)>(-1);
  17692. $$11176200 = (($3) + -1)|0;
  17693. $23 = ($$11176200|0)>(-1);
  17694. $$0164259 = 0;
  17695. L13: while(1) {
  17696. $24 = Math_imul($$0164259, $3)|0;
  17697. $25 = Math_imul($24, $1)|0;
  17698. $26 = (($0) + ($25)|0);
  17699. $27 = Math_imul($24, $2)|0;
  17700. $28 = (($7) + ($27)|0);
  17701. do {
  17702. switch ($11|0) {
  17703. case 10: {
  17704. if ($12) {
  17705. $$0151255 = $26;$$0165257 = $$0165254;$$0256 = $28;
  17706. while(1) {
  17707. $29 = HEAP8[$$0151255>>0]|0;
  17708. HEAP8[$$0256>>0] = $29;
  17709. $30 = ((($$0256)) + 1|0);
  17710. HEAP8[$30>>0] = -1;
  17711. $31 = ((($$0151255)) + 1|0);
  17712. $32 = ((($$0256)) + 2|0);
  17713. $$0165 = (($$0165257) + -1)|0;
  17714. $33 = ($$0165|0)>(-1);
  17715. if ($33) {
  17716. $$0151255 = $31;$$0165257 = $$0165;$$0256 = $32;
  17717. } else {
  17718. break;
  17719. }
  17720. }
  17721. }
  17722. break;
  17723. }
  17724. case 11: {
  17725. if ($13) {
  17726. $$1152250 = $26;$$1166252 = $$1166249;$$1251 = $28;
  17727. while(1) {
  17728. $34 = HEAP8[$$1152250>>0]|0;
  17729. $35 = ((($$1251)) + 2|0);
  17730. HEAP8[$35>>0] = $34;
  17731. $36 = ((($$1251)) + 1|0);
  17732. HEAP8[$36>>0] = $34;
  17733. HEAP8[$$1251>>0] = $34;
  17734. $37 = ((($$1152250)) + 1|0);
  17735. $38 = ((($$1251)) + 3|0);
  17736. $$1166 = (($$1166252) + -1)|0;
  17737. $39 = ($$1166|0)>(-1);
  17738. if ($39) {
  17739. $$1152250 = $37;$$1166252 = $$1166;$$1251 = $38;
  17740. } else {
  17741. break;
  17742. }
  17743. }
  17744. }
  17745. break;
  17746. }
  17747. case 12: {
  17748. if ($14) {
  17749. $$2153245 = $26;$$2167247 = $$2167244;$$2246 = $28;
  17750. while(1) {
  17751. $40 = HEAP8[$$2153245>>0]|0;
  17752. $41 = ((($$2246)) + 2|0);
  17753. HEAP8[$41>>0] = $40;
  17754. $42 = ((($$2246)) + 1|0);
  17755. HEAP8[$42>>0] = $40;
  17756. HEAP8[$$2246>>0] = $40;
  17757. $43 = ((($$2246)) + 3|0);
  17758. HEAP8[$43>>0] = -1;
  17759. $44 = ((($$2153245)) + 1|0);
  17760. $45 = ((($$2246)) + 4|0);
  17761. $$2167 = (($$2167247) + -1)|0;
  17762. $46 = ($$2167|0)>(-1);
  17763. if ($46) {
  17764. $$2153245 = $44;$$2167247 = $$2167;$$2246 = $45;
  17765. } else {
  17766. break;
  17767. }
  17768. }
  17769. }
  17770. break;
  17771. }
  17772. case 17: {
  17773. if ($15) {
  17774. $$3154240 = $26;$$3168242 = $$3168239;$$3241 = $28;
  17775. while(1) {
  17776. $47 = HEAP8[$$3154240>>0]|0;
  17777. HEAP8[$$3241>>0] = $47;
  17778. $48 = ((($$3154240)) + 2|0);
  17779. $49 = ((($$3241)) + 1|0);
  17780. $$3168 = (($$3168242) + -1)|0;
  17781. $50 = ($$3168|0)>(-1);
  17782. if ($50) {
  17783. $$3154240 = $48;$$3168242 = $$3168;$$3241 = $49;
  17784. } else {
  17785. break;
  17786. }
  17787. }
  17788. }
  17789. break;
  17790. }
  17791. case 19: {
  17792. if ($16) {
  17793. $$4155235 = $26;$$4169237 = $$4169234;$$4236 = $28;
  17794. while(1) {
  17795. $51 = HEAP8[$$4155235>>0]|0;
  17796. $52 = ((($$4236)) + 2|0);
  17797. HEAP8[$52>>0] = $51;
  17798. $53 = ((($$4236)) + 1|0);
  17799. HEAP8[$53>>0] = $51;
  17800. HEAP8[$$4236>>0] = $51;
  17801. $54 = ((($$4155235)) + 2|0);
  17802. $55 = ((($$4236)) + 3|0);
  17803. $$4169 = (($$4169237) + -1)|0;
  17804. $56 = ($$4169|0)>(-1);
  17805. if ($56) {
  17806. $$4155235 = $54;$$4169237 = $$4169;$$4236 = $55;
  17807. } else {
  17808. break;
  17809. }
  17810. }
  17811. }
  17812. break;
  17813. }
  17814. case 20: {
  17815. if ($17) {
  17816. $$5156230 = $26;$$5170232 = $$5170229;$$5231 = $28;
  17817. while(1) {
  17818. $57 = HEAP8[$$5156230>>0]|0;
  17819. $58 = ((($$5231)) + 2|0);
  17820. HEAP8[$58>>0] = $57;
  17821. $59 = ((($$5231)) + 1|0);
  17822. HEAP8[$59>>0] = $57;
  17823. HEAP8[$$5231>>0] = $57;
  17824. $60 = ((($$5156230)) + 1|0);
  17825. $61 = HEAP8[$60>>0]|0;
  17826. $62 = ((($$5231)) + 3|0);
  17827. HEAP8[$62>>0] = $61;
  17828. $63 = ((($$5156230)) + 2|0);
  17829. $64 = ((($$5231)) + 4|0);
  17830. $$5170 = (($$5170232) + -1)|0;
  17831. $65 = ($$5170|0)>(-1);
  17832. if ($65) {
  17833. $$5156230 = $63;$$5170232 = $$5170;$$5231 = $64;
  17834. } else {
  17835. break;
  17836. }
  17837. }
  17838. }
  17839. break;
  17840. }
  17841. case 28: {
  17842. if ($18) {
  17843. $$6157225 = $26;$$6171227 = $$6171224;$$6226 = $28;
  17844. while(1) {
  17845. $66 = HEAP8[$$6157225>>0]|0;
  17846. HEAP8[$$6226>>0] = $66;
  17847. $67 = ((($$6157225)) + 1|0);
  17848. $68 = HEAP8[$67>>0]|0;
  17849. $69 = ((($$6226)) + 1|0);
  17850. HEAP8[$69>>0] = $68;
  17851. $70 = ((($$6157225)) + 2|0);
  17852. $71 = HEAP8[$70>>0]|0;
  17853. $72 = ((($$6226)) + 2|0);
  17854. HEAP8[$72>>0] = $71;
  17855. $73 = ((($$6226)) + 3|0);
  17856. HEAP8[$73>>0] = -1;
  17857. $74 = ((($$6157225)) + 3|0);
  17858. $75 = ((($$6226)) + 4|0);
  17859. $$6171 = (($$6171227) + -1)|0;
  17860. $76 = ($$6171|0)>(-1);
  17861. if ($76) {
  17862. $$6157225 = $74;$$6171227 = $$6171;$$6226 = $75;
  17863. } else {
  17864. break;
  17865. }
  17866. }
  17867. }
  17868. break;
  17869. }
  17870. case 25: {
  17871. if ($19) {
  17872. $$7158220 = $26;$$7172222 = $$7172219;$$7221 = $28;
  17873. while(1) {
  17874. $77 = HEAP8[$$7158220>>0]|0;
  17875. $78 = $77&255;
  17876. $79 = ((($$7158220)) + 1|0);
  17877. $80 = HEAP8[$79>>0]|0;
  17878. $81 = $80&255;
  17879. $82 = ((($$7158220)) + 2|0);
  17880. $83 = HEAP8[$82>>0]|0;
  17881. $84 = $83&255;
  17882. $85 = (_stbi__compute_y($78,$81,$84)|0);
  17883. HEAP8[$$7221>>0] = $85;
  17884. $86 = ((($$7158220)) + 3|0);
  17885. $87 = ((($$7221)) + 1|0);
  17886. $$7172 = (($$7172222) + -1)|0;
  17887. $88 = ($$7172|0)>(-1);
  17888. if ($88) {
  17889. $$7158220 = $86;$$7172222 = $$7172;$$7221 = $87;
  17890. } else {
  17891. break;
  17892. }
  17893. }
  17894. }
  17895. break;
  17896. }
  17897. case 26: {
  17898. if ($20) {
  17899. $$8159215 = $26;$$8173217 = $$8173214;$$8216 = $28;
  17900. while(1) {
  17901. $89 = HEAP8[$$8159215>>0]|0;
  17902. $90 = $89&255;
  17903. $91 = ((($$8159215)) + 1|0);
  17904. $92 = HEAP8[$91>>0]|0;
  17905. $93 = $92&255;
  17906. $94 = ((($$8159215)) + 2|0);
  17907. $95 = HEAP8[$94>>0]|0;
  17908. $96 = $95&255;
  17909. $97 = (_stbi__compute_y($90,$93,$96)|0);
  17910. HEAP8[$$8216>>0] = $97;
  17911. $98 = ((($$8216)) + 1|0);
  17912. HEAP8[$98>>0] = -1;
  17913. $99 = ((($$8159215)) + 3|0);
  17914. $100 = ((($$8216)) + 2|0);
  17915. $$8173 = (($$8173217) + -1)|0;
  17916. $101 = ($$8173|0)>(-1);
  17917. if ($101) {
  17918. $$8159215 = $99;$$8173217 = $$8173;$$8216 = $100;
  17919. } else {
  17920. break;
  17921. }
  17922. }
  17923. }
  17924. break;
  17925. }
  17926. case 33: {
  17927. if ($21) {
  17928. $$9160210 = $26;$$9174212 = $$9174209;$$9211 = $28;
  17929. while(1) {
  17930. $102 = HEAP8[$$9160210>>0]|0;
  17931. $103 = $102&255;
  17932. $104 = ((($$9160210)) + 1|0);
  17933. $105 = HEAP8[$104>>0]|0;
  17934. $106 = $105&255;
  17935. $107 = ((($$9160210)) + 2|0);
  17936. $108 = HEAP8[$107>>0]|0;
  17937. $109 = $108&255;
  17938. $110 = (_stbi__compute_y($103,$106,$109)|0);
  17939. HEAP8[$$9211>>0] = $110;
  17940. $111 = ((($$9160210)) + 4|0);
  17941. $112 = ((($$9211)) + 1|0);
  17942. $$9174 = (($$9174212) + -1)|0;
  17943. $113 = ($$9174|0)>(-1);
  17944. if ($113) {
  17945. $$9160210 = $111;$$9174212 = $$9174;$$9211 = $112;
  17946. } else {
  17947. break;
  17948. }
  17949. }
  17950. }
  17951. break;
  17952. }
  17953. case 34: {
  17954. if ($22) {
  17955. $$10161205 = $26;$$10175207 = $$10175204;$$10206 = $28;
  17956. while(1) {
  17957. $114 = HEAP8[$$10161205>>0]|0;
  17958. $115 = $114&255;
  17959. $116 = ((($$10161205)) + 1|0);
  17960. $117 = HEAP8[$116>>0]|0;
  17961. $118 = $117&255;
  17962. $119 = ((($$10161205)) + 2|0);
  17963. $120 = HEAP8[$119>>0]|0;
  17964. $121 = $120&255;
  17965. $122 = (_stbi__compute_y($115,$118,$121)|0);
  17966. HEAP8[$$10206>>0] = $122;
  17967. $123 = ((($$10161205)) + 3|0);
  17968. $124 = HEAP8[$123>>0]|0;
  17969. $125 = ((($$10206)) + 1|0);
  17970. HEAP8[$125>>0] = $124;
  17971. $126 = ((($$10161205)) + 4|0);
  17972. $127 = ((($$10206)) + 2|0);
  17973. $$10175 = (($$10175207) + -1)|0;
  17974. $128 = ($$10175|0)>(-1);
  17975. if ($128) {
  17976. $$10161205 = $126;$$10175207 = $$10175;$$10206 = $127;
  17977. } else {
  17978. break;
  17979. }
  17980. }
  17981. }
  17982. break;
  17983. }
  17984. case 35: {
  17985. if ($23) {
  17986. $$11162201 = $26;$$11176203 = $$11176200;$$11202 = $28;
  17987. while(1) {
  17988. $129 = HEAP8[$$11162201>>0]|0;
  17989. HEAP8[$$11202>>0] = $129;
  17990. $130 = ((($$11162201)) + 1|0);
  17991. $131 = HEAP8[$130>>0]|0;
  17992. $132 = ((($$11202)) + 1|0);
  17993. HEAP8[$132>>0] = $131;
  17994. $133 = ((($$11162201)) + 2|0);
  17995. $134 = HEAP8[$133>>0]|0;
  17996. $135 = ((($$11202)) + 2|0);
  17997. HEAP8[$135>>0] = $134;
  17998. $136 = ((($$11162201)) + 4|0);
  17999. $137 = ((($$11202)) + 3|0);
  18000. $$11176 = (($$11176203) + -1)|0;
  18001. $138 = ($$11176|0)>(-1);
  18002. if ($138) {
  18003. $$11162201 = $136;$$11176203 = $$11176;$$11202 = $137;
  18004. } else {
  18005. break;
  18006. }
  18007. }
  18008. }
  18009. break;
  18010. }
  18011. default: {
  18012. break L13;
  18013. }
  18014. }
  18015. } while(0);
  18016. $139 = (($$0164259) + 1)|0;
  18017. $140 = ($139|0)<($4|0);
  18018. if ($140) {
  18019. $$0164259 = $139;
  18020. } else {
  18021. break L11;
  18022. }
  18023. }
  18024. ___assert_fail((9826|0),(9676|0),1506,(9828|0));
  18025. // unreachable;
  18026. }
  18027. } while(0);
  18028. _free($0);
  18029. $$0163 = $7;
  18030. return ($$0163|0);
  18031. }
  18032. function _stbi__convert_format16($0,$1,$2,$3,$4) {
  18033. $0 = $0|0;
  18034. $1 = $1|0;
  18035. $2 = $2|0;
  18036. $3 = $3|0;
  18037. $4 = $4|0;
  18038. var $$0151255 = 0, $$0163 = 0, $$0164259 = 0, $$0165 = 0, $$0165254 = 0, $$0165257 = 0, $$0256 = 0, $$10161205 = 0, $$10175 = 0, $$10175204 = 0, $$10175207 = 0, $$10206 = 0, $$11162201 = 0, $$11176 = 0, $$11176200 = 0, $$11176203 = 0, $$11202 = 0, $$1152250 = 0, $$1166 = 0, $$1166249 = 0;
  18039. var $$1166252 = 0, $$1251 = 0, $$2153245 = 0, $$2167 = 0, $$2167244 = 0, $$2167247 = 0, $$2246 = 0, $$3154240 = 0, $$3168 = 0, $$3168239 = 0, $$3168242 = 0, $$3241 = 0, $$4155235 = 0, $$4169 = 0, $$4169234 = 0, $$4169237 = 0, $$4236 = 0, $$5156230 = 0, $$5170 = 0, $$5170229 = 0;
  18040. var $$5170232 = 0, $$5231 = 0, $$6157225 = 0, $$6171 = 0, $$6171224 = 0, $$6171227 = 0, $$6226 = 0, $$7158220 = 0, $$7172 = 0, $$7172219 = 0, $$7172222 = 0, $$7221 = 0, $$8159215 = 0, $$8173 = 0, $$8173214 = 0, $$8173217 = 0, $$8216 = 0, $$9160210 = 0, $$9174 = 0, $$9174209 = 0;
  18041. var $$9174212 = 0, $$9211 = 0, $$off = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0;
  18042. var $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0;
  18043. var $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0;
  18044. var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $40 = 0, $41 = 0, $42 = 0;
  18045. var $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0;
  18046. var $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0;
  18047. var $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0;
  18048. var $98 = 0, $99 = 0, label = 0, sp = 0;
  18049. sp = STACKTOP;
  18050. $5 = ($2|0)==($1|0);
  18051. if ($5) {
  18052. $$0163 = $0;
  18053. return ($$0163|0);
  18054. }
  18055. $$off = (($2) + -1)|0;
  18056. $6 = ($$off>>>0)<(4);
  18057. if (!($6)) {
  18058. ___assert_fail((9772|0),(9676|0),1526,(9803|0));
  18059. // unreachable;
  18060. }
  18061. $7 = $2 << 1;
  18062. $8 = Math_imul($7, $3)|0;
  18063. $9 = Math_imul($8, $4)|0;
  18064. $10 = (_stbi__malloc($9)|0);
  18065. $11 = ($10|0)==(0|0);
  18066. if ($11) {
  18067. _free($0);
  18068. _stbi__err(9731);
  18069. $$0163 = 0;
  18070. return ($$0163|0);
  18071. }
  18072. $12 = ($4|0)>(0);
  18073. L11: do {
  18074. if ($12) {
  18075. $13 = $1 << 3;
  18076. $14 = (($13) + ($2))|0;
  18077. $$0165254 = (($3) + -1)|0;
  18078. $15 = ($$0165254|0)>(-1);
  18079. $$1166249 = (($3) + -1)|0;
  18080. $16 = ($$1166249|0)>(-1);
  18081. $$2167244 = (($3) + -1)|0;
  18082. $17 = ($$2167244|0)>(-1);
  18083. $$3168239 = (($3) + -1)|0;
  18084. $18 = ($$3168239|0)>(-1);
  18085. $$4169234 = (($3) + -1)|0;
  18086. $19 = ($$4169234|0)>(-1);
  18087. $$5170229 = (($3) + -1)|0;
  18088. $20 = ($$5170229|0)>(-1);
  18089. $$6171224 = (($3) + -1)|0;
  18090. $21 = ($$6171224|0)>(-1);
  18091. $$7172219 = (($3) + -1)|0;
  18092. $22 = ($$7172219|0)>(-1);
  18093. $$8173214 = (($3) + -1)|0;
  18094. $23 = ($$8173214|0)>(-1);
  18095. $$9174209 = (($3) + -1)|0;
  18096. $24 = ($$9174209|0)>(-1);
  18097. $$10175204 = (($3) + -1)|0;
  18098. $25 = ($$10175204|0)>(-1);
  18099. $$11176200 = (($3) + -1)|0;
  18100. $26 = ($$11176200|0)>(-1);
  18101. $$0164259 = 0;
  18102. L13: while(1) {
  18103. $27 = Math_imul($$0164259, $3)|0;
  18104. $28 = Math_imul($27, $1)|0;
  18105. $29 = (($0) + ($28<<1)|0);
  18106. $30 = Math_imul($27, $2)|0;
  18107. $31 = (($10) + ($30<<1)|0);
  18108. do {
  18109. switch ($14|0) {
  18110. case 10: {
  18111. if ($15) {
  18112. $$0151255 = $29;$$0165257 = $$0165254;$$0256 = $31;
  18113. while(1) {
  18114. $32 = HEAP16[$$0151255>>1]|0;
  18115. HEAP16[$$0256>>1] = $32;
  18116. $33 = ((($$0256)) + 2|0);
  18117. HEAP16[$33>>1] = -1;
  18118. $34 = ((($$0151255)) + 2|0);
  18119. $35 = ((($$0256)) + 4|0);
  18120. $$0165 = (($$0165257) + -1)|0;
  18121. $36 = ($$0165|0)>(-1);
  18122. if ($36) {
  18123. $$0151255 = $34;$$0165257 = $$0165;$$0256 = $35;
  18124. } else {
  18125. break;
  18126. }
  18127. }
  18128. }
  18129. break;
  18130. }
  18131. case 11: {
  18132. if ($16) {
  18133. $$1152250 = $29;$$1166252 = $$1166249;$$1251 = $31;
  18134. while(1) {
  18135. $37 = HEAP16[$$1152250>>1]|0;
  18136. $38 = ((($$1251)) + 4|0);
  18137. HEAP16[$38>>1] = $37;
  18138. $39 = ((($$1251)) + 2|0);
  18139. HEAP16[$39>>1] = $37;
  18140. HEAP16[$$1251>>1] = $37;
  18141. $40 = ((($$1152250)) + 2|0);
  18142. $41 = ((($$1251)) + 6|0);
  18143. $$1166 = (($$1166252) + -1)|0;
  18144. $42 = ($$1166|0)>(-1);
  18145. if ($42) {
  18146. $$1152250 = $40;$$1166252 = $$1166;$$1251 = $41;
  18147. } else {
  18148. break;
  18149. }
  18150. }
  18151. }
  18152. break;
  18153. }
  18154. case 12: {
  18155. if ($17) {
  18156. $$2153245 = $29;$$2167247 = $$2167244;$$2246 = $31;
  18157. while(1) {
  18158. $43 = HEAP16[$$2153245>>1]|0;
  18159. $44 = ((($$2246)) + 4|0);
  18160. HEAP16[$44>>1] = $43;
  18161. $45 = ((($$2246)) + 2|0);
  18162. HEAP16[$45>>1] = $43;
  18163. HEAP16[$$2246>>1] = $43;
  18164. $46 = ((($$2246)) + 6|0);
  18165. HEAP16[$46>>1] = -1;
  18166. $47 = ((($$2153245)) + 2|0);
  18167. $48 = ((($$2246)) + 8|0);
  18168. $$2167 = (($$2167247) + -1)|0;
  18169. $49 = ($$2167|0)>(-1);
  18170. if ($49) {
  18171. $$2153245 = $47;$$2167247 = $$2167;$$2246 = $48;
  18172. } else {
  18173. break;
  18174. }
  18175. }
  18176. }
  18177. break;
  18178. }
  18179. case 17: {
  18180. if ($18) {
  18181. $$3154240 = $29;$$3168242 = $$3168239;$$3241 = $31;
  18182. while(1) {
  18183. $50 = HEAP16[$$3154240>>1]|0;
  18184. HEAP16[$$3241>>1] = $50;
  18185. $51 = ((($$3154240)) + 4|0);
  18186. $52 = ((($$3241)) + 2|0);
  18187. $$3168 = (($$3168242) + -1)|0;
  18188. $53 = ($$3168|0)>(-1);
  18189. if ($53) {
  18190. $$3154240 = $51;$$3168242 = $$3168;$$3241 = $52;
  18191. } else {
  18192. break;
  18193. }
  18194. }
  18195. }
  18196. break;
  18197. }
  18198. case 19: {
  18199. if ($19) {
  18200. $$4155235 = $29;$$4169237 = $$4169234;$$4236 = $31;
  18201. while(1) {
  18202. $54 = HEAP16[$$4155235>>1]|0;
  18203. $55 = ((($$4236)) + 4|0);
  18204. HEAP16[$55>>1] = $54;
  18205. $56 = ((($$4236)) + 2|0);
  18206. HEAP16[$56>>1] = $54;
  18207. HEAP16[$$4236>>1] = $54;
  18208. $57 = ((($$4155235)) + 4|0);
  18209. $58 = ((($$4236)) + 6|0);
  18210. $$4169 = (($$4169237) + -1)|0;
  18211. $59 = ($$4169|0)>(-1);
  18212. if ($59) {
  18213. $$4155235 = $57;$$4169237 = $$4169;$$4236 = $58;
  18214. } else {
  18215. break;
  18216. }
  18217. }
  18218. }
  18219. break;
  18220. }
  18221. case 20: {
  18222. if ($20) {
  18223. $$5156230 = $29;$$5170232 = $$5170229;$$5231 = $31;
  18224. while(1) {
  18225. $60 = HEAP16[$$5156230>>1]|0;
  18226. $61 = ((($$5231)) + 4|0);
  18227. HEAP16[$61>>1] = $60;
  18228. $62 = ((($$5231)) + 2|0);
  18229. HEAP16[$62>>1] = $60;
  18230. HEAP16[$$5231>>1] = $60;
  18231. $63 = ((($$5156230)) + 2|0);
  18232. $64 = HEAP16[$63>>1]|0;
  18233. $65 = ((($$5231)) + 6|0);
  18234. HEAP16[$65>>1] = $64;
  18235. $66 = ((($$5156230)) + 4|0);
  18236. $67 = ((($$5231)) + 8|0);
  18237. $$5170 = (($$5170232) + -1)|0;
  18238. $68 = ($$5170|0)>(-1);
  18239. if ($68) {
  18240. $$5156230 = $66;$$5170232 = $$5170;$$5231 = $67;
  18241. } else {
  18242. break;
  18243. }
  18244. }
  18245. }
  18246. break;
  18247. }
  18248. case 28: {
  18249. if ($21) {
  18250. $$6157225 = $29;$$6171227 = $$6171224;$$6226 = $31;
  18251. while(1) {
  18252. $69 = HEAP16[$$6157225>>1]|0;
  18253. HEAP16[$$6226>>1] = $69;
  18254. $70 = ((($$6157225)) + 2|0);
  18255. $71 = HEAP16[$70>>1]|0;
  18256. $72 = ((($$6226)) + 2|0);
  18257. HEAP16[$72>>1] = $71;
  18258. $73 = ((($$6157225)) + 4|0);
  18259. $74 = HEAP16[$73>>1]|0;
  18260. $75 = ((($$6226)) + 4|0);
  18261. HEAP16[$75>>1] = $74;
  18262. $76 = ((($$6226)) + 6|0);
  18263. HEAP16[$76>>1] = -1;
  18264. $77 = ((($$6157225)) + 6|0);
  18265. $78 = ((($$6226)) + 8|0);
  18266. $$6171 = (($$6171227) + -1)|0;
  18267. $79 = ($$6171|0)>(-1);
  18268. if ($79) {
  18269. $$6157225 = $77;$$6171227 = $$6171;$$6226 = $78;
  18270. } else {
  18271. break;
  18272. }
  18273. }
  18274. }
  18275. break;
  18276. }
  18277. case 25: {
  18278. if ($22) {
  18279. $$7158220 = $29;$$7172222 = $$7172219;$$7221 = $31;
  18280. while(1) {
  18281. $80 = HEAP16[$$7158220>>1]|0;
  18282. $81 = $80&65535;
  18283. $82 = ((($$7158220)) + 2|0);
  18284. $83 = HEAP16[$82>>1]|0;
  18285. $84 = $83&65535;
  18286. $85 = ((($$7158220)) + 4|0);
  18287. $86 = HEAP16[$85>>1]|0;
  18288. $87 = $86&65535;
  18289. $88 = (_stbi__compute_y_16($81,$84,$87)|0);
  18290. HEAP16[$$7221>>1] = $88;
  18291. $89 = ((($$7158220)) + 6|0);
  18292. $90 = ((($$7221)) + 2|0);
  18293. $$7172 = (($$7172222) + -1)|0;
  18294. $91 = ($$7172|0)>(-1);
  18295. if ($91) {
  18296. $$7158220 = $89;$$7172222 = $$7172;$$7221 = $90;
  18297. } else {
  18298. break;
  18299. }
  18300. }
  18301. }
  18302. break;
  18303. }
  18304. case 26: {
  18305. if ($23) {
  18306. $$8159215 = $29;$$8173217 = $$8173214;$$8216 = $31;
  18307. while(1) {
  18308. $92 = HEAP16[$$8159215>>1]|0;
  18309. $93 = $92&65535;
  18310. $94 = ((($$8159215)) + 2|0);
  18311. $95 = HEAP16[$94>>1]|0;
  18312. $96 = $95&65535;
  18313. $97 = ((($$8159215)) + 4|0);
  18314. $98 = HEAP16[$97>>1]|0;
  18315. $99 = $98&65535;
  18316. $100 = (_stbi__compute_y_16($93,$96,$99)|0);
  18317. HEAP16[$$8216>>1] = $100;
  18318. $101 = ((($$8216)) + 2|0);
  18319. HEAP16[$101>>1] = -1;
  18320. $102 = ((($$8159215)) + 6|0);
  18321. $103 = ((($$8216)) + 4|0);
  18322. $$8173 = (($$8173217) + -1)|0;
  18323. $104 = ($$8173|0)>(-1);
  18324. if ($104) {
  18325. $$8159215 = $102;$$8173217 = $$8173;$$8216 = $103;
  18326. } else {
  18327. break;
  18328. }
  18329. }
  18330. }
  18331. break;
  18332. }
  18333. case 33: {
  18334. if ($24) {
  18335. $$9160210 = $29;$$9174212 = $$9174209;$$9211 = $31;
  18336. while(1) {
  18337. $105 = HEAP16[$$9160210>>1]|0;
  18338. $106 = $105&65535;
  18339. $107 = ((($$9160210)) + 2|0);
  18340. $108 = HEAP16[$107>>1]|0;
  18341. $109 = $108&65535;
  18342. $110 = ((($$9160210)) + 4|0);
  18343. $111 = HEAP16[$110>>1]|0;
  18344. $112 = $111&65535;
  18345. $113 = (_stbi__compute_y_16($106,$109,$112)|0);
  18346. HEAP16[$$9211>>1] = $113;
  18347. $114 = ((($$9160210)) + 8|0);
  18348. $115 = ((($$9211)) + 2|0);
  18349. $$9174 = (($$9174212) + -1)|0;
  18350. $116 = ($$9174|0)>(-1);
  18351. if ($116) {
  18352. $$9160210 = $114;$$9174212 = $$9174;$$9211 = $115;
  18353. } else {
  18354. break;
  18355. }
  18356. }
  18357. }
  18358. break;
  18359. }
  18360. case 34: {
  18361. if ($25) {
  18362. $$10161205 = $29;$$10175207 = $$10175204;$$10206 = $31;
  18363. while(1) {
  18364. $117 = HEAP16[$$10161205>>1]|0;
  18365. $118 = $117&65535;
  18366. $119 = ((($$10161205)) + 2|0);
  18367. $120 = HEAP16[$119>>1]|0;
  18368. $121 = $120&65535;
  18369. $122 = ((($$10161205)) + 4|0);
  18370. $123 = HEAP16[$122>>1]|0;
  18371. $124 = $123&65535;
  18372. $125 = (_stbi__compute_y_16($118,$121,$124)|0);
  18373. HEAP16[$$10206>>1] = $125;
  18374. $126 = ((($$10161205)) + 6|0);
  18375. $127 = HEAP16[$126>>1]|0;
  18376. $128 = ((($$10206)) + 2|0);
  18377. HEAP16[$128>>1] = $127;
  18378. $129 = ((($$10161205)) + 8|0);
  18379. $130 = ((($$10206)) + 4|0);
  18380. $$10175 = (($$10175207) + -1)|0;
  18381. $131 = ($$10175|0)>(-1);
  18382. if ($131) {
  18383. $$10161205 = $129;$$10175207 = $$10175;$$10206 = $130;
  18384. } else {
  18385. break;
  18386. }
  18387. }
  18388. }
  18389. break;
  18390. }
  18391. case 35: {
  18392. if ($26) {
  18393. $$11162201 = $29;$$11176203 = $$11176200;$$11202 = $31;
  18394. while(1) {
  18395. $132 = HEAP16[$$11162201>>1]|0;
  18396. HEAP16[$$11202>>1] = $132;
  18397. $133 = ((($$11162201)) + 2|0);
  18398. $134 = HEAP16[$133>>1]|0;
  18399. $135 = ((($$11202)) + 2|0);
  18400. HEAP16[$135>>1] = $134;
  18401. $136 = ((($$11162201)) + 4|0);
  18402. $137 = HEAP16[$136>>1]|0;
  18403. $138 = ((($$11202)) + 4|0);
  18404. HEAP16[$138>>1] = $137;
  18405. $139 = ((($$11162201)) + 8|0);
  18406. $140 = ((($$11202)) + 6|0);
  18407. $$11176 = (($$11176203) + -1)|0;
  18408. $141 = ($$11176|0)>(-1);
  18409. if ($141) {
  18410. $$11162201 = $139;$$11176203 = $$11176;$$11202 = $140;
  18411. } else {
  18412. break;
  18413. }
  18414. }
  18415. }
  18416. break;
  18417. }
  18418. default: {
  18419. break L13;
  18420. }
  18421. }
  18422. } while(0);
  18423. $142 = (($$0164259) + 1)|0;
  18424. $143 = ($142|0)<($4|0);
  18425. if ($143) {
  18426. $$0164259 = $142;
  18427. } else {
  18428. break L11;
  18429. }
  18430. }
  18431. ___assert_fail((9826|0),(9676|0),1555,(9803|0));
  18432. // unreachable;
  18433. }
  18434. } while(0);
  18435. _free($0);
  18436. $$0163 = $10;
  18437. return ($$0163|0);
  18438. }
  18439. function _stbi__compute_y_16($0,$1,$2) {
  18440. $0 = $0|0;
  18441. $1 = $1|0;
  18442. $2 = $2|0;
  18443. var $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
  18444. sp = STACKTOP;
  18445. $3 = ($0*77)|0;
  18446. $4 = ($1*150)|0;
  18447. $5 = (($4) + ($3))|0;
  18448. $6 = ($2*29)|0;
  18449. $7 = (($5) + ($6))|0;
  18450. $8 = $7 >>> 8;
  18451. $9 = $8&65535;
  18452. return ($9|0);
  18453. }
  18454. function _stbi__malloc_mad3($0,$1,$2) {
  18455. $0 = $0|0;
  18456. $1 = $1|0;
  18457. $2 = $2|0;
  18458. var $$0 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, label = 0, sp = 0;
  18459. sp = STACKTOP;
  18460. $3 = (_stbi__mad3sizes_valid($0,$1,$2)|0);
  18461. $4 = ($3|0)==(0);
  18462. if ($4) {
  18463. $$0 = 0;
  18464. return ($$0|0);
  18465. }
  18466. $5 = Math_imul($1, $0)|0;
  18467. $6 = Math_imul($5, $2)|0;
  18468. $7 = (_stbi__malloc($6)|0);
  18469. $$0 = $7;
  18470. return ($$0|0);
  18471. }
  18472. function _stbi__compute_y($0,$1,$2) {
  18473. $0 = $0|0;
  18474. $1 = $1|0;
  18475. $2 = $2|0;
  18476. var $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
  18477. sp = STACKTOP;
  18478. $3 = ($0*77)|0;
  18479. $4 = ($1*150)|0;
  18480. $5 = (($4) + ($3))|0;
  18481. $6 = ($2*29)|0;
  18482. $7 = (($5) + ($6))|0;
  18483. $8 = $7 >>> 8;
  18484. $9 = $8&255;
  18485. return ($9|0);
  18486. }
  18487. function _stbi__mad3sizes_valid($0,$1,$2) {
  18488. $0 = $0|0;
  18489. $1 = $1|0;
  18490. $2 = $2|0;
  18491. var $10 = 0, $11 = 0, $12 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
  18492. sp = STACKTOP;
  18493. $3 = (_stbi__mul2sizes_valid($0,$1)|0);
  18494. $4 = ($3|0)==(0);
  18495. if ($4) {
  18496. $12 = 0;
  18497. } else {
  18498. $5 = Math_imul($1, $0)|0;
  18499. $6 = (_stbi__mul2sizes_valid($5,$2)|0);
  18500. $7 = ($6|0)==(0);
  18501. if ($7) {
  18502. $12 = 0;
  18503. } else {
  18504. $8 = Math_imul($5, $2)|0;
  18505. $9 = (_stbi__addsizes_valid($8)|0);
  18506. $10 = ($9|0)!=(0);
  18507. $12 = $10;
  18508. }
  18509. }
  18510. $11 = $12&1;
  18511. return ($11|0);
  18512. }
  18513. function _stbi__mul2sizes_valid($0,$1) {
  18514. $0 = $0|0;
  18515. $1 = $1|0;
  18516. var $$0 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, label = 0, sp = 0;
  18517. sp = STACKTOP;
  18518. $2 = $1 | $0;
  18519. $3 = ($2|0)<(0);
  18520. if ($3) {
  18521. $$0 = 0;
  18522. } else {
  18523. $4 = ($1|0)==(0);
  18524. if ($4) {
  18525. $$0 = 1;
  18526. } else {
  18527. $5 = (2147483647 / ($1|0))&-1;
  18528. $6 = ($5|0)>=($0|0);
  18529. $7 = $6&1;
  18530. $$0 = $7;
  18531. }
  18532. }
  18533. return ($$0|0);
  18534. }
  18535. function _stbi__addsizes_valid($0) {
  18536. $0 = $0|0;
  18537. var label = 0, sp = 0;
  18538. sp = STACKTOP;
  18539. return 1;
  18540. }
  18541. function _stbi__check_png_header($0) {
  18542. $0 = $0|0;
  18543. var $$05 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
  18544. sp = STACKTOP;
  18545. $1 = (_stbi__get8($0)|0);
  18546. $2 = ($1<<24>>24)==(-119);
  18547. if ($2) {
  18548. $3 = (_stbi__get8($0)|0);
  18549. $4 = ($3<<24>>24)==(80);
  18550. if ($4) {
  18551. $5 = (_stbi__get8($0)|0);
  18552. $6 = ($5<<24>>24)==(78);
  18553. if ($6) {
  18554. $7 = (_stbi__get8($0)|0);
  18555. $8 = ($7<<24>>24)==(71);
  18556. if ($8) {
  18557. $9 = (_stbi__get8($0)|0);
  18558. $10 = ($9<<24>>24)==(13);
  18559. if ($10) {
  18560. $11 = (_stbi__get8($0)|0);
  18561. $12 = ($11<<24>>24)==(10);
  18562. if ($12) {
  18563. $13 = (_stbi__get8($0)|0);
  18564. $14 = ($13<<24>>24)==(26);
  18565. if ($14) {
  18566. $15 = (_stbi__get8($0)|0);
  18567. $16 = ($15<<24>>24)==(10);
  18568. if ($16) {
  18569. $$05 = 1;
  18570. return ($$05|0);
  18571. }
  18572. }
  18573. }
  18574. }
  18575. }
  18576. }
  18577. }
  18578. }
  18579. _stbi__err(11087);
  18580. $$05 = 0;
  18581. return ($$05|0);
  18582. }
  18583. function _stbi__get_chunk_header($0,$1) {
  18584. $0 = $0|0;
  18585. $1 = $1|0;
  18586. var $$sroa$4$0$$sroa_idx2 = 0, $2 = 0, $3 = 0, label = 0, sp = 0;
  18587. sp = STACKTOP;
  18588. $2 = (_stbi__get32be($1)|0);
  18589. $3 = (_stbi__get32be($1)|0);
  18590. HEAP32[$0>>2] = $2;
  18591. $$sroa$4$0$$sroa_idx2 = ((($0)) + 4|0);
  18592. HEAP32[$$sroa$4$0$$sroa_idx2>>2] = $3;
  18593. return;
  18594. }
  18595. function _stbi__skip($0,$1) {
  18596. $0 = $0|0;
  18597. $1 = $1|0;
  18598. var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0;
  18599. var $8 = 0, $9 = 0, label = 0, sp = 0;
  18600. sp = STACKTOP;
  18601. $2 = ($1|0)<(0);
  18602. if ($2) {
  18603. $3 = ((($0)) + 172|0);
  18604. $4 = HEAP32[$3>>2]|0;
  18605. $5 = ((($0)) + 168|0);
  18606. HEAP32[$5>>2] = $4;
  18607. return;
  18608. }
  18609. $6 = ((($0)) + 16|0);
  18610. $7 = HEAP32[$6>>2]|0;
  18611. $8 = ($7|0)==(0|0);
  18612. if (!($8)) {
  18613. $9 = ((($0)) + 172|0);
  18614. $10 = HEAP32[$9>>2]|0;
  18615. $11 = ((($0)) + 168|0);
  18616. $12 = HEAP32[$11>>2]|0;
  18617. $13 = $10;
  18618. $14 = (($13) - ($12))|0;
  18619. $15 = ($14|0)<($1|0);
  18620. if ($15) {
  18621. HEAP32[$11>>2] = $10;
  18622. $16 = ((($0)) + 20|0);
  18623. $17 = HEAP32[$16>>2]|0;
  18624. $18 = ((($0)) + 28|0);
  18625. $19 = HEAP32[$18>>2]|0;
  18626. $20 = (($1) - ($14))|0;
  18627. FUNCTION_TABLE_vii[$17 & 63]($19,$20);
  18628. return;
  18629. }
  18630. }
  18631. $21 = ((($0)) + 168|0);
  18632. $22 = HEAP32[$21>>2]|0;
  18633. $23 = (($22) + ($1)|0);
  18634. HEAP32[$21>>2] = $23;
  18635. return;
  18636. }
  18637. function _stbi__get32be($0) {
  18638. $0 = $0|0;
  18639. var $1 = 0, $2 = 0, $3 = 0, $4 = 0, label = 0, sp = 0;
  18640. sp = STACKTOP;
  18641. $1 = (_stbi__get16be($0)|0);
  18642. $2 = $1 << 16;
  18643. $3 = (_stbi__get16be($0)|0);
  18644. $4 = (($2) + ($3))|0;
  18645. return ($4|0);
  18646. }
  18647. function _stbi__get8($0) {
  18648. $0 = $0|0;
  18649. var $$0 = 0, $$sink6 = 0, $1 = 0, $10 = 0, $11 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
  18650. sp = STACKTOP;
  18651. $1 = ((($0)) + 168|0);
  18652. $2 = HEAP32[$1>>2]|0;
  18653. $3 = ((($0)) + 172|0);
  18654. $4 = HEAP32[$3>>2]|0;
  18655. $5 = ($2>>>0)<($4>>>0);
  18656. do {
  18657. if ($5) {
  18658. $$sink6 = $2;
  18659. } else {
  18660. $6 = ((($0)) + 32|0);
  18661. $7 = HEAP32[$6>>2]|0;
  18662. $8 = ($7|0)==(0);
  18663. if ($8) {
  18664. $$0 = 0;
  18665. return ($$0|0);
  18666. } else {
  18667. _stbi__refill_buffer($0);
  18668. $9 = HEAP32[$1>>2]|0;
  18669. $$sink6 = $9;
  18670. break;
  18671. }
  18672. }
  18673. } while(0);
  18674. $10 = ((($$sink6)) + 1|0);
  18675. HEAP32[$1>>2] = $10;
  18676. $11 = HEAP8[$$sink6>>0]|0;
  18677. $$0 = $11;
  18678. return ($$0|0);
  18679. }
  18680. function _stbi__get16be($0) {
  18681. $0 = $0|0;
  18682. var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, label = 0, sp = 0;
  18683. sp = STACKTOP;
  18684. $1 = (_stbi__get8($0)|0);
  18685. $2 = $1&255;
  18686. $3 = $2 << 8;
  18687. $4 = (_stbi__get8($0)|0);
  18688. $5 = $4&255;
  18689. $6 = $3 | $5;
  18690. return ($6|0);
  18691. }
  18692. function _stbi__getn($0,$1,$2) {
  18693. $0 = $0|0;
  18694. $1 = $1|0;
  18695. $2 = $2|0;
  18696. var $$1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0;
  18697. var $29 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
  18698. sp = STACKTOP;
  18699. $3 = ((($0)) + 16|0);
  18700. $4 = HEAP32[$3>>2]|0;
  18701. $5 = ($4|0)==(0|0);
  18702. if (!($5)) {
  18703. $6 = ((($0)) + 172|0);
  18704. $7 = HEAP32[$6>>2]|0;
  18705. $8 = ((($0)) + 168|0);
  18706. $9 = HEAP32[$8>>2]|0;
  18707. $10 = $9;
  18708. $11 = (($7) - ($10))|0;
  18709. $12 = ($11|0)<($2|0);
  18710. if ($12) {
  18711. _memcpy(($1|0),($9|0),($11|0))|0;
  18712. $13 = HEAP32[$3>>2]|0;
  18713. $14 = ((($0)) + 28|0);
  18714. $15 = HEAP32[$14>>2]|0;
  18715. $16 = (($1) + ($11)|0);
  18716. $17 = (($2) - ($11))|0;
  18717. $18 = (FUNCTION_TABLE_iiii[$13 & 15]($15,$16,$17)|0);
  18718. $19 = ($18|0)==($17|0);
  18719. $20 = $19&1;
  18720. $21 = HEAP32[$6>>2]|0;
  18721. HEAP32[$8>>2] = $21;
  18722. $$1 = $20;
  18723. return ($$1|0);
  18724. }
  18725. }
  18726. $22 = ((($0)) + 168|0);
  18727. $23 = HEAP32[$22>>2]|0;
  18728. $24 = (($23) + ($2)|0);
  18729. $25 = ((($0)) + 172|0);
  18730. $26 = HEAP32[$25>>2]|0;
  18731. $27 = ($24>>>0)>($26>>>0);
  18732. if ($27) {
  18733. $$1 = 0;
  18734. return ($$1|0);
  18735. }
  18736. _memcpy(($1|0),($23|0),($2|0))|0;
  18737. $28 = HEAP32[$22>>2]|0;
  18738. $29 = (($28) + ($2)|0);
  18739. HEAP32[$22>>2] = $29;
  18740. $$1 = 1;
  18741. return ($$1|0);
  18742. }
  18743. function _stbi_zlib_decode_malloc_guesssize_headerflag($0,$1,$2,$3,$4) {
  18744. $0 = $0|0;
  18745. $1 = $1|0;
  18746. $2 = $2|0;
  18747. $3 = $3|0;
  18748. $4 = $4|0;
  18749. var $$0 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
  18750. sp = STACKTOP;
  18751. STACKTOP = STACKTOP + 4080|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(4080|0);
  18752. $5 = sp;
  18753. $6 = (_stbi__malloc($2)|0);
  18754. $7 = ($6|0)==(0|0);
  18755. do {
  18756. if ($7) {
  18757. $$0 = 0;
  18758. } else {
  18759. HEAP32[$5>>2] = $0;
  18760. $8 = (($0) + ($1)|0);
  18761. $9 = ((($5)) + 4|0);
  18762. HEAP32[$9>>2] = $8;
  18763. $10 = (_stbi__do_zlib($5,$6,$2,1,$4)|0);
  18764. $11 = ($10|0)==(0);
  18765. $12 = ((($5)) + 20|0);
  18766. $13 = HEAP32[$12>>2]|0;
  18767. if ($11) {
  18768. _free($13);
  18769. $$0 = 0;
  18770. break;
  18771. }
  18772. $14 = ($3|0)==(0|0);
  18773. if ($14) {
  18774. $$0 = $13;
  18775. } else {
  18776. $15 = ((($5)) + 16|0);
  18777. $16 = HEAP32[$15>>2]|0;
  18778. $17 = $13;
  18779. $18 = (($16) - ($17))|0;
  18780. HEAP32[$3>>2] = $18;
  18781. $$0 = $13;
  18782. }
  18783. }
  18784. } while(0);
  18785. STACKTOP = sp;return ($$0|0);
  18786. }
  18787. function _stbi__create_png_image($0,$1,$2,$3,$4,$5,$6) {
  18788. $0 = $0|0;
  18789. $1 = $1|0;
  18790. $2 = $2|0;
  18791. $3 = $3|0;
  18792. $4 = $4|0;
  18793. $5 = $5|0;
  18794. $6 = $6|0;
  18795. var $$0103117 = 0, $$0106116 = 0, $$0107115 = 0, $$095119 = 0, $$099118 = 0, $$3102$ph = 0, $$398$ph = 0, $$4 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0;
  18796. var $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $40 = 0, $41 = 0;
  18797. var $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $60 = 0, $61 = 0;
  18798. var $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0;
  18799. var $80 = 0, $81 = 0, $82 = 0, $9 = 0, $or$cond = 0, label = 0, sp = 0;
  18800. sp = STACKTOP;
  18801. $7 = ($4|0)==(16);
  18802. $8 = $7 ? 2 : 1;
  18803. $9 = Math_imul($8, $3)|0;
  18804. $10 = ($6|0)==(0);
  18805. $11 = HEAP32[$0>>2]|0;
  18806. $12 = HEAP32[$11>>2]|0;
  18807. $13 = ((($11)) + 4|0);
  18808. $14 = HEAP32[$13>>2]|0;
  18809. if ($10) {
  18810. $15 = (_stbi__create_png_image_raw($0,$1,$2,$3,$12,$14,$4,$5)|0);
  18811. $$4 = $15;
  18812. return ($$4|0);
  18813. }
  18814. $16 = (_stbi__malloc_mad3($12,$14,$9)|0);
  18815. $17 = ((($0)) + 12|0);
  18816. $18 = ((($0)) + 12|0);
  18817. $$0103117 = 0;$$095119 = $1;$$099118 = $2;
  18818. while(1) {
  18819. $19 = HEAP32[$0>>2]|0;
  18820. $20 = HEAP32[$19>>2]|0;
  18821. $21 = (3020 + ($$0103117<<2)|0);
  18822. $22 = HEAP32[$21>>2]|0;
  18823. $23 = (3048 + ($$0103117<<2)|0);
  18824. $24 = HEAP32[$23>>2]|0;
  18825. $25 = (($20) + -1)|0;
  18826. $26 = (($25) - ($22))|0;
  18827. $27 = (($26) + ($24))|0;
  18828. $28 = (($27>>>0) / ($24>>>0))&-1;
  18829. $29 = ((($19)) + 4|0);
  18830. $30 = HEAP32[$29>>2]|0;
  18831. $31 = (3076 + ($$0103117<<2)|0);
  18832. $32 = HEAP32[$31>>2]|0;
  18833. $33 = (3104 + ($$0103117<<2)|0);
  18834. $34 = HEAP32[$33>>2]|0;
  18835. $35 = (($30) + -1)|0;
  18836. $36 = (($35) - ($32))|0;
  18837. $37 = (($36) + ($34))|0;
  18838. $38 = (($37>>>0) / ($34>>>0))&-1;
  18839. $39 = ($24>>>0)<=($27>>>0);
  18840. $40 = ($34>>>0)<=($37>>>0);
  18841. $or$cond = $39 & $40;
  18842. if ($or$cond) {
  18843. $41 = ((($19)) + 8|0);
  18844. $42 = HEAP32[$41>>2]|0;
  18845. $43 = Math_imul($28, $4)|0;
  18846. $44 = Math_imul($43, $42)|0;
  18847. $45 = (($44) + 7)|0;
  18848. $46 = $45 >> 3;
  18849. $47 = (($46) + 1)|0;
  18850. $48 = Math_imul($47, $38)|0;
  18851. $49 = (_stbi__create_png_image_raw($0,$$095119,$$099118,$3,$28,$38,$4,$5)|0);
  18852. $50 = ($49|0)==(0);
  18853. if ($50) {
  18854. label = 13;
  18855. break;
  18856. }
  18857. $51 = ($38|0)>(0);
  18858. if ($51) {
  18859. $52 = ($28|0)>(0);
  18860. $$0106116 = 0;
  18861. while(1) {
  18862. if ($52) {
  18863. $53 = HEAP32[$33>>2]|0;
  18864. $54 = Math_imul($53, $$0106116)|0;
  18865. $55 = HEAP32[$31>>2]|0;
  18866. $56 = (($54) + ($55))|0;
  18867. $57 = HEAP32[$23>>2]|0;
  18868. $58 = HEAP32[$21>>2]|0;
  18869. $59 = Math_imul($56, $9)|0;
  18870. $60 = Math_imul($$0106116, $28)|0;
  18871. $$0107115 = 0;
  18872. while(1) {
  18873. $61 = Math_imul($57, $$0107115)|0;
  18874. $62 = (($61) + ($58))|0;
  18875. $63 = HEAP32[$0>>2]|0;
  18876. $64 = HEAP32[$63>>2]|0;
  18877. $65 = Math_imul($59, $64)|0;
  18878. $66 = (($16) + ($65)|0);
  18879. $67 = Math_imul($62, $9)|0;
  18880. $68 = (($66) + ($67)|0);
  18881. $69 = HEAP32[$18>>2]|0;
  18882. $70 = (($$0107115) + ($60))|0;
  18883. $71 = Math_imul($70, $9)|0;
  18884. $72 = (($69) + ($71)|0);
  18885. _memcpy(($68|0),($72|0),($9|0))|0;
  18886. $73 = (($$0107115) + 1)|0;
  18887. $74 = ($73|0)<($28|0);
  18888. if ($74) {
  18889. $$0107115 = $73;
  18890. } else {
  18891. break;
  18892. }
  18893. }
  18894. }
  18895. $75 = (($$0106116) + 1)|0;
  18896. $76 = ($75|0)<($38|0);
  18897. if ($76) {
  18898. $$0106116 = $75;
  18899. } else {
  18900. break;
  18901. }
  18902. }
  18903. }
  18904. $77 = HEAP32[$17>>2]|0;
  18905. _free($77);
  18906. $78 = (($$095119) + ($48)|0);
  18907. $79 = (($$099118) - ($48))|0;
  18908. $$3102$ph = $79;$$398$ph = $78;
  18909. } else {
  18910. $$3102$ph = $$099118;$$398$ph = $$095119;
  18911. }
  18912. $80 = (($$0103117) + 1)|0;
  18913. $81 = ($80|0)<(7);
  18914. if ($81) {
  18915. $$0103117 = $80;$$095119 = $$398$ph;$$099118 = $$3102$ph;
  18916. } else {
  18917. label = 15;
  18918. break;
  18919. }
  18920. }
  18921. if ((label|0) == 13) {
  18922. _free($16);
  18923. $$4 = 0;
  18924. return ($$4|0);
  18925. }
  18926. else if ((label|0) == 15) {
  18927. $82 = ((($0)) + 12|0);
  18928. HEAP32[$82>>2] = $16;
  18929. $$4 = 1;
  18930. return ($$4|0);
  18931. }
  18932. return (0)|0;
  18933. }
  18934. function _stbi__compute_transparency16($0,$1,$2) {
  18935. $0 = $0|0;
  18936. $1 = $1|0;
  18937. $2 = $2|0;
  18938. var $$0323 = 0, $$04 = 0, $$1335 = 0, $$16 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
  18939. var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $exitcond9 = 0, $not$ = 0, label = 0, sp = 0;
  18940. sp = STACKTOP;
  18941. $3 = HEAP32[$0>>2]|0;
  18942. $4 = HEAP32[$3>>2]|0;
  18943. $5 = ((($3)) + 4|0);
  18944. $6 = HEAP32[$5>>2]|0;
  18945. $7 = Math_imul($6, $4)|0;
  18946. $8 = ((($0)) + 12|0);
  18947. $9 = HEAP32[$8>>2]|0;
  18948. switch ($2|0) {
  18949. case 2: {
  18950. $13 = ($7|0)==(0);
  18951. if ($13) {
  18952. return;
  18953. } else {
  18954. $$0323 = 0;$$04 = $9;
  18955. }
  18956. while(1) {
  18957. $14 = HEAP16[$$04>>1]|0;
  18958. $15 = HEAP16[$1>>1]|0;
  18959. $not$ = ($14<<16>>16)!=($15<<16>>16);
  18960. $16 = $not$ << 31 >> 31;
  18961. $17 = ((($$04)) + 2|0);
  18962. HEAP16[$17>>1] = $16;
  18963. $18 = ((($$04)) + 4|0);
  18964. $19 = (($$0323) + 1)|0;
  18965. $exitcond = ($19|0)==($7|0);
  18966. if ($exitcond) {
  18967. break;
  18968. } else {
  18969. $$0323 = $19;$$04 = $18;
  18970. }
  18971. }
  18972. return;
  18973. break;
  18974. }
  18975. case 4: {
  18976. $10 = ($7|0)==(0);
  18977. if ($10) {
  18978. return;
  18979. }
  18980. $11 = ((($1)) + 2|0);
  18981. $12 = ((($1)) + 4|0);
  18982. $$1335 = 0;$$16 = $9;
  18983. while(1) {
  18984. $20 = HEAP16[$$16>>1]|0;
  18985. $21 = HEAP16[$1>>1]|0;
  18986. $22 = ($20<<16>>16)==($21<<16>>16);
  18987. if ($22) {
  18988. $23 = ((($$16)) + 2|0);
  18989. $24 = HEAP16[$23>>1]|0;
  18990. $25 = HEAP16[$11>>1]|0;
  18991. $26 = ($24<<16>>16)==($25<<16>>16);
  18992. if ($26) {
  18993. $27 = ((($$16)) + 4|0);
  18994. $28 = HEAP16[$27>>1]|0;
  18995. $29 = HEAP16[$12>>1]|0;
  18996. $30 = ($28<<16>>16)==($29<<16>>16);
  18997. if ($30) {
  18998. $31 = ((($$16)) + 6|0);
  18999. HEAP16[$31>>1] = 0;
  19000. }
  19001. }
  19002. }
  19003. $32 = ((($$16)) + 8|0);
  19004. $33 = (($$1335) + 1)|0;
  19005. $exitcond9 = ($33|0)==($7|0);
  19006. if ($exitcond9) {
  19007. break;
  19008. } else {
  19009. $$1335 = $33;$$16 = $32;
  19010. }
  19011. }
  19012. return;
  19013. break;
  19014. }
  19015. default: {
  19016. ___assert_fail((10169|0),(9676|0),4569,(10221|0));
  19017. // unreachable;
  19018. }
  19019. }
  19020. }
  19021. function _stbi__compute_transparency($0,$1,$2) {
  19022. $0 = $0|0;
  19023. $1 = $1|0;
  19024. $2 = $2|0;
  19025. var $$0323 = 0, $$04 = 0, $$1335 = 0, $$16 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
  19026. var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $exitcond9 = 0, $not$ = 0, label = 0, sp = 0;
  19027. sp = STACKTOP;
  19028. $3 = HEAP32[$0>>2]|0;
  19029. $4 = HEAP32[$3>>2]|0;
  19030. $5 = ((($3)) + 4|0);
  19031. $6 = HEAP32[$5>>2]|0;
  19032. $7 = Math_imul($6, $4)|0;
  19033. $8 = ((($0)) + 12|0);
  19034. $9 = HEAP32[$8>>2]|0;
  19035. switch ($2|0) {
  19036. case 2: {
  19037. $13 = ($7|0)==(0);
  19038. if ($13) {
  19039. return;
  19040. } else {
  19041. $$0323 = 0;$$04 = $9;
  19042. }
  19043. while(1) {
  19044. $14 = HEAP8[$$04>>0]|0;
  19045. $15 = HEAP8[$1>>0]|0;
  19046. $not$ = ($14<<24>>24)!=($15<<24>>24);
  19047. $16 = $not$ << 31 >> 31;
  19048. $17 = ((($$04)) + 1|0);
  19049. HEAP8[$17>>0] = $16;
  19050. $18 = ((($$04)) + 2|0);
  19051. $19 = (($$0323) + 1)|0;
  19052. $exitcond = ($19|0)==($7|0);
  19053. if ($exitcond) {
  19054. break;
  19055. } else {
  19056. $$0323 = $19;$$04 = $18;
  19057. }
  19058. }
  19059. return;
  19060. break;
  19061. }
  19062. case 4: {
  19063. $10 = ($7|0)==(0);
  19064. if ($10) {
  19065. return;
  19066. }
  19067. $11 = ((($1)) + 1|0);
  19068. $12 = ((($1)) + 2|0);
  19069. $$1335 = 0;$$16 = $9;
  19070. while(1) {
  19071. $20 = HEAP8[$$16>>0]|0;
  19072. $21 = HEAP8[$1>>0]|0;
  19073. $22 = ($20<<24>>24)==($21<<24>>24);
  19074. if ($22) {
  19075. $23 = ((($$16)) + 1|0);
  19076. $24 = HEAP8[$23>>0]|0;
  19077. $25 = HEAP8[$11>>0]|0;
  19078. $26 = ($24<<24>>24)==($25<<24>>24);
  19079. if ($26) {
  19080. $27 = ((($$16)) + 2|0);
  19081. $28 = HEAP8[$27>>0]|0;
  19082. $29 = HEAP8[$12>>0]|0;
  19083. $30 = ($28<<24>>24)==($29<<24>>24);
  19084. if ($30) {
  19085. $31 = ((($$16)) + 3|0);
  19086. HEAP8[$31>>0] = 0;
  19087. }
  19088. }
  19089. }
  19090. $32 = ((($$16)) + 4|0);
  19091. $33 = (($$1335) + 1)|0;
  19092. $exitcond9 = ($33|0)==($7|0);
  19093. if ($exitcond9) {
  19094. break;
  19095. } else {
  19096. $$1335 = $33;$$16 = $32;
  19097. }
  19098. }
  19099. return;
  19100. break;
  19101. }
  19102. default: {
  19103. ___assert_fail((10169|0),(9676|0),4544,(10194|0));
  19104. // unreachable;
  19105. }
  19106. }
  19107. }
  19108. function _stbi__de_iphone($0) {
  19109. $0 = $0|0;
  19110. var $$05158 = 0, $$059 = 0, $$15263 = 0, $$164 = 0, $$25360 = 0, $$261 = 0, $$sink = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0;
  19111. var $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0;
  19112. var $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $exitcond68 = 0, $exitcond69 = 0, label = 0, sp = 0;
  19113. sp = STACKTOP;
  19114. $1 = HEAP32[$0>>2]|0;
  19115. $2 = HEAP32[$1>>2]|0;
  19116. $3 = ((($1)) + 4|0);
  19117. $4 = HEAP32[$3>>2]|0;
  19118. $5 = Math_imul($4, $2)|0;
  19119. $6 = ((($0)) + 12|0);
  19120. $7 = HEAP32[$6>>2]|0;
  19121. $8 = ((($1)) + 12|0);
  19122. $9 = HEAP32[$8>>2]|0;
  19123. switch ($9|0) {
  19124. case 3: {
  19125. $10 = ($5|0)==(0);
  19126. if ($10) {
  19127. return;
  19128. } else {
  19129. $$05158 = $7;$$059 = 0;
  19130. }
  19131. while(1) {
  19132. $11 = HEAP8[$$05158>>0]|0;
  19133. $12 = ((($$05158)) + 2|0);
  19134. $13 = HEAP8[$12>>0]|0;
  19135. HEAP8[$$05158>>0] = $13;
  19136. HEAP8[$12>>0] = $11;
  19137. $14 = ((($$05158)) + 3|0);
  19138. $15 = (($$059) + 1)|0;
  19139. $exitcond = ($15|0)==($5|0);
  19140. if ($exitcond) {
  19141. break;
  19142. } else {
  19143. $$05158 = $14;$$059 = $15;
  19144. }
  19145. }
  19146. return;
  19147. break;
  19148. }
  19149. case 4: {
  19150. $16 = HEAP32[5194]|0;
  19151. $17 = ($16|0)==(0);
  19152. $18 = ($5|0)!=(0);
  19153. if ($17) {
  19154. if ($18) {
  19155. $$25360 = $7;$$261 = 0;
  19156. } else {
  19157. return;
  19158. }
  19159. while(1) {
  19160. $42 = HEAP8[$$25360>>0]|0;
  19161. $43 = ((($$25360)) + 2|0);
  19162. $44 = HEAP8[$43>>0]|0;
  19163. HEAP8[$$25360>>0] = $44;
  19164. HEAP8[$43>>0] = $42;
  19165. $45 = ((($$25360)) + 4|0);
  19166. $46 = (($$261) + 1)|0;
  19167. $exitcond68 = ($46|0)==($5|0);
  19168. if ($exitcond68) {
  19169. break;
  19170. } else {
  19171. $$25360 = $45;$$261 = $46;
  19172. }
  19173. }
  19174. return;
  19175. }
  19176. if ($18) {
  19177. $$15263 = $7;$$164 = 0;
  19178. } else {
  19179. return;
  19180. }
  19181. while(1) {
  19182. $19 = ((($$15263)) + 3|0);
  19183. $20 = HEAP8[$19>>0]|0;
  19184. $21 = HEAP8[$$15263>>0]|0;
  19185. $22 = ($20<<24>>24)==(0);
  19186. $23 = ((($$15263)) + 2|0);
  19187. $24 = HEAP8[$23>>0]|0;
  19188. if ($22) {
  19189. HEAP8[$$15263>>0] = $24;
  19190. $$sink = $21;
  19191. } else {
  19192. $25 = $24&255;
  19193. $26 = ($25*255)|0;
  19194. $27 = $20&255;
  19195. $28 = (($26>>>0) / ($27>>>0))&-1;
  19196. $29 = $28&255;
  19197. HEAP8[$$15263>>0] = $29;
  19198. $30 = ((($$15263)) + 1|0);
  19199. $31 = HEAP8[$30>>0]|0;
  19200. $32 = $31&255;
  19201. $33 = ($32*255)|0;
  19202. $34 = (($33>>>0) / ($27>>>0))&-1;
  19203. $35 = $34&255;
  19204. HEAP8[$30>>0] = $35;
  19205. $36 = $21&255;
  19206. $37 = ($36*255)|0;
  19207. $38 = (($37>>>0) / ($27>>>0))&-1;
  19208. $39 = $38&255;
  19209. $$sink = $39;
  19210. }
  19211. HEAP8[$23>>0] = $$sink;
  19212. $40 = ((($$15263)) + 4|0);
  19213. $41 = (($$164) + 1)|0;
  19214. $exitcond69 = ($41|0)==($5|0);
  19215. if ($exitcond69) {
  19216. break;
  19217. } else {
  19218. $$15263 = $40;$$164 = $41;
  19219. }
  19220. }
  19221. return;
  19222. break;
  19223. }
  19224. default: {
  19225. ___assert_fail((10135|0),(9676|0),4650,(10153|0));
  19226. // unreachable;
  19227. }
  19228. }
  19229. }
  19230. function _stbi__expand_png_palette($0,$1,$2) {
  19231. $0 = $0|0;
  19232. $1 = $1|0;
  19233. $2 = $2|0;
  19234. var $$0 = 0, $$0574 = 0, $$0583 = 0, $$1595 = 0, $$16 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0;
  19235. var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0;
  19236. var $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $exitcond9 = 0, label = 0, sp = 0;
  19237. sp = STACKTOP;
  19238. $3 = HEAP32[$0>>2]|0;
  19239. $4 = HEAP32[$3>>2]|0;
  19240. $5 = ((($3)) + 4|0);
  19241. $6 = HEAP32[$5>>2]|0;
  19242. $7 = Math_imul($6, $4)|0;
  19243. $8 = ((($0)) + 12|0);
  19244. $9 = HEAP32[$8>>2]|0;
  19245. $10 = (_stbi__malloc_mad2($7,$2)|0);
  19246. $11 = ($10|0)==(0|0);
  19247. if ($11) {
  19248. _stbi__err(9731);
  19249. $$0 = 0;
  19250. return ($$0|0);
  19251. }
  19252. $12 = ($2|0)==(3);
  19253. $13 = ($7|0)!=(0);
  19254. if ($12) {
  19255. if ($13) {
  19256. $$0574 = 0;$$0583 = $10;
  19257. while(1) {
  19258. $14 = (($9) + ($$0574)|0);
  19259. $15 = HEAP8[$14>>0]|0;
  19260. $16 = $15&255;
  19261. $17 = $16 << 2;
  19262. $18 = (($1) + ($17)|0);
  19263. $19 = HEAP8[$18>>0]|0;
  19264. HEAP8[$$0583>>0] = $19;
  19265. $20 = $17 | 1;
  19266. $21 = (($1) + ($20)|0);
  19267. $22 = HEAP8[$21>>0]|0;
  19268. $23 = ((($$0583)) + 1|0);
  19269. HEAP8[$23>>0] = $22;
  19270. $24 = $17 | 2;
  19271. $25 = (($1) + ($24)|0);
  19272. $26 = HEAP8[$25>>0]|0;
  19273. $27 = ((($$0583)) + 2|0);
  19274. HEAP8[$27>>0] = $26;
  19275. $28 = ((($$0583)) + 3|0);
  19276. $29 = (($$0574) + 1)|0;
  19277. $exitcond = ($29|0)==($7|0);
  19278. if ($exitcond) {
  19279. break;
  19280. } else {
  19281. $$0574 = $29;$$0583 = $28;
  19282. }
  19283. }
  19284. }
  19285. } else {
  19286. if ($13) {
  19287. $$1595 = $10;$$16 = 0;
  19288. while(1) {
  19289. $30 = (($9) + ($$16)|0);
  19290. $31 = HEAP8[$30>>0]|0;
  19291. $32 = $31&255;
  19292. $33 = $32 << 2;
  19293. $34 = (($1) + ($33)|0);
  19294. $35 = HEAP8[$34>>0]|0;
  19295. HEAP8[$$1595>>0] = $35;
  19296. $36 = $33 | 1;
  19297. $37 = (($1) + ($36)|0);
  19298. $38 = HEAP8[$37>>0]|0;
  19299. $39 = ((($$1595)) + 1|0);
  19300. HEAP8[$39>>0] = $38;
  19301. $40 = $33 | 2;
  19302. $41 = (($1) + ($40)|0);
  19303. $42 = HEAP8[$41>>0]|0;
  19304. $43 = ((($$1595)) + 2|0);
  19305. HEAP8[$43>>0] = $42;
  19306. $44 = $33 | 3;
  19307. $45 = (($1) + ($44)|0);
  19308. $46 = HEAP8[$45>>0]|0;
  19309. $47 = ((($$1595)) + 3|0);
  19310. HEAP8[$47>>0] = $46;
  19311. $48 = ((($$1595)) + 4|0);
  19312. $49 = (($$16) + 1)|0;
  19313. $exitcond9 = ($49|0)==($7|0);
  19314. if ($exitcond9) {
  19315. break;
  19316. } else {
  19317. $$1595 = $48;$$16 = $49;
  19318. }
  19319. }
  19320. }
  19321. }
  19322. $50 = HEAP32[$8>>2]|0;
  19323. _free($50);
  19324. HEAP32[$8>>2] = $10;
  19325. $$0 = 1;
  19326. return ($$0|0);
  19327. }
  19328. function _stbi__malloc_mad2($0,$1) {
  19329. $0 = $0|0;
  19330. $1 = $1|0;
  19331. var $$0 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0;
  19332. sp = STACKTOP;
  19333. $2 = (_stbi__mad2sizes_valid($0,$1)|0);
  19334. $3 = ($2|0)==(0);
  19335. if ($3) {
  19336. $$0 = 0;
  19337. return ($$0|0);
  19338. }
  19339. $4 = Math_imul($1, $0)|0;
  19340. $5 = (_stbi__malloc($4)|0);
  19341. $$0 = $5;
  19342. return ($$0|0);
  19343. }
  19344. function _stbi__mad2sizes_valid($0,$1) {
  19345. $0 = $0|0;
  19346. $1 = $1|0;
  19347. var $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, label = 0, sp = 0;
  19348. sp = STACKTOP;
  19349. $2 = (_stbi__mul2sizes_valid($0,$1)|0);
  19350. $3 = ($2|0)==(0);
  19351. if ($3) {
  19352. $8 = 0;
  19353. $7 = $8&1;
  19354. return ($7|0);
  19355. }
  19356. $4 = Math_imul($1, $0)|0;
  19357. $5 = (_stbi__addsizes_valid($4)|0);
  19358. $6 = ($5|0)!=(0);
  19359. $8 = $6;
  19360. $7 = $8&1;
  19361. return ($7|0);
  19362. }
  19363. function _stbi__create_png_image_raw($0,$1,$2,$3,$4,$5,$6,$7) {
  19364. $0 = $0|0;
  19365. $1 = $1|0;
  19366. $2 = $2|0;
  19367. $3 = $3|0;
  19368. $4 = $4|0;
  19369. $5 = $5|0;
  19370. $6 = $6|0;
  19371. $7 = $7|0;
  19372. var $$0568 = 0, $$0568724 = 0, $$0568725 = 0, $$0571$lcssa = 0, $$0571715 = 0, $$0574$lcssa = 0, $$0574714 = 0, $$0577817 = 0, $$0588 = 0, $$0597 = 0, $$0608816 = 0, $$0611815 = 0, $$0614 = 0, $$0614793 = 0, $$0614796 = 0, $$0623814 = 0, $$0625734 = 0, $$0731 = 0, $$1 = 0, $$10635764 = 0;
  19373. var $$11$ph = 0, $$11636755 = 0, $$12747 = 0, $$13739 = 0, $$14$lcssa = 0, $$14713 = 0, $$15$lcssa = 0, $$15705 = 0, $$1572$lcssa = 0, $$1572707 = 0, $$1575$lcssa = 0, $$1575706 = 0, $$1578 = 0, $$16$lcssa = 0, $$1609 = 0, $$1612 = 0, $$1615 = 0, $$1615785 = 0, $$1615788 = 0, $$1624727 = 0;
  19374. var $$1626812 = 0, $$16700 = 0, $$1721 = 0, $$1722 = 0, $$2 = 0, $$2573$lcssa = 0, $$2573702 = 0, $$2579795 = 0, $$2599794 = 0, $$2616 = 0, $$2616776 = 0, $$2616780 = 0, $$2627810 = 0, $$3580787 = 0, $$3592778 = 0, $$3600786 = 0, $$3617 = 0, $$3617767 = 0, $$3617771 = 0, $$3628808 = 0;
  19375. var $$4$lcssa = 0, $$4581779 = 0, $$4593769 = 0, $$4601777 = 0, $$4618 = 0, $$4618758 = 0, $$4618762 = 0, $$4629806 = 0, $$4701 = 0, $$5582770 = 0, $$5594760 = 0, $$5602768 = 0, $$5619 = 0, $$5619750 = 0, $$5619753 = 0, $$5630804 = 0, $$6583761 = 0, $$6603759 = 0, $$6620 = 0, $$6620742 = 0;
  19376. var $$6620745 = 0, $$6631802 = 0, $$7584752 = 0, $$7604751 = 0, $$7621798 = 0, $$7632790 = 0, $$8585744 = 0, $$8605743 = 0, $$8622729 = 0, $$8633782 = 0, $$9586 = 0, $$9606799 = 0, $$9634773 = 0, $$not = 0, $$sink = 0, $$sink1 = 0, $$sink641 = 0, $10 = 0, $100 = 0, $101 = 0;
  19377. var $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0;
  19378. var $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0;
  19379. var $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0;
  19380. var $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0;
  19381. var $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0;
  19382. var $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0;
  19383. var $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0;
  19384. var $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0;
  19385. var $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0;
  19386. var $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0;
  19387. var $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $30 = 0, $300 = 0, $301 = 0;
  19388. var $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0, $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0;
  19389. var $320 = 0, $321 = 0, $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0, $332 = 0, $333 = 0, $334 = 0, $335 = 0, $336 = 0, $337 = 0, $338 = 0;
  19390. var $339 = 0, $34 = 0, $340 = 0, $341 = 0, $342 = 0, $343 = 0, $344 = 0, $345 = 0, $346 = 0, $347 = 0, $348 = 0, $349 = 0, $35 = 0, $350 = 0, $351 = 0, $352 = 0, $353 = 0, $354 = 0, $355 = 0, $356 = 0;
  19391. var $357 = 0, $358 = 0, $359 = 0, $36 = 0, $360 = 0, $361 = 0, $362 = 0, $363 = 0, $364 = 0, $365 = 0, $366 = 0, $367 = 0, $368 = 0, $369 = 0, $37 = 0, $370 = 0, $371 = 0, $372 = 0, $373 = 0, $374 = 0;
  19392. var $375 = 0, $376 = 0, $377 = 0, $378 = 0, $379 = 0, $38 = 0, $380 = 0, $381 = 0, $382 = 0, $383 = 0, $384 = 0, $385 = 0, $386 = 0, $387 = 0, $388 = 0, $389 = 0, $39 = 0, $390 = 0, $391 = 0, $392 = 0;
  19393. var $393 = 0, $394 = 0, $395 = 0, $396 = 0, $397 = 0, $398 = 0, $399 = 0, $40 = 0, $400 = 0, $401 = 0, $402 = 0, $403 = 0, $404 = 0, $405 = 0, $406 = 0, $407 = 0, $408 = 0, $409 = 0, $41 = 0, $410 = 0;
  19394. var $411 = 0, $412 = 0, $413 = 0, $414 = 0, $415 = 0, $416 = 0, $417 = 0, $418 = 0, $419 = 0, $42 = 0, $420 = 0, $421 = 0, $422 = 0, $423 = 0, $424 = 0, $425 = 0, $426 = 0, $427 = 0, $428 = 0, $429 = 0;
  19395. var $43 = 0, $430 = 0, $431 = 0, $432 = 0, $433 = 0, $434 = 0, $435 = 0, $436 = 0, $437 = 0, $438 = 0, $439 = 0, $44 = 0, $440 = 0, $441 = 0, $442 = 0, $443 = 0, $444 = 0, $445 = 0, $446 = 0, $447 = 0;
  19396. var $448 = 0, $449 = 0, $45 = 0, $450 = 0, $451 = 0, $452 = 0, $453 = 0, $454 = 0, $455 = 0, $456 = 0, $457 = 0, $458 = 0, $459 = 0, $46 = 0, $460 = 0, $461 = 0, $462 = 0, $463 = 0, $464 = 0, $465 = 0;
  19397. var $466 = 0, $467 = 0, $468 = 0, $469 = 0, $47 = 0, $470 = 0, $471 = 0, $472 = 0, $473 = 0, $474 = 0, $475 = 0, $476 = 0, $477 = 0, $478 = 0, $479 = 0, $48 = 0, $480 = 0, $481 = 0, $482 = 0, $483 = 0;
  19398. var $484 = 0, $485 = 0, $486 = 0, $487 = 0, $488 = 0, $489 = 0, $49 = 0, $490 = 0, $491 = 0, $492 = 0, $493 = 0, $494 = 0, $495 = 0, $496 = 0, $497 = 0, $498 = 0, $499 = 0, $50 = 0, $500 = 0, $501 = 0;
  19399. var $502 = 0, $503 = 0, $504 = 0, $505 = 0, $506 = 0, $507 = 0, $508 = 0, $509 = 0, $51 = 0, $510 = 0, $511 = 0, $512 = 0, $513 = 0, $514 = 0, $515 = 0, $516 = 0, $517 = 0, $518 = 0, $519 = 0, $52 = 0;
  19400. var $520 = 0, $521 = 0, $522 = 0, $523 = 0, $524 = 0, $525 = 0, $526 = 0, $527 = 0, $528 = 0, $529 = 0, $53 = 0, $530 = 0, $531 = 0, $532 = 0, $533 = 0, $534 = 0, $535 = 0, $536 = 0, $537 = 0, $538 = 0;
  19401. var $539 = 0, $54 = 0, $540 = 0, $541 = 0, $542 = 0, $543 = 0, $544 = 0, $545 = 0, $546 = 0, $547 = 0, $548 = 0, $549 = 0, $55 = 0, $550 = 0, $551 = 0, $552 = 0, $553 = 0, $554 = 0, $555 = 0, $556 = 0;
  19402. var $557 = 0, $558 = 0, $559 = 0, $56 = 0, $560 = 0, $561 = 0, $562 = 0, $563 = 0, $564 = 0, $565 = 0, $566 = 0, $567 = 0, $568 = 0, $569 = 0, $57 = 0, $570 = 0, $571 = 0, $572 = 0, $573 = 0, $574 = 0;
  19403. var $575 = 0, $576 = 0, $577 = 0, $578 = 0, $579 = 0, $58 = 0, $580 = 0, $581 = 0, $582 = 0, $583 = 0, $584 = 0, $585 = 0, $586 = 0, $587 = 0, $588 = 0, $589 = 0, $59 = 0, $590 = 0, $591 = 0, $592 = 0;
  19404. var $593 = 0, $594 = 0, $595 = 0, $596 = 0, $597 = 0, $598 = 0, $599 = 0, $60 = 0, $600 = 0, $601 = 0, $602 = 0, $603 = 0, $604 = 0, $605 = 0, $606 = 0, $607 = 0, $608 = 0, $609 = 0, $61 = 0, $610 = 0;
  19405. var $611 = 0, $612 = 0, $613 = 0, $614 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0;
  19406. var $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0;
  19407. var $96 = 0, $97 = 0, $98 = 0, $99 = 0, $brmerge = 0, $brmerge894 = 0, $exitcond = 0, $exitcond864 = 0, $exitcond865 = 0, $exitcond867 = 0, $exitcond869 = 0, $exitcond871 = 0, $exitcond873 = 0, $exitcond875 = 0, $exitcond877 = 0, $exitcond880 = 0, $exitcond881 = 0, $exitcond882 = 0, $exitcond883 = 0, $exitcond884 = 0;
  19408. var $exitcond885 = 0, $exitcond886 = 0, $indvars$iv = 0, $indvars$iv$next = 0, $indvars$iv$next849 = 0, $indvars$iv$next852 = 0, $indvars$iv$next855 = 0, $indvars$iv$next858 = 0, $indvars$iv$next861 = 0, $indvars$iv848 = 0, $indvars$iv851 = 0, $indvars$iv854 = 0, $indvars$iv857 = 0, $indvars$iv860 = 0, $or$cond = 0, $scevgep = 0, $scevgep850 = 0, $scevgep853 = 0, $scevgep856 = 0, $scevgep859 = 0;
  19409. var $scevgep862 = 0, $scevgep866 = 0, $scevgep868 = 0, $scevgep870 = 0, $scevgep872 = 0, $scevgep874 = 0, $scevgep876 = 0, $scevgep879 = 0, $trunc = 0, $trunc637 = 0, $trunc638 = 0, label = 0, sp = 0;
  19410. sp = STACKTOP;
  19411. $8 = ($6|0)==(16);
  19412. $9 = $8 ? 2 : 1;
  19413. $10 = HEAP32[$0>>2]|0;
  19414. $11 = Math_imul($4, $3)|0;
  19415. $12 = Math_imul($9, $11)|0;
  19416. $13 = ((($10)) + 8|0);
  19417. $14 = HEAP32[$13>>2]|0;
  19418. $15 = Math_imul($9, $3)|0;
  19419. $16 = Math_imul($14, $9)|0;
  19420. $17 = ($14|0)==($3|0);
  19421. $18 = (($14) + 1)|0;
  19422. $19 = ($18|0)==($3|0);
  19423. $or$cond = $17 | $19;
  19424. if (!($or$cond)) {
  19425. ___assert_fail((10250|0),(9676|0),4294,(10291|0));
  19426. // unreachable;
  19427. }
  19428. $20 = (_stbi__malloc_mad3($4,$5,$15)|0);
  19429. $21 = ((($0)) + 12|0);
  19430. HEAP32[$21>>2] = $20;
  19431. $22 = ($20|0)==(0|0);
  19432. if ($22) {
  19433. _stbi__err(9731);
  19434. $$2 = 0;
  19435. return ($$2|0);
  19436. }
  19437. $23 = Math_imul($14, $4)|0;
  19438. $24 = Math_imul($23, $6)|0;
  19439. $25 = (($24) + 7)|0;
  19440. $26 = $25 >>> 3;
  19441. $27 = (($26) + 1)|0;
  19442. $28 = Math_imul($27, $5)|0;
  19443. $29 = HEAP32[$10>>2]|0;
  19444. $30 = ($29|0)==($4|0);
  19445. if ($30) {
  19446. $31 = ((($10)) + 4|0);
  19447. $32 = HEAP32[$31>>2]|0;
  19448. $33 = ($32|0)==($5|0);
  19449. if ($33) {
  19450. $34 = ($28|0)==($2|0);
  19451. if (!($34)) {
  19452. _stbi__err(10318);
  19453. $$2 = 0;
  19454. return ($$2|0);
  19455. }
  19456. } else {
  19457. label = 9;
  19458. }
  19459. } else {
  19460. label = 9;
  19461. }
  19462. if ((label|0) == 9) {
  19463. $35 = ($28>>>0)>($2>>>0);
  19464. if ($35) {
  19465. _stbi__err(10318);
  19466. $$2 = 0;
  19467. return ($$2|0);
  19468. }
  19469. }
  19470. $36 = ($5|0)==(0);
  19471. L18: do {
  19472. if (!($36)) {
  19473. $37 = ($6|0)<(8);
  19474. $38 = ($26>>>0)>($4>>>0);
  19475. $39 = (($11) - ($26))|0;
  19476. $40 = (0 - ($12))|0;
  19477. $41 = ($6|0)==(8);
  19478. $brmerge = $37 | $17;
  19479. $42 = ($4|0)==(0);
  19480. $$0614793 = (($4) + -1)|0;
  19481. $43 = ($$0614793|0)==(0);
  19482. $$1615785 = (($4) + -1)|0;
  19483. $44 = ($$1615785|0)==(0);
  19484. $$2616776 = (($4) + -1)|0;
  19485. $45 = ($$2616776|0)==(0);
  19486. $$3617767 = (($4) + -1)|0;
  19487. $46 = ($$3617767|0)==(0);
  19488. $$4618758 = (($4) + -1)|0;
  19489. $47 = ($$4618758|0)==(0);
  19490. $$5619750 = (($4) + -1)|0;
  19491. $48 = ($$5619750|0)==(0);
  19492. $$6620742 = (($4) + -1)|0;
  19493. $49 = ($$6620742|0)==(0);
  19494. $$not = $8 ^ 1;
  19495. $brmerge894 = $42 | $$not;
  19496. $$0577817 = $1;$$0608816 = $4;$$0611815 = $16;$$0623814 = 0;
  19497. while(1) {
  19498. $50 = HEAP32[$21>>2]|0;
  19499. $51 = Math_imul($$0623814, $12)|0;
  19500. $52 = (($50) + ($51)|0);
  19501. $53 = ((($$0577817)) + 1|0);
  19502. $54 = HEAP8[$$0577817>>0]|0;
  19503. $55 = $54&255;
  19504. $56 = ($54&255)>(4);
  19505. if ($56) {
  19506. label = 105;
  19507. break;
  19508. }
  19509. if ($37) {
  19510. if ($38) {
  19511. label = 16;
  19512. break;
  19513. }
  19514. $57 = (($52) + ($39)|0);
  19515. $$0597 = $57;$$1609 = $26;$$1612 = 1;
  19516. } else {
  19517. $$0597 = $52;$$1609 = $$0608816;$$1612 = $$0611815;
  19518. }
  19519. $58 = (($$0597) + ($40)|0);
  19520. $59 = ($$0623814|0)==(0);
  19521. if ($59) {
  19522. $60 = (10357 + ($55)|0);
  19523. $61 = HEAP8[$60>>0]|0;
  19524. $62 = $61&255;
  19525. $$0588 = $62;
  19526. } else {
  19527. $$0588 = $55;
  19528. }
  19529. $63 = ($$1612|0)>(0);
  19530. L30: do {
  19531. if ($63) {
  19532. $trunc638 = $$0588&255;
  19533. $$0625734 = 0;
  19534. while(1) {
  19535. switch ($trunc638<<24>>24) {
  19536. case 0: {
  19537. $64 = (($53) + ($$0625734)|0);
  19538. $65 = HEAP8[$64>>0]|0;
  19539. $$sink = $65;
  19540. label = 30;
  19541. break;
  19542. }
  19543. case 1: {
  19544. $66 = (($53) + ($$0625734)|0);
  19545. $67 = HEAP8[$66>>0]|0;
  19546. $$sink = $67;
  19547. label = 30;
  19548. break;
  19549. }
  19550. case 2: {
  19551. $68 = (($53) + ($$0625734)|0);
  19552. $69 = HEAP8[$68>>0]|0;
  19553. $70 = $69&255;
  19554. $71 = (($58) + ($$0625734)|0);
  19555. $72 = HEAP8[$71>>0]|0;
  19556. $73 = $72&255;
  19557. $74 = (($73) + ($70))|0;
  19558. $75 = $74&255;
  19559. $$sink = $75;
  19560. label = 30;
  19561. break;
  19562. }
  19563. case 3: {
  19564. $76 = (($53) + ($$0625734)|0);
  19565. $77 = HEAP8[$76>>0]|0;
  19566. $78 = $77&255;
  19567. $79 = (($58) + ($$0625734)|0);
  19568. $80 = HEAP8[$79>>0]|0;
  19569. $81 = $80&255;
  19570. $82 = $81 >>> 1;
  19571. $83 = (($82) + ($78))|0;
  19572. $84 = $83&255;
  19573. $$sink = $84;
  19574. label = 30;
  19575. break;
  19576. }
  19577. case 4: {
  19578. $85 = (($53) + ($$0625734)|0);
  19579. $86 = HEAP8[$85>>0]|0;
  19580. $87 = $86&255;
  19581. $88 = (($58) + ($$0625734)|0);
  19582. $89 = HEAP8[$88>>0]|0;
  19583. $90 = $89&255;
  19584. $91 = (_stbi__paeth(0,$90,0)|0);
  19585. $92 = (($91) + ($87))|0;
  19586. $93 = $92&255;
  19587. $$sink = $93;
  19588. label = 30;
  19589. break;
  19590. }
  19591. case 5: {
  19592. $94 = (($53) + ($$0625734)|0);
  19593. $95 = HEAP8[$94>>0]|0;
  19594. $$sink = $95;
  19595. label = 30;
  19596. break;
  19597. }
  19598. case 6: {
  19599. $96 = (($53) + ($$0625734)|0);
  19600. $97 = HEAP8[$96>>0]|0;
  19601. $$sink = $97;
  19602. label = 30;
  19603. break;
  19604. }
  19605. default: {
  19606. }
  19607. }
  19608. if ((label|0) == 30) {
  19609. label = 0;
  19610. $$sink1 = (($$0597) + ($$0625734)|0);
  19611. HEAP8[$$sink1>>0] = $$sink;
  19612. }
  19613. $98 = (($$0625734) + 1)|0;
  19614. $exitcond864 = ($98|0)==($$1612|0);
  19615. if ($exitcond864) {
  19616. break L30;
  19617. } else {
  19618. $$0625734 = $98;
  19619. }
  19620. }
  19621. }
  19622. } while(0);
  19623. do {
  19624. if ($41) {
  19625. if (!($17)) {
  19626. $99 = (($$0597) + ($14)|0);
  19627. HEAP8[$99>>0] = -1;
  19628. }
  19629. $100 = (($53) + ($14)|0);
  19630. $$1578 = $100;$$sink641 = $3;
  19631. } else {
  19632. if (!($8)) {
  19633. $105 = ((($$0577817)) + 2|0);
  19634. $$1578 = $105;$$sink641 = 1;
  19635. break;
  19636. }
  19637. if (!($17)) {
  19638. $101 = (($$1612) + 1)|0;
  19639. $102 = (($$0597) + ($101)|0);
  19640. $103 = (($$0597) + ($$1612)|0);
  19641. HEAP8[$103>>0] = -1;
  19642. HEAP8[$102>>0] = -1;
  19643. }
  19644. $104 = (($53) + ($$1612)|0);
  19645. $$1578 = $104;$$sink641 = $15;
  19646. }
  19647. } while(0);
  19648. $106 = (($$0597) + ($$sink641)|0);
  19649. $107 = (($58) + ($$sink641)|0);
  19650. if ($brmerge) {
  19651. $108 = (($$1609) + -1)|0;
  19652. $109 = Math_imul($108, $$1612)|0;
  19653. $trunc637 = $$0588&255;
  19654. switch ($trunc637<<24>>24) {
  19655. case 0: {
  19656. _memcpy(($106|0),($$1578|0),($109|0))|0;
  19657. break;
  19658. }
  19659. case 1: {
  19660. $115 = ($109|0)>(0);
  19661. if ($115) {
  19662. $$1626812 = 0;
  19663. while(1) {
  19664. $116 = (($$1578) + ($$1626812)|0);
  19665. $117 = HEAP8[$116>>0]|0;
  19666. $118 = $117&255;
  19667. $119 = (($$1626812) - ($$1612))|0;
  19668. $120 = (($106) + ($119)|0);
  19669. $121 = HEAP8[$120>>0]|0;
  19670. $122 = $121&255;
  19671. $123 = (($122) + ($118))|0;
  19672. $124 = $123&255;
  19673. $125 = (($106) + ($$1626812)|0);
  19674. HEAP8[$125>>0] = $124;
  19675. $126 = (($$1626812) + 1)|0;
  19676. $exitcond886 = ($126|0)==($109|0);
  19677. if ($exitcond886) {
  19678. break;
  19679. } else {
  19680. $$1626812 = $126;
  19681. }
  19682. }
  19683. }
  19684. break;
  19685. }
  19686. case 2: {
  19687. $114 = ($109|0)>(0);
  19688. if ($114) {
  19689. $$2627810 = 0;
  19690. while(1) {
  19691. $127 = (($$1578) + ($$2627810)|0);
  19692. $128 = HEAP8[$127>>0]|0;
  19693. $129 = $128&255;
  19694. $130 = (($107) + ($$2627810)|0);
  19695. $131 = HEAP8[$130>>0]|0;
  19696. $132 = $131&255;
  19697. $133 = (($132) + ($129))|0;
  19698. $134 = $133&255;
  19699. $135 = (($106) + ($$2627810)|0);
  19700. HEAP8[$135>>0] = $134;
  19701. $136 = (($$2627810) + 1)|0;
  19702. $exitcond885 = ($136|0)==($109|0);
  19703. if ($exitcond885) {
  19704. break;
  19705. } else {
  19706. $$2627810 = $136;
  19707. }
  19708. }
  19709. }
  19710. break;
  19711. }
  19712. case 3: {
  19713. $113 = ($109|0)>(0);
  19714. if ($113) {
  19715. $$3628808 = 0;
  19716. while(1) {
  19717. $137 = (($$1578) + ($$3628808)|0);
  19718. $138 = HEAP8[$137>>0]|0;
  19719. $139 = $138&255;
  19720. $140 = (($107) + ($$3628808)|0);
  19721. $141 = HEAP8[$140>>0]|0;
  19722. $142 = $141&255;
  19723. $143 = (($$3628808) - ($$1612))|0;
  19724. $144 = (($106) + ($143)|0);
  19725. $145 = HEAP8[$144>>0]|0;
  19726. $146 = $145&255;
  19727. $147 = (($146) + ($142))|0;
  19728. $148 = $147 >>> 1;
  19729. $149 = (($148) + ($139))|0;
  19730. $150 = $149&255;
  19731. $151 = (($106) + ($$3628808)|0);
  19732. HEAP8[$151>>0] = $150;
  19733. $152 = (($$3628808) + 1)|0;
  19734. $exitcond884 = ($152|0)==($109|0);
  19735. if ($exitcond884) {
  19736. break;
  19737. } else {
  19738. $$3628808 = $152;
  19739. }
  19740. }
  19741. }
  19742. break;
  19743. }
  19744. case 4: {
  19745. $112 = ($109|0)>(0);
  19746. if ($112) {
  19747. $$4629806 = 0;
  19748. while(1) {
  19749. $153 = (($$1578) + ($$4629806)|0);
  19750. $154 = HEAP8[$153>>0]|0;
  19751. $155 = $154&255;
  19752. $156 = (($$4629806) - ($$1612))|0;
  19753. $157 = (($106) + ($156)|0);
  19754. $158 = HEAP8[$157>>0]|0;
  19755. $159 = $158&255;
  19756. $160 = (($107) + ($$4629806)|0);
  19757. $161 = HEAP8[$160>>0]|0;
  19758. $162 = $161&255;
  19759. $163 = (($107) + ($156)|0);
  19760. $164 = HEAP8[$163>>0]|0;
  19761. $165 = $164&255;
  19762. $166 = (_stbi__paeth($159,$162,$165)|0);
  19763. $167 = (($166) + ($155))|0;
  19764. $168 = $167&255;
  19765. $169 = (($106) + ($$4629806)|0);
  19766. HEAP8[$169>>0] = $168;
  19767. $170 = (($$4629806) + 1)|0;
  19768. $exitcond883 = ($170|0)==($109|0);
  19769. if ($exitcond883) {
  19770. break;
  19771. } else {
  19772. $$4629806 = $170;
  19773. }
  19774. }
  19775. }
  19776. break;
  19777. }
  19778. case 5: {
  19779. $111 = ($109|0)>(0);
  19780. if ($111) {
  19781. $$5630804 = 0;
  19782. while(1) {
  19783. $171 = (($$1578) + ($$5630804)|0);
  19784. $172 = HEAP8[$171>>0]|0;
  19785. $173 = $172&255;
  19786. $174 = (($$5630804) - ($$1612))|0;
  19787. $175 = (($106) + ($174)|0);
  19788. $176 = HEAP8[$175>>0]|0;
  19789. $177 = $176&255;
  19790. $178 = $177 >>> 1;
  19791. $179 = (($178) + ($173))|0;
  19792. $180 = $179&255;
  19793. $181 = (($106) + ($$5630804)|0);
  19794. HEAP8[$181>>0] = $180;
  19795. $182 = (($$5630804) + 1)|0;
  19796. $exitcond882 = ($182|0)==($109|0);
  19797. if ($exitcond882) {
  19798. break;
  19799. } else {
  19800. $$5630804 = $182;
  19801. }
  19802. }
  19803. }
  19804. break;
  19805. }
  19806. case 6: {
  19807. $110 = ($109|0)>(0);
  19808. if ($110) {
  19809. $$6631802 = 0;
  19810. while(1) {
  19811. $183 = (($$1578) + ($$6631802)|0);
  19812. $184 = HEAP8[$183>>0]|0;
  19813. $185 = $184&255;
  19814. $186 = (($$6631802) - ($$1612))|0;
  19815. $187 = (($106) + ($186)|0);
  19816. $188 = HEAP8[$187>>0]|0;
  19817. $189 = $188&255;
  19818. $190 = (_stbi__paeth($189,0,0)|0);
  19819. $191 = (($190) + ($185))|0;
  19820. $192 = $191&255;
  19821. $193 = (($106) + ($$6631802)|0);
  19822. HEAP8[$193>>0] = $192;
  19823. $194 = (($$6631802) + 1)|0;
  19824. $exitcond881 = ($194|0)==($109|0);
  19825. if ($exitcond881) {
  19826. break;
  19827. } else {
  19828. $$6631802 = $194;
  19829. }
  19830. }
  19831. }
  19832. break;
  19833. }
  19834. default: {
  19835. }
  19836. }
  19837. $195 = (($$1578) + ($109)|0);
  19838. $$11$ph = $195;
  19839. } else {
  19840. if (!($19)) {
  19841. label = 58;
  19842. break;
  19843. }
  19844. $trunc = $$0588&255;
  19845. switch ($trunc<<24>>24) {
  19846. case 0: {
  19847. if ($43) {
  19848. $$9586 = $$1578;
  19849. } else {
  19850. $208 = ($$1612|0)>(0);
  19851. $209 = Math_imul($$6620742, $$1612)|0;
  19852. $$0614796 = $$0614793;$$2579795 = $$1578;$$2599794 = $106;
  19853. while(1) {
  19854. if ($208) {
  19855. $$7632790 = 0;
  19856. while(1) {
  19857. $210 = (($$2579795) + ($$7632790)|0);
  19858. $211 = HEAP8[$210>>0]|0;
  19859. $212 = (($$2599794) + ($$7632790)|0);
  19860. HEAP8[$212>>0] = $211;
  19861. $213 = (($$7632790) + 1)|0;
  19862. $exitcond877 = ($213|0)==($$1612|0);
  19863. if ($exitcond877) {
  19864. break;
  19865. } else {
  19866. $$7632790 = $213;
  19867. }
  19868. }
  19869. }
  19870. $214 = (($$2599794) + ($$1612)|0);
  19871. HEAP8[$214>>0] = -1;
  19872. $215 = (($$2579795) + ($$1612)|0);
  19873. $216 = (($$2599794) + ($15)|0);
  19874. $$0614 = (($$0614796) + -1)|0;
  19875. $217 = ($$0614|0)==(0);
  19876. if ($217) {
  19877. break;
  19878. } else {
  19879. $$0614796 = $$0614;$$2579795 = $215;$$2599794 = $216;
  19880. }
  19881. }
  19882. $scevgep879 = (($$1578) + ($209)|0);
  19883. $$9586 = $scevgep879;
  19884. }
  19885. break;
  19886. }
  19887. case 1: {
  19888. if ($44) {
  19889. $$9586 = $$1578;
  19890. } else {
  19891. $206 = ($$1612|0)>(0);
  19892. $207 = Math_imul($$6620742, $$1612)|0;
  19893. $$1615788 = $$1615785;$$3580787 = $$1578;$$3600786 = $106;
  19894. while(1) {
  19895. if ($206) {
  19896. $$8633782 = 0;
  19897. while(1) {
  19898. $218 = (($$3580787) + ($$8633782)|0);
  19899. $219 = HEAP8[$218>>0]|0;
  19900. $220 = $219&255;
  19901. $221 = (($$8633782) - ($15))|0;
  19902. $222 = (($$3600786) + ($221)|0);
  19903. $223 = HEAP8[$222>>0]|0;
  19904. $224 = $223&255;
  19905. $225 = (($224) + ($220))|0;
  19906. $226 = $225&255;
  19907. $227 = (($$3600786) + ($$8633782)|0);
  19908. HEAP8[$227>>0] = $226;
  19909. $228 = (($$8633782) + 1)|0;
  19910. $exitcond875 = ($228|0)==($$1612|0);
  19911. if ($exitcond875) {
  19912. break;
  19913. } else {
  19914. $$8633782 = $228;
  19915. }
  19916. }
  19917. }
  19918. $229 = (($$3600786) + ($$1612)|0);
  19919. HEAP8[$229>>0] = -1;
  19920. $230 = (($$3580787) + ($$1612)|0);
  19921. $231 = (($$3600786) + ($15)|0);
  19922. $$1615 = (($$1615788) + -1)|0;
  19923. $232 = ($$1615|0)==(0);
  19924. if ($232) {
  19925. break;
  19926. } else {
  19927. $$1615788 = $$1615;$$3580787 = $230;$$3600786 = $231;
  19928. }
  19929. }
  19930. $scevgep876 = (($$1578) + ($207)|0);
  19931. $$9586 = $scevgep876;
  19932. }
  19933. break;
  19934. }
  19935. case 2: {
  19936. if ($45) {
  19937. $$9586 = $$1578;
  19938. } else {
  19939. $204 = ($$1612|0)>(0);
  19940. $205 = Math_imul($$6620742, $$1612)|0;
  19941. $$2616780 = $$2616776;$$3592778 = $107;$$4581779 = $$1578;$$4601777 = $106;
  19942. while(1) {
  19943. if ($204) {
  19944. $$9634773 = 0;
  19945. while(1) {
  19946. $233 = (($$4581779) + ($$9634773)|0);
  19947. $234 = HEAP8[$233>>0]|0;
  19948. $235 = $234&255;
  19949. $236 = (($$3592778) + ($$9634773)|0);
  19950. $237 = HEAP8[$236>>0]|0;
  19951. $238 = $237&255;
  19952. $239 = (($238) + ($235))|0;
  19953. $240 = $239&255;
  19954. $241 = (($$4601777) + ($$9634773)|0);
  19955. HEAP8[$241>>0] = $240;
  19956. $242 = (($$9634773) + 1)|0;
  19957. $exitcond873 = ($242|0)==($$1612|0);
  19958. if ($exitcond873) {
  19959. break;
  19960. } else {
  19961. $$9634773 = $242;
  19962. }
  19963. }
  19964. }
  19965. $243 = (($$4601777) + ($$1612)|0);
  19966. HEAP8[$243>>0] = -1;
  19967. $244 = (($$4581779) + ($$1612)|0);
  19968. $245 = (($$4601777) + ($15)|0);
  19969. $246 = (($$3592778) + ($15)|0);
  19970. $$2616 = (($$2616780) + -1)|0;
  19971. $247 = ($$2616|0)==(0);
  19972. if ($247) {
  19973. break;
  19974. } else {
  19975. $$2616780 = $$2616;$$3592778 = $246;$$4581779 = $244;$$4601777 = $245;
  19976. }
  19977. }
  19978. $scevgep874 = (($$1578) + ($205)|0);
  19979. $$9586 = $scevgep874;
  19980. }
  19981. break;
  19982. }
  19983. case 3: {
  19984. if ($46) {
  19985. $$9586 = $$1578;
  19986. } else {
  19987. $202 = ($$1612|0)>(0);
  19988. $203 = Math_imul($$6620742, $$1612)|0;
  19989. $$3617771 = $$3617767;$$4593769 = $107;$$5582770 = $$1578;$$5602768 = $106;
  19990. while(1) {
  19991. if ($202) {
  19992. $$10635764 = 0;
  19993. while(1) {
  19994. $248 = (($$5582770) + ($$10635764)|0);
  19995. $249 = HEAP8[$248>>0]|0;
  19996. $250 = $249&255;
  19997. $251 = (($$4593769) + ($$10635764)|0);
  19998. $252 = HEAP8[$251>>0]|0;
  19999. $253 = $252&255;
  20000. $254 = (($$10635764) - ($15))|0;
  20001. $255 = (($$5602768) + ($254)|0);
  20002. $256 = HEAP8[$255>>0]|0;
  20003. $257 = $256&255;
  20004. $258 = (($257) + ($253))|0;
  20005. $259 = $258 >>> 1;
  20006. $260 = (($259) + ($250))|0;
  20007. $261 = $260&255;
  20008. $262 = (($$5602768) + ($$10635764)|0);
  20009. HEAP8[$262>>0] = $261;
  20010. $263 = (($$10635764) + 1)|0;
  20011. $exitcond871 = ($263|0)==($$1612|0);
  20012. if ($exitcond871) {
  20013. break;
  20014. } else {
  20015. $$10635764 = $263;
  20016. }
  20017. }
  20018. }
  20019. $264 = (($$5602768) + ($$1612)|0);
  20020. HEAP8[$264>>0] = -1;
  20021. $265 = (($$5582770) + ($$1612)|0);
  20022. $266 = (($$5602768) + ($15)|0);
  20023. $267 = (($$4593769) + ($15)|0);
  20024. $$3617 = (($$3617771) + -1)|0;
  20025. $268 = ($$3617|0)==(0);
  20026. if ($268) {
  20027. break;
  20028. } else {
  20029. $$3617771 = $$3617;$$4593769 = $267;$$5582770 = $265;$$5602768 = $266;
  20030. }
  20031. }
  20032. $scevgep872 = (($$1578) + ($203)|0);
  20033. $$9586 = $scevgep872;
  20034. }
  20035. break;
  20036. }
  20037. case 4: {
  20038. if ($47) {
  20039. $$9586 = $$1578;
  20040. } else {
  20041. $200 = ($$1612|0)>(0);
  20042. $201 = Math_imul($$6620742, $$1612)|0;
  20043. $$4618762 = $$4618758;$$5594760 = $107;$$6583761 = $$1578;$$6603759 = $106;
  20044. while(1) {
  20045. if ($200) {
  20046. $$11636755 = 0;
  20047. while(1) {
  20048. $269 = (($$6583761) + ($$11636755)|0);
  20049. $270 = HEAP8[$269>>0]|0;
  20050. $271 = $270&255;
  20051. $272 = (($$11636755) - ($15))|0;
  20052. $273 = (($$6603759) + ($272)|0);
  20053. $274 = HEAP8[$273>>0]|0;
  20054. $275 = $274&255;
  20055. $276 = (($$5594760) + ($$11636755)|0);
  20056. $277 = HEAP8[$276>>0]|0;
  20057. $278 = $277&255;
  20058. $279 = (($$5594760) + ($272)|0);
  20059. $280 = HEAP8[$279>>0]|0;
  20060. $281 = $280&255;
  20061. $282 = (_stbi__paeth($275,$278,$281)|0);
  20062. $283 = (($282) + ($271))|0;
  20063. $284 = $283&255;
  20064. $285 = (($$6603759) + ($$11636755)|0);
  20065. HEAP8[$285>>0] = $284;
  20066. $286 = (($$11636755) + 1)|0;
  20067. $exitcond869 = ($286|0)==($$1612|0);
  20068. if ($exitcond869) {
  20069. break;
  20070. } else {
  20071. $$11636755 = $286;
  20072. }
  20073. }
  20074. }
  20075. $287 = (($$6603759) + ($$1612)|0);
  20076. HEAP8[$287>>0] = -1;
  20077. $288 = (($$6583761) + ($$1612)|0);
  20078. $289 = (($$6603759) + ($15)|0);
  20079. $290 = (($$5594760) + ($15)|0);
  20080. $$4618 = (($$4618762) + -1)|0;
  20081. $291 = ($$4618|0)==(0);
  20082. if ($291) {
  20083. break;
  20084. } else {
  20085. $$4618762 = $$4618;$$5594760 = $290;$$6583761 = $288;$$6603759 = $289;
  20086. }
  20087. }
  20088. $scevgep870 = (($$1578) + ($201)|0);
  20089. $$9586 = $scevgep870;
  20090. }
  20091. break;
  20092. }
  20093. case 5: {
  20094. if ($48) {
  20095. $$9586 = $$1578;
  20096. } else {
  20097. $198 = ($$1612|0)>(0);
  20098. $199 = Math_imul($$6620742, $$1612)|0;
  20099. $$5619753 = $$5619750;$$7584752 = $$1578;$$7604751 = $106;
  20100. while(1) {
  20101. if ($198) {
  20102. $$12747 = 0;
  20103. while(1) {
  20104. $292 = (($$7584752) + ($$12747)|0);
  20105. $293 = HEAP8[$292>>0]|0;
  20106. $294 = $293&255;
  20107. $295 = (($$12747) - ($15))|0;
  20108. $296 = (($$7604751) + ($295)|0);
  20109. $297 = HEAP8[$296>>0]|0;
  20110. $298 = $297&255;
  20111. $299 = $298 >>> 1;
  20112. $300 = (($299) + ($294))|0;
  20113. $301 = $300&255;
  20114. $302 = (($$7604751) + ($$12747)|0);
  20115. HEAP8[$302>>0] = $301;
  20116. $303 = (($$12747) + 1)|0;
  20117. $exitcond867 = ($303|0)==($$1612|0);
  20118. if ($exitcond867) {
  20119. break;
  20120. } else {
  20121. $$12747 = $303;
  20122. }
  20123. }
  20124. }
  20125. $304 = (($$7604751) + ($$1612)|0);
  20126. HEAP8[$304>>0] = -1;
  20127. $305 = (($$7584752) + ($$1612)|0);
  20128. $306 = (($$7604751) + ($15)|0);
  20129. $$5619 = (($$5619753) + -1)|0;
  20130. $307 = ($$5619|0)==(0);
  20131. if ($307) {
  20132. break;
  20133. } else {
  20134. $$5619753 = $$5619;$$7584752 = $305;$$7604751 = $306;
  20135. }
  20136. }
  20137. $scevgep868 = (($$1578) + ($199)|0);
  20138. $$9586 = $scevgep868;
  20139. }
  20140. break;
  20141. }
  20142. case 6: {
  20143. if ($49) {
  20144. $$9586 = $$1578;
  20145. } else {
  20146. $196 = ($$1612|0)>(0);
  20147. $197 = Math_imul($$6620742, $$1612)|0;
  20148. $$6620745 = $$6620742;$$8585744 = $$1578;$$8605743 = $106;
  20149. while(1) {
  20150. if ($196) {
  20151. $$13739 = 0;
  20152. while(1) {
  20153. $308 = (($$8585744) + ($$13739)|0);
  20154. $309 = HEAP8[$308>>0]|0;
  20155. $310 = $309&255;
  20156. $311 = (($$13739) - ($15))|0;
  20157. $312 = (($$8605743) + ($311)|0);
  20158. $313 = HEAP8[$312>>0]|0;
  20159. $314 = $313&255;
  20160. $315 = (_stbi__paeth($314,0,0)|0);
  20161. $316 = (($315) + ($310))|0;
  20162. $317 = $316&255;
  20163. $318 = (($$8605743) + ($$13739)|0);
  20164. HEAP8[$318>>0] = $317;
  20165. $319 = (($$13739) + 1)|0;
  20166. $exitcond865 = ($319|0)==($$1612|0);
  20167. if ($exitcond865) {
  20168. break;
  20169. } else {
  20170. $$13739 = $319;
  20171. }
  20172. }
  20173. }
  20174. $320 = (($$8605743) + ($$1612)|0);
  20175. HEAP8[$320>>0] = -1;
  20176. $321 = (($$8585744) + ($$1612)|0);
  20177. $322 = (($$8605743) + ($15)|0);
  20178. $$6620 = (($$6620745) + -1)|0;
  20179. $323 = ($$6620|0)==(0);
  20180. if ($323) {
  20181. break;
  20182. } else {
  20183. $$6620745 = $$6620;$$8585744 = $321;$$8605743 = $322;
  20184. }
  20185. }
  20186. $scevgep866 = (($$1578) + ($197)|0);
  20187. $$9586 = $scevgep866;
  20188. }
  20189. break;
  20190. }
  20191. default: {
  20192. $$9586 = $$1578;
  20193. }
  20194. }
  20195. if ($brmerge894) {
  20196. $$11$ph = $$9586;
  20197. } else {
  20198. $324 = HEAP32[$21>>2]|0;
  20199. $325 = (($324) + ($51)|0);
  20200. $326 = (($$1612) + 1)|0;
  20201. $$7621798 = 0;$$9606799 = $325;
  20202. while(1) {
  20203. $327 = (($$9606799) + ($326)|0);
  20204. HEAP8[$327>>0] = -1;
  20205. $328 = (($$7621798) + 1)|0;
  20206. $329 = (($$9606799) + ($15)|0);
  20207. $exitcond880 = ($328|0)==($4|0);
  20208. if ($exitcond880) {
  20209. $$11$ph = $$9586;
  20210. break;
  20211. } else {
  20212. $$7621798 = $328;$$9606799 = $329;
  20213. }
  20214. }
  20215. }
  20216. }
  20217. $330 = (($$0623814) + 1)|0;
  20218. $331 = ($330>>>0)<($5>>>0);
  20219. if ($331) {
  20220. $$0577817 = $$11$ph;$$0608816 = $$1609;$$0611815 = $$1612;$$0623814 = $330;
  20221. } else {
  20222. break L18;
  20223. }
  20224. }
  20225. if ((label|0) == 16) {
  20226. ___assert_fail((10336|0),(9676|0),4315,(10291|0));
  20227. // unreachable;
  20228. }
  20229. else if ((label|0) == 58) {
  20230. ___assert_fail((10362|0),(9676|0),4377,(10291|0));
  20231. // unreachable;
  20232. }
  20233. else if ((label|0) == 105) {
  20234. _stbi__err(10379);
  20235. $$2 = 0;
  20236. return ($$2|0);
  20237. }
  20238. }
  20239. } while(0);
  20240. $332 = ($6|0)<(8);
  20241. if (!($332)) {
  20242. if (!($8)) {
  20243. $$2 = 1;
  20244. return ($$2|0);
  20245. }
  20246. $601 = Math_imul($4, $3)|0;
  20247. $602 = Math_imul($601, $5)|0;
  20248. $603 = ($602|0)==(0);
  20249. if ($603) {
  20250. $$2 = 1;
  20251. return ($$2|0);
  20252. }
  20253. $604 = HEAP32[$21>>2]|0;
  20254. $$0731 = $604;$$8622729 = 0;
  20255. while(1) {
  20256. $605 = HEAP8[$$0731>>0]|0;
  20257. $606 = $605&255;
  20258. $607 = $606 << 8;
  20259. $608 = ((($$0731)) + 1|0);
  20260. $609 = HEAP8[$608>>0]|0;
  20261. $610 = $609&255;
  20262. $611 = $607 | $610;
  20263. $612 = $611&65535;
  20264. HEAP16[$$0731>>1] = $612;
  20265. $613 = (($$8622729) + 1)|0;
  20266. $614 = ((($$0731)) + 2|0);
  20267. $exitcond = ($613|0)==($602|0);
  20268. if ($exitcond) {
  20269. $$2 = 1;
  20270. break;
  20271. } else {
  20272. $$0731 = $614;$$8622729 = $613;
  20273. }
  20274. }
  20275. return ($$2|0);
  20276. }
  20277. $333 = ($5|0)==(0);
  20278. if ($333) {
  20279. $$2 = 1;
  20280. return ($$2|0);
  20281. }
  20282. $334 = (0 - ($26))|0;
  20283. $335 = ($7|0)==(0);
  20284. $336 = (10075 + ($6)|0);
  20285. $$0568724 = (($4) + -1)|0;
  20286. $337 = ($$0568724|0)>(-1);
  20287. $$1721 = (($4) + -1)|0;
  20288. $338 = ($$1721|0)>(-1);
  20289. $339 = ($23|0)>(1);
  20290. $340 = ($23|0)>(3);
  20291. $341 = ($23|0)>(7);
  20292. $342 = (($23) + -8)|0;
  20293. $343 = $342 >>> 3;
  20294. $344 = $343 << 3;
  20295. $345 = (($344) + 8)|0;
  20296. $346 = (($342) - ($344))|0;
  20297. $347 = (($343) + ($11))|0;
  20298. $348 = (($347) + 1)|0;
  20299. $349 = (($348) - ($26))|0;
  20300. $350 = (($23) + -4)|0;
  20301. $351 = $350 >>> 2;
  20302. $352 = $351 << 2;
  20303. $353 = (($352) + 4)|0;
  20304. $354 = (($350) - ($352))|0;
  20305. $355 = (($351) + ($11))|0;
  20306. $356 = (($355) + 1)|0;
  20307. $357 = (($356) - ($26))|0;
  20308. $358 = (($23) + -2)|0;
  20309. $359 = $358 >>> 1;
  20310. $360 = $359 << 1;
  20311. $361 = (($360) + 2)|0;
  20312. $362 = (($358) - ($360))|0;
  20313. $363 = (($359) + ($11))|0;
  20314. $364 = (($363) + 1)|0;
  20315. $365 = (($364) - ($26))|0;
  20316. $$1624727 = 0;$indvars$iv = $345;$indvars$iv848 = $349;$indvars$iv851 = $353;$indvars$iv854 = $357;$indvars$iv857 = $361;$indvars$iv860 = $365;
  20317. L174: while(1) {
  20318. $366 = HEAP32[$21>>2]|0;
  20319. $367 = Math_imul($$1624727, $12)|0;
  20320. $368 = (($366) + ($367)|0);
  20321. $369 = (($368) + ($11)|0);
  20322. $370 = (($369) + ($334)|0);
  20323. if ($335) {
  20324. $371 = HEAP8[$336>>0]|0;
  20325. $372 = $371&255;
  20326. $377 = $372;
  20327. } else {
  20328. $377 = 1;
  20329. }
  20330. switch ($6|0) {
  20331. case 4: {
  20332. if ($339) {
  20333. $scevgep859 = (($366) + ($indvars$iv857)|0);
  20334. $$0571715 = $370;$$0574714 = $368;$$14713 = $23;
  20335. while(1) {
  20336. $373 = HEAP8[$$0571715>>0]|0;
  20337. $374 = $373&255;
  20338. $375 = $374 >>> 4;
  20339. $376 = Math_imul($375, $377)|0;
  20340. $378 = $376&255;
  20341. $379 = ((($$0574714)) + 1|0);
  20342. HEAP8[$$0574714>>0] = $378;
  20343. $380 = HEAP8[$$0571715>>0]|0;
  20344. $381 = $380 & 15;
  20345. $382 = $381&255;
  20346. $383 = Math_imul($382, $377)|0;
  20347. $384 = $383&255;
  20348. $385 = ((($$0574714)) + 2|0);
  20349. HEAP8[$379>>0] = $384;
  20350. $386 = (($$14713) + -2)|0;
  20351. $387 = ((($$0571715)) + 1|0);
  20352. $388 = ($386|0)>(1);
  20353. if ($388) {
  20354. $$0571715 = $387;$$0574714 = $385;$$14713 = $386;
  20355. } else {
  20356. break;
  20357. }
  20358. }
  20359. $scevgep862 = (($366) + ($indvars$iv860)|0);
  20360. $$0571$lcssa = $scevgep862;$$0574$lcssa = $scevgep859;$$14$lcssa = $362;
  20361. } else {
  20362. $$0571$lcssa = $370;$$0574$lcssa = $368;$$14$lcssa = $23;
  20363. }
  20364. $389 = ($$14$lcssa|0)==(1);
  20365. if ($389) {
  20366. $390 = HEAP8[$$0571$lcssa>>0]|0;
  20367. $391 = $390&255;
  20368. $392 = $391 >>> 4;
  20369. $393 = Math_imul($392, $377)|0;
  20370. $394 = $393&255;
  20371. HEAP8[$$0574$lcssa>>0] = $394;
  20372. }
  20373. break;
  20374. }
  20375. case 2: {
  20376. if ($340) {
  20377. $scevgep853 = (($366) + ($indvars$iv851)|0);
  20378. $$15705 = $23;$$1572707 = $370;$$1575706 = $368;
  20379. while(1) {
  20380. $395 = HEAP8[$$1572707>>0]|0;
  20381. $396 = $395&255;
  20382. $397 = $396 >>> 6;
  20383. $398 = Math_imul($397, $377)|0;
  20384. $399 = $398&255;
  20385. $400 = ((($$1575706)) + 1|0);
  20386. HEAP8[$$1575706>>0] = $399;
  20387. $401 = HEAP8[$$1572707>>0]|0;
  20388. $402 = $401&255;
  20389. $403 = $402 >>> 4;
  20390. $404 = $403 & 3;
  20391. $405 = Math_imul($404, $377)|0;
  20392. $406 = $405&255;
  20393. $407 = ((($$1575706)) + 2|0);
  20394. HEAP8[$400>>0] = $406;
  20395. $408 = HEAP8[$$1572707>>0]|0;
  20396. $409 = $408&255;
  20397. $410 = $409 >>> 2;
  20398. $411 = $410 & 3;
  20399. $412 = Math_imul($411, $377)|0;
  20400. $413 = $412&255;
  20401. $414 = ((($$1575706)) + 3|0);
  20402. HEAP8[$407>>0] = $413;
  20403. $415 = HEAP8[$$1572707>>0]|0;
  20404. $416 = $415 & 3;
  20405. $417 = $416&255;
  20406. $418 = Math_imul($417, $377)|0;
  20407. $419 = $418&255;
  20408. $420 = ((($$1575706)) + 4|0);
  20409. HEAP8[$414>>0] = $419;
  20410. $421 = (($$15705) + -4)|0;
  20411. $422 = ((($$1572707)) + 1|0);
  20412. $423 = ($421|0)>(3);
  20413. if ($423) {
  20414. $$15705 = $421;$$1572707 = $422;$$1575706 = $420;
  20415. } else {
  20416. break;
  20417. }
  20418. }
  20419. $scevgep856 = (($366) + ($indvars$iv854)|0);
  20420. $$15$lcssa = $354;$$1572$lcssa = $scevgep856;$$1575$lcssa = $scevgep853;
  20421. } else {
  20422. $$15$lcssa = $23;$$1572$lcssa = $370;$$1575$lcssa = $368;
  20423. }
  20424. $424 = ($$15$lcssa|0)>(0);
  20425. if ($424) {
  20426. $425 = HEAP8[$$1572$lcssa>>0]|0;
  20427. $426 = $425&255;
  20428. $427 = $426 >>> 6;
  20429. $428 = Math_imul($427, $377)|0;
  20430. $429 = $428&255;
  20431. HEAP8[$$1575$lcssa>>0] = $429;
  20432. $430 = ($$15$lcssa|0)==(1);
  20433. if (!($430)) {
  20434. $431 = ((($$1575$lcssa)) + 1|0);
  20435. $432 = HEAP8[$$1572$lcssa>>0]|0;
  20436. $433 = $432&255;
  20437. $434 = $433 >>> 4;
  20438. $435 = $434 & 3;
  20439. $436 = Math_imul($435, $377)|0;
  20440. $437 = $436&255;
  20441. HEAP8[$431>>0] = $437;
  20442. $438 = ($$15$lcssa|0)>(2);
  20443. if ($438) {
  20444. $439 = ((($$1575$lcssa)) + 2|0);
  20445. $440 = HEAP8[$$1572$lcssa>>0]|0;
  20446. $441 = $440&255;
  20447. $442 = $441 >>> 2;
  20448. $443 = $442 & 3;
  20449. $444 = Math_imul($443, $377)|0;
  20450. $445 = $444&255;
  20451. HEAP8[$439>>0] = $445;
  20452. }
  20453. }
  20454. }
  20455. break;
  20456. }
  20457. case 1: {
  20458. if ($341) {
  20459. $scevgep = (($366) + ($indvars$iv)|0);
  20460. $$16700 = $23;$$2573702 = $370;$$4701 = $368;
  20461. while(1) {
  20462. $446 = HEAP8[$$2573702>>0]|0;
  20463. $447 = $446&255;
  20464. $448 = $447 >>> 7;
  20465. $449 = (0 - ($448))|0;
  20466. $450 = $377 & $449;
  20467. $451 = $450&255;
  20468. $452 = ((($$4701)) + 1|0);
  20469. HEAP8[$$4701>>0] = $451;
  20470. $453 = HEAP8[$$2573702>>0]|0;
  20471. $454 = $453&255;
  20472. $455 = $454 >>> 6;
  20473. $456 = $455 & 1;
  20474. $457 = (0 - ($456))|0;
  20475. $458 = $377 & $457;
  20476. $459 = $458&255;
  20477. $460 = ((($$4701)) + 2|0);
  20478. HEAP8[$452>>0] = $459;
  20479. $461 = HEAP8[$$2573702>>0]|0;
  20480. $462 = $461&255;
  20481. $463 = $462 >>> 5;
  20482. $464 = $463 & 1;
  20483. $465 = (0 - ($464))|0;
  20484. $466 = $377 & $465;
  20485. $467 = $466&255;
  20486. $468 = ((($$4701)) + 3|0);
  20487. HEAP8[$460>>0] = $467;
  20488. $469 = HEAP8[$$2573702>>0]|0;
  20489. $470 = $469&255;
  20490. $471 = $470 >>> 4;
  20491. $472 = $471 & 1;
  20492. $473 = (0 - ($472))|0;
  20493. $474 = $377 & $473;
  20494. $475 = $474&255;
  20495. $476 = ((($$4701)) + 4|0);
  20496. HEAP8[$468>>0] = $475;
  20497. $477 = HEAP8[$$2573702>>0]|0;
  20498. $478 = $477&255;
  20499. $479 = $478 >>> 3;
  20500. $480 = $479 & 1;
  20501. $481 = (0 - ($480))|0;
  20502. $482 = $377 & $481;
  20503. $483 = $482&255;
  20504. $484 = ((($$4701)) + 5|0);
  20505. HEAP8[$476>>0] = $483;
  20506. $485 = HEAP8[$$2573702>>0]|0;
  20507. $486 = $485&255;
  20508. $487 = $486 >>> 2;
  20509. $488 = $487 & 1;
  20510. $489 = (0 - ($488))|0;
  20511. $490 = $377 & $489;
  20512. $491 = $490&255;
  20513. $492 = ((($$4701)) + 6|0);
  20514. HEAP8[$484>>0] = $491;
  20515. $493 = HEAP8[$$2573702>>0]|0;
  20516. $494 = $493&255;
  20517. $495 = $494 >>> 1;
  20518. $496 = $495 & 1;
  20519. $497 = (0 - ($496))|0;
  20520. $498 = $377 & $497;
  20521. $499 = $498&255;
  20522. $500 = ((($$4701)) + 7|0);
  20523. HEAP8[$492>>0] = $499;
  20524. $501 = HEAP8[$$2573702>>0]|0;
  20525. $502 = $501 & 1;
  20526. $503 = $502&255;
  20527. $504 = (0 - ($503))|0;
  20528. $505 = $377 & $504;
  20529. $506 = $505&255;
  20530. $507 = ((($$4701)) + 8|0);
  20531. HEAP8[$500>>0] = $506;
  20532. $508 = (($$16700) + -8)|0;
  20533. $509 = ((($$2573702)) + 1|0);
  20534. $510 = ($508|0)>(7);
  20535. if ($510) {
  20536. $$16700 = $508;$$2573702 = $509;$$4701 = $507;
  20537. } else {
  20538. break;
  20539. }
  20540. }
  20541. $scevgep850 = (($366) + ($indvars$iv848)|0);
  20542. $$16$lcssa = $346;$$2573$lcssa = $scevgep850;$$4$lcssa = $scevgep;
  20543. } else {
  20544. $$16$lcssa = $23;$$2573$lcssa = $370;$$4$lcssa = $368;
  20545. }
  20546. $511 = ($$16$lcssa|0)>(0);
  20547. if ($511) {
  20548. $512 = HEAP8[$$2573$lcssa>>0]|0;
  20549. $513 = $512&255;
  20550. $514 = $513 >>> 7;
  20551. $515 = (0 - ($514))|0;
  20552. $516 = $377 & $515;
  20553. $517 = $516&255;
  20554. HEAP8[$$4$lcssa>>0] = $517;
  20555. $518 = ($$16$lcssa|0)==(1);
  20556. if (!($518)) {
  20557. $519 = ((($$4$lcssa)) + 1|0);
  20558. $520 = HEAP8[$$2573$lcssa>>0]|0;
  20559. $521 = $520&255;
  20560. $522 = $521 >>> 6;
  20561. $523 = $522 & 1;
  20562. $524 = (0 - ($523))|0;
  20563. $525 = $377 & $524;
  20564. $526 = $525&255;
  20565. HEAP8[$519>>0] = $526;
  20566. $527 = ($$16$lcssa|0)>(2);
  20567. if ($527) {
  20568. $528 = ((($$4$lcssa)) + 2|0);
  20569. $529 = HEAP8[$$2573$lcssa>>0]|0;
  20570. $530 = $529&255;
  20571. $531 = $530 >>> 5;
  20572. $532 = $531 & 1;
  20573. $533 = (0 - ($532))|0;
  20574. $534 = $377 & $533;
  20575. $535 = $534&255;
  20576. HEAP8[$528>>0] = $535;
  20577. $536 = ($$16$lcssa|0)==(3);
  20578. if (!($536)) {
  20579. $537 = ((($$4$lcssa)) + 3|0);
  20580. $538 = HEAP8[$$2573$lcssa>>0]|0;
  20581. $539 = $538&255;
  20582. $540 = $539 >>> 4;
  20583. $541 = $540 & 1;
  20584. $542 = (0 - ($541))|0;
  20585. $543 = $377 & $542;
  20586. $544 = $543&255;
  20587. HEAP8[$537>>0] = $544;
  20588. $545 = ($$16$lcssa|0)>(4);
  20589. if ($545) {
  20590. $546 = ((($$4$lcssa)) + 4|0);
  20591. $547 = HEAP8[$$2573$lcssa>>0]|0;
  20592. $548 = $547&255;
  20593. $549 = $548 >>> 3;
  20594. $550 = $549 & 1;
  20595. $551 = (0 - ($550))|0;
  20596. $552 = $377 & $551;
  20597. $553 = $552&255;
  20598. HEAP8[$546>>0] = $553;
  20599. $554 = ($$16$lcssa|0)==(5);
  20600. if (!($554)) {
  20601. $555 = ((($$4$lcssa)) + 5|0);
  20602. $556 = HEAP8[$$2573$lcssa>>0]|0;
  20603. $557 = $556&255;
  20604. $558 = $557 >>> 2;
  20605. $559 = $558 & 1;
  20606. $560 = (0 - ($559))|0;
  20607. $561 = $377 & $560;
  20608. $562 = $561&255;
  20609. HEAP8[$555>>0] = $562;
  20610. $563 = ($$16$lcssa|0)>(6);
  20611. if ($563) {
  20612. $564 = ((($$4$lcssa)) + 6|0);
  20613. $565 = HEAP8[$$2573$lcssa>>0]|0;
  20614. $566 = $565&255;
  20615. $567 = $566 >>> 1;
  20616. $568 = $567 & 1;
  20617. $569 = (0 - ($568))|0;
  20618. $570 = $377 & $569;
  20619. $571 = $570&255;
  20620. HEAP8[$564>>0] = $571;
  20621. }
  20622. }
  20623. }
  20624. }
  20625. }
  20626. }
  20627. }
  20628. break;
  20629. }
  20630. default: {
  20631. }
  20632. }
  20633. L213: do {
  20634. if (!($17)) {
  20635. $572 = HEAP32[$21>>2]|0;
  20636. $573 = (($572) + ($367)|0);
  20637. switch ($14|0) {
  20638. case 1: {
  20639. if ($337) {
  20640. $$0568725 = $$0568724;
  20641. } else {
  20642. break L213;
  20643. }
  20644. while(1) {
  20645. $574 = $$0568725 << 1;
  20646. $575 = $574 | 1;
  20647. $576 = (($573) + ($575)|0);
  20648. HEAP8[$576>>0] = -1;
  20649. $577 = (($573) + ($$0568725)|0);
  20650. $578 = HEAP8[$577>>0]|0;
  20651. $579 = (($573) + ($574)|0);
  20652. HEAP8[$579>>0] = $578;
  20653. $$0568 = (($$0568725) + -1)|0;
  20654. $580 = ($$0568|0)>(-1);
  20655. if ($580) {
  20656. $$0568725 = $$0568;
  20657. } else {
  20658. break;
  20659. }
  20660. }
  20661. break;
  20662. }
  20663. case 3: {
  20664. if ($338) {
  20665. $$1722 = $$1721;
  20666. } else {
  20667. break L213;
  20668. }
  20669. while(1) {
  20670. $581 = $$1722 << 2;
  20671. $582 = $581 | 3;
  20672. $583 = (($573) + ($582)|0);
  20673. HEAP8[$583>>0] = -1;
  20674. $584 = ($$1722*3)|0;
  20675. $585 = (($584) + 2)|0;
  20676. $586 = (($573) + ($585)|0);
  20677. $587 = HEAP8[$586>>0]|0;
  20678. $588 = $581 | 2;
  20679. $589 = (($573) + ($588)|0);
  20680. HEAP8[$589>>0] = $587;
  20681. $590 = (($584) + 1)|0;
  20682. $591 = (($573) + ($590)|0);
  20683. $592 = HEAP8[$591>>0]|0;
  20684. $593 = $581 | 1;
  20685. $594 = (($573) + ($593)|0);
  20686. HEAP8[$594>>0] = $592;
  20687. $595 = (($573) + ($584)|0);
  20688. $596 = HEAP8[$595>>0]|0;
  20689. $597 = (($573) + ($581)|0);
  20690. HEAP8[$597>>0] = $596;
  20691. $$1 = (($$1722) + -1)|0;
  20692. $598 = ($$1|0)>(-1);
  20693. if ($598) {
  20694. $$1722 = $$1;
  20695. } else {
  20696. break;
  20697. }
  20698. }
  20699. break;
  20700. }
  20701. default: {
  20702. label = 144;
  20703. break L174;
  20704. }
  20705. }
  20706. }
  20707. } while(0);
  20708. $599 = (($$1624727) + 1)|0;
  20709. $600 = ($599>>>0)<($5>>>0);
  20710. $indvars$iv$next = (($indvars$iv) + ($12))|0;
  20711. $indvars$iv$next849 = (($indvars$iv848) + ($12))|0;
  20712. $indvars$iv$next852 = (($indvars$iv851) + ($12))|0;
  20713. $indvars$iv$next855 = (($indvars$iv854) + ($12))|0;
  20714. $indvars$iv$next858 = (($indvars$iv857) + ($12))|0;
  20715. $indvars$iv$next861 = (($indvars$iv860) + ($12))|0;
  20716. if ($600) {
  20717. $$1624727 = $599;$indvars$iv = $indvars$iv$next;$indvars$iv848 = $indvars$iv$next849;$indvars$iv851 = $indvars$iv$next852;$indvars$iv854 = $indvars$iv$next855;$indvars$iv857 = $indvars$iv$next858;$indvars$iv860 = $indvars$iv$next861;
  20718. } else {
  20719. $$2 = 1;
  20720. label = 151;
  20721. break;
  20722. }
  20723. }
  20724. if ((label|0) == 144) {
  20725. ___assert_fail((10394|0),(9676|0),4466,(10291|0));
  20726. // unreachable;
  20727. }
  20728. else if ((label|0) == 151) {
  20729. return ($$2|0);
  20730. }
  20731. return (0)|0;
  20732. }
  20733. function _stbi__paeth($0,$1,$2) {
  20734. $0 = $0|0;
  20735. $1 = $1|0;
  20736. $2 = $2|0;
  20737. var $$ = 0, $$0 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $ispos = 0, $ispos26 = 0, $ispos28 = 0, $neg = 0, $neg27 = 0, $neg29 = 0, $or$cond = 0;
  20738. var label = 0, sp = 0;
  20739. sp = STACKTOP;
  20740. $3 = (($1) + ($0))|0;
  20741. $4 = (($3) - ($2))|0;
  20742. $5 = (($4) - ($0))|0;
  20743. $ispos = ($5|0)>(-1);
  20744. $neg = (0 - ($5))|0;
  20745. $6 = $ispos ? $5 : $neg;
  20746. $7 = (($4) - ($1))|0;
  20747. $ispos26 = ($7|0)>(-1);
  20748. $neg27 = (0 - ($7))|0;
  20749. $8 = $ispos26 ? $7 : $neg27;
  20750. $9 = (($4) - ($2))|0;
  20751. $ispos28 = ($9|0)>(-1);
  20752. $neg29 = (0 - ($9))|0;
  20753. $10 = $ispos28 ? $9 : $neg29;
  20754. $11 = ($6|0)>($8|0);
  20755. $12 = ($6|0)>($10|0);
  20756. $or$cond = $11 | $12;
  20757. $13 = ($8|0)>($10|0);
  20758. $$ = $13 ? $2 : $1;
  20759. $$0 = $or$cond ? $$ : $0;
  20760. return ($$0|0);
  20761. }
  20762. function _stbi__do_zlib($0,$1,$2,$3,$4) {
  20763. $0 = $0|0;
  20764. $1 = $1|0;
  20765. $2 = $2|0;
  20766. $3 = $3|0;
  20767. $4 = $4|0;
  20768. var $10 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
  20769. sp = STACKTOP;
  20770. $5 = ((($0)) + 20|0);
  20771. HEAP32[$5>>2] = $1;
  20772. $6 = ((($0)) + 16|0);
  20773. HEAP32[$6>>2] = $1;
  20774. $7 = (($1) + ($2)|0);
  20775. $8 = ((($0)) + 24|0);
  20776. HEAP32[$8>>2] = $7;
  20777. $9 = ((($0)) + 28|0);
  20778. HEAP32[$9>>2] = $3;
  20779. $10 = (_stbi__parse_zlib($0,$4)|0);
  20780. return ($10|0);
  20781. }
  20782. function _stbi__parse_zlib($0,$1) {
  20783. $0 = $0|0;
  20784. $1 = $1|0;
  20785. var $$0 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0;
  20786. var $9 = 0, label = 0, sp = 0;
  20787. sp = STACKTOP;
  20788. $2 = ($1|0)==(0);
  20789. if (!($2)) {
  20790. $3 = (_stbi__parse_zlib_header($0)|0);
  20791. $4 = ($3|0)==(0);
  20792. if ($4) {
  20793. $$0 = 0;
  20794. return ($$0|0);
  20795. }
  20796. }
  20797. $5 = ((($0)) + 8|0);
  20798. HEAP32[$5>>2] = 0;
  20799. $6 = ((($0)) + 12|0);
  20800. HEAP32[$6>>2] = 0;
  20801. $7 = ((($0)) + 32|0);
  20802. $8 = ((($0)) + 2052|0);
  20803. L5: while(1) {
  20804. $9 = (_stbi__zreceive($0,1)|0);
  20805. $10 = (_stbi__zreceive($0,2)|0);
  20806. switch ($10|0) {
  20807. case 3: {
  20808. $$0 = 0;
  20809. label = 11;
  20810. break L5;
  20811. break;
  20812. }
  20813. case 0: {
  20814. $11 = (_stbi__parse_uncompressed_block($0)|0);
  20815. $12 = ($11|0)==(0);
  20816. if ($12) {
  20817. $$0 = 0;
  20818. label = 11;
  20819. break L5;
  20820. }
  20821. break;
  20822. }
  20823. case 1: {
  20824. $13 = (_stbi__zbuild_huffman($7,10405,288)|0);
  20825. $14 = ($13|0)==(0);
  20826. if ($14) {
  20827. $$0 = 0;
  20828. label = 11;
  20829. break L5;
  20830. }
  20831. $15 = (_stbi__zbuild_huffman($8,10693,32)|0);
  20832. $16 = ($15|0)==(0);
  20833. if ($16) {
  20834. $$0 = 0;
  20835. label = 11;
  20836. break L5;
  20837. } else {
  20838. label = 9;
  20839. }
  20840. break;
  20841. }
  20842. default: {
  20843. $17 = (_stbi__compute_huffman_codes($0)|0);
  20844. $18 = ($17|0)==(0);
  20845. if ($18) {
  20846. $$0 = 0;
  20847. label = 11;
  20848. break L5;
  20849. } else {
  20850. label = 9;
  20851. }
  20852. }
  20853. }
  20854. if ((label|0) == 9) {
  20855. label = 0;
  20856. $19 = (_stbi__parse_huffman_block($0)|0);
  20857. $20 = ($19|0)==(0);
  20858. if ($20) {
  20859. $$0 = 0;
  20860. label = 11;
  20861. break;
  20862. }
  20863. }
  20864. $21 = ($9|0)==(0);
  20865. if (!($21)) {
  20866. $$0 = 1;
  20867. label = 11;
  20868. break;
  20869. }
  20870. }
  20871. if ((label|0) == 11) {
  20872. return ($$0|0);
  20873. }
  20874. return (0)|0;
  20875. }
  20876. function _stbi__parse_zlib_header($0) {
  20877. $0 = $0|0;
  20878. var $$0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
  20879. sp = STACKTOP;
  20880. $1 = (_stbi__zget8($0)|0);
  20881. $2 = $1&255;
  20882. $3 = $2 & 15;
  20883. $4 = (_stbi__zget8($0)|0);
  20884. $5 = $4&255;
  20885. $6 = $2 << 8;
  20886. $7 = $6 | $5;
  20887. $8 = (($7>>>0) % 31)&-1;
  20888. $9 = ($8|0)==(0);
  20889. if (!($9)) {
  20890. _stbi__err(11040);
  20891. $$0 = 0;
  20892. return ($$0|0);
  20893. }
  20894. $10 = $5 & 32;
  20895. $11 = ($10|0)==(0);
  20896. if (!($11)) {
  20897. _stbi__err(11056);
  20898. $$0 = 0;
  20899. return ($$0|0);
  20900. }
  20901. $12 = ($3|0)==(8);
  20902. if ($12) {
  20903. $$0 = 1;
  20904. return ($$0|0);
  20905. }
  20906. _stbi__err(11071);
  20907. $$0 = 0;
  20908. return ($$0|0);
  20909. }
  20910. function _stbi__zreceive($0,$1) {
  20911. $0 = $0|0;
  20912. $1 = $1|0;
  20913. var $10 = 0, $11 = 0, $12 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
  20914. sp = STACKTOP;
  20915. $2 = ((($0)) + 8|0);
  20916. $3 = HEAP32[$2>>2]|0;
  20917. $4 = ($3|0)<($1|0);
  20918. if ($4) {
  20919. _stbi__fill_bits($0);
  20920. }
  20921. $5 = ((($0)) + 12|0);
  20922. $6 = HEAP32[$5>>2]|0;
  20923. $7 = 1 << $1;
  20924. $8 = (($7) + -1)|0;
  20925. $9 = $6 & $8;
  20926. $10 = $6 >>> $1;
  20927. HEAP32[$5>>2] = $10;
  20928. $11 = HEAP32[$2>>2]|0;
  20929. $12 = (($11) - ($1))|0;
  20930. HEAP32[$2>>2] = $12;
  20931. return ($9|0);
  20932. }
  20933. function _stbi__parse_uncompressed_block($0) {
  20934. $0 = $0|0;
  20935. var $$0$lcssa = 0, $$034 = 0, $$037 = 0, $$136 = 0, $$lcssa = 0, $$ph = 0, $$pr = 0, $$promoted = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0;
  20936. var $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0;
  20937. var $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0;
  20938. var $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $exitcond47 = 0, $smax = 0, label = 0, sp = 0;
  20939. sp = STACKTOP;
  20940. STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
  20941. $1 = sp;
  20942. $2 = ((($0)) + 8|0);
  20943. $3 = HEAP32[$2>>2]|0;
  20944. $4 = $3 & 7;
  20945. $5 = ($4|0)==(0);
  20946. if ($5) {
  20947. $$ph = $3;
  20948. } else {
  20949. (_stbi__zreceive($0,$4)|0);
  20950. $$pr = HEAP32[$2>>2]|0;
  20951. $$ph = $$pr;
  20952. }
  20953. $6 = ($$ph|0)>(0);
  20954. if ($6) {
  20955. $7 = ((($0)) + 12|0);
  20956. $$promoted = HEAP32[$7>>2]|0;
  20957. $8 = $$ph ^ -1;
  20958. $9 = ($8|0)>(-9);
  20959. $smax = $9 ? $8 : -9;
  20960. $10 = (($$ph) + ($smax))|0;
  20961. $11 = (($10) + 8)|0;
  20962. $12 = $11 >>> 3;
  20963. $13 = (($12) + 1)|0;
  20964. $14 = $12 << 3;
  20965. $$037 = 0;$16 = $$promoted;
  20966. while(1) {
  20967. $15 = $16&255;
  20968. $17 = (($$037) + 1)|0;
  20969. $18 = (($1) + ($$037)|0);
  20970. HEAP8[$18>>0] = $15;
  20971. $19 = $16 >>> 8;
  20972. $exitcond47 = ($17|0)==($13|0);
  20973. if ($exitcond47) {
  20974. break;
  20975. } else {
  20976. $$037 = $17;$16 = $19;
  20977. }
  20978. }
  20979. $20 = (($$ph) + -8)|0;
  20980. $21 = (($20) - ($14))|0;
  20981. HEAP32[$7>>2] = $19;
  20982. HEAP32[$2>>2] = $21;
  20983. $$0$lcssa = $13;$$lcssa = $21;
  20984. } else {
  20985. $$0$lcssa = 0;$$lcssa = $$ph;
  20986. }
  20987. $22 = ($$lcssa|0)==(0);
  20988. if (!($22)) {
  20989. ___assert_fail((10962|0),(9676|0),4033,(10979|0));
  20990. // unreachable;
  20991. }
  20992. $23 = ($$0$lcssa|0)<(4);
  20993. if ($23) {
  20994. $$136 = $$0$lcssa;
  20995. while(1) {
  20996. $24 = (_stbi__zget8($0)|0);
  20997. $25 = (($$136) + 1)|0;
  20998. $26 = (($1) + ($$136)|0);
  20999. HEAP8[$26>>0] = $24;
  21000. $exitcond = ($25|0)==(4);
  21001. if ($exitcond) {
  21002. break;
  21003. } else {
  21004. $$136 = $25;
  21005. }
  21006. }
  21007. }
  21008. $27 = ((($1)) + 1|0);
  21009. $28 = HEAP8[$27>>0]|0;
  21010. $29 = $28&255;
  21011. $30 = $29 << 8;
  21012. $31 = HEAP8[$1>>0]|0;
  21013. $32 = $31&255;
  21014. $33 = $30 | $32;
  21015. $34 = ((($1)) + 3|0);
  21016. $35 = HEAP8[$34>>0]|0;
  21017. $36 = $35&255;
  21018. $37 = $36 << 8;
  21019. $38 = ((($1)) + 2|0);
  21020. $39 = HEAP8[$38>>0]|0;
  21021. $40 = $39&255;
  21022. $41 = $37 | $40;
  21023. $42 = $33 ^ 65535;
  21024. $43 = ($41|0)==($42|0);
  21025. if (!($43)) {
  21026. _stbi__err(11010);
  21027. $$034 = 0;
  21028. STACKTOP = sp;return ($$034|0);
  21029. }
  21030. $44 = HEAP32[$0>>2]|0;
  21031. $45 = (($44) + ($33)|0);
  21032. $46 = ((($0)) + 4|0);
  21033. $47 = HEAP32[$46>>2]|0;
  21034. $48 = ($45>>>0)>($47>>>0);
  21035. if ($48) {
  21036. _stbi__err(11023);
  21037. $$034 = 0;
  21038. STACKTOP = sp;return ($$034|0);
  21039. }
  21040. $49 = ((($0)) + 16|0);
  21041. $50 = HEAP32[$49>>2]|0;
  21042. $51 = (($50) + ($33)|0);
  21043. $52 = ((($0)) + 24|0);
  21044. $53 = HEAP32[$52>>2]|0;
  21045. $54 = ($51>>>0)>($53>>>0);
  21046. if ($54) {
  21047. $55 = (_stbi__zexpand($0,$50,$33)|0);
  21048. $56 = ($55|0)==(0);
  21049. if ($56) {
  21050. $$034 = 0;
  21051. STACKTOP = sp;return ($$034|0);
  21052. }
  21053. }
  21054. $57 = HEAP32[$49>>2]|0;
  21055. $58 = HEAP32[$0>>2]|0;
  21056. _memcpy(($57|0),($58|0),($33|0))|0;
  21057. $59 = HEAP32[$0>>2]|0;
  21058. $60 = (($59) + ($33)|0);
  21059. HEAP32[$0>>2] = $60;
  21060. $61 = HEAP32[$49>>2]|0;
  21061. $62 = (($61) + ($33)|0);
  21062. HEAP32[$49>>2] = $62;
  21063. $$034 = 1;
  21064. STACKTOP = sp;return ($$034|0);
  21065. }
  21066. function _stbi__zbuild_huffman($0,$1,$2) {
  21067. $0 = $0|0;
  21068. $1 = $1|0;
  21069. $2 = $2|0;
  21070. var $$075 = 0, $$07688 = 0, $$07785 = 0, $$07884 = 0, $$081 = 0, $$286 = 0, $$382 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0;
  21071. var $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0;
  21072. var $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0;
  21073. var $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0;
  21074. var $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0;
  21075. var $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $exitcond = 0, $exitcond91 = 0, $or$cond = 0, dest = 0, label = 0, sp = 0, stop = 0;
  21076. sp = STACKTOP;
  21077. STACKTOP = STACKTOP + 144|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(144|0);
  21078. $3 = sp + 72|0;
  21079. $4 = sp;
  21080. dest=$4; stop=dest+68|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0));
  21081. _memset(($0|0),0,1024)|0;
  21082. $5 = ($2|0)>(0);
  21083. if ($5) {
  21084. $$07688 = 0;
  21085. while(1) {
  21086. $6 = (($1) + ($$07688)|0);
  21087. $7 = HEAP8[$6>>0]|0;
  21088. $8 = $7&255;
  21089. $9 = (($4) + ($8<<2)|0);
  21090. $10 = HEAP32[$9>>2]|0;
  21091. $11 = (($10) + 1)|0;
  21092. HEAP32[$9>>2] = $11;
  21093. $12 = (($$07688) + 1)|0;
  21094. $exitcond91 = ($12|0)==($2|0);
  21095. if ($exitcond91) {
  21096. break;
  21097. } else {
  21098. $$07688 = $12;
  21099. }
  21100. }
  21101. }
  21102. HEAP32[$4>>2] = 0;
  21103. $16 = ((($4)) + 4|0);
  21104. $17 = HEAP32[$16>>2]|0;
  21105. $18 = ($17|0)>(2);
  21106. if (!($18)) {
  21107. $13 = ((($4)) + 8|0);
  21108. $14 = HEAP32[$13>>2]|0;
  21109. $15 = ($14|0)>(4);
  21110. if (!($15)) {
  21111. $69 = ((($4)) + 12|0);
  21112. $70 = HEAP32[$69>>2]|0;
  21113. $71 = ($70|0)>(8);
  21114. if (!($71)) {
  21115. $72 = ((($4)) + 16|0);
  21116. $73 = HEAP32[$72>>2]|0;
  21117. $74 = ($73|0)>(16);
  21118. if (!($74)) {
  21119. $75 = ((($4)) + 20|0);
  21120. $76 = HEAP32[$75>>2]|0;
  21121. $77 = ($76|0)>(32);
  21122. if (!($77)) {
  21123. $78 = ((($4)) + 24|0);
  21124. $79 = HEAP32[$78>>2]|0;
  21125. $80 = ($79|0)>(64);
  21126. if (!($80)) {
  21127. $81 = ((($4)) + 28|0);
  21128. $82 = HEAP32[$81>>2]|0;
  21129. $83 = ($82|0)>(128);
  21130. if (!($83)) {
  21131. $84 = ((($4)) + 32|0);
  21132. $85 = HEAP32[$84>>2]|0;
  21133. $86 = ($85|0)>(256);
  21134. if (!($86)) {
  21135. $87 = ((($4)) + 36|0);
  21136. $88 = HEAP32[$87>>2]|0;
  21137. $89 = ($88|0)>(512);
  21138. if (!($89)) {
  21139. $90 = ((($4)) + 40|0);
  21140. $91 = HEAP32[$90>>2]|0;
  21141. $92 = ($91|0)>(1024);
  21142. if (!($92)) {
  21143. $93 = ((($4)) + 44|0);
  21144. $94 = HEAP32[$93>>2]|0;
  21145. $95 = ($94|0)>(2048);
  21146. if (!($95)) {
  21147. $96 = ((($4)) + 48|0);
  21148. $97 = HEAP32[$96>>2]|0;
  21149. $98 = ($97|0)>(4096);
  21150. if (!($98)) {
  21151. $99 = ((($4)) + 52|0);
  21152. $100 = HEAP32[$99>>2]|0;
  21153. $101 = ($100|0)>(8192);
  21154. if (!($101)) {
  21155. $102 = ((($4)) + 56|0);
  21156. $103 = HEAP32[$102>>2]|0;
  21157. $104 = ($103|0)>(16384);
  21158. if (!($104)) {
  21159. $105 = ((($4)) + 60|0);
  21160. $106 = HEAP32[$105>>2]|0;
  21161. $107 = ($106|0)>(32768);
  21162. if (!($107)) {
  21163. $$07785 = 0;$$07884 = 0;$$286 = 1;
  21164. while(1) {
  21165. $19 = (($3) + ($$286<<2)|0);
  21166. HEAP32[$19>>2] = $$07884;
  21167. $20 = $$07884&65535;
  21168. $21 = (((($0)) + 1024|0) + ($$286<<1)|0);
  21169. HEAP16[$21>>1] = $20;
  21170. $22 = $$07785&65535;
  21171. $23 = (((($0)) + 1124|0) + ($$286<<1)|0);
  21172. HEAP16[$23>>1] = $22;
  21173. $24 = (($4) + ($$286<<2)|0);
  21174. $25 = HEAP32[$24>>2]|0;
  21175. $26 = (($25) + ($$07884))|0;
  21176. $27 = ($25|0)!=(0);
  21177. $28 = 1 << $$286;
  21178. $29 = ($26|0)>($28|0);
  21179. $or$cond = $27 & $29;
  21180. if ($or$cond) {
  21181. label = 7;
  21182. break;
  21183. }
  21184. $30 = (16 - ($$286))|0;
  21185. $31 = $26 << $30;
  21186. $32 = (((($0)) + 1056|0) + ($$286<<2)|0);
  21187. HEAP32[$32>>2] = $31;
  21188. $33 = $26 << 1;
  21189. $34 = (($25) + ($$07785))|0;
  21190. $35 = (($$286) + 1)|0;
  21191. $36 = ($35|0)<(16);
  21192. if ($36) {
  21193. $$07785 = $34;$$07884 = $33;$$286 = $35;
  21194. } else {
  21195. break;
  21196. }
  21197. }
  21198. if ((label|0) == 7) {
  21199. _stbi__err(10900);
  21200. $$075 = 0;
  21201. STACKTOP = sp;return ($$075|0);
  21202. }
  21203. $37 = ((($0)) + 1120|0);
  21204. HEAP32[$37>>2] = 65536;
  21205. $38 = ($2|0)>(0);
  21206. if ($38) {
  21207. $$382 = 0;
  21208. } else {
  21209. $$075 = 1;
  21210. STACKTOP = sp;return ($$075|0);
  21211. }
  21212. while(1) {
  21213. $39 = (($1) + ($$382)|0);
  21214. $40 = HEAP8[$39>>0]|0;
  21215. $41 = $40&255;
  21216. $42 = ($40<<24>>24)==(0);
  21217. if (!($42)) {
  21218. $43 = (($3) + ($41<<2)|0);
  21219. $44 = HEAP32[$43>>2]|0;
  21220. $45 = (((($0)) + 1024|0) + ($41<<1)|0);
  21221. $46 = HEAP16[$45>>1]|0;
  21222. $47 = $46&65535;
  21223. $48 = (($44) - ($47))|0;
  21224. $49 = (((($0)) + 1124|0) + ($41<<1)|0);
  21225. $50 = HEAP16[$49>>1]|0;
  21226. $51 = $50&65535;
  21227. $52 = (($48) + ($51))|0;
  21228. $53 = $41 << 9;
  21229. $54 = $53 | $$382;
  21230. $55 = $54&65535;
  21231. $56 = (((($0)) + 1156|0) + ($52)|0);
  21232. HEAP8[$56>>0] = $40;
  21233. $57 = $$382&65535;
  21234. $58 = (((($0)) + 1444|0) + ($52<<1)|0);
  21235. HEAP16[$58>>1] = $57;
  21236. $59 = ($40&255)<(10);
  21237. do {
  21238. if ($59) {
  21239. $60 = (_stbi__bit_reverse($44,$41)|0);
  21240. $61 = ($60|0)<(512);
  21241. if (!($61)) {
  21242. break;
  21243. }
  21244. $62 = 1 << $41;
  21245. $$081 = $60;
  21246. while(1) {
  21247. $63 = (($0) + ($$081<<1)|0);
  21248. HEAP16[$63>>1] = $55;
  21249. $64 = (($$081) + ($62))|0;
  21250. $65 = ($64|0)<(512);
  21251. if ($65) {
  21252. $$081 = $64;
  21253. } else {
  21254. break;
  21255. }
  21256. }
  21257. }
  21258. } while(0);
  21259. $66 = HEAP32[$43>>2]|0;
  21260. $67 = (($66) + 1)|0;
  21261. HEAP32[$43>>2] = $67;
  21262. }
  21263. $68 = (($$382) + 1)|0;
  21264. $exitcond = ($68|0)==($2|0);
  21265. if ($exitcond) {
  21266. $$075 = 1;
  21267. break;
  21268. } else {
  21269. $$382 = $68;
  21270. }
  21271. }
  21272. STACKTOP = sp;return ($$075|0);
  21273. }
  21274. }
  21275. }
  21276. }
  21277. }
  21278. }
  21279. }
  21280. }
  21281. }
  21282. }
  21283. }
  21284. }
  21285. }
  21286. }
  21287. }
  21288. _stbi__err(10952);
  21289. $$075 = 0;
  21290. STACKTOP = sp;return ($$075|0);
  21291. }
  21292. function _stbi__compute_huffman_codes($0) {
  21293. $0 = $0|0;
  21294. var $$ = 0, $$0 = 0, $$061 = 0, $$06579 = 0, $$066$be = 0, $$066$lcssa = 0, $$06678 = 0, $$4 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0;
  21295. var $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0;
  21296. var $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $not$ = 0, dest = 0;
  21297. var label = 0, sp = 0, stop = 0;
  21298. sp = STACKTOP;
  21299. STACKTOP = STACKTOP + 2496|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(2496|0);
  21300. $1 = sp;
  21301. $2 = sp + 2039|0;
  21302. $3 = sp + 2020|0;
  21303. $4 = (_stbi__zreceive($0,5)|0);
  21304. $5 = (($4) + 257)|0;
  21305. $6 = (_stbi__zreceive($0,5)|0);
  21306. $7 = (($6) + 1)|0;
  21307. $8 = (_stbi__zreceive($0,4)|0);
  21308. $9 = (($8) + 4)|0;
  21309. $10 = (($7) + ($5))|0;
  21310. dest=$3; stop=dest+19|0; do { HEAP8[dest>>0]=0|0; dest=dest+1|0; } while ((dest|0) < (stop|0));
  21311. $11 = ($9|0)>(0);
  21312. if ($11) {
  21313. $$06579 = 0;
  21314. while(1) {
  21315. $12 = (_stbi__zreceive($0,3)|0);
  21316. $13 = $12&255;
  21317. $14 = (11746 + ($$06579)|0);
  21318. $15 = HEAP8[$14>>0]|0;
  21319. $16 = $15&255;
  21320. $17 = (($3) + ($16)|0);
  21321. HEAP8[$17>>0] = $13;
  21322. $18 = (($$06579) + 1)|0;
  21323. $exitcond = ($18|0)==($9|0);
  21324. if ($exitcond) {
  21325. break;
  21326. } else {
  21327. $$06579 = $18;
  21328. }
  21329. }
  21330. }
  21331. $19 = (_stbi__zbuild_huffman($1,$3,19)|0);
  21332. $20 = ($19|0)==(0);
  21333. if ($20) {
  21334. $$4 = 0;
  21335. STACKTOP = sp;return ($$4|0);
  21336. }
  21337. $21 = ($10|0)>(0);
  21338. L8: do {
  21339. if ($21) {
  21340. $$06678 = 0;
  21341. L9: while(1) {
  21342. $22 = (_stbi__zhuffman_decode($0,$1)|0);
  21343. $23 = ($22>>>0)>(18);
  21344. if ($23) {
  21345. label = 6;
  21346. break;
  21347. }
  21348. $24 = ($22|0)<(16);
  21349. if ($24) {
  21350. $25 = $22&255;
  21351. $26 = (($$06678) + 1)|0;
  21352. $27 = (($2) + ($$06678)|0);
  21353. HEAP8[$27>>0] = $25;
  21354. $$066$be = $26;
  21355. } else {
  21356. switch ($22|0) {
  21357. case 16: {
  21358. $28 = (_stbi__zreceive($0,2)|0);
  21359. $29 = ($$06678|0)==(0);
  21360. if ($29) {
  21361. label = 11;
  21362. break L9;
  21363. }
  21364. $30 = (($28) + 3)|0;
  21365. $31 = (($$06678) + -1)|0;
  21366. $32 = (($2) + ($31)|0);
  21367. $33 = HEAP8[$32>>0]|0;
  21368. $$0 = $33;$$061 = $30;
  21369. break;
  21370. }
  21371. case 17: {
  21372. $34 = (_stbi__zreceive($0,3)|0);
  21373. $35 = (($34) + 3)|0;
  21374. $$0 = 0;$$061 = $35;
  21375. break;
  21376. }
  21377. case 18: {
  21378. $36 = (_stbi__zreceive($0,7)|0);
  21379. $37 = (($36) + 11)|0;
  21380. $$0 = 0;$$061 = $37;
  21381. break;
  21382. }
  21383. default: {
  21384. label = 14;
  21385. break L9;
  21386. }
  21387. }
  21388. $38 = (($10) - ($$06678))|0;
  21389. $39 = ($38|0)<($$061|0);
  21390. if ($39) {
  21391. label = 17;
  21392. break;
  21393. }
  21394. $40 = (($2) + ($$06678)|0);
  21395. _memset(($40|0),($$0|0),($$061|0))|0;
  21396. $41 = (($$061) + ($$06678))|0;
  21397. $$066$be = $41;
  21398. }
  21399. $42 = ($10|0)>($$066$be|0);
  21400. if ($42) {
  21401. $$06678 = $$066$be;
  21402. } else {
  21403. $$066$lcssa = $$066$be;
  21404. break L8;
  21405. }
  21406. }
  21407. if ((label|0) == 6) {
  21408. _stbi__err(10900);
  21409. $$4 = 0;
  21410. STACKTOP = sp;return ($$4|0);
  21411. }
  21412. else if ((label|0) == 11) {
  21413. _stbi__err(10900);
  21414. $$4 = 0;
  21415. STACKTOP = sp;return ($$4|0);
  21416. }
  21417. else if ((label|0) == 14) {
  21418. ___assert_fail((10916|0),(9676|0),4006,(10924|0));
  21419. // unreachable;
  21420. }
  21421. else if ((label|0) == 17) {
  21422. _stbi__err(10900);
  21423. $$4 = 0;
  21424. STACKTOP = sp;return ($$4|0);
  21425. }
  21426. } else {
  21427. $$066$lcssa = 0;
  21428. }
  21429. } while(0);
  21430. $43 = ($10|0)==($$066$lcssa|0);
  21431. if (!($43)) {
  21432. _stbi__err(10900);
  21433. $$4 = 0;
  21434. STACKTOP = sp;return ($$4|0);
  21435. }
  21436. $44 = ((($0)) + 32|0);
  21437. $45 = (_stbi__zbuild_huffman($44,$2,$5)|0);
  21438. $46 = ($45|0)==(0);
  21439. if ($46) {
  21440. $$4 = 0;
  21441. STACKTOP = sp;return ($$4|0);
  21442. }
  21443. $47 = ((($0)) + 2052|0);
  21444. $48 = (($2) + ($5)|0);
  21445. $49 = (_stbi__zbuild_huffman($47,$48,$7)|0);
  21446. $not$ = ($49|0)!=(0);
  21447. $$ = $not$&1;
  21448. $$4 = $$;
  21449. STACKTOP = sp;return ($$4|0);
  21450. }
  21451. function _stbi__parse_huffman_block($0) {
  21452. $0 = $0|0;
  21453. var $$063 = 0, $$064 = 0, $$067 = 0, $$070 = 0, $$171 = 0, $$266 = 0, $$272 = 0, $$3$ph = 0, $$5 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0;
  21454. var $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0;
  21455. var $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0;
  21456. var $56 = 0, $57 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $scevgep = 0, $scevgep92 = 0, label = 0, sp = 0;
  21457. sp = STACKTOP;
  21458. $1 = ((($0)) + 16|0);
  21459. $2 = HEAP32[$1>>2]|0;
  21460. $3 = ((($0)) + 32|0);
  21461. $4 = ((($0)) + 24|0);
  21462. $5 = ((($0)) + 2052|0);
  21463. $6 = ((($0)) + 20|0);
  21464. $7 = ((($0)) + 24|0);
  21465. $$070 = $2;
  21466. while(1) {
  21467. $10 = (_stbi__zhuffman_decode($0,$3)|0);
  21468. $11 = ($10|0)<(256);
  21469. if ($11) {
  21470. $12 = ($10|0)<(0);
  21471. if ($12) {
  21472. label = 6;
  21473. break;
  21474. }
  21475. $13 = HEAP32[$4>>2]|0;
  21476. $14 = ($$070>>>0)<($13>>>0);
  21477. if ($14) {
  21478. $$171 = $$070;
  21479. } else {
  21480. $15 = (_stbi__zexpand($0,$$070,1)|0);
  21481. $16 = ($15|0)==(0);
  21482. if ($16) {
  21483. $$3$ph = 0;
  21484. label = 28;
  21485. break;
  21486. }
  21487. $17 = HEAP32[$1>>2]|0;
  21488. $$171 = $17;
  21489. }
  21490. $18 = $10&255;
  21491. $19 = ((($$171)) + 1|0);
  21492. HEAP8[$$171>>0] = $18;
  21493. $$070 = $19;
  21494. continue;
  21495. }
  21496. $20 = ($10|0)==(256);
  21497. if ($20) {
  21498. label = 12;
  21499. break;
  21500. }
  21501. $21 = (($10) + -257)|0;
  21502. $22 = (3280 + ($21<<2)|0);
  21503. $23 = HEAP32[$22>>2]|0;
  21504. $24 = (($10) + -265)|0;
  21505. $25 = ($24>>>0)<(20);
  21506. if ($25) {
  21507. $26 = (3156 + ($21<<2)|0);
  21508. $27 = HEAP32[$26>>2]|0;
  21509. $28 = (_stbi__zreceive($0,$27)|0);
  21510. $29 = (($28) + ($23))|0;
  21511. $$064 = $29;
  21512. } else {
  21513. $$064 = $23;
  21514. }
  21515. $30 = (_stbi__zhuffman_decode($0,$5)|0);
  21516. $31 = ($30|0)<(0);
  21517. if ($31) {
  21518. label = 16;
  21519. break;
  21520. }
  21521. $32 = (3532 + ($30<<2)|0);
  21522. $33 = HEAP32[$32>>2]|0;
  21523. $34 = (($30) + -4)|0;
  21524. $35 = ($34>>>0)<(26);
  21525. if ($35) {
  21526. $36 = (3404 + ($30<<2)|0);
  21527. $37 = HEAP32[$36>>2]|0;
  21528. $38 = (_stbi__zreceive($0,$37)|0);
  21529. $39 = (($38) + ($33))|0;
  21530. $$063 = $39;
  21531. } else {
  21532. $$063 = $33;
  21533. }
  21534. $40 = HEAP32[$6>>2]|0;
  21535. $41 = $$070;
  21536. $42 = (($41) - ($40))|0;
  21537. $43 = ($42|0)<($$063|0);
  21538. if ($43) {
  21539. label = 20;
  21540. break;
  21541. }
  21542. $44 = (($$070) + ($$064)|0);
  21543. $45 = HEAP32[$7>>2]|0;
  21544. $46 = ($44>>>0)>($45>>>0);
  21545. if ($46) {
  21546. $47 = (_stbi__zexpand($0,$$070,$$064)|0);
  21547. $48 = ($47|0)==(0);
  21548. if ($48) {
  21549. $$3$ph = 0;
  21550. label = 28;
  21551. break;
  21552. }
  21553. $49 = HEAP32[$1>>2]|0;
  21554. $$272 = $49;
  21555. } else {
  21556. $$272 = $$070;
  21557. }
  21558. $50 = (0 - ($$063))|0;
  21559. $9 = (($$272) + ($50)|0);
  21560. $51 = ($$063|0)==(1);
  21561. $52 = ($$064|0)!=(0);
  21562. if ($51) {
  21563. if (!($52)) {
  21564. $$070 = $$272;
  21565. continue;
  21566. }
  21567. $8 = HEAP8[$9>>0]|0;
  21568. _memset(($$272|0),($8|0),($$064|0))|0;
  21569. $scevgep92 = (($$272) + ($$064)|0);
  21570. $$070 = $scevgep92;
  21571. continue;
  21572. }
  21573. if ($52) {
  21574. $$067 = $9;$$266 = $$064;$$5 = $$272;
  21575. } else {
  21576. $$070 = $$272;
  21577. continue;
  21578. }
  21579. while(1) {
  21580. $53 = ((($$067)) + 1|0);
  21581. $54 = HEAP8[$$067>>0]|0;
  21582. $55 = ((($$5)) + 1|0);
  21583. HEAP8[$$5>>0] = $54;
  21584. $56 = (($$266) + -1)|0;
  21585. $57 = ($56|0)==(0);
  21586. if ($57) {
  21587. break;
  21588. } else {
  21589. $$067 = $53;$$266 = $56;$$5 = $55;
  21590. }
  21591. }
  21592. $scevgep = (($$272) + ($$064)|0);
  21593. $$070 = $scevgep;
  21594. }
  21595. if ((label|0) == 6) {
  21596. _stbi__err(10725);
  21597. $$3$ph = 0;
  21598. return ($$3$ph|0);
  21599. }
  21600. else if ((label|0) == 12) {
  21601. HEAP32[$1>>2] = $$070;
  21602. $$3$ph = 1;
  21603. return ($$3$ph|0);
  21604. }
  21605. else if ((label|0) == 16) {
  21606. _stbi__err(10725);
  21607. $$3$ph = 0;
  21608. return ($$3$ph|0);
  21609. }
  21610. else if ((label|0) == 20) {
  21611. _stbi__err(10742);
  21612. $$3$ph = 0;
  21613. return ($$3$ph|0);
  21614. }
  21615. else if ((label|0) == 28) {
  21616. return ($$3$ph|0);
  21617. }
  21618. return (0)|0;
  21619. }
  21620. function _stbi__zhuffman_decode($0,$1) {
  21621. $0 = $0|0;
  21622. $1 = $1|0;
  21623. var $$0 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
  21624. sp = STACKTOP;
  21625. $2 = ((($0)) + 8|0);
  21626. $3 = HEAP32[$2>>2]|0;
  21627. $4 = ($3|0)<(16);
  21628. if ($4) {
  21629. _stbi__fill_bits($0);
  21630. }
  21631. $5 = ((($0)) + 12|0);
  21632. $6 = HEAP32[$5>>2]|0;
  21633. $7 = $6 & 511;
  21634. $8 = (($1) + ($7<<1)|0);
  21635. $9 = HEAP16[$8>>1]|0;
  21636. $10 = $9&65535;
  21637. $11 = ($9<<16>>16)==(0);
  21638. if ($11) {
  21639. $17 = (_stbi__zhuffman_decode_slowpath($0,$1)|0);
  21640. $$0 = $17;
  21641. return ($$0|0);
  21642. } else {
  21643. $12 = $10 >>> 9;
  21644. $13 = $6 >>> $12;
  21645. HEAP32[$5>>2] = $13;
  21646. $14 = HEAP32[$2>>2]|0;
  21647. $15 = (($14) - ($12))|0;
  21648. HEAP32[$2>>2] = $15;
  21649. $16 = $10 & 511;
  21650. $$0 = $16;
  21651. return ($$0|0);
  21652. }
  21653. return (0)|0;
  21654. }
  21655. function _stbi__zexpand($0,$1,$2) {
  21656. $0 = $0|0;
  21657. $1 = $1|0;
  21658. $2 = $2|0;
  21659. var $$0 = 0, $$029 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0;
  21660. var $9 = 0, label = 0, sp = 0;
  21661. sp = STACKTOP;
  21662. $3 = ((($0)) + 16|0);
  21663. HEAP32[$3>>2] = $1;
  21664. $4 = ((($0)) + 28|0);
  21665. $5 = HEAP32[$4>>2]|0;
  21666. $6 = ($5|0)==(0);
  21667. if ($6) {
  21668. _stbi__err(10751);
  21669. $$0 = 0;
  21670. return ($$0|0);
  21671. }
  21672. $7 = ((($0)) + 20|0);
  21673. $8 = HEAP32[$7>>2]|0;
  21674. $9 = $1;
  21675. $10 = $8;
  21676. $11 = (($9) - ($10))|0;
  21677. $12 = ((($0)) + 24|0);
  21678. $13 = HEAP32[$12>>2]|0;
  21679. $14 = (($13) - ($10))|0;
  21680. $15 = (($11) + ($2))|0;
  21681. $$029 = $14;
  21682. while(1) {
  21683. $16 = ($15|0)>($$029|0);
  21684. $17 = $$029 << 1;
  21685. if ($16) {
  21686. $$029 = $17;
  21687. } else {
  21688. break;
  21689. }
  21690. }
  21691. $18 = (_realloc($8,$$029)|0);
  21692. $19 = ($18|0)==(0|0);
  21693. if ($19) {
  21694. _stbi__err(9731);
  21695. $$0 = 0;
  21696. return ($$0|0);
  21697. } else {
  21698. HEAP32[$7>>2] = $18;
  21699. $20 = (($18) + ($11)|0);
  21700. HEAP32[$3>>2] = $20;
  21701. $21 = (($18) + ($$029)|0);
  21702. HEAP32[$12>>2] = $21;
  21703. $$0 = 1;
  21704. return ($$0|0);
  21705. }
  21706. return (0)|0;
  21707. }
  21708. function _stbi__fill_bits($0) {
  21709. $0 = $0|0;
  21710. var $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
  21711. sp = STACKTOP;
  21712. $1 = ((($0)) + 12|0);
  21713. $2 = ((($0)) + 8|0);
  21714. while(1) {
  21715. $3 = HEAP32[$1>>2]|0;
  21716. $4 = HEAP32[$2>>2]|0;
  21717. $5 = 1 << $4;
  21718. $6 = ($3>>>0)<($5>>>0);
  21719. if (!($6)) {
  21720. label = 3;
  21721. break;
  21722. }
  21723. $7 = (_stbi__zget8($0)|0);
  21724. $8 = $7&255;
  21725. $9 = HEAP32[$2>>2]|0;
  21726. $10 = $8 << $9;
  21727. $11 = HEAP32[$1>>2]|0;
  21728. $12 = $11 | $10;
  21729. HEAP32[$1>>2] = $12;
  21730. $13 = (($9) + 8)|0;
  21731. HEAP32[$2>>2] = $13;
  21732. $14 = ($13|0)<(25);
  21733. if (!($14)) {
  21734. label = 5;
  21735. break;
  21736. }
  21737. }
  21738. if ((label|0) == 3) {
  21739. ___assert_fail((10847|0),(9676|0),3848,(10884|0));
  21740. // unreachable;
  21741. }
  21742. else if ((label|0) == 5) {
  21743. return;
  21744. }
  21745. }
  21746. function _stbi__zhuffman_decode_slowpath($0,$1) {
  21747. $0 = $0|0;
  21748. $1 = $1|0;
  21749. var $$0 = 0, $$025 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
  21750. var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
  21751. sp = STACKTOP;
  21752. $2 = ((($0)) + 12|0);
  21753. $3 = HEAP32[$2>>2]|0;
  21754. $4 = (_stbi__bit_reverse($3,16)|0);
  21755. $$025 = 10;
  21756. while(1) {
  21757. $5 = (((($1)) + 1056|0) + ($$025<<2)|0);
  21758. $6 = HEAP32[$5>>2]|0;
  21759. $7 = ($4|0)<($6|0);
  21760. $8 = (($$025) + 1)|0;
  21761. if ($7) {
  21762. break;
  21763. } else {
  21764. $$025 = $8;
  21765. }
  21766. }
  21767. $9 = ($$025|0)==(16);
  21768. if ($9) {
  21769. $$0 = -1;
  21770. return ($$0|0);
  21771. }
  21772. $10 = (16 - ($$025))|0;
  21773. $11 = $4 >> $10;
  21774. $12 = (((($1)) + 1024|0) + ($$025<<1)|0);
  21775. $13 = HEAP16[$12>>1]|0;
  21776. $14 = $13&65535;
  21777. $15 = (($11) - ($14))|0;
  21778. $16 = (((($1)) + 1124|0) + ($$025<<1)|0);
  21779. $17 = HEAP16[$16>>1]|0;
  21780. $18 = $17&65535;
  21781. $19 = (($15) + ($18))|0;
  21782. $20 = (((($1)) + 1156|0) + ($19)|0);
  21783. $21 = HEAP8[$20>>0]|0;
  21784. $22 = $21&255;
  21785. $23 = ($22|0)==($$025|0);
  21786. if (!($23)) {
  21787. ___assert_fail((10771|0),(9676|0),3876,(10787|0));
  21788. // unreachable;
  21789. }
  21790. $24 = HEAP32[$2>>2]|0;
  21791. $25 = $24 >>> $$025;
  21792. HEAP32[$2>>2] = $25;
  21793. $26 = ((($0)) + 8|0);
  21794. $27 = HEAP32[$26>>2]|0;
  21795. $28 = (($27) - ($$025))|0;
  21796. HEAP32[$26>>2] = $28;
  21797. $29 = (((($1)) + 1444|0) + ($19<<1)|0);
  21798. $30 = HEAP16[$29>>1]|0;
  21799. $31 = $30&65535;
  21800. $$0 = $31;
  21801. return ($$0|0);
  21802. }
  21803. function _stbi__bit_reverse($0,$1) {
  21804. $0 = $0|0;
  21805. $1 = $1|0;
  21806. var $2 = 0, $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0;
  21807. sp = STACKTOP;
  21808. $2 = ($1|0)<(17);
  21809. if ($2) {
  21810. $3 = (_stbi__bitreverse16($0)|0);
  21811. $4 = (16 - ($1))|0;
  21812. $5 = $3 >> $4;
  21813. return ($5|0);
  21814. } else {
  21815. ___assert_fail((10818|0),(9676|0),3766,(10829|0));
  21816. // unreachable;
  21817. }
  21818. return (0)|0;
  21819. }
  21820. function _stbi__bitreverse16($0) {
  21821. $0 = $0|0;
  21822. var $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0;
  21823. var sp = 0;
  21824. sp = STACKTOP;
  21825. $1 = $0 >>> 1;
  21826. $2 = $1 & 21845;
  21827. $3 = $0 << 1;
  21828. $4 = $3 & 43690;
  21829. $5 = $2 | $4;
  21830. $6 = $5 >>> 2;
  21831. $7 = $6 & 13107;
  21832. $8 = $5 << 2;
  21833. $9 = $8 & 52428;
  21834. $10 = $7 | $9;
  21835. $11 = $10 >>> 4;
  21836. $12 = $11 & 3855;
  21837. $13 = $10 << 4;
  21838. $14 = $13 & 61680;
  21839. $15 = $12 | $14;
  21840. $16 = $15 >>> 8;
  21841. $17 = $15 << 8;
  21842. $18 = $17 & 65280;
  21843. $19 = $18 | $16;
  21844. return ($19|0);
  21845. }
  21846. function _stbi__zget8($0) {
  21847. $0 = $0|0;
  21848. var $$0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, label = 0, sp = 0;
  21849. sp = STACKTOP;
  21850. $1 = HEAP32[$0>>2]|0;
  21851. $2 = ((($0)) + 4|0);
  21852. $3 = HEAP32[$2>>2]|0;
  21853. $4 = ($1>>>0)<($3>>>0);
  21854. if (!($4)) {
  21855. $$0 = 0;
  21856. return ($$0|0);
  21857. }
  21858. $5 = ((($1)) + 1|0);
  21859. HEAP32[$0>>2] = $5;
  21860. $6 = HEAP8[$1>>0]|0;
  21861. $$0 = $6;
  21862. return ($$0|0);
  21863. }
  21864. function _stbi__refill_buffer($0) {
  21865. $0 = $0|0;
  21866. var $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
  21867. sp = STACKTOP;
  21868. $1 = ((($0)) + 16|0);
  21869. $2 = HEAP32[$1>>2]|0;
  21870. $3 = ((($0)) + 28|0);
  21871. $4 = HEAP32[$3>>2]|0;
  21872. $5 = ((($0)) + 40|0);
  21873. $6 = ((($0)) + 36|0);
  21874. $7 = HEAP32[$6>>2]|0;
  21875. $8 = (FUNCTION_TABLE_iiii[$2 & 15]($4,$5,$7)|0);
  21876. $9 = ($8|0)==(0);
  21877. if ($9) {
  21878. $10 = ((($0)) + 32|0);
  21879. HEAP32[$10>>2] = 0;
  21880. $11 = ((($0)) + 168|0);
  21881. HEAP32[$11>>2] = $5;
  21882. $12 = ((($0)) + 41|0);
  21883. $13 = ((($0)) + 172|0);
  21884. HEAP32[$13>>2] = $12;
  21885. HEAP8[$5>>0] = 0;
  21886. return;
  21887. } else {
  21888. $14 = ((($0)) + 168|0);
  21889. HEAP32[$14>>2] = $5;
  21890. $15 = (((($0)) + 40|0) + ($8)|0);
  21891. $16 = ((($0)) + 172|0);
  21892. HEAP32[$16>>2] = $15;
  21893. return;
  21894. }
  21895. }
  21896. function _stbi__rewind($0) {
  21897. $0 = $0|0;
  21898. var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, label = 0, sp = 0;
  21899. sp = STACKTOP;
  21900. $1 = ((($0)) + 176|0);
  21901. $2 = HEAP32[$1>>2]|0;
  21902. $3 = ((($0)) + 168|0);
  21903. HEAP32[$3>>2] = $2;
  21904. $4 = ((($0)) + 180|0);
  21905. $5 = HEAP32[$4>>2]|0;
  21906. $6 = ((($0)) + 172|0);
  21907. HEAP32[$6>>2] = $5;
  21908. return;
  21909. }
  21910. function _stbi__start_callbacks($0,$1,$2) {
  21911. $0 = $0|0;
  21912. $1 = $1|0;
  21913. $2 = $2|0;
  21914. var $10 = 0, $11 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
  21915. sp = STACKTOP;
  21916. $3 = ((($0)) + 16|0);
  21917. ;HEAP32[$3>>2]=HEAP32[$1>>2]|0;HEAP32[$3+4>>2]=HEAP32[$1+4>>2]|0;HEAP32[$3+8>>2]=HEAP32[$1+8>>2]|0;
  21918. $4 = ((($0)) + 28|0);
  21919. HEAP32[$4>>2] = $2;
  21920. $5 = ((($0)) + 36|0);
  21921. HEAP32[$5>>2] = 128;
  21922. $6 = ((($0)) + 32|0);
  21923. HEAP32[$6>>2] = 1;
  21924. $7 = ((($0)) + 40|0);
  21925. $8 = ((($0)) + 176|0);
  21926. HEAP32[$8>>2] = $7;
  21927. _stbi__refill_buffer($0);
  21928. $9 = ((($0)) + 172|0);
  21929. $10 = HEAP32[$9>>2]|0;
  21930. $11 = ((($0)) + 180|0);
  21931. HEAP32[$11>>2] = $10;
  21932. return;
  21933. }
  21934. function _stbi__stdio_read($0,$1,$2) {
  21935. $0 = $0|0;
  21936. $1 = $1|0;
  21937. $2 = $2|0;
  21938. var $3 = 0, label = 0, sp = 0;
  21939. sp = STACKTOP;
  21940. $3 = (_fread($1,1,$2,$0)|0);
  21941. return ($3|0);
  21942. }
  21943. function _stbi__stdio_skip($0,$1) {
  21944. $0 = $0|0;
  21945. $1 = $1|0;
  21946. var label = 0, sp = 0;
  21947. sp = STACKTOP;
  21948. (_fseek($0,$1,1)|0);
  21949. return;
  21950. }
  21951. function _stbi__stdio_eof($0) {
  21952. $0 = $0|0;
  21953. var $1 = 0, label = 0, sp = 0;
  21954. sp = STACKTOP;
  21955. $1 = (_feof($0)|0);
  21956. return ($1|0);
  21957. }
  21958. function _LoadImage($0,$1) {
  21959. $0 = $0|0;
  21960. $1 = $1|0;
  21961. var $$sink = 0, $$sroa$0$0 = 0, $$sroa$0$0$copyload = 0, $$sroa$0$1 = 0, $$sroa$0$144 = 0, $$sroa$10$0 = 0, $$sroa$10$0$$sroa_idx19 = 0, $$sroa$10$0$$sroa_idx20 = 0, $$sroa$10$0$copyload = 0, $$sroa$10$1 = 0, $$sroa$10$140 = 0, $$sroa$10$141 = 0, $$sroa$13$0 = 0, $$sroa$13$0$$sroa_idx23 = 0, $$sroa$13$0$$sroa_idx24 = 0, $$sroa$13$0$copyload = 0, $$sroa$13$1 = 0, $$sroa$13$146 = 0, $$sroa$13$147 = 0, $$sroa$15$0 = 0;
  21962. var $$sroa$15$0$$sroa_idx27 = 0, $$sroa$15$0$$sroa_idx28 = 0, $$sroa$15$0$copyload = 0, $$sroa$15$1 = 0, $$sroa$15$2 = 0, $$sroa$15$248 = 0, $$sroa$15$249 = 0, $$sroa$7$0 = 0, $$sroa$7$0$$sroa_idx15 = 0, $$sroa$7$0$$sroa_idx16 = 0, $$sroa$7$0$copyload = 0, $$sroa$7$1 = 0, $$sroa$7$142 = 0, $$sroa$7$143 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0;
  21963. var $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0;
  21964. var $vararg_buffer1 = 0, $vararg_buffer4 = 0, $vararg_buffer9 = 0, $vararg_ptr7 = 0, $vararg_ptr8 = 0, label = 0, sp = 0;
  21965. sp = STACKTOP;
  21966. STACKTOP = STACKTOP + 80|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(80|0);
  21967. $vararg_buffer9 = sp + 32|0;
  21968. $vararg_buffer4 = sp + 16|0;
  21969. $vararg_buffer1 = sp + 8|0;
  21970. $vararg_buffer = sp;
  21971. $2 = sp + 48|0;
  21972. $3 = sp + 44|0;
  21973. $4 = sp + 40|0;
  21974. $5 = sp + 36|0;
  21975. $6 = (_IsFileExtension($1,11099)|0);
  21976. $7 = ($6|0)==(0);
  21977. do {
  21978. if ($7) {
  21979. $19 = (_IsFileExtension($1,11152)|0);
  21980. $20 = ($19|0)==(0);
  21981. if ($20) {
  21982. HEAP32[$vararg_buffer1>>2] = $1;
  21983. _TraceLog(2,11157,$vararg_buffer1);
  21984. $$sroa$10$141 = 0;$$sroa$13$147 = 0;$$sroa$15$249 = 0;$$sroa$7$143 = 0;
  21985. break;
  21986. }
  21987. HEAP32[$3>>2] = 0;
  21988. HEAP32[$4>>2] = 0;
  21989. HEAP32[$5>>2] = 0;
  21990. $21 = (_fopen($1,11291)|0);
  21991. $22 = (_stbi_load_from_file($21,$3,$4,$5,0)|0);
  21992. (_fclose($21)|0);
  21993. $23 = HEAP32[$3>>2]|0;
  21994. $24 = HEAP32[$4>>2]|0;
  21995. $25 = HEAP32[$5>>2]|0;
  21996. switch ($25|0) {
  21997. case 1: {
  21998. $$sink = 1;
  21999. label = 11;
  22000. break;
  22001. }
  22002. case 2: {
  22003. $$sink = 2;
  22004. label = 11;
  22005. break;
  22006. }
  22007. case 3: {
  22008. $$sink = 4;
  22009. label = 11;
  22010. break;
  22011. }
  22012. case 4: {
  22013. $$sink = 7;
  22014. label = 11;
  22015. break;
  22016. }
  22017. default: {
  22018. $$sroa$15$1 = 0;
  22019. }
  22020. }
  22021. if ((label|0) == 11) {
  22022. $$sroa$15$1 = $$sink;
  22023. }
  22024. $$sroa$0$1 = $22;$$sroa$10$1 = $24;$$sroa$13$1 = 1;$$sroa$15$2 = $$sroa$15$1;$$sroa$7$1 = $23;
  22025. label = 14;
  22026. } else {
  22027. $8 = (_LoadResource($1,0)|0);
  22028. $9 = HEAP32[$8>>2]|0;
  22029. $10 = ($9|0)==(1);
  22030. if ($10) {
  22031. $11 = ((($8)) + 20|0);
  22032. $12 = HEAP32[$11>>2]|0;
  22033. $13 = ((($8)) + 4|0);
  22034. $14 = HEAP32[$13>>2]|0;
  22035. $15 = ((($8)) + 8|0);
  22036. $16 = HEAP32[$15>>2]|0;
  22037. $17 = ((($8)) + 12|0);
  22038. $18 = HEAP32[$17>>2]|0;
  22039. _LoadImagePro($2,$12,$14,$16,$18);
  22040. $$sroa$0$0$copyload = HEAP32[$2>>2]|0;
  22041. $$sroa$7$0$$sroa_idx15 = ((($2)) + 4|0);
  22042. $$sroa$7$0$copyload = HEAP32[$$sroa$7$0$$sroa_idx15>>2]|0;
  22043. $$sroa$10$0$$sroa_idx19 = ((($2)) + 8|0);
  22044. $$sroa$10$0$copyload = HEAP32[$$sroa$10$0$$sroa_idx19>>2]|0;
  22045. $$sroa$13$0$$sroa_idx23 = ((($2)) + 12|0);
  22046. $$sroa$13$0$copyload = HEAP32[$$sroa$13$0$$sroa_idx23>>2]|0;
  22047. $$sroa$15$0$$sroa_idx27 = ((($2)) + 16|0);
  22048. $$sroa$15$0$copyload = HEAP32[$$sroa$15$0$$sroa_idx27>>2]|0;
  22049. $$sroa$0$0 = $$sroa$0$0$copyload;$$sroa$10$0 = $$sroa$10$0$copyload;$$sroa$13$0 = $$sroa$13$0$copyload;$$sroa$15$0 = $$sroa$15$0$copyload;$$sroa$7$0 = $$sroa$7$0$copyload;
  22050. } else {
  22051. HEAP32[$vararg_buffer>>2] = $1;
  22052. _TraceLog(2,11105,$vararg_buffer);
  22053. $$sroa$0$0 = 0;$$sroa$10$0 = 0;$$sroa$13$0 = 0;$$sroa$15$0 = 0;$$sroa$7$0 = 0;
  22054. }
  22055. _UnloadResource($8);
  22056. $$sroa$0$1 = $$sroa$0$0;$$sroa$10$1 = $$sroa$10$0;$$sroa$13$1 = $$sroa$13$0;$$sroa$15$2 = $$sroa$15$0;$$sroa$7$1 = $$sroa$7$0;
  22057. label = 14;
  22058. }
  22059. } while(0);
  22060. if ((label|0) == 14) {
  22061. $26 = ($$sroa$0$1|0)==(0|0);
  22062. if ($26) {
  22063. $$sroa$10$141 = $$sroa$10$1;$$sroa$13$147 = $$sroa$13$1;$$sroa$15$249 = $$sroa$15$2;$$sroa$7$143 = $$sroa$7$1;
  22064. } else {
  22065. HEAP32[$vararg_buffer4>>2] = $1;
  22066. $vararg_ptr7 = ((($vararg_buffer4)) + 4|0);
  22067. HEAP32[$vararg_ptr7>>2] = $$sroa$7$1;
  22068. $vararg_ptr8 = ((($vararg_buffer4)) + 8|0);
  22069. HEAP32[$vararg_ptr8>>2] = $$sroa$10$1;
  22070. _TraceLog(0,11193,$vararg_buffer4);
  22071. $$sroa$0$144 = $$sroa$0$1;$$sroa$10$140 = $$sroa$10$1;$$sroa$13$146 = $$sroa$13$1;$$sroa$15$248 = $$sroa$15$2;$$sroa$7$142 = $$sroa$7$1;
  22072. HEAP32[$0>>2] = $$sroa$0$144;
  22073. $$sroa$7$0$$sroa_idx16 = ((($0)) + 4|0);
  22074. HEAP32[$$sroa$7$0$$sroa_idx16>>2] = $$sroa$7$142;
  22075. $$sroa$10$0$$sroa_idx20 = ((($0)) + 8|0);
  22076. HEAP32[$$sroa$10$0$$sroa_idx20>>2] = $$sroa$10$140;
  22077. $$sroa$13$0$$sroa_idx24 = ((($0)) + 12|0);
  22078. HEAP32[$$sroa$13$0$$sroa_idx24>>2] = $$sroa$13$146;
  22079. $$sroa$15$0$$sroa_idx28 = ((($0)) + 16|0);
  22080. HEAP32[$$sroa$15$0$$sroa_idx28>>2] = $$sroa$15$248;
  22081. STACKTOP = sp;return;
  22082. }
  22083. }
  22084. HEAP32[$vararg_buffer9>>2] = $1;
  22085. _TraceLog(2,11232,$vararg_buffer9);
  22086. $$sroa$0$144 = 0;$$sroa$10$140 = $$sroa$10$141;$$sroa$13$146 = $$sroa$13$147;$$sroa$15$248 = $$sroa$15$249;$$sroa$7$142 = $$sroa$7$143;
  22087. HEAP32[$0>>2] = $$sroa$0$144;
  22088. $$sroa$7$0$$sroa_idx16 = ((($0)) + 4|0);
  22089. HEAP32[$$sroa$7$0$$sroa_idx16>>2] = $$sroa$7$142;
  22090. $$sroa$10$0$$sroa_idx20 = ((($0)) + 8|0);
  22091. HEAP32[$$sroa$10$0$$sroa_idx20>>2] = $$sroa$10$140;
  22092. $$sroa$13$0$$sroa_idx24 = ((($0)) + 12|0);
  22093. HEAP32[$$sroa$13$0$$sroa_idx24>>2] = $$sroa$13$146;
  22094. $$sroa$15$0$$sroa_idx28 = ((($0)) + 16|0);
  22095. HEAP32[$$sroa$15$0$$sroa_idx28>>2] = $$sroa$15$248;
  22096. STACKTOP = sp;return;
  22097. }
  22098. function _LoadResource($0,$1) {
  22099. $0 = $0|0;
  22100. $1 = $1|0;
  22101. var $$0$lcssa = 0, $$05665 = 0, $$05764 = 0, $$1 = 0, $$2 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0;
  22102. var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0;
  22103. var $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0;
  22104. var $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond60 = 0;
  22105. var $or$cond62 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer4 = 0, $vararg_buffer8 = 0, $vararg_ptr11 = 0, $vararg_ptr7 = 0, label = 0, sp = 0;
  22106. sp = STACKTOP;
  22107. STACKTOP = STACKTOP + 80|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(80|0);
  22108. $vararg_buffer8 = sp + 24|0;
  22109. $vararg_buffer4 = sp + 16|0;
  22110. $vararg_buffer1 = sp + 8|0;
  22111. $vararg_buffer = sp;
  22112. $2 = sp + 64|0;
  22113. $3 = sp + 32|0;
  22114. $4 = (_fopen($0,11291)|0);
  22115. $5 = ($4|0)==(0|0);
  22116. if ($5) {
  22117. HEAP32[$vararg_buffer>>2] = $0;
  22118. _TraceLog(2,11294,$vararg_buffer);
  22119. $$2 = 0;
  22120. STACKTOP = sp;return ($$2|0);
  22121. }
  22122. (_fread($2,1,1,$4)|0);
  22123. $6 = ((($2)) + 1|0);
  22124. (_fread($6,1,1,$4)|0);
  22125. $7 = ((($2)) + 2|0);
  22126. (_fread($7,1,1,$4)|0);
  22127. $8 = ((($2)) + 3|0);
  22128. (_fread($8,1,1,$4)|0);
  22129. $9 = ((($2)) + 4|0);
  22130. (_fread($9,2,1,$4)|0);
  22131. $10 = ((($2)) + 6|0);
  22132. (_fread($10,2,1,$4)|0);
  22133. $11 = HEAP8[$2>>0]|0;
  22134. $12 = ($11<<24>>24)==(114);
  22135. $13 = HEAP8[$6>>0]|0;
  22136. $14 = ($13<<24>>24)==(82);
  22137. $or$cond = $12 | $14;
  22138. $15 = HEAP8[$7>>0]|0;
  22139. $16 = ($15<<24>>24)==(69);
  22140. $or$cond60 = $or$cond | $16;
  22141. $17 = HEAP8[$8>>0]|0;
  22142. $18 = ($17<<24>>24)==(83);
  22143. $or$cond62 = $or$cond60 | $18;
  22144. if ($or$cond62) {
  22145. $19 = HEAP16[$10>>1]|0;
  22146. $20 = ($19<<16>>16)==(0);
  22147. if ($20) {
  22148. $$0$lcssa = 0;
  22149. } else {
  22150. $21 = ((($3)) + 7|0);
  22151. $22 = HEAP16[$10>>1]|0;
  22152. $23 = $22&65535;
  22153. $24 = ((($3)) + 8|0);
  22154. $25 = ((($3)) + 4|0);
  22155. $26 = ((($3)) + 16|0);
  22156. $27 = ((($3)) + 20|0);
  22157. $28 = ((($3)) + 24|0);
  22158. $29 = ((($3)) + 28|0);
  22159. $30 = ((($3)) + 8|0);
  22160. $31 = ((($3)) + 5|0);
  22161. $32 = ((($3)) + 12|0);
  22162. $$05665 = 0;
  22163. while(1) {
  22164. (_fread($3,32,1,$4)|0);
  22165. $36 = HEAP8[$21>>0]|0;
  22166. $37 = $36&255;
  22167. $38 = ($37*24)|0;
  22168. $39 = (_malloc($38)|0);
  22169. $40 = HEAP32[$3>>2]|0;
  22170. $41 = ($40|0)==($1|0);
  22171. if ($41) {
  22172. $42 = HEAP8[$21>>0]|0;
  22173. $43 = ($42<<24>>24)==(0);
  22174. if (!($43)) {
  22175. $$05764 = 0;
  22176. while(1) {
  22177. $44 = HEAP8[$25>>0]|0;
  22178. $45 = $44&255;
  22179. $46 = (($39) + (($$05764*24)|0)|0);
  22180. HEAP32[$46>>2] = $45;
  22181. $47 = HEAP32[$26>>2]|0;
  22182. $48 = (((($39) + (($$05764*24)|0)|0)) + 4|0);
  22183. HEAP32[$48>>2] = $47;
  22184. $49 = HEAP32[$27>>2]|0;
  22185. $50 = (((($39) + (($$05764*24)|0)|0)) + 8|0);
  22186. HEAP32[$50>>2] = $49;
  22187. $51 = HEAP32[$28>>2]|0;
  22188. $52 = (((($39) + (($$05764*24)|0)|0)) + 12|0);
  22189. HEAP32[$52>>2] = $51;
  22190. $53 = HEAP32[$29>>2]|0;
  22191. $54 = (((($39) + (($$05764*24)|0)|0)) + 16|0);
  22192. HEAP32[$54>>2] = $53;
  22193. $55 = HEAP32[$30>>2]|0;
  22194. $56 = (_malloc($55)|0);
  22195. (_fread($56,$55,1,$4)|0);
  22196. $57 = HEAP8[$31>>0]|0;
  22197. $58 = ($57<<24>>24)==(1);
  22198. if ($58) {
  22199. $59 = HEAP32[$30>>2]|0;
  22200. $60 = HEAP32[$32>>2]|0;
  22201. $61 = (_DecompressData($56,$59,$60)|0);
  22202. $62 = (((($39) + (($$05764*24)|0)|0)) + 20|0);
  22203. HEAP32[$62>>2] = $61;
  22204. _free($56);
  22205. } else {
  22206. $63 = (((($39) + (($$05764*24)|0)|0)) + 20|0);
  22207. HEAP32[$63>>2] = $56;
  22208. }
  22209. $64 = (((($39) + (($$05764*24)|0)|0)) + 20|0);
  22210. $65 = HEAP32[$64>>2]|0;
  22211. $66 = ($65|0)==(0|0);
  22212. if (!($66)) {
  22213. $67 = HEAP32[$3>>2]|0;
  22214. HEAP32[$vararg_buffer4>>2] = $0;
  22215. $vararg_ptr7 = ((($vararg_buffer4)) + 4|0);
  22216. HEAP32[$vararg_ptr7>>2] = $67;
  22217. _TraceLog(0,11391,$vararg_buffer4);
  22218. }
  22219. (_fread($3,32,1,$4)|0);
  22220. $68 = (($$05764) + 1)|0;
  22221. $69 = HEAP8[$21>>0]|0;
  22222. $70 = $69&255;
  22223. $71 = ($68|0)<($70|0);
  22224. if ($71) {
  22225. $$05764 = $68;
  22226. } else {
  22227. break;
  22228. }
  22229. }
  22230. }
  22231. } else {
  22232. $72 = HEAP32[$24>>2]|0;
  22233. (_fseek($4,$72,1)|0);
  22234. }
  22235. $73 = (($$05665) + 1)|0;
  22236. $74 = ($73|0)<($23|0);
  22237. if ($74) {
  22238. $$05665 = $73;
  22239. } else {
  22240. $$0$lcssa = $39;
  22241. break;
  22242. }
  22243. }
  22244. }
  22245. $33 = ((($$0$lcssa)) + 20|0);
  22246. $34 = HEAP32[$33>>2]|0;
  22247. $35 = ($34|0)==(0|0);
  22248. if ($35) {
  22249. HEAP32[$vararg_buffer8>>2] = $0;
  22250. $vararg_ptr11 = ((($vararg_buffer8)) + 4|0);
  22251. HEAP32[$vararg_ptr11>>2] = $1;
  22252. _TraceLog(2,11437,$vararg_buffer8);
  22253. $$1 = $$0$lcssa;
  22254. } else {
  22255. $$1 = $$0$lcssa;
  22256. }
  22257. } else {
  22258. HEAP32[$vararg_buffer1>>2] = $0;
  22259. _TraceLog(2,11345,$vararg_buffer1);
  22260. $$1 = 0;
  22261. }
  22262. (_fclose($4)|0);
  22263. $$2 = $$1;
  22264. STACKTOP = sp;return ($$2|0);
  22265. }
  22266. function _LoadImagePro($0,$1,$2,$3,$4) {
  22267. $0 = $0|0;
  22268. $1 = $1|0;
  22269. $2 = $2|0;
  22270. $3 = $3|0;
  22271. $4 = $4|0;
  22272. var $$byval_copy = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
  22273. sp = STACKTOP;
  22274. STACKTOP = STACKTOP + 48|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(48|0);
  22275. $$byval_copy = sp + 20|0;
  22276. $5 = sp;
  22277. HEAP32[$5>>2] = $1;
  22278. $6 = ((($5)) + 4|0);
  22279. HEAP32[$6>>2] = $2;
  22280. $7 = ((($5)) + 8|0);
  22281. HEAP32[$7>>2] = $3;
  22282. $8 = ((($5)) + 12|0);
  22283. HEAP32[$8>>2] = 1;
  22284. $9 = ((($5)) + 16|0);
  22285. HEAP32[$9>>2] = $4;
  22286. ;HEAP32[$$byval_copy>>2]=HEAP32[$5>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$5+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[$5+8>>2]|0;HEAP32[$$byval_copy+12>>2]=HEAP32[$5+12>>2]|0;HEAP32[$$byval_copy+16>>2]=HEAP32[$5+16>>2]|0;
  22287. _ImageCopy($0,$$byval_copy);
  22288. STACKTOP = sp;return;
  22289. }
  22290. function _UnloadResource($0) {
  22291. $0 = $0|0;
  22292. var $1 = 0, $2 = 0, $3 = 0, label = 0, sp = 0;
  22293. sp = STACKTOP;
  22294. $1 = ((($0)) + 20|0);
  22295. $2 = HEAP32[$1>>2]|0;
  22296. $3 = ($2|0)==(0|0);
  22297. if ($3) {
  22298. return;
  22299. }
  22300. _free($2);
  22301. return;
  22302. }
  22303. function _ImageCopy($0,$1) {
  22304. $0 = $0|0;
  22305. $1 = $1|0;
  22306. var $$0 = 0, $$sroa$6$0 = 0, $$sroa$6$0$$sroa_idx10 = 0, $$sroa$7$0 = 0, $$sroa$7$0$$sroa_idx12 = 0, $$sroa$8$0 = 0, $$sroa$8$0$$sroa_idx14 = 0, $$sroa$9$0 = 0, $$sroa$9$0$$sroa_idx16 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0;
  22307. var $20 = 0, $21 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, label = 0, sp = 0;
  22308. sp = STACKTOP;
  22309. STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
  22310. $vararg_buffer = sp;
  22311. $2 = ((($1)) + 4|0);
  22312. $3 = HEAP32[$2>>2]|0;
  22313. $4 = ((($1)) + 8|0);
  22314. $5 = HEAP32[$4>>2]|0;
  22315. $6 = Math_imul($5, $3)|0;
  22316. $7 = ((($1)) + 16|0);
  22317. $8 = HEAP32[$7>>2]|0;
  22318. switch ($8|0) {
  22319. case 17: case 14: case 11: case 10: case 1: {
  22320. $$0 = $6;
  22321. break;
  22322. }
  22323. case 6: case 5: case 3: case 2: {
  22324. $9 = $6 << 1;
  22325. $$0 = $9;
  22326. break;
  22327. }
  22328. case 4: {
  22329. $10 = ($6*3)|0;
  22330. $$0 = $10;
  22331. break;
  22332. }
  22333. case 7: {
  22334. $11 = $6 << 2;
  22335. $$0 = $11;
  22336. break;
  22337. }
  22338. case 16: case 15: case 13: case 12: case 9: case 8: {
  22339. $12 = (($6|0) / 2)&-1;
  22340. $$0 = $12;
  22341. break;
  22342. }
  22343. case 18: {
  22344. $13 = (($6|0) / 4)&-1;
  22345. $$0 = $13;
  22346. break;
  22347. }
  22348. default: {
  22349. _TraceLog(2,11263,$vararg_buffer);
  22350. $$0 = $6;
  22351. }
  22352. }
  22353. $14 = (_malloc($$0)|0);
  22354. $15 = ($14|0)==(0|0);
  22355. if ($15) {
  22356. $$sroa$6$0 = 0;$$sroa$7$0 = 0;$$sroa$8$0 = 0;$$sroa$9$0 = 0;
  22357. } else {
  22358. $16 = HEAP32[$1>>2]|0;
  22359. _memcpy(($14|0),($16|0),($$0|0))|0;
  22360. $17 = HEAP32[$2>>2]|0;
  22361. $18 = HEAP32[$4>>2]|0;
  22362. $19 = ((($1)) + 12|0);
  22363. $20 = HEAP32[$19>>2]|0;
  22364. $21 = HEAP32[$7>>2]|0;
  22365. $$sroa$6$0 = $17;$$sroa$7$0 = $18;$$sroa$8$0 = $20;$$sroa$9$0 = $21;
  22366. }
  22367. HEAP32[$0>>2] = $14;
  22368. $$sroa$6$0$$sroa_idx10 = ((($0)) + 4|0);
  22369. HEAP32[$$sroa$6$0$$sroa_idx10>>2] = $$sroa$6$0;
  22370. $$sroa$7$0$$sroa_idx12 = ((($0)) + 8|0);
  22371. HEAP32[$$sroa$7$0$$sroa_idx12>>2] = $$sroa$7$0;
  22372. $$sroa$8$0$$sroa_idx14 = ((($0)) + 12|0);
  22373. HEAP32[$$sroa$8$0$$sroa_idx14>>2] = $$sroa$8$0;
  22374. $$sroa$9$0$$sroa_idx16 = ((($0)) + 16|0);
  22375. HEAP32[$$sroa$9$0$$sroa_idx16>>2] = $$sroa$9$0;
  22376. STACKTOP = sp;return;
  22377. }
  22378. function _DecompressData($0,$1,$2) {
  22379. $0 = $0|0;
  22380. $1 = $1|0;
  22381. $2 = $2|0;
  22382. var $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer10 = 0, $vararg_buffer3 = 0, $vararg_buffer5 = 0, $vararg_buffer7 = 0, $vararg_ptr13 = 0, label = 0, sp = 0;
  22383. sp = STACKTOP;
  22384. STACKTOP = STACKTOP + 48|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(48|0);
  22385. $vararg_buffer10 = sp + 40|0;
  22386. $vararg_buffer7 = sp + 32|0;
  22387. $vararg_buffer5 = sp + 24|0;
  22388. $vararg_buffer3 = sp + 16|0;
  22389. $vararg_buffer1 = sp + 8|0;
  22390. $vararg_buffer = sp;
  22391. $3 = (_malloc($2)|0);
  22392. $4 = ($3|0)==(0|0);
  22393. if ($4) {
  22394. _TraceLog(2,11487,$vararg_buffer);
  22395. STACKTOP = sp;return ($3|0);
  22396. }
  22397. $5 = (_tinfl_decompress_mem_to_mem($3,$2,$0,$1,1)|0);
  22398. $6 = ($5|0)==(-1);
  22399. if ($6) {
  22400. _TraceLog(2,11526,$vararg_buffer1);
  22401. _free($3);
  22402. }
  22403. $7 = ($5|0)==($2|0);
  22404. if (!($7)) {
  22405. _TraceLog(2,11552,$vararg_buffer3);
  22406. HEAP32[$vararg_buffer5>>2] = $2;
  22407. _TraceLog(2,11615,$vararg_buffer5);
  22408. HEAP32[$vararg_buffer7>>2] = $5;
  22409. _TraceLog(2,11650,$vararg_buffer7);
  22410. }
  22411. HEAP32[$vararg_buffer10>>2] = $1;
  22412. $vararg_ptr13 = ((($vararg_buffer10)) + 4|0);
  22413. HEAP32[$vararg_ptr13>>2] = $5;
  22414. _TraceLog(0,11685,$vararg_buffer10);
  22415. STACKTOP = sp;return ($3|0);
  22416. }
  22417. function _tinfl_decompress_mem_to_mem($0,$1,$2,$3,$4) {
  22418. $0 = $0|0;
  22419. $1 = $1|0;
  22420. $2 = $2|0;
  22421. $3 = $3|0;
  22422. $4 = $4|0;
  22423. var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
  22424. sp = STACKTOP;
  22425. STACKTOP = STACKTOP + 11008|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(11008|0);
  22426. $5 = sp + 11000|0;
  22427. $6 = sp;
  22428. $7 = sp + 8|0;
  22429. HEAP32[$5>>2] = $1;
  22430. HEAP32[$6>>2] = $3;
  22431. HEAP32[$7>>2] = 0;
  22432. $8 = $4 & -7;
  22433. $9 = $8 | 4;
  22434. $10 = (_tinfl_decompress($7,$2,$6,$0,$0,$5,$9)|0);
  22435. $11 = ($10|0)!=(0);
  22436. $12 = HEAP32[$5>>2]|0;
  22437. $13 = $11 ? -1 : $12;
  22438. STACKTOP = sp;return ($13|0);
  22439. }
  22440. function _tinfl_decompress($0,$1,$2,$3,$4,$5,$6) {
  22441. $0 = $0|0;
  22442. $1 = $1|0;
  22443. $2 = $2|0;
  22444. $3 = $3|0;
  22445. $4 = $4|0;
  22446. $5 = $5|0;
  22447. $6 = $6|0;
  22448. var $$ = 0, $$$301127 = 0, $$010861840 = 0, $$010871839 = 0, $$010881838 = 0, $$010911856 = 0, $$010941846 = 0, $$010951864 = 0, $$01097 = 0, $$01194 = 0, $$011971855 = 0, $$01202 = 0, $$01202$shrunk = 0, $$01203 = 0, $$01300 = 0, $$01300$shrunk = 0, $$01309 = 0, $$01410 = 0, $$01410$shrunk = 0, $$01411 = 0;
  22449. var $$01411$shrunk = 0, $$01412 = 0, $$01413 = 0, $$01413$shrunk = 0, $$01416 = 0, $$01507 = 0, $$01607 = 0, $$01834 = 0, $$0937$lcssa = 0, $$09371833 = 0, $$0938$lcssa = 0, $$09381832 = 0, $$0941$lcssa = 0, $$09411816 = 0, $$09431831 = 0, $$09441830 = 0, $$0947 = 0, $$0947$shrunk = 0, $$0948 = 0, $$0949 = 0;
  22450. var $$0950 = 0, $$0950$shrunk = 0, $$0951 = 0, $$0952 = 0, $$0952$shrunk = 0, $$0953 = 0, $$0956 = 0, $$0959 = 0, $$0959$shrunk = 0, $$0960 = 0, $$0963 = 0, $$0967 = 0, $$0971 = 0, $$0971$shrunk = 0, $$0972 = 0, $$0975 = 0, $$0978 = 0, $$0979 = 0, $$0979$shrunk = 0, $$0980 = 0;
  22451. var $$0980$shrunk = 0, $$0981 = 0, $$0984 = 0, $$0987 = 0, $$0991 = 0, $$1$lcssa = 0, $$100 = 0, $$1001409 = 0, $$101426 = 0, $$101617 = 0, $$110891852 = 0, $$11098 = 0, $$11098$ph = 0, $$111427 = 0, $$111518 = 0, $$111618 = 0, $$11198 = 0, $$11204 = 0, $$11204$ph = 0, $$11310 = 0;
  22452. var $$11310$ph = 0, $$11417 = 0, $$11508 = 0, $$11608 = 0, $$11818 = 0, $$121428 = 0, $$121428$ph = 0, $$121519 = 0, $$121619 = 0, $$121619$ph = 0, $$13 = 0, $$131004 = 0, $$131110 = 0, $$131216 = 0, $$131322 = 0, $$131429 = 0, $$131520 = 0, $$131620 = 0, $$14 = 0, $$141005 = 0;
  22453. var $$141111 = 0, $$141217 = 0, $$141323 = 0, $$141430 = 0, $$141521 = 0, $$141621 = 0, $$15 = 0, $$151006 = 0, $$151112 = 0, $$151218 = 0, $$151324 = 0, $$151431 = 0, $$151522 = 0, $$151622 = 0, $$16 = 0, $$161007 = 0, $$161113 = 0, $$161113$ph = 0, $$161219 = 0, $$161325 = 0;
  22454. var $$161432 = 0, $$161523 = 0, $$161623 = 0, $$17 = 0, $$17$ph = 0, $$171008 = 0, $$171008$ph = 0, $$171114 = 0, $$171220 = 0, $$171220$ph = 0, $$171326 = 0, $$171326$ph = 0, $$171433 = 0, $$171524 = 0, $$171624 = 0, $$1753 = 0, $$1754 = 0, $$18 = 0, $$181009 = 0, $$181115 = 0;
  22455. var $$181221 = 0, $$181327 = 0, $$181434 = 0, $$181525 = 0, $$181625 = 0, $$19 = 0, $$191010 = 0, $$191116 = 0, $$191222 = 0, $$191328 = 0, $$191435 = 0, $$191526 = 0, $$191626 = 0, $$1939$lcssa = 0, $$19391817 = 0, $$19421823 = 0, $$1945$lcssa = 0, $$19451815 = 0, $$1954 = 0, $$1957 = 0;
  22456. var $$1961 = 0, $$1961$ = 0, $$1964 = 0, $$1968 = 0, $$1973 = 0, $$1976 = 0, $$1982 = 0, $$1985 = 0, $$1988 = 0, $$1988$ph = 0, $$1992 = 0, $$1992$ph = 0, $$2$lcssa = 0, $$20 = 0, $$201011 = 0, $$201117 = 0, $$201223 = 0, $$201329 = 0, $$201436 = 0, $$201527 = 0;
  22457. var $$201627 = 0, $$21 = 0, $$21099 = 0, $$211012 = 0, $$211118 = 0, $$211224 = 0, $$211330 = 0, $$211437 = 0, $$211437$ph = 0, $$211528 = 0, $$211628 = 0, $$211628$ph = 0, $$21196 = 0, $$21199$lcssa = 0, $$211991845 = 0, $$21205 = 0, $$21311 = 0, $$21418 = 0, $$21509 = 0, $$21609 = 0;
  22458. var $$21825 = 0, $$22 = 0, $$221013 = 0, $$221119 = 0, $$221225 = 0, $$221331 = 0, $$221438 = 0, $$221529 = 0, $$221629 = 0, $$23 = 0, $$231014 = 0, $$231120 = 0, $$231226 = 0, $$231332 = 0, $$231439 = 0, $$231530 = 0, $$231630 = 0, $$24 = 0, $$241015 = 0, $$241121 = 0;
  22459. var $$241227 = 0, $$241333 = 0, $$241440 = 0, $$241531 = 0, $$241631 = 0, $$25 = 0, $$251016 = 0, $$251122 = 0, $$251122$ph = 0, $$251228 = 0, $$251334 = 0, $$251441 = 0, $$251532 = 0, $$251632 = 0, $$26 = 0, $$26$ph = 0, $$261017 = 0, $$261017$ph = 0, $$261123 = 0, $$261229 = 0;
  22460. var $$261229$ph = 0, $$261335 = 0, $$261335$ph = 0, $$261442 = 0, $$261533 = 0, $$261633 = 0, $$27 = 0, $$271018 = 0, $$271124 = 0, $$271230 = 0, $$271336 = 0, $$271443 = 0, $$271534 = 0, $$271634 = 0, $$28 = 0, $$281019 = 0, $$281125 = 0, $$281231 = 0, $$281337 = 0, $$281444 = 0;
  22461. var $$281535 = 0, $$281635 = 0, $$29 = 0, $$291020 = 0, $$291126 = 0, $$291232 = 0, $$291338 = 0, $$291445 = 0, $$291536 = 0, $$291636 = 0, $$2940$lcssa = 0, $$29401824 = 0, $$2946$lcssa = 0, $$29461822 = 0, $$2955 = 0, $$2958 = 0, $$2965 = 0, $$2969 = 0, $$2974 = 0, $$2977 = 0;
  22462. var $$2983 = 0, $$2986 = 0, $$2989 = 0, $$2993 = 0, $$30 = 0, $$301021 = 0, $$301127 = 0, $$301233 = 0, $$301339 = 0, $$301446 = 0, $$301537 = 0, $$301637 = 0, $$31 = 0, $$31100$v = 0, $$311022 = 0, $$311128 = 0, $$311234 = 0, $$311340 = 0, $$311447 = 0, $$311538 = 0;
  22463. var $$311638 = 0, $$31200 = 0, $$31206 = 0, $$31206$ph = 0, $$31312 = 0, $$31312$ph = 0, $$31419 = 0, $$31419$ph = 0, $$31610 = 0, $$31610$ph = 0, $$32 = 0, $$321023 = 0, $$321129 = 0, $$321235 = 0, $$321341 = 0, $$321448 = 0, $$321448$ph = 0, $$321539 = 0, $$321639 = 0, $$321639$ph = 0;
  22464. var $$33 = 0, $$331024 = 0, $$331130 = 0, $$331236 = 0, $$331342 = 0, $$331449 = 0, $$331540 = 0, $$331640 = 0, $$34 = 0, $$341025 = 0, $$341131 = 0, $$341237 = 0, $$341343 = 0, $$341450 = 0, $$341541 = 0, $$341641 = 0, $$35 = 0, $$351026 = 0, $$351132 = 0, $$351238 = 0;
  22465. var $$351344 = 0, $$351451 = 0, $$351542 = 0, $$351642 = 0, $$36 = 0, $$361027 = 0, $$361027$ph = 0, $$361133 = 0, $$361133$ph = 0, $$361239 = 0, $$361345 = 0, $$361452 = 0, $$361543 = 0, $$361643 = 0, $$37 = 0, $$37$ph = 0, $$371028 = 0, $$371134 = 0, $$371240 = 0, $$371240$ph = 0;
  22466. var $$371346 = 0, $$371346$ph = 0, $$371453 = 0, $$371453$ph = 0, $$371544 = 0, $$371644 = 0, $$371644$ph = 0, $$38 = 0, $$381029 = 0, $$381135 = 0, $$381241 = 0, $$381347 = 0, $$381454 = 0, $$381545 = 0, $$381645 = 0, $$39 = 0, $$391030 = 0, $$391136 = 0, $$391242 = 0, $$391348 = 0;
  22467. var $$391455 = 0, $$391546 = 0, $$391646 = 0, $$3966 = 0, $$3970 = 0, $$3990 = 0, $$3990$ph = 0, $$3994 = 0, $$3994$ph = 0, $$40 = 0, $$401031 = 0, $$401137 = 0, $$401243 = 0, $$401349 = 0, $$401456 = 0, $$401547 = 0, $$401647 = 0, $$41 = 0, $$411032 = 0, $$411032$ph = 0;
  22468. var $$411138 = 0, $$411138$ph = 0, $$411244 = 0, $$411350 = 0, $$411457 = 0, $$411548 = 0, $$411648 = 0, $$41201 = 0, $$41420 = 0, $$41511 = 0, $$41611 = 0, $$42 = 0, $$42$ph = 0, $$421033 = 0, $$421139 = 0, $$421245 = 0, $$421245$ph = 0, $$421351 = 0, $$421351$ph = 0, $$421458 = 0;
  22469. var $$421549 = 0, $$421649 = 0, $$43 = 0, $$431034 = 0, $$431140 = 0, $$431246 = 0, $$431352 = 0, $$431459 = 0, $$431550 = 0, $$431650 = 0, $$44 = 0, $$441035 = 0, $$441141 = 0, $$441247 = 0, $$441353 = 0, $$441460 = 0, $$441460$ph = 0, $$441551 = 0, $$441651 = 0, $$441651$ph = 0;
  22470. var $$45 = 0, $$451036 = 0, $$451142 = 0, $$451248 = 0, $$451354 = 0, $$451461 = 0, $$451552 = 0, $$451652 = 0, $$46 = 0, $$461037 = 0, $$461143 = 0, $$461249 = 0, $$461355 = 0, $$461462 = 0, $$461553 = 0, $$461653 = 0, $$47 = 0, $$471038 = 0, $$471144 = 0, $$471250 = 0;
  22471. var $$471356 = 0, $$471463 = 0, $$471554 = 0, $$471654 = 0, $$48 = 0, $$481039 = 0, $$481039$ph = 0, $$481145 = 0, $$481145$ph = 0, $$481251 = 0, $$481357 = 0, $$481464 = 0, $$481555 = 0, $$481655 = 0, $$49 = 0, $$49$ph = 0, $$491040 = 0, $$491146 = 0, $$491252 = 0, $$491252$ph = 0;
  22472. var $$491358 = 0, $$491358$ph = 0, $$491465 = 0, $$491465$ph = 0, $$491556 = 0, $$491656 = 0, $$491656$ph = 0, $$5 = 0, $$50 = 0, $$501041 = 0, $$501147 = 0, $$501253 = 0, $$501359 = 0, $$501466 = 0, $$501557 = 0, $$501657 = 0, $$51 = 0, $$51102 = 0, $$511042 = 0, $$511148 = 0;
  22473. var $$511254 = 0, $$511360 = 0, $$511467 = 0, $$511558 = 0, $$511658 = 0, $$51208 = 0, $$51314 = 0, $$51512 = 0, $$52 = 0, $$521043 = 0, $$521043$ph = 0, $$521149 = 0, $$521255 = 0, $$521361 = 0, $$521468 = 0, $$521559 = 0, $$521659 = 0, $$53 = 0, $$531044 = 0, $$531150 = 0;
  22474. var $$531150$ph = 0, $$531256 = 0, $$531362 = 0, $$531469 = 0, $$531560 = 0, $$531660 = 0, $$54 = 0, $$54$ph = 0, $$541045 = 0, $$541151 = 0, $$541257 = 0, $$541257$ph = 0, $$541363 = 0, $$541363$ph = 0, $$541470$ph = 0, $$541561 = 0, $$541661$lcssa = 0, $$541661$ph = 0, $$5416611868 = 0, $$55 = 0;
  22475. var $$551046 = 0, $$551152 = 0, $$551258 = 0, $$551364 = 0, $$551471 = 0, $$551562 = 0, $$551662 = 0, $$56 = 0, $$561047 = 0, $$561153 = 0, $$561259 = 0, $$561365 = 0, $$561472 = 0, $$561563 = 0, $$561663 = 0, $$57 = 0, $$571048$ph = 0, $$571154 = 0, $$571260 = 0, $$571366 = 0;
  22476. var $$571473 = 0, $$571473$ph = 0, $$571564 = 0, $$571664 = 0, $$571664$ph = 0, $$58 = 0, $$581049 = 0, $$581155$lcssa = 0, $$581155$ph = 0, $$5811551871 = 0, $$581261 = 0, $$581367 = 0, $$581474 = 0, $$581565$lcssa = 0, $$581565$ph = 0, $$5815651869 = 0, $$581665 = 0, $$59$lcssa = 0, $$59$ph = 0, $$591050 = 0;
  22477. var $$591156 = 0, $$591262$ph = 0, $$591368$lcssa = 0, $$591368$ph = 0, $$5913681870 = 0, $$591475 = 0, $$591566 = 0, $$591666 = 0, $$591872 = 0, $$5996 = 0, $$6 = 0, $$60 = 0, $$601051 = 0, $$601051$ph = 0, $$601157 = 0, $$601263 = 0, $$601369 = 0, $$601476 = 0, $$601567 = 0, $$61 = 0;
  22478. var $$61103 = 0, $$611052 = 0, $$611158 = 0, $$611158$ph = 0, $$611264 = 0, $$611370 = 0, $$611477 = 0, $$611568 = 0, $$611668 = 0, $$61209 = 0, $$61315 = 0, $$61513 = 0, $$62 = 0, $$62$ph = 0, $$621053 = 0, $$621159 = 0, $$621265 = 0, $$621265$ph = 0, $$621371 = 0, $$621371$ph = 0;
  22479. var $$621478 = 0, $$621569 = 0, $$621669 = 0, $$63 = 0, $$631054 = 0, $$631266 = 0, $$631372 = 0, $$631479 = 0, $$631479$ph = 0, $$631570 = 0, $$631670 = 0, $$64 = 0, $$641055 = 0, $$641161 = 0, $$641267 = 0, $$641373 = 0, $$641480 = 0, $$641571 = 0, $$641671 = 0, $$641671$ph = 0;
  22480. var $$65 = 0, $$651056 = 0, $$651162 = 0, $$651268 = 0, $$651374 = 0, $$651481 = 0, $$651572 = 0, $$651672 = 0, $$66 = 0, $$661057 = 0, $$661057$ph = 0, $$661163 = 0, $$661269 = 0, $$661375 = 0, $$661482 = 0, $$661673 = 0, $$671058 = 0, $$671164 = 0, $$671164$ph = 0, $$671270 = 0;
  22481. var $$671483 = 0, $$671574 = 0, $$671674 = 0, $$68 = 0, $$681059 = 0, $$681165 = 0, $$681271 = 0, $$681271$ph = 0, $$681377 = 0, $$681484 = 0, $$681484$ph = 0, $$681575 = 0, $$681675 = 0, $$69 = 0, $$691060 = 0, $$691166 = 0, $$691272 = 0, $$691378 = 0, $$691485 = 0, $$691576 = 0;
  22482. var $$691676 = 0, $$691676$ph = 0, $$6997 = 0, $$7 = 0, $$70 = 0, $$701061 = 0, $$701167 = 0, $$701273 = 0, $$701379 = 0, $$701486 = 0, $$701577 = 0, $$701677 = 0, $$71 = 0, $$71$ph = 0, $$71104 = 0, $$711062 = 0, $$711062$ph = 0, $$711168 = 0, $$711274 = 0, $$711380 = 0;
  22483. var $$711380$ph = 0, $$711487 = 0, $$711578 = 0, $$711678 = 0, $$71210 = 0, $$71316 = 0, $$71514 = 0, $$72 = 0, $$721063 = 0, $$721169 = 0, $$721169$ph = 0, $$721275 = 0, $$721381 = 0, $$721488 = 0, $$721488$ph = 0, $$721579 = 0, $$721679 = 0, $$73 = 0, $$731064 = 0, $$731170 = 0;
  22484. var $$731276 = 0, $$731276$ph = 0, $$731382 = 0, $$731489 = 0, $$731580 = 0, $$731680 = 0, $$731680$ph = 0, $$74 = 0, $$741065 = 0, $$741065$ph = 0, $$741171 = 0, $$741277 = 0, $$741383 = 0, $$741490 = 0, $$741581 = 0, $$741681 = 0, $$75 = 0, $$751066 = 0, $$751172 = 0, $$751278 = 0;
  22485. var $$751384 = 0, $$751491 = 0, $$751582 = 0, $$751682 = 0, $$76 = 0, $$76$ph = 0, $$761067 = 0, $$761173 = 0, $$761173$ph = 0, $$761279 = 0, $$761279$ph = 0, $$761385 = 0, $$761385$ph = 0, $$761492 = 0, $$761583 = 0, $$761683 = 0, $$77 = 0, $$771068 = 0, $$771174 = 0, $$771280 = 0;
  22486. var $$771386 = 0, $$771584 = 0, $$771684 = 0, $$78 = 0, $$781069 = 0, $$781175 = 0, $$781281 = 0, $$781387 = 0, $$781585 = 0, $$781685 = 0, $$79 = 0, $$791070 = 0, $$791176 = 0, $$791282 = 0, $$791388 = 0, $$791586 = 0, $$791686 = 0, $$7998 = 0, $$8 = 0, $$8$ph = 0;
  22487. var $$80 = 0, $$80$ph = 0, $$801071 = 0, $$801177 = 0, $$801283 = 0, $$801389 = 0, $$801389$ph = 0, $$801496 = 0, $$801587 = 0, $$801687 = 0, $$81 = 0, $$81105 = 0, $$81105$ph = 0, $$811178 = 0, $$811284 = 0, $$811390 = 0, $$811497 = 0, $$811588 = 0, $$81211 = 0, $$81211$ph = 0;
  22488. var $$81317 = 0, $$81317$ph = 0, $$81424 = 0, $$81515 = 0, $$81615 = 0, $$82 = 0, $$821179 = 0, $$821285 = 0, $$821391 = 0, $$821498 = 0, $$821589 = 0, $$83 = 0, $$831180 = 0, $$831392 = 0, $$831499 = 0, $$831590 = 0, $$84 = 0, $$841075 = 0, $$841393 = 0, $$841500 = 0;
  22489. var $$841500$ph = 0, $$841591 = 0, $$841691 = 0, $$85 = 0, $$851076 = 0, $$851394 = 0, $$851501 = 0, $$851592 = 0, $$851692 = 0, $$86 = 0, $$861077 = 0, $$861289 = 0, $$861395 = 0, $$861502 = 0, $$861693 = 0, $$871078 = 0, $$871184 = 0, $$871290 = 0, $$871503 = 0, $$871694 = 0;
  22490. var $$881079 = 0, $$881079$ph = 0, $$881185 = 0, $$881291 = 0, $$881504 = 0, $$881595 = 0, $$881695 = 0, $$881695$ph = 0, $$891080 = 0, $$891186 = 0, $$891292 = 0, $$891505 = 0, $$891596 = 0, $$891696 = 0, $$8999 = 0, $$8999$ph = 0, $$9 = 0, $$90 = 0, $$901081 = 0, $$901187 = 0;
  22491. var $$901187$ph = 0, $$901293 = 0, $$901293$ph = 0, $$901399 = 0, $$901506 = 0, $$901597 = 0, $$901697 = 0, $$91 = 0, $$91000 = 0, $$91106 = 0, $$911082 = 0, $$911188 = 0, $$911294 = 0, $$911400 = 0, $$911598 = 0, $$911698 = 0, $$91212 = 0, $$91318 = 0, $$91425 = 0, $$91616 = 0;
  22492. var $$92 = 0, $$921083 = 0, $$921189 = 0, $$921295 = 0, $$921401 = 0, $$921599 = 0, $$921699 = 0, $$93 = 0, $$931084 = 0, $$931190 = 0, $$931296 = 0, $$931402 = 0, $$931600 = 0, $$931700 = 0, $$94 = 0, $$94$ph = 0, $$941085 = 0, $$941191 = 0, $$941297 = 0, $$941403 = 0;
  22493. var $$941403$ph = 0, $$941601 = 0, $$941701 = 0, $$95 = 0, $$951192 = 0, $$951298 = 0, $$951404 = 0, $$951602 = 0, $$96 = 0, $$961193 = 0, $$961299 = 0, $$961405 = 0, $$961603 = 0, $$97 = 0, $$971406 = 0, $$971604 = 0, $$98 = 0, $$981407 = 0, $$981605 = 0, $$99 = 0;
  22494. var $$991408 = 0, $$991606 = 0, $$lcssa1778 = 0, $$lcssa1779 = 0, $$lcssa1799 = 0, $$lcssa1802 = 0, $$not = 0, $$not1747 = 0, $$sink12 = 0, $$sink13 = 0, $$sink16 = 0, $$sink17 = 0, $$sink1705 = 0, $$sink1710 = 0, $$sink1713 = 0, $$sink1716 = 0, $$sink1719 = 0, $$sink1722 = 0, $$sink1729 = 0, $$sink1732 = 0;
  22495. var $$sink1736 = 0, $$sink1739 = 0, $$sink1743 = 0, $$sink1746 = 0, $$sink1750 = 0, $$sink3 = 0, $$sink3$shrunk = 0, $$sink30 = 0, $$sink9 = 0, $$sink9$shrunk = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0;
  22496. var $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0;
  22497. var $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0;
  22498. var $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0;
  22499. var $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0;
  22500. var $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0;
  22501. var $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0;
  22502. var $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0;
  22503. var $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0;
  22504. var $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0;
  22505. var $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0;
  22506. var $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0;
  22507. var $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0, $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0, $321 = 0, $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0;
  22508. var $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0, $332 = 0, $333 = 0, $334 = 0, $335 = 0, $336 = 0, $337 = 0, $338 = 0, $339 = 0, $34 = 0, $340 = 0, $341 = 0, $342 = 0, $343 = 0, $344 = 0;
  22509. var $345 = 0, $346 = 0, $347 = 0, $348 = 0, $349 = 0, $35 = 0, $350 = 0, $351 = 0, $352 = 0, $353 = 0, $354 = 0, $355 = 0, $356 = 0, $357 = 0, $358 = 0, $359 = 0, $36 = 0, $360 = 0, $361 = 0, $362 = 0;
  22510. var $363 = 0, $364 = 0, $365 = 0, $366 = 0, $367 = 0, $368 = 0, $369 = 0, $37 = 0, $370 = 0, $371 = 0, $372 = 0, $373 = 0, $374 = 0, $375 = 0, $376 = 0, $377 = 0, $378 = 0, $379 = 0, $38 = 0, $380 = 0;
  22511. var $381 = 0, $382 = 0, $383 = 0, $384 = 0, $385 = 0, $386 = 0, $387 = 0, $388 = 0, $389 = 0, $39 = 0, $390 = 0, $391 = 0, $392 = 0, $393 = 0, $394 = 0, $395 = 0, $396 = 0, $397 = 0, $398 = 0, $399 = 0;
  22512. var $40 = 0, $400 = 0, $401 = 0, $402 = 0, $403 = 0, $404 = 0, $405 = 0, $406 = 0, $407 = 0, $408 = 0, $409 = 0, $41 = 0, $410 = 0, $411 = 0, $412 = 0, $413 = 0, $414 = 0, $415 = 0, $416 = 0, $417 = 0;
  22513. var $418 = 0, $419 = 0, $42 = 0, $420 = 0, $421 = 0, $422 = 0, $423 = 0, $424 = 0, $425 = 0, $426 = 0, $427 = 0, $428 = 0, $429 = 0, $43 = 0, $430 = 0, $431 = 0, $432 = 0, $433 = 0, $434 = 0, $435 = 0;
  22514. var $436 = 0, $437 = 0, $438 = 0, $439 = 0, $44 = 0, $440 = 0, $441 = 0, $442 = 0, $443 = 0, $444 = 0, $445 = 0, $446 = 0, $447 = 0, $448 = 0, $449 = 0, $45 = 0, $450 = 0, $451 = 0, $452 = 0, $453 = 0;
  22515. var $454 = 0, $455 = 0, $456 = 0, $457 = 0, $458 = 0, $459 = 0, $46 = 0, $460 = 0, $461 = 0, $462 = 0, $463 = 0, $464 = 0, $465 = 0, $466 = 0, $467 = 0, $468 = 0, $469 = 0, $47 = 0, $470 = 0, $471 = 0;
  22516. var $472 = 0, $473 = 0, $474 = 0, $475 = 0, $476 = 0, $477 = 0, $478 = 0, $479 = 0, $48 = 0, $480 = 0, $481 = 0, $482 = 0, $483 = 0, $484 = 0, $485 = 0, $486 = 0, $487 = 0, $488 = 0, $489 = 0, $49 = 0;
  22517. var $490 = 0, $491 = 0, $492 = 0, $493 = 0, $494 = 0, $495 = 0, $496 = 0, $497 = 0, $498 = 0, $499 = 0, $50 = 0, $500 = 0, $501 = 0, $502 = 0, $503 = 0, $504 = 0, $505 = 0, $506 = 0, $507 = 0, $508 = 0;
  22518. var $509 = 0, $51 = 0, $510 = 0, $511 = 0, $512 = 0, $513 = 0, $514 = 0, $515 = 0, $516 = 0, $517 = 0, $518 = 0, $519 = 0, $52 = 0, $520 = 0, $521 = 0, $522 = 0, $523 = 0, $524 = 0, $525 = 0, $526 = 0;
  22519. var $527 = 0, $528 = 0, $529 = 0, $53 = 0, $530 = 0, $531 = 0, $532 = 0, $533 = 0, $534 = 0, $535 = 0, $536 = 0, $537 = 0, $538 = 0, $539 = 0, $54 = 0, $540 = 0, $541 = 0, $542 = 0, $543 = 0, $544 = 0;
  22520. var $545 = 0, $546 = 0, $547 = 0, $548 = 0, $549 = 0, $55 = 0, $550 = 0, $551 = 0, $552 = 0, $553 = 0, $554 = 0, $555 = 0, $556 = 0, $557 = 0, $558 = 0, $559 = 0, $56 = 0, $560 = 0, $561 = 0, $562 = 0;
  22521. var $563 = 0, $564 = 0, $565 = 0, $566 = 0, $567 = 0, $568 = 0, $569 = 0, $57 = 0, $570 = 0, $571 = 0, $572 = 0, $573 = 0, $574 = 0, $575 = 0, $576 = 0, $577 = 0, $578 = 0, $579 = 0, $58 = 0, $580 = 0;
  22522. var $581 = 0, $582 = 0, $583 = 0, $584 = 0, $585 = 0, $586 = 0, $587 = 0, $588 = 0, $589 = 0, $59 = 0, $590 = 0, $591 = 0, $592 = 0, $593 = 0, $594 = 0, $595 = 0, $596 = 0, $597 = 0, $598 = 0, $599 = 0;
  22523. var $60 = 0, $600 = 0, $601 = 0, $602 = 0, $603 = 0, $604 = 0, $605 = 0, $606 = 0, $607 = 0, $608 = 0, $609 = 0, $61 = 0, $610 = 0, $611 = 0, $612 = 0, $613 = 0, $614 = 0, $615 = 0, $616 = 0, $617 = 0;
  22524. var $618 = 0, $619 = 0, $62 = 0, $620 = 0, $621 = 0, $622 = 0, $623 = 0, $624 = 0, $625 = 0, $626 = 0, $627 = 0, $628 = 0, $629 = 0, $63 = 0, $630 = 0, $631 = 0, $632 = 0, $633 = 0, $634 = 0, $635 = 0;
  22525. var $636 = 0, $637 = 0, $638 = 0, $639 = 0, $64 = 0, $640 = 0, $641 = 0, $642 = 0, $643 = 0, $644 = 0, $645 = 0, $646 = 0, $647 = 0, $648 = 0, $649 = 0, $65 = 0, $650 = 0, $651 = 0, $652 = 0, $653 = 0;
  22526. var $654 = 0, $655 = 0, $656 = 0, $657 = 0, $658 = 0, $659 = 0, $66 = 0, $660 = 0, $661 = 0, $662 = 0, $663 = 0, $664 = 0, $665 = 0, $666 = 0, $667 = 0, $668 = 0, $669 = 0, $67 = 0, $670 = 0, $671 = 0;
  22527. var $672 = 0, $673 = 0, $674 = 0, $675 = 0, $676 = 0, $677 = 0, $678 = 0, $679 = 0, $68 = 0, $680 = 0, $681 = 0, $682 = 0, $683 = 0, $684 = 0, $685 = 0, $686 = 0, $687 = 0, $688 = 0, $689 = 0, $69 = 0;
  22528. var $690 = 0, $691 = 0, $692 = 0, $693 = 0, $694 = 0, $695 = 0, $696 = 0, $697 = 0, $698 = 0, $699 = 0, $7 = 0, $70 = 0, $700 = 0, $701 = 0, $702 = 0, $703 = 0, $704 = 0, $705 = 0, $706 = 0, $707 = 0;
  22529. var $708 = 0, $709 = 0, $71 = 0, $710 = 0, $711 = 0, $712 = 0, $713 = 0, $714 = 0, $715 = 0, $716 = 0, $717 = 0, $718 = 0, $719 = 0, $72 = 0, $720 = 0, $721 = 0, $722 = 0, $723 = 0, $724 = 0, $725 = 0;
  22530. var $726 = 0, $727 = 0, $728 = 0, $729 = 0, $73 = 0, $730 = 0, $731 = 0, $732 = 0, $733 = 0, $734 = 0, $735 = 0, $736 = 0, $737 = 0, $738 = 0, $739 = 0, $74 = 0, $740 = 0, $741 = 0, $742 = 0, $743 = 0;
  22531. var $744 = 0, $745 = 0, $746 = 0, $747 = 0, $748 = 0, $749 = 0, $75 = 0, $750 = 0, $751 = 0, $752 = 0, $753 = 0, $754 = 0, $755 = 0, $756 = 0, $757 = 0, $758 = 0, $759 = 0, $76 = 0, $760 = 0, $761 = 0;
  22532. var $762 = 0, $763 = 0, $764 = 0, $765 = 0, $766 = 0, $767 = 0, $768 = 0, $769 = 0, $77 = 0, $770 = 0, $771 = 0, $772 = 0, $773 = 0, $774 = 0, $775 = 0, $776 = 0, $777 = 0, $778 = 0, $779 = 0, $78 = 0;
  22533. var $780 = 0, $781 = 0, $782 = 0, $783 = 0, $784 = 0, $785 = 0, $786 = 0, $787 = 0, $788 = 0, $789 = 0, $79 = 0, $790 = 0, $791 = 0, $792 = 0, $793 = 0, $794 = 0, $795 = 0, $796 = 0, $797 = 0, $798 = 0;
  22534. var $799 = 0, $8 = 0, $80 = 0, $800 = 0, $801 = 0, $802 = 0, $803 = 0, $804 = 0, $805 = 0, $806 = 0, $807 = 0, $808 = 0, $809 = 0, $81 = 0, $810 = 0, $811 = 0, $812 = 0, $813 = 0, $814 = 0, $815 = 0;
  22535. var $816 = 0, $817 = 0, $818 = 0, $819 = 0, $82 = 0, $820 = 0, $821 = 0, $822 = 0, $823 = 0, $824 = 0, $825 = 0, $826 = 0, $827 = 0, $828 = 0, $829 = 0, $83 = 0, $830 = 0, $831 = 0, $832 = 0, $833 = 0;
  22536. var $834 = 0, $835 = 0, $836 = 0, $837 = 0, $838 = 0, $839 = 0, $84 = 0, $840 = 0, $841 = 0, $842 = 0, $843 = 0, $844 = 0, $845 = 0, $846 = 0, $847 = 0, $848 = 0, $849 = 0, $85 = 0, $850 = 0, $851 = 0;
  22537. var $852 = 0, $853 = 0, $854 = 0, $855 = 0, $856 = 0, $857 = 0, $858 = 0, $859 = 0, $86 = 0, $860 = 0, $861 = 0, $862 = 0, $863 = 0, $864 = 0, $865 = 0, $866 = 0, $867 = 0, $868 = 0, $869 = 0, $87 = 0;
  22538. var $870 = 0, $871 = 0, $872 = 0, $873 = 0, $874 = 0, $875 = 0, $876 = 0, $877 = 0, $878 = 0, $879 = 0, $88 = 0, $880 = 0, $881 = 0, $882 = 0, $883 = 0, $884 = 0, $885 = 0, $886 = 0, $887 = 0, $888 = 0;
  22539. var $889 = 0, $89 = 0, $890 = 0, $891 = 0, $892 = 0, $893 = 0, $894 = 0, $895 = 0, $896 = 0, $897 = 0, $898 = 0, $899 = 0, $9 = 0, $90 = 0, $900 = 0, $901 = 0, $902 = 0, $903 = 0, $904 = 0, $905 = 0;
  22540. var $906 = 0, $907 = 0, $908 = 0, $909 = 0, $91 = 0, $910 = 0, $911 = 0, $912 = 0, $913 = 0, $914 = 0, $915 = 0, $916 = 0, $917 = 0, $918 = 0, $919 = 0, $92 = 0, $920 = 0, $921 = 0, $922 = 0, $923 = 0;
  22541. var $924 = 0, $925 = 0, $926 = 0, $927 = 0, $928 = 0, $929 = 0, $93 = 0, $930 = 0, $931 = 0, $932 = 0, $933 = 0, $934 = 0, $935 = 0, $936 = 0, $937 = 0, $938 = 0, $939 = 0, $94 = 0, $940 = 0, $941 = 0;
  22542. var $942 = 0, $943 = 0, $944 = 0, $945 = 0, $946 = 0, $947 = 0, $948 = 0, $949 = 0, $95 = 0, $950 = 0, $951 = 0, $952 = 0, $953 = 0, $954 = 0, $955 = 0, $956 = 0, $957 = 0, $958 = 0, $959 = 0, $96 = 0;
  22543. var $960 = 0, $961 = 0, $962 = 0, $963 = 0, $964 = 0, $965 = 0, $966 = 0, $97 = 0, $98 = 0, $99 = 0, $brmerge = 0, $exitcond = 0, $not$ = 0, $not$1755 = 0, $or$cond = 0, $or$cond1702 = 0, $or$cond1752 = 0, $or$cond24 = 0, $or$cond29 = 0, $scevgep = 0;
  22544. var $scevgep1947 = 0, $scevgep1948 = 0, $scevgep1955 = 0, $scevgep1957 = 0, $scevgep1959 = 0, $scevgep19611962 = 0, $trunc = 0, $trunc$clear = 0, dest = 0, label = 0, sp = 0, stop = 0;
  22545. sp = STACKTOP;
  22546. STACKTOP = STACKTOP + 144|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(144|0);
  22547. $7 = sp + 64|0;
  22548. $8 = sp;
  22549. $9 = HEAP32[$2>>2]|0;
  22550. $10 = (($1) + ($9)|0);
  22551. $11 = HEAP32[$5>>2]|0;
  22552. $12 = (($4) + ($11)|0);
  22553. $13 = $6 & 4;
  22554. $14 = ($13|0)!=(0);
  22555. $15 = $4;
  22556. $16 = $3;
  22557. $17 = $16 ^ -1;
  22558. $18 = (($15) + ($17))|0;
  22559. $19 = (($18) + ($11))|0;
  22560. $$1753 = $14 ? -1 : $19;
  22561. $20 = (($$1753) + 1)|0;
  22562. $21 = $20 & $$1753;
  22563. $22 = ($21|0)!=(0);
  22564. $23 = ($4>>>0)<($3>>>0);
  22565. $or$cond1702 = $23 | $22;
  22566. if ($or$cond1702) {
  22567. HEAP32[$5>>2] = 0;
  22568. HEAP32[$2>>2] = 0;
  22569. $$0951 = -3;
  22570. STACKTOP = sp;return ($$0951|0);
  22571. }
  22572. $24 = ((($0)) + 4|0);
  22573. $25 = HEAP32[$24>>2]|0;
  22574. $26 = ((($0)) + 56|0);
  22575. $27 = HEAP32[$26>>2]|0;
  22576. $28 = ((($0)) + 32|0);
  22577. $29 = HEAP32[$28>>2]|0;
  22578. $30 = ((($0)) + 36|0);
  22579. $31 = HEAP32[$30>>2]|0;
  22580. $32 = ((($0)) + 40|0);
  22581. $33 = HEAP32[$32>>2]|0;
  22582. $34 = ((($0)) + 60|0);
  22583. $35 = HEAP32[$34>>2]|0;
  22584. $36 = HEAP32[$0>>2]|0;
  22585. L5: do {
  22586. switch ($36|0) {
  22587. case 0: {
  22588. $37 = ((($0)) + 12|0);
  22589. HEAP32[$37>>2] = 0;
  22590. $38 = ((($0)) + 8|0);
  22591. HEAP32[$38>>2] = 0;
  22592. $39 = ((($0)) + 28|0);
  22593. HEAP32[$39>>2] = 1;
  22594. $40 = ((($0)) + 16|0);
  22595. HEAP32[$40>>2] = 1;
  22596. $41 = $6 & 1;
  22597. $42 = ($41|0)==(0);
  22598. if ($42) {
  22599. $$01416 = $35;$$01607 = $4;$$41511 = $1;$$5 = 0;$$51102 = 0;$$51208 = 0;$$51314 = 0;$$5996 = 0;
  22600. label = 14;
  22601. } else {
  22602. $43 = ($9|0)<(1);
  22603. if ($43) {
  22604. $$01097 = 0;$$01203 = 0;$$01309 = 0;$$0987 = 0;$$0991 = 0;
  22605. label = 6;
  22606. } else {
  22607. $$11098$ph = 0;$$11204$ph = 0;$$11310$ph = 0;$$1988$ph = 0;$$1992$ph = 0;
  22608. label = 8;
  22609. }
  22610. }
  22611. break;
  22612. }
  22613. case 1: {
  22614. $46 = ($9|0)>(0);
  22615. if ($46) {
  22616. $$11098$ph = $31;$$11204$ph = $33;$$11310$ph = $27;$$1988$ph = $25;$$1992$ph = $29;
  22617. label = 8;
  22618. } else {
  22619. $$01097 = $31;$$01203 = $33;$$01309 = $27;$$0987 = $25;$$0991 = $29;
  22620. label = 6;
  22621. }
  22622. break;
  22623. }
  22624. case 2: {
  22625. $53 = ($9|0)>(0);
  22626. if ($53) {
  22627. $$31206$ph = $33;$$31312$ph = $27;$$3990$ph = $25;$$3994$ph = $29;$$sink1705 = $1;
  22628. label = 12;
  22629. } else {
  22630. $$11508 = $1;$$21099 = $31;$$21205 = $33;$$21311 = $27;$$2989 = $25;$$2993 = $29;
  22631. label = 10;
  22632. }
  22633. break;
  22634. }
  22635. case 36: {
  22636. $$0960 = -1;$$891505 = $35;$$931084 = $29;$$931700 = $4;$$951192 = $31;$$951298 = $33;$$981605 = $1;$$99 = $25;$$991408 = $27;$$sink30 = 36;
  22637. label = 243;
  22638. break;
  22639. }
  22640. case 3: {
  22641. $75 = ($9|0)>(0);
  22642. if ($75) {
  22643. $$31419$ph = $35;$$31610$ph = $4;$$8$ph = $25;$$81105$ph = $31;$$81211$ph = $33;$$81317$ph = $27;$$8999$ph = $29;$$sink1710 = $1;
  22644. label = 18;
  22645. } else {
  22646. $$21418 = $35;$$21609 = $4;$$61513 = $1;$$7 = $25;$$71104 = $31;$$71210 = $33;$$71316 = $27;$$7998 = $29;
  22647. label = 16;
  22648. }
  22649. break;
  22650. }
  22651. case 5: {
  22652. $90 = ($9|0)>(0);
  22653. if ($90) {
  22654. $91 = ((($1)) + 1|0);
  22655. $92 = HEAP8[$1>>0]|0;
  22656. $93 = $92&255;
  22657. $$01412 = $93;$$111518 = $91;
  22658. } else {
  22659. $88 = $6 & 2;
  22660. $89 = ($88|0)==(0);
  22661. if ($89) {
  22662. $$01412 = 0;$$111518 = $1;
  22663. } else {
  22664. $$0960 = 1;$$891505 = $35;$$931084 = $29;$$931700 = $4;$$951192 = $31;$$951298 = $33;$$981605 = $1;$$99 = $25;$$991408 = $27;$$sink30 = 5;
  22665. label = 243;
  22666. break L5;
  22667. }
  22668. }
  22669. $94 = $$01412 << $25;
  22670. $95 = $94 | $27;
  22671. $96 = (($25) + 8)|0;
  22672. $$121519 = $$111518;$$13 = $96;$$131004 = $29;$$131216 = $33;$$131322 = $95;$$81424 = $35;$$81615 = $4;
  22673. label = 25;
  22674. break;
  22675. }
  22676. case 6: {
  22677. $106 = ($9|0)>(0);
  22678. if ($106) {
  22679. $$121428$ph = $35;$$121619$ph = $4;$$161113$ph = $31;$$17$ph = $25;$$171008$ph = $29;$$171220$ph = $33;$$171326$ph = $27;$$sink1713 = $1;
  22680. label = 32;
  22681. } else {
  22682. $$111427 = $35;$$111618 = $4;$$151112 = $31;$$151522 = $1;$$16 = $25;$$161007 = $29;$$161219 = $33;$$161325 = $27;
  22683. label = 30;
  22684. }
  22685. break;
  22686. }
  22687. case 7: {
  22688. $120 = ($9|0)>(0);
  22689. if ($120) {
  22690. $121 = ((($1)) + 1|0);
  22691. $122 = HEAP8[$1>>0]|0;
  22692. $$151431 = $35;$$151622 = $4;$$191116 = $31;$$191526 = $121;$$20 = $25;$$201011 = $29;$$201223 = $33;$$201329 = $27;$$sink12 = $122;
  22693. label = 39;
  22694. } else {
  22695. $$141430 = $35;$$141621 = $4;$$181115 = $31;$$181525 = $1;$$19 = $25;$$191010 = $29;$$191222 = $33;$$191328 = $27;
  22696. label = 36;
  22697. }
  22698. break;
  22699. }
  22700. case 39: {
  22701. $$171433 = $35;$$171624 = $4;$$211118 = $31;$$211528 = $1;$$22 = $25;$$221013 = $29;$$221225 = $33;$$221331 = $27;
  22702. label = 43;
  22703. break;
  22704. }
  22705. case 51: {
  22706. $152 = ($9|0)>(0);
  22707. if ($152) {
  22708. $$211437$ph = $35;$$211628$ph = $4;$$251122$ph = $31;$$26$ph = $25;$$261017$ph = $29;$$261229$ph = $33;$$261335$ph = $27;$$sink1716 = $1;
  22709. label = 49;
  22710. } else {
  22711. $$201436 = $35;$$201627 = $4;$$241121 = $31;$$241531 = $1;$$25 = $25;$$251016 = $29;$$251228 = $33;$$251334 = $27;
  22712. label = 47;
  22713. }
  22714. break;
  22715. }
  22716. case 52: {
  22717. $$231439 = $35;$$231630 = $4;$$271018 = $29;$$271124 = $31;$$271534 = $1;$$28 = $25;$$281231 = $33;$$281337 = $27;
  22718. label = 52;
  22719. break;
  22720. }
  22721. case 9: {
  22722. $$251441 = $35;$$251632 = $4;$$291020 = $29;$$291126 = $31;$$291536 = $1;$$30 = $25;$$301233 = $33;$$301339 = $27;
  22723. label = 55;
  22724. break;
  22725. }
  22726. case 38: {
  22727. $$261442 = $35;$$261633 = $4;$$301021 = $29;$$301127 = $31;$$301537 = $1;$$31 = $25;$$311234 = $33;$$311340 = $27;
  22728. label = 56;
  22729. break;
  22730. }
  22731. case 40: {
  22732. $$271443 = $35;$$271634 = $4;$$311022 = $29;$$311128 = $31;$$311538 = $1;$$32 = $25;$$321235 = $33;$$321341 = $27;
  22733. label = 58;
  22734. break;
  22735. }
  22736. case 10: {
  22737. $$281444 = $35;$$281635 = $4;$$321023 = $29;$$321129 = $31;$$321539 = $1;$$33 = $25;$$331236 = $33;$$331342 = $27;
  22738. label = 60;
  22739. break;
  22740. }
  22741. case 11: {
  22742. $193 = ($9|0)>(0);
  22743. if ($193) {
  22744. $$321448$ph = $35;$$321639$ph = $4;$$361027$ph = $29;$$361133$ph = $31;$$37$ph = $25;$$371240$ph = $33;$$371346$ph = $27;$$sink1719 = $1;
  22745. label = 66;
  22746. } else {
  22747. $$311447 = $35;$$311638 = $4;$$351026 = $29;$$351132 = $31;$$351542 = $1;$$36 = $25;$$361239 = $33;$$361345 = $27;
  22748. label = 64;
  22749. }
  22750. break;
  22751. }
  22752. case 14: {
  22753. $224 = ($9|0)>(0);
  22754. if ($224) {
  22755. $$371453$ph = $35;$$371644$ph = $4;$$411032$ph = $29;$$411138$ph = $31;$$42$ph = $25;$$421245$ph = $33;$$421351$ph = $27;$$sink1722 = $1;
  22756. label = 75;
  22757. } else {
  22758. $$361452 = $35;$$361643 = $4;$$401031 = $29;$$401137 = $31;$$401547 = $1;$$41 = $25;$$411244 = $33;$$411350 = $27;
  22759. label = 73;
  22760. }
  22761. break;
  22762. }
  22763. case 35: {
  22764. $$401456 = $35;$$401647 = $4;$$441035 = $29;$$441141 = $31;$$441551 = $1;$$45 = $25;$$451248 = $33;$$451354 = $27;
  22765. label = 86;
  22766. break;
  22767. }
  22768. case 16: {
  22769. $452 = ($9|0)>(0);
  22770. if ($452) {
  22771. $$441460$ph = $35;$$441651$ph = $4;$$481039$ph = $29;$$481145$ph = $31;$$49$ph = $25;$$491252$ph = $33;$$491358$ph = $27;$$sink1729 = $1;
  22772. label = 116;
  22773. } else {
  22774. $$431459 = $35;$$431650 = $4;$$471038 = $29;$$471144 = $31;$$471554 = $1;$$48 = $25;$$481251 = $33;$$481357 = $27;
  22775. label = 114;
  22776. }
  22777. break;
  22778. }
  22779. case 17: {
  22780. $$461462 = $35;$$461653 = $4;$$491040 = $29;$$501147 = $31;$$501557 = $1;$$51 = $25;$$511254 = $33;$$511360 = $27;
  22781. label = 125;
  22782. break;
  22783. }
  22784. case 18: {
  22785. $503 = ($9|0)>(0);
  22786. if ($503) {
  22787. $$491465$ph = $35;$$491656$ph = $4;$$521043$ph = $29;$$531150$ph = $31;$$54$ph = $25;$$541257$ph = $33;$$541363$ph = $27;$$sink1732 = $1;
  22788. label = 130;
  22789. } else {
  22790. $$481464 = $35;$$481655 = $4;$$511042 = $29;$$521149 = $31;$$521559 = $1;$$53 = $25;$$531256 = $33;$$531362 = $27;
  22791. label = 128;
  22792. }
  22793. break;
  22794. }
  22795. case 21: {
  22796. $$511467 = $35;$$511658 = $4;$$541045 = $29;$$551152 = $31;$$551562 = $1;$$56 = $25;$$561259 = $33;$$561365 = $27;
  22797. label = 136;
  22798. break;
  22799. }
  22800. case 23: {
  22801. $572 = ($9|0)>(0);
  22802. if ($572) {
  22803. $$571473$ph = $35;$$571664$ph = $4;$$601051$ph = $29;$$611158$ph = $31;$$62$ph = $25;$$621265$ph = $33;$$621371$ph = $27;$$sink1736 = $1;
  22804. label = 153;
  22805. } else {
  22806. $$561472 = $35;$$561663 = $4;$$591050 = $29;$$601157 = $31;$$601567 = $1;$$61 = $25;$$611264 = $33;$$611370 = $27;
  22807. label = 151;
  22808. }
  22809. break;
  22810. }
  22811. case 24: {
  22812. $$591475 = $35;$$591666 = $4;$$621053 = $29;$$621159 = $31;$$631570 = $1;$$64 = $25;$$641267 = $33;$$641373 = $27;
  22813. label = 160;
  22814. break;
  22815. }
  22816. case 25: {
  22817. $696 = ($9|0)>(0);
  22818. if ($696) {
  22819. $$631479$ph = $35;$$641671$ph = $4;$$661057$ph = $29;$$671164$ph = $31;$$681271$ph = $33;$$71$ph = $25;$$711380$ph = $27;$$sink1739 = $1;
  22820. label = 182;
  22821. } else {
  22822. $$621478 = $35;$$631670 = $4;$$651056 = $29;$$661163 = $31;$$671270 = $33;$$691576 = $1;$$70 = $25;$$701379 = $27;
  22823. label = 180;
  22824. }
  22825. break;
  22826. }
  22827. case 26: {
  22828. $737 = ($9|0)>(0);
  22829. if ($737) {
  22830. $$681484$ph = $35;$$691676$ph = $4;$$711062$ph = $29;$$721169$ph = $31;$$731276$ph = $33;$$76$ph = $25;$$761385$ph = $27;$$sink1743 = $1;
  22831. label = 195;
  22832. } else {
  22833. $$671483 = $35;$$681675 = $4;$$701061 = $29;$$711168 = $31;$$721275 = $33;$$741581 = $1;$$75 = $25;$$751384 = $27;
  22834. label = 193;
  22835. }
  22836. break;
  22837. }
  22838. case 27: {
  22839. $784 = ($9|0)>(0);
  22840. if ($784) {
  22841. $$721488$ph = $35;$$731680$ph = $4;$$741065$ph = $29;$$761173$ph = $31;$$761279$ph = $33;$$80$ph = $25;$$801389$ph = $27;$$sink1746 = $1;
  22842. label = 206;
  22843. } else {
  22844. $$711487 = $35;$$721679 = $4;$$731064 = $29;$$751172 = $31;$$751278 = $33;$$781585 = $1;$$79 = $25;$$791388 = $27;
  22845. label = 204;
  22846. }
  22847. break;
  22848. }
  22849. case 37: {
  22850. $$731489 = $35;$$761683 = $4;$$771068 = $29;$$791176 = $31;$$791282 = $33;$$821589 = $1;$$83 = $25;$$831392 = $27;
  22851. label = 210;
  22852. break;
  22853. }
  22854. case 53: {
  22855. $$751491 = $35;$$781685 = $4;$$791070 = $29;$$811178 = $31;$$811284 = $33;$$841591 = $1;$$85 = $25;$$851394 = $27;
  22856. label = 213;
  22857. break;
  22858. }
  22859. case 32: {
  22860. $842 = ($9|0)>(0);
  22861. if ($842) {
  22862. $843 = ((($1)) + 1|0);
  22863. $844 = HEAP8[$1>>0]|0;
  22864. $845 = $844&255;
  22865. $$0949 = $845;$$881595 = $843;
  22866. } else {
  22867. $840 = $6 & 2;
  22868. $841 = ($840|0)==(0);
  22869. if ($841) {
  22870. $$0949 = 0;$$881595 = $1;
  22871. } else {
  22872. $$0960 = 1;$$891505 = $35;$$931084 = $29;$$931700 = $4;$$951192 = $31;$$951298 = $33;$$981605 = $1;$$99 = $25;$$991408 = $27;$$sink30 = 32;
  22873. label = 243;
  22874. break L5;
  22875. }
  22876. }
  22877. $846 = $$0949 << $25;
  22878. $847 = $846 | $27;
  22879. $848 = (($25) + 8)|0;
  22880. $$801496 = $35;$$841075 = $29;$$841691 = $4;$$861289 = $33;$$891596 = $$881595;$$90 = $848;$$901399 = $847;
  22881. label = 226;
  22882. break;
  22883. }
  22884. case 41: {
  22885. $858 = ($9|0)>(0);
  22886. if ($858) {
  22887. $$841500$ph = $35;$$881079$ph = $29;$$881695$ph = $4;$$901187$ph = $31;$$901293$ph = $33;$$94$ph = $25;$$941403$ph = $27;$$sink1750 = $1;
  22888. label = 233;
  22889. } else {
  22890. $$831499 = $35;$$871078 = $29;$$871694 = $4;$$891186 = $31;$$891292 = $33;$$921599 = $1;$$93 = $25;$$931402 = $27;
  22891. label = 231;
  22892. }
  22893. break;
  22894. }
  22895. case 42: {
  22896. $871 = ($9|0)>(0);
  22897. if ($871) {
  22898. $872 = ((($1)) + 1|0);
  22899. $873 = HEAP8[$1>>0]|0;
  22900. $874 = $873&255;
  22901. $$0948 = $874;$$871503 = $35;$$911082 = $29;$$911698 = $4;$$931190 = $31;$$931296 = $33;$$961603 = $872;$$97 = $25;$$971406 = $27;
  22902. label = 241;
  22903. } else {
  22904. $$861502 = $35;$$901081 = $29;$$901697 = $4;$$921189 = $31;$$921295 = $33;$$951602 = $1;$$96 = $25;$$961405 = $27;
  22905. label = 237;
  22906. }
  22907. break;
  22908. }
  22909. case 34: {
  22910. $$881504 = $35;$$921083 = $29;$$921699 = $4;$$941191 = $31;$$941297 = $33;$$971604 = $1;$$98 = $25;$$981407 = $27;
  22911. label = 242;
  22912. break;
  22913. }
  22914. default: {
  22915. $$100 = $25;$$1001409 = $27;$$1961 = -1;$$901506 = $35;$$941085 = $29;$$941701 = $4;$$961193 = $31;$$961299 = $33;$$991606 = $1;
  22916. label = 244;
  22917. }
  22918. }
  22919. } while(0);
  22920. if ((label|0) == 6) {
  22921. $44 = $6 & 2;
  22922. $45 = ($44|0)==(0);
  22923. if ($45) {
  22924. $$01507 = $1;$$11098 = $$01097;$$11204 = $$01203;$$11310 = $$01309;$$1988 = $$0987;$$1992 = $$0991;$$sink3$shrunk = 0;
  22925. label = 9;
  22926. } else {
  22927. $$0960 = 1;$$891505 = $35;$$931084 = $$0991;$$931700 = $4;$$951192 = $$01097;$$951298 = $$01203;$$981605 = $1;$$99 = $$0987;$$991408 = $$01309;$$sink30 = 1;
  22928. label = 243;
  22929. }
  22930. }
  22931. else if ((label|0) == 8) {
  22932. $47 = ((($1)) + 1|0);
  22933. $48 = HEAP8[$1>>0]|0;
  22934. $$01507 = $47;$$11098 = $$11098$ph;$$11204 = $$11204$ph;$$11310 = $$11310$ph;$$1988 = $$1988$ph;$$1992 = $$1992$ph;$$sink3$shrunk = $48;
  22935. label = 9;
  22936. }
  22937. if ((label|0) == 9) {
  22938. $$sink3 = $$sink3$shrunk&255;
  22939. $49 = ((($0)) + 8|0);
  22940. HEAP32[$49>>2] = $$sink3;
  22941. $50 = ($$01507>>>0)<($10>>>0);
  22942. if ($50) {
  22943. $$31206$ph = $$11204;$$31312$ph = $$11310;$$3990$ph = $$1988;$$3994$ph = $$1992;$$sink1705 = $$01507;
  22944. label = 12;
  22945. } else {
  22946. $$11508 = $$01507;$$21099 = $$11098;$$21205 = $$11204;$$21311 = $$11310;$$2989 = $$1988;$$2993 = $$1992;
  22947. label = 10;
  22948. }
  22949. }
  22950. if ((label|0) == 10) {
  22951. $51 = $6 & 2;
  22952. $52 = ($51|0)==(0);
  22953. if ($52) {
  22954. $$21509 = $$11508;$$31206 = $$21205;$$31312 = $$21311;$$3990 = $$2989;$$3994 = $$2993;$$sink9$shrunk = 0;
  22955. label = 13;
  22956. } else {
  22957. $$0960 = 1;$$891505 = $35;$$931084 = $$2993;$$931700 = $4;$$951192 = $$21099;$$951298 = $$21205;$$981605 = $$11508;$$99 = $$2989;$$991408 = $$21311;$$sink30 = 2;
  22958. label = 243;
  22959. }
  22960. }
  22961. else if ((label|0) == 12) {
  22962. $54 = ((($$sink1705)) + 1|0);
  22963. $55 = HEAP8[$$sink1705>>0]|0;
  22964. $$21509 = $54;$$31206 = $$31206$ph;$$31312 = $$31312$ph;$$3990 = $$3990$ph;$$3994 = $$3994$ph;$$sink9$shrunk = $55;
  22965. label = 13;
  22966. }
  22967. if ((label|0) == 13) {
  22968. $$sink9 = $$sink9$shrunk&255;
  22969. $56 = ((($0)) + 12|0);
  22970. HEAP32[$56>>2] = $$sink9;
  22971. $57 = ((($0)) + 8|0);
  22972. $58 = HEAP32[$57>>2]|0;
  22973. $59 = $58 << 8;
  22974. $60 = $59 | $$sink9;
  22975. $61 = (($60>>>0) % 31)&-1;
  22976. $62 = $$sink9 & 32;
  22977. $63 = $61 | $62;
  22978. $64 = $58 & 15;
  22979. $65 = ($64|0)!=(8);
  22980. $not$ = ($63|0)!=(0);
  22981. $$1754 = $65 | $not$;
  22982. $66 = $58 >>> 4;
  22983. $67 = 256 << $66;
  22984. $68 = ($67>>>0)>(32768);
  22985. $69 = ($20>>>0)<($67>>>0);
  22986. $$ = $68 | $69;
  22987. $not$1755 = $14 ^ 1;
  22988. $70 = $$ & $not$1755;
  22989. $$31100$v = $70 | $$1754;
  22990. if ($$31100$v) {
  22991. $$0960 = -1;$$891505 = $35;$$931084 = $$3994;$$931700 = $4;$$951192 = 1;$$951298 = $$31206;$$981605 = $$21509;$$99 = $$3990;$$991408 = $$31312;$$sink30 = 36;
  22992. label = 243;
  22993. } else {
  22994. $$01416 = $35;$$01607 = $4;$$41511 = $$21509;$$5 = $$3990;$$51102 = 0;$$51208 = $$31206;$$51314 = $$31312;$$5996 = $$3994;
  22995. label = 14;
  22996. }
  22997. }
  22998. L46: while(1) {
  22999. switch (label|0) {
  23000. case 14: {
  23001. label = 0;
  23002. $71 = ($$5>>>0)<(3);
  23003. if ($71) {
  23004. $$11417 = $$01416;$$11608 = $$01607;$$51512 = $$41511;$$6 = $$5;$$61103 = $$51102;$$61209 = $$51208;$$61315 = $$51314;$$6997 = $$5996;
  23005. label = 15;
  23006. } else {
  23007. $$41420 = $$01416;$$41611 = $$01607;$$81515 = $$41511;$$9 = $$5;$$91000 = $$5996;$$91106 = $$51102;$$91212 = $$51208;$$91318 = $$51314;
  23008. label = 20;
  23009. }
  23010. break;
  23011. }
  23012. case 16: {
  23013. label = 0;
  23014. $73 = $6 & 2;
  23015. $74 = ($73|0)==(0);
  23016. if ($74) {
  23017. $$01413$shrunk = 0;$$31419 = $$21418;$$31610 = $$21609;$$71514 = $$61513;$$8 = $$7;$$81105 = $$71104;$$81211 = $$71210;$$81317 = $$71316;$$8999 = $$7998;
  23018. label = 19;
  23019. } else {
  23020. $$0960 = 1;$$891505 = $$21418;$$931084 = $$7998;$$931700 = $$21609;$$951192 = $$71104;$$951298 = $$71210;$$981605 = $$61513;$$99 = $$7;$$991408 = $$71316;$$sink30 = 3;
  23021. label = 243;
  23022. continue L46;
  23023. }
  23024. break;
  23025. }
  23026. case 18: {
  23027. label = 0;
  23028. $76 = ((($$sink1710)) + 1|0);
  23029. $77 = HEAP8[$$sink1710>>0]|0;
  23030. $$01413$shrunk = $77;$$31419 = $$31419$ph;$$31610 = $$31610$ph;$$71514 = $76;$$8 = $$8$ph;$$81105 = $$81105$ph;$$81211 = $$81211$ph;$$81317 = $$81317$ph;$$8999 = $$8999$ph;
  23031. label = 19;
  23032. break;
  23033. }
  23034. case 25: {
  23035. label = 0;
  23036. $97 = $$13 & 7;
  23037. $98 = $$131322 >>> $97;
  23038. $99 = (($$13) - ($97))|0;
  23039. $$131110 = 0;$$131520 = $$121519;$$14 = $99;$$141005 = $$131004;$$141217 = $$131216;$$141323 = $98;$$91425 = $$81424;$$91616 = $$81615;
  23040. label = 26;
  23041. break;
  23042. }
  23043. case 30: {
  23044. label = 0;
  23045. $104 = $6 & 2;
  23046. $105 = ($104|0)==(0);
  23047. if ($105) {
  23048. $$01411$shrunk = 0;$$121428 = $$111427;$$121619 = $$111618;$$161113 = $$151112;$$161523 = $$151522;$$17 = $$16;$$171008 = $$161007;$$171220 = $$161219;$$171326 = $$161325;
  23049. label = 33;
  23050. } else {
  23051. $$0960 = 1;$$891505 = $$111427;$$931084 = $$161007;$$931700 = $$111618;$$951192 = $$151112;$$951298 = $$161219;$$981605 = $$151522;$$99 = $$16;$$991408 = $$161325;$$sink30 = 6;
  23052. label = 243;
  23053. continue L46;
  23054. }
  23055. break;
  23056. }
  23057. case 32: {
  23058. label = 0;
  23059. $107 = ((($$sink1713)) + 1|0);
  23060. $108 = HEAP8[$$sink1713>>0]|0;
  23061. $$01411$shrunk = $108;$$121428 = $$121428$ph;$$121619 = $$121619$ph;$$161113 = $$161113$ph;$$161523 = $107;$$17 = $$17$ph;$$171008 = $$171008$ph;$$171220 = $$171220$ph;$$171326 = $$171326$ph;
  23062. label = 33;
  23063. break;
  23064. }
  23065. case 36: {
  23066. label = 0;
  23067. $118 = $6 & 2;
  23068. $119 = ($118|0)==(0);
  23069. if ($119) {
  23070. $$151431 = $$141430;$$151622 = $$141621;$$191116 = $$181115;$$191526 = $$181525;$$20 = $$19;$$201011 = $$191010;$$201223 = $$191222;$$201329 = $$191328;$$sink12 = 0;
  23071. label = 39;
  23072. continue L46;
  23073. } else {
  23074. $$0960 = 1;$$891505 = $$141430;$$931084 = $$191010;$$931700 = $$141621;$$951192 = $$181115;$$951298 = $$191222;$$981605 = $$181525;$$99 = $$19;$$991408 = $$191328;$$sink30 = 7;
  23075. label = 243;
  23076. continue L46;
  23077. }
  23078. break;
  23079. }
  23080. case 39: {
  23081. label = 0;
  23082. $$sink13 = (((($0)) + 10528|0) + ($$191116)|0);
  23083. HEAP8[$$sink13>>0] = $$sink12;
  23084. $$161432 = $$151431;$$161623 = $$151622;$$201117 = $$191116;$$201527 = $$191526;$$21 = $$20;$$211012 = $$201011;$$211224 = $$201223;$$211330 = $$201329;
  23085. label = 41;
  23086. break;
  23087. }
  23088. case 43: {
  23089. label = 0;
  23090. $$0960 = -1;$$891505 = $$171433;$$931084 = $$221013;$$931700 = $$171624;$$951192 = $$211118;$$951298 = $$221225;$$981605 = $$211528;$$99 = $$22;$$991408 = $$221331;$$sink30 = 39;
  23091. label = 243;
  23092. continue L46;
  23093. break;
  23094. }
  23095. case 47: {
  23096. label = 0;
  23097. $150 = $6 & 2;
  23098. $151 = ($150|0)==(0);
  23099. if ($151) {
  23100. $$01410$shrunk = 0;$$211437 = $$201436;$$211628 = $$201627;$$251122 = $$241121;$$251532 = $$241531;$$26 = $$25;$$261017 = $$251016;$$261229 = $$251228;$$261335 = $$251334;
  23101. label = 50;
  23102. } else {
  23103. $$0960 = 1;$$891505 = $$201436;$$931084 = $$251016;$$931700 = $$201627;$$951192 = $$241121;$$951298 = $$251228;$$981605 = $$241531;$$99 = $$25;$$991408 = $$251334;$$sink30 = 51;
  23104. label = 243;
  23105. continue L46;
  23106. }
  23107. break;
  23108. }
  23109. case 49: {
  23110. label = 0;
  23111. $153 = ((($$sink1716)) + 1|0);
  23112. $154 = HEAP8[$$sink1716>>0]|0;
  23113. $$01410$shrunk = $154;$$211437 = $$211437$ph;$$211628 = $$211628$ph;$$251122 = $$251122$ph;$$251532 = $153;$$26 = $$26$ph;$$261017 = $$261017$ph;$$261229 = $$261229$ph;$$261335 = $$261335$ph;
  23114. label = 50;
  23115. break;
  23116. }
  23117. case 52: {
  23118. label = 0;
  23119. $162 = ($$231630>>>0)<($12>>>0);
  23120. if (!($162)) {
  23121. $$0960 = 2;$$891505 = $$231439;$$931084 = $$271018;$$931700 = $$231630;$$951192 = $$271124;$$951298 = $$281231;$$981605 = $$271534;$$99 = $$28;$$991408 = $$281337;$$sink30 = 52;
  23122. label = 243;
  23123. continue L46;
  23124. }
  23125. $163 = $$271018&255;
  23126. $164 = ((($$231630)) + 1|0);
  23127. HEAP8[$$231630>>0] = $163;
  23128. $165 = (($$271124) + -1)|0;
  23129. $$181434 = $$231439;$$181625 = $164;$$221119 = $165;$$221529 = $$271534;$$23 = $$28;$$231014 = $$271018;$$231226 = $$281231;$$231332 = $$281337;
  23130. label = 44;
  23131. break;
  23132. }
  23133. case 55: {
  23134. label = 0;
  23135. $167 = ($$251632>>>0)<($12>>>0);
  23136. if ($167) {
  23137. $$261442 = $$251441;$$261633 = $$251632;$$301021 = $$291020;$$301127 = $$291126;$$301537 = $$291536;$$31 = $$30;$$311234 = $$301233;$$311340 = $$301339;
  23138. label = 56;
  23139. continue L46;
  23140. } else {
  23141. $$0960 = 2;$$891505 = $$251441;$$931084 = $$291020;$$931700 = $$251632;$$951192 = $$291126;$$951298 = $$301233;$$981605 = $$291536;$$99 = $$30;$$991408 = $$301339;$$sink30 = 9;
  23142. label = 243;
  23143. continue L46;
  23144. }
  23145. break;
  23146. }
  23147. case 56: {
  23148. label = 0;
  23149. $168 = ($$301537>>>0)<($10>>>0);
  23150. if ($168) {
  23151. $171 = $12;
  23152. $172 = $$261633;
  23153. $173 = (($171) - ($172))|0;
  23154. $174 = $10;
  23155. $175 = $$301537;
  23156. $176 = (($174) - ($175))|0;
  23157. $177 = ($173>>>0)<($176>>>0);
  23158. $$sink17 = $177 ? $12 : $10;
  23159. $$sink16 = $177 ? $$261633 : $$301537;
  23160. $178 = $$sink17;
  23161. $179 = $$sink16;
  23162. $180 = (($178) - ($179))|0;
  23163. $181 = ($180>>>0)<($$301127>>>0);
  23164. $$$301127 = $181 ? $180 : $$301127;
  23165. _memcpy(($$261633|0),($$301537|0),($$$301127|0))|0;
  23166. $182 = (($$301537) + ($$$301127)|0);
  23167. $183 = (($$261633) + ($$$301127)|0);
  23168. $184 = (($$301127) - ($$$301127))|0;
  23169. $$241440 = $$261442;$$241631 = $183;$$281019 = $$301021;$$281125 = $184;$$281535 = $182;$$29 = $$31;$$291232 = $$311234;$$291338 = $$311340;
  23170. label = 54;
  23171. break;
  23172. } else {
  23173. $169 = $6 & 2;
  23174. $170 = ($169|0)==(0);
  23175. if ($170) {
  23176. $$271443 = $$261442;$$271634 = $$261633;$$311022 = $$301021;$$311128 = $$301127;$$311538 = $$301537;$$32 = $$31;$$321235 = $$311234;$$321341 = $$311340;
  23177. label = 58;
  23178. continue L46;
  23179. } else {
  23180. $$0960 = 1;$$891505 = $$261442;$$931084 = $$301021;$$931700 = $$261633;$$951192 = $$301127;$$951298 = $$311234;$$981605 = $$301537;$$99 = $$31;$$991408 = $$311340;$$sink30 = 38;
  23181. label = 243;
  23182. continue L46;
  23183. }
  23184. }
  23185. break;
  23186. }
  23187. case 58: {
  23188. label = 0;
  23189. $$0960 = -1;$$891505 = $$271443;$$931084 = $$311022;$$931700 = $$271634;$$951192 = $$311128;$$951298 = $$321235;$$981605 = $$311538;$$99 = $$32;$$991408 = $$321341;$$sink30 = 40;
  23190. label = 243;
  23191. continue L46;
  23192. break;
  23193. }
  23194. case 60: {
  23195. label = 0;
  23196. $$0960 = -1;$$891505 = $$281444;$$931084 = $$321023;$$931700 = $$281635;$$951192 = $$321129;$$951298 = $$331236;$$981605 = $$321539;$$99 = $$33;$$991408 = $$331342;$$sink30 = 10;
  23197. label = 243;
  23198. continue L46;
  23199. break;
  23200. }
  23201. case 64: {
  23202. label = 0;
  23203. $191 = $6 & 2;
  23204. $192 = ($191|0)==(0);
  23205. if ($192) {
  23206. $$01300$shrunk = 0;$$321448 = $$311447;$$321639 = $$311638;$$361027 = $$351026;$$361133 = $$351132;$$361543 = $$351542;$$37 = $$36;$$371240 = $$361239;$$371346 = $$361345;
  23207. label = 67;
  23208. } else {
  23209. $$0960 = 1;$$891505 = $$311447;$$931084 = $$351026;$$931700 = $$311638;$$951192 = $$351132;$$951298 = $$361239;$$981605 = $$351542;$$99 = $$36;$$991408 = $$361345;$$sink30 = 11;
  23210. label = 243;
  23211. continue L46;
  23212. }
  23213. break;
  23214. }
  23215. case 66: {
  23216. label = 0;
  23217. $194 = ((($$sink1719)) + 1|0);
  23218. $195 = HEAP8[$$sink1719>>0]|0;
  23219. $$01300$shrunk = $195;$$321448 = $$321448$ph;$$321639 = $$321639$ph;$$361027 = $$361027$ph;$$361133 = $$361133$ph;$$361543 = $194;$$37 = $$37$ph;$$371240 = $$371240$ph;$$371346 = $$371346$ph;
  23220. label = 67;
  23221. break;
  23222. }
  23223. case 73: {
  23224. label = 0;
  23225. $222 = $6 & 2;
  23226. $223 = ($222|0)==(0);
  23227. if ($223) {
  23228. $$01202$shrunk = 0;$$371453 = $$361452;$$371644 = $$361643;$$411032 = $$401031;$$411138 = $$401137;$$411548 = $$401547;$$42 = $$41;$$421245 = $$411244;$$421351 = $$411350;
  23229. label = 76;
  23230. } else {
  23231. $$0960 = 1;$$891505 = $$361452;$$931084 = $$401031;$$931700 = $$361643;$$951192 = $$401137;$$951298 = $$411244;$$981605 = $$401547;$$99 = $$41;$$991408 = $$411350;$$sink30 = 14;
  23232. label = 243;
  23233. continue L46;
  23234. }
  23235. break;
  23236. }
  23237. case 75: {
  23238. label = 0;
  23239. $225 = ((($$sink1722)) + 1|0);
  23240. $226 = HEAP8[$$sink1722>>0]|0;
  23241. $$01202$shrunk = $226;$$371453 = $$371453$ph;$$371644 = $$371644$ph;$$411032 = $$411032$ph;$$411138 = $$411138$ph;$$411548 = $225;$$42 = $$42$ph;$$421245 = $$421245$ph;$$421351 = $$421351$ph;
  23242. label = 76;
  23243. break;
  23244. }
  23245. case 86: {
  23246. label = 0;
  23247. $$0960 = -1;$$891505 = $$401456;$$931084 = $$441035;$$931700 = $$401647;$$951192 = $$441141;$$951298 = $$451248;$$981605 = $$441551;$$99 = $$45;$$991408 = $$451354;$$sink30 = 35;
  23248. label = 243;
  23249. continue L46;
  23250. break;
  23251. }
  23252. case 114: {
  23253. label = 0;
  23254. $450 = $6 & 2;
  23255. $451 = ($450|0)==(0);
  23256. if ($451) {
  23257. $$0980$shrunk = 0;$$441460 = $$431459;$$441651 = $$431650;$$481039 = $$471038;$$481145 = $$471144;$$481555 = $$471554;$$49 = $$48;$$491252 = $$481251;$$491358 = $$481357;
  23258. label = 117;
  23259. } else {
  23260. $$0960 = 1;$$891505 = $$431459;$$931084 = $$471038;$$931700 = $$431650;$$951192 = $$471144;$$951298 = $$481251;$$981605 = $$471554;$$99 = $$48;$$991408 = $$481357;$$sink30 = 16;
  23261. label = 243;
  23262. continue L46;
  23263. }
  23264. break;
  23265. }
  23266. case 116: {
  23267. label = 0;
  23268. $453 = ((($$sink1729)) + 1|0);
  23269. $454 = HEAP8[$$sink1729>>0]|0;
  23270. $$0980$shrunk = $454;$$441460 = $$441460$ph;$$441651 = $$441651$ph;$$481039 = $$481039$ph;$$481145 = $$481145$ph;$$481555 = $453;$$49 = $$49$ph;$$491252 = $$491252$ph;$$491358 = $$491358$ph;
  23271. label = 117;
  23272. break;
  23273. }
  23274. case 125: {
  23275. label = 0;
  23276. $$0960 = -1;$$891505 = $$461462;$$931084 = $$491040;$$931700 = $$461653;$$951192 = $$501147;$$951298 = $$511254;$$981605 = $$501557;$$99 = $$51;$$991408 = $$511360;$$sink30 = 17;
  23277. label = 243;
  23278. continue L46;
  23279. break;
  23280. }
  23281. case 128: {
  23282. label = 0;
  23283. $501 = $6 & 2;
  23284. $502 = ($501|0)==(0);
  23285. if ($502) {
  23286. $$0979$shrunk = 0;$$491465 = $$481464;$$491656 = $$481655;$$521043 = $$511042;$$531150 = $$521149;$$531560 = $$521559;$$54 = $$53;$$541257 = $$531256;$$541363 = $$531362;
  23287. label = 131;
  23288. } else {
  23289. $$0960 = 1;$$891505 = $$481464;$$931084 = $$511042;$$931700 = $$481655;$$951192 = $$521149;$$951298 = $$531256;$$981605 = $$521559;$$99 = $$53;$$991408 = $$531362;$$sink30 = 18;
  23290. label = 243;
  23291. continue L46;
  23292. }
  23293. break;
  23294. }
  23295. case 130: {
  23296. label = 0;
  23297. $504 = ((($$sink1732)) + 1|0);
  23298. $505 = HEAP8[$$sink1732>>0]|0;
  23299. $$0979$shrunk = $505;$$491465 = $$491465$ph;$$491656 = $$491656$ph;$$521043 = $$521043$ph;$$531150 = $$531150$ph;$$531560 = $504;$$54 = $$54$ph;$$541257 = $$541257$ph;$$541363 = $$541363$ph;
  23300. label = 131;
  23301. break;
  23302. }
  23303. case 136: {
  23304. label = 0;
  23305. $$0960 = -1;$$891505 = $$511467;$$931084 = $$541045;$$931700 = $$511658;$$951192 = $$551152;$$951298 = $$561259;$$981605 = $$551562;$$99 = $$56;$$991408 = $$561365;$$sink30 = 21;
  23306. label = 243;
  23307. continue L46;
  23308. break;
  23309. }
  23310. case 151: {
  23311. label = 0;
  23312. $570 = $6 & 2;
  23313. $571 = ($570|0)==(0);
  23314. if ($571) {
  23315. $$0971$shrunk = 0;$$571473 = $$561472;$$571664 = $$561663;$$601051 = $$591050;$$611158 = $$601157;$$611568 = $$601567;$$62 = $$61;$$621265 = $$611264;$$621371 = $$611370;
  23316. label = 154;
  23317. } else {
  23318. $$0960 = 1;$$891505 = $$561472;$$931084 = $$591050;$$931700 = $$561663;$$951192 = $$601157;$$951298 = $$611264;$$981605 = $$601567;$$99 = $$61;$$991408 = $$611370;$$sink30 = 23;
  23319. label = 243;
  23320. continue L46;
  23321. }
  23322. break;
  23323. }
  23324. case 153: {
  23325. label = 0;
  23326. $573 = ((($$sink1736)) + 1|0);
  23327. $574 = HEAP8[$$sink1736>>0]|0;
  23328. $$0971$shrunk = $574;$$571473 = $$571473$ph;$$571664 = $$571664$ph;$$601051 = $$601051$ph;$$611158 = $$611158$ph;$$611568 = $573;$$62 = $$62$ph;$$621265 = $$621265$ph;$$621371 = $$621371$ph;
  23329. label = 154;
  23330. break;
  23331. }
  23332. case 160: {
  23333. label = 0;
  23334. $610 = ($$591666>>>0)<($12>>>0);
  23335. if (!($610)) {
  23336. $$0960 = 2;$$891505 = $$591475;$$931084 = $$621053;$$931700 = $$591666;$$951192 = $$621159;$$951298 = $$641267;$$981605 = $$631570;$$99 = $$64;$$991408 = $$641373;$$sink30 = 24;
  23337. label = 243;
  23338. continue L46;
  23339. }
  23340. $611 = $$621159&255;
  23341. $612 = ((($$591666)) + 1|0);
  23342. HEAP8[$$591666>>0] = $611;
  23343. $$541470$ph = $$591475;$$541661$ph = $612;$$571048$ph = $$621053;$$581155$ph = $$621159;$$581565$ph = $$631570;$$59$ph = $$64;$$591262$ph = $$641267;$$591368$ph = $$641373;
  23344. label = 140;
  23345. break;
  23346. }
  23347. case 180: {
  23348. label = 0;
  23349. $694 = $6 & 2;
  23350. $695 = ($694|0)==(0);
  23351. if ($695) {
  23352. $$0959$shrunk = 0;$$631479 = $$621478;$$641671 = $$631670;$$661057 = $$651056;$$671164 = $$661163;$$681271 = $$671270;$$701577 = $$691576;$$71 = $$70;$$711380 = $$701379;
  23353. label = 183;
  23354. } else {
  23355. $$0960 = 1;$$891505 = $$621478;$$931084 = $$651056;$$931700 = $$631670;$$951192 = $$661163;$$951298 = $$671270;$$981605 = $$691576;$$99 = $$70;$$991408 = $$701379;$$sink30 = 25;
  23356. label = 243;
  23357. continue L46;
  23358. }
  23359. break;
  23360. }
  23361. case 182: {
  23362. label = 0;
  23363. $697 = ((($$sink1739)) + 1|0);
  23364. $698 = HEAP8[$$sink1739>>0]|0;
  23365. $$0959$shrunk = $698;$$631479 = $$631479$ph;$$641671 = $$641671$ph;$$661057 = $$661057$ph;$$671164 = $$671164$ph;$$681271 = $$681271$ph;$$701577 = $697;$$71 = $$71$ph;$$711380 = $$711380$ph;
  23366. label = 183;
  23367. break;
  23368. }
  23369. case 193: {
  23370. label = 0;
  23371. $735 = $6 & 2;
  23372. $736 = ($735|0)==(0);
  23373. if ($736) {
  23374. $$0952$shrunk = 0;$$681484 = $$671483;$$691676 = $$681675;$$711062 = $$701061;$$721169 = $$711168;$$731276 = $$721275;$$751582 = $$741581;$$76 = $$75;$$761385 = $$751384;
  23375. label = 196;
  23376. } else {
  23377. $$0960 = 1;$$891505 = $$671483;$$931084 = $$701061;$$931700 = $$681675;$$951192 = $$711168;$$951298 = $$721275;$$981605 = $$741581;$$99 = $$75;$$991408 = $$751384;$$sink30 = 26;
  23378. label = 243;
  23379. continue L46;
  23380. }
  23381. break;
  23382. }
  23383. case 195: {
  23384. label = 0;
  23385. $738 = ((($$sink1743)) + 1|0);
  23386. $739 = HEAP8[$$sink1743>>0]|0;
  23387. $$0952$shrunk = $739;$$681484 = $$681484$ph;$$691676 = $$691676$ph;$$711062 = $$711062$ph;$$721169 = $$721169$ph;$$731276 = $$731276$ph;$$751582 = $738;$$76 = $$76$ph;$$761385 = $$761385$ph;
  23388. label = 196;
  23389. break;
  23390. }
  23391. case 204: {
  23392. label = 0;
  23393. $782 = $6 & 2;
  23394. $783 = ($782|0)==(0);
  23395. if ($783) {
  23396. $$0950$shrunk = 0;$$721488 = $$711487;$$731680 = $$721679;$$741065 = $$731064;$$761173 = $$751172;$$761279 = $$751278;$$791586 = $$781585;$$80 = $$79;$$801389 = $$791388;
  23397. label = 207;
  23398. } else {
  23399. $$0960 = 1;$$891505 = $$711487;$$931084 = $$731064;$$931700 = $$721679;$$951192 = $$751172;$$951298 = $$751278;$$981605 = $$781585;$$99 = $$79;$$991408 = $$791388;$$sink30 = 27;
  23400. label = 243;
  23401. continue L46;
  23402. }
  23403. break;
  23404. }
  23405. case 206: {
  23406. label = 0;
  23407. $785 = ((($$sink1746)) + 1|0);
  23408. $786 = HEAP8[$$sink1746>>0]|0;
  23409. $$0950$shrunk = $786;$$721488 = $$721488$ph;$$731680 = $$731680$ph;$$741065 = $$741065$ph;$$761173 = $$761173$ph;$$761279 = $$761279$ph;$$791586 = $785;$$80 = $$80$ph;$$801389 = $$801389$ph;
  23410. label = 207;
  23411. break;
  23412. }
  23413. case 210: {
  23414. label = 0;
  23415. $$0960 = -1;$$891505 = $$731489;$$931084 = $$771068;$$931700 = $$761683;$$951192 = $$791176;$$951298 = $$791282;$$981605 = $$821589;$$99 = $$83;$$991408 = $$831392;$$sink30 = 37;
  23416. label = 243;
  23417. continue L46;
  23418. break;
  23419. }
  23420. case 213: {
  23421. label = 0;
  23422. $809 = ($$781685>>>0)<($12>>>0);
  23423. if (!($809)) {
  23424. $$0960 = 2;$$891505 = $$751491;$$931084 = $$791070;$$931700 = $$781685;$$951192 = $$811178;$$951298 = $$811284;$$981605 = $$841591;$$99 = $$85;$$991408 = $$851394;$$sink30 = 53;
  23425. label = 243;
  23426. continue L46;
  23427. }
  23428. $810 = (($$751491) + 1)|0;
  23429. $811 = (($$751491) - ($$791070))|0;
  23430. $812 = $811 & $$1753;
  23431. $813 = (($3) + ($812)|0);
  23432. $814 = HEAP8[$813>>0]|0;
  23433. $815 = ((($$781685)) + 1|0);
  23434. HEAP8[$$781685>>0] = $814;
  23435. $$741490 = $810;$$771684 = $815;$$781069 = $$791070;$$801177 = $$811178;$$801283 = $$811284;$$831590 = $$841591;$$84 = $$85;$$841393 = $$851394;
  23436. label = 212;
  23437. break;
  23438. }
  23439. case 226: {
  23440. label = 0;
  23441. $849 = $$90 & 7;
  23442. $850 = $$901399 >>> $849;
  23443. $851 = (($$90) - ($849))|0;
  23444. $$811497 = $$801496;$$851076 = $$841075;$$851692 = $$841691;$$871184 = 0;$$871290 = $$861289;$$901597 = $$891596;$$91 = $851;$$911400 = $850;
  23445. label = 227;
  23446. break;
  23447. }
  23448. case 231: {
  23449. label = 0;
  23450. $856 = $6 & 2;
  23451. $857 = ($856|0)==(0);
  23452. if ($857) {
  23453. $$0947$shrunk = 0;$$841500 = $$831499;$$881079 = $$871078;$$881695 = $$871694;$$901187 = $$891186;$$901293 = $$891292;$$931600 = $$921599;$$94 = $$93;$$941403 = $$931402;
  23454. label = 234;
  23455. } else {
  23456. $$0960 = 1;$$891505 = $$831499;$$931084 = $$871078;$$931700 = $$871694;$$951192 = $$891186;$$951298 = $$891292;$$981605 = $$921599;$$99 = $$93;$$991408 = $$931402;$$sink30 = 41;
  23457. label = 243;
  23458. continue L46;
  23459. }
  23460. break;
  23461. }
  23462. case 233: {
  23463. label = 0;
  23464. $859 = ((($$sink1750)) + 1|0);
  23465. $860 = HEAP8[$$sink1750>>0]|0;
  23466. $$0947$shrunk = $860;$$841500 = $$841500$ph;$$881079 = $$881079$ph;$$881695 = $$881695$ph;$$901187 = $$901187$ph;$$901293 = $$901293$ph;$$931600 = $859;$$94 = $$94$ph;$$941403 = $$941403$ph;
  23467. label = 234;
  23468. break;
  23469. }
  23470. case 237: {
  23471. label = 0;
  23472. $869 = $6 & 2;
  23473. $870 = ($869|0)==(0);
  23474. if ($870) {
  23475. $$0948 = 0;$$871503 = $$861502;$$911082 = $$901081;$$911698 = $$901697;$$931190 = $$921189;$$931296 = $$921295;$$961603 = $$951602;$$97 = $$96;$$971406 = $$961405;
  23476. label = 241;
  23477. continue L46;
  23478. } else {
  23479. $$0960 = 1;$$891505 = $$861502;$$931084 = $$901081;$$931700 = $$901697;$$951192 = $$921189;$$951298 = $$921295;$$981605 = $$951602;$$99 = $$96;$$991408 = $$961405;$$sink30 = 42;
  23480. label = 243;
  23481. continue L46;
  23482. }
  23483. break;
  23484. }
  23485. case 241: {
  23486. label = 0;
  23487. $878 = ((($0)) + 16|0);
  23488. $879 = HEAP32[$878>>2]|0;
  23489. $880 = $879 << 8;
  23490. $881 = $880 | $$0948;
  23491. HEAP32[$878>>2] = $881;
  23492. $882 = (($$931190) + 1)|0;
  23493. $$811497 = $$871503;$$851076 = $$911082;$$851692 = $$911698;$$871184 = $882;$$871290 = $$931296;$$901597 = $$961603;$$91 = $$97;$$911400 = $$971406;
  23494. label = 227;
  23495. break;
  23496. }
  23497. case 242: {
  23498. label = 0;
  23499. $$0960 = 0;$$891505 = $$881504;$$931084 = $$921083;$$931700 = $$921699;$$951192 = $$941191;$$951298 = $$941297;$$981605 = $$971604;$$99 = $$98;$$991408 = $$981407;$$sink30 = 34;
  23500. label = 243;
  23501. continue L46;
  23502. break;
  23503. }
  23504. case 243: {
  23505. label = 0;
  23506. HEAP32[$0>>2] = $$sink30;
  23507. $$100 = $$99;$$1001409 = $$991408;$$1961 = $$0960;$$901506 = $$891505;$$941085 = $$931084;$$941701 = $$931700;$$961193 = $$951192;$$961299 = $$951298;$$991606 = $$981605;
  23508. label = 244;
  23509. continue L46;
  23510. break;
  23511. }
  23512. case 244: {
  23513. label = 0;
  23514. HEAP32[$24>>2] = $$100;
  23515. HEAP32[$26>>2] = $$1001409;
  23516. HEAP32[$28>>2] = $$941085;
  23517. HEAP32[$30>>2] = $$961193;
  23518. HEAP32[$32>>2] = $$961299;
  23519. HEAP32[$34>>2] = $$901506;
  23520. $883 = $$991606;
  23521. $884 = $1;
  23522. $885 = (($883) - ($884))|0;
  23523. HEAP32[$2>>2] = $885;
  23524. $886 = $$941701;
  23525. $887 = $4;
  23526. $888 = (($886) - ($887))|0;
  23527. HEAP32[$5>>2] = $888;
  23528. $889 = $6 & 9;
  23529. $890 = ($889|0)!=(0);
  23530. $891 = ($$1961|0)>(-1);
  23531. $or$cond29 = $890 & $891;
  23532. if ($or$cond29) {
  23533. break L46;
  23534. } else {
  23535. $$0951 = $$1961;
  23536. label = 258;
  23537. break L46;
  23538. }
  23539. break;
  23540. }
  23541. }
  23542. switch (label|0) {
  23543. case 19: {
  23544. label = 0;
  23545. $$01413 = $$01413$shrunk&255;
  23546. $78 = $$01413 << $$8;
  23547. $79 = $78 | $$81317;
  23548. $80 = (($$8) + 8)|0;
  23549. $81 = ($80>>>0)<(3);
  23550. if ($81) {
  23551. $$11417 = $$31419;$$11608 = $$31610;$$51512 = $$71514;$$6 = $80;$$61103 = $$81105;$$61209 = $$81211;$$61315 = $79;$$6997 = $$8999;
  23552. label = 15;
  23553. } else {
  23554. $$41420 = $$31419;$$41611 = $$31610;$$81515 = $$71514;$$9 = $80;$$91000 = $$8999;$$91106 = $$81105;$$91212 = $$81211;$$91318 = $79;
  23555. label = 20;
  23556. }
  23557. break;
  23558. }
  23559. case 33: {
  23560. label = 0;
  23561. $$01411 = $$01411$shrunk&255;
  23562. $109 = $$01411 << $$17;
  23563. $110 = $109 | $$171326;
  23564. $111 = (($$17) + 8)|0;
  23565. $112 = ($$17>>>0)>(4294967287);
  23566. if ($112) {
  23567. $$101426 = $$121428;$$101617 = $$121619;$$141111 = $$161113;$$141521 = $$161523;$$15 = $111;$$151006 = $$171008;$$151218 = $$171220;$$151324 = $110;
  23568. label = 29;
  23569. } else {
  23570. $$131429 = $$121428;$$131620 = $$121619;$$171114 = $$161113;$$171524 = $$161523;$$18 = $111;$$181009 = $$171008;$$181221 = $$171220;$$181327 = $110;
  23571. label = 34;
  23572. }
  23573. break;
  23574. }
  23575. case 50: {
  23576. label = 0;
  23577. $$01410 = $$01410$shrunk&255;
  23578. $155 = $$01410 << $$26;
  23579. $156 = $155 | $$261335;
  23580. $157 = (($$26) + 8)|0;
  23581. $158 = ($$26>>>0)>(4294967287);
  23582. if ($158) {
  23583. $$191435 = $$211437;$$191626 = $$211628;$$231120 = $$251122;$$231530 = $$251532;$$24 = $157;$$241015 = $$261017;$$241227 = $$261229;$$241333 = $156;
  23584. label = 46;
  23585. } else {
  23586. $$221438 = $$211437;$$221629 = $$211628;$$261123 = $$251122;$$261533 = $$251532;$$27 = $157;$$271230 = $$261229;$$271336 = $156;
  23587. label = 51;
  23588. }
  23589. break;
  23590. }
  23591. case 67: {
  23592. label = 0;
  23593. $$01300 = $$01300$shrunk&255;
  23594. $196 = $$01300 << $$37;
  23595. $197 = $196 | $$371346;
  23596. $198 = (($$37) + 8)|0;
  23597. $199 = (11742 + ($$361133)|0);
  23598. $200 = HEAP8[$199>>0]|0;
  23599. $201 = $200 << 24 >> 24;
  23600. $202 = ($198>>>0)<($201>>>0);
  23601. if ($202) {
  23602. $$301446 = $$321448;$$301637 = $$321639;$$341025 = $$361027;$$341131 = $$361133;$$341541 = $$361543;$$35 = $198;$$351238 = $$371240;$$351344 = $197;
  23603. label = 63;
  23604. } else {
  23605. $$331449 = $$321448;$$331640 = $$321639;$$371028 = $$361027;$$371134 = $$361133;$$371544 = $$361543;$$38 = $198;$$381241 = $$371240;$$381347 = $197;
  23606. label = 68;
  23607. }
  23608. break;
  23609. }
  23610. case 76: {
  23611. label = 0;
  23612. $$01202 = $$01202$shrunk&255;
  23613. $227 = $$01202 << $$42;
  23614. $228 = $227 | $$421351;
  23615. $229 = (($$42) + 8)|0;
  23616. $230 = ($229>>>0)<(3);
  23617. if ($230) {
  23618. $$351451 = $$371453;$$351642 = $$371644;$$391030 = $$411032;$$391136 = $$411138;$$391546 = $$411548;$$40 = $229;$$401243 = $$421245;$$401349 = $228;
  23619. label = 72;
  23620. } else {
  23621. $$381454 = $$371453;$$381645 = $$371644;$$421033 = $$411032;$$421139 = $$411138;$$421549 = $$411548;$$43 = $229;$$431246 = $$421245;$$431352 = $228;
  23622. label = 77;
  23623. }
  23624. break;
  23625. }
  23626. case 117: {
  23627. label = 0;
  23628. $$0980 = $$0980$shrunk&255;
  23629. $455 = $$0980 << $$49;
  23630. $456 = $455 | $$491358;
  23631. $457 = (($$49) + 8)|0;
  23632. $458 = ($457>>>0)<(15);
  23633. if ($458) {
  23634. $$421458 = $$441460;$$421649 = $$441651;$$461037 = $$481039;$$461143 = $$481145;$$461553 = $$481555;$$47 = $457;$$471250 = $$491252;$$471356 = $456;
  23635. label = 108;
  23636. } else {
  23637. $$451461 = $$441460;$$451652 = $$441651;$$491146 = $$481145;$$491556 = $$481555;$$50 = $457;$$501253 = $$491252;$$501359 = $456;
  23638. label = 119;
  23639. }
  23640. break;
  23641. }
  23642. case 131: {
  23643. label = 0;
  23644. $$0979 = $$0979$shrunk&255;
  23645. $506 = $$0979 << $$54;
  23646. $507 = $506 | $$541363;
  23647. $508 = (($$54) + 8)|0;
  23648. $509 = ($508>>>0)<($$541257>>>0);
  23649. if ($509) {
  23650. $$471463 = $$491465;$$471654 = $$491656;$$501041 = $$521043;$$511148 = $$531150;$$511558 = $$531560;$$52 = $508;$$521255 = $$541257;$$521361 = $507;
  23651. label = 127;
  23652. } else {
  23653. $$501466 = $$491465;$$501657 = $$491656;$$531044 = $$521043;$$541151 = $$531150;$$541561 = $$531560;$$55 = $508;$$551258 = $$541257;$$551364 = $507;
  23654. label = 132;
  23655. }
  23656. break;
  23657. }
  23658. case 154: {
  23659. label = 0;
  23660. $$0971 = $$0971$shrunk&255;
  23661. $575 = $$0971 << $$62;
  23662. $576 = $575 | $$621371;
  23663. $577 = (($$62) + 8)|0;
  23664. $578 = ($577>>>0)<(15);
  23665. if ($578) {
  23666. $$551471 = $$571473;$$551662 = $$571664;$$581049 = $$601051;$$591156 = $$611158;$$591566 = $$611568;$$60 = $577;$$601263 = $$621265;$$601369 = $576;
  23667. label = 145;
  23668. } else {
  23669. $$581474 = $$571473;$$581665 = $$571664;$$611052 = $$601051;$$621569 = $$611568;$$63 = $577;$$631266 = $$621265;$$631372 = $576;
  23670. label = 156;
  23671. }
  23672. break;
  23673. }
  23674. case 183: {
  23675. label = 0;
  23676. $$0959 = $$0959$shrunk&255;
  23677. $699 = $$0959 << $$71;
  23678. $700 = $699 | $$711380;
  23679. $701 = (($$71) + 8)|0;
  23680. $702 = ($701>>>0)<($$681271>>>0);
  23681. if ($702) {
  23682. $$611477 = $$631479;$$621669 = $$641671;$$641055 = $$661057;$$651162 = $$671164;$$661269 = $$681271;$$681575 = $$701577;$$69 = $701;$$691378 = $700;
  23683. label = 179;
  23684. } else {
  23685. $$641480 = $$631479;$$651672 = $$641671;$$671058 = $$661057;$$681165 = $$671164;$$691272 = $$681271;$$711578 = $$701577;$$72 = $701;$$721381 = $700;
  23686. label = 184;
  23687. }
  23688. break;
  23689. }
  23690. case 196: {
  23691. label = 0;
  23692. $$0952 = $$0952$shrunk&255;
  23693. $740 = $$0952 << $$76;
  23694. $741 = $740 | $$761385;
  23695. $742 = (($$76) + 8)|0;
  23696. $743 = ($742>>>0)<(15);
  23697. if ($743) {
  23698. $$661482 = $$681484;$$671674 = $$691676;$$691060 = $$711062;$$701167 = $$721169;$$711274 = $$731276;$$731580 = $$751582;$$74 = $742;$$741383 = $741;
  23699. label = 187;
  23700. } else {
  23701. $$691485 = $$681484;$$701677 = $$691676;$$731170 = $$721169;$$761583 = $$751582;$$77 = $742;$$771386 = $741;
  23702. label = 198;
  23703. }
  23704. break;
  23705. }
  23706. case 207: {
  23707. label = 0;
  23708. $$0950 = $$0950$shrunk&255;
  23709. $787 = $$0950 << $$80;
  23710. $788 = $787 | $$801389;
  23711. $789 = (($$80) + 8)|0;
  23712. $790 = ($789>>>0)<($$761279>>>0);
  23713. if ($790) {
  23714. $$701486 = $$721488;$$711678 = $$731680;$$721063 = $$741065;$$741171 = $$761173;$$741277 = $$761279;$$771584 = $$791586;$$78 = $789;$$781387 = $788;
  23715. label = 203;
  23716. } else {
  23717. $$741681 = $$731680;$$751066 = $$741065;$$771174 = $$761173;$$771280 = $$761279;$$801587 = $$791586;$$81 = $789;$$811390 = $788;
  23718. label = 208;
  23719. }
  23720. break;
  23721. }
  23722. case 227: {
  23723. label = 0;
  23724. $852 = ($$871184>>>0)<(4);
  23725. if (!($852)) {
  23726. $$881504 = $$811497;$$921083 = $$851076;$$921699 = $$851692;$$941191 = $$871184;$$941297 = $$871290;$$971604 = $$901597;$$98 = $$91;$$981407 = $$911400;
  23727. label = 242;
  23728. continue L46;
  23729. }
  23730. $853 = ($$91|0)==(0);
  23731. if (!($853)) {
  23732. $854 = ($$91>>>0)<(8);
  23733. if ($854) {
  23734. $$821498 = $$811497;$$861077 = $$851076;$$861693 = $$851692;$$881185 = $$871184;$$881291 = $$871290;$$911598 = $$901597;$$92 = $$91;$$921401 = $$911400;
  23735. label = 230;
  23736. break;
  23737. } else {
  23738. $$851501 = $$811497;$$891080 = $$851076;$$891696 = $$851692;$$911188 = $$871184;$$911294 = $$871290;$$941601 = $$901597;$$95 = $$91;$$951404 = $$911400;
  23739. label = 235;
  23740. break;
  23741. }
  23742. }
  23743. $868 = ($$901597>>>0)<($10>>>0);
  23744. if (!($868)) {
  23745. $$861502 = $$811497;$$901081 = $$851076;$$901697 = $$851692;$$921189 = $$871184;$$921295 = $$871290;$$951602 = $$901597;$$96 = 0;$$961405 = $$911400;
  23746. label = 237;
  23747. continue L46;
  23748. }
  23749. $875 = ((($$901597)) + 1|0);
  23750. $876 = HEAP8[$$901597>>0]|0;
  23751. $877 = $876&255;
  23752. $$0948 = $877;$$871503 = $$811497;$$911082 = $$851076;$$911698 = $$851692;$$931190 = $$871184;$$931296 = $$871290;$$961603 = $875;$$97 = 0;$$971406 = $$911400;
  23753. label = 241;
  23754. continue L46;
  23755. break;
  23756. }
  23757. case 234: {
  23758. label = 0;
  23759. $$0947 = $$0947$shrunk&255;
  23760. $861 = $$0947 << $$94;
  23761. $862 = $861 | $$941403;
  23762. $863 = (($$94) + 8)|0;
  23763. $864 = ($$94>>>0)>(4294967287);
  23764. if ($864) {
  23765. $$821498 = $$841500;$$861077 = $$881079;$$861693 = $$881695;$$881185 = $$901187;$$881291 = $$901293;$$911598 = $$931600;$$92 = $863;$$921401 = $862;
  23766. label = 230;
  23767. } else {
  23768. $$851501 = $$841500;$$891080 = $$881079;$$891696 = $$881695;$$911188 = $$901187;$$911294 = $$901293;$$941601 = $$931600;$$95 = $863;$$951404 = $862;
  23769. label = 235;
  23770. }
  23771. break;
  23772. }
  23773. }
  23774. L119: do {
  23775. if ((label|0) == 15) {
  23776. label = 0;
  23777. $72 = ($$51512>>>0)<($10>>>0);
  23778. if ($72) {
  23779. $$31419$ph = $$11417;$$31610$ph = $$11608;$$8$ph = $$6;$$81105$ph = $$61103;$$81211$ph = $$61209;$$81317$ph = $$61315;$$8999$ph = $$6997;$$sink1710 = $$51512;
  23780. label = 18;
  23781. continue L46;
  23782. } else {
  23783. $$21418 = $$11417;$$21609 = $$11608;$$61513 = $$51512;$$7 = $$6;$$71104 = $$61103;$$71210 = $$61209;$$71316 = $$61315;$$7998 = $$6997;
  23784. label = 16;
  23785. continue L46;
  23786. }
  23787. }
  23788. else if ((label|0) == 20) {
  23789. label = 0;
  23790. $82 = $$91318 & 7;
  23791. $83 = ((($0)) + 20|0);
  23792. HEAP32[$83>>2] = $82;
  23793. $84 = $$91318 >>> 3;
  23794. $85 = (($$9) + -3)|0;
  23795. $86 = $82 >>> 1;
  23796. $87 = ((($0)) + 24|0);
  23797. HEAP32[$87>>2] = $86;
  23798. $trunc = $86&255;
  23799. $trunc$clear = $trunc & 3;
  23800. switch ($trunc$clear<<24>>24) {
  23801. case 0: {
  23802. $$121519 = $$81515;$$13 = $85;$$131004 = $$91000;$$131216 = $$91212;$$131322 = $84;$$81424 = $$41420;$$81615 = $$41611;
  23803. label = 25;
  23804. continue L46;
  23805. break;
  23806. }
  23807. case 3: {
  23808. $$281444 = $$41420;$$281635 = $$41611;$$321023 = $$91000;$$321129 = $$91106;$$321539 = $$81515;$$33 = $85;$$331236 = $$91212;$$331342 = $84;
  23809. label = 60;
  23810. continue L46;
  23811. break;
  23812. }
  23813. case 1: {
  23814. break;
  23815. }
  23816. default: {
  23817. $$291445 = $$41420;$$291636 = $$41611;$$331024 = $$91000;$$331130 = 0;$$331540 = $$81515;$$34 = $85;$$341237 = $$91212;$$341343 = $84;
  23818. label = 61;
  23819. break L119;
  23820. }
  23821. }
  23822. $240 = ((($0)) + 44|0);
  23823. HEAP32[$240>>2] = 288;
  23824. $241 = ((($0)) + 48|0);
  23825. HEAP32[$241>>2] = 32;
  23826. $242 = ((($0)) + 3552|0);
  23827. ;HEAP32[$242>>2]=84215045|0;HEAP32[$242+4>>2]=84215045|0;HEAP32[$242+8>>2]=84215045|0;HEAP32[$242+12>>2]=84215045|0;HEAP32[$242+16>>2]=84215045|0;HEAP32[$242+20>>2]=84215045|0;HEAP32[$242+24>>2]=84215045|0;HEAP32[$242+28>>2]=84215045|0;
  23828. $scevgep19611962 = ((($0)) + 64|0);
  23829. _memset(($scevgep19611962|0),8,144)|0;
  23830. $scevgep1959 = ((($0)) + 208|0);
  23831. dest=$scevgep1959; stop=dest+112|0; do { HEAP8[dest>>0]=9|0; dest=dest+1|0; } while ((dest|0) < (stop|0));
  23832. $scevgep1957 = ((($0)) + 320|0);
  23833. dest=$scevgep1957; stop=dest+24|0; do { HEAP8[dest>>0]=7|0; dest=dest+1|0; } while ((dest|0) < (stop|0));
  23834. $scevgep1955 = ((($0)) + 344|0);
  23835. $243 = $scevgep1955;
  23836. $244 = $243;
  23837. HEAP8[$244>>0]=134744072&255;HEAP8[$244+1>>0]=(134744072>>8)&255;HEAP8[$244+2>>0]=(134744072>>16)&255;HEAP8[$244+3>>0]=134744072>>24;
  23838. $245 = (($243) + 4)|0;
  23839. $246 = $245;
  23840. HEAP8[$246>>0]=134744072&255;HEAP8[$246+1>>0]=(134744072>>8)&255;HEAP8[$246+2>>0]=(134744072>>16)&255;HEAP8[$246+3>>0]=134744072>>24;
  23841. $$391455 = $$41420;$$391646 = $$41611;$$431034 = $$91000;$$431140 = $$91106;$$431550 = $$81515;$$44 = $85;$$441247 = $$91212;$$441353 = $84;
  23842. label = 80;
  23843. }
  23844. else if ((label|0) == 230) {
  23845. label = 0;
  23846. $855 = ($$911598>>>0)<($10>>>0);
  23847. if ($855) {
  23848. $$841500$ph = $$821498;$$881079$ph = $$861077;$$881695$ph = $$861693;$$901187$ph = $$881185;$$901293$ph = $$881291;$$94$ph = $$92;$$941403$ph = $$921401;$$sink1750 = $$911598;
  23849. label = 233;
  23850. continue L46;
  23851. } else {
  23852. $$831499 = $$821498;$$871078 = $$861077;$$871694 = $$861693;$$891186 = $$881185;$$891292 = $$881291;$$921599 = $$911598;$$93 = $$92;$$931402 = $$921401;
  23853. label = 231;
  23854. continue L46;
  23855. }
  23856. }
  23857. else if ((label|0) == 235) {
  23858. label = 0;
  23859. $865 = $$951404 & 255;
  23860. $866 = $$951404 >>> 8;
  23861. $867 = (($$95) + -8)|0;
  23862. $$0948 = $865;$$871503 = $$851501;$$911082 = $$891080;$$911698 = $$891696;$$931190 = $$911188;$$931296 = $$911294;$$961603 = $$941601;$$97 = $867;$$971406 = $866;
  23863. label = 241;
  23864. continue L46;
  23865. }
  23866. } while(0);
  23867. L125: while(1) {
  23868. L126: switch (label|0) {
  23869. case 26: {
  23870. label = 0;
  23871. $100 = ($$131110>>>0)<(4);
  23872. if (!($100)) {
  23873. $127 = ((($0)) + 10528|0);
  23874. $128 = HEAP8[$127>>0]|0;
  23875. $129 = $128&255;
  23876. $130 = ((($0)) + 10529|0);
  23877. $131 = HEAP8[$130>>0]|0;
  23878. $132 = $131&255;
  23879. $133 = $132 << 8;
  23880. $134 = $133 | $129;
  23881. $135 = ((($0)) + 10530|0);
  23882. $136 = HEAP8[$135>>0]|0;
  23883. $137 = $136&255;
  23884. $138 = ((($0)) + 10531|0);
  23885. $139 = HEAP8[$138>>0]|0;
  23886. $140 = $139&255;
  23887. $141 = $140 << 8;
  23888. $142 = $141 | $137;
  23889. $143 = $142 ^ 65535;
  23890. $144 = ($134|0)==($143|0);
  23891. if ($144) {
  23892. $$181434 = $$91425;$$181625 = $$91616;$$221119 = $134;$$221529 = $$131520;$$23 = $$14;$$231014 = $$141005;$$231226 = $$141217;$$231332 = $$141323;
  23893. label = 44;
  23894. continue L125;
  23895. } else {
  23896. $$171433 = $$91425;$$171624 = $$91616;$$211118 = $134;$$211528 = $$131520;$$22 = $$14;$$221013 = $$141005;$$221225 = $$141217;$$221331 = $$141323;
  23897. label = 43;
  23898. continue L46;
  23899. }
  23900. }
  23901. $101 = ($$14|0)==(0);
  23902. if (!($101)) {
  23903. $102 = ($$14>>>0)<(8);
  23904. if ($102) {
  23905. $$101426 = $$91425;$$101617 = $$91616;$$141111 = $$131110;$$141521 = $$131520;$$15 = $$14;$$151006 = $$141005;$$151218 = $$141217;$$151324 = $$141323;
  23906. label = 29;
  23907. continue L125;
  23908. } else {
  23909. $$131429 = $$91425;$$131620 = $$91616;$$171114 = $$131110;$$171524 = $$131520;$$18 = $$14;$$181009 = $$141005;$$181221 = $$141217;$$181327 = $$141323;
  23910. label = 34;
  23911. continue L125;
  23912. }
  23913. }
  23914. $117 = ($$131520>>>0)<($10>>>0);
  23915. if (!($117)) {
  23916. $$141430 = $$91425;$$141621 = $$91616;$$181115 = $$131110;$$181525 = $$131520;$$19 = 0;$$191010 = $$141005;$$191222 = $$141217;$$191328 = $$141323;
  23917. label = 36;
  23918. continue L46;
  23919. }
  23920. $123 = ((($$131520)) + 1|0);
  23921. $124 = HEAP8[$$131520>>0]|0;
  23922. $125 = (((($0)) + 10528|0) + ($$131110)|0);
  23923. HEAP8[$125>>0] = $124;
  23924. $$161432 = $$91425;$$161623 = $$91616;$$201117 = $$131110;$$201527 = $123;$$21 = 0;$$211012 = $$141005;$$211224 = $$141217;$$211330 = $$141323;
  23925. label = 41;
  23926. continue L125;
  23927. break;
  23928. }
  23929. case 29: {
  23930. label = 0;
  23931. $103 = ($$141521>>>0)<($10>>>0);
  23932. if ($103) {
  23933. $$121428$ph = $$101426;$$121619$ph = $$101617;$$161113$ph = $$141111;$$17$ph = $$15;$$171008$ph = $$151006;$$171220$ph = $$151218;$$171326$ph = $$151324;$$sink1713 = $$141521;
  23934. label = 32;
  23935. continue L46;
  23936. } else {
  23937. $$111427 = $$101426;$$111618 = $$101617;$$151112 = $$141111;$$151522 = $$141521;$$16 = $$15;$$161007 = $$151006;$$161219 = $$151218;$$161325 = $$151324;
  23938. label = 30;
  23939. continue L46;
  23940. }
  23941. break;
  23942. }
  23943. case 34: {
  23944. label = 0;
  23945. $113 = $$181327&255;
  23946. $114 = (((($0)) + 10528|0) + ($$171114)|0);
  23947. HEAP8[$114>>0] = $113;
  23948. $115 = $$181327 >>> 8;
  23949. $116 = (($$18) + -8)|0;
  23950. $$161432 = $$131429;$$161623 = $$131620;$$201117 = $$171114;$$201527 = $$171524;$$21 = $116;$$211012 = $$181009;$$211224 = $$181221;$$211330 = $115;
  23951. label = 41;
  23952. continue L125;
  23953. break;
  23954. }
  23955. case 41: {
  23956. label = 0;
  23957. $126 = (($$201117) + 1)|0;
  23958. $$131110 = $126;$$131520 = $$201527;$$14 = $$21;$$141005 = $$211012;$$141217 = $$211224;$$141323 = $$211330;$$91425 = $$161432;$$91616 = $$161623;
  23959. label = 26;
  23960. continue L125;
  23961. break;
  23962. }
  23963. case 44: {
  23964. label = 0;
  23965. $145 = ($$221119|0)!=(0);
  23966. $146 = ($$23|0)!=(0);
  23967. $147 = $145 & $146;
  23968. if (!($147)) {
  23969. $$241440 = $$181434;$$241631 = $$181625;$$281019 = $$231014;$$281125 = $$221119;$$281535 = $$221529;$$29 = $$23;$$291232 = $$231226;$$291338 = $$231332;
  23970. label = 54;
  23971. continue L125;
  23972. }
  23973. $148 = ($$23>>>0)<(8);
  23974. if ($148) {
  23975. $$191435 = $$181434;$$191626 = $$181625;$$231120 = $$221119;$$231530 = $$221529;$$24 = $$23;$$241015 = $$231014;$$241227 = $$231226;$$241333 = $$231332;
  23976. label = 46;
  23977. continue L125;
  23978. } else {
  23979. $$221438 = $$181434;$$221629 = $$181625;$$261123 = $$221119;$$261533 = $$221529;$$27 = $$23;$$271230 = $$231226;$$271336 = $$231332;
  23980. label = 51;
  23981. continue L125;
  23982. }
  23983. break;
  23984. }
  23985. case 46: {
  23986. label = 0;
  23987. $149 = ($$231530>>>0)<($10>>>0);
  23988. if ($149) {
  23989. $$211437$ph = $$191435;$$211628$ph = $$191626;$$251122$ph = $$231120;$$26$ph = $$24;$$261017$ph = $$241015;$$261229$ph = $$241227;$$261335$ph = $$241333;$$sink1716 = $$231530;
  23990. label = 49;
  23991. continue L46;
  23992. } else {
  23993. $$201436 = $$191435;$$201627 = $$191626;$$241121 = $$231120;$$241531 = $$231530;$$25 = $$24;$$251016 = $$241015;$$251228 = $$241227;$$251334 = $$241333;
  23994. label = 47;
  23995. continue L46;
  23996. }
  23997. break;
  23998. }
  23999. case 51: {
  24000. label = 0;
  24001. $159 = $$271336 & 255;
  24002. $160 = $$271336 >>> 8;
  24003. $161 = (($$27) + -8)|0;
  24004. $$231439 = $$221438;$$231630 = $$221629;$$271018 = $159;$$271124 = $$261123;$$271534 = $$261533;$$28 = $161;$$281231 = $$271230;$$281337 = $160;
  24005. label = 52;
  24006. continue L46;
  24007. break;
  24008. }
  24009. case 54: {
  24010. label = 0;
  24011. $166 = ($$281125|0)==(0);
  24012. if ($166) {
  24013. $$761492 = $$241440;$$801071 = $$281019;$$801687 = $$241631;$$821285 = $$291232;$$831180 = 0;$$851592 = $$281535;$$86 = $$29;$$861395 = $$291338;
  24014. label = 220;
  24015. break L125;
  24016. } else {
  24017. $$251441 = $$241440;$$251632 = $$241631;$$291020 = $$281019;$$291126 = $$281125;$$291536 = $$281535;$$30 = $$29;$$301233 = $$291232;$$301339 = $$291338;
  24018. label = 55;
  24019. continue L46;
  24020. }
  24021. break;
  24022. }
  24023. case 61: {
  24024. label = 0;
  24025. $185 = ($$331130>>>0)<(3);
  24026. if ($185) {
  24027. $186 = (11742 + ($$331130)|0);
  24028. $187 = HEAP8[$186>>0]|0;
  24029. $188 = $187 << 24 >> 24;
  24030. $189 = ($$34>>>0)<($188>>>0);
  24031. if ($189) {
  24032. $$301446 = $$291445;$$301637 = $$291636;$$341025 = $$331024;$$341131 = $$331130;$$341541 = $$331540;$$35 = $$34;$$351238 = $$341237;$$351344 = $$341343;
  24033. label = 63;
  24034. continue L125;
  24035. } else {
  24036. $$331449 = $$291445;$$331640 = $$291636;$$371028 = $$331024;$$371134 = $$331130;$$371544 = $$331540;$$38 = $$34;$$381241 = $$341237;$$381347 = $$341343;
  24037. label = 68;
  24038. continue L125;
  24039. }
  24040. } else {
  24041. $216 = ((($0)) + 7040|0);
  24042. _memset(($216|0),0,288)|0;
  24043. $$341450 = $$291445;$$341641 = $$291636;$$381029 = $$331024;$$381135 = 0;$$381545 = $$331540;$$39 = $$34;$$391242 = $$341237;$$391348 = $$341343;
  24044. label = 70;
  24045. break;
  24046. }
  24047. break;
  24048. }
  24049. case 63: {
  24050. label = 0;
  24051. $190 = ($$341541>>>0)<($10>>>0);
  24052. if ($190) {
  24053. $$321448$ph = $$301446;$$321639$ph = $$301637;$$361027$ph = $$341025;$$361133$ph = $$341131;$$37$ph = $$35;$$371240$ph = $$351238;$$371346$ph = $$351344;$$sink1719 = $$341541;
  24054. label = 66;
  24055. continue L46;
  24056. } else {
  24057. $$311447 = $$301446;$$311638 = $$301637;$$351026 = $$341025;$$351132 = $$341131;$$351542 = $$341541;$$36 = $$35;$$361239 = $$351238;$$361345 = $$351344;
  24058. label = 64;
  24059. continue L46;
  24060. }
  24061. break;
  24062. }
  24063. case 68: {
  24064. label = 0;
  24065. $203 = (11742 + ($$371134)|0);
  24066. $204 = HEAP8[$203>>0]|0;
  24067. $205 = $204 << 24 >> 24;
  24068. $206 = 1 << $205;
  24069. $207 = (($206) + -1)|0;
  24070. $208 = $207 & $$381347;
  24071. $209 = (((($0)) + 44|0) + ($$371134<<2)|0);
  24072. $210 = $$381347 >>> $205;
  24073. $211 = (($$38) - ($205))|0;
  24074. $212 = (3144 + ($$371134<<2)|0);
  24075. $213 = HEAP32[$212>>2]|0;
  24076. $214 = (($208) + ($213))|0;
  24077. HEAP32[$209>>2] = $214;
  24078. $215 = (($$371134) + 1)|0;
  24079. $$291445 = $$331449;$$291636 = $$331640;$$331024 = $$371028;$$331130 = $215;$$331540 = $$371544;$$34 = $211;$$341237 = $$381241;$$341343 = $210;
  24080. label = 61;
  24081. continue L125;
  24082. break;
  24083. }
  24084. case 72: {
  24085. label = 0;
  24086. $221 = ($$391546>>>0)<($10>>>0);
  24087. if ($221) {
  24088. $$371453$ph = $$351451;$$371644$ph = $$351642;$$411032$ph = $$391030;$$411138$ph = $$391136;$$42$ph = $$40;$$421245$ph = $$401243;$$421351$ph = $$401349;$$sink1722 = $$391546;
  24089. label = 75;
  24090. continue L46;
  24091. } else {
  24092. $$361452 = $$351451;$$361643 = $$351642;$$401031 = $$391030;$$401137 = $$391136;$$401547 = $$391546;$$41 = $$40;$$411244 = $$401243;$$411350 = $$401349;
  24093. label = 73;
  24094. continue L46;
  24095. }
  24096. break;
  24097. }
  24098. case 77: {
  24099. label = 0;
  24100. $231 = $$431352 & 7;
  24101. $232 = $$431352 >>> 3;
  24102. $233 = (($$43) + -3)|0;
  24103. $234 = $231&255;
  24104. $235 = (11746 + ($$421139)|0);
  24105. $236 = HEAP8[$235>>0]|0;
  24106. $237 = $236&255;
  24107. $238 = (((($0)) + 7040|0) + ($237)|0);
  24108. HEAP8[$238>>0] = $234;
  24109. $239 = (($$421139) + 1)|0;
  24110. $$341450 = $$381454;$$341641 = $$381645;$$381029 = $$421033;$$381135 = $239;$$381545 = $$421549;$$39 = $233;$$391242 = $$431246;$$391348 = $232;
  24111. label = 70;
  24112. break;
  24113. }
  24114. case 80: {
  24115. label = 0;
  24116. $247 = ((($0)) + 24|0);
  24117. $248 = HEAP32[$247>>2]|0;
  24118. $249 = ($248|0)>(-1);
  24119. if ($249) {
  24120. dest=$8; stop=dest+64|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0));
  24121. $250 = (((((($0)) + 64|0) + (($248*3488)|0)|0)) + 288|0);
  24122. _memset(($250|0),0,3200)|0;
  24123. $251 = HEAP32[$247>>2]|0;
  24124. $252 = (((($0)) + 44|0) + ($251<<2)|0);
  24125. $253 = HEAP32[$252>>2]|0;
  24126. $254 = ($253|0)==(0);
  24127. if (!($254)) {
  24128. $255 = HEAP32[$247>>2]|0;
  24129. $256 = (((($0)) + 44|0) + ($255<<2)|0);
  24130. $257 = HEAP32[$256>>2]|0;
  24131. $$010951864 = 0;
  24132. while(1) {
  24133. $258 = ((((($0)) + 64|0) + (($248*3488)|0)|0) + ($$010951864)|0);
  24134. $259 = HEAP8[$258>>0]|0;
  24135. $260 = $259&255;
  24136. $261 = (($8) + ($260<<2)|0);
  24137. $262 = HEAP32[$261>>2]|0;
  24138. $263 = (($262) + 1)|0;
  24139. HEAP32[$261>>2] = $263;
  24140. $264 = (($$010951864) + 1)|0;
  24141. $265 = ($264>>>0)<($257>>>0);
  24142. if ($265) {
  24143. $$010951864 = $264;
  24144. } else {
  24145. break;
  24146. }
  24147. }
  24148. }
  24149. $266 = ((($7)) + 4|0);
  24150. HEAP32[$266>>2] = 0;
  24151. HEAP32[$7>>2] = 0;
  24152. $267 = ((($8)) + 4|0);
  24153. $268 = HEAP32[$267>>2]|0;
  24154. $269 = $268 << 1;
  24155. $270 = ((($7)) + 8|0);
  24156. HEAP32[$270>>2] = $269;
  24157. $271 = ((($8)) + 8|0);
  24158. $272 = HEAP32[$271>>2]|0;
  24159. $273 = (($272) + ($268))|0;
  24160. $274 = (($272) + ($269))|0;
  24161. $275 = $274 << 1;
  24162. $276 = ((($7)) + 12|0);
  24163. HEAP32[$276>>2] = $275;
  24164. $277 = ((($8)) + 12|0);
  24165. $278 = HEAP32[$277>>2]|0;
  24166. $279 = (($278) + ($273))|0;
  24167. $280 = (($278) + ($275))|0;
  24168. $281 = $280 << 1;
  24169. $282 = ((($7)) + 16|0);
  24170. HEAP32[$282>>2] = $281;
  24171. $283 = ((($8)) + 16|0);
  24172. $284 = HEAP32[$283>>2]|0;
  24173. $285 = (($284) + ($279))|0;
  24174. $286 = (($284) + ($281))|0;
  24175. $287 = $286 << 1;
  24176. $288 = ((($7)) + 20|0);
  24177. HEAP32[$288>>2] = $287;
  24178. $289 = ((($8)) + 20|0);
  24179. $290 = HEAP32[$289>>2]|0;
  24180. $291 = (($290) + ($285))|0;
  24181. $292 = (($290) + ($287))|0;
  24182. $293 = $292 << 1;
  24183. $294 = ((($7)) + 24|0);
  24184. HEAP32[$294>>2] = $293;
  24185. $295 = ((($8)) + 24|0);
  24186. $296 = HEAP32[$295>>2]|0;
  24187. $297 = (($296) + ($291))|0;
  24188. $298 = (($296) + ($293))|0;
  24189. $299 = $298 << 1;
  24190. $300 = ((($7)) + 28|0);
  24191. HEAP32[$300>>2] = $299;
  24192. $301 = ((($8)) + 28|0);
  24193. $302 = HEAP32[$301>>2]|0;
  24194. $303 = (($302) + ($297))|0;
  24195. $304 = (($302) + ($299))|0;
  24196. $305 = $304 << 1;
  24197. $306 = ((($7)) + 32|0);
  24198. HEAP32[$306>>2] = $305;
  24199. $307 = ((($8)) + 32|0);
  24200. $308 = HEAP32[$307>>2]|0;
  24201. $309 = (($308) + ($303))|0;
  24202. $310 = (($308) + ($305))|0;
  24203. $311 = $310 << 1;
  24204. $312 = ((($7)) + 36|0);
  24205. HEAP32[$312>>2] = $311;
  24206. $313 = ((($8)) + 36|0);
  24207. $314 = HEAP32[$313>>2]|0;
  24208. $315 = (($314) + ($309))|0;
  24209. $316 = (($314) + ($311))|0;
  24210. $317 = $316 << 1;
  24211. $318 = ((($7)) + 40|0);
  24212. HEAP32[$318>>2] = $317;
  24213. $319 = ((($8)) + 40|0);
  24214. $320 = HEAP32[$319>>2]|0;
  24215. $321 = (($320) + ($315))|0;
  24216. $322 = (($320) + ($317))|0;
  24217. $323 = $322 << 1;
  24218. $324 = ((($7)) + 44|0);
  24219. HEAP32[$324>>2] = $323;
  24220. $325 = ((($8)) + 44|0);
  24221. $326 = HEAP32[$325>>2]|0;
  24222. $327 = (($326) + ($321))|0;
  24223. $328 = (($326) + ($323))|0;
  24224. $329 = $328 << 1;
  24225. $330 = ((($7)) + 48|0);
  24226. HEAP32[$330>>2] = $329;
  24227. $331 = ((($8)) + 48|0);
  24228. $332 = HEAP32[$331>>2]|0;
  24229. $333 = (($332) + ($327))|0;
  24230. $334 = (($332) + ($329))|0;
  24231. $335 = $334 << 1;
  24232. $336 = ((($7)) + 52|0);
  24233. HEAP32[$336>>2] = $335;
  24234. $337 = ((($8)) + 52|0);
  24235. $338 = HEAP32[$337>>2]|0;
  24236. $339 = (($338) + ($333))|0;
  24237. $340 = (($338) + ($335))|0;
  24238. $341 = $340 << 1;
  24239. $342 = ((($7)) + 56|0);
  24240. HEAP32[$342>>2] = $341;
  24241. $343 = ((($8)) + 56|0);
  24242. $344 = HEAP32[$343>>2]|0;
  24243. $345 = (($344) + ($339))|0;
  24244. $346 = (($344) + ($341))|0;
  24245. $347 = $346 << 1;
  24246. $348 = ((($7)) + 60|0);
  24247. HEAP32[$348>>2] = $347;
  24248. $349 = ((($8)) + 60|0);
  24249. $350 = HEAP32[$349>>2]|0;
  24250. $351 = (($350) + ($345))|0;
  24251. $352 = (($350) + ($347))|0;
  24252. $353 = $352 << 1;
  24253. $354 = ((($7)) + 64|0);
  24254. HEAP32[$354>>2] = $353;
  24255. $355 = ($353|0)!=(65536);
  24256. $356 = ($351>>>0)>(1);
  24257. $or$cond = $355 & $356;
  24258. if ($or$cond) {
  24259. $$401456 = $$391455;$$401647 = $$391646;$$441035 = $$431034;$$441141 = $$431140;$$441551 = $$431550;$$45 = $$44;$$451248 = $$441247;$$451354 = $$441353;
  24260. label = 86;
  24261. continue L46;
  24262. }
  24263. $357 = HEAP32[$247>>2]|0;
  24264. $358 = (((($0)) + 44|0) + ($357<<2)|0);
  24265. $359 = HEAP32[$358>>2]|0;
  24266. $360 = ($359|0)==(0);
  24267. if ($360) {
  24268. $$lcssa1779 = $357;
  24269. } else {
  24270. $$010911856 = 0;$$011971855 = -1;
  24271. while(1) {
  24272. $361 = ((((($0)) + 64|0) + (($248*3488)|0)|0) + ($$010911856)|0);
  24273. $362 = HEAP8[$361>>0]|0;
  24274. $363 = $362&255;
  24275. $364 = ($362<<24>>24)==(0);
  24276. L142: do {
  24277. if ($364) {
  24278. $$41201 = $$011971855;
  24279. } else {
  24280. $365 = (($7) + ($363<<2)|0);
  24281. $366 = HEAP32[$365>>2]|0;
  24282. $367 = (($366) + 1)|0;
  24283. HEAP32[$365>>2] = $367;
  24284. $$010861840 = $366;$$010871839 = $363;$$010881838 = 0;
  24285. while(1) {
  24286. $368 = $$010881838 << 1;
  24287. $369 = $$010861840 & 1;
  24288. $370 = $369 | $368;
  24289. $371 = (($$010871839) + -1)|0;
  24290. $372 = $$010861840 >>> 1;
  24291. $373 = ($371|0)==(0);
  24292. if ($373) {
  24293. break;
  24294. } else {
  24295. $$010861840 = $372;$$010871839 = $371;$$010881838 = $370;
  24296. }
  24297. }
  24298. $374 = ($362&255)<(11);
  24299. if ($374) {
  24300. $375 = $363 << 9;
  24301. $376 = $375 | $$010911856;
  24302. $377 = $376&65535;
  24303. $378 = ($370>>>0)<(1024);
  24304. if (!($378)) {
  24305. $$41201 = $$011971855;
  24306. break;
  24307. }
  24308. $379 = 1 << $363;
  24309. $$110891852 = $370;
  24310. while(1) {
  24311. $380 = ((((((($0)) + 64|0) + (($248*3488)|0)|0)) + 288|0) + ($$110891852<<1)|0);
  24312. HEAP16[$380>>1] = $377;
  24313. $381 = (($$110891852) + ($379))|0;
  24314. $382 = ($381>>>0)<(1024);
  24315. if ($382) {
  24316. $$110891852 = $381;
  24317. } else {
  24318. $$41201 = $$011971855;
  24319. break L142;
  24320. }
  24321. }
  24322. }
  24323. $383 = $370 & 1023;
  24324. $384 = ((((((($0)) + 64|0) + (($248*3488)|0)|0)) + 288|0) + ($383<<1)|0);
  24325. $385 = HEAP16[$384>>1]|0;
  24326. $386 = $385 << 16 >> 16;
  24327. $387 = ($385<<16>>16)==(0);
  24328. if ($387) {
  24329. $388 = (($$011971855) + -2)|0;
  24330. $389 = $$011971855&65535;
  24331. HEAP16[$384>>1] = $389;
  24332. $$01194 = $$011971855;$$11198 = $388;
  24333. } else {
  24334. $$01194 = $386;$$11198 = $$011971855;
  24335. }
  24336. $390 = $$010881838 >>> 9;
  24337. $391 = ($362&255)>(11);
  24338. $392 = $390 & 1;
  24339. $393 = (($392) - ($$01194))|0;
  24340. $394 = (($393) + -1)|0;
  24341. if ($391) {
  24342. $395 = $390 & 4194303;
  24343. $$010941846 = $363;$$211991845 = $$11198;$397 = $394;$406 = $395;
  24344. while(1) {
  24345. $396 = ((((((($0)) + 64|0) + (($248*3488)|0)|0)) + 2336|0) + ($397<<1)|0);
  24346. $398 = HEAP16[$396>>1]|0;
  24347. $399 = ($398<<16>>16)==(0);
  24348. if ($399) {
  24349. $400 = $$211991845&65535;
  24350. HEAP16[$396>>1] = $400;
  24351. $401 = (($$211991845) + -2)|0;
  24352. $$21196 = $$211991845;$$31200 = $401;
  24353. } else {
  24354. $402 = $398 << 16 >> 16;
  24355. $$21196 = $402;$$31200 = $$211991845;
  24356. }
  24357. $403 = (($$010941846) + -1)|0;
  24358. $404 = ($403>>>0)>(11);
  24359. $405 = $406 >>> 1;
  24360. $407 = $405 & 1;
  24361. $408 = (($407) - ($$21196))|0;
  24362. $409 = (($408) + -1)|0;
  24363. if ($404) {
  24364. $$010941846 = $403;$$211991845 = $$31200;$397 = $409;$406 = $405;
  24365. } else {
  24366. $$21199$lcssa = $$31200;$$lcssa1778 = $409;
  24367. break;
  24368. }
  24369. }
  24370. } else {
  24371. $$21199$lcssa = $$11198;$$lcssa1778 = $394;
  24372. }
  24373. $410 = $$010911856&65535;
  24374. $411 = ((((((($0)) + 64|0) + (($248*3488)|0)|0)) + 2336|0) + ($$lcssa1778<<1)|0);
  24375. HEAP16[$411>>1] = $410;
  24376. $$41201 = $$21199$lcssa;
  24377. }
  24378. } while(0);
  24379. $412 = (($$010911856) + 1)|0;
  24380. $413 = HEAP32[$247>>2]|0;
  24381. $414 = (((($0)) + 44|0) + ($413<<2)|0);
  24382. $415 = HEAP32[$414>>2]|0;
  24383. $416 = ($412>>>0)<($415>>>0);
  24384. if ($416) {
  24385. $$010911856 = $412;$$011971855 = $$41201;
  24386. } else {
  24387. $$lcssa1779 = $413;
  24388. break;
  24389. }
  24390. }
  24391. }
  24392. $417 = ($$lcssa1779|0)==(2);
  24393. if ($417) {
  24394. $$411457 = $$391455;$$411648 = $$391646;$$451036 = $$431034;$$451142 = 0;$$451552 = $$431550;$$46 = $$44;$$461249 = $$441247;$$461355 = $$441353;
  24395. label = 105;
  24396. } else {
  24397. $$521468 = $$391455;$$521659 = $$391646;$$551046 = $$431034;$$561153 = $$431140;$$561563 = $$431550;$$57 = $$44;$$571260 = $$441247;$$571366 = $$441353;
  24398. label = 138;
  24399. }
  24400. } else {
  24401. $$531469 = $$391455;$$531660 = $$391646;$$561047 = $$431034;$$571154 = $$431140;$$571564 = $$431550;$$58 = $$44;$$581261 = $$441247;$$581367 = $$441353;
  24402. label = 139;
  24403. }
  24404. break;
  24405. }
  24406. case 108: {
  24407. label = 0;
  24408. $429 = $$471356 & 1023;
  24409. $430 = (((($0)) + 7328|0) + ($429<<1)|0);
  24410. $431 = HEAP16[$430>>1]|0;
  24411. $432 = $431 << 16 >> 16;
  24412. $433 = ($431<<16>>16)>(-1);
  24413. if ($433) {
  24414. $434 = $432 >> 9;
  24415. $435 = (($434) + -1)|0;
  24416. $436 = ($435>>>0)<($$47>>>0);
  24417. if ($436) {
  24418. $$451461 = $$421458;$$451652 = $$421649;$$491146 = $$461143;$$491556 = $$461553;$$50 = $$47;$$501253 = $$471250;$$501359 = $$471356;
  24419. label = 119;
  24420. continue L125;
  24421. } else {
  24422. label = 113;
  24423. break L125;
  24424. }
  24425. }
  24426. $437 = ($$47>>>0)>(10);
  24427. if ($437) {
  24428. $$0981 = 10;$$0984 = $432;
  24429. } else {
  24430. label = 113;
  24431. break L125;
  24432. }
  24433. while(1) {
  24434. $438 = $$0984 ^ -1;
  24435. $439 = $$471356 >>> $$0981;
  24436. $440 = $439 & 1;
  24437. $441 = (($440) + ($438))|0;
  24438. $442 = (((($0)) + 9376|0) + ($441<<1)|0);
  24439. $443 = HEAP16[$442>>1]|0;
  24440. $444 = ($443<<16>>16)<(0);
  24441. if (!($444)) {
  24442. $$451461 = $$421458;$$451652 = $$421649;$$491146 = $$461143;$$491556 = $$461553;$$50 = $$47;$$501253 = $$471250;$$501359 = $$471356;
  24443. label = 119;
  24444. continue L125;
  24445. }
  24446. $445 = (($$0981) + 1)|0;
  24447. $446 = $443 << 16 >> 16;
  24448. $447 = (($$0981) + 2)|0;
  24449. $448 = ($$47>>>0)<($447>>>0);
  24450. if ($448) {
  24451. label = 113;
  24452. break L125;
  24453. } else {
  24454. $$0981 = $445;$$0984 = $446;
  24455. }
  24456. }
  24457. break;
  24458. }
  24459. case 119: {
  24460. label = 0;
  24461. $471 = $$501359 & 1023;
  24462. $472 = (((($0)) + 7328|0) + ($471<<1)|0);
  24463. $473 = HEAP16[$472>>1]|0;
  24464. $474 = $473 << 16 >> 16;
  24465. $475 = ($473<<16>>16)>(-1);
  24466. if ($475) {
  24467. $476 = $474 >> 9;
  24468. $477 = $474 & 511;
  24469. $$2983 = $476;$$2986 = $477;
  24470. } else {
  24471. $$1982 = 10;$$1985 = $474;
  24472. while(1) {
  24473. $478 = $$1985 ^ -1;
  24474. $479 = (($$1982) + 1)|0;
  24475. $480 = $$501359 >>> $$1982;
  24476. $481 = $480 & 1;
  24477. $482 = (($481) + ($478))|0;
  24478. $483 = (((($0)) + 9376|0) + ($482<<1)|0);
  24479. $484 = HEAP16[$483>>1]|0;
  24480. $485 = $484 << 16 >> 16;
  24481. $486 = ($484<<16>>16)<(0);
  24482. if ($486) {
  24483. $$1982 = $479;$$1985 = $485;
  24484. } else {
  24485. $$2983 = $479;$$2986 = $485;
  24486. break;
  24487. }
  24488. }
  24489. }
  24490. $487 = $$501359 >>> $$2983;
  24491. $488 = (($$50) - ($$2983))|0;
  24492. $489 = ($$2986>>>0)<(16);
  24493. if ($489) {
  24494. $490 = $$2986&255;
  24495. $491 = (($$491146) + 1)|0;
  24496. $492 = (((($0)) + 10532|0) + ($$491146)|0);
  24497. HEAP8[$492>>0] = $490;
  24498. $$411457 = $$451461;$$411648 = $$451652;$$451036 = $$2986;$$451142 = $491;$$451552 = $$491556;$$46 = $488;$$461249 = $$501253;$$461355 = $487;
  24499. label = 105;
  24500. break;
  24501. }
  24502. $493 = ($$2986|0)!=(16);
  24503. $494 = ($$491146|0)!=(0);
  24504. $or$cond24 = $494 | $493;
  24505. if (!($or$cond24)) {
  24506. $$461462 = $$451461;$$461653 = $$451652;$$491040 = $$2986;$$501147 = $$491146;$$501557 = $$491556;$$51 = $488;$$511254 = $$501253;$$511360 = $487;
  24507. label = 125;
  24508. continue L46;
  24509. }
  24510. $495 = (($$2986) + -16)|0;
  24511. $496 = (11765 + ($495)|0);
  24512. $497 = HEAP8[$496>>0]|0;
  24513. $498 = $497 << 24 >> 24;
  24514. $499 = ($488>>>0)<($498>>>0);
  24515. if ($499) {
  24516. $$471463 = $$451461;$$471654 = $$451652;$$501041 = $$2986;$$511148 = $$491146;$$511558 = $$491556;$$52 = $488;$$521255 = $498;$$521361 = $487;
  24517. label = 127;
  24518. continue L125;
  24519. } else {
  24520. $$501466 = $$451461;$$501657 = $$451652;$$531044 = $$2986;$$541151 = $$491146;$$541561 = $$491556;$$55 = $488;$$551258 = $498;$$551364 = $487;
  24521. label = 132;
  24522. continue L125;
  24523. }
  24524. break;
  24525. }
  24526. case 127: {
  24527. label = 0;
  24528. $500 = ($$511558>>>0)<($10>>>0);
  24529. if ($500) {
  24530. $$491465$ph = $$471463;$$491656$ph = $$471654;$$521043$ph = $$501041;$$531150$ph = $$511148;$$54$ph = $$52;$$541257$ph = $$521255;$$541363$ph = $$521361;$$sink1732 = $$511558;
  24531. label = 130;
  24532. continue L46;
  24533. } else {
  24534. $$481464 = $$471463;$$481655 = $$471654;$$511042 = $$501041;$$521149 = $$511148;$$521559 = $$511558;$$53 = $$52;$$531256 = $$521255;$$531362 = $$521361;
  24535. label = 128;
  24536. continue L46;
  24537. }
  24538. break;
  24539. }
  24540. case 132: {
  24541. label = 0;
  24542. $510 = 1 << $$551258;
  24543. $511 = (($510) + -1)|0;
  24544. $512 = $511 & $$551364;
  24545. $513 = $$551364 >>> $$551258;
  24546. $514 = (($$55) - ($$551258))|0;
  24547. $515 = (($$531044) + -16)|0;
  24548. $516 = (11769 + ($515)|0);
  24549. $517 = HEAP8[$516>>0]|0;
  24550. $518 = $517 << 24 >> 24;
  24551. $519 = (($518) + ($512))|0;
  24552. $520 = (((($0)) + 10532|0) + ($$541151)|0);
  24553. $521 = ($$531044|0)==(16);
  24554. if ($521) {
  24555. $522 = (($$541151) + -1)|0;
  24556. $523 = (((($0)) + 10532|0) + ($522)|0);
  24557. $524 = HEAP8[$523>>0]|0;
  24558. $525 = $524&255;
  24559. $527 = $525;
  24560. } else {
  24561. $527 = 0;
  24562. }
  24563. $526 = $527&255;
  24564. _memset(($520|0),($526|0),($519|0))|0;
  24565. $528 = (($519) + ($$541151))|0;
  24566. $$411457 = $$501466;$$411648 = $$501657;$$451036 = $$531044;$$451142 = $528;$$451552 = $$541561;$$46 = $514;$$461249 = $$551258;$$461355 = $513;
  24567. label = 105;
  24568. break;
  24569. }
  24570. case 140: {
  24571. label = 0;
  24572. $539 = $10;
  24573. $540 = $$581565$ph;
  24574. $541 = (($539) - ($540))|0;
  24575. $542 = ($541|0)<(4);
  24576. $543 = ($$59$ph>>>0)<(15);
  24577. L241: do {
  24578. if ($542) {
  24579. $$541661$lcssa = $$541661$ph;$$581155$lcssa = $$581155$ph;$$581565$lcssa = $$581565$ph;$$59$lcssa = $$59$ph;$$591368$lcssa = $$591368$ph;$$lcssa1799 = $543;$$lcssa1802 = $541;
  24580. } else {
  24581. $544 = $12;
  24582. $$5416611868 = $$541661$ph;$$5811551871 = $$581155$ph;$$5815651869 = $$581565$ph;$$5913681870 = $$591368$ph;$$591872 = $$59$ph;$965 = $543;$966 = $541;
  24583. while(1) {
  24584. $545 = $$5416611868;
  24585. $546 = (($544) - ($545))|0;
  24586. $547 = ($546|0)<(2);
  24587. if ($547) {
  24588. $$541661$lcssa = $$5416611868;$$581155$lcssa = $$5811551871;$$581565$lcssa = $$5815651869;$$59$lcssa = $$591872;$$591368$lcssa = $$5913681870;$$lcssa1799 = $965;$$lcssa1802 = $966;
  24589. break L241;
  24590. }
  24591. if ($965) {
  24592. $613 = HEAP8[$$5815651869>>0]|0;
  24593. $614 = $613&255;
  24594. $615 = ((($$5815651869)) + 1|0);
  24595. $616 = HEAP8[$615>>0]|0;
  24596. $617 = $616&255;
  24597. $618 = $617 << 8;
  24598. $619 = $618 | $614;
  24599. $620 = $619 << $$591872;
  24600. $621 = $620 | $$5913681870;
  24601. $622 = ((($$5815651869)) + 2|0);
  24602. $623 = (($$591872) + 16)|0;
  24603. $$641571 = $622;$$65 = $623;$$651374 = $621;
  24604. } else {
  24605. $$641571 = $$5815651869;$$65 = $$591872;$$651374 = $$5913681870;
  24606. }
  24607. $624 = $$651374 & 1023;
  24608. $625 = (((($0)) + 352|0) + ($624<<1)|0);
  24609. $626 = HEAP16[$625>>1]|0;
  24610. $627 = $626 << 16 >> 16;
  24611. $628 = ($626<<16>>16)>(-1);
  24612. if ($628) {
  24613. $629 = $627 >> 9;
  24614. $$1964 = $629;$$1968 = $627;
  24615. } else {
  24616. $$0963 = 10;$$0967 = $627;
  24617. while(1) {
  24618. $630 = $$0967 ^ -1;
  24619. $631 = (($$0963) + 1)|0;
  24620. $632 = $$651374 >>> $$0963;
  24621. $633 = $632 & 1;
  24622. $634 = (($633) + ($630))|0;
  24623. $635 = (((($0)) + 2400|0) + ($634<<1)|0);
  24624. $636 = HEAP16[$635>>1]|0;
  24625. $637 = $636 << 16 >> 16;
  24626. $638 = ($636<<16>>16)<(0);
  24627. if ($638) {
  24628. $$0963 = $631;$$0967 = $637;
  24629. } else {
  24630. $$1964 = $631;$$1968 = $637;
  24631. break;
  24632. }
  24633. }
  24634. }
  24635. $639 = $$651374 >>> $$1964;
  24636. $640 = (($$65) - ($$1964))|0;
  24637. $641 = $$1968 & 256;
  24638. $642 = ($641|0)==(0);
  24639. if (!($642)) {
  24640. $$601476 = $$541470$ph;$$611668 = $$5416611868;$$631054 = $$571048$ph;$$641161 = $$1968;$$651268 = $$591262$ph;$$671574 = $$641571;$$68 = $640;$$681377 = $639;
  24641. label = 176;
  24642. break L126;
  24643. }
  24644. $643 = ($640>>>0)<(15);
  24645. if ($643) {
  24646. $644 = HEAP8[$$641571>>0]|0;
  24647. $645 = $644&255;
  24648. $646 = ((($$641571)) + 1|0);
  24649. $647 = HEAP8[$646>>0]|0;
  24650. $648 = $647&255;
  24651. $649 = $648 << 8;
  24652. $650 = $649 | $645;
  24653. $651 = $650 << $640;
  24654. $652 = $651 | $639;
  24655. $653 = ((($$641571)) + 2|0);
  24656. $654 = (($640) + 16)|0;
  24657. $$651572 = $653;$$66 = $654;$$661375 = $652;
  24658. } else {
  24659. $$651572 = $$641571;$$66 = $640;$$661375 = $639;
  24660. }
  24661. $655 = $$661375 & 1023;
  24662. $656 = (((($0)) + 352|0) + ($655<<1)|0);
  24663. $657 = HEAP16[$656>>1]|0;
  24664. $658 = $657 << 16 >> 16;
  24665. $659 = ($657<<16>>16)>(-1);
  24666. if ($659) {
  24667. $660 = $658 >> 9;
  24668. $$3966 = $660;$$3970 = $658;
  24669. } else {
  24670. $$2965 = 10;$$2969 = $658;
  24671. while(1) {
  24672. $661 = $$2969 ^ -1;
  24673. $662 = (($$2965) + 1)|0;
  24674. $663 = $$661375 >>> $$2965;
  24675. $664 = $663 & 1;
  24676. $665 = (($664) + ($661))|0;
  24677. $666 = (((($0)) + 2400|0) + ($665<<1)|0);
  24678. $667 = HEAP16[$666>>1]|0;
  24679. $668 = $667 << 16 >> 16;
  24680. $669 = ($667<<16>>16)<(0);
  24681. if ($669) {
  24682. $$2965 = $662;$$2969 = $668;
  24683. } else {
  24684. $$3966 = $662;$$3970 = $668;
  24685. break;
  24686. }
  24687. }
  24688. }
  24689. $670 = $$661375 >>> $$3966;
  24690. $671 = (($$66) - ($$3966))|0;
  24691. $672 = $$1968&255;
  24692. HEAP8[$$5416611868>>0] = $672;
  24693. $673 = $$3970 & 256;
  24694. $674 = ($673|0)==(0);
  24695. if (!($674)) {
  24696. break;
  24697. }
  24698. $676 = $$3970&255;
  24699. $677 = ((($$5416611868)) + 1|0);
  24700. HEAP8[$677>>0] = $676;
  24701. $678 = ((($$5416611868)) + 2|0);
  24702. $679 = $$651572;
  24703. $680 = (($539) - ($679))|0;
  24704. $681 = ($680|0)<(4);
  24705. $682 = ($671>>>0)<(15);
  24706. if ($681) {
  24707. $$541661$lcssa = $678;$$581155$lcssa = $$1968;$$581565$lcssa = $$651572;$$59$lcssa = $671;$$591368$lcssa = $670;$$lcssa1799 = $682;$$lcssa1802 = $680;
  24708. break L241;
  24709. } else {
  24710. $$5416611868 = $678;$$5811551871 = $$1968;$$5815651869 = $$651572;$$5913681870 = $670;$$591872 = $671;$965 = $682;$966 = $680;
  24711. }
  24712. }
  24713. $675 = ((($$5416611868)) + 1|0);
  24714. $$601476 = $$541470$ph;$$611668 = $675;$$631054 = $$571048$ph;$$641161 = $$3970;$$651268 = $$591262$ph;$$671574 = $$651572;$$68 = $671;$$681377 = $670;
  24715. label = 176;
  24716. break L126;
  24717. }
  24718. } while(0);
  24719. if (!($$lcssa1799)) {
  24720. $$581474 = $$541470$ph;$$581665 = $$541661$lcssa;$$611052 = $$571048$ph;$$621569 = $$581565$lcssa;$$63 = $$59$lcssa;$$631266 = $$591262$ph;$$631372 = $$591368$lcssa;
  24721. label = 156;
  24722. continue L125;
  24723. }
  24724. $548 = ($$lcssa1802|0)<(2);
  24725. if ($548) {
  24726. $$551471 = $$541470$ph;$$551662 = $$541661$lcssa;$$581049 = $$571048$ph;$$591156 = $$581155$lcssa;$$591566 = $$581565$lcssa;$$60 = $$59$lcssa;$$601263 = $$591262$ph;$$601369 = $$591368$lcssa;
  24727. label = 145;
  24728. continue L125;
  24729. }
  24730. $579 = HEAP8[$$581565$lcssa>>0]|0;
  24731. $580 = $579&255;
  24732. $581 = $580 << $$59$lcssa;
  24733. $582 = ((($$581565$lcssa)) + 1|0);
  24734. $583 = HEAP8[$582>>0]|0;
  24735. $584 = $583&255;
  24736. $585 = (($$59$lcssa) + 8)|0;
  24737. $586 = $584 << $585;
  24738. $587 = $581 | $$591368$lcssa;
  24739. $588 = $587 | $586;
  24740. $589 = ((($$581565$lcssa)) + 2|0);
  24741. $590 = (($$59$lcssa) + 16)|0;
  24742. $$581474 = $$541470$ph;$$581665 = $$541661$lcssa;$$611052 = $$571048$ph;$$621569 = $589;$$63 = $590;$$631266 = $$591262$ph;$$631372 = $588;
  24743. label = 156;
  24744. continue L125;
  24745. break;
  24746. }
  24747. case 145: {
  24748. label = 0;
  24749. $549 = $$601369 & 1023;
  24750. $550 = (((($0)) + 352|0) + ($549<<1)|0);
  24751. $551 = HEAP16[$550>>1]|0;
  24752. $552 = $551 << 16 >> 16;
  24753. $553 = ($551<<16>>16)>(-1);
  24754. if ($553) {
  24755. $554 = $552 >> 9;
  24756. $555 = (($554) + -1)|0;
  24757. $556 = ($555>>>0)<($$60>>>0);
  24758. if ($556) {
  24759. $$581474 = $$551471;$$581665 = $$551662;$$611052 = $$581049;$$621569 = $$591566;$$63 = $$60;$$631266 = $$601263;$$631372 = $$601369;
  24760. label = 156;
  24761. continue L125;
  24762. } else {
  24763. label = 150;
  24764. break L125;
  24765. }
  24766. }
  24767. $557 = ($$60>>>0)>(10);
  24768. if ($557) {
  24769. $$0972 = 10;$$0975 = $552;
  24770. } else {
  24771. label = 150;
  24772. break L125;
  24773. }
  24774. while(1) {
  24775. $558 = $$0975 ^ -1;
  24776. $559 = $$601369 >>> $$0972;
  24777. $560 = $559 & 1;
  24778. $561 = (($560) + ($558))|0;
  24779. $562 = (((($0)) + 2400|0) + ($561<<1)|0);
  24780. $563 = HEAP16[$562>>1]|0;
  24781. $564 = ($563<<16>>16)<(0);
  24782. if (!($564)) {
  24783. $$581474 = $$551471;$$581665 = $$551662;$$611052 = $$581049;$$621569 = $$591566;$$63 = $$60;$$631266 = $$601263;$$631372 = $$601369;
  24784. label = 156;
  24785. continue L125;
  24786. }
  24787. $565 = (($$0972) + 1)|0;
  24788. $566 = $563 << 16 >> 16;
  24789. $567 = (($$0972) + 2)|0;
  24790. $568 = ($$60>>>0)<($567>>>0);
  24791. if ($568) {
  24792. label = 150;
  24793. break L125;
  24794. } else {
  24795. $$0972 = $565;$$0975 = $566;
  24796. }
  24797. }
  24798. break;
  24799. }
  24800. case 156: {
  24801. label = 0;
  24802. $591 = $$631372 & 1023;
  24803. $592 = (((($0)) + 352|0) + ($591<<1)|0);
  24804. $593 = HEAP16[$592>>1]|0;
  24805. $594 = $593 << 16 >> 16;
  24806. $595 = ($593<<16>>16)>(-1);
  24807. if ($595) {
  24808. $596 = $594 >> 9;
  24809. $597 = $594 & 511;
  24810. $$2974 = $596;$$2977 = $597;
  24811. } else {
  24812. $$1973 = 10;$$1976 = $594;
  24813. while(1) {
  24814. $598 = $$1976 ^ -1;
  24815. $599 = (($$1973) + 1)|0;
  24816. $600 = $$631372 >>> $$1973;
  24817. $601 = $600 & 1;
  24818. $602 = (($601) + ($598))|0;
  24819. $603 = (((($0)) + 2400|0) + ($602<<1)|0);
  24820. $604 = HEAP16[$603>>1]|0;
  24821. $605 = $604 << 16 >> 16;
  24822. $606 = ($604<<16>>16)<(0);
  24823. if ($606) {
  24824. $$1973 = $599;$$1976 = $605;
  24825. } else {
  24826. $$2974 = $599;$$2977 = $605;
  24827. break;
  24828. }
  24829. }
  24830. }
  24831. $607 = $$631372 >>> $$2974;
  24832. $608 = (($$63) - ($$2974))|0;
  24833. $609 = ($$2977>>>0)>(255);
  24834. if ($609) {
  24835. $$601476 = $$581474;$$611668 = $$581665;$$631054 = $$611052;$$641161 = $$2977;$$651268 = $$631266;$$671574 = $$621569;$$68 = $608;$$681377 = $607;
  24836. label = 176;
  24837. } else {
  24838. $$591475 = $$581474;$$591666 = $$581665;$$621053 = $$611052;$$621159 = $$2977;$$631570 = $$621569;$$64 = $608;$$641267 = $$631266;$$641373 = $607;
  24839. label = 160;
  24840. continue L46;
  24841. }
  24842. break;
  24843. }
  24844. case 179: {
  24845. label = 0;
  24846. $693 = ($$681575>>>0)<($10>>>0);
  24847. if ($693) {
  24848. $$631479$ph = $$611477;$$641671$ph = $$621669;$$661057$ph = $$641055;$$671164$ph = $$651162;$$681271$ph = $$661269;$$71$ph = $$69;$$711380$ph = $$691378;$$sink1739 = $$681575;
  24849. label = 182;
  24850. continue L46;
  24851. } else {
  24852. $$621478 = $$611477;$$631670 = $$621669;$$651056 = $$641055;$$661163 = $$651162;$$671270 = $$661269;$$691576 = $$681575;$$70 = $$69;$$701379 = $$691378;
  24853. label = 180;
  24854. continue L46;
  24855. }
  24856. break;
  24857. }
  24858. case 184: {
  24859. label = 0;
  24860. $703 = 1 << $$691272;
  24861. $704 = (($703) + -1)|0;
  24862. $705 = $704 & $$721381;
  24863. $706 = $$721381 >>> $$691272;
  24864. $707 = (($$72) - ($$691272))|0;
  24865. $708 = (($705) + ($$681165))|0;
  24866. $$651481 = $$641480;$$661673 = $$651672;$$681059 = $$671058;$$691166 = $708;$$701273 = $$691272;$$721579 = $$711578;$$73 = $707;$$731382 = $706;
  24867. label = 185;
  24868. break;
  24869. }
  24870. case 187: {
  24871. label = 0;
  24872. $714 = $$741383 & 1023;
  24873. $715 = (((($0)) + 3840|0) + ($714<<1)|0);
  24874. $716 = HEAP16[$715>>1]|0;
  24875. $717 = $716 << 16 >> 16;
  24876. $718 = ($716<<16>>16)>(-1);
  24877. if ($718) {
  24878. $719 = $717 >> 9;
  24879. $720 = (($719) + -1)|0;
  24880. $721 = ($720>>>0)<($$74>>>0);
  24881. if ($721) {
  24882. $$691485 = $$661482;$$701677 = $$671674;$$731170 = $$701167;$$761583 = $$731580;$$77 = $$74;$$771386 = $$741383;
  24883. label = 198;
  24884. continue L125;
  24885. } else {
  24886. label = 192;
  24887. break L125;
  24888. }
  24889. }
  24890. $722 = ($$74>>>0)>(10);
  24891. if ($722) {
  24892. $$0953 = 10;$$0956 = $717;
  24893. } else {
  24894. label = 192;
  24895. break L125;
  24896. }
  24897. while(1) {
  24898. $723 = $$0956 ^ -1;
  24899. $724 = $$741383 >>> $$0953;
  24900. $725 = $724 & 1;
  24901. $726 = (($725) + ($723))|0;
  24902. $727 = (((($0)) + 5888|0) + ($726<<1)|0);
  24903. $728 = HEAP16[$727>>1]|0;
  24904. $729 = ($728<<16>>16)<(0);
  24905. if (!($729)) {
  24906. $$691485 = $$661482;$$701677 = $$671674;$$731170 = $$701167;$$761583 = $$731580;$$77 = $$74;$$771386 = $$741383;
  24907. label = 198;
  24908. continue L125;
  24909. }
  24910. $730 = (($$0953) + 1)|0;
  24911. $731 = $728 << 16 >> 16;
  24912. $732 = (($$0953) + 2)|0;
  24913. $733 = ($$74>>>0)<($732>>>0);
  24914. if ($733) {
  24915. label = 192;
  24916. break L125;
  24917. } else {
  24918. $$0953 = $730;$$0956 = $731;
  24919. }
  24920. }
  24921. break;
  24922. }
  24923. case 198: {
  24924. label = 0;
  24925. $756 = $$771386 & 1023;
  24926. $757 = (((($0)) + 3840|0) + ($756<<1)|0);
  24927. $758 = HEAP16[$757>>1]|0;
  24928. $759 = $758 << 16 >> 16;
  24929. $760 = ($758<<16>>16)>(-1);
  24930. if ($760) {
  24931. $761 = $759 >> 9;
  24932. $762 = $759 & 511;
  24933. $$2955 = $761;$$2958 = $762;
  24934. } else {
  24935. $$1954 = 10;$$1957 = $759;
  24936. while(1) {
  24937. $763 = $$1957 ^ -1;
  24938. $764 = (($$1954) + 1)|0;
  24939. $765 = $$771386 >>> $$1954;
  24940. $766 = $765 & 1;
  24941. $767 = (($766) + ($763))|0;
  24942. $768 = (((($0)) + 5888|0) + ($767<<1)|0);
  24943. $769 = HEAP16[$768>>1]|0;
  24944. $770 = $769 << 16 >> 16;
  24945. $771 = ($769<<16>>16)<(0);
  24946. if ($771) {
  24947. $$1954 = $764;$$1957 = $770;
  24948. } else {
  24949. $$2955 = $764;$$2958 = $770;
  24950. break;
  24951. }
  24952. }
  24953. }
  24954. $772 = $$771386 >>> $$2955;
  24955. $773 = (($$77) - ($$2955))|0;
  24956. $774 = (3404 + ($$2958<<2)|0);
  24957. $775 = HEAP32[$774>>2]|0;
  24958. $776 = (3532 + ($$2958<<2)|0);
  24959. $777 = HEAP32[$776>>2]|0;
  24960. $778 = (($$2958) + -4)|0;
  24961. $779 = ($778>>>0)<(26);
  24962. if ($779) {
  24963. $780 = ($773>>>0)<($775>>>0);
  24964. if ($780) {
  24965. $$701486 = $$691485;$$711678 = $$701677;$$721063 = $777;$$741171 = $$731170;$$741277 = $775;$$771584 = $$761583;$$78 = $773;$$781387 = $772;
  24966. label = 203;
  24967. continue L125;
  24968. } else {
  24969. $$741681 = $$701677;$$751066 = $777;$$771174 = $$731170;$$771280 = $775;$$801587 = $$761583;$$81 = $773;$$811390 = $772;
  24970. label = 208;
  24971. continue L125;
  24972. }
  24973. } else {
  24974. $$751682 = $$701677;$$761067 = $777;$$781175 = $$731170;$$781281 = $775;$$811588 = $$761583;$$82 = $773;$$821391 = $772;
  24975. label = 209;
  24976. }
  24977. break;
  24978. }
  24979. case 203: {
  24980. label = 0;
  24981. $781 = ($$771584>>>0)<($10>>>0);
  24982. if ($781) {
  24983. $$721488$ph = $$701486;$$731680$ph = $$711678;$$741065$ph = $$721063;$$761173$ph = $$741171;$$761279$ph = $$741277;$$80$ph = $$78;$$801389$ph = $$781387;$$sink1746 = $$771584;
  24984. label = 206;
  24985. continue L46;
  24986. } else {
  24987. $$711487 = $$701486;$$721679 = $$711678;$$731064 = $$721063;$$751172 = $$741171;$$751278 = $$741277;$$781585 = $$771584;$$79 = $$78;$$791388 = $$781387;
  24988. label = 204;
  24989. continue L46;
  24990. }
  24991. break;
  24992. }
  24993. case 208: {
  24994. label = 0;
  24995. $791 = 1 << $$771280;
  24996. $792 = (($791) + -1)|0;
  24997. $793 = $792 & $$811390;
  24998. $794 = $$811390 >>> $$771280;
  24999. $795 = (($$81) - ($$771280))|0;
  25000. $796 = (($793) + ($$751066))|0;
  25001. $$751682 = $$741681;$$761067 = $796;$$781175 = $$771174;$$781281 = $$771280;$$811588 = $$801587;$$82 = $795;$$821391 = $794;
  25002. label = 209;
  25003. break;
  25004. }
  25005. case 212: {
  25006. label = 0;
  25007. $807 = (($$801177) + -1)|0;
  25008. $808 = ($$801177|0)==(0);
  25009. if ($808) {
  25010. $$531469 = $$741490;$$531660 = $$771684;$$561047 = $$781069;$$571154 = $807;$$571564 = $$831590;$$58 = $$84;$$581261 = $$801283;$$581367 = $$841393;
  25011. label = 139;
  25012. } else {
  25013. $$751491 = $$741490;$$781685 = $$771684;$$791070 = $$781069;$$811178 = $807;$$811284 = $$801283;$$841591 = $$831590;$$85 = $$84;$$851394 = $$841393;
  25014. label = 213;
  25015. continue L46;
  25016. }
  25017. break;
  25018. }
  25019. }
  25020. do {
  25021. if ((label|0) == 70) {
  25022. label = 0;
  25023. $217 = ((($0)) + 52|0);
  25024. $218 = HEAP32[$217>>2]|0;
  25025. $219 = ($$381135>>>0)<($218>>>0);
  25026. if ($219) {
  25027. $220 = ($$39>>>0)<(3);
  25028. if ($220) {
  25029. $$351451 = $$341450;$$351642 = $$341641;$$391030 = $$381029;$$391136 = $$381135;$$391546 = $$381545;$$40 = $$39;$$401243 = $$391242;$$401349 = $$391348;
  25030. label = 72;
  25031. continue L125;
  25032. } else {
  25033. $$381454 = $$341450;$$381645 = $$341641;$$421033 = $$381029;$$421139 = $$381135;$$421549 = $$381545;$$43 = $$39;$$431246 = $$391242;$$431352 = $$391348;
  25034. label = 77;
  25035. continue L125;
  25036. }
  25037. } else {
  25038. HEAP32[$217>>2] = 19;
  25039. $$391455 = $$341450;$$391646 = $$341641;$$431034 = $$381029;$$431140 = $$381135;$$431550 = $$381545;$$44 = $$39;$$441247 = $$391242;$$441353 = $$391348;
  25040. label = 80;
  25041. continue L125;
  25042. }
  25043. }
  25044. else if ((label|0) == 105) {
  25045. label = 0;
  25046. $418 = ((($0)) + 44|0);
  25047. $419 = HEAP32[$418>>2]|0;
  25048. $420 = ((($0)) + 48|0);
  25049. $421 = HEAP32[$420>>2]|0;
  25050. $422 = (($421) + ($419))|0;
  25051. $423 = ($$451142>>>0)<($422>>>0);
  25052. if (!($423)) {
  25053. $529 = ($422|0)==($$451142|0);
  25054. if (!($529)) {
  25055. $$511467 = $$411457;$$511658 = $$411648;$$541045 = $$451036;$$551152 = $$451142;$$551562 = $$451552;$$56 = $$46;$$561259 = $$461249;$$561365 = $$461355;
  25056. label = 136;
  25057. continue L46;
  25058. }
  25059. $530 = ((($0)) + 64|0);
  25060. $531 = ((($0)) + 10532|0);
  25061. _memcpy(($530|0),($531|0),($419|0))|0;
  25062. $532 = ((($0)) + 3552|0);
  25063. $533 = HEAP32[$418>>2]|0;
  25064. $534 = (((($0)) + 10532|0) + ($533)|0);
  25065. $535 = HEAP32[$420>>2]|0;
  25066. _memcpy(($532|0),($534|0),($535|0))|0;
  25067. $$521468 = $$411457;$$521659 = $$411648;$$551046 = $$451036;$$561153 = $$451142;$$561563 = $$451552;$$57 = $$46;$$571260 = $$461249;$$571366 = $$461355;
  25068. label = 138;
  25069. break;
  25070. }
  25071. $424 = ($$46>>>0)<(15);
  25072. if (!($424)) {
  25073. $$451461 = $$411457;$$451652 = $$411648;$$491146 = $$451142;$$491556 = $$451552;$$50 = $$46;$$501253 = $$461249;$$501359 = $$461355;
  25074. label = 119;
  25075. continue L125;
  25076. }
  25077. $425 = $10;
  25078. $426 = $$451552;
  25079. $427 = (($425) - ($426))|0;
  25080. $428 = ($427|0)<(2);
  25081. if ($428) {
  25082. $$421458 = $$411457;$$421649 = $$411648;$$461037 = $$451036;$$461143 = $$451142;$$461553 = $$451552;$$47 = $$46;$$471250 = $$461249;$$471356 = $$461355;
  25083. label = 108;
  25084. continue L125;
  25085. }
  25086. $459 = HEAP8[$$451552>>0]|0;
  25087. $460 = $459&255;
  25088. $461 = $460 << $$46;
  25089. $462 = ((($$451552)) + 1|0);
  25090. $463 = HEAP8[$462>>0]|0;
  25091. $464 = $463&255;
  25092. $465 = (($$46) + 8)|0;
  25093. $466 = $464 << $465;
  25094. $467 = $461 | $$461355;
  25095. $468 = $467 | $466;
  25096. $469 = ((($$451552)) + 2|0);
  25097. $470 = (($$46) + 16)|0;
  25098. $$451461 = $$411457;$$451652 = $$411648;$$491146 = $$451142;$$491556 = $469;$$50 = $470;$$501253 = $$461249;$$501359 = $468;
  25099. label = 119;
  25100. continue L125;
  25101. }
  25102. else if ((label|0) == 176) {
  25103. label = 0;
  25104. $683 = $$641161 & 511;
  25105. $684 = ($683|0)==(256);
  25106. if ($684) {
  25107. $$761492 = $$601476;$$801071 = $$631054;$$801687 = $$611668;$$821285 = $$651268;$$831180 = 256;$$851592 = $$671574;$$86 = $$68;$$861395 = $$681377;
  25108. label = 220;
  25109. break L125;
  25110. }
  25111. $685 = (($683) + -257)|0;
  25112. $686 = (3156 + ($685<<2)|0);
  25113. $687 = HEAP32[$686>>2]|0;
  25114. $688 = (3280 + ($685<<2)|0);
  25115. $689 = HEAP32[$688>>2]|0;
  25116. $690 = (($683) + -265)|0;
  25117. $691 = ($690>>>0)<(20);
  25118. if ($691) {
  25119. $692 = ($$68>>>0)<($687>>>0);
  25120. if ($692) {
  25121. $$611477 = $$601476;$$621669 = $$611668;$$641055 = $$631054;$$651162 = $689;$$661269 = $687;$$681575 = $$671574;$$69 = $$68;$$691378 = $$681377;
  25122. label = 179;
  25123. continue L125;
  25124. } else {
  25125. $$641480 = $$601476;$$651672 = $$611668;$$671058 = $$631054;$$681165 = $689;$$691272 = $687;$$711578 = $$671574;$$72 = $$68;$$721381 = $$681377;
  25126. label = 184;
  25127. continue L125;
  25128. }
  25129. } else {
  25130. $$651481 = $$601476;$$661673 = $$611668;$$681059 = $$631054;$$691166 = $689;$$701273 = $687;$$721579 = $$671574;$$73 = $$68;$$731382 = $$681377;
  25131. label = 185;
  25132. }
  25133. }
  25134. else if ((label|0) == 209) {
  25135. label = 0;
  25136. $797 = $$751682;
  25137. $798 = $3;
  25138. $799 = (($797) - ($798))|0;
  25139. $$not = ($799>>>0)>=($$761067>>>0);
  25140. $$not1747 = $14 ^ 1;
  25141. $brmerge = $$not | $$not1747;
  25142. if (!($brmerge)) {
  25143. $$731489 = $799;$$761683 = $$751682;$$771068 = $$761067;$$791176 = $$781175;$$791282 = $$781281;$$821589 = $$811588;$$83 = $$82;$$831392 = $$821391;
  25144. label = 210;
  25145. continue L46;
  25146. }
  25147. $800 = (($799) - ($$761067))|0;
  25148. $801 = $800 & $$1753;
  25149. $802 = (($3) + ($801)|0);
  25150. $803 = ($$751682>>>0)>($802>>>0);
  25151. $804 = $803 ? $$751682 : $802;
  25152. $805 = (($804) + ($$781175)|0);
  25153. $806 = ($805>>>0)>($12>>>0);
  25154. if ($806) {
  25155. $$741490 = $799;$$771684 = $$751682;$$781069 = $$761067;$$801177 = $$781175;$$801283 = $$781281;$$831590 = $$811588;$$84 = $$82;$$841393 = $$821391;
  25156. label = 212;
  25157. continue L125;
  25158. } else {
  25159. $$0978 = $802;$$791686 = $$751682;$$821179 = $$781175;
  25160. }
  25161. while(1) {
  25162. $816 = HEAP8[$$0978>>0]|0;
  25163. HEAP8[$$791686>>0] = $816;
  25164. $817 = ((($$0978)) + 1|0);
  25165. $818 = HEAP8[$817>>0]|0;
  25166. $819 = ((($$791686)) + 1|0);
  25167. HEAP8[$819>>0] = $818;
  25168. $820 = ((($$0978)) + 2|0);
  25169. $821 = HEAP8[$820>>0]|0;
  25170. $822 = ((($$791686)) + 2|0);
  25171. HEAP8[$822>>0] = $821;
  25172. $823 = ((($$791686)) + 3|0);
  25173. $824 = ((($$0978)) + 3|0);
  25174. $825 = (($$821179) + -3)|0;
  25175. $826 = ($825|0)>(2);
  25176. if ($826) {
  25177. $$0978 = $824;$$791686 = $823;$$821179 = $825;
  25178. } else {
  25179. break;
  25180. }
  25181. }
  25182. $827 = ($825|0)>(0);
  25183. if ($827) {
  25184. $828 = HEAP8[$824>>0]|0;
  25185. HEAP8[$823>>0] = $828;
  25186. $829 = ($825|0)==(1);
  25187. if (!($829)) {
  25188. $830 = ((($$0978)) + 4|0);
  25189. $831 = HEAP8[$830>>0]|0;
  25190. $832 = ((($$791686)) + 4|0);
  25191. HEAP8[$832>>0] = $831;
  25192. }
  25193. $833 = (($823) + ($825)|0);
  25194. $$531469 = $799;$$531660 = $833;$$561047 = $$761067;$$571154 = $825;$$571564 = $$811588;$$58 = $$82;$$581261 = $$781281;$$581367 = $$821391;
  25195. label = 139;
  25196. } else {
  25197. $$531469 = $799;$$531660 = $823;$$561047 = $$761067;$$571154 = $825;$$571564 = $$811588;$$58 = $$82;$$581261 = $$781281;$$581367 = $$821391;
  25198. label = 139;
  25199. }
  25200. }
  25201. } while(0);
  25202. if ((label|0) == 138) {
  25203. label = 0;
  25204. $536 = ((($0)) + 24|0);
  25205. $537 = HEAP32[$536>>2]|0;
  25206. $538 = (($537) + -1)|0;
  25207. HEAP32[$536>>2] = $538;
  25208. $$391455 = $$521468;$$391646 = $$521659;$$431034 = $$551046;$$431140 = $$561153;$$431550 = $$561563;$$44 = $$57;$$441247 = $$571260;$$441353 = $$571366;
  25209. label = 80;
  25210. continue;
  25211. }
  25212. else if ((label|0) == 139) {
  25213. label = 0;
  25214. $$541470$ph = $$531469;$$541661$ph = $$531660;$$571048$ph = $$561047;$$581155$ph = $$571154;$$581565$ph = $$571564;$$59$ph = $$58;$$591262$ph = $$581261;$$591368$ph = $$581367;
  25215. label = 140;
  25216. continue;
  25217. }
  25218. else if ((label|0) == 185) {
  25219. label = 0;
  25220. $709 = ($$73>>>0)<(15);
  25221. if (!($709)) {
  25222. $$691485 = $$651481;$$701677 = $$661673;$$731170 = $$691166;$$761583 = $$721579;$$77 = $$73;$$771386 = $$731382;
  25223. label = 198;
  25224. continue;
  25225. }
  25226. $710 = $10;
  25227. $711 = $$721579;
  25228. $712 = (($710) - ($711))|0;
  25229. $713 = ($712|0)<(2);
  25230. if ($713) {
  25231. $$661482 = $$651481;$$671674 = $$661673;$$691060 = $$681059;$$701167 = $$691166;$$711274 = $$701273;$$731580 = $$721579;$$74 = $$73;$$741383 = $$731382;
  25232. label = 187;
  25233. continue;
  25234. }
  25235. $744 = HEAP8[$$721579>>0]|0;
  25236. $745 = $744&255;
  25237. $746 = $745 << $$73;
  25238. $747 = ((($$721579)) + 1|0);
  25239. $748 = HEAP8[$747>>0]|0;
  25240. $749 = $748&255;
  25241. $750 = (($$73) + 8)|0;
  25242. $751 = $749 << $750;
  25243. $752 = $746 | $$731382;
  25244. $753 = $752 | $751;
  25245. $754 = ((($$721579)) + 2|0);
  25246. $755 = (($$73) + 16)|0;
  25247. $$691485 = $$651481;$$701677 = $$661673;$$731170 = $$691166;$$761583 = $754;$$77 = $755;$$771386 = $753;
  25248. label = 198;
  25249. continue;
  25250. }
  25251. }
  25252. if ((label|0) == 113) {
  25253. label = 0;
  25254. $449 = ($$461553>>>0)<($10>>>0);
  25255. if ($449) {
  25256. $$441460$ph = $$421458;$$441651$ph = $$421649;$$481039$ph = $$461037;$$481145$ph = $$461143;$$49$ph = $$47;$$491252$ph = $$471250;$$491358$ph = $$471356;$$sink1729 = $$461553;
  25257. label = 116;
  25258. continue;
  25259. } else {
  25260. $$431459 = $$421458;$$431650 = $$421649;$$471038 = $$461037;$$471144 = $$461143;$$471554 = $$461553;$$48 = $$47;$$481251 = $$471250;$$481357 = $$471356;
  25261. label = 114;
  25262. continue;
  25263. }
  25264. }
  25265. else if ((label|0) == 150) {
  25266. label = 0;
  25267. $569 = ($$591566>>>0)<($10>>>0);
  25268. if ($569) {
  25269. $$571473$ph = $$551471;$$571664$ph = $$551662;$$601051$ph = $$581049;$$611158$ph = $$591156;$$62$ph = $$60;$$621265$ph = $$601263;$$621371$ph = $$601369;$$sink1736 = $$591566;
  25270. label = 153;
  25271. continue;
  25272. } else {
  25273. $$561472 = $$551471;$$561663 = $$551662;$$591050 = $$581049;$$601157 = $$591156;$$601567 = $$591566;$$61 = $$60;$$611264 = $$601263;$$611370 = $$601369;
  25274. label = 151;
  25275. continue;
  25276. }
  25277. }
  25278. else if ((label|0) == 192) {
  25279. label = 0;
  25280. $734 = ($$731580>>>0)<($10>>>0);
  25281. if ($734) {
  25282. $$681484$ph = $$661482;$$691676$ph = $$671674;$$711062$ph = $$691060;$$721169$ph = $$701167;$$731276$ph = $$711274;$$76$ph = $$74;$$761385$ph = $$741383;$$sink1743 = $$731580;
  25283. label = 195;
  25284. continue;
  25285. } else {
  25286. $$671483 = $$661482;$$681675 = $$671674;$$701061 = $$691060;$$711168 = $$701167;$$721275 = $$711274;$$741581 = $$731580;$$75 = $$74;$$751384 = $$741383;
  25287. label = 193;
  25288. continue;
  25289. }
  25290. }
  25291. else if ((label|0) == 220) {
  25292. label = 0;
  25293. $834 = ((($0)) + 20|0);
  25294. $835 = HEAP32[$834>>2]|0;
  25295. $836 = $835 & 1;
  25296. $837 = ($836|0)==(0);
  25297. if ($837) {
  25298. $$01416 = $$761492;$$01607 = $$801687;$$41511 = $$851592;$$5 = $$86;$$51102 = $$831180;$$51208 = $$821285;$$51314 = $$861395;$$5996 = $$801071;
  25299. label = 14;
  25300. continue;
  25301. }
  25302. $838 = $6 & 1;
  25303. $839 = ($838|0)==(0);
  25304. if ($839) {
  25305. $$881504 = $$761492;$$921083 = $$801071;$$921699 = $$801687;$$941191 = $$831180;$$941297 = $$821285;$$971604 = $$851592;$$98 = $$86;$$981407 = $$861395;
  25306. label = 242;
  25307. continue;
  25308. } else {
  25309. $$801496 = $$761492;$$841075 = $$801071;$$841691 = $$801687;$$861289 = $$821285;$$891596 = $$851592;$$90 = $$86;$$901399 = $$861395;
  25310. label = 226;
  25311. continue;
  25312. }
  25313. }
  25314. }
  25315. if ((label|0) == 258) {
  25316. STACKTOP = sp;return ($$0951|0);
  25317. }
  25318. $892 = ((($0)) + 28|0);
  25319. $893 = HEAP32[$892>>2]|0;
  25320. $894 = $893 & 65535;
  25321. $895 = $893 >>> 16;
  25322. $896 = ($888|0)==(0);
  25323. if ($896) {
  25324. $$0937$lcssa = $895;$$0938$lcssa = $894;
  25325. } else {
  25326. $897 = (($888>>>0) % 5552)&-1;
  25327. $$01834 = $897;$$09371833 = $895;$$09381832 = $894;$$09431831 = $888;$$09441830 = $4;
  25328. while(1) {
  25329. $898 = ($$01834>>>0)>(7);
  25330. if ($898) {
  25331. $899 = (($$01834) + -8)|0;
  25332. $900 = $899 & -8;
  25333. $scevgep = ((($$09441830)) + 8|0);
  25334. $$09411816 = 0;$$11818 = $$09371833;$$19391817 = $$09381832;$$19451815 = $$09441830;
  25335. while(1) {
  25336. $904 = HEAP8[$$19451815>>0]|0;
  25337. $905 = $904&255;
  25338. $906 = (($905) + ($$19391817))|0;
  25339. $907 = (($906) + ($$11818))|0;
  25340. $908 = ((($$19451815)) + 1|0);
  25341. $909 = HEAP8[$908>>0]|0;
  25342. $910 = $909&255;
  25343. $911 = (($906) + ($910))|0;
  25344. $912 = (($907) + ($911))|0;
  25345. $913 = ((($$19451815)) + 2|0);
  25346. $914 = HEAP8[$913>>0]|0;
  25347. $915 = $914&255;
  25348. $916 = (($911) + ($915))|0;
  25349. $917 = (($912) + ($916))|0;
  25350. $918 = ((($$19451815)) + 3|0);
  25351. $919 = HEAP8[$918>>0]|0;
  25352. $920 = $919&255;
  25353. $921 = (($916) + ($920))|0;
  25354. $922 = (($917) + ($921))|0;
  25355. $923 = ((($$19451815)) + 4|0);
  25356. $924 = HEAP8[$923>>0]|0;
  25357. $925 = $924&255;
  25358. $926 = (($921) + ($925))|0;
  25359. $927 = (($922) + ($926))|0;
  25360. $928 = ((($$19451815)) + 5|0);
  25361. $929 = HEAP8[$928>>0]|0;
  25362. $930 = $929&255;
  25363. $931 = (($926) + ($930))|0;
  25364. $932 = (($927) + ($931))|0;
  25365. $933 = ((($$19451815)) + 6|0);
  25366. $934 = HEAP8[$933>>0]|0;
  25367. $935 = $934&255;
  25368. $936 = (($931) + ($935))|0;
  25369. $937 = (($932) + ($936))|0;
  25370. $938 = ((($$19451815)) + 7|0);
  25371. $939 = HEAP8[$938>>0]|0;
  25372. $940 = $939&255;
  25373. $941 = (($936) + ($940))|0;
  25374. $942 = (($937) + ($941))|0;
  25375. $943 = (($$09411816) + 8)|0;
  25376. $944 = ((($$19451815)) + 8|0);
  25377. $945 = $943 | 7;
  25378. $946 = ($945>>>0)<($$01834>>>0);
  25379. if ($946) {
  25380. $$09411816 = $943;$$11818 = $942;$$19391817 = $941;$$19451815 = $944;
  25381. } else {
  25382. break;
  25383. }
  25384. }
  25385. $901 = (($900) + 8)|0;
  25386. $scevgep1947 = (($scevgep) + ($900)|0);
  25387. $$0941$lcssa = $901;$$1$lcssa = $942;$$1939$lcssa = $941;$$1945$lcssa = $scevgep1947;
  25388. } else {
  25389. $$0941$lcssa = 0;$$1$lcssa = $$09371833;$$1939$lcssa = $$09381832;$$1945$lcssa = $$09441830;
  25390. }
  25391. $902 = ($$01834>>>0)>($$0941$lcssa>>>0);
  25392. if ($902) {
  25393. $903 = (($$01834) - ($$0941$lcssa))|0;
  25394. $$19421823 = $$0941$lcssa;$$21825 = $$1$lcssa;$$29401824 = $$1939$lcssa;$$29461822 = $$1945$lcssa;
  25395. while(1) {
  25396. $947 = ((($$29461822)) + 1|0);
  25397. $948 = HEAP8[$$29461822>>0]|0;
  25398. $949 = $948&255;
  25399. $950 = (($949) + ($$29401824))|0;
  25400. $951 = (($950) + ($$21825))|0;
  25401. $952 = (($$19421823) + 1)|0;
  25402. $exitcond = ($952|0)==($$01834|0);
  25403. if ($exitcond) {
  25404. break;
  25405. } else {
  25406. $$19421823 = $952;$$21825 = $951;$$29401824 = $950;$$29461822 = $947;
  25407. }
  25408. }
  25409. $scevgep1948 = (($$1945$lcssa) + ($903)|0);
  25410. $$2$lcssa = $951;$$2940$lcssa = $950;$$2946$lcssa = $scevgep1948;
  25411. } else {
  25412. $$2$lcssa = $$1$lcssa;$$2940$lcssa = $$1939$lcssa;$$2946$lcssa = $$1945$lcssa;
  25413. }
  25414. $953 = (($$2940$lcssa>>>0) % 65521)&-1;
  25415. $954 = (($$2$lcssa>>>0) % 65521)&-1;
  25416. $955 = (($$09431831) - ($$01834))|0;
  25417. $956 = ($955|0)==(0);
  25418. if ($956) {
  25419. $$0937$lcssa = $954;$$0938$lcssa = $953;
  25420. break;
  25421. } else {
  25422. $$01834 = 5552;$$09371833 = $954;$$09381832 = $953;$$09431831 = $955;$$09441830 = $$2946$lcssa;
  25423. }
  25424. }
  25425. }
  25426. $957 = $$0937$lcssa << 16;
  25427. $958 = $957 | $$0938$lcssa;
  25428. HEAP32[$892>>2] = $958;
  25429. $959 = ($$1961|0)!=(0);
  25430. $960 = $6 & 1;
  25431. $961 = ($960|0)==(0);
  25432. $or$cond1752 = $961 | $959;
  25433. if ($or$cond1752) {
  25434. $$0951 = $$1961;
  25435. STACKTOP = sp;return ($$0951|0);
  25436. } else {
  25437. $962 = ((($0)) + 16|0);
  25438. $963 = HEAP32[$962>>2]|0;
  25439. $964 = ($958|0)==($963|0);
  25440. $$1961$ = $964 ? $$1961 : -2;
  25441. STACKTOP = sp;return ($$1961$|0);
  25442. }
  25443. return (0)|0;
  25444. }
  25445. function _LoadTexture($0,$1) {
  25446. $0 = $0|0;
  25447. $1 = $1|0;
  25448. var $$byval_copy1 = 0, $$sroa$0$0 = 0, $$sroa$0$0$copyload = 0, $$sroa$5 = 0, $$sroa$5$0$$sroa_idx = 0, $$sroa$5$0$$sroa_idx5 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $vararg_buffer = 0, label = 0, sp = 0;
  25449. sp = STACKTOP;
  25450. STACKTOP = STACKTOP + 80|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(80|0);
  25451. $$byval_copy1 = sp + 60|0;
  25452. $vararg_buffer = sp + 16|0;
  25453. $$sroa$5 = sp;
  25454. $2 = sp + 20|0;
  25455. $3 = sp + 40|0;
  25456. _LoadImage($2,$1);
  25457. $4 = HEAP32[$2>>2]|0;
  25458. $5 = ($4|0)==(0|0);
  25459. if ($5) {
  25460. _TraceLog(2,11773,$vararg_buffer);
  25461. $$sroa$0$0 = 0;
  25462. } else {
  25463. ;HEAP32[$$byval_copy1>>2]=HEAP32[$2>>2]|0;HEAP32[$$byval_copy1+4>>2]=HEAP32[$2+4>>2]|0;HEAP32[$$byval_copy1+8>>2]=HEAP32[$2+8>>2]|0;HEAP32[$$byval_copy1+12>>2]=HEAP32[$2+12>>2]|0;HEAP32[$$byval_copy1+16>>2]=HEAP32[$2+16>>2]|0;
  25464. _LoadTextureFromImage($3,$$byval_copy1);
  25465. $$sroa$0$0$copyload = HEAP32[$3>>2]|0;
  25466. $$sroa$5$0$$sroa_idx = ((($3)) + 4|0);
  25467. ;HEAP32[$$sroa$5>>2]=HEAP32[$$sroa$5$0$$sroa_idx>>2]|0;HEAP32[$$sroa$5+4>>2]=HEAP32[$$sroa$5$0$$sroa_idx+4>>2]|0;HEAP32[$$sroa$5+8>>2]=HEAP32[$$sroa$5$0$$sroa_idx+8>>2]|0;HEAP32[$$sroa$5+12>>2]=HEAP32[$$sroa$5$0$$sroa_idx+12>>2]|0;
  25468. ;HEAP32[$$byval_copy1>>2]=HEAP32[$2>>2]|0;HEAP32[$$byval_copy1+4>>2]=HEAP32[$2+4>>2]|0;HEAP32[$$byval_copy1+8>>2]=HEAP32[$2+8>>2]|0;HEAP32[$$byval_copy1+12>>2]=HEAP32[$2+12>>2]|0;HEAP32[$$byval_copy1+16>>2]=HEAP32[$2+16>>2]|0;
  25469. _UnloadImage($$byval_copy1);
  25470. $$sroa$0$0 = $$sroa$0$0$copyload;
  25471. }
  25472. HEAP32[$0>>2] = $$sroa$0$0;
  25473. $$sroa$5$0$$sroa_idx5 = ((($0)) + 4|0);
  25474. ;HEAP32[$$sroa$5$0$$sroa_idx5>>2]=HEAP32[$$sroa$5>>2]|0;HEAP32[$$sroa$5$0$$sroa_idx5+4>>2]=HEAP32[$$sroa$5+4>>2]|0;HEAP32[$$sroa$5$0$$sroa_idx5+8>>2]=HEAP32[$$sroa$5+8>>2]|0;HEAP32[$$sroa$5$0$$sroa_idx5+12>>2]=HEAP32[$$sroa$5+12>>2]|0;
  25475. STACKTOP = sp;return;
  25476. }
  25477. function _GetDefaultFont($0) {
  25478. $0 = $0|0;
  25479. var label = 0, sp = 0;
  25480. sp = STACKTOP;
  25481. ;HEAP32[$0>>2]=HEAP32[18568>>2]|0;HEAP32[$0+4>>2]=HEAP32[18568+4>>2]|0;HEAP32[$0+8>>2]=HEAP32[18568+8>>2]|0;HEAP32[$0+12>>2]=HEAP32[18568+12>>2]|0;HEAP32[$0+16>>2]=HEAP32[18568+16>>2]|0;HEAP32[$0+20>>2]=HEAP32[18568+20>>2]|0;HEAP32[$0+24>>2]=HEAP32[18568+24>>2]|0;HEAP32[$0+28>>2]=HEAP32[18568+28>>2]|0;
  25482. return;
  25483. }
  25484. function _GetCharIndex($0,$1) {
  25485. $0 = $0|0;
  25486. $1 = $1|0;
  25487. var $$08 = 0, $$09 = 0, $10 = 0, $11 = 0, $12 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
  25488. sp = STACKTOP;
  25489. $2 = ((($0)) + 24|0);
  25490. $3 = HEAP32[$2>>2]|0;
  25491. $4 = ($3|0)>(0);
  25492. if (!($4)) {
  25493. $$08 = 0;
  25494. return ($$08|0);
  25495. }
  25496. $5 = ((($0)) + 28|0);
  25497. $6 = HEAP32[$5>>2]|0;
  25498. $$09 = 0;
  25499. while(1) {
  25500. $7 = (($6) + ($$09<<5)|0);
  25501. $8 = HEAP32[$7>>2]|0;
  25502. $9 = ($8|0)==($1|0);
  25503. if ($9) {
  25504. $$08 = $$09;
  25505. label = 5;
  25506. break;
  25507. }
  25508. $10 = (($$09) + 1)|0;
  25509. $11 = HEAP32[$2>>2]|0;
  25510. $12 = ($10|0)<($11|0);
  25511. if ($12) {
  25512. $$09 = $10;
  25513. } else {
  25514. $$08 = 0;
  25515. label = 5;
  25516. break;
  25517. }
  25518. }
  25519. if ((label|0) == 5) {
  25520. return ($$08|0);
  25521. }
  25522. return (0)|0;
  25523. }
  25524. function _DrawTexturePro($0,$1,$2,$3,$4,$5) {
  25525. $0 = $0|0;
  25526. $1 = $1|0;
  25527. $2 = $2|0;
  25528. $3 = $3|0;
  25529. $4 = +$4;
  25530. $5 = $5|0;
  25531. var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0.0, $22 = 0, $23 = 0, $24 = 0.0, $25 = 0.0, $26 = 0.0, $27 = 0, $28 = 0.0, $29 = 0.0;
  25532. var $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0.0, $39 = 0, $40 = 0, $41 = 0.0, $42 = 0.0, $43 = 0, $44 = 0, $45 = 0.0, $46 = 0, $47 = 0, $48 = 0.0, $49 = 0.0;
  25533. var $50 = 0, $51 = 0.0, $52 = 0, $53 = 0.0, $54 = 0.0, $55 = 0, $56 = 0, $57 = 0, $58 = 0.0, $59 = 0, $6 = 0, $60 = 0.0, $61 = 0.0, $62 = 0, $63 = 0, $64 = 0.0, $65 = 0, $66 = 0, $67 = 0, $68 = 0.0;
  25534. var $69 = 0, $7 = 0, $70 = 0.0, $71 = 0.0, $72 = 0, $73 = 0, $74 = 0, $75 = 0.0, $76 = 0, $77 = 0.0, $78 = 0.0, $79 = 0, $8 = 0, $80 = 0, $81 = 0.0, $82 = 0, $83 = 0.0, $84 = 0, $85 = 0, $86 = 0;
  25535. var $87 = 0.0, $88 = 0, $89 = 0.0, $9 = 0, $90 = 0.0, $91 = 0, $92 = 0.0, $93 = 0, $94 = 0.0, $95 = 0.0, $96 = 0, $97 = 0.0, label = 0, sp = 0;
  25536. sp = STACKTOP;
  25537. $6 = HEAP32[$0>>2]|0;
  25538. $7 = ($6|0)==(0);
  25539. if ($7) {
  25540. return;
  25541. }
  25542. $8 = ((($1)) + 8|0);
  25543. $9 = HEAP32[$8>>2]|0;
  25544. $10 = ($9|0)<(0);
  25545. if ($10) {
  25546. $11 = HEAP32[$1>>2]|0;
  25547. $12 = (($11) - ($9))|0;
  25548. HEAP32[$1>>2] = $12;
  25549. }
  25550. $13 = ((($1)) + 12|0);
  25551. $14 = HEAP32[$13>>2]|0;
  25552. $15 = ($14|0)<(0);
  25553. if ($15) {
  25554. $16 = ((($1)) + 4|0);
  25555. $17 = HEAP32[$16>>2]|0;
  25556. $18 = (($17) - ($14))|0;
  25557. HEAP32[$16>>2] = $18;
  25558. }
  25559. $19 = HEAP32[$0>>2]|0;
  25560. _rlEnableTexture($19);
  25561. _rlPushMatrix();
  25562. $20 = HEAP32[$2>>2]|0;
  25563. $21 = (+($20|0));
  25564. $22 = ((($2)) + 4|0);
  25565. $23 = HEAP32[$22>>2]|0;
  25566. $24 = (+($23|0));
  25567. _rlTranslatef($21,$24,0.0);
  25568. _rlRotatef($4,0.0,0.0,1.0);
  25569. $25 = +HEAPF32[$3>>2];
  25570. $26 = -$25;
  25571. $27 = ((($3)) + 4|0);
  25572. $28 = +HEAPF32[$27>>2];
  25573. $29 = -$28;
  25574. _rlTranslatef($26,$29,0.0);
  25575. _rlBegin(7);
  25576. $30 = HEAP8[$5>>0]|0;
  25577. $31 = ((($5)) + 1|0);
  25578. $32 = HEAP8[$31>>0]|0;
  25579. $33 = ((($5)) + 2|0);
  25580. $34 = HEAP8[$33>>0]|0;
  25581. $35 = ((($5)) + 3|0);
  25582. $36 = HEAP8[$35>>0]|0;
  25583. _rlColor4ub($30,$32,$34,$36);
  25584. $37 = HEAP32[$1>>2]|0;
  25585. $38 = (+($37|0));
  25586. $39 = ((($0)) + 4|0);
  25587. $40 = HEAP32[$39>>2]|0;
  25588. $41 = (+($40|0));
  25589. $42 = $38 / $41;
  25590. $43 = ((($1)) + 4|0);
  25591. $44 = HEAP32[$43>>2]|0;
  25592. $45 = (+($44|0));
  25593. $46 = ((($0)) + 8|0);
  25594. $47 = HEAP32[$46>>2]|0;
  25595. $48 = (+($47|0));
  25596. $49 = $45 / $48;
  25597. _rlTexCoord2f($42,$49);
  25598. _rlVertex2f(0.0,0.0);
  25599. $50 = HEAP32[$1>>2]|0;
  25600. $51 = (+($50|0));
  25601. $52 = HEAP32[$39>>2]|0;
  25602. $53 = (+($52|0));
  25603. $54 = $51 / $53;
  25604. $55 = HEAP32[$43>>2]|0;
  25605. $56 = HEAP32[$13>>2]|0;
  25606. $57 = (($56) + ($55))|0;
  25607. $58 = (+($57|0));
  25608. $59 = HEAP32[$46>>2]|0;
  25609. $60 = (+($59|0));
  25610. $61 = $58 / $60;
  25611. _rlTexCoord2f($54,$61);
  25612. $62 = ((($2)) + 12|0);
  25613. $63 = HEAP32[$62>>2]|0;
  25614. $64 = (+($63|0));
  25615. _rlVertex2f(0.0,$64);
  25616. $65 = HEAP32[$1>>2]|0;
  25617. $66 = HEAP32[$8>>2]|0;
  25618. $67 = (($66) + ($65))|0;
  25619. $68 = (+($67|0));
  25620. $69 = HEAP32[$39>>2]|0;
  25621. $70 = (+($69|0));
  25622. $71 = $68 / $70;
  25623. $72 = HEAP32[$43>>2]|0;
  25624. $73 = HEAP32[$13>>2]|0;
  25625. $74 = (($73) + ($72))|0;
  25626. $75 = (+($74|0));
  25627. $76 = HEAP32[$46>>2]|0;
  25628. $77 = (+($76|0));
  25629. $78 = $75 / $77;
  25630. _rlTexCoord2f($71,$78);
  25631. $79 = ((($2)) + 8|0);
  25632. $80 = HEAP32[$79>>2]|0;
  25633. $81 = (+($80|0));
  25634. $82 = HEAP32[$62>>2]|0;
  25635. $83 = (+($82|0));
  25636. _rlVertex2f($81,$83);
  25637. $84 = HEAP32[$1>>2]|0;
  25638. $85 = HEAP32[$8>>2]|0;
  25639. $86 = (($85) + ($84))|0;
  25640. $87 = (+($86|0));
  25641. $88 = HEAP32[$39>>2]|0;
  25642. $89 = (+($88|0));
  25643. $90 = $87 / $89;
  25644. $91 = HEAP32[$43>>2]|0;
  25645. $92 = (+($91|0));
  25646. $93 = HEAP32[$46>>2]|0;
  25647. $94 = (+($93|0));
  25648. $95 = $92 / $94;
  25649. _rlTexCoord2f($90,$95);
  25650. $96 = HEAP32[$79>>2]|0;
  25651. $97 = (+($96|0));
  25652. _rlVertex2f($97,0.0);
  25653. _rlEnd();
  25654. _rlPopMatrix();
  25655. _rlDisableTexture();
  25656. return;
  25657. }
  25658. function _DrawText($0,$1,$2,$3,$4) {
  25659. $0 = $0|0;
  25660. $1 = $1|0;
  25661. $2 = $2|0;
  25662. $3 = $3|0;
  25663. $4 = $4|0;
  25664. var $$ = 0, $$byval_copy = 0, $$byval_copy1 = 0, $$byval_copy2 = 0, $10 = 0.0, $11 = 0, $12 = 0.0, $13 = 0, $14 = 0, $15 = 0.0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
  25665. sp = STACKTOP;
  25666. STACKTOP = STACKTOP + 128|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(128|0);
  25667. $$byval_copy2 = sp + 112|0;
  25668. $$byval_copy1 = sp + 104|0;
  25669. $$byval_copy = sp + 72|0;
  25670. $5 = sp + 32|0;
  25671. $6 = sp + 64|0;
  25672. $7 = sp;
  25673. _GetDefaultFont($5);
  25674. $8 = HEAP32[$5>>2]|0;
  25675. $9 = ($8|0)==(0);
  25676. if ($9) {
  25677. STACKTOP = sp;return;
  25678. }
  25679. $10 = (+($1|0));
  25680. HEAPF32[$6>>2] = $10;
  25681. $11 = ((($6)) + 4|0);
  25682. $12 = (+($2|0));
  25683. HEAPF32[$11>>2] = $12;
  25684. $13 = ($3|0)>(10);
  25685. $$ = $13 ? $3 : 10;
  25686. $14 = (($$>>>0) / 10)&-1;
  25687. _GetDefaultFont($7);
  25688. $15 = (+($$|0));
  25689. ;HEAP32[$$byval_copy>>2]=HEAP32[$7>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$7+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[$7+8>>2]|0;HEAP32[$$byval_copy+12>>2]=HEAP32[$7+12>>2]|0;HEAP32[$$byval_copy+16>>2]=HEAP32[$7+16>>2]|0;HEAP32[$$byval_copy+20>>2]=HEAP32[$7+20>>2]|0;HEAP32[$$byval_copy+24>>2]=HEAP32[$7+24>>2]|0;HEAP32[$$byval_copy+28>>2]=HEAP32[$7+28>>2]|0;
  25690. ;HEAP32[$$byval_copy1>>2]=HEAP32[$6>>2]|0;HEAP32[$$byval_copy1+4>>2]=HEAP32[$6+4>>2]|0;
  25691. ;HEAP8[$$byval_copy2>>0]=HEAP8[$4>>0]|0;HEAP8[$$byval_copy2+1>>0]=HEAP8[$4+1>>0]|0;HEAP8[$$byval_copy2+2>>0]=HEAP8[$4+2>>0]|0;HEAP8[$$byval_copy2+3>>0]=HEAP8[$4+3>>0]|0;
  25692. _DrawTextEx($$byval_copy,$0,$$byval_copy1,$15,$14,$$byval_copy2);
  25693. STACKTOP = sp;return;
  25694. }
  25695. function _DrawTextEx($0,$1,$2,$3,$4,$5) {
  25696. $0 = $0|0;
  25697. $1 = $1|0;
  25698. $2 = $2|0;
  25699. $3 = +$3;
  25700. $4 = $4|0;
  25701. $5 = $5|0;
  25702. var $$04954 = 0, $$05153 = 0, $$055 = 0, $$1 = 0, $$150 = 0, $$152 = 0, $$2 = 0, $$byval_copy1 = 0, $$byval_copy2 = 0, $$byval_copy3 = 0, $$byval_copy4 = 0, $$byval_copy5 = 0, $$sink = 0, $10 = 0, $11 = 0.0, $12 = 0.0, $13 = 0, $14 = 0, $15 = 0.0, $16 = 0;
  25703. var $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0.0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0.0, $28 = 0.0, $29 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0;
  25704. var $37 = 0, $38 = 0, $39 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0.0, $45 = 0.0, $46 = 0, $47 = 0, $48 = 0.0, $49 = 0.0, $50 = 0.0, $51 = 0, $52 = 0.0, $53 = 0.0, $54 = 0.0, $55 = 0, $56 = 0;
  25705. var $57 = 0.0, $58 = 0.0, $59 = 0.0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0.0, $64 = 0.0, $65 = 0, $66 = 0, $67 = 0, $68 = 0.0, $69 = 0.0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0;
  25706. var $75 = 0, $76 = 0, $77 = 0.0, $78 = 0.0, $79 = 0.0, $8 = 0, $80 = 0, $81 = 0, $82 = 0.0, $83 = 0.0, $84 = 0.0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $9 = 0, label = 0, sp = 0;
  25707. sp = STACKTOP;
  25708. STACKTOP = STACKTOP + 128|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(128|0);
  25709. $$byval_copy5 = sp + 88|0;
  25710. $$byval_copy4 = sp + 80|0;
  25711. $$byval_copy3 = sp + 64|0;
  25712. $$byval_copy2 = sp + 48|0;
  25713. $$byval_copy1 = sp + 24|0;
  25714. $6 = sp + 8|0;
  25715. $7 = sp;
  25716. $8 = (_strlen($1)|0);
  25717. $9 = ((($0)) + 20|0);
  25718. $10 = HEAP32[$9>>2]|0;
  25719. $11 = (+($10|0));
  25720. $12 = $3 / $11;
  25721. $13 = ($8|0)>(0);
  25722. if (!($13)) {
  25723. STACKTOP = sp;return;
  25724. }
  25725. $14 = ((($0)) + 28|0);
  25726. $15 = +HEAPF32[$2>>2];
  25727. $16 = ((($6)) + 4|0);
  25728. $17 = ((($2)) + 4|0);
  25729. $18 = ((($6)) + 8|0);
  25730. $19 = ((($6)) + 12|0);
  25731. $20 = ((($7)) + 4|0);
  25732. $21 = (+($4|0));
  25733. $$04954 = 0;$$05153 = 0;$$055 = 0;
  25734. while(1) {
  25735. $22 = (($1) + ($$055)|0);
  25736. $23 = HEAP8[$22>>0]|0;
  25737. switch ($23<<24>>24) {
  25738. case 10: {
  25739. $24 = HEAP32[$9>>2]|0;
  25740. $25 = (($24|0) / 2)&-1;
  25741. $26 = (($25) + ($24))|0;
  25742. $27 = (+($26|0));
  25743. $28 = $12 * $27;
  25744. $29 = (~~(($28)));
  25745. $30 = (($29) + ($$05153))|0;
  25746. $$150 = 0;$$152 = $30;$$2 = $$055;
  25747. break;
  25748. }
  25749. case -62: {
  25750. $31 = (($$055) + 1)|0;
  25751. $32 = (($1) + ($31)|0);
  25752. $33 = HEAP8[$32>>0]|0;
  25753. $34 = $33&255;
  25754. $$1 = $31;$$sink = $34;
  25755. label = 9;
  25756. break;
  25757. }
  25758. case -61: {
  25759. $35 = (($$055) + 1)|0;
  25760. $36 = (($1) + ($35)|0);
  25761. $37 = HEAP8[$36>>0]|0;
  25762. $38 = $37&255;
  25763. $39 = (($38) + 64)|0;
  25764. $$1 = $35;$$sink = $39;
  25765. label = 9;
  25766. break;
  25767. }
  25768. default: {
  25769. $40 = $23 << 24 >> 24;
  25770. $$1 = $$055;$$sink = $40;
  25771. label = 9;
  25772. }
  25773. }
  25774. do {
  25775. if ((label|0) == 9) {
  25776. label = 0;
  25777. ;HEAP32[$$byval_copy5>>2]=HEAP32[$0>>2]|0;HEAP32[$$byval_copy5+4>>2]=HEAP32[$0+4>>2]|0;HEAP32[$$byval_copy5+8>>2]=HEAP32[$0+8>>2]|0;HEAP32[$$byval_copy5+12>>2]=HEAP32[$0+12>>2]|0;HEAP32[$$byval_copy5+16>>2]=HEAP32[$0+16>>2]|0;HEAP32[$$byval_copy5+20>>2]=HEAP32[$0+20>>2]|0;HEAP32[$$byval_copy5+24>>2]=HEAP32[$0+24>>2]|0;HEAP32[$$byval_copy5+28>>2]=HEAP32[$0+28>>2]|0;
  25778. $41 = (_GetCharIndex($$byval_copy5,$$sink)|0);
  25779. $42 = HEAP32[$14>>2]|0;
  25780. $43 = (((($42) + ($41<<5)|0)) + 4|0);
  25781. $44 = (+($$04954|0));
  25782. $45 = $44 + $15;
  25783. $46 = (((($42) + ($41<<5)|0)) + 20|0);
  25784. $47 = HEAP32[$46>>2]|0;
  25785. $48 = (+($47|0));
  25786. $49 = $12 * $48;
  25787. $50 = $45 + $49;
  25788. $51 = (~~(($50)));
  25789. HEAP32[$6>>2] = $51;
  25790. $52 = +HEAPF32[$17>>2];
  25791. $53 = (+($$05153|0));
  25792. $54 = $53 + $52;
  25793. $55 = (((($42) + ($41<<5)|0)) + 24|0);
  25794. $56 = HEAP32[$55>>2]|0;
  25795. $57 = (+($56|0));
  25796. $58 = $12 * $57;
  25797. $59 = $54 + $58;
  25798. $60 = (~~(($59)));
  25799. HEAP32[$16>>2] = $60;
  25800. $61 = (((($42) + ($41<<5)|0)) + 12|0);
  25801. $62 = HEAP32[$61>>2]|0;
  25802. $63 = (+($62|0));
  25803. $64 = $12 * $63;
  25804. $65 = (~~(($64)));
  25805. HEAP32[$18>>2] = $65;
  25806. $66 = (((($42) + ($41<<5)|0)) + 16|0);
  25807. $67 = HEAP32[$66>>2]|0;
  25808. $68 = (+($67|0));
  25809. $69 = $12 * $68;
  25810. $70 = (~~(($69)));
  25811. HEAP32[$19>>2] = $70;
  25812. HEAPF32[$7>>2] = 0.0;
  25813. HEAPF32[$20>>2] = 0.0;
  25814. ;HEAP32[$$byval_copy1>>2]=HEAP32[$0>>2]|0;HEAP32[$$byval_copy1+4>>2]=HEAP32[$0+4>>2]|0;HEAP32[$$byval_copy1+8>>2]=HEAP32[$0+8>>2]|0;HEAP32[$$byval_copy1+12>>2]=HEAP32[$0+12>>2]|0;HEAP32[$$byval_copy1+16>>2]=HEAP32[$0+16>>2]|0;
  25815. ;HEAP32[$$byval_copy2>>2]=HEAP32[$43>>2]|0;HEAP32[$$byval_copy2+4>>2]=HEAP32[$43+4>>2]|0;HEAP32[$$byval_copy2+8>>2]=HEAP32[$43+8>>2]|0;HEAP32[$$byval_copy2+12>>2]=HEAP32[$43+12>>2]|0;
  25816. ;HEAP32[$$byval_copy3>>2]=HEAP32[$6>>2]|0;HEAP32[$$byval_copy3+4>>2]=HEAP32[$6+4>>2]|0;HEAP32[$$byval_copy3+8>>2]=HEAP32[$6+8>>2]|0;HEAP32[$$byval_copy3+12>>2]=HEAP32[$6+12>>2]|0;
  25817. ;HEAP32[$$byval_copy4>>2]=HEAP32[$7>>2]|0;HEAP32[$$byval_copy4+4>>2]=HEAP32[$7+4>>2]|0;
  25818. ;HEAP8[$$byval_copy5>>0]=HEAP8[$5>>0]|0;HEAP8[$$byval_copy5+1>>0]=HEAP8[$5+1>>0]|0;HEAP8[$$byval_copy5+2>>0]=HEAP8[$5+2>>0]|0;HEAP8[$$byval_copy5+3>>0]=HEAP8[$5+3>>0]|0;
  25819. _DrawTexturePro($$byval_copy1,$$byval_copy2,$$byval_copy3,$$byval_copy4,0.0,$$byval_copy5);
  25820. $71 = HEAP32[$14>>2]|0;
  25821. $72 = (((($71) + ($41<<5)|0)) + 28|0);
  25822. $73 = HEAP32[$72>>2]|0;
  25823. $74 = ($73|0)==(0);
  25824. if ($74) {
  25825. $75 = (((($71) + ($41<<5)|0)) + 12|0);
  25826. $76 = HEAP32[$75>>2]|0;
  25827. $77 = (+($76|0));
  25828. $78 = $12 * $77;
  25829. $79 = $21 + $78;
  25830. $80 = (~~(($79)));
  25831. $81 = (($80) + ($$04954))|0;
  25832. $$150 = $81;$$152 = $$05153;$$2 = $$1;
  25833. break;
  25834. } else {
  25835. $82 = (+($73|0));
  25836. $83 = $12 * $82;
  25837. $84 = $21 + $83;
  25838. $85 = (~~(($84)));
  25839. $86 = (($85) + ($$04954))|0;
  25840. $$150 = $86;$$152 = $$05153;$$2 = $$1;
  25841. break;
  25842. }
  25843. }
  25844. } while(0);
  25845. $87 = (($$2) + 1)|0;
  25846. $88 = ($87|0)<($8|0);
  25847. if ($88) {
  25848. $$04954 = $$150;$$05153 = $$152;$$055 = $87;
  25849. } else {
  25850. break;
  25851. }
  25852. }
  25853. STACKTOP = sp;return;
  25854. }
  25855. function _FormatText($0,$varargs) {
  25856. $0 = $0|0;
  25857. $varargs = $varargs|0;
  25858. var $1 = 0, label = 0, sp = 0;
  25859. sp = STACKTOP;
  25860. STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
  25861. $1 = sp;
  25862. HEAP32[$1>>2] = $varargs;
  25863. (_vsprintf(22655,$0,$1)|0);
  25864. STACKTOP = sp;return (22655|0);
  25865. }
  25866. function _DrawFPS($0,$1) {
  25867. $0 = $0|0;
  25868. $1 = $1|0;
  25869. var $$byval_copy = 0, $$sink = 0, $10 = 0, $11 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
  25870. sp = STACKTOP;
  25871. STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
  25872. $$byval_copy = sp;
  25873. $2 = sp + 4|0;
  25874. $3 = HEAP32[5195]|0;
  25875. $4 = HEAP32[915]|0;
  25876. $5 = ($3|0)<($4|0);
  25877. if ($5) {
  25878. $6 = (($3) + 1)|0;
  25879. $$sink = $6;
  25880. } else {
  25881. $7 = (_GetFPS()|0);
  25882. HEAP32[5196] = $7;
  25883. HEAP32[915] = $7;
  25884. $$sink = 0;
  25885. }
  25886. HEAP32[5195] = $$sink;
  25887. $8 = HEAP32[5196]|0;
  25888. HEAP32[$$byval_copy>>2] = $8;
  25889. (_FormatText(11802,$$byval_copy)|0);
  25890. HEAP8[$2>>0] = 0;
  25891. $9 = ((($2)) + 1|0);
  25892. HEAP8[$9>>0] = -98;
  25893. $10 = ((($2)) + 2|0);
  25894. HEAP8[$10>>0] = 47;
  25895. $11 = ((($2)) + 3|0);
  25896. HEAP8[$11>>0] = -1;
  25897. ;HEAP8[$$byval_copy>>0]=HEAP8[$2>>0]|0;HEAP8[$$byval_copy+1>>0]=HEAP8[$2+1>>0]|0;HEAP8[$$byval_copy+2>>0]=HEAP8[$2+2>>0]|0;HEAP8[$$byval_copy+3>>0]=HEAP8[$2+3>>0]|0;
  25898. _DrawText(22655,$0,$1,20,$$byval_copy);
  25899. STACKTOP = sp;return;
  25900. }
  25901. function _DrawGrid($0,$1) {
  25902. $0 = $0|0;
  25903. $1 = +$1;
  25904. var $$024 = 0, $10 = 0.0, $11 = 0.0, $12 = 0, $13 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0.0, $6 = 0.0, $7 = 0.0, $8 = 0.0, $9 = 0, label = 0, sp = 0;
  25905. sp = STACKTOP;
  25906. $2 = (($0|0) / 2)&-1;
  25907. _rlBegin(1);
  25908. $3 = (0 - ($2))|0;
  25909. $4 = ($2|0)<($3|0);
  25910. if ($4) {
  25911. _rlEnd();
  25912. return;
  25913. }
  25914. $5 = (+($3|0));
  25915. $6 = $5 * $1;
  25916. $7 = (+($2|0));
  25917. $8 = $7 * $1;
  25918. $$024 = $3;
  25919. while(1) {
  25920. $9 = ($$024|0)==(0);
  25921. if ($9) {
  25922. _rlColor3f(0.5,0.5,0.5);
  25923. _rlColor3f(0.5,0.5,0.5);
  25924. _rlColor3f(0.5,0.5,0.5);
  25925. _rlColor3f(0.5,0.5,0.5);
  25926. } else {
  25927. _rlColor3f(0.75,0.75,0.75);
  25928. _rlColor3f(0.75,0.75,0.75);
  25929. _rlColor3f(0.75,0.75,0.75);
  25930. _rlColor3f(0.75,0.75,0.75);
  25931. }
  25932. $10 = (+($$024|0));
  25933. $11 = $10 * $1;
  25934. _rlVertex3f($11,0.0,$6);
  25935. _rlVertex3f($11,0.0,$8);
  25936. _rlVertex3f($6,0.0,$11);
  25937. _rlVertex3f($8,0.0,$11);
  25938. $12 = (($$024) + 1)|0;
  25939. $13 = ($$024|0)<($2|0);
  25940. if ($13) {
  25941. $$024 = $12;
  25942. } else {
  25943. break;
  25944. }
  25945. }
  25946. _rlEnd();
  25947. return;
  25948. }
  25949. function _DrawGizmo($0) {
  25950. $0 = $0|0;
  25951. var $1 = 0.0, $2 = 0, $3 = 0.0, $4 = 0, $5 = 0.0, label = 0, sp = 0;
  25952. sp = STACKTOP;
  25953. _rlPushMatrix();
  25954. $1 = +HEAPF32[$0>>2];
  25955. $2 = ((($0)) + 4|0);
  25956. $3 = +HEAPF32[$2>>2];
  25957. $4 = ((($0)) + 8|0);
  25958. $5 = +HEAPF32[$4>>2];
  25959. _rlTranslatef($1,$3,$5);
  25960. _rlScalef(1.0,1.0,1.0);
  25961. _rlBegin(1);
  25962. _rlColor3f(1.0,0.0,0.0);
  25963. _rlVertex3f(0.0,0.0,0.0);
  25964. _rlColor3f(1.0,0.0,0.0);
  25965. _rlVertex3f(1.0,0.0,0.0);
  25966. _rlColor3f(0.0,1.0,0.0);
  25967. _rlVertex3f(0.0,0.0,0.0);
  25968. _rlColor3f(0.0,1.0,0.0);
  25969. _rlVertex3f(0.0,1.0,0.0);
  25970. _rlColor3f(0.0,0.0,1.0);
  25971. _rlVertex3f(0.0,0.0,0.0);
  25972. _rlColor3f(0.0,0.0,1.0);
  25973. _rlVertex3f(0.0,0.0,1.0);
  25974. _rlEnd();
  25975. _rlPopMatrix();
  25976. return;
  25977. }
  25978. function _LoadMesh($0,$1) {
  25979. $0 = $0|0;
  25980. $1 = $1|0;
  25981. var $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $vararg_buffer = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
  25982. sp = STACKTOP;
  25983. STACKTOP = STACKTOP + 144|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(144|0);
  25984. $vararg_buffer = sp;
  25985. $2 = sp + 72|0;
  25986. $3 = sp + 4|0;
  25987. dest=$2; stop=dest+68|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0));
  25988. $4 = (_IsFileExtension($1,11810)|0);
  25989. $5 = ($4|0)==(0);
  25990. if (!($5)) {
  25991. _LoadOBJ($3,$1);
  25992. dest=$2; src=$3; stop=dest+68|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  25993. }
  25994. $6 = HEAP32[$2>>2]|0;
  25995. $7 = ($6|0)==(0);
  25996. if ($7) {
  25997. _TraceLog(2,11815,$vararg_buffer);
  25998. } else {
  25999. _rlglLoadMesh($2,0);
  26000. }
  26001. dest=$0; src=$2; stop=dest+68|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  26002. STACKTOP = sp;return;
  26003. }
  26004. function _LoadOBJ($0,$1) {
  26005. $0 = $0|0;
  26006. $1 = $1|0;
  26007. var $$0$ph374433 = 0, $$0$ph377422 = 0, $$0$ph379$lcssa386 = 0, $$0$ph379412 = 0, $$0$ph445 = 0, $$0344$ph373432 = 0, $$0344$ph376$lcssa388 = 0, $$0344$ph376421 = 0, $$0344$ph444 = 0, $$0345$ph372$lcssa389 = 0, $$0345$ph372431 = 0, $$0345$ph443 = 0, $$0346$ph$lcssa = 0, $$0346$ph442 = 0, $$0347392 = 0, $$0348391 = 0, $$0350$ph = 0, $$0350$ph$ph = 0, $$0351$ph$ph = 0, $$0352$ph = 0;
  26008. var $$0352$ph$ph = 0, $$0353$ph365399 = 0, $$0353$ph367397 = 0, $$0353$ph402 = 0, $$0354$ph364398 = 0, $$0354$ph401 = 0, $$0355$ph400 = 0, $$0356 = 0, $$0357 = 0, $$1 = 0, $$byval_copy102 = 0, $$byval_copy103 = 0, $$sroa$12$0$$sroa_idx244 = 0, $$sroa$12247$0$$sroa_idx249 = 0, $$sroa$31$0$$sroa_idx270 = 0, $$sroa$45$0$$sroa_idx286 = 0, $$sroa$45289$0$$sroa_idx291 = 0, $$sroa$64$0 = 0, $$sroa$64$0$$sroa_idx312 = 0, $$sroa$74$0$$sroa_idx324 = 0;
  26009. var $$sroa$75 = 0, $$sroa$75$0$$sroa_idx = 0, $$sroa$75$0$$sroa_idx328 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0;
  26010. var $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0;
  26011. var $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0;
  26012. var $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0;
  26013. var $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0;
  26014. var $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0;
  26015. var $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0;
  26016. var $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0.0, $238 = 0.0, $239 = 0, $24 = 0, $240 = 0;
  26017. var $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0.0, $249 = 0.0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0.0;
  26018. var $26 = 0, $260 = 0.0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0;
  26019. var $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0;
  26020. var $296 = 0, $297 = 0, $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0.0, $312 = 0;
  26021. var $313 = 0, $314 = 0.0, $315 = 0, $316 = 0, $317 = 0.0, $318 = 0, $319 = 0, $32 = 0, $320 = 0.0, $321 = 0, $322 = 0, $323 = 0.0, $324 = 0, $325 = 0, $326 = 0.0, $327 = 0.0, $328 = 0.0, $329 = 0.0, $33 = 0, $330 = 0.0;
  26022. var $331 = 0.0, $332 = 0.0, $333 = 0.0, $334 = 0.0, $335 = 0.0, $336 = 0.0, $337 = 0.0, $338 = 0.0, $339 = 0.0, $34 = 0, $340 = 0.0, $341 = 0.0, $342 = 0.0, $343 = 0.0, $344 = 0.0, $345 = 0.0, $346 = 0.0, $347 = 0, $348 = 0, $349 = 0;
  26023. var $35 = 0, $350 = 0, $351 = 0, $352 = 0, $353 = 0, $354 = 0, $355 = 0, $356 = 0, $357 = 0, $358 = 0, $359 = 0, $36 = 0, $360 = 0, $361 = 0, $362 = 0, $363 = 0, $364 = 0, $365 = 0, $366 = 0, $367 = 0;
  26024. var $368 = 0, $369 = 0, $37 = 0, $370 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0;
  26025. var $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0;
  26026. var $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0;
  26027. var $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer11 = 0, $vararg_buffer23 = 0, $vararg_buffer26 = 0, $vararg_buffer29 = 0, $vararg_buffer33 = 0, $vararg_buffer36 = 0;
  26028. var $vararg_buffer4 = 0, $vararg_buffer41 = 0, $vararg_buffer44 = 0, $vararg_buffer49 = 0, $vararg_buffer52 = 0, $vararg_buffer55 = 0, $vararg_buffer58 = 0, $vararg_buffer63 = 0, $vararg_buffer7 = 0, $vararg_buffer71 = 0, $vararg_buffer79 = 0, $vararg_buffer90 = 0, $vararg_ptr10 = 0, $vararg_ptr14 = 0, $vararg_ptr18 = 0, $vararg_ptr22 = 0, $vararg_ptr32 = 0, $vararg_ptr39 = 0, $vararg_ptr40 = 0, $vararg_ptr47 = 0;
  26029. var $vararg_ptr48 = 0, $vararg_ptr61 = 0, $vararg_ptr62 = 0, $vararg_ptr66 = 0, $vararg_ptr67 = 0, $vararg_ptr68 = 0, $vararg_ptr69 = 0, $vararg_ptr70 = 0, $vararg_ptr74 = 0, $vararg_ptr75 = 0, $vararg_ptr76 = 0, $vararg_ptr77 = 0, $vararg_ptr78 = 0, $vararg_ptr82 = 0, $vararg_ptr83 = 0, $vararg_ptr84 = 0, $vararg_ptr85 = 0, $vararg_ptr86 = 0, $vararg_ptr87 = 0, $vararg_ptr88 = 0;
  26030. var $vararg_ptr89 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
  26031. sp = STACKTOP;
  26032. STACKTOP = STACKTOP + 672|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(672|0);
  26033. $$byval_copy103 = sp + 320|0;
  26034. $$byval_copy102 = sp + 304|0;
  26035. $vararg_buffer90 = sp + 296|0;
  26036. $vararg_buffer79 = sp + 256|0;
  26037. $vararg_buffer71 = sp + 232|0;
  26038. $vararg_buffer63 = sp + 208|0;
  26039. $vararg_buffer58 = sp + 192|0;
  26040. $vararg_buffer55 = sp + 184|0;
  26041. $vararg_buffer52 = sp + 176|0;
  26042. $vararg_buffer49 = sp + 168|0;
  26043. $vararg_buffer44 = sp + 152|0;
  26044. $vararg_buffer41 = sp + 144|0;
  26045. $vararg_buffer36 = sp + 128|0;
  26046. $vararg_buffer33 = sp + 120|0;
  26047. $vararg_buffer29 = sp + 112|0;
  26048. $vararg_buffer26 = sp + 104|0;
  26049. $vararg_buffer23 = sp + 96|0;
  26050. $vararg_buffer11 = sp + 80|0;
  26051. $vararg_buffer7 = sp + 64|0;
  26052. $vararg_buffer4 = sp + 56|0;
  26053. $vararg_buffer1 = sp + 48|0;
  26054. $vararg_buffer = sp + 40|0;
  26055. $$sroa$75 = sp;
  26056. $2 = sp + 664|0;
  26057. $3 = sp + 464|0;
  26058. $4 = sp + 428|0;
  26059. $5 = sp + 416|0;
  26060. $6 = sp + 452|0;
  26061. $7 = sp + 440|0;
  26062. $8 = sp + 404|0;
  26063. $9 = sp + 392|0;
  26064. $10 = sp + 380|0;
  26065. $11 = sp + 368|0;
  26066. $12 = sp + 356|0;
  26067. $13 = sp + 344|0;
  26068. $14 = sp + 332|0;
  26069. dest=$$sroa$75; stop=dest+36|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0));
  26070. $15 = (_fopen($1,11840)|0);
  26071. $16 = ($15|0)==(0|0);
  26072. if ($16) {
  26073. HEAP32[$vararg_buffer>>2] = $1;
  26074. _TraceLog(2,11843,$vararg_buffer);
  26075. $$sroa$75$0$$sroa_idx = ((($0)) + 32|0);
  26076. ;HEAP32[$0>>2]=0|0;HEAP32[$0+4>>2]=0|0;HEAP32[$0+8>>2]=0|0;HEAP32[$0+12>>2]=0|0;HEAP32[$0+16>>2]=0|0;HEAP32[$0+20>>2]=0|0;HEAP32[$0+24>>2]=0|0;HEAP32[$0+28>>2]=0|0;
  26077. dest=$$sroa$75$0$$sroa_idx; src=$$sroa$75; stop=dest+36|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  26078. STACKTOP = sp;return;
  26079. }
  26080. $17 = (_feof($15)|0);
  26081. $18 = ($17|0)==(0);
  26082. L5: do {
  26083. if ($18) {
  26084. $$0$ph445 = 0;$$0344$ph444 = 0;$$0345$ph443 = 0;$$0346$ph442 = 0;
  26085. while(1) {
  26086. $$0$ph374433 = $$0$ph445;$$0344$ph373432 = $$0344$ph444;$$0345$ph372431 = $$0345$ph443;
  26087. L8: while(1) {
  26088. $$0$ph377422 = $$0$ph374433;$$0344$ph376421 = $$0344$ph373432;
  26089. L10: while(1) {
  26090. $$0$ph379412 = $$0$ph377422;
  26091. L12: while(1) {
  26092. L14: while(1) {
  26093. HEAP32[$vararg_buffer1>>2] = $2;
  26094. (_fscanf($15,11877,$vararg_buffer1)|0);
  26095. $19 = HEAP8[$2>>0]|0;
  26096. $20 = $19 << 24 >> 24;
  26097. switch ($20|0) {
  26098. case 102: {
  26099. break L8;
  26100. break;
  26101. }
  26102. case 118: {
  26103. break L14;
  26104. break;
  26105. }
  26106. case 117: case 109: case 115: case 103: case 111: case 35: {
  26107. (_fgets($3,200,$15)|0);
  26108. break;
  26109. }
  26110. default: {
  26111. }
  26112. }
  26113. $21 = (_feof($15)|0);
  26114. $22 = ($21|0)==(0);
  26115. if (!($22)) {
  26116. $$0$ph379$lcssa386 = $$0$ph379412;$$0344$ph376$lcssa388 = $$0344$ph376421;$$0345$ph372$lcssa389 = $$0345$ph372431;$$0346$ph$lcssa = $$0346$ph442;
  26117. break L5;
  26118. }
  26119. }
  26120. HEAP32[$vararg_buffer4>>2] = $2;
  26121. (_fscanf($15,11877,$vararg_buffer4)|0);
  26122. $23 = HEAP8[$2>>0]|0;
  26123. switch ($23<<24>>24) {
  26124. case 116: {
  26125. break L10;
  26126. break;
  26127. }
  26128. case 110: {
  26129. break L12;
  26130. break;
  26131. }
  26132. default: {
  26133. }
  26134. }
  26135. $30 = (($$0$ph379412) + 1)|0;
  26136. (_fgets($3,200,$15)|0);
  26137. $31 = (_feof($15)|0);
  26138. $32 = ($31|0)==(0);
  26139. if ($32) {
  26140. $$0$ph379412 = $30;
  26141. } else {
  26142. $$0$ph379$lcssa386 = $30;$$0344$ph376$lcssa388 = $$0344$ph376421;$$0345$ph372$lcssa389 = $$0345$ph372431;$$0346$ph$lcssa = $$0346$ph442;
  26143. break L5;
  26144. }
  26145. }
  26146. $27 = (($$0344$ph376421) + 1)|0;
  26147. (_fgets($3,200,$15)|0);
  26148. $28 = (_feof($15)|0);
  26149. $29 = ($28|0)==(0);
  26150. if ($29) {
  26151. $$0$ph377422 = $$0$ph379412;$$0344$ph376421 = $27;
  26152. } else {
  26153. $$0$ph379$lcssa386 = $$0$ph379412;$$0344$ph376$lcssa388 = $27;$$0345$ph372$lcssa389 = $$0345$ph372431;$$0346$ph$lcssa = $$0346$ph442;
  26154. break L5;
  26155. }
  26156. }
  26157. $24 = (($$0345$ph372431) + 1)|0;
  26158. (_fgets($3,200,$15)|0);
  26159. $25 = (_feof($15)|0);
  26160. $26 = ($25|0)==(0);
  26161. if ($26) {
  26162. $$0$ph374433 = $$0$ph379412;$$0344$ph373432 = $$0344$ph376421;$$0345$ph372431 = $24;
  26163. } else {
  26164. $$0$ph379$lcssa386 = $$0$ph379412;$$0344$ph376$lcssa388 = $$0344$ph376421;$$0345$ph372$lcssa389 = $24;$$0346$ph$lcssa = $$0346$ph442;
  26165. break L5;
  26166. }
  26167. }
  26168. $33 = (($$0346$ph442) + 1)|0;
  26169. (_fgets($3,200,$15)|0);
  26170. $34 = (_feof($15)|0);
  26171. $35 = ($34|0)==(0);
  26172. if ($35) {
  26173. $$0$ph445 = $$0$ph379412;$$0344$ph444 = $$0344$ph376421;$$0345$ph443 = $$0345$ph372431;$$0346$ph442 = $33;
  26174. } else {
  26175. $$0$ph379$lcssa386 = $$0$ph379412;$$0344$ph376$lcssa388 = $$0344$ph376421;$$0345$ph372$lcssa389 = $$0345$ph372431;$$0346$ph$lcssa = $33;
  26176. break;
  26177. }
  26178. }
  26179. } else {
  26180. $$0$ph379$lcssa386 = 0;$$0344$ph376$lcssa388 = 0;$$0345$ph372$lcssa389 = 0;$$0346$ph$lcssa = 0;
  26181. }
  26182. } while(0);
  26183. HEAP32[$vararg_buffer7>>2] = $1;
  26184. $vararg_ptr10 = ((($vararg_buffer7)) + 4|0);
  26185. HEAP32[$vararg_ptr10>>2] = $$0$ph379$lcssa386;
  26186. _TraceLog(3,11880,$vararg_buffer7);
  26187. HEAP32[$vararg_buffer11>>2] = $1;
  26188. $vararg_ptr14 = ((($vararg_buffer11)) + 4|0);
  26189. HEAP32[$vararg_ptr14>>2] = $$0345$ph372$lcssa389;
  26190. _TraceLog(3,11908,$vararg_buffer11);
  26191. HEAP32[$$byval_copy102>>2] = $1;
  26192. $vararg_ptr18 = ((($$byval_copy102)) + 4|0);
  26193. HEAP32[$vararg_ptr18>>2] = $$0344$ph376$lcssa388;
  26194. _TraceLog(3,11937,$$byval_copy102);
  26195. HEAP32[$$byval_copy103>>2] = $1;
  26196. $vararg_ptr22 = ((($$byval_copy103)) + 4|0);
  26197. HEAP32[$vararg_ptr22>>2] = $$0346$ph$lcssa;
  26198. _TraceLog(3,11964,$$byval_copy103);
  26199. $36 = ($$0$ph379$lcssa386*12)|0;
  26200. $37 = (_malloc($36)|0);
  26201. $38 = ($$0344$ph376$lcssa388|0)>(0);
  26202. if ($38) {
  26203. $39 = ($$0344$ph376$lcssa388*12)|0;
  26204. $40 = (_malloc($39)|0);
  26205. $$0357 = $40;$369 = $40;
  26206. } else {
  26207. $$0357 = 0;$369 = 0;
  26208. }
  26209. $41 = ($$0345$ph372$lcssa389|0)>(0);
  26210. if ($41) {
  26211. $42 = $$0345$ph372$lcssa389 << 3;
  26212. $43 = (_malloc($42)|0);
  26213. $$0356 = $43;$370 = $43;
  26214. } else {
  26215. $$0356 = 0;$370 = 0;
  26216. }
  26217. _rewind($15);
  26218. $44 = (_feof($15)|0);
  26219. $45 = ($44|0)==(0);
  26220. L31: do {
  26221. if ($45) {
  26222. $$0353$ph402 = 0;$$0354$ph401 = 0;$$0355$ph400 = 0;
  26223. while(1) {
  26224. $$0353$ph365399 = $$0353$ph402;$$0354$ph364398 = $$0354$ph401;
  26225. L34: while(1) {
  26226. $$0353$ph367397 = $$0353$ph365399;
  26227. L36: while(1) {
  26228. L38: while(1) {
  26229. HEAP32[$vararg_buffer23>>2] = $2;
  26230. (_fscanf($15,11877,$vararg_buffer23)|0);
  26231. $46 = HEAP8[$2>>0]|0;
  26232. $47 = $46 << 24 >> 24;
  26233. switch ($47|0) {
  26234. case 118: {
  26235. break L38;
  26236. break;
  26237. }
  26238. case 102: case 117: case 109: case 115: case 103: case 111: case 35: {
  26239. (_fgets($3,200,$15)|0);
  26240. break;
  26241. }
  26242. default: {
  26243. }
  26244. }
  26245. $48 = (_feof($15)|0);
  26246. $49 = ($48|0)==(0);
  26247. if (!($49)) {
  26248. break L31;
  26249. }
  26250. }
  26251. HEAP32[$vararg_buffer26>>2] = $2;
  26252. (_fscanf($15,11877,$vararg_buffer26)|0);
  26253. $50 = HEAP8[$2>>0]|0;
  26254. switch ($50<<24>>24) {
  26255. case 110: {
  26256. break L36;
  26257. break;
  26258. }
  26259. case 116: {
  26260. break;
  26261. }
  26262. default: {
  26263. break L34;
  26264. }
  26265. }
  26266. $51 = (($$0356) + ($$0353$ph367397<<3)|0);
  26267. $52 = (((($$0356) + ($$0353$ph367397<<3)|0)) + 4|0);
  26268. HEAP32[$vararg_buffer29>>2] = $51;
  26269. $vararg_ptr32 = ((($vararg_buffer29)) + 4|0);
  26270. HEAP32[$vararg_ptr32>>2] = $52;
  26271. (_fscanf($15,11993,$vararg_buffer29)|0);
  26272. $53 = (($$0353$ph367397) + 1)|0;
  26273. HEAP32[$vararg_buffer33>>2] = $2;
  26274. (_fscanf($15,11877,$vararg_buffer33)|0);
  26275. $54 = (_feof($15)|0);
  26276. $55 = ($54|0)==(0);
  26277. if ($55) {
  26278. $$0353$ph367397 = $53;
  26279. } else {
  26280. break L31;
  26281. }
  26282. }
  26283. $56 = (($$0357) + (($$0354$ph364398*12)|0)|0);
  26284. $57 = (((($$0357) + (($$0354$ph364398*12)|0)|0)) + 4|0);
  26285. $58 = (((($$0357) + (($$0354$ph364398*12)|0)|0)) + 8|0);
  26286. HEAP32[$vararg_buffer36>>2] = $56;
  26287. $vararg_ptr39 = ((($vararg_buffer36)) + 4|0);
  26288. HEAP32[$vararg_ptr39>>2] = $57;
  26289. $vararg_ptr40 = ((($vararg_buffer36)) + 8|0);
  26290. HEAP32[$vararg_ptr40>>2] = $58;
  26291. (_fscanf($15,12007,$vararg_buffer36)|0);
  26292. $59 = (($$0354$ph364398) + 1)|0;
  26293. HEAP32[$vararg_buffer41>>2] = $2;
  26294. (_fscanf($15,11877,$vararg_buffer41)|0);
  26295. $60 = (_feof($15)|0);
  26296. $61 = ($60|0)==(0);
  26297. if ($61) {
  26298. $$0353$ph365399 = $$0353$ph367397;$$0354$ph364398 = $59;
  26299. } else {
  26300. break L31;
  26301. }
  26302. }
  26303. $62 = (($37) + (($$0355$ph400*12)|0)|0);
  26304. $63 = (((($37) + (($$0355$ph400*12)|0)|0)) + 4|0);
  26305. $64 = (((($37) + (($$0355$ph400*12)|0)|0)) + 8|0);
  26306. HEAP32[$vararg_buffer44>>2] = $62;
  26307. $vararg_ptr47 = ((($vararg_buffer44)) + 4|0);
  26308. HEAP32[$vararg_ptr47>>2] = $63;
  26309. $vararg_ptr48 = ((($vararg_buffer44)) + 8|0);
  26310. HEAP32[$vararg_ptr48>>2] = $64;
  26311. (_fscanf($15,12007,$vararg_buffer44)|0);
  26312. $65 = (($$0355$ph400) + 1)|0;
  26313. HEAP32[$vararg_buffer49>>2] = $2;
  26314. (_fscanf($15,11877,$vararg_buffer49)|0);
  26315. $66 = (_feof($15)|0);
  26316. $67 = ($66|0)==(0);
  26317. if ($67) {
  26318. $$0353$ph402 = $$0353$ph367397;$$0354$ph401 = $$0354$ph364398;$$0355$ph400 = $65;
  26319. } else {
  26320. break;
  26321. }
  26322. }
  26323. }
  26324. } while(0);
  26325. $68 = ($$0346$ph$lcssa*3)|0;
  26326. $69 = ($$0346$ph$lcssa*9)|0;
  26327. $70 = ($$0346$ph$lcssa*36)|0;
  26328. $71 = (_malloc($70)|0);
  26329. $72 = ($$0346$ph$lcssa*6)|0;
  26330. $73 = ($$0346$ph$lcssa*24)|0;
  26331. $74 = (_malloc($73)|0);
  26332. $75 = (_malloc($70)|0);
  26333. _rewind($15);
  26334. $76 = ($$0344$ph376$lcssa388|0)==(0);
  26335. if ($76) {
  26336. HEAP32[$vararg_buffer52>>2] = $1;
  26337. _TraceLog(0,12016,$vararg_buffer52);
  26338. }
  26339. $77 = ($$0345$ph372$lcssa389|0)==(0);
  26340. $78 = $$0344$ph376$lcssa388 | $$0345$ph372$lcssa389;
  26341. $79 = ($78|0)==(0);
  26342. $80 = ((($vararg_buffer11)) + 4|0);
  26343. $81 = ((($vararg_buffer11)) + 8|0);
  26344. $82 = ((($vararg_buffer11)) + 4|0);
  26345. $83 = ((($vararg_buffer11)) + 8|0);
  26346. $84 = ((($4)) + 4|0);
  26347. $85 = ((($4)) + 8|0);
  26348. $86 = ((($5)) + 4|0);
  26349. $87 = ((($5)) + 8|0);
  26350. $88 = ((($vararg_buffer11)) + 4|0);
  26351. $89 = ((($vararg_buffer7)) + 4|0);
  26352. $90 = ((($vararg_buffer11)) + 8|0);
  26353. $91 = ((($vararg_buffer7)) + 8|0);
  26354. $92 = ((($vararg_buffer11)) + 4|0);
  26355. $93 = ((($4)) + 4|0);
  26356. $94 = ((($vararg_buffer11)) + 8|0);
  26357. $95 = ((($4)) + 8|0);
  26358. $96 = ((($vararg_buffer11)) + 4|0);
  26359. $97 = ((($vararg_buffer7)) + 4|0);
  26360. $98 = ((($4)) + 4|0);
  26361. $99 = ((($vararg_buffer11)) + 8|0);
  26362. $100 = ((($vararg_buffer7)) + 8|0);
  26363. $101 = ((($4)) + 8|0);
  26364. $102 = ((($vararg_buffer7)) + 4|0);
  26365. $103 = ((($vararg_buffer7)) + 8|0);
  26366. $$0350$ph$ph = 0;$$0351$ph$ph = 0;$$0352$ph$ph = 0;
  26367. L51: while(1) {
  26368. $$0350$ph = $$0350$ph$ph;$$0352$ph = $$0352$ph$ph;
  26369. while(1) {
  26370. $104 = (_feof($15)|0);
  26371. $105 = ($104|0)==(0);
  26372. if (!($105)) {
  26373. break L51;
  26374. }
  26375. L55: while(1) {
  26376. HEAP32[$vararg_buffer55>>2] = $2;
  26377. (_fscanf($15,11877,$vararg_buffer55)|0);
  26378. $106 = HEAP8[$2>>0]|0;
  26379. $107 = $106 << 24 >> 24;
  26380. switch ($107|0) {
  26381. case 102: {
  26382. break L55;
  26383. break;
  26384. }
  26385. case 118: case 117: case 109: case 115: case 103: case 111: case 35: {
  26386. (_fgets($3,200,$15)|0);
  26387. break;
  26388. }
  26389. default: {
  26390. }
  26391. }
  26392. $108 = (_feof($15)|0);
  26393. $109 = ($108|0)==(0);
  26394. if (!($109)) {
  26395. break L51;
  26396. }
  26397. }
  26398. do {
  26399. if ($79) {
  26400. HEAP32[$vararg_buffer58>>2] = $vararg_buffer11;
  26401. $vararg_ptr61 = ((($vararg_buffer58)) + 4|0);
  26402. HEAP32[$vararg_ptr61>>2] = $80;
  26403. $vararg_ptr62 = ((($vararg_buffer58)) + 8|0);
  26404. HEAP32[$vararg_ptr62>>2] = $81;
  26405. (_fscanf($15,12087,$vararg_buffer58)|0);
  26406. } else {
  26407. if ($76) {
  26408. HEAP32[$vararg_buffer63>>2] = $vararg_buffer11;
  26409. $vararg_ptr66 = ((($vararg_buffer63)) + 4|0);
  26410. HEAP32[$vararg_ptr66>>2] = $vararg_buffer7;
  26411. $vararg_ptr67 = ((($vararg_buffer63)) + 8|0);
  26412. HEAP32[$vararg_ptr67>>2] = $88;
  26413. $vararg_ptr68 = ((($vararg_buffer63)) + 12|0);
  26414. HEAP32[$vararg_ptr68>>2] = $89;
  26415. $vararg_ptr69 = ((($vararg_buffer63)) + 16|0);
  26416. HEAP32[$vararg_ptr69>>2] = $90;
  26417. $vararg_ptr70 = ((($vararg_buffer63)) + 20|0);
  26418. HEAP32[$vararg_ptr70>>2] = $91;
  26419. (_fscanf($15,12096,$vararg_buffer63)|0);
  26420. break;
  26421. }
  26422. if ($77) {
  26423. HEAP32[$vararg_buffer71>>2] = $vararg_buffer11;
  26424. $vararg_ptr74 = ((($vararg_buffer71)) + 4|0);
  26425. HEAP32[$vararg_ptr74>>2] = $4;
  26426. $vararg_ptr75 = ((($vararg_buffer71)) + 8|0);
  26427. HEAP32[$vararg_ptr75>>2] = $92;
  26428. $vararg_ptr76 = ((($vararg_buffer71)) + 12|0);
  26429. HEAP32[$vararg_ptr76>>2] = $93;
  26430. $vararg_ptr77 = ((($vararg_buffer71)) + 16|0);
  26431. HEAP32[$vararg_ptr77>>2] = $94;
  26432. $vararg_ptr78 = ((($vararg_buffer71)) + 20|0);
  26433. HEAP32[$vararg_ptr78>>2] = $95;
  26434. (_fscanf($15,12114,$vararg_buffer71)|0);
  26435. break;
  26436. } else {
  26437. HEAP32[$vararg_buffer79>>2] = $vararg_buffer11;
  26438. $vararg_ptr82 = ((($vararg_buffer79)) + 4|0);
  26439. HEAP32[$vararg_ptr82>>2] = $vararg_buffer7;
  26440. $vararg_ptr83 = ((($vararg_buffer79)) + 8|0);
  26441. HEAP32[$vararg_ptr83>>2] = $4;
  26442. $vararg_ptr84 = ((($vararg_buffer79)) + 12|0);
  26443. HEAP32[$vararg_ptr84>>2] = $96;
  26444. $vararg_ptr85 = ((($vararg_buffer79)) + 16|0);
  26445. HEAP32[$vararg_ptr85>>2] = $97;
  26446. $vararg_ptr86 = ((($vararg_buffer79)) + 20|0);
  26447. HEAP32[$vararg_ptr86>>2] = $98;
  26448. $vararg_ptr87 = ((($vararg_buffer79)) + 24|0);
  26449. HEAP32[$vararg_ptr87>>2] = $99;
  26450. $vararg_ptr88 = ((($vararg_buffer79)) + 28|0);
  26451. HEAP32[$vararg_ptr88>>2] = $100;
  26452. $vararg_ptr89 = ((($vararg_buffer79)) + 32|0);
  26453. HEAP32[$vararg_ptr89>>2] = $101;
  26454. (_fscanf($15,12135,$vararg_buffer79)|0);
  26455. break;
  26456. }
  26457. }
  26458. } while(0);
  26459. $110 = HEAP32[$vararg_buffer11>>2]|0;
  26460. $111 = (($110) + -1)|0;
  26461. $112 = (($37) + (($111*12)|0)|0);
  26462. $113 = HEAP32[$112>>2]|0;
  26463. $114 = (($71) + ($$0352$ph<<2)|0);
  26464. HEAP32[$114>>2] = $113;
  26465. $115 = (((($37) + (($111*12)|0)|0)) + 4|0);
  26466. $116 = HEAP32[$115>>2]|0;
  26467. $117 = (($$0352$ph) + 1)|0;
  26468. $118 = (($71) + ($117<<2)|0);
  26469. HEAP32[$118>>2] = $116;
  26470. $119 = (((($37) + (($111*12)|0)|0)) + 8|0);
  26471. $120 = HEAP32[$119>>2]|0;
  26472. $121 = (($$0352$ph) + 2)|0;
  26473. $122 = (($71) + ($121<<2)|0);
  26474. HEAP32[$122>>2] = $120;
  26475. $123 = (($$0352$ph) + 3)|0;
  26476. $124 = HEAP32[$82>>2]|0;
  26477. $125 = (($124) + -1)|0;
  26478. $126 = (($37) + (($125*12)|0)|0);
  26479. $127 = HEAP32[$126>>2]|0;
  26480. $128 = (($71) + ($123<<2)|0);
  26481. HEAP32[$128>>2] = $127;
  26482. $129 = (((($37) + (($125*12)|0)|0)) + 4|0);
  26483. $130 = HEAP32[$129>>2]|0;
  26484. $131 = (($$0352$ph) + 4)|0;
  26485. $132 = (($71) + ($131<<2)|0);
  26486. HEAP32[$132>>2] = $130;
  26487. $133 = (((($37) + (($125*12)|0)|0)) + 8|0);
  26488. $134 = HEAP32[$133>>2]|0;
  26489. $135 = (($$0352$ph) + 5)|0;
  26490. $136 = (($71) + ($135<<2)|0);
  26491. HEAP32[$136>>2] = $134;
  26492. $137 = (($$0352$ph) + 6)|0;
  26493. $138 = HEAP32[$83>>2]|0;
  26494. $139 = (($138) + -1)|0;
  26495. $140 = (($37) + (($139*12)|0)|0);
  26496. $141 = HEAP32[$140>>2]|0;
  26497. $142 = (($71) + ($137<<2)|0);
  26498. HEAP32[$142>>2] = $141;
  26499. $143 = (((($37) + (($139*12)|0)|0)) + 4|0);
  26500. $144 = HEAP32[$143>>2]|0;
  26501. $145 = (($$0352$ph) + 7)|0;
  26502. $146 = (($71) + ($145<<2)|0);
  26503. HEAP32[$146>>2] = $144;
  26504. $147 = (((($37) + (($139*12)|0)|0)) + 8|0);
  26505. $148 = HEAP32[$147>>2]|0;
  26506. $149 = (($$0352$ph) + 8)|0;
  26507. $150 = (($71) + ($149<<2)|0);
  26508. HEAP32[$150>>2] = $148;
  26509. $151 = (($$0352$ph) + 9)|0;
  26510. if ($38) {
  26511. $152 = HEAP32[$4>>2]|0;
  26512. $153 = (($152) + -1)|0;
  26513. $154 = (($$0357) + (($153*12)|0)|0);
  26514. $155 = HEAP32[$154>>2]|0;
  26515. $156 = (($75) + ($$0350$ph<<2)|0);
  26516. HEAP32[$156>>2] = $155;
  26517. $157 = (((($$0357) + (($153*12)|0)|0)) + 4|0);
  26518. $158 = HEAP32[$157>>2]|0;
  26519. $159 = (($$0350$ph) + 1)|0;
  26520. $160 = (($75) + ($159<<2)|0);
  26521. HEAP32[$160>>2] = $158;
  26522. $161 = (((($$0357) + (($153*12)|0)|0)) + 8|0);
  26523. $162 = HEAP32[$161>>2]|0;
  26524. $163 = (($$0350$ph) + 2)|0;
  26525. $164 = (($75) + ($163<<2)|0);
  26526. HEAP32[$164>>2] = $162;
  26527. $165 = (($$0350$ph) + 3)|0;
  26528. $166 = HEAP32[$84>>2]|0;
  26529. $167 = (($166) + -1)|0;
  26530. $168 = (($$0357) + (($167*12)|0)|0);
  26531. $169 = HEAP32[$168>>2]|0;
  26532. $170 = (($75) + ($165<<2)|0);
  26533. HEAP32[$170>>2] = $169;
  26534. $171 = (((($$0357) + (($167*12)|0)|0)) + 4|0);
  26535. $172 = HEAP32[$171>>2]|0;
  26536. $173 = (($$0350$ph) + 4)|0;
  26537. $174 = (($75) + ($173<<2)|0);
  26538. HEAP32[$174>>2] = $172;
  26539. $175 = (((($$0357) + (($167*12)|0)|0)) + 8|0);
  26540. $176 = HEAP32[$175>>2]|0;
  26541. $177 = (($$0350$ph) + 5)|0;
  26542. $178 = (($75) + ($177<<2)|0);
  26543. HEAP32[$178>>2] = $176;
  26544. $179 = (($$0350$ph) + 6)|0;
  26545. $180 = HEAP32[$85>>2]|0;
  26546. $181 = (($180) + -1)|0;
  26547. $182 = (($$0357) + (($181*12)|0)|0);
  26548. $183 = HEAP32[$182>>2]|0;
  26549. $184 = (($75) + ($179<<2)|0);
  26550. HEAP32[$184>>2] = $183;
  26551. $185 = (((($$0357) + (($181*12)|0)|0)) + 4|0);
  26552. $186 = HEAP32[$185>>2]|0;
  26553. $187 = (($$0350$ph) + 7)|0;
  26554. $188 = (($75) + ($187<<2)|0);
  26555. HEAP32[$188>>2] = $186;
  26556. $189 = (((($$0357) + (($181*12)|0)|0)) + 8|0);
  26557. $190 = HEAP32[$189>>2]|0;
  26558. $191 = (($$0350$ph) + 8)|0;
  26559. $192 = (($75) + ($191<<2)|0);
  26560. HEAP32[$192>>2] = $190;
  26561. } else {
  26562. $193 = HEAP32[$82>>2]|0;
  26563. $194 = (($193) + -1)|0;
  26564. $195 = (($37) + (($194*12)|0)|0);
  26565. $196 = HEAP32[$vararg_buffer11>>2]|0;
  26566. $197 = (($196) + -1)|0;
  26567. $198 = (($37) + (($197*12)|0)|0);
  26568. ;HEAP32[$$byval_copy102>>2]=HEAP32[$195>>2]|0;HEAP32[$$byval_copy102+4>>2]=HEAP32[$195+4>>2]|0;HEAP32[$$byval_copy102+8>>2]=HEAP32[$195+8>>2]|0;
  26569. ;HEAP32[$$byval_copy103>>2]=HEAP32[$198>>2]|0;HEAP32[$$byval_copy103+4>>2]=HEAP32[$198+4>>2]|0;HEAP32[$$byval_copy103+8>>2]=HEAP32[$198+8>>2]|0;
  26570. _VectorSubtract($6,$$byval_copy102,$$byval_copy103);
  26571. $199 = HEAP32[$83>>2]|0;
  26572. $200 = (($199) + -1)|0;
  26573. $201 = (($37) + (($200*12)|0)|0);
  26574. $202 = HEAP32[$vararg_buffer11>>2]|0;
  26575. $203 = (($202) + -1)|0;
  26576. $204 = (($37) + (($203*12)|0)|0);
  26577. ;HEAP32[$$byval_copy102>>2]=HEAP32[$201>>2]|0;HEAP32[$$byval_copy102+4>>2]=HEAP32[$201+4>>2]|0;HEAP32[$$byval_copy102+8>>2]=HEAP32[$201+8>>2]|0;
  26578. ;HEAP32[$$byval_copy103>>2]=HEAP32[$204>>2]|0;HEAP32[$$byval_copy103+4>>2]=HEAP32[$204+4>>2]|0;HEAP32[$$byval_copy103+8>>2]=HEAP32[$204+8>>2]|0;
  26579. _VectorSubtract($7,$$byval_copy102,$$byval_copy103);
  26580. ;HEAP32[$$byval_copy102>>2]=HEAP32[$6>>2]|0;HEAP32[$$byval_copy102+4>>2]=HEAP32[$6+4>>2]|0;HEAP32[$$byval_copy102+8>>2]=HEAP32[$6+8>>2]|0;
  26581. ;HEAP32[$$byval_copy103>>2]=HEAP32[$7>>2]|0;HEAP32[$$byval_copy103+4>>2]=HEAP32[$7+4>>2]|0;HEAP32[$$byval_copy103+8>>2]=HEAP32[$7+8>>2]|0;
  26582. _VectorCrossProduct($5,$$byval_copy102,$$byval_copy103);
  26583. _VectorNormalize($5);
  26584. $205 = HEAP32[$5>>2]|0;
  26585. $206 = (($75) + ($$0350$ph<<2)|0);
  26586. HEAP32[$206>>2] = $205;
  26587. $207 = HEAP32[$86>>2]|0;
  26588. $208 = (($$0350$ph) + 1)|0;
  26589. $209 = (($75) + ($208<<2)|0);
  26590. HEAP32[$209>>2] = $207;
  26591. $210 = HEAP32[$87>>2]|0;
  26592. $211 = (($$0350$ph) + 2)|0;
  26593. $212 = (($75) + ($211<<2)|0);
  26594. HEAP32[$212>>2] = $210;
  26595. $213 = (($$0350$ph) + 3)|0;
  26596. $214 = HEAP32[$5>>2]|0;
  26597. $215 = (($75) + ($213<<2)|0);
  26598. HEAP32[$215>>2] = $214;
  26599. $216 = HEAP32[$86>>2]|0;
  26600. $217 = (($$0350$ph) + 4)|0;
  26601. $218 = (($75) + ($217<<2)|0);
  26602. HEAP32[$218>>2] = $216;
  26603. $219 = HEAP32[$87>>2]|0;
  26604. $220 = (($$0350$ph) + 5)|0;
  26605. $221 = (($75) + ($220<<2)|0);
  26606. HEAP32[$221>>2] = $219;
  26607. $222 = (($$0350$ph) + 6)|0;
  26608. $223 = HEAP32[$5>>2]|0;
  26609. $224 = (($75) + ($222<<2)|0);
  26610. HEAP32[$224>>2] = $223;
  26611. $225 = HEAP32[$86>>2]|0;
  26612. $226 = (($$0350$ph) + 7)|0;
  26613. $227 = (($75) + ($226<<2)|0);
  26614. HEAP32[$227>>2] = $225;
  26615. $228 = HEAP32[$87>>2]|0;
  26616. $229 = (($$0350$ph) + 8)|0;
  26617. $230 = (($75) + ($229<<2)|0);
  26618. HEAP32[$230>>2] = $228;
  26619. }
  26620. $$1 = (($$0350$ph) + 9)|0;
  26621. if ($41) {
  26622. break;
  26623. } else {
  26624. $$0350$ph = $$1;$$0352$ph = $151;
  26625. }
  26626. }
  26627. $231 = HEAP32[$vararg_buffer7>>2]|0;
  26628. $232 = (($231) + -1)|0;
  26629. $233 = (($$0356) + ($232<<3)|0);
  26630. $234 = HEAP32[$233>>2]|0;
  26631. $235 = (($74) + ($$0351$ph$ph<<2)|0);
  26632. HEAP32[$235>>2] = $234;
  26633. $236 = (((($$0356) + ($232<<3)|0)) + 4|0);
  26634. $237 = +HEAPF32[$236>>2];
  26635. $238 = 1.0 - $237;
  26636. $239 = $$0351$ph$ph | 1;
  26637. $240 = (($74) + ($239<<2)|0);
  26638. HEAPF32[$240>>2] = $238;
  26639. $241 = (($$0351$ph$ph) + 2)|0;
  26640. $242 = HEAP32[$102>>2]|0;
  26641. $243 = (($242) + -1)|0;
  26642. $244 = (($$0356) + ($243<<3)|0);
  26643. $245 = HEAP32[$244>>2]|0;
  26644. $246 = (($74) + ($241<<2)|0);
  26645. HEAP32[$246>>2] = $245;
  26646. $247 = (((($$0356) + ($243<<3)|0)) + 4|0);
  26647. $248 = +HEAPF32[$247>>2];
  26648. $249 = 1.0 - $248;
  26649. $250 = (($$0351$ph$ph) + 3)|0;
  26650. $251 = (($74) + ($250<<2)|0);
  26651. HEAPF32[$251>>2] = $249;
  26652. $252 = (($$0351$ph$ph) + 4)|0;
  26653. $253 = HEAP32[$103>>2]|0;
  26654. $254 = (($253) + -1)|0;
  26655. $255 = (($$0356) + ($254<<3)|0);
  26656. $256 = HEAP32[$255>>2]|0;
  26657. $257 = (($74) + ($252<<2)|0);
  26658. HEAP32[$257>>2] = $256;
  26659. $258 = (((($$0356) + ($254<<3)|0)) + 4|0);
  26660. $259 = +HEAPF32[$258>>2];
  26661. $260 = 1.0 - $259;
  26662. $261 = (($$0351$ph$ph) + 5)|0;
  26663. $262 = (($74) + ($261<<2)|0);
  26664. HEAPF32[$262>>2] = $260;
  26665. $263 = (($$0351$ph$ph) + 6)|0;
  26666. $$0350$ph$ph = $$1;$$0351$ph$ph = $263;$$0352$ph$ph = $151;
  26667. }
  26668. (_fclose($15)|0);
  26669. $264 = ($$0345$ph372$lcssa389|0)==(0);
  26670. if ($264) {
  26671. $265 = ($72|0)>(0);
  26672. if ($265) {
  26673. $368 = ($$0346$ph$lcssa*24)|0;
  26674. _memset(($74|0),0,($368|0))|0;
  26675. $$sroa$64$0 = 0;
  26676. } else {
  26677. $$sroa$64$0 = 0;
  26678. }
  26679. } else {
  26680. $266 = (_malloc($70)|0);
  26681. $267 = ($69|0)>(0);
  26682. if ($267) {
  26683. $268 = ((($5)) + 4|0);
  26684. $269 = ((($5)) + 8|0);
  26685. $270 = ((($8)) + 4|0);
  26686. $271 = ((($8)) + 8|0);
  26687. $272 = ((($9)) + 4|0);
  26688. $273 = ((($9)) + 8|0);
  26689. $274 = ((($12)) + 4|0);
  26690. $275 = ((($10)) + 4|0);
  26691. $276 = ((($12)) + 8|0);
  26692. $277 = ((($10)) + 8|0);
  26693. $278 = ((($13)) + 4|0);
  26694. $279 = ((($11)) + 4|0);
  26695. $280 = ((($13)) + 8|0);
  26696. $281 = ((($11)) + 8|0);
  26697. $282 = ((($14)) + 4|0);
  26698. $283 = ((($14)) + 8|0);
  26699. $$0347392 = 0;$$0348391 = 0;
  26700. while(1) {
  26701. $284 = (($71) + ($$0348391<<2)|0);
  26702. $285 = HEAP32[$284>>2]|0;
  26703. HEAP32[$5>>2] = $285;
  26704. $286 = (($$0348391) + 1)|0;
  26705. $287 = (($71) + ($286<<2)|0);
  26706. $288 = HEAP32[$287>>2]|0;
  26707. HEAP32[$268>>2] = $288;
  26708. $289 = (($$0348391) + 2)|0;
  26709. $290 = (($71) + ($289<<2)|0);
  26710. $291 = HEAP32[$290>>2]|0;
  26711. HEAP32[$269>>2] = $291;
  26712. $292 = (($$0348391) + 3)|0;
  26713. $293 = (($71) + ($292<<2)|0);
  26714. $294 = HEAP32[$293>>2]|0;
  26715. HEAP32[$8>>2] = $294;
  26716. $295 = (($$0348391) + 4)|0;
  26717. $296 = (($71) + ($295<<2)|0);
  26718. $297 = HEAP32[$296>>2]|0;
  26719. HEAP32[$270>>2] = $297;
  26720. $298 = (($$0348391) + 5)|0;
  26721. $299 = (($71) + ($298<<2)|0);
  26722. $300 = HEAP32[$299>>2]|0;
  26723. HEAP32[$271>>2] = $300;
  26724. $301 = (($$0348391) + 6)|0;
  26725. $302 = (($71) + ($301<<2)|0);
  26726. $303 = HEAP32[$302>>2]|0;
  26727. HEAP32[$9>>2] = $303;
  26728. $304 = (($$0348391) + 7)|0;
  26729. $305 = (($71) + ($304<<2)|0);
  26730. $306 = HEAP32[$305>>2]|0;
  26731. HEAP32[$272>>2] = $306;
  26732. $307 = (($$0348391) + 8)|0;
  26733. $308 = (($71) + ($307<<2)|0);
  26734. $309 = HEAP32[$308>>2]|0;
  26735. HEAP32[$273>>2] = $309;
  26736. $310 = (($74) + ($$0347392<<2)|0);
  26737. $311 = +HEAPF32[$310>>2];
  26738. $312 = $$0347392 | 1;
  26739. $313 = (($74) + ($312<<2)|0);
  26740. $314 = +HEAPF32[$313>>2];
  26741. $315 = (($$0347392) + 2)|0;
  26742. $316 = (($74) + ($315<<2)|0);
  26743. $317 = +HEAPF32[$316>>2];
  26744. $318 = (($$0347392) + 3)|0;
  26745. $319 = (($74) + ($318<<2)|0);
  26746. $320 = +HEAPF32[$319>>2];
  26747. $321 = (($$0347392) + 4)|0;
  26748. $322 = (($74) + ($321<<2)|0);
  26749. $323 = +HEAPF32[$322>>2];
  26750. $324 = (($$0347392) + 5)|0;
  26751. $325 = (($74) + ($324<<2)|0);
  26752. $326 = +HEAPF32[$325>>2];
  26753. ;HEAP32[$$byval_copy102>>2]=HEAP32[$8>>2]|0;HEAP32[$$byval_copy102+4>>2]=HEAP32[$8+4>>2]|0;HEAP32[$$byval_copy102+8>>2]=HEAP32[$8+8>>2]|0;
  26754. ;HEAP32[$$byval_copy103>>2]=HEAP32[$5>>2]|0;HEAP32[$$byval_copy103+4>>2]=HEAP32[$5+4>>2]|0;HEAP32[$$byval_copy103+8>>2]=HEAP32[$5+8>>2]|0;
  26755. _VectorSubtract($10,$$byval_copy102,$$byval_copy103);
  26756. ;HEAP32[$$byval_copy102>>2]=HEAP32[$9>>2]|0;HEAP32[$$byval_copy102+4>>2]=HEAP32[$9+4>>2]|0;HEAP32[$$byval_copy102+8>>2]=HEAP32[$9+8>>2]|0;
  26757. ;HEAP32[$$byval_copy103>>2]=HEAP32[$5>>2]|0;HEAP32[$$byval_copy103+4>>2]=HEAP32[$5+4>>2]|0;HEAP32[$$byval_copy103+8>>2]=HEAP32[$5+8>>2]|0;
  26758. _VectorSubtract($11,$$byval_copy102,$$byval_copy103);
  26759. $327 = $317 - $311;
  26760. $328 = $320 - $314;
  26761. $329 = $323 - $311;
  26762. $330 = $326 - $314;
  26763. $331 = $327 * $330;
  26764. $332 = $328 * $329;
  26765. $333 = $331 - $332;
  26766. $334 = 1.0 / $333;
  26767. $335 = +HEAPF32[$10>>2];
  26768. $336 = $330 * $335;
  26769. HEAPF32[$12>>2] = $336;
  26770. $337 = +HEAPF32[$275>>2];
  26771. $338 = $330 * $337;
  26772. HEAPF32[$274>>2] = $338;
  26773. $339 = +HEAPF32[$277>>2];
  26774. $340 = $330 * $339;
  26775. HEAPF32[$276>>2] = $340;
  26776. $341 = +HEAPF32[$11>>2];
  26777. $342 = $328 * $341;
  26778. HEAPF32[$13>>2] = $342;
  26779. $343 = +HEAPF32[$279>>2];
  26780. $344 = $328 * $343;
  26781. HEAPF32[$278>>2] = $344;
  26782. $345 = +HEAPF32[$281>>2];
  26783. $346 = $328 * $345;
  26784. HEAPF32[$280>>2] = $346;
  26785. ;HEAP32[$$byval_copy102>>2]=HEAP32[$12>>2]|0;HEAP32[$$byval_copy102+4>>2]=HEAP32[$12+4>>2]|0;HEAP32[$$byval_copy102+8>>2]=HEAP32[$12+8>>2]|0;
  26786. ;HEAP32[$$byval_copy103>>2]=HEAP32[$13>>2]|0;HEAP32[$$byval_copy103+4>>2]=HEAP32[$13+4>>2]|0;HEAP32[$$byval_copy103+8>>2]=HEAP32[$13+8>>2]|0;
  26787. _VectorSubtract($14,$$byval_copy102,$$byval_copy103);
  26788. _VectorScale($14,$334);
  26789. $347 = HEAP32[$14>>2]|0;
  26790. $348 = (($266) + ($$0348391<<2)|0);
  26791. HEAP32[$348>>2] = $347;
  26792. $349 = HEAP32[$282>>2]|0;
  26793. $350 = (($266) + ($286<<2)|0);
  26794. HEAP32[$350>>2] = $349;
  26795. $351 = HEAP32[$283>>2]|0;
  26796. $352 = (($266) + ($289<<2)|0);
  26797. HEAP32[$352>>2] = $351;
  26798. $353 = HEAP32[$14>>2]|0;
  26799. $354 = (($266) + ($292<<2)|0);
  26800. HEAP32[$354>>2] = $353;
  26801. $355 = HEAP32[$282>>2]|0;
  26802. $356 = (($266) + ($295<<2)|0);
  26803. HEAP32[$356>>2] = $355;
  26804. $357 = HEAP32[$283>>2]|0;
  26805. $358 = (($266) + ($298<<2)|0);
  26806. HEAP32[$358>>2] = $357;
  26807. $359 = HEAP32[$14>>2]|0;
  26808. $360 = (($266) + ($301<<2)|0);
  26809. HEAP32[$360>>2] = $359;
  26810. $361 = HEAP32[$282>>2]|0;
  26811. $362 = (($266) + ($304<<2)|0);
  26812. HEAP32[$362>>2] = $361;
  26813. $363 = HEAP32[$283>>2]|0;
  26814. $364 = (($266) + ($307<<2)|0);
  26815. HEAP32[$364>>2] = $363;
  26816. $365 = (($$0348391) + 9)|0;
  26817. $366 = (($$0347392) + 6)|0;
  26818. $367 = ($365|0)<($69|0);
  26819. if ($367) {
  26820. $$0347392 = $366;$$0348391 = $365;
  26821. } else {
  26822. $$sroa$64$0 = $266;
  26823. break;
  26824. }
  26825. }
  26826. } else {
  26827. $$sroa$64$0 = $266;
  26828. }
  26829. }
  26830. _free($37);
  26831. _free($369);
  26832. _free($370);
  26833. HEAP32[$vararg_buffer90>>2] = $1;
  26834. _TraceLog(0,12162,$vararg_buffer90);
  26835. HEAP32[$0>>2] = $68;
  26836. $$sroa$12$0$$sroa_idx244 = ((($0)) + 4|0);
  26837. HEAP32[$$sroa$12$0$$sroa_idx244>>2] = 0;
  26838. $$sroa$12247$0$$sroa_idx249 = ((($0)) + 8|0);
  26839. HEAP32[$$sroa$12247$0$$sroa_idx249>>2] = $71;
  26840. $$sroa$31$0$$sroa_idx270 = ((($0)) + 12|0);
  26841. HEAP32[$$sroa$31$0$$sroa_idx270>>2] = $74;
  26842. $$sroa$45$0$$sroa_idx286 = ((($0)) + 16|0);
  26843. HEAP32[$$sroa$45$0$$sroa_idx286>>2] = 0;
  26844. $$sroa$45289$0$$sroa_idx291 = ((($0)) + 20|0);
  26845. HEAP32[$$sroa$45289$0$$sroa_idx291>>2] = $75;
  26846. $$sroa$64$0$$sroa_idx312 = ((($0)) + 24|0);
  26847. HEAP32[$$sroa$64$0$$sroa_idx312>>2] = $$sroa$64$0;
  26848. $$sroa$74$0$$sroa_idx324 = ((($0)) + 28|0);
  26849. HEAP32[$$sroa$74$0$$sroa_idx324>>2] = 0;
  26850. $$sroa$75$0$$sroa_idx328 = ((($0)) + 32|0);
  26851. dest=$$sroa$75$0$$sroa_idx328; src=$$sroa$75; stop=dest+36|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  26852. STACKTOP = sp;return;
  26853. }
  26854. function _LoadModel($0,$1) {
  26855. $0 = $0|0;
  26856. $1 = $1|0;
  26857. var $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
  26858. sp = STACKTOP;
  26859. STACKTOP = STACKTOP + 464|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(464|0);
  26860. $2 = sp + 200|0;
  26861. $3 = sp + 136|0;
  26862. $4 = sp;
  26863. _memset(($2|0),0,264)|0;
  26864. _LoadMesh($2,$1);
  26865. $5 = ((($2)) + 68|0);
  26866. _MatrixIdentity($3);
  26867. dest=$5; src=$3; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  26868. $6 = ((($2)) + 132|0);
  26869. _LoadDefaultMaterial($4);
  26870. _memcpy(($6|0),($4|0),132)|0;
  26871. _memcpy(($0|0),($2|0),264)|0;
  26872. STACKTOP = sp;return;
  26873. }
  26874. function _LoadDefaultMaterial($0) {
  26875. $0 = $0|0;
  26876. var $$sroa$09 = 0, $$sroa$09$56$sroa_idx = 0, $$sroa$18$0$$sroa_idx15 = 0, $$sroa$6$0$$sroa_idx = 0, $1 = 0, $2 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
  26877. sp = STACKTOP;
  26878. STACKTOP = STACKTOP + 192|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(192|0);
  26879. $$sroa$09 = sp;
  26880. $1 = sp + 136|0;
  26881. $2 = sp + 116|0;
  26882. dest=$$sroa$09; stop=dest+116|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0));
  26883. _GetDefaultShader($1);
  26884. dest=$$sroa$09; src=$1; stop=dest+56|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  26885. _GetDefaultTexture($2);
  26886. $$sroa$09$56$sroa_idx = ((($$sroa$09)) + 56|0);
  26887. ;HEAP32[$$sroa$09$56$sroa_idx>>2]=HEAP32[$2>>2]|0;HEAP32[$$sroa$09$56$sroa_idx+4>>2]=HEAP32[$2+4>>2]|0;HEAP32[$$sroa$09$56$sroa_idx+8>>2]=HEAP32[$2+8>>2]|0;HEAP32[$$sroa$09$56$sroa_idx+12>>2]=HEAP32[$2+12>>2]|0;HEAP32[$$sroa$09$56$sroa_idx+16>>2]=HEAP32[$2+16>>2]|0;
  26888. dest=$0; src=$$sroa$09; stop=dest+116|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  26889. $$sroa$6$0$$sroa_idx = ((($0)) + 116|0);
  26890. $$sroa$18$0$$sroa_idx15 = ((($0)) + 128|0);
  26891. ;HEAP32[$$sroa$6$0$$sroa_idx>>2]=4294967295|0;HEAP32[$$sroa$6$0$$sroa_idx+4>>2]=4294967295|0;HEAP32[$$sroa$6$0$$sroa_idx+8>>2]=4294967295|0;
  26892. HEAPF32[$$sroa$18$0$$sroa_idx15>>2] = 100.0;
  26893. STACKTOP = sp;return;
  26894. }
  26895. function _UnloadMesh($0) {
  26896. $0 = $0|0;
  26897. var label = 0, sp = 0;
  26898. sp = STACKTOP;
  26899. _rlglUnloadMesh($0);
  26900. return;
  26901. }
  26902. function _UnloadModel($0) {
  26903. $0 = $0|0;
  26904. var $$byval_copy = 0, $1 = 0, $vararg_buffer = 0, label = 0, sp = 0;
  26905. sp = STACKTOP;
  26906. STACKTOP = STACKTOP + 144|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(144|0);
  26907. $$byval_copy = sp + 4|0;
  26908. $vararg_buffer = sp;
  26909. _UnloadMesh($0);
  26910. $1 = ((($0)) + 132|0);
  26911. _memcpy(($$byval_copy|0),($1|0),132)|0;
  26912. _UnloadMaterial($$byval_copy);
  26913. _TraceLog(0,12206,$vararg_buffer);
  26914. STACKTOP = sp;return;
  26915. }
  26916. function _UnloadMaterial($0) {
  26917. $0 = $0|0;
  26918. var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, label = 0, sp = 0;
  26919. sp = STACKTOP;
  26920. $1 = ((($0)) + 56|0);
  26921. $2 = HEAP32[$1>>2]|0;
  26922. _rlDeleteTextures($2);
  26923. $3 = ((($0)) + 76|0);
  26924. $4 = HEAP32[$3>>2]|0;
  26925. _rlDeleteTextures($4);
  26926. $5 = ((($0)) + 96|0);
  26927. $6 = HEAP32[$5>>2]|0;
  26928. _rlDeleteTextures($6);
  26929. return;
  26930. }
  26931. function _DrawModel($0,$1,$2,$3) {
  26932. $0 = $0|0;
  26933. $1 = $1|0;
  26934. $2 = +$2;
  26935. $3 = $3|0;
  26936. var $$byval_copy = 0, $$byval_copy1 = 0, $$byval_copy2 = 0, $$byval_copy3 = 0, $$byval_copy4 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, label = 0, sp = 0;
  26937. sp = STACKTOP;
  26938. STACKTOP = STACKTOP + 336|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(336|0);
  26939. $$byval_copy4 = sp + 324|0;
  26940. $$byval_copy3 = sp + 312|0;
  26941. $$byval_copy2 = sp + 300|0;
  26942. $$byval_copy1 = sp + 288|0;
  26943. $$byval_copy = sp + 24|0;
  26944. $4 = sp + 12|0;
  26945. $5 = sp;
  26946. HEAPF32[$4>>2] = $2;
  26947. $6 = ((($4)) + 4|0);
  26948. HEAPF32[$6>>2] = $2;
  26949. $7 = ((($4)) + 8|0);
  26950. HEAPF32[$7>>2] = $2;
  26951. ;HEAP32[$5>>2]=0|0;HEAP32[$5+4>>2]=0|0;HEAP32[$5+8>>2]=0|0;
  26952. _memcpy(($$byval_copy|0),($0|0),264)|0;
  26953. ;HEAP32[$$byval_copy1>>2]=HEAP32[$1>>2]|0;HEAP32[$$byval_copy1+4>>2]=HEAP32[$1+4>>2]|0;HEAP32[$$byval_copy1+8>>2]=HEAP32[$1+8>>2]|0;
  26954. ;HEAP32[$$byval_copy2>>2]=HEAP32[$5>>2]|0;HEAP32[$$byval_copy2+4>>2]=HEAP32[$5+4>>2]|0;HEAP32[$$byval_copy2+8>>2]=HEAP32[$5+8>>2]|0;
  26955. ;HEAP32[$$byval_copy3>>2]=HEAP32[$4>>2]|0;HEAP32[$$byval_copy3+4>>2]=HEAP32[$4+4>>2]|0;HEAP32[$$byval_copy3+8>>2]=HEAP32[$4+8>>2]|0;
  26956. ;HEAP8[$$byval_copy4>>0]=HEAP8[$3>>0]|0;HEAP8[$$byval_copy4+1>>0]=HEAP8[$3+1>>0]|0;HEAP8[$$byval_copy4+2>>0]=HEAP8[$3+2>>0]|0;HEAP8[$$byval_copy4+3>>0]=HEAP8[$3+3>>0]|0;
  26957. _DrawModelEx($$byval_copy,$$byval_copy1,$$byval_copy2,0.0,$$byval_copy3,$$byval_copy4);
  26958. STACKTOP = sp;return;
  26959. }
  26960. function _DrawModelEx($0,$1,$2,$3,$4,$5) {
  26961. $0 = $0|0;
  26962. $1 = $1|0;
  26963. $2 = $2|0;
  26964. $3 = +$3;
  26965. $4 = $4|0;
  26966. $5 = $5|0;
  26967. var $$byval_copy5 = 0, $$byval_copy6 = 0, $$byval_copy7 = 0, $10 = 0, $11 = 0.0, $12 = 0.0, $13 = 0, $14 = 0.0, $15 = 0, $16 = 0.0, $17 = 0.0, $18 = 0, $19 = 0.0, $20 = 0, $21 = 0.0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $6 = 0;
  26968. var $7 = 0, $8 = 0, $9 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
  26969. sp = STACKTOP;
  26970. STACKTOP = STACKTOP + 592|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(592|0);
  26971. $$byval_copy7 = sp + 520|0;
  26972. $$byval_copy6 = sp + 388|0;
  26973. $$byval_copy5 = sp + 320|0;
  26974. $6 = sp + 128|0;
  26975. $7 = sp + 64|0;
  26976. $8 = sp;
  26977. $9 = sp + 256|0;
  26978. $10 = sp + 192|0;
  26979. $11 = $3 * 0.01745329238474369;
  26980. ;HEAP32[$$byval_copy7>>2]=HEAP32[$2>>2]|0;HEAP32[$$byval_copy7+4>>2]=HEAP32[$2+4>>2]|0;HEAP32[$$byval_copy7+8>>2]=HEAP32[$2+8>>2]|0;
  26981. _MatrixRotate($6,$$byval_copy7,$11);
  26982. $12 = +HEAPF32[$4>>2];
  26983. $13 = ((($4)) + 4|0);
  26984. $14 = +HEAPF32[$13>>2];
  26985. $15 = ((($4)) + 8|0);
  26986. $16 = +HEAPF32[$15>>2];
  26987. _MatrixScale($7,$12,$14,$16);
  26988. $17 = +HEAPF32[$1>>2];
  26989. $18 = ((($1)) + 4|0);
  26990. $19 = +HEAPF32[$18>>2];
  26991. $20 = ((($1)) + 8|0);
  26992. $21 = +HEAPF32[$20>>2];
  26993. _MatrixTranslate($8,$17,$19,$21);
  26994. $22 = ((($0)) + 68|0);
  26995. dest=$$byval_copy6; src=$7; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  26996. dest=$$byval_copy7; src=$6; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  26997. _MatrixMultiply($9,$$byval_copy6,$$byval_copy7);
  26998. dest=$$byval_copy6; src=$9; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  26999. dest=$$byval_copy7; src=$8; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  27000. _MatrixMultiply($10,$$byval_copy6,$$byval_copy7);
  27001. dest=$22; src=$10; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  27002. $23 = ((($0)) + 132|0);
  27003. $24 = ((($0)) + 248|0);
  27004. $25 = HEAPU8[$5>>0]|(HEAPU8[$5+1>>0]<<8)|(HEAPU8[$5+2>>0]<<16)|(HEAPU8[$5+3>>0]<<24);
  27005. HEAP32[$24>>2] = $25;
  27006. dest=$$byval_copy5; src=$0; stop=dest+68|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  27007. _memcpy(($$byval_copy6|0),($23|0),132)|0;
  27008. dest=$$byval_copy7; src=$10; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  27009. _rlglDrawMesh($$byval_copy5,$$byval_copy6,$$byval_copy7);
  27010. STACKTOP = sp;return;
  27011. }
  27012. function _emscripten_GetProcAddress($0) {
  27013. $0 = $0|0;
  27014. var $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0;
  27015. var $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0;
  27016. var $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0;
  27017. var $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0;
  27018. var $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0;
  27019. var $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0;
  27020. var $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0;
  27021. var $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0;
  27022. var $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0;
  27023. var $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0;
  27024. var $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0;
  27025. var $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0, $314 = 0;
  27026. var $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0, $321 = 0, $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0, $332 = 0;
  27027. var $333 = 0, $334 = 0, $335 = 0, $336 = 0, $337 = 0, $338 = 0, $339 = 0, $34 = 0, $340 = 0, $341 = 0, $342 = 0, $343 = 0, $344 = 0, $345 = 0, $346 = 0, $347 = 0, $348 = 0, $349 = 0, $35 = 0, $350 = 0;
  27028. var $351 = 0, $352 = 0, $353 = 0, $354 = 0, $355 = 0, $356 = 0, $357 = 0, $358 = 0, $359 = 0, $36 = 0, $360 = 0, $361 = 0, $362 = 0, $363 = 0, $364 = 0, $365 = 0, $366 = 0, $367 = 0, $368 = 0, $369 = 0;
  27029. var $37 = 0, $370 = 0, $371 = 0, $372 = 0, $373 = 0, $374 = 0, $375 = 0, $376 = 0, $377 = 0, $378 = 0, $379 = 0, $38 = 0, $380 = 0, $381 = 0, $382 = 0, $383 = 0, $384 = 0, $385 = 0, $386 = 0, $387 = 0;
  27030. var $388 = 0, $389 = 0, $39 = 0, $390 = 0, $391 = 0, $392 = 0, $393 = 0, $394 = 0, $395 = 0, $396 = 0, $397 = 0, $398 = 0, $399 = 0, $4 = 0, $40 = 0, $400 = 0, $401 = 0, $402 = 0, $403 = 0, $404 = 0;
  27031. var $405 = 0, $406 = 0, $407 = 0, $408 = 0, $409 = 0, $41 = 0, $410 = 0, $411 = 0, $412 = 0, $413 = 0, $414 = 0, $415 = 0, $416 = 0, $417 = 0, $418 = 0, $419 = 0, $42 = 0, $420 = 0, $421 = 0, $422 = 0;
  27032. var $423 = 0, $424 = 0, $425 = 0, $426 = 0, $427 = 0, $428 = 0, $429 = 0, $43 = 0, $430 = 0, $431 = 0, $432 = 0, $433 = 0, $434 = 0, $435 = 0, $436 = 0, $437 = 0, $438 = 0, $439 = 0, $44 = 0, $440 = 0;
  27033. var $441 = 0, $442 = 0, $443 = 0, $444 = 0, $445 = 0, $446 = 0, $447 = 0, $448 = 0, $449 = 0, $45 = 0, $450 = 0, $451 = 0, $452 = 0, $453 = 0, $454 = 0, $455 = 0, $456 = 0, $457 = 0, $458 = 0, $459 = 0;
  27034. var $46 = 0, $460 = 0, $461 = 0, $462 = 0, $463 = 0, $464 = 0, $465 = 0, $466 = 0, $467 = 0, $468 = 0, $469 = 0, $47 = 0, $470 = 0, $471 = 0, $472 = 0, $473 = 0, $474 = 0, $475 = 0, $476 = 0, $477 = 0;
  27035. var $478 = 0, $479 = 0, $48 = 0, $480 = 0, $481 = 0, $482 = 0, $483 = 0, $484 = 0, $485 = 0, $486 = 0, $487 = 0, $488 = 0, $489 = 0, $49 = 0, $490 = 0, $491 = 0, $492 = 0, $493 = 0, $494 = 0, $495 = 0;
  27036. var $496 = 0, $497 = 0, $498 = 0, $499 = 0, $5 = 0, $50 = 0, $500 = 0, $501 = 0, $502 = 0, $503 = 0, $504 = 0, $505 = 0, $506 = 0, $507 = 0, $508 = 0, $509 = 0, $51 = 0, $510 = 0, $511 = 0, $512 = 0;
  27037. var $513 = 0, $514 = 0, $515 = 0, $516 = 0, $517 = 0, $518 = 0, $519 = 0, $52 = 0, $520 = 0, $521 = 0, $522 = 0, $523 = 0, $524 = 0, $525 = 0, $526 = 0, $527 = 0, $528 = 0, $529 = 0, $53 = 0, $530 = 0;
  27038. var $531 = 0, $532 = 0, $533 = 0, $534 = 0, $535 = 0, $536 = 0, $537 = 0, $538 = 0, $539 = 0, $54 = 0, $540 = 0, $541 = 0, $542 = 0, $543 = 0, $544 = 0, $545 = 0, $546 = 0, $547 = 0, $548 = 0, $549 = 0;
  27039. var $55 = 0, $550 = 0, $551 = 0, $552 = 0, $553 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0;
  27040. var $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0;
  27041. var $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, label = 0, sp = 0;
  27042. sp = STACKTOP;
  27043. STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
  27044. $1 = sp + 12|0;
  27045. $2 = sp + 8|0;
  27046. $3 = sp + 4|0;
  27047. $4 = sp;
  27048. HEAP32[$2>>2] = $0;
  27049. $5 = HEAP32[$2>>2]|0;
  27050. $6 = (_strlen($5)|0);
  27051. $7 = (($6) + 1)|0;
  27052. $8 = (_malloc($7)|0);
  27053. HEAP32[$3>>2] = $8;
  27054. $9 = HEAP32[$3>>2]|0;
  27055. $10 = HEAP32[$2>>2]|0;
  27056. (_strcpy($9,$10)|0);
  27057. $11 = HEAP32[$3>>2]|0;
  27058. $12 = (_strstr($11,12264)|0);
  27059. HEAP32[$4>>2] = $12;
  27060. $13 = HEAP32[$4>>2]|0;
  27061. $14 = ($13|0)!=(0|0);
  27062. if ($14) {
  27063. $15 = HEAP32[$4>>2]|0;
  27064. HEAP8[$15>>0] = 0;
  27065. }
  27066. $16 = HEAP32[$3>>2]|0;
  27067. $17 = (_strstr($16,12268)|0);
  27068. HEAP32[$4>>2] = $17;
  27069. $18 = HEAP32[$4>>2]|0;
  27070. $19 = ($18|0)!=(0|0);
  27071. if ($19) {
  27072. $20 = HEAP32[$4>>2]|0;
  27073. HEAP8[$20>>0] = 0;
  27074. }
  27075. $21 = HEAP32[$3>>2]|0;
  27076. $22 = (_strstr($21,12272)|0);
  27077. HEAP32[$4>>2] = $22;
  27078. $23 = HEAP32[$4>>2]|0;
  27079. $24 = ($23|0)!=(0|0);
  27080. if ($24) {
  27081. $25 = HEAP32[$4>>2]|0;
  27082. HEAP8[$25>>0] = 0;
  27083. }
  27084. $26 = HEAP32[$3>>2]|0;
  27085. $27 = (_strstr($26,12276)|0);
  27086. HEAP32[$4>>2] = $27;
  27087. $28 = HEAP32[$4>>2]|0;
  27088. $29 = ($28|0)!=(0|0);
  27089. if ($29) {
  27090. $30 = HEAP32[$4>>2]|0;
  27091. HEAP8[$30>>0] = 0;
  27092. }
  27093. $31 = HEAP32[$3>>2]|0;
  27094. $32 = (_strcmp($31,12282)|0);
  27095. $33 = ($32|0)!=(0);
  27096. do {
  27097. if ($33) {
  27098. $34 = HEAP32[$3>>2]|0;
  27099. $35 = (_strcmp($34,12320)|0);
  27100. $36 = ($35|0)!=(0);
  27101. if (!($36)) {
  27102. HEAP32[$3>>2] = 12339;
  27103. break;
  27104. }
  27105. $37 = HEAP32[$3>>2]|0;
  27106. $38 = (_strcmp($37,12352)|0);
  27107. $39 = ($38|0)!=(0);
  27108. if (!($39)) {
  27109. HEAP32[$3>>2] = 12373;
  27110. break;
  27111. }
  27112. $40 = HEAP32[$3>>2]|0;
  27113. $41 = (_strcmp($40,12388)|0);
  27114. $42 = ($41|0)!=(0);
  27115. if (!($42)) {
  27116. HEAP32[$3>>2] = 12403;
  27117. break;
  27118. }
  27119. $43 = HEAP32[$3>>2]|0;
  27120. $44 = (_strcmp($43,12418)|0);
  27121. $45 = ($44|0)!=(0);
  27122. if (!($45)) {
  27123. HEAP32[$3>>2] = 12433;
  27124. }
  27125. } else {
  27126. HEAP32[$3>>2] = 12304;
  27127. }
  27128. } while(0);
  27129. $46 = HEAP32[$3>>2]|0;
  27130. $47 = (_strcmp($46,12448)|0);
  27131. $48 = ($47|0)!=(0);
  27132. do {
  27133. if ($48) {
  27134. $49 = HEAP32[$3>>2]|0;
  27135. $50 = (_strcmp($49,12462)|0);
  27136. $51 = ($50|0)!=(0);
  27137. if (!($51)) {
  27138. HEAP32[$1>>2] = 3;
  27139. break;
  27140. }
  27141. $52 = HEAP32[$3>>2]|0;
  27142. $53 = (_strcmp($52,12474)|0);
  27143. $54 = ($53|0)!=(0);
  27144. if (!($54)) {
  27145. HEAP32[$1>>2] = 7;
  27146. break;
  27147. }
  27148. $55 = HEAP32[$3>>2]|0;
  27149. $56 = (_strcmp($55,12488)|0);
  27150. $57 = ($56|0)!=(0);
  27151. if (!($57)) {
  27152. HEAP32[$1>>2] = 8;
  27153. break;
  27154. }
  27155. $58 = HEAP32[$3>>2]|0;
  27156. $59 = (_strcmp($58,12500)|0);
  27157. $60 = ($59|0)!=(0);
  27158. if (!($60)) {
  27159. HEAP32[$1>>2] = 9;
  27160. break;
  27161. }
  27162. $61 = HEAP32[$3>>2]|0;
  27163. $62 = (_strcmp($61,12514)|0);
  27164. $63 = ($62|0)!=(0);
  27165. if (!($63)) {
  27166. HEAP32[$1>>2] = 10;
  27167. break;
  27168. }
  27169. $64 = HEAP32[$3>>2]|0;
  27170. $65 = (_strcmp($64,12528)|0);
  27171. $66 = ($65|0)!=(0);
  27172. if (!($66)) {
  27173. HEAP32[$1>>2] = 11;
  27174. break;
  27175. }
  27176. $67 = HEAP32[$3>>2]|0;
  27177. $68 = (_strcmp($67,12545)|0);
  27178. $69 = ($68|0)!=(0);
  27179. if (!($69)) {
  27180. HEAP32[$1>>2] = 1;
  27181. break;
  27182. }
  27183. $70 = HEAP32[$3>>2]|0;
  27184. $71 = (_strcmp($70,12568)|0);
  27185. $72 = ($71|0)!=(0);
  27186. if (!($72)) {
  27187. HEAP32[$1>>2] = 1;
  27188. break;
  27189. }
  27190. $73 = HEAP32[$3>>2]|0;
  27191. $74 = (_strcmp($73,12594)|0);
  27192. $75 = ($74|0)!=(0);
  27193. if (!($75)) {
  27194. HEAP32[$1>>2] = 2;
  27195. break;
  27196. }
  27197. $76 = HEAP32[$3>>2]|0;
  27198. $77 = (_strcmp($76,12607)|0);
  27199. $78 = ($77|0)!=(0);
  27200. if (!($78)) {
  27201. HEAP32[$1>>2] = 3;
  27202. break;
  27203. }
  27204. $79 = HEAP32[$3>>2]|0;
  27205. $80 = (_strcmp($79,12623)|0);
  27206. $81 = ($80|0)!=(0);
  27207. if (!($81)) {
  27208. HEAP32[$1>>2] = 1;
  27209. break;
  27210. }
  27211. $82 = HEAP32[$3>>2]|0;
  27212. $83 = (_strcmp($82,12636)|0);
  27213. $84 = ($83|0)!=(0);
  27214. if (!($84)) {
  27215. HEAP32[$1>>2] = 12;
  27216. break;
  27217. }
  27218. $85 = HEAP32[$3>>2]|0;
  27219. $86 = (_strcmp($85,12650)|0);
  27220. $87 = ($86|0)!=(0);
  27221. if (!($87)) {
  27222. HEAP32[$1>>2] = 2;
  27223. break;
  27224. }
  27225. $88 = HEAP32[$3>>2]|0;
  27226. $89 = (_strcmp($88,12670)|0);
  27227. $90 = ($89|0)!=(0);
  27228. if (!($90)) {
  27229. HEAP32[$1>>2] = 3;
  27230. break;
  27231. }
  27232. $91 = HEAP32[$3>>2]|0;
  27233. $92 = (_strcmp($91,12690)|0);
  27234. $93 = ($92|0)!=(0);
  27235. if (!($93)) {
  27236. HEAP32[$1>>2] = 4;
  27237. break;
  27238. }
  27239. $94 = HEAP32[$3>>2]|0;
  27240. $95 = (_strcmp($94,12707)|0);
  27241. $96 = ($95|0)!=(0);
  27242. if (!($96)) {
  27243. HEAP32[$1>>2] = 5;
  27244. break;
  27245. }
  27246. $97 = HEAP32[$3>>2]|0;
  27247. $98 = (_strcmp($97,12724)|0);
  27248. $99 = ($98|0)!=(0);
  27249. if (!($99)) {
  27250. HEAP32[$1>>2] = 4;
  27251. break;
  27252. }
  27253. $100 = HEAP32[$3>>2]|0;
  27254. $101 = (_strcmp($100,12736)|0);
  27255. $102 = ($101|0)!=(0);
  27256. if (!($102)) {
  27257. HEAP32[$1>>2] = 13;
  27258. break;
  27259. }
  27260. $103 = HEAP32[$3>>2]|0;
  27261. $104 = (_strcmp($103,12749)|0);
  27262. $105 = ($104|0)!=(0);
  27263. if (!($105)) {
  27264. HEAP32[$1>>2] = 14;
  27265. break;
  27266. }
  27267. $106 = HEAP32[$3>>2]|0;
  27268. $107 = (_strcmp($106,12765)|0);
  27269. $108 = ($107|0)!=(0);
  27270. if (!($108)) {
  27271. HEAP32[$1>>2] = 6;
  27272. break;
  27273. }
  27274. $109 = HEAP32[$3>>2]|0;
  27275. $110 = (_strcmp($109,12788)|0);
  27276. $111 = ($110|0)!=(0);
  27277. if (!($111)) {
  27278. HEAP32[$1>>2] = 2;
  27279. break;
  27280. }
  27281. $112 = HEAP32[$3>>2]|0;
  27282. $113 = (_strcmp($112,12801)|0);
  27283. $114 = ($113|0)!=(0);
  27284. if (!($114)) {
  27285. HEAP32[$1>>2] = 3;
  27286. break;
  27287. }
  27288. $115 = HEAP32[$3>>2]|0;
  27289. $116 = (_strcmp($115,12817)|0);
  27290. $117 = ($116|0)!=(0);
  27291. if (!($117)) {
  27292. HEAP32[$1>>2] = 5;
  27293. break;
  27294. }
  27295. $118 = HEAP32[$3>>2]|0;
  27296. $119 = (_strcmp($118,12828)|0);
  27297. $120 = ($119|0)!=(0);
  27298. if (!($120)) {
  27299. HEAP32[$1>>2] = 15;
  27300. break;
  27301. }
  27302. $121 = HEAP32[$3>>2]|0;
  27303. $122 = (_strcmp($121,12847)|0);
  27304. $123 = ($122|0)!=(0);
  27305. if (!($123)) {
  27306. HEAP32[$1>>2] = 16;
  27307. break;
  27308. }
  27309. $124 = HEAP32[$3>>2]|0;
  27310. $125 = (_strcmp($124,12869)|0);
  27311. $126 = ($125|0)!=(0);
  27312. if (!($126)) {
  27313. HEAP32[$1>>2] = 17;
  27314. break;
  27315. }
  27316. $127 = HEAP32[$3>>2]|0;
  27317. $128 = (_strcmp($127,12888)|0);
  27318. $129 = ($128|0)!=(0);
  27319. if (!($129)) {
  27320. HEAP32[$1>>2] = 7;
  27321. break;
  27322. }
  27323. $130 = HEAP32[$3>>2]|0;
  27324. $131 = (_strcmp($130,12917)|0);
  27325. $132 = ($131|0)!=(0);
  27326. if (!($132)) {
  27327. HEAP32[$1>>2] = 6;
  27328. break;
  27329. }
  27330. $133 = HEAP32[$3>>2]|0;
  27331. $134 = (_strcmp($133,12934)|0);
  27332. $135 = ($134|0)!=(0);
  27333. if (!($135)) {
  27334. HEAP32[$1>>2] = 8;
  27335. break;
  27336. }
  27337. $136 = HEAP32[$3>>2]|0;
  27338. $137 = (_strcmp($136,12949)|0);
  27339. $138 = ($137|0)!=(0);
  27340. if (!($138)) {
  27341. HEAP32[$1>>2] = 9;
  27342. break;
  27343. }
  27344. $139 = HEAP32[$3>>2]|0;
  27345. $140 = (_strcmp($139,12964)|0);
  27346. $141 = ($140|0)!=(0);
  27347. if (!($141)) {
  27348. HEAP32[$1>>2] = 1;
  27349. break;
  27350. }
  27351. $142 = HEAP32[$3>>2]|0;
  27352. $143 = (_strcmp($142,12985)|0);
  27353. $144 = ($143|0)!=(0);
  27354. if (!($144)) {
  27355. HEAP32[$1>>2] = 10;
  27356. break;
  27357. }
  27358. $145 = HEAP32[$3>>2]|0;
  27359. $146 = (_strcmp($145,13005)|0);
  27360. $147 = ($146|0)!=(0);
  27361. if (!($147)) {
  27362. HEAP32[$1>>2] = 11;
  27363. break;
  27364. }
  27365. $148 = HEAP32[$3>>2]|0;
  27366. $149 = (_strcmp($148,13025)|0);
  27367. $150 = ($149|0)!=(0);
  27368. if (!($150)) {
  27369. HEAP32[$1>>2] = 12;
  27370. break;
  27371. }
  27372. $151 = HEAP32[$3>>2]|0;
  27373. $152 = (_strcmp($151,13051)|0);
  27374. $153 = ($152|0)!=(0);
  27375. if (!($153)) {
  27376. HEAP32[$1>>2] = 2;
  27377. break;
  27378. }
  27379. $154 = HEAP32[$3>>2]|0;
  27380. $155 = (_strcmp($154,13070)|0);
  27381. $156 = ($155|0)!=(0);
  27382. if (!($156)) {
  27383. HEAP32[$1>>2] = 1;
  27384. break;
  27385. }
  27386. $157 = HEAP32[$3>>2]|0;
  27387. $158 = (_strcmp($157,13082)|0);
  27388. $159 = ($158|0)!=(0);
  27389. if (!($159)) {
  27390. HEAP32[$1>>2] = 3;
  27391. break;
  27392. }
  27393. $160 = HEAP32[$3>>2]|0;
  27394. $161 = (_strcmp($160,13094)|0);
  27395. $162 = ($161|0)!=(0);
  27396. if (!($162)) {
  27397. HEAP32[$1>>2] = 1;
  27398. break;
  27399. }
  27400. $163 = HEAP32[$3>>2]|0;
  27401. $164 = (_strcmp($163,13106)|0);
  27402. $165 = ($164|0)!=(0);
  27403. if (!($165)) {
  27404. HEAP32[$1>>2] = 1;
  27405. break;
  27406. }
  27407. $166 = HEAP32[$3>>2]|0;
  27408. $167 = (_strcmp($166,13118)|0);
  27409. $168 = ($167|0)!=(0);
  27410. if (!($168)) {
  27411. HEAP32[$1>>2] = 18;
  27412. break;
  27413. }
  27414. $169 = HEAP32[$3>>2]|0;
  27415. $170 = (_strcmp($169,13130)|0);
  27416. $171 = ($170|0)!=(0);
  27417. if (!($171)) {
  27418. HEAP32[$1>>2] = 13;
  27419. break;
  27420. }
  27421. $172 = HEAP32[$3>>2]|0;
  27422. $173 = (_strcmp($172,13142)|0);
  27423. $174 = ($173|0)!=(0);
  27424. if (!($174)) {
  27425. HEAP32[$1>>2] = 4;
  27426. break;
  27427. }
  27428. $175 = HEAP32[$3>>2]|0;
  27429. $176 = (_strcmp($175,13154)|0);
  27430. $177 = ($176|0)!=(0);
  27431. if (!($177)) {
  27432. HEAP32[$1>>2] = 2;
  27433. break;
  27434. }
  27435. $178 = HEAP32[$3>>2]|0;
  27436. $179 = (_strcmp($178,13166)|0);
  27437. $180 = ($179|0)!=(0);
  27438. if (!($180)) {
  27439. HEAP32[$1>>2] = 14;
  27440. break;
  27441. }
  27442. $181 = HEAP32[$3>>2]|0;
  27443. $182 = (_strcmp($181,13179)|0);
  27444. $183 = ($182|0)!=(0);
  27445. if (!($183)) {
  27446. HEAP32[$1>>2] = 15;
  27447. break;
  27448. }
  27449. $184 = HEAP32[$3>>2]|0;
  27450. $185 = (_strcmp($184,13192)|0);
  27451. $186 = ($185|0)!=(0);
  27452. if (!($186)) {
  27453. HEAP32[$1>>2] = 16;
  27454. break;
  27455. }
  27456. $187 = HEAP32[$3>>2]|0;
  27457. $188 = (_strcmp($187,13205)|0);
  27458. $189 = ($188|0)!=(0);
  27459. if (!($189)) {
  27460. HEAP32[$1>>2] = 17;
  27461. break;
  27462. }
  27463. $190 = HEAP32[$3>>2]|0;
  27464. $191 = (_strcmp($190,13218)|0);
  27465. $192 = ($191|0)!=(0);
  27466. if (!($192)) {
  27467. HEAP32[$1>>2] = 18;
  27468. break;
  27469. }
  27470. $193 = HEAP32[$3>>2]|0;
  27471. $194 = (_strcmp($193,13231)|0);
  27472. $195 = ($194|0)!=(0);
  27473. if (!($195)) {
  27474. HEAP32[$1>>2] = 19;
  27475. break;
  27476. }
  27477. $196 = HEAP32[$3>>2]|0;
  27478. $197 = (_strcmp($196,13244)|0);
  27479. $198 = ($197|0)!=(0);
  27480. if (!($198)) {
  27481. HEAP32[$1>>2] = 20;
  27482. break;
  27483. }
  27484. $199 = HEAP32[$3>>2]|0;
  27485. $200 = (_strcmp($199,13257)|0);
  27486. $201 = ($200|0)!=(0);
  27487. if (!($201)) {
  27488. HEAP32[$1>>2] = 21;
  27489. break;
  27490. }
  27491. $202 = HEAP32[$3>>2]|0;
  27492. $203 = (_strcmp($202,13270)|0);
  27493. $204 = ($203|0)!=(0);
  27494. if (!($204)) {
  27495. HEAP32[$1>>2] = 5;
  27496. break;
  27497. }
  27498. $205 = HEAP32[$3>>2]|0;
  27499. $206 = (_strcmp($205,13289)|0);
  27500. $207 = ($206|0)!=(0);
  27501. if (!($207)) {
  27502. HEAP32[$1>>2] = 6;
  27503. break;
  27504. }
  27505. $208 = HEAP32[$3>>2]|0;
  27506. $209 = (_strcmp($208,13308)|0);
  27507. $210 = ($209|0)!=(0);
  27508. if (!($210)) {
  27509. HEAP32[$1>>2] = 7;
  27510. break;
  27511. }
  27512. $211 = HEAP32[$3>>2]|0;
  27513. $212 = (_strcmp($211,13327)|0);
  27514. $213 = ($212|0)!=(0);
  27515. if (!($213)) {
  27516. HEAP32[$1>>2] = 19;
  27517. break;
  27518. }
  27519. $214 = HEAP32[$3>>2]|0;
  27520. $215 = (_strcmp($214,13340)|0);
  27521. $216 = ($215|0)!=(0);
  27522. if (!($216)) {
  27523. HEAP32[$1>>2] = 20;
  27524. break;
  27525. }
  27526. $217 = HEAP32[$3>>2]|0;
  27527. $218 = (_strcmp($217,13358)|0);
  27528. $219 = ($218|0)!=(0);
  27529. if (!($219)) {
  27530. HEAP32[$1>>2] = 21;
  27531. break;
  27532. }
  27533. $220 = HEAP32[$3>>2]|0;
  27534. $221 = (_strcmp($220,13376)|0);
  27535. $222 = ($221|0)!=(0);
  27536. if (!($222)) {
  27537. HEAP32[$1>>2] = 22;
  27538. break;
  27539. }
  27540. $223 = HEAP32[$3>>2]|0;
  27541. $224 = (_strcmp($223,13394)|0);
  27542. $225 = ($224|0)!=(0);
  27543. if (!($225)) {
  27544. HEAP32[$1>>2] = 23;
  27545. break;
  27546. }
  27547. $226 = HEAP32[$3>>2]|0;
  27548. $227 = (_strcmp($226,13412)|0);
  27549. $228 = ($227|0)!=(0);
  27550. if (!($228)) {
  27551. HEAP32[$1>>2] = 2;
  27552. break;
  27553. }
  27554. $229 = HEAP32[$3>>2]|0;
  27555. $230 = (_strcmp($229,13432)|0);
  27556. $231 = ($230|0)!=(0);
  27557. if (!($231)) {
  27558. HEAP32[$1>>2] = 3;
  27559. break;
  27560. }
  27561. $232 = HEAP32[$3>>2]|0;
  27562. $233 = (_strcmp($232,12373)|0);
  27563. $234 = ($233|0)!=(0);
  27564. if (!($234)) {
  27565. HEAP32[$1>>2] = 7;
  27566. break;
  27567. }
  27568. $235 = HEAP32[$3>>2]|0;
  27569. $236 = (_strcmp($235,13450)|0);
  27570. $237 = ($236|0)!=(0);
  27571. if (!($237)) {
  27572. HEAP32[$1>>2] = 1;
  27573. break;
  27574. }
  27575. $238 = HEAP32[$3>>2]|0;
  27576. $239 = (_strcmp($238,13465)|0);
  27577. $240 = ($239|0)!=(0);
  27578. if (!($240)) {
  27579. HEAP32[$1>>2] = 8;
  27580. break;
  27581. }
  27582. $241 = HEAP32[$3>>2]|0;
  27583. $242 = (_strcmp($241,13486)|0);
  27584. $243 = ($242|0)!=(0);
  27585. if (!($243)) {
  27586. HEAP32[$1>>2] = 9;
  27587. break;
  27588. }
  27589. $244 = HEAP32[$3>>2]|0;
  27590. $245 = (_strcmp($244,13501)|0);
  27591. $246 = ($245|0)!=(0);
  27592. if (!($246)) {
  27593. HEAP32[$1>>2] = 10;
  27594. break;
  27595. }
  27596. $247 = HEAP32[$3>>2]|0;
  27597. $248 = (_strcmp($247,13519)|0);
  27598. $249 = ($248|0)!=(0);
  27599. if (!($249)) {
  27600. HEAP32[$1>>2] = 2;
  27601. break;
  27602. }
  27603. $250 = HEAP32[$3>>2]|0;
  27604. $251 = (_strcmp($250,13535)|0);
  27605. $252 = ($251|0)!=(0);
  27606. if (!($252)) {
  27607. HEAP32[$1>>2] = 11;
  27608. break;
  27609. }
  27610. $253 = HEAP32[$3>>2]|0;
  27611. $254 = (_strcmp($253,13554)|0);
  27612. $255 = ($254|0)!=(0);
  27613. if (!($255)) {
  27614. HEAP32[$1>>2] = 22;
  27615. break;
  27616. }
  27617. $256 = HEAP32[$3>>2]|0;
  27618. $257 = (_strcmp($256,13568)|0);
  27619. $258 = ($257|0)!=(0);
  27620. if (!($258)) {
  27621. HEAP32[$1>>2] = 23;
  27622. break;
  27623. }
  27624. $259 = HEAP32[$3>>2]|0;
  27625. $260 = (_strcmp($259,13583)|0);
  27626. $261 = ($260|0)!=(0);
  27627. if (!($261)) {
  27628. HEAP32[$1>>2] = 8;
  27629. break;
  27630. }
  27631. $262 = HEAP32[$3>>2]|0;
  27632. $263 = (_strcmp($262,12304)|0);
  27633. $264 = ($263|0)!=(0);
  27634. if (!($264)) {
  27635. HEAP32[$1>>2] = 1;
  27636. break;
  27637. }
  27638. $265 = HEAP32[$3>>2]|0;
  27639. $266 = (_strcmp($265,13594)|0);
  27640. $267 = ($266|0)!=(0);
  27641. if (!($267)) {
  27642. HEAP32[$1>>2] = 3;
  27643. break;
  27644. }
  27645. $268 = HEAP32[$3>>2]|0;
  27646. $269 = (_strcmp($268,12403)|0);
  27647. $270 = ($269|0)!=(0);
  27648. if (!($270)) {
  27649. HEAP32[$1>>2] = 24;
  27650. break;
  27651. }
  27652. $271 = HEAP32[$3>>2]|0;
  27653. $272 = (_strcmp($271,12433)|0);
  27654. $273 = ($272|0)!=(0);
  27655. if (!($273)) {
  27656. HEAP32[$1>>2] = 25;
  27657. break;
  27658. }
  27659. $274 = HEAP32[$3>>2]|0;
  27660. $275 = (_strcmp($274,13610)|0);
  27661. $276 = ($275|0)!=(0);
  27662. if (!($276)) {
  27663. HEAP32[$1>>2] = 12;
  27664. break;
  27665. }
  27666. $277 = HEAP32[$3>>2]|0;
  27667. $278 = (_strcmp($277,13637)|0);
  27668. $279 = ($278|0)!=(0);
  27669. if (!($279)) {
  27670. HEAP32[$1>>2] = 4;
  27671. break;
  27672. }
  27673. $280 = HEAP32[$3>>2]|0;
  27674. $281 = (_strcmp($280,13651)|0);
  27675. $282 = ($281|0)!=(0);
  27676. if (!($282)) {
  27677. HEAP32[$1>>2] = 13;
  27678. break;
  27679. }
  27680. $283 = HEAP32[$3>>2]|0;
  27681. $284 = (_strcmp($283,12339)|0);
  27682. $285 = ($284|0)!=(0);
  27683. if (!($285)) {
  27684. HEAP32[$1>>2] = 5;
  27685. break;
  27686. }
  27687. $286 = HEAP32[$3>>2]|0;
  27688. $287 = (_strcmp($286,13671)|0);
  27689. $288 = ($287|0)!=(0);
  27690. if (!($288)) {
  27691. HEAP32[$1>>2] = 6;
  27692. break;
  27693. }
  27694. $289 = HEAP32[$3>>2]|0;
  27695. $290 = (_strcmp($289,13689)|0);
  27696. $291 = ($290|0)!=(0);
  27697. if (!($291)) {
  27698. HEAP32[$1>>2] = 9;
  27699. break;
  27700. }
  27701. $292 = HEAP32[$3>>2]|0;
  27702. $293 = (_strcmp($292,13701)|0);
  27703. $294 = ($293|0)!=(0);
  27704. if (!($294)) {
  27705. HEAP32[$1>>2] = 24;
  27706. break;
  27707. }
  27708. $295 = HEAP32[$3>>2]|0;
  27709. $296 = (_strcmp($295,13722)|0);
  27710. $297 = ($296|0)!=(0);
  27711. if (!($297)) {
  27712. HEAP32[$1>>2] = 26;
  27713. break;
  27714. }
  27715. $298 = HEAP32[$3>>2]|0;
  27716. $299 = (_strcmp($298,13740)|0);
  27717. $300 = ($299|0)!=(0);
  27718. if (!($300)) {
  27719. HEAP32[$1>>2] = 27;
  27720. break;
  27721. }
  27722. $301 = HEAP32[$3>>2]|0;
  27723. $302 = (_strcmp($301,13758)|0);
  27724. $303 = ($302|0)!=(0);
  27725. if (!($303)) {
  27726. HEAP32[$1>>2] = 28;
  27727. break;
  27728. }
  27729. $304 = HEAP32[$3>>2]|0;
  27730. $305 = (_strcmp($304,13779)|0);
  27731. $306 = ($305|0)!=(0);
  27732. if (!($306)) {
  27733. HEAP32[$1>>2] = 14;
  27734. break;
  27735. }
  27736. $307 = HEAP32[$3>>2]|0;
  27737. $308 = (_strcmp($307,13805)|0);
  27738. $309 = ($308|0)!=(0);
  27739. if (!($309)) {
  27740. HEAP32[$1>>2] = 3;
  27741. break;
  27742. }
  27743. $310 = HEAP32[$3>>2]|0;
  27744. $311 = (_strcmp($310,13828)|0);
  27745. $312 = ($311|0)!=(0);
  27746. if (!($312)) {
  27747. HEAP32[$1>>2] = 15;
  27748. break;
  27749. }
  27750. $313 = HEAP32[$3>>2]|0;
  27751. $314 = (_strcmp($313,13866)|0);
  27752. $315 = ($314|0)!=(0);
  27753. if (!($315)) {
  27754. HEAP32[$1>>2] = 10;
  27755. break;
  27756. }
  27757. $316 = HEAP32[$3>>2]|0;
  27758. $317 = (_strcmp($316,13882)|0);
  27759. $318 = ($317|0)!=(0);
  27760. if (!($318)) {
  27761. HEAP32[$1>>2] = 7;
  27762. break;
  27763. }
  27764. $319 = HEAP32[$3>>2]|0;
  27765. $320 = (_strcmp($319,13897)|0);
  27766. $321 = ($320|0)!=(0);
  27767. if (!($321)) {
  27768. HEAP32[$1>>2] = 25;
  27769. break;
  27770. }
  27771. $322 = HEAP32[$3>>2]|0;
  27772. $323 = (_strcmp($322,13920)|0);
  27773. $324 = ($323|0)!=(0);
  27774. if (!($324)) {
  27775. HEAP32[$1>>2] = 16;
  27776. break;
  27777. }
  27778. $325 = HEAP32[$3>>2]|0;
  27779. $326 = (_strcmp($325,13933)|0);
  27780. $327 = ($326|0)!=(0);
  27781. if (!($327)) {
  27782. HEAP32[$1>>2] = 29;
  27783. break;
  27784. }
  27785. $328 = HEAP32[$3>>2]|0;
  27786. $329 = (_strcmp($328,13947)|0);
  27787. $330 = ($329|0)!=(0);
  27788. if (!($330)) {
  27789. HEAP32[$1>>2] = 30;
  27790. break;
  27791. }
  27792. $331 = HEAP32[$3>>2]|0;
  27793. $332 = (_strcmp($331,13961)|0);
  27794. $333 = ($332|0)!=(0);
  27795. if (!($333)) {
  27796. HEAP32[$1>>2] = 1;
  27797. break;
  27798. }
  27799. $334 = HEAP32[$3>>2]|0;
  27800. $335 = (_strcmp($334,13981)|0);
  27801. $336 = ($335|0)!=(0);
  27802. if (!($336)) {
  27803. HEAP32[$1>>2] = 8;
  27804. break;
  27805. }
  27806. $337 = HEAP32[$3>>2]|0;
  27807. $338 = (_strcmp($337,14001)|0);
  27808. $339 = ($338|0)!=(0);
  27809. if (!($339)) {
  27810. HEAP32[$1>>2] = 17;
  27811. break;
  27812. }
  27813. $340 = HEAP32[$3>>2]|0;
  27814. $341 = (_strcmp($340,14017)|0);
  27815. $342 = ($341|0)!=(0);
  27816. if (!($342)) {
  27817. HEAP32[$1>>2] = 18;
  27818. break;
  27819. }
  27820. $343 = HEAP32[$3>>2]|0;
  27821. $344 = (_strcmp($343,14035)|0);
  27822. $345 = ($344|0)!=(0);
  27823. if (!($345)) {
  27824. HEAP32[$1>>2] = 26;
  27825. break;
  27826. }
  27827. $346 = HEAP32[$3>>2]|0;
  27828. $347 = (_strcmp($346,14051)|0);
  27829. $348 = ($347|0)!=(0);
  27830. if (!($348)) {
  27831. HEAP32[$1>>2] = 19;
  27832. break;
  27833. }
  27834. $349 = HEAP32[$3>>2]|0;
  27835. $350 = (_strcmp($349,14066)|0);
  27836. $351 = ($350|0)!=(0);
  27837. if (!($351)) {
  27838. HEAP32[$1>>2] = 9;
  27839. break;
  27840. }
  27841. $352 = HEAP32[$3>>2]|0;
  27842. $353 = (_strcmp($352,14088)|0);
  27843. $354 = ($353|0)!=(0);
  27844. if (!($354)) {
  27845. HEAP32[$1>>2] = 31;
  27846. break;
  27847. }
  27848. $355 = HEAP32[$3>>2]|0;
  27849. $356 = (_strcmp($355,14106)|0);
  27850. $357 = ($356|0)!=(0);
  27851. if (!($357)) {
  27852. HEAP32[$1>>2] = 32;
  27853. break;
  27854. }
  27855. $358 = HEAP32[$3>>2]|0;
  27856. $359 = (_strcmp($358,14127)|0);
  27857. $360 = ($359|0)!=(0);
  27858. if (!($360)) {
  27859. HEAP32[$1>>2] = 10;
  27860. break;
  27861. }
  27862. $361 = HEAP32[$3>>2]|0;
  27863. $362 = (_strcmp($361,14145)|0);
  27864. $363 = ($362|0)!=(0);
  27865. if (!($363)) {
  27866. HEAP32[$1>>2] = 11;
  27867. break;
  27868. }
  27869. $364 = HEAP32[$3>>2]|0;
  27870. $365 = (_strcmp($364,14158)|0);
  27871. $366 = ($365|0)!=(0);
  27872. if (!($366)) {
  27873. HEAP32[$1>>2] = 2;
  27874. break;
  27875. }
  27876. $367 = HEAP32[$3>>2]|0;
  27877. $368 = (_strcmp($367,14173)|0);
  27878. $369 = ($368|0)!=(0);
  27879. if (!($369)) {
  27880. HEAP32[$1>>2] = 12;
  27881. break;
  27882. }
  27883. $370 = HEAP32[$3>>2]|0;
  27884. $371 = (_strcmp($370,14187)|0);
  27885. $372 = ($371|0)!=(0);
  27886. if (!($372)) {
  27887. HEAP32[$1>>2] = 1;
  27888. break;
  27889. }
  27890. $373 = HEAP32[$3>>2]|0;
  27891. $374 = (_strcmp($373,14197)|0);
  27892. $375 = ($374|0)!=(0);
  27893. if (!($375)) {
  27894. HEAP32[$1>>2] = 1;
  27895. break;
  27896. }
  27897. $376 = HEAP32[$3>>2]|0;
  27898. $377 = (_strcmp($376,14207)|0);
  27899. $378 = ($377|0)!=(0);
  27900. if (!($378)) {
  27901. HEAP32[$1>>2] = 2;
  27902. break;
  27903. }
  27904. $379 = HEAP32[$3>>2]|0;
  27905. $380 = (_strcmp($379,14229)|0);
  27906. $381 = ($380|0)!=(0);
  27907. if (!($381)) {
  27908. HEAP32[$1>>2] = 13;
  27909. break;
  27910. }
  27911. $382 = HEAP32[$3>>2]|0;
  27912. $383 = (_strcmp($382,14255)|0);
  27913. $384 = ($383|0)!=(0);
  27914. if (!($384)) {
  27915. HEAP32[$1>>2] = 14;
  27916. break;
  27917. }
  27918. $385 = HEAP32[$3>>2]|0;
  27919. $386 = (_strcmp($385,14282)|0);
  27920. $387 = ($386|0)!=(0);
  27921. if (!($387)) {
  27922. HEAP32[$1>>2] = 27;
  27923. break;
  27924. }
  27925. $388 = HEAP32[$3>>2]|0;
  27926. $389 = (_strcmp($388,14295)|0);
  27927. $390 = ($389|0)!=(0);
  27928. if (!($390)) {
  27929. HEAP32[$1>>2] = 20;
  27930. break;
  27931. }
  27932. $391 = HEAP32[$3>>2]|0;
  27933. $392 = (_strcmp($391,14310)|0);
  27934. $393 = ($392|0)!=(0);
  27935. if (!($393)) {
  27936. HEAP32[$1>>2] = 4;
  27937. break;
  27938. }
  27939. $394 = HEAP32[$3>>2]|0;
  27940. $395 = (_strcmp($394,14325)|0);
  27941. $396 = ($395|0)!=(0);
  27942. if (!($396)) {
  27943. HEAP32[$1>>2] = 3;
  27944. break;
  27945. }
  27946. $397 = HEAP32[$3>>2]|0;
  27947. $398 = (_strcmp($397,14349)|0);
  27948. $399 = ($398|0)!=(0);
  27949. if (!($399)) {
  27950. HEAP32[$1>>2] = 2;
  27951. break;
  27952. }
  27953. $400 = HEAP32[$3>>2]|0;
  27954. $401 = (_strcmp($400,14360)|0);
  27955. $402 = ($401|0)!=(0);
  27956. if (!($402)) {
  27957. HEAP32[$1>>2] = 33;
  27958. break;
  27959. }
  27960. $403 = HEAP32[$3>>2]|0;
  27961. $404 = (_strcmp($403,14382)|0);
  27962. $405 = ($404|0)!=(0);
  27963. if (!($405)) {
  27964. HEAP32[$1>>2] = 21;
  27965. break;
  27966. }
  27967. $406 = HEAP32[$3>>2]|0;
  27968. $407 = (_strcmp($406,14404)|0);
  27969. $408 = ($407|0)!=(0);
  27970. if (!($408)) {
  27971. HEAP32[$1>>2] = 5;
  27972. break;
  27973. }
  27974. $409 = HEAP32[$3>>2]|0;
  27975. $410 = (_strcmp($409,14428)|0);
  27976. $411 = ($410|0)!=(0);
  27977. if (!($411)) {
  27978. HEAP32[$1>>2] = 4;
  27979. break;
  27980. }
  27981. $412 = HEAP32[$3>>2]|0;
  27982. $413 = (_strcmp($412,14437)|0);
  27983. $414 = ($413|0)!=(0);
  27984. if (!($414)) {
  27985. HEAP32[$1>>2] = 5;
  27986. break;
  27987. }
  27988. $415 = HEAP32[$3>>2]|0;
  27989. $416 = (_strcmp($415,14445)|0);
  27990. $417 = ($416|0)!=(0);
  27991. if (!($417)) {
  27992. HEAP32[$1>>2] = 1;
  27993. break;
  27994. }
  27995. $418 = HEAP32[$3>>2]|0;
  27996. $419 = (_strcmp($418,14458)|0);
  27997. $420 = ($419|0)!=(0);
  27998. if (!($420)) {
  27999. HEAP32[$1>>2] = 2;
  28000. break;
  28001. }
  28002. $421 = HEAP32[$3>>2]|0;
  28003. $422 = (_strcmp($421,14472)|0);
  28004. $423 = ($422|0)!=(0);
  28005. if (!($423)) {
  28006. HEAP32[$1>>2] = 15;
  28007. break;
  28008. }
  28009. $424 = HEAP32[$3>>2]|0;
  28010. $425 = (_strcmp($424,14484)|0);
  28011. $426 = ($425|0)!=(0);
  28012. if (!($426)) {
  28013. HEAP32[$1>>2] = 16;
  28014. break;
  28015. }
  28016. $427 = HEAP32[$3>>2]|0;
  28017. $428 = (_strcmp($427,14493)|0);
  28018. $429 = ($428|0)!=(0);
  28019. if (!($429)) {
  28020. HEAP32[$1>>2] = 17;
  28021. break;
  28022. }
  28023. $430 = HEAP32[$3>>2]|0;
  28024. $431 = (_strcmp($430,14503)|0);
  28025. $432 = ($431|0)!=(0);
  28026. if (!($432)) {
  28027. HEAP32[$1>>2] = 18;
  28028. break;
  28029. }
  28030. $433 = HEAP32[$3>>2]|0;
  28031. $434 = (_strcmp($433,14515)|0);
  28032. $435 = ($434|0)!=(0);
  28033. if (!($435)) {
  28034. HEAP32[$1>>2] = 19;
  28035. break;
  28036. }
  28037. $436 = HEAP32[$3>>2]|0;
  28038. $437 = (_strcmp($436,14526)|0);
  28039. $438 = ($437|0)!=(0);
  28040. if (!($438)) {
  28041. HEAP32[$1>>2] = 20;
  28042. break;
  28043. }
  28044. $439 = HEAP32[$3>>2]|0;
  28045. $440 = (_strcmp($439,14534)|0);
  28046. $441 = ($440|0)!=(0);
  28047. if (!($441)) {
  28048. HEAP32[$1>>2] = 3;
  28049. break;
  28050. }
  28051. $442 = HEAP32[$3>>2]|0;
  28052. $443 = (_strcmp($442,14546)|0);
  28053. $444 = ($443|0)!=(0);
  28054. if (!($444)) {
  28055. HEAP32[$1>>2] = 21;
  28056. break;
  28057. }
  28058. $445 = HEAP32[$3>>2]|0;
  28059. $446 = (_strcmp($445,14561)|0);
  28060. $447 = ($446|0)!=(0);
  28061. if (!($447)) {
  28062. HEAP32[$1>>2] = 22;
  28063. break;
  28064. }
  28065. $448 = HEAP32[$3>>2]|0;
  28066. $449 = (_strcmp($448,14573)|0);
  28067. $450 = ($449|0)!=(0);
  28068. if (!($450)) {
  28069. HEAP32[$1>>2] = 23;
  28070. break;
  28071. }
  28072. $451 = HEAP32[$3>>2]|0;
  28073. $452 = (_strcmp($451,14587)|0);
  28074. $453 = ($452|0)!=(0);
  28075. if (!($453)) {
  28076. HEAP32[$1>>2] = 11;
  28077. break;
  28078. }
  28079. $454 = HEAP32[$3>>2]|0;
  28080. $455 = (_strcmp($454,14612)|0);
  28081. $456 = ($455|0)!=(0);
  28082. if (!($456)) {
  28083. HEAP32[$1>>2] = 24;
  28084. break;
  28085. }
  28086. $457 = HEAP32[$3>>2]|0;
  28087. $458 = (_strcmp($457,14629)|0);
  28088. $459 = ($458|0)!=(0);
  28089. if (!($459)) {
  28090. HEAP32[$1>>2] = 25;
  28091. break;
  28092. }
  28093. $460 = HEAP32[$3>>2]|0;
  28094. $461 = (_strcmp($460,14645)|0);
  28095. $462 = ($461|0)!=(0);
  28096. if (!($462)) {
  28097. HEAP32[$1>>2] = 26;
  28098. break;
  28099. }
  28100. $463 = HEAP32[$3>>2]|0;
  28101. $464 = (_strcmp($463,14661)|0);
  28102. $465 = ($464|0)!=(0);
  28103. if (!($465)) {
  28104. HEAP32[$1>>2] = 12;
  28105. break;
  28106. }
  28107. $466 = HEAP32[$3>>2]|0;
  28108. $467 = (_strcmp($466,14673)|0);
  28109. $468 = ($467|0)!=(0);
  28110. if (!($468)) {
  28111. HEAP32[$1>>2] = 34;
  28112. break;
  28113. }
  28114. $469 = HEAP32[$3>>2]|0;
  28115. $470 = (_strcmp($469,14685)|0);
  28116. $471 = ($470|0)!=(0);
  28117. if (!($471)) {
  28118. HEAP32[$1>>2] = 35;
  28119. break;
  28120. }
  28121. $472 = HEAP32[$3>>2]|0;
  28122. $473 = (_strcmp($472,14709)|0);
  28123. $474 = ($473|0)!=(0);
  28124. if (!($474)) {
  28125. HEAP32[$1>>2] = 1;
  28126. break;
  28127. }
  28128. $475 = HEAP32[$3>>2]|0;
  28129. $476 = (_strcmp($475,14722)|0);
  28130. $477 = ($476|0)!=(0);
  28131. if (!($477)) {
  28132. HEAP32[$1>>2] = 2;
  28133. break;
  28134. }
  28135. $478 = HEAP32[$3>>2]|0;
  28136. $479 = (_strcmp($478,14736)|0);
  28137. $480 = ($479|0)!=(0);
  28138. if (!($480)) {
  28139. HEAP32[$1>>2] = 36;
  28140. break;
  28141. }
  28142. $481 = HEAP32[$3>>2]|0;
  28143. $482 = (_strcmp($481,14758)|0);
  28144. $483 = ($482|0)!=(0);
  28145. if (!($483)) {
  28146. HEAP32[$1>>2] = 37;
  28147. break;
  28148. }
  28149. $484 = HEAP32[$3>>2]|0;
  28150. $485 = (_strcmp($484,14765)|0);
  28151. $486 = ($485|0)!=(0);
  28152. if (!($486)) {
  28153. HEAP32[$1>>2] = 3;
  28154. break;
  28155. }
  28156. $487 = HEAP32[$3>>2]|0;
  28157. $488 = (_strcmp($487,14781)|0);
  28158. $489 = ($488|0)!=(0);
  28159. if (!($489)) {
  28160. HEAP32[$1>>2] = 2;
  28161. break;
  28162. }
  28163. $490 = HEAP32[$3>>2]|0;
  28164. $491 = (_strcmp($490,14798)|0);
  28165. $492 = ($491|0)!=(0);
  28166. if (!($492)) {
  28167. HEAP32[$1>>2] = 1;
  28168. break;
  28169. }
  28170. $493 = HEAP32[$3>>2]|0;
  28171. $494 = (_strcmp($493,14815)|0);
  28172. $495 = ($494|0)!=(0);
  28173. if (!($495)) {
  28174. HEAP32[$1>>2] = 28;
  28175. break;
  28176. }
  28177. $496 = HEAP32[$3>>2]|0;
  28178. $497 = (_strcmp($496,14831)|0);
  28179. $498 = ($497|0)!=(0);
  28180. if (!($498)) {
  28181. HEAP32[$1>>2] = 1;
  28182. break;
  28183. }
  28184. $499 = HEAP32[$3>>2]|0;
  28185. $500 = (_strcmp($499,14847)|0);
  28186. $501 = ($500|0)!=(0);
  28187. if (!($501)) {
  28188. HEAP32[$1>>2] = 4;
  28189. break;
  28190. }
  28191. $502 = HEAP32[$3>>2]|0;
  28192. $503 = (_strcmp($502,14864)|0);
  28193. $504 = ($503|0)!=(0);
  28194. if (!($504)) {
  28195. HEAP32[$1>>2] = 29;
  28196. break;
  28197. }
  28198. $505 = HEAP32[$3>>2]|0;
  28199. $506 = (_strcmp($505,14878)|0);
  28200. $507 = ($506|0)!=(0);
  28201. if (!($507)) {
  28202. HEAP32[$1>>2] = 30;
  28203. break;
  28204. }
  28205. $508 = HEAP32[$3>>2]|0;
  28206. $509 = (_strcmp($508,14890)|0);
  28207. $510 = ($509|0)!=(0);
  28208. if (!($510)) {
  28209. HEAP32[$1>>2] = 22;
  28210. break;
  28211. }
  28212. $511 = HEAP32[$3>>2]|0;
  28213. $512 = (_strcmp($511,14901)|0);
  28214. $513 = ($512|0)!=(0);
  28215. if (!($513)) {
  28216. HEAP32[$1>>2] = 2;
  28217. break;
  28218. }
  28219. $514 = HEAP32[$3>>2]|0;
  28220. $515 = (_strcmp($514,14914)|0);
  28221. $516 = ($515|0)!=(0);
  28222. if (!($516)) {
  28223. HEAP32[$1>>2] = 23;
  28224. break;
  28225. }
  28226. $517 = HEAP32[$3>>2]|0;
  28227. $518 = (_strcmp($517,14924)|0);
  28228. $519 = ($518|0)!=(0);
  28229. if (!($519)) {
  28230. HEAP32[$1>>2] = 2;
  28231. break;
  28232. }
  28233. $520 = HEAP32[$3>>2]|0;
  28234. $521 = (_strcmp($520,14941)|0);
  28235. $522 = ($521|0)!=(0);
  28236. if (!($522)) {
  28237. HEAP32[$1>>2] = 24;
  28238. break;
  28239. }
  28240. $523 = HEAP32[$3>>2]|0;
  28241. $524 = (_strcmp($523,14953)|0);
  28242. $525 = ($524|0)!=(0);
  28243. if (!($525)) {
  28244. HEAP32[$1>>2] = 25;
  28245. break;
  28246. }
  28247. $526 = HEAP32[$3>>2]|0;
  28248. $527 = (_strcmp($526,14975)|0);
  28249. $528 = ($527|0)!=(0);
  28250. if (!($528)) {
  28251. HEAP32[$1>>2] = 26;
  28252. break;
  28253. }
  28254. $529 = HEAP32[$3>>2]|0;
  28255. $530 = (_strcmp($529,14995)|0);
  28256. $531 = ($530|0)!=(0);
  28257. if (!($531)) {
  28258. HEAP32[$1>>2] = 3;
  28259. break;
  28260. }
  28261. $532 = HEAP32[$3>>2]|0;
  28262. $533 = (_strcmp($532,15008)|0);
  28263. $534 = ($533|0)!=(0);
  28264. if (!($534)) {
  28265. HEAP32[$1>>2] = 27;
  28266. break;
  28267. }
  28268. $535 = HEAP32[$3>>2]|0;
  28269. $536 = (_strcmp($535,15030)|0);
  28270. $537 = ($536|0)!=(0);
  28271. if (!($537)) {
  28272. HEAP32[$1>>2] = 28;
  28273. break;
  28274. }
  28275. $538 = HEAP32[$3>>2]|0;
  28276. $539 = (_strcmp($538,15050)|0);
  28277. $540 = ($539|0)!=(0);
  28278. if (!($540)) {
  28279. HEAP32[$1>>2] = 2;
  28280. break;
  28281. }
  28282. $541 = HEAP32[$3>>2]|0;
  28283. $542 = (_strcmp($541,15067)|0);
  28284. $543 = ($542|0)!=(0);
  28285. if (!($543)) {
  28286. HEAP32[$1>>2] = 2;
  28287. break;
  28288. }
  28289. $544 = HEAP32[$3>>2]|0;
  28290. $545 = (_strcmp($544,15084)|0);
  28291. $546 = ($545|0)!=(0);
  28292. if (!($546)) {
  28293. HEAP32[$1>>2] = 3;
  28294. break;
  28295. }
  28296. $547 = HEAP32[$3>>2]|0;
  28297. $548 = (_strcmp($547,15104)|0);
  28298. $549 = ($548|0)!=(0);
  28299. if ($549) {
  28300. $550 = HEAP32[$2>>2]|0;
  28301. $551 = HEAP32[$3>>2]|0;
  28302. $552 = _emscripten_asm_const_iii(0, ($550|0), ($551|0))|0;
  28303. HEAP32[$1>>2] = 0;
  28304. break;
  28305. } else {
  28306. HEAP32[$1>>2] = 38;
  28307. break;
  28308. }
  28309. } else {
  28310. HEAP32[$1>>2] = 6;
  28311. }
  28312. } while(0);
  28313. $553 = HEAP32[$1>>2]|0;
  28314. STACKTOP = sp;return ($553|0);
  28315. }
  28316. function _emscripten_get_global_libc() {
  28317. var label = 0, sp = 0;
  28318. sp = STACKTOP;
  28319. return (20788|0);
  28320. }
  28321. function ___stdio_close($0) {
  28322. $0 = $0|0;
  28323. var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $vararg_buffer = 0, label = 0, sp = 0;
  28324. sp = STACKTOP;
  28325. STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
  28326. $vararg_buffer = sp;
  28327. $1 = ((($0)) + 60|0);
  28328. $2 = HEAP32[$1>>2]|0;
  28329. $3 = (_dummy_738($2)|0);
  28330. HEAP32[$vararg_buffer>>2] = $3;
  28331. $4 = (___syscall6(6,($vararg_buffer|0))|0);
  28332. $5 = (___syscall_ret($4)|0);
  28333. STACKTOP = sp;return ($5|0);
  28334. }
  28335. function ___stdio_write($0,$1,$2) {
  28336. $0 = $0|0;
  28337. $1 = $1|0;
  28338. $2 = $2|0;
  28339. var $$0 = 0, $$04756 = 0, $$04855 = 0, $$04954 = 0, $$051 = 0, $$1 = 0, $$150 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0;
  28340. var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0;
  28341. var $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_buffer3 = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, $vararg_ptr6 = 0;
  28342. var $vararg_ptr7 = 0, label = 0, sp = 0;
  28343. sp = STACKTOP;
  28344. STACKTOP = STACKTOP + 48|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(48|0);
  28345. $vararg_buffer3 = sp + 16|0;
  28346. $vararg_buffer = sp;
  28347. $3 = sp + 32|0;
  28348. $4 = ((($0)) + 28|0);
  28349. $5 = HEAP32[$4>>2]|0;
  28350. HEAP32[$3>>2] = $5;
  28351. $6 = ((($3)) + 4|0);
  28352. $7 = ((($0)) + 20|0);
  28353. $8 = HEAP32[$7>>2]|0;
  28354. $9 = (($8) - ($5))|0;
  28355. HEAP32[$6>>2] = $9;
  28356. $10 = ((($3)) + 8|0);
  28357. HEAP32[$10>>2] = $1;
  28358. $11 = ((($3)) + 12|0);
  28359. HEAP32[$11>>2] = $2;
  28360. $12 = (($9) + ($2))|0;
  28361. $13 = ((($0)) + 60|0);
  28362. $14 = HEAP32[$13>>2]|0;
  28363. $15 = $3;
  28364. HEAP32[$vararg_buffer>>2] = $14;
  28365. $vararg_ptr1 = ((($vararg_buffer)) + 4|0);
  28366. HEAP32[$vararg_ptr1>>2] = $15;
  28367. $vararg_ptr2 = ((($vararg_buffer)) + 8|0);
  28368. HEAP32[$vararg_ptr2>>2] = 2;
  28369. $16 = (___syscall146(146,($vararg_buffer|0))|0);
  28370. $17 = (___syscall_ret($16)|0);
  28371. $18 = ($12|0)==($17|0);
  28372. L1: do {
  28373. if ($18) {
  28374. label = 3;
  28375. } else {
  28376. $$04756 = 2;$$04855 = $12;$$04954 = $3;$26 = $17;
  28377. while(1) {
  28378. $25 = ($26|0)<(0);
  28379. if ($25) {
  28380. break;
  28381. }
  28382. $34 = (($$04855) - ($26))|0;
  28383. $35 = ((($$04954)) + 4|0);
  28384. $36 = HEAP32[$35>>2]|0;
  28385. $37 = ($26>>>0)>($36>>>0);
  28386. $38 = ((($$04954)) + 8|0);
  28387. $$150 = $37 ? $38 : $$04954;
  28388. $39 = $37 << 31 >> 31;
  28389. $$1 = (($39) + ($$04756))|0;
  28390. $40 = $37 ? $36 : 0;
  28391. $$0 = (($26) - ($40))|0;
  28392. $41 = HEAP32[$$150>>2]|0;
  28393. $42 = (($41) + ($$0)|0);
  28394. HEAP32[$$150>>2] = $42;
  28395. $43 = ((($$150)) + 4|0);
  28396. $44 = HEAP32[$43>>2]|0;
  28397. $45 = (($44) - ($$0))|0;
  28398. HEAP32[$43>>2] = $45;
  28399. $46 = HEAP32[$13>>2]|0;
  28400. $47 = $$150;
  28401. HEAP32[$vararg_buffer3>>2] = $46;
  28402. $vararg_ptr6 = ((($vararg_buffer3)) + 4|0);
  28403. HEAP32[$vararg_ptr6>>2] = $47;
  28404. $vararg_ptr7 = ((($vararg_buffer3)) + 8|0);
  28405. HEAP32[$vararg_ptr7>>2] = $$1;
  28406. $48 = (___syscall146(146,($vararg_buffer3|0))|0);
  28407. $49 = (___syscall_ret($48)|0);
  28408. $50 = ($34|0)==($49|0);
  28409. if ($50) {
  28410. label = 3;
  28411. break L1;
  28412. } else {
  28413. $$04756 = $$1;$$04855 = $34;$$04954 = $$150;$26 = $49;
  28414. }
  28415. }
  28416. $27 = ((($0)) + 16|0);
  28417. HEAP32[$27>>2] = 0;
  28418. HEAP32[$4>>2] = 0;
  28419. HEAP32[$7>>2] = 0;
  28420. $28 = HEAP32[$0>>2]|0;
  28421. $29 = $28 | 32;
  28422. HEAP32[$0>>2] = $29;
  28423. $30 = ($$04756|0)==(2);
  28424. if ($30) {
  28425. $$051 = 0;
  28426. } else {
  28427. $31 = ((($$04954)) + 4|0);
  28428. $32 = HEAP32[$31>>2]|0;
  28429. $33 = (($2) - ($32))|0;
  28430. $$051 = $33;
  28431. }
  28432. }
  28433. } while(0);
  28434. if ((label|0) == 3) {
  28435. $19 = ((($0)) + 44|0);
  28436. $20 = HEAP32[$19>>2]|0;
  28437. $21 = ((($0)) + 48|0);
  28438. $22 = HEAP32[$21>>2]|0;
  28439. $23 = (($20) + ($22)|0);
  28440. $24 = ((($0)) + 16|0);
  28441. HEAP32[$24>>2] = $23;
  28442. HEAP32[$4>>2] = $20;
  28443. HEAP32[$7>>2] = $20;
  28444. $$051 = $2;
  28445. }
  28446. STACKTOP = sp;return ($$051|0);
  28447. }
  28448. function ___stdio_seek($0,$1,$2) {
  28449. $0 = $0|0;
  28450. $1 = $1|0;
  28451. $2 = $2|0;
  28452. var $$pre = 0, $10 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, $vararg_ptr3 = 0, $vararg_ptr4 = 0, label = 0, sp = 0;
  28453. sp = STACKTOP;
  28454. STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
  28455. $vararg_buffer = sp;
  28456. $3 = sp + 20|0;
  28457. $4 = ((($0)) + 60|0);
  28458. $5 = HEAP32[$4>>2]|0;
  28459. $6 = $3;
  28460. HEAP32[$vararg_buffer>>2] = $5;
  28461. $vararg_ptr1 = ((($vararg_buffer)) + 4|0);
  28462. HEAP32[$vararg_ptr1>>2] = 0;
  28463. $vararg_ptr2 = ((($vararg_buffer)) + 8|0);
  28464. HEAP32[$vararg_ptr2>>2] = $1;
  28465. $vararg_ptr3 = ((($vararg_buffer)) + 12|0);
  28466. HEAP32[$vararg_ptr3>>2] = $6;
  28467. $vararg_ptr4 = ((($vararg_buffer)) + 16|0);
  28468. HEAP32[$vararg_ptr4>>2] = $2;
  28469. $7 = (___syscall140(140,($vararg_buffer|0))|0);
  28470. $8 = (___syscall_ret($7)|0);
  28471. $9 = ($8|0)<(0);
  28472. if ($9) {
  28473. HEAP32[$3>>2] = -1;
  28474. $10 = -1;
  28475. } else {
  28476. $$pre = HEAP32[$3>>2]|0;
  28477. $10 = $$pre;
  28478. }
  28479. STACKTOP = sp;return ($10|0);
  28480. }
  28481. function ___syscall_ret($0) {
  28482. $0 = $0|0;
  28483. var $$0 = 0, $1 = 0, $2 = 0, $3 = 0, label = 0, sp = 0;
  28484. sp = STACKTOP;
  28485. $1 = ($0>>>0)>(4294963200);
  28486. if ($1) {
  28487. $2 = (0 - ($0))|0;
  28488. $3 = (___errno_location()|0);
  28489. HEAP32[$3>>2] = $2;
  28490. $$0 = -1;
  28491. } else {
  28492. $$0 = $0;
  28493. }
  28494. return ($$0|0);
  28495. }
  28496. function ___errno_location() {
  28497. var $0 = 0, $1 = 0, label = 0, sp = 0;
  28498. sp = STACKTOP;
  28499. $0 = (___pthread_self_108()|0);
  28500. $1 = ((($0)) + 64|0);
  28501. return ($1|0);
  28502. }
  28503. function ___pthread_self_108() {
  28504. var $0 = 0, label = 0, sp = 0;
  28505. sp = STACKTOP;
  28506. $0 = (_pthread_self()|0);
  28507. return ($0|0);
  28508. }
  28509. function _pthread_self() {
  28510. var label = 0, sp = 0;
  28511. sp = STACKTOP;
  28512. return (3868|0);
  28513. }
  28514. function _dummy_738($0) {
  28515. $0 = $0|0;
  28516. var label = 0, sp = 0;
  28517. sp = STACKTOP;
  28518. return ($0|0);
  28519. }
  28520. function ___stdio_read($0,$1,$2) {
  28521. $0 = $0|0;
  28522. $1 = $1|0;
  28523. $2 = $2|0;
  28524. var $$0 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0;
  28525. var $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, label = 0, sp = 0;
  28526. sp = STACKTOP;
  28527. STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
  28528. $vararg_buffer = sp;
  28529. $3 = sp + 16|0;
  28530. HEAP32[$3>>2] = $1;
  28531. $4 = ((($3)) + 4|0);
  28532. $5 = ((($0)) + 48|0);
  28533. $6 = HEAP32[$5>>2]|0;
  28534. $7 = ($6|0)!=(0);
  28535. $8 = $7&1;
  28536. $9 = (($2) - ($8))|0;
  28537. HEAP32[$4>>2] = $9;
  28538. $10 = ((($3)) + 8|0);
  28539. $11 = ((($0)) + 44|0);
  28540. $12 = HEAP32[$11>>2]|0;
  28541. HEAP32[$10>>2] = $12;
  28542. $13 = ((($3)) + 12|0);
  28543. HEAP32[$13>>2] = $6;
  28544. $14 = ((($0)) + 60|0);
  28545. $15 = HEAP32[$14>>2]|0;
  28546. $16 = $3;
  28547. HEAP32[$vararg_buffer>>2] = $15;
  28548. $vararg_ptr1 = ((($vararg_buffer)) + 4|0);
  28549. HEAP32[$vararg_ptr1>>2] = $16;
  28550. $vararg_ptr2 = ((($vararg_buffer)) + 8|0);
  28551. HEAP32[$vararg_ptr2>>2] = 2;
  28552. $17 = (___syscall145(145,($vararg_buffer|0))|0);
  28553. $18 = (___syscall_ret($17)|0);
  28554. $19 = ($18|0)<(1);
  28555. if ($19) {
  28556. $20 = $18 & 48;
  28557. $21 = $20 ^ 16;
  28558. $22 = HEAP32[$0>>2]|0;
  28559. $23 = $22 | $21;
  28560. HEAP32[$0>>2] = $23;
  28561. $$0 = $18;
  28562. } else {
  28563. $24 = HEAP32[$4>>2]|0;
  28564. $25 = ($18>>>0)>($24>>>0);
  28565. if ($25) {
  28566. $26 = (($18) - ($24))|0;
  28567. $27 = HEAP32[$11>>2]|0;
  28568. $28 = ((($0)) + 4|0);
  28569. HEAP32[$28>>2] = $27;
  28570. $29 = (($27) + ($26)|0);
  28571. $30 = ((($0)) + 8|0);
  28572. HEAP32[$30>>2] = $29;
  28573. $31 = HEAP32[$5>>2]|0;
  28574. $32 = ($31|0)==(0);
  28575. if ($32) {
  28576. $$0 = $2;
  28577. } else {
  28578. $33 = ((($27)) + 1|0);
  28579. HEAP32[$28>>2] = $33;
  28580. $34 = HEAP8[$27>>0]|0;
  28581. $35 = (($2) + -1)|0;
  28582. $36 = (($1) + ($35)|0);
  28583. HEAP8[$36>>0] = $34;
  28584. $$0 = $2;
  28585. }
  28586. } else {
  28587. $$0 = $18;
  28588. }
  28589. }
  28590. STACKTOP = sp;return ($$0|0);
  28591. }
  28592. function ___stdout_write($0,$1,$2) {
  28593. $0 = $0|0;
  28594. $1 = $1|0;
  28595. $2 = $2|0;
  28596. var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, label = 0, sp = 0;
  28597. sp = STACKTOP;
  28598. STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
  28599. $vararg_buffer = sp;
  28600. $3 = sp + 16|0;
  28601. $4 = ((($0)) + 36|0);
  28602. HEAP32[$4>>2] = 10;
  28603. $5 = HEAP32[$0>>2]|0;
  28604. $6 = $5 & 64;
  28605. $7 = ($6|0)==(0);
  28606. if ($7) {
  28607. $8 = ((($0)) + 60|0);
  28608. $9 = HEAP32[$8>>2]|0;
  28609. $10 = $3;
  28610. HEAP32[$vararg_buffer>>2] = $9;
  28611. $vararg_ptr1 = ((($vararg_buffer)) + 4|0);
  28612. HEAP32[$vararg_ptr1>>2] = 21523;
  28613. $vararg_ptr2 = ((($vararg_buffer)) + 8|0);
  28614. HEAP32[$vararg_ptr2>>2] = $10;
  28615. $11 = (___syscall54(54,($vararg_buffer|0))|0);
  28616. $12 = ($11|0)==(0);
  28617. if (!($12)) {
  28618. $13 = ((($0)) + 75|0);
  28619. HEAP8[$13>>0] = -1;
  28620. }
  28621. }
  28622. $14 = (___stdio_write($0,$1,$2)|0);
  28623. STACKTOP = sp;return ($14|0);
  28624. }
  28625. function ___shlim($0,$1) {
  28626. $0 = $0|0;
  28627. $1 = $1|0;
  28628. var $$sink = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, label = 0, sp = 0;
  28629. sp = STACKTOP;
  28630. $2 = ((($0)) + 104|0);
  28631. HEAP32[$2>>2] = $1;
  28632. $3 = ((($0)) + 8|0);
  28633. $4 = HEAP32[$3>>2]|0;
  28634. $5 = ((($0)) + 4|0);
  28635. $6 = HEAP32[$5>>2]|0;
  28636. $7 = $4;
  28637. $8 = $6;
  28638. $9 = (($7) - ($8))|0;
  28639. $10 = ((($0)) + 108|0);
  28640. HEAP32[$10>>2] = $9;
  28641. $11 = ($1|0)!=(0);
  28642. $12 = ($9|0)>($1|0);
  28643. $or$cond = $11 & $12;
  28644. $13 = (($6) + ($1)|0);
  28645. $$sink = $or$cond ? $13 : $4;
  28646. $14 = ((($0)) + 100|0);
  28647. HEAP32[$14>>2] = $$sink;
  28648. return;
  28649. }
  28650. function ___intscan($0,$1,$2,$3,$4) {
  28651. $0 = $0|0;
  28652. $1 = $1|0;
  28653. $2 = $2|0;
  28654. $3 = $3|0;
  28655. $4 = $4|0;
  28656. var $$0154222 = 0, $$0157 = 0, $$0157$ = 0, $$0159 = 0, $$1155192 = 0, $$1158 = 0, $$1160 = 0, $$1160169 = 0, $$1165 = 0, $$1165167 = 0, $$1165168 = 0, $$166 = 0, $$2156210 = 0, $$2161$be = 0, $$2161$lcssa = 0, $$3162$be = 0, $$3162215 = 0, $$4163$be = 0, $$4163$lcssa = 0, $$5$be = 0;
  28657. var $$6$be = 0, $$6$lcssa = 0, $$7$be = 0, $$7198 = 0, $$8 = 0, $$9$be = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0;
  28658. var $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0;
  28659. var $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0;
  28660. var $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0;
  28661. var $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0;
  28662. var $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0;
  28663. var $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0;
  28664. var $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0;
  28665. var $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0;
  28666. var $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0;
  28667. var $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0;
  28668. var $294 = 0, $295 = 0, $296 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0;
  28669. var $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0;
  28670. var $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0;
  28671. var $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $or$cond = 0, $or$cond12 = 0;
  28672. var $or$cond187 = 0, $or$cond5 = 0, $or$cond7 = 0, label = 0, sp = 0;
  28673. sp = STACKTOP;
  28674. $5 = ($1>>>0)>(36);
  28675. L1: do {
  28676. if ($5) {
  28677. $8 = (___errno_location()|0);
  28678. HEAP32[$8>>2] = 22;
  28679. $289 = 0;$290 = 0;
  28680. } else {
  28681. $6 = ((($0)) + 4|0);
  28682. $7 = ((($0)) + 100|0);
  28683. while(1) {
  28684. $9 = HEAP32[$6>>2]|0;
  28685. $10 = HEAP32[$7>>2]|0;
  28686. $11 = ($9>>>0)<($10>>>0);
  28687. if ($11) {
  28688. $12 = ((($9)) + 1|0);
  28689. HEAP32[$6>>2] = $12;
  28690. $13 = HEAP8[$9>>0]|0;
  28691. $14 = $13&255;
  28692. $16 = $14;
  28693. } else {
  28694. $15 = (___shgetc($0)|0);
  28695. $16 = $15;
  28696. }
  28697. $17 = (_isspace($16)|0);
  28698. $18 = ($17|0)==(0);
  28699. if ($18) {
  28700. break;
  28701. }
  28702. }
  28703. L11: do {
  28704. switch ($16|0) {
  28705. case 43: case 45: {
  28706. $19 = ($16|0)==(45);
  28707. $20 = $19 << 31 >> 31;
  28708. $21 = HEAP32[$6>>2]|0;
  28709. $22 = HEAP32[$7>>2]|0;
  28710. $23 = ($21>>>0)<($22>>>0);
  28711. if ($23) {
  28712. $24 = ((($21)) + 1|0);
  28713. HEAP32[$6>>2] = $24;
  28714. $25 = HEAP8[$21>>0]|0;
  28715. $26 = $25&255;
  28716. $$0157 = $20;$$0159 = $26;
  28717. break L11;
  28718. } else {
  28719. $27 = (___shgetc($0)|0);
  28720. $$0157 = $20;$$0159 = $27;
  28721. break L11;
  28722. }
  28723. break;
  28724. }
  28725. default: {
  28726. $$0157 = 0;$$0159 = $16;
  28727. }
  28728. }
  28729. } while(0);
  28730. $28 = ($1|0)==(0);
  28731. $29 = $1 | 16;
  28732. $30 = ($29|0)==(16);
  28733. $31 = ($$0159|0)==(48);
  28734. $or$cond5 = $30 & $31;
  28735. do {
  28736. if ($or$cond5) {
  28737. $32 = HEAP32[$6>>2]|0;
  28738. $33 = HEAP32[$7>>2]|0;
  28739. $34 = ($32>>>0)<($33>>>0);
  28740. if ($34) {
  28741. $35 = ((($32)) + 1|0);
  28742. HEAP32[$6>>2] = $35;
  28743. $36 = HEAP8[$32>>0]|0;
  28744. $37 = $36&255;
  28745. $40 = $37;
  28746. } else {
  28747. $38 = (___shgetc($0)|0);
  28748. $40 = $38;
  28749. }
  28750. $39 = $40 | 32;
  28751. $41 = ($39|0)==(120);
  28752. if (!($41)) {
  28753. if ($28) {
  28754. $$1160169 = $40;$$1165168 = 8;
  28755. label = 46;
  28756. break;
  28757. } else {
  28758. $$1160 = $40;$$1165 = $1;
  28759. label = 32;
  28760. break;
  28761. }
  28762. }
  28763. $42 = HEAP32[$6>>2]|0;
  28764. $43 = HEAP32[$7>>2]|0;
  28765. $44 = ($42>>>0)<($43>>>0);
  28766. if ($44) {
  28767. $45 = ((($42)) + 1|0);
  28768. HEAP32[$6>>2] = $45;
  28769. $46 = HEAP8[$42>>0]|0;
  28770. $47 = $46&255;
  28771. $50 = $47;
  28772. } else {
  28773. $48 = (___shgetc($0)|0);
  28774. $50 = $48;
  28775. }
  28776. $49 = ((15221) + ($50)|0);
  28777. $51 = HEAP8[$49>>0]|0;
  28778. $52 = ($51&255)>(15);
  28779. if ($52) {
  28780. $53 = HEAP32[$7>>2]|0;
  28781. $54 = ($53|0)!=(0|0);
  28782. if ($54) {
  28783. $55 = HEAP32[$6>>2]|0;
  28784. $56 = ((($55)) + -1|0);
  28785. HEAP32[$6>>2] = $56;
  28786. }
  28787. $57 = ($2|0)==(0);
  28788. if ($57) {
  28789. ___shlim($0,0);
  28790. $289 = 0;$290 = 0;
  28791. break L1;
  28792. }
  28793. if (!($54)) {
  28794. $289 = 0;$290 = 0;
  28795. break L1;
  28796. }
  28797. $58 = HEAP32[$6>>2]|0;
  28798. $59 = ((($58)) + -1|0);
  28799. HEAP32[$6>>2] = $59;
  28800. $289 = 0;$290 = 0;
  28801. break L1;
  28802. } else {
  28803. $$1160169 = $50;$$1165168 = 16;
  28804. label = 46;
  28805. }
  28806. } else {
  28807. $$166 = $28 ? 10 : $1;
  28808. $60 = ((15221) + ($$0159)|0);
  28809. $61 = HEAP8[$60>>0]|0;
  28810. $62 = $61&255;
  28811. $63 = ($62>>>0)<($$166>>>0);
  28812. if ($63) {
  28813. $$1160 = $$0159;$$1165 = $$166;
  28814. label = 32;
  28815. } else {
  28816. $64 = HEAP32[$7>>2]|0;
  28817. $65 = ($64|0)==(0|0);
  28818. if (!($65)) {
  28819. $66 = HEAP32[$6>>2]|0;
  28820. $67 = ((($66)) + -1|0);
  28821. HEAP32[$6>>2] = $67;
  28822. }
  28823. ___shlim($0,0);
  28824. $68 = (___errno_location()|0);
  28825. HEAP32[$68>>2] = 22;
  28826. $289 = 0;$290 = 0;
  28827. break L1;
  28828. }
  28829. }
  28830. } while(0);
  28831. L43: do {
  28832. if ((label|0) == 32) {
  28833. $69 = ($$1165|0)==(10);
  28834. if ($69) {
  28835. $70 = (($$1160) + -48)|0;
  28836. $71 = ($70>>>0)<(10);
  28837. if ($71) {
  28838. $$0154222 = 0;$74 = $70;
  28839. while(1) {
  28840. $72 = ($$0154222*10)|0;
  28841. $73 = (($72) + ($74))|0;
  28842. $75 = HEAP32[$6>>2]|0;
  28843. $76 = HEAP32[$7>>2]|0;
  28844. $77 = ($75>>>0)<($76>>>0);
  28845. if ($77) {
  28846. $78 = ((($75)) + 1|0);
  28847. HEAP32[$6>>2] = $78;
  28848. $79 = HEAP8[$75>>0]|0;
  28849. $80 = $79&255;
  28850. $$2161$be = $80;
  28851. } else {
  28852. $81 = (___shgetc($0)|0);
  28853. $$2161$be = $81;
  28854. }
  28855. $82 = (($$2161$be) + -48)|0;
  28856. $83 = ($82>>>0)<(10);
  28857. $84 = ($73>>>0)<(429496729);
  28858. $85 = $83 & $84;
  28859. if ($85) {
  28860. $$0154222 = $73;$74 = $82;
  28861. } else {
  28862. break;
  28863. }
  28864. }
  28865. $$2161$lcssa = $$2161$be;$291 = $73;$292 = 0;
  28866. } else {
  28867. $$2161$lcssa = $$1160;$291 = 0;$292 = 0;
  28868. }
  28869. $86 = (($$2161$lcssa) + -48)|0;
  28870. $87 = ($86>>>0)<(10);
  28871. if ($87) {
  28872. $$3162215 = $$2161$lcssa;$88 = $291;$89 = $292;$93 = $86;
  28873. while(1) {
  28874. $90 = (___muldi3(($88|0),($89|0),10,0)|0);
  28875. $91 = tempRet0;
  28876. $92 = ($93|0)<(0);
  28877. $94 = $92 << 31 >> 31;
  28878. $95 = $93 ^ -1;
  28879. $96 = $94 ^ -1;
  28880. $97 = ($91>>>0)>($96>>>0);
  28881. $98 = ($90>>>0)>($95>>>0);
  28882. $99 = ($91|0)==($96|0);
  28883. $100 = $99 & $98;
  28884. $101 = $97 | $100;
  28885. if ($101) {
  28886. $$1165167 = 10;$$8 = $$3162215;$293 = $88;$294 = $89;
  28887. label = 72;
  28888. break L43;
  28889. }
  28890. $102 = (_i64Add(($90|0),($91|0),($93|0),($94|0))|0);
  28891. $103 = tempRet0;
  28892. $104 = HEAP32[$6>>2]|0;
  28893. $105 = HEAP32[$7>>2]|0;
  28894. $106 = ($104>>>0)<($105>>>0);
  28895. if ($106) {
  28896. $107 = ((($104)) + 1|0);
  28897. HEAP32[$6>>2] = $107;
  28898. $108 = HEAP8[$104>>0]|0;
  28899. $109 = $108&255;
  28900. $$3162$be = $109;
  28901. } else {
  28902. $110 = (___shgetc($0)|0);
  28903. $$3162$be = $110;
  28904. }
  28905. $111 = (($$3162$be) + -48)|0;
  28906. $112 = ($111>>>0)<(10);
  28907. $113 = ($103>>>0)<(429496729);
  28908. $114 = ($102>>>0)<(2576980378);
  28909. $115 = ($103|0)==(429496729);
  28910. $116 = $115 & $114;
  28911. $117 = $113 | $116;
  28912. $or$cond7 = $112 & $117;
  28913. if ($or$cond7) {
  28914. $$3162215 = $$3162$be;$88 = $102;$89 = $103;$93 = $111;
  28915. } else {
  28916. break;
  28917. }
  28918. }
  28919. $118 = ($111>>>0)>(9);
  28920. if ($118) {
  28921. $$1158 = $$0157;$263 = $103;$265 = $102;
  28922. } else {
  28923. $$1165167 = 10;$$8 = $$3162$be;$293 = $102;$294 = $103;
  28924. label = 72;
  28925. }
  28926. } else {
  28927. $$1158 = $$0157;$263 = $292;$265 = $291;
  28928. }
  28929. } else {
  28930. $$1160169 = $$1160;$$1165168 = $$1165;
  28931. label = 46;
  28932. }
  28933. }
  28934. } while(0);
  28935. L63: do {
  28936. if ((label|0) == 46) {
  28937. $119 = (($$1165168) + -1)|0;
  28938. $120 = $119 & $$1165168;
  28939. $121 = ($120|0)==(0);
  28940. if ($121) {
  28941. $126 = ($$1165168*23)|0;
  28942. $127 = $126 >>> 5;
  28943. $128 = $127 & 7;
  28944. $129 = (15477 + ($128)|0);
  28945. $130 = HEAP8[$129>>0]|0;
  28946. $131 = $130 << 24 >> 24;
  28947. $132 = ((15221) + ($$1160169)|0);
  28948. $133 = HEAP8[$132>>0]|0;
  28949. $134 = $133&255;
  28950. $135 = ($134>>>0)<($$1165168>>>0);
  28951. if ($135) {
  28952. $$1155192 = 0;$138 = $134;
  28953. while(1) {
  28954. $136 = $$1155192 << $131;
  28955. $137 = $138 | $136;
  28956. $139 = HEAP32[$6>>2]|0;
  28957. $140 = HEAP32[$7>>2]|0;
  28958. $141 = ($139>>>0)<($140>>>0);
  28959. if ($141) {
  28960. $142 = ((($139)) + 1|0);
  28961. HEAP32[$6>>2] = $142;
  28962. $143 = HEAP8[$139>>0]|0;
  28963. $144 = $143&255;
  28964. $$4163$be = $144;
  28965. } else {
  28966. $145 = (___shgetc($0)|0);
  28967. $$4163$be = $145;
  28968. }
  28969. $146 = ((15221) + ($$4163$be)|0);
  28970. $147 = HEAP8[$146>>0]|0;
  28971. $148 = $147&255;
  28972. $149 = ($148>>>0)<($$1165168>>>0);
  28973. $150 = ($137>>>0)<(134217728);
  28974. $151 = $150 & $149;
  28975. if ($151) {
  28976. $$1155192 = $137;$138 = $148;
  28977. } else {
  28978. break;
  28979. }
  28980. }
  28981. $$4163$lcssa = $$4163$be;$155 = $147;$158 = 0;$160 = $137;
  28982. } else {
  28983. $$4163$lcssa = $$1160169;$155 = $133;$158 = 0;$160 = 0;
  28984. }
  28985. $152 = (_bitshift64Lshr(-1,-1,($131|0))|0);
  28986. $153 = tempRet0;
  28987. $154 = $155&255;
  28988. $156 = ($154>>>0)>=($$1165168>>>0);
  28989. $157 = ($158>>>0)>($153>>>0);
  28990. $159 = ($160>>>0)>($152>>>0);
  28991. $161 = ($158|0)==($153|0);
  28992. $162 = $161 & $159;
  28993. $163 = $157 | $162;
  28994. $or$cond187 = $156 | $163;
  28995. if ($or$cond187) {
  28996. $$1165167 = $$1165168;$$8 = $$4163$lcssa;$293 = $160;$294 = $158;
  28997. label = 72;
  28998. break;
  28999. } else {
  29000. $164 = $160;$165 = $158;$169 = $155;
  29001. }
  29002. while(1) {
  29003. $166 = (_bitshift64Shl(($164|0),($165|0),($131|0))|0);
  29004. $167 = tempRet0;
  29005. $168 = $169&255;
  29006. $170 = $168 | $166;
  29007. $171 = HEAP32[$6>>2]|0;
  29008. $172 = HEAP32[$7>>2]|0;
  29009. $173 = ($171>>>0)<($172>>>0);
  29010. if ($173) {
  29011. $174 = ((($171)) + 1|0);
  29012. HEAP32[$6>>2] = $174;
  29013. $175 = HEAP8[$171>>0]|0;
  29014. $176 = $175&255;
  29015. $$5$be = $176;
  29016. } else {
  29017. $177 = (___shgetc($0)|0);
  29018. $$5$be = $177;
  29019. }
  29020. $178 = ((15221) + ($$5$be)|0);
  29021. $179 = HEAP8[$178>>0]|0;
  29022. $180 = $179&255;
  29023. $181 = ($180>>>0)>=($$1165168>>>0);
  29024. $182 = ($167>>>0)>($153>>>0);
  29025. $183 = ($170>>>0)>($152>>>0);
  29026. $184 = ($167|0)==($153|0);
  29027. $185 = $184 & $183;
  29028. $186 = $182 | $185;
  29029. $or$cond = $181 | $186;
  29030. if ($or$cond) {
  29031. $$1165167 = $$1165168;$$8 = $$5$be;$293 = $170;$294 = $167;
  29032. label = 72;
  29033. break L63;
  29034. } else {
  29035. $164 = $170;$165 = $167;$169 = $179;
  29036. }
  29037. }
  29038. }
  29039. $122 = ((15221) + ($$1160169)|0);
  29040. $123 = HEAP8[$122>>0]|0;
  29041. $124 = $123&255;
  29042. $125 = ($124>>>0)<($$1165168>>>0);
  29043. if ($125) {
  29044. $$2156210 = 0;$189 = $124;
  29045. while(1) {
  29046. $187 = Math_imul($$2156210, $$1165168)|0;
  29047. $188 = (($189) + ($187))|0;
  29048. $190 = HEAP32[$6>>2]|0;
  29049. $191 = HEAP32[$7>>2]|0;
  29050. $192 = ($190>>>0)<($191>>>0);
  29051. if ($192) {
  29052. $193 = ((($190)) + 1|0);
  29053. HEAP32[$6>>2] = $193;
  29054. $194 = HEAP8[$190>>0]|0;
  29055. $195 = $194&255;
  29056. $$6$be = $195;
  29057. } else {
  29058. $196 = (___shgetc($0)|0);
  29059. $$6$be = $196;
  29060. }
  29061. $197 = ((15221) + ($$6$be)|0);
  29062. $198 = HEAP8[$197>>0]|0;
  29063. $199 = $198&255;
  29064. $200 = ($199>>>0)<($$1165168>>>0);
  29065. $201 = ($188>>>0)<(119304647);
  29066. $202 = $201 & $200;
  29067. if ($202) {
  29068. $$2156210 = $188;$189 = $199;
  29069. } else {
  29070. break;
  29071. }
  29072. }
  29073. $$6$lcssa = $$6$be;$204 = $198;$295 = $188;$296 = 0;
  29074. } else {
  29075. $$6$lcssa = $$1160169;$204 = $123;$295 = 0;$296 = 0;
  29076. }
  29077. $203 = $204&255;
  29078. $205 = ($203>>>0)<($$1165168>>>0);
  29079. if ($205) {
  29080. $206 = (___udivdi3(-1,-1,($$1165168|0),0)|0);
  29081. $207 = tempRet0;
  29082. $$7198 = $$6$lcssa;$209 = $296;$211 = $295;$218 = $204;
  29083. while(1) {
  29084. $208 = ($209>>>0)>($207>>>0);
  29085. $210 = ($211>>>0)>($206>>>0);
  29086. $212 = ($209|0)==($207|0);
  29087. $213 = $212 & $210;
  29088. $214 = $208 | $213;
  29089. if ($214) {
  29090. $$1165167 = $$1165168;$$8 = $$7198;$293 = $211;$294 = $209;
  29091. label = 72;
  29092. break L63;
  29093. }
  29094. $215 = (___muldi3(($211|0),($209|0),($$1165168|0),0)|0);
  29095. $216 = tempRet0;
  29096. $217 = $218&255;
  29097. $219 = $217 ^ -1;
  29098. $220 = ($216>>>0)>(4294967295);
  29099. $221 = ($215>>>0)>($219>>>0);
  29100. $222 = ($216|0)==(-1);
  29101. $223 = $222 & $221;
  29102. $224 = $220 | $223;
  29103. if ($224) {
  29104. $$1165167 = $$1165168;$$8 = $$7198;$293 = $211;$294 = $209;
  29105. label = 72;
  29106. break L63;
  29107. }
  29108. $225 = (_i64Add(($217|0),0,($215|0),($216|0))|0);
  29109. $226 = tempRet0;
  29110. $227 = HEAP32[$6>>2]|0;
  29111. $228 = HEAP32[$7>>2]|0;
  29112. $229 = ($227>>>0)<($228>>>0);
  29113. if ($229) {
  29114. $230 = ((($227)) + 1|0);
  29115. HEAP32[$6>>2] = $230;
  29116. $231 = HEAP8[$227>>0]|0;
  29117. $232 = $231&255;
  29118. $$7$be = $232;
  29119. } else {
  29120. $233 = (___shgetc($0)|0);
  29121. $$7$be = $233;
  29122. }
  29123. $234 = ((15221) + ($$7$be)|0);
  29124. $235 = HEAP8[$234>>0]|0;
  29125. $236 = $235&255;
  29126. $237 = ($236>>>0)<($$1165168>>>0);
  29127. if ($237) {
  29128. $$7198 = $$7$be;$209 = $226;$211 = $225;$218 = $235;
  29129. } else {
  29130. $$1165167 = $$1165168;$$8 = $$7$be;$293 = $225;$294 = $226;
  29131. label = 72;
  29132. break;
  29133. }
  29134. }
  29135. } else {
  29136. $$1165167 = $$1165168;$$8 = $$6$lcssa;$293 = $295;$294 = $296;
  29137. label = 72;
  29138. }
  29139. }
  29140. } while(0);
  29141. if ((label|0) == 72) {
  29142. $238 = ((15221) + ($$8)|0);
  29143. $239 = HEAP8[$238>>0]|0;
  29144. $240 = $239&255;
  29145. $241 = ($240>>>0)<($$1165167>>>0);
  29146. if ($241) {
  29147. while(1) {
  29148. $242 = HEAP32[$6>>2]|0;
  29149. $243 = HEAP32[$7>>2]|0;
  29150. $244 = ($242>>>0)<($243>>>0);
  29151. if ($244) {
  29152. $245 = ((($242)) + 1|0);
  29153. HEAP32[$6>>2] = $245;
  29154. $246 = HEAP8[$242>>0]|0;
  29155. $247 = $246&255;
  29156. $$9$be = $247;
  29157. } else {
  29158. $248 = (___shgetc($0)|0);
  29159. $$9$be = $248;
  29160. }
  29161. $249 = ((15221) + ($$9$be)|0);
  29162. $250 = HEAP8[$249>>0]|0;
  29163. $251 = $250&255;
  29164. $252 = ($251>>>0)<($$1165167>>>0);
  29165. if (!($252)) {
  29166. break;
  29167. }
  29168. }
  29169. $253 = (___errno_location()|0);
  29170. HEAP32[$253>>2] = 34;
  29171. $254 = $3 & 1;
  29172. $255 = ($254|0)==(0);
  29173. $256 = (0)==(0);
  29174. $257 = $255 & $256;
  29175. $$0157$ = $257 ? $$0157 : 0;
  29176. $$1158 = $$0157$;$263 = $4;$265 = $3;
  29177. } else {
  29178. $$1158 = $$0157;$263 = $294;$265 = $293;
  29179. }
  29180. }
  29181. $258 = HEAP32[$7>>2]|0;
  29182. $259 = ($258|0)==(0|0);
  29183. if (!($259)) {
  29184. $260 = HEAP32[$6>>2]|0;
  29185. $261 = ((($260)) + -1|0);
  29186. HEAP32[$6>>2] = $261;
  29187. }
  29188. $262 = ($263>>>0)<($4>>>0);
  29189. $264 = ($265>>>0)<($3>>>0);
  29190. $266 = ($263|0)==($4|0);
  29191. $267 = $266 & $264;
  29192. $268 = $262 | $267;
  29193. if (!($268)) {
  29194. $269 = $3 & 1;
  29195. $270 = ($269|0)!=(0);
  29196. $271 = (0)!=(0);
  29197. $272 = $270 | $271;
  29198. $273 = ($$1158|0)!=(0);
  29199. $or$cond12 = $272 | $273;
  29200. if (!($or$cond12)) {
  29201. $274 = (___errno_location()|0);
  29202. HEAP32[$274>>2] = 34;
  29203. $275 = (_i64Add(($3|0),($4|0),-1,-1)|0);
  29204. $276 = tempRet0;
  29205. $289 = $276;$290 = $275;
  29206. break;
  29207. }
  29208. $277 = ($263>>>0)>($4>>>0);
  29209. $278 = ($265>>>0)>($3>>>0);
  29210. $279 = ($263|0)==($4|0);
  29211. $280 = $279 & $278;
  29212. $281 = $277 | $280;
  29213. if ($281) {
  29214. $282 = (___errno_location()|0);
  29215. HEAP32[$282>>2] = 34;
  29216. $289 = $4;$290 = $3;
  29217. break;
  29218. }
  29219. }
  29220. $283 = ($$1158|0)<(0);
  29221. $284 = $283 << 31 >> 31;
  29222. $285 = $265 ^ $$1158;
  29223. $286 = $263 ^ $284;
  29224. $287 = (_i64Subtract(($285|0),($286|0),($$1158|0),($284|0))|0);
  29225. $288 = tempRet0;
  29226. $289 = $288;$290 = $287;
  29227. }
  29228. } while(0);
  29229. tempRet0 = ($289);
  29230. return ($290|0);
  29231. }
  29232. function ___shgetc($0) {
  29233. $0 = $0|0;
  29234. var $$0 = 0, $$phi$trans$insert = 0, $$phi$trans$insert28$phi$trans$insert = 0, $$pre = 0, $$pre$phi34Z2D = 0, $$pre29$pre = 0, $$pre35 = 0, $$sink = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0;
  29235. var $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0;
  29236. var $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
  29237. sp = STACKTOP;
  29238. $1 = ((($0)) + 104|0);
  29239. $2 = HEAP32[$1>>2]|0;
  29240. $3 = ($2|0)==(0);
  29241. if ($3) {
  29242. label = 3;
  29243. } else {
  29244. $4 = ((($0)) + 108|0);
  29245. $5 = HEAP32[$4>>2]|0;
  29246. $6 = ($5|0)<($2|0);
  29247. if ($6) {
  29248. label = 3;
  29249. } else {
  29250. label = 4;
  29251. }
  29252. }
  29253. if ((label|0) == 3) {
  29254. $7 = (___uflow($0)|0);
  29255. $8 = ($7|0)<(0);
  29256. if ($8) {
  29257. label = 4;
  29258. } else {
  29259. $10 = HEAP32[$1>>2]|0;
  29260. $11 = ($10|0)==(0);
  29261. $$phi$trans$insert = ((($0)) + 8|0);
  29262. if ($11) {
  29263. $$pre = HEAP32[$$phi$trans$insert>>2]|0;
  29264. $$phi$trans$insert28$phi$trans$insert = ((($0)) + 4|0);
  29265. $$pre29$pre = HEAP32[$$phi$trans$insert28$phi$trans$insert>>2]|0;
  29266. $$pre35 = ((($0)) + 108|0);
  29267. $$pre$phi34Z2D = $$pre35;$$sink = $$pre;$26 = $$pre;$29 = $$pre29$pre;
  29268. } else {
  29269. $12 = HEAP32[$$phi$trans$insert>>2]|0;
  29270. $13 = ((($0)) + 4|0);
  29271. $14 = HEAP32[$13>>2]|0;
  29272. $15 = $14;
  29273. $16 = (($12) - ($15))|0;
  29274. $17 = ((($0)) + 108|0);
  29275. $18 = HEAP32[$17>>2]|0;
  29276. $19 = (($10) - ($18))|0;
  29277. $20 = ($16|0)<($19|0);
  29278. $21 = $12;
  29279. if ($20) {
  29280. $$pre$phi34Z2D = $17;$$sink = $21;$26 = $21;$29 = $14;
  29281. } else {
  29282. $22 = (($19) + -1)|0;
  29283. $23 = (($14) + ($22)|0);
  29284. $$pre$phi34Z2D = $17;$$sink = $23;$26 = $21;$29 = $14;
  29285. }
  29286. }
  29287. $24 = ((($0)) + 100|0);
  29288. HEAP32[$24>>2] = $$sink;
  29289. $25 = ($26|0)==(0|0);
  29290. if (!($25)) {
  29291. $27 = $26;
  29292. $28 = $29;
  29293. $30 = HEAP32[$$pre$phi34Z2D>>2]|0;
  29294. $31 = (($27) + 1)|0;
  29295. $32 = (($31) - ($28))|0;
  29296. $33 = (($32) + ($30))|0;
  29297. HEAP32[$$pre$phi34Z2D>>2] = $33;
  29298. }
  29299. $34 = ((($29)) + -1|0);
  29300. $35 = HEAP8[$34>>0]|0;
  29301. $36 = $35&255;
  29302. $37 = ($36|0)==($7|0);
  29303. if ($37) {
  29304. $$0 = $7;
  29305. } else {
  29306. $38 = $7&255;
  29307. HEAP8[$34>>0] = $38;
  29308. $$0 = $7;
  29309. }
  29310. }
  29311. }
  29312. if ((label|0) == 4) {
  29313. $9 = ((($0)) + 100|0);
  29314. HEAP32[$9>>2] = 0;
  29315. $$0 = -1;
  29316. }
  29317. return ($$0|0);
  29318. }
  29319. function _isspace($0) {
  29320. $0 = $0|0;
  29321. var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0;
  29322. sp = STACKTOP;
  29323. $1 = ($0|0)==(32);
  29324. $2 = (($0) + -9)|0;
  29325. $3 = ($2>>>0)<(5);
  29326. $4 = $1 | $3;
  29327. $5 = $4&1;
  29328. return ($5|0);
  29329. }
  29330. function ___uflow($0) {
  29331. $0 = $0|0;
  29332. var $$0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
  29333. sp = STACKTOP;
  29334. STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
  29335. $1 = sp;
  29336. $2 = (___toread($0)|0);
  29337. $3 = ($2|0)==(0);
  29338. if ($3) {
  29339. $4 = ((($0)) + 32|0);
  29340. $5 = HEAP32[$4>>2]|0;
  29341. $6 = (FUNCTION_TABLE_iiii[$5 & 15]($0,$1,1)|0);
  29342. $7 = ($6|0)==(1);
  29343. if ($7) {
  29344. $8 = HEAP8[$1>>0]|0;
  29345. $9 = $8&255;
  29346. $$0 = $9;
  29347. } else {
  29348. $$0 = -1;
  29349. }
  29350. } else {
  29351. $$0 = -1;
  29352. }
  29353. STACKTOP = sp;return ($$0|0);
  29354. }
  29355. function ___toread($0) {
  29356. $0 = $0|0;
  29357. var $$0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
  29358. var $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $sext = 0, label = 0, sp = 0;
  29359. sp = STACKTOP;
  29360. $1 = ((($0)) + 74|0);
  29361. $2 = HEAP8[$1>>0]|0;
  29362. $3 = $2 << 24 >> 24;
  29363. $4 = (($3) + 255)|0;
  29364. $5 = $4 | $3;
  29365. $6 = $5&255;
  29366. HEAP8[$1>>0] = $6;
  29367. $7 = ((($0)) + 20|0);
  29368. $8 = HEAP32[$7>>2]|0;
  29369. $9 = ((($0)) + 28|0);
  29370. $10 = HEAP32[$9>>2]|0;
  29371. $11 = ($8>>>0)>($10>>>0);
  29372. if ($11) {
  29373. $12 = ((($0)) + 36|0);
  29374. $13 = HEAP32[$12>>2]|0;
  29375. (FUNCTION_TABLE_iiii[$13 & 15]($0,0,0)|0);
  29376. }
  29377. $14 = ((($0)) + 16|0);
  29378. HEAP32[$14>>2] = 0;
  29379. HEAP32[$9>>2] = 0;
  29380. HEAP32[$7>>2] = 0;
  29381. $15 = HEAP32[$0>>2]|0;
  29382. $16 = $15 & 4;
  29383. $17 = ($16|0)==(0);
  29384. if ($17) {
  29385. $19 = ((($0)) + 44|0);
  29386. $20 = HEAP32[$19>>2]|0;
  29387. $21 = ((($0)) + 48|0);
  29388. $22 = HEAP32[$21>>2]|0;
  29389. $23 = (($20) + ($22)|0);
  29390. $24 = ((($0)) + 8|0);
  29391. HEAP32[$24>>2] = $23;
  29392. $25 = ((($0)) + 4|0);
  29393. HEAP32[$25>>2] = $23;
  29394. $26 = $15 << 27;
  29395. $sext = $26 >> 31;
  29396. $$0 = $sext;
  29397. } else {
  29398. $18 = $15 | 32;
  29399. HEAP32[$0>>2] = $18;
  29400. $$0 = -1;
  29401. }
  29402. return ($$0|0);
  29403. }
  29404. function _copysign($0,$1) {
  29405. $0 = +$0;
  29406. $1 = +$1;
  29407. var $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0.0, label = 0, sp = 0;
  29408. sp = STACKTOP;
  29409. HEAPF64[tempDoublePtr>>3] = $0;$2 = HEAP32[tempDoublePtr>>2]|0;
  29410. $3 = HEAP32[tempDoublePtr+4>>2]|0;
  29411. HEAPF64[tempDoublePtr>>3] = $1;$4 = HEAP32[tempDoublePtr>>2]|0;
  29412. $5 = HEAP32[tempDoublePtr+4>>2]|0;
  29413. $6 = $3 & 2147483647;
  29414. $7 = $5 & -2147483648;
  29415. $8 = $7 | $6;
  29416. HEAP32[tempDoublePtr>>2] = $2;HEAP32[tempDoublePtr+4>>2] = $8;$9 = +HEAPF64[tempDoublePtr>>3];
  29417. return (+$9);
  29418. }
  29419. function _strcmp($0,$1) {
  29420. $0 = $0|0;
  29421. $1 = $1|0;
  29422. var $$011 = 0, $$0710 = 0, $$lcssa = 0, $$lcssa8 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond9 = 0, label = 0;
  29423. var sp = 0;
  29424. sp = STACKTOP;
  29425. $2 = HEAP8[$0>>0]|0;
  29426. $3 = HEAP8[$1>>0]|0;
  29427. $4 = ($2<<24>>24)!=($3<<24>>24);
  29428. $5 = ($2<<24>>24)==(0);
  29429. $or$cond9 = $5 | $4;
  29430. if ($or$cond9) {
  29431. $$lcssa = $3;$$lcssa8 = $2;
  29432. } else {
  29433. $$011 = $1;$$0710 = $0;
  29434. while(1) {
  29435. $6 = ((($$0710)) + 1|0);
  29436. $7 = ((($$011)) + 1|0);
  29437. $8 = HEAP8[$6>>0]|0;
  29438. $9 = HEAP8[$7>>0]|0;
  29439. $10 = ($8<<24>>24)!=($9<<24>>24);
  29440. $11 = ($8<<24>>24)==(0);
  29441. $or$cond = $11 | $10;
  29442. if ($or$cond) {
  29443. $$lcssa = $9;$$lcssa8 = $8;
  29444. break;
  29445. } else {
  29446. $$011 = $7;$$0710 = $6;
  29447. }
  29448. }
  29449. }
  29450. $12 = $$lcssa8&255;
  29451. $13 = $$lcssa&255;
  29452. $14 = (($12) - ($13))|0;
  29453. return ($14|0);
  29454. }
  29455. function _memcmp($0,$1,$2) {
  29456. $0 = $0|0;
  29457. $1 = $1|0;
  29458. $2 = $2|0;
  29459. var $$01318 = 0, $$01417 = 0, $$019 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
  29460. sp = STACKTOP;
  29461. $3 = ($2|0)==(0);
  29462. L1: do {
  29463. if ($3) {
  29464. $14 = 0;
  29465. } else {
  29466. $$01318 = $0;$$01417 = $2;$$019 = $1;
  29467. while(1) {
  29468. $4 = HEAP8[$$01318>>0]|0;
  29469. $5 = HEAP8[$$019>>0]|0;
  29470. $6 = ($4<<24>>24)==($5<<24>>24);
  29471. if (!($6)) {
  29472. break;
  29473. }
  29474. $7 = (($$01417) + -1)|0;
  29475. $8 = ((($$01318)) + 1|0);
  29476. $9 = ((($$019)) + 1|0);
  29477. $10 = ($7|0)==(0);
  29478. if ($10) {
  29479. $14 = 0;
  29480. break L1;
  29481. } else {
  29482. $$01318 = $8;$$01417 = $7;$$019 = $9;
  29483. }
  29484. }
  29485. $11 = $4&255;
  29486. $12 = $5&255;
  29487. $13 = (($11) - ($12))|0;
  29488. $14 = $13;
  29489. }
  29490. } while(0);
  29491. return ($14|0);
  29492. }
  29493. function _vsprintf($0,$1,$2) {
  29494. $0 = $0|0;
  29495. $1 = $1|0;
  29496. $2 = $2|0;
  29497. var $3 = 0, label = 0, sp = 0;
  29498. sp = STACKTOP;
  29499. $3 = (_vsnprintf($0,2147483647,$1,$2)|0);
  29500. return ($3|0);
  29501. }
  29502. function _vsnprintf($0,$1,$2,$3) {
  29503. $0 = $0|0;
  29504. $1 = $1|0;
  29505. $2 = $2|0;
  29506. $3 = $3|0;
  29507. var $$$015 = 0, $$0 = 0, $$014 = 0, $$015 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
  29508. var $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
  29509. sp = STACKTOP;
  29510. STACKTOP = STACKTOP + 128|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(128|0);
  29511. $4 = sp + 124|0;
  29512. $5 = sp;
  29513. dest=$5; src=4244; stop=dest+124|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
  29514. $6 = (($1) + -1)|0;
  29515. $7 = ($6>>>0)>(2147483646);
  29516. if ($7) {
  29517. $8 = ($1|0)==(0);
  29518. if ($8) {
  29519. $$014 = $4;$$015 = 1;
  29520. label = 4;
  29521. } else {
  29522. $9 = (___errno_location()|0);
  29523. HEAP32[$9>>2] = 75;
  29524. $$0 = -1;
  29525. }
  29526. } else {
  29527. $$014 = $0;$$015 = $1;
  29528. label = 4;
  29529. }
  29530. if ((label|0) == 4) {
  29531. $10 = $$014;
  29532. $11 = (-2 - ($10))|0;
  29533. $12 = ($$015>>>0)>($11>>>0);
  29534. $$$015 = $12 ? $11 : $$015;
  29535. $13 = ((($5)) + 48|0);
  29536. HEAP32[$13>>2] = $$$015;
  29537. $14 = ((($5)) + 20|0);
  29538. HEAP32[$14>>2] = $$014;
  29539. $15 = ((($5)) + 44|0);
  29540. HEAP32[$15>>2] = $$014;
  29541. $16 = (($$014) + ($$$015)|0);
  29542. $17 = ((($5)) + 16|0);
  29543. HEAP32[$17>>2] = $16;
  29544. $18 = ((($5)) + 28|0);
  29545. HEAP32[$18>>2] = $16;
  29546. $19 = (_vfprintf($5,$2,$3)|0);
  29547. $20 = ($$$015|0)==(0);
  29548. if ($20) {
  29549. $$0 = $19;
  29550. } else {
  29551. $21 = HEAP32[$14>>2]|0;
  29552. $22 = HEAP32[$17>>2]|0;
  29553. $23 = ($21|0)==($22|0);
  29554. $24 = $23 << 31 >> 31;
  29555. $25 = (($21) + ($24)|0);
  29556. HEAP8[$25>>0] = 0;
  29557. $$0 = $19;
  29558. }
  29559. }
  29560. STACKTOP = sp;return ($$0|0);
  29561. }
  29562. function _vfprintf($0,$1,$2) {
  29563. $0 = $0|0;
  29564. $1 = $1|0;
  29565. $2 = $2|0;
  29566. var $$ = 0, $$0 = 0, $$1 = 0, $$1$ = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
  29567. var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $5 = 0, $6 = 0, $7 = 0;
  29568. var $8 = 0, $9 = 0, $vacopy_currentptr = 0, dest = 0, label = 0, sp = 0, stop = 0;
  29569. sp = STACKTOP;
  29570. STACKTOP = STACKTOP + 224|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(224|0);
  29571. $3 = sp + 120|0;
  29572. $4 = sp + 80|0;
  29573. $5 = sp;
  29574. $6 = sp + 136|0;
  29575. dest=$4; stop=dest+40|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0));
  29576. $vacopy_currentptr = HEAP32[$2>>2]|0;
  29577. HEAP32[$3>>2] = $vacopy_currentptr;
  29578. $7 = (_printf_core(0,$1,$3,$5,$4)|0);
  29579. $8 = ($7|0)<(0);
  29580. if ($8) {
  29581. $$0 = -1;
  29582. } else {
  29583. $9 = ((($0)) + 76|0);
  29584. $10 = HEAP32[$9>>2]|0;
  29585. $11 = ($10|0)>(-1);
  29586. if ($11) {
  29587. $12 = (___lockfile($0)|0);
  29588. $40 = $12;
  29589. } else {
  29590. $40 = 0;
  29591. }
  29592. $13 = HEAP32[$0>>2]|0;
  29593. $14 = $13 & 32;
  29594. $15 = ((($0)) + 74|0);
  29595. $16 = HEAP8[$15>>0]|0;
  29596. $17 = ($16<<24>>24)<(1);
  29597. if ($17) {
  29598. $18 = $13 & -33;
  29599. HEAP32[$0>>2] = $18;
  29600. }
  29601. $19 = ((($0)) + 48|0);
  29602. $20 = HEAP32[$19>>2]|0;
  29603. $21 = ($20|0)==(0);
  29604. if ($21) {
  29605. $23 = ((($0)) + 44|0);
  29606. $24 = HEAP32[$23>>2]|0;
  29607. HEAP32[$23>>2] = $6;
  29608. $25 = ((($0)) + 28|0);
  29609. HEAP32[$25>>2] = $6;
  29610. $26 = ((($0)) + 20|0);
  29611. HEAP32[$26>>2] = $6;
  29612. HEAP32[$19>>2] = 80;
  29613. $27 = ((($6)) + 80|0);
  29614. $28 = ((($0)) + 16|0);
  29615. HEAP32[$28>>2] = $27;
  29616. $29 = (_printf_core($0,$1,$3,$5,$4)|0);
  29617. $30 = ($24|0)==(0|0);
  29618. if ($30) {
  29619. $$1 = $29;
  29620. } else {
  29621. $31 = ((($0)) + 36|0);
  29622. $32 = HEAP32[$31>>2]|0;
  29623. (FUNCTION_TABLE_iiii[$32 & 15]($0,0,0)|0);
  29624. $33 = HEAP32[$26>>2]|0;
  29625. $34 = ($33|0)==(0|0);
  29626. $$ = $34 ? -1 : $29;
  29627. HEAP32[$23>>2] = $24;
  29628. HEAP32[$19>>2] = 0;
  29629. HEAP32[$28>>2] = 0;
  29630. HEAP32[$25>>2] = 0;
  29631. HEAP32[$26>>2] = 0;
  29632. $$1 = $$;
  29633. }
  29634. } else {
  29635. $22 = (_printf_core($0,$1,$3,$5,$4)|0);
  29636. $$1 = $22;
  29637. }
  29638. $35 = HEAP32[$0>>2]|0;
  29639. $36 = $35 & 32;
  29640. $37 = ($36|0)==(0);
  29641. $$1$ = $37 ? $$1 : -1;
  29642. $38 = $35 | $14;
  29643. HEAP32[$0>>2] = $38;
  29644. $39 = ($40|0)==(0);
  29645. if (!($39)) {
  29646. ___unlockfile($0);
  29647. }
  29648. $$0 = $$1$;
  29649. }
  29650. STACKTOP = sp;return ($$0|0);
  29651. }
  29652. function _printf_core($0,$1,$2,$3,$4) {
  29653. $0 = $0|0;
  29654. $1 = $1|0;
  29655. $2 = $2|0;
  29656. $3 = $3|0;
  29657. $4 = $4|0;
  29658. var $$ = 0, $$$ = 0, $$$0259 = 0, $$$0262 = 0, $$$0269 = 0, $$$4266 = 0, $$$5 = 0, $$0 = 0, $$0228 = 0, $$0228$ = 0, $$0229322 = 0, $$0232 = 0, $$0235 = 0, $$0237 = 0, $$0240$lcssa = 0, $$0240$lcssa357 = 0, $$0240321 = 0, $$0243 = 0, $$0247 = 0, $$0249$lcssa = 0;
  29659. var $$0249306 = 0, $$0252 = 0, $$0253 = 0, $$0254 = 0, $$0254$$0254$ = 0, $$0259 = 0, $$0262$lcssa = 0, $$0262311 = 0, $$0269 = 0, $$0269$phi = 0, $$1 = 0, $$1230333 = 0, $$1233 = 0, $$1236 = 0, $$1238 = 0, $$1241332 = 0, $$1244320 = 0, $$1248 = 0, $$1250 = 0, $$1255 = 0;
  29660. var $$1260 = 0, $$1263 = 0, $$1263$ = 0, $$1270 = 0, $$2 = 0, $$2234 = 0, $$2239 = 0, $$2242305 = 0, $$2245 = 0, $$2251 = 0, $$2256 = 0, $$2256$ = 0, $$2256$$$2256 = 0, $$2261 = 0, $$2271 = 0, $$284$ = 0, $$289 = 0, $$290 = 0, $$3257 = 0, $$3265 = 0;
  29661. var $$3272 = 0, $$3303 = 0, $$377 = 0, $$4258355 = 0, $$4266 = 0, $$5 = 0, $$6268 = 0, $$lcssa295 = 0, $$pre = 0, $$pre346 = 0, $$pre347 = 0, $$pre347$pre = 0, $$pre349 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0;
  29662. var $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0;
  29663. var $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0;
  29664. var $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0;
  29665. var $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0;
  29666. var $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0;
  29667. var $197 = 0, $198 = 0, $199 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0;
  29668. var $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0;
  29669. var $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0;
  29670. var $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0;
  29671. var $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0;
  29672. var $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0;
  29673. var $306 = 0.0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0, $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0, $321 = 0, $322 = 0, $323 = 0;
  29674. var $324 = 0, $325 = 0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
  29675. var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0;
  29676. var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0;
  29677. var $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0;
  29678. var $arglist_current = 0, $arglist_current2 = 0, $arglist_next = 0, $arglist_next3 = 0, $expanded = 0, $expanded10 = 0, $expanded11 = 0, $expanded13 = 0, $expanded14 = 0, $expanded15 = 0, $expanded4 = 0, $expanded6 = 0, $expanded7 = 0, $expanded8 = 0, $isdigit = 0, $isdigit275 = 0, $isdigit277 = 0, $isdigittmp = 0, $isdigittmp$ = 0, $isdigittmp274 = 0;
  29679. var $isdigittmp276 = 0, $narrow = 0, $or$cond = 0, $or$cond281 = 0, $or$cond283 = 0, $or$cond286 = 0, $storemerge = 0, $storemerge273310 = 0, $storemerge278 = 0, $trunc = 0, label = 0, sp = 0;
  29680. sp = STACKTOP;
  29681. STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(64|0);
  29682. $5 = sp + 16|0;
  29683. $6 = sp;
  29684. $7 = sp + 24|0;
  29685. $8 = sp + 8|0;
  29686. $9 = sp + 20|0;
  29687. HEAP32[$5>>2] = $1;
  29688. $10 = ($0|0)!=(0|0);
  29689. $11 = ((($7)) + 40|0);
  29690. $12 = $11;
  29691. $13 = ((($7)) + 39|0);
  29692. $14 = ((($8)) + 4|0);
  29693. $$0243 = 0;$$0247 = 0;$$0269 = 0;$21 = $1;
  29694. L1: while(1) {
  29695. $15 = ($$0247|0)>(-1);
  29696. do {
  29697. if ($15) {
  29698. $16 = (2147483647 - ($$0247))|0;
  29699. $17 = ($$0243|0)>($16|0);
  29700. if ($17) {
  29701. $18 = (___errno_location()|0);
  29702. HEAP32[$18>>2] = 75;
  29703. $$1248 = -1;
  29704. break;
  29705. } else {
  29706. $19 = (($$0243) + ($$0247))|0;
  29707. $$1248 = $19;
  29708. break;
  29709. }
  29710. } else {
  29711. $$1248 = $$0247;
  29712. }
  29713. } while(0);
  29714. $20 = HEAP8[$21>>0]|0;
  29715. $22 = ($20<<24>>24)==(0);
  29716. if ($22) {
  29717. label = 87;
  29718. break;
  29719. } else {
  29720. $23 = $20;$25 = $21;
  29721. }
  29722. L9: while(1) {
  29723. switch ($23<<24>>24) {
  29724. case 37: {
  29725. $$0249306 = $25;$27 = $25;
  29726. label = 9;
  29727. break L9;
  29728. break;
  29729. }
  29730. case 0: {
  29731. $$0249$lcssa = $25;$39 = $25;
  29732. break L9;
  29733. break;
  29734. }
  29735. default: {
  29736. }
  29737. }
  29738. $24 = ((($25)) + 1|0);
  29739. HEAP32[$5>>2] = $24;
  29740. $$pre = HEAP8[$24>>0]|0;
  29741. $23 = $$pre;$25 = $24;
  29742. }
  29743. L12: do {
  29744. if ((label|0) == 9) {
  29745. while(1) {
  29746. label = 0;
  29747. $26 = ((($27)) + 1|0);
  29748. $28 = HEAP8[$26>>0]|0;
  29749. $29 = ($28<<24>>24)==(37);
  29750. if (!($29)) {
  29751. $$0249$lcssa = $$0249306;$39 = $27;
  29752. break L12;
  29753. }
  29754. $30 = ((($$0249306)) + 1|0);
  29755. $31 = ((($27)) + 2|0);
  29756. HEAP32[$5>>2] = $31;
  29757. $32 = HEAP8[$31>>0]|0;
  29758. $33 = ($32<<24>>24)==(37);
  29759. if ($33) {
  29760. $$0249306 = $30;$27 = $31;
  29761. label = 9;
  29762. } else {
  29763. $$0249$lcssa = $30;$39 = $31;
  29764. break;
  29765. }
  29766. }
  29767. }
  29768. } while(0);
  29769. $34 = $$0249$lcssa;
  29770. $35 = $21;
  29771. $36 = (($34) - ($35))|0;
  29772. if ($10) {
  29773. _out($0,$21,$36);
  29774. }
  29775. $37 = ($36|0)==(0);
  29776. if (!($37)) {
  29777. $$0269$phi = $$0269;$$0243 = $36;$$0247 = $$1248;$21 = $39;$$0269 = $$0269$phi;
  29778. continue;
  29779. }
  29780. $38 = ((($39)) + 1|0);
  29781. $40 = HEAP8[$38>>0]|0;
  29782. $41 = $40 << 24 >> 24;
  29783. $isdigittmp = (($41) + -48)|0;
  29784. $isdigit = ($isdigittmp>>>0)<(10);
  29785. if ($isdigit) {
  29786. $42 = ((($39)) + 2|0);
  29787. $43 = HEAP8[$42>>0]|0;
  29788. $44 = ($43<<24>>24)==(36);
  29789. $45 = ((($39)) + 3|0);
  29790. $$377 = $44 ? $45 : $38;
  29791. $$$0269 = $44 ? 1 : $$0269;
  29792. $isdigittmp$ = $44 ? $isdigittmp : -1;
  29793. $$0253 = $isdigittmp$;$$1270 = $$$0269;$storemerge = $$377;
  29794. } else {
  29795. $$0253 = -1;$$1270 = $$0269;$storemerge = $38;
  29796. }
  29797. HEAP32[$5>>2] = $storemerge;
  29798. $46 = HEAP8[$storemerge>>0]|0;
  29799. $47 = $46 << 24 >> 24;
  29800. $48 = (($47) + -32)|0;
  29801. $49 = ($48>>>0)<(32);
  29802. L24: do {
  29803. if ($49) {
  29804. $$0262311 = 0;$329 = $46;$51 = $48;$storemerge273310 = $storemerge;
  29805. while(1) {
  29806. $50 = 1 << $51;
  29807. $52 = $50 & 75913;
  29808. $53 = ($52|0)==(0);
  29809. if ($53) {
  29810. $$0262$lcssa = $$0262311;$$lcssa295 = $329;$62 = $storemerge273310;
  29811. break L24;
  29812. }
  29813. $54 = $50 | $$0262311;
  29814. $55 = ((($storemerge273310)) + 1|0);
  29815. HEAP32[$5>>2] = $55;
  29816. $56 = HEAP8[$55>>0]|0;
  29817. $57 = $56 << 24 >> 24;
  29818. $58 = (($57) + -32)|0;
  29819. $59 = ($58>>>0)<(32);
  29820. if ($59) {
  29821. $$0262311 = $54;$329 = $56;$51 = $58;$storemerge273310 = $55;
  29822. } else {
  29823. $$0262$lcssa = $54;$$lcssa295 = $56;$62 = $55;
  29824. break;
  29825. }
  29826. }
  29827. } else {
  29828. $$0262$lcssa = 0;$$lcssa295 = $46;$62 = $storemerge;
  29829. }
  29830. } while(0);
  29831. $60 = ($$lcssa295<<24>>24)==(42);
  29832. if ($60) {
  29833. $61 = ((($62)) + 1|0);
  29834. $63 = HEAP8[$61>>0]|0;
  29835. $64 = $63 << 24 >> 24;
  29836. $isdigittmp276 = (($64) + -48)|0;
  29837. $isdigit277 = ($isdigittmp276>>>0)<(10);
  29838. if ($isdigit277) {
  29839. $65 = ((($62)) + 2|0);
  29840. $66 = HEAP8[$65>>0]|0;
  29841. $67 = ($66<<24>>24)==(36);
  29842. if ($67) {
  29843. $68 = (($4) + ($isdigittmp276<<2)|0);
  29844. HEAP32[$68>>2] = 10;
  29845. $69 = HEAP8[$61>>0]|0;
  29846. $70 = $69 << 24 >> 24;
  29847. $71 = (($70) + -48)|0;
  29848. $72 = (($3) + ($71<<3)|0);
  29849. $73 = $72;
  29850. $74 = $73;
  29851. $75 = HEAP32[$74>>2]|0;
  29852. $76 = (($73) + 4)|0;
  29853. $77 = $76;
  29854. $78 = HEAP32[$77>>2]|0;
  29855. $79 = ((($62)) + 3|0);
  29856. $$0259 = $75;$$2271 = 1;$storemerge278 = $79;
  29857. } else {
  29858. label = 23;
  29859. }
  29860. } else {
  29861. label = 23;
  29862. }
  29863. if ((label|0) == 23) {
  29864. label = 0;
  29865. $80 = ($$1270|0)==(0);
  29866. if (!($80)) {
  29867. $$0 = -1;
  29868. break;
  29869. }
  29870. if ($10) {
  29871. $arglist_current = HEAP32[$2>>2]|0;
  29872. $81 = $arglist_current;
  29873. $82 = ((0) + 4|0);
  29874. $expanded4 = $82;
  29875. $expanded = (($expanded4) - 1)|0;
  29876. $83 = (($81) + ($expanded))|0;
  29877. $84 = ((0) + 4|0);
  29878. $expanded8 = $84;
  29879. $expanded7 = (($expanded8) - 1)|0;
  29880. $expanded6 = $expanded7 ^ -1;
  29881. $85 = $83 & $expanded6;
  29882. $86 = $85;
  29883. $87 = HEAP32[$86>>2]|0;
  29884. $arglist_next = ((($86)) + 4|0);
  29885. HEAP32[$2>>2] = $arglist_next;
  29886. $$0259 = $87;$$2271 = 0;$storemerge278 = $61;
  29887. } else {
  29888. $$0259 = 0;$$2271 = 0;$storemerge278 = $61;
  29889. }
  29890. }
  29891. HEAP32[$5>>2] = $storemerge278;
  29892. $88 = ($$0259|0)<(0);
  29893. $89 = $$0262$lcssa | 8192;
  29894. $90 = (0 - ($$0259))|0;
  29895. $$$0262 = $88 ? $89 : $$0262$lcssa;
  29896. $$$0259 = $88 ? $90 : $$0259;
  29897. $$1260 = $$$0259;$$1263 = $$$0262;$$3272 = $$2271;$94 = $storemerge278;
  29898. } else {
  29899. $91 = (_getint($5)|0);
  29900. $92 = ($91|0)<(0);
  29901. if ($92) {
  29902. $$0 = -1;
  29903. break;
  29904. }
  29905. $$pre346 = HEAP32[$5>>2]|0;
  29906. $$1260 = $91;$$1263 = $$0262$lcssa;$$3272 = $$1270;$94 = $$pre346;
  29907. }
  29908. $93 = HEAP8[$94>>0]|0;
  29909. $95 = ($93<<24>>24)==(46);
  29910. do {
  29911. if ($95) {
  29912. $96 = ((($94)) + 1|0);
  29913. $97 = HEAP8[$96>>0]|0;
  29914. $98 = ($97<<24>>24)==(42);
  29915. if (!($98)) {
  29916. $125 = ((($94)) + 1|0);
  29917. HEAP32[$5>>2] = $125;
  29918. $126 = (_getint($5)|0);
  29919. $$pre347$pre = HEAP32[$5>>2]|0;
  29920. $$0254 = $126;$$pre347 = $$pre347$pre;
  29921. break;
  29922. }
  29923. $99 = ((($94)) + 2|0);
  29924. $100 = HEAP8[$99>>0]|0;
  29925. $101 = $100 << 24 >> 24;
  29926. $isdigittmp274 = (($101) + -48)|0;
  29927. $isdigit275 = ($isdigittmp274>>>0)<(10);
  29928. if ($isdigit275) {
  29929. $102 = ((($94)) + 3|0);
  29930. $103 = HEAP8[$102>>0]|0;
  29931. $104 = ($103<<24>>24)==(36);
  29932. if ($104) {
  29933. $105 = (($4) + ($isdigittmp274<<2)|0);
  29934. HEAP32[$105>>2] = 10;
  29935. $106 = HEAP8[$99>>0]|0;
  29936. $107 = $106 << 24 >> 24;
  29937. $108 = (($107) + -48)|0;
  29938. $109 = (($3) + ($108<<3)|0);
  29939. $110 = $109;
  29940. $111 = $110;
  29941. $112 = HEAP32[$111>>2]|0;
  29942. $113 = (($110) + 4)|0;
  29943. $114 = $113;
  29944. $115 = HEAP32[$114>>2]|0;
  29945. $116 = ((($94)) + 4|0);
  29946. HEAP32[$5>>2] = $116;
  29947. $$0254 = $112;$$pre347 = $116;
  29948. break;
  29949. }
  29950. }
  29951. $117 = ($$3272|0)==(0);
  29952. if (!($117)) {
  29953. $$0 = -1;
  29954. break L1;
  29955. }
  29956. if ($10) {
  29957. $arglist_current2 = HEAP32[$2>>2]|0;
  29958. $118 = $arglist_current2;
  29959. $119 = ((0) + 4|0);
  29960. $expanded11 = $119;
  29961. $expanded10 = (($expanded11) - 1)|0;
  29962. $120 = (($118) + ($expanded10))|0;
  29963. $121 = ((0) + 4|0);
  29964. $expanded15 = $121;
  29965. $expanded14 = (($expanded15) - 1)|0;
  29966. $expanded13 = $expanded14 ^ -1;
  29967. $122 = $120 & $expanded13;
  29968. $123 = $122;
  29969. $124 = HEAP32[$123>>2]|0;
  29970. $arglist_next3 = ((($123)) + 4|0);
  29971. HEAP32[$2>>2] = $arglist_next3;
  29972. $330 = $124;
  29973. } else {
  29974. $330 = 0;
  29975. }
  29976. HEAP32[$5>>2] = $99;
  29977. $$0254 = $330;$$pre347 = $99;
  29978. } else {
  29979. $$0254 = -1;$$pre347 = $94;
  29980. }
  29981. } while(0);
  29982. $$0252 = 0;$128 = $$pre347;
  29983. while(1) {
  29984. $127 = HEAP8[$128>>0]|0;
  29985. $129 = $127 << 24 >> 24;
  29986. $130 = (($129) + -65)|0;
  29987. $131 = ($130>>>0)>(57);
  29988. if ($131) {
  29989. $$0 = -1;
  29990. break L1;
  29991. }
  29992. $132 = ((($128)) + 1|0);
  29993. HEAP32[$5>>2] = $132;
  29994. $133 = HEAP8[$128>>0]|0;
  29995. $134 = $133 << 24 >> 24;
  29996. $135 = (($134) + -65)|0;
  29997. $136 = ((15486 + (($$0252*58)|0)|0) + ($135)|0);
  29998. $137 = HEAP8[$136>>0]|0;
  29999. $138 = $137&255;
  30000. $139 = (($138) + -1)|0;
  30001. $140 = ($139>>>0)<(8);
  30002. if ($140) {
  30003. $$0252 = $138;$128 = $132;
  30004. } else {
  30005. break;
  30006. }
  30007. }
  30008. $141 = ($137<<24>>24)==(0);
  30009. if ($141) {
  30010. $$0 = -1;
  30011. break;
  30012. }
  30013. $142 = ($137<<24>>24)==(19);
  30014. $143 = ($$0253|0)>(-1);
  30015. do {
  30016. if ($142) {
  30017. if ($143) {
  30018. $$0 = -1;
  30019. break L1;
  30020. } else {
  30021. label = 49;
  30022. }
  30023. } else {
  30024. if ($143) {
  30025. $144 = (($4) + ($$0253<<2)|0);
  30026. HEAP32[$144>>2] = $138;
  30027. $145 = (($3) + ($$0253<<3)|0);
  30028. $146 = $145;
  30029. $147 = $146;
  30030. $148 = HEAP32[$147>>2]|0;
  30031. $149 = (($146) + 4)|0;
  30032. $150 = $149;
  30033. $151 = HEAP32[$150>>2]|0;
  30034. $152 = $6;
  30035. $153 = $152;
  30036. HEAP32[$153>>2] = $148;
  30037. $154 = (($152) + 4)|0;
  30038. $155 = $154;
  30039. HEAP32[$155>>2] = $151;
  30040. label = 49;
  30041. break;
  30042. }
  30043. if (!($10)) {
  30044. $$0 = 0;
  30045. break L1;
  30046. }
  30047. _pop_arg($6,$138,$2);
  30048. }
  30049. } while(0);
  30050. if ((label|0) == 49) {
  30051. label = 0;
  30052. if (!($10)) {
  30053. $$0243 = 0;$$0247 = $$1248;$$0269 = $$3272;$21 = $132;
  30054. continue;
  30055. }
  30056. }
  30057. $156 = HEAP8[$128>>0]|0;
  30058. $157 = $156 << 24 >> 24;
  30059. $158 = ($$0252|0)!=(0);
  30060. $159 = $157 & 15;
  30061. $160 = ($159|0)==(3);
  30062. $or$cond281 = $158 & $160;
  30063. $161 = $157 & -33;
  30064. $$0235 = $or$cond281 ? $161 : $157;
  30065. $162 = $$1263 & 8192;
  30066. $163 = ($162|0)==(0);
  30067. $164 = $$1263 & -65537;
  30068. $$1263$ = $163 ? $$1263 : $164;
  30069. L71: do {
  30070. switch ($$0235|0) {
  30071. case 110: {
  30072. $trunc = $$0252&255;
  30073. switch ($trunc<<24>>24) {
  30074. case 0: {
  30075. $171 = HEAP32[$6>>2]|0;
  30076. HEAP32[$171>>2] = $$1248;
  30077. $$0243 = 0;$$0247 = $$1248;$$0269 = $$3272;$21 = $132;
  30078. continue L1;
  30079. break;
  30080. }
  30081. case 1: {
  30082. $172 = HEAP32[$6>>2]|0;
  30083. HEAP32[$172>>2] = $$1248;
  30084. $$0243 = 0;$$0247 = $$1248;$$0269 = $$3272;$21 = $132;
  30085. continue L1;
  30086. break;
  30087. }
  30088. case 2: {
  30089. $173 = ($$1248|0)<(0);
  30090. $174 = $173 << 31 >> 31;
  30091. $175 = HEAP32[$6>>2]|0;
  30092. $176 = $175;
  30093. $177 = $176;
  30094. HEAP32[$177>>2] = $$1248;
  30095. $178 = (($176) + 4)|0;
  30096. $179 = $178;
  30097. HEAP32[$179>>2] = $174;
  30098. $$0243 = 0;$$0247 = $$1248;$$0269 = $$3272;$21 = $132;
  30099. continue L1;
  30100. break;
  30101. }
  30102. case 3: {
  30103. $180 = $$1248&65535;
  30104. $181 = HEAP32[$6>>2]|0;
  30105. HEAP16[$181>>1] = $180;
  30106. $$0243 = 0;$$0247 = $$1248;$$0269 = $$3272;$21 = $132;
  30107. continue L1;
  30108. break;
  30109. }
  30110. case 4: {
  30111. $182 = $$1248&255;
  30112. $183 = HEAP32[$6>>2]|0;
  30113. HEAP8[$183>>0] = $182;
  30114. $$0243 = 0;$$0247 = $$1248;$$0269 = $$3272;$21 = $132;
  30115. continue L1;
  30116. break;
  30117. }
  30118. case 6: {
  30119. $184 = HEAP32[$6>>2]|0;
  30120. HEAP32[$184>>2] = $$1248;
  30121. $$0243 = 0;$$0247 = $$1248;$$0269 = $$3272;$21 = $132;
  30122. continue L1;
  30123. break;
  30124. }
  30125. case 7: {
  30126. $185 = ($$1248|0)<(0);
  30127. $186 = $185 << 31 >> 31;
  30128. $187 = HEAP32[$6>>2]|0;
  30129. $188 = $187;
  30130. $189 = $188;
  30131. HEAP32[$189>>2] = $$1248;
  30132. $190 = (($188) + 4)|0;
  30133. $191 = $190;
  30134. HEAP32[$191>>2] = $186;
  30135. $$0243 = 0;$$0247 = $$1248;$$0269 = $$3272;$21 = $132;
  30136. continue L1;
  30137. break;
  30138. }
  30139. default: {
  30140. $$0243 = 0;$$0247 = $$1248;$$0269 = $$3272;$21 = $132;
  30141. continue L1;
  30142. }
  30143. }
  30144. break;
  30145. }
  30146. case 112: {
  30147. $192 = ($$0254>>>0)>(8);
  30148. $193 = $192 ? $$0254 : 8;
  30149. $194 = $$1263$ | 8;
  30150. $$1236 = 120;$$1255 = $193;$$3265 = $194;
  30151. label = 61;
  30152. break;
  30153. }
  30154. case 88: case 120: {
  30155. $$1236 = $$0235;$$1255 = $$0254;$$3265 = $$1263$;
  30156. label = 61;
  30157. break;
  30158. }
  30159. case 111: {
  30160. $210 = $6;
  30161. $211 = $210;
  30162. $212 = HEAP32[$211>>2]|0;
  30163. $213 = (($210) + 4)|0;
  30164. $214 = $213;
  30165. $215 = HEAP32[$214>>2]|0;
  30166. $216 = (_fmt_o($212,$215,$11)|0);
  30167. $217 = $$1263$ & 8;
  30168. $218 = ($217|0)==(0);
  30169. $219 = $216;
  30170. $220 = (($12) - ($219))|0;
  30171. $221 = ($$0254|0)>($220|0);
  30172. $222 = (($220) + 1)|0;
  30173. $223 = $218 | $221;
  30174. $$0254$$0254$ = $223 ? $$0254 : $222;
  30175. $$0228 = $216;$$1233 = 0;$$1238 = 15950;$$2256 = $$0254$$0254$;$$4266 = $$1263$;$248 = $212;$250 = $215;
  30176. label = 67;
  30177. break;
  30178. }
  30179. case 105: case 100: {
  30180. $224 = $6;
  30181. $225 = $224;
  30182. $226 = HEAP32[$225>>2]|0;
  30183. $227 = (($224) + 4)|0;
  30184. $228 = $227;
  30185. $229 = HEAP32[$228>>2]|0;
  30186. $230 = ($229|0)<(0);
  30187. if ($230) {
  30188. $231 = (_i64Subtract(0,0,($226|0),($229|0))|0);
  30189. $232 = tempRet0;
  30190. $233 = $6;
  30191. $234 = $233;
  30192. HEAP32[$234>>2] = $231;
  30193. $235 = (($233) + 4)|0;
  30194. $236 = $235;
  30195. HEAP32[$236>>2] = $232;
  30196. $$0232 = 1;$$0237 = 15950;$242 = $231;$243 = $232;
  30197. label = 66;
  30198. break L71;
  30199. } else {
  30200. $237 = $$1263$ & 2048;
  30201. $238 = ($237|0)==(0);
  30202. $239 = $$1263$ & 1;
  30203. $240 = ($239|0)==(0);
  30204. $$ = $240 ? 15950 : (15952);
  30205. $$$ = $238 ? $$ : (15951);
  30206. $241 = $$1263$ & 2049;
  30207. $narrow = ($241|0)!=(0);
  30208. $$284$ = $narrow&1;
  30209. $$0232 = $$284$;$$0237 = $$$;$242 = $226;$243 = $229;
  30210. label = 66;
  30211. break L71;
  30212. }
  30213. break;
  30214. }
  30215. case 117: {
  30216. $165 = $6;
  30217. $166 = $165;
  30218. $167 = HEAP32[$166>>2]|0;
  30219. $168 = (($165) + 4)|0;
  30220. $169 = $168;
  30221. $170 = HEAP32[$169>>2]|0;
  30222. $$0232 = 0;$$0237 = 15950;$242 = $167;$243 = $170;
  30223. label = 66;
  30224. break;
  30225. }
  30226. case 99: {
  30227. $259 = $6;
  30228. $260 = $259;
  30229. $261 = HEAP32[$260>>2]|0;
  30230. $262 = (($259) + 4)|0;
  30231. $263 = $262;
  30232. $264 = HEAP32[$263>>2]|0;
  30233. $265 = $261&255;
  30234. HEAP8[$13>>0] = $265;
  30235. $$2 = $13;$$2234 = 0;$$2239 = 15950;$$2251 = $11;$$5 = 1;$$6268 = $164;
  30236. break;
  30237. }
  30238. case 109: {
  30239. $266 = (___errno_location()|0);
  30240. $267 = HEAP32[$266>>2]|0;
  30241. $268 = (_strerror($267)|0);
  30242. $$1 = $268;
  30243. label = 71;
  30244. break;
  30245. }
  30246. case 115: {
  30247. $269 = HEAP32[$6>>2]|0;
  30248. $270 = ($269|0)!=(0|0);
  30249. $271 = $270 ? $269 : 15960;
  30250. $$1 = $271;
  30251. label = 71;
  30252. break;
  30253. }
  30254. case 67: {
  30255. $278 = $6;
  30256. $279 = $278;
  30257. $280 = HEAP32[$279>>2]|0;
  30258. $281 = (($278) + 4)|0;
  30259. $282 = $281;
  30260. $283 = HEAP32[$282>>2]|0;
  30261. HEAP32[$8>>2] = $280;
  30262. HEAP32[$14>>2] = 0;
  30263. HEAP32[$6>>2] = $8;
  30264. $$4258355 = -1;$331 = $8;
  30265. label = 75;
  30266. break;
  30267. }
  30268. case 83: {
  30269. $$pre349 = HEAP32[$6>>2]|0;
  30270. $284 = ($$0254|0)==(0);
  30271. if ($284) {
  30272. _pad_674($0,32,$$1260,0,$$1263$);
  30273. $$0240$lcssa357 = 0;
  30274. label = 84;
  30275. } else {
  30276. $$4258355 = $$0254;$331 = $$pre349;
  30277. label = 75;
  30278. }
  30279. break;
  30280. }
  30281. case 65: case 71: case 70: case 69: case 97: case 103: case 102: case 101: {
  30282. $306 = +HEAPF64[$6>>3];
  30283. $307 = (_fmt_fp($0,$306,$$1260,$$0254,$$1263$,$$0235)|0);
  30284. $$0243 = $307;$$0247 = $$1248;$$0269 = $$3272;$21 = $132;
  30285. continue L1;
  30286. break;
  30287. }
  30288. default: {
  30289. $$2 = $21;$$2234 = 0;$$2239 = 15950;$$2251 = $11;$$5 = $$0254;$$6268 = $$1263$;
  30290. }
  30291. }
  30292. } while(0);
  30293. L95: do {
  30294. if ((label|0) == 61) {
  30295. label = 0;
  30296. $195 = $6;
  30297. $196 = $195;
  30298. $197 = HEAP32[$196>>2]|0;
  30299. $198 = (($195) + 4)|0;
  30300. $199 = $198;
  30301. $200 = HEAP32[$199>>2]|0;
  30302. $201 = $$1236 & 32;
  30303. $202 = (_fmt_x($197,$200,$11,$201)|0);
  30304. $203 = ($197|0)==(0);
  30305. $204 = ($200|0)==(0);
  30306. $205 = $203 & $204;
  30307. $206 = $$3265 & 8;
  30308. $207 = ($206|0)==(0);
  30309. $or$cond283 = $207 | $205;
  30310. $208 = $$1236 >> 4;
  30311. $209 = (15950 + ($208)|0);
  30312. $$289 = $or$cond283 ? 15950 : $209;
  30313. $$290 = $or$cond283 ? 0 : 2;
  30314. $$0228 = $202;$$1233 = $$290;$$1238 = $$289;$$2256 = $$1255;$$4266 = $$3265;$248 = $197;$250 = $200;
  30315. label = 67;
  30316. }
  30317. else if ((label|0) == 66) {
  30318. label = 0;
  30319. $244 = (_fmt_u($242,$243,$11)|0);
  30320. $$0228 = $244;$$1233 = $$0232;$$1238 = $$0237;$$2256 = $$0254;$$4266 = $$1263$;$248 = $242;$250 = $243;
  30321. label = 67;
  30322. }
  30323. else if ((label|0) == 71) {
  30324. label = 0;
  30325. $272 = (_memchr($$1,0,$$0254)|0);
  30326. $273 = ($272|0)==(0|0);
  30327. $274 = $272;
  30328. $275 = $$1;
  30329. $276 = (($274) - ($275))|0;
  30330. $277 = (($$1) + ($$0254)|0);
  30331. $$3257 = $273 ? $$0254 : $276;
  30332. $$1250 = $273 ? $277 : $272;
  30333. $$2 = $$1;$$2234 = 0;$$2239 = 15950;$$2251 = $$1250;$$5 = $$3257;$$6268 = $164;
  30334. }
  30335. else if ((label|0) == 75) {
  30336. label = 0;
  30337. $$0229322 = $331;$$0240321 = 0;$$1244320 = 0;
  30338. while(1) {
  30339. $285 = HEAP32[$$0229322>>2]|0;
  30340. $286 = ($285|0)==(0);
  30341. if ($286) {
  30342. $$0240$lcssa = $$0240321;$$2245 = $$1244320;
  30343. break;
  30344. }
  30345. $287 = (_wctomb($9,$285)|0);
  30346. $288 = ($287|0)<(0);
  30347. $289 = (($$4258355) - ($$0240321))|0;
  30348. $290 = ($287>>>0)>($289>>>0);
  30349. $or$cond286 = $288 | $290;
  30350. if ($or$cond286) {
  30351. $$0240$lcssa = $$0240321;$$2245 = $287;
  30352. break;
  30353. }
  30354. $291 = ((($$0229322)) + 4|0);
  30355. $292 = (($287) + ($$0240321))|0;
  30356. $293 = ($$4258355>>>0)>($292>>>0);
  30357. if ($293) {
  30358. $$0229322 = $291;$$0240321 = $292;$$1244320 = $287;
  30359. } else {
  30360. $$0240$lcssa = $292;$$2245 = $287;
  30361. break;
  30362. }
  30363. }
  30364. $294 = ($$2245|0)<(0);
  30365. if ($294) {
  30366. $$0 = -1;
  30367. break L1;
  30368. }
  30369. _pad_674($0,32,$$1260,$$0240$lcssa,$$1263$);
  30370. $295 = ($$0240$lcssa|0)==(0);
  30371. if ($295) {
  30372. $$0240$lcssa357 = 0;
  30373. label = 84;
  30374. } else {
  30375. $$1230333 = $331;$$1241332 = 0;
  30376. while(1) {
  30377. $296 = HEAP32[$$1230333>>2]|0;
  30378. $297 = ($296|0)==(0);
  30379. if ($297) {
  30380. $$0240$lcssa357 = $$0240$lcssa;
  30381. label = 84;
  30382. break L95;
  30383. }
  30384. $298 = (_wctomb($9,$296)|0);
  30385. $299 = (($298) + ($$1241332))|0;
  30386. $300 = ($299|0)>($$0240$lcssa|0);
  30387. if ($300) {
  30388. $$0240$lcssa357 = $$0240$lcssa;
  30389. label = 84;
  30390. break L95;
  30391. }
  30392. $301 = ((($$1230333)) + 4|0);
  30393. _out($0,$9,$298);
  30394. $302 = ($299>>>0)<($$0240$lcssa>>>0);
  30395. if ($302) {
  30396. $$1230333 = $301;$$1241332 = $299;
  30397. } else {
  30398. $$0240$lcssa357 = $$0240$lcssa;
  30399. label = 84;
  30400. break;
  30401. }
  30402. }
  30403. }
  30404. }
  30405. } while(0);
  30406. if ((label|0) == 67) {
  30407. label = 0;
  30408. $245 = ($$2256|0)>(-1);
  30409. $246 = $$4266 & -65537;
  30410. $$$4266 = $245 ? $246 : $$4266;
  30411. $247 = ($248|0)!=(0);
  30412. $249 = ($250|0)!=(0);
  30413. $251 = $247 | $249;
  30414. $252 = ($$2256|0)!=(0);
  30415. $or$cond = $252 | $251;
  30416. $253 = $$0228;
  30417. $254 = (($12) - ($253))|0;
  30418. $255 = $251 ^ 1;
  30419. $256 = $255&1;
  30420. $257 = (($256) + ($254))|0;
  30421. $258 = ($$2256|0)>($257|0);
  30422. $$2256$ = $258 ? $$2256 : $257;
  30423. $$2256$$$2256 = $or$cond ? $$2256$ : $$2256;
  30424. $$0228$ = $or$cond ? $$0228 : $11;
  30425. $$2 = $$0228$;$$2234 = $$1233;$$2239 = $$1238;$$2251 = $11;$$5 = $$2256$$$2256;$$6268 = $$$4266;
  30426. }
  30427. else if ((label|0) == 84) {
  30428. label = 0;
  30429. $303 = $$1263$ ^ 8192;
  30430. _pad_674($0,32,$$1260,$$0240$lcssa357,$303);
  30431. $304 = ($$1260|0)>($$0240$lcssa357|0);
  30432. $305 = $304 ? $$1260 : $$0240$lcssa357;
  30433. $$0243 = $305;$$0247 = $$1248;$$0269 = $$3272;$21 = $132;
  30434. continue;
  30435. }
  30436. $308 = $$2251;
  30437. $309 = $$2;
  30438. $310 = (($308) - ($309))|0;
  30439. $311 = ($$5|0)<($310|0);
  30440. $$$5 = $311 ? $310 : $$5;
  30441. $312 = (($$$5) + ($$2234))|0;
  30442. $313 = ($$1260|0)<($312|0);
  30443. $$2261 = $313 ? $312 : $$1260;
  30444. _pad_674($0,32,$$2261,$312,$$6268);
  30445. _out($0,$$2239,$$2234);
  30446. $314 = $$6268 ^ 65536;
  30447. _pad_674($0,48,$$2261,$312,$314);
  30448. _pad_674($0,48,$$$5,$310,0);
  30449. _out($0,$$2,$310);
  30450. $315 = $$6268 ^ 8192;
  30451. _pad_674($0,32,$$2261,$312,$315);
  30452. $$0243 = $$2261;$$0247 = $$1248;$$0269 = $$3272;$21 = $132;
  30453. }
  30454. L114: do {
  30455. if ((label|0) == 87) {
  30456. $316 = ($0|0)==(0|0);
  30457. if ($316) {
  30458. $317 = ($$0269|0)==(0);
  30459. if ($317) {
  30460. $$0 = 0;
  30461. } else {
  30462. $$2242305 = 1;
  30463. while(1) {
  30464. $318 = (($4) + ($$2242305<<2)|0);
  30465. $319 = HEAP32[$318>>2]|0;
  30466. $320 = ($319|0)==(0);
  30467. if ($320) {
  30468. $$3303 = $$2242305;
  30469. break;
  30470. }
  30471. $321 = (($3) + ($$2242305<<3)|0);
  30472. _pop_arg($321,$319,$2);
  30473. $322 = (($$2242305) + 1)|0;
  30474. $323 = ($322|0)<(10);
  30475. if ($323) {
  30476. $$2242305 = $322;
  30477. } else {
  30478. $$0 = 1;
  30479. break L114;
  30480. }
  30481. }
  30482. while(1) {
  30483. $326 = (($4) + ($$3303<<2)|0);
  30484. $327 = HEAP32[$326>>2]|0;
  30485. $328 = ($327|0)==(0);
  30486. $325 = (($$3303) + 1)|0;
  30487. if (!($328)) {
  30488. $$0 = -1;
  30489. break L114;
  30490. }
  30491. $324 = ($325|0)<(10);
  30492. if ($324) {
  30493. $$3303 = $325;
  30494. } else {
  30495. $$0 = 1;
  30496. break;
  30497. }
  30498. }
  30499. }
  30500. } else {
  30501. $$0 = $$1248;
  30502. }
  30503. }
  30504. } while(0);
  30505. STACKTOP = sp;return ($$0|0);
  30506. }
  30507. function ___lockfile($0) {
  30508. $0 = $0|0;
  30509. var label = 0, sp = 0;
  30510. sp = STACKTOP;
  30511. return 0;
  30512. }
  30513. function ___unlockfile($0) {
  30514. $0 = $0|0;
  30515. var label = 0, sp = 0;
  30516. sp = STACKTOP;
  30517. return;
  30518. }
  30519. function _out($0,$1,$2) {
  30520. $0 = $0|0;
  30521. $1 = $1|0;
  30522. $2 = $2|0;
  30523. var $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0;
  30524. sp = STACKTOP;
  30525. $3 = HEAP32[$0>>2]|0;
  30526. $4 = $3 & 32;
  30527. $5 = ($4|0)==(0);
  30528. if ($5) {
  30529. (___fwritex($1,$2,$0)|0);
  30530. }
  30531. return;
  30532. }
  30533. function _getint($0) {
  30534. $0 = $0|0;
  30535. var $$0$lcssa = 0, $$06 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $isdigit = 0, $isdigit5 = 0, $isdigittmp = 0, $isdigittmp4 = 0, $isdigittmp7 = 0, label = 0, sp = 0;
  30536. sp = STACKTOP;
  30537. $1 = HEAP32[$0>>2]|0;
  30538. $2 = HEAP8[$1>>0]|0;
  30539. $3 = $2 << 24 >> 24;
  30540. $isdigittmp4 = (($3) + -48)|0;
  30541. $isdigit5 = ($isdigittmp4>>>0)<(10);
  30542. if ($isdigit5) {
  30543. $$06 = 0;$7 = $1;$isdigittmp7 = $isdigittmp4;
  30544. while(1) {
  30545. $4 = ($$06*10)|0;
  30546. $5 = (($isdigittmp7) + ($4))|0;
  30547. $6 = ((($7)) + 1|0);
  30548. HEAP32[$0>>2] = $6;
  30549. $8 = HEAP8[$6>>0]|0;
  30550. $9 = $8 << 24 >> 24;
  30551. $isdigittmp = (($9) + -48)|0;
  30552. $isdigit = ($isdigittmp>>>0)<(10);
  30553. if ($isdigit) {
  30554. $$06 = $5;$7 = $6;$isdigittmp7 = $isdigittmp;
  30555. } else {
  30556. $$0$lcssa = $5;
  30557. break;
  30558. }
  30559. }
  30560. } else {
  30561. $$0$lcssa = 0;
  30562. }
  30563. return ($$0$lcssa|0);
  30564. }
  30565. function _pop_arg($0,$1,$2) {
  30566. $0 = $0|0;
  30567. $1 = $1|0;
  30568. $2 = $2|0;
  30569. var $$mask = 0, $$mask31 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0.0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0;
  30570. var $116 = 0.0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0;
  30571. var $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0;
  30572. var $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0;
  30573. var $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0;
  30574. var $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $arglist_current = 0, $arglist_current11 = 0, $arglist_current14 = 0, $arglist_current17 = 0;
  30575. var $arglist_current2 = 0, $arglist_current20 = 0, $arglist_current23 = 0, $arglist_current26 = 0, $arglist_current5 = 0, $arglist_current8 = 0, $arglist_next = 0, $arglist_next12 = 0, $arglist_next15 = 0, $arglist_next18 = 0, $arglist_next21 = 0, $arglist_next24 = 0, $arglist_next27 = 0, $arglist_next3 = 0, $arglist_next6 = 0, $arglist_next9 = 0, $expanded = 0, $expanded28 = 0, $expanded30 = 0, $expanded31 = 0;
  30576. var $expanded32 = 0, $expanded34 = 0, $expanded35 = 0, $expanded37 = 0, $expanded38 = 0, $expanded39 = 0, $expanded41 = 0, $expanded42 = 0, $expanded44 = 0, $expanded45 = 0, $expanded46 = 0, $expanded48 = 0, $expanded49 = 0, $expanded51 = 0, $expanded52 = 0, $expanded53 = 0, $expanded55 = 0, $expanded56 = 0, $expanded58 = 0, $expanded59 = 0;
  30577. var $expanded60 = 0, $expanded62 = 0, $expanded63 = 0, $expanded65 = 0, $expanded66 = 0, $expanded67 = 0, $expanded69 = 0, $expanded70 = 0, $expanded72 = 0, $expanded73 = 0, $expanded74 = 0, $expanded76 = 0, $expanded77 = 0, $expanded79 = 0, $expanded80 = 0, $expanded81 = 0, $expanded83 = 0, $expanded84 = 0, $expanded86 = 0, $expanded87 = 0;
  30578. var $expanded88 = 0, $expanded90 = 0, $expanded91 = 0, $expanded93 = 0, $expanded94 = 0, $expanded95 = 0, label = 0, sp = 0;
  30579. sp = STACKTOP;
  30580. $3 = ($1>>>0)>(20);
  30581. L1: do {
  30582. if (!($3)) {
  30583. do {
  30584. switch ($1|0) {
  30585. case 9: {
  30586. $arglist_current = HEAP32[$2>>2]|0;
  30587. $4 = $arglist_current;
  30588. $5 = ((0) + 4|0);
  30589. $expanded28 = $5;
  30590. $expanded = (($expanded28) - 1)|0;
  30591. $6 = (($4) + ($expanded))|0;
  30592. $7 = ((0) + 4|0);
  30593. $expanded32 = $7;
  30594. $expanded31 = (($expanded32) - 1)|0;
  30595. $expanded30 = $expanded31 ^ -1;
  30596. $8 = $6 & $expanded30;
  30597. $9 = $8;
  30598. $10 = HEAP32[$9>>2]|0;
  30599. $arglist_next = ((($9)) + 4|0);
  30600. HEAP32[$2>>2] = $arglist_next;
  30601. HEAP32[$0>>2] = $10;
  30602. break L1;
  30603. break;
  30604. }
  30605. case 10: {
  30606. $arglist_current2 = HEAP32[$2>>2]|0;
  30607. $11 = $arglist_current2;
  30608. $12 = ((0) + 4|0);
  30609. $expanded35 = $12;
  30610. $expanded34 = (($expanded35) - 1)|0;
  30611. $13 = (($11) + ($expanded34))|0;
  30612. $14 = ((0) + 4|0);
  30613. $expanded39 = $14;
  30614. $expanded38 = (($expanded39) - 1)|0;
  30615. $expanded37 = $expanded38 ^ -1;
  30616. $15 = $13 & $expanded37;
  30617. $16 = $15;
  30618. $17 = HEAP32[$16>>2]|0;
  30619. $arglist_next3 = ((($16)) + 4|0);
  30620. HEAP32[$2>>2] = $arglist_next3;
  30621. $18 = ($17|0)<(0);
  30622. $19 = $18 << 31 >> 31;
  30623. $20 = $0;
  30624. $21 = $20;
  30625. HEAP32[$21>>2] = $17;
  30626. $22 = (($20) + 4)|0;
  30627. $23 = $22;
  30628. HEAP32[$23>>2] = $19;
  30629. break L1;
  30630. break;
  30631. }
  30632. case 11: {
  30633. $arglist_current5 = HEAP32[$2>>2]|0;
  30634. $24 = $arglist_current5;
  30635. $25 = ((0) + 4|0);
  30636. $expanded42 = $25;
  30637. $expanded41 = (($expanded42) - 1)|0;
  30638. $26 = (($24) + ($expanded41))|0;
  30639. $27 = ((0) + 4|0);
  30640. $expanded46 = $27;
  30641. $expanded45 = (($expanded46) - 1)|0;
  30642. $expanded44 = $expanded45 ^ -1;
  30643. $28 = $26 & $expanded44;
  30644. $29 = $28;
  30645. $30 = HEAP32[$29>>2]|0;
  30646. $arglist_next6 = ((($29)) + 4|0);
  30647. HEAP32[$2>>2] = $arglist_next6;
  30648. $31 = $0;
  30649. $32 = $31;
  30650. HEAP32[$32>>2] = $30;
  30651. $33 = (($31) + 4)|0;
  30652. $34 = $33;
  30653. HEAP32[$34>>2] = 0;
  30654. break L1;
  30655. break;
  30656. }
  30657. case 12: {
  30658. $arglist_current8 = HEAP32[$2>>2]|0;
  30659. $35 = $arglist_current8;
  30660. $36 = ((0) + 8|0);
  30661. $expanded49 = $36;
  30662. $expanded48 = (($expanded49) - 1)|0;
  30663. $37 = (($35) + ($expanded48))|0;
  30664. $38 = ((0) + 8|0);
  30665. $expanded53 = $38;
  30666. $expanded52 = (($expanded53) - 1)|0;
  30667. $expanded51 = $expanded52 ^ -1;
  30668. $39 = $37 & $expanded51;
  30669. $40 = $39;
  30670. $41 = $40;
  30671. $42 = $41;
  30672. $43 = HEAP32[$42>>2]|0;
  30673. $44 = (($41) + 4)|0;
  30674. $45 = $44;
  30675. $46 = HEAP32[$45>>2]|0;
  30676. $arglist_next9 = ((($40)) + 8|0);
  30677. HEAP32[$2>>2] = $arglist_next9;
  30678. $47 = $0;
  30679. $48 = $47;
  30680. HEAP32[$48>>2] = $43;
  30681. $49 = (($47) + 4)|0;
  30682. $50 = $49;
  30683. HEAP32[$50>>2] = $46;
  30684. break L1;
  30685. break;
  30686. }
  30687. case 13: {
  30688. $arglist_current11 = HEAP32[$2>>2]|0;
  30689. $51 = $arglist_current11;
  30690. $52 = ((0) + 4|0);
  30691. $expanded56 = $52;
  30692. $expanded55 = (($expanded56) - 1)|0;
  30693. $53 = (($51) + ($expanded55))|0;
  30694. $54 = ((0) + 4|0);
  30695. $expanded60 = $54;
  30696. $expanded59 = (($expanded60) - 1)|0;
  30697. $expanded58 = $expanded59 ^ -1;
  30698. $55 = $53 & $expanded58;
  30699. $56 = $55;
  30700. $57 = HEAP32[$56>>2]|0;
  30701. $arglist_next12 = ((($56)) + 4|0);
  30702. HEAP32[$2>>2] = $arglist_next12;
  30703. $58 = $57&65535;
  30704. $59 = $58 << 16 >> 16;
  30705. $60 = ($59|0)<(0);
  30706. $61 = $60 << 31 >> 31;
  30707. $62 = $0;
  30708. $63 = $62;
  30709. HEAP32[$63>>2] = $59;
  30710. $64 = (($62) + 4)|0;
  30711. $65 = $64;
  30712. HEAP32[$65>>2] = $61;
  30713. break L1;
  30714. break;
  30715. }
  30716. case 14: {
  30717. $arglist_current14 = HEAP32[$2>>2]|0;
  30718. $66 = $arglist_current14;
  30719. $67 = ((0) + 4|0);
  30720. $expanded63 = $67;
  30721. $expanded62 = (($expanded63) - 1)|0;
  30722. $68 = (($66) + ($expanded62))|0;
  30723. $69 = ((0) + 4|0);
  30724. $expanded67 = $69;
  30725. $expanded66 = (($expanded67) - 1)|0;
  30726. $expanded65 = $expanded66 ^ -1;
  30727. $70 = $68 & $expanded65;
  30728. $71 = $70;
  30729. $72 = HEAP32[$71>>2]|0;
  30730. $arglist_next15 = ((($71)) + 4|0);
  30731. HEAP32[$2>>2] = $arglist_next15;
  30732. $$mask31 = $72 & 65535;
  30733. $73 = $0;
  30734. $74 = $73;
  30735. HEAP32[$74>>2] = $$mask31;
  30736. $75 = (($73) + 4)|0;
  30737. $76 = $75;
  30738. HEAP32[$76>>2] = 0;
  30739. break L1;
  30740. break;
  30741. }
  30742. case 15: {
  30743. $arglist_current17 = HEAP32[$2>>2]|0;
  30744. $77 = $arglist_current17;
  30745. $78 = ((0) + 4|0);
  30746. $expanded70 = $78;
  30747. $expanded69 = (($expanded70) - 1)|0;
  30748. $79 = (($77) + ($expanded69))|0;
  30749. $80 = ((0) + 4|0);
  30750. $expanded74 = $80;
  30751. $expanded73 = (($expanded74) - 1)|0;
  30752. $expanded72 = $expanded73 ^ -1;
  30753. $81 = $79 & $expanded72;
  30754. $82 = $81;
  30755. $83 = HEAP32[$82>>2]|0;
  30756. $arglist_next18 = ((($82)) + 4|0);
  30757. HEAP32[$2>>2] = $arglist_next18;
  30758. $84 = $83&255;
  30759. $85 = $84 << 24 >> 24;
  30760. $86 = ($85|0)<(0);
  30761. $87 = $86 << 31 >> 31;
  30762. $88 = $0;
  30763. $89 = $88;
  30764. HEAP32[$89>>2] = $85;
  30765. $90 = (($88) + 4)|0;
  30766. $91 = $90;
  30767. HEAP32[$91>>2] = $87;
  30768. break L1;
  30769. break;
  30770. }
  30771. case 16: {
  30772. $arglist_current20 = HEAP32[$2>>2]|0;
  30773. $92 = $arglist_current20;
  30774. $93 = ((0) + 4|0);
  30775. $expanded77 = $93;
  30776. $expanded76 = (($expanded77) - 1)|0;
  30777. $94 = (($92) + ($expanded76))|0;
  30778. $95 = ((0) + 4|0);
  30779. $expanded81 = $95;
  30780. $expanded80 = (($expanded81) - 1)|0;
  30781. $expanded79 = $expanded80 ^ -1;
  30782. $96 = $94 & $expanded79;
  30783. $97 = $96;
  30784. $98 = HEAP32[$97>>2]|0;
  30785. $arglist_next21 = ((($97)) + 4|0);
  30786. HEAP32[$2>>2] = $arglist_next21;
  30787. $$mask = $98 & 255;
  30788. $99 = $0;
  30789. $100 = $99;
  30790. HEAP32[$100>>2] = $$mask;
  30791. $101 = (($99) + 4)|0;
  30792. $102 = $101;
  30793. HEAP32[$102>>2] = 0;
  30794. break L1;
  30795. break;
  30796. }
  30797. case 17: {
  30798. $arglist_current23 = HEAP32[$2>>2]|0;
  30799. $103 = $arglist_current23;
  30800. $104 = ((0) + 8|0);
  30801. $expanded84 = $104;
  30802. $expanded83 = (($expanded84) - 1)|0;
  30803. $105 = (($103) + ($expanded83))|0;
  30804. $106 = ((0) + 8|0);
  30805. $expanded88 = $106;
  30806. $expanded87 = (($expanded88) - 1)|0;
  30807. $expanded86 = $expanded87 ^ -1;
  30808. $107 = $105 & $expanded86;
  30809. $108 = $107;
  30810. $109 = +HEAPF64[$108>>3];
  30811. $arglist_next24 = ((($108)) + 8|0);
  30812. HEAP32[$2>>2] = $arglist_next24;
  30813. HEAPF64[$0>>3] = $109;
  30814. break L1;
  30815. break;
  30816. }
  30817. case 18: {
  30818. $arglist_current26 = HEAP32[$2>>2]|0;
  30819. $110 = $arglist_current26;
  30820. $111 = ((0) + 8|0);
  30821. $expanded91 = $111;
  30822. $expanded90 = (($expanded91) - 1)|0;
  30823. $112 = (($110) + ($expanded90))|0;
  30824. $113 = ((0) + 8|0);
  30825. $expanded95 = $113;
  30826. $expanded94 = (($expanded95) - 1)|0;
  30827. $expanded93 = $expanded94 ^ -1;
  30828. $114 = $112 & $expanded93;
  30829. $115 = $114;
  30830. $116 = +HEAPF64[$115>>3];
  30831. $arglist_next27 = ((($115)) + 8|0);
  30832. HEAP32[$2>>2] = $arglist_next27;
  30833. HEAPF64[$0>>3] = $116;
  30834. break L1;
  30835. break;
  30836. }
  30837. default: {
  30838. break L1;
  30839. }
  30840. }
  30841. } while(0);
  30842. }
  30843. } while(0);
  30844. return;
  30845. }
  30846. function _fmt_x($0,$1,$2,$3) {
  30847. $0 = $0|0;
  30848. $1 = $1|0;
  30849. $2 = $2|0;
  30850. $3 = $3|0;
  30851. var $$05$lcssa = 0, $$056 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0;
  30852. var sp = 0;
  30853. sp = STACKTOP;
  30854. $4 = ($0|0)==(0);
  30855. $5 = ($1|0)==(0);
  30856. $6 = $4 & $5;
  30857. if ($6) {
  30858. $$05$lcssa = $2;
  30859. } else {
  30860. $$056 = $2;$15 = $1;$8 = $0;
  30861. while(1) {
  30862. $7 = $8 & 15;
  30863. $9 = (15998 + ($7)|0);
  30864. $10 = HEAP8[$9>>0]|0;
  30865. $11 = $10&255;
  30866. $12 = $11 | $3;
  30867. $13 = $12&255;
  30868. $14 = ((($$056)) + -1|0);
  30869. HEAP8[$14>>0] = $13;
  30870. $16 = (_bitshift64Lshr(($8|0),($15|0),4)|0);
  30871. $17 = tempRet0;
  30872. $18 = ($16|0)==(0);
  30873. $19 = ($17|0)==(0);
  30874. $20 = $18 & $19;
  30875. if ($20) {
  30876. $$05$lcssa = $14;
  30877. break;
  30878. } else {
  30879. $$056 = $14;$15 = $17;$8 = $16;
  30880. }
  30881. }
  30882. }
  30883. return ($$05$lcssa|0);
  30884. }
  30885. function _fmt_o($0,$1,$2) {
  30886. $0 = $0|0;
  30887. $1 = $1|0;
  30888. $2 = $2|0;
  30889. var $$0$lcssa = 0, $$06 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
  30890. sp = STACKTOP;
  30891. $3 = ($0|0)==(0);
  30892. $4 = ($1|0)==(0);
  30893. $5 = $3 & $4;
  30894. if ($5) {
  30895. $$0$lcssa = $2;
  30896. } else {
  30897. $$06 = $2;$11 = $1;$7 = $0;
  30898. while(1) {
  30899. $6 = $7&255;
  30900. $8 = $6 & 7;
  30901. $9 = $8 | 48;
  30902. $10 = ((($$06)) + -1|0);
  30903. HEAP8[$10>>0] = $9;
  30904. $12 = (_bitshift64Lshr(($7|0),($11|0),3)|0);
  30905. $13 = tempRet0;
  30906. $14 = ($12|0)==(0);
  30907. $15 = ($13|0)==(0);
  30908. $16 = $14 & $15;
  30909. if ($16) {
  30910. $$0$lcssa = $10;
  30911. break;
  30912. } else {
  30913. $$06 = $10;$11 = $13;$7 = $12;
  30914. }
  30915. }
  30916. }
  30917. return ($$0$lcssa|0);
  30918. }
  30919. function _fmt_u($0,$1,$2) {
  30920. $0 = $0|0;
  30921. $1 = $1|0;
  30922. $2 = $2|0;
  30923. var $$010$lcssa$off0 = 0, $$012 = 0, $$09$lcssa = 0, $$0914 = 0, $$1$lcssa = 0, $$111 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0;
  30924. var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
  30925. sp = STACKTOP;
  30926. $3 = ($1>>>0)>(0);
  30927. $4 = ($0>>>0)>(4294967295);
  30928. $5 = ($1|0)==(0);
  30929. $6 = $5 & $4;
  30930. $7 = $3 | $6;
  30931. if ($7) {
  30932. $$0914 = $2;$8 = $0;$9 = $1;
  30933. while(1) {
  30934. $10 = (___uremdi3(($8|0),($9|0),10,0)|0);
  30935. $11 = tempRet0;
  30936. $12 = $10&255;
  30937. $13 = $12 | 48;
  30938. $14 = ((($$0914)) + -1|0);
  30939. HEAP8[$14>>0] = $13;
  30940. $15 = (___udivdi3(($8|0),($9|0),10,0)|0);
  30941. $16 = tempRet0;
  30942. $17 = ($9>>>0)>(9);
  30943. $18 = ($8>>>0)>(4294967295);
  30944. $19 = ($9|0)==(9);
  30945. $20 = $19 & $18;
  30946. $21 = $17 | $20;
  30947. if ($21) {
  30948. $$0914 = $14;$8 = $15;$9 = $16;
  30949. } else {
  30950. break;
  30951. }
  30952. }
  30953. $$010$lcssa$off0 = $15;$$09$lcssa = $14;
  30954. } else {
  30955. $$010$lcssa$off0 = $0;$$09$lcssa = $2;
  30956. }
  30957. $22 = ($$010$lcssa$off0|0)==(0);
  30958. if ($22) {
  30959. $$1$lcssa = $$09$lcssa;
  30960. } else {
  30961. $$012 = $$010$lcssa$off0;$$111 = $$09$lcssa;
  30962. while(1) {
  30963. $23 = (($$012>>>0) % 10)&-1;
  30964. $24 = $23 | 48;
  30965. $25 = $24&255;
  30966. $26 = ((($$111)) + -1|0);
  30967. HEAP8[$26>>0] = $25;
  30968. $27 = (($$012>>>0) / 10)&-1;
  30969. $28 = ($$012>>>0)<(10);
  30970. if ($28) {
  30971. $$1$lcssa = $26;
  30972. break;
  30973. } else {
  30974. $$012 = $27;$$111 = $26;
  30975. }
  30976. }
  30977. }
  30978. return ($$1$lcssa|0);
  30979. }
  30980. function _strerror($0) {
  30981. $0 = $0|0;
  30982. var $1 = 0, $2 = 0, $3 = 0, $4 = 0, label = 0, sp = 0;
  30983. sp = STACKTOP;
  30984. $1 = (___pthread_self_105()|0);
  30985. $2 = ((($1)) + 188|0);
  30986. $3 = HEAP32[$2>>2]|0;
  30987. $4 = (___strerror_l($0,$3)|0);
  30988. return ($4|0);
  30989. }
  30990. function _memchr($0,$1,$2) {
  30991. $0 = $0|0;
  30992. $1 = $1|0;
  30993. $2 = $2|0;
  30994. var $$0$lcssa = 0, $$035$lcssa = 0, $$035$lcssa65 = 0, $$03555 = 0, $$036$lcssa = 0, $$036$lcssa64 = 0, $$03654 = 0, $$046 = 0, $$137$lcssa = 0, $$13745 = 0, $$140 = 0, $$2 = 0, $$23839 = 0, $$3 = 0, $$lcssa = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0;
  30995. var $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0;
  30996. var $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond53 = 0, label = 0, sp = 0;
  30997. sp = STACKTOP;
  30998. $3 = $1 & 255;
  30999. $4 = $0;
  31000. $5 = $4 & 3;
  31001. $6 = ($5|0)!=(0);
  31002. $7 = ($2|0)!=(0);
  31003. $or$cond53 = $7 & $6;
  31004. L1: do {
  31005. if ($or$cond53) {
  31006. $8 = $1&255;
  31007. $$03555 = $0;$$03654 = $2;
  31008. while(1) {
  31009. $9 = HEAP8[$$03555>>0]|0;
  31010. $10 = ($9<<24>>24)==($8<<24>>24);
  31011. if ($10) {
  31012. $$035$lcssa65 = $$03555;$$036$lcssa64 = $$03654;
  31013. label = 6;
  31014. break L1;
  31015. }
  31016. $11 = ((($$03555)) + 1|0);
  31017. $12 = (($$03654) + -1)|0;
  31018. $13 = $11;
  31019. $14 = $13 & 3;
  31020. $15 = ($14|0)!=(0);
  31021. $16 = ($12|0)!=(0);
  31022. $or$cond = $16 & $15;
  31023. if ($or$cond) {
  31024. $$03555 = $11;$$03654 = $12;
  31025. } else {
  31026. $$035$lcssa = $11;$$036$lcssa = $12;$$lcssa = $16;
  31027. label = 5;
  31028. break;
  31029. }
  31030. }
  31031. } else {
  31032. $$035$lcssa = $0;$$036$lcssa = $2;$$lcssa = $7;
  31033. label = 5;
  31034. }
  31035. } while(0);
  31036. if ((label|0) == 5) {
  31037. if ($$lcssa) {
  31038. $$035$lcssa65 = $$035$lcssa;$$036$lcssa64 = $$036$lcssa;
  31039. label = 6;
  31040. } else {
  31041. $$2 = $$035$lcssa;$$3 = 0;
  31042. }
  31043. }
  31044. L8: do {
  31045. if ((label|0) == 6) {
  31046. $17 = HEAP8[$$035$lcssa65>>0]|0;
  31047. $18 = $1&255;
  31048. $19 = ($17<<24>>24)==($18<<24>>24);
  31049. if ($19) {
  31050. $$2 = $$035$lcssa65;$$3 = $$036$lcssa64;
  31051. } else {
  31052. $20 = Math_imul($3, 16843009)|0;
  31053. $21 = ($$036$lcssa64>>>0)>(3);
  31054. L11: do {
  31055. if ($21) {
  31056. $$046 = $$035$lcssa65;$$13745 = $$036$lcssa64;
  31057. while(1) {
  31058. $22 = HEAP32[$$046>>2]|0;
  31059. $23 = $22 ^ $20;
  31060. $24 = (($23) + -16843009)|0;
  31061. $25 = $23 & -2139062144;
  31062. $26 = $25 ^ -2139062144;
  31063. $27 = $26 & $24;
  31064. $28 = ($27|0)==(0);
  31065. if (!($28)) {
  31066. break;
  31067. }
  31068. $29 = ((($$046)) + 4|0);
  31069. $30 = (($$13745) + -4)|0;
  31070. $31 = ($30>>>0)>(3);
  31071. if ($31) {
  31072. $$046 = $29;$$13745 = $30;
  31073. } else {
  31074. $$0$lcssa = $29;$$137$lcssa = $30;
  31075. label = 11;
  31076. break L11;
  31077. }
  31078. }
  31079. $$140 = $$046;$$23839 = $$13745;
  31080. } else {
  31081. $$0$lcssa = $$035$lcssa65;$$137$lcssa = $$036$lcssa64;
  31082. label = 11;
  31083. }
  31084. } while(0);
  31085. if ((label|0) == 11) {
  31086. $32 = ($$137$lcssa|0)==(0);
  31087. if ($32) {
  31088. $$2 = $$0$lcssa;$$3 = 0;
  31089. break;
  31090. } else {
  31091. $$140 = $$0$lcssa;$$23839 = $$137$lcssa;
  31092. }
  31093. }
  31094. while(1) {
  31095. $33 = HEAP8[$$140>>0]|0;
  31096. $34 = ($33<<24>>24)==($18<<24>>24);
  31097. if ($34) {
  31098. $$2 = $$140;$$3 = $$23839;
  31099. break L8;
  31100. }
  31101. $35 = ((($$140)) + 1|0);
  31102. $36 = (($$23839) + -1)|0;
  31103. $37 = ($36|0)==(0);
  31104. if ($37) {
  31105. $$2 = $35;$$3 = 0;
  31106. break;
  31107. } else {
  31108. $$140 = $35;$$23839 = $36;
  31109. }
  31110. }
  31111. }
  31112. }
  31113. } while(0);
  31114. $38 = ($$3|0)!=(0);
  31115. $39 = $38 ? $$2 : 0;
  31116. return ($39|0);
  31117. }
  31118. function _pad_674($0,$1,$2,$3,$4) {
  31119. $0 = $0|0;
  31120. $1 = $1|0;
  31121. $2 = $2|0;
  31122. $3 = $3|0;
  31123. $4 = $4|0;
  31124. var $$0$lcssa = 0, $$011 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, label = 0, sp = 0;
  31125. sp = STACKTOP;
  31126. STACKTOP = STACKTOP + 256|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(256|0);
  31127. $5 = sp;
  31128. $6 = $4 & 73728;
  31129. $7 = ($6|0)==(0);
  31130. $8 = ($2|0)>($3|0);
  31131. $or$cond = $8 & $7;
  31132. if ($or$cond) {
  31133. $9 = (($2) - ($3))|0;
  31134. $10 = ($9>>>0)<(256);
  31135. $11 = $10 ? $9 : 256;
  31136. _memset(($5|0),($1|0),($11|0))|0;
  31137. $12 = ($9>>>0)>(255);
  31138. if ($12) {
  31139. $13 = (($2) - ($3))|0;
  31140. $$011 = $9;
  31141. while(1) {
  31142. _out($0,$5,256);
  31143. $14 = (($$011) + -256)|0;
  31144. $15 = ($14>>>0)>(255);
  31145. if ($15) {
  31146. $$011 = $14;
  31147. } else {
  31148. break;
  31149. }
  31150. }
  31151. $16 = $13 & 255;
  31152. $$0$lcssa = $16;
  31153. } else {
  31154. $$0$lcssa = $9;
  31155. }
  31156. _out($0,$5,$$0$lcssa);
  31157. }
  31158. STACKTOP = sp;return;
  31159. }
  31160. function _wctomb($0,$1) {
  31161. $0 = $0|0;
  31162. $1 = $1|0;
  31163. var $$0 = 0, $2 = 0, $3 = 0, label = 0, sp = 0;
  31164. sp = STACKTOP;
  31165. $2 = ($0|0)==(0|0);
  31166. if ($2) {
  31167. $$0 = 0;
  31168. } else {
  31169. $3 = (_wcrtomb($0,$1,0)|0);
  31170. $$0 = $3;
  31171. }
  31172. return ($$0|0);
  31173. }
  31174. function _fmt_fp($0,$1,$2,$3,$4,$5) {
  31175. $0 = $0|0;
  31176. $1 = +$1;
  31177. $2 = $2|0;
  31178. $3 = $3|0;
  31179. $4 = $4|0;
  31180. $5 = $5|0;
  31181. var $$ = 0, $$$ = 0, $$$$559 = 0.0, $$$3484 = 0, $$$3484691 = 0, $$$3484692 = 0, $$$3501 = 0, $$$4502 = 0, $$$542 = 0.0, $$$559 = 0.0, $$0 = 0, $$0463$lcssa = 0, $$0463584 = 0, $$0464594 = 0, $$0471 = 0.0, $$0479 = 0, $$0487642 = 0, $$0488 = 0, $$0488653 = 0, $$0488655 = 0;
  31182. var $$0496$$9 = 0, $$0497654 = 0, $$0498 = 0, $$0509582 = 0.0, $$0510 = 0, $$0511 = 0, $$0514637 = 0, $$0520 = 0, $$0521 = 0, $$0521$ = 0, $$0523 = 0, $$0525 = 0, $$0527 = 0, $$0527629 = 0, $$0527631 = 0, $$0530636 = 0, $$1465 = 0, $$1467 = 0.0, $$1469 = 0.0, $$1472 = 0.0;
  31183. var $$1480 = 0, $$1482$lcssa = 0, $$1482661 = 0, $$1489641 = 0, $$1499$lcssa = 0, $$1499660 = 0, $$1508583 = 0, $$1512$lcssa = 0, $$1512607 = 0, $$1515 = 0, $$1524 = 0, $$1526 = 0, $$1528614 = 0, $$1531$lcssa = 0, $$1531630 = 0, $$1598 = 0, $$2 = 0, $$2473 = 0.0, $$2476 = 0, $$2476$$547 = 0;
  31184. var $$2476$$549 = 0, $$2483$ph = 0, $$2500 = 0, $$2513 = 0, $$2516618 = 0, $$2529 = 0, $$2532617 = 0, $$3 = 0.0, $$3477 = 0, $$3484$lcssa = 0, $$3484648 = 0, $$3501$lcssa = 0, $$3501647 = 0, $$3533613 = 0, $$4 = 0.0, $$4478$lcssa = 0, $$4478590 = 0, $$4492 = 0, $$4502 = 0, $$4518 = 0;
  31185. var $$5$lcssa = 0, $$534$ = 0, $$539 = 0, $$539$ = 0, $$542 = 0.0, $$546 = 0, $$548 = 0, $$5486$lcssa = 0, $$5486623 = 0, $$5493597 = 0, $$5519$ph = 0, $$555 = 0, $$556 = 0, $$559 = 0.0, $$5602 = 0, $$6 = 0, $$6494589 = 0, $$7495601 = 0, $$7505 = 0, $$7505$ = 0;
  31186. var $$7505$ph = 0, $$8 = 0, $$9$ph = 0, $$lcssa673 = 0, $$neg = 0, $$neg567 = 0, $$pn = 0, $$pn566 = 0, $$pr = 0, $$pr564 = 0, $$pre = 0, $$pre$phi690Z2D = 0, $$pre689 = 0, $$sink545$lcssa = 0, $$sink545622 = 0, $$sink562 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0;
  31187. var $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0.0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0.0, $117 = 0.0, $118 = 0.0, $119 = 0, $12 = 0, $120 = 0;
  31188. var $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0;
  31189. var $14 = 0.0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0;
  31190. var $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0;
  31191. var $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0;
  31192. var $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0;
  31193. var $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0.0, $229 = 0.0, $23 = 0;
  31194. var $230 = 0, $231 = 0.0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0;
  31195. var $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0;
  31196. var $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0;
  31197. var $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0;
  31198. var $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0, $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0;
  31199. var $321 = 0, $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0, $332 = 0, $333 = 0, $334 = 0, $335 = 0, $336 = 0, $337 = 0, $338 = 0, $339 = 0;
  31200. var $34 = 0, $340 = 0, $341 = 0, $342 = 0, $343 = 0, $344 = 0, $345 = 0, $346 = 0, $347 = 0, $348 = 0, $349 = 0, $35 = 0.0, $350 = 0, $351 = 0, $352 = 0, $353 = 0, $354 = 0, $355 = 0, $356 = 0, $357 = 0;
  31201. var $358 = 0, $359 = 0, $36 = 0.0, $360 = 0, $361 = 0, $362 = 0, $363 = 0, $364 = 0, $365 = 0, $366 = 0, $367 = 0, $368 = 0, $369 = 0, $37 = 0, $370 = 0, $371 = 0, $372 = 0, $373 = 0, $374 = 0, $375 = 0;
  31202. var $376 = 0, $377 = 0, $378 = 0, $379 = 0, $38 = 0, $380 = 0, $381 = 0, $382 = 0, $383 = 0, $384 = 0, $385 = 0, $386 = 0, $387 = 0, $388 = 0, $39 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
  31203. var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $50 = 0, $51 = 0.0, $52 = 0, $53 = 0, $54 = 0, $55 = 0.0, $56 = 0.0, $57 = 0.0, $58 = 0.0, $59 = 0.0, $6 = 0, $60 = 0.0, $61 = 0, $62 = 0, $63 = 0;
  31204. var $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0;
  31205. var $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0.0, $88 = 0.0, $89 = 0.0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $exitcond = 0;
  31206. var $narrow = 0, $not$ = 0, $notlhs = 0, $notrhs = 0, $or$cond = 0, $or$cond3$not = 0, $or$cond537 = 0, $or$cond541 = 0, $or$cond544 = 0, $or$cond554 = 0, $or$cond6 = 0, $scevgep684 = 0, $scevgep684685 = 0, label = 0, sp = 0;
  31207. sp = STACKTOP;
  31208. STACKTOP = STACKTOP + 560|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(560|0);
  31209. $6 = sp + 8|0;
  31210. $7 = sp;
  31211. $8 = sp + 524|0;
  31212. $9 = $8;
  31213. $10 = sp + 512|0;
  31214. HEAP32[$7>>2] = 0;
  31215. $11 = ((($10)) + 12|0);
  31216. (___DOUBLE_BITS_675($1)|0);
  31217. $12 = tempRet0;
  31218. $13 = ($12|0)<(0);
  31219. if ($13) {
  31220. $14 = -$1;
  31221. $$0471 = $14;$$0520 = 1;$$0521 = 15967;
  31222. } else {
  31223. $15 = $4 & 2048;
  31224. $16 = ($15|0)==(0);
  31225. $17 = $4 & 1;
  31226. $18 = ($17|0)==(0);
  31227. $$ = $18 ? (15968) : (15973);
  31228. $$$ = $16 ? $$ : (15970);
  31229. $19 = $4 & 2049;
  31230. $narrow = ($19|0)!=(0);
  31231. $$534$ = $narrow&1;
  31232. $$0471 = $1;$$0520 = $$534$;$$0521 = $$$;
  31233. }
  31234. (___DOUBLE_BITS_675($$0471)|0);
  31235. $20 = tempRet0;
  31236. $21 = $20 & 2146435072;
  31237. $22 = ($21>>>0)<(2146435072);
  31238. $23 = (0)<(0);
  31239. $24 = ($21|0)==(2146435072);
  31240. $25 = $24 & $23;
  31241. $26 = $22 | $25;
  31242. do {
  31243. if ($26) {
  31244. $35 = (+_frexpl($$0471,$7));
  31245. $36 = $35 * 2.0;
  31246. $37 = $36 != 0.0;
  31247. if ($37) {
  31248. $38 = HEAP32[$7>>2]|0;
  31249. $39 = (($38) + -1)|0;
  31250. HEAP32[$7>>2] = $39;
  31251. }
  31252. $40 = $5 | 32;
  31253. $41 = ($40|0)==(97);
  31254. if ($41) {
  31255. $42 = $5 & 32;
  31256. $43 = ($42|0)==(0);
  31257. $44 = ((($$0521)) + 9|0);
  31258. $$0521$ = $43 ? $$0521 : $44;
  31259. $45 = $$0520 | 2;
  31260. $46 = ($3>>>0)>(11);
  31261. $47 = (12 - ($3))|0;
  31262. $48 = ($47|0)==(0);
  31263. $49 = $46 | $48;
  31264. do {
  31265. if ($49) {
  31266. $$1472 = $36;
  31267. } else {
  31268. $$0509582 = 8.0;$$1508583 = $47;
  31269. while(1) {
  31270. $50 = (($$1508583) + -1)|0;
  31271. $51 = $$0509582 * 16.0;
  31272. $52 = ($50|0)==(0);
  31273. if ($52) {
  31274. break;
  31275. } else {
  31276. $$0509582 = $51;$$1508583 = $50;
  31277. }
  31278. }
  31279. $53 = HEAP8[$$0521$>>0]|0;
  31280. $54 = ($53<<24>>24)==(45);
  31281. if ($54) {
  31282. $55 = -$36;
  31283. $56 = $55 - $51;
  31284. $57 = $51 + $56;
  31285. $58 = -$57;
  31286. $$1472 = $58;
  31287. break;
  31288. } else {
  31289. $59 = $36 + $51;
  31290. $60 = $59 - $51;
  31291. $$1472 = $60;
  31292. break;
  31293. }
  31294. }
  31295. } while(0);
  31296. $61 = HEAP32[$7>>2]|0;
  31297. $62 = ($61|0)<(0);
  31298. $63 = (0 - ($61))|0;
  31299. $64 = $62 ? $63 : $61;
  31300. $65 = ($64|0)<(0);
  31301. $66 = $65 << 31 >> 31;
  31302. $67 = (_fmt_u($64,$66,$11)|0);
  31303. $68 = ($67|0)==($11|0);
  31304. if ($68) {
  31305. $69 = ((($10)) + 11|0);
  31306. HEAP8[$69>>0] = 48;
  31307. $$0511 = $69;
  31308. } else {
  31309. $$0511 = $67;
  31310. }
  31311. $70 = $61 >> 31;
  31312. $71 = $70 & 2;
  31313. $72 = (($71) + 43)|0;
  31314. $73 = $72&255;
  31315. $74 = ((($$0511)) + -1|0);
  31316. HEAP8[$74>>0] = $73;
  31317. $75 = (($5) + 15)|0;
  31318. $76 = $75&255;
  31319. $77 = ((($$0511)) + -2|0);
  31320. HEAP8[$77>>0] = $76;
  31321. $notrhs = ($3|0)<(1);
  31322. $78 = $4 & 8;
  31323. $79 = ($78|0)==(0);
  31324. $$0523 = $8;$$2473 = $$1472;
  31325. while(1) {
  31326. $80 = (~~(($$2473)));
  31327. $81 = (15998 + ($80)|0);
  31328. $82 = HEAP8[$81>>0]|0;
  31329. $83 = $82&255;
  31330. $84 = $83 | $42;
  31331. $85 = $84&255;
  31332. $86 = ((($$0523)) + 1|0);
  31333. HEAP8[$$0523>>0] = $85;
  31334. $87 = (+($80|0));
  31335. $88 = $$2473 - $87;
  31336. $89 = $88 * 16.0;
  31337. $90 = $86;
  31338. $91 = (($90) - ($9))|0;
  31339. $92 = ($91|0)==(1);
  31340. if ($92) {
  31341. $notlhs = $89 == 0.0;
  31342. $or$cond3$not = $notrhs & $notlhs;
  31343. $or$cond = $79 & $or$cond3$not;
  31344. if ($or$cond) {
  31345. $$1524 = $86;
  31346. } else {
  31347. $93 = ((($$0523)) + 2|0);
  31348. HEAP8[$86>>0] = 46;
  31349. $$1524 = $93;
  31350. }
  31351. } else {
  31352. $$1524 = $86;
  31353. }
  31354. $94 = $89 != 0.0;
  31355. if ($94) {
  31356. $$0523 = $$1524;$$2473 = $89;
  31357. } else {
  31358. break;
  31359. }
  31360. }
  31361. $95 = ($3|0)!=(0);
  31362. $96 = $77;
  31363. $97 = $11;
  31364. $98 = $$1524;
  31365. $99 = (($98) - ($9))|0;
  31366. $100 = (($97) - ($96))|0;
  31367. $101 = (($99) + -2)|0;
  31368. $102 = ($101|0)<($3|0);
  31369. $or$cond537 = $95 & $102;
  31370. $103 = (($3) + 2)|0;
  31371. $$pn = $or$cond537 ? $103 : $99;
  31372. $$0525 = (($100) + ($45))|0;
  31373. $104 = (($$0525) + ($$pn))|0;
  31374. _pad_674($0,32,$2,$104,$4);
  31375. _out($0,$$0521$,$45);
  31376. $105 = $4 ^ 65536;
  31377. _pad_674($0,48,$2,$104,$105);
  31378. _out($0,$8,$99);
  31379. $106 = (($$pn) - ($99))|0;
  31380. _pad_674($0,48,$106,0,0);
  31381. _out($0,$77,$100);
  31382. $107 = $4 ^ 8192;
  31383. _pad_674($0,32,$2,$104,$107);
  31384. $$sink562 = $104;
  31385. break;
  31386. }
  31387. $108 = ($3|0)<(0);
  31388. $$539 = $108 ? 6 : $3;
  31389. if ($37) {
  31390. $109 = $36 * 268435456.0;
  31391. $110 = HEAP32[$7>>2]|0;
  31392. $111 = (($110) + -28)|0;
  31393. HEAP32[$7>>2] = $111;
  31394. $$3 = $109;$$pr = $111;
  31395. } else {
  31396. $$pre = HEAP32[$7>>2]|0;
  31397. $$3 = $36;$$pr = $$pre;
  31398. }
  31399. $112 = ($$pr|0)<(0);
  31400. $113 = ((($6)) + 288|0);
  31401. $$556 = $112 ? $6 : $113;
  31402. $$0498 = $$556;$$4 = $$3;
  31403. while(1) {
  31404. $114 = (~~(($$4))>>>0);
  31405. HEAP32[$$0498>>2] = $114;
  31406. $115 = ((($$0498)) + 4|0);
  31407. $116 = (+($114>>>0));
  31408. $117 = $$4 - $116;
  31409. $118 = $117 * 1.0E+9;
  31410. $119 = $118 != 0.0;
  31411. if ($119) {
  31412. $$0498 = $115;$$4 = $118;
  31413. } else {
  31414. break;
  31415. }
  31416. }
  31417. $120 = ($$pr|0)>(0);
  31418. if ($120) {
  31419. $$1482661 = $$556;$$1499660 = $115;$122 = $$pr;
  31420. while(1) {
  31421. $121 = ($122|0)<(29);
  31422. $123 = $121 ? $122 : 29;
  31423. $$0488653 = ((($$1499660)) + -4|0);
  31424. $124 = ($$0488653>>>0)<($$1482661>>>0);
  31425. if ($124) {
  31426. $$2483$ph = $$1482661;
  31427. } else {
  31428. $$0488655 = $$0488653;$$0497654 = 0;
  31429. while(1) {
  31430. $125 = HEAP32[$$0488655>>2]|0;
  31431. $126 = (_bitshift64Shl(($125|0),0,($123|0))|0);
  31432. $127 = tempRet0;
  31433. $128 = (_i64Add(($126|0),($127|0),($$0497654|0),0)|0);
  31434. $129 = tempRet0;
  31435. $130 = (___uremdi3(($128|0),($129|0),1000000000,0)|0);
  31436. $131 = tempRet0;
  31437. HEAP32[$$0488655>>2] = $130;
  31438. $132 = (___udivdi3(($128|0),($129|0),1000000000,0)|0);
  31439. $133 = tempRet0;
  31440. $$0488 = ((($$0488655)) + -4|0);
  31441. $134 = ($$0488>>>0)<($$1482661>>>0);
  31442. if ($134) {
  31443. break;
  31444. } else {
  31445. $$0488655 = $$0488;$$0497654 = $132;
  31446. }
  31447. }
  31448. $135 = ($132|0)==(0);
  31449. if ($135) {
  31450. $$2483$ph = $$1482661;
  31451. } else {
  31452. $136 = ((($$1482661)) + -4|0);
  31453. HEAP32[$136>>2] = $132;
  31454. $$2483$ph = $136;
  31455. }
  31456. }
  31457. $$2500 = $$1499660;
  31458. while(1) {
  31459. $137 = ($$2500>>>0)>($$2483$ph>>>0);
  31460. if (!($137)) {
  31461. break;
  31462. }
  31463. $138 = ((($$2500)) + -4|0);
  31464. $139 = HEAP32[$138>>2]|0;
  31465. $140 = ($139|0)==(0);
  31466. if ($140) {
  31467. $$2500 = $138;
  31468. } else {
  31469. break;
  31470. }
  31471. }
  31472. $141 = HEAP32[$7>>2]|0;
  31473. $142 = (($141) - ($123))|0;
  31474. HEAP32[$7>>2] = $142;
  31475. $143 = ($142|0)>(0);
  31476. if ($143) {
  31477. $$1482661 = $$2483$ph;$$1499660 = $$2500;$122 = $142;
  31478. } else {
  31479. $$1482$lcssa = $$2483$ph;$$1499$lcssa = $$2500;$$pr564 = $142;
  31480. break;
  31481. }
  31482. }
  31483. } else {
  31484. $$1482$lcssa = $$556;$$1499$lcssa = $115;$$pr564 = $$pr;
  31485. }
  31486. $144 = ($$pr564|0)<(0);
  31487. if ($144) {
  31488. $145 = (($$539) + 25)|0;
  31489. $146 = (($145|0) / 9)&-1;
  31490. $147 = (($146) + 1)|0;
  31491. $148 = ($40|0)==(102);
  31492. $$3484648 = $$1482$lcssa;$$3501647 = $$1499$lcssa;$150 = $$pr564;
  31493. while(1) {
  31494. $149 = (0 - ($150))|0;
  31495. $151 = ($149|0)<(9);
  31496. $152 = $151 ? $149 : 9;
  31497. $153 = ($$3484648>>>0)<($$3501647>>>0);
  31498. if ($153) {
  31499. $157 = 1 << $152;
  31500. $158 = (($157) + -1)|0;
  31501. $159 = 1000000000 >>> $152;
  31502. $$0487642 = 0;$$1489641 = $$3484648;
  31503. while(1) {
  31504. $160 = HEAP32[$$1489641>>2]|0;
  31505. $161 = $160 & $158;
  31506. $162 = $160 >>> $152;
  31507. $163 = (($162) + ($$0487642))|0;
  31508. HEAP32[$$1489641>>2] = $163;
  31509. $164 = Math_imul($161, $159)|0;
  31510. $165 = ((($$1489641)) + 4|0);
  31511. $166 = ($165>>>0)<($$3501647>>>0);
  31512. if ($166) {
  31513. $$0487642 = $164;$$1489641 = $165;
  31514. } else {
  31515. break;
  31516. }
  31517. }
  31518. $167 = HEAP32[$$3484648>>2]|0;
  31519. $168 = ($167|0)==(0);
  31520. $169 = ((($$3484648)) + 4|0);
  31521. $$$3484 = $168 ? $169 : $$3484648;
  31522. $170 = ($164|0)==(0);
  31523. if ($170) {
  31524. $$$3484692 = $$$3484;$$4502 = $$3501647;
  31525. } else {
  31526. $171 = ((($$3501647)) + 4|0);
  31527. HEAP32[$$3501647>>2] = $164;
  31528. $$$3484692 = $$$3484;$$4502 = $171;
  31529. }
  31530. } else {
  31531. $154 = HEAP32[$$3484648>>2]|0;
  31532. $155 = ($154|0)==(0);
  31533. $156 = ((($$3484648)) + 4|0);
  31534. $$$3484691 = $155 ? $156 : $$3484648;
  31535. $$$3484692 = $$$3484691;$$4502 = $$3501647;
  31536. }
  31537. $172 = $148 ? $$556 : $$$3484692;
  31538. $173 = $$4502;
  31539. $174 = $172;
  31540. $175 = (($173) - ($174))|0;
  31541. $176 = $175 >> 2;
  31542. $177 = ($176|0)>($147|0);
  31543. $178 = (($172) + ($147<<2)|0);
  31544. $$$4502 = $177 ? $178 : $$4502;
  31545. $179 = HEAP32[$7>>2]|0;
  31546. $180 = (($179) + ($152))|0;
  31547. HEAP32[$7>>2] = $180;
  31548. $181 = ($180|0)<(0);
  31549. if ($181) {
  31550. $$3484648 = $$$3484692;$$3501647 = $$$4502;$150 = $180;
  31551. } else {
  31552. $$3484$lcssa = $$$3484692;$$3501$lcssa = $$$4502;
  31553. break;
  31554. }
  31555. }
  31556. } else {
  31557. $$3484$lcssa = $$1482$lcssa;$$3501$lcssa = $$1499$lcssa;
  31558. }
  31559. $182 = ($$3484$lcssa>>>0)<($$3501$lcssa>>>0);
  31560. $183 = $$556;
  31561. if ($182) {
  31562. $184 = $$3484$lcssa;
  31563. $185 = (($183) - ($184))|0;
  31564. $186 = $185 >> 2;
  31565. $187 = ($186*9)|0;
  31566. $188 = HEAP32[$$3484$lcssa>>2]|0;
  31567. $189 = ($188>>>0)<(10);
  31568. if ($189) {
  31569. $$1515 = $187;
  31570. } else {
  31571. $$0514637 = $187;$$0530636 = 10;
  31572. while(1) {
  31573. $190 = ($$0530636*10)|0;
  31574. $191 = (($$0514637) + 1)|0;
  31575. $192 = ($188>>>0)<($190>>>0);
  31576. if ($192) {
  31577. $$1515 = $191;
  31578. break;
  31579. } else {
  31580. $$0514637 = $191;$$0530636 = $190;
  31581. }
  31582. }
  31583. }
  31584. } else {
  31585. $$1515 = 0;
  31586. }
  31587. $193 = ($40|0)!=(102);
  31588. $194 = $193 ? $$1515 : 0;
  31589. $195 = (($$539) - ($194))|0;
  31590. $196 = ($40|0)==(103);
  31591. $197 = ($$539|0)!=(0);
  31592. $198 = $197 & $196;
  31593. $$neg = $198 << 31 >> 31;
  31594. $199 = (($195) + ($$neg))|0;
  31595. $200 = $$3501$lcssa;
  31596. $201 = (($200) - ($183))|0;
  31597. $202 = $201 >> 2;
  31598. $203 = ($202*9)|0;
  31599. $204 = (($203) + -9)|0;
  31600. $205 = ($199|0)<($204|0);
  31601. if ($205) {
  31602. $206 = ((($$556)) + 4|0);
  31603. $207 = (($199) + 9216)|0;
  31604. $208 = (($207|0) / 9)&-1;
  31605. $209 = (($208) + -1024)|0;
  31606. $210 = (($206) + ($209<<2)|0);
  31607. $211 = (($207|0) % 9)&-1;
  31608. $$0527629 = (($211) + 1)|0;
  31609. $212 = ($$0527629|0)<(9);
  31610. if ($212) {
  31611. $$0527631 = $$0527629;$$1531630 = 10;
  31612. while(1) {
  31613. $213 = ($$1531630*10)|0;
  31614. $$0527 = (($$0527631) + 1)|0;
  31615. $exitcond = ($$0527|0)==(9);
  31616. if ($exitcond) {
  31617. $$1531$lcssa = $213;
  31618. break;
  31619. } else {
  31620. $$0527631 = $$0527;$$1531630 = $213;
  31621. }
  31622. }
  31623. } else {
  31624. $$1531$lcssa = 10;
  31625. }
  31626. $214 = HEAP32[$210>>2]|0;
  31627. $215 = (($214>>>0) % ($$1531$lcssa>>>0))&-1;
  31628. $216 = ($215|0)==(0);
  31629. $217 = ((($210)) + 4|0);
  31630. $218 = ($217|0)==($$3501$lcssa|0);
  31631. $or$cond541 = $218 & $216;
  31632. if ($or$cond541) {
  31633. $$4492 = $210;$$4518 = $$1515;$$8 = $$3484$lcssa;
  31634. } else {
  31635. $219 = (($214>>>0) / ($$1531$lcssa>>>0))&-1;
  31636. $220 = $219 & 1;
  31637. $221 = ($220|0)==(0);
  31638. $$542 = $221 ? 9007199254740992.0 : 9007199254740994.0;
  31639. $222 = (($$1531$lcssa|0) / 2)&-1;
  31640. $223 = ($215>>>0)<($222>>>0);
  31641. $224 = ($215|0)==($222|0);
  31642. $or$cond544 = $218 & $224;
  31643. $$559 = $or$cond544 ? 1.0 : 1.5;
  31644. $$$559 = $223 ? 0.5 : $$559;
  31645. $225 = ($$0520|0)==(0);
  31646. if ($225) {
  31647. $$1467 = $$$559;$$1469 = $$542;
  31648. } else {
  31649. $226 = HEAP8[$$0521>>0]|0;
  31650. $227 = ($226<<24>>24)==(45);
  31651. $228 = -$$542;
  31652. $229 = -$$$559;
  31653. $$$542 = $227 ? $228 : $$542;
  31654. $$$$559 = $227 ? $229 : $$$559;
  31655. $$1467 = $$$$559;$$1469 = $$$542;
  31656. }
  31657. $230 = (($214) - ($215))|0;
  31658. HEAP32[$210>>2] = $230;
  31659. $231 = $$1469 + $$1467;
  31660. $232 = $231 != $$1469;
  31661. if ($232) {
  31662. $233 = (($230) + ($$1531$lcssa))|0;
  31663. HEAP32[$210>>2] = $233;
  31664. $234 = ($233>>>0)>(999999999);
  31665. if ($234) {
  31666. $$5486623 = $$3484$lcssa;$$sink545622 = $210;
  31667. while(1) {
  31668. $235 = ((($$sink545622)) + -4|0);
  31669. HEAP32[$$sink545622>>2] = 0;
  31670. $236 = ($235>>>0)<($$5486623>>>0);
  31671. if ($236) {
  31672. $237 = ((($$5486623)) + -4|0);
  31673. HEAP32[$237>>2] = 0;
  31674. $$6 = $237;
  31675. } else {
  31676. $$6 = $$5486623;
  31677. }
  31678. $238 = HEAP32[$235>>2]|0;
  31679. $239 = (($238) + 1)|0;
  31680. HEAP32[$235>>2] = $239;
  31681. $240 = ($239>>>0)>(999999999);
  31682. if ($240) {
  31683. $$5486623 = $$6;$$sink545622 = $235;
  31684. } else {
  31685. $$5486$lcssa = $$6;$$sink545$lcssa = $235;
  31686. break;
  31687. }
  31688. }
  31689. } else {
  31690. $$5486$lcssa = $$3484$lcssa;$$sink545$lcssa = $210;
  31691. }
  31692. $241 = $$5486$lcssa;
  31693. $242 = (($183) - ($241))|0;
  31694. $243 = $242 >> 2;
  31695. $244 = ($243*9)|0;
  31696. $245 = HEAP32[$$5486$lcssa>>2]|0;
  31697. $246 = ($245>>>0)<(10);
  31698. if ($246) {
  31699. $$4492 = $$sink545$lcssa;$$4518 = $244;$$8 = $$5486$lcssa;
  31700. } else {
  31701. $$2516618 = $244;$$2532617 = 10;
  31702. while(1) {
  31703. $247 = ($$2532617*10)|0;
  31704. $248 = (($$2516618) + 1)|0;
  31705. $249 = ($245>>>0)<($247>>>0);
  31706. if ($249) {
  31707. $$4492 = $$sink545$lcssa;$$4518 = $248;$$8 = $$5486$lcssa;
  31708. break;
  31709. } else {
  31710. $$2516618 = $248;$$2532617 = $247;
  31711. }
  31712. }
  31713. }
  31714. } else {
  31715. $$4492 = $210;$$4518 = $$1515;$$8 = $$3484$lcssa;
  31716. }
  31717. }
  31718. $250 = ((($$4492)) + 4|0);
  31719. $251 = ($$3501$lcssa>>>0)>($250>>>0);
  31720. $$$3501 = $251 ? $250 : $$3501$lcssa;
  31721. $$5519$ph = $$4518;$$7505$ph = $$$3501;$$9$ph = $$8;
  31722. } else {
  31723. $$5519$ph = $$1515;$$7505$ph = $$3501$lcssa;$$9$ph = $$3484$lcssa;
  31724. }
  31725. $$7505 = $$7505$ph;
  31726. while(1) {
  31727. $252 = ($$7505>>>0)>($$9$ph>>>0);
  31728. if (!($252)) {
  31729. $$lcssa673 = 0;
  31730. break;
  31731. }
  31732. $253 = ((($$7505)) + -4|0);
  31733. $254 = HEAP32[$253>>2]|0;
  31734. $255 = ($254|0)==(0);
  31735. if ($255) {
  31736. $$7505 = $253;
  31737. } else {
  31738. $$lcssa673 = 1;
  31739. break;
  31740. }
  31741. }
  31742. $256 = (0 - ($$5519$ph))|0;
  31743. do {
  31744. if ($196) {
  31745. $not$ = $197 ^ 1;
  31746. $257 = $not$&1;
  31747. $$539$ = (($257) + ($$539))|0;
  31748. $258 = ($$539$|0)>($$5519$ph|0);
  31749. $259 = ($$5519$ph|0)>(-5);
  31750. $or$cond6 = $258 & $259;
  31751. if ($or$cond6) {
  31752. $260 = (($5) + -1)|0;
  31753. $$neg567 = (($$539$) + -1)|0;
  31754. $261 = (($$neg567) - ($$5519$ph))|0;
  31755. $$0479 = $260;$$2476 = $261;
  31756. } else {
  31757. $262 = (($5) + -2)|0;
  31758. $263 = (($$539$) + -1)|0;
  31759. $$0479 = $262;$$2476 = $263;
  31760. }
  31761. $264 = $4 & 8;
  31762. $265 = ($264|0)==(0);
  31763. if ($265) {
  31764. if ($$lcssa673) {
  31765. $266 = ((($$7505)) + -4|0);
  31766. $267 = HEAP32[$266>>2]|0;
  31767. $268 = ($267|0)==(0);
  31768. if ($268) {
  31769. $$2529 = 9;
  31770. } else {
  31771. $269 = (($267>>>0) % 10)&-1;
  31772. $270 = ($269|0)==(0);
  31773. if ($270) {
  31774. $$1528614 = 0;$$3533613 = 10;
  31775. while(1) {
  31776. $271 = ($$3533613*10)|0;
  31777. $272 = (($$1528614) + 1)|0;
  31778. $273 = (($267>>>0) % ($271>>>0))&-1;
  31779. $274 = ($273|0)==(0);
  31780. if ($274) {
  31781. $$1528614 = $272;$$3533613 = $271;
  31782. } else {
  31783. $$2529 = $272;
  31784. break;
  31785. }
  31786. }
  31787. } else {
  31788. $$2529 = 0;
  31789. }
  31790. }
  31791. } else {
  31792. $$2529 = 9;
  31793. }
  31794. $275 = $$0479 | 32;
  31795. $276 = ($275|0)==(102);
  31796. $277 = $$7505;
  31797. $278 = (($277) - ($183))|0;
  31798. $279 = $278 >> 2;
  31799. $280 = ($279*9)|0;
  31800. $281 = (($280) + -9)|0;
  31801. if ($276) {
  31802. $282 = (($281) - ($$2529))|0;
  31803. $283 = ($282|0)>(0);
  31804. $$546 = $283 ? $282 : 0;
  31805. $284 = ($$2476|0)<($$546|0);
  31806. $$2476$$547 = $284 ? $$2476 : $$546;
  31807. $$1480 = $$0479;$$3477 = $$2476$$547;$$pre$phi690Z2D = 0;
  31808. break;
  31809. } else {
  31810. $285 = (($281) + ($$5519$ph))|0;
  31811. $286 = (($285) - ($$2529))|0;
  31812. $287 = ($286|0)>(0);
  31813. $$548 = $287 ? $286 : 0;
  31814. $288 = ($$2476|0)<($$548|0);
  31815. $$2476$$549 = $288 ? $$2476 : $$548;
  31816. $$1480 = $$0479;$$3477 = $$2476$$549;$$pre$phi690Z2D = 0;
  31817. break;
  31818. }
  31819. } else {
  31820. $$1480 = $$0479;$$3477 = $$2476;$$pre$phi690Z2D = $264;
  31821. }
  31822. } else {
  31823. $$pre689 = $4 & 8;
  31824. $$1480 = $5;$$3477 = $$539;$$pre$phi690Z2D = $$pre689;
  31825. }
  31826. } while(0);
  31827. $289 = $$3477 | $$pre$phi690Z2D;
  31828. $290 = ($289|0)!=(0);
  31829. $291 = $290&1;
  31830. $292 = $$1480 | 32;
  31831. $293 = ($292|0)==(102);
  31832. if ($293) {
  31833. $294 = ($$5519$ph|0)>(0);
  31834. $295 = $294 ? $$5519$ph : 0;
  31835. $$2513 = 0;$$pn566 = $295;
  31836. } else {
  31837. $296 = ($$5519$ph|0)<(0);
  31838. $297 = $296 ? $256 : $$5519$ph;
  31839. $298 = ($297|0)<(0);
  31840. $299 = $298 << 31 >> 31;
  31841. $300 = (_fmt_u($297,$299,$11)|0);
  31842. $301 = $11;
  31843. $302 = $300;
  31844. $303 = (($301) - ($302))|0;
  31845. $304 = ($303|0)<(2);
  31846. if ($304) {
  31847. $$1512607 = $300;
  31848. while(1) {
  31849. $305 = ((($$1512607)) + -1|0);
  31850. HEAP8[$305>>0] = 48;
  31851. $306 = $305;
  31852. $307 = (($301) - ($306))|0;
  31853. $308 = ($307|0)<(2);
  31854. if ($308) {
  31855. $$1512607 = $305;
  31856. } else {
  31857. $$1512$lcssa = $305;
  31858. break;
  31859. }
  31860. }
  31861. } else {
  31862. $$1512$lcssa = $300;
  31863. }
  31864. $309 = $$5519$ph >> 31;
  31865. $310 = $309 & 2;
  31866. $311 = (($310) + 43)|0;
  31867. $312 = $311&255;
  31868. $313 = ((($$1512$lcssa)) + -1|0);
  31869. HEAP8[$313>>0] = $312;
  31870. $314 = $$1480&255;
  31871. $315 = ((($$1512$lcssa)) + -2|0);
  31872. HEAP8[$315>>0] = $314;
  31873. $316 = $315;
  31874. $317 = (($301) - ($316))|0;
  31875. $$2513 = $315;$$pn566 = $317;
  31876. }
  31877. $318 = (($$0520) + 1)|0;
  31878. $319 = (($318) + ($$3477))|0;
  31879. $$1526 = (($319) + ($291))|0;
  31880. $320 = (($$1526) + ($$pn566))|0;
  31881. _pad_674($0,32,$2,$320,$4);
  31882. _out($0,$$0521,$$0520);
  31883. $321 = $4 ^ 65536;
  31884. _pad_674($0,48,$2,$320,$321);
  31885. if ($293) {
  31886. $322 = ($$9$ph>>>0)>($$556>>>0);
  31887. $$0496$$9 = $322 ? $$556 : $$9$ph;
  31888. $323 = ((($8)) + 9|0);
  31889. $324 = $323;
  31890. $325 = ((($8)) + 8|0);
  31891. $$5493597 = $$0496$$9;
  31892. while(1) {
  31893. $326 = HEAP32[$$5493597>>2]|0;
  31894. $327 = (_fmt_u($326,0,$323)|0);
  31895. $328 = ($$5493597|0)==($$0496$$9|0);
  31896. if ($328) {
  31897. $334 = ($327|0)==($323|0);
  31898. if ($334) {
  31899. HEAP8[$325>>0] = 48;
  31900. $$1465 = $325;
  31901. } else {
  31902. $$1465 = $327;
  31903. }
  31904. } else {
  31905. $329 = ($327>>>0)>($8>>>0);
  31906. if ($329) {
  31907. $330 = $327;
  31908. $331 = (($330) - ($9))|0;
  31909. _memset(($8|0),48,($331|0))|0;
  31910. $$0464594 = $327;
  31911. while(1) {
  31912. $332 = ((($$0464594)) + -1|0);
  31913. $333 = ($332>>>0)>($8>>>0);
  31914. if ($333) {
  31915. $$0464594 = $332;
  31916. } else {
  31917. $$1465 = $332;
  31918. break;
  31919. }
  31920. }
  31921. } else {
  31922. $$1465 = $327;
  31923. }
  31924. }
  31925. $335 = $$1465;
  31926. $336 = (($324) - ($335))|0;
  31927. _out($0,$$1465,$336);
  31928. $337 = ((($$5493597)) + 4|0);
  31929. $338 = ($337>>>0)>($$556>>>0);
  31930. if ($338) {
  31931. break;
  31932. } else {
  31933. $$5493597 = $337;
  31934. }
  31935. }
  31936. $339 = ($289|0)==(0);
  31937. if (!($339)) {
  31938. _out($0,16014,1);
  31939. }
  31940. $340 = ($337>>>0)<($$7505>>>0);
  31941. $341 = ($$3477|0)>(0);
  31942. $342 = $340 & $341;
  31943. if ($342) {
  31944. $$4478590 = $$3477;$$6494589 = $337;
  31945. while(1) {
  31946. $343 = HEAP32[$$6494589>>2]|0;
  31947. $344 = (_fmt_u($343,0,$323)|0);
  31948. $345 = ($344>>>0)>($8>>>0);
  31949. if ($345) {
  31950. $346 = $344;
  31951. $347 = (($346) - ($9))|0;
  31952. _memset(($8|0),48,($347|0))|0;
  31953. $$0463584 = $344;
  31954. while(1) {
  31955. $348 = ((($$0463584)) + -1|0);
  31956. $349 = ($348>>>0)>($8>>>0);
  31957. if ($349) {
  31958. $$0463584 = $348;
  31959. } else {
  31960. $$0463$lcssa = $348;
  31961. break;
  31962. }
  31963. }
  31964. } else {
  31965. $$0463$lcssa = $344;
  31966. }
  31967. $350 = ($$4478590|0)<(9);
  31968. $351 = $350 ? $$4478590 : 9;
  31969. _out($0,$$0463$lcssa,$351);
  31970. $352 = ((($$6494589)) + 4|0);
  31971. $353 = (($$4478590) + -9)|0;
  31972. $354 = ($352>>>0)<($$7505>>>0);
  31973. $355 = ($$4478590|0)>(9);
  31974. $356 = $354 & $355;
  31975. if ($356) {
  31976. $$4478590 = $353;$$6494589 = $352;
  31977. } else {
  31978. $$4478$lcssa = $353;
  31979. break;
  31980. }
  31981. }
  31982. } else {
  31983. $$4478$lcssa = $$3477;
  31984. }
  31985. $357 = (($$4478$lcssa) + 9)|0;
  31986. _pad_674($0,48,$357,9,0);
  31987. } else {
  31988. $358 = ((($$9$ph)) + 4|0);
  31989. $$7505$ = $$lcssa673 ? $$7505 : $358;
  31990. $359 = ($$3477|0)>(-1);
  31991. if ($359) {
  31992. $360 = ((($8)) + 9|0);
  31993. $361 = ($$pre$phi690Z2D|0)==(0);
  31994. $362 = $360;
  31995. $363 = (0 - ($9))|0;
  31996. $364 = ((($8)) + 8|0);
  31997. $$5602 = $$3477;$$7495601 = $$9$ph;
  31998. while(1) {
  31999. $365 = HEAP32[$$7495601>>2]|0;
  32000. $366 = (_fmt_u($365,0,$360)|0);
  32001. $367 = ($366|0)==($360|0);
  32002. if ($367) {
  32003. HEAP8[$364>>0] = 48;
  32004. $$0 = $364;
  32005. } else {
  32006. $$0 = $366;
  32007. }
  32008. $368 = ($$7495601|0)==($$9$ph|0);
  32009. do {
  32010. if ($368) {
  32011. $372 = ((($$0)) + 1|0);
  32012. _out($0,$$0,1);
  32013. $373 = ($$5602|0)<(1);
  32014. $or$cond554 = $361 & $373;
  32015. if ($or$cond554) {
  32016. $$2 = $372;
  32017. break;
  32018. }
  32019. _out($0,16014,1);
  32020. $$2 = $372;
  32021. } else {
  32022. $369 = ($$0>>>0)>($8>>>0);
  32023. if (!($369)) {
  32024. $$2 = $$0;
  32025. break;
  32026. }
  32027. $scevgep684 = (($$0) + ($363)|0);
  32028. $scevgep684685 = $scevgep684;
  32029. _memset(($8|0),48,($scevgep684685|0))|0;
  32030. $$1598 = $$0;
  32031. while(1) {
  32032. $370 = ((($$1598)) + -1|0);
  32033. $371 = ($370>>>0)>($8>>>0);
  32034. if ($371) {
  32035. $$1598 = $370;
  32036. } else {
  32037. $$2 = $370;
  32038. break;
  32039. }
  32040. }
  32041. }
  32042. } while(0);
  32043. $374 = $$2;
  32044. $375 = (($362) - ($374))|0;
  32045. $376 = ($$5602|0)>($375|0);
  32046. $377 = $376 ? $375 : $$5602;
  32047. _out($0,$$2,$377);
  32048. $378 = (($$5602) - ($375))|0;
  32049. $379 = ((($$7495601)) + 4|0);
  32050. $380 = ($379>>>0)<($$7505$>>>0);
  32051. $381 = ($378|0)>(-1);
  32052. $382 = $380 & $381;
  32053. if ($382) {
  32054. $$5602 = $378;$$7495601 = $379;
  32055. } else {
  32056. $$5$lcssa = $378;
  32057. break;
  32058. }
  32059. }
  32060. } else {
  32061. $$5$lcssa = $$3477;
  32062. }
  32063. $383 = (($$5$lcssa) + 18)|0;
  32064. _pad_674($0,48,$383,18,0);
  32065. $384 = $11;
  32066. $385 = $$2513;
  32067. $386 = (($384) - ($385))|0;
  32068. _out($0,$$2513,$386);
  32069. }
  32070. $387 = $4 ^ 8192;
  32071. _pad_674($0,32,$2,$320,$387);
  32072. $$sink562 = $320;
  32073. } else {
  32074. $27 = $5 & 32;
  32075. $28 = ($27|0)!=(0);
  32076. $29 = $28 ? 15986 : 15990;
  32077. $30 = ($$0471 != $$0471) | (0.0 != 0.0);
  32078. $31 = $28 ? 17917 : 15994;
  32079. $$0510 = $30 ? $31 : $29;
  32080. $32 = (($$0520) + 3)|0;
  32081. $33 = $4 & -65537;
  32082. _pad_674($0,32,$2,$32,$33);
  32083. _out($0,$$0521,$$0520);
  32084. _out($0,$$0510,3);
  32085. $34 = $4 ^ 8192;
  32086. _pad_674($0,32,$2,$32,$34);
  32087. $$sink562 = $32;
  32088. }
  32089. } while(0);
  32090. $388 = ($$sink562|0)<($2|0);
  32091. $$555 = $388 ? $2 : $$sink562;
  32092. STACKTOP = sp;return ($$555|0);
  32093. }
  32094. function ___DOUBLE_BITS_675($0) {
  32095. $0 = +$0;
  32096. var $1 = 0, $2 = 0, label = 0, sp = 0;
  32097. sp = STACKTOP;
  32098. HEAPF64[tempDoublePtr>>3] = $0;$1 = HEAP32[tempDoublePtr>>2]|0;
  32099. $2 = HEAP32[tempDoublePtr+4>>2]|0;
  32100. tempRet0 = ($2);
  32101. return ($1|0);
  32102. }
  32103. function _frexpl($0,$1) {
  32104. $0 = +$0;
  32105. $1 = $1|0;
  32106. var $2 = 0.0, label = 0, sp = 0;
  32107. sp = STACKTOP;
  32108. $2 = (+_frexp($0,$1));
  32109. return (+$2);
  32110. }
  32111. function _frexp($0,$1) {
  32112. $0 = +$0;
  32113. $1 = $1|0;
  32114. var $$0 = 0.0, $$016 = 0.0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0.0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0.0, $9 = 0.0, $storemerge = 0, $trunc$clear = 0, label = 0;
  32115. var sp = 0;
  32116. sp = STACKTOP;
  32117. HEAPF64[tempDoublePtr>>3] = $0;$2 = HEAP32[tempDoublePtr>>2]|0;
  32118. $3 = HEAP32[tempDoublePtr+4>>2]|0;
  32119. $4 = (_bitshift64Lshr(($2|0),($3|0),52)|0);
  32120. $5 = tempRet0;
  32121. $6 = $4&65535;
  32122. $trunc$clear = $6 & 2047;
  32123. switch ($trunc$clear<<16>>16) {
  32124. case 0: {
  32125. $7 = $0 != 0.0;
  32126. if ($7) {
  32127. $8 = $0 * 1.8446744073709552E+19;
  32128. $9 = (+_frexp($8,$1));
  32129. $10 = HEAP32[$1>>2]|0;
  32130. $11 = (($10) + -64)|0;
  32131. $$016 = $9;$storemerge = $11;
  32132. } else {
  32133. $$016 = $0;$storemerge = 0;
  32134. }
  32135. HEAP32[$1>>2] = $storemerge;
  32136. $$0 = $$016;
  32137. break;
  32138. }
  32139. case 2047: {
  32140. $$0 = $0;
  32141. break;
  32142. }
  32143. default: {
  32144. $12 = $4 & 2047;
  32145. $13 = (($12) + -1022)|0;
  32146. HEAP32[$1>>2] = $13;
  32147. $14 = $3 & -2146435073;
  32148. $15 = $14 | 1071644672;
  32149. HEAP32[tempDoublePtr>>2] = $2;HEAP32[tempDoublePtr+4>>2] = $15;$16 = +HEAPF64[tempDoublePtr>>3];
  32150. $$0 = $16;
  32151. }
  32152. }
  32153. return (+$$0);
  32154. }
  32155. function _wcrtomb($0,$1,$2) {
  32156. $0 = $0|0;
  32157. $1 = $1|0;
  32158. $2 = $2|0;
  32159. var $$0 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0;
  32160. var $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0;
  32161. var $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $not$ = 0, $or$cond = 0, label = 0, sp = 0;
  32162. sp = STACKTOP;
  32163. $3 = ($0|0)==(0|0);
  32164. do {
  32165. if ($3) {
  32166. $$0 = 1;
  32167. } else {
  32168. $4 = ($1>>>0)<(128);
  32169. if ($4) {
  32170. $5 = $1&255;
  32171. HEAP8[$0>>0] = $5;
  32172. $$0 = 1;
  32173. break;
  32174. }
  32175. $6 = (___pthread_self_448()|0);
  32176. $7 = ((($6)) + 188|0);
  32177. $8 = HEAP32[$7>>2]|0;
  32178. $9 = HEAP32[$8>>2]|0;
  32179. $not$ = ($9|0)==(0|0);
  32180. if ($not$) {
  32181. $10 = $1 & -128;
  32182. $11 = ($10|0)==(57216);
  32183. if ($11) {
  32184. $13 = $1&255;
  32185. HEAP8[$0>>0] = $13;
  32186. $$0 = 1;
  32187. break;
  32188. } else {
  32189. $12 = (___errno_location()|0);
  32190. HEAP32[$12>>2] = 84;
  32191. $$0 = -1;
  32192. break;
  32193. }
  32194. }
  32195. $14 = ($1>>>0)<(2048);
  32196. if ($14) {
  32197. $15 = $1 >>> 6;
  32198. $16 = $15 | 192;
  32199. $17 = $16&255;
  32200. $18 = ((($0)) + 1|0);
  32201. HEAP8[$0>>0] = $17;
  32202. $19 = $1 & 63;
  32203. $20 = $19 | 128;
  32204. $21 = $20&255;
  32205. HEAP8[$18>>0] = $21;
  32206. $$0 = 2;
  32207. break;
  32208. }
  32209. $22 = ($1>>>0)<(55296);
  32210. $23 = $1 & -8192;
  32211. $24 = ($23|0)==(57344);
  32212. $or$cond = $22 | $24;
  32213. if ($or$cond) {
  32214. $25 = $1 >>> 12;
  32215. $26 = $25 | 224;
  32216. $27 = $26&255;
  32217. $28 = ((($0)) + 1|0);
  32218. HEAP8[$0>>0] = $27;
  32219. $29 = $1 >>> 6;
  32220. $30 = $29 & 63;
  32221. $31 = $30 | 128;
  32222. $32 = $31&255;
  32223. $33 = ((($0)) + 2|0);
  32224. HEAP8[$28>>0] = $32;
  32225. $34 = $1 & 63;
  32226. $35 = $34 | 128;
  32227. $36 = $35&255;
  32228. HEAP8[$33>>0] = $36;
  32229. $$0 = 3;
  32230. break;
  32231. }
  32232. $37 = (($1) + -65536)|0;
  32233. $38 = ($37>>>0)<(1048576);
  32234. if ($38) {
  32235. $39 = $1 >>> 18;
  32236. $40 = $39 | 240;
  32237. $41 = $40&255;
  32238. $42 = ((($0)) + 1|0);
  32239. HEAP8[$0>>0] = $41;
  32240. $43 = $1 >>> 12;
  32241. $44 = $43 & 63;
  32242. $45 = $44 | 128;
  32243. $46 = $45&255;
  32244. $47 = ((($0)) + 2|0);
  32245. HEAP8[$42>>0] = $46;
  32246. $48 = $1 >>> 6;
  32247. $49 = $48 & 63;
  32248. $50 = $49 | 128;
  32249. $51 = $50&255;
  32250. $52 = ((($0)) + 3|0);
  32251. HEAP8[$47>>0] = $51;
  32252. $53 = $1 & 63;
  32253. $54 = $53 | 128;
  32254. $55 = $54&255;
  32255. HEAP8[$52>>0] = $55;
  32256. $$0 = 4;
  32257. break;
  32258. } else {
  32259. $56 = (___errno_location()|0);
  32260. HEAP32[$56>>2] = 84;
  32261. $$0 = -1;
  32262. break;
  32263. }
  32264. }
  32265. } while(0);
  32266. return ($$0|0);
  32267. }
  32268. function ___pthread_self_448() {
  32269. var $0 = 0, label = 0, sp = 0;
  32270. sp = STACKTOP;
  32271. $0 = (_pthread_self()|0);
  32272. return ($0|0);
  32273. }
  32274. function ___pthread_self_105() {
  32275. var $0 = 0, label = 0, sp = 0;
  32276. sp = STACKTOP;
  32277. $0 = (_pthread_self()|0);
  32278. return ($0|0);
  32279. }
  32280. function ___strerror_l($0,$1) {
  32281. $0 = $0|0;
  32282. $1 = $1|0;
  32283. var $$012$lcssa = 0, $$01214 = 0, $$016 = 0, $$113 = 0, $$115 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0;
  32284. var label = 0, sp = 0;
  32285. sp = STACKTOP;
  32286. $$016 = 0;
  32287. while(1) {
  32288. $3 = (16016 + ($$016)|0);
  32289. $4 = HEAP8[$3>>0]|0;
  32290. $5 = $4&255;
  32291. $6 = ($5|0)==($0|0);
  32292. if ($6) {
  32293. label = 2;
  32294. break;
  32295. }
  32296. $7 = (($$016) + 1)|0;
  32297. $8 = ($7|0)==(87);
  32298. if ($8) {
  32299. $$01214 = 16104;$$115 = 87;
  32300. label = 5;
  32301. break;
  32302. } else {
  32303. $$016 = $7;
  32304. }
  32305. }
  32306. if ((label|0) == 2) {
  32307. $2 = ($$016|0)==(0);
  32308. if ($2) {
  32309. $$012$lcssa = 16104;
  32310. } else {
  32311. $$01214 = 16104;$$115 = $$016;
  32312. label = 5;
  32313. }
  32314. }
  32315. if ((label|0) == 5) {
  32316. while(1) {
  32317. label = 0;
  32318. $$113 = $$01214;
  32319. while(1) {
  32320. $9 = HEAP8[$$113>>0]|0;
  32321. $10 = ($9<<24>>24)==(0);
  32322. $11 = ((($$113)) + 1|0);
  32323. if ($10) {
  32324. break;
  32325. } else {
  32326. $$113 = $11;
  32327. }
  32328. }
  32329. $12 = (($$115) + -1)|0;
  32330. $13 = ($12|0)==(0);
  32331. if ($13) {
  32332. $$012$lcssa = $11;
  32333. break;
  32334. } else {
  32335. $$01214 = $11;$$115 = $12;
  32336. label = 5;
  32337. }
  32338. }
  32339. }
  32340. $14 = ((($1)) + 20|0);
  32341. $15 = HEAP32[$14>>2]|0;
  32342. $16 = (___lctrans($$012$lcssa,$15)|0);
  32343. return ($16|0);
  32344. }
  32345. function ___lctrans($0,$1) {
  32346. $0 = $0|0;
  32347. $1 = $1|0;
  32348. var $2 = 0, label = 0, sp = 0;
  32349. sp = STACKTOP;
  32350. $2 = (___lctrans_impl($0,$1)|0);
  32351. return ($2|0);
  32352. }
  32353. function ___lctrans_impl($0,$1) {
  32354. $0 = $0|0;
  32355. $1 = $1|0;
  32356. var $$0 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, label = 0, sp = 0;
  32357. sp = STACKTOP;
  32358. $2 = ($1|0)==(0|0);
  32359. if ($2) {
  32360. $$0 = 0;
  32361. } else {
  32362. $3 = HEAP32[$1>>2]|0;
  32363. $4 = ((($1)) + 4|0);
  32364. $5 = HEAP32[$4>>2]|0;
  32365. $6 = (___mo_lookup($3,$5,$0)|0);
  32366. $$0 = $6;
  32367. }
  32368. $7 = ($$0|0)!=(0|0);
  32369. $8 = $7 ? $$0 : $0;
  32370. return ($8|0);
  32371. }
  32372. function ___mo_lookup($0,$1,$2) {
  32373. $0 = $0|0;
  32374. $1 = $1|0;
  32375. $2 = $2|0;
  32376. var $$ = 0, $$090 = 0, $$094 = 0, $$191 = 0, $$195 = 0, $$4 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0;
  32377. var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0;
  32378. var $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0;
  32379. var $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond102 = 0, $or$cond104 = 0, label = 0, sp = 0;
  32380. sp = STACKTOP;
  32381. $3 = HEAP32[$0>>2]|0;
  32382. $4 = (($3) + 1794895138)|0;
  32383. $5 = ((($0)) + 8|0);
  32384. $6 = HEAP32[$5>>2]|0;
  32385. $7 = (_swapc($6,$4)|0);
  32386. $8 = ((($0)) + 12|0);
  32387. $9 = HEAP32[$8>>2]|0;
  32388. $10 = (_swapc($9,$4)|0);
  32389. $11 = ((($0)) + 16|0);
  32390. $12 = HEAP32[$11>>2]|0;
  32391. $13 = (_swapc($12,$4)|0);
  32392. $14 = $1 >>> 2;
  32393. $15 = ($7>>>0)<($14>>>0);
  32394. L1: do {
  32395. if ($15) {
  32396. $16 = $7 << 2;
  32397. $17 = (($1) - ($16))|0;
  32398. $18 = ($10>>>0)<($17>>>0);
  32399. $19 = ($13>>>0)<($17>>>0);
  32400. $or$cond = $18 & $19;
  32401. if ($or$cond) {
  32402. $20 = $13 | $10;
  32403. $21 = $20 & 3;
  32404. $22 = ($21|0)==(0);
  32405. if ($22) {
  32406. $23 = $10 >>> 2;
  32407. $24 = $13 >>> 2;
  32408. $$090 = 0;$$094 = $7;
  32409. while(1) {
  32410. $25 = $$094 >>> 1;
  32411. $26 = (($$090) + ($25))|0;
  32412. $27 = $26 << 1;
  32413. $28 = (($27) + ($23))|0;
  32414. $29 = (($0) + ($28<<2)|0);
  32415. $30 = HEAP32[$29>>2]|0;
  32416. $31 = (_swapc($30,$4)|0);
  32417. $32 = (($28) + 1)|0;
  32418. $33 = (($0) + ($32<<2)|0);
  32419. $34 = HEAP32[$33>>2]|0;
  32420. $35 = (_swapc($34,$4)|0);
  32421. $36 = ($35>>>0)<($1>>>0);
  32422. $37 = (($1) - ($35))|0;
  32423. $38 = ($31>>>0)<($37>>>0);
  32424. $or$cond102 = $36 & $38;
  32425. if (!($or$cond102)) {
  32426. $$4 = 0;
  32427. break L1;
  32428. }
  32429. $39 = (($35) + ($31))|0;
  32430. $40 = (($0) + ($39)|0);
  32431. $41 = HEAP8[$40>>0]|0;
  32432. $42 = ($41<<24>>24)==(0);
  32433. if (!($42)) {
  32434. $$4 = 0;
  32435. break L1;
  32436. }
  32437. $43 = (($0) + ($35)|0);
  32438. $44 = (_strcmp($2,$43)|0);
  32439. $45 = ($44|0)==(0);
  32440. if ($45) {
  32441. break;
  32442. }
  32443. $62 = ($$094|0)==(1);
  32444. $63 = ($44|0)<(0);
  32445. $64 = (($$094) - ($25))|0;
  32446. $$195 = $63 ? $25 : $64;
  32447. $$191 = $63 ? $$090 : $26;
  32448. if ($62) {
  32449. $$4 = 0;
  32450. break L1;
  32451. } else {
  32452. $$090 = $$191;$$094 = $$195;
  32453. }
  32454. }
  32455. $46 = (($27) + ($24))|0;
  32456. $47 = (($0) + ($46<<2)|0);
  32457. $48 = HEAP32[$47>>2]|0;
  32458. $49 = (_swapc($48,$4)|0);
  32459. $50 = (($46) + 1)|0;
  32460. $51 = (($0) + ($50<<2)|0);
  32461. $52 = HEAP32[$51>>2]|0;
  32462. $53 = (_swapc($52,$4)|0);
  32463. $54 = ($53>>>0)<($1>>>0);
  32464. $55 = (($1) - ($53))|0;
  32465. $56 = ($49>>>0)<($55>>>0);
  32466. $or$cond104 = $54 & $56;
  32467. if ($or$cond104) {
  32468. $57 = (($0) + ($53)|0);
  32469. $58 = (($53) + ($49))|0;
  32470. $59 = (($0) + ($58)|0);
  32471. $60 = HEAP8[$59>>0]|0;
  32472. $61 = ($60<<24>>24)==(0);
  32473. $$ = $61 ? $57 : 0;
  32474. $$4 = $$;
  32475. } else {
  32476. $$4 = 0;
  32477. }
  32478. } else {
  32479. $$4 = 0;
  32480. }
  32481. } else {
  32482. $$4 = 0;
  32483. }
  32484. } else {
  32485. $$4 = 0;
  32486. }
  32487. } while(0);
  32488. return ($$4|0);
  32489. }
  32490. function _swapc($0,$1) {
  32491. $0 = $0|0;
  32492. $1 = $1|0;
  32493. var $$ = 0, $2 = 0, $3 = 0, label = 0, sp = 0;
  32494. sp = STACKTOP;
  32495. $2 = ($1|0)==(0);
  32496. $3 = (_llvm_bswap_i32(($0|0))|0);
  32497. $$ = $2 ? $0 : $3;
  32498. return ($$|0);
  32499. }
  32500. function ___fwritex($0,$1,$2) {
  32501. $0 = $0|0;
  32502. $1 = $1|0;
  32503. $2 = $2|0;
  32504. var $$038 = 0, $$042 = 0, $$1 = 0, $$139 = 0, $$141 = 0, $$143 = 0, $$pre = 0, $$pre47 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0;
  32505. var $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0;
  32506. var label = 0, sp = 0;
  32507. sp = STACKTOP;
  32508. $3 = ((($2)) + 16|0);
  32509. $4 = HEAP32[$3>>2]|0;
  32510. $5 = ($4|0)==(0|0);
  32511. if ($5) {
  32512. $7 = (___towrite($2)|0);
  32513. $8 = ($7|0)==(0);
  32514. if ($8) {
  32515. $$pre = HEAP32[$3>>2]|0;
  32516. $12 = $$pre;
  32517. label = 5;
  32518. } else {
  32519. $$1 = 0;
  32520. }
  32521. } else {
  32522. $6 = $4;
  32523. $12 = $6;
  32524. label = 5;
  32525. }
  32526. L5: do {
  32527. if ((label|0) == 5) {
  32528. $9 = ((($2)) + 20|0);
  32529. $10 = HEAP32[$9>>2]|0;
  32530. $11 = (($12) - ($10))|0;
  32531. $13 = ($11>>>0)<($1>>>0);
  32532. $14 = $10;
  32533. if ($13) {
  32534. $15 = ((($2)) + 36|0);
  32535. $16 = HEAP32[$15>>2]|0;
  32536. $17 = (FUNCTION_TABLE_iiii[$16 & 15]($2,$0,$1)|0);
  32537. $$1 = $17;
  32538. break;
  32539. }
  32540. $18 = ((($2)) + 75|0);
  32541. $19 = HEAP8[$18>>0]|0;
  32542. $20 = ($19<<24>>24)>(-1);
  32543. L10: do {
  32544. if ($20) {
  32545. $$038 = $1;
  32546. while(1) {
  32547. $21 = ($$038|0)==(0);
  32548. if ($21) {
  32549. $$139 = 0;$$141 = $0;$$143 = $1;$31 = $14;
  32550. break L10;
  32551. }
  32552. $22 = (($$038) + -1)|0;
  32553. $23 = (($0) + ($22)|0);
  32554. $24 = HEAP8[$23>>0]|0;
  32555. $25 = ($24<<24>>24)==(10);
  32556. if ($25) {
  32557. break;
  32558. } else {
  32559. $$038 = $22;
  32560. }
  32561. }
  32562. $26 = ((($2)) + 36|0);
  32563. $27 = HEAP32[$26>>2]|0;
  32564. $28 = (FUNCTION_TABLE_iiii[$27 & 15]($2,$0,$$038)|0);
  32565. $29 = ($28>>>0)<($$038>>>0);
  32566. if ($29) {
  32567. $$1 = $28;
  32568. break L5;
  32569. }
  32570. $30 = (($0) + ($$038)|0);
  32571. $$042 = (($1) - ($$038))|0;
  32572. $$pre47 = HEAP32[$9>>2]|0;
  32573. $$139 = $$038;$$141 = $30;$$143 = $$042;$31 = $$pre47;
  32574. } else {
  32575. $$139 = 0;$$141 = $0;$$143 = $1;$31 = $14;
  32576. }
  32577. } while(0);
  32578. _memcpy(($31|0),($$141|0),($$143|0))|0;
  32579. $32 = HEAP32[$9>>2]|0;
  32580. $33 = (($32) + ($$143)|0);
  32581. HEAP32[$9>>2] = $33;
  32582. $34 = (($$139) + ($$143))|0;
  32583. $$1 = $34;
  32584. }
  32585. } while(0);
  32586. return ($$1|0);
  32587. }
  32588. function ___towrite($0) {
  32589. $0 = $0|0;
  32590. var $$0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0;
  32591. var $9 = 0, label = 0, sp = 0;
  32592. sp = STACKTOP;
  32593. $1 = ((($0)) + 74|0);
  32594. $2 = HEAP8[$1>>0]|0;
  32595. $3 = $2 << 24 >> 24;
  32596. $4 = (($3) + 255)|0;
  32597. $5 = $4 | $3;
  32598. $6 = $5&255;
  32599. HEAP8[$1>>0] = $6;
  32600. $7 = HEAP32[$0>>2]|0;
  32601. $8 = $7 & 8;
  32602. $9 = ($8|0)==(0);
  32603. if ($9) {
  32604. $11 = ((($0)) + 8|0);
  32605. HEAP32[$11>>2] = 0;
  32606. $12 = ((($0)) + 4|0);
  32607. HEAP32[$12>>2] = 0;
  32608. $13 = ((($0)) + 44|0);
  32609. $14 = HEAP32[$13>>2]|0;
  32610. $15 = ((($0)) + 28|0);
  32611. HEAP32[$15>>2] = $14;
  32612. $16 = ((($0)) + 20|0);
  32613. HEAP32[$16>>2] = $14;
  32614. $17 = ((($0)) + 48|0);
  32615. $18 = HEAP32[$17>>2]|0;
  32616. $19 = (($14) + ($18)|0);
  32617. $20 = ((($0)) + 16|0);
  32618. HEAP32[$20>>2] = $19;
  32619. $$0 = 0;
  32620. } else {
  32621. $10 = $7 | 32;
  32622. HEAP32[$0>>2] = $10;
  32623. $$0 = -1;
  32624. }
  32625. return ($$0|0);
  32626. }
  32627. function _sn_write($0,$1,$2) {
  32628. $0 = $0|0;
  32629. $1 = $1|0;
  32630. $2 = $2|0;
  32631. var $$ = 0, $10 = 0, $11 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
  32632. sp = STACKTOP;
  32633. $3 = ((($0)) + 16|0);
  32634. $4 = HEAP32[$3>>2]|0;
  32635. $5 = ((($0)) + 20|0);
  32636. $6 = HEAP32[$5>>2]|0;
  32637. $7 = $6;
  32638. $8 = (($4) - ($7))|0;
  32639. $9 = ($8>>>0)>($2>>>0);
  32640. $$ = $9 ? $2 : $8;
  32641. _memcpy(($6|0),($1|0),($$|0))|0;
  32642. $10 = HEAP32[$5>>2]|0;
  32643. $11 = (($10) + ($$)|0);
  32644. HEAP32[$5>>2] = $11;
  32645. return ($2|0);
  32646. }
  32647. function ___floatscan($0,$1,$2) {
  32648. $0 = $0|0;
  32649. $1 = $1|0;
  32650. $2 = $2|0;
  32651. var $$0 = 0, $$0105$ph = 0, $$0106$ph = 0, $$0107$lcssa = 0, $$0107127 = 0, $$0113 = 0, $$0114 = 0.0, $$1$lcssa = 0, $$1108 = 0, $$1128 = 0, $$2 = 0, $$2109125 = 0, $$3110 = 0, $$3126 = 0, $$4 = 0, $$4111 = 0, $$5 = 0, $$6 = 0, $$in = 0, $$old8 = 0;
  32652. var $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0;
  32653. var $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0.0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0.0, $14 = 0, $15 = 0;
  32654. var $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0;
  32655. var $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0;
  32656. var $53 = 0.0, $54 = 0.0, $55 = 0.0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0;
  32657. var $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0;
  32658. var $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $or$cond = 0, $or$cond5 = 0, $or$cond7 = 0, $or$cond9 = 0, label = 0, sp = 0;
  32659. sp = STACKTOP;
  32660. switch ($1|0) {
  32661. case 0: {
  32662. $$0105$ph = -149;$$0106$ph = 24;
  32663. label = 4;
  32664. break;
  32665. }
  32666. case 1: {
  32667. $$0105$ph = -1074;$$0106$ph = 53;
  32668. label = 4;
  32669. break;
  32670. }
  32671. case 2: {
  32672. $$0105$ph = -1074;$$0106$ph = 53;
  32673. label = 4;
  32674. break;
  32675. }
  32676. default: {
  32677. $$0114 = 0.0;
  32678. }
  32679. }
  32680. L4: do {
  32681. if ((label|0) == 4) {
  32682. $3 = ((($0)) + 4|0);
  32683. $4 = ((($0)) + 100|0);
  32684. while(1) {
  32685. $5 = HEAP32[$3>>2]|0;
  32686. $6 = HEAP32[$4>>2]|0;
  32687. $7 = ($5>>>0)<($6>>>0);
  32688. if ($7) {
  32689. $8 = ((($5)) + 1|0);
  32690. HEAP32[$3>>2] = $8;
  32691. $9 = HEAP8[$5>>0]|0;
  32692. $10 = $9&255;
  32693. $12 = $10;
  32694. } else {
  32695. $11 = (___shgetc($0)|0);
  32696. $12 = $11;
  32697. }
  32698. $13 = (_isspace($12)|0);
  32699. $14 = ($13|0)==(0);
  32700. if ($14) {
  32701. break;
  32702. }
  32703. }
  32704. L13: do {
  32705. switch ($12|0) {
  32706. case 43: case 45: {
  32707. $15 = ($12|0)==(45);
  32708. $16 = $15&1;
  32709. $17 = $16 << 1;
  32710. $18 = (1 - ($17))|0;
  32711. $19 = HEAP32[$3>>2]|0;
  32712. $20 = HEAP32[$4>>2]|0;
  32713. $21 = ($19>>>0)<($20>>>0);
  32714. if ($21) {
  32715. $22 = ((($19)) + 1|0);
  32716. HEAP32[$3>>2] = $22;
  32717. $23 = HEAP8[$19>>0]|0;
  32718. $24 = $23&255;
  32719. $$0 = $24;$$0113 = $18;
  32720. break L13;
  32721. } else {
  32722. $25 = (___shgetc($0)|0);
  32723. $$0 = $25;$$0113 = $18;
  32724. break L13;
  32725. }
  32726. break;
  32727. }
  32728. default: {
  32729. $$0 = $12;$$0113 = 1;
  32730. }
  32731. }
  32732. } while(0);
  32733. $$0107127 = 0;$$1128 = $$0;
  32734. while(1) {
  32735. $26 = $$1128 | 32;
  32736. $27 = (17908 + ($$0107127)|0);
  32737. $28 = HEAP8[$27>>0]|0;
  32738. $29 = $28 << 24 >> 24;
  32739. $30 = ($26|0)==($29|0);
  32740. if (!($30)) {
  32741. $$0107$lcssa = $$0107127;$$1$lcssa = $$1128;
  32742. break;
  32743. }
  32744. $31 = ($$0107127>>>0)<(7);
  32745. do {
  32746. if ($31) {
  32747. $32 = HEAP32[$3>>2]|0;
  32748. $33 = HEAP32[$4>>2]|0;
  32749. $34 = ($32>>>0)<($33>>>0);
  32750. if ($34) {
  32751. $35 = ((($32)) + 1|0);
  32752. HEAP32[$3>>2] = $35;
  32753. $36 = HEAP8[$32>>0]|0;
  32754. $37 = $36&255;
  32755. $$2 = $37;
  32756. break;
  32757. } else {
  32758. $38 = (___shgetc($0)|0);
  32759. $$2 = $38;
  32760. break;
  32761. }
  32762. } else {
  32763. $$2 = $$1128;
  32764. }
  32765. } while(0);
  32766. $39 = (($$0107127) + 1)|0;
  32767. $40 = ($39>>>0)<(8);
  32768. if ($40) {
  32769. $$0107127 = $39;$$1128 = $$2;
  32770. } else {
  32771. $$0107$lcssa = $39;$$1$lcssa = $$2;
  32772. break;
  32773. }
  32774. }
  32775. L29: do {
  32776. switch ($$0107$lcssa|0) {
  32777. case 8: {
  32778. break;
  32779. }
  32780. case 3: {
  32781. label = 23;
  32782. break;
  32783. }
  32784. default: {
  32785. $41 = ($$0107$lcssa>>>0)>(3);
  32786. $42 = ($2|0)!=(0);
  32787. $or$cond5 = $42 & $41;
  32788. if ($or$cond5) {
  32789. $43 = ($$0107$lcssa|0)==(8);
  32790. if ($43) {
  32791. break L29;
  32792. } else {
  32793. label = 23;
  32794. break L29;
  32795. }
  32796. }
  32797. $56 = ($$0107$lcssa|0)==(0);
  32798. L34: do {
  32799. if ($56) {
  32800. $$2109125 = 0;$$3126 = $$1$lcssa;
  32801. while(1) {
  32802. $57 = $$3126 | 32;
  32803. $58 = (17917 + ($$2109125)|0);
  32804. $59 = HEAP8[$58>>0]|0;
  32805. $60 = $59 << 24 >> 24;
  32806. $61 = ($57|0)==($60|0);
  32807. if (!($61)) {
  32808. $$3110 = $$2109125;$$5 = $$3126;
  32809. break L34;
  32810. }
  32811. $62 = ($$2109125>>>0)<(2);
  32812. do {
  32813. if ($62) {
  32814. $63 = HEAP32[$3>>2]|0;
  32815. $64 = HEAP32[$4>>2]|0;
  32816. $65 = ($63>>>0)<($64>>>0);
  32817. if ($65) {
  32818. $66 = ((($63)) + 1|0);
  32819. HEAP32[$3>>2] = $66;
  32820. $67 = HEAP8[$63>>0]|0;
  32821. $68 = $67&255;
  32822. $$4 = $68;
  32823. break;
  32824. } else {
  32825. $69 = (___shgetc($0)|0);
  32826. $$4 = $69;
  32827. break;
  32828. }
  32829. } else {
  32830. $$4 = $$3126;
  32831. }
  32832. } while(0);
  32833. $70 = (($$2109125) + 1)|0;
  32834. $71 = ($70>>>0)<(3);
  32835. if ($71) {
  32836. $$2109125 = $70;$$3126 = $$4;
  32837. } else {
  32838. $$3110 = $70;$$5 = $$4;
  32839. break;
  32840. }
  32841. }
  32842. } else {
  32843. $$3110 = $$0107$lcssa;$$5 = $$1$lcssa;
  32844. }
  32845. } while(0);
  32846. switch ($$3110|0) {
  32847. case 3: {
  32848. $72 = HEAP32[$3>>2]|0;
  32849. $73 = HEAP32[$4>>2]|0;
  32850. $74 = ($72>>>0)<($73>>>0);
  32851. if ($74) {
  32852. $75 = ((($72)) + 1|0);
  32853. HEAP32[$3>>2] = $75;
  32854. $76 = HEAP8[$72>>0]|0;
  32855. $77 = $76&255;
  32856. $80 = $77;
  32857. } else {
  32858. $78 = (___shgetc($0)|0);
  32859. $80 = $78;
  32860. }
  32861. $79 = ($80|0)==(40);
  32862. if ($79) {
  32863. $$4111 = 1;
  32864. } else {
  32865. $81 = HEAP32[$4>>2]|0;
  32866. $82 = ($81|0)==(0|0);
  32867. if ($82) {
  32868. $$0114 = nan;
  32869. break L4;
  32870. }
  32871. $83 = HEAP32[$3>>2]|0;
  32872. $84 = ((($83)) + -1|0);
  32873. HEAP32[$3>>2] = $84;
  32874. $$0114 = nan;
  32875. break L4;
  32876. }
  32877. while(1) {
  32878. $85 = HEAP32[$3>>2]|0;
  32879. $86 = HEAP32[$4>>2]|0;
  32880. $87 = ($85>>>0)<($86>>>0);
  32881. if ($87) {
  32882. $88 = ((($85)) + 1|0);
  32883. HEAP32[$3>>2] = $88;
  32884. $89 = HEAP8[$85>>0]|0;
  32885. $90 = $89&255;
  32886. $93 = $90;
  32887. } else {
  32888. $91 = (___shgetc($0)|0);
  32889. $93 = $91;
  32890. }
  32891. $92 = (($93) + -48)|0;
  32892. $94 = ($92>>>0)<(10);
  32893. $95 = (($93) + -65)|0;
  32894. $96 = ($95>>>0)<(26);
  32895. $or$cond = $94 | $96;
  32896. if (!($or$cond)) {
  32897. $97 = (($93) + -97)|0;
  32898. $98 = ($97>>>0)<(26);
  32899. $99 = ($93|0)==(95);
  32900. $or$cond7 = $99 | $98;
  32901. if (!($or$cond7)) {
  32902. break;
  32903. }
  32904. }
  32905. $111 = (($$4111) + 1)|0;
  32906. $$4111 = $111;
  32907. }
  32908. $100 = ($93|0)==(41);
  32909. if ($100) {
  32910. $$0114 = nan;
  32911. break L4;
  32912. }
  32913. $101 = HEAP32[$4>>2]|0;
  32914. $102 = ($101|0)==(0|0);
  32915. if (!($102)) {
  32916. $103 = HEAP32[$3>>2]|0;
  32917. $104 = ((($103)) + -1|0);
  32918. HEAP32[$3>>2] = $104;
  32919. }
  32920. if (!($42)) {
  32921. $106 = (___errno_location()|0);
  32922. HEAP32[$106>>2] = 22;
  32923. ___shlim($0,0);
  32924. $$0114 = 0.0;
  32925. break L4;
  32926. }
  32927. $105 = ($$4111|0)==(0);
  32928. if ($105) {
  32929. $$0114 = nan;
  32930. break L4;
  32931. } else {
  32932. $$in = $$4111;
  32933. }
  32934. while(1) {
  32935. $107 = (($$in) + -1)|0;
  32936. if (!($102)) {
  32937. $108 = HEAP32[$3>>2]|0;
  32938. $109 = ((($108)) + -1|0);
  32939. HEAP32[$3>>2] = $109;
  32940. }
  32941. $110 = ($107|0)==(0);
  32942. if ($110) {
  32943. $$0114 = nan;
  32944. break L4;
  32945. } else {
  32946. $$in = $107;
  32947. }
  32948. }
  32949. break;
  32950. }
  32951. case 0: {
  32952. $117 = ($$5|0)==(48);
  32953. if ($117) {
  32954. $118 = HEAP32[$3>>2]|0;
  32955. $119 = HEAP32[$4>>2]|0;
  32956. $120 = ($118>>>0)<($119>>>0);
  32957. if ($120) {
  32958. $121 = ((($118)) + 1|0);
  32959. HEAP32[$3>>2] = $121;
  32960. $122 = HEAP8[$118>>0]|0;
  32961. $123 = $122&255;
  32962. $126 = $123;
  32963. } else {
  32964. $124 = (___shgetc($0)|0);
  32965. $126 = $124;
  32966. }
  32967. $125 = $126 | 32;
  32968. $127 = ($125|0)==(120);
  32969. if ($127) {
  32970. $128 = (+_hexfloat($0,$$0106$ph,$$0105$ph,$$0113,$2));
  32971. $$0114 = $128;
  32972. break L4;
  32973. }
  32974. $129 = HEAP32[$4>>2]|0;
  32975. $130 = ($129|0)==(0|0);
  32976. if ($130) {
  32977. $$6 = 48;
  32978. } else {
  32979. $131 = HEAP32[$3>>2]|0;
  32980. $132 = ((($131)) + -1|0);
  32981. HEAP32[$3>>2] = $132;
  32982. $$6 = 48;
  32983. }
  32984. } else {
  32985. $$6 = $$5;
  32986. }
  32987. $133 = (+_decfloat($0,$$6,$$0106$ph,$$0105$ph,$$0113,$2));
  32988. $$0114 = $133;
  32989. break L4;
  32990. break;
  32991. }
  32992. default: {
  32993. $112 = HEAP32[$4>>2]|0;
  32994. $113 = ($112|0)==(0|0);
  32995. if (!($113)) {
  32996. $114 = HEAP32[$3>>2]|0;
  32997. $115 = ((($114)) + -1|0);
  32998. HEAP32[$3>>2] = $115;
  32999. }
  33000. $116 = (___errno_location()|0);
  33001. HEAP32[$116>>2] = 22;
  33002. ___shlim($0,0);
  33003. $$0114 = 0.0;
  33004. break L4;
  33005. }
  33006. }
  33007. }
  33008. }
  33009. } while(0);
  33010. if ((label|0) == 23) {
  33011. $44 = HEAP32[$4>>2]|0;
  33012. $45 = ($44|0)==(0|0);
  33013. if (!($45)) {
  33014. $46 = HEAP32[$3>>2]|0;
  33015. $47 = ((($46)) + -1|0);
  33016. HEAP32[$3>>2] = $47;
  33017. }
  33018. $48 = ($2|0)!=(0);
  33019. $49 = ($$0107$lcssa>>>0)>(3);
  33020. $or$cond9 = $48 & $49;
  33021. if ($or$cond9) {
  33022. $$1108 = $$0107$lcssa;
  33023. while(1) {
  33024. if (!($45)) {
  33025. $50 = HEAP32[$3>>2]|0;
  33026. $51 = ((($50)) + -1|0);
  33027. HEAP32[$3>>2] = $51;
  33028. }
  33029. $52 = (($$1108) + -1)|0;
  33030. $$old8 = ($52>>>0)>(3);
  33031. if ($$old8) {
  33032. $$1108 = $52;
  33033. } else {
  33034. break;
  33035. }
  33036. }
  33037. }
  33038. }
  33039. $53 = (+($$0113|0));
  33040. $54 = $53 * inf;
  33041. $55 = $54;
  33042. $$0114 = $55;
  33043. }
  33044. } while(0);
  33045. return (+$$0114);
  33046. }
  33047. function _hexfloat($0,$1,$2,$3,$4) {
  33048. $0 = $0|0;
  33049. $1 = $1|0;
  33050. $2 = $2|0;
  33051. $3 = $3|0;
  33052. $4 = $4|0;
  33053. var $$0 = 0, $$0133 = 0, $$0142 = 0, $$0146 = 0, $$0148 = 0, $$0148$ = 0, $$0151 = 0.0, $$0152 = 0.0, $$0155 = 0.0, $$0155$ = 0.0, $$0159 = 0, $$0165 = 0.0, $$0166 = 0, $$0166169 = 0, $$0166170 = 0, $$1$ph = 0, $$1147 = 0, $$1149 = 0, $$1153 = 0.0, $$1156 = 0.0;
  33054. var $$1160 = 0, $$2 = 0, $$2$lcssa = 0, $$2144 = 0, $$2150 = 0, $$2154 = 0.0, $$2157 = 0.0, $$2161 = 0, $$3145 = 0, $$3158$lcssa = 0.0, $$3158179 = 0.0, $$3162$lcssa = 0, $$3162183 = 0, $$4 = 0.0, $$4163$lcssa = 0, $$4163178 = 0, $$5 = 0.0, $$5164 = 0, $$6 = 0, $$pn = 0.0;
  33055. var $$pre = 0.0, $$pre$phiZ2D = 0.0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0;
  33056. var $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0;
  33057. var $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0.0, $143 = 0.0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0;
  33058. var $152 = 0, $153 = 0.0, $154 = 0.0, $155 = 0.0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0.0, $167 = 0.0, $168 = 0.0, $169 = 0, $17 = 0;
  33059. var $170 = 0, $171 = 0.0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0;
  33060. var $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0.0, $197 = 0, $198 = 0.0, $199 = 0.0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0.0, $206 = 0.0;
  33061. var $207 = 0.0, $208 = 0.0, $209 = 0.0, $21 = 0, $210 = 0.0, $211 = 0, $212 = 0, $213 = 0.0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0;
  33062. var $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0;
  33063. var $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0.0, $67 = 0.0;
  33064. var $68 = 0.0, $69 = 0.0, $7 = 0, $70 = 0, $71 = 0, $72 = 0.0, $73 = 0.0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0;
  33065. var $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0.0, $96 = 0.0, $97 = 0, $98 = 0, $99 = 0, $not$ = 0, $or$cond = 0, $or$cond168 = 0, $or$cond206 = 0, $or$cond4 = 0;
  33066. var $or$cond6 = 0, label = 0, sp = 0;
  33067. sp = STACKTOP;
  33068. $5 = ((($0)) + 4|0);
  33069. $6 = HEAP32[$5>>2]|0;
  33070. $7 = ((($0)) + 100|0);
  33071. $8 = HEAP32[$7>>2]|0;
  33072. $9 = ($6>>>0)<($8>>>0);
  33073. if ($9) {
  33074. $10 = ((($6)) + 1|0);
  33075. HEAP32[$5>>2] = $10;
  33076. $11 = HEAP8[$6>>0]|0;
  33077. $12 = $11&255;
  33078. $$0 = $12;$$0142 = 0;
  33079. } else {
  33080. $13 = (___shgetc($0)|0);
  33081. $$0 = $13;$$0142 = 0;
  33082. }
  33083. L4: while(1) {
  33084. switch ($$0|0) {
  33085. case 46: {
  33086. label = 8;
  33087. break L4;
  33088. break;
  33089. }
  33090. case 48: {
  33091. break;
  33092. }
  33093. default: {
  33094. $$0146 = 0;$$0148 = 0;$$0152 = 1.0;$$0155 = 0.0;$$0159 = 0;$$2 = $$0;$$2144 = $$0142;$101 = 0;$53 = 0;$55 = 0;$99 = 0;
  33095. break L4;
  33096. }
  33097. }
  33098. $14 = HEAP32[$5>>2]|0;
  33099. $15 = HEAP32[$7>>2]|0;
  33100. $16 = ($14>>>0)<($15>>>0);
  33101. if ($16) {
  33102. $17 = ((($14)) + 1|0);
  33103. HEAP32[$5>>2] = $17;
  33104. $18 = HEAP8[$14>>0]|0;
  33105. $19 = $18&255;
  33106. $$0 = $19;$$0142 = 1;
  33107. continue;
  33108. } else {
  33109. $20 = (___shgetc($0)|0);
  33110. $$0 = $20;$$0142 = 1;
  33111. continue;
  33112. }
  33113. }
  33114. if ((label|0) == 8) {
  33115. $21 = HEAP32[$5>>2]|0;
  33116. $22 = HEAP32[$7>>2]|0;
  33117. $23 = ($21>>>0)<($22>>>0);
  33118. if ($23) {
  33119. $24 = ((($21)) + 1|0);
  33120. HEAP32[$5>>2] = $24;
  33121. $25 = HEAP8[$21>>0]|0;
  33122. $26 = $25&255;
  33123. $$1$ph = $26;
  33124. } else {
  33125. $27 = (___shgetc($0)|0);
  33126. $$1$ph = $27;
  33127. }
  33128. $28 = ($$1$ph|0)==(48);
  33129. if ($28) {
  33130. $36 = 0;$37 = 0;
  33131. while(1) {
  33132. $29 = HEAP32[$5>>2]|0;
  33133. $30 = HEAP32[$7>>2]|0;
  33134. $31 = ($29>>>0)<($30>>>0);
  33135. if ($31) {
  33136. $32 = ((($29)) + 1|0);
  33137. HEAP32[$5>>2] = $32;
  33138. $33 = HEAP8[$29>>0]|0;
  33139. $34 = $33&255;
  33140. $41 = $34;
  33141. } else {
  33142. $35 = (___shgetc($0)|0);
  33143. $41 = $35;
  33144. }
  33145. $38 = (_i64Add(($36|0),($37|0),-1,-1)|0);
  33146. $39 = tempRet0;
  33147. $40 = ($41|0)==(48);
  33148. if ($40) {
  33149. $36 = $38;$37 = $39;
  33150. } else {
  33151. $$0146 = 1;$$0148 = 0;$$0152 = 1.0;$$0155 = 0.0;$$0159 = 0;$$2 = $41;$$2144 = 1;$101 = $39;$53 = 0;$55 = 0;$99 = $38;
  33152. break;
  33153. }
  33154. }
  33155. } else {
  33156. $$0146 = 1;$$0148 = 0;$$0152 = 1.0;$$0155 = 0.0;$$0159 = 0;$$2 = $$1$ph;$$2144 = $$0142;$101 = 0;$53 = 0;$55 = 0;$99 = 0;
  33157. }
  33158. }
  33159. while(1) {
  33160. $42 = (($$2) + -48)|0;
  33161. $43 = ($42>>>0)<(10);
  33162. $44 = ($$2|0)==(46);
  33163. if (!($43)) {
  33164. $45 = $$2 | 32;
  33165. $46 = (($45) + -97)|0;
  33166. $47 = ($46>>>0)<(6);
  33167. $or$cond6 = $44 | $47;
  33168. if (!($or$cond6)) {
  33169. $$2$lcssa = $$2;
  33170. break;
  33171. }
  33172. }
  33173. if ($44) {
  33174. $48 = ($$0146|0)==(0);
  33175. if ($48) {
  33176. $$1147 = 1;$$2150 = $$0148;$$2154 = $$0152;$$2157 = $$0155;$$2161 = $$0159;$$3145 = $$2144;$214 = $55;$215 = $53;$216 = $55;$217 = $53;
  33177. } else {
  33178. $$2$lcssa = 46;
  33179. break;
  33180. }
  33181. } else {
  33182. $49 = ($$2|0)>(57);
  33183. $50 = $$2 | 32;
  33184. $51 = (($50) + -87)|0;
  33185. $$0133 = $49 ? $51 : $42;
  33186. $52 = ($53|0)<(0);
  33187. $54 = ($55>>>0)<(8);
  33188. $56 = ($53|0)==(0);
  33189. $57 = $56 & $54;
  33190. $58 = $52 | $57;
  33191. do {
  33192. if ($58) {
  33193. $59 = $$0159 << 4;
  33194. $60 = (($$0133) + ($59))|0;
  33195. $$1149 = $$0148;$$1153 = $$0152;$$1156 = $$0155;$$1160 = $60;
  33196. } else {
  33197. $61 = ($53|0)<(0);
  33198. $62 = ($55>>>0)<(14);
  33199. $63 = ($53|0)==(0);
  33200. $64 = $63 & $62;
  33201. $65 = $61 | $64;
  33202. if ($65) {
  33203. $66 = (+($$0133|0));
  33204. $67 = $$0152 * 0.0625;
  33205. $68 = $67 * $66;
  33206. $69 = $$0155 + $68;
  33207. $$1149 = $$0148;$$1153 = $67;$$1156 = $69;$$1160 = $$0159;
  33208. break;
  33209. } else {
  33210. $70 = ($$0133|0)==(0);
  33211. $71 = ($$0148|0)!=(0);
  33212. $or$cond = $71 | $70;
  33213. $72 = $$0152 * 0.5;
  33214. $73 = $$0155 + $72;
  33215. $$0155$ = $or$cond ? $$0155 : $73;
  33216. $$0148$ = $or$cond ? $$0148 : 1;
  33217. $$1149 = $$0148$;$$1153 = $$0152;$$1156 = $$0155$;$$1160 = $$0159;
  33218. break;
  33219. }
  33220. }
  33221. } while(0);
  33222. $74 = (_i64Add(($55|0),($53|0),1,0)|0);
  33223. $75 = tempRet0;
  33224. $$1147 = $$0146;$$2150 = $$1149;$$2154 = $$1153;$$2157 = $$1156;$$2161 = $$1160;$$3145 = 1;$214 = $99;$215 = $101;$216 = $74;$217 = $75;
  33225. }
  33226. $76 = HEAP32[$5>>2]|0;
  33227. $77 = HEAP32[$7>>2]|0;
  33228. $78 = ($76>>>0)<($77>>>0);
  33229. if ($78) {
  33230. $79 = ((($76)) + 1|0);
  33231. HEAP32[$5>>2] = $79;
  33232. $80 = HEAP8[$76>>0]|0;
  33233. $81 = $80&255;
  33234. $$0146 = $$1147;$$0148 = $$2150;$$0152 = $$2154;$$0155 = $$2157;$$0159 = $$2161;$$2 = $81;$$2144 = $$3145;$101 = $215;$53 = $217;$55 = $216;$99 = $214;
  33235. continue;
  33236. } else {
  33237. $82 = (___shgetc($0)|0);
  33238. $$0146 = $$1147;$$0148 = $$2150;$$0152 = $$2154;$$0155 = $$2157;$$0159 = $$2161;$$2 = $82;$$2144 = $$3145;$101 = $215;$53 = $217;$55 = $216;$99 = $214;
  33239. continue;
  33240. }
  33241. }
  33242. $83 = ($$2144|0)==(0);
  33243. do {
  33244. if ($83) {
  33245. $84 = HEAP32[$7>>2]|0;
  33246. $85 = ($84|0)!=(0|0);
  33247. if ($85) {
  33248. $86 = HEAP32[$5>>2]|0;
  33249. $87 = ((($86)) + -1|0);
  33250. HEAP32[$5>>2] = $87;
  33251. }
  33252. $88 = ($4|0)==(0);
  33253. if ($88) {
  33254. ___shlim($0,0);
  33255. } else {
  33256. if ($85) {
  33257. $89 = HEAP32[$5>>2]|0;
  33258. $90 = ((($89)) + -1|0);
  33259. HEAP32[$5>>2] = $90;
  33260. }
  33261. $91 = ($$0146|0)==(0);
  33262. $92 = ($84|0)==(0|0);
  33263. $or$cond206 = $91 | $92;
  33264. if (!($or$cond206)) {
  33265. $93 = HEAP32[$5>>2]|0;
  33266. $94 = ((($93)) + -1|0);
  33267. HEAP32[$5>>2] = $94;
  33268. }
  33269. }
  33270. $95 = (+($3|0));
  33271. $96 = $95 * 0.0;
  33272. $$0165 = $96;
  33273. } else {
  33274. $97 = ($$0146|0)==(0);
  33275. $98 = $97 ? $55 : $99;
  33276. $100 = $97 ? $53 : $101;
  33277. $102 = ($53|0)<(0);
  33278. $103 = ($55>>>0)<(8);
  33279. $104 = ($53|0)==(0);
  33280. $105 = $104 & $103;
  33281. $106 = $102 | $105;
  33282. if ($106) {
  33283. $$3162183 = $$0159;$108 = $55;$109 = $53;
  33284. while(1) {
  33285. $107 = $$3162183 << 4;
  33286. $110 = (_i64Add(($108|0),($109|0),1,0)|0);
  33287. $111 = tempRet0;
  33288. $112 = ($111|0)<(0);
  33289. $113 = ($110>>>0)<(8);
  33290. $114 = ($111|0)==(0);
  33291. $115 = $114 & $113;
  33292. $116 = $112 | $115;
  33293. if ($116) {
  33294. $$3162183 = $107;$108 = $110;$109 = $111;
  33295. } else {
  33296. $$3162$lcssa = $107;
  33297. break;
  33298. }
  33299. }
  33300. } else {
  33301. $$3162$lcssa = $$0159;
  33302. }
  33303. $117 = $$2$lcssa | 32;
  33304. $118 = ($117|0)==(112);
  33305. if ($118) {
  33306. $119 = (_scanexp($0,$4)|0);
  33307. $120 = tempRet0;
  33308. $121 = ($119|0)==(0);
  33309. $122 = ($120|0)==(-2147483648);
  33310. $123 = $121 & $122;
  33311. if ($123) {
  33312. $124 = ($4|0)==(0);
  33313. if ($124) {
  33314. ___shlim($0,0);
  33315. $$0165 = 0.0;
  33316. break;
  33317. }
  33318. $125 = HEAP32[$7>>2]|0;
  33319. $126 = ($125|0)==(0|0);
  33320. if ($126) {
  33321. $137 = 0;$138 = 0;
  33322. } else {
  33323. $127 = HEAP32[$5>>2]|0;
  33324. $128 = ((($127)) + -1|0);
  33325. HEAP32[$5>>2] = $128;
  33326. $137 = 0;$138 = 0;
  33327. }
  33328. } else {
  33329. $137 = $119;$138 = $120;
  33330. }
  33331. } else {
  33332. $129 = HEAP32[$7>>2]|0;
  33333. $130 = ($129|0)==(0|0);
  33334. if ($130) {
  33335. $137 = 0;$138 = 0;
  33336. } else {
  33337. $131 = HEAP32[$5>>2]|0;
  33338. $132 = ((($131)) + -1|0);
  33339. HEAP32[$5>>2] = $132;
  33340. $137 = 0;$138 = 0;
  33341. }
  33342. }
  33343. $133 = (_bitshift64Shl(($98|0),($100|0),2)|0);
  33344. $134 = tempRet0;
  33345. $135 = (_i64Add(($133|0),($134|0),-32,-1)|0);
  33346. $136 = tempRet0;
  33347. $139 = (_i64Add(($135|0),($136|0),($137|0),($138|0))|0);
  33348. $140 = tempRet0;
  33349. $141 = ($$3162$lcssa|0)==(0);
  33350. if ($141) {
  33351. $142 = (+($3|0));
  33352. $143 = $142 * 0.0;
  33353. $$0165 = $143;
  33354. break;
  33355. }
  33356. $144 = (0 - ($2))|0;
  33357. $145 = ($144|0)<(0);
  33358. $146 = $145 << 31 >> 31;
  33359. $147 = ($140|0)>($146|0);
  33360. $148 = ($139>>>0)>($144>>>0);
  33361. $149 = ($140|0)==($146|0);
  33362. $150 = $149 & $148;
  33363. $151 = $147 | $150;
  33364. if ($151) {
  33365. $152 = (___errno_location()|0);
  33366. HEAP32[$152>>2] = 34;
  33367. $153 = (+($3|0));
  33368. $154 = $153 * 1.7976931348623157E+308;
  33369. $155 = $154 * 1.7976931348623157E+308;
  33370. $$0165 = $155;
  33371. break;
  33372. }
  33373. $156 = (($2) + -106)|0;
  33374. $157 = ($156|0)<(0);
  33375. $158 = $157 << 31 >> 31;
  33376. $159 = ($140|0)<($158|0);
  33377. $160 = ($139>>>0)<($156>>>0);
  33378. $161 = ($140|0)==($158|0);
  33379. $162 = $161 & $160;
  33380. $163 = $159 | $162;
  33381. if ($163) {
  33382. $165 = (___errno_location()|0);
  33383. HEAP32[$165>>2] = 34;
  33384. $166 = (+($3|0));
  33385. $167 = $166 * 2.2250738585072014E-308;
  33386. $168 = $167 * 2.2250738585072014E-308;
  33387. $$0165 = $168;
  33388. break;
  33389. }
  33390. $164 = ($$3162$lcssa|0)>(-1);
  33391. if ($164) {
  33392. $$3158179 = $$0155;$$4163178 = $$3162$lcssa;$173 = $139;$174 = $140;
  33393. while(1) {
  33394. $169 = !($$3158179 >= 0.5);
  33395. $170 = $$4163178 << 1;
  33396. $171 = $$3158179 + -1.0;
  33397. $not$ = $169 ^ 1;
  33398. $172 = $not$&1;
  33399. $$5164 = $170 | $172;
  33400. $$pn = $169 ? $$3158179 : $171;
  33401. $$4 = $$3158179 + $$pn;
  33402. $175 = (_i64Add(($173|0),($174|0),-1,-1)|0);
  33403. $176 = tempRet0;
  33404. $177 = ($$5164|0)>(-1);
  33405. if ($177) {
  33406. $$3158179 = $$4;$$4163178 = $$5164;$173 = $175;$174 = $176;
  33407. } else {
  33408. $$3158$lcssa = $$4;$$4163$lcssa = $$5164;$184 = $175;$185 = $176;
  33409. break;
  33410. }
  33411. }
  33412. } else {
  33413. $$3158$lcssa = $$0155;$$4163$lcssa = $$3162$lcssa;$184 = $139;$185 = $140;
  33414. }
  33415. $178 = ($1|0)<(0);
  33416. $179 = $178 << 31 >> 31;
  33417. $180 = ($2|0)<(0);
  33418. $181 = $180 << 31 >> 31;
  33419. $182 = (_i64Subtract(32,0,($2|0),($181|0))|0);
  33420. $183 = tempRet0;
  33421. $186 = (_i64Add(($182|0),($183|0),($184|0),($185|0))|0);
  33422. $187 = tempRet0;
  33423. $188 = ($179|0)>($187|0);
  33424. $189 = ($1>>>0)>($186>>>0);
  33425. $190 = ($179|0)==($187|0);
  33426. $191 = $190 & $189;
  33427. $192 = $188 | $191;
  33428. if ($192) {
  33429. $193 = ($186|0)>(0);
  33430. if ($193) {
  33431. $$0166 = $186;
  33432. label = 59;
  33433. } else {
  33434. $$0166170 = 0;$197 = 84;
  33435. label = 61;
  33436. }
  33437. } else {
  33438. $$0166 = $1;
  33439. label = 59;
  33440. }
  33441. if ((label|0) == 59) {
  33442. $194 = ($$0166|0)<(53);
  33443. $195 = (84 - ($$0166))|0;
  33444. if ($194) {
  33445. $$0166170 = $$0166;$197 = $195;
  33446. label = 61;
  33447. } else {
  33448. $$pre = (+($3|0));
  33449. $$0151 = 0.0;$$0166169 = $$0166;$$pre$phiZ2D = $$pre;
  33450. }
  33451. }
  33452. if ((label|0) == 61) {
  33453. $196 = (+($3|0));
  33454. $198 = (+_scalbn(1.0,$197));
  33455. $199 = (+_copysignl($198,$196));
  33456. $$0151 = $199;$$0166169 = $$0166170;$$pre$phiZ2D = $196;
  33457. }
  33458. $200 = ($$0166169|0)<(32);
  33459. $201 = $$3158$lcssa != 0.0;
  33460. $or$cond4 = $201 & $200;
  33461. $202 = $$4163$lcssa & 1;
  33462. $203 = ($202|0)==(0);
  33463. $or$cond168 = $203 & $or$cond4;
  33464. $204 = $or$cond168&1;
  33465. $$6 = (($204) + ($$4163$lcssa))|0;
  33466. $$5 = $or$cond168 ? 0.0 : $$3158$lcssa;
  33467. $205 = (+($$6>>>0));
  33468. $206 = $$pre$phiZ2D * $205;
  33469. $207 = $$0151 + $206;
  33470. $208 = $$pre$phiZ2D * $$5;
  33471. $209 = $208 + $207;
  33472. $210 = $209 - $$0151;
  33473. $211 = $210 != 0.0;
  33474. if (!($211)) {
  33475. $212 = (___errno_location()|0);
  33476. HEAP32[$212>>2] = 34;
  33477. }
  33478. $213 = (+_scalbnl($210,$184));
  33479. $$0165 = $213;
  33480. }
  33481. } while(0);
  33482. return (+$$0165);
  33483. }
  33484. function _decfloat($0,$1,$2,$3,$4,$5) {
  33485. $0 = $0|0;
  33486. $1 = $1|0;
  33487. $2 = $2|0;
  33488. $3 = $3|0;
  33489. $4 = $4|0;
  33490. $5 = $5|0;
  33491. var $$ = 0, $$$0345 = 0, $$$0350 = 0, $$$0385 = 0, $$$0401 = 0, $$$5355 = 0, $$$5390 = 0, $$0329 = 0, $$0332490 = 0, $$0333 = 0, $$0334 = 0, $$0336486 = 0, $$0340496 = 0, $$0341$lcssa = 0, $$0341463 = 0, $$0341464 = 0, $$0341465 = 0, $$0341513 = 0, $$0345$lcssa = 0, $$0345467 = 0;
  33492. var $$0345468 = 0, $$0345469 = 0, $$0345512 = 0, $$0350$lcssa554 = 0, $$0350494 = 0, $$0360 = 0.0, $$0361 = 0.0, $$0365484 = 0.0, $$0372 = 0, $$0380 = 0, $$0380$ph = 0, $$0385$lcssa553 = 0, $$0385493 = 0, $$0393 = 0, $$0396 = 0, $$0401$lcssa = 0, $$0401473 = 0, $$0401474 = 0, $$0401475 = 0, $$0401509 = 0;
  33493. var $$1 = 0.0, $$10 = 0, $$1330$be = 0, $$1330$ph = 0, $$1335 = 0, $$1337 = 0, $$1362 = 0.0, $$1366 = 0.0, $$1373 = 0, $$1373$ph448 = 0, $$1381 = 0, $$1381$ph = 0, $$1381$ph558 = 0, $$1394$lcssa = 0, $$1394511 = 0, $$2 = 0, $$2343 = 0, $$2347 = 0, $$2352$ph449 = 0, $$2367 = 0.0;
  33494. var $$2371$v = 0, $$2374 = 0, $$2387$ph447 = 0, $$2395 = 0, $$2398 = 0, $$2403 = 0, $$3$be = 0, $$3$lcssa = 0, $$3344503 = 0, $$3348 = 0, $$3364 = 0.0, $$3368 = 0.0, $$3375 = 0, $$3383 = 0, $$3399$lcssa = 0, $$3399510 = 0, $$3514 = 0, $$413 = 0, $$425 = 0, $$4349495 = 0;
  33495. var $$4354 = 0, $$4354$ph = 0, $$4354$ph559 = 0, $$4376 = 0, $$4384 = 0, $$4389$ph = 0, $$4389$ph445 = 0, $$4400 = 0, $$4485 = 0, $$5 = 0, $$5$in = 0, $$5355488 = 0, $$5390487 = 0, $$6378$ph = 0, $$6489 = 0, $$9483 = 0, $$neg442 = 0, $$neg443 = 0, $$pre = 0, $$promoted = 0;
  33496. var $$sink = 0, $$sink421$off0 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0.0, $103 = 0.0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0;
  33497. var $116 = 0, $117 = 0, $118 = 0, $119 = 0.0, $12 = 0, $120 = 0.0, $121 = 0.0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0.0, $132 = 0.0, $133 = 0.0;
  33498. var $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0.0, $144 = 0.0, $145 = 0.0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0;
  33499. var $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0.0, $159 = 0.0, $16 = 0, $160 = 0.0, $161 = 0, $162 = 0.0, $163 = 0.0, $164 = 0.0, $165 = 0, $166 = 0, $167 = 0, $168 = 0.0, $169 = 0.0, $17 = 0;
  33500. var $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0.0, $177 = 0.0, $178 = 0.0, $179 = 0, $18 = 0, $180 = 0.0, $181 = 0.0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0;
  33501. var $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0;
  33502. var $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0;
  33503. var $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0;
  33504. var $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0;
  33505. var $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0;
  33506. var $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0;
  33507. var $298 = 0, $299 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0.0, $304 = 0, $305 = 0, $306 = 0.0, $307 = 0.0, $308 = 0, $309 = 0.0, $31 = 0, $310 = 0.0, $311 = 0, $312 = 0, $313 = 0, $314 = 0, $315 = 0;
  33508. var $316 = 0, $317 = 0.0, $318 = 0.0, $319 = 0, $32 = 0, $320 = 0.0, $321 = 0.0, $322 = 0.0, $323 = 0.0, $324 = 0, $325 = 0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0, $332 = 0, $333 = 0;
  33509. var $334 = 0.0, $335 = 0.0, $336 = 0, $337 = 0.0, $338 = 0.0, $339 = 0, $34 = 0, $340 = 0, $341 = 0, $342 = 0.0, $343 = 0.0, $344 = 0.0, $345 = 0.0, $346 = 0, $347 = 0, $348 = 0.0, $349 = 0, $35 = 0, $350 = 0.0, $351 = 0.0;
  33510. var $352 = 0.0, $353 = 0, $354 = 0, $355 = 0, $356 = 0.0, $357 = 0, $358 = 0.0, $359 = 0, $36 = 0, $360 = 0, $361 = 0, $362 = 0, $363 = 0, $364 = 0, $365 = 0.0, $366 = 0, $367 = 0, $368 = 0, $369 = 0, $37 = 0;
  33511. var $370 = 0, $371 = 0, $372 = 0, $373 = 0, $374 = 0, $375 = 0, $376 = 0, $377 = 0, $378 = 0, $379 = 0, $38 = 0, $380 = 0, $381 = 0, $382 = 0, $383 = 0, $384 = 0, $385 = 0, $39 = 0, $40 = 0, $41 = 0;
  33512. var $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0;
  33513. var $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0;
  33514. var $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0;
  33515. var $98 = 0, $99 = 0, $cond = 0, $exitcond = 0, $exitcond551 = 0, $narrow = 0, $not$ = 0, $or$cond = 0, $or$cond11 = 0, $or$cond14 = 0, $or$cond415 = 0, $or$cond417 = 0, $or$cond419 = 0, $or$cond420 = 0, $or$cond422 = 0, $or$cond422$not = 0, $or$cond423 = 0, $or$cond426 = 0, $or$cond5 = 0, $sum = 0;
  33516. var label = 0, sp = 0;
  33517. sp = STACKTOP;
  33518. STACKTOP = STACKTOP + 512|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(512|0);
  33519. $6 = sp;
  33520. $sum = (($3) + ($2))|0;
  33521. $7 = (0 - ($sum))|0;
  33522. $8 = ((($0)) + 4|0);
  33523. $9 = ((($0)) + 100|0);
  33524. $$0329 = $1;$$0396 = 0;
  33525. L1: while(1) {
  33526. switch ($$0329|0) {
  33527. case 46: {
  33528. label = 6;
  33529. break L1;
  33530. break;
  33531. }
  33532. case 48: {
  33533. break;
  33534. }
  33535. default: {
  33536. $$0393 = 0;$$2 = $$0329;$$2398 = $$0396;$366 = 0;$367 = 0;
  33537. break L1;
  33538. }
  33539. }
  33540. $10 = HEAP32[$8>>2]|0;
  33541. $11 = HEAP32[$9>>2]|0;
  33542. $12 = ($10>>>0)<($11>>>0);
  33543. if ($12) {
  33544. $13 = ((($10)) + 1|0);
  33545. HEAP32[$8>>2] = $13;
  33546. $14 = HEAP8[$10>>0]|0;
  33547. $15 = $14&255;
  33548. $$0329 = $15;$$0396 = 1;
  33549. continue;
  33550. } else {
  33551. $16 = (___shgetc($0)|0);
  33552. $$0329 = $16;$$0396 = 1;
  33553. continue;
  33554. }
  33555. }
  33556. if ((label|0) == 6) {
  33557. $17 = HEAP32[$8>>2]|0;
  33558. $18 = HEAP32[$9>>2]|0;
  33559. $19 = ($17>>>0)<($18>>>0);
  33560. if ($19) {
  33561. $20 = ((($17)) + 1|0);
  33562. HEAP32[$8>>2] = $20;
  33563. $21 = HEAP8[$17>>0]|0;
  33564. $22 = $21&255;
  33565. $$1330$ph = $22;
  33566. } else {
  33567. $23 = (___shgetc($0)|0);
  33568. $$1330$ph = $23;
  33569. }
  33570. $24 = ($$1330$ph|0)==(48);
  33571. if ($24) {
  33572. $25 = 0;$26 = 0;
  33573. while(1) {
  33574. $27 = (_i64Add(($25|0),($26|0),-1,-1)|0);
  33575. $28 = tempRet0;
  33576. $29 = HEAP32[$8>>2]|0;
  33577. $30 = HEAP32[$9>>2]|0;
  33578. $31 = ($29>>>0)<($30>>>0);
  33579. if ($31) {
  33580. $32 = ((($29)) + 1|0);
  33581. HEAP32[$8>>2] = $32;
  33582. $33 = HEAP8[$29>>0]|0;
  33583. $34 = $33&255;
  33584. $$1330$be = $34;
  33585. } else {
  33586. $35 = (___shgetc($0)|0);
  33587. $$1330$be = $35;
  33588. }
  33589. $36 = ($$1330$be|0)==(48);
  33590. if ($36) {
  33591. $25 = $27;$26 = $28;
  33592. } else {
  33593. $$0393 = 1;$$2 = $$1330$be;$$2398 = 1;$366 = $27;$367 = $28;
  33594. break;
  33595. }
  33596. }
  33597. } else {
  33598. $$0393 = 1;$$2 = $$1330$ph;$$2398 = $$0396;$366 = 0;$367 = 0;
  33599. }
  33600. }
  33601. HEAP32[$6>>2] = 0;
  33602. $37 = (($$2) + -48)|0;
  33603. $38 = ($37>>>0)<(10);
  33604. $39 = ($$2|0)==(46);
  33605. $40 = $39 | $38;
  33606. L20: do {
  33607. if ($40) {
  33608. $41 = ((($6)) + 496|0);
  33609. $$0341513 = 0;$$0345512 = 0;$$0401509 = 0;$$1394511 = $$0393;$$3399510 = $$2398;$$3514 = $$2;$368 = $39;$369 = $37;$370 = $366;$371 = $367;$44 = 0;$45 = 0;
  33610. L22: while(1) {
  33611. do {
  33612. if ($368) {
  33613. $cond = ($$1394511|0)==(0);
  33614. if ($cond) {
  33615. $$2343 = $$0341513;$$2347 = $$0345512;$$2395 = 1;$$2403 = $$0401509;$$4400 = $$3399510;$372 = $44;$373 = $45;$374 = $44;$375 = $45;
  33616. } else {
  33617. break L22;
  33618. }
  33619. } else {
  33620. $43 = ($$0345512|0)<(125);
  33621. $46 = (_i64Add(($44|0),($45|0),1,0)|0);
  33622. $47 = tempRet0;
  33623. $48 = ($$3514|0)!=(48);
  33624. if (!($43)) {
  33625. if (!($48)) {
  33626. $$2343 = $$0341513;$$2347 = $$0345512;$$2395 = $$1394511;$$2403 = $$0401509;$$4400 = $$3399510;$372 = $370;$373 = $371;$374 = $46;$375 = $47;
  33627. break;
  33628. }
  33629. $57 = HEAP32[$41>>2]|0;
  33630. $58 = $57 | 1;
  33631. HEAP32[$41>>2] = $58;
  33632. $$2343 = $$0341513;$$2347 = $$0345512;$$2395 = $$1394511;$$2403 = $$0401509;$$4400 = $$3399510;$372 = $370;$373 = $371;$374 = $46;$375 = $47;
  33633. break;
  33634. }
  33635. $$$0401 = $48 ? $46 : $$0401509;
  33636. $49 = ($$0341513|0)==(0);
  33637. $$pre = (($6) + ($$0345512<<2)|0);
  33638. if ($49) {
  33639. $$sink = $369;
  33640. } else {
  33641. $50 = HEAP32[$$pre>>2]|0;
  33642. $51 = ($50*10)|0;
  33643. $52 = (($$3514) + -48)|0;
  33644. $53 = (($52) + ($51))|0;
  33645. $$sink = $53;
  33646. }
  33647. HEAP32[$$pre>>2] = $$sink;
  33648. $54 = (($$0341513) + 1)|0;
  33649. $55 = ($54|0)==(9);
  33650. $56 = $55&1;
  33651. $$$0345 = (($56) + ($$0345512))|0;
  33652. $$413 = $55 ? 0 : $54;
  33653. $$2343 = $$413;$$2347 = $$$0345;$$2395 = $$1394511;$$2403 = $$$0401;$$4400 = 1;$372 = $370;$373 = $371;$374 = $46;$375 = $47;
  33654. }
  33655. } while(0);
  33656. $59 = HEAP32[$8>>2]|0;
  33657. $60 = HEAP32[$9>>2]|0;
  33658. $61 = ($59>>>0)<($60>>>0);
  33659. if ($61) {
  33660. $62 = ((($59)) + 1|0);
  33661. HEAP32[$8>>2] = $62;
  33662. $63 = HEAP8[$59>>0]|0;
  33663. $64 = $63&255;
  33664. $$3$be = $64;
  33665. } else {
  33666. $65 = (___shgetc($0)|0);
  33667. $$3$be = $65;
  33668. }
  33669. $66 = (($$3$be) + -48)|0;
  33670. $67 = ($66>>>0)<(10);
  33671. $68 = ($$3$be|0)==(46);
  33672. $69 = $68 | $67;
  33673. if ($69) {
  33674. $$0341513 = $$2343;$$0345512 = $$2347;$$0401509 = $$2403;$$1394511 = $$2395;$$3399510 = $$4400;$$3514 = $$3$be;$368 = $68;$369 = $66;$370 = $372;$371 = $373;$44 = $374;$45 = $375;
  33675. } else {
  33676. $$0341$lcssa = $$2343;$$0345$lcssa = $$2347;$$0401$lcssa = $$2403;$$1394$lcssa = $$2395;$$3$lcssa = $$3$be;$$3399$lcssa = $$4400;$72 = $372;$73 = $374;$75 = $373;$76 = $375;
  33677. label = 29;
  33678. break L20;
  33679. }
  33680. }
  33681. $42 = ($$3399510|0)!=(0);
  33682. $$0341465 = $$0341513;$$0345469 = $$0345512;$$0401475 = $$0401509;$376 = $44;$377 = $45;$378 = $370;$379 = $371;$380 = $42;
  33683. label = 37;
  33684. } else {
  33685. $$0341$lcssa = 0;$$0345$lcssa = 0;$$0401$lcssa = 0;$$1394$lcssa = $$0393;$$3$lcssa = $$2;$$3399$lcssa = $$2398;$72 = $366;$73 = 0;$75 = $367;$76 = 0;
  33686. label = 29;
  33687. }
  33688. } while(0);
  33689. do {
  33690. if ((label|0) == 29) {
  33691. $70 = ($$1394$lcssa|0)==(0);
  33692. $71 = $70 ? $73 : $72;
  33693. $74 = $70 ? $76 : $75;
  33694. $77 = ($$3399$lcssa|0)!=(0);
  33695. $78 = $$3$lcssa | 32;
  33696. $79 = ($78|0)==(101);
  33697. $or$cond415 = $77 & $79;
  33698. if (!($or$cond415)) {
  33699. $94 = ($$3$lcssa|0)>(-1);
  33700. if ($94) {
  33701. $$0341465 = $$0341$lcssa;$$0345469 = $$0345$lcssa;$$0401475 = $$0401$lcssa;$376 = $73;$377 = $76;$378 = $71;$379 = $74;$380 = $77;
  33702. label = 37;
  33703. break;
  33704. } else {
  33705. $$0341464 = $$0341$lcssa;$$0345468 = $$0345$lcssa;$$0401474 = $$0401$lcssa;$381 = $73;$382 = $76;$383 = $77;$384 = $71;$385 = $74;
  33706. label = 39;
  33707. break;
  33708. }
  33709. }
  33710. $80 = (_scanexp($0,$5)|0);
  33711. $81 = tempRet0;
  33712. $82 = ($80|0)==(0);
  33713. $83 = ($81|0)==(-2147483648);
  33714. $84 = $82 & $83;
  33715. if ($84) {
  33716. $85 = ($5|0)==(0);
  33717. if ($85) {
  33718. ___shlim($0,0);
  33719. $$1 = 0.0;
  33720. break;
  33721. }
  33722. $86 = HEAP32[$9>>2]|0;
  33723. $87 = ($86|0)==(0|0);
  33724. if ($87) {
  33725. $90 = 0;$91 = 0;
  33726. } else {
  33727. $88 = HEAP32[$8>>2]|0;
  33728. $89 = ((($88)) + -1|0);
  33729. HEAP32[$8>>2] = $89;
  33730. $90 = 0;$91 = 0;
  33731. }
  33732. } else {
  33733. $90 = $80;$91 = $81;
  33734. }
  33735. $92 = (_i64Add(($90|0),($91|0),($71|0),($74|0))|0);
  33736. $93 = tempRet0;
  33737. $$0341463 = $$0341$lcssa;$$0345467 = $$0345$lcssa;$$0401473 = $$0401$lcssa;$105 = $92;$106 = $73;$108 = $93;$109 = $76;
  33738. label = 41;
  33739. }
  33740. } while(0);
  33741. if ((label|0) == 37) {
  33742. $95 = HEAP32[$9>>2]|0;
  33743. $96 = ($95|0)==(0|0);
  33744. if ($96) {
  33745. $$0341464 = $$0341465;$$0345468 = $$0345469;$$0401474 = $$0401475;$381 = $376;$382 = $377;$383 = $380;$384 = $378;$385 = $379;
  33746. label = 39;
  33747. } else {
  33748. $97 = HEAP32[$8>>2]|0;
  33749. $98 = ((($97)) + -1|0);
  33750. HEAP32[$8>>2] = $98;
  33751. if ($380) {
  33752. $$0341463 = $$0341465;$$0345467 = $$0345469;$$0401473 = $$0401475;$105 = $378;$106 = $376;$108 = $379;$109 = $377;
  33753. label = 41;
  33754. } else {
  33755. label = 40;
  33756. }
  33757. }
  33758. }
  33759. if ((label|0) == 39) {
  33760. if ($383) {
  33761. $$0341463 = $$0341464;$$0345467 = $$0345468;$$0401473 = $$0401474;$105 = $384;$106 = $381;$108 = $385;$109 = $382;
  33762. label = 41;
  33763. } else {
  33764. label = 40;
  33765. }
  33766. }
  33767. do {
  33768. if ((label|0) == 40) {
  33769. $99 = (___errno_location()|0);
  33770. HEAP32[$99>>2] = 22;
  33771. ___shlim($0,0);
  33772. $$1 = 0.0;
  33773. }
  33774. else if ((label|0) == 41) {
  33775. $100 = HEAP32[$6>>2]|0;
  33776. $101 = ($100|0)==(0);
  33777. if ($101) {
  33778. $102 = (+($4|0));
  33779. $103 = $102 * 0.0;
  33780. $$1 = $103;
  33781. break;
  33782. }
  33783. $104 = ($105|0)==($106|0);
  33784. $107 = ($108|0)==($109|0);
  33785. $110 = $104 & $107;
  33786. $111 = ($109|0)<(0);
  33787. $112 = ($106>>>0)<(10);
  33788. $113 = ($109|0)==(0);
  33789. $114 = $113 & $112;
  33790. $115 = $111 | $114;
  33791. $or$cond = $115 & $110;
  33792. if ($or$cond) {
  33793. $116 = ($2|0)>(30);
  33794. $117 = $100 >>> $2;
  33795. $118 = ($117|0)==(0);
  33796. $or$cond417 = $116 | $118;
  33797. if ($or$cond417) {
  33798. $119 = (+($4|0));
  33799. $120 = (+($100>>>0));
  33800. $121 = $119 * $120;
  33801. $$1 = $121;
  33802. break;
  33803. }
  33804. }
  33805. $122 = (($3|0) / -2)&-1;
  33806. $123 = ($122|0)<(0);
  33807. $124 = $123 << 31 >> 31;
  33808. $125 = ($108|0)>($124|0);
  33809. $126 = ($105>>>0)>($122>>>0);
  33810. $127 = ($108|0)==($124|0);
  33811. $128 = $127 & $126;
  33812. $129 = $125 | $128;
  33813. if ($129) {
  33814. $130 = (___errno_location()|0);
  33815. HEAP32[$130>>2] = 34;
  33816. $131 = (+($4|0));
  33817. $132 = $131 * 1.7976931348623157E+308;
  33818. $133 = $132 * 1.7976931348623157E+308;
  33819. $$1 = $133;
  33820. break;
  33821. }
  33822. $134 = (($3) + -106)|0;
  33823. $135 = ($134|0)<(0);
  33824. $136 = $135 << 31 >> 31;
  33825. $137 = ($108|0)<($136|0);
  33826. $138 = ($105>>>0)<($134>>>0);
  33827. $139 = ($108|0)==($136|0);
  33828. $140 = $139 & $138;
  33829. $141 = $137 | $140;
  33830. if ($141) {
  33831. $142 = (___errno_location()|0);
  33832. HEAP32[$142>>2] = 34;
  33833. $143 = (+($4|0));
  33834. $144 = $143 * 2.2250738585072014E-308;
  33835. $145 = $144 * 2.2250738585072014E-308;
  33836. $$1 = $145;
  33837. break;
  33838. }
  33839. $146 = ($$0341463|0)==(0);
  33840. if ($146) {
  33841. $$3348 = $$0345467;
  33842. } else {
  33843. $147 = ($$0341463|0)<(9);
  33844. if ($147) {
  33845. $148 = (($6) + ($$0345467<<2)|0);
  33846. $$promoted = HEAP32[$148>>2]|0;
  33847. $$3344503 = $$0341463;$150 = $$promoted;
  33848. while(1) {
  33849. $149 = ($150*10)|0;
  33850. $151 = (($$3344503) + 1)|0;
  33851. $exitcond551 = ($151|0)==(9);
  33852. if ($exitcond551) {
  33853. break;
  33854. } else {
  33855. $$3344503 = $151;$150 = $149;
  33856. }
  33857. }
  33858. HEAP32[$148>>2] = $149;
  33859. }
  33860. $152 = (($$0345467) + 1)|0;
  33861. $$3348 = $152;
  33862. }
  33863. $153 = ($$0401473|0)<(9);
  33864. if ($153) {
  33865. $154 = ($$0401473|0)<=($105|0);
  33866. $155 = ($105|0)<(18);
  33867. $or$cond5 = $154 & $155;
  33868. if ($or$cond5) {
  33869. $156 = ($105|0)==(9);
  33870. $157 = HEAP32[$6>>2]|0;
  33871. if ($156) {
  33872. $158 = (+($4|0));
  33873. $159 = (+($157>>>0));
  33874. $160 = $158 * $159;
  33875. $$1 = $160;
  33876. break;
  33877. }
  33878. $161 = ($105|0)<(9);
  33879. if ($161) {
  33880. $162 = (+($4|0));
  33881. $163 = (+($157>>>0));
  33882. $164 = $162 * $163;
  33883. $165 = (8 - ($105))|0;
  33884. $166 = (4368 + ($165<<2)|0);
  33885. $167 = HEAP32[$166>>2]|0;
  33886. $168 = (+($167|0));
  33887. $169 = $164 / $168;
  33888. $$1 = $169;
  33889. break;
  33890. }
  33891. $$neg442 = Math_imul($105, -3)|0;
  33892. $$neg443 = (($2) + 27)|0;
  33893. $170 = (($$neg443) + ($$neg442))|0;
  33894. $171 = ($170|0)>(30);
  33895. $172 = $157 >>> $170;
  33896. $173 = ($172|0)==(0);
  33897. $or$cond419 = $171 | $173;
  33898. if ($or$cond419) {
  33899. $174 = (($105) + -10)|0;
  33900. $175 = (4368 + ($174<<2)|0);
  33901. $176 = (+($4|0));
  33902. $177 = (+($157>>>0));
  33903. $178 = $176 * $177;
  33904. $179 = HEAP32[$175>>2]|0;
  33905. $180 = (+($179|0));
  33906. $181 = $178 * $180;
  33907. $$1 = $181;
  33908. break;
  33909. }
  33910. }
  33911. }
  33912. $182 = (($105|0) % 9)&-1;
  33913. $183 = ($182|0)==(0);
  33914. if ($183) {
  33915. $$0380$ph = 0;$$1373$ph448 = $$3348;$$2352$ph449 = 0;$$2387$ph447 = $105;
  33916. } else {
  33917. $184 = ($105|0)>(-1);
  33918. $185 = (($182) + 9)|0;
  33919. $186 = $184 ? $182 : $185;
  33920. $187 = (8 - ($186))|0;
  33921. $188 = (4368 + ($187<<2)|0);
  33922. $189 = HEAP32[$188>>2]|0;
  33923. $190 = ($$3348|0)==(0);
  33924. if ($190) {
  33925. $$0350$lcssa554 = 0;$$0372 = 0;$$0385$lcssa553 = $105;
  33926. } else {
  33927. $191 = (1000000000 / ($189|0))&-1;
  33928. $$0340496 = 0;$$0350494 = 0;$$0385493 = $105;$$4349495 = 0;
  33929. while(1) {
  33930. $192 = (($6) + ($$4349495<<2)|0);
  33931. $193 = HEAP32[$192>>2]|0;
  33932. $194 = (($193>>>0) % ($189>>>0))&-1;
  33933. $195 = (($193>>>0) / ($189>>>0))&-1;
  33934. $196 = (($195) + ($$0340496))|0;
  33935. HEAP32[$192>>2] = $196;
  33936. $197 = Math_imul($191, $194)|0;
  33937. $198 = ($$4349495|0)==($$0350494|0);
  33938. $199 = ($196|0)==(0);
  33939. $or$cond420 = $198 & $199;
  33940. $200 = (($$0350494) + 1)|0;
  33941. $201 = $200 & 127;
  33942. $202 = (($$0385493) + -9)|0;
  33943. $$$0385 = $or$cond420 ? $202 : $$0385493;
  33944. $$$0350 = $or$cond420 ? $201 : $$0350494;
  33945. $203 = (($$4349495) + 1)|0;
  33946. $204 = ($203|0)==($$3348|0);
  33947. if ($204) {
  33948. break;
  33949. } else {
  33950. $$0340496 = $197;$$0350494 = $$$0350;$$0385493 = $$$0385;$$4349495 = $203;
  33951. }
  33952. }
  33953. $205 = ($197|0)==(0);
  33954. if ($205) {
  33955. $$0350$lcssa554 = $$$0350;$$0372 = $$3348;$$0385$lcssa553 = $$$0385;
  33956. } else {
  33957. $206 = (($6) + ($$3348<<2)|0);
  33958. $207 = (($$3348) + 1)|0;
  33959. HEAP32[$206>>2] = $197;
  33960. $$0350$lcssa554 = $$$0350;$$0372 = $207;$$0385$lcssa553 = $$$0385;
  33961. }
  33962. }
  33963. $208 = (9 - ($186))|0;
  33964. $209 = (($208) + ($$0385$lcssa553))|0;
  33965. $$0380$ph = 0;$$1373$ph448 = $$0372;$$2352$ph449 = $$0350$lcssa554;$$2387$ph447 = $209;
  33966. }
  33967. L101: while(1) {
  33968. $210 = ($$2387$ph447|0)<(18);
  33969. $211 = ($$2387$ph447|0)==(18);
  33970. $212 = (($6) + ($$2352$ph449<<2)|0);
  33971. $$0380 = $$0380$ph;$$1373 = $$1373$ph448;
  33972. while(1) {
  33973. if (!($210)) {
  33974. if (!($211)) {
  33975. $$1381$ph = $$0380;$$4354$ph = $$2352$ph449;$$4389$ph445 = $$2387$ph447;$$6378$ph = $$1373;
  33976. break L101;
  33977. }
  33978. $213 = HEAP32[$212>>2]|0;
  33979. $214 = ($213>>>0)<(9007199);
  33980. if (!($214)) {
  33981. $$1381$ph = $$0380;$$4354$ph = $$2352$ph449;$$4389$ph445 = 18;$$6378$ph = $$1373;
  33982. break L101;
  33983. }
  33984. }
  33985. $215 = (($$1373) + 127)|0;
  33986. $$0334 = 0;$$2374 = $$1373;$$5$in = $215;
  33987. while(1) {
  33988. $$5 = $$5$in & 127;
  33989. $216 = (($6) + ($$5<<2)|0);
  33990. $217 = HEAP32[$216>>2]|0;
  33991. $218 = (_bitshift64Shl(($217|0),0,29)|0);
  33992. $219 = tempRet0;
  33993. $220 = (_i64Add(($218|0),($219|0),($$0334|0),0)|0);
  33994. $221 = tempRet0;
  33995. $222 = ($221>>>0)>(0);
  33996. $223 = ($220>>>0)>(1000000000);
  33997. $224 = ($221|0)==(0);
  33998. $225 = $224 & $223;
  33999. $226 = $222 | $225;
  34000. if ($226) {
  34001. $227 = (___udivdi3(($220|0),($221|0),1000000000,0)|0);
  34002. $228 = tempRet0;
  34003. $229 = (___uremdi3(($220|0),($221|0),1000000000,0)|0);
  34004. $230 = tempRet0;
  34005. $$1335 = $227;$$sink421$off0 = $229;
  34006. } else {
  34007. $$1335 = 0;$$sink421$off0 = $220;
  34008. }
  34009. HEAP32[$216>>2] = $$sink421$off0;
  34010. $231 = (($$2374) + 127)|0;
  34011. $232 = $231 & 127;
  34012. $233 = ($$5|0)!=($232|0);
  34013. $234 = ($$5|0)==($$2352$ph449|0);
  34014. $or$cond422 = $233 | $234;
  34015. $or$cond422$not = $or$cond422 ^ 1;
  34016. $235 = ($$sink421$off0|0)==(0);
  34017. $or$cond423 = $235 & $or$cond422$not;
  34018. $$3375 = $or$cond423 ? $$5 : $$2374;
  34019. $236 = (($$5) + -1)|0;
  34020. if ($234) {
  34021. break;
  34022. } else {
  34023. $$0334 = $$1335;$$2374 = $$3375;$$5$in = $236;
  34024. }
  34025. }
  34026. $237 = (($$0380) + -29)|0;
  34027. $238 = ($$1335|0)==(0);
  34028. if ($238) {
  34029. $$0380 = $237;$$1373 = $$3375;
  34030. } else {
  34031. break;
  34032. }
  34033. }
  34034. $239 = (($$2387$ph447) + 9)|0;
  34035. $240 = (($$2352$ph449) + 127)|0;
  34036. $241 = $240 & 127;
  34037. $242 = ($241|0)==($$3375|0);
  34038. $243 = (($$3375) + 127)|0;
  34039. $244 = $243 & 127;
  34040. $245 = (($$3375) + 126)|0;
  34041. $246 = $245 & 127;
  34042. $247 = (($6) + ($246<<2)|0);
  34043. if ($242) {
  34044. $248 = (($6) + ($244<<2)|0);
  34045. $249 = HEAP32[$248>>2]|0;
  34046. $250 = HEAP32[$247>>2]|0;
  34047. $251 = $250 | $249;
  34048. HEAP32[$247>>2] = $251;
  34049. $$4376 = $244;
  34050. } else {
  34051. $$4376 = $$3375;
  34052. }
  34053. $252 = (($6) + ($241<<2)|0);
  34054. HEAP32[$252>>2] = $$1335;
  34055. $$0380$ph = $237;$$1373$ph448 = $$4376;$$2352$ph449 = $241;$$2387$ph447 = $239;
  34056. }
  34057. L119: while(1) {
  34058. $289 = (($$6378$ph) + 1)|0;
  34059. $287 = $289 & 127;
  34060. $290 = (($$6378$ph) + 127)|0;
  34061. $291 = $290 & 127;
  34062. $292 = (($6) + ($291<<2)|0);
  34063. $$1381$ph558 = $$1381$ph;$$4354$ph559 = $$4354$ph;$$4389$ph = $$4389$ph445;
  34064. while(1) {
  34065. $265 = ($$4389$ph|0)==(18);
  34066. $293 = ($$4389$ph|0)>(27);
  34067. $$425 = $293 ? 9 : 1;
  34068. $$1381 = $$1381$ph558;$$4354 = $$4354$ph559;
  34069. while(1) {
  34070. $$0336486 = 0;
  34071. while(1) {
  34072. $253 = (($$0336486) + ($$4354))|0;
  34073. $254 = $253 & 127;
  34074. $255 = ($254|0)==($$6378$ph|0);
  34075. if ($255) {
  34076. $$1337 = 2;
  34077. label = 88;
  34078. break;
  34079. }
  34080. $256 = (($6) + ($254<<2)|0);
  34081. $257 = HEAP32[$256>>2]|0;
  34082. $258 = (4400 + ($$0336486<<2)|0);
  34083. $259 = HEAP32[$258>>2]|0;
  34084. $260 = ($257>>>0)<($259>>>0);
  34085. if ($260) {
  34086. $$1337 = 2;
  34087. label = 88;
  34088. break;
  34089. }
  34090. $261 = ($257>>>0)>($259>>>0);
  34091. if ($261) {
  34092. break;
  34093. }
  34094. $262 = (($$0336486) + 1)|0;
  34095. $263 = ($262|0)<(2);
  34096. if ($263) {
  34097. $$0336486 = $262;
  34098. } else {
  34099. $$1337 = $262;
  34100. label = 88;
  34101. break;
  34102. }
  34103. }
  34104. if ((label|0) == 88) {
  34105. label = 0;
  34106. $264 = ($$1337|0)==(2);
  34107. $or$cond11 = $265 & $264;
  34108. if ($or$cond11) {
  34109. $$0365484 = 0.0;$$4485 = 0;$$9483 = $$6378$ph;
  34110. break L119;
  34111. }
  34112. }
  34113. $266 = (($$425) + ($$1381))|0;
  34114. $267 = ($$4354|0)==($$6378$ph|0);
  34115. if ($267) {
  34116. $$1381 = $266;$$4354 = $$6378$ph;
  34117. } else {
  34118. break;
  34119. }
  34120. }
  34121. $268 = 1 << $$425;
  34122. $269 = (($268) + -1)|0;
  34123. $270 = 1000000000 >>> $$425;
  34124. $$0332490 = 0;$$5355488 = $$4354;$$5390487 = $$4389$ph;$$6489 = $$4354;
  34125. while(1) {
  34126. $271 = (($6) + ($$6489<<2)|0);
  34127. $272 = HEAP32[$271>>2]|0;
  34128. $273 = $272 & $269;
  34129. $274 = $272 >>> $$425;
  34130. $275 = (($274) + ($$0332490))|0;
  34131. HEAP32[$271>>2] = $275;
  34132. $276 = Math_imul($273, $270)|0;
  34133. $277 = ($$6489|0)==($$5355488|0);
  34134. $278 = ($275|0)==(0);
  34135. $or$cond426 = $277 & $278;
  34136. $279 = (($$5355488) + 1)|0;
  34137. $280 = $279 & 127;
  34138. $281 = (($$5390487) + -9)|0;
  34139. $$$5390 = $or$cond426 ? $281 : $$5390487;
  34140. $$$5355 = $or$cond426 ? $280 : $$5355488;
  34141. $282 = (($$6489) + 1)|0;
  34142. $283 = $282 & 127;
  34143. $284 = ($283|0)==($$6378$ph|0);
  34144. if ($284) {
  34145. break;
  34146. } else {
  34147. $$0332490 = $276;$$5355488 = $$$5355;$$5390487 = $$$5390;$$6489 = $283;
  34148. }
  34149. }
  34150. $285 = ($276|0)==(0);
  34151. if ($285) {
  34152. $$1381$ph558 = $266;$$4354$ph559 = $$$5355;$$4389$ph = $$$5390;
  34153. continue;
  34154. }
  34155. $286 = ($287|0)==($$$5355|0);
  34156. if (!($286)) {
  34157. break;
  34158. }
  34159. $294 = HEAP32[$292>>2]|0;
  34160. $295 = $294 | 1;
  34161. HEAP32[$292>>2] = $295;
  34162. $$1381$ph558 = $266;$$4354$ph559 = $$$5355;$$4389$ph = $$$5390;
  34163. }
  34164. $288 = (($6) + ($$6378$ph<<2)|0);
  34165. HEAP32[$288>>2] = $276;
  34166. $$1381$ph = $266;$$4354$ph = $$$5355;$$4389$ph445 = $$$5390;$$6378$ph = $287;
  34167. }
  34168. while(1) {
  34169. $296 = (($$4485) + ($$4354))|0;
  34170. $297 = $296 & 127;
  34171. $298 = ($297|0)==($$9483|0);
  34172. $299 = (($$9483) + 1)|0;
  34173. $300 = $299 & 127;
  34174. if ($298) {
  34175. $301 = (($300) + -1)|0;
  34176. $302 = (($6) + ($301<<2)|0);
  34177. HEAP32[$302>>2] = 0;
  34178. $$10 = $300;
  34179. } else {
  34180. $$10 = $$9483;
  34181. }
  34182. $303 = $$0365484 * 1.0E+9;
  34183. $304 = (($6) + ($297<<2)|0);
  34184. $305 = HEAP32[$304>>2]|0;
  34185. $306 = (+($305>>>0));
  34186. $307 = $303 + $306;
  34187. $308 = (($$4485) + 1)|0;
  34188. $exitcond = ($308|0)==(2);
  34189. if ($exitcond) {
  34190. break;
  34191. } else {
  34192. $$0365484 = $307;$$4485 = $308;$$9483 = $$10;
  34193. }
  34194. }
  34195. $309 = (+($4|0));
  34196. $310 = $309 * $307;
  34197. $311 = (($$1381) + 53)|0;
  34198. $312 = (($311) - ($3))|0;
  34199. $313 = ($312|0)<($2|0);
  34200. $314 = ($312|0)>(0);
  34201. $$ = $314 ? $312 : 0;
  34202. $$0333 = $313 ? $$ : $2;
  34203. $315 = ($$0333|0)<(53);
  34204. if ($315) {
  34205. $316 = (105 - ($$0333))|0;
  34206. $317 = (+_scalbn(1.0,$316));
  34207. $318 = (+_copysignl($317,$310));
  34208. $319 = (53 - ($$0333))|0;
  34209. $320 = (+_scalbn(1.0,$319));
  34210. $321 = (+_fmodl($310,$320));
  34211. $322 = $310 - $321;
  34212. $323 = $318 + $322;
  34213. $$0360 = $318;$$0361 = $321;$$1366 = $323;
  34214. } else {
  34215. $$0360 = 0.0;$$0361 = 0.0;$$1366 = $310;
  34216. }
  34217. $324 = (($$4354) + 2)|0;
  34218. $325 = $324 & 127;
  34219. $326 = ($325|0)==($$10|0);
  34220. if ($326) {
  34221. $$3364 = $$0361;
  34222. } else {
  34223. $327 = (($6) + ($325<<2)|0);
  34224. $328 = HEAP32[$327>>2]|0;
  34225. $329 = ($328>>>0)<(500000000);
  34226. do {
  34227. if ($329) {
  34228. $330 = ($328|0)==(0);
  34229. if ($330) {
  34230. $331 = (($$4354) + 3)|0;
  34231. $332 = $331 & 127;
  34232. $333 = ($332|0)==($$10|0);
  34233. if ($333) {
  34234. $$1362 = $$0361;
  34235. break;
  34236. }
  34237. }
  34238. $334 = $309 * 0.25;
  34239. $335 = $334 + $$0361;
  34240. $$1362 = $335;
  34241. } else {
  34242. $336 = ($328|0)==(500000000);
  34243. if (!($336)) {
  34244. $337 = $309 * 0.75;
  34245. $338 = $337 + $$0361;
  34246. $$1362 = $338;
  34247. break;
  34248. }
  34249. $339 = (($$4354) + 3)|0;
  34250. $340 = $339 & 127;
  34251. $341 = ($340|0)==($$10|0);
  34252. if ($341) {
  34253. $342 = $309 * 0.5;
  34254. $343 = $342 + $$0361;
  34255. $$1362 = $343;
  34256. break;
  34257. } else {
  34258. $344 = $309 * 0.75;
  34259. $345 = $344 + $$0361;
  34260. $$1362 = $345;
  34261. break;
  34262. }
  34263. }
  34264. } while(0);
  34265. $346 = (53 - ($$0333))|0;
  34266. $347 = ($346|0)>(1);
  34267. if ($347) {
  34268. $348 = (+_fmodl($$1362,1.0));
  34269. $349 = $348 != 0.0;
  34270. if ($349) {
  34271. $$3364 = $$1362;
  34272. } else {
  34273. $350 = $$1362 + 1.0;
  34274. $$3364 = $350;
  34275. }
  34276. } else {
  34277. $$3364 = $$1362;
  34278. }
  34279. }
  34280. $351 = $$1366 + $$3364;
  34281. $352 = $351 - $$0360;
  34282. $353 = $311 & 2147483647;
  34283. $354 = (-2 - ($sum))|0;
  34284. $355 = ($353|0)>($354|0);
  34285. do {
  34286. if ($355) {
  34287. $356 = (+Math_abs((+$352)));
  34288. $357 = !($356 >= 9007199254740992.0);
  34289. $358 = $352 * 0.5;
  34290. $not$ = $357 ^ 1;
  34291. $359 = $not$&1;
  34292. $$3383 = (($359) + ($$1381))|0;
  34293. $$2367 = $357 ? $352 : $358;
  34294. $360 = (($$3383) + 50)|0;
  34295. $361 = ($360|0)>($7|0);
  34296. if (!($361)) {
  34297. $362 = ($$0333|0)!=($312|0);
  34298. $narrow = $362 | $357;
  34299. $$2371$v = $313 & $narrow;
  34300. $363 = $$3364 != 0.0;
  34301. $or$cond14 = $363 & $$2371$v;
  34302. if (!($or$cond14)) {
  34303. $$3368 = $$2367;$$4384 = $$3383;
  34304. break;
  34305. }
  34306. }
  34307. $364 = (___errno_location()|0);
  34308. HEAP32[$364>>2] = 34;
  34309. $$3368 = $$2367;$$4384 = $$3383;
  34310. } else {
  34311. $$3368 = $352;$$4384 = $$1381;
  34312. }
  34313. } while(0);
  34314. $365 = (+_scalbnl($$3368,$$4384));
  34315. $$1 = $365;
  34316. }
  34317. } while(0);
  34318. STACKTOP = sp;return (+$$1);
  34319. }
  34320. function _scanexp($0,$1) {
  34321. $0 = $0|0;
  34322. $1 = $1|0;
  34323. var $$0 = 0, $$04861 = 0, $$049 = 0, $$1$be = 0, $$160 = 0, $$2$be = 0, $$2$lcssa = 0, $$254 = 0, $$3$be = 0, $$lcssa = 0, $$pre = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0;
  34324. var $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0;
  34325. var $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0;
  34326. var $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0;
  34327. var $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0;
  34328. var $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $or$cond3 = 0, label = 0, sp = 0;
  34329. sp = STACKTOP;
  34330. $2 = ((($0)) + 4|0);
  34331. $3 = HEAP32[$2>>2]|0;
  34332. $4 = ((($0)) + 100|0);
  34333. $5 = HEAP32[$4>>2]|0;
  34334. $6 = ($3>>>0)<($5>>>0);
  34335. if ($6) {
  34336. $7 = ((($3)) + 1|0);
  34337. HEAP32[$2>>2] = $7;
  34338. $8 = HEAP8[$3>>0]|0;
  34339. $9 = $8&255;
  34340. $11 = $9;
  34341. } else {
  34342. $10 = (___shgetc($0)|0);
  34343. $11 = $10;
  34344. }
  34345. switch ($11|0) {
  34346. case 43: case 45: {
  34347. $12 = ($11|0)==(45);
  34348. $13 = $12&1;
  34349. $14 = HEAP32[$2>>2]|0;
  34350. $15 = HEAP32[$4>>2]|0;
  34351. $16 = ($14>>>0)<($15>>>0);
  34352. if ($16) {
  34353. $17 = ((($14)) + 1|0);
  34354. HEAP32[$2>>2] = $17;
  34355. $18 = HEAP8[$14>>0]|0;
  34356. $19 = $18&255;
  34357. $22 = $19;
  34358. } else {
  34359. $20 = (___shgetc($0)|0);
  34360. $22 = $20;
  34361. }
  34362. $21 = (($22) + -48)|0;
  34363. $23 = ($21>>>0)>(9);
  34364. $24 = ($1|0)!=(0);
  34365. $or$cond3 = $24 & $23;
  34366. if ($or$cond3) {
  34367. $25 = HEAP32[$4>>2]|0;
  34368. $26 = ($25|0)==(0|0);
  34369. if ($26) {
  34370. $$0 = $13;$$049 = $22;
  34371. } else {
  34372. $27 = HEAP32[$2>>2]|0;
  34373. $28 = ((($27)) + -1|0);
  34374. HEAP32[$2>>2] = $28;
  34375. $$0 = $13;$$049 = $22;
  34376. }
  34377. } else {
  34378. $$0 = $13;$$049 = $22;
  34379. }
  34380. break;
  34381. }
  34382. default: {
  34383. $$0 = 0;$$049 = $11;
  34384. }
  34385. }
  34386. $29 = (($$049) + -48)|0;
  34387. $30 = ($29>>>0)>(9);
  34388. if ($30) {
  34389. $31 = HEAP32[$4>>2]|0;
  34390. $32 = ($31|0)==(0|0);
  34391. if ($32) {
  34392. $100 = -2147483648;$101 = 0;
  34393. } else {
  34394. $33 = HEAP32[$2>>2]|0;
  34395. $34 = ((($33)) + -1|0);
  34396. HEAP32[$2>>2] = $34;
  34397. $100 = -2147483648;$101 = 0;
  34398. }
  34399. } else {
  34400. $$04861 = 0;$$160 = $$049;
  34401. while(1) {
  34402. $35 = ($$04861*10)|0;
  34403. $36 = (($$160) + -48)|0;
  34404. $37 = (($36) + ($35))|0;
  34405. $38 = HEAP32[$2>>2]|0;
  34406. $39 = HEAP32[$4>>2]|0;
  34407. $40 = ($38>>>0)<($39>>>0);
  34408. if ($40) {
  34409. $41 = ((($38)) + 1|0);
  34410. HEAP32[$2>>2] = $41;
  34411. $42 = HEAP8[$38>>0]|0;
  34412. $43 = $42&255;
  34413. $$1$be = $43;
  34414. } else {
  34415. $44 = (___shgetc($0)|0);
  34416. $$1$be = $44;
  34417. }
  34418. $45 = (($$1$be) + -48)|0;
  34419. $46 = ($45>>>0)<(10);
  34420. $47 = ($37|0)<(214748364);
  34421. $48 = $46 & $47;
  34422. if ($48) {
  34423. $$04861 = $37;$$160 = $$1$be;
  34424. } else {
  34425. break;
  34426. }
  34427. }
  34428. $49 = ($37|0)<(0);
  34429. $50 = $49 << 31 >> 31;
  34430. $51 = (($$1$be) + -48)|0;
  34431. $52 = ($51>>>0)<(10);
  34432. if ($52) {
  34433. $$254 = $$1$be;$56 = $37;$57 = $50;
  34434. while(1) {
  34435. $58 = (___muldi3(($56|0),($57|0),10,0)|0);
  34436. $59 = tempRet0;
  34437. $60 = ($$254|0)<(0);
  34438. $61 = $60 << 31 >> 31;
  34439. $62 = (_i64Add(($$254|0),($61|0),-48,-1)|0);
  34440. $63 = tempRet0;
  34441. $64 = (_i64Add(($62|0),($63|0),($58|0),($59|0))|0);
  34442. $65 = tempRet0;
  34443. $66 = HEAP32[$2>>2]|0;
  34444. $67 = HEAP32[$4>>2]|0;
  34445. $68 = ($66>>>0)<($67>>>0);
  34446. if ($68) {
  34447. $69 = ((($66)) + 1|0);
  34448. HEAP32[$2>>2] = $69;
  34449. $70 = HEAP8[$66>>0]|0;
  34450. $71 = $70&255;
  34451. $$2$be = $71;
  34452. } else {
  34453. $72 = (___shgetc($0)|0);
  34454. $$2$be = $72;
  34455. }
  34456. $73 = (($$2$be) + -48)|0;
  34457. $74 = ($73>>>0)<(10);
  34458. $75 = ($65|0)<(21474836);
  34459. $76 = ($64>>>0)<(2061584302);
  34460. $77 = ($65|0)==(21474836);
  34461. $78 = $77 & $76;
  34462. $79 = $75 | $78;
  34463. $80 = $74 & $79;
  34464. if ($80) {
  34465. $$254 = $$2$be;$56 = $64;$57 = $65;
  34466. } else {
  34467. $$2$lcssa = $$2$be;$94 = $64;$95 = $65;
  34468. break;
  34469. }
  34470. }
  34471. } else {
  34472. $$2$lcssa = $$1$be;$94 = $37;$95 = $50;
  34473. }
  34474. $53 = (($$2$lcssa) + -48)|0;
  34475. $54 = ($53>>>0)<(10);
  34476. $55 = HEAP32[$4>>2]|0;
  34477. if ($54) {
  34478. $83 = $55;
  34479. while(1) {
  34480. $81 = HEAP32[$2>>2]|0;
  34481. $82 = ($81>>>0)<($83>>>0);
  34482. if ($82) {
  34483. $84 = ((($81)) + 1|0);
  34484. HEAP32[$2>>2] = $84;
  34485. $85 = HEAP8[$81>>0]|0;
  34486. $86 = $85&255;
  34487. $$3$be = $86;$102 = $83;
  34488. } else {
  34489. $87 = (___shgetc($0)|0);
  34490. $$pre = HEAP32[$4>>2]|0;
  34491. $$3$be = $87;$102 = $$pre;
  34492. }
  34493. $88 = (($$3$be) + -48)|0;
  34494. $89 = ($88>>>0)<(10);
  34495. if ($89) {
  34496. $83 = $102;
  34497. } else {
  34498. $$lcssa = $102;
  34499. break;
  34500. }
  34501. }
  34502. } else {
  34503. $$lcssa = $55;
  34504. }
  34505. $90 = ($$lcssa|0)==(0|0);
  34506. if (!($90)) {
  34507. $91 = HEAP32[$2>>2]|0;
  34508. $92 = ((($91)) + -1|0);
  34509. HEAP32[$2>>2] = $92;
  34510. }
  34511. $93 = ($$0|0)!=(0);
  34512. $96 = (_i64Subtract(0,0,($94|0),($95|0))|0);
  34513. $97 = tempRet0;
  34514. $98 = $93 ? $96 : $94;
  34515. $99 = $93 ? $97 : $95;
  34516. $100 = $99;$101 = $98;
  34517. }
  34518. tempRet0 = ($100);
  34519. return ($101|0);
  34520. }
  34521. function _scalbn($0,$1) {
  34522. $0 = +$0;
  34523. $1 = $1|0;
  34524. var $$ = 0, $$$ = 0, $$0 = 0.0, $$020 = 0, $$1 = 0, $$1$ = 0, $$21 = 0.0, $$22 = 0.0, $10 = 0.0, $11 = 0, $12 = 0, $13 = 0.0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0.0, $2 = 0, $20 = 0.0;
  34525. var $3 = 0.0, $4 = 0, $5 = 0, $6 = 0.0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
  34526. sp = STACKTOP;
  34527. $2 = ($1|0)>(1023);
  34528. if ($2) {
  34529. $3 = $0 * 8.9884656743115795E+307;
  34530. $4 = (($1) + -1023)|0;
  34531. $5 = ($4|0)>(1023);
  34532. $6 = $3 * 8.9884656743115795E+307;
  34533. $7 = (($1) + -2046)|0;
  34534. $8 = ($7|0)<(1023);
  34535. $$ = $8 ? $7 : 1023;
  34536. $$$ = $5 ? $$ : $4;
  34537. $$21 = $5 ? $6 : $3;
  34538. $$0 = $$21;$$020 = $$$;
  34539. } else {
  34540. $9 = ($1|0)<(-1022);
  34541. if ($9) {
  34542. $10 = $0 * 2.2250738585072014E-308;
  34543. $11 = (($1) + 1022)|0;
  34544. $12 = ($11|0)<(-1022);
  34545. $13 = $10 * 2.2250738585072014E-308;
  34546. $14 = (($1) + 2044)|0;
  34547. $15 = ($14|0)>(-1022);
  34548. $$1 = $15 ? $14 : -1022;
  34549. $$1$ = $12 ? $$1 : $11;
  34550. $$22 = $12 ? $13 : $10;
  34551. $$0 = $$22;$$020 = $$1$;
  34552. } else {
  34553. $$0 = $0;$$020 = $1;
  34554. }
  34555. }
  34556. $16 = (($$020) + 1023)|0;
  34557. $17 = (_bitshift64Shl(($16|0),0,52)|0);
  34558. $18 = tempRet0;
  34559. HEAP32[tempDoublePtr>>2] = $17;HEAP32[tempDoublePtr+4>>2] = $18;$19 = +HEAPF64[tempDoublePtr>>3];
  34560. $20 = $$0 * $19;
  34561. return (+$20);
  34562. }
  34563. function _copysignl($0,$1) {
  34564. $0 = +$0;
  34565. $1 = +$1;
  34566. var $2 = 0.0, label = 0, sp = 0;
  34567. sp = STACKTOP;
  34568. $2 = (+_copysign($0,$1));
  34569. return (+$2);
  34570. }
  34571. function _fmodl($0,$1) {
  34572. $0 = +$0;
  34573. $1 = +$1;
  34574. var $2 = 0.0, label = 0, sp = 0;
  34575. sp = STACKTOP;
  34576. $2 = (+_fmod($0,$1));
  34577. return (+$2);
  34578. }
  34579. function _scalbnl($0,$1) {
  34580. $0 = +$0;
  34581. $1 = $1|0;
  34582. var $2 = 0.0, label = 0, sp = 0;
  34583. sp = STACKTOP;
  34584. $2 = (+_scalbn($0,$1));
  34585. return (+$2);
  34586. }
  34587. function _fmod($0,$1) {
  34588. $0 = +$0;
  34589. $1 = +$1;
  34590. var $$ = 0.0, $$070 = 0.0, $$071$lcssa = 0, $$07194 = 0, $$073$lcssa = 0, $$073100 = 0, $$172$ph = 0, $$174 = 0, $$275$lcssa = 0, $$27586 = 0, $$376$lcssa = 0, $$37683 = 0, $$lcssa = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0.0, $104 = 0, $105 = 0;
  34591. var $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0;
  34592. var $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0.0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0;
  34593. var $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0.0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0;
  34594. var $160 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0.0, $28 = 0.0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0;
  34595. var $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0.0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0;
  34596. var $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0;
  34597. var $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0;
  34598. var $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $or$cond = 0, label = 0, sp = 0;
  34599. sp = STACKTOP;
  34600. HEAPF64[tempDoublePtr>>3] = $0;$2 = HEAP32[tempDoublePtr>>2]|0;
  34601. $3 = HEAP32[tempDoublePtr+4>>2]|0;
  34602. HEAPF64[tempDoublePtr>>3] = $1;$4 = HEAP32[tempDoublePtr>>2]|0;
  34603. $5 = HEAP32[tempDoublePtr+4>>2]|0;
  34604. $6 = (_bitshift64Lshr(($2|0),($3|0),52)|0);
  34605. $7 = tempRet0;
  34606. $8 = $6 & 2047;
  34607. $9 = (_bitshift64Lshr(($4|0),($5|0),52)|0);
  34608. $10 = tempRet0;
  34609. $11 = $9 & 2047;
  34610. $12 = $3 & -2147483648;
  34611. $13 = (_bitshift64Shl(($4|0),($5|0),1)|0);
  34612. $14 = tempRet0;
  34613. $15 = ($13|0)==(0);
  34614. $16 = ($14|0)==(0);
  34615. $17 = $15 & $16;
  34616. L1: do {
  34617. if ($17) {
  34618. label = 3;
  34619. } else {
  34620. $18 = (___DOUBLE_BITS_272($1)|0);
  34621. $19 = tempRet0;
  34622. $20 = $19 & 2147483647;
  34623. $21 = ($20>>>0)>(2146435072);
  34624. $22 = ($18>>>0)>(0);
  34625. $23 = ($20|0)==(2146435072);
  34626. $24 = $23 & $22;
  34627. $25 = $21 | $24;
  34628. $26 = ($8|0)==(2047);
  34629. $or$cond = $26 | $25;
  34630. if ($or$cond) {
  34631. label = 3;
  34632. } else {
  34633. $29 = (_bitshift64Shl(($2|0),($3|0),1)|0);
  34634. $30 = tempRet0;
  34635. $31 = ($30>>>0)>($14>>>0);
  34636. $32 = ($29>>>0)>($13>>>0);
  34637. $33 = ($30|0)==($14|0);
  34638. $34 = $33 & $32;
  34639. $35 = $31 | $34;
  34640. if (!($35)) {
  34641. $36 = ($29|0)==($13|0);
  34642. $37 = ($30|0)==($14|0);
  34643. $38 = $36 & $37;
  34644. $39 = $0 * 0.0;
  34645. $$ = $38 ? $39 : $0;
  34646. return (+$$);
  34647. }
  34648. $40 = ($8|0)==(0);
  34649. if ($40) {
  34650. $41 = (_bitshift64Shl(($2|0),($3|0),12)|0);
  34651. $42 = tempRet0;
  34652. $43 = ($42|0)>(-1);
  34653. $44 = ($41>>>0)>(4294967295);
  34654. $45 = ($42|0)==(-1);
  34655. $46 = $45 & $44;
  34656. $47 = $43 | $46;
  34657. if ($47) {
  34658. $$073100 = 0;$49 = $41;$50 = $42;
  34659. while(1) {
  34660. $48 = (($$073100) + -1)|0;
  34661. $51 = (_bitshift64Shl(($49|0),($50|0),1)|0);
  34662. $52 = tempRet0;
  34663. $53 = ($52|0)>(-1);
  34664. $54 = ($51>>>0)>(4294967295);
  34665. $55 = ($52|0)==(-1);
  34666. $56 = $55 & $54;
  34667. $57 = $53 | $56;
  34668. if ($57) {
  34669. $$073100 = $48;$49 = $51;$50 = $52;
  34670. } else {
  34671. $$073$lcssa = $48;
  34672. break;
  34673. }
  34674. }
  34675. } else {
  34676. $$073$lcssa = 0;
  34677. }
  34678. $58 = (1 - ($$073$lcssa))|0;
  34679. $59 = (_bitshift64Shl(($2|0),($3|0),($58|0))|0);
  34680. $60 = tempRet0;
  34681. $$174 = $$073$lcssa;$87 = $59;$88 = $60;
  34682. } else {
  34683. $61 = $3 & 1048575;
  34684. $62 = $61 | 1048576;
  34685. $$174 = $8;$87 = $2;$88 = $62;
  34686. }
  34687. $63 = ($11|0)==(0);
  34688. if ($63) {
  34689. $64 = (_bitshift64Shl(($4|0),($5|0),12)|0);
  34690. $65 = tempRet0;
  34691. $66 = ($65|0)>(-1);
  34692. $67 = ($64>>>0)>(4294967295);
  34693. $68 = ($65|0)==(-1);
  34694. $69 = $68 & $67;
  34695. $70 = $66 | $69;
  34696. if ($70) {
  34697. $$07194 = 0;$72 = $64;$73 = $65;
  34698. while(1) {
  34699. $71 = (($$07194) + -1)|0;
  34700. $74 = (_bitshift64Shl(($72|0),($73|0),1)|0);
  34701. $75 = tempRet0;
  34702. $76 = ($75|0)>(-1);
  34703. $77 = ($74>>>0)>(4294967295);
  34704. $78 = ($75|0)==(-1);
  34705. $79 = $78 & $77;
  34706. $80 = $76 | $79;
  34707. if ($80) {
  34708. $$07194 = $71;$72 = $74;$73 = $75;
  34709. } else {
  34710. $$071$lcssa = $71;
  34711. break;
  34712. }
  34713. }
  34714. } else {
  34715. $$071$lcssa = 0;
  34716. }
  34717. $81 = (1 - ($$071$lcssa))|0;
  34718. $82 = (_bitshift64Shl(($4|0),($5|0),($81|0))|0);
  34719. $83 = tempRet0;
  34720. $$172$ph = $$071$lcssa;$89 = $82;$90 = $83;
  34721. } else {
  34722. $84 = $5 & 1048575;
  34723. $85 = $84 | 1048576;
  34724. $$172$ph = $11;$89 = $4;$90 = $85;
  34725. }
  34726. $86 = ($$174|0)>($$172$ph|0);
  34727. $91 = (_i64Subtract(($87|0),($88|0),($89|0),($90|0))|0);
  34728. $92 = tempRet0;
  34729. $93 = ($92|0)>(-1);
  34730. $94 = ($91>>>0)>(4294967295);
  34731. $95 = ($92|0)==(-1);
  34732. $96 = $95 & $94;
  34733. $97 = $93 | $96;
  34734. L23: do {
  34735. if ($86) {
  34736. $$27586 = $$174;$101 = $92;$156 = $97;$157 = $87;$158 = $88;$99 = $91;
  34737. while(1) {
  34738. if ($156) {
  34739. $98 = ($99|0)==(0);
  34740. $100 = ($101|0)==(0);
  34741. $102 = $98 & $100;
  34742. if ($102) {
  34743. break;
  34744. } else {
  34745. $104 = $99;$105 = $101;
  34746. }
  34747. } else {
  34748. $104 = $157;$105 = $158;
  34749. }
  34750. $106 = (_bitshift64Shl(($104|0),($105|0),1)|0);
  34751. $107 = tempRet0;
  34752. $108 = (($$27586) + -1)|0;
  34753. $109 = ($108|0)>($$172$ph|0);
  34754. $110 = (_i64Subtract(($106|0),($107|0),($89|0),($90|0))|0);
  34755. $111 = tempRet0;
  34756. $112 = ($111|0)>(-1);
  34757. $113 = ($110>>>0)>(4294967295);
  34758. $114 = ($111|0)==(-1);
  34759. $115 = $114 & $113;
  34760. $116 = $112 | $115;
  34761. if ($109) {
  34762. $$27586 = $108;$101 = $111;$156 = $116;$157 = $106;$158 = $107;$99 = $110;
  34763. } else {
  34764. $$275$lcssa = $108;$$lcssa = $116;$118 = $110;$120 = $111;$159 = $106;$160 = $107;
  34765. break L23;
  34766. }
  34767. }
  34768. $103 = $0 * 0.0;
  34769. $$070 = $103;
  34770. break L1;
  34771. } else {
  34772. $$275$lcssa = $$174;$$lcssa = $97;$118 = $91;$120 = $92;$159 = $87;$160 = $88;
  34773. }
  34774. } while(0);
  34775. if ($$lcssa) {
  34776. $117 = ($118|0)==(0);
  34777. $119 = ($120|0)==(0);
  34778. $121 = $117 & $119;
  34779. if ($121) {
  34780. $129 = $0 * 0.0;
  34781. $$070 = $129;
  34782. break;
  34783. } else {
  34784. $123 = $120;$125 = $118;
  34785. }
  34786. } else {
  34787. $123 = $160;$125 = $159;
  34788. }
  34789. $122 = ($123>>>0)<(1048576);
  34790. $124 = ($125>>>0)<(0);
  34791. $126 = ($123|0)==(1048576);
  34792. $127 = $126 & $124;
  34793. $128 = $122 | $127;
  34794. if ($128) {
  34795. $$37683 = $$275$lcssa;$130 = $125;$131 = $123;
  34796. while(1) {
  34797. $132 = (_bitshift64Shl(($130|0),($131|0),1)|0);
  34798. $133 = tempRet0;
  34799. $134 = (($$37683) + -1)|0;
  34800. $135 = ($133>>>0)<(1048576);
  34801. $136 = ($132>>>0)<(0);
  34802. $137 = ($133|0)==(1048576);
  34803. $138 = $137 & $136;
  34804. $139 = $135 | $138;
  34805. if ($139) {
  34806. $$37683 = $134;$130 = $132;$131 = $133;
  34807. } else {
  34808. $$376$lcssa = $134;$141 = $132;$142 = $133;
  34809. break;
  34810. }
  34811. }
  34812. } else {
  34813. $$376$lcssa = $$275$lcssa;$141 = $125;$142 = $123;
  34814. }
  34815. $140 = ($$376$lcssa|0)>(0);
  34816. if ($140) {
  34817. $143 = (_i64Add(($141|0),($142|0),0,-1048576)|0);
  34818. $144 = tempRet0;
  34819. $145 = (_bitshift64Shl(($$376$lcssa|0),0,52)|0);
  34820. $146 = tempRet0;
  34821. $147 = $143 | $145;
  34822. $148 = $144 | $146;
  34823. $153 = $148;$155 = $147;
  34824. } else {
  34825. $149 = (1 - ($$376$lcssa))|0;
  34826. $150 = (_bitshift64Lshr(($141|0),($142|0),($149|0))|0);
  34827. $151 = tempRet0;
  34828. $153 = $151;$155 = $150;
  34829. }
  34830. $152 = $153 | $12;
  34831. HEAP32[tempDoublePtr>>2] = $155;HEAP32[tempDoublePtr+4>>2] = $152;$154 = +HEAPF64[tempDoublePtr>>3];
  34832. $$070 = $154;
  34833. }
  34834. }
  34835. } while(0);
  34836. if ((label|0) == 3) {
  34837. $27 = $0 * $1;
  34838. $28 = $27 / $27;
  34839. $$070 = $28;
  34840. }
  34841. return (+$$070);
  34842. }
  34843. function ___DOUBLE_BITS_272($0) {
  34844. $0 = +$0;
  34845. var $1 = 0, $2 = 0, label = 0, sp = 0;
  34846. sp = STACKTOP;
  34847. HEAPF64[tempDoublePtr>>3] = $0;$1 = HEAP32[tempDoublePtr>>2]|0;
  34848. $2 = HEAP32[tempDoublePtr+4>>2]|0;
  34849. tempRet0 = ($2);
  34850. return ($1|0);
  34851. }
  34852. function _strlen($0) {
  34853. $0 = $0|0;
  34854. var $$0 = 0, $$015$lcssa = 0, $$01519 = 0, $$1$lcssa = 0, $$pn = 0, $$pre = 0, $$sink = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0;
  34855. var $21 = 0, $22 = 0, $23 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
  34856. sp = STACKTOP;
  34857. $1 = $0;
  34858. $2 = $1 & 3;
  34859. $3 = ($2|0)==(0);
  34860. L1: do {
  34861. if ($3) {
  34862. $$015$lcssa = $0;
  34863. label = 4;
  34864. } else {
  34865. $$01519 = $0;$23 = $1;
  34866. while(1) {
  34867. $4 = HEAP8[$$01519>>0]|0;
  34868. $5 = ($4<<24>>24)==(0);
  34869. if ($5) {
  34870. $$sink = $23;
  34871. break L1;
  34872. }
  34873. $6 = ((($$01519)) + 1|0);
  34874. $7 = $6;
  34875. $8 = $7 & 3;
  34876. $9 = ($8|0)==(0);
  34877. if ($9) {
  34878. $$015$lcssa = $6;
  34879. label = 4;
  34880. break;
  34881. } else {
  34882. $$01519 = $6;$23 = $7;
  34883. }
  34884. }
  34885. }
  34886. } while(0);
  34887. if ((label|0) == 4) {
  34888. $$0 = $$015$lcssa;
  34889. while(1) {
  34890. $10 = HEAP32[$$0>>2]|0;
  34891. $11 = (($10) + -16843009)|0;
  34892. $12 = $10 & -2139062144;
  34893. $13 = $12 ^ -2139062144;
  34894. $14 = $13 & $11;
  34895. $15 = ($14|0)==(0);
  34896. $16 = ((($$0)) + 4|0);
  34897. if ($15) {
  34898. $$0 = $16;
  34899. } else {
  34900. break;
  34901. }
  34902. }
  34903. $17 = $10&255;
  34904. $18 = ($17<<24>>24)==(0);
  34905. if ($18) {
  34906. $$1$lcssa = $$0;
  34907. } else {
  34908. $$pn = $$0;
  34909. while(1) {
  34910. $19 = ((($$pn)) + 1|0);
  34911. $$pre = HEAP8[$19>>0]|0;
  34912. $20 = ($$pre<<24>>24)==(0);
  34913. if ($20) {
  34914. $$1$lcssa = $19;
  34915. break;
  34916. } else {
  34917. $$pn = $19;
  34918. }
  34919. }
  34920. }
  34921. $21 = $$1$lcssa;
  34922. $$sink = $21;
  34923. }
  34924. $22 = (($$sink) - ($1))|0;
  34925. return ($22|0);
  34926. }
  34927. function _strchr($0,$1) {
  34928. $0 = $0|0;
  34929. $1 = $1|0;
  34930. var $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, label = 0, sp = 0;
  34931. sp = STACKTOP;
  34932. $2 = (___strchrnul($0,$1)|0);
  34933. $3 = HEAP8[$2>>0]|0;
  34934. $4 = $1&255;
  34935. $5 = ($3<<24>>24)==($4<<24>>24);
  34936. $6 = $5 ? $2 : 0;
  34937. return ($6|0);
  34938. }
  34939. function ___strchrnul($0,$1) {
  34940. $0 = $0|0;
  34941. $1 = $1|0;
  34942. var $$0 = 0, $$029$lcssa = 0, $$02936 = 0, $$030$lcssa = 0, $$03039 = 0, $$1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0;
  34943. var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0;
  34944. var $41 = 0, $42 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond33 = 0, label = 0, sp = 0;
  34945. sp = STACKTOP;
  34946. $2 = $1 & 255;
  34947. $3 = ($2|0)==(0);
  34948. L1: do {
  34949. if ($3) {
  34950. $8 = (_strlen($0)|0);
  34951. $9 = (($0) + ($8)|0);
  34952. $$0 = $9;
  34953. } else {
  34954. $4 = $0;
  34955. $5 = $4 & 3;
  34956. $6 = ($5|0)==(0);
  34957. if ($6) {
  34958. $$030$lcssa = $0;
  34959. } else {
  34960. $7 = $1&255;
  34961. $$03039 = $0;
  34962. while(1) {
  34963. $10 = HEAP8[$$03039>>0]|0;
  34964. $11 = ($10<<24>>24)==(0);
  34965. $12 = ($10<<24>>24)==($7<<24>>24);
  34966. $or$cond = $11 | $12;
  34967. if ($or$cond) {
  34968. $$0 = $$03039;
  34969. break L1;
  34970. }
  34971. $13 = ((($$03039)) + 1|0);
  34972. $14 = $13;
  34973. $15 = $14 & 3;
  34974. $16 = ($15|0)==(0);
  34975. if ($16) {
  34976. $$030$lcssa = $13;
  34977. break;
  34978. } else {
  34979. $$03039 = $13;
  34980. }
  34981. }
  34982. }
  34983. $17 = Math_imul($2, 16843009)|0;
  34984. $18 = HEAP32[$$030$lcssa>>2]|0;
  34985. $19 = (($18) + -16843009)|0;
  34986. $20 = $18 & -2139062144;
  34987. $21 = $20 ^ -2139062144;
  34988. $22 = $21 & $19;
  34989. $23 = ($22|0)==(0);
  34990. L10: do {
  34991. if ($23) {
  34992. $$02936 = $$030$lcssa;$25 = $18;
  34993. while(1) {
  34994. $24 = $25 ^ $17;
  34995. $26 = (($24) + -16843009)|0;
  34996. $27 = $24 & -2139062144;
  34997. $28 = $27 ^ -2139062144;
  34998. $29 = $28 & $26;
  34999. $30 = ($29|0)==(0);
  35000. if (!($30)) {
  35001. $$029$lcssa = $$02936;
  35002. break L10;
  35003. }
  35004. $31 = ((($$02936)) + 4|0);
  35005. $32 = HEAP32[$31>>2]|0;
  35006. $33 = (($32) + -16843009)|0;
  35007. $34 = $32 & -2139062144;
  35008. $35 = $34 ^ -2139062144;
  35009. $36 = $35 & $33;
  35010. $37 = ($36|0)==(0);
  35011. if ($37) {
  35012. $$02936 = $31;$25 = $32;
  35013. } else {
  35014. $$029$lcssa = $31;
  35015. break;
  35016. }
  35017. }
  35018. } else {
  35019. $$029$lcssa = $$030$lcssa;
  35020. }
  35021. } while(0);
  35022. $38 = $1&255;
  35023. $$1 = $$029$lcssa;
  35024. while(1) {
  35025. $39 = HEAP8[$$1>>0]|0;
  35026. $40 = ($39<<24>>24)==(0);
  35027. $41 = ($39<<24>>24)==($38<<24>>24);
  35028. $or$cond33 = $40 | $41;
  35029. $42 = ((($$1)) + 1|0);
  35030. if ($or$cond33) {
  35031. $$0 = $$1;
  35032. break;
  35033. } else {
  35034. $$1 = $42;
  35035. }
  35036. }
  35037. }
  35038. } while(0);
  35039. return ($$0|0);
  35040. }
  35041. function _mbrtowc($0,$1,$2,$3) {
  35042. $0 = $0|0;
  35043. $1 = $1|0;
  35044. $2 = $2|0;
  35045. $3 = $3|0;
  35046. var $$ = 0, $$0 = 0, $$03952 = 0, $$04051 = 0, $$04350 = 0, $$1 = 0, $$141 = 0, $$144 = 0, $$2 = 0, $$47 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0;
  35047. var $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0;
  35048. var $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0;
  35049. var $not$ = 0, label = 0, sp = 0;
  35050. sp = STACKTOP;
  35051. STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
  35052. $4 = sp;
  35053. $5 = ($3|0)==(0|0);
  35054. $$ = $5 ? 20852 : $3;
  35055. $6 = HEAP32[$$>>2]|0;
  35056. $7 = ($1|0)==(0|0);
  35057. L1: do {
  35058. if ($7) {
  35059. $8 = ($6|0)==(0);
  35060. if ($8) {
  35061. $$0 = 0;
  35062. } else {
  35063. label = 17;
  35064. }
  35065. } else {
  35066. $9 = ($0|0)==(0|0);
  35067. $$47 = $9 ? $4 : $0;
  35068. $10 = ($2|0)==(0);
  35069. if ($10) {
  35070. $$0 = -2;
  35071. } else {
  35072. $11 = ($6|0)==(0);
  35073. if ($11) {
  35074. $12 = HEAP8[$1>>0]|0;
  35075. $13 = ($12<<24>>24)>(-1);
  35076. if ($13) {
  35077. $14 = $12&255;
  35078. HEAP32[$$47>>2] = $14;
  35079. $15 = ($12<<24>>24)!=(0);
  35080. $16 = $15&1;
  35081. $$0 = $16;
  35082. break;
  35083. }
  35084. $17 = (___pthread_self_439()|0);
  35085. $18 = ((($17)) + 188|0);
  35086. $19 = HEAP32[$18>>2]|0;
  35087. $20 = HEAP32[$19>>2]|0;
  35088. $not$ = ($20|0)==(0|0);
  35089. $21 = HEAP8[$1>>0]|0;
  35090. if ($not$) {
  35091. $22 = $21 << 24 >> 24;
  35092. $23 = $22 & 57343;
  35093. HEAP32[$$47>>2] = $23;
  35094. $$0 = 1;
  35095. break;
  35096. }
  35097. $24 = $21&255;
  35098. $25 = (($24) + -194)|0;
  35099. $26 = ($25>>>0)>(50);
  35100. if ($26) {
  35101. label = 17;
  35102. break;
  35103. }
  35104. $27 = ((($1)) + 1|0);
  35105. $28 = (3664 + ($25<<2)|0);
  35106. $29 = HEAP32[$28>>2]|0;
  35107. $30 = (($2) + -1)|0;
  35108. $31 = ($30|0)==(0);
  35109. if ($31) {
  35110. $$2 = $29;
  35111. } else {
  35112. $$03952 = $27;$$04051 = $29;$$04350 = $30;
  35113. label = 11;
  35114. }
  35115. } else {
  35116. $$03952 = $1;$$04051 = $6;$$04350 = $2;
  35117. label = 11;
  35118. }
  35119. L14: do {
  35120. if ((label|0) == 11) {
  35121. $32 = HEAP8[$$03952>>0]|0;
  35122. $33 = $32&255;
  35123. $34 = $33 >>> 3;
  35124. $35 = (($34) + -16)|0;
  35125. $36 = $$04051 >> 26;
  35126. $37 = (($34) + ($36))|0;
  35127. $38 = $35 | $37;
  35128. $39 = ($38>>>0)>(7);
  35129. if ($39) {
  35130. label = 17;
  35131. break L1;
  35132. } else {
  35133. $$1 = $$03952;$$141 = $$04051;$$144 = $$04350;$43 = $32;
  35134. }
  35135. while(1) {
  35136. $40 = $$141 << 6;
  35137. $41 = ((($$1)) + 1|0);
  35138. $42 = $43&255;
  35139. $44 = (($42) + -128)|0;
  35140. $45 = $44 | $40;
  35141. $46 = (($$144) + -1)|0;
  35142. $47 = ($45|0)<(0);
  35143. if (!($47)) {
  35144. break;
  35145. }
  35146. $49 = ($46|0)==(0);
  35147. if ($49) {
  35148. $$2 = $45;
  35149. break L14;
  35150. }
  35151. $50 = HEAP8[$41>>0]|0;
  35152. $51 = $50 & -64;
  35153. $52 = ($51<<24>>24)==(-128);
  35154. if ($52) {
  35155. $$1 = $41;$$141 = $45;$$144 = $46;$43 = $50;
  35156. } else {
  35157. label = 17;
  35158. break L1;
  35159. }
  35160. }
  35161. HEAP32[$$>>2] = 0;
  35162. HEAP32[$$47>>2] = $45;
  35163. $48 = (($2) - ($46))|0;
  35164. $$0 = $48;
  35165. break L1;
  35166. }
  35167. } while(0);
  35168. HEAP32[$$>>2] = $$2;
  35169. $$0 = -2;
  35170. }
  35171. }
  35172. } while(0);
  35173. if ((label|0) == 17) {
  35174. HEAP32[$$>>2] = 0;
  35175. $53 = (___errno_location()|0);
  35176. HEAP32[$53>>2] = 84;
  35177. $$0 = -1;
  35178. }
  35179. STACKTOP = sp;return ($$0|0);
  35180. }
  35181. function ___pthread_self_439() {
  35182. var $0 = 0, label = 0, sp = 0;
  35183. sp = STACKTOP;
  35184. $0 = (_pthread_self()|0);
  35185. return ($0|0);
  35186. }
  35187. function _strcpy($0,$1) {
  35188. $0 = $0|0;
  35189. $1 = $1|0;
  35190. var label = 0, sp = 0;
  35191. sp = STACKTOP;
  35192. (___stpcpy($0,$1)|0);
  35193. return ($0|0);
  35194. }
  35195. function ___stpcpy($0,$1) {
  35196. $0 = $0|0;
  35197. $1 = $1|0;
  35198. var $$0$lcssa = 0, $$025$lcssa = 0, $$02536 = 0, $$026$lcssa = 0, $$02642 = 0, $$027$lcssa = 0, $$02741 = 0, $$029 = 0, $$037 = 0, $$1$ph = 0, $$128$ph = 0, $$12834 = 0, $$135 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0;
  35199. var $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0;
  35200. var $35 = 0, $36 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
  35201. sp = STACKTOP;
  35202. $2 = $1;
  35203. $3 = $0;
  35204. $4 = $2 ^ $3;
  35205. $5 = $4 & 3;
  35206. $6 = ($5|0)==(0);
  35207. L1: do {
  35208. if ($6) {
  35209. $7 = $2 & 3;
  35210. $8 = ($7|0)==(0);
  35211. if ($8) {
  35212. $$026$lcssa = $1;$$027$lcssa = $0;
  35213. } else {
  35214. $$02642 = $1;$$02741 = $0;
  35215. while(1) {
  35216. $9 = HEAP8[$$02642>>0]|0;
  35217. HEAP8[$$02741>>0] = $9;
  35218. $10 = ($9<<24>>24)==(0);
  35219. if ($10) {
  35220. $$029 = $$02741;
  35221. break L1;
  35222. }
  35223. $11 = ((($$02642)) + 1|0);
  35224. $12 = ((($$02741)) + 1|0);
  35225. $13 = $11;
  35226. $14 = $13 & 3;
  35227. $15 = ($14|0)==(0);
  35228. if ($15) {
  35229. $$026$lcssa = $11;$$027$lcssa = $12;
  35230. break;
  35231. } else {
  35232. $$02642 = $11;$$02741 = $12;
  35233. }
  35234. }
  35235. }
  35236. $16 = HEAP32[$$026$lcssa>>2]|0;
  35237. $17 = (($16) + -16843009)|0;
  35238. $18 = $16 & -2139062144;
  35239. $19 = $18 ^ -2139062144;
  35240. $20 = $19 & $17;
  35241. $21 = ($20|0)==(0);
  35242. if ($21) {
  35243. $$02536 = $$027$lcssa;$$037 = $$026$lcssa;$24 = $16;
  35244. while(1) {
  35245. $22 = ((($$037)) + 4|0);
  35246. $23 = ((($$02536)) + 4|0);
  35247. HEAP32[$$02536>>2] = $24;
  35248. $25 = HEAP32[$22>>2]|0;
  35249. $26 = (($25) + -16843009)|0;
  35250. $27 = $25 & -2139062144;
  35251. $28 = $27 ^ -2139062144;
  35252. $29 = $28 & $26;
  35253. $30 = ($29|0)==(0);
  35254. if ($30) {
  35255. $$02536 = $23;$$037 = $22;$24 = $25;
  35256. } else {
  35257. $$0$lcssa = $22;$$025$lcssa = $23;
  35258. break;
  35259. }
  35260. }
  35261. } else {
  35262. $$0$lcssa = $$026$lcssa;$$025$lcssa = $$027$lcssa;
  35263. }
  35264. $$1$ph = $$0$lcssa;$$128$ph = $$025$lcssa;
  35265. label = 8;
  35266. } else {
  35267. $$1$ph = $1;$$128$ph = $0;
  35268. label = 8;
  35269. }
  35270. } while(0);
  35271. if ((label|0) == 8) {
  35272. $31 = HEAP8[$$1$ph>>0]|0;
  35273. HEAP8[$$128$ph>>0] = $31;
  35274. $32 = ($31<<24>>24)==(0);
  35275. if ($32) {
  35276. $$029 = $$128$ph;
  35277. } else {
  35278. $$12834 = $$128$ph;$$135 = $$1$ph;
  35279. while(1) {
  35280. $33 = ((($$135)) + 1|0);
  35281. $34 = ((($$12834)) + 1|0);
  35282. $35 = HEAP8[$33>>0]|0;
  35283. HEAP8[$34>>0] = $35;
  35284. $36 = ($35<<24>>24)==(0);
  35285. if ($36) {
  35286. $$029 = $34;
  35287. break;
  35288. } else {
  35289. $$12834 = $34;$$135 = $33;
  35290. }
  35291. }
  35292. }
  35293. }
  35294. return ($$029|0);
  35295. }
  35296. function ___unlist_locked_file($0) {
  35297. $0 = $0|0;
  35298. var $$pre = 0, $$sink = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
  35299. sp = STACKTOP;
  35300. $1 = ((($0)) + 68|0);
  35301. $2 = HEAP32[$1>>2]|0;
  35302. $3 = ($2|0)==(0);
  35303. if (!($3)) {
  35304. $4 = ((($0)) + 116|0);
  35305. $5 = HEAP32[$4>>2]|0;
  35306. $6 = ($5|0)==(0|0);
  35307. $$pre = ((($0)) + 112|0);
  35308. if (!($6)) {
  35309. $7 = HEAP32[$$pre>>2]|0;
  35310. $8 = ((($5)) + 112|0);
  35311. HEAP32[$8>>2] = $7;
  35312. }
  35313. $9 = HEAP32[$$pre>>2]|0;
  35314. $10 = ($9|0)==(0|0);
  35315. if ($10) {
  35316. $12 = (___pthread_self_607()|0);
  35317. $13 = ((($12)) + 232|0);
  35318. $$sink = $13;
  35319. } else {
  35320. $11 = ((($9)) + 116|0);
  35321. $$sink = $11;
  35322. }
  35323. HEAP32[$$sink>>2] = $5;
  35324. }
  35325. return;
  35326. }
  35327. function ___pthread_self_607() {
  35328. var $0 = 0, label = 0, sp = 0;
  35329. sp = STACKTOP;
  35330. $0 = (_pthread_self()|0);
  35331. return ($0|0);
  35332. }
  35333. function _fopen($0,$1) {
  35334. $0 = $0|0;
  35335. $1 = $1|0;
  35336. var $$0 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $memchr = 0, $vararg_buffer = 0, $vararg_buffer3 = 0, $vararg_buffer8 = 0, $vararg_ptr1 = 0;
  35337. var $vararg_ptr2 = 0, $vararg_ptr6 = 0, $vararg_ptr7 = 0, label = 0, sp = 0;
  35338. sp = STACKTOP;
  35339. STACKTOP = STACKTOP + 48|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(48|0);
  35340. $vararg_buffer8 = sp + 32|0;
  35341. $vararg_buffer3 = sp + 16|0;
  35342. $vararg_buffer = sp;
  35343. $2 = HEAP8[$1>>0]|0;
  35344. $3 = $2 << 24 >> 24;
  35345. $memchr = (_memchr(17921,$3,4)|0);
  35346. $4 = ($memchr|0)==(0|0);
  35347. if ($4) {
  35348. $5 = (___errno_location()|0);
  35349. HEAP32[$5>>2] = 22;
  35350. $$0 = 0;
  35351. } else {
  35352. $6 = (___fmodeflags($1)|0);
  35353. $7 = $0;
  35354. $8 = $6 | 32768;
  35355. HEAP32[$vararg_buffer>>2] = $7;
  35356. $vararg_ptr1 = ((($vararg_buffer)) + 4|0);
  35357. HEAP32[$vararg_ptr1>>2] = $8;
  35358. $vararg_ptr2 = ((($vararg_buffer)) + 8|0);
  35359. HEAP32[$vararg_ptr2>>2] = 438;
  35360. $9 = (___syscall5(5,($vararg_buffer|0))|0);
  35361. $10 = (___syscall_ret($9)|0);
  35362. $11 = ($10|0)<(0);
  35363. if ($11) {
  35364. $$0 = 0;
  35365. } else {
  35366. $12 = $6 & 524288;
  35367. $13 = ($12|0)==(0);
  35368. if (!($13)) {
  35369. HEAP32[$vararg_buffer3>>2] = $10;
  35370. $vararg_ptr6 = ((($vararg_buffer3)) + 4|0);
  35371. HEAP32[$vararg_ptr6>>2] = 2;
  35372. $vararg_ptr7 = ((($vararg_buffer3)) + 8|0);
  35373. HEAP32[$vararg_ptr7>>2] = 1;
  35374. (___syscall221(221,($vararg_buffer3|0))|0);
  35375. }
  35376. $14 = (___fdopen($10,$1)|0);
  35377. $15 = ($14|0)==(0|0);
  35378. if ($15) {
  35379. HEAP32[$vararg_buffer8>>2] = $10;
  35380. (___syscall6(6,($vararg_buffer8|0))|0);
  35381. $$0 = 0;
  35382. } else {
  35383. $$0 = $14;
  35384. }
  35385. }
  35386. }
  35387. STACKTOP = sp;return ($$0|0);
  35388. }
  35389. function ___fmodeflags($0) {
  35390. $0 = $0|0;
  35391. var $$ = 0, $$$4 = 0, $$0 = 0, $$0$ = 0, $$2 = 0, $$2$ = 0, $$4 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0;
  35392. var $8 = 0, $9 = 0, $not$ = 0, label = 0, sp = 0;
  35393. sp = STACKTOP;
  35394. $1 = (_strchr($0,43)|0);
  35395. $2 = ($1|0)==(0|0);
  35396. $3 = HEAP8[$0>>0]|0;
  35397. $not$ = ($3<<24>>24)!=(114);
  35398. $$ = $not$&1;
  35399. $$0 = $2 ? $$ : 2;
  35400. $4 = (_strchr($0,120)|0);
  35401. $5 = ($4|0)==(0|0);
  35402. $6 = $$0 | 128;
  35403. $$0$ = $5 ? $$0 : $6;
  35404. $7 = (_strchr($0,101)|0);
  35405. $8 = ($7|0)==(0|0);
  35406. $9 = $$0$ | 524288;
  35407. $$2 = $8 ? $$0$ : $9;
  35408. $10 = ($3<<24>>24)==(114);
  35409. $11 = $$2 | 64;
  35410. $$2$ = $10 ? $$2 : $11;
  35411. $12 = ($3<<24>>24)==(119);
  35412. $13 = $$2$ | 512;
  35413. $$4 = $12 ? $13 : $$2$;
  35414. $14 = ($3<<24>>24)==(97);
  35415. $15 = $$4 | 1024;
  35416. $$$4 = $14 ? $15 : $$4;
  35417. return ($$$4|0);
  35418. }
  35419. function ___fdopen($0,$1) {
  35420. $0 = $0|0;
  35421. $1 = $1|0;
  35422. var $$0 = 0, $$pre = 0, $$pre31 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
  35423. var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $5 = 0, $6 = 0;
  35424. var $7 = 0, $8 = 0, $9 = 0, $memchr = 0, $vararg_buffer = 0, $vararg_buffer12 = 0, $vararg_buffer3 = 0, $vararg_buffer7 = 0, $vararg_ptr1 = 0, $vararg_ptr10 = 0, $vararg_ptr11 = 0, $vararg_ptr15 = 0, $vararg_ptr16 = 0, $vararg_ptr2 = 0, $vararg_ptr6 = 0, dest = 0, label = 0, sp = 0, stop = 0;
  35425. sp = STACKTOP;
  35426. STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(64|0);
  35427. $vararg_buffer12 = sp + 40|0;
  35428. $vararg_buffer7 = sp + 24|0;
  35429. $vararg_buffer3 = sp + 16|0;
  35430. $vararg_buffer = sp;
  35431. $2 = sp + 56|0;
  35432. $3 = HEAP8[$1>>0]|0;
  35433. $4 = $3 << 24 >> 24;
  35434. $memchr = (_memchr(17921,$4,4)|0);
  35435. $5 = ($memchr|0)==(0|0);
  35436. if ($5) {
  35437. $6 = (___errno_location()|0);
  35438. HEAP32[$6>>2] = 22;
  35439. $$0 = 0;
  35440. } else {
  35441. $7 = (_malloc(1156)|0);
  35442. $8 = ($7|0)==(0|0);
  35443. if ($8) {
  35444. $$0 = 0;
  35445. } else {
  35446. dest=$7; stop=dest+124|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0));
  35447. $9 = (_strchr($1,43)|0);
  35448. $10 = ($9|0)==(0|0);
  35449. if ($10) {
  35450. $11 = ($3<<24>>24)==(114);
  35451. $12 = $11 ? 8 : 4;
  35452. HEAP32[$7>>2] = $12;
  35453. }
  35454. $13 = (_strchr($1,101)|0);
  35455. $14 = ($13|0)==(0|0);
  35456. if ($14) {
  35457. $16 = $3;
  35458. } else {
  35459. HEAP32[$vararg_buffer>>2] = $0;
  35460. $vararg_ptr1 = ((($vararg_buffer)) + 4|0);
  35461. HEAP32[$vararg_ptr1>>2] = 2;
  35462. $vararg_ptr2 = ((($vararg_buffer)) + 8|0);
  35463. HEAP32[$vararg_ptr2>>2] = 1;
  35464. (___syscall221(221,($vararg_buffer|0))|0);
  35465. $$pre = HEAP8[$1>>0]|0;
  35466. $16 = $$pre;
  35467. }
  35468. $15 = ($16<<24>>24)==(97);
  35469. if ($15) {
  35470. HEAP32[$vararg_buffer3>>2] = $0;
  35471. $vararg_ptr6 = ((($vararg_buffer3)) + 4|0);
  35472. HEAP32[$vararg_ptr6>>2] = 3;
  35473. $17 = (___syscall221(221,($vararg_buffer3|0))|0);
  35474. $18 = $17 & 1024;
  35475. $19 = ($18|0)==(0);
  35476. if ($19) {
  35477. $20 = $17 | 1024;
  35478. HEAP32[$vararg_buffer7>>2] = $0;
  35479. $vararg_ptr10 = ((($vararg_buffer7)) + 4|0);
  35480. HEAP32[$vararg_ptr10>>2] = 4;
  35481. $vararg_ptr11 = ((($vararg_buffer7)) + 8|0);
  35482. HEAP32[$vararg_ptr11>>2] = $20;
  35483. (___syscall221(221,($vararg_buffer7|0))|0);
  35484. }
  35485. $21 = HEAP32[$7>>2]|0;
  35486. $22 = $21 | 128;
  35487. HEAP32[$7>>2] = $22;
  35488. $29 = $22;
  35489. } else {
  35490. $$pre31 = HEAP32[$7>>2]|0;
  35491. $29 = $$pre31;
  35492. }
  35493. $23 = ((($7)) + 60|0);
  35494. HEAP32[$23>>2] = $0;
  35495. $24 = ((($7)) + 132|0);
  35496. $25 = ((($7)) + 44|0);
  35497. HEAP32[$25>>2] = $24;
  35498. $26 = ((($7)) + 48|0);
  35499. HEAP32[$26>>2] = 1024;
  35500. $27 = ((($7)) + 75|0);
  35501. HEAP8[$27>>0] = -1;
  35502. $28 = $29 & 8;
  35503. $30 = ($28|0)==(0);
  35504. if ($30) {
  35505. $31 = $2;
  35506. HEAP32[$vararg_buffer12>>2] = $0;
  35507. $vararg_ptr15 = ((($vararg_buffer12)) + 4|0);
  35508. HEAP32[$vararg_ptr15>>2] = 21523;
  35509. $vararg_ptr16 = ((($vararg_buffer12)) + 8|0);
  35510. HEAP32[$vararg_ptr16>>2] = $31;
  35511. $32 = (___syscall54(54,($vararg_buffer12|0))|0);
  35512. $33 = ($32|0)==(0);
  35513. if ($33) {
  35514. HEAP8[$27>>0] = 10;
  35515. }
  35516. }
  35517. $34 = ((($7)) + 32|0);
  35518. HEAP32[$34>>2] = 11;
  35519. $35 = ((($7)) + 36|0);
  35520. HEAP32[$35>>2] = 10;
  35521. $36 = ((($7)) + 40|0);
  35522. HEAP32[$36>>2] = 3;
  35523. $37 = ((($7)) + 12|0);
  35524. HEAP32[$37>>2] = 2;
  35525. $38 = HEAP32[(20792)>>2]|0;
  35526. $39 = ($38|0)==(0);
  35527. if ($39) {
  35528. $40 = ((($7)) + 76|0);
  35529. HEAP32[$40>>2] = -1;
  35530. }
  35531. $41 = (___ofl_add($7)|0);
  35532. $$0 = $7;
  35533. }
  35534. }
  35535. STACKTOP = sp;return ($$0|0);
  35536. }
  35537. function ___ofl_add($0) {
  35538. $0 = $0|0;
  35539. var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, label = 0, sp = 0;
  35540. sp = STACKTOP;
  35541. $1 = (___ofl_lock()|0);
  35542. $2 = HEAP32[$1>>2]|0;
  35543. $3 = ((($0)) + 56|0);
  35544. HEAP32[$3>>2] = $2;
  35545. $4 = HEAP32[$1>>2]|0;
  35546. $5 = ($4|0)==(0|0);
  35547. if (!($5)) {
  35548. $6 = ((($4)) + 52|0);
  35549. HEAP32[$6>>2] = $0;
  35550. }
  35551. HEAP32[$1>>2] = $0;
  35552. ___ofl_unlock();
  35553. return ($0|0);
  35554. }
  35555. function ___ofl_lock() {
  35556. var label = 0, sp = 0;
  35557. sp = STACKTOP;
  35558. ___lock((20856|0));
  35559. return (20864|0);
  35560. }
  35561. function ___ofl_unlock() {
  35562. var label = 0, sp = 0;
  35563. sp = STACKTOP;
  35564. ___unlock((20856|0));
  35565. return;
  35566. }
  35567. function _fclose($0) {
  35568. $0 = $0|0;
  35569. var $$pre = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
  35570. var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
  35571. sp = STACKTOP;
  35572. $1 = ((($0)) + 76|0);
  35573. $2 = HEAP32[$1>>2]|0;
  35574. $3 = ($2|0)>(-1);
  35575. if ($3) {
  35576. $4 = (___lockfile($0)|0);
  35577. $29 = $4;
  35578. } else {
  35579. $29 = 0;
  35580. }
  35581. ___unlist_locked_file($0);
  35582. $5 = HEAP32[$0>>2]|0;
  35583. $6 = $5 & 1;
  35584. $7 = ($6|0)!=(0);
  35585. if (!($7)) {
  35586. $8 = (___ofl_lock()|0);
  35587. $9 = ((($0)) + 52|0);
  35588. $10 = HEAP32[$9>>2]|0;
  35589. $11 = ($10|0)==(0|0);
  35590. $12 = $10;
  35591. $$pre = ((($0)) + 56|0);
  35592. if (!($11)) {
  35593. $13 = HEAP32[$$pre>>2]|0;
  35594. $14 = ((($10)) + 56|0);
  35595. HEAP32[$14>>2] = $13;
  35596. }
  35597. $15 = HEAP32[$$pre>>2]|0;
  35598. $16 = ($15|0)==(0|0);
  35599. if (!($16)) {
  35600. $17 = ((($15)) + 52|0);
  35601. HEAP32[$17>>2] = $12;
  35602. }
  35603. $18 = HEAP32[$8>>2]|0;
  35604. $19 = ($18|0)==($0|0);
  35605. if ($19) {
  35606. HEAP32[$8>>2] = $15;
  35607. }
  35608. ___ofl_unlock();
  35609. }
  35610. $20 = (_fflush($0)|0);
  35611. $21 = ((($0)) + 12|0);
  35612. $22 = HEAP32[$21>>2]|0;
  35613. $23 = (FUNCTION_TABLE_ii[$22 & 15]($0)|0);
  35614. $24 = $23 | $20;
  35615. $25 = ((($0)) + 92|0);
  35616. $26 = HEAP32[$25>>2]|0;
  35617. $27 = ($26|0)==(0|0);
  35618. if (!($27)) {
  35619. _free($26);
  35620. }
  35621. if ($7) {
  35622. $28 = ($29|0)==(0);
  35623. if (!($28)) {
  35624. ___unlockfile($0);
  35625. }
  35626. } else {
  35627. _free($0);
  35628. }
  35629. return ($24|0);
  35630. }
  35631. function _fflush($0) {
  35632. $0 = $0|0;
  35633. var $$0 = 0, $$023 = 0, $$02325 = 0, $$02327 = 0, $$024$lcssa = 0, $$02426 = 0, $$1 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0;
  35634. var $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $phitmp = 0, label = 0, sp = 0;
  35635. sp = STACKTOP;
  35636. $1 = ($0|0)==(0|0);
  35637. do {
  35638. if ($1) {
  35639. $8 = HEAP32[1060]|0;
  35640. $9 = ($8|0)==(0|0);
  35641. if ($9) {
  35642. $29 = 0;
  35643. } else {
  35644. $10 = HEAP32[1060]|0;
  35645. $11 = (_fflush($10)|0);
  35646. $29 = $11;
  35647. }
  35648. $12 = (___ofl_lock()|0);
  35649. $$02325 = HEAP32[$12>>2]|0;
  35650. $13 = ($$02325|0)==(0|0);
  35651. if ($13) {
  35652. $$024$lcssa = $29;
  35653. } else {
  35654. $$02327 = $$02325;$$02426 = $29;
  35655. while(1) {
  35656. $14 = ((($$02327)) + 76|0);
  35657. $15 = HEAP32[$14>>2]|0;
  35658. $16 = ($15|0)>(-1);
  35659. if ($16) {
  35660. $17 = (___lockfile($$02327)|0);
  35661. $26 = $17;
  35662. } else {
  35663. $26 = 0;
  35664. }
  35665. $18 = ((($$02327)) + 20|0);
  35666. $19 = HEAP32[$18>>2]|0;
  35667. $20 = ((($$02327)) + 28|0);
  35668. $21 = HEAP32[$20>>2]|0;
  35669. $22 = ($19>>>0)>($21>>>0);
  35670. if ($22) {
  35671. $23 = (___fflush_unlocked($$02327)|0);
  35672. $24 = $23 | $$02426;
  35673. $$1 = $24;
  35674. } else {
  35675. $$1 = $$02426;
  35676. }
  35677. $25 = ($26|0)==(0);
  35678. if (!($25)) {
  35679. ___unlockfile($$02327);
  35680. }
  35681. $27 = ((($$02327)) + 56|0);
  35682. $$023 = HEAP32[$27>>2]|0;
  35683. $28 = ($$023|0)==(0|0);
  35684. if ($28) {
  35685. $$024$lcssa = $$1;
  35686. break;
  35687. } else {
  35688. $$02327 = $$023;$$02426 = $$1;
  35689. }
  35690. }
  35691. }
  35692. ___ofl_unlock();
  35693. $$0 = $$024$lcssa;
  35694. } else {
  35695. $2 = ((($0)) + 76|0);
  35696. $3 = HEAP32[$2>>2]|0;
  35697. $4 = ($3|0)>(-1);
  35698. if (!($4)) {
  35699. $5 = (___fflush_unlocked($0)|0);
  35700. $$0 = $5;
  35701. break;
  35702. }
  35703. $6 = (___lockfile($0)|0);
  35704. $phitmp = ($6|0)==(0);
  35705. $7 = (___fflush_unlocked($0)|0);
  35706. if ($phitmp) {
  35707. $$0 = $7;
  35708. } else {
  35709. ___unlockfile($0);
  35710. $$0 = $7;
  35711. }
  35712. }
  35713. } while(0);
  35714. return ($$0|0);
  35715. }
  35716. function ___fflush_unlocked($0) {
  35717. $0 = $0|0;
  35718. var $$0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0;
  35719. var $9 = 0, label = 0, sp = 0;
  35720. sp = STACKTOP;
  35721. $1 = ((($0)) + 20|0);
  35722. $2 = HEAP32[$1>>2]|0;
  35723. $3 = ((($0)) + 28|0);
  35724. $4 = HEAP32[$3>>2]|0;
  35725. $5 = ($2>>>0)>($4>>>0);
  35726. if ($5) {
  35727. $6 = ((($0)) + 36|0);
  35728. $7 = HEAP32[$6>>2]|0;
  35729. (FUNCTION_TABLE_iiii[$7 & 15]($0,0,0)|0);
  35730. $8 = HEAP32[$1>>2]|0;
  35731. $9 = ($8|0)==(0|0);
  35732. if ($9) {
  35733. $$0 = -1;
  35734. } else {
  35735. label = 3;
  35736. }
  35737. } else {
  35738. label = 3;
  35739. }
  35740. if ((label|0) == 3) {
  35741. $10 = ((($0)) + 4|0);
  35742. $11 = HEAP32[$10>>2]|0;
  35743. $12 = ((($0)) + 8|0);
  35744. $13 = HEAP32[$12>>2]|0;
  35745. $14 = ($11>>>0)<($13>>>0);
  35746. if ($14) {
  35747. $15 = $11;
  35748. $16 = $13;
  35749. $17 = (($15) - ($16))|0;
  35750. $18 = ((($0)) + 40|0);
  35751. $19 = HEAP32[$18>>2]|0;
  35752. (FUNCTION_TABLE_iiii[$19 & 15]($0,$17,1)|0);
  35753. }
  35754. $20 = ((($0)) + 16|0);
  35755. HEAP32[$20>>2] = 0;
  35756. HEAP32[$3>>2] = 0;
  35757. HEAP32[$1>>2] = 0;
  35758. HEAP32[$12>>2] = 0;
  35759. HEAP32[$10>>2] = 0;
  35760. $$0 = 0;
  35761. }
  35762. return ($$0|0);
  35763. }
  35764. function _fgets($0,$1,$2) {
  35765. $0 = $0|0;
  35766. $1 = $1|0;
  35767. $2 = $2|0;
  35768. var $$0 = 0, $$06266 = 0, $$063 = 0, $$064 = 0, $$1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0;
  35769. var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0;
  35770. var $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond3 = 0;
  35771. var $sext$mask = 0, label = 0, sp = 0;
  35772. sp = STACKTOP;
  35773. $3 = ((($2)) + 76|0);
  35774. $4 = HEAP32[$3>>2]|0;
  35775. $5 = ($4|0)>(-1);
  35776. if ($5) {
  35777. $6 = (___lockfile($2)|0);
  35778. $17 = $6;
  35779. } else {
  35780. $17 = 0;
  35781. }
  35782. $7 = (($1) + -1)|0;
  35783. $8 = ($1|0)<(2);
  35784. $9 = ($7|0)!=(0);
  35785. if ($8) {
  35786. $10 = ((($2)) + 74|0);
  35787. $11 = HEAP8[$10>>0]|0;
  35788. $12 = $11 << 24 >> 24;
  35789. $13 = (($12) + 255)|0;
  35790. $14 = $13 | $12;
  35791. $15 = $14&255;
  35792. HEAP8[$10>>0] = $15;
  35793. $16 = ($17|0)==(0);
  35794. if (!($16)) {
  35795. ___unlockfile($2);
  35796. }
  35797. if ($9) {
  35798. $$0 = 0;
  35799. } else {
  35800. HEAP8[$0>>0] = 0;
  35801. $$0 = $0;
  35802. }
  35803. } else {
  35804. L11: do {
  35805. if ($9) {
  35806. $18 = ((($2)) + 4|0);
  35807. $19 = ((($2)) + 8|0);
  35808. $$063 = $7;$$064 = $0;
  35809. while(1) {
  35810. $20 = HEAP32[$18>>2]|0;
  35811. $21 = HEAP32[$19>>2]|0;
  35812. $22 = $20;
  35813. $23 = (($21) - ($22))|0;
  35814. $24 = (_memchr($20,10,$23)|0);
  35815. $25 = ($24|0)==(0|0);
  35816. $26 = $24;
  35817. $27 = (1 - ($22))|0;
  35818. $28 = (($27) + ($26))|0;
  35819. $29 = $25 ? $23 : $28;
  35820. $30 = ($29>>>0)<($$063>>>0);
  35821. $31 = $30 ? $29 : $$063;
  35822. _memcpy(($$064|0),($20|0),($31|0))|0;
  35823. $32 = HEAP32[$18>>2]|0;
  35824. $33 = (($32) + ($31)|0);
  35825. HEAP32[$18>>2] = $33;
  35826. $34 = (($$064) + ($31)|0);
  35827. $35 = (($$063) - ($31))|0;
  35828. $36 = ($35|0)!=(0);
  35829. $or$cond = $25 & $36;
  35830. if (!($or$cond)) {
  35831. $$1 = $34;
  35832. label = 17;
  35833. break L11;
  35834. }
  35835. $37 = HEAP32[$19>>2]|0;
  35836. $38 = ($33>>>0)<($37>>>0);
  35837. if ($38) {
  35838. $39 = ((($33)) + 1|0);
  35839. HEAP32[$18>>2] = $39;
  35840. $40 = HEAP8[$33>>0]|0;
  35841. $41 = $40&255;
  35842. $50 = $41;
  35843. } else {
  35844. $42 = (___uflow($2)|0);
  35845. $43 = ($42|0)<(0);
  35846. if ($43) {
  35847. break;
  35848. } else {
  35849. $50 = $42;
  35850. }
  35851. }
  35852. $48 = (($35) + -1)|0;
  35853. $49 = $50&255;
  35854. $51 = ((($34)) + 1|0);
  35855. HEAP8[$34>>0] = $49;
  35856. $sext$mask = $50 & 255;
  35857. $52 = ($sext$mask|0)!=(10);
  35858. $53 = ($48|0)!=(0);
  35859. $or$cond3 = $53 & $52;
  35860. if ($or$cond3) {
  35861. $$063 = $48;$$064 = $51;
  35862. } else {
  35863. $$1 = $51;
  35864. label = 17;
  35865. break L11;
  35866. }
  35867. }
  35868. $44 = ($34|0)==($0|0);
  35869. if ($44) {
  35870. $$06266 = 0;
  35871. } else {
  35872. $45 = HEAP32[$2>>2]|0;
  35873. $46 = $45 & 16;
  35874. $47 = ($46|0)==(0);
  35875. if ($47) {
  35876. $$06266 = 0;
  35877. } else {
  35878. $$1 = $34;
  35879. label = 17;
  35880. }
  35881. }
  35882. } else {
  35883. $$1 = $0;
  35884. label = 17;
  35885. }
  35886. } while(0);
  35887. if ((label|0) == 17) {
  35888. $54 = ($0|0)==(0|0);
  35889. if ($54) {
  35890. $$06266 = 0;
  35891. } else {
  35892. HEAP8[$$1>>0] = 0;
  35893. $$06266 = $0;
  35894. }
  35895. }
  35896. $55 = ($17|0)==(0);
  35897. if ($55) {
  35898. $$0 = $$06266;
  35899. } else {
  35900. ___unlockfile($2);
  35901. $$0 = $$06266;
  35902. }
  35903. }
  35904. return ($$0|0);
  35905. }
  35906. function _feof($0) {
  35907. $0 = $0|0;
  35908. var $$lobit = 0, $$lobit8 = 0, $$lobit9 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $phitmp = 0, label = 0, sp = 0;
  35909. sp = STACKTOP;
  35910. $1 = ((($0)) + 76|0);
  35911. $2 = HEAP32[$1>>2]|0;
  35912. $3 = ($2|0)>(-1);
  35913. if ($3) {
  35914. $6 = (___lockfile($0)|0);
  35915. $phitmp = ($6|0)==(0);
  35916. $7 = HEAP32[$0>>2]|0;
  35917. $8 = $7 >>> 4;
  35918. $$lobit = $8 & 1;
  35919. if ($phitmp) {
  35920. $$lobit9 = $$lobit;
  35921. } else {
  35922. ___unlockfile($0);
  35923. $$lobit9 = $$lobit;
  35924. }
  35925. } else {
  35926. $4 = HEAP32[$0>>2]|0;
  35927. $5 = $4 >>> 4;
  35928. $$lobit8 = $5 & 1;
  35929. $$lobit9 = $$lobit8;
  35930. }
  35931. return ($$lobit9|0);
  35932. }
  35933. function _fscanf($0,$1,$varargs) {
  35934. $0 = $0|0;
  35935. $1 = $1|0;
  35936. $varargs = $varargs|0;
  35937. var $2 = 0, $3 = 0, label = 0, sp = 0;
  35938. sp = STACKTOP;
  35939. STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
  35940. $2 = sp;
  35941. HEAP32[$2>>2] = $varargs;
  35942. $3 = (_vfscanf($0,$1,$2)|0);
  35943. STACKTOP = sp;return ($3|0);
  35944. }
  35945. function _vfscanf($0,$1,$2) {
  35946. $0 = $0|0;
  35947. $1 = $1|0;
  35948. $2 = $2|0;
  35949. var $$ = 0, $$$0266 = 0, $$$0268 = 0, $$$0305 = 0, $$$3 = 0, $$0266$lcssa = 0, $$0266417 = 0, $$0268 = 0, $$0272 = 0, $$0273429 = 0, $$0276$ph = 0, $$0278$ph = 0, $$0278$ph$phi = 0, $$0278$ph336 = 0, $$0283428 = 0, $$0286420 = 0, $$0288$ = 0, $$0288425 = 0, $$0292 = 0, $$0293 = 0;
  35950. var $$0305423 = 0, $$10 = 0, $$11 = 0, $$1267 = 0, $$1271 = 0, $$1274 = 0, $$1277$ph = 0, $$1279 = 0, $$1284 = 0, $$1289 = 0, $$2 = 0, $$2275 = 0, $$2280 = 0, $$2280$ph = 0, $$2280$ph$phi = 0, $$2285 = 0, $$2290 = 0, $$2307$ph = 0, $$3$lcssa = 0, $$319 = 0;
  35951. var $$320 = 0, $$321 = 0, $$322 = 0, $$327 = 0, $$328$le439 = 0, $$328$le441 = 0, $$3281 = 0, $$3291 = 0, $$3416 = 0, $$4282 = 0, $$4309 = 0, $$5 = 0, $$5299 = 0, $$5310 = 0, $$6 = 0, $$6311 = 0, $$7 = 0, $$7$ph = 0, $$7312 = 0, $$8 = 0;
  35952. var $$8313 = 0, $$9 = 0, $$9314 = 0, $$9314$ph = 0, $$lcssa355 = 0, $$not = 0, $$old4 = 0, $$ph = 0, $$ph353 = 0, $$pre = 0, $$pre$phi516Z2D = 0, $$pre507 = 0, $$pre509 = 0, $$pre511 = 0, $$pre512 = 0, $$pre513 = 0, $$pre514 = 0, $$pre515 = 0, $$sink443 = 0, $$sroa$2$0$$sroa_idx13 = 0;
  35953. var $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0;
  35954. var $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0;
  35955. var $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0;
  35956. var $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0;
  35957. var $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0;
  35958. var $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0;
  35959. var $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0;
  35960. var $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0;
  35961. var $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0;
  35962. var $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0;
  35963. var $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0.0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0.0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0;
  35964. var $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0;
  35965. var $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0;
  35966. var $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0;
  35967. var $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0;
  35968. var $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $arglist_current = 0, $arglist_next = 0, $expanded = 0, $expanded1 = 0, $expanded3 = 0, $expanded4 = 0, $expanded5 = 0, $factor = 0, $factor331 = 0, $isdigit = 0;
  35969. var $isdigit316 = 0, $isdigit316415 = 0, $isdigittmp = 0, $isdigittmp315 = 0, $isdigittmp315414 = 0, $narrow = 0, $narrow469 = 0, $or$cond = 0, $or$cond3 = 0, $or$cond318 = 0, $or$cond5 = 0, $trunc = 0, label = 0, sp = 0;
  35970. sp = STACKTOP;
  35971. STACKTOP = STACKTOP + 288|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(288|0);
  35972. $3 = sp + 8|0;
  35973. $4 = sp + 17|0;
  35974. $5 = sp;
  35975. $6 = sp + 16|0;
  35976. $7 = ((($0)) + 76|0);
  35977. $8 = HEAP32[$7>>2]|0;
  35978. $9 = ($8|0)>(-1);
  35979. if ($9) {
  35980. $10 = (___lockfile($0)|0);
  35981. $306 = $10;
  35982. } else {
  35983. $306 = 0;
  35984. }
  35985. $11 = HEAP8[$1>>0]|0;
  35986. $12 = ($11<<24>>24)==(0);
  35987. L4: do {
  35988. if ($12) {
  35989. $$3291 = 0;
  35990. } else {
  35991. $13 = ((($0)) + 4|0);
  35992. $14 = ((($0)) + 100|0);
  35993. $15 = ((($0)) + 108|0);
  35994. $16 = ((($0)) + 8|0);
  35995. $17 = ((($4)) + 10|0);
  35996. $18 = ((($4)) + 33|0);
  35997. $$sroa$2$0$$sroa_idx13 = ((($3)) + 4|0);
  35998. $19 = ((($4)) + 46|0);
  35999. $20 = ((($4)) + 94|0);
  36000. $21 = ((($4)) + 1|0);
  36001. $22 = ((($4)) + 1|0);
  36002. $$0273429 = $1;$$0283428 = 0;$$0288425 = 0;$$0305423 = 0;$102 = 0;$24 = $11;
  36003. L6: while(1) {
  36004. $23 = $24&255;
  36005. $25 = (_isspace($23)|0);
  36006. $26 = ($25|0)==(0);
  36007. L8: do {
  36008. if ($26) {
  36009. $53 = ($24<<24>>24)==(37);
  36010. L10: do {
  36011. if ($53) {
  36012. $54 = ((($$0273429)) + 1|0);
  36013. $55 = HEAP8[$54>>0]|0;
  36014. L12: do {
  36015. switch ($55<<24>>24) {
  36016. case 37: {
  36017. break L10;
  36018. break;
  36019. }
  36020. case 42: {
  36021. $76 = ((($$0273429)) + 2|0);
  36022. $$0293 = 0;$$2275 = $76;
  36023. break;
  36024. }
  36025. default: {
  36026. $77 = $55&255;
  36027. $isdigittmp = (($77) + -48)|0;
  36028. $isdigit = ($isdigittmp>>>0)<(10);
  36029. if ($isdigit) {
  36030. $78 = ((($$0273429)) + 2|0);
  36031. $79 = HEAP8[$78>>0]|0;
  36032. $80 = ($79<<24>>24)==(36);
  36033. if ($80) {
  36034. $81 = (_arg_n($2,$isdigittmp)|0);
  36035. $82 = ((($$0273429)) + 3|0);
  36036. $$0293 = $81;$$2275 = $82;
  36037. break L12;
  36038. }
  36039. }
  36040. $arglist_current = HEAP32[$2>>2]|0;
  36041. $83 = $arglist_current;
  36042. $84 = ((0) + 4|0);
  36043. $expanded1 = $84;
  36044. $expanded = (($expanded1) - 1)|0;
  36045. $85 = (($83) + ($expanded))|0;
  36046. $86 = ((0) + 4|0);
  36047. $expanded5 = $86;
  36048. $expanded4 = (($expanded5) - 1)|0;
  36049. $expanded3 = $expanded4 ^ -1;
  36050. $87 = $85 & $expanded3;
  36051. $88 = $87;
  36052. $89 = HEAP32[$88>>2]|0;
  36053. $arglist_next = ((($88)) + 4|0);
  36054. HEAP32[$2>>2] = $arglist_next;
  36055. $$0293 = $89;$$2275 = $54;
  36056. }
  36057. }
  36058. } while(0);
  36059. $90 = HEAP8[$$2275>>0]|0;
  36060. $91 = $90&255;
  36061. $isdigittmp315414 = (($91) + -48)|0;
  36062. $isdigit316415 = ($isdigittmp315414>>>0)<(10);
  36063. if ($isdigit316415) {
  36064. $$0266417 = 0;$$3416 = $$2275;$95 = $91;
  36065. while(1) {
  36066. $92 = ($$0266417*10)|0;
  36067. $93 = (($92) + -48)|0;
  36068. $94 = (($93) + ($95))|0;
  36069. $96 = ((($$3416)) + 1|0);
  36070. $97 = HEAP8[$96>>0]|0;
  36071. $98 = $97&255;
  36072. $isdigittmp315 = (($98) + -48)|0;
  36073. $isdigit316 = ($isdigittmp315>>>0)<(10);
  36074. if ($isdigit316) {
  36075. $$0266417 = $94;$$3416 = $96;$95 = $98;
  36076. } else {
  36077. $$0266$lcssa = $94;$$3$lcssa = $96;$$lcssa355 = $97;
  36078. break;
  36079. }
  36080. }
  36081. } else {
  36082. $$0266$lcssa = 0;$$3$lcssa = $$2275;$$lcssa355 = $90;
  36083. }
  36084. $99 = ($$lcssa355<<24>>24)==(109);
  36085. $100 = ($$0293|0)!=(0|0);
  36086. $101 = ((($$3$lcssa)) + 1|0);
  36087. $$$0305 = $99 ? 0 : $$0305423;
  36088. $$327 = $99 ? 0 : $102;
  36089. $$$3 = $99 ? $101 : $$3$lcssa;
  36090. $narrow = $100 & $99;
  36091. $103 = ((($$$3)) + 1|0);
  36092. $104 = HEAP8[$$$3>>0]|0;
  36093. switch ($104<<24>>24) {
  36094. case 104: {
  36095. $105 = HEAP8[$103>>0]|0;
  36096. $106 = ($105<<24>>24)==(104);
  36097. $107 = ((($$$3)) + 2|0);
  36098. $$319 = $106 ? $107 : $103;
  36099. $$320 = $106 ? -2 : -1;
  36100. $$0268 = $$320;$$5 = $$319;
  36101. break;
  36102. }
  36103. case 108: {
  36104. $108 = HEAP8[$103>>0]|0;
  36105. $109 = ($108<<24>>24)==(108);
  36106. $110 = ((($$$3)) + 2|0);
  36107. $$321 = $109 ? $110 : $103;
  36108. $$322 = $109 ? 3 : 1;
  36109. $$0268 = $$322;$$5 = $$321;
  36110. break;
  36111. }
  36112. case 106: {
  36113. $$0268 = 3;$$5 = $103;
  36114. break;
  36115. }
  36116. case 116: case 122: {
  36117. $$0268 = 1;$$5 = $103;
  36118. break;
  36119. }
  36120. case 76: {
  36121. $$0268 = 2;$$5 = $103;
  36122. break;
  36123. }
  36124. case 110: case 112: case 67: case 83: case 91: case 99: case 115: case 88: case 71: case 70: case 69: case 65: case 103: case 102: case 101: case 97: case 120: case 117: case 111: case 105: case 100: {
  36125. $$0268 = 0;$$5 = $$$3;
  36126. break;
  36127. }
  36128. default: {
  36129. $$7312 = $$$0305;$309 = $$327;$narrow469 = $narrow;
  36130. label = 137;
  36131. break L6;
  36132. }
  36133. }
  36134. $111 = HEAP8[$$5>>0]|0;
  36135. $112 = $111&255;
  36136. $113 = $112 & 47;
  36137. $114 = ($113|0)==(3);
  36138. $115 = $112 | 32;
  36139. $$ = $114 ? $115 : $112;
  36140. $$$0268 = $114 ? 1 : $$0268;
  36141. $trunc = $$&255;
  36142. switch ($trunc<<24>>24) {
  36143. case 99: {
  36144. $116 = ($$0266$lcssa|0)>(1);
  36145. $$$0266 = $116 ? $$0266$lcssa : 1;
  36146. $$1267 = $$$0266;$$1284 = $$0283428;
  36147. break;
  36148. }
  36149. case 91: {
  36150. $$1267 = $$0266$lcssa;$$1284 = $$0283428;
  36151. break;
  36152. }
  36153. case 110: {
  36154. $117 = ($$0283428|0)<(0);
  36155. $118 = $117 << 31 >> 31;
  36156. _store_int($$0293,$$$0268,$$0283428,$118);
  36157. $$11 = $$5;$$1289 = $$0288425;$$2285 = $$0283428;$$6311 = $$$0305;$307 = $$327;
  36158. break L8;
  36159. break;
  36160. }
  36161. default: {
  36162. ___shlim($0,0);
  36163. while(1) {
  36164. $119 = HEAP32[$13>>2]|0;
  36165. $120 = HEAP32[$14>>2]|0;
  36166. $121 = ($119>>>0)<($120>>>0);
  36167. if ($121) {
  36168. $122 = ((($119)) + 1|0);
  36169. HEAP32[$13>>2] = $122;
  36170. $123 = HEAP8[$119>>0]|0;
  36171. $124 = $123&255;
  36172. $126 = $124;
  36173. } else {
  36174. $125 = (___shgetc($0)|0);
  36175. $126 = $125;
  36176. }
  36177. $127 = (_isspace($126)|0);
  36178. $128 = ($127|0)==(0);
  36179. if ($128) {
  36180. break;
  36181. }
  36182. }
  36183. $129 = HEAP32[$14>>2]|0;
  36184. $130 = ($129|0)==(0|0);
  36185. if ($130) {
  36186. $$pre507 = HEAP32[$13>>2]|0;
  36187. $138 = $$pre507;
  36188. } else {
  36189. $131 = HEAP32[$13>>2]|0;
  36190. $132 = ((($131)) + -1|0);
  36191. HEAP32[$13>>2] = $132;
  36192. $133 = $132;
  36193. $138 = $133;
  36194. }
  36195. $134 = HEAP32[$15>>2]|0;
  36196. $135 = HEAP32[$16>>2]|0;
  36197. $136 = (($134) + ($$0283428))|0;
  36198. $137 = (($136) + ($138))|0;
  36199. $139 = (($137) - ($135))|0;
  36200. $$1267 = $$0266$lcssa;$$1284 = $139;
  36201. }
  36202. }
  36203. ___shlim($0,$$1267);
  36204. $140 = HEAP32[$13>>2]|0;
  36205. $141 = HEAP32[$14>>2]|0;
  36206. $142 = ($140>>>0)<($141>>>0);
  36207. if ($142) {
  36208. $143 = ((($140)) + 1|0);
  36209. HEAP32[$13>>2] = $143;
  36210. $147 = $141;
  36211. } else {
  36212. $144 = (___shgetc($0)|0);
  36213. $145 = ($144|0)<(0);
  36214. if ($145) {
  36215. $$7312 = $$$0305;$309 = $$327;$narrow469 = $narrow;
  36216. label = 137;
  36217. break L6;
  36218. }
  36219. $$pre509 = HEAP32[$14>>2]|0;
  36220. $147 = $$pre509;
  36221. }
  36222. $146 = ($147|0)==(0|0);
  36223. if (!($146)) {
  36224. $148 = HEAP32[$13>>2]|0;
  36225. $149 = ((($148)) + -1|0);
  36226. HEAP32[$13>>2] = $149;
  36227. }
  36228. L55: do {
  36229. switch ($trunc<<24>>24) {
  36230. case 91: case 99: case 115: {
  36231. $150 = ($$|0)==(99);
  36232. $151 = $$ | 16;
  36233. $152 = ($151|0)==(115);
  36234. L57: do {
  36235. if ($152) {
  36236. $153 = ($$|0)==(115);
  36237. _memset(($21|0),-1,256)|0;
  36238. HEAP8[$4>>0] = 0;
  36239. if ($153) {
  36240. HEAP8[$18>>0] = 0;
  36241. ;HEAP8[$17>>0]=0|0;HEAP8[$17+1>>0]=0|0;HEAP8[$17+2>>0]=0|0;HEAP8[$17+3>>0]=0|0;HEAP8[$17+4>>0]=0|0;
  36242. $$9 = $$5;
  36243. } else {
  36244. $$9 = $$5;
  36245. }
  36246. } else {
  36247. $154 = ((($$5)) + 1|0);
  36248. $155 = HEAP8[$154>>0]|0;
  36249. $156 = ($155<<24>>24)==(94);
  36250. $157 = ((($$5)) + 2|0);
  36251. $$0292 = $156&1;
  36252. $$6 = $156 ? $157 : $154;
  36253. $158 = $156&1;
  36254. _memset(($22|0),($158|0),256)|0;
  36255. HEAP8[$4>>0] = 0;
  36256. $159 = HEAP8[$$6>>0]|0;
  36257. switch ($159<<24>>24) {
  36258. case 45: {
  36259. $$sink443 = $19;
  36260. label = 64;
  36261. break;
  36262. }
  36263. case 93: {
  36264. $$sink443 = $20;
  36265. label = 64;
  36266. break;
  36267. }
  36268. default: {
  36269. $$pre514 = $$0292 ^ 1;
  36270. $$pre515 = $$pre514&255;
  36271. $$7$ph = $$6;$$pre$phi516Z2D = $$pre515;
  36272. }
  36273. }
  36274. if ((label|0) == 64) {
  36275. label = 0;
  36276. $160 = ((($$6)) + 1|0);
  36277. $161 = $$0292 ^ 1;
  36278. $162 = $161&255;
  36279. HEAP8[$$sink443>>0] = $162;
  36280. $$7$ph = $160;$$pre$phi516Z2D = $162;
  36281. }
  36282. $$7 = $$7$ph;
  36283. while(1) {
  36284. $163 = HEAP8[$$7>>0]|0;
  36285. L69: do {
  36286. switch ($163<<24>>24) {
  36287. case 0: {
  36288. $$7312 = $$$0305;$309 = $$327;$narrow469 = $narrow;
  36289. label = 137;
  36290. break L6;
  36291. break;
  36292. }
  36293. case 93: {
  36294. $$9 = $$7;
  36295. break L57;
  36296. break;
  36297. }
  36298. case 45: {
  36299. $164 = ((($$7)) + 1|0);
  36300. $165 = HEAP8[$164>>0]|0;
  36301. switch ($165<<24>>24) {
  36302. case 93: case 0: {
  36303. $$8 = $$7;$176 = 45;
  36304. break L69;
  36305. break;
  36306. }
  36307. default: {
  36308. }
  36309. }
  36310. $166 = ((($$7)) + -1|0);
  36311. $167 = HEAP8[$166>>0]|0;
  36312. $168 = ($167&255)<($165&255);
  36313. if ($168) {
  36314. $169 = $167&255;
  36315. $$0286420 = $169;
  36316. while(1) {
  36317. $170 = (($$0286420) + 1)|0;
  36318. $171 = (($4) + ($170)|0);
  36319. HEAP8[$171>>0] = $$pre$phi516Z2D;
  36320. $172 = HEAP8[$164>>0]|0;
  36321. $173 = $172&255;
  36322. $174 = ($170|0)<($173|0);
  36323. if ($174) {
  36324. $$0286420 = $170;
  36325. } else {
  36326. $$8 = $164;$176 = $172;
  36327. break;
  36328. }
  36329. }
  36330. } else {
  36331. $$8 = $164;$176 = $165;
  36332. }
  36333. break;
  36334. }
  36335. default: {
  36336. $$8 = $$7;$176 = $163;
  36337. }
  36338. }
  36339. } while(0);
  36340. $175 = $176&255;
  36341. $177 = (($175) + 1)|0;
  36342. $178 = (($4) + ($177)|0);
  36343. HEAP8[$178>>0] = $$pre$phi516Z2D;
  36344. $179 = ((($$8)) + 1|0);
  36345. $$7 = $179;
  36346. }
  36347. }
  36348. } while(0);
  36349. $180 = (($$1267) + 1)|0;
  36350. $181 = $150 ? $180 : 31;
  36351. $182 = ($$$0268|0)==(1);
  36352. L77: do {
  36353. if ($182) {
  36354. if ($narrow) {
  36355. $183 = $181 << 2;
  36356. $184 = (_malloc($183)|0);
  36357. $185 = ($184|0)==(0|0);
  36358. if ($185) {
  36359. $$7312 = 0;$309 = 0;$narrow469 = 1;
  36360. label = 137;
  36361. break L6;
  36362. } else {
  36363. $311 = $184;
  36364. }
  36365. } else {
  36366. $311 = $$0293;
  36367. }
  36368. HEAP32[$3>>2] = 0;
  36369. HEAP32[$$sroa$2$0$$sroa_idx13>>2] = 0;
  36370. $$0276$ph = $181;$$0278$ph = 0;$$ph = $311;
  36371. L82: while(1) {
  36372. $186 = ($$ph|0)==(0|0);
  36373. $$0278$ph336 = $$0278$ph;
  36374. while(1) {
  36375. L86: while(1) {
  36376. $187 = HEAP32[$13>>2]|0;
  36377. $188 = HEAP32[$14>>2]|0;
  36378. $189 = ($187>>>0)<($188>>>0);
  36379. if ($189) {
  36380. $190 = ((($187)) + 1|0);
  36381. HEAP32[$13>>2] = $190;
  36382. $191 = HEAP8[$187>>0]|0;
  36383. $192 = $191&255;
  36384. $195 = $192;
  36385. } else {
  36386. $193 = (___shgetc($0)|0);
  36387. $195 = $193;
  36388. }
  36389. $194 = (($195) + 1)|0;
  36390. $196 = (($4) + ($194)|0);
  36391. $197 = HEAP8[$196>>0]|0;
  36392. $198 = ($197<<24>>24)==(0);
  36393. if ($198) {
  36394. break L82;
  36395. }
  36396. $199 = $195&255;
  36397. HEAP8[$6>>0] = $199;
  36398. $200 = (_mbrtowc($5,$6,1,$3)|0);
  36399. switch ($200|0) {
  36400. case -1: {
  36401. $$7312 = 0;$309 = $$ph;$narrow469 = $narrow;
  36402. label = 137;
  36403. break L6;
  36404. break;
  36405. }
  36406. case -2: {
  36407. break;
  36408. }
  36409. default: {
  36410. break L86;
  36411. }
  36412. }
  36413. }
  36414. if ($186) {
  36415. $$1279 = $$0278$ph336;
  36416. } else {
  36417. $201 = (($$ph) + ($$0278$ph336<<2)|0);
  36418. $202 = (($$0278$ph336) + 1)|0;
  36419. $203 = HEAP32[$5>>2]|0;
  36420. HEAP32[$201>>2] = $203;
  36421. $$1279 = $202;
  36422. }
  36423. $204 = ($$1279|0)==($$0276$ph|0);
  36424. $or$cond = $narrow & $204;
  36425. if ($or$cond) {
  36426. break;
  36427. } else {
  36428. $$0278$ph336 = $$1279;
  36429. }
  36430. }
  36431. $factor331 = $$0276$ph << 1;
  36432. $205 = $factor331 | 1;
  36433. $206 = $205 << 2;
  36434. $207 = (_realloc($$ph,$206)|0);
  36435. $208 = ($207|0)==(0|0);
  36436. if ($208) {
  36437. $$7312 = 0;$309 = $$ph;$narrow469 = 1;
  36438. label = 137;
  36439. break L6;
  36440. } else {
  36441. $$0278$ph$phi = $$0276$ph;$$0276$ph = $205;$$ph = $207;$$0278$ph = $$0278$ph$phi;
  36442. }
  36443. }
  36444. $209 = (_mbsinit($3)|0);
  36445. $210 = ($209|0)==(0);
  36446. if ($210) {
  36447. $$7312 = 0;$309 = $$ph;$narrow469 = $narrow;
  36448. label = 137;
  36449. break L6;
  36450. } else {
  36451. $$4282 = $$0278$ph336;$$4309 = 0;$$5299 = $$ph;$312 = $$ph;
  36452. }
  36453. } else {
  36454. if ($narrow) {
  36455. $211 = (_malloc($181)|0);
  36456. $212 = ($211|0)==(0|0);
  36457. if ($212) {
  36458. $$7312 = 0;$309 = 0;$narrow469 = 1;
  36459. label = 137;
  36460. break L6;
  36461. } else {
  36462. $$1277$ph = $181;$$2280$ph = 0;$$2307$ph = $211;
  36463. }
  36464. while(1) {
  36465. $$2280 = $$2280$ph;
  36466. while(1) {
  36467. $213 = HEAP32[$13>>2]|0;
  36468. $214 = HEAP32[$14>>2]|0;
  36469. $215 = ($213>>>0)<($214>>>0);
  36470. if ($215) {
  36471. $216 = ((($213)) + 1|0);
  36472. HEAP32[$13>>2] = $216;
  36473. $217 = HEAP8[$213>>0]|0;
  36474. $218 = $217&255;
  36475. $221 = $218;
  36476. } else {
  36477. $219 = (___shgetc($0)|0);
  36478. $221 = $219;
  36479. }
  36480. $220 = (($221) + 1)|0;
  36481. $222 = (($4) + ($220)|0);
  36482. $223 = HEAP8[$222>>0]|0;
  36483. $224 = ($223<<24>>24)==(0);
  36484. if ($224) {
  36485. $$4282 = $$2280;$$4309 = $$2307$ph;$$5299 = 0;$312 = 0;
  36486. break L77;
  36487. }
  36488. $225 = $221&255;
  36489. $226 = (($$2280) + 1)|0;
  36490. $227 = (($$2307$ph) + ($$2280)|0);
  36491. HEAP8[$227>>0] = $225;
  36492. $228 = ($226|0)==($$1277$ph|0);
  36493. if ($228) {
  36494. break;
  36495. } else {
  36496. $$2280 = $226;
  36497. }
  36498. }
  36499. $factor = $$1277$ph << 1;
  36500. $229 = $factor | 1;
  36501. $230 = (_realloc($$2307$ph,$229)|0);
  36502. $231 = ($230|0)==(0|0);
  36503. if ($231) {
  36504. $$7312 = $$2307$ph;$309 = 0;$narrow469 = 1;
  36505. label = 137;
  36506. break L6;
  36507. } else {
  36508. $$2280$ph$phi = $$1277$ph;$$1277$ph = $229;$$2307$ph = $230;$$2280$ph = $$2280$ph$phi;
  36509. }
  36510. }
  36511. }
  36512. $232 = ($$0293|0)==(0|0);
  36513. if ($232) {
  36514. $250 = $147;
  36515. while(1) {
  36516. $248 = HEAP32[$13>>2]|0;
  36517. $249 = ($248>>>0)<($250>>>0);
  36518. if ($249) {
  36519. $251 = ((($248)) + 1|0);
  36520. HEAP32[$13>>2] = $251;
  36521. $252 = HEAP8[$248>>0]|0;
  36522. $253 = $252&255;
  36523. $256 = $253;
  36524. } else {
  36525. $254 = (___shgetc($0)|0);
  36526. $256 = $254;
  36527. }
  36528. $255 = (($256) + 1)|0;
  36529. $257 = (($4) + ($255)|0);
  36530. $258 = HEAP8[$257>>0]|0;
  36531. $259 = ($258<<24>>24)==(0);
  36532. if ($259) {
  36533. $$4282 = 0;$$4309 = 0;$$5299 = 0;$312 = 0;
  36534. break L77;
  36535. }
  36536. $$pre512 = HEAP32[$14>>2]|0;
  36537. $250 = $$pre512;
  36538. }
  36539. } else {
  36540. $$3281 = 0;$235 = $147;
  36541. while(1) {
  36542. $233 = HEAP32[$13>>2]|0;
  36543. $234 = ($233>>>0)<($235>>>0);
  36544. if ($234) {
  36545. $236 = ((($233)) + 1|0);
  36546. HEAP32[$13>>2] = $236;
  36547. $237 = HEAP8[$233>>0]|0;
  36548. $238 = $237&255;
  36549. $241 = $238;
  36550. } else {
  36551. $239 = (___shgetc($0)|0);
  36552. $241 = $239;
  36553. }
  36554. $240 = (($241) + 1)|0;
  36555. $242 = (($4) + ($240)|0);
  36556. $243 = HEAP8[$242>>0]|0;
  36557. $244 = ($243<<24>>24)==(0);
  36558. if ($244) {
  36559. $$4282 = $$3281;$$4309 = $$0293;$$5299 = 0;$312 = 0;
  36560. break L77;
  36561. }
  36562. $245 = $241&255;
  36563. $246 = (($$3281) + 1)|0;
  36564. $247 = (($$0293) + ($$3281)|0);
  36565. HEAP8[$247>>0] = $245;
  36566. $$pre511 = HEAP32[$14>>2]|0;
  36567. $$3281 = $246;$235 = $$pre511;
  36568. }
  36569. }
  36570. }
  36571. } while(0);
  36572. $260 = HEAP32[$14>>2]|0;
  36573. $261 = ($260|0)==(0|0);
  36574. if ($261) {
  36575. $$pre513 = HEAP32[$13>>2]|0;
  36576. $268 = $$pre513;
  36577. } else {
  36578. $262 = HEAP32[$13>>2]|0;
  36579. $263 = ((($262)) + -1|0);
  36580. HEAP32[$13>>2] = $263;
  36581. $264 = $263;
  36582. $268 = $264;
  36583. }
  36584. $265 = HEAP32[$15>>2]|0;
  36585. $266 = HEAP32[$16>>2]|0;
  36586. $267 = (($268) - ($266))|0;
  36587. $269 = (($267) + ($265))|0;
  36588. $270 = ($269|0)==(0);
  36589. if ($270) {
  36590. $$9314$ph = $$4309;$$ph353 = $312;
  36591. label = 139;
  36592. break L6;
  36593. }
  36594. $$not = $150 ^ 1;
  36595. $271 = ($269|0)==($$1267|0);
  36596. $or$cond318 = $271 | $$not;
  36597. if (!($or$cond318)) {
  36598. $$9314$ph = $$4309;$$ph353 = $312;
  36599. label = 139;
  36600. break L6;
  36601. }
  36602. do {
  36603. if ($narrow) {
  36604. if ($182) {
  36605. HEAP32[$$0293>>2] = $$5299;
  36606. break;
  36607. } else {
  36608. HEAP32[$$0293>>2] = $$4309;
  36609. break;
  36610. }
  36611. }
  36612. } while(0);
  36613. if ($150) {
  36614. $$10 = $$9;$$5310 = $$4309;$310 = $312;
  36615. } else {
  36616. $272 = ($$5299|0)==(0|0);
  36617. if (!($272)) {
  36618. $273 = (($$5299) + ($$4282<<2)|0);
  36619. HEAP32[$273>>2] = 0;
  36620. }
  36621. $274 = ($$4309|0)==(0|0);
  36622. if ($274) {
  36623. $$10 = $$9;$$5310 = 0;$310 = $312;
  36624. break L55;
  36625. }
  36626. $275 = (($$4309) + ($$4282)|0);
  36627. HEAP8[$275>>0] = 0;
  36628. $$10 = $$9;$$5310 = $$4309;$310 = $312;
  36629. }
  36630. break;
  36631. }
  36632. case 120: case 88: case 112: {
  36633. $$0272 = 16;
  36634. label = 125;
  36635. break;
  36636. }
  36637. case 111: {
  36638. $$0272 = 8;
  36639. label = 125;
  36640. break;
  36641. }
  36642. case 117: case 100: {
  36643. $$0272 = 10;
  36644. label = 125;
  36645. break;
  36646. }
  36647. case 105: {
  36648. $$0272 = 0;
  36649. label = 125;
  36650. break;
  36651. }
  36652. case 71: case 103: case 70: case 102: case 69: case 101: case 65: case 97: {
  36653. $285 = (+___floatscan($0,$$$0268,0));
  36654. $286 = HEAP32[$15>>2]|0;
  36655. $287 = HEAP32[$13>>2]|0;
  36656. $288 = HEAP32[$16>>2]|0;
  36657. $289 = (($288) - ($287))|0;
  36658. $290 = ($286|0)==($289|0);
  36659. if ($290) {
  36660. $$9314$ph = $$$0305;$$ph353 = $$327;
  36661. label = 139;
  36662. break L6;
  36663. }
  36664. $291 = ($$0293|0)==(0|0);
  36665. if ($291) {
  36666. $$10 = $$5;$$5310 = $$$0305;$310 = $$327;
  36667. } else {
  36668. switch ($$$0268|0) {
  36669. case 0: {
  36670. $292 = $285;
  36671. HEAPF32[$$0293>>2] = $292;
  36672. $$10 = $$5;$$5310 = $$$0305;$310 = $$327;
  36673. break L55;
  36674. break;
  36675. }
  36676. case 1: {
  36677. HEAPF64[$$0293>>3] = $285;
  36678. $$10 = $$5;$$5310 = $$$0305;$310 = $$327;
  36679. break L55;
  36680. break;
  36681. }
  36682. case 2: {
  36683. HEAPF64[$$0293>>3] = $285;
  36684. $$10 = $$5;$$5310 = $$$0305;$310 = $$327;
  36685. break L55;
  36686. break;
  36687. }
  36688. default: {
  36689. $$10 = $$5;$$5310 = $$$0305;$310 = $$327;
  36690. break L55;
  36691. }
  36692. }
  36693. }
  36694. break;
  36695. }
  36696. default: {
  36697. $$10 = $$5;$$5310 = $$$0305;$310 = $$327;
  36698. }
  36699. }
  36700. } while(0);
  36701. do {
  36702. if ((label|0) == 125) {
  36703. label = 0;
  36704. $276 = (___intscan($0,$$0272,0,-1,-1)|0);
  36705. $277 = tempRet0;
  36706. $278 = HEAP32[$15>>2]|0;
  36707. $279 = HEAP32[$13>>2]|0;
  36708. $280 = HEAP32[$16>>2]|0;
  36709. $281 = (($280) - ($279))|0;
  36710. $282 = ($278|0)==($281|0);
  36711. if ($282) {
  36712. $$9314$ph = $$$0305;$$ph353 = $$327;
  36713. label = 139;
  36714. break L6;
  36715. }
  36716. $283 = ($$|0)==(112);
  36717. $or$cond3 = $100 & $283;
  36718. if ($or$cond3) {
  36719. $284 = $276;
  36720. HEAP32[$$0293>>2] = $284;
  36721. $$10 = $$5;$$5310 = $$$0305;$310 = $$327;
  36722. break;
  36723. } else {
  36724. _store_int($$0293,$$$0268,$276,$277);
  36725. $$10 = $$5;$$5310 = $$$0305;$310 = $$327;
  36726. break;
  36727. }
  36728. }
  36729. } while(0);
  36730. $293 = HEAP32[$15>>2]|0;
  36731. $294 = HEAP32[$13>>2]|0;
  36732. $295 = HEAP32[$16>>2]|0;
  36733. $296 = (($293) + ($$1284))|0;
  36734. $297 = (($296) + ($294))|0;
  36735. $298 = (($297) - ($295))|0;
  36736. $299 = $100&1;
  36737. $$0288$ = (($299) + ($$0288425))|0;
  36738. $$11 = $$10;$$1289 = $$0288$;$$2285 = $298;$$6311 = $$5310;$307 = $310;
  36739. break L8;
  36740. }
  36741. } while(0);
  36742. $56 = $53&1;
  36743. $57 = (($$0273429) + ($56)|0);
  36744. ___shlim($0,0);
  36745. $58 = HEAP32[$13>>2]|0;
  36746. $59 = HEAP32[$14>>2]|0;
  36747. $60 = ($58>>>0)<($59>>>0);
  36748. if ($60) {
  36749. $61 = ((($58)) + 1|0);
  36750. HEAP32[$13>>2] = $61;
  36751. $62 = HEAP8[$58>>0]|0;
  36752. $63 = $62&255;
  36753. $68 = $63;
  36754. } else {
  36755. $64 = (___shgetc($0)|0);
  36756. $68 = $64;
  36757. }
  36758. $65 = HEAP8[$57>>0]|0;
  36759. $66 = $65&255;
  36760. $67 = ($68|0)==($66|0);
  36761. if (!($67)) {
  36762. label = 22;
  36763. break L6;
  36764. }
  36765. $75 = (($$0283428) + 1)|0;
  36766. $$11 = $57;$$1289 = $$0288425;$$2285 = $75;$$6311 = $$0305423;$307 = $102;
  36767. } else {
  36768. $$1274 = $$0273429;
  36769. while(1) {
  36770. $27 = ((($$1274)) + 1|0);
  36771. $28 = HEAP8[$27>>0]|0;
  36772. $29 = $28&255;
  36773. $30 = (_isspace($29)|0);
  36774. $31 = ($30|0)==(0);
  36775. if ($31) {
  36776. break;
  36777. } else {
  36778. $$1274 = $27;
  36779. }
  36780. }
  36781. ___shlim($0,0);
  36782. while(1) {
  36783. $32 = HEAP32[$13>>2]|0;
  36784. $33 = HEAP32[$14>>2]|0;
  36785. $34 = ($32>>>0)<($33>>>0);
  36786. if ($34) {
  36787. $35 = ((($32)) + 1|0);
  36788. HEAP32[$13>>2] = $35;
  36789. $36 = HEAP8[$32>>0]|0;
  36790. $37 = $36&255;
  36791. $39 = $37;
  36792. } else {
  36793. $38 = (___shgetc($0)|0);
  36794. $39 = $38;
  36795. }
  36796. $40 = (_isspace($39)|0);
  36797. $41 = ($40|0)==(0);
  36798. if ($41) {
  36799. break;
  36800. }
  36801. }
  36802. $42 = HEAP32[$14>>2]|0;
  36803. $43 = ($42|0)==(0|0);
  36804. if ($43) {
  36805. $$pre = HEAP32[$13>>2]|0;
  36806. $51 = $$pre;
  36807. } else {
  36808. $44 = HEAP32[$13>>2]|0;
  36809. $45 = ((($44)) + -1|0);
  36810. HEAP32[$13>>2] = $45;
  36811. $46 = $45;
  36812. $51 = $46;
  36813. }
  36814. $47 = HEAP32[$15>>2]|0;
  36815. $48 = HEAP32[$16>>2]|0;
  36816. $49 = (($47) + ($$0283428))|0;
  36817. $50 = (($49) + ($51))|0;
  36818. $52 = (($50) - ($48))|0;
  36819. $$11 = $$1274;$$1289 = $$0288425;$$2285 = $52;$$6311 = $$0305423;$307 = $102;
  36820. }
  36821. } while(0);
  36822. $300 = ((($$11)) + 1|0);
  36823. $301 = HEAP8[$300>>0]|0;
  36824. $302 = ($301<<24>>24)==(0);
  36825. if ($302) {
  36826. $$3291 = $$1289;
  36827. break L4;
  36828. } else {
  36829. $$0273429 = $300;$$0283428 = $$2285;$$0288425 = $$1289;$$0305423 = $$6311;$102 = $307;$24 = $301;
  36830. }
  36831. }
  36832. if ((label|0) == 22) {
  36833. $69 = HEAP32[$14>>2]|0;
  36834. $70 = ($69|0)==(0|0);
  36835. if (!($70)) {
  36836. $71 = HEAP32[$13>>2]|0;
  36837. $72 = ((($71)) + -1|0);
  36838. HEAP32[$13>>2] = $72;
  36839. }
  36840. $73 = ($68|0)>(-1);
  36841. $74 = ($$0288425|0)!=(0);
  36842. $or$cond5 = $74 | $73;
  36843. if ($or$cond5) {
  36844. $$3291 = $$0288425;
  36845. break;
  36846. } else {
  36847. $$1271 = 0;$$8313 = $$0305423;$308 = $102;
  36848. label = 138;
  36849. }
  36850. }
  36851. else if ((label|0) == 137) {
  36852. $$328$le441 = $narrow469&1;
  36853. $$old4 = ($$0288425|0)==(0);
  36854. if ($$old4) {
  36855. $$1271 = $$328$le441;$$8313 = $$7312;$308 = $309;
  36856. label = 138;
  36857. } else {
  36858. $$2 = $$328$le441;$$2290 = $$0288425;$$9314 = $$7312;$304 = $309;
  36859. }
  36860. }
  36861. else if ((label|0) == 139) {
  36862. $$328$le439 = $narrow&1;
  36863. $$2 = $$328$le439;$$2290 = $$0288425;$$9314 = $$9314$ph;$304 = $$ph353;
  36864. }
  36865. if ((label|0) == 138) {
  36866. $$2 = $$1271;$$2290 = -1;$$9314 = $$8313;$304 = $308;
  36867. }
  36868. $303 = ($$2|0)==(0);
  36869. if ($303) {
  36870. $$3291 = $$2290;
  36871. } else {
  36872. _free($$9314);
  36873. _free($304);
  36874. $$3291 = $$2290;
  36875. }
  36876. }
  36877. } while(0);
  36878. $305 = ($306|0)==(0);
  36879. if (!($305)) {
  36880. ___unlockfile($0);
  36881. }
  36882. STACKTOP = sp;return ($$3291|0);
  36883. }
  36884. function _arg_n($0,$1) {
  36885. $0 = $0|0;
  36886. $1 = $1|0;
  36887. var $$0 = 0, $10 = 0, $11 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $arglist_current = 0, $arglist_next = 0, $expanded = 0, $expanded1 = 0, $expanded3 = 0, $expanded4 = 0, $expanded5 = 0, $vacopy_currentptr = 0, label = 0;
  36888. var sp = 0;
  36889. sp = STACKTOP;
  36890. STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
  36891. $2 = sp;
  36892. $vacopy_currentptr = HEAP32[$0>>2]|0;
  36893. HEAP32[$2>>2] = $vacopy_currentptr;
  36894. $$0 = $1;
  36895. while(1) {
  36896. $3 = ($$0>>>0)>(1);
  36897. $arglist_current = HEAP32[$2>>2]|0;
  36898. $4 = $arglist_current;
  36899. $5 = ((0) + 4|0);
  36900. $expanded1 = $5;
  36901. $expanded = (($expanded1) - 1)|0;
  36902. $6 = (($4) + ($expanded))|0;
  36903. $7 = ((0) + 4|0);
  36904. $expanded5 = $7;
  36905. $expanded4 = (($expanded5) - 1)|0;
  36906. $expanded3 = $expanded4 ^ -1;
  36907. $8 = $6 & $expanded3;
  36908. $9 = $8;
  36909. $10 = HEAP32[$9>>2]|0;
  36910. $arglist_next = ((($9)) + 4|0);
  36911. HEAP32[$2>>2] = $arglist_next;
  36912. $11 = (($$0) + -1)|0;
  36913. if ($3) {
  36914. $$0 = $11;
  36915. } else {
  36916. break;
  36917. }
  36918. }
  36919. STACKTOP = sp;return ($10|0);
  36920. }
  36921. function _store_int($0,$1,$2,$3) {
  36922. $0 = $0|0;
  36923. $1 = $1|0;
  36924. $2 = $2|0;
  36925. $3 = $3|0;
  36926. var $10 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
  36927. sp = STACKTOP;
  36928. $4 = ($0|0)==(0|0);
  36929. L1: do {
  36930. if (!($4)) {
  36931. switch ($1|0) {
  36932. case -2: {
  36933. $5 = $2&255;
  36934. HEAP8[$0>>0] = $5;
  36935. break L1;
  36936. break;
  36937. }
  36938. case -1: {
  36939. $6 = $2&65535;
  36940. HEAP16[$0>>1] = $6;
  36941. break L1;
  36942. break;
  36943. }
  36944. case 0: {
  36945. HEAP32[$0>>2] = $2;
  36946. break L1;
  36947. break;
  36948. }
  36949. case 1: {
  36950. HEAP32[$0>>2] = $2;
  36951. break L1;
  36952. break;
  36953. }
  36954. case 3: {
  36955. $7 = $0;
  36956. $8 = $7;
  36957. HEAP32[$8>>2] = $2;
  36958. $9 = (($7) + 4)|0;
  36959. $10 = $9;
  36960. HEAP32[$10>>2] = $3;
  36961. break L1;
  36962. break;
  36963. }
  36964. default: {
  36965. break L1;
  36966. }
  36967. }
  36968. }
  36969. } while(0);
  36970. return;
  36971. }
  36972. function _mbsinit($0) {
  36973. $0 = $0|0;
  36974. var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0;
  36975. sp = STACKTOP;
  36976. $1 = ($0|0)==(0|0);
  36977. if ($1) {
  36978. $5 = 1;
  36979. } else {
  36980. $2 = HEAP32[$0>>2]|0;
  36981. $3 = ($2|0)==(0);
  36982. $5 = $3;
  36983. }
  36984. $4 = $5&1;
  36985. return ($4|0);
  36986. }
  36987. function _fseek($0,$1,$2) {
  36988. $0 = $0|0;
  36989. $1 = $1|0;
  36990. $2 = $2|0;
  36991. var $3 = 0, label = 0, sp = 0;
  36992. sp = STACKTOP;
  36993. $3 = (___fseeko($0,$1,$2)|0);
  36994. return ($3|0);
  36995. }
  36996. function ___fseeko($0,$1,$2) {
  36997. $0 = $0|0;
  36998. $1 = $1|0;
  36999. $2 = $2|0;
  37000. var $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $phitmp = 0, label = 0, sp = 0;
  37001. sp = STACKTOP;
  37002. $3 = ((($0)) + 76|0);
  37003. $4 = HEAP32[$3>>2]|0;
  37004. $5 = ($4|0)>(-1);
  37005. if ($5) {
  37006. $7 = (___lockfile($0)|0);
  37007. $phitmp = ($7|0)==(0);
  37008. $8 = (___fseeko_unlocked($0,$1,$2)|0);
  37009. if ($phitmp) {
  37010. $9 = $8;
  37011. } else {
  37012. ___unlockfile($0);
  37013. $9 = $8;
  37014. }
  37015. } else {
  37016. $6 = (___fseeko_unlocked($0,$1,$2)|0);
  37017. $9 = $6;
  37018. }
  37019. return ($9|0);
  37020. }
  37021. function ___fseeko_unlocked($0,$1,$2) {
  37022. $0 = $0|0;
  37023. $1 = $1|0;
  37024. $2 = $2|0;
  37025. var $$0 = 0, $$019 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0;
  37026. var $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
  37027. sp = STACKTOP;
  37028. $3 = ($2|0)==(1);
  37029. if ($3) {
  37030. $4 = ((($0)) + 8|0);
  37031. $5 = HEAP32[$4>>2]|0;
  37032. $6 = ((($0)) + 4|0);
  37033. $7 = HEAP32[$6>>2]|0;
  37034. $8 = (($1) - ($5))|0;
  37035. $9 = (($8) + ($7))|0;
  37036. $$019 = $9;
  37037. } else {
  37038. $$019 = $1;
  37039. }
  37040. $10 = ((($0)) + 20|0);
  37041. $11 = HEAP32[$10>>2]|0;
  37042. $12 = ((($0)) + 28|0);
  37043. $13 = HEAP32[$12>>2]|0;
  37044. $14 = ($11>>>0)>($13>>>0);
  37045. if ($14) {
  37046. $15 = ((($0)) + 36|0);
  37047. $16 = HEAP32[$15>>2]|0;
  37048. (FUNCTION_TABLE_iiii[$16 & 15]($0,0,0)|0);
  37049. $17 = HEAP32[$10>>2]|0;
  37050. $18 = ($17|0)==(0|0);
  37051. if ($18) {
  37052. $$0 = -1;
  37053. } else {
  37054. label = 5;
  37055. }
  37056. } else {
  37057. label = 5;
  37058. }
  37059. if ((label|0) == 5) {
  37060. $19 = ((($0)) + 16|0);
  37061. HEAP32[$19>>2] = 0;
  37062. HEAP32[$12>>2] = 0;
  37063. HEAP32[$10>>2] = 0;
  37064. $20 = ((($0)) + 40|0);
  37065. $21 = HEAP32[$20>>2]|0;
  37066. $22 = (FUNCTION_TABLE_iiii[$21 & 15]($0,$$019,$2)|0);
  37067. $23 = ($22|0)<(0);
  37068. if ($23) {
  37069. $$0 = -1;
  37070. } else {
  37071. $24 = ((($0)) + 8|0);
  37072. HEAP32[$24>>2] = 0;
  37073. $25 = ((($0)) + 4|0);
  37074. HEAP32[$25>>2] = 0;
  37075. $26 = HEAP32[$0>>2]|0;
  37076. $27 = $26 & -17;
  37077. HEAP32[$0>>2] = $27;
  37078. $$0 = 0;
  37079. }
  37080. }
  37081. return ($$0|0);
  37082. }
  37083. function _strstr($0,$1) {
  37084. $0 = $0|0;
  37085. $1 = $1|0;
  37086. var $$0 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0;
  37087. var $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
  37088. sp = STACKTOP;
  37089. $2 = HEAP8[$1>>0]|0;
  37090. $3 = ($2<<24>>24)==(0);
  37091. do {
  37092. if ($3) {
  37093. $$0 = $0;
  37094. } else {
  37095. $4 = $2 << 24 >> 24;
  37096. $5 = (_strchr($0,$4)|0);
  37097. $6 = ($5|0)==(0|0);
  37098. if ($6) {
  37099. $$0 = 0;
  37100. } else {
  37101. $7 = ((($1)) + 1|0);
  37102. $8 = HEAP8[$7>>0]|0;
  37103. $9 = ($8<<24>>24)==(0);
  37104. if ($9) {
  37105. $$0 = $5;
  37106. } else {
  37107. $10 = ((($5)) + 1|0);
  37108. $11 = HEAP8[$10>>0]|0;
  37109. $12 = ($11<<24>>24)==(0);
  37110. if ($12) {
  37111. $$0 = 0;
  37112. } else {
  37113. $13 = ((($1)) + 2|0);
  37114. $14 = HEAP8[$13>>0]|0;
  37115. $15 = ($14<<24>>24)==(0);
  37116. if ($15) {
  37117. $16 = (_twobyte_strstr($5,$1)|0);
  37118. $$0 = $16;
  37119. break;
  37120. }
  37121. $17 = ((($5)) + 2|0);
  37122. $18 = HEAP8[$17>>0]|0;
  37123. $19 = ($18<<24>>24)==(0);
  37124. if ($19) {
  37125. $$0 = 0;
  37126. } else {
  37127. $20 = ((($1)) + 3|0);
  37128. $21 = HEAP8[$20>>0]|0;
  37129. $22 = ($21<<24>>24)==(0);
  37130. if ($22) {
  37131. $23 = (_threebyte_strstr($5,$1)|0);
  37132. $$0 = $23;
  37133. break;
  37134. }
  37135. $24 = ((($5)) + 3|0);
  37136. $25 = HEAP8[$24>>0]|0;
  37137. $26 = ($25<<24>>24)==(0);
  37138. if ($26) {
  37139. $$0 = 0;
  37140. } else {
  37141. $27 = ((($1)) + 4|0);
  37142. $28 = HEAP8[$27>>0]|0;
  37143. $29 = ($28<<24>>24)==(0);
  37144. if ($29) {
  37145. $30 = (_fourbyte_strstr($5,$1)|0);
  37146. $$0 = $30;
  37147. break;
  37148. } else {
  37149. $31 = (_twoway_strstr($5,$1)|0);
  37150. $$0 = $31;
  37151. break;
  37152. }
  37153. }
  37154. }
  37155. }
  37156. }
  37157. }
  37158. }
  37159. } while(0);
  37160. return ($$0|0);
  37161. }
  37162. function _twobyte_strstr($0,$1) {
  37163. $0 = $0|0;
  37164. $1 = $1|0;
  37165. var $$lcssa = 0, $$sink = 0, $$sink$in = 0, $$sink$masked = 0, $$sink17$sink = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0;
  37166. var label = 0, sp = 0;
  37167. sp = STACKTOP;
  37168. $2 = HEAP8[$1>>0]|0;
  37169. $3 = $2&255;
  37170. $4 = $3 << 8;
  37171. $5 = ((($1)) + 1|0);
  37172. $6 = HEAP8[$5>>0]|0;
  37173. $7 = $6&255;
  37174. $8 = $4 | $7;
  37175. $9 = HEAP8[$0>>0]|0;
  37176. $10 = $9&255;
  37177. $$sink$in = $10;$$sink17$sink = $0;
  37178. while(1) {
  37179. $11 = ((($$sink17$sink)) + 1|0);
  37180. $12 = HEAP8[$11>>0]|0;
  37181. $13 = ($12<<24>>24)==(0);
  37182. if ($13) {
  37183. $$lcssa = 0;
  37184. break;
  37185. }
  37186. $$sink = $$sink$in << 8;
  37187. $14 = $12&255;
  37188. $$sink$masked = $$sink & 65280;
  37189. $15 = $14 | $$sink$masked;
  37190. $16 = ($15|0)==($8|0);
  37191. if ($16) {
  37192. $$lcssa = $$sink17$sink;
  37193. break;
  37194. } else {
  37195. $$sink$in = $15;$$sink17$sink = $11;
  37196. }
  37197. }
  37198. return ($$lcssa|0);
  37199. }
  37200. function _threebyte_strstr($0,$1) {
  37201. $0 = $0|0;
  37202. $1 = $1|0;
  37203. var $$016$lcssa = 0, $$01619 = 0, $$020 = 0, $$lcssa = 0, $$not = 0, $$not17 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0;
  37204. var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $4 = 0, $5 = 0, $6 = 0;
  37205. var $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond18 = 0, label = 0, sp = 0;
  37206. sp = STACKTOP;
  37207. $2 = HEAP8[$1>>0]|0;
  37208. $3 = $2&255;
  37209. $4 = $3 << 24;
  37210. $5 = ((($1)) + 1|0);
  37211. $6 = HEAP8[$5>>0]|0;
  37212. $7 = $6&255;
  37213. $8 = $7 << 16;
  37214. $9 = $8 | $4;
  37215. $10 = ((($1)) + 2|0);
  37216. $11 = HEAP8[$10>>0]|0;
  37217. $12 = $11&255;
  37218. $13 = $12 << 8;
  37219. $14 = $9 | $13;
  37220. $15 = HEAP8[$0>>0]|0;
  37221. $16 = $15&255;
  37222. $17 = $16 << 24;
  37223. $18 = ((($0)) + 1|0);
  37224. $19 = HEAP8[$18>>0]|0;
  37225. $20 = $19&255;
  37226. $21 = $20 << 16;
  37227. $22 = $21 | $17;
  37228. $23 = ((($0)) + 2|0);
  37229. $24 = HEAP8[$23>>0]|0;
  37230. $25 = $24&255;
  37231. $26 = $25 << 8;
  37232. $27 = $22 | $26;
  37233. $28 = ($24<<24>>24)!=(0);
  37234. $$not17 = $28 ^ 1;
  37235. $29 = ($27|0)==($14|0);
  37236. $or$cond18 = $29 | $$not17;
  37237. if ($or$cond18) {
  37238. $$016$lcssa = $23;$$lcssa = $28;
  37239. } else {
  37240. $$01619 = $23;$$020 = $27;
  37241. while(1) {
  37242. $30 = ((($$01619)) + 1|0);
  37243. $31 = HEAP8[$30>>0]|0;
  37244. $32 = $31&255;
  37245. $33 = $32 | $$020;
  37246. $34 = $33 << 8;
  37247. $35 = ($31<<24>>24)!=(0);
  37248. $$not = $35 ^ 1;
  37249. $36 = ($34|0)==($14|0);
  37250. $or$cond = $36 | $$not;
  37251. if ($or$cond) {
  37252. $$016$lcssa = $30;$$lcssa = $35;
  37253. break;
  37254. } else {
  37255. $$01619 = $30;$$020 = $34;
  37256. }
  37257. }
  37258. }
  37259. $37 = ((($$016$lcssa)) + -2|0);
  37260. $38 = $$lcssa ? $37 : 0;
  37261. return ($38|0);
  37262. }
  37263. function _fourbyte_strstr($0,$1) {
  37264. $0 = $0|0;
  37265. $1 = $1|0;
  37266. var $$lcssa = 0, $$not = 0, $$not22 = 0, $$sink21$lcssa = 0, $$sink2124 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0;
  37267. var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0;
  37268. var $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond23 = 0, label = 0, sp = 0;
  37269. sp = STACKTOP;
  37270. $2 = HEAP8[$1>>0]|0;
  37271. $3 = $2&255;
  37272. $4 = $3 << 24;
  37273. $5 = ((($1)) + 1|0);
  37274. $6 = HEAP8[$5>>0]|0;
  37275. $7 = $6&255;
  37276. $8 = $7 << 16;
  37277. $9 = $8 | $4;
  37278. $10 = ((($1)) + 2|0);
  37279. $11 = HEAP8[$10>>0]|0;
  37280. $12 = $11&255;
  37281. $13 = $12 << 8;
  37282. $14 = $9 | $13;
  37283. $15 = ((($1)) + 3|0);
  37284. $16 = HEAP8[$15>>0]|0;
  37285. $17 = $16&255;
  37286. $18 = $14 | $17;
  37287. $19 = HEAP8[$0>>0]|0;
  37288. $20 = $19&255;
  37289. $21 = $20 << 24;
  37290. $22 = ((($0)) + 1|0);
  37291. $23 = HEAP8[$22>>0]|0;
  37292. $24 = $23&255;
  37293. $25 = $24 << 16;
  37294. $26 = $25 | $21;
  37295. $27 = ((($0)) + 2|0);
  37296. $28 = HEAP8[$27>>0]|0;
  37297. $29 = $28&255;
  37298. $30 = $29 << 8;
  37299. $31 = $26 | $30;
  37300. $32 = ((($0)) + 3|0);
  37301. $33 = HEAP8[$32>>0]|0;
  37302. $34 = $33&255;
  37303. $35 = $34 | $31;
  37304. $36 = ($33<<24>>24)!=(0);
  37305. $$not22 = $36 ^ 1;
  37306. $37 = ($35|0)==($18|0);
  37307. $or$cond23 = $37 | $$not22;
  37308. if ($or$cond23) {
  37309. $$lcssa = $36;$$sink21$lcssa = $32;
  37310. } else {
  37311. $$sink2124 = $32;$39 = $35;
  37312. while(1) {
  37313. $38 = $39 << 8;
  37314. $40 = ((($$sink2124)) + 1|0);
  37315. $41 = HEAP8[$40>>0]|0;
  37316. $42 = $41&255;
  37317. $43 = $42 | $38;
  37318. $44 = ($41<<24>>24)!=(0);
  37319. $$not = $44 ^ 1;
  37320. $45 = ($43|0)==($18|0);
  37321. $or$cond = $45 | $$not;
  37322. if ($or$cond) {
  37323. $$lcssa = $44;$$sink21$lcssa = $40;
  37324. break;
  37325. } else {
  37326. $$sink2124 = $40;$39 = $43;
  37327. }
  37328. }
  37329. }
  37330. $46 = ((($$sink21$lcssa)) + -3|0);
  37331. $47 = $$lcssa ? $46 : 0;
  37332. return ($47|0);
  37333. }
  37334. function _twoway_strstr($0,$1) {
  37335. $0 = $0|0;
  37336. $1 = $1|0;
  37337. var $$0166 = 0, $$0168 = 0, $$0169 = 0, $$0169$be = 0, $$0170 = 0, $$0175$ph$ph$lcssa220 = 0, $$0175$ph$ph$lcssa220323 = 0, $$0175$ph$ph256 = 0, $$0179244 = 0, $$0183$ph200$ph255 = 0, $$0183$ph200250 = 0, $$0183$ph262 = 0, $$0185$ph$lcssa = 0, $$0185$ph$lcssa322 = 0, $$0185$ph261 = 0, $$0187$lcssa320321 = 0, $$0187266 = 0, $$1176$$0175 = 0, $$1176$ph$ph$lcssa211 = 0, $$1176$ph$ph235 = 0;
  37338. var $$1180224 = 0, $$1184$ph196$ph234 = 0, $$1184$ph196229 = 0, $$1184$ph241 = 0, $$1186$$0185 = 0, $$1186$$0185$ = 0, $$1186$ph$lcssa = 0, $$1186$ph240 = 0, $$2181 = 0, $$2181$sink = 0, $$3 = 0, $$3173 = 0, $$3178 = 0, $$3182223 = 0, $$4 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0;
  37339. var $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0;
  37340. var $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0;
  37341. var $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0;
  37342. var $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0;
  37343. var $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0;
  37344. var $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0;
  37345. var $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $cond = 0, $cond191 = 0, $cond191222 = 0, $cond265 = 0, $div = 0, $div188 = 0, $or$cond = 0, $or$cond190 = 0, label = 0, sp = 0;
  37346. sp = STACKTOP;
  37347. STACKTOP = STACKTOP + 1056|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(1056|0);
  37348. $2 = sp + 1024|0;
  37349. $3 = sp;
  37350. ;HEAP32[$2>>2]=0|0;HEAP32[$2+4>>2]=0|0;HEAP32[$2+8>>2]=0|0;HEAP32[$2+12>>2]=0|0;HEAP32[$2+16>>2]=0|0;HEAP32[$2+20>>2]=0|0;HEAP32[$2+24>>2]=0|0;HEAP32[$2+28>>2]=0|0;
  37351. $4 = HEAP8[$1>>0]|0;
  37352. $cond265 = ($4<<24>>24)==(0);
  37353. L1: do {
  37354. if ($cond265) {
  37355. $$0175$ph$ph$lcssa220323 = 1;$$0185$ph$lcssa322 = -1;$$0187$lcssa320321 = 0;$$1176$ph$ph$lcssa211 = 1;$$1186$ph$lcssa = -1;
  37356. label = 27;
  37357. } else {
  37358. $5 = $4&255;
  37359. $$0187266 = 0;$12 = $4;$20 = $5;
  37360. while(1) {
  37361. $8 = (($0) + ($$0187266)|0);
  37362. $9 = HEAP8[$8>>0]|0;
  37363. $10 = ($9<<24>>24)==(0);
  37364. if ($10) {
  37365. $$3 = 0;
  37366. break L1;
  37367. }
  37368. $11 = $12 & 31;
  37369. $13 = $11&255;
  37370. $14 = 1 << $13;
  37371. $div188 = ($12&255) >>> 5;
  37372. $15 = $div188&255;
  37373. $16 = (($2) + ($15<<2)|0);
  37374. $17 = HEAP32[$16>>2]|0;
  37375. $18 = $17 | $14;
  37376. HEAP32[$16>>2] = $18;
  37377. $7 = (($$0187266) + 1)|0;
  37378. $19 = (($3) + ($20<<2)|0);
  37379. HEAP32[$19>>2] = $7;
  37380. $21 = (($1) + ($7)|0);
  37381. $22 = HEAP8[$21>>0]|0;
  37382. $23 = $22&255;
  37383. $cond = ($22<<24>>24)==(0);
  37384. if ($cond) {
  37385. break;
  37386. } else {
  37387. $$0187266 = $7;$12 = $22;$20 = $23;
  37388. }
  37389. }
  37390. $6 = ($7>>>0)>(1);
  37391. if ($6) {
  37392. $$0183$ph262 = 0;$$0185$ph261 = -1;$129 = 1;
  37393. L7: while(1) {
  37394. $$0175$ph$ph256 = 1;$$0183$ph200$ph255 = $$0183$ph262;$132 = $129;
  37395. while(1) {
  37396. $$0183$ph200250 = $$0183$ph200$ph255;$131 = $132;
  37397. L11: while(1) {
  37398. $$0179244 = 1;$31 = $131;
  37399. while(1) {
  37400. $27 = (($$0179244) + ($$0185$ph261))|0;
  37401. $28 = (($1) + ($27)|0);
  37402. $29 = HEAP8[$28>>0]|0;
  37403. $30 = (($1) + ($31)|0);
  37404. $32 = HEAP8[$30>>0]|0;
  37405. $33 = ($29<<24>>24)==($32<<24>>24);
  37406. if (!($33)) {
  37407. break L11;
  37408. }
  37409. $34 = ($$0179244|0)==($$0175$ph$ph256|0);
  37410. $25 = (($$0179244) + 1)|0;
  37411. if ($34) {
  37412. break;
  37413. }
  37414. $24 = (($25) + ($$0183$ph200250))|0;
  37415. $26 = ($24>>>0)<($7>>>0);
  37416. if ($26) {
  37417. $$0179244 = $25;$31 = $24;
  37418. } else {
  37419. $$0175$ph$ph$lcssa220 = $$0175$ph$ph256;$$0185$ph$lcssa = $$0185$ph261;
  37420. break L7;
  37421. }
  37422. }
  37423. $35 = (($$0175$ph$ph256) + ($$0183$ph200250))|0;
  37424. $36 = (($35) + 1)|0;
  37425. $37 = ($36>>>0)<($7>>>0);
  37426. if ($37) {
  37427. $$0183$ph200250 = $35;$131 = $36;
  37428. } else {
  37429. $$0175$ph$ph$lcssa220 = $$0175$ph$ph256;$$0185$ph$lcssa = $$0185$ph261;
  37430. break L7;
  37431. }
  37432. }
  37433. $38 = ($29&255)>($32&255);
  37434. $39 = (($31) - ($$0185$ph261))|0;
  37435. if (!($38)) {
  37436. break;
  37437. }
  37438. $43 = (($31) + 1)|0;
  37439. $44 = ($43>>>0)<($7>>>0);
  37440. if ($44) {
  37441. $$0175$ph$ph256 = $39;$$0183$ph200$ph255 = $31;$132 = $43;
  37442. } else {
  37443. $$0175$ph$ph$lcssa220 = $39;$$0185$ph$lcssa = $$0185$ph261;
  37444. break L7;
  37445. }
  37446. }
  37447. $40 = (($$0183$ph200250) + 1)|0;
  37448. $41 = (($$0183$ph200250) + 2)|0;
  37449. $42 = ($41>>>0)<($7>>>0);
  37450. if ($42) {
  37451. $$0183$ph262 = $40;$$0185$ph261 = $$0183$ph200250;$129 = $41;
  37452. } else {
  37453. $$0175$ph$ph$lcssa220 = 1;$$0185$ph$lcssa = $$0183$ph200250;
  37454. break;
  37455. }
  37456. }
  37457. if ($6) {
  37458. $$1184$ph241 = 0;$$1186$ph240 = -1;$130 = 1;
  37459. while(1) {
  37460. $$1176$ph$ph235 = 1;$$1184$ph196$ph234 = $$1184$ph241;$134 = $130;
  37461. while(1) {
  37462. $$1184$ph196229 = $$1184$ph196$ph234;$133 = $134;
  37463. L26: while(1) {
  37464. $$1180224 = 1;$52 = $133;
  37465. while(1) {
  37466. $48 = (($$1180224) + ($$1186$ph240))|0;
  37467. $49 = (($1) + ($48)|0);
  37468. $50 = HEAP8[$49>>0]|0;
  37469. $51 = (($1) + ($52)|0);
  37470. $53 = HEAP8[$51>>0]|0;
  37471. $54 = ($50<<24>>24)==($53<<24>>24);
  37472. if (!($54)) {
  37473. break L26;
  37474. }
  37475. $55 = ($$1180224|0)==($$1176$ph$ph235|0);
  37476. $46 = (($$1180224) + 1)|0;
  37477. if ($55) {
  37478. break;
  37479. }
  37480. $45 = (($46) + ($$1184$ph196229))|0;
  37481. $47 = ($45>>>0)<($7>>>0);
  37482. if ($47) {
  37483. $$1180224 = $46;$52 = $45;
  37484. } else {
  37485. $$0175$ph$ph$lcssa220323 = $$0175$ph$ph$lcssa220;$$0185$ph$lcssa322 = $$0185$ph$lcssa;$$0187$lcssa320321 = $7;$$1176$ph$ph$lcssa211 = $$1176$ph$ph235;$$1186$ph$lcssa = $$1186$ph240;
  37486. label = 27;
  37487. break L1;
  37488. }
  37489. }
  37490. $56 = (($$1176$ph$ph235) + ($$1184$ph196229))|0;
  37491. $57 = (($56) + 1)|0;
  37492. $58 = ($57>>>0)<($7>>>0);
  37493. if ($58) {
  37494. $$1184$ph196229 = $56;$133 = $57;
  37495. } else {
  37496. $$0175$ph$ph$lcssa220323 = $$0175$ph$ph$lcssa220;$$0185$ph$lcssa322 = $$0185$ph$lcssa;$$0187$lcssa320321 = $7;$$1176$ph$ph$lcssa211 = $$1176$ph$ph235;$$1186$ph$lcssa = $$1186$ph240;
  37497. label = 27;
  37498. break L1;
  37499. }
  37500. }
  37501. $59 = ($50&255)<($53&255);
  37502. $60 = (($52) - ($$1186$ph240))|0;
  37503. if (!($59)) {
  37504. break;
  37505. }
  37506. $64 = (($52) + 1)|0;
  37507. $65 = ($64>>>0)<($7>>>0);
  37508. if ($65) {
  37509. $$1176$ph$ph235 = $60;$$1184$ph196$ph234 = $52;$134 = $64;
  37510. } else {
  37511. $$0175$ph$ph$lcssa220323 = $$0175$ph$ph$lcssa220;$$0185$ph$lcssa322 = $$0185$ph$lcssa;$$0187$lcssa320321 = $7;$$1176$ph$ph$lcssa211 = $60;$$1186$ph$lcssa = $$1186$ph240;
  37512. label = 27;
  37513. break L1;
  37514. }
  37515. }
  37516. $61 = (($$1184$ph196229) + 1)|0;
  37517. $62 = (($$1184$ph196229) + 2)|0;
  37518. $63 = ($62>>>0)<($7>>>0);
  37519. if ($63) {
  37520. $$1184$ph241 = $61;$$1186$ph240 = $$1184$ph196229;$130 = $62;
  37521. } else {
  37522. $$0175$ph$ph$lcssa220323 = $$0175$ph$ph$lcssa220;$$0185$ph$lcssa322 = $$0185$ph$lcssa;$$0187$lcssa320321 = $7;$$1176$ph$ph$lcssa211 = 1;$$1186$ph$lcssa = $$1184$ph196229;
  37523. label = 27;
  37524. break;
  37525. }
  37526. }
  37527. } else {
  37528. $$0175$ph$ph$lcssa220323 = $$0175$ph$ph$lcssa220;$$0185$ph$lcssa322 = $$0185$ph$lcssa;$$0187$lcssa320321 = $7;$$1176$ph$ph$lcssa211 = 1;$$1186$ph$lcssa = -1;
  37529. label = 27;
  37530. }
  37531. } else {
  37532. $$0175$ph$ph$lcssa220323 = 1;$$0185$ph$lcssa322 = -1;$$0187$lcssa320321 = $7;$$1176$ph$ph$lcssa211 = 1;$$1186$ph$lcssa = -1;
  37533. label = 27;
  37534. }
  37535. }
  37536. } while(0);
  37537. L36: do {
  37538. if ((label|0) == 27) {
  37539. $66 = (($$1186$ph$lcssa) + 1)|0;
  37540. $67 = (($$0185$ph$lcssa322) + 1)|0;
  37541. $68 = ($66>>>0)>($67>>>0);
  37542. $$1176$$0175 = $68 ? $$1176$ph$ph$lcssa211 : $$0175$ph$ph$lcssa220323;
  37543. $$1186$$0185 = $68 ? $$1186$ph$lcssa : $$0185$ph$lcssa322;
  37544. $69 = (($1) + ($$1176$$0175)|0);
  37545. $70 = (($$1186$$0185) + 1)|0;
  37546. $71 = (_memcmp($1,$69,$70)|0);
  37547. $72 = ($71|0)==(0);
  37548. if ($72) {
  37549. $77 = (($$0187$lcssa320321) - ($$1176$$0175))|0;
  37550. $$0168 = $77;$$3178 = $$1176$$0175;
  37551. } else {
  37552. $73 = (($$0187$lcssa320321) - ($$1186$$0185))|0;
  37553. $74 = (($73) + -1)|0;
  37554. $75 = ($$1186$$0185>>>0)>($74>>>0);
  37555. $$1186$$0185$ = $75 ? $$1186$$0185 : $74;
  37556. $76 = (($$1186$$0185$) + 1)|0;
  37557. $$0168 = 0;$$3178 = $76;
  37558. }
  37559. $78 = $$0187$lcssa320321 | 63;
  37560. $79 = (($$0187$lcssa320321) + -1)|0;
  37561. $80 = ($$0168|0)!=(0);
  37562. $81 = (($$0187$lcssa320321) - ($$3178))|0;
  37563. $$0166 = $0;$$0169 = 0;$$0170 = $0;
  37564. while(1) {
  37565. $82 = $$0170;
  37566. $83 = $$0166;
  37567. $84 = (($82) - ($83))|0;
  37568. $85 = ($84>>>0)<($$0187$lcssa320321>>>0);
  37569. do {
  37570. if ($85) {
  37571. $86 = (_memchr($$0170,0,$78)|0);
  37572. $87 = ($86|0)==(0|0);
  37573. if ($87) {
  37574. $91 = (($$0170) + ($78)|0);
  37575. $$3173 = $91;
  37576. break;
  37577. } else {
  37578. $88 = $86;
  37579. $89 = (($88) - ($83))|0;
  37580. $90 = ($89>>>0)<($$0187$lcssa320321>>>0);
  37581. if ($90) {
  37582. $$3 = 0;
  37583. break L36;
  37584. } else {
  37585. $$3173 = $86;
  37586. break;
  37587. }
  37588. }
  37589. } else {
  37590. $$3173 = $$0170;
  37591. }
  37592. } while(0);
  37593. $92 = (($$0166) + ($79)|0);
  37594. $93 = HEAP8[$92>>0]|0;
  37595. $div = ($93&255) >>> 5;
  37596. $94 = $div&255;
  37597. $95 = (($2) + ($94<<2)|0);
  37598. $96 = HEAP32[$95>>2]|0;
  37599. $97 = $93 & 31;
  37600. $98 = $97&255;
  37601. $99 = 1 << $98;
  37602. $100 = $99 & $96;
  37603. $101 = ($100|0)==(0);
  37604. L50: do {
  37605. if ($101) {
  37606. $$0169$be = 0;$$2181$sink = $$0187$lcssa320321;
  37607. } else {
  37608. $102 = $93&255;
  37609. $103 = (($3) + ($102<<2)|0);
  37610. $104 = HEAP32[$103>>2]|0;
  37611. $105 = (($$0187$lcssa320321) - ($104))|0;
  37612. $106 = ($105|0)==(0);
  37613. if (!($106)) {
  37614. $107 = ($$0169|0)!=(0);
  37615. $or$cond = $80 & $107;
  37616. $108 = ($105>>>0)<($$3178>>>0);
  37617. $or$cond190 = $or$cond & $108;
  37618. $$2181 = $or$cond190 ? $81 : $105;
  37619. $$0169$be = 0;$$2181$sink = $$2181;
  37620. break;
  37621. }
  37622. $110 = ($70>>>0)>($$0169>>>0);
  37623. $111 = $110 ? $70 : $$0169;
  37624. $112 = (($1) + ($111)|0);
  37625. $113 = HEAP8[$112>>0]|0;
  37626. $cond191222 = ($113<<24>>24)==(0);
  37627. L55: do {
  37628. if ($cond191222) {
  37629. $$4 = $70;
  37630. } else {
  37631. $$3182223 = $111;$117 = $113;
  37632. while(1) {
  37633. $114 = (($$0166) + ($$3182223)|0);
  37634. $115 = HEAP8[$114>>0]|0;
  37635. $116 = ($117<<24>>24)==($115<<24>>24);
  37636. if (!($116)) {
  37637. break;
  37638. }
  37639. $118 = (($$3182223) + 1)|0;
  37640. $119 = (($1) + ($118)|0);
  37641. $120 = HEAP8[$119>>0]|0;
  37642. $cond191 = ($120<<24>>24)==(0);
  37643. if ($cond191) {
  37644. $$4 = $70;
  37645. break L55;
  37646. } else {
  37647. $$3182223 = $118;$117 = $120;
  37648. }
  37649. }
  37650. $121 = (($$3182223) - ($$1186$$0185))|0;
  37651. $$0169$be = 0;$$2181$sink = $121;
  37652. break L50;
  37653. }
  37654. } while(0);
  37655. while(1) {
  37656. $122 = ($$4>>>0)>($$0169>>>0);
  37657. if (!($122)) {
  37658. $$3 = $$0166;
  37659. break L36;
  37660. }
  37661. $123 = (($$4) + -1)|0;
  37662. $124 = (($1) + ($123)|0);
  37663. $125 = HEAP8[$124>>0]|0;
  37664. $126 = (($$0166) + ($123)|0);
  37665. $127 = HEAP8[$126>>0]|0;
  37666. $128 = ($125<<24>>24)==($127<<24>>24);
  37667. if ($128) {
  37668. $$4 = $123;
  37669. } else {
  37670. $$0169$be = $$0168;$$2181$sink = $$3178;
  37671. break;
  37672. }
  37673. }
  37674. }
  37675. } while(0);
  37676. $109 = (($$0166) + ($$2181$sink)|0);
  37677. $$0166 = $109;$$0169 = $$0169$be;$$0170 = $$3173;
  37678. }
  37679. }
  37680. } while(0);
  37681. STACKTOP = sp;return ($$3|0);
  37682. }
  37683. function _strrchr($0,$1) {
  37684. $0 = $0|0;
  37685. $1 = $1|0;
  37686. var $2 = 0, $3 = 0, $4 = 0, label = 0, sp = 0;
  37687. sp = STACKTOP;
  37688. $2 = (_strlen($0)|0);
  37689. $3 = (($2) + 1)|0;
  37690. $4 = (___memrchr($0,$1,$3)|0);
  37691. return ($4|0);
  37692. }
  37693. function ___memrchr($0,$1,$2) {
  37694. $0 = $0|0;
  37695. $1 = $1|0;
  37696. $2 = $2|0;
  37697. var $$0 = 0, $$09 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, label = 0, sp = 0;
  37698. sp = STACKTOP;
  37699. $3 = $1&255;
  37700. $$09 = $2;
  37701. while(1) {
  37702. $4 = (($$09) + -1)|0;
  37703. $5 = ($$09|0)==(0);
  37704. if ($5) {
  37705. $$0 = 0;
  37706. break;
  37707. }
  37708. $6 = (($0) + ($4)|0);
  37709. $7 = HEAP8[$6>>0]|0;
  37710. $8 = ($7<<24>>24)==($3<<24>>24);
  37711. if ($8) {
  37712. $$0 = $6;
  37713. break;
  37714. } else {
  37715. $$09 = $4;
  37716. }
  37717. }
  37718. return ($$0|0);
  37719. }
  37720. function _strspn($0,$1) {
  37721. $0 = $0|0;
  37722. $1 = $1|0;
  37723. var $$0 = 0, $$01925 = 0, $$020 = 0, $$1$lcssa = 0, $$123 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0;
  37724. var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0;
  37725. var $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $div = 0, $div21 = 0, label = 0, sp = 0;
  37726. sp = STACKTOP;
  37727. STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
  37728. $2 = sp;
  37729. ;HEAP32[$2>>2]=0|0;HEAP32[$2+4>>2]=0|0;HEAP32[$2+8>>2]=0|0;HEAP32[$2+12>>2]=0|0;HEAP32[$2+16>>2]=0|0;HEAP32[$2+20>>2]=0|0;HEAP32[$2+24>>2]=0|0;HEAP32[$2+28>>2]=0|0;
  37730. $3 = HEAP8[$1>>0]|0;
  37731. $4 = ($3<<24>>24)==(0);
  37732. do {
  37733. if ($4) {
  37734. $$0 = 0;
  37735. } else {
  37736. $5 = ((($1)) + 1|0);
  37737. $6 = HEAP8[$5>>0]|0;
  37738. $7 = ($6<<24>>24)==(0);
  37739. if ($7) {
  37740. $$020 = $0;
  37741. while(1) {
  37742. $8 = HEAP8[$$020>>0]|0;
  37743. $9 = ($8<<24>>24)==($3<<24>>24);
  37744. $10 = ((($$020)) + 1|0);
  37745. if ($9) {
  37746. $$020 = $10;
  37747. } else {
  37748. break;
  37749. }
  37750. }
  37751. $11 = $$020;
  37752. $12 = $0;
  37753. $13 = (($11) - ($12))|0;
  37754. $$0 = $13;
  37755. break;
  37756. } else {
  37757. $$01925 = $1;$17 = $3;
  37758. }
  37759. while(1) {
  37760. $16 = $17 & 31;
  37761. $18 = $16&255;
  37762. $19 = 1 << $18;
  37763. $div21 = ($17&255) >>> 5;
  37764. $20 = $div21&255;
  37765. $21 = (($2) + ($20<<2)|0);
  37766. $22 = HEAP32[$21>>2]|0;
  37767. $23 = $22 | $19;
  37768. HEAP32[$21>>2] = $23;
  37769. $24 = ((($$01925)) + 1|0);
  37770. $25 = HEAP8[$24>>0]|0;
  37771. $26 = ($25<<24>>24)==(0);
  37772. if ($26) {
  37773. break;
  37774. } else {
  37775. $$01925 = $24;$17 = $25;
  37776. }
  37777. }
  37778. $14 = HEAP8[$0>>0]|0;
  37779. $15 = ($14<<24>>24)==(0);
  37780. L10: do {
  37781. if ($15) {
  37782. $$1$lcssa = $0;
  37783. } else {
  37784. $$123 = $0;$27 = $14;
  37785. while(1) {
  37786. $div = ($27&255) >>> 5;
  37787. $28 = $div&255;
  37788. $29 = (($2) + ($28<<2)|0);
  37789. $30 = HEAP32[$29>>2]|0;
  37790. $31 = $27 & 31;
  37791. $32 = $31&255;
  37792. $33 = 1 << $32;
  37793. $34 = $30 & $33;
  37794. $35 = ($34|0)==(0);
  37795. if ($35) {
  37796. $$1$lcssa = $$123;
  37797. break L10;
  37798. }
  37799. $36 = ((($$123)) + 1|0);
  37800. $37 = HEAP8[$36>>0]|0;
  37801. $38 = ($37<<24>>24)==(0);
  37802. if ($38) {
  37803. $$1$lcssa = $36;
  37804. break;
  37805. } else {
  37806. $$123 = $36;$27 = $37;
  37807. }
  37808. }
  37809. }
  37810. } while(0);
  37811. $39 = $$1$lcssa;
  37812. $40 = $0;
  37813. $41 = (($39) - ($40))|0;
  37814. $$0 = $41;
  37815. }
  37816. } while(0);
  37817. STACKTOP = sp;return ($$0|0);
  37818. }
  37819. function _srand($0) {
  37820. $0 = $0|0;
  37821. var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0;
  37822. sp = STACKTOP;
  37823. $1 = (($0) + -1)|0;
  37824. $2 = 18192;
  37825. $3 = $2;
  37826. HEAP32[$3>>2] = $1;
  37827. $4 = (($2) + 4)|0;
  37828. $5 = $4;
  37829. HEAP32[$5>>2] = 0;
  37830. return;
  37831. }
  37832. function _fread($0,$1,$2,$3) {
  37833. $0 = $0|0;
  37834. $1 = $1|0;
  37835. $2 = $2|0;
  37836. $3 = $3|0;
  37837. var $$ = 0, $$0 = 0, $$054$ph = 0, $$05460 = 0, $$056$ph = 0, $$05659 = 0, $$57 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0;
  37838. var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0;
  37839. var $42 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
  37840. sp = STACKTOP;
  37841. $4 = Math_imul($2, $1)|0;
  37842. $5 = ($1|0)==(0);
  37843. $$ = $5 ? 0 : $2;
  37844. $6 = ((($3)) + 76|0);
  37845. $7 = HEAP32[$6>>2]|0;
  37846. $8 = ($7|0)>(-1);
  37847. if ($8) {
  37848. $9 = (___lockfile($3)|0);
  37849. $36 = $9;
  37850. } else {
  37851. $36 = 0;
  37852. }
  37853. $10 = ((($3)) + 74|0);
  37854. $11 = HEAP8[$10>>0]|0;
  37855. $12 = $11 << 24 >> 24;
  37856. $13 = (($12) + 255)|0;
  37857. $14 = $13 | $12;
  37858. $15 = $14&255;
  37859. HEAP8[$10>>0] = $15;
  37860. $16 = ((($3)) + 8|0);
  37861. $17 = HEAP32[$16>>2]|0;
  37862. $18 = ((($3)) + 4|0);
  37863. $19 = HEAP32[$18>>2]|0;
  37864. $20 = $19;
  37865. $21 = (($17) - ($20))|0;
  37866. $22 = ($21|0)>(0);
  37867. $23 = ($21>>>0)<($4>>>0);
  37868. $$57 = $23 ? $21 : $4;
  37869. if ($22) {
  37870. $24 = (($4) - ($$57))|0;
  37871. $25 = (($0) + ($$57)|0);
  37872. _memcpy(($0|0),($19|0),($$57|0))|0;
  37873. $26 = (($19) + ($$57)|0);
  37874. HEAP32[$18>>2] = $26;
  37875. $$054$ph = $24;$$056$ph = $25;
  37876. } else {
  37877. $$054$ph = $4;$$056$ph = $0;
  37878. }
  37879. $27 = ($$054$ph|0)==(0);
  37880. L7: do {
  37881. if ($27) {
  37882. label = 13;
  37883. } else {
  37884. $28 = ((($3)) + 32|0);
  37885. $$05460 = $$054$ph;$$05659 = $$056$ph;
  37886. while(1) {
  37887. $29 = (___toread($3)|0);
  37888. $30 = ($29|0)==(0);
  37889. if (!($30)) {
  37890. break;
  37891. }
  37892. $31 = HEAP32[$28>>2]|0;
  37893. $32 = (FUNCTION_TABLE_iiii[$31 & 15]($3,$$05659,$$05460)|0);
  37894. $33 = (($32) + 1)|0;
  37895. $34 = ($33>>>0)<(2);
  37896. if ($34) {
  37897. break;
  37898. }
  37899. $39 = (($$05460) - ($32))|0;
  37900. $40 = (($$05659) + ($32)|0);
  37901. $41 = ($39|0)==(0);
  37902. if ($41) {
  37903. label = 13;
  37904. break L7;
  37905. } else {
  37906. $$05460 = $39;$$05659 = $40;
  37907. }
  37908. }
  37909. $35 = ($36|0)==(0);
  37910. if (!($35)) {
  37911. ___unlockfile($3);
  37912. }
  37913. $37 = (($4) - ($$05460))|0;
  37914. $38 = (($37>>>0) / ($1>>>0))&-1;
  37915. $$0 = $38;
  37916. }
  37917. } while(0);
  37918. if ((label|0) == 13) {
  37919. $42 = ($36|0)==(0);
  37920. if ($42) {
  37921. $$0 = $$;
  37922. } else {
  37923. ___unlockfile($3);
  37924. $$0 = $$;
  37925. }
  37926. }
  37927. return ($$0|0);
  37928. }
  37929. function _rewind($0) {
  37930. $0 = $0|0;
  37931. var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $phitmp = 0, label = 0, sp = 0;
  37932. sp = STACKTOP;
  37933. $1 = ((($0)) + 76|0);
  37934. $2 = HEAP32[$1>>2]|0;
  37935. $3 = ($2|0)>(-1);
  37936. if ($3) {
  37937. $4 = (___lockfile($0)|0);
  37938. $phitmp = ($4|0)==(0);
  37939. (___fseeko_unlocked($0,0,0)|0);
  37940. $5 = HEAP32[$0>>2]|0;
  37941. $6 = $5 & -33;
  37942. HEAP32[$0>>2] = $6;
  37943. if (!($phitmp)) {
  37944. ___unlockfile($0);
  37945. }
  37946. } else {
  37947. (___fseeko_unlocked($0,0,0)|0);
  37948. $7 = HEAP32[$0>>2]|0;
  37949. $8 = $7 & -33;
  37950. HEAP32[$0>>2] = $8;
  37951. }
  37952. return;
  37953. }
  37954. function _vprintf($0,$1) {
  37955. $0 = $0|0;
  37956. $1 = $1|0;
  37957. var $2 = 0, $3 = 0, label = 0, sp = 0;
  37958. sp = STACKTOP;
  37959. $2 = HEAP32[1028]|0;
  37960. $3 = (_vfprintf($2,$0,$1)|0);
  37961. return ($3|0);
  37962. }
  37963. function _strcspn($0,$1) {
  37964. $0 = $0|0;
  37965. $1 = $1|0;
  37966. var $$01824 = 0, $$019$sink = 0, $$01922 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
  37967. var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $div = 0;
  37968. var $div20 = 0, label = 0, sp = 0;
  37969. sp = STACKTOP;
  37970. STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
  37971. $2 = sp;
  37972. $3 = HEAP8[$1>>0]|0;
  37973. $4 = ($3<<24>>24)==(0);
  37974. L1: do {
  37975. if ($4) {
  37976. label = 3;
  37977. } else {
  37978. $5 = ((($1)) + 1|0);
  37979. $6 = HEAP8[$5>>0]|0;
  37980. $7 = ($6<<24>>24)==(0);
  37981. if ($7) {
  37982. label = 3;
  37983. } else {
  37984. ;HEAP32[$2>>2]=0|0;HEAP32[$2+4>>2]=0|0;HEAP32[$2+8>>2]=0|0;HEAP32[$2+12>>2]=0|0;HEAP32[$2+16>>2]=0|0;HEAP32[$2+20>>2]=0|0;HEAP32[$2+24>>2]=0|0;HEAP32[$2+28>>2]=0|0;
  37985. $$01824 = $1;$13 = $3;
  37986. while(1) {
  37987. $12 = $13 & 31;
  37988. $14 = $12&255;
  37989. $15 = 1 << $14;
  37990. $div20 = ($13&255) >>> 5;
  37991. $16 = $div20&255;
  37992. $17 = (($2) + ($16<<2)|0);
  37993. $18 = HEAP32[$17>>2]|0;
  37994. $19 = $18 | $15;
  37995. HEAP32[$17>>2] = $19;
  37996. $20 = ((($$01824)) + 1|0);
  37997. $21 = HEAP8[$20>>0]|0;
  37998. $22 = ($21<<24>>24)==(0);
  37999. if ($22) {
  38000. break;
  38001. } else {
  38002. $$01824 = $20;$13 = $21;
  38003. }
  38004. }
  38005. $10 = HEAP8[$0>>0]|0;
  38006. $11 = ($10<<24>>24)==(0);
  38007. if ($11) {
  38008. $$019$sink = $0;
  38009. } else {
  38010. $$01922 = $0;$23 = $10;
  38011. while(1) {
  38012. $div = ($23&255) >>> 5;
  38013. $24 = $div&255;
  38014. $25 = (($2) + ($24<<2)|0);
  38015. $26 = HEAP32[$25>>2]|0;
  38016. $27 = $23 & 31;
  38017. $28 = $27&255;
  38018. $29 = 1 << $28;
  38019. $30 = $26 & $29;
  38020. $31 = ($30|0)==(0);
  38021. if (!($31)) {
  38022. $$019$sink = $$01922;
  38023. break L1;
  38024. }
  38025. $32 = ((($$01922)) + 1|0);
  38026. $33 = HEAP8[$32>>0]|0;
  38027. $34 = ($33<<24>>24)==(0);
  38028. if ($34) {
  38029. $$019$sink = $32;
  38030. break;
  38031. } else {
  38032. $$01922 = $32;$23 = $33;
  38033. }
  38034. }
  38035. }
  38036. }
  38037. }
  38038. } while(0);
  38039. if ((label|0) == 3) {
  38040. $8 = $3 << 24 >> 24;
  38041. $9 = (___strchrnul($0,$8)|0);
  38042. $$019$sink = $9;
  38043. }
  38044. $35 = $$019$sink;
  38045. $36 = $0;
  38046. $37 = (($35) - ($36))|0;
  38047. STACKTOP = sp;return ($37|0);
  38048. }
  38049. function _strcat($0,$1) {
  38050. $0 = $0|0;
  38051. $1 = $1|0;
  38052. var $2 = 0, $3 = 0, label = 0, sp = 0;
  38053. sp = STACKTOP;
  38054. $2 = (_strlen($0)|0);
  38055. $3 = (($0) + ($2)|0);
  38056. (_strcpy($3,$1)|0);
  38057. return ($0|0);
  38058. }
  38059. function _strtok($0,$1) {
  38060. $0 = $0|0;
  38061. $1 = $1|0;
  38062. var $$0 = 0, $$010 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
  38063. sp = STACKTOP;
  38064. $2 = ($0|0)==(0|0);
  38065. if ($2) {
  38066. $3 = HEAP32[5217]|0;
  38067. $4 = ($3|0)==(0|0);
  38068. if ($4) {
  38069. $$0 = 0;
  38070. } else {
  38071. $$010 = $3;
  38072. label = 3;
  38073. }
  38074. } else {
  38075. $$010 = $0;
  38076. label = 3;
  38077. }
  38078. do {
  38079. if ((label|0) == 3) {
  38080. $5 = (_strspn($$010,$1)|0);
  38081. $6 = (($$010) + ($5)|0);
  38082. $7 = HEAP8[$6>>0]|0;
  38083. $8 = ($7<<24>>24)==(0);
  38084. if ($8) {
  38085. HEAP32[5217] = 0;
  38086. $$0 = 0;
  38087. break;
  38088. }
  38089. $9 = (_strcspn($6,$1)|0);
  38090. $10 = (($6) + ($9)|0);
  38091. HEAP32[5217] = $10;
  38092. $11 = HEAP8[$10>>0]|0;
  38093. $12 = ($11<<24>>24)==(0);
  38094. if ($12) {
  38095. HEAP32[5217] = 0;
  38096. $$0 = $6;
  38097. break;
  38098. } else {
  38099. $13 = ((($10)) + 1|0);
  38100. HEAP32[5217] = $13;
  38101. HEAP8[$10>>0] = 0;
  38102. $$0 = $6;
  38103. break;
  38104. }
  38105. }
  38106. } while(0);
  38107. return ($$0|0);
  38108. }
  38109. function _malloc($0) {
  38110. $0 = $0|0;
  38111. var $$$0192$i = 0, $$$0193$i = 0, $$$4236$i = 0, $$$4351$i = 0, $$$i = 0, $$0 = 0, $$0$i$i = 0, $$0$i$i$i = 0, $$0$i18$i = 0, $$01$i$i = 0, $$0189$i = 0, $$0192$lcssa$i = 0, $$01928$i = 0, $$0193$lcssa$i = 0, $$01937$i = 0, $$0197 = 0, $$0199 = 0, $$0206$i$i = 0, $$0207$i$i = 0, $$0211$i$i = 0;
  38112. var $$0212$i$i = 0, $$024371$i = 0, $$0287$i$i = 0, $$0288$i$i = 0, $$0289$i$i = 0, $$0295$i$i = 0, $$0296$i$i = 0, $$0342$i = 0, $$0344$i = 0, $$0345$i = 0, $$0347$i = 0, $$0353$i = 0, $$0358$i = 0, $$0359$$i = 0, $$0359$i = 0, $$0361$i = 0, $$0362$i = 0, $$0368$i = 0, $$1196$i = 0, $$1198$i = 0;
  38113. var $$124470$i = 0, $$1291$i$i = 0, $$1293$i$i = 0, $$1343$i = 0, $$1348$i = 0, $$1363$i = 0, $$1370$i = 0, $$1374$i = 0, $$2234253237$i = 0, $$2247$ph$i = 0, $$2253$ph$i = 0, $$2355$i = 0, $$3$i = 0, $$3$i$i = 0, $$3$i201 = 0, $$3350$i = 0, $$3372$i = 0, $$4$lcssa$i = 0, $$4$ph$i = 0, $$415$i = 0;
  38114. var $$4236$i = 0, $$4351$lcssa$i = 0, $$435114$i = 0, $$4357$$4$i = 0, $$4357$ph$i = 0, $$435713$i = 0, $$723948$i = 0, $$749$i = 0, $$pre = 0, $$pre$i = 0, $$pre$i$i = 0, $$pre$i19$i = 0, $$pre$i210 = 0, $$pre$i212 = 0, $$pre$phi$i$iZ2D = 0, $$pre$phi$i20$iZ2D = 0, $$pre$phi$i211Z2D = 0, $$pre$phi$iZ2D = 0, $$pre$phi11$i$iZ2D = 0, $$pre$phiZ2D = 0;
  38115. var $$pre10$i$i = 0, $$sink1$i = 0, $$sink1$i$i = 0, $$sink16$i = 0, $$sink2$i = 0, $$sink2$i204 = 0, $$sink3$i = 0, $1 = 0, $10 = 0, $100 = 0, $1000 = 0, $1001 = 0, $1002 = 0, $1003 = 0, $1004 = 0, $1005 = 0, $1006 = 0, $1007 = 0, $1008 = 0, $1009 = 0;
  38116. var $101 = 0, $1010 = 0, $1011 = 0, $1012 = 0, $1013 = 0, $1014 = 0, $1015 = 0, $1016 = 0, $1017 = 0, $1018 = 0, $1019 = 0, $102 = 0, $1020 = 0, $1021 = 0, $1022 = 0, $1023 = 0, $1024 = 0, $1025 = 0, $1026 = 0, $1027 = 0;
  38117. var $1028 = 0, $1029 = 0, $103 = 0, $1030 = 0, $1031 = 0, $1032 = 0, $1033 = 0, $1034 = 0, $1035 = 0, $1036 = 0, $1037 = 0, $1038 = 0, $1039 = 0, $104 = 0, $1040 = 0, $1041 = 0, $1042 = 0, $1043 = 0, $1044 = 0, $1045 = 0;
  38118. var $1046 = 0, $1047 = 0, $1048 = 0, $1049 = 0, $105 = 0, $1050 = 0, $1051 = 0, $1052 = 0, $1053 = 0, $1054 = 0, $1055 = 0, $1056 = 0, $1057 = 0, $1058 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0;
  38119. var $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0;
  38120. var $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0;
  38121. var $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0;
  38122. var $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0;
  38123. var $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0;
  38124. var $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0;
  38125. var $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0;
  38126. var $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0;
  38127. var $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0;
  38128. var $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0;
  38129. var $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0;
  38130. var $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0, $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0, $321 = 0, $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0, $327 = 0;
  38131. var $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0, $332 = 0, $333 = 0, $334 = 0, $335 = 0, $336 = 0, $337 = 0, $338 = 0, $339 = 0, $34 = 0, $340 = 0, $341 = 0, $342 = 0, $343 = 0, $344 = 0, $345 = 0;
  38132. var $346 = 0, $347 = 0, $348 = 0, $349 = 0, $35 = 0, $350 = 0, $351 = 0, $352 = 0, $353 = 0, $354 = 0, $355 = 0, $356 = 0, $357 = 0, $358 = 0, $359 = 0, $36 = 0, $360 = 0, $361 = 0, $362 = 0, $363 = 0;
  38133. var $364 = 0, $365 = 0, $366 = 0, $367 = 0, $368 = 0, $369 = 0, $37 = 0, $370 = 0, $371 = 0, $372 = 0, $373 = 0, $374 = 0, $375 = 0, $376 = 0, $377 = 0, $378 = 0, $379 = 0, $38 = 0, $380 = 0, $381 = 0;
  38134. var $382 = 0, $383 = 0, $384 = 0, $385 = 0, $386 = 0, $387 = 0, $388 = 0, $389 = 0, $39 = 0, $390 = 0, $391 = 0, $392 = 0, $393 = 0, $394 = 0, $395 = 0, $396 = 0, $397 = 0, $398 = 0, $399 = 0, $4 = 0;
  38135. var $40 = 0, $400 = 0, $401 = 0, $402 = 0, $403 = 0, $404 = 0, $405 = 0, $406 = 0, $407 = 0, $408 = 0, $409 = 0, $41 = 0, $410 = 0, $411 = 0, $412 = 0, $413 = 0, $414 = 0, $415 = 0, $416 = 0, $417 = 0;
  38136. var $418 = 0, $419 = 0, $42 = 0, $420 = 0, $421 = 0, $422 = 0, $423 = 0, $424 = 0, $425 = 0, $426 = 0, $427 = 0, $428 = 0, $429 = 0, $43 = 0, $430 = 0, $431 = 0, $432 = 0, $433 = 0, $434 = 0, $435 = 0;
  38137. var $436 = 0, $437 = 0, $438 = 0, $439 = 0, $44 = 0, $440 = 0, $441 = 0, $442 = 0, $443 = 0, $444 = 0, $445 = 0, $446 = 0, $447 = 0, $448 = 0, $449 = 0, $45 = 0, $450 = 0, $451 = 0, $452 = 0, $453 = 0;
  38138. var $454 = 0, $455 = 0, $456 = 0, $457 = 0, $458 = 0, $459 = 0, $46 = 0, $460 = 0, $461 = 0, $462 = 0, $463 = 0, $464 = 0, $465 = 0, $466 = 0, $467 = 0, $468 = 0, $469 = 0, $47 = 0, $470 = 0, $471 = 0;
  38139. var $472 = 0, $473 = 0, $474 = 0, $475 = 0, $476 = 0, $477 = 0, $478 = 0, $479 = 0, $48 = 0, $480 = 0, $481 = 0, $482 = 0, $483 = 0, $484 = 0, $485 = 0, $486 = 0, $487 = 0, $488 = 0, $489 = 0, $49 = 0;
  38140. var $490 = 0, $491 = 0, $492 = 0, $493 = 0, $494 = 0, $495 = 0, $496 = 0, $497 = 0, $498 = 0, $499 = 0, $5 = 0, $50 = 0, $500 = 0, $501 = 0, $502 = 0, $503 = 0, $504 = 0, $505 = 0, $506 = 0, $507 = 0;
  38141. var $508 = 0, $509 = 0, $51 = 0, $510 = 0, $511 = 0, $512 = 0, $513 = 0, $514 = 0, $515 = 0, $516 = 0, $517 = 0, $518 = 0, $519 = 0, $52 = 0, $520 = 0, $521 = 0, $522 = 0, $523 = 0, $524 = 0, $525 = 0;
  38142. var $526 = 0, $527 = 0, $528 = 0, $529 = 0, $53 = 0, $530 = 0, $531 = 0, $532 = 0, $533 = 0, $534 = 0, $535 = 0, $536 = 0, $537 = 0, $538 = 0, $539 = 0, $54 = 0, $540 = 0, $541 = 0, $542 = 0, $543 = 0;
  38143. var $544 = 0, $545 = 0, $546 = 0, $547 = 0, $548 = 0, $549 = 0, $55 = 0, $550 = 0, $551 = 0, $552 = 0, $553 = 0, $554 = 0, $555 = 0, $556 = 0, $557 = 0, $558 = 0, $559 = 0, $56 = 0, $560 = 0, $561 = 0;
  38144. var $562 = 0, $563 = 0, $564 = 0, $565 = 0, $566 = 0, $567 = 0, $568 = 0, $569 = 0, $57 = 0, $570 = 0, $571 = 0, $572 = 0, $573 = 0, $574 = 0, $575 = 0, $576 = 0, $577 = 0, $578 = 0, $579 = 0, $58 = 0;
  38145. var $580 = 0, $581 = 0, $582 = 0, $583 = 0, $584 = 0, $585 = 0, $586 = 0, $587 = 0, $588 = 0, $589 = 0, $59 = 0, $590 = 0, $591 = 0, $592 = 0, $593 = 0, $594 = 0, $595 = 0, $596 = 0, $597 = 0, $598 = 0;
  38146. var $599 = 0, $6 = 0, $60 = 0, $600 = 0, $601 = 0, $602 = 0, $603 = 0, $604 = 0, $605 = 0, $606 = 0, $607 = 0, $608 = 0, $609 = 0, $61 = 0, $610 = 0, $611 = 0, $612 = 0, $613 = 0, $614 = 0, $615 = 0;
  38147. var $616 = 0, $617 = 0, $618 = 0, $619 = 0, $62 = 0, $620 = 0, $621 = 0, $622 = 0, $623 = 0, $624 = 0, $625 = 0, $626 = 0, $627 = 0, $628 = 0, $629 = 0, $63 = 0, $630 = 0, $631 = 0, $632 = 0, $633 = 0;
  38148. var $634 = 0, $635 = 0, $636 = 0, $637 = 0, $638 = 0, $639 = 0, $64 = 0, $640 = 0, $641 = 0, $642 = 0, $643 = 0, $644 = 0, $645 = 0, $646 = 0, $647 = 0, $648 = 0, $649 = 0, $65 = 0, $650 = 0, $651 = 0;
  38149. var $652 = 0, $653 = 0, $654 = 0, $655 = 0, $656 = 0, $657 = 0, $658 = 0, $659 = 0, $66 = 0, $660 = 0, $661 = 0, $662 = 0, $663 = 0, $664 = 0, $665 = 0, $666 = 0, $667 = 0, $668 = 0, $669 = 0, $67 = 0;
  38150. var $670 = 0, $671 = 0, $672 = 0, $673 = 0, $674 = 0, $675 = 0, $676 = 0, $677 = 0, $678 = 0, $679 = 0, $68 = 0, $680 = 0, $681 = 0, $682 = 0, $683 = 0, $684 = 0, $685 = 0, $686 = 0, $687 = 0, $688 = 0;
  38151. var $689 = 0, $69 = 0, $690 = 0, $691 = 0, $692 = 0, $693 = 0, $694 = 0, $695 = 0, $696 = 0, $697 = 0, $698 = 0, $699 = 0, $7 = 0, $70 = 0, $700 = 0, $701 = 0, $702 = 0, $703 = 0, $704 = 0, $705 = 0;
  38152. var $706 = 0, $707 = 0, $708 = 0, $709 = 0, $71 = 0, $710 = 0, $711 = 0, $712 = 0, $713 = 0, $714 = 0, $715 = 0, $716 = 0, $717 = 0, $718 = 0, $719 = 0, $72 = 0, $720 = 0, $721 = 0, $722 = 0, $723 = 0;
  38153. var $724 = 0, $725 = 0, $726 = 0, $727 = 0, $728 = 0, $729 = 0, $73 = 0, $730 = 0, $731 = 0, $732 = 0, $733 = 0, $734 = 0, $735 = 0, $736 = 0, $737 = 0, $738 = 0, $739 = 0, $74 = 0, $740 = 0, $741 = 0;
  38154. var $742 = 0, $743 = 0, $744 = 0, $745 = 0, $746 = 0, $747 = 0, $748 = 0, $749 = 0, $75 = 0, $750 = 0, $751 = 0, $752 = 0, $753 = 0, $754 = 0, $755 = 0, $756 = 0, $757 = 0, $758 = 0, $759 = 0, $76 = 0;
  38155. var $760 = 0, $761 = 0, $762 = 0, $763 = 0, $764 = 0, $765 = 0, $766 = 0, $767 = 0, $768 = 0, $769 = 0, $77 = 0, $770 = 0, $771 = 0, $772 = 0, $773 = 0, $774 = 0, $775 = 0, $776 = 0, $777 = 0, $778 = 0;
  38156. var $779 = 0, $78 = 0, $780 = 0, $781 = 0, $782 = 0, $783 = 0, $784 = 0, $785 = 0, $786 = 0, $787 = 0, $788 = 0, $789 = 0, $79 = 0, $790 = 0, $791 = 0, $792 = 0, $793 = 0, $794 = 0, $795 = 0, $796 = 0;
  38157. var $797 = 0, $798 = 0, $799 = 0, $8 = 0, $80 = 0, $800 = 0, $801 = 0, $802 = 0, $803 = 0, $804 = 0, $805 = 0, $806 = 0, $807 = 0, $808 = 0, $809 = 0, $81 = 0, $810 = 0, $811 = 0, $812 = 0, $813 = 0;
  38158. var $814 = 0, $815 = 0, $816 = 0, $817 = 0, $818 = 0, $819 = 0, $82 = 0, $820 = 0, $821 = 0, $822 = 0, $823 = 0, $824 = 0, $825 = 0, $826 = 0, $827 = 0, $828 = 0, $829 = 0, $83 = 0, $830 = 0, $831 = 0;
  38159. var $832 = 0, $833 = 0, $834 = 0, $835 = 0, $836 = 0, $837 = 0, $838 = 0, $839 = 0, $84 = 0, $840 = 0, $841 = 0, $842 = 0, $843 = 0, $844 = 0, $845 = 0, $846 = 0, $847 = 0, $848 = 0, $849 = 0, $85 = 0;
  38160. var $850 = 0, $851 = 0, $852 = 0, $853 = 0, $854 = 0, $855 = 0, $856 = 0, $857 = 0, $858 = 0, $859 = 0, $86 = 0, $860 = 0, $861 = 0, $862 = 0, $863 = 0, $864 = 0, $865 = 0, $866 = 0, $867 = 0, $868 = 0;
  38161. var $869 = 0, $87 = 0, $870 = 0, $871 = 0, $872 = 0, $873 = 0, $874 = 0, $875 = 0, $876 = 0, $877 = 0, $878 = 0, $879 = 0, $88 = 0, $880 = 0, $881 = 0, $882 = 0, $883 = 0, $884 = 0, $885 = 0, $886 = 0;
  38162. var $887 = 0, $888 = 0, $889 = 0, $89 = 0, $890 = 0, $891 = 0, $892 = 0, $893 = 0, $894 = 0, $895 = 0, $896 = 0, $897 = 0, $898 = 0, $899 = 0, $9 = 0, $90 = 0, $900 = 0, $901 = 0, $902 = 0, $903 = 0;
  38163. var $904 = 0, $905 = 0, $906 = 0, $907 = 0, $908 = 0, $909 = 0, $91 = 0, $910 = 0, $911 = 0, $912 = 0, $913 = 0, $914 = 0, $915 = 0, $916 = 0, $917 = 0, $918 = 0, $919 = 0, $92 = 0, $920 = 0, $921 = 0;
  38164. var $922 = 0, $923 = 0, $924 = 0, $925 = 0, $926 = 0, $927 = 0, $928 = 0, $929 = 0, $93 = 0, $930 = 0, $931 = 0, $932 = 0, $933 = 0, $934 = 0, $935 = 0, $936 = 0, $937 = 0, $938 = 0, $939 = 0, $94 = 0;
  38165. var $940 = 0, $941 = 0, $942 = 0, $943 = 0, $944 = 0, $945 = 0, $946 = 0, $947 = 0, $948 = 0, $949 = 0, $95 = 0, $950 = 0, $951 = 0, $952 = 0, $953 = 0, $954 = 0, $955 = 0, $956 = 0, $957 = 0, $958 = 0;
  38166. var $959 = 0, $96 = 0, $960 = 0, $961 = 0, $962 = 0, $963 = 0, $964 = 0, $965 = 0, $966 = 0, $967 = 0, $968 = 0, $969 = 0, $97 = 0, $970 = 0, $971 = 0, $972 = 0, $973 = 0, $974 = 0, $975 = 0, $976 = 0;
  38167. var $977 = 0, $978 = 0, $979 = 0, $98 = 0, $980 = 0, $981 = 0, $982 = 0, $983 = 0, $984 = 0, $985 = 0, $986 = 0, $987 = 0, $988 = 0, $989 = 0, $99 = 0, $990 = 0, $991 = 0, $992 = 0, $993 = 0, $994 = 0;
  38168. var $995 = 0, $996 = 0, $997 = 0, $998 = 0, $999 = 0, $cond$i = 0, $cond$i$i = 0, $cond$i208 = 0, $exitcond$i$i = 0, $not$$i = 0, $not$$i$i = 0, $not$$i17$i = 0, $not$$i209 = 0, $not$$i216 = 0, $not$1$i = 0, $not$1$i203 = 0, $not$5$i = 0, $not$7$i$i = 0, $not$8$i = 0, $not$9$i = 0;
  38169. var $or$cond$i = 0, $or$cond$i214 = 0, $or$cond1$i = 0, $or$cond10$i = 0, $or$cond11$i = 0, $or$cond11$not$i = 0, $or$cond12$i = 0, $or$cond2$i = 0, $or$cond2$i215 = 0, $or$cond5$i = 0, $or$cond50$i = 0, $or$cond51$i = 0, $or$cond7$i = 0, label = 0, sp = 0;
  38170. sp = STACKTOP;
  38171. STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
  38172. $1 = sp;
  38173. $2 = ($0>>>0)<(245);
  38174. do {
  38175. if ($2) {
  38176. $3 = ($0>>>0)<(11);
  38177. $4 = (($0) + 11)|0;
  38178. $5 = $4 & -8;
  38179. $6 = $3 ? 16 : $5;
  38180. $7 = $6 >>> 3;
  38181. $8 = HEAP32[5218]|0;
  38182. $9 = $8 >>> $7;
  38183. $10 = $9 & 3;
  38184. $11 = ($10|0)==(0);
  38185. if (!($11)) {
  38186. $12 = $9 & 1;
  38187. $13 = $12 ^ 1;
  38188. $14 = (($13) + ($7))|0;
  38189. $15 = $14 << 1;
  38190. $16 = (20912 + ($15<<2)|0);
  38191. $17 = ((($16)) + 8|0);
  38192. $18 = HEAP32[$17>>2]|0;
  38193. $19 = ((($18)) + 8|0);
  38194. $20 = HEAP32[$19>>2]|0;
  38195. $21 = ($16|0)==($20|0);
  38196. do {
  38197. if ($21) {
  38198. $22 = 1 << $14;
  38199. $23 = $22 ^ -1;
  38200. $24 = $8 & $23;
  38201. HEAP32[5218] = $24;
  38202. } else {
  38203. $25 = HEAP32[(20888)>>2]|0;
  38204. $26 = ($20>>>0)<($25>>>0);
  38205. if ($26) {
  38206. _abort();
  38207. // unreachable;
  38208. }
  38209. $27 = ((($20)) + 12|0);
  38210. $28 = HEAP32[$27>>2]|0;
  38211. $29 = ($28|0)==($18|0);
  38212. if ($29) {
  38213. HEAP32[$27>>2] = $16;
  38214. HEAP32[$17>>2] = $20;
  38215. break;
  38216. } else {
  38217. _abort();
  38218. // unreachable;
  38219. }
  38220. }
  38221. } while(0);
  38222. $30 = $14 << 3;
  38223. $31 = $30 | 3;
  38224. $32 = ((($18)) + 4|0);
  38225. HEAP32[$32>>2] = $31;
  38226. $33 = (($18) + ($30)|0);
  38227. $34 = ((($33)) + 4|0);
  38228. $35 = HEAP32[$34>>2]|0;
  38229. $36 = $35 | 1;
  38230. HEAP32[$34>>2] = $36;
  38231. $$0 = $19;
  38232. STACKTOP = sp;return ($$0|0);
  38233. }
  38234. $37 = HEAP32[(20880)>>2]|0;
  38235. $38 = ($6>>>0)>($37>>>0);
  38236. if ($38) {
  38237. $39 = ($9|0)==(0);
  38238. if (!($39)) {
  38239. $40 = $9 << $7;
  38240. $41 = 2 << $7;
  38241. $42 = (0 - ($41))|0;
  38242. $43 = $41 | $42;
  38243. $44 = $40 & $43;
  38244. $45 = (0 - ($44))|0;
  38245. $46 = $44 & $45;
  38246. $47 = (($46) + -1)|0;
  38247. $48 = $47 >>> 12;
  38248. $49 = $48 & 16;
  38249. $50 = $47 >>> $49;
  38250. $51 = $50 >>> 5;
  38251. $52 = $51 & 8;
  38252. $53 = $52 | $49;
  38253. $54 = $50 >>> $52;
  38254. $55 = $54 >>> 2;
  38255. $56 = $55 & 4;
  38256. $57 = $53 | $56;
  38257. $58 = $54 >>> $56;
  38258. $59 = $58 >>> 1;
  38259. $60 = $59 & 2;
  38260. $61 = $57 | $60;
  38261. $62 = $58 >>> $60;
  38262. $63 = $62 >>> 1;
  38263. $64 = $63 & 1;
  38264. $65 = $61 | $64;
  38265. $66 = $62 >>> $64;
  38266. $67 = (($65) + ($66))|0;
  38267. $68 = $67 << 1;
  38268. $69 = (20912 + ($68<<2)|0);
  38269. $70 = ((($69)) + 8|0);
  38270. $71 = HEAP32[$70>>2]|0;
  38271. $72 = ((($71)) + 8|0);
  38272. $73 = HEAP32[$72>>2]|0;
  38273. $74 = ($69|0)==($73|0);
  38274. do {
  38275. if ($74) {
  38276. $75 = 1 << $67;
  38277. $76 = $75 ^ -1;
  38278. $77 = $8 & $76;
  38279. HEAP32[5218] = $77;
  38280. $98 = $77;
  38281. } else {
  38282. $78 = HEAP32[(20888)>>2]|0;
  38283. $79 = ($73>>>0)<($78>>>0);
  38284. if ($79) {
  38285. _abort();
  38286. // unreachable;
  38287. }
  38288. $80 = ((($73)) + 12|0);
  38289. $81 = HEAP32[$80>>2]|0;
  38290. $82 = ($81|0)==($71|0);
  38291. if ($82) {
  38292. HEAP32[$80>>2] = $69;
  38293. HEAP32[$70>>2] = $73;
  38294. $98 = $8;
  38295. break;
  38296. } else {
  38297. _abort();
  38298. // unreachable;
  38299. }
  38300. }
  38301. } while(0);
  38302. $83 = $67 << 3;
  38303. $84 = (($83) - ($6))|0;
  38304. $85 = $6 | 3;
  38305. $86 = ((($71)) + 4|0);
  38306. HEAP32[$86>>2] = $85;
  38307. $87 = (($71) + ($6)|0);
  38308. $88 = $84 | 1;
  38309. $89 = ((($87)) + 4|0);
  38310. HEAP32[$89>>2] = $88;
  38311. $90 = (($87) + ($84)|0);
  38312. HEAP32[$90>>2] = $84;
  38313. $91 = ($37|0)==(0);
  38314. if (!($91)) {
  38315. $92 = HEAP32[(20892)>>2]|0;
  38316. $93 = $37 >>> 3;
  38317. $94 = $93 << 1;
  38318. $95 = (20912 + ($94<<2)|0);
  38319. $96 = 1 << $93;
  38320. $97 = $98 & $96;
  38321. $99 = ($97|0)==(0);
  38322. if ($99) {
  38323. $100 = $98 | $96;
  38324. HEAP32[5218] = $100;
  38325. $$pre = ((($95)) + 8|0);
  38326. $$0199 = $95;$$pre$phiZ2D = $$pre;
  38327. } else {
  38328. $101 = ((($95)) + 8|0);
  38329. $102 = HEAP32[$101>>2]|0;
  38330. $103 = HEAP32[(20888)>>2]|0;
  38331. $104 = ($102>>>0)<($103>>>0);
  38332. if ($104) {
  38333. _abort();
  38334. // unreachable;
  38335. } else {
  38336. $$0199 = $102;$$pre$phiZ2D = $101;
  38337. }
  38338. }
  38339. HEAP32[$$pre$phiZ2D>>2] = $92;
  38340. $105 = ((($$0199)) + 12|0);
  38341. HEAP32[$105>>2] = $92;
  38342. $106 = ((($92)) + 8|0);
  38343. HEAP32[$106>>2] = $$0199;
  38344. $107 = ((($92)) + 12|0);
  38345. HEAP32[$107>>2] = $95;
  38346. }
  38347. HEAP32[(20880)>>2] = $84;
  38348. HEAP32[(20892)>>2] = $87;
  38349. $$0 = $72;
  38350. STACKTOP = sp;return ($$0|0);
  38351. }
  38352. $108 = HEAP32[(20876)>>2]|0;
  38353. $109 = ($108|0)==(0);
  38354. if ($109) {
  38355. $$0197 = $6;
  38356. } else {
  38357. $110 = (0 - ($108))|0;
  38358. $111 = $108 & $110;
  38359. $112 = (($111) + -1)|0;
  38360. $113 = $112 >>> 12;
  38361. $114 = $113 & 16;
  38362. $115 = $112 >>> $114;
  38363. $116 = $115 >>> 5;
  38364. $117 = $116 & 8;
  38365. $118 = $117 | $114;
  38366. $119 = $115 >>> $117;
  38367. $120 = $119 >>> 2;
  38368. $121 = $120 & 4;
  38369. $122 = $118 | $121;
  38370. $123 = $119 >>> $121;
  38371. $124 = $123 >>> 1;
  38372. $125 = $124 & 2;
  38373. $126 = $122 | $125;
  38374. $127 = $123 >>> $125;
  38375. $128 = $127 >>> 1;
  38376. $129 = $128 & 1;
  38377. $130 = $126 | $129;
  38378. $131 = $127 >>> $129;
  38379. $132 = (($130) + ($131))|0;
  38380. $133 = (21176 + ($132<<2)|0);
  38381. $134 = HEAP32[$133>>2]|0;
  38382. $135 = ((($134)) + 4|0);
  38383. $136 = HEAP32[$135>>2]|0;
  38384. $137 = $136 & -8;
  38385. $138 = (($137) - ($6))|0;
  38386. $139 = ((($134)) + 16|0);
  38387. $140 = HEAP32[$139>>2]|0;
  38388. $not$5$i = ($140|0)==(0|0);
  38389. $$sink16$i = $not$5$i&1;
  38390. $141 = (((($134)) + 16|0) + ($$sink16$i<<2)|0);
  38391. $142 = HEAP32[$141>>2]|0;
  38392. $143 = ($142|0)==(0|0);
  38393. if ($143) {
  38394. $$0192$lcssa$i = $134;$$0193$lcssa$i = $138;
  38395. } else {
  38396. $$01928$i = $134;$$01937$i = $138;$145 = $142;
  38397. while(1) {
  38398. $144 = ((($145)) + 4|0);
  38399. $146 = HEAP32[$144>>2]|0;
  38400. $147 = $146 & -8;
  38401. $148 = (($147) - ($6))|0;
  38402. $149 = ($148>>>0)<($$01937$i>>>0);
  38403. $$$0193$i = $149 ? $148 : $$01937$i;
  38404. $$$0192$i = $149 ? $145 : $$01928$i;
  38405. $150 = ((($145)) + 16|0);
  38406. $151 = HEAP32[$150>>2]|0;
  38407. $not$$i = ($151|0)==(0|0);
  38408. $$sink1$i = $not$$i&1;
  38409. $152 = (((($145)) + 16|0) + ($$sink1$i<<2)|0);
  38410. $153 = HEAP32[$152>>2]|0;
  38411. $154 = ($153|0)==(0|0);
  38412. if ($154) {
  38413. $$0192$lcssa$i = $$$0192$i;$$0193$lcssa$i = $$$0193$i;
  38414. break;
  38415. } else {
  38416. $$01928$i = $$$0192$i;$$01937$i = $$$0193$i;$145 = $153;
  38417. }
  38418. }
  38419. }
  38420. $155 = HEAP32[(20888)>>2]|0;
  38421. $156 = ($$0192$lcssa$i>>>0)<($155>>>0);
  38422. if ($156) {
  38423. _abort();
  38424. // unreachable;
  38425. }
  38426. $157 = (($$0192$lcssa$i) + ($6)|0);
  38427. $158 = ($$0192$lcssa$i>>>0)<($157>>>0);
  38428. if (!($158)) {
  38429. _abort();
  38430. // unreachable;
  38431. }
  38432. $159 = ((($$0192$lcssa$i)) + 24|0);
  38433. $160 = HEAP32[$159>>2]|0;
  38434. $161 = ((($$0192$lcssa$i)) + 12|0);
  38435. $162 = HEAP32[$161>>2]|0;
  38436. $163 = ($162|0)==($$0192$lcssa$i|0);
  38437. do {
  38438. if ($163) {
  38439. $173 = ((($$0192$lcssa$i)) + 20|0);
  38440. $174 = HEAP32[$173>>2]|0;
  38441. $175 = ($174|0)==(0|0);
  38442. if ($175) {
  38443. $176 = ((($$0192$lcssa$i)) + 16|0);
  38444. $177 = HEAP32[$176>>2]|0;
  38445. $178 = ($177|0)==(0|0);
  38446. if ($178) {
  38447. $$3$i = 0;
  38448. break;
  38449. } else {
  38450. $$1196$i = $177;$$1198$i = $176;
  38451. }
  38452. } else {
  38453. $$1196$i = $174;$$1198$i = $173;
  38454. }
  38455. while(1) {
  38456. $179 = ((($$1196$i)) + 20|0);
  38457. $180 = HEAP32[$179>>2]|0;
  38458. $181 = ($180|0)==(0|0);
  38459. if (!($181)) {
  38460. $$1196$i = $180;$$1198$i = $179;
  38461. continue;
  38462. }
  38463. $182 = ((($$1196$i)) + 16|0);
  38464. $183 = HEAP32[$182>>2]|0;
  38465. $184 = ($183|0)==(0|0);
  38466. if ($184) {
  38467. break;
  38468. } else {
  38469. $$1196$i = $183;$$1198$i = $182;
  38470. }
  38471. }
  38472. $185 = ($$1198$i>>>0)<($155>>>0);
  38473. if ($185) {
  38474. _abort();
  38475. // unreachable;
  38476. } else {
  38477. HEAP32[$$1198$i>>2] = 0;
  38478. $$3$i = $$1196$i;
  38479. break;
  38480. }
  38481. } else {
  38482. $164 = ((($$0192$lcssa$i)) + 8|0);
  38483. $165 = HEAP32[$164>>2]|0;
  38484. $166 = ($165>>>0)<($155>>>0);
  38485. if ($166) {
  38486. _abort();
  38487. // unreachable;
  38488. }
  38489. $167 = ((($165)) + 12|0);
  38490. $168 = HEAP32[$167>>2]|0;
  38491. $169 = ($168|0)==($$0192$lcssa$i|0);
  38492. if (!($169)) {
  38493. _abort();
  38494. // unreachable;
  38495. }
  38496. $170 = ((($162)) + 8|0);
  38497. $171 = HEAP32[$170>>2]|0;
  38498. $172 = ($171|0)==($$0192$lcssa$i|0);
  38499. if ($172) {
  38500. HEAP32[$167>>2] = $162;
  38501. HEAP32[$170>>2] = $165;
  38502. $$3$i = $162;
  38503. break;
  38504. } else {
  38505. _abort();
  38506. // unreachable;
  38507. }
  38508. }
  38509. } while(0);
  38510. $186 = ($160|0)==(0|0);
  38511. L73: do {
  38512. if (!($186)) {
  38513. $187 = ((($$0192$lcssa$i)) + 28|0);
  38514. $188 = HEAP32[$187>>2]|0;
  38515. $189 = (21176 + ($188<<2)|0);
  38516. $190 = HEAP32[$189>>2]|0;
  38517. $191 = ($$0192$lcssa$i|0)==($190|0);
  38518. do {
  38519. if ($191) {
  38520. HEAP32[$189>>2] = $$3$i;
  38521. $cond$i = ($$3$i|0)==(0|0);
  38522. if ($cond$i) {
  38523. $192 = 1 << $188;
  38524. $193 = $192 ^ -1;
  38525. $194 = $108 & $193;
  38526. HEAP32[(20876)>>2] = $194;
  38527. break L73;
  38528. }
  38529. } else {
  38530. $195 = HEAP32[(20888)>>2]|0;
  38531. $196 = ($160>>>0)<($195>>>0);
  38532. if ($196) {
  38533. _abort();
  38534. // unreachable;
  38535. } else {
  38536. $197 = ((($160)) + 16|0);
  38537. $198 = HEAP32[$197>>2]|0;
  38538. $not$1$i = ($198|0)!=($$0192$lcssa$i|0);
  38539. $$sink2$i = $not$1$i&1;
  38540. $199 = (((($160)) + 16|0) + ($$sink2$i<<2)|0);
  38541. HEAP32[$199>>2] = $$3$i;
  38542. $200 = ($$3$i|0)==(0|0);
  38543. if ($200) {
  38544. break L73;
  38545. } else {
  38546. break;
  38547. }
  38548. }
  38549. }
  38550. } while(0);
  38551. $201 = HEAP32[(20888)>>2]|0;
  38552. $202 = ($$3$i>>>0)<($201>>>0);
  38553. if ($202) {
  38554. _abort();
  38555. // unreachable;
  38556. }
  38557. $203 = ((($$3$i)) + 24|0);
  38558. HEAP32[$203>>2] = $160;
  38559. $204 = ((($$0192$lcssa$i)) + 16|0);
  38560. $205 = HEAP32[$204>>2]|0;
  38561. $206 = ($205|0)==(0|0);
  38562. do {
  38563. if (!($206)) {
  38564. $207 = ($205>>>0)<($201>>>0);
  38565. if ($207) {
  38566. _abort();
  38567. // unreachable;
  38568. } else {
  38569. $208 = ((($$3$i)) + 16|0);
  38570. HEAP32[$208>>2] = $205;
  38571. $209 = ((($205)) + 24|0);
  38572. HEAP32[$209>>2] = $$3$i;
  38573. break;
  38574. }
  38575. }
  38576. } while(0);
  38577. $210 = ((($$0192$lcssa$i)) + 20|0);
  38578. $211 = HEAP32[$210>>2]|0;
  38579. $212 = ($211|0)==(0|0);
  38580. if (!($212)) {
  38581. $213 = HEAP32[(20888)>>2]|0;
  38582. $214 = ($211>>>0)<($213>>>0);
  38583. if ($214) {
  38584. _abort();
  38585. // unreachable;
  38586. } else {
  38587. $215 = ((($$3$i)) + 20|0);
  38588. HEAP32[$215>>2] = $211;
  38589. $216 = ((($211)) + 24|0);
  38590. HEAP32[$216>>2] = $$3$i;
  38591. break;
  38592. }
  38593. }
  38594. }
  38595. } while(0);
  38596. $217 = ($$0193$lcssa$i>>>0)<(16);
  38597. if ($217) {
  38598. $218 = (($$0193$lcssa$i) + ($6))|0;
  38599. $219 = $218 | 3;
  38600. $220 = ((($$0192$lcssa$i)) + 4|0);
  38601. HEAP32[$220>>2] = $219;
  38602. $221 = (($$0192$lcssa$i) + ($218)|0);
  38603. $222 = ((($221)) + 4|0);
  38604. $223 = HEAP32[$222>>2]|0;
  38605. $224 = $223 | 1;
  38606. HEAP32[$222>>2] = $224;
  38607. } else {
  38608. $225 = $6 | 3;
  38609. $226 = ((($$0192$lcssa$i)) + 4|0);
  38610. HEAP32[$226>>2] = $225;
  38611. $227 = $$0193$lcssa$i | 1;
  38612. $228 = ((($157)) + 4|0);
  38613. HEAP32[$228>>2] = $227;
  38614. $229 = (($157) + ($$0193$lcssa$i)|0);
  38615. HEAP32[$229>>2] = $$0193$lcssa$i;
  38616. $230 = ($37|0)==(0);
  38617. if (!($230)) {
  38618. $231 = HEAP32[(20892)>>2]|0;
  38619. $232 = $37 >>> 3;
  38620. $233 = $232 << 1;
  38621. $234 = (20912 + ($233<<2)|0);
  38622. $235 = 1 << $232;
  38623. $236 = $8 & $235;
  38624. $237 = ($236|0)==(0);
  38625. if ($237) {
  38626. $238 = $8 | $235;
  38627. HEAP32[5218] = $238;
  38628. $$pre$i = ((($234)) + 8|0);
  38629. $$0189$i = $234;$$pre$phi$iZ2D = $$pre$i;
  38630. } else {
  38631. $239 = ((($234)) + 8|0);
  38632. $240 = HEAP32[$239>>2]|0;
  38633. $241 = HEAP32[(20888)>>2]|0;
  38634. $242 = ($240>>>0)<($241>>>0);
  38635. if ($242) {
  38636. _abort();
  38637. // unreachable;
  38638. } else {
  38639. $$0189$i = $240;$$pre$phi$iZ2D = $239;
  38640. }
  38641. }
  38642. HEAP32[$$pre$phi$iZ2D>>2] = $231;
  38643. $243 = ((($$0189$i)) + 12|0);
  38644. HEAP32[$243>>2] = $231;
  38645. $244 = ((($231)) + 8|0);
  38646. HEAP32[$244>>2] = $$0189$i;
  38647. $245 = ((($231)) + 12|0);
  38648. HEAP32[$245>>2] = $234;
  38649. }
  38650. HEAP32[(20880)>>2] = $$0193$lcssa$i;
  38651. HEAP32[(20892)>>2] = $157;
  38652. }
  38653. $246 = ((($$0192$lcssa$i)) + 8|0);
  38654. $$0 = $246;
  38655. STACKTOP = sp;return ($$0|0);
  38656. }
  38657. } else {
  38658. $$0197 = $6;
  38659. }
  38660. } else {
  38661. $247 = ($0>>>0)>(4294967231);
  38662. if ($247) {
  38663. $$0197 = -1;
  38664. } else {
  38665. $248 = (($0) + 11)|0;
  38666. $249 = $248 & -8;
  38667. $250 = HEAP32[(20876)>>2]|0;
  38668. $251 = ($250|0)==(0);
  38669. if ($251) {
  38670. $$0197 = $249;
  38671. } else {
  38672. $252 = (0 - ($249))|0;
  38673. $253 = $248 >>> 8;
  38674. $254 = ($253|0)==(0);
  38675. if ($254) {
  38676. $$0358$i = 0;
  38677. } else {
  38678. $255 = ($249>>>0)>(16777215);
  38679. if ($255) {
  38680. $$0358$i = 31;
  38681. } else {
  38682. $256 = (($253) + 1048320)|0;
  38683. $257 = $256 >>> 16;
  38684. $258 = $257 & 8;
  38685. $259 = $253 << $258;
  38686. $260 = (($259) + 520192)|0;
  38687. $261 = $260 >>> 16;
  38688. $262 = $261 & 4;
  38689. $263 = $262 | $258;
  38690. $264 = $259 << $262;
  38691. $265 = (($264) + 245760)|0;
  38692. $266 = $265 >>> 16;
  38693. $267 = $266 & 2;
  38694. $268 = $263 | $267;
  38695. $269 = (14 - ($268))|0;
  38696. $270 = $264 << $267;
  38697. $271 = $270 >>> 15;
  38698. $272 = (($269) + ($271))|0;
  38699. $273 = $272 << 1;
  38700. $274 = (($272) + 7)|0;
  38701. $275 = $249 >>> $274;
  38702. $276 = $275 & 1;
  38703. $277 = $276 | $273;
  38704. $$0358$i = $277;
  38705. }
  38706. }
  38707. $278 = (21176 + ($$0358$i<<2)|0);
  38708. $279 = HEAP32[$278>>2]|0;
  38709. $280 = ($279|0)==(0|0);
  38710. L117: do {
  38711. if ($280) {
  38712. $$2355$i = 0;$$3$i201 = 0;$$3350$i = $252;
  38713. label = 81;
  38714. } else {
  38715. $281 = ($$0358$i|0)==(31);
  38716. $282 = $$0358$i >>> 1;
  38717. $283 = (25 - ($282))|0;
  38718. $284 = $281 ? 0 : $283;
  38719. $285 = $249 << $284;
  38720. $$0342$i = 0;$$0347$i = $252;$$0353$i = $279;$$0359$i = $285;$$0362$i = 0;
  38721. while(1) {
  38722. $286 = ((($$0353$i)) + 4|0);
  38723. $287 = HEAP32[$286>>2]|0;
  38724. $288 = $287 & -8;
  38725. $289 = (($288) - ($249))|0;
  38726. $290 = ($289>>>0)<($$0347$i>>>0);
  38727. if ($290) {
  38728. $291 = ($289|0)==(0);
  38729. if ($291) {
  38730. $$415$i = $$0353$i;$$435114$i = 0;$$435713$i = $$0353$i;
  38731. label = 85;
  38732. break L117;
  38733. } else {
  38734. $$1343$i = $$0353$i;$$1348$i = $289;
  38735. }
  38736. } else {
  38737. $$1343$i = $$0342$i;$$1348$i = $$0347$i;
  38738. }
  38739. $292 = ((($$0353$i)) + 20|0);
  38740. $293 = HEAP32[$292>>2]|0;
  38741. $294 = $$0359$i >>> 31;
  38742. $295 = (((($$0353$i)) + 16|0) + ($294<<2)|0);
  38743. $296 = HEAP32[$295>>2]|0;
  38744. $297 = ($293|0)==(0|0);
  38745. $298 = ($293|0)==($296|0);
  38746. $or$cond2$i = $297 | $298;
  38747. $$1363$i = $or$cond2$i ? $$0362$i : $293;
  38748. $299 = ($296|0)==(0|0);
  38749. $not$8$i = $299 ^ 1;
  38750. $300 = $not$8$i&1;
  38751. $$0359$$i = $$0359$i << $300;
  38752. if ($299) {
  38753. $$2355$i = $$1363$i;$$3$i201 = $$1343$i;$$3350$i = $$1348$i;
  38754. label = 81;
  38755. break;
  38756. } else {
  38757. $$0342$i = $$1343$i;$$0347$i = $$1348$i;$$0353$i = $296;$$0359$i = $$0359$$i;$$0362$i = $$1363$i;
  38758. }
  38759. }
  38760. }
  38761. } while(0);
  38762. if ((label|0) == 81) {
  38763. $301 = ($$2355$i|0)==(0|0);
  38764. $302 = ($$3$i201|0)==(0|0);
  38765. $or$cond$i = $301 & $302;
  38766. if ($or$cond$i) {
  38767. $303 = 2 << $$0358$i;
  38768. $304 = (0 - ($303))|0;
  38769. $305 = $303 | $304;
  38770. $306 = $250 & $305;
  38771. $307 = ($306|0)==(0);
  38772. if ($307) {
  38773. $$0197 = $249;
  38774. break;
  38775. }
  38776. $308 = (0 - ($306))|0;
  38777. $309 = $306 & $308;
  38778. $310 = (($309) + -1)|0;
  38779. $311 = $310 >>> 12;
  38780. $312 = $311 & 16;
  38781. $313 = $310 >>> $312;
  38782. $314 = $313 >>> 5;
  38783. $315 = $314 & 8;
  38784. $316 = $315 | $312;
  38785. $317 = $313 >>> $315;
  38786. $318 = $317 >>> 2;
  38787. $319 = $318 & 4;
  38788. $320 = $316 | $319;
  38789. $321 = $317 >>> $319;
  38790. $322 = $321 >>> 1;
  38791. $323 = $322 & 2;
  38792. $324 = $320 | $323;
  38793. $325 = $321 >>> $323;
  38794. $326 = $325 >>> 1;
  38795. $327 = $326 & 1;
  38796. $328 = $324 | $327;
  38797. $329 = $325 >>> $327;
  38798. $330 = (($328) + ($329))|0;
  38799. $331 = (21176 + ($330<<2)|0);
  38800. $332 = HEAP32[$331>>2]|0;
  38801. $$4$ph$i = 0;$$4357$ph$i = $332;
  38802. } else {
  38803. $$4$ph$i = $$3$i201;$$4357$ph$i = $$2355$i;
  38804. }
  38805. $333 = ($$4357$ph$i|0)==(0|0);
  38806. if ($333) {
  38807. $$4$lcssa$i = $$4$ph$i;$$4351$lcssa$i = $$3350$i;
  38808. } else {
  38809. $$415$i = $$4$ph$i;$$435114$i = $$3350$i;$$435713$i = $$4357$ph$i;
  38810. label = 85;
  38811. }
  38812. }
  38813. if ((label|0) == 85) {
  38814. while(1) {
  38815. label = 0;
  38816. $334 = ((($$435713$i)) + 4|0);
  38817. $335 = HEAP32[$334>>2]|0;
  38818. $336 = $335 & -8;
  38819. $337 = (($336) - ($249))|0;
  38820. $338 = ($337>>>0)<($$435114$i>>>0);
  38821. $$$4351$i = $338 ? $337 : $$435114$i;
  38822. $$4357$$4$i = $338 ? $$435713$i : $$415$i;
  38823. $339 = ((($$435713$i)) + 16|0);
  38824. $340 = HEAP32[$339>>2]|0;
  38825. $not$1$i203 = ($340|0)==(0|0);
  38826. $$sink2$i204 = $not$1$i203&1;
  38827. $341 = (((($$435713$i)) + 16|0) + ($$sink2$i204<<2)|0);
  38828. $342 = HEAP32[$341>>2]|0;
  38829. $343 = ($342|0)==(0|0);
  38830. if ($343) {
  38831. $$4$lcssa$i = $$4357$$4$i;$$4351$lcssa$i = $$$4351$i;
  38832. break;
  38833. } else {
  38834. $$415$i = $$4357$$4$i;$$435114$i = $$$4351$i;$$435713$i = $342;
  38835. label = 85;
  38836. }
  38837. }
  38838. }
  38839. $344 = ($$4$lcssa$i|0)==(0|0);
  38840. if ($344) {
  38841. $$0197 = $249;
  38842. } else {
  38843. $345 = HEAP32[(20880)>>2]|0;
  38844. $346 = (($345) - ($249))|0;
  38845. $347 = ($$4351$lcssa$i>>>0)<($346>>>0);
  38846. if ($347) {
  38847. $348 = HEAP32[(20888)>>2]|0;
  38848. $349 = ($$4$lcssa$i>>>0)<($348>>>0);
  38849. if ($349) {
  38850. _abort();
  38851. // unreachable;
  38852. }
  38853. $350 = (($$4$lcssa$i) + ($249)|0);
  38854. $351 = ($$4$lcssa$i>>>0)<($350>>>0);
  38855. if (!($351)) {
  38856. _abort();
  38857. // unreachable;
  38858. }
  38859. $352 = ((($$4$lcssa$i)) + 24|0);
  38860. $353 = HEAP32[$352>>2]|0;
  38861. $354 = ((($$4$lcssa$i)) + 12|0);
  38862. $355 = HEAP32[$354>>2]|0;
  38863. $356 = ($355|0)==($$4$lcssa$i|0);
  38864. do {
  38865. if ($356) {
  38866. $366 = ((($$4$lcssa$i)) + 20|0);
  38867. $367 = HEAP32[$366>>2]|0;
  38868. $368 = ($367|0)==(0|0);
  38869. if ($368) {
  38870. $369 = ((($$4$lcssa$i)) + 16|0);
  38871. $370 = HEAP32[$369>>2]|0;
  38872. $371 = ($370|0)==(0|0);
  38873. if ($371) {
  38874. $$3372$i = 0;
  38875. break;
  38876. } else {
  38877. $$1370$i = $370;$$1374$i = $369;
  38878. }
  38879. } else {
  38880. $$1370$i = $367;$$1374$i = $366;
  38881. }
  38882. while(1) {
  38883. $372 = ((($$1370$i)) + 20|0);
  38884. $373 = HEAP32[$372>>2]|0;
  38885. $374 = ($373|0)==(0|0);
  38886. if (!($374)) {
  38887. $$1370$i = $373;$$1374$i = $372;
  38888. continue;
  38889. }
  38890. $375 = ((($$1370$i)) + 16|0);
  38891. $376 = HEAP32[$375>>2]|0;
  38892. $377 = ($376|0)==(0|0);
  38893. if ($377) {
  38894. break;
  38895. } else {
  38896. $$1370$i = $376;$$1374$i = $375;
  38897. }
  38898. }
  38899. $378 = ($$1374$i>>>0)<($348>>>0);
  38900. if ($378) {
  38901. _abort();
  38902. // unreachable;
  38903. } else {
  38904. HEAP32[$$1374$i>>2] = 0;
  38905. $$3372$i = $$1370$i;
  38906. break;
  38907. }
  38908. } else {
  38909. $357 = ((($$4$lcssa$i)) + 8|0);
  38910. $358 = HEAP32[$357>>2]|0;
  38911. $359 = ($358>>>0)<($348>>>0);
  38912. if ($359) {
  38913. _abort();
  38914. // unreachable;
  38915. }
  38916. $360 = ((($358)) + 12|0);
  38917. $361 = HEAP32[$360>>2]|0;
  38918. $362 = ($361|0)==($$4$lcssa$i|0);
  38919. if (!($362)) {
  38920. _abort();
  38921. // unreachable;
  38922. }
  38923. $363 = ((($355)) + 8|0);
  38924. $364 = HEAP32[$363>>2]|0;
  38925. $365 = ($364|0)==($$4$lcssa$i|0);
  38926. if ($365) {
  38927. HEAP32[$360>>2] = $355;
  38928. HEAP32[$363>>2] = $358;
  38929. $$3372$i = $355;
  38930. break;
  38931. } else {
  38932. _abort();
  38933. // unreachable;
  38934. }
  38935. }
  38936. } while(0);
  38937. $379 = ($353|0)==(0|0);
  38938. L164: do {
  38939. if ($379) {
  38940. $470 = $250;
  38941. } else {
  38942. $380 = ((($$4$lcssa$i)) + 28|0);
  38943. $381 = HEAP32[$380>>2]|0;
  38944. $382 = (21176 + ($381<<2)|0);
  38945. $383 = HEAP32[$382>>2]|0;
  38946. $384 = ($$4$lcssa$i|0)==($383|0);
  38947. do {
  38948. if ($384) {
  38949. HEAP32[$382>>2] = $$3372$i;
  38950. $cond$i208 = ($$3372$i|0)==(0|0);
  38951. if ($cond$i208) {
  38952. $385 = 1 << $381;
  38953. $386 = $385 ^ -1;
  38954. $387 = $250 & $386;
  38955. HEAP32[(20876)>>2] = $387;
  38956. $470 = $387;
  38957. break L164;
  38958. }
  38959. } else {
  38960. $388 = HEAP32[(20888)>>2]|0;
  38961. $389 = ($353>>>0)<($388>>>0);
  38962. if ($389) {
  38963. _abort();
  38964. // unreachable;
  38965. } else {
  38966. $390 = ((($353)) + 16|0);
  38967. $391 = HEAP32[$390>>2]|0;
  38968. $not$$i209 = ($391|0)!=($$4$lcssa$i|0);
  38969. $$sink3$i = $not$$i209&1;
  38970. $392 = (((($353)) + 16|0) + ($$sink3$i<<2)|0);
  38971. HEAP32[$392>>2] = $$3372$i;
  38972. $393 = ($$3372$i|0)==(0|0);
  38973. if ($393) {
  38974. $470 = $250;
  38975. break L164;
  38976. } else {
  38977. break;
  38978. }
  38979. }
  38980. }
  38981. } while(0);
  38982. $394 = HEAP32[(20888)>>2]|0;
  38983. $395 = ($$3372$i>>>0)<($394>>>0);
  38984. if ($395) {
  38985. _abort();
  38986. // unreachable;
  38987. }
  38988. $396 = ((($$3372$i)) + 24|0);
  38989. HEAP32[$396>>2] = $353;
  38990. $397 = ((($$4$lcssa$i)) + 16|0);
  38991. $398 = HEAP32[$397>>2]|0;
  38992. $399 = ($398|0)==(0|0);
  38993. do {
  38994. if (!($399)) {
  38995. $400 = ($398>>>0)<($394>>>0);
  38996. if ($400) {
  38997. _abort();
  38998. // unreachable;
  38999. } else {
  39000. $401 = ((($$3372$i)) + 16|0);
  39001. HEAP32[$401>>2] = $398;
  39002. $402 = ((($398)) + 24|0);
  39003. HEAP32[$402>>2] = $$3372$i;
  39004. break;
  39005. }
  39006. }
  39007. } while(0);
  39008. $403 = ((($$4$lcssa$i)) + 20|0);
  39009. $404 = HEAP32[$403>>2]|0;
  39010. $405 = ($404|0)==(0|0);
  39011. if ($405) {
  39012. $470 = $250;
  39013. } else {
  39014. $406 = HEAP32[(20888)>>2]|0;
  39015. $407 = ($404>>>0)<($406>>>0);
  39016. if ($407) {
  39017. _abort();
  39018. // unreachable;
  39019. } else {
  39020. $408 = ((($$3372$i)) + 20|0);
  39021. HEAP32[$408>>2] = $404;
  39022. $409 = ((($404)) + 24|0);
  39023. HEAP32[$409>>2] = $$3372$i;
  39024. $470 = $250;
  39025. break;
  39026. }
  39027. }
  39028. }
  39029. } while(0);
  39030. $410 = ($$4351$lcssa$i>>>0)<(16);
  39031. do {
  39032. if ($410) {
  39033. $411 = (($$4351$lcssa$i) + ($249))|0;
  39034. $412 = $411 | 3;
  39035. $413 = ((($$4$lcssa$i)) + 4|0);
  39036. HEAP32[$413>>2] = $412;
  39037. $414 = (($$4$lcssa$i) + ($411)|0);
  39038. $415 = ((($414)) + 4|0);
  39039. $416 = HEAP32[$415>>2]|0;
  39040. $417 = $416 | 1;
  39041. HEAP32[$415>>2] = $417;
  39042. } else {
  39043. $418 = $249 | 3;
  39044. $419 = ((($$4$lcssa$i)) + 4|0);
  39045. HEAP32[$419>>2] = $418;
  39046. $420 = $$4351$lcssa$i | 1;
  39047. $421 = ((($350)) + 4|0);
  39048. HEAP32[$421>>2] = $420;
  39049. $422 = (($350) + ($$4351$lcssa$i)|0);
  39050. HEAP32[$422>>2] = $$4351$lcssa$i;
  39051. $423 = $$4351$lcssa$i >>> 3;
  39052. $424 = ($$4351$lcssa$i>>>0)<(256);
  39053. if ($424) {
  39054. $425 = $423 << 1;
  39055. $426 = (20912 + ($425<<2)|0);
  39056. $427 = HEAP32[5218]|0;
  39057. $428 = 1 << $423;
  39058. $429 = $427 & $428;
  39059. $430 = ($429|0)==(0);
  39060. if ($430) {
  39061. $431 = $427 | $428;
  39062. HEAP32[5218] = $431;
  39063. $$pre$i210 = ((($426)) + 8|0);
  39064. $$0368$i = $426;$$pre$phi$i211Z2D = $$pre$i210;
  39065. } else {
  39066. $432 = ((($426)) + 8|0);
  39067. $433 = HEAP32[$432>>2]|0;
  39068. $434 = HEAP32[(20888)>>2]|0;
  39069. $435 = ($433>>>0)<($434>>>0);
  39070. if ($435) {
  39071. _abort();
  39072. // unreachable;
  39073. } else {
  39074. $$0368$i = $433;$$pre$phi$i211Z2D = $432;
  39075. }
  39076. }
  39077. HEAP32[$$pre$phi$i211Z2D>>2] = $350;
  39078. $436 = ((($$0368$i)) + 12|0);
  39079. HEAP32[$436>>2] = $350;
  39080. $437 = ((($350)) + 8|0);
  39081. HEAP32[$437>>2] = $$0368$i;
  39082. $438 = ((($350)) + 12|0);
  39083. HEAP32[$438>>2] = $426;
  39084. break;
  39085. }
  39086. $439 = $$4351$lcssa$i >>> 8;
  39087. $440 = ($439|0)==(0);
  39088. if ($440) {
  39089. $$0361$i = 0;
  39090. } else {
  39091. $441 = ($$4351$lcssa$i>>>0)>(16777215);
  39092. if ($441) {
  39093. $$0361$i = 31;
  39094. } else {
  39095. $442 = (($439) + 1048320)|0;
  39096. $443 = $442 >>> 16;
  39097. $444 = $443 & 8;
  39098. $445 = $439 << $444;
  39099. $446 = (($445) + 520192)|0;
  39100. $447 = $446 >>> 16;
  39101. $448 = $447 & 4;
  39102. $449 = $448 | $444;
  39103. $450 = $445 << $448;
  39104. $451 = (($450) + 245760)|0;
  39105. $452 = $451 >>> 16;
  39106. $453 = $452 & 2;
  39107. $454 = $449 | $453;
  39108. $455 = (14 - ($454))|0;
  39109. $456 = $450 << $453;
  39110. $457 = $456 >>> 15;
  39111. $458 = (($455) + ($457))|0;
  39112. $459 = $458 << 1;
  39113. $460 = (($458) + 7)|0;
  39114. $461 = $$4351$lcssa$i >>> $460;
  39115. $462 = $461 & 1;
  39116. $463 = $462 | $459;
  39117. $$0361$i = $463;
  39118. }
  39119. }
  39120. $464 = (21176 + ($$0361$i<<2)|0);
  39121. $465 = ((($350)) + 28|0);
  39122. HEAP32[$465>>2] = $$0361$i;
  39123. $466 = ((($350)) + 16|0);
  39124. $467 = ((($466)) + 4|0);
  39125. HEAP32[$467>>2] = 0;
  39126. HEAP32[$466>>2] = 0;
  39127. $468 = 1 << $$0361$i;
  39128. $469 = $470 & $468;
  39129. $471 = ($469|0)==(0);
  39130. if ($471) {
  39131. $472 = $470 | $468;
  39132. HEAP32[(20876)>>2] = $472;
  39133. HEAP32[$464>>2] = $350;
  39134. $473 = ((($350)) + 24|0);
  39135. HEAP32[$473>>2] = $464;
  39136. $474 = ((($350)) + 12|0);
  39137. HEAP32[$474>>2] = $350;
  39138. $475 = ((($350)) + 8|0);
  39139. HEAP32[$475>>2] = $350;
  39140. break;
  39141. }
  39142. $476 = HEAP32[$464>>2]|0;
  39143. $477 = ($$0361$i|0)==(31);
  39144. $478 = $$0361$i >>> 1;
  39145. $479 = (25 - ($478))|0;
  39146. $480 = $477 ? 0 : $479;
  39147. $481 = $$4351$lcssa$i << $480;
  39148. $$0344$i = $481;$$0345$i = $476;
  39149. while(1) {
  39150. $482 = ((($$0345$i)) + 4|0);
  39151. $483 = HEAP32[$482>>2]|0;
  39152. $484 = $483 & -8;
  39153. $485 = ($484|0)==($$4351$lcssa$i|0);
  39154. if ($485) {
  39155. label = 139;
  39156. break;
  39157. }
  39158. $486 = $$0344$i >>> 31;
  39159. $487 = (((($$0345$i)) + 16|0) + ($486<<2)|0);
  39160. $488 = $$0344$i << 1;
  39161. $489 = HEAP32[$487>>2]|0;
  39162. $490 = ($489|0)==(0|0);
  39163. if ($490) {
  39164. label = 136;
  39165. break;
  39166. } else {
  39167. $$0344$i = $488;$$0345$i = $489;
  39168. }
  39169. }
  39170. if ((label|0) == 136) {
  39171. $491 = HEAP32[(20888)>>2]|0;
  39172. $492 = ($487>>>0)<($491>>>0);
  39173. if ($492) {
  39174. _abort();
  39175. // unreachable;
  39176. } else {
  39177. HEAP32[$487>>2] = $350;
  39178. $493 = ((($350)) + 24|0);
  39179. HEAP32[$493>>2] = $$0345$i;
  39180. $494 = ((($350)) + 12|0);
  39181. HEAP32[$494>>2] = $350;
  39182. $495 = ((($350)) + 8|0);
  39183. HEAP32[$495>>2] = $350;
  39184. break;
  39185. }
  39186. }
  39187. else if ((label|0) == 139) {
  39188. $496 = ((($$0345$i)) + 8|0);
  39189. $497 = HEAP32[$496>>2]|0;
  39190. $498 = HEAP32[(20888)>>2]|0;
  39191. $499 = ($497>>>0)>=($498>>>0);
  39192. $not$9$i = ($$0345$i>>>0)>=($498>>>0);
  39193. $500 = $499 & $not$9$i;
  39194. if ($500) {
  39195. $501 = ((($497)) + 12|0);
  39196. HEAP32[$501>>2] = $350;
  39197. HEAP32[$496>>2] = $350;
  39198. $502 = ((($350)) + 8|0);
  39199. HEAP32[$502>>2] = $497;
  39200. $503 = ((($350)) + 12|0);
  39201. HEAP32[$503>>2] = $$0345$i;
  39202. $504 = ((($350)) + 24|0);
  39203. HEAP32[$504>>2] = 0;
  39204. break;
  39205. } else {
  39206. _abort();
  39207. // unreachable;
  39208. }
  39209. }
  39210. }
  39211. } while(0);
  39212. $505 = ((($$4$lcssa$i)) + 8|0);
  39213. $$0 = $505;
  39214. STACKTOP = sp;return ($$0|0);
  39215. } else {
  39216. $$0197 = $249;
  39217. }
  39218. }
  39219. }
  39220. }
  39221. }
  39222. } while(0);
  39223. $506 = HEAP32[(20880)>>2]|0;
  39224. $507 = ($506>>>0)<($$0197>>>0);
  39225. if (!($507)) {
  39226. $508 = (($506) - ($$0197))|0;
  39227. $509 = HEAP32[(20892)>>2]|0;
  39228. $510 = ($508>>>0)>(15);
  39229. if ($510) {
  39230. $511 = (($509) + ($$0197)|0);
  39231. HEAP32[(20892)>>2] = $511;
  39232. HEAP32[(20880)>>2] = $508;
  39233. $512 = $508 | 1;
  39234. $513 = ((($511)) + 4|0);
  39235. HEAP32[$513>>2] = $512;
  39236. $514 = (($511) + ($508)|0);
  39237. HEAP32[$514>>2] = $508;
  39238. $515 = $$0197 | 3;
  39239. $516 = ((($509)) + 4|0);
  39240. HEAP32[$516>>2] = $515;
  39241. } else {
  39242. HEAP32[(20880)>>2] = 0;
  39243. HEAP32[(20892)>>2] = 0;
  39244. $517 = $506 | 3;
  39245. $518 = ((($509)) + 4|0);
  39246. HEAP32[$518>>2] = $517;
  39247. $519 = (($509) + ($506)|0);
  39248. $520 = ((($519)) + 4|0);
  39249. $521 = HEAP32[$520>>2]|0;
  39250. $522 = $521 | 1;
  39251. HEAP32[$520>>2] = $522;
  39252. }
  39253. $523 = ((($509)) + 8|0);
  39254. $$0 = $523;
  39255. STACKTOP = sp;return ($$0|0);
  39256. }
  39257. $524 = HEAP32[(20884)>>2]|0;
  39258. $525 = ($524>>>0)>($$0197>>>0);
  39259. if ($525) {
  39260. $526 = (($524) - ($$0197))|0;
  39261. HEAP32[(20884)>>2] = $526;
  39262. $527 = HEAP32[(20896)>>2]|0;
  39263. $528 = (($527) + ($$0197)|0);
  39264. HEAP32[(20896)>>2] = $528;
  39265. $529 = $526 | 1;
  39266. $530 = ((($528)) + 4|0);
  39267. HEAP32[$530>>2] = $529;
  39268. $531 = $$0197 | 3;
  39269. $532 = ((($527)) + 4|0);
  39270. HEAP32[$532>>2] = $531;
  39271. $533 = ((($527)) + 8|0);
  39272. $$0 = $533;
  39273. STACKTOP = sp;return ($$0|0);
  39274. }
  39275. $534 = HEAP32[5336]|0;
  39276. $535 = ($534|0)==(0);
  39277. if ($535) {
  39278. HEAP32[(21352)>>2] = 4096;
  39279. HEAP32[(21348)>>2] = 4096;
  39280. HEAP32[(21356)>>2] = -1;
  39281. HEAP32[(21360)>>2] = -1;
  39282. HEAP32[(21364)>>2] = 0;
  39283. HEAP32[(21316)>>2] = 0;
  39284. $536 = $1;
  39285. $537 = $536 & -16;
  39286. $538 = $537 ^ 1431655768;
  39287. HEAP32[$1>>2] = $538;
  39288. HEAP32[5336] = $538;
  39289. $542 = 4096;
  39290. } else {
  39291. $$pre$i212 = HEAP32[(21352)>>2]|0;
  39292. $542 = $$pre$i212;
  39293. }
  39294. $539 = (($$0197) + 48)|0;
  39295. $540 = (($$0197) + 47)|0;
  39296. $541 = (($542) + ($540))|0;
  39297. $543 = (0 - ($542))|0;
  39298. $544 = $541 & $543;
  39299. $545 = ($544>>>0)>($$0197>>>0);
  39300. if (!($545)) {
  39301. $$0 = 0;
  39302. STACKTOP = sp;return ($$0|0);
  39303. }
  39304. $546 = HEAP32[(21312)>>2]|0;
  39305. $547 = ($546|0)==(0);
  39306. if (!($547)) {
  39307. $548 = HEAP32[(21304)>>2]|0;
  39308. $549 = (($548) + ($544))|0;
  39309. $550 = ($549>>>0)<=($548>>>0);
  39310. $551 = ($549>>>0)>($546>>>0);
  39311. $or$cond1$i = $550 | $551;
  39312. if ($or$cond1$i) {
  39313. $$0 = 0;
  39314. STACKTOP = sp;return ($$0|0);
  39315. }
  39316. }
  39317. $552 = HEAP32[(21316)>>2]|0;
  39318. $553 = $552 & 4;
  39319. $554 = ($553|0)==(0);
  39320. L244: do {
  39321. if ($554) {
  39322. $555 = HEAP32[(20896)>>2]|0;
  39323. $556 = ($555|0)==(0|0);
  39324. L246: do {
  39325. if ($556) {
  39326. label = 163;
  39327. } else {
  39328. $$0$i$i = (21320);
  39329. while(1) {
  39330. $557 = HEAP32[$$0$i$i>>2]|0;
  39331. $558 = ($557>>>0)>($555>>>0);
  39332. if (!($558)) {
  39333. $559 = ((($$0$i$i)) + 4|0);
  39334. $560 = HEAP32[$559>>2]|0;
  39335. $561 = (($557) + ($560)|0);
  39336. $562 = ($561>>>0)>($555>>>0);
  39337. if ($562) {
  39338. break;
  39339. }
  39340. }
  39341. $563 = ((($$0$i$i)) + 8|0);
  39342. $564 = HEAP32[$563>>2]|0;
  39343. $565 = ($564|0)==(0|0);
  39344. if ($565) {
  39345. label = 163;
  39346. break L246;
  39347. } else {
  39348. $$0$i$i = $564;
  39349. }
  39350. }
  39351. $588 = (($541) - ($524))|0;
  39352. $589 = $588 & $543;
  39353. $590 = ($589>>>0)<(2147483647);
  39354. if ($590) {
  39355. $591 = (_sbrk(($589|0))|0);
  39356. $592 = HEAP32[$$0$i$i>>2]|0;
  39357. $593 = HEAP32[$559>>2]|0;
  39358. $594 = (($592) + ($593)|0);
  39359. $595 = ($591|0)==($594|0);
  39360. if ($595) {
  39361. $596 = ($591|0)==((-1)|0);
  39362. if ($596) {
  39363. $$2234253237$i = $589;
  39364. } else {
  39365. $$723948$i = $589;$$749$i = $591;
  39366. label = 180;
  39367. break L244;
  39368. }
  39369. } else {
  39370. $$2247$ph$i = $591;$$2253$ph$i = $589;
  39371. label = 171;
  39372. }
  39373. } else {
  39374. $$2234253237$i = 0;
  39375. }
  39376. }
  39377. } while(0);
  39378. do {
  39379. if ((label|0) == 163) {
  39380. $566 = (_sbrk(0)|0);
  39381. $567 = ($566|0)==((-1)|0);
  39382. if ($567) {
  39383. $$2234253237$i = 0;
  39384. } else {
  39385. $568 = $566;
  39386. $569 = HEAP32[(21348)>>2]|0;
  39387. $570 = (($569) + -1)|0;
  39388. $571 = $570 & $568;
  39389. $572 = ($571|0)==(0);
  39390. $573 = (($570) + ($568))|0;
  39391. $574 = (0 - ($569))|0;
  39392. $575 = $573 & $574;
  39393. $576 = (($575) - ($568))|0;
  39394. $577 = $572 ? 0 : $576;
  39395. $$$i = (($577) + ($544))|0;
  39396. $578 = HEAP32[(21304)>>2]|0;
  39397. $579 = (($$$i) + ($578))|0;
  39398. $580 = ($$$i>>>0)>($$0197>>>0);
  39399. $581 = ($$$i>>>0)<(2147483647);
  39400. $or$cond$i214 = $580 & $581;
  39401. if ($or$cond$i214) {
  39402. $582 = HEAP32[(21312)>>2]|0;
  39403. $583 = ($582|0)==(0);
  39404. if (!($583)) {
  39405. $584 = ($579>>>0)<=($578>>>0);
  39406. $585 = ($579>>>0)>($582>>>0);
  39407. $or$cond2$i215 = $584 | $585;
  39408. if ($or$cond2$i215) {
  39409. $$2234253237$i = 0;
  39410. break;
  39411. }
  39412. }
  39413. $586 = (_sbrk(($$$i|0))|0);
  39414. $587 = ($586|0)==($566|0);
  39415. if ($587) {
  39416. $$723948$i = $$$i;$$749$i = $566;
  39417. label = 180;
  39418. break L244;
  39419. } else {
  39420. $$2247$ph$i = $586;$$2253$ph$i = $$$i;
  39421. label = 171;
  39422. }
  39423. } else {
  39424. $$2234253237$i = 0;
  39425. }
  39426. }
  39427. }
  39428. } while(0);
  39429. do {
  39430. if ((label|0) == 171) {
  39431. $597 = (0 - ($$2253$ph$i))|0;
  39432. $598 = ($$2247$ph$i|0)!=((-1)|0);
  39433. $599 = ($$2253$ph$i>>>0)<(2147483647);
  39434. $or$cond7$i = $599 & $598;
  39435. $600 = ($539>>>0)>($$2253$ph$i>>>0);
  39436. $or$cond10$i = $600 & $or$cond7$i;
  39437. if (!($or$cond10$i)) {
  39438. $610 = ($$2247$ph$i|0)==((-1)|0);
  39439. if ($610) {
  39440. $$2234253237$i = 0;
  39441. break;
  39442. } else {
  39443. $$723948$i = $$2253$ph$i;$$749$i = $$2247$ph$i;
  39444. label = 180;
  39445. break L244;
  39446. }
  39447. }
  39448. $601 = HEAP32[(21352)>>2]|0;
  39449. $602 = (($540) - ($$2253$ph$i))|0;
  39450. $603 = (($602) + ($601))|0;
  39451. $604 = (0 - ($601))|0;
  39452. $605 = $603 & $604;
  39453. $606 = ($605>>>0)<(2147483647);
  39454. if (!($606)) {
  39455. $$723948$i = $$2253$ph$i;$$749$i = $$2247$ph$i;
  39456. label = 180;
  39457. break L244;
  39458. }
  39459. $607 = (_sbrk(($605|0))|0);
  39460. $608 = ($607|0)==((-1)|0);
  39461. if ($608) {
  39462. (_sbrk(($597|0))|0);
  39463. $$2234253237$i = 0;
  39464. break;
  39465. } else {
  39466. $609 = (($605) + ($$2253$ph$i))|0;
  39467. $$723948$i = $609;$$749$i = $$2247$ph$i;
  39468. label = 180;
  39469. break L244;
  39470. }
  39471. }
  39472. } while(0);
  39473. $611 = HEAP32[(21316)>>2]|0;
  39474. $612 = $611 | 4;
  39475. HEAP32[(21316)>>2] = $612;
  39476. $$4236$i = $$2234253237$i;
  39477. label = 178;
  39478. } else {
  39479. $$4236$i = 0;
  39480. label = 178;
  39481. }
  39482. } while(0);
  39483. if ((label|0) == 178) {
  39484. $613 = ($544>>>0)<(2147483647);
  39485. if ($613) {
  39486. $614 = (_sbrk(($544|0))|0);
  39487. $615 = (_sbrk(0)|0);
  39488. $616 = ($614|0)!=((-1)|0);
  39489. $617 = ($615|0)!=((-1)|0);
  39490. $or$cond5$i = $616 & $617;
  39491. $618 = ($614>>>0)<($615>>>0);
  39492. $or$cond11$i = $618 & $or$cond5$i;
  39493. $619 = $615;
  39494. $620 = $614;
  39495. $621 = (($619) - ($620))|0;
  39496. $622 = (($$0197) + 40)|0;
  39497. $623 = ($621>>>0)>($622>>>0);
  39498. $$$4236$i = $623 ? $621 : $$4236$i;
  39499. $or$cond11$not$i = $or$cond11$i ^ 1;
  39500. $624 = ($614|0)==((-1)|0);
  39501. $not$$i216 = $623 ^ 1;
  39502. $625 = $624 | $not$$i216;
  39503. $or$cond50$i = $625 | $or$cond11$not$i;
  39504. if (!($or$cond50$i)) {
  39505. $$723948$i = $$$4236$i;$$749$i = $614;
  39506. label = 180;
  39507. }
  39508. }
  39509. }
  39510. if ((label|0) == 180) {
  39511. $626 = HEAP32[(21304)>>2]|0;
  39512. $627 = (($626) + ($$723948$i))|0;
  39513. HEAP32[(21304)>>2] = $627;
  39514. $628 = HEAP32[(21308)>>2]|0;
  39515. $629 = ($627>>>0)>($628>>>0);
  39516. if ($629) {
  39517. HEAP32[(21308)>>2] = $627;
  39518. }
  39519. $630 = HEAP32[(20896)>>2]|0;
  39520. $631 = ($630|0)==(0|0);
  39521. do {
  39522. if ($631) {
  39523. $632 = HEAP32[(20888)>>2]|0;
  39524. $633 = ($632|0)==(0|0);
  39525. $634 = ($$749$i>>>0)<($632>>>0);
  39526. $or$cond12$i = $633 | $634;
  39527. if ($or$cond12$i) {
  39528. HEAP32[(20888)>>2] = $$749$i;
  39529. }
  39530. HEAP32[(21320)>>2] = $$749$i;
  39531. HEAP32[(21324)>>2] = $$723948$i;
  39532. HEAP32[(21332)>>2] = 0;
  39533. $635 = HEAP32[5336]|0;
  39534. HEAP32[(20908)>>2] = $635;
  39535. HEAP32[(20904)>>2] = -1;
  39536. $$01$i$i = 0;
  39537. while(1) {
  39538. $636 = $$01$i$i << 1;
  39539. $637 = (20912 + ($636<<2)|0);
  39540. $638 = ((($637)) + 12|0);
  39541. HEAP32[$638>>2] = $637;
  39542. $639 = ((($637)) + 8|0);
  39543. HEAP32[$639>>2] = $637;
  39544. $640 = (($$01$i$i) + 1)|0;
  39545. $exitcond$i$i = ($640|0)==(32);
  39546. if ($exitcond$i$i) {
  39547. break;
  39548. } else {
  39549. $$01$i$i = $640;
  39550. }
  39551. }
  39552. $641 = (($$723948$i) + -40)|0;
  39553. $642 = ((($$749$i)) + 8|0);
  39554. $643 = $642;
  39555. $644 = $643 & 7;
  39556. $645 = ($644|0)==(0);
  39557. $646 = (0 - ($643))|0;
  39558. $647 = $646 & 7;
  39559. $648 = $645 ? 0 : $647;
  39560. $649 = (($$749$i) + ($648)|0);
  39561. $650 = (($641) - ($648))|0;
  39562. HEAP32[(20896)>>2] = $649;
  39563. HEAP32[(20884)>>2] = $650;
  39564. $651 = $650 | 1;
  39565. $652 = ((($649)) + 4|0);
  39566. HEAP32[$652>>2] = $651;
  39567. $653 = (($649) + ($650)|0);
  39568. $654 = ((($653)) + 4|0);
  39569. HEAP32[$654>>2] = 40;
  39570. $655 = HEAP32[(21360)>>2]|0;
  39571. HEAP32[(20900)>>2] = $655;
  39572. } else {
  39573. $$024371$i = (21320);
  39574. while(1) {
  39575. $656 = HEAP32[$$024371$i>>2]|0;
  39576. $657 = ((($$024371$i)) + 4|0);
  39577. $658 = HEAP32[$657>>2]|0;
  39578. $659 = (($656) + ($658)|0);
  39579. $660 = ($$749$i|0)==($659|0);
  39580. if ($660) {
  39581. label = 190;
  39582. break;
  39583. }
  39584. $661 = ((($$024371$i)) + 8|0);
  39585. $662 = HEAP32[$661>>2]|0;
  39586. $663 = ($662|0)==(0|0);
  39587. if ($663) {
  39588. break;
  39589. } else {
  39590. $$024371$i = $662;
  39591. }
  39592. }
  39593. if ((label|0) == 190) {
  39594. $664 = ((($$024371$i)) + 12|0);
  39595. $665 = HEAP32[$664>>2]|0;
  39596. $666 = $665 & 8;
  39597. $667 = ($666|0)==(0);
  39598. if ($667) {
  39599. $668 = ($630>>>0)>=($656>>>0);
  39600. $669 = ($630>>>0)<($$749$i>>>0);
  39601. $or$cond51$i = $669 & $668;
  39602. if ($or$cond51$i) {
  39603. $670 = (($658) + ($$723948$i))|0;
  39604. HEAP32[$657>>2] = $670;
  39605. $671 = HEAP32[(20884)>>2]|0;
  39606. $672 = ((($630)) + 8|0);
  39607. $673 = $672;
  39608. $674 = $673 & 7;
  39609. $675 = ($674|0)==(0);
  39610. $676 = (0 - ($673))|0;
  39611. $677 = $676 & 7;
  39612. $678 = $675 ? 0 : $677;
  39613. $679 = (($630) + ($678)|0);
  39614. $680 = (($$723948$i) - ($678))|0;
  39615. $681 = (($671) + ($680))|0;
  39616. HEAP32[(20896)>>2] = $679;
  39617. HEAP32[(20884)>>2] = $681;
  39618. $682 = $681 | 1;
  39619. $683 = ((($679)) + 4|0);
  39620. HEAP32[$683>>2] = $682;
  39621. $684 = (($679) + ($681)|0);
  39622. $685 = ((($684)) + 4|0);
  39623. HEAP32[$685>>2] = 40;
  39624. $686 = HEAP32[(21360)>>2]|0;
  39625. HEAP32[(20900)>>2] = $686;
  39626. break;
  39627. }
  39628. }
  39629. }
  39630. $687 = HEAP32[(20888)>>2]|0;
  39631. $688 = ($$749$i>>>0)<($687>>>0);
  39632. if ($688) {
  39633. HEAP32[(20888)>>2] = $$749$i;
  39634. $752 = $$749$i;
  39635. } else {
  39636. $752 = $687;
  39637. }
  39638. $689 = (($$749$i) + ($$723948$i)|0);
  39639. $$124470$i = (21320);
  39640. while(1) {
  39641. $690 = HEAP32[$$124470$i>>2]|0;
  39642. $691 = ($690|0)==($689|0);
  39643. if ($691) {
  39644. label = 198;
  39645. break;
  39646. }
  39647. $692 = ((($$124470$i)) + 8|0);
  39648. $693 = HEAP32[$692>>2]|0;
  39649. $694 = ($693|0)==(0|0);
  39650. if ($694) {
  39651. break;
  39652. } else {
  39653. $$124470$i = $693;
  39654. }
  39655. }
  39656. if ((label|0) == 198) {
  39657. $695 = ((($$124470$i)) + 12|0);
  39658. $696 = HEAP32[$695>>2]|0;
  39659. $697 = $696 & 8;
  39660. $698 = ($697|0)==(0);
  39661. if ($698) {
  39662. HEAP32[$$124470$i>>2] = $$749$i;
  39663. $699 = ((($$124470$i)) + 4|0);
  39664. $700 = HEAP32[$699>>2]|0;
  39665. $701 = (($700) + ($$723948$i))|0;
  39666. HEAP32[$699>>2] = $701;
  39667. $702 = ((($$749$i)) + 8|0);
  39668. $703 = $702;
  39669. $704 = $703 & 7;
  39670. $705 = ($704|0)==(0);
  39671. $706 = (0 - ($703))|0;
  39672. $707 = $706 & 7;
  39673. $708 = $705 ? 0 : $707;
  39674. $709 = (($$749$i) + ($708)|0);
  39675. $710 = ((($689)) + 8|0);
  39676. $711 = $710;
  39677. $712 = $711 & 7;
  39678. $713 = ($712|0)==(0);
  39679. $714 = (0 - ($711))|0;
  39680. $715 = $714 & 7;
  39681. $716 = $713 ? 0 : $715;
  39682. $717 = (($689) + ($716)|0);
  39683. $718 = $717;
  39684. $719 = $709;
  39685. $720 = (($718) - ($719))|0;
  39686. $721 = (($709) + ($$0197)|0);
  39687. $722 = (($720) - ($$0197))|0;
  39688. $723 = $$0197 | 3;
  39689. $724 = ((($709)) + 4|0);
  39690. HEAP32[$724>>2] = $723;
  39691. $725 = ($717|0)==($630|0);
  39692. do {
  39693. if ($725) {
  39694. $726 = HEAP32[(20884)>>2]|0;
  39695. $727 = (($726) + ($722))|0;
  39696. HEAP32[(20884)>>2] = $727;
  39697. HEAP32[(20896)>>2] = $721;
  39698. $728 = $727 | 1;
  39699. $729 = ((($721)) + 4|0);
  39700. HEAP32[$729>>2] = $728;
  39701. } else {
  39702. $730 = HEAP32[(20892)>>2]|0;
  39703. $731 = ($717|0)==($730|0);
  39704. if ($731) {
  39705. $732 = HEAP32[(20880)>>2]|0;
  39706. $733 = (($732) + ($722))|0;
  39707. HEAP32[(20880)>>2] = $733;
  39708. HEAP32[(20892)>>2] = $721;
  39709. $734 = $733 | 1;
  39710. $735 = ((($721)) + 4|0);
  39711. HEAP32[$735>>2] = $734;
  39712. $736 = (($721) + ($733)|0);
  39713. HEAP32[$736>>2] = $733;
  39714. break;
  39715. }
  39716. $737 = ((($717)) + 4|0);
  39717. $738 = HEAP32[$737>>2]|0;
  39718. $739 = $738 & 3;
  39719. $740 = ($739|0)==(1);
  39720. if ($740) {
  39721. $741 = $738 & -8;
  39722. $742 = $738 >>> 3;
  39723. $743 = ($738>>>0)<(256);
  39724. L314: do {
  39725. if ($743) {
  39726. $744 = ((($717)) + 8|0);
  39727. $745 = HEAP32[$744>>2]|0;
  39728. $746 = ((($717)) + 12|0);
  39729. $747 = HEAP32[$746>>2]|0;
  39730. $748 = $742 << 1;
  39731. $749 = (20912 + ($748<<2)|0);
  39732. $750 = ($745|0)==($749|0);
  39733. do {
  39734. if (!($750)) {
  39735. $751 = ($745>>>0)<($752>>>0);
  39736. if ($751) {
  39737. _abort();
  39738. // unreachable;
  39739. }
  39740. $753 = ((($745)) + 12|0);
  39741. $754 = HEAP32[$753>>2]|0;
  39742. $755 = ($754|0)==($717|0);
  39743. if ($755) {
  39744. break;
  39745. }
  39746. _abort();
  39747. // unreachable;
  39748. }
  39749. } while(0);
  39750. $756 = ($747|0)==($745|0);
  39751. if ($756) {
  39752. $757 = 1 << $742;
  39753. $758 = $757 ^ -1;
  39754. $759 = HEAP32[5218]|0;
  39755. $760 = $759 & $758;
  39756. HEAP32[5218] = $760;
  39757. break;
  39758. }
  39759. $761 = ($747|0)==($749|0);
  39760. do {
  39761. if ($761) {
  39762. $$pre10$i$i = ((($747)) + 8|0);
  39763. $$pre$phi11$i$iZ2D = $$pre10$i$i;
  39764. } else {
  39765. $762 = ($747>>>0)<($752>>>0);
  39766. if ($762) {
  39767. _abort();
  39768. // unreachable;
  39769. }
  39770. $763 = ((($747)) + 8|0);
  39771. $764 = HEAP32[$763>>2]|0;
  39772. $765 = ($764|0)==($717|0);
  39773. if ($765) {
  39774. $$pre$phi11$i$iZ2D = $763;
  39775. break;
  39776. }
  39777. _abort();
  39778. // unreachable;
  39779. }
  39780. } while(0);
  39781. $766 = ((($745)) + 12|0);
  39782. HEAP32[$766>>2] = $747;
  39783. HEAP32[$$pre$phi11$i$iZ2D>>2] = $745;
  39784. } else {
  39785. $767 = ((($717)) + 24|0);
  39786. $768 = HEAP32[$767>>2]|0;
  39787. $769 = ((($717)) + 12|0);
  39788. $770 = HEAP32[$769>>2]|0;
  39789. $771 = ($770|0)==($717|0);
  39790. do {
  39791. if ($771) {
  39792. $781 = ((($717)) + 16|0);
  39793. $782 = ((($781)) + 4|0);
  39794. $783 = HEAP32[$782>>2]|0;
  39795. $784 = ($783|0)==(0|0);
  39796. if ($784) {
  39797. $785 = HEAP32[$781>>2]|0;
  39798. $786 = ($785|0)==(0|0);
  39799. if ($786) {
  39800. $$3$i$i = 0;
  39801. break;
  39802. } else {
  39803. $$1291$i$i = $785;$$1293$i$i = $781;
  39804. }
  39805. } else {
  39806. $$1291$i$i = $783;$$1293$i$i = $782;
  39807. }
  39808. while(1) {
  39809. $787 = ((($$1291$i$i)) + 20|0);
  39810. $788 = HEAP32[$787>>2]|0;
  39811. $789 = ($788|0)==(0|0);
  39812. if (!($789)) {
  39813. $$1291$i$i = $788;$$1293$i$i = $787;
  39814. continue;
  39815. }
  39816. $790 = ((($$1291$i$i)) + 16|0);
  39817. $791 = HEAP32[$790>>2]|0;
  39818. $792 = ($791|0)==(0|0);
  39819. if ($792) {
  39820. break;
  39821. } else {
  39822. $$1291$i$i = $791;$$1293$i$i = $790;
  39823. }
  39824. }
  39825. $793 = ($$1293$i$i>>>0)<($752>>>0);
  39826. if ($793) {
  39827. _abort();
  39828. // unreachable;
  39829. } else {
  39830. HEAP32[$$1293$i$i>>2] = 0;
  39831. $$3$i$i = $$1291$i$i;
  39832. break;
  39833. }
  39834. } else {
  39835. $772 = ((($717)) + 8|0);
  39836. $773 = HEAP32[$772>>2]|0;
  39837. $774 = ($773>>>0)<($752>>>0);
  39838. if ($774) {
  39839. _abort();
  39840. // unreachable;
  39841. }
  39842. $775 = ((($773)) + 12|0);
  39843. $776 = HEAP32[$775>>2]|0;
  39844. $777 = ($776|0)==($717|0);
  39845. if (!($777)) {
  39846. _abort();
  39847. // unreachable;
  39848. }
  39849. $778 = ((($770)) + 8|0);
  39850. $779 = HEAP32[$778>>2]|0;
  39851. $780 = ($779|0)==($717|0);
  39852. if ($780) {
  39853. HEAP32[$775>>2] = $770;
  39854. HEAP32[$778>>2] = $773;
  39855. $$3$i$i = $770;
  39856. break;
  39857. } else {
  39858. _abort();
  39859. // unreachable;
  39860. }
  39861. }
  39862. } while(0);
  39863. $794 = ($768|0)==(0|0);
  39864. if ($794) {
  39865. break;
  39866. }
  39867. $795 = ((($717)) + 28|0);
  39868. $796 = HEAP32[$795>>2]|0;
  39869. $797 = (21176 + ($796<<2)|0);
  39870. $798 = HEAP32[$797>>2]|0;
  39871. $799 = ($717|0)==($798|0);
  39872. do {
  39873. if ($799) {
  39874. HEAP32[$797>>2] = $$3$i$i;
  39875. $cond$i$i = ($$3$i$i|0)==(0|0);
  39876. if (!($cond$i$i)) {
  39877. break;
  39878. }
  39879. $800 = 1 << $796;
  39880. $801 = $800 ^ -1;
  39881. $802 = HEAP32[(20876)>>2]|0;
  39882. $803 = $802 & $801;
  39883. HEAP32[(20876)>>2] = $803;
  39884. break L314;
  39885. } else {
  39886. $804 = HEAP32[(20888)>>2]|0;
  39887. $805 = ($768>>>0)<($804>>>0);
  39888. if ($805) {
  39889. _abort();
  39890. // unreachable;
  39891. } else {
  39892. $806 = ((($768)) + 16|0);
  39893. $807 = HEAP32[$806>>2]|0;
  39894. $not$$i17$i = ($807|0)!=($717|0);
  39895. $$sink1$i$i = $not$$i17$i&1;
  39896. $808 = (((($768)) + 16|0) + ($$sink1$i$i<<2)|0);
  39897. HEAP32[$808>>2] = $$3$i$i;
  39898. $809 = ($$3$i$i|0)==(0|0);
  39899. if ($809) {
  39900. break L314;
  39901. } else {
  39902. break;
  39903. }
  39904. }
  39905. }
  39906. } while(0);
  39907. $810 = HEAP32[(20888)>>2]|0;
  39908. $811 = ($$3$i$i>>>0)<($810>>>0);
  39909. if ($811) {
  39910. _abort();
  39911. // unreachable;
  39912. }
  39913. $812 = ((($$3$i$i)) + 24|0);
  39914. HEAP32[$812>>2] = $768;
  39915. $813 = ((($717)) + 16|0);
  39916. $814 = HEAP32[$813>>2]|0;
  39917. $815 = ($814|0)==(0|0);
  39918. do {
  39919. if (!($815)) {
  39920. $816 = ($814>>>0)<($810>>>0);
  39921. if ($816) {
  39922. _abort();
  39923. // unreachable;
  39924. } else {
  39925. $817 = ((($$3$i$i)) + 16|0);
  39926. HEAP32[$817>>2] = $814;
  39927. $818 = ((($814)) + 24|0);
  39928. HEAP32[$818>>2] = $$3$i$i;
  39929. break;
  39930. }
  39931. }
  39932. } while(0);
  39933. $819 = ((($813)) + 4|0);
  39934. $820 = HEAP32[$819>>2]|0;
  39935. $821 = ($820|0)==(0|0);
  39936. if ($821) {
  39937. break;
  39938. }
  39939. $822 = HEAP32[(20888)>>2]|0;
  39940. $823 = ($820>>>0)<($822>>>0);
  39941. if ($823) {
  39942. _abort();
  39943. // unreachable;
  39944. } else {
  39945. $824 = ((($$3$i$i)) + 20|0);
  39946. HEAP32[$824>>2] = $820;
  39947. $825 = ((($820)) + 24|0);
  39948. HEAP32[$825>>2] = $$3$i$i;
  39949. break;
  39950. }
  39951. }
  39952. } while(0);
  39953. $826 = (($717) + ($741)|0);
  39954. $827 = (($741) + ($722))|0;
  39955. $$0$i18$i = $826;$$0287$i$i = $827;
  39956. } else {
  39957. $$0$i18$i = $717;$$0287$i$i = $722;
  39958. }
  39959. $828 = ((($$0$i18$i)) + 4|0);
  39960. $829 = HEAP32[$828>>2]|0;
  39961. $830 = $829 & -2;
  39962. HEAP32[$828>>2] = $830;
  39963. $831 = $$0287$i$i | 1;
  39964. $832 = ((($721)) + 4|0);
  39965. HEAP32[$832>>2] = $831;
  39966. $833 = (($721) + ($$0287$i$i)|0);
  39967. HEAP32[$833>>2] = $$0287$i$i;
  39968. $834 = $$0287$i$i >>> 3;
  39969. $835 = ($$0287$i$i>>>0)<(256);
  39970. if ($835) {
  39971. $836 = $834 << 1;
  39972. $837 = (20912 + ($836<<2)|0);
  39973. $838 = HEAP32[5218]|0;
  39974. $839 = 1 << $834;
  39975. $840 = $838 & $839;
  39976. $841 = ($840|0)==(0);
  39977. do {
  39978. if ($841) {
  39979. $842 = $838 | $839;
  39980. HEAP32[5218] = $842;
  39981. $$pre$i19$i = ((($837)) + 8|0);
  39982. $$0295$i$i = $837;$$pre$phi$i20$iZ2D = $$pre$i19$i;
  39983. } else {
  39984. $843 = ((($837)) + 8|0);
  39985. $844 = HEAP32[$843>>2]|0;
  39986. $845 = HEAP32[(20888)>>2]|0;
  39987. $846 = ($844>>>0)<($845>>>0);
  39988. if (!($846)) {
  39989. $$0295$i$i = $844;$$pre$phi$i20$iZ2D = $843;
  39990. break;
  39991. }
  39992. _abort();
  39993. // unreachable;
  39994. }
  39995. } while(0);
  39996. HEAP32[$$pre$phi$i20$iZ2D>>2] = $721;
  39997. $847 = ((($$0295$i$i)) + 12|0);
  39998. HEAP32[$847>>2] = $721;
  39999. $848 = ((($721)) + 8|0);
  40000. HEAP32[$848>>2] = $$0295$i$i;
  40001. $849 = ((($721)) + 12|0);
  40002. HEAP32[$849>>2] = $837;
  40003. break;
  40004. }
  40005. $850 = $$0287$i$i >>> 8;
  40006. $851 = ($850|0)==(0);
  40007. do {
  40008. if ($851) {
  40009. $$0296$i$i = 0;
  40010. } else {
  40011. $852 = ($$0287$i$i>>>0)>(16777215);
  40012. if ($852) {
  40013. $$0296$i$i = 31;
  40014. break;
  40015. }
  40016. $853 = (($850) + 1048320)|0;
  40017. $854 = $853 >>> 16;
  40018. $855 = $854 & 8;
  40019. $856 = $850 << $855;
  40020. $857 = (($856) + 520192)|0;
  40021. $858 = $857 >>> 16;
  40022. $859 = $858 & 4;
  40023. $860 = $859 | $855;
  40024. $861 = $856 << $859;
  40025. $862 = (($861) + 245760)|0;
  40026. $863 = $862 >>> 16;
  40027. $864 = $863 & 2;
  40028. $865 = $860 | $864;
  40029. $866 = (14 - ($865))|0;
  40030. $867 = $861 << $864;
  40031. $868 = $867 >>> 15;
  40032. $869 = (($866) + ($868))|0;
  40033. $870 = $869 << 1;
  40034. $871 = (($869) + 7)|0;
  40035. $872 = $$0287$i$i >>> $871;
  40036. $873 = $872 & 1;
  40037. $874 = $873 | $870;
  40038. $$0296$i$i = $874;
  40039. }
  40040. } while(0);
  40041. $875 = (21176 + ($$0296$i$i<<2)|0);
  40042. $876 = ((($721)) + 28|0);
  40043. HEAP32[$876>>2] = $$0296$i$i;
  40044. $877 = ((($721)) + 16|0);
  40045. $878 = ((($877)) + 4|0);
  40046. HEAP32[$878>>2] = 0;
  40047. HEAP32[$877>>2] = 0;
  40048. $879 = HEAP32[(20876)>>2]|0;
  40049. $880 = 1 << $$0296$i$i;
  40050. $881 = $879 & $880;
  40051. $882 = ($881|0)==(0);
  40052. if ($882) {
  40053. $883 = $879 | $880;
  40054. HEAP32[(20876)>>2] = $883;
  40055. HEAP32[$875>>2] = $721;
  40056. $884 = ((($721)) + 24|0);
  40057. HEAP32[$884>>2] = $875;
  40058. $885 = ((($721)) + 12|0);
  40059. HEAP32[$885>>2] = $721;
  40060. $886 = ((($721)) + 8|0);
  40061. HEAP32[$886>>2] = $721;
  40062. break;
  40063. }
  40064. $887 = HEAP32[$875>>2]|0;
  40065. $888 = ($$0296$i$i|0)==(31);
  40066. $889 = $$0296$i$i >>> 1;
  40067. $890 = (25 - ($889))|0;
  40068. $891 = $888 ? 0 : $890;
  40069. $892 = $$0287$i$i << $891;
  40070. $$0288$i$i = $892;$$0289$i$i = $887;
  40071. while(1) {
  40072. $893 = ((($$0289$i$i)) + 4|0);
  40073. $894 = HEAP32[$893>>2]|0;
  40074. $895 = $894 & -8;
  40075. $896 = ($895|0)==($$0287$i$i|0);
  40076. if ($896) {
  40077. label = 265;
  40078. break;
  40079. }
  40080. $897 = $$0288$i$i >>> 31;
  40081. $898 = (((($$0289$i$i)) + 16|0) + ($897<<2)|0);
  40082. $899 = $$0288$i$i << 1;
  40083. $900 = HEAP32[$898>>2]|0;
  40084. $901 = ($900|0)==(0|0);
  40085. if ($901) {
  40086. label = 262;
  40087. break;
  40088. } else {
  40089. $$0288$i$i = $899;$$0289$i$i = $900;
  40090. }
  40091. }
  40092. if ((label|0) == 262) {
  40093. $902 = HEAP32[(20888)>>2]|0;
  40094. $903 = ($898>>>0)<($902>>>0);
  40095. if ($903) {
  40096. _abort();
  40097. // unreachable;
  40098. } else {
  40099. HEAP32[$898>>2] = $721;
  40100. $904 = ((($721)) + 24|0);
  40101. HEAP32[$904>>2] = $$0289$i$i;
  40102. $905 = ((($721)) + 12|0);
  40103. HEAP32[$905>>2] = $721;
  40104. $906 = ((($721)) + 8|0);
  40105. HEAP32[$906>>2] = $721;
  40106. break;
  40107. }
  40108. }
  40109. else if ((label|0) == 265) {
  40110. $907 = ((($$0289$i$i)) + 8|0);
  40111. $908 = HEAP32[$907>>2]|0;
  40112. $909 = HEAP32[(20888)>>2]|0;
  40113. $910 = ($908>>>0)>=($909>>>0);
  40114. $not$7$i$i = ($$0289$i$i>>>0)>=($909>>>0);
  40115. $911 = $910 & $not$7$i$i;
  40116. if ($911) {
  40117. $912 = ((($908)) + 12|0);
  40118. HEAP32[$912>>2] = $721;
  40119. HEAP32[$907>>2] = $721;
  40120. $913 = ((($721)) + 8|0);
  40121. HEAP32[$913>>2] = $908;
  40122. $914 = ((($721)) + 12|0);
  40123. HEAP32[$914>>2] = $$0289$i$i;
  40124. $915 = ((($721)) + 24|0);
  40125. HEAP32[$915>>2] = 0;
  40126. break;
  40127. } else {
  40128. _abort();
  40129. // unreachable;
  40130. }
  40131. }
  40132. }
  40133. } while(0);
  40134. $1047 = ((($709)) + 8|0);
  40135. $$0 = $1047;
  40136. STACKTOP = sp;return ($$0|0);
  40137. }
  40138. }
  40139. $$0$i$i$i = (21320);
  40140. while(1) {
  40141. $916 = HEAP32[$$0$i$i$i>>2]|0;
  40142. $917 = ($916>>>0)>($630>>>0);
  40143. if (!($917)) {
  40144. $918 = ((($$0$i$i$i)) + 4|0);
  40145. $919 = HEAP32[$918>>2]|0;
  40146. $920 = (($916) + ($919)|0);
  40147. $921 = ($920>>>0)>($630>>>0);
  40148. if ($921) {
  40149. break;
  40150. }
  40151. }
  40152. $922 = ((($$0$i$i$i)) + 8|0);
  40153. $923 = HEAP32[$922>>2]|0;
  40154. $$0$i$i$i = $923;
  40155. }
  40156. $924 = ((($920)) + -47|0);
  40157. $925 = ((($924)) + 8|0);
  40158. $926 = $925;
  40159. $927 = $926 & 7;
  40160. $928 = ($927|0)==(0);
  40161. $929 = (0 - ($926))|0;
  40162. $930 = $929 & 7;
  40163. $931 = $928 ? 0 : $930;
  40164. $932 = (($924) + ($931)|0);
  40165. $933 = ((($630)) + 16|0);
  40166. $934 = ($932>>>0)<($933>>>0);
  40167. $935 = $934 ? $630 : $932;
  40168. $936 = ((($935)) + 8|0);
  40169. $937 = ((($935)) + 24|0);
  40170. $938 = (($$723948$i) + -40)|0;
  40171. $939 = ((($$749$i)) + 8|0);
  40172. $940 = $939;
  40173. $941 = $940 & 7;
  40174. $942 = ($941|0)==(0);
  40175. $943 = (0 - ($940))|0;
  40176. $944 = $943 & 7;
  40177. $945 = $942 ? 0 : $944;
  40178. $946 = (($$749$i) + ($945)|0);
  40179. $947 = (($938) - ($945))|0;
  40180. HEAP32[(20896)>>2] = $946;
  40181. HEAP32[(20884)>>2] = $947;
  40182. $948 = $947 | 1;
  40183. $949 = ((($946)) + 4|0);
  40184. HEAP32[$949>>2] = $948;
  40185. $950 = (($946) + ($947)|0);
  40186. $951 = ((($950)) + 4|0);
  40187. HEAP32[$951>>2] = 40;
  40188. $952 = HEAP32[(21360)>>2]|0;
  40189. HEAP32[(20900)>>2] = $952;
  40190. $953 = ((($935)) + 4|0);
  40191. HEAP32[$953>>2] = 27;
  40192. ;HEAP32[$936>>2]=HEAP32[(21320)>>2]|0;HEAP32[$936+4>>2]=HEAP32[(21320)+4>>2]|0;HEAP32[$936+8>>2]=HEAP32[(21320)+8>>2]|0;HEAP32[$936+12>>2]=HEAP32[(21320)+12>>2]|0;
  40193. HEAP32[(21320)>>2] = $$749$i;
  40194. HEAP32[(21324)>>2] = $$723948$i;
  40195. HEAP32[(21332)>>2] = 0;
  40196. HEAP32[(21328)>>2] = $936;
  40197. $955 = $937;
  40198. while(1) {
  40199. $954 = ((($955)) + 4|0);
  40200. HEAP32[$954>>2] = 7;
  40201. $956 = ((($955)) + 8|0);
  40202. $957 = ($956>>>0)<($920>>>0);
  40203. if ($957) {
  40204. $955 = $954;
  40205. } else {
  40206. break;
  40207. }
  40208. }
  40209. $958 = ($935|0)==($630|0);
  40210. if (!($958)) {
  40211. $959 = $935;
  40212. $960 = $630;
  40213. $961 = (($959) - ($960))|0;
  40214. $962 = HEAP32[$953>>2]|0;
  40215. $963 = $962 & -2;
  40216. HEAP32[$953>>2] = $963;
  40217. $964 = $961 | 1;
  40218. $965 = ((($630)) + 4|0);
  40219. HEAP32[$965>>2] = $964;
  40220. HEAP32[$935>>2] = $961;
  40221. $966 = $961 >>> 3;
  40222. $967 = ($961>>>0)<(256);
  40223. if ($967) {
  40224. $968 = $966 << 1;
  40225. $969 = (20912 + ($968<<2)|0);
  40226. $970 = HEAP32[5218]|0;
  40227. $971 = 1 << $966;
  40228. $972 = $970 & $971;
  40229. $973 = ($972|0)==(0);
  40230. if ($973) {
  40231. $974 = $970 | $971;
  40232. HEAP32[5218] = $974;
  40233. $$pre$i$i = ((($969)) + 8|0);
  40234. $$0211$i$i = $969;$$pre$phi$i$iZ2D = $$pre$i$i;
  40235. } else {
  40236. $975 = ((($969)) + 8|0);
  40237. $976 = HEAP32[$975>>2]|0;
  40238. $977 = HEAP32[(20888)>>2]|0;
  40239. $978 = ($976>>>0)<($977>>>0);
  40240. if ($978) {
  40241. _abort();
  40242. // unreachable;
  40243. } else {
  40244. $$0211$i$i = $976;$$pre$phi$i$iZ2D = $975;
  40245. }
  40246. }
  40247. HEAP32[$$pre$phi$i$iZ2D>>2] = $630;
  40248. $979 = ((($$0211$i$i)) + 12|0);
  40249. HEAP32[$979>>2] = $630;
  40250. $980 = ((($630)) + 8|0);
  40251. HEAP32[$980>>2] = $$0211$i$i;
  40252. $981 = ((($630)) + 12|0);
  40253. HEAP32[$981>>2] = $969;
  40254. break;
  40255. }
  40256. $982 = $961 >>> 8;
  40257. $983 = ($982|0)==(0);
  40258. if ($983) {
  40259. $$0212$i$i = 0;
  40260. } else {
  40261. $984 = ($961>>>0)>(16777215);
  40262. if ($984) {
  40263. $$0212$i$i = 31;
  40264. } else {
  40265. $985 = (($982) + 1048320)|0;
  40266. $986 = $985 >>> 16;
  40267. $987 = $986 & 8;
  40268. $988 = $982 << $987;
  40269. $989 = (($988) + 520192)|0;
  40270. $990 = $989 >>> 16;
  40271. $991 = $990 & 4;
  40272. $992 = $991 | $987;
  40273. $993 = $988 << $991;
  40274. $994 = (($993) + 245760)|0;
  40275. $995 = $994 >>> 16;
  40276. $996 = $995 & 2;
  40277. $997 = $992 | $996;
  40278. $998 = (14 - ($997))|0;
  40279. $999 = $993 << $996;
  40280. $1000 = $999 >>> 15;
  40281. $1001 = (($998) + ($1000))|0;
  40282. $1002 = $1001 << 1;
  40283. $1003 = (($1001) + 7)|0;
  40284. $1004 = $961 >>> $1003;
  40285. $1005 = $1004 & 1;
  40286. $1006 = $1005 | $1002;
  40287. $$0212$i$i = $1006;
  40288. }
  40289. }
  40290. $1007 = (21176 + ($$0212$i$i<<2)|0);
  40291. $1008 = ((($630)) + 28|0);
  40292. HEAP32[$1008>>2] = $$0212$i$i;
  40293. $1009 = ((($630)) + 20|0);
  40294. HEAP32[$1009>>2] = 0;
  40295. HEAP32[$933>>2] = 0;
  40296. $1010 = HEAP32[(20876)>>2]|0;
  40297. $1011 = 1 << $$0212$i$i;
  40298. $1012 = $1010 & $1011;
  40299. $1013 = ($1012|0)==(0);
  40300. if ($1013) {
  40301. $1014 = $1010 | $1011;
  40302. HEAP32[(20876)>>2] = $1014;
  40303. HEAP32[$1007>>2] = $630;
  40304. $1015 = ((($630)) + 24|0);
  40305. HEAP32[$1015>>2] = $1007;
  40306. $1016 = ((($630)) + 12|0);
  40307. HEAP32[$1016>>2] = $630;
  40308. $1017 = ((($630)) + 8|0);
  40309. HEAP32[$1017>>2] = $630;
  40310. break;
  40311. }
  40312. $1018 = HEAP32[$1007>>2]|0;
  40313. $1019 = ($$0212$i$i|0)==(31);
  40314. $1020 = $$0212$i$i >>> 1;
  40315. $1021 = (25 - ($1020))|0;
  40316. $1022 = $1019 ? 0 : $1021;
  40317. $1023 = $961 << $1022;
  40318. $$0206$i$i = $1023;$$0207$i$i = $1018;
  40319. while(1) {
  40320. $1024 = ((($$0207$i$i)) + 4|0);
  40321. $1025 = HEAP32[$1024>>2]|0;
  40322. $1026 = $1025 & -8;
  40323. $1027 = ($1026|0)==($961|0);
  40324. if ($1027) {
  40325. label = 292;
  40326. break;
  40327. }
  40328. $1028 = $$0206$i$i >>> 31;
  40329. $1029 = (((($$0207$i$i)) + 16|0) + ($1028<<2)|0);
  40330. $1030 = $$0206$i$i << 1;
  40331. $1031 = HEAP32[$1029>>2]|0;
  40332. $1032 = ($1031|0)==(0|0);
  40333. if ($1032) {
  40334. label = 289;
  40335. break;
  40336. } else {
  40337. $$0206$i$i = $1030;$$0207$i$i = $1031;
  40338. }
  40339. }
  40340. if ((label|0) == 289) {
  40341. $1033 = HEAP32[(20888)>>2]|0;
  40342. $1034 = ($1029>>>0)<($1033>>>0);
  40343. if ($1034) {
  40344. _abort();
  40345. // unreachable;
  40346. } else {
  40347. HEAP32[$1029>>2] = $630;
  40348. $1035 = ((($630)) + 24|0);
  40349. HEAP32[$1035>>2] = $$0207$i$i;
  40350. $1036 = ((($630)) + 12|0);
  40351. HEAP32[$1036>>2] = $630;
  40352. $1037 = ((($630)) + 8|0);
  40353. HEAP32[$1037>>2] = $630;
  40354. break;
  40355. }
  40356. }
  40357. else if ((label|0) == 292) {
  40358. $1038 = ((($$0207$i$i)) + 8|0);
  40359. $1039 = HEAP32[$1038>>2]|0;
  40360. $1040 = HEAP32[(20888)>>2]|0;
  40361. $1041 = ($1039>>>0)>=($1040>>>0);
  40362. $not$$i$i = ($$0207$i$i>>>0)>=($1040>>>0);
  40363. $1042 = $1041 & $not$$i$i;
  40364. if ($1042) {
  40365. $1043 = ((($1039)) + 12|0);
  40366. HEAP32[$1043>>2] = $630;
  40367. HEAP32[$1038>>2] = $630;
  40368. $1044 = ((($630)) + 8|0);
  40369. HEAP32[$1044>>2] = $1039;
  40370. $1045 = ((($630)) + 12|0);
  40371. HEAP32[$1045>>2] = $$0207$i$i;
  40372. $1046 = ((($630)) + 24|0);
  40373. HEAP32[$1046>>2] = 0;
  40374. break;
  40375. } else {
  40376. _abort();
  40377. // unreachable;
  40378. }
  40379. }
  40380. }
  40381. }
  40382. } while(0);
  40383. $1048 = HEAP32[(20884)>>2]|0;
  40384. $1049 = ($1048>>>0)>($$0197>>>0);
  40385. if ($1049) {
  40386. $1050 = (($1048) - ($$0197))|0;
  40387. HEAP32[(20884)>>2] = $1050;
  40388. $1051 = HEAP32[(20896)>>2]|0;
  40389. $1052 = (($1051) + ($$0197)|0);
  40390. HEAP32[(20896)>>2] = $1052;
  40391. $1053 = $1050 | 1;
  40392. $1054 = ((($1052)) + 4|0);
  40393. HEAP32[$1054>>2] = $1053;
  40394. $1055 = $$0197 | 3;
  40395. $1056 = ((($1051)) + 4|0);
  40396. HEAP32[$1056>>2] = $1055;
  40397. $1057 = ((($1051)) + 8|0);
  40398. $$0 = $1057;
  40399. STACKTOP = sp;return ($$0|0);
  40400. }
  40401. }
  40402. $1058 = (___errno_location()|0);
  40403. HEAP32[$1058>>2] = 12;
  40404. $$0 = 0;
  40405. STACKTOP = sp;return ($$0|0);
  40406. }
  40407. function _free($0) {
  40408. $0 = $0|0;
  40409. var $$0212$i = 0, $$0212$in$i = 0, $$0383 = 0, $$0384 = 0, $$0396 = 0, $$0403 = 0, $$1 = 0, $$1382 = 0, $$1387 = 0, $$1390 = 0, $$1398 = 0, $$1402 = 0, $$2 = 0, $$3 = 0, $$3400 = 0, $$pre = 0, $$pre$phi443Z2D = 0, $$pre$phi445Z2D = 0, $$pre$phiZ2D = 0, $$pre442 = 0;
  40410. var $$pre444 = 0, $$sink3 = 0, $$sink5 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0;
  40411. var $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0;
  40412. var $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0;
  40413. var $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0;
  40414. var $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0;
  40415. var $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0;
  40416. var $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0;
  40417. var $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0;
  40418. var $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0;
  40419. var $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0;
  40420. var $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0;
  40421. var $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0;
  40422. var $312 = 0, $313 = 0, $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0;
  40423. var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0;
  40424. var $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0;
  40425. var $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0;
  40426. var $99 = 0, $cond421 = 0, $cond422 = 0, $not$ = 0, $not$405 = 0, $not$437 = 0, label = 0, sp = 0;
  40427. sp = STACKTOP;
  40428. $1 = ($0|0)==(0|0);
  40429. if ($1) {
  40430. return;
  40431. }
  40432. $2 = ((($0)) + -8|0);
  40433. $3 = HEAP32[(20888)>>2]|0;
  40434. $4 = ($2>>>0)<($3>>>0);
  40435. if ($4) {
  40436. _abort();
  40437. // unreachable;
  40438. }
  40439. $5 = ((($0)) + -4|0);
  40440. $6 = HEAP32[$5>>2]|0;
  40441. $7 = $6 & 3;
  40442. $8 = ($7|0)==(1);
  40443. if ($8) {
  40444. _abort();
  40445. // unreachable;
  40446. }
  40447. $9 = $6 & -8;
  40448. $10 = (($2) + ($9)|0);
  40449. $11 = $6 & 1;
  40450. $12 = ($11|0)==(0);
  40451. L10: do {
  40452. if ($12) {
  40453. $13 = HEAP32[$2>>2]|0;
  40454. $14 = ($7|0)==(0);
  40455. if ($14) {
  40456. return;
  40457. }
  40458. $15 = (0 - ($13))|0;
  40459. $16 = (($2) + ($15)|0);
  40460. $17 = (($13) + ($9))|0;
  40461. $18 = ($16>>>0)<($3>>>0);
  40462. if ($18) {
  40463. _abort();
  40464. // unreachable;
  40465. }
  40466. $19 = HEAP32[(20892)>>2]|0;
  40467. $20 = ($16|0)==($19|0);
  40468. if ($20) {
  40469. $104 = ((($10)) + 4|0);
  40470. $105 = HEAP32[$104>>2]|0;
  40471. $106 = $105 & 3;
  40472. $107 = ($106|0)==(3);
  40473. if (!($107)) {
  40474. $$1 = $16;$$1382 = $17;$113 = $16;
  40475. break;
  40476. }
  40477. $108 = (($16) + ($17)|0);
  40478. $109 = ((($16)) + 4|0);
  40479. $110 = $17 | 1;
  40480. $111 = $105 & -2;
  40481. HEAP32[(20880)>>2] = $17;
  40482. HEAP32[$104>>2] = $111;
  40483. HEAP32[$109>>2] = $110;
  40484. HEAP32[$108>>2] = $17;
  40485. return;
  40486. }
  40487. $21 = $13 >>> 3;
  40488. $22 = ($13>>>0)<(256);
  40489. if ($22) {
  40490. $23 = ((($16)) + 8|0);
  40491. $24 = HEAP32[$23>>2]|0;
  40492. $25 = ((($16)) + 12|0);
  40493. $26 = HEAP32[$25>>2]|0;
  40494. $27 = $21 << 1;
  40495. $28 = (20912 + ($27<<2)|0);
  40496. $29 = ($24|0)==($28|0);
  40497. if (!($29)) {
  40498. $30 = ($24>>>0)<($3>>>0);
  40499. if ($30) {
  40500. _abort();
  40501. // unreachable;
  40502. }
  40503. $31 = ((($24)) + 12|0);
  40504. $32 = HEAP32[$31>>2]|0;
  40505. $33 = ($32|0)==($16|0);
  40506. if (!($33)) {
  40507. _abort();
  40508. // unreachable;
  40509. }
  40510. }
  40511. $34 = ($26|0)==($24|0);
  40512. if ($34) {
  40513. $35 = 1 << $21;
  40514. $36 = $35 ^ -1;
  40515. $37 = HEAP32[5218]|0;
  40516. $38 = $37 & $36;
  40517. HEAP32[5218] = $38;
  40518. $$1 = $16;$$1382 = $17;$113 = $16;
  40519. break;
  40520. }
  40521. $39 = ($26|0)==($28|0);
  40522. if ($39) {
  40523. $$pre444 = ((($26)) + 8|0);
  40524. $$pre$phi445Z2D = $$pre444;
  40525. } else {
  40526. $40 = ($26>>>0)<($3>>>0);
  40527. if ($40) {
  40528. _abort();
  40529. // unreachable;
  40530. }
  40531. $41 = ((($26)) + 8|0);
  40532. $42 = HEAP32[$41>>2]|0;
  40533. $43 = ($42|0)==($16|0);
  40534. if ($43) {
  40535. $$pre$phi445Z2D = $41;
  40536. } else {
  40537. _abort();
  40538. // unreachable;
  40539. }
  40540. }
  40541. $44 = ((($24)) + 12|0);
  40542. HEAP32[$44>>2] = $26;
  40543. HEAP32[$$pre$phi445Z2D>>2] = $24;
  40544. $$1 = $16;$$1382 = $17;$113 = $16;
  40545. break;
  40546. }
  40547. $45 = ((($16)) + 24|0);
  40548. $46 = HEAP32[$45>>2]|0;
  40549. $47 = ((($16)) + 12|0);
  40550. $48 = HEAP32[$47>>2]|0;
  40551. $49 = ($48|0)==($16|0);
  40552. do {
  40553. if ($49) {
  40554. $59 = ((($16)) + 16|0);
  40555. $60 = ((($59)) + 4|0);
  40556. $61 = HEAP32[$60>>2]|0;
  40557. $62 = ($61|0)==(0|0);
  40558. if ($62) {
  40559. $63 = HEAP32[$59>>2]|0;
  40560. $64 = ($63|0)==(0|0);
  40561. if ($64) {
  40562. $$3 = 0;
  40563. break;
  40564. } else {
  40565. $$1387 = $63;$$1390 = $59;
  40566. }
  40567. } else {
  40568. $$1387 = $61;$$1390 = $60;
  40569. }
  40570. while(1) {
  40571. $65 = ((($$1387)) + 20|0);
  40572. $66 = HEAP32[$65>>2]|0;
  40573. $67 = ($66|0)==(0|0);
  40574. if (!($67)) {
  40575. $$1387 = $66;$$1390 = $65;
  40576. continue;
  40577. }
  40578. $68 = ((($$1387)) + 16|0);
  40579. $69 = HEAP32[$68>>2]|0;
  40580. $70 = ($69|0)==(0|0);
  40581. if ($70) {
  40582. break;
  40583. } else {
  40584. $$1387 = $69;$$1390 = $68;
  40585. }
  40586. }
  40587. $71 = ($$1390>>>0)<($3>>>0);
  40588. if ($71) {
  40589. _abort();
  40590. // unreachable;
  40591. } else {
  40592. HEAP32[$$1390>>2] = 0;
  40593. $$3 = $$1387;
  40594. break;
  40595. }
  40596. } else {
  40597. $50 = ((($16)) + 8|0);
  40598. $51 = HEAP32[$50>>2]|0;
  40599. $52 = ($51>>>0)<($3>>>0);
  40600. if ($52) {
  40601. _abort();
  40602. // unreachable;
  40603. }
  40604. $53 = ((($51)) + 12|0);
  40605. $54 = HEAP32[$53>>2]|0;
  40606. $55 = ($54|0)==($16|0);
  40607. if (!($55)) {
  40608. _abort();
  40609. // unreachable;
  40610. }
  40611. $56 = ((($48)) + 8|0);
  40612. $57 = HEAP32[$56>>2]|0;
  40613. $58 = ($57|0)==($16|0);
  40614. if ($58) {
  40615. HEAP32[$53>>2] = $48;
  40616. HEAP32[$56>>2] = $51;
  40617. $$3 = $48;
  40618. break;
  40619. } else {
  40620. _abort();
  40621. // unreachable;
  40622. }
  40623. }
  40624. } while(0);
  40625. $72 = ($46|0)==(0|0);
  40626. if ($72) {
  40627. $$1 = $16;$$1382 = $17;$113 = $16;
  40628. } else {
  40629. $73 = ((($16)) + 28|0);
  40630. $74 = HEAP32[$73>>2]|0;
  40631. $75 = (21176 + ($74<<2)|0);
  40632. $76 = HEAP32[$75>>2]|0;
  40633. $77 = ($16|0)==($76|0);
  40634. do {
  40635. if ($77) {
  40636. HEAP32[$75>>2] = $$3;
  40637. $cond421 = ($$3|0)==(0|0);
  40638. if ($cond421) {
  40639. $78 = 1 << $74;
  40640. $79 = $78 ^ -1;
  40641. $80 = HEAP32[(20876)>>2]|0;
  40642. $81 = $80 & $79;
  40643. HEAP32[(20876)>>2] = $81;
  40644. $$1 = $16;$$1382 = $17;$113 = $16;
  40645. break L10;
  40646. }
  40647. } else {
  40648. $82 = HEAP32[(20888)>>2]|0;
  40649. $83 = ($46>>>0)<($82>>>0);
  40650. if ($83) {
  40651. _abort();
  40652. // unreachable;
  40653. } else {
  40654. $84 = ((($46)) + 16|0);
  40655. $85 = HEAP32[$84>>2]|0;
  40656. $not$405 = ($85|0)!=($16|0);
  40657. $$sink3 = $not$405&1;
  40658. $86 = (((($46)) + 16|0) + ($$sink3<<2)|0);
  40659. HEAP32[$86>>2] = $$3;
  40660. $87 = ($$3|0)==(0|0);
  40661. if ($87) {
  40662. $$1 = $16;$$1382 = $17;$113 = $16;
  40663. break L10;
  40664. } else {
  40665. break;
  40666. }
  40667. }
  40668. }
  40669. } while(0);
  40670. $88 = HEAP32[(20888)>>2]|0;
  40671. $89 = ($$3>>>0)<($88>>>0);
  40672. if ($89) {
  40673. _abort();
  40674. // unreachable;
  40675. }
  40676. $90 = ((($$3)) + 24|0);
  40677. HEAP32[$90>>2] = $46;
  40678. $91 = ((($16)) + 16|0);
  40679. $92 = HEAP32[$91>>2]|0;
  40680. $93 = ($92|0)==(0|0);
  40681. do {
  40682. if (!($93)) {
  40683. $94 = ($92>>>0)<($88>>>0);
  40684. if ($94) {
  40685. _abort();
  40686. // unreachable;
  40687. } else {
  40688. $95 = ((($$3)) + 16|0);
  40689. HEAP32[$95>>2] = $92;
  40690. $96 = ((($92)) + 24|0);
  40691. HEAP32[$96>>2] = $$3;
  40692. break;
  40693. }
  40694. }
  40695. } while(0);
  40696. $97 = ((($91)) + 4|0);
  40697. $98 = HEAP32[$97>>2]|0;
  40698. $99 = ($98|0)==(0|0);
  40699. if ($99) {
  40700. $$1 = $16;$$1382 = $17;$113 = $16;
  40701. } else {
  40702. $100 = HEAP32[(20888)>>2]|0;
  40703. $101 = ($98>>>0)<($100>>>0);
  40704. if ($101) {
  40705. _abort();
  40706. // unreachable;
  40707. } else {
  40708. $102 = ((($$3)) + 20|0);
  40709. HEAP32[$102>>2] = $98;
  40710. $103 = ((($98)) + 24|0);
  40711. HEAP32[$103>>2] = $$3;
  40712. $$1 = $16;$$1382 = $17;$113 = $16;
  40713. break;
  40714. }
  40715. }
  40716. }
  40717. } else {
  40718. $$1 = $2;$$1382 = $9;$113 = $2;
  40719. }
  40720. } while(0);
  40721. $112 = ($113>>>0)<($10>>>0);
  40722. if (!($112)) {
  40723. _abort();
  40724. // unreachable;
  40725. }
  40726. $114 = ((($10)) + 4|0);
  40727. $115 = HEAP32[$114>>2]|0;
  40728. $116 = $115 & 1;
  40729. $117 = ($116|0)==(0);
  40730. if ($117) {
  40731. _abort();
  40732. // unreachable;
  40733. }
  40734. $118 = $115 & 2;
  40735. $119 = ($118|0)==(0);
  40736. if ($119) {
  40737. $120 = HEAP32[(20896)>>2]|0;
  40738. $121 = ($10|0)==($120|0);
  40739. $122 = HEAP32[(20892)>>2]|0;
  40740. if ($121) {
  40741. $123 = HEAP32[(20884)>>2]|0;
  40742. $124 = (($123) + ($$1382))|0;
  40743. HEAP32[(20884)>>2] = $124;
  40744. HEAP32[(20896)>>2] = $$1;
  40745. $125 = $124 | 1;
  40746. $126 = ((($$1)) + 4|0);
  40747. HEAP32[$126>>2] = $125;
  40748. $127 = ($$1|0)==($122|0);
  40749. if (!($127)) {
  40750. return;
  40751. }
  40752. HEAP32[(20892)>>2] = 0;
  40753. HEAP32[(20880)>>2] = 0;
  40754. return;
  40755. }
  40756. $128 = ($10|0)==($122|0);
  40757. if ($128) {
  40758. $129 = HEAP32[(20880)>>2]|0;
  40759. $130 = (($129) + ($$1382))|0;
  40760. HEAP32[(20880)>>2] = $130;
  40761. HEAP32[(20892)>>2] = $113;
  40762. $131 = $130 | 1;
  40763. $132 = ((($$1)) + 4|0);
  40764. HEAP32[$132>>2] = $131;
  40765. $133 = (($113) + ($130)|0);
  40766. HEAP32[$133>>2] = $130;
  40767. return;
  40768. }
  40769. $134 = $115 & -8;
  40770. $135 = (($134) + ($$1382))|0;
  40771. $136 = $115 >>> 3;
  40772. $137 = ($115>>>0)<(256);
  40773. L108: do {
  40774. if ($137) {
  40775. $138 = ((($10)) + 8|0);
  40776. $139 = HEAP32[$138>>2]|0;
  40777. $140 = ((($10)) + 12|0);
  40778. $141 = HEAP32[$140>>2]|0;
  40779. $142 = $136 << 1;
  40780. $143 = (20912 + ($142<<2)|0);
  40781. $144 = ($139|0)==($143|0);
  40782. if (!($144)) {
  40783. $145 = HEAP32[(20888)>>2]|0;
  40784. $146 = ($139>>>0)<($145>>>0);
  40785. if ($146) {
  40786. _abort();
  40787. // unreachable;
  40788. }
  40789. $147 = ((($139)) + 12|0);
  40790. $148 = HEAP32[$147>>2]|0;
  40791. $149 = ($148|0)==($10|0);
  40792. if (!($149)) {
  40793. _abort();
  40794. // unreachable;
  40795. }
  40796. }
  40797. $150 = ($141|0)==($139|0);
  40798. if ($150) {
  40799. $151 = 1 << $136;
  40800. $152 = $151 ^ -1;
  40801. $153 = HEAP32[5218]|0;
  40802. $154 = $153 & $152;
  40803. HEAP32[5218] = $154;
  40804. break;
  40805. }
  40806. $155 = ($141|0)==($143|0);
  40807. if ($155) {
  40808. $$pre442 = ((($141)) + 8|0);
  40809. $$pre$phi443Z2D = $$pre442;
  40810. } else {
  40811. $156 = HEAP32[(20888)>>2]|0;
  40812. $157 = ($141>>>0)<($156>>>0);
  40813. if ($157) {
  40814. _abort();
  40815. // unreachable;
  40816. }
  40817. $158 = ((($141)) + 8|0);
  40818. $159 = HEAP32[$158>>2]|0;
  40819. $160 = ($159|0)==($10|0);
  40820. if ($160) {
  40821. $$pre$phi443Z2D = $158;
  40822. } else {
  40823. _abort();
  40824. // unreachable;
  40825. }
  40826. }
  40827. $161 = ((($139)) + 12|0);
  40828. HEAP32[$161>>2] = $141;
  40829. HEAP32[$$pre$phi443Z2D>>2] = $139;
  40830. } else {
  40831. $162 = ((($10)) + 24|0);
  40832. $163 = HEAP32[$162>>2]|0;
  40833. $164 = ((($10)) + 12|0);
  40834. $165 = HEAP32[$164>>2]|0;
  40835. $166 = ($165|0)==($10|0);
  40836. do {
  40837. if ($166) {
  40838. $177 = ((($10)) + 16|0);
  40839. $178 = ((($177)) + 4|0);
  40840. $179 = HEAP32[$178>>2]|0;
  40841. $180 = ($179|0)==(0|0);
  40842. if ($180) {
  40843. $181 = HEAP32[$177>>2]|0;
  40844. $182 = ($181|0)==(0|0);
  40845. if ($182) {
  40846. $$3400 = 0;
  40847. break;
  40848. } else {
  40849. $$1398 = $181;$$1402 = $177;
  40850. }
  40851. } else {
  40852. $$1398 = $179;$$1402 = $178;
  40853. }
  40854. while(1) {
  40855. $183 = ((($$1398)) + 20|0);
  40856. $184 = HEAP32[$183>>2]|0;
  40857. $185 = ($184|0)==(0|0);
  40858. if (!($185)) {
  40859. $$1398 = $184;$$1402 = $183;
  40860. continue;
  40861. }
  40862. $186 = ((($$1398)) + 16|0);
  40863. $187 = HEAP32[$186>>2]|0;
  40864. $188 = ($187|0)==(0|0);
  40865. if ($188) {
  40866. break;
  40867. } else {
  40868. $$1398 = $187;$$1402 = $186;
  40869. }
  40870. }
  40871. $189 = HEAP32[(20888)>>2]|0;
  40872. $190 = ($$1402>>>0)<($189>>>0);
  40873. if ($190) {
  40874. _abort();
  40875. // unreachable;
  40876. } else {
  40877. HEAP32[$$1402>>2] = 0;
  40878. $$3400 = $$1398;
  40879. break;
  40880. }
  40881. } else {
  40882. $167 = ((($10)) + 8|0);
  40883. $168 = HEAP32[$167>>2]|0;
  40884. $169 = HEAP32[(20888)>>2]|0;
  40885. $170 = ($168>>>0)<($169>>>0);
  40886. if ($170) {
  40887. _abort();
  40888. // unreachable;
  40889. }
  40890. $171 = ((($168)) + 12|0);
  40891. $172 = HEAP32[$171>>2]|0;
  40892. $173 = ($172|0)==($10|0);
  40893. if (!($173)) {
  40894. _abort();
  40895. // unreachable;
  40896. }
  40897. $174 = ((($165)) + 8|0);
  40898. $175 = HEAP32[$174>>2]|0;
  40899. $176 = ($175|0)==($10|0);
  40900. if ($176) {
  40901. HEAP32[$171>>2] = $165;
  40902. HEAP32[$174>>2] = $168;
  40903. $$3400 = $165;
  40904. break;
  40905. } else {
  40906. _abort();
  40907. // unreachable;
  40908. }
  40909. }
  40910. } while(0);
  40911. $191 = ($163|0)==(0|0);
  40912. if (!($191)) {
  40913. $192 = ((($10)) + 28|0);
  40914. $193 = HEAP32[$192>>2]|0;
  40915. $194 = (21176 + ($193<<2)|0);
  40916. $195 = HEAP32[$194>>2]|0;
  40917. $196 = ($10|0)==($195|0);
  40918. do {
  40919. if ($196) {
  40920. HEAP32[$194>>2] = $$3400;
  40921. $cond422 = ($$3400|0)==(0|0);
  40922. if ($cond422) {
  40923. $197 = 1 << $193;
  40924. $198 = $197 ^ -1;
  40925. $199 = HEAP32[(20876)>>2]|0;
  40926. $200 = $199 & $198;
  40927. HEAP32[(20876)>>2] = $200;
  40928. break L108;
  40929. }
  40930. } else {
  40931. $201 = HEAP32[(20888)>>2]|0;
  40932. $202 = ($163>>>0)<($201>>>0);
  40933. if ($202) {
  40934. _abort();
  40935. // unreachable;
  40936. } else {
  40937. $203 = ((($163)) + 16|0);
  40938. $204 = HEAP32[$203>>2]|0;
  40939. $not$ = ($204|0)!=($10|0);
  40940. $$sink5 = $not$&1;
  40941. $205 = (((($163)) + 16|0) + ($$sink5<<2)|0);
  40942. HEAP32[$205>>2] = $$3400;
  40943. $206 = ($$3400|0)==(0|0);
  40944. if ($206) {
  40945. break L108;
  40946. } else {
  40947. break;
  40948. }
  40949. }
  40950. }
  40951. } while(0);
  40952. $207 = HEAP32[(20888)>>2]|0;
  40953. $208 = ($$3400>>>0)<($207>>>0);
  40954. if ($208) {
  40955. _abort();
  40956. // unreachable;
  40957. }
  40958. $209 = ((($$3400)) + 24|0);
  40959. HEAP32[$209>>2] = $163;
  40960. $210 = ((($10)) + 16|0);
  40961. $211 = HEAP32[$210>>2]|0;
  40962. $212 = ($211|0)==(0|0);
  40963. do {
  40964. if (!($212)) {
  40965. $213 = ($211>>>0)<($207>>>0);
  40966. if ($213) {
  40967. _abort();
  40968. // unreachable;
  40969. } else {
  40970. $214 = ((($$3400)) + 16|0);
  40971. HEAP32[$214>>2] = $211;
  40972. $215 = ((($211)) + 24|0);
  40973. HEAP32[$215>>2] = $$3400;
  40974. break;
  40975. }
  40976. }
  40977. } while(0);
  40978. $216 = ((($210)) + 4|0);
  40979. $217 = HEAP32[$216>>2]|0;
  40980. $218 = ($217|0)==(0|0);
  40981. if (!($218)) {
  40982. $219 = HEAP32[(20888)>>2]|0;
  40983. $220 = ($217>>>0)<($219>>>0);
  40984. if ($220) {
  40985. _abort();
  40986. // unreachable;
  40987. } else {
  40988. $221 = ((($$3400)) + 20|0);
  40989. HEAP32[$221>>2] = $217;
  40990. $222 = ((($217)) + 24|0);
  40991. HEAP32[$222>>2] = $$3400;
  40992. break;
  40993. }
  40994. }
  40995. }
  40996. }
  40997. } while(0);
  40998. $223 = $135 | 1;
  40999. $224 = ((($$1)) + 4|0);
  41000. HEAP32[$224>>2] = $223;
  41001. $225 = (($113) + ($135)|0);
  41002. HEAP32[$225>>2] = $135;
  41003. $226 = HEAP32[(20892)>>2]|0;
  41004. $227 = ($$1|0)==($226|0);
  41005. if ($227) {
  41006. HEAP32[(20880)>>2] = $135;
  41007. return;
  41008. } else {
  41009. $$2 = $135;
  41010. }
  41011. } else {
  41012. $228 = $115 & -2;
  41013. HEAP32[$114>>2] = $228;
  41014. $229 = $$1382 | 1;
  41015. $230 = ((($$1)) + 4|0);
  41016. HEAP32[$230>>2] = $229;
  41017. $231 = (($113) + ($$1382)|0);
  41018. HEAP32[$231>>2] = $$1382;
  41019. $$2 = $$1382;
  41020. }
  41021. $232 = $$2 >>> 3;
  41022. $233 = ($$2>>>0)<(256);
  41023. if ($233) {
  41024. $234 = $232 << 1;
  41025. $235 = (20912 + ($234<<2)|0);
  41026. $236 = HEAP32[5218]|0;
  41027. $237 = 1 << $232;
  41028. $238 = $236 & $237;
  41029. $239 = ($238|0)==(0);
  41030. if ($239) {
  41031. $240 = $236 | $237;
  41032. HEAP32[5218] = $240;
  41033. $$pre = ((($235)) + 8|0);
  41034. $$0403 = $235;$$pre$phiZ2D = $$pre;
  41035. } else {
  41036. $241 = ((($235)) + 8|0);
  41037. $242 = HEAP32[$241>>2]|0;
  41038. $243 = HEAP32[(20888)>>2]|0;
  41039. $244 = ($242>>>0)<($243>>>0);
  41040. if ($244) {
  41041. _abort();
  41042. // unreachable;
  41043. } else {
  41044. $$0403 = $242;$$pre$phiZ2D = $241;
  41045. }
  41046. }
  41047. HEAP32[$$pre$phiZ2D>>2] = $$1;
  41048. $245 = ((($$0403)) + 12|0);
  41049. HEAP32[$245>>2] = $$1;
  41050. $246 = ((($$1)) + 8|0);
  41051. HEAP32[$246>>2] = $$0403;
  41052. $247 = ((($$1)) + 12|0);
  41053. HEAP32[$247>>2] = $235;
  41054. return;
  41055. }
  41056. $248 = $$2 >>> 8;
  41057. $249 = ($248|0)==(0);
  41058. if ($249) {
  41059. $$0396 = 0;
  41060. } else {
  41061. $250 = ($$2>>>0)>(16777215);
  41062. if ($250) {
  41063. $$0396 = 31;
  41064. } else {
  41065. $251 = (($248) + 1048320)|0;
  41066. $252 = $251 >>> 16;
  41067. $253 = $252 & 8;
  41068. $254 = $248 << $253;
  41069. $255 = (($254) + 520192)|0;
  41070. $256 = $255 >>> 16;
  41071. $257 = $256 & 4;
  41072. $258 = $257 | $253;
  41073. $259 = $254 << $257;
  41074. $260 = (($259) + 245760)|0;
  41075. $261 = $260 >>> 16;
  41076. $262 = $261 & 2;
  41077. $263 = $258 | $262;
  41078. $264 = (14 - ($263))|0;
  41079. $265 = $259 << $262;
  41080. $266 = $265 >>> 15;
  41081. $267 = (($264) + ($266))|0;
  41082. $268 = $267 << 1;
  41083. $269 = (($267) + 7)|0;
  41084. $270 = $$2 >>> $269;
  41085. $271 = $270 & 1;
  41086. $272 = $271 | $268;
  41087. $$0396 = $272;
  41088. }
  41089. }
  41090. $273 = (21176 + ($$0396<<2)|0);
  41091. $274 = ((($$1)) + 28|0);
  41092. HEAP32[$274>>2] = $$0396;
  41093. $275 = ((($$1)) + 16|0);
  41094. $276 = ((($$1)) + 20|0);
  41095. HEAP32[$276>>2] = 0;
  41096. HEAP32[$275>>2] = 0;
  41097. $277 = HEAP32[(20876)>>2]|0;
  41098. $278 = 1 << $$0396;
  41099. $279 = $277 & $278;
  41100. $280 = ($279|0)==(0);
  41101. do {
  41102. if ($280) {
  41103. $281 = $277 | $278;
  41104. HEAP32[(20876)>>2] = $281;
  41105. HEAP32[$273>>2] = $$1;
  41106. $282 = ((($$1)) + 24|0);
  41107. HEAP32[$282>>2] = $273;
  41108. $283 = ((($$1)) + 12|0);
  41109. HEAP32[$283>>2] = $$1;
  41110. $284 = ((($$1)) + 8|0);
  41111. HEAP32[$284>>2] = $$1;
  41112. } else {
  41113. $285 = HEAP32[$273>>2]|0;
  41114. $286 = ($$0396|0)==(31);
  41115. $287 = $$0396 >>> 1;
  41116. $288 = (25 - ($287))|0;
  41117. $289 = $286 ? 0 : $288;
  41118. $290 = $$2 << $289;
  41119. $$0383 = $290;$$0384 = $285;
  41120. while(1) {
  41121. $291 = ((($$0384)) + 4|0);
  41122. $292 = HEAP32[$291>>2]|0;
  41123. $293 = $292 & -8;
  41124. $294 = ($293|0)==($$2|0);
  41125. if ($294) {
  41126. label = 124;
  41127. break;
  41128. }
  41129. $295 = $$0383 >>> 31;
  41130. $296 = (((($$0384)) + 16|0) + ($295<<2)|0);
  41131. $297 = $$0383 << 1;
  41132. $298 = HEAP32[$296>>2]|0;
  41133. $299 = ($298|0)==(0|0);
  41134. if ($299) {
  41135. label = 121;
  41136. break;
  41137. } else {
  41138. $$0383 = $297;$$0384 = $298;
  41139. }
  41140. }
  41141. if ((label|0) == 121) {
  41142. $300 = HEAP32[(20888)>>2]|0;
  41143. $301 = ($296>>>0)<($300>>>0);
  41144. if ($301) {
  41145. _abort();
  41146. // unreachable;
  41147. } else {
  41148. HEAP32[$296>>2] = $$1;
  41149. $302 = ((($$1)) + 24|0);
  41150. HEAP32[$302>>2] = $$0384;
  41151. $303 = ((($$1)) + 12|0);
  41152. HEAP32[$303>>2] = $$1;
  41153. $304 = ((($$1)) + 8|0);
  41154. HEAP32[$304>>2] = $$1;
  41155. break;
  41156. }
  41157. }
  41158. else if ((label|0) == 124) {
  41159. $305 = ((($$0384)) + 8|0);
  41160. $306 = HEAP32[$305>>2]|0;
  41161. $307 = HEAP32[(20888)>>2]|0;
  41162. $308 = ($306>>>0)>=($307>>>0);
  41163. $not$437 = ($$0384>>>0)>=($307>>>0);
  41164. $309 = $308 & $not$437;
  41165. if ($309) {
  41166. $310 = ((($306)) + 12|0);
  41167. HEAP32[$310>>2] = $$1;
  41168. HEAP32[$305>>2] = $$1;
  41169. $311 = ((($$1)) + 8|0);
  41170. HEAP32[$311>>2] = $306;
  41171. $312 = ((($$1)) + 12|0);
  41172. HEAP32[$312>>2] = $$0384;
  41173. $313 = ((($$1)) + 24|0);
  41174. HEAP32[$313>>2] = 0;
  41175. break;
  41176. } else {
  41177. _abort();
  41178. // unreachable;
  41179. }
  41180. }
  41181. }
  41182. } while(0);
  41183. $314 = HEAP32[(20904)>>2]|0;
  41184. $315 = (($314) + -1)|0;
  41185. HEAP32[(20904)>>2] = $315;
  41186. $316 = ($315|0)==(0);
  41187. if ($316) {
  41188. $$0212$in$i = (21328);
  41189. } else {
  41190. return;
  41191. }
  41192. while(1) {
  41193. $$0212$i = HEAP32[$$0212$in$i>>2]|0;
  41194. $317 = ($$0212$i|0)==(0|0);
  41195. $318 = ((($$0212$i)) + 8|0);
  41196. if ($317) {
  41197. break;
  41198. } else {
  41199. $$0212$in$i = $318;
  41200. }
  41201. }
  41202. HEAP32[(20904)>>2] = -1;
  41203. return;
  41204. }
  41205. function _realloc($0,$1) {
  41206. $0 = $0|0;
  41207. $1 = $1|0;
  41208. var $$1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $3 = 0, $4 = 0, $5 = 0;
  41209. var $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
  41210. sp = STACKTOP;
  41211. $2 = ($0|0)==(0|0);
  41212. if ($2) {
  41213. $3 = (_malloc($1)|0);
  41214. $$1 = $3;
  41215. return ($$1|0);
  41216. }
  41217. $4 = ($1>>>0)>(4294967231);
  41218. if ($4) {
  41219. $5 = (___errno_location()|0);
  41220. HEAP32[$5>>2] = 12;
  41221. $$1 = 0;
  41222. return ($$1|0);
  41223. }
  41224. $6 = ($1>>>0)<(11);
  41225. $7 = (($1) + 11)|0;
  41226. $8 = $7 & -8;
  41227. $9 = $6 ? 16 : $8;
  41228. $10 = ((($0)) + -8|0);
  41229. $11 = (_try_realloc_chunk($10,$9)|0);
  41230. $12 = ($11|0)==(0|0);
  41231. if (!($12)) {
  41232. $13 = ((($11)) + 8|0);
  41233. $$1 = $13;
  41234. return ($$1|0);
  41235. }
  41236. $14 = (_malloc($1)|0);
  41237. $15 = ($14|0)==(0|0);
  41238. if ($15) {
  41239. $$1 = 0;
  41240. return ($$1|0);
  41241. }
  41242. $16 = ((($0)) + -4|0);
  41243. $17 = HEAP32[$16>>2]|0;
  41244. $18 = $17 & -8;
  41245. $19 = $17 & 3;
  41246. $20 = ($19|0)==(0);
  41247. $21 = $20 ? 8 : 4;
  41248. $22 = (($18) - ($21))|0;
  41249. $23 = ($22>>>0)<($1>>>0);
  41250. $24 = $23 ? $22 : $1;
  41251. _memcpy(($14|0),($0|0),($24|0))|0;
  41252. _free($0);
  41253. $$1 = $14;
  41254. return ($$1|0);
  41255. }
  41256. function _try_realloc_chunk($0,$1) {
  41257. $0 = $0|0;
  41258. $1 = $1|0;
  41259. var $$1272 = 0, $$1275 = 0, $$2 = 0, $$3 = 0, $$pre = 0, $$pre$phiZ2D = 0, $$sink1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0;
  41260. var $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0;
  41261. var $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0;
  41262. var $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0;
  41263. var $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
  41264. var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
  41265. var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0;
  41266. var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0;
  41267. var $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0;
  41268. var $cond = 0, $not$ = 0, $notlhs = 0, $notrhs = 0, $or$cond$not = 0, $or$cond3 = 0, $storemerge = 0, $storemerge1 = 0, label = 0, sp = 0;
  41269. sp = STACKTOP;
  41270. $2 = ((($0)) + 4|0);
  41271. $3 = HEAP32[$2>>2]|0;
  41272. $4 = $3 & -8;
  41273. $5 = (($0) + ($4)|0);
  41274. $6 = HEAP32[(20888)>>2]|0;
  41275. $7 = $3 & 3;
  41276. $notlhs = ($0>>>0)>=($6>>>0);
  41277. $notrhs = ($7|0)!=(1);
  41278. $or$cond$not = $notrhs & $notlhs;
  41279. $8 = ($0>>>0)<($5>>>0);
  41280. $or$cond3 = $or$cond$not & $8;
  41281. if (!($or$cond3)) {
  41282. _abort();
  41283. // unreachable;
  41284. }
  41285. $9 = ((($5)) + 4|0);
  41286. $10 = HEAP32[$9>>2]|0;
  41287. $11 = $10 & 1;
  41288. $12 = ($11|0)==(0);
  41289. if ($12) {
  41290. _abort();
  41291. // unreachable;
  41292. }
  41293. $13 = ($7|0)==(0);
  41294. if ($13) {
  41295. $14 = ($1>>>0)<(256);
  41296. if ($14) {
  41297. $$2 = 0;
  41298. return ($$2|0);
  41299. }
  41300. $15 = (($1) + 4)|0;
  41301. $16 = ($4>>>0)<($15>>>0);
  41302. if (!($16)) {
  41303. $17 = (($4) - ($1))|0;
  41304. $18 = HEAP32[(21352)>>2]|0;
  41305. $19 = $18 << 1;
  41306. $20 = ($17>>>0)>($19>>>0);
  41307. if (!($20)) {
  41308. $$2 = $0;
  41309. return ($$2|0);
  41310. }
  41311. }
  41312. $$2 = 0;
  41313. return ($$2|0);
  41314. }
  41315. $21 = ($4>>>0)<($1>>>0);
  41316. if (!($21)) {
  41317. $22 = (($4) - ($1))|0;
  41318. $23 = ($22>>>0)>(15);
  41319. if (!($23)) {
  41320. $$2 = $0;
  41321. return ($$2|0);
  41322. }
  41323. $24 = (($0) + ($1)|0);
  41324. $25 = $3 & 1;
  41325. $26 = $25 | $1;
  41326. $27 = $26 | 2;
  41327. HEAP32[$2>>2] = $27;
  41328. $28 = ((($24)) + 4|0);
  41329. $29 = $22 | 3;
  41330. HEAP32[$28>>2] = $29;
  41331. $30 = (($24) + ($22)|0);
  41332. $31 = ((($30)) + 4|0);
  41333. $32 = HEAP32[$31>>2]|0;
  41334. $33 = $32 | 1;
  41335. HEAP32[$31>>2] = $33;
  41336. _dispose_chunk($24,$22);
  41337. $$2 = $0;
  41338. return ($$2|0);
  41339. }
  41340. $34 = HEAP32[(20896)>>2]|0;
  41341. $35 = ($5|0)==($34|0);
  41342. if ($35) {
  41343. $36 = HEAP32[(20884)>>2]|0;
  41344. $37 = (($36) + ($4))|0;
  41345. $38 = ($37>>>0)>($1>>>0);
  41346. $39 = (($37) - ($1))|0;
  41347. $40 = (($0) + ($1)|0);
  41348. if (!($38)) {
  41349. $$2 = 0;
  41350. return ($$2|0);
  41351. }
  41352. $41 = $39 | 1;
  41353. $42 = ((($40)) + 4|0);
  41354. $43 = $3 & 1;
  41355. $44 = $43 | $1;
  41356. $45 = $44 | 2;
  41357. HEAP32[$2>>2] = $45;
  41358. HEAP32[$42>>2] = $41;
  41359. HEAP32[(20896)>>2] = $40;
  41360. HEAP32[(20884)>>2] = $39;
  41361. $$2 = $0;
  41362. return ($$2|0);
  41363. }
  41364. $46 = HEAP32[(20892)>>2]|0;
  41365. $47 = ($5|0)==($46|0);
  41366. if ($47) {
  41367. $48 = HEAP32[(20880)>>2]|0;
  41368. $49 = (($48) + ($4))|0;
  41369. $50 = ($49>>>0)<($1>>>0);
  41370. if ($50) {
  41371. $$2 = 0;
  41372. return ($$2|0);
  41373. }
  41374. $51 = (($49) - ($1))|0;
  41375. $52 = ($51>>>0)>(15);
  41376. $53 = $3 & 1;
  41377. if ($52) {
  41378. $54 = (($0) + ($1)|0);
  41379. $55 = (($54) + ($51)|0);
  41380. $56 = $53 | $1;
  41381. $57 = $56 | 2;
  41382. HEAP32[$2>>2] = $57;
  41383. $58 = ((($54)) + 4|0);
  41384. $59 = $51 | 1;
  41385. HEAP32[$58>>2] = $59;
  41386. HEAP32[$55>>2] = $51;
  41387. $60 = ((($55)) + 4|0);
  41388. $61 = HEAP32[$60>>2]|0;
  41389. $62 = $61 & -2;
  41390. HEAP32[$60>>2] = $62;
  41391. $storemerge = $54;$storemerge1 = $51;
  41392. } else {
  41393. $63 = $53 | $49;
  41394. $64 = $63 | 2;
  41395. HEAP32[$2>>2] = $64;
  41396. $65 = (($0) + ($49)|0);
  41397. $66 = ((($65)) + 4|0);
  41398. $67 = HEAP32[$66>>2]|0;
  41399. $68 = $67 | 1;
  41400. HEAP32[$66>>2] = $68;
  41401. $storemerge = 0;$storemerge1 = 0;
  41402. }
  41403. HEAP32[(20880)>>2] = $storemerge1;
  41404. HEAP32[(20892)>>2] = $storemerge;
  41405. $$2 = $0;
  41406. return ($$2|0);
  41407. }
  41408. $69 = $10 & 2;
  41409. $70 = ($69|0)==(0);
  41410. if (!($70)) {
  41411. $$2 = 0;
  41412. return ($$2|0);
  41413. }
  41414. $71 = $10 & -8;
  41415. $72 = (($71) + ($4))|0;
  41416. $73 = ($72>>>0)<($1>>>0);
  41417. if ($73) {
  41418. $$2 = 0;
  41419. return ($$2|0);
  41420. }
  41421. $74 = (($72) - ($1))|0;
  41422. $75 = $10 >>> 3;
  41423. $76 = ($10>>>0)<(256);
  41424. L49: do {
  41425. if ($76) {
  41426. $77 = ((($5)) + 8|0);
  41427. $78 = HEAP32[$77>>2]|0;
  41428. $79 = ((($5)) + 12|0);
  41429. $80 = HEAP32[$79>>2]|0;
  41430. $81 = $75 << 1;
  41431. $82 = (20912 + ($81<<2)|0);
  41432. $83 = ($78|0)==($82|0);
  41433. if (!($83)) {
  41434. $84 = ($78>>>0)<($6>>>0);
  41435. if ($84) {
  41436. _abort();
  41437. // unreachable;
  41438. }
  41439. $85 = ((($78)) + 12|0);
  41440. $86 = HEAP32[$85>>2]|0;
  41441. $87 = ($86|0)==($5|0);
  41442. if (!($87)) {
  41443. _abort();
  41444. // unreachable;
  41445. }
  41446. }
  41447. $88 = ($80|0)==($78|0);
  41448. if ($88) {
  41449. $89 = 1 << $75;
  41450. $90 = $89 ^ -1;
  41451. $91 = HEAP32[5218]|0;
  41452. $92 = $91 & $90;
  41453. HEAP32[5218] = $92;
  41454. break;
  41455. }
  41456. $93 = ($80|0)==($82|0);
  41457. if ($93) {
  41458. $$pre = ((($80)) + 8|0);
  41459. $$pre$phiZ2D = $$pre;
  41460. } else {
  41461. $94 = ($80>>>0)<($6>>>0);
  41462. if ($94) {
  41463. _abort();
  41464. // unreachable;
  41465. }
  41466. $95 = ((($80)) + 8|0);
  41467. $96 = HEAP32[$95>>2]|0;
  41468. $97 = ($96|0)==($5|0);
  41469. if ($97) {
  41470. $$pre$phiZ2D = $95;
  41471. } else {
  41472. _abort();
  41473. // unreachable;
  41474. }
  41475. }
  41476. $98 = ((($78)) + 12|0);
  41477. HEAP32[$98>>2] = $80;
  41478. HEAP32[$$pre$phiZ2D>>2] = $78;
  41479. } else {
  41480. $99 = ((($5)) + 24|0);
  41481. $100 = HEAP32[$99>>2]|0;
  41482. $101 = ((($5)) + 12|0);
  41483. $102 = HEAP32[$101>>2]|0;
  41484. $103 = ($102|0)==($5|0);
  41485. do {
  41486. if ($103) {
  41487. $113 = ((($5)) + 16|0);
  41488. $114 = ((($113)) + 4|0);
  41489. $115 = HEAP32[$114>>2]|0;
  41490. $116 = ($115|0)==(0|0);
  41491. if ($116) {
  41492. $117 = HEAP32[$113>>2]|0;
  41493. $118 = ($117|0)==(0|0);
  41494. if ($118) {
  41495. $$3 = 0;
  41496. break;
  41497. } else {
  41498. $$1272 = $117;$$1275 = $113;
  41499. }
  41500. } else {
  41501. $$1272 = $115;$$1275 = $114;
  41502. }
  41503. while(1) {
  41504. $119 = ((($$1272)) + 20|0);
  41505. $120 = HEAP32[$119>>2]|0;
  41506. $121 = ($120|0)==(0|0);
  41507. if (!($121)) {
  41508. $$1272 = $120;$$1275 = $119;
  41509. continue;
  41510. }
  41511. $122 = ((($$1272)) + 16|0);
  41512. $123 = HEAP32[$122>>2]|0;
  41513. $124 = ($123|0)==(0|0);
  41514. if ($124) {
  41515. break;
  41516. } else {
  41517. $$1272 = $123;$$1275 = $122;
  41518. }
  41519. }
  41520. $125 = ($$1275>>>0)<($6>>>0);
  41521. if ($125) {
  41522. _abort();
  41523. // unreachable;
  41524. } else {
  41525. HEAP32[$$1275>>2] = 0;
  41526. $$3 = $$1272;
  41527. break;
  41528. }
  41529. } else {
  41530. $104 = ((($5)) + 8|0);
  41531. $105 = HEAP32[$104>>2]|0;
  41532. $106 = ($105>>>0)<($6>>>0);
  41533. if ($106) {
  41534. _abort();
  41535. // unreachable;
  41536. }
  41537. $107 = ((($105)) + 12|0);
  41538. $108 = HEAP32[$107>>2]|0;
  41539. $109 = ($108|0)==($5|0);
  41540. if (!($109)) {
  41541. _abort();
  41542. // unreachable;
  41543. }
  41544. $110 = ((($102)) + 8|0);
  41545. $111 = HEAP32[$110>>2]|0;
  41546. $112 = ($111|0)==($5|0);
  41547. if ($112) {
  41548. HEAP32[$107>>2] = $102;
  41549. HEAP32[$110>>2] = $105;
  41550. $$3 = $102;
  41551. break;
  41552. } else {
  41553. _abort();
  41554. // unreachable;
  41555. }
  41556. }
  41557. } while(0);
  41558. $126 = ($100|0)==(0|0);
  41559. if (!($126)) {
  41560. $127 = ((($5)) + 28|0);
  41561. $128 = HEAP32[$127>>2]|0;
  41562. $129 = (21176 + ($128<<2)|0);
  41563. $130 = HEAP32[$129>>2]|0;
  41564. $131 = ($5|0)==($130|0);
  41565. do {
  41566. if ($131) {
  41567. HEAP32[$129>>2] = $$3;
  41568. $cond = ($$3|0)==(0|0);
  41569. if ($cond) {
  41570. $132 = 1 << $128;
  41571. $133 = $132 ^ -1;
  41572. $134 = HEAP32[(20876)>>2]|0;
  41573. $135 = $134 & $133;
  41574. HEAP32[(20876)>>2] = $135;
  41575. break L49;
  41576. }
  41577. } else {
  41578. $136 = HEAP32[(20888)>>2]|0;
  41579. $137 = ($100>>>0)<($136>>>0);
  41580. if ($137) {
  41581. _abort();
  41582. // unreachable;
  41583. } else {
  41584. $138 = ((($100)) + 16|0);
  41585. $139 = HEAP32[$138>>2]|0;
  41586. $not$ = ($139|0)!=($5|0);
  41587. $$sink1 = $not$&1;
  41588. $140 = (((($100)) + 16|0) + ($$sink1<<2)|0);
  41589. HEAP32[$140>>2] = $$3;
  41590. $141 = ($$3|0)==(0|0);
  41591. if ($141) {
  41592. break L49;
  41593. } else {
  41594. break;
  41595. }
  41596. }
  41597. }
  41598. } while(0);
  41599. $142 = HEAP32[(20888)>>2]|0;
  41600. $143 = ($$3>>>0)<($142>>>0);
  41601. if ($143) {
  41602. _abort();
  41603. // unreachable;
  41604. }
  41605. $144 = ((($$3)) + 24|0);
  41606. HEAP32[$144>>2] = $100;
  41607. $145 = ((($5)) + 16|0);
  41608. $146 = HEAP32[$145>>2]|0;
  41609. $147 = ($146|0)==(0|0);
  41610. do {
  41611. if (!($147)) {
  41612. $148 = ($146>>>0)<($142>>>0);
  41613. if ($148) {
  41614. _abort();
  41615. // unreachable;
  41616. } else {
  41617. $149 = ((($$3)) + 16|0);
  41618. HEAP32[$149>>2] = $146;
  41619. $150 = ((($146)) + 24|0);
  41620. HEAP32[$150>>2] = $$3;
  41621. break;
  41622. }
  41623. }
  41624. } while(0);
  41625. $151 = ((($145)) + 4|0);
  41626. $152 = HEAP32[$151>>2]|0;
  41627. $153 = ($152|0)==(0|0);
  41628. if (!($153)) {
  41629. $154 = HEAP32[(20888)>>2]|0;
  41630. $155 = ($152>>>0)<($154>>>0);
  41631. if ($155) {
  41632. _abort();
  41633. // unreachable;
  41634. } else {
  41635. $156 = ((($$3)) + 20|0);
  41636. HEAP32[$156>>2] = $152;
  41637. $157 = ((($152)) + 24|0);
  41638. HEAP32[$157>>2] = $$3;
  41639. break;
  41640. }
  41641. }
  41642. }
  41643. }
  41644. } while(0);
  41645. $158 = ($74>>>0)<(16);
  41646. $159 = $3 & 1;
  41647. if ($158) {
  41648. $160 = $72 | $159;
  41649. $161 = $160 | 2;
  41650. HEAP32[$2>>2] = $161;
  41651. $162 = (($0) + ($72)|0);
  41652. $163 = ((($162)) + 4|0);
  41653. $164 = HEAP32[$163>>2]|0;
  41654. $165 = $164 | 1;
  41655. HEAP32[$163>>2] = $165;
  41656. $$2 = $0;
  41657. return ($$2|0);
  41658. } else {
  41659. $166 = (($0) + ($1)|0);
  41660. $167 = $159 | $1;
  41661. $168 = $167 | 2;
  41662. HEAP32[$2>>2] = $168;
  41663. $169 = ((($166)) + 4|0);
  41664. $170 = $74 | 3;
  41665. HEAP32[$169>>2] = $170;
  41666. $171 = (($166) + ($74)|0);
  41667. $172 = ((($171)) + 4|0);
  41668. $173 = HEAP32[$172>>2]|0;
  41669. $174 = $173 | 1;
  41670. HEAP32[$172>>2] = $174;
  41671. _dispose_chunk($166,$74);
  41672. $$2 = $0;
  41673. return ($$2|0);
  41674. }
  41675. return (0)|0;
  41676. }
  41677. function _dispose_chunk($0,$1) {
  41678. $0 = $0|0;
  41679. $1 = $1|0;
  41680. var $$0419 = 0, $$0420 = 0, $$0431 = 0, $$0438 = 0, $$1 = 0, $$1418 = 0, $$1426 = 0, $$1429 = 0, $$1433 = 0, $$1437 = 0, $$2 = 0, $$3 = 0, $$3435 = 0, $$pre = 0, $$pre$phi24Z2D = 0, $$pre$phi26Z2D = 0, $$pre$phiZ2D = 0, $$pre23 = 0, $$pre25 = 0, $$sink2 = 0;
  41681. var $$sink4 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0;
  41682. var $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0;
  41683. var $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0;
  41684. var $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0;
  41685. var $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0;
  41686. var $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0;
  41687. var $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0;
  41688. var $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0;
  41689. var $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0;
  41690. var $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0;
  41691. var $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0;
  41692. var $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0;
  41693. var $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0;
  41694. var $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0;
  41695. var $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0;
  41696. var $97 = 0, $98 = 0, $99 = 0, $cond = 0, $cond17 = 0, $not$ = 0, $not$1 = 0, $not$19 = 0, label = 0, sp = 0;
  41697. sp = STACKTOP;
  41698. $2 = (($0) + ($1)|0);
  41699. $3 = ((($0)) + 4|0);
  41700. $4 = HEAP32[$3>>2]|0;
  41701. $5 = $4 & 1;
  41702. $6 = ($5|0)==(0);
  41703. L1: do {
  41704. if ($6) {
  41705. $7 = HEAP32[$0>>2]|0;
  41706. $8 = $4 & 3;
  41707. $9 = ($8|0)==(0);
  41708. if ($9) {
  41709. return;
  41710. }
  41711. $10 = (0 - ($7))|0;
  41712. $11 = (($0) + ($10)|0);
  41713. $12 = (($7) + ($1))|0;
  41714. $13 = HEAP32[(20888)>>2]|0;
  41715. $14 = ($11>>>0)<($13>>>0);
  41716. if ($14) {
  41717. _abort();
  41718. // unreachable;
  41719. }
  41720. $15 = HEAP32[(20892)>>2]|0;
  41721. $16 = ($11|0)==($15|0);
  41722. if ($16) {
  41723. $100 = ((($2)) + 4|0);
  41724. $101 = HEAP32[$100>>2]|0;
  41725. $102 = $101 & 3;
  41726. $103 = ($102|0)==(3);
  41727. if (!($103)) {
  41728. $$1 = $11;$$1418 = $12;
  41729. break;
  41730. }
  41731. $104 = (($11) + ($12)|0);
  41732. $105 = ((($11)) + 4|0);
  41733. $106 = $12 | 1;
  41734. $107 = $101 & -2;
  41735. HEAP32[(20880)>>2] = $12;
  41736. HEAP32[$100>>2] = $107;
  41737. HEAP32[$105>>2] = $106;
  41738. HEAP32[$104>>2] = $12;
  41739. return;
  41740. }
  41741. $17 = $7 >>> 3;
  41742. $18 = ($7>>>0)<(256);
  41743. if ($18) {
  41744. $19 = ((($11)) + 8|0);
  41745. $20 = HEAP32[$19>>2]|0;
  41746. $21 = ((($11)) + 12|0);
  41747. $22 = HEAP32[$21>>2]|0;
  41748. $23 = $17 << 1;
  41749. $24 = (20912 + ($23<<2)|0);
  41750. $25 = ($20|0)==($24|0);
  41751. if (!($25)) {
  41752. $26 = ($20>>>0)<($13>>>0);
  41753. if ($26) {
  41754. _abort();
  41755. // unreachable;
  41756. }
  41757. $27 = ((($20)) + 12|0);
  41758. $28 = HEAP32[$27>>2]|0;
  41759. $29 = ($28|0)==($11|0);
  41760. if (!($29)) {
  41761. _abort();
  41762. // unreachable;
  41763. }
  41764. }
  41765. $30 = ($22|0)==($20|0);
  41766. if ($30) {
  41767. $31 = 1 << $17;
  41768. $32 = $31 ^ -1;
  41769. $33 = HEAP32[5218]|0;
  41770. $34 = $33 & $32;
  41771. HEAP32[5218] = $34;
  41772. $$1 = $11;$$1418 = $12;
  41773. break;
  41774. }
  41775. $35 = ($22|0)==($24|0);
  41776. if ($35) {
  41777. $$pre25 = ((($22)) + 8|0);
  41778. $$pre$phi26Z2D = $$pre25;
  41779. } else {
  41780. $36 = ($22>>>0)<($13>>>0);
  41781. if ($36) {
  41782. _abort();
  41783. // unreachable;
  41784. }
  41785. $37 = ((($22)) + 8|0);
  41786. $38 = HEAP32[$37>>2]|0;
  41787. $39 = ($38|0)==($11|0);
  41788. if ($39) {
  41789. $$pre$phi26Z2D = $37;
  41790. } else {
  41791. _abort();
  41792. // unreachable;
  41793. }
  41794. }
  41795. $40 = ((($20)) + 12|0);
  41796. HEAP32[$40>>2] = $22;
  41797. HEAP32[$$pre$phi26Z2D>>2] = $20;
  41798. $$1 = $11;$$1418 = $12;
  41799. break;
  41800. }
  41801. $41 = ((($11)) + 24|0);
  41802. $42 = HEAP32[$41>>2]|0;
  41803. $43 = ((($11)) + 12|0);
  41804. $44 = HEAP32[$43>>2]|0;
  41805. $45 = ($44|0)==($11|0);
  41806. do {
  41807. if ($45) {
  41808. $55 = ((($11)) + 16|0);
  41809. $56 = ((($55)) + 4|0);
  41810. $57 = HEAP32[$56>>2]|0;
  41811. $58 = ($57|0)==(0|0);
  41812. if ($58) {
  41813. $59 = HEAP32[$55>>2]|0;
  41814. $60 = ($59|0)==(0|0);
  41815. if ($60) {
  41816. $$3 = 0;
  41817. break;
  41818. } else {
  41819. $$1426 = $59;$$1429 = $55;
  41820. }
  41821. } else {
  41822. $$1426 = $57;$$1429 = $56;
  41823. }
  41824. while(1) {
  41825. $61 = ((($$1426)) + 20|0);
  41826. $62 = HEAP32[$61>>2]|0;
  41827. $63 = ($62|0)==(0|0);
  41828. if (!($63)) {
  41829. $$1426 = $62;$$1429 = $61;
  41830. continue;
  41831. }
  41832. $64 = ((($$1426)) + 16|0);
  41833. $65 = HEAP32[$64>>2]|0;
  41834. $66 = ($65|0)==(0|0);
  41835. if ($66) {
  41836. break;
  41837. } else {
  41838. $$1426 = $65;$$1429 = $64;
  41839. }
  41840. }
  41841. $67 = ($$1429>>>0)<($13>>>0);
  41842. if ($67) {
  41843. _abort();
  41844. // unreachable;
  41845. } else {
  41846. HEAP32[$$1429>>2] = 0;
  41847. $$3 = $$1426;
  41848. break;
  41849. }
  41850. } else {
  41851. $46 = ((($11)) + 8|0);
  41852. $47 = HEAP32[$46>>2]|0;
  41853. $48 = ($47>>>0)<($13>>>0);
  41854. if ($48) {
  41855. _abort();
  41856. // unreachable;
  41857. }
  41858. $49 = ((($47)) + 12|0);
  41859. $50 = HEAP32[$49>>2]|0;
  41860. $51 = ($50|0)==($11|0);
  41861. if (!($51)) {
  41862. _abort();
  41863. // unreachable;
  41864. }
  41865. $52 = ((($44)) + 8|0);
  41866. $53 = HEAP32[$52>>2]|0;
  41867. $54 = ($53|0)==($11|0);
  41868. if ($54) {
  41869. HEAP32[$49>>2] = $44;
  41870. HEAP32[$52>>2] = $47;
  41871. $$3 = $44;
  41872. break;
  41873. } else {
  41874. _abort();
  41875. // unreachable;
  41876. }
  41877. }
  41878. } while(0);
  41879. $68 = ($42|0)==(0|0);
  41880. if ($68) {
  41881. $$1 = $11;$$1418 = $12;
  41882. } else {
  41883. $69 = ((($11)) + 28|0);
  41884. $70 = HEAP32[$69>>2]|0;
  41885. $71 = (21176 + ($70<<2)|0);
  41886. $72 = HEAP32[$71>>2]|0;
  41887. $73 = ($11|0)==($72|0);
  41888. do {
  41889. if ($73) {
  41890. HEAP32[$71>>2] = $$3;
  41891. $cond = ($$3|0)==(0|0);
  41892. if ($cond) {
  41893. $74 = 1 << $70;
  41894. $75 = $74 ^ -1;
  41895. $76 = HEAP32[(20876)>>2]|0;
  41896. $77 = $76 & $75;
  41897. HEAP32[(20876)>>2] = $77;
  41898. $$1 = $11;$$1418 = $12;
  41899. break L1;
  41900. }
  41901. } else {
  41902. $78 = HEAP32[(20888)>>2]|0;
  41903. $79 = ($42>>>0)<($78>>>0);
  41904. if ($79) {
  41905. _abort();
  41906. // unreachable;
  41907. } else {
  41908. $80 = ((($42)) + 16|0);
  41909. $81 = HEAP32[$80>>2]|0;
  41910. $not$1 = ($81|0)!=($11|0);
  41911. $$sink2 = $not$1&1;
  41912. $82 = (((($42)) + 16|0) + ($$sink2<<2)|0);
  41913. HEAP32[$82>>2] = $$3;
  41914. $83 = ($$3|0)==(0|0);
  41915. if ($83) {
  41916. $$1 = $11;$$1418 = $12;
  41917. break L1;
  41918. } else {
  41919. break;
  41920. }
  41921. }
  41922. }
  41923. } while(0);
  41924. $84 = HEAP32[(20888)>>2]|0;
  41925. $85 = ($$3>>>0)<($84>>>0);
  41926. if ($85) {
  41927. _abort();
  41928. // unreachable;
  41929. }
  41930. $86 = ((($$3)) + 24|0);
  41931. HEAP32[$86>>2] = $42;
  41932. $87 = ((($11)) + 16|0);
  41933. $88 = HEAP32[$87>>2]|0;
  41934. $89 = ($88|0)==(0|0);
  41935. do {
  41936. if (!($89)) {
  41937. $90 = ($88>>>0)<($84>>>0);
  41938. if ($90) {
  41939. _abort();
  41940. // unreachable;
  41941. } else {
  41942. $91 = ((($$3)) + 16|0);
  41943. HEAP32[$91>>2] = $88;
  41944. $92 = ((($88)) + 24|0);
  41945. HEAP32[$92>>2] = $$3;
  41946. break;
  41947. }
  41948. }
  41949. } while(0);
  41950. $93 = ((($87)) + 4|0);
  41951. $94 = HEAP32[$93>>2]|0;
  41952. $95 = ($94|0)==(0|0);
  41953. if ($95) {
  41954. $$1 = $11;$$1418 = $12;
  41955. } else {
  41956. $96 = HEAP32[(20888)>>2]|0;
  41957. $97 = ($94>>>0)<($96>>>0);
  41958. if ($97) {
  41959. _abort();
  41960. // unreachable;
  41961. } else {
  41962. $98 = ((($$3)) + 20|0);
  41963. HEAP32[$98>>2] = $94;
  41964. $99 = ((($94)) + 24|0);
  41965. HEAP32[$99>>2] = $$3;
  41966. $$1 = $11;$$1418 = $12;
  41967. break;
  41968. }
  41969. }
  41970. }
  41971. } else {
  41972. $$1 = $0;$$1418 = $1;
  41973. }
  41974. } while(0);
  41975. $108 = HEAP32[(20888)>>2]|0;
  41976. $109 = ($2>>>0)<($108>>>0);
  41977. if ($109) {
  41978. _abort();
  41979. // unreachable;
  41980. }
  41981. $110 = ((($2)) + 4|0);
  41982. $111 = HEAP32[$110>>2]|0;
  41983. $112 = $111 & 2;
  41984. $113 = ($112|0)==(0);
  41985. if ($113) {
  41986. $114 = HEAP32[(20896)>>2]|0;
  41987. $115 = ($2|0)==($114|0);
  41988. $116 = HEAP32[(20892)>>2]|0;
  41989. if ($115) {
  41990. $117 = HEAP32[(20884)>>2]|0;
  41991. $118 = (($117) + ($$1418))|0;
  41992. HEAP32[(20884)>>2] = $118;
  41993. HEAP32[(20896)>>2] = $$1;
  41994. $119 = $118 | 1;
  41995. $120 = ((($$1)) + 4|0);
  41996. HEAP32[$120>>2] = $119;
  41997. $121 = ($$1|0)==($116|0);
  41998. if (!($121)) {
  41999. return;
  42000. }
  42001. HEAP32[(20892)>>2] = 0;
  42002. HEAP32[(20880)>>2] = 0;
  42003. return;
  42004. }
  42005. $122 = ($2|0)==($116|0);
  42006. if ($122) {
  42007. $123 = HEAP32[(20880)>>2]|0;
  42008. $124 = (($123) + ($$1418))|0;
  42009. HEAP32[(20880)>>2] = $124;
  42010. HEAP32[(20892)>>2] = $$1;
  42011. $125 = $124 | 1;
  42012. $126 = ((($$1)) + 4|0);
  42013. HEAP32[$126>>2] = $125;
  42014. $127 = (($$1) + ($124)|0);
  42015. HEAP32[$127>>2] = $124;
  42016. return;
  42017. }
  42018. $128 = $111 & -8;
  42019. $129 = (($128) + ($$1418))|0;
  42020. $130 = $111 >>> 3;
  42021. $131 = ($111>>>0)<(256);
  42022. L96: do {
  42023. if ($131) {
  42024. $132 = ((($2)) + 8|0);
  42025. $133 = HEAP32[$132>>2]|0;
  42026. $134 = ((($2)) + 12|0);
  42027. $135 = HEAP32[$134>>2]|0;
  42028. $136 = $130 << 1;
  42029. $137 = (20912 + ($136<<2)|0);
  42030. $138 = ($133|0)==($137|0);
  42031. if (!($138)) {
  42032. $139 = ($133>>>0)<($108>>>0);
  42033. if ($139) {
  42034. _abort();
  42035. // unreachable;
  42036. }
  42037. $140 = ((($133)) + 12|0);
  42038. $141 = HEAP32[$140>>2]|0;
  42039. $142 = ($141|0)==($2|0);
  42040. if (!($142)) {
  42041. _abort();
  42042. // unreachable;
  42043. }
  42044. }
  42045. $143 = ($135|0)==($133|0);
  42046. if ($143) {
  42047. $144 = 1 << $130;
  42048. $145 = $144 ^ -1;
  42049. $146 = HEAP32[5218]|0;
  42050. $147 = $146 & $145;
  42051. HEAP32[5218] = $147;
  42052. break;
  42053. }
  42054. $148 = ($135|0)==($137|0);
  42055. if ($148) {
  42056. $$pre23 = ((($135)) + 8|0);
  42057. $$pre$phi24Z2D = $$pre23;
  42058. } else {
  42059. $149 = ($135>>>0)<($108>>>0);
  42060. if ($149) {
  42061. _abort();
  42062. // unreachable;
  42063. }
  42064. $150 = ((($135)) + 8|0);
  42065. $151 = HEAP32[$150>>2]|0;
  42066. $152 = ($151|0)==($2|0);
  42067. if ($152) {
  42068. $$pre$phi24Z2D = $150;
  42069. } else {
  42070. _abort();
  42071. // unreachable;
  42072. }
  42073. }
  42074. $153 = ((($133)) + 12|0);
  42075. HEAP32[$153>>2] = $135;
  42076. HEAP32[$$pre$phi24Z2D>>2] = $133;
  42077. } else {
  42078. $154 = ((($2)) + 24|0);
  42079. $155 = HEAP32[$154>>2]|0;
  42080. $156 = ((($2)) + 12|0);
  42081. $157 = HEAP32[$156>>2]|0;
  42082. $158 = ($157|0)==($2|0);
  42083. do {
  42084. if ($158) {
  42085. $168 = ((($2)) + 16|0);
  42086. $169 = ((($168)) + 4|0);
  42087. $170 = HEAP32[$169>>2]|0;
  42088. $171 = ($170|0)==(0|0);
  42089. if ($171) {
  42090. $172 = HEAP32[$168>>2]|0;
  42091. $173 = ($172|0)==(0|0);
  42092. if ($173) {
  42093. $$3435 = 0;
  42094. break;
  42095. } else {
  42096. $$1433 = $172;$$1437 = $168;
  42097. }
  42098. } else {
  42099. $$1433 = $170;$$1437 = $169;
  42100. }
  42101. while(1) {
  42102. $174 = ((($$1433)) + 20|0);
  42103. $175 = HEAP32[$174>>2]|0;
  42104. $176 = ($175|0)==(0|0);
  42105. if (!($176)) {
  42106. $$1433 = $175;$$1437 = $174;
  42107. continue;
  42108. }
  42109. $177 = ((($$1433)) + 16|0);
  42110. $178 = HEAP32[$177>>2]|0;
  42111. $179 = ($178|0)==(0|0);
  42112. if ($179) {
  42113. break;
  42114. } else {
  42115. $$1433 = $178;$$1437 = $177;
  42116. }
  42117. }
  42118. $180 = ($$1437>>>0)<($108>>>0);
  42119. if ($180) {
  42120. _abort();
  42121. // unreachable;
  42122. } else {
  42123. HEAP32[$$1437>>2] = 0;
  42124. $$3435 = $$1433;
  42125. break;
  42126. }
  42127. } else {
  42128. $159 = ((($2)) + 8|0);
  42129. $160 = HEAP32[$159>>2]|0;
  42130. $161 = ($160>>>0)<($108>>>0);
  42131. if ($161) {
  42132. _abort();
  42133. // unreachable;
  42134. }
  42135. $162 = ((($160)) + 12|0);
  42136. $163 = HEAP32[$162>>2]|0;
  42137. $164 = ($163|0)==($2|0);
  42138. if (!($164)) {
  42139. _abort();
  42140. // unreachable;
  42141. }
  42142. $165 = ((($157)) + 8|0);
  42143. $166 = HEAP32[$165>>2]|0;
  42144. $167 = ($166|0)==($2|0);
  42145. if ($167) {
  42146. HEAP32[$162>>2] = $157;
  42147. HEAP32[$165>>2] = $160;
  42148. $$3435 = $157;
  42149. break;
  42150. } else {
  42151. _abort();
  42152. // unreachable;
  42153. }
  42154. }
  42155. } while(0);
  42156. $181 = ($155|0)==(0|0);
  42157. if (!($181)) {
  42158. $182 = ((($2)) + 28|0);
  42159. $183 = HEAP32[$182>>2]|0;
  42160. $184 = (21176 + ($183<<2)|0);
  42161. $185 = HEAP32[$184>>2]|0;
  42162. $186 = ($2|0)==($185|0);
  42163. do {
  42164. if ($186) {
  42165. HEAP32[$184>>2] = $$3435;
  42166. $cond17 = ($$3435|0)==(0|0);
  42167. if ($cond17) {
  42168. $187 = 1 << $183;
  42169. $188 = $187 ^ -1;
  42170. $189 = HEAP32[(20876)>>2]|0;
  42171. $190 = $189 & $188;
  42172. HEAP32[(20876)>>2] = $190;
  42173. break L96;
  42174. }
  42175. } else {
  42176. $191 = HEAP32[(20888)>>2]|0;
  42177. $192 = ($155>>>0)<($191>>>0);
  42178. if ($192) {
  42179. _abort();
  42180. // unreachable;
  42181. } else {
  42182. $193 = ((($155)) + 16|0);
  42183. $194 = HEAP32[$193>>2]|0;
  42184. $not$ = ($194|0)!=($2|0);
  42185. $$sink4 = $not$&1;
  42186. $195 = (((($155)) + 16|0) + ($$sink4<<2)|0);
  42187. HEAP32[$195>>2] = $$3435;
  42188. $196 = ($$3435|0)==(0|0);
  42189. if ($196) {
  42190. break L96;
  42191. } else {
  42192. break;
  42193. }
  42194. }
  42195. }
  42196. } while(0);
  42197. $197 = HEAP32[(20888)>>2]|0;
  42198. $198 = ($$3435>>>0)<($197>>>0);
  42199. if ($198) {
  42200. _abort();
  42201. // unreachable;
  42202. }
  42203. $199 = ((($$3435)) + 24|0);
  42204. HEAP32[$199>>2] = $155;
  42205. $200 = ((($2)) + 16|0);
  42206. $201 = HEAP32[$200>>2]|0;
  42207. $202 = ($201|0)==(0|0);
  42208. do {
  42209. if (!($202)) {
  42210. $203 = ($201>>>0)<($197>>>0);
  42211. if ($203) {
  42212. _abort();
  42213. // unreachable;
  42214. } else {
  42215. $204 = ((($$3435)) + 16|0);
  42216. HEAP32[$204>>2] = $201;
  42217. $205 = ((($201)) + 24|0);
  42218. HEAP32[$205>>2] = $$3435;
  42219. break;
  42220. }
  42221. }
  42222. } while(0);
  42223. $206 = ((($200)) + 4|0);
  42224. $207 = HEAP32[$206>>2]|0;
  42225. $208 = ($207|0)==(0|0);
  42226. if (!($208)) {
  42227. $209 = HEAP32[(20888)>>2]|0;
  42228. $210 = ($207>>>0)<($209>>>0);
  42229. if ($210) {
  42230. _abort();
  42231. // unreachable;
  42232. } else {
  42233. $211 = ((($$3435)) + 20|0);
  42234. HEAP32[$211>>2] = $207;
  42235. $212 = ((($207)) + 24|0);
  42236. HEAP32[$212>>2] = $$3435;
  42237. break;
  42238. }
  42239. }
  42240. }
  42241. }
  42242. } while(0);
  42243. $213 = $129 | 1;
  42244. $214 = ((($$1)) + 4|0);
  42245. HEAP32[$214>>2] = $213;
  42246. $215 = (($$1) + ($129)|0);
  42247. HEAP32[$215>>2] = $129;
  42248. $216 = HEAP32[(20892)>>2]|0;
  42249. $217 = ($$1|0)==($216|0);
  42250. if ($217) {
  42251. HEAP32[(20880)>>2] = $129;
  42252. return;
  42253. } else {
  42254. $$2 = $129;
  42255. }
  42256. } else {
  42257. $218 = $111 & -2;
  42258. HEAP32[$110>>2] = $218;
  42259. $219 = $$1418 | 1;
  42260. $220 = ((($$1)) + 4|0);
  42261. HEAP32[$220>>2] = $219;
  42262. $221 = (($$1) + ($$1418)|0);
  42263. HEAP32[$221>>2] = $$1418;
  42264. $$2 = $$1418;
  42265. }
  42266. $222 = $$2 >>> 3;
  42267. $223 = ($$2>>>0)<(256);
  42268. if ($223) {
  42269. $224 = $222 << 1;
  42270. $225 = (20912 + ($224<<2)|0);
  42271. $226 = HEAP32[5218]|0;
  42272. $227 = 1 << $222;
  42273. $228 = $226 & $227;
  42274. $229 = ($228|0)==(0);
  42275. if ($229) {
  42276. $230 = $226 | $227;
  42277. HEAP32[5218] = $230;
  42278. $$pre = ((($225)) + 8|0);
  42279. $$0438 = $225;$$pre$phiZ2D = $$pre;
  42280. } else {
  42281. $231 = ((($225)) + 8|0);
  42282. $232 = HEAP32[$231>>2]|0;
  42283. $233 = HEAP32[(20888)>>2]|0;
  42284. $234 = ($232>>>0)<($233>>>0);
  42285. if ($234) {
  42286. _abort();
  42287. // unreachable;
  42288. } else {
  42289. $$0438 = $232;$$pre$phiZ2D = $231;
  42290. }
  42291. }
  42292. HEAP32[$$pre$phiZ2D>>2] = $$1;
  42293. $235 = ((($$0438)) + 12|0);
  42294. HEAP32[$235>>2] = $$1;
  42295. $236 = ((($$1)) + 8|0);
  42296. HEAP32[$236>>2] = $$0438;
  42297. $237 = ((($$1)) + 12|0);
  42298. HEAP32[$237>>2] = $225;
  42299. return;
  42300. }
  42301. $238 = $$2 >>> 8;
  42302. $239 = ($238|0)==(0);
  42303. if ($239) {
  42304. $$0431 = 0;
  42305. } else {
  42306. $240 = ($$2>>>0)>(16777215);
  42307. if ($240) {
  42308. $$0431 = 31;
  42309. } else {
  42310. $241 = (($238) + 1048320)|0;
  42311. $242 = $241 >>> 16;
  42312. $243 = $242 & 8;
  42313. $244 = $238 << $243;
  42314. $245 = (($244) + 520192)|0;
  42315. $246 = $245 >>> 16;
  42316. $247 = $246 & 4;
  42317. $248 = $247 | $243;
  42318. $249 = $244 << $247;
  42319. $250 = (($249) + 245760)|0;
  42320. $251 = $250 >>> 16;
  42321. $252 = $251 & 2;
  42322. $253 = $248 | $252;
  42323. $254 = (14 - ($253))|0;
  42324. $255 = $249 << $252;
  42325. $256 = $255 >>> 15;
  42326. $257 = (($254) + ($256))|0;
  42327. $258 = $257 << 1;
  42328. $259 = (($257) + 7)|0;
  42329. $260 = $$2 >>> $259;
  42330. $261 = $260 & 1;
  42331. $262 = $261 | $258;
  42332. $$0431 = $262;
  42333. }
  42334. }
  42335. $263 = (21176 + ($$0431<<2)|0);
  42336. $264 = ((($$1)) + 28|0);
  42337. HEAP32[$264>>2] = $$0431;
  42338. $265 = ((($$1)) + 16|0);
  42339. $266 = ((($$1)) + 20|0);
  42340. HEAP32[$266>>2] = 0;
  42341. HEAP32[$265>>2] = 0;
  42342. $267 = HEAP32[(20876)>>2]|0;
  42343. $268 = 1 << $$0431;
  42344. $269 = $267 & $268;
  42345. $270 = ($269|0)==(0);
  42346. if ($270) {
  42347. $271 = $267 | $268;
  42348. HEAP32[(20876)>>2] = $271;
  42349. HEAP32[$263>>2] = $$1;
  42350. $272 = ((($$1)) + 24|0);
  42351. HEAP32[$272>>2] = $263;
  42352. $273 = ((($$1)) + 12|0);
  42353. HEAP32[$273>>2] = $$1;
  42354. $274 = ((($$1)) + 8|0);
  42355. HEAP32[$274>>2] = $$1;
  42356. return;
  42357. }
  42358. $275 = HEAP32[$263>>2]|0;
  42359. $276 = ($$0431|0)==(31);
  42360. $277 = $$0431 >>> 1;
  42361. $278 = (25 - ($277))|0;
  42362. $279 = $276 ? 0 : $278;
  42363. $280 = $$2 << $279;
  42364. $$0419 = $280;$$0420 = $275;
  42365. while(1) {
  42366. $281 = ((($$0420)) + 4|0);
  42367. $282 = HEAP32[$281>>2]|0;
  42368. $283 = $282 & -8;
  42369. $284 = ($283|0)==($$2|0);
  42370. if ($284) {
  42371. label = 121;
  42372. break;
  42373. }
  42374. $285 = $$0419 >>> 31;
  42375. $286 = (((($$0420)) + 16|0) + ($285<<2)|0);
  42376. $287 = $$0419 << 1;
  42377. $288 = HEAP32[$286>>2]|0;
  42378. $289 = ($288|0)==(0|0);
  42379. if ($289) {
  42380. label = 118;
  42381. break;
  42382. } else {
  42383. $$0419 = $287;$$0420 = $288;
  42384. }
  42385. }
  42386. if ((label|0) == 118) {
  42387. $290 = HEAP32[(20888)>>2]|0;
  42388. $291 = ($286>>>0)<($290>>>0);
  42389. if ($291) {
  42390. _abort();
  42391. // unreachable;
  42392. }
  42393. HEAP32[$286>>2] = $$1;
  42394. $292 = ((($$1)) + 24|0);
  42395. HEAP32[$292>>2] = $$0420;
  42396. $293 = ((($$1)) + 12|0);
  42397. HEAP32[$293>>2] = $$1;
  42398. $294 = ((($$1)) + 8|0);
  42399. HEAP32[$294>>2] = $$1;
  42400. return;
  42401. }
  42402. else if ((label|0) == 121) {
  42403. $295 = ((($$0420)) + 8|0);
  42404. $296 = HEAP32[$295>>2]|0;
  42405. $297 = HEAP32[(20888)>>2]|0;
  42406. $298 = ($296>>>0)>=($297>>>0);
  42407. $not$19 = ($$0420>>>0)>=($297>>>0);
  42408. $299 = $298 & $not$19;
  42409. if (!($299)) {
  42410. _abort();
  42411. // unreachable;
  42412. }
  42413. $300 = ((($296)) + 12|0);
  42414. HEAP32[$300>>2] = $$1;
  42415. HEAP32[$295>>2] = $$1;
  42416. $301 = ((($$1)) + 8|0);
  42417. HEAP32[$301>>2] = $296;
  42418. $302 = ((($$1)) + 12|0);
  42419. HEAP32[$302>>2] = $$0420;
  42420. $303 = ((($$1)) + 24|0);
  42421. HEAP32[$303>>2] = 0;
  42422. return;
  42423. }
  42424. }
  42425. function runPostSets() {
  42426. }
  42427. function _memset(ptr, value, num) {
  42428. ptr = ptr|0; value = value|0; num = num|0;
  42429. var end = 0, aligned_end = 0, block_aligned_end = 0, value4 = 0;
  42430. end = (ptr + num)|0;
  42431. value = value & 0xff;
  42432. if ((num|0) >= 67 /* 64 bytes for an unrolled loop + 3 bytes for unaligned head*/) {
  42433. while ((ptr&3) != 0) {
  42434. HEAP8[((ptr)>>0)]=value;
  42435. ptr = (ptr+1)|0;
  42436. }
  42437. aligned_end = (end & -4)|0;
  42438. block_aligned_end = (aligned_end - 64)|0;
  42439. value4 = value | (value << 8) | (value << 16) | (value << 24);
  42440. while((ptr|0) <= (block_aligned_end|0)) {
  42441. HEAP32[((ptr)>>2)]=value4;
  42442. HEAP32[(((ptr)+(4))>>2)]=value4;
  42443. HEAP32[(((ptr)+(8))>>2)]=value4;
  42444. HEAP32[(((ptr)+(12))>>2)]=value4;
  42445. HEAP32[(((ptr)+(16))>>2)]=value4;
  42446. HEAP32[(((ptr)+(20))>>2)]=value4;
  42447. HEAP32[(((ptr)+(24))>>2)]=value4;
  42448. HEAP32[(((ptr)+(28))>>2)]=value4;
  42449. HEAP32[(((ptr)+(32))>>2)]=value4;
  42450. HEAP32[(((ptr)+(36))>>2)]=value4;
  42451. HEAP32[(((ptr)+(40))>>2)]=value4;
  42452. HEAP32[(((ptr)+(44))>>2)]=value4;
  42453. HEAP32[(((ptr)+(48))>>2)]=value4;
  42454. HEAP32[(((ptr)+(52))>>2)]=value4;
  42455. HEAP32[(((ptr)+(56))>>2)]=value4;
  42456. HEAP32[(((ptr)+(60))>>2)]=value4;
  42457. ptr = (ptr + 64)|0;
  42458. }
  42459. while ((ptr|0) < (aligned_end|0) ) {
  42460. HEAP32[((ptr)>>2)]=value4;
  42461. ptr = (ptr+4)|0;
  42462. }
  42463. }
  42464. // The remaining bytes.
  42465. while ((ptr|0) < (end|0)) {
  42466. HEAP8[((ptr)>>0)]=value;
  42467. ptr = (ptr+1)|0;
  42468. }
  42469. return (end-num)|0;
  42470. }
  42471. function _i64Subtract(a, b, c, d) {
  42472. a = a|0; b = b|0; c = c|0; d = d|0;
  42473. var l = 0, h = 0;
  42474. l = (a - c)>>>0;
  42475. h = (b - d)>>>0;
  42476. h = (b - d - (((c>>>0) > (a>>>0))|0))>>>0; // Borrow one from high word to low word on underflow.
  42477. return ((tempRet0 = h,l|0)|0);
  42478. }
  42479. function _i64Add(a, b, c, d) {
  42480. /*
  42481. x = a + b*2^32
  42482. y = c + d*2^32
  42483. result = l + h*2^32
  42484. */
  42485. a = a|0; b = b|0; c = c|0; d = d|0;
  42486. var l = 0, h = 0;
  42487. l = (a + c)>>>0;
  42488. h = (b + d + (((l>>>0) < (a>>>0))|0))>>>0; // Add carry from low word to high word on overflow.
  42489. return ((tempRet0 = h,l|0)|0);
  42490. }
  42491. function _llvm_cttz_i32(x) {
  42492. x = x|0;
  42493. var ret = 0;
  42494. ret = ((HEAP8[(((cttz_i8)+(x & 0xff))>>0)])|0);
  42495. if ((ret|0) < 8) return ret|0;
  42496. ret = ((HEAP8[(((cttz_i8)+((x >> 8)&0xff))>>0)])|0);
  42497. if ((ret|0) < 8) return (ret + 8)|0;
  42498. ret = ((HEAP8[(((cttz_i8)+((x >> 16)&0xff))>>0)])|0);
  42499. if ((ret|0) < 8) return (ret + 16)|0;
  42500. return (((HEAP8[(((cttz_i8)+(x >>> 24))>>0)])|0) + 24)|0;
  42501. }
  42502. function ___udivmoddi4($a$0, $a$1, $b$0, $b$1, $rem) {
  42503. $a$0 = $a$0 | 0;
  42504. $a$1 = $a$1 | 0;
  42505. $b$0 = $b$0 | 0;
  42506. $b$1 = $b$1 | 0;
  42507. $rem = $rem | 0;
  42508. var $n_sroa_0_0_extract_trunc = 0, $n_sroa_1_4_extract_shift$0 = 0, $n_sroa_1_4_extract_trunc = 0, $d_sroa_0_0_extract_trunc = 0, $d_sroa_1_4_extract_shift$0 = 0, $d_sroa_1_4_extract_trunc = 0, $4 = 0, $17 = 0, $37 = 0, $49 = 0, $51 = 0, $57 = 0, $58 = 0, $66 = 0, $78 = 0, $86 = 0, $88 = 0, $89 = 0, $91 = 0, $92 = 0, $95 = 0, $105 = 0, $117 = 0, $119 = 0, $125 = 0, $126 = 0, $130 = 0, $q_sroa_1_1_ph = 0, $q_sroa_0_1_ph = 0, $r_sroa_1_1_ph = 0, $r_sroa_0_1_ph = 0, $sr_1_ph = 0, $d_sroa_0_0_insert_insert99$0 = 0, $d_sroa_0_0_insert_insert99$1 = 0, $137$0 = 0, $137$1 = 0, $carry_0203 = 0, $sr_1202 = 0, $r_sroa_0_1201 = 0, $r_sroa_1_1200 = 0, $q_sroa_0_1199 = 0, $q_sroa_1_1198 = 0, $147 = 0, $149 = 0, $r_sroa_0_0_insert_insert42$0 = 0, $r_sroa_0_0_insert_insert42$1 = 0, $150$1 = 0, $151$0 = 0, $152 = 0, $154$0 = 0, $r_sroa_0_0_extract_trunc = 0, $r_sroa_1_4_extract_trunc = 0, $155 = 0, $carry_0_lcssa$0 = 0, $carry_0_lcssa$1 = 0, $r_sroa_0_1_lcssa = 0, $r_sroa_1_1_lcssa = 0, $q_sroa_0_1_lcssa = 0, $q_sroa_1_1_lcssa = 0, $q_sroa_0_0_insert_ext75$0 = 0, $q_sroa_0_0_insert_ext75$1 = 0, $q_sroa_0_0_insert_insert77$1 = 0, $_0$0 = 0, $_0$1 = 0;
  42509. $n_sroa_0_0_extract_trunc = $a$0;
  42510. $n_sroa_1_4_extract_shift$0 = $a$1;
  42511. $n_sroa_1_4_extract_trunc = $n_sroa_1_4_extract_shift$0;
  42512. $d_sroa_0_0_extract_trunc = $b$0;
  42513. $d_sroa_1_4_extract_shift$0 = $b$1;
  42514. $d_sroa_1_4_extract_trunc = $d_sroa_1_4_extract_shift$0;
  42515. if (($n_sroa_1_4_extract_trunc | 0) == 0) {
  42516. $4 = ($rem | 0) != 0;
  42517. if (($d_sroa_1_4_extract_trunc | 0) == 0) {
  42518. if ($4) {
  42519. HEAP32[$rem >> 2] = ($n_sroa_0_0_extract_trunc >>> 0) % ($d_sroa_0_0_extract_trunc >>> 0);
  42520. HEAP32[$rem + 4 >> 2] = 0;
  42521. }
  42522. $_0$1 = 0;
  42523. $_0$0 = ($n_sroa_0_0_extract_trunc >>> 0) / ($d_sroa_0_0_extract_trunc >>> 0) >>> 0;
  42524. return (tempRet0 = $_0$1, $_0$0) | 0;
  42525. } else {
  42526. if (!$4) {
  42527. $_0$1 = 0;
  42528. $_0$0 = 0;
  42529. return (tempRet0 = $_0$1, $_0$0) | 0;
  42530. }
  42531. HEAP32[$rem >> 2] = $a$0 & -1;
  42532. HEAP32[$rem + 4 >> 2] = $a$1 & 0;
  42533. $_0$1 = 0;
  42534. $_0$0 = 0;
  42535. return (tempRet0 = $_0$1, $_0$0) | 0;
  42536. }
  42537. }
  42538. $17 = ($d_sroa_1_4_extract_trunc | 0) == 0;
  42539. do {
  42540. if (($d_sroa_0_0_extract_trunc | 0) == 0) {
  42541. if ($17) {
  42542. if (($rem | 0) != 0) {
  42543. HEAP32[$rem >> 2] = ($n_sroa_1_4_extract_trunc >>> 0) % ($d_sroa_0_0_extract_trunc >>> 0);
  42544. HEAP32[$rem + 4 >> 2] = 0;
  42545. }
  42546. $_0$1 = 0;
  42547. $_0$0 = ($n_sroa_1_4_extract_trunc >>> 0) / ($d_sroa_0_0_extract_trunc >>> 0) >>> 0;
  42548. return (tempRet0 = $_0$1, $_0$0) | 0;
  42549. }
  42550. if (($n_sroa_0_0_extract_trunc | 0) == 0) {
  42551. if (($rem | 0) != 0) {
  42552. HEAP32[$rem >> 2] = 0;
  42553. HEAP32[$rem + 4 >> 2] = ($n_sroa_1_4_extract_trunc >>> 0) % ($d_sroa_1_4_extract_trunc >>> 0);
  42554. }
  42555. $_0$1 = 0;
  42556. $_0$0 = ($n_sroa_1_4_extract_trunc >>> 0) / ($d_sroa_1_4_extract_trunc >>> 0) >>> 0;
  42557. return (tempRet0 = $_0$1, $_0$0) | 0;
  42558. }
  42559. $37 = $d_sroa_1_4_extract_trunc - 1 | 0;
  42560. if (($37 & $d_sroa_1_4_extract_trunc | 0) == 0) {
  42561. if (($rem | 0) != 0) {
  42562. HEAP32[$rem >> 2] = 0 | $a$0 & -1;
  42563. HEAP32[$rem + 4 >> 2] = $37 & $n_sroa_1_4_extract_trunc | $a$1 & 0;
  42564. }
  42565. $_0$1 = 0;
  42566. $_0$0 = $n_sroa_1_4_extract_trunc >>> ((_llvm_cttz_i32($d_sroa_1_4_extract_trunc | 0) | 0) >>> 0);
  42567. return (tempRet0 = $_0$1, $_0$0) | 0;
  42568. }
  42569. $49 = Math_clz32($d_sroa_1_4_extract_trunc | 0) | 0;
  42570. $51 = $49 - (Math_clz32($n_sroa_1_4_extract_trunc | 0) | 0) | 0;
  42571. if ($51 >>> 0 <= 30) {
  42572. $57 = $51 + 1 | 0;
  42573. $58 = 31 - $51 | 0;
  42574. $sr_1_ph = $57;
  42575. $r_sroa_0_1_ph = $n_sroa_1_4_extract_trunc << $58 | $n_sroa_0_0_extract_trunc >>> ($57 >>> 0);
  42576. $r_sroa_1_1_ph = $n_sroa_1_4_extract_trunc >>> ($57 >>> 0);
  42577. $q_sroa_0_1_ph = 0;
  42578. $q_sroa_1_1_ph = $n_sroa_0_0_extract_trunc << $58;
  42579. break;
  42580. }
  42581. if (($rem | 0) == 0) {
  42582. $_0$1 = 0;
  42583. $_0$0 = 0;
  42584. return (tempRet0 = $_0$1, $_0$0) | 0;
  42585. }
  42586. HEAP32[$rem >> 2] = 0 | $a$0 & -1;
  42587. HEAP32[$rem + 4 >> 2] = $n_sroa_1_4_extract_shift$0 | $a$1 & 0;
  42588. $_0$1 = 0;
  42589. $_0$0 = 0;
  42590. return (tempRet0 = $_0$1, $_0$0) | 0;
  42591. } else {
  42592. if (!$17) {
  42593. $117 = Math_clz32($d_sroa_1_4_extract_trunc | 0) | 0;
  42594. $119 = $117 - (Math_clz32($n_sroa_1_4_extract_trunc | 0) | 0) | 0;
  42595. if ($119 >>> 0 <= 31) {
  42596. $125 = $119 + 1 | 0;
  42597. $126 = 31 - $119 | 0;
  42598. $130 = $119 - 31 >> 31;
  42599. $sr_1_ph = $125;
  42600. $r_sroa_0_1_ph = $n_sroa_0_0_extract_trunc >>> ($125 >>> 0) & $130 | $n_sroa_1_4_extract_trunc << $126;
  42601. $r_sroa_1_1_ph = $n_sroa_1_4_extract_trunc >>> ($125 >>> 0) & $130;
  42602. $q_sroa_0_1_ph = 0;
  42603. $q_sroa_1_1_ph = $n_sroa_0_0_extract_trunc << $126;
  42604. break;
  42605. }
  42606. if (($rem | 0) == 0) {
  42607. $_0$1 = 0;
  42608. $_0$0 = 0;
  42609. return (tempRet0 = $_0$1, $_0$0) | 0;
  42610. }
  42611. HEAP32[$rem >> 2] = 0 | $a$0 & -1;
  42612. HEAP32[$rem + 4 >> 2] = $n_sroa_1_4_extract_shift$0 | $a$1 & 0;
  42613. $_0$1 = 0;
  42614. $_0$0 = 0;
  42615. return (tempRet0 = $_0$1, $_0$0) | 0;
  42616. }
  42617. $66 = $d_sroa_0_0_extract_trunc - 1 | 0;
  42618. if (($66 & $d_sroa_0_0_extract_trunc | 0) != 0) {
  42619. $86 = (Math_clz32($d_sroa_0_0_extract_trunc | 0) | 0) + 33 | 0;
  42620. $88 = $86 - (Math_clz32($n_sroa_1_4_extract_trunc | 0) | 0) | 0;
  42621. $89 = 64 - $88 | 0;
  42622. $91 = 32 - $88 | 0;
  42623. $92 = $91 >> 31;
  42624. $95 = $88 - 32 | 0;
  42625. $105 = $95 >> 31;
  42626. $sr_1_ph = $88;
  42627. $r_sroa_0_1_ph = $91 - 1 >> 31 & $n_sroa_1_4_extract_trunc >>> ($95 >>> 0) | ($n_sroa_1_4_extract_trunc << $91 | $n_sroa_0_0_extract_trunc >>> ($88 >>> 0)) & $105;
  42628. $r_sroa_1_1_ph = $105 & $n_sroa_1_4_extract_trunc >>> ($88 >>> 0);
  42629. $q_sroa_0_1_ph = $n_sroa_0_0_extract_trunc << $89 & $92;
  42630. $q_sroa_1_1_ph = ($n_sroa_1_4_extract_trunc << $89 | $n_sroa_0_0_extract_trunc >>> ($95 >>> 0)) & $92 | $n_sroa_0_0_extract_trunc << $91 & $88 - 33 >> 31;
  42631. break;
  42632. }
  42633. if (($rem | 0) != 0) {
  42634. HEAP32[$rem >> 2] = $66 & $n_sroa_0_0_extract_trunc;
  42635. HEAP32[$rem + 4 >> 2] = 0;
  42636. }
  42637. if (($d_sroa_0_0_extract_trunc | 0) == 1) {
  42638. $_0$1 = $n_sroa_1_4_extract_shift$0 | $a$1 & 0;
  42639. $_0$0 = 0 | $a$0 & -1;
  42640. return (tempRet0 = $_0$1, $_0$0) | 0;
  42641. } else {
  42642. $78 = _llvm_cttz_i32($d_sroa_0_0_extract_trunc | 0) | 0;
  42643. $_0$1 = 0 | $n_sroa_1_4_extract_trunc >>> ($78 >>> 0);
  42644. $_0$0 = $n_sroa_1_4_extract_trunc << 32 - $78 | $n_sroa_0_0_extract_trunc >>> ($78 >>> 0) | 0;
  42645. return (tempRet0 = $_0$1, $_0$0) | 0;
  42646. }
  42647. }
  42648. } while (0);
  42649. if (($sr_1_ph | 0) == 0) {
  42650. $q_sroa_1_1_lcssa = $q_sroa_1_1_ph;
  42651. $q_sroa_0_1_lcssa = $q_sroa_0_1_ph;
  42652. $r_sroa_1_1_lcssa = $r_sroa_1_1_ph;
  42653. $r_sroa_0_1_lcssa = $r_sroa_0_1_ph;
  42654. $carry_0_lcssa$1 = 0;
  42655. $carry_0_lcssa$0 = 0;
  42656. } else {
  42657. $d_sroa_0_0_insert_insert99$0 = 0 | $b$0 & -1;
  42658. $d_sroa_0_0_insert_insert99$1 = $d_sroa_1_4_extract_shift$0 | $b$1 & 0;
  42659. $137$0 = _i64Add($d_sroa_0_0_insert_insert99$0 | 0, $d_sroa_0_0_insert_insert99$1 | 0, -1, -1) | 0;
  42660. $137$1 = tempRet0;
  42661. $q_sroa_1_1198 = $q_sroa_1_1_ph;
  42662. $q_sroa_0_1199 = $q_sroa_0_1_ph;
  42663. $r_sroa_1_1200 = $r_sroa_1_1_ph;
  42664. $r_sroa_0_1201 = $r_sroa_0_1_ph;
  42665. $sr_1202 = $sr_1_ph;
  42666. $carry_0203 = 0;
  42667. while (1) {
  42668. $147 = $q_sroa_0_1199 >>> 31 | $q_sroa_1_1198 << 1;
  42669. $149 = $carry_0203 | $q_sroa_0_1199 << 1;
  42670. $r_sroa_0_0_insert_insert42$0 = 0 | ($r_sroa_0_1201 << 1 | $q_sroa_1_1198 >>> 31);
  42671. $r_sroa_0_0_insert_insert42$1 = $r_sroa_0_1201 >>> 31 | $r_sroa_1_1200 << 1 | 0;
  42672. _i64Subtract($137$0 | 0, $137$1 | 0, $r_sroa_0_0_insert_insert42$0 | 0, $r_sroa_0_0_insert_insert42$1 | 0) | 0;
  42673. $150$1 = tempRet0;
  42674. $151$0 = $150$1 >> 31 | (($150$1 | 0) < 0 ? -1 : 0) << 1;
  42675. $152 = $151$0 & 1;
  42676. $154$0 = _i64Subtract($r_sroa_0_0_insert_insert42$0 | 0, $r_sroa_0_0_insert_insert42$1 | 0, $151$0 & $d_sroa_0_0_insert_insert99$0 | 0, ((($150$1 | 0) < 0 ? -1 : 0) >> 31 | (($150$1 | 0) < 0 ? -1 : 0) << 1) & $d_sroa_0_0_insert_insert99$1 | 0) | 0;
  42677. $r_sroa_0_0_extract_trunc = $154$0;
  42678. $r_sroa_1_4_extract_trunc = tempRet0;
  42679. $155 = $sr_1202 - 1 | 0;
  42680. if (($155 | 0) == 0) {
  42681. break;
  42682. } else {
  42683. $q_sroa_1_1198 = $147;
  42684. $q_sroa_0_1199 = $149;
  42685. $r_sroa_1_1200 = $r_sroa_1_4_extract_trunc;
  42686. $r_sroa_0_1201 = $r_sroa_0_0_extract_trunc;
  42687. $sr_1202 = $155;
  42688. $carry_0203 = $152;
  42689. }
  42690. }
  42691. $q_sroa_1_1_lcssa = $147;
  42692. $q_sroa_0_1_lcssa = $149;
  42693. $r_sroa_1_1_lcssa = $r_sroa_1_4_extract_trunc;
  42694. $r_sroa_0_1_lcssa = $r_sroa_0_0_extract_trunc;
  42695. $carry_0_lcssa$1 = 0;
  42696. $carry_0_lcssa$0 = $152;
  42697. }
  42698. $q_sroa_0_0_insert_ext75$0 = $q_sroa_0_1_lcssa;
  42699. $q_sroa_0_0_insert_ext75$1 = 0;
  42700. $q_sroa_0_0_insert_insert77$1 = $q_sroa_1_1_lcssa | $q_sroa_0_0_insert_ext75$1;
  42701. if (($rem | 0) != 0) {
  42702. HEAP32[$rem >> 2] = 0 | $r_sroa_0_1_lcssa;
  42703. HEAP32[$rem + 4 >> 2] = $r_sroa_1_1_lcssa | 0;
  42704. }
  42705. $_0$1 = (0 | $q_sroa_0_0_insert_ext75$0) >>> 31 | $q_sroa_0_0_insert_insert77$1 << 1 | ($q_sroa_0_0_insert_ext75$1 << 1 | $q_sroa_0_0_insert_ext75$0 >>> 31) & 0 | $carry_0_lcssa$1;
  42706. $_0$0 = ($q_sroa_0_0_insert_ext75$0 << 1 | 0 >>> 31) & -2 | $carry_0_lcssa$0;
  42707. return (tempRet0 = $_0$1, $_0$0) | 0;
  42708. }
  42709. function ___udivdi3($a$0, $a$1, $b$0, $b$1) {
  42710. $a$0 = $a$0 | 0;
  42711. $a$1 = $a$1 | 0;
  42712. $b$0 = $b$0 | 0;
  42713. $b$1 = $b$1 | 0;
  42714. var $1$0 = 0;
  42715. $1$0 = ___udivmoddi4($a$0, $a$1, $b$0, $b$1, 0) | 0;
  42716. return $1$0 | 0;
  42717. }
  42718. function ___muldsi3($a, $b) {
  42719. $a = $a | 0;
  42720. $b = $b | 0;
  42721. var $1 = 0, $2 = 0, $3 = 0, $6 = 0, $8 = 0, $11 = 0, $12 = 0;
  42722. $1 = $a & 65535;
  42723. $2 = $b & 65535;
  42724. $3 = Math_imul($2, $1) | 0;
  42725. $6 = $a >>> 16;
  42726. $8 = ($3 >>> 16) + (Math_imul($2, $6) | 0) | 0;
  42727. $11 = $b >>> 16;
  42728. $12 = Math_imul($11, $1) | 0;
  42729. return (tempRet0 = (($8 >>> 16) + (Math_imul($11, $6) | 0) | 0) + ((($8 & 65535) + $12 | 0) >>> 16) | 0, 0 | ($8 + $12 << 16 | $3 & 65535)) | 0;
  42730. }
  42731. function ___muldi3($a$0, $a$1, $b$0, $b$1) {
  42732. $a$0 = $a$0 | 0;
  42733. $a$1 = $a$1 | 0;
  42734. $b$0 = $b$0 | 0;
  42735. $b$1 = $b$1 | 0;
  42736. var $x_sroa_0_0_extract_trunc = 0, $y_sroa_0_0_extract_trunc = 0, $1$0 = 0, $1$1 = 0, $2 = 0;
  42737. $x_sroa_0_0_extract_trunc = $a$0;
  42738. $y_sroa_0_0_extract_trunc = $b$0;
  42739. $1$0 = ___muldsi3($x_sroa_0_0_extract_trunc, $y_sroa_0_0_extract_trunc) | 0;
  42740. $1$1 = tempRet0;
  42741. $2 = Math_imul($a$1, $y_sroa_0_0_extract_trunc) | 0;
  42742. return (tempRet0 = ((Math_imul($b$1, $x_sroa_0_0_extract_trunc) | 0) + $2 | 0) + $1$1 | $1$1 & 0, 0 | $1$0 & -1) | 0;
  42743. }
  42744. function _memcpy(dest, src, num) {
  42745. dest = dest|0; src = src|0; num = num|0;
  42746. var ret = 0;
  42747. var aligned_dest_end = 0;
  42748. var block_aligned_dest_end = 0;
  42749. var dest_end = 0;
  42750. // Test against a benchmarked cutoff limit for when HEAPU8.set() becomes faster to use.
  42751. if ((num|0) >=
  42752. 8192
  42753. ) {
  42754. return _emscripten_memcpy_big(dest|0, src|0, num|0)|0;
  42755. }
  42756. ret = dest|0;
  42757. dest_end = (dest + num)|0;
  42758. if ((dest&3) == (src&3)) {
  42759. // The initial unaligned < 4-byte front.
  42760. while (dest & 3) {
  42761. if ((num|0) == 0) return ret|0;
  42762. HEAP8[((dest)>>0)]=((HEAP8[((src)>>0)])|0);
  42763. dest = (dest+1)|0;
  42764. src = (src+1)|0;
  42765. num = (num-1)|0;
  42766. }
  42767. aligned_dest_end = (dest_end & -4)|0;
  42768. block_aligned_dest_end = (aligned_dest_end - 64)|0;
  42769. while ((dest|0) <= (block_aligned_dest_end|0) ) {
  42770. HEAP32[((dest)>>2)]=((HEAP32[((src)>>2)])|0);
  42771. HEAP32[(((dest)+(4))>>2)]=((HEAP32[(((src)+(4))>>2)])|0);
  42772. HEAP32[(((dest)+(8))>>2)]=((HEAP32[(((src)+(8))>>2)])|0);
  42773. HEAP32[(((dest)+(12))>>2)]=((HEAP32[(((src)+(12))>>2)])|0);
  42774. HEAP32[(((dest)+(16))>>2)]=((HEAP32[(((src)+(16))>>2)])|0);
  42775. HEAP32[(((dest)+(20))>>2)]=((HEAP32[(((src)+(20))>>2)])|0);
  42776. HEAP32[(((dest)+(24))>>2)]=((HEAP32[(((src)+(24))>>2)])|0);
  42777. HEAP32[(((dest)+(28))>>2)]=((HEAP32[(((src)+(28))>>2)])|0);
  42778. HEAP32[(((dest)+(32))>>2)]=((HEAP32[(((src)+(32))>>2)])|0);
  42779. HEAP32[(((dest)+(36))>>2)]=((HEAP32[(((src)+(36))>>2)])|0);
  42780. HEAP32[(((dest)+(40))>>2)]=((HEAP32[(((src)+(40))>>2)])|0);
  42781. HEAP32[(((dest)+(44))>>2)]=((HEAP32[(((src)+(44))>>2)])|0);
  42782. HEAP32[(((dest)+(48))>>2)]=((HEAP32[(((src)+(48))>>2)])|0);
  42783. HEAP32[(((dest)+(52))>>2)]=((HEAP32[(((src)+(52))>>2)])|0);
  42784. HEAP32[(((dest)+(56))>>2)]=((HEAP32[(((src)+(56))>>2)])|0);
  42785. HEAP32[(((dest)+(60))>>2)]=((HEAP32[(((src)+(60))>>2)])|0);
  42786. dest = (dest+64)|0;
  42787. src = (src+64)|0;
  42788. }
  42789. while ((dest|0) < (aligned_dest_end|0) ) {
  42790. HEAP32[((dest)>>2)]=((HEAP32[((src)>>2)])|0);
  42791. dest = (dest+4)|0;
  42792. src = (src+4)|0;
  42793. }
  42794. } else {
  42795. // In the unaligned copy case, unroll a bit as well.
  42796. aligned_dest_end = (dest_end - 4)|0;
  42797. while ((dest|0) < (aligned_dest_end|0) ) {
  42798. HEAP8[((dest)>>0)]=((HEAP8[((src)>>0)])|0);
  42799. HEAP8[(((dest)+(1))>>0)]=((HEAP8[(((src)+(1))>>0)])|0);
  42800. HEAP8[(((dest)+(2))>>0)]=((HEAP8[(((src)+(2))>>0)])|0);
  42801. HEAP8[(((dest)+(3))>>0)]=((HEAP8[(((src)+(3))>>0)])|0);
  42802. dest = (dest+4)|0;
  42803. src = (src+4)|0;
  42804. }
  42805. }
  42806. // The remaining unaligned < 4 byte tail.
  42807. while ((dest|0) < (dest_end|0)) {
  42808. HEAP8[((dest)>>0)]=((HEAP8[((src)>>0)])|0);
  42809. dest = (dest+1)|0;
  42810. src = (src+1)|0;
  42811. }
  42812. return ret|0;
  42813. }
  42814. function _memmove(dest, src, num) {
  42815. dest = dest|0; src = src|0; num = num|0;
  42816. var ret = 0;
  42817. if (((src|0) < (dest|0)) & ((dest|0) < ((src + num)|0))) {
  42818. // Unlikely case: Copy backwards in a safe manner
  42819. ret = dest;
  42820. src = (src + num)|0;
  42821. dest = (dest + num)|0;
  42822. while ((num|0) > 0) {
  42823. dest = (dest - 1)|0;
  42824. src = (src - 1)|0;
  42825. num = (num - 1)|0;
  42826. HEAP8[((dest)>>0)]=((HEAP8[((src)>>0)])|0);
  42827. }
  42828. dest = ret;
  42829. } else {
  42830. _memcpy(dest, src, num) | 0;
  42831. }
  42832. return dest | 0;
  42833. }
  42834. function ___uremdi3($a$0, $a$1, $b$0, $b$1) {
  42835. $a$0 = $a$0 | 0;
  42836. $a$1 = $a$1 | 0;
  42837. $b$0 = $b$0 | 0;
  42838. $b$1 = $b$1 | 0;
  42839. var $rem = 0, __stackBase__ = 0;
  42840. __stackBase__ = STACKTOP;
  42841. STACKTOP = STACKTOP + 16 | 0;
  42842. $rem = __stackBase__ | 0;
  42843. ___udivmoddi4($a$0, $a$1, $b$0, $b$1, $rem) | 0;
  42844. STACKTOP = __stackBase__;
  42845. return (tempRet0 = HEAP32[$rem + 4 >> 2] | 0, HEAP32[$rem >> 2] | 0) | 0;
  42846. }
  42847. function _roundf(f) {
  42848. f = +f;
  42849. return f >= +0 ? +Math_floor(f + +0.5) : +Math_ceil(f - +0.5); // TODO: use fround?
  42850. }
  42851. function _bitshift64Lshr(low, high, bits) {
  42852. low = low|0; high = high|0; bits = bits|0;
  42853. var ander = 0;
  42854. if ((bits|0) < 32) {
  42855. ander = ((1 << bits) - 1)|0;
  42856. tempRet0 = high >>> bits;
  42857. return (low >>> bits) | ((high&ander) << (32 - bits));
  42858. }
  42859. tempRet0 = 0;
  42860. return (high >>> (bits - 32))|0;
  42861. }
  42862. function _sbrk(increment) {
  42863. increment = increment|0;
  42864. var oldDynamicTop = 0;
  42865. var oldDynamicTopOnChange = 0;
  42866. var newDynamicTop = 0;
  42867. var totalMemory = 0;
  42868. increment = ((increment + 15) & -16)|0;
  42869. oldDynamicTop = HEAP32[DYNAMICTOP_PTR>>2]|0;
  42870. newDynamicTop = oldDynamicTop + increment | 0;
  42871. if (((increment|0) > 0 & (newDynamicTop|0) < (oldDynamicTop|0)) // Detect and fail if we would wrap around signed 32-bit int.
  42872. | (newDynamicTop|0) < 0) { // Also underflow, sbrk() should be able to be used to subtract.
  42873. abortOnCannotGrowMemory()|0;
  42874. ___setErrNo(12);
  42875. return -1;
  42876. }
  42877. HEAP32[DYNAMICTOP_PTR>>2] = newDynamicTop;
  42878. totalMemory = getTotalMemory()|0;
  42879. if ((newDynamicTop|0) > (totalMemory|0)) {
  42880. if ((enlargeMemory()|0) == 0) {
  42881. ___setErrNo(12);
  42882. HEAP32[DYNAMICTOP_PTR>>2] = oldDynamicTop;
  42883. return -1;
  42884. }
  42885. }
  42886. return oldDynamicTop|0;
  42887. }
  42888. function _bitshift64Shl(low, high, bits) {
  42889. low = low|0; high = high|0; bits = bits|0;
  42890. var ander = 0;
  42891. if ((bits|0) < 32) {
  42892. ander = ((1 << bits) - 1)|0;
  42893. tempRet0 = (high << bits) | ((low&(ander << (32 - bits))) >>> (32 - bits));
  42894. return low << bits;
  42895. }
  42896. tempRet0 = low << (bits - 32);
  42897. return 0;
  42898. }
  42899. function _llvm_bswap_i32(x) {
  42900. x = x|0;
  42901. return (((x&0xff)<<24) | (((x>>8)&0xff)<<16) | (((x>>16)&0xff)<<8) | (x>>>24))|0;
  42902. }
  42903. function dynCall_viiiii(index,a1,a2,a3,a4,a5) {
  42904. index = index|0;
  42905. a1=a1|0; a2=a2|0; a3=a3|0; a4=a4|0; a5=a5|0;
  42906. FUNCTION_TABLE_viiiii[index&7](a1|0,a2|0,a3|0,a4|0,a5|0);
  42907. }
  42908. function dynCall_vd(index,a1) {
  42909. index = index|0;
  42910. a1=+a1;
  42911. FUNCTION_TABLE_vd[index&3](+a1);
  42912. }
  42913. function dynCall_vid(index,a1,a2) {
  42914. index = index|0;
  42915. a1=a1|0; a2=+a2;
  42916. FUNCTION_TABLE_vid[index&3](a1|0,+a2);
  42917. }
  42918. function dynCall_vi(index,a1) {
  42919. index = index|0;
  42920. a1=a1|0;
  42921. FUNCTION_TABLE_vi[index&31](a1|0);
  42922. }
  42923. function dynCall_vii(index,a1,a2) {
  42924. index = index|0;
  42925. a1=a1|0; a2=a2|0;
  42926. FUNCTION_TABLE_vii[index&63](a1|0,a2|0);
  42927. }
  42928. function dynCall_ii(index,a1) {
  42929. index = index|0;
  42930. a1=a1|0;
  42931. return FUNCTION_TABLE_ii[index&15](a1|0)|0;
  42932. }
  42933. function dynCall_viddd(index,a1,a2,a3,a4) {
  42934. index = index|0;
  42935. a1=a1|0; a2=+a2; a3=+a3; a4=+a4;
  42936. FUNCTION_TABLE_viddd[index&3](a1|0,+a2,+a3,+a4);
  42937. }
  42938. function dynCall_vidd(index,a1,a2,a3) {
  42939. index = index|0;
  42940. a1=a1|0; a2=+a2; a3=+a3;
  42941. FUNCTION_TABLE_vidd[index&7](a1|0,+a2,+a3);
  42942. }
  42943. function dynCall_iiii(index,a1,a2,a3) {
  42944. index = index|0;
  42945. a1=a1|0; a2=a2|0; a3=a3|0;
  42946. return FUNCTION_TABLE_iiii[index&15](a1|0,a2|0,a3|0)|0;
  42947. }
  42948. function dynCall_viiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8) {
  42949. index = index|0;
  42950. a1=a1|0; a2=a2|0; a3=a3|0; a4=a4|0; a5=a5|0; a6=a6|0; a7=a7|0; a8=a8|0;
  42951. FUNCTION_TABLE_viiiiiiii[index&3](a1|0,a2|0,a3|0,a4|0,a5|0,a6|0,a7|0,a8|0);
  42952. }
  42953. function dynCall_viiiiii(index,a1,a2,a3,a4,a5,a6) {
  42954. index = index|0;
  42955. a1=a1|0; a2=a2|0; a3=a3|0; a4=a4|0; a5=a5|0; a6=a6|0;
  42956. FUNCTION_TABLE_viiiiii[index&3](a1|0,a2|0,a3|0,a4|0,a5|0,a6|0);
  42957. }
  42958. function dynCall_viii(index,a1,a2,a3) {
  42959. index = index|0;
  42960. a1=a1|0; a2=a2|0; a3=a3|0;
  42961. FUNCTION_TABLE_viii[index&31](a1|0,a2|0,a3|0);
  42962. }
  42963. function dynCall_vidddd(index,a1,a2,a3,a4,a5) {
  42964. index = index|0;
  42965. a1=a1|0; a2=+a2; a3=+a3; a4=+a4; a5=+a5;
  42966. FUNCTION_TABLE_vidddd[index&3](a1|0,+a2,+a3,+a4,+a5);
  42967. }
  42968. function dynCall_vdi(index,a1,a2) {
  42969. index = index|0;
  42970. a1=+a1; a2=a2|0;
  42971. FUNCTION_TABLE_vdi[index&1](+a1,a2|0);
  42972. }
  42973. function dynCall_viiiiiii(index,a1,a2,a3,a4,a5,a6,a7) {
  42974. index = index|0;
  42975. a1=a1|0; a2=a2|0; a3=a3|0; a4=a4|0; a5=a5|0; a6=a6|0; a7=a7|0;
  42976. FUNCTION_TABLE_viiiiiii[index&3](a1|0,a2|0,a3|0,a4|0,a5|0,a6|0,a7|0);
  42977. }
  42978. function dynCall_viiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9) {
  42979. index = index|0;
  42980. a1=a1|0; a2=a2|0; a3=a3|0; a4=a4|0; a5=a5|0; a6=a6|0; a7=a7|0; a8=a8|0; a9=a9|0;
  42981. FUNCTION_TABLE_viiiiiiiii[index&3](a1|0,a2|0,a3|0,a4|0,a5|0,a6|0,a7|0,a8|0,a9|0);
  42982. }
  42983. function dynCall_iii(index,a1,a2) {
  42984. index = index|0;
  42985. a1=a1|0; a2=a2|0;
  42986. return FUNCTION_TABLE_iii[index&3](a1|0,a2|0)|0;
  42987. }
  42988. function dynCall_i(index) {
  42989. index = index|0;
  42990. return FUNCTION_TABLE_i[index&3]()|0;
  42991. }
  42992. function dynCall_vdddddd(index,a1,a2,a3,a4,a5,a6) {
  42993. index = index|0;
  42994. a1=+a1; a2=+a2; a3=+a3; a4=+a4; a5=+a5; a6=+a6;
  42995. FUNCTION_TABLE_vdddddd[index&1](+a1,+a2,+a3,+a4,+a5,+a6);
  42996. }
  42997. function dynCall_vdddd(index,a1,a2,a3,a4) {
  42998. index = index|0;
  42999. a1=+a1; a2=+a2; a3=+a3; a4=+a4;
  43000. FUNCTION_TABLE_vdddd[index&3](+a1,+a2,+a3,+a4);
  43001. }
  43002. function dynCall_vdd(index,a1,a2) {
  43003. index = index|0;
  43004. a1=+a1; a2=+a2;
  43005. FUNCTION_TABLE_vdd[index&3](+a1,+a2);
  43006. }
  43007. function dynCall_v(index) {
  43008. index = index|0;
  43009. FUNCTION_TABLE_v[index&7]();
  43010. }
  43011. function dynCall_viid(index,a1,a2,a3) {
  43012. index = index|0;
  43013. a1=a1|0; a2=a2|0; a3=+a3;
  43014. FUNCTION_TABLE_viid[index&1](a1|0,a2|0,+a3);
  43015. }
  43016. function dynCall_viiii(index,a1,a2,a3,a4) {
  43017. index = index|0;
  43018. a1=a1|0; a2=a2|0; a3=a3|0; a4=a4|0;
  43019. FUNCTION_TABLE_viiii[index&31](a1|0,a2|0,a3|0,a4|0);
  43020. }
  43021. function b0(p0,p1,p2,p3,p4) {
  43022. p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0; nullFunc_viiiii(0);
  43023. }
  43024. function _emscripten_glUniform4i__wrapper(p0,p1,p2,p3,p4) {
  43025. p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0; _emscripten_glUniform4i(p0|0,p1|0,p2|0,p3|0,p4|0);
  43026. }
  43027. function _emscripten_glFramebufferTexture2D__wrapper(p0,p1,p2,p3,p4) {
  43028. p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0; _emscripten_glFramebufferTexture2D(p0|0,p1|0,p2|0,p3|0,p4|0);
  43029. }
  43030. function _emscripten_glShaderBinary__wrapper(p0,p1,p2,p3,p4) {
  43031. p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0; _emscripten_glShaderBinary(p0|0,p1|0,p2|0,p3|0,p4|0);
  43032. }
  43033. function _emscripten_glDrawElementsInstanced__wrapper(p0,p1,p2,p3,p4) {
  43034. p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0; _emscripten_glDrawElementsInstanced(p0|0,p1|0,p2|0,p3|0,p4|0);
  43035. }
  43036. function b1(p0) {
  43037. p0 = +p0; nullFunc_vd(1);
  43038. }
  43039. function _emscripten_glClearDepth__wrapper(p0) {
  43040. p0 = +p0; _emscripten_glClearDepth(+p0);
  43041. }
  43042. function _emscripten_glClearDepthf__wrapper(p0) {
  43043. p0 = +p0; _emscripten_glClearDepthf(+p0);
  43044. }
  43045. function _emscripten_glLineWidth__wrapper(p0) {
  43046. p0 = +p0; _emscripten_glLineWidth(+p0);
  43047. }
  43048. function b2(p0,p1) {
  43049. p0 = p0|0;p1 = +p1; nullFunc_vid(2);
  43050. }
  43051. function _emscripten_glUniform1f__wrapper(p0,p1) {
  43052. p0 = p0|0;p1 = +p1; _emscripten_glUniform1f(p0|0,+p1);
  43053. }
  43054. function _emscripten_glVertexAttrib1f__wrapper(p0,p1) {
  43055. p0 = p0|0;p1 = +p1; _emscripten_glVertexAttrib1f(p0|0,+p1);
  43056. }
  43057. function b3(p0) {
  43058. p0 = p0|0; nullFunc_vi(3);
  43059. }
  43060. function _emscripten_glDeleteShader__wrapper(p0) {
  43061. p0 = p0|0; _emscripten_glDeleteShader(p0|0);
  43062. }
  43063. function _emscripten_glCompileShader__wrapper(p0) {
  43064. p0 = p0|0; _emscripten_glCompileShader(p0|0);
  43065. }
  43066. function _emscripten_glDeleteProgram__wrapper(p0) {
  43067. p0 = p0|0; _emscripten_glDeleteProgram(p0|0);
  43068. }
  43069. function _emscripten_glLinkProgram__wrapper(p0) {
  43070. p0 = p0|0; _emscripten_glLinkProgram(p0|0);
  43071. }
  43072. function _emscripten_glUseProgram__wrapper(p0) {
  43073. p0 = p0|0; _emscripten_glUseProgram(p0|0);
  43074. }
  43075. function _emscripten_glValidateProgram__wrapper(p0) {
  43076. p0 = p0|0; _emscripten_glValidateProgram(p0|0);
  43077. }
  43078. function _emscripten_glDeleteObjectARB__wrapper(p0) {
  43079. p0 = p0|0; _emscripten_glDeleteObjectARB(p0|0);
  43080. }
  43081. function _emscripten_glEnableClientState__wrapper(p0) {
  43082. p0 = p0|0; _emscripten_glEnableClientState(p0|0);
  43083. }
  43084. function _emscripten_glClientActiveTexture__wrapper(p0) {
  43085. p0 = p0|0; _emscripten_glClientActiveTexture(p0|0);
  43086. }
  43087. function _emscripten_glBindVertexArray__wrapper(p0) {
  43088. p0 = p0|0; _emscripten_glBindVertexArray(p0|0);
  43089. }
  43090. function _emscripten_glMatrixMode__wrapper(p0) {
  43091. p0 = p0|0; _emscripten_glMatrixMode(p0|0);
  43092. }
  43093. function _emscripten_glLoadMatrixf__wrapper(p0) {
  43094. p0 = p0|0; _emscripten_glLoadMatrixf(p0|0);
  43095. }
  43096. function _emscripten_glEnableVertexAttribArray__wrapper(p0) {
  43097. p0 = p0|0; _emscripten_glEnableVertexAttribArray(p0|0);
  43098. }
  43099. function _emscripten_glDisableVertexAttribArray__wrapper(p0) {
  43100. p0 = p0|0; _emscripten_glDisableVertexAttribArray(p0|0);
  43101. }
  43102. function _emscripten_glDepthFunc__wrapper(p0) {
  43103. p0 = p0|0; _emscripten_glDepthFunc(p0|0);
  43104. }
  43105. function _emscripten_glEnable__wrapper(p0) {
  43106. p0 = p0|0; _emscripten_glEnable(p0|0);
  43107. }
  43108. function _emscripten_glDisable__wrapper(p0) {
  43109. p0 = p0|0; _emscripten_glDisable(p0|0);
  43110. }
  43111. function _emscripten_glFrontFace__wrapper(p0) {
  43112. p0 = p0|0; _emscripten_glFrontFace(p0|0);
  43113. }
  43114. function _emscripten_glCullFace__wrapper(p0) {
  43115. p0 = p0|0; _emscripten_glCullFace(p0|0);
  43116. }
  43117. function _emscripten_glClear__wrapper(p0) {
  43118. p0 = p0|0; _emscripten_glClear(p0|0);
  43119. }
  43120. function _emscripten_glClearStencil__wrapper(p0) {
  43121. p0 = p0|0; _emscripten_glClearStencil(p0|0);
  43122. }
  43123. function _emscripten_glDepthMask__wrapper(p0) {
  43124. p0 = p0|0; _emscripten_glDepthMask(p0|0);
  43125. }
  43126. function _emscripten_glStencilMask__wrapper(p0) {
  43127. p0 = p0|0; _emscripten_glStencilMask(p0|0);
  43128. }
  43129. function _emscripten_glGenerateMipmap__wrapper(p0) {
  43130. p0 = p0|0; _emscripten_glGenerateMipmap(p0|0);
  43131. }
  43132. function _emscripten_glActiveTexture__wrapper(p0) {
  43133. p0 = p0|0; _emscripten_glActiveTexture(p0|0);
  43134. }
  43135. function _emscripten_glBlendEquation__wrapper(p0) {
  43136. p0 = p0|0; _emscripten_glBlendEquation(p0|0);
  43137. }
  43138. function b4(p0,p1) {
  43139. p0 = p0|0;p1 = p1|0; nullFunc_vii(4);
  43140. }
  43141. function _emscripten_glPixelStorei__wrapper(p0,p1) {
  43142. p0 = p0|0;p1 = p1|0; _emscripten_glPixelStorei(p0|0,p1|0);
  43143. }
  43144. function _emscripten_glGetIntegerv__wrapper(p0,p1) {
  43145. p0 = p0|0;p1 = p1|0; _emscripten_glGetIntegerv(p0|0,p1|0);
  43146. }
  43147. function _emscripten_glGetFloatv__wrapper(p0,p1) {
  43148. p0 = p0|0;p1 = p1|0; _emscripten_glGetFloatv(p0|0,p1|0);
  43149. }
  43150. function _emscripten_glGetBooleanv__wrapper(p0,p1) {
  43151. p0 = p0|0;p1 = p1|0; _emscripten_glGetBooleanv(p0|0,p1|0);
  43152. }
  43153. function _emscripten_glGenTextures__wrapper(p0,p1) {
  43154. p0 = p0|0;p1 = p1|0; _emscripten_glGenTextures(p0|0,p1|0);
  43155. }
  43156. function _emscripten_glDeleteTextures__wrapper(p0,p1) {
  43157. p0 = p0|0;p1 = p1|0; _emscripten_glDeleteTextures(p0|0,p1|0);
  43158. }
  43159. function _emscripten_glBindTexture__wrapper(p0,p1) {
  43160. p0 = p0|0;p1 = p1|0; _emscripten_glBindTexture(p0|0,p1|0);
  43161. }
  43162. function _emscripten_glGenBuffers__wrapper(p0,p1) {
  43163. p0 = p0|0;p1 = p1|0; _emscripten_glGenBuffers(p0|0,p1|0);
  43164. }
  43165. function _emscripten_glDeleteBuffers__wrapper(p0,p1) {
  43166. p0 = p0|0;p1 = p1|0; _emscripten_glDeleteBuffers(p0|0,p1|0);
  43167. }
  43168. function _emscripten_glGenRenderbuffers__wrapper(p0,p1) {
  43169. p0 = p0|0;p1 = p1|0; _emscripten_glGenRenderbuffers(p0|0,p1|0);
  43170. }
  43171. function _emscripten_glDeleteRenderbuffers__wrapper(p0,p1) {
  43172. p0 = p0|0;p1 = p1|0; _emscripten_glDeleteRenderbuffers(p0|0,p1|0);
  43173. }
  43174. function _emscripten_glBindRenderbuffer__wrapper(p0,p1) {
  43175. p0 = p0|0;p1 = p1|0; _emscripten_glBindRenderbuffer(p0|0,p1|0);
  43176. }
  43177. function _emscripten_glUniform1i__wrapper(p0,p1) {
  43178. p0 = p0|0;p1 = p1|0; _emscripten_glUniform1i(p0|0,p1|0);
  43179. }
  43180. function _emscripten_glBindBuffer__wrapper(p0,p1) {
  43181. p0 = p0|0;p1 = p1|0; _emscripten_glBindBuffer(p0|0,p1|0);
  43182. }
  43183. function _emscripten_glVertexAttrib1fv__wrapper(p0,p1) {
  43184. p0 = p0|0;p1 = p1|0; _emscripten_glVertexAttrib1fv(p0|0,p1|0);
  43185. }
  43186. function _emscripten_glVertexAttrib2fv__wrapper(p0,p1) {
  43187. p0 = p0|0;p1 = p1|0; _emscripten_glVertexAttrib2fv(p0|0,p1|0);
  43188. }
  43189. function _emscripten_glVertexAttrib3fv__wrapper(p0,p1) {
  43190. p0 = p0|0;p1 = p1|0; _emscripten_glVertexAttrib3fv(p0|0,p1|0);
  43191. }
  43192. function _emscripten_glVertexAttrib4fv__wrapper(p0,p1) {
  43193. p0 = p0|0;p1 = p1|0; _emscripten_glVertexAttrib4fv(p0|0,p1|0);
  43194. }
  43195. function _emscripten_glAttachShader__wrapper(p0,p1) {
  43196. p0 = p0|0;p1 = p1|0; _emscripten_glAttachShader(p0|0,p1|0);
  43197. }
  43198. function _emscripten_glDetachShader__wrapper(p0,p1) {
  43199. p0 = p0|0;p1 = p1|0; _emscripten_glDetachShader(p0|0,p1|0);
  43200. }
  43201. function _emscripten_glBindFramebuffer__wrapper(p0,p1) {
  43202. p0 = p0|0;p1 = p1|0; _emscripten_glBindFramebuffer(p0|0,p1|0);
  43203. }
  43204. function _emscripten_glGenFramebuffers__wrapper(p0,p1) {
  43205. p0 = p0|0;p1 = p1|0; _emscripten_glGenFramebuffers(p0|0,p1|0);
  43206. }
  43207. function _emscripten_glDeleteFramebuffers__wrapper(p0,p1) {
  43208. p0 = p0|0;p1 = p1|0; _emscripten_glDeleteFramebuffers(p0|0,p1|0);
  43209. }
  43210. function _emscripten_glBindProgramARB__wrapper(p0,p1) {
  43211. p0 = p0|0;p1 = p1|0; _emscripten_glBindProgramARB(p0|0,p1|0);
  43212. }
  43213. function _emscripten_glGetPointerv__wrapper(p0,p1) {
  43214. p0 = p0|0;p1 = p1|0; _emscripten_glGetPointerv(p0|0,p1|0);
  43215. }
  43216. function _emscripten_glGenVertexArrays__wrapper(p0,p1) {
  43217. p0 = p0|0;p1 = p1|0; _emscripten_glGenVertexArrays(p0|0,p1|0);
  43218. }
  43219. function _emscripten_glDeleteVertexArrays__wrapper(p0,p1) {
  43220. p0 = p0|0;p1 = p1|0; _emscripten_glDeleteVertexArrays(p0|0,p1|0);
  43221. }
  43222. function _emscripten_glVertexAttribDivisor__wrapper(p0,p1) {
  43223. p0 = p0|0;p1 = p1|0; _emscripten_glVertexAttribDivisor(p0|0,p1|0);
  43224. }
  43225. function _emscripten_glBlendFunc__wrapper(p0,p1) {
  43226. p0 = p0|0;p1 = p1|0; _emscripten_glBlendFunc(p0|0,p1|0);
  43227. }
  43228. function _emscripten_glBlendEquationSeparate__wrapper(p0,p1) {
  43229. p0 = p0|0;p1 = p1|0; _emscripten_glBlendEquationSeparate(p0|0,p1|0);
  43230. }
  43231. function _emscripten_glStencilMaskSeparate__wrapper(p0,p1) {
  43232. p0 = p0|0;p1 = p1|0; _emscripten_glStencilMaskSeparate(p0|0,p1|0);
  43233. }
  43234. function _emscripten_glHint__wrapper(p0,p1) {
  43235. p0 = p0|0;p1 = p1|0; _emscripten_glHint(p0|0,p1|0);
  43236. }
  43237. function _emscripten_glDrawBuffers__wrapper(p0,p1) {
  43238. p0 = p0|0;p1 = p1|0; _emscripten_glDrawBuffers(p0|0,p1|0);
  43239. }
  43240. function b5(p0) {
  43241. p0 = p0|0; nullFunc_ii(5);return 0;
  43242. }
  43243. function _emscripten_glGetString__wrapper(p0) {
  43244. p0 = p0|0; return _emscripten_glGetString(p0|0)|0;
  43245. }
  43246. function _emscripten_glIsTexture__wrapper(p0) {
  43247. p0 = p0|0; return _emscripten_glIsTexture(p0|0)|0;
  43248. }
  43249. function _emscripten_glIsBuffer__wrapper(p0) {
  43250. p0 = p0|0; return _emscripten_glIsBuffer(p0|0)|0;
  43251. }
  43252. function _emscripten_glIsRenderbuffer__wrapper(p0) {
  43253. p0 = p0|0; return _emscripten_glIsRenderbuffer(p0|0)|0;
  43254. }
  43255. function _emscripten_glCreateShader__wrapper(p0) {
  43256. p0 = p0|0; return _emscripten_glCreateShader(p0|0)|0;
  43257. }
  43258. function _emscripten_glIsShader__wrapper(p0) {
  43259. p0 = p0|0; return _emscripten_glIsShader(p0|0)|0;
  43260. }
  43261. function _emscripten_glIsProgram__wrapper(p0) {
  43262. p0 = p0|0; return _emscripten_glIsProgram(p0|0)|0;
  43263. }
  43264. function _emscripten_glIsFramebuffer__wrapper(p0) {
  43265. p0 = p0|0; return _emscripten_glIsFramebuffer(p0|0)|0;
  43266. }
  43267. function _emscripten_glCheckFramebufferStatus__wrapper(p0) {
  43268. p0 = p0|0; return _emscripten_glCheckFramebufferStatus(p0|0)|0;
  43269. }
  43270. function _emscripten_glIsEnabled__wrapper(p0) {
  43271. p0 = p0|0; return _emscripten_glIsEnabled(p0|0)|0;
  43272. }
  43273. function b6(p0,p1,p2,p3) {
  43274. p0 = p0|0;p1 = +p1;p2 = +p2;p3 = +p3; nullFunc_viddd(6);
  43275. }
  43276. function _emscripten_glUniform3f__wrapper(p0,p1,p2,p3) {
  43277. p0 = p0|0;p1 = +p1;p2 = +p2;p3 = +p3; _emscripten_glUniform3f(p0|0,+p1,+p2,+p3);
  43278. }
  43279. function _emscripten_glVertexAttrib3f__wrapper(p0,p1,p2,p3) {
  43280. p0 = p0|0;p1 = +p1;p2 = +p2;p3 = +p3; _emscripten_glVertexAttrib3f(p0|0,+p1,+p2,+p3);
  43281. }
  43282. function b7(p0,p1,p2) {
  43283. p0 = p0|0;p1 = +p1;p2 = +p2; nullFunc_vidd(7);
  43284. }
  43285. function _emscripten_glUniform2f__wrapper(p0,p1,p2) {
  43286. p0 = p0|0;p1 = +p1;p2 = +p2; _emscripten_glUniform2f(p0|0,+p1,+p2);
  43287. }
  43288. function _emscripten_glVertexAttrib2f__wrapper(p0,p1,p2) {
  43289. p0 = p0|0;p1 = +p1;p2 = +p2; _emscripten_glVertexAttrib2f(p0|0,+p1,+p2);
  43290. }
  43291. function b8(p0,p1,p2) {
  43292. p0 = p0|0;p1 = p1|0;p2 = p2|0; nullFunc_iiii(8);return 0;
  43293. }
  43294. function b9(p0,p1,p2,p3,p4,p5,p6,p7) {
  43295. p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0; nullFunc_viiiiiiii(9);
  43296. }
  43297. function _emscripten_glCompressedTexImage2D__wrapper(p0,p1,p2,p3,p4,p5,p6,p7) {
  43298. p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0; _emscripten_glCompressedTexImage2D(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0,p7|0);
  43299. }
  43300. function _emscripten_glCopyTexImage2D__wrapper(p0,p1,p2,p3,p4,p5,p6,p7) {
  43301. p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0; _emscripten_glCopyTexImage2D(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0,p7|0);
  43302. }
  43303. function _emscripten_glCopyTexSubImage2D__wrapper(p0,p1,p2,p3,p4,p5,p6,p7) {
  43304. p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0; _emscripten_glCopyTexSubImage2D(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0,p7|0);
  43305. }
  43306. function b10(p0,p1,p2,p3,p4,p5) {
  43307. p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0; nullFunc_viiiiii(10);
  43308. }
  43309. function _emscripten_glDrawRangeElements__wrapper(p0,p1,p2,p3,p4,p5) {
  43310. p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0; _emscripten_glDrawRangeElements(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0);
  43311. }
  43312. function _emscripten_glVertexAttribPointer__wrapper(p0,p1,p2,p3,p4,p5) {
  43313. p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0; _emscripten_glVertexAttribPointer(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0);
  43314. }
  43315. function b11(p0,p1,p2) {
  43316. p0 = p0|0;p1 = p1|0;p2 = p2|0; nullFunc_viii(11);
  43317. }
  43318. function _emscripten_glGetTexParameterfv__wrapper(p0,p1,p2) {
  43319. p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetTexParameterfv(p0|0,p1|0,p2|0);
  43320. }
  43321. function _emscripten_glGetTexParameteriv__wrapper(p0,p1,p2) {
  43322. p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetTexParameteriv(p0|0,p1|0,p2|0);
  43323. }
  43324. function _emscripten_glTexParameterfv__wrapper(p0,p1,p2) {
  43325. p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glTexParameterfv(p0|0,p1|0,p2|0);
  43326. }
  43327. function _emscripten_glTexParameteriv__wrapper(p0,p1,p2) {
  43328. p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glTexParameteriv(p0|0,p1|0,p2|0);
  43329. }
  43330. function _emscripten_glGetBufferParameteriv__wrapper(p0,p1,p2) {
  43331. p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetBufferParameteriv(p0|0,p1|0,p2|0);
  43332. }
  43333. function _emscripten_glGetRenderbufferParameteriv__wrapper(p0,p1,p2) {
  43334. p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetRenderbufferParameteriv(p0|0,p1|0,p2|0);
  43335. }
  43336. function _emscripten_glGetUniformfv__wrapper(p0,p1,p2) {
  43337. p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetUniformfv(p0|0,p1|0,p2|0);
  43338. }
  43339. function _emscripten_glGetUniformiv__wrapper(p0,p1,p2) {
  43340. p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetUniformiv(p0|0,p1|0,p2|0);
  43341. }
  43342. function _emscripten_glGetVertexAttribfv__wrapper(p0,p1,p2) {
  43343. p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetVertexAttribfv(p0|0,p1|0,p2|0);
  43344. }
  43345. function _emscripten_glGetVertexAttribiv__wrapper(p0,p1,p2) {
  43346. p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetVertexAttribiv(p0|0,p1|0,p2|0);
  43347. }
  43348. function _emscripten_glGetVertexAttribPointerv__wrapper(p0,p1,p2) {
  43349. p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetVertexAttribPointerv(p0|0,p1|0,p2|0);
  43350. }
  43351. function _emscripten_glUniform2i__wrapper(p0,p1,p2) {
  43352. p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform2i(p0|0,p1|0,p2|0);
  43353. }
  43354. function _emscripten_glUniform1iv__wrapper(p0,p1,p2) {
  43355. p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform1iv(p0|0,p1|0,p2|0);
  43356. }
  43357. function _emscripten_glUniform2iv__wrapper(p0,p1,p2) {
  43358. p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform2iv(p0|0,p1|0,p2|0);
  43359. }
  43360. function _emscripten_glUniform3iv__wrapper(p0,p1,p2) {
  43361. p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform3iv(p0|0,p1|0,p2|0);
  43362. }
  43363. function _emscripten_glUniform4iv__wrapper(p0,p1,p2) {
  43364. p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform4iv(p0|0,p1|0,p2|0);
  43365. }
  43366. function _emscripten_glUniform1fv__wrapper(p0,p1,p2) {
  43367. p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform1fv(p0|0,p1|0,p2|0);
  43368. }
  43369. function _emscripten_glUniform2fv__wrapper(p0,p1,p2) {
  43370. p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform2fv(p0|0,p1|0,p2|0);
  43371. }
  43372. function _emscripten_glUniform3fv__wrapper(p0,p1,p2) {
  43373. p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform3fv(p0|0,p1|0,p2|0);
  43374. }
  43375. function _emscripten_glUniform4fv__wrapper(p0,p1,p2) {
  43376. p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform4fv(p0|0,p1|0,p2|0);
  43377. }
  43378. function _emscripten_glGetShaderiv__wrapper(p0,p1,p2) {
  43379. p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetShaderiv(p0|0,p1|0,p2|0);
  43380. }
  43381. function _emscripten_glGetProgramiv__wrapper(p0,p1,p2) {
  43382. p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetProgramiv(p0|0,p1|0,p2|0);
  43383. }
  43384. function _emscripten_glBindAttribLocation__wrapper(p0,p1,p2) {
  43385. p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glBindAttribLocation(p0|0,p1|0,p2|0);
  43386. }
  43387. function _emscripten_glGetObjectParameterivARB__wrapper(p0,p1,p2) {
  43388. p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetObjectParameterivARB(p0|0,p1|0,p2|0);
  43389. }
  43390. function _emscripten_glNormalPointer__wrapper(p0,p1,p2) {
  43391. p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glNormalPointer(p0|0,p1|0,p2|0);
  43392. }
  43393. function _emscripten_glDrawArrays__wrapper(p0,p1,p2) {
  43394. p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glDrawArrays(p0|0,p1|0,p2|0);
  43395. }
  43396. function _emscripten_glTexParameteri__wrapper(p0,p1,p2) {
  43397. p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glTexParameteri(p0|0,p1|0,p2|0);
  43398. }
  43399. function _emscripten_glStencilFunc__wrapper(p0,p1,p2) {
  43400. p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glStencilFunc(p0|0,p1|0,p2|0);
  43401. }
  43402. function _emscripten_glStencilOp__wrapper(p0,p1,p2) {
  43403. p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glStencilOp(p0|0,p1|0,p2|0);
  43404. }
  43405. function b12(p0,p1,p2,p3,p4) {
  43406. p0 = p0|0;p1 = +p1;p2 = +p2;p3 = +p3;p4 = +p4; nullFunc_vidddd(12);
  43407. }
  43408. function _emscripten_glUniform4f__wrapper(p0,p1,p2,p3,p4) {
  43409. p0 = p0|0;p1 = +p1;p2 = +p2;p3 = +p3;p4 = +p4; _emscripten_glUniform4f(p0|0,+p1,+p2,+p3,+p4);
  43410. }
  43411. function _emscripten_glVertexAttrib4f__wrapper(p0,p1,p2,p3,p4) {
  43412. p0 = p0|0;p1 = +p1;p2 = +p2;p3 = +p3;p4 = +p4; _emscripten_glVertexAttrib4f(p0|0,+p1,+p2,+p3,+p4);
  43413. }
  43414. function b13(p0,p1) {
  43415. p0 = +p0;p1 = p1|0; nullFunc_vdi(13);
  43416. }
  43417. function _emscripten_glSampleCoverage__wrapper(p0,p1) {
  43418. p0 = +p0;p1 = p1|0; _emscripten_glSampleCoverage(+p0,p1|0);
  43419. }
  43420. function b14(p0,p1,p2,p3,p4,p5,p6) {
  43421. p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0; nullFunc_viiiiiii(14);
  43422. }
  43423. function _emscripten_glReadPixels__wrapper(p0,p1,p2,p3,p4,p5,p6) {
  43424. p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0; _emscripten_glReadPixels(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0);
  43425. }
  43426. function _emscripten_glGetActiveUniform__wrapper(p0,p1,p2,p3,p4,p5,p6) {
  43427. p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0; _emscripten_glGetActiveUniform(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0);
  43428. }
  43429. function _emscripten_glGetActiveAttrib__wrapper(p0,p1,p2,p3,p4,p5,p6) {
  43430. p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0; _emscripten_glGetActiveAttrib(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0);
  43431. }
  43432. function b15(p0,p1,p2,p3,p4,p5,p6,p7,p8) {
  43433. p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0;p8 = p8|0; nullFunc_viiiiiiiii(15);
  43434. }
  43435. function _emscripten_glCompressedTexSubImage2D__wrapper(p0,p1,p2,p3,p4,p5,p6,p7,p8) {
  43436. p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0;p8 = p8|0; _emscripten_glCompressedTexSubImage2D(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0,p7|0,p8|0);
  43437. }
  43438. function _emscripten_glTexImage2D__wrapper(p0,p1,p2,p3,p4,p5,p6,p7,p8) {
  43439. p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0;p8 = p8|0; _emscripten_glTexImage2D(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0,p7|0,p8|0);
  43440. }
  43441. function _emscripten_glTexSubImage2D__wrapper(p0,p1,p2,p3,p4,p5,p6,p7,p8) {
  43442. p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0;p8 = p8|0; _emscripten_glTexSubImage2D(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0,p7|0,p8|0);
  43443. }
  43444. function b16(p0,p1) {
  43445. p0 = p0|0;p1 = p1|0; nullFunc_iii(16);return 0;
  43446. }
  43447. function _emscripten_glGetUniformLocation__wrapper(p0,p1) {
  43448. p0 = p0|0;p1 = p1|0; return _emscripten_glGetUniformLocation(p0|0,p1|0)|0;
  43449. }
  43450. function _emscripten_glGetAttribLocation__wrapper(p0,p1) {
  43451. p0 = p0|0;p1 = p1|0; return _emscripten_glGetAttribLocation(p0|0,p1|0)|0;
  43452. }
  43453. function b17() {
  43454. ; nullFunc_i(17);return 0;
  43455. }
  43456. function _emscripten_glCreateProgram__wrapper() {
  43457. ; return _emscripten_glCreateProgram()|0;
  43458. }
  43459. function _emscripten_glGetError__wrapper() {
  43460. ; return _emscripten_glGetError()|0;
  43461. }
  43462. function b18(p0,p1,p2,p3,p4,p5) {
  43463. p0 = +p0;p1 = +p1;p2 = +p2;p3 = +p3;p4 = +p4;p5 = +p5; nullFunc_vdddddd(18);
  43464. }
  43465. function _emscripten_glFrustum__wrapper(p0,p1,p2,p3,p4,p5) {
  43466. p0 = +p0;p1 = +p1;p2 = +p2;p3 = +p3;p4 = +p4;p5 = +p5; _emscripten_glFrustum(+p0,+p1,+p2,+p3,+p4,+p5);
  43467. }
  43468. function b19(p0,p1,p2,p3) {
  43469. p0 = +p0;p1 = +p1;p2 = +p2;p3 = +p3; nullFunc_vdddd(19);
  43470. }
  43471. function _emscripten_glRotatef__wrapper(p0,p1,p2,p3) {
  43472. p0 = +p0;p1 = +p1;p2 = +p2;p3 = +p3; _emscripten_glRotatef(+p0,+p1,+p2,+p3);
  43473. }
  43474. function _emscripten_glClearColor__wrapper(p0,p1,p2,p3) {
  43475. p0 = +p0;p1 = +p1;p2 = +p2;p3 = +p3; _emscripten_glClearColor(+p0,+p1,+p2,+p3);
  43476. }
  43477. function _emscripten_glBlendColor__wrapper(p0,p1,p2,p3) {
  43478. p0 = +p0;p1 = +p1;p2 = +p2;p3 = +p3; _emscripten_glBlendColor(+p0,+p1,+p2,+p3);
  43479. }
  43480. function b20(p0,p1) {
  43481. p0 = +p0;p1 = +p1; nullFunc_vdd(20);
  43482. }
  43483. function _emscripten_glDepthRange__wrapper(p0,p1) {
  43484. p0 = +p0;p1 = +p1; _emscripten_glDepthRange(+p0,+p1);
  43485. }
  43486. function _emscripten_glDepthRangef__wrapper(p0,p1) {
  43487. p0 = +p0;p1 = +p1; _emscripten_glDepthRangef(+p0,+p1);
  43488. }
  43489. function _emscripten_glPolygonOffset__wrapper(p0,p1) {
  43490. p0 = +p0;p1 = +p1; _emscripten_glPolygonOffset(+p0,+p1);
  43491. }
  43492. function b21() {
  43493. ; nullFunc_v(21);
  43494. }
  43495. function _emscripten_glLoadIdentity__wrapper() {
  43496. ; _emscripten_glLoadIdentity();
  43497. }
  43498. function _emscripten_glReleaseShaderCompiler__wrapper() {
  43499. ; _emscripten_glReleaseShaderCompiler();
  43500. }
  43501. function _emscripten_glFinish__wrapper() {
  43502. ; _emscripten_glFinish();
  43503. }
  43504. function _emscripten_glFlush__wrapper() {
  43505. ; _emscripten_glFlush();
  43506. }
  43507. function b22(p0,p1,p2) {
  43508. p0 = p0|0;p1 = p1|0;p2 = +p2; nullFunc_viid(22);
  43509. }
  43510. function _emscripten_glTexParameterf__wrapper(p0,p1,p2) {
  43511. p0 = p0|0;p1 = p1|0;p2 = +p2; _emscripten_glTexParameterf(p0|0,p1|0,+p2);
  43512. }
  43513. function b23(p0,p1,p2,p3) {
  43514. p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; nullFunc_viiii(23);
  43515. }
  43516. function _emscripten_glBufferData__wrapper(p0,p1,p2,p3) {
  43517. p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glBufferData(p0|0,p1|0,p2|0,p3|0);
  43518. }
  43519. function _emscripten_glBufferSubData__wrapper(p0,p1,p2,p3) {
  43520. p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glBufferSubData(p0|0,p1|0,p2|0,p3|0);
  43521. }
  43522. function _emscripten_glUniform3i__wrapper(p0,p1,p2,p3) {
  43523. p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glUniform3i(p0|0,p1|0,p2|0,p3|0);
  43524. }
  43525. function _emscripten_glUniformMatrix2fv__wrapper(p0,p1,p2,p3) {
  43526. p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glUniformMatrix2fv(p0|0,p1|0,p2|0,p3|0);
  43527. }
  43528. function _emscripten_glUniformMatrix3fv__wrapper(p0,p1,p2,p3) {
  43529. p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glUniformMatrix3fv(p0|0,p1|0,p2|0,p3|0);
  43530. }
  43531. function _emscripten_glUniformMatrix4fv__wrapper(p0,p1,p2,p3) {
  43532. p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glUniformMatrix4fv(p0|0,p1|0,p2|0,p3|0);
  43533. }
  43534. function _emscripten_glGetAttachedShaders__wrapper(p0,p1,p2,p3) {
  43535. p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glGetAttachedShaders(p0|0,p1|0,p2|0,p3|0);
  43536. }
  43537. function _emscripten_glShaderSource__wrapper(p0,p1,p2,p3) {
  43538. p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glShaderSource(p0|0,p1|0,p2|0,p3|0);
  43539. }
  43540. function _emscripten_glGetShaderSource__wrapper(p0,p1,p2,p3) {
  43541. p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glGetShaderSource(p0|0,p1|0,p2|0,p3|0);
  43542. }
  43543. function _emscripten_glGetShaderInfoLog__wrapper(p0,p1,p2,p3) {
  43544. p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glGetShaderInfoLog(p0|0,p1|0,p2|0,p3|0);
  43545. }
  43546. function _emscripten_glGetShaderPrecisionFormat__wrapper(p0,p1,p2,p3) {
  43547. p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glGetShaderPrecisionFormat(p0|0,p1|0,p2|0,p3|0);
  43548. }
  43549. function _emscripten_glGetProgramInfoLog__wrapper(p0,p1,p2,p3) {
  43550. p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glGetProgramInfoLog(p0|0,p1|0,p2|0,p3|0);
  43551. }
  43552. function _emscripten_glFramebufferRenderbuffer__wrapper(p0,p1,p2,p3) {
  43553. p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glFramebufferRenderbuffer(p0|0,p1|0,p2|0,p3|0);
  43554. }
  43555. function _emscripten_glGetFramebufferAttachmentParameteriv__wrapper(p0,p1,p2,p3) {
  43556. p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glGetFramebufferAttachmentParameteriv(p0|0,p1|0,p2|0,p3|0);
  43557. }
  43558. function _emscripten_glGetInfoLogARB__wrapper(p0,p1,p2,p3) {
  43559. p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glGetInfoLogARB(p0|0,p1|0,p2|0,p3|0);
  43560. }
  43561. function _emscripten_glVertexPointer__wrapper(p0,p1,p2,p3) {
  43562. p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glVertexPointer(p0|0,p1|0,p2|0,p3|0);
  43563. }
  43564. function _emscripten_glTexCoordPointer__wrapper(p0,p1,p2,p3) {
  43565. p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glTexCoordPointer(p0|0,p1|0,p2|0,p3|0);
  43566. }
  43567. function _emscripten_glColorPointer__wrapper(p0,p1,p2,p3) {
  43568. p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glColorPointer(p0|0,p1|0,p2|0,p3|0);
  43569. }
  43570. function _emscripten_glDrawElements__wrapper(p0,p1,p2,p3) {
  43571. p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glDrawElements(p0|0,p1|0,p2|0,p3|0);
  43572. }
  43573. function _emscripten_glDrawArraysInstanced__wrapper(p0,p1,p2,p3) {
  43574. p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glDrawArraysInstanced(p0|0,p1|0,p2|0,p3|0);
  43575. }
  43576. function _emscripten_glViewport__wrapper(p0,p1,p2,p3) {
  43577. p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glViewport(p0|0,p1|0,p2|0,p3|0);
  43578. }
  43579. function _emscripten_glScissor__wrapper(p0,p1,p2,p3) {
  43580. p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glScissor(p0|0,p1|0,p2|0,p3|0);
  43581. }
  43582. function _emscripten_glColorMask__wrapper(p0,p1,p2,p3) {
  43583. p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glColorMask(p0|0,p1|0,p2|0,p3|0);
  43584. }
  43585. function _emscripten_glRenderbufferStorage__wrapper(p0,p1,p2,p3) {
  43586. p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glRenderbufferStorage(p0|0,p1|0,p2|0,p3|0);
  43587. }
  43588. function _emscripten_glBlendFuncSeparate__wrapper(p0,p1,p2,p3) {
  43589. p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glBlendFuncSeparate(p0|0,p1|0,p2|0,p3|0);
  43590. }
  43591. function _emscripten_glStencilFuncSeparate__wrapper(p0,p1,p2,p3) {
  43592. p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glStencilFuncSeparate(p0|0,p1|0,p2|0,p3|0);
  43593. }
  43594. function _emscripten_glStencilOpSeparate__wrapper(p0,p1,p2,p3) {
  43595. p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glStencilOpSeparate(p0|0,p1|0,p2|0,p3|0);
  43596. }
  43597. // EMSCRIPTEN_END_FUNCS
  43598. var FUNCTION_TABLE_viiiii = [b0,_KeyCallback,_emscripten_glUniform4i__wrapper,_emscripten_glFramebufferTexture2D__wrapper,_emscripten_glShaderBinary__wrapper,_emscripten_glDrawElementsInstanced__wrapper,b0,b0];
  43599. var FUNCTION_TABLE_vd = [b1,_emscripten_glClearDepth__wrapper,_emscripten_glClearDepthf__wrapper,_emscripten_glLineWidth__wrapper];
  43600. var FUNCTION_TABLE_vid = [b2,_emscripten_glUniform1f__wrapper,_emscripten_glVertexAttrib1f__wrapper,b2];
  43601. var FUNCTION_TABLE_vi = [b3,_emscripten_glDeleteShader__wrapper,_emscripten_glCompileShader__wrapper,_emscripten_glDeleteProgram__wrapper,_emscripten_glLinkProgram__wrapper,_emscripten_glUseProgram__wrapper,_emscripten_glValidateProgram__wrapper,_emscripten_glDeleteObjectARB__wrapper,_emscripten_glEnableClientState__wrapper,_emscripten_glClientActiveTexture__wrapper,_emscripten_glBindVertexArray__wrapper,_emscripten_glMatrixMode__wrapper,_emscripten_glLoadMatrixf__wrapper,_emscripten_glEnableVertexAttribArray__wrapper,_emscripten_glDisableVertexAttribArray__wrapper,_emscripten_glDepthFunc__wrapper,_emscripten_glEnable__wrapper,_emscripten_glDisable__wrapper,_emscripten_glFrontFace__wrapper,_emscripten_glCullFace__wrapper,_emscripten_glClear__wrapper,_emscripten_glClearStencil__wrapper,_emscripten_glDepthMask__wrapper,_emscripten_glStencilMask__wrapper,_emscripten_glGenerateMipmap__wrapper,_emscripten_glActiveTexture__wrapper,_emscripten_glBlendEquation__wrapper,b3,b3
  43602. ,b3,b3,b3];
  43603. var FUNCTION_TABLE_vii = [b4,_stbi__stdio_skip,_ErrorCallback,_CursorEnterCallback,_CharCallback,_WindowIconifyCallback,_emscripten_glPixelStorei__wrapper,_emscripten_glGetIntegerv__wrapper,_emscripten_glGetFloatv__wrapper,_emscripten_glGetBooleanv__wrapper,_emscripten_glGenTextures__wrapper,_emscripten_glDeleteTextures__wrapper,_emscripten_glBindTexture__wrapper,_emscripten_glGenBuffers__wrapper,_emscripten_glDeleteBuffers__wrapper,_emscripten_glGenRenderbuffers__wrapper,_emscripten_glDeleteRenderbuffers__wrapper,_emscripten_glBindRenderbuffer__wrapper,_emscripten_glUniform1i__wrapper,_emscripten_glBindBuffer__wrapper,_emscripten_glVertexAttrib1fv__wrapper,_emscripten_glVertexAttrib2fv__wrapper,_emscripten_glVertexAttrib3fv__wrapper,_emscripten_glVertexAttrib4fv__wrapper,_emscripten_glAttachShader__wrapper,_emscripten_glDetachShader__wrapper,_emscripten_glBindFramebuffer__wrapper,_emscripten_glGenFramebuffers__wrapper,_emscripten_glDeleteFramebuffers__wrapper,_emscripten_glBindProgramARB__wrapper,_emscripten_glGetPointerv__wrapper,_emscripten_glGenVertexArrays__wrapper,_emscripten_glDeleteVertexArrays__wrapper,_emscripten_glVertexAttribDivisor__wrapper,_emscripten_glBlendFunc__wrapper,_emscripten_glBlendEquationSeparate__wrapper,_emscripten_glStencilMaskSeparate__wrapper,_emscripten_glHint__wrapper,_emscripten_glDrawBuffers__wrapper,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4
  43604. ,b4,b4,b4,b4,b4];
  43605. var FUNCTION_TABLE_ii = [b5,_stbi__stdio_eof,___stdio_close,_emscripten_glGetString__wrapper,_emscripten_glIsTexture__wrapper,_emscripten_glIsBuffer__wrapper,_emscripten_glIsRenderbuffer__wrapper,_emscripten_glCreateShader__wrapper,_emscripten_glIsShader__wrapper,_emscripten_glIsProgram__wrapper,_emscripten_glIsFramebuffer__wrapper,_emscripten_glCheckFramebufferStatus__wrapper,_emscripten_glIsEnabled__wrapper,b5,b5,b5];
  43606. var FUNCTION_TABLE_viddd = [b6,_emscripten_glUniform3f__wrapper,_emscripten_glVertexAttrib3f__wrapper,b6];
  43607. var FUNCTION_TABLE_vidd = [b7,_MouseCursorPosCallback,_ScrollCallback,_emscripten_glUniform2f__wrapper,_emscripten_glVertexAttrib2f__wrapper,b7,b7,b7];
  43608. var FUNCTION_TABLE_iiii = [b8,_stbi__stdio_read,___stdout_write,___stdio_seek,_sn_write,_EmscriptenFullscreenChangeCallback,_EmscriptenKeyboardCallback,_EmscriptenMouseCallback,_EmscriptenTouchCallback,_EmscriptenGamepadCallback,___stdio_write,___stdio_read,b8,b8,b8,b8];
  43609. var FUNCTION_TABLE_viiiiiiii = [b9,_emscripten_glCompressedTexImage2D__wrapper,_emscripten_glCopyTexImage2D__wrapper,_emscripten_glCopyTexSubImage2D__wrapper];
  43610. var FUNCTION_TABLE_viiiiii = [b10,_emscripten_glDrawRangeElements__wrapper,_emscripten_glVertexAttribPointer__wrapper,b10];
  43611. var FUNCTION_TABLE_viii = [b11,_WindowSizeCallback,_emscripten_glGetTexParameterfv__wrapper,_emscripten_glGetTexParameteriv__wrapper,_emscripten_glTexParameterfv__wrapper,_emscripten_glTexParameteriv__wrapper,_emscripten_glGetBufferParameteriv__wrapper,_emscripten_glGetRenderbufferParameteriv__wrapper,_emscripten_glGetUniformfv__wrapper,_emscripten_glGetUniformiv__wrapper,_emscripten_glGetVertexAttribfv__wrapper,_emscripten_glGetVertexAttribiv__wrapper,_emscripten_glGetVertexAttribPointerv__wrapper,_emscripten_glUniform2i__wrapper,_emscripten_glUniform1iv__wrapper,_emscripten_glUniform2iv__wrapper,_emscripten_glUniform3iv__wrapper,_emscripten_glUniform4iv__wrapper,_emscripten_glUniform1fv__wrapper,_emscripten_glUniform2fv__wrapper,_emscripten_glUniform3fv__wrapper,_emscripten_glUniform4fv__wrapper,_emscripten_glGetShaderiv__wrapper,_emscripten_glGetProgramiv__wrapper,_emscripten_glBindAttribLocation__wrapper,_emscripten_glGetObjectParameterivARB__wrapper,_emscripten_glNormalPointer__wrapper,_emscripten_glDrawArrays__wrapper,_emscripten_glTexParameteri__wrapper,_emscripten_glStencilFunc__wrapper,_emscripten_glStencilOp__wrapper,b11];
  43612. var FUNCTION_TABLE_vidddd = [b12,_emscripten_glUniform4f__wrapper,_emscripten_glVertexAttrib4f__wrapper,b12];
  43613. var FUNCTION_TABLE_vdi = [b13,_emscripten_glSampleCoverage__wrapper];
  43614. var FUNCTION_TABLE_viiiiiii = [b14,_emscripten_glReadPixels__wrapper,_emscripten_glGetActiveUniform__wrapper,_emscripten_glGetActiveAttrib__wrapper];
  43615. var FUNCTION_TABLE_viiiiiiiii = [b15,_emscripten_glCompressedTexSubImage2D__wrapper,_emscripten_glTexImage2D__wrapper,_emscripten_glTexSubImage2D__wrapper];
  43616. var FUNCTION_TABLE_iii = [b16,_emscripten_glGetUniformLocation__wrapper,_emscripten_glGetAttribLocation__wrapper,b16];
  43617. var FUNCTION_TABLE_i = [b17,_emscripten_glCreateProgram__wrapper,_emscripten_glGetError__wrapper,b17];
  43618. var FUNCTION_TABLE_vdddddd = [b18,_emscripten_glFrustum__wrapper];
  43619. var FUNCTION_TABLE_vdddd = [b19,_emscripten_glRotatef__wrapper,_emscripten_glClearColor__wrapper,_emscripten_glBlendColor__wrapper];
  43620. var FUNCTION_TABLE_vdd = [b20,_emscripten_glDepthRange__wrapper,_emscripten_glDepthRangef__wrapper,_emscripten_glPolygonOffset__wrapper];
  43621. var FUNCTION_TABLE_v = [b21,_UpdateDrawFrame,_emscripten_glLoadIdentity__wrapper,_emscripten_glReleaseShaderCompiler__wrapper,_emscripten_glFinish__wrapper,_emscripten_glFlush__wrapper,b21,b21];
  43622. var FUNCTION_TABLE_viid = [b22,_emscripten_glTexParameterf__wrapper];
  43623. var FUNCTION_TABLE_viiii = [b23,_MouseButtonCallback,_emscripten_glBufferData__wrapper,_emscripten_glBufferSubData__wrapper,_emscripten_glUniform3i__wrapper,_emscripten_glUniformMatrix2fv__wrapper,_emscripten_glUniformMatrix3fv__wrapper,_emscripten_glUniformMatrix4fv__wrapper,_emscripten_glGetAttachedShaders__wrapper,_emscripten_glShaderSource__wrapper,_emscripten_glGetShaderSource__wrapper,_emscripten_glGetShaderInfoLog__wrapper,_emscripten_glGetShaderPrecisionFormat__wrapper,_emscripten_glGetProgramInfoLog__wrapper,_emscripten_glFramebufferRenderbuffer__wrapper,_emscripten_glGetFramebufferAttachmentParameteriv__wrapper,_emscripten_glGetInfoLogARB__wrapper,_emscripten_glVertexPointer__wrapper,_emscripten_glTexCoordPointer__wrapper,_emscripten_glColorPointer__wrapper,_emscripten_glDrawElements__wrapper,_emscripten_glDrawArraysInstanced__wrapper,_emscripten_glViewport__wrapper,_emscripten_glScissor__wrapper,_emscripten_glColorMask__wrapper,_emscripten_glRenderbufferStorage__wrapper,_emscripten_glBlendFuncSeparate__wrapper,_emscripten_glStencilFuncSeparate__wrapper,_emscripten_glStencilOpSeparate__wrapper,b23,b23,b23];
  43624. return { _roundf: _roundf, _main: _main, _memset: _memset, _bitshift64Lshr: _bitshift64Lshr, _bitshift64Shl: _bitshift64Shl, _fflush: _fflush, _llvm_cttz_i32: _llvm_cttz_i32, _sbrk: _sbrk, _memcpy: _memcpy, _llvm_bswap_i32: _llvm_bswap_i32, ___muldi3: ___muldi3, ___uremdi3: ___uremdi3, _i64Subtract: _i64Subtract, ___udivmoddi4: ___udivmoddi4, _i64Add: _i64Add, _emscripten_get_global_libc: _emscripten_get_global_libc, _emscripten_GetProcAddress: _emscripten_GetProcAddress, ___udivdi3: ___udivdi3, ___errno_location: ___errno_location, ___muldsi3: ___muldsi3, _free: _free, _memmove: _memmove, _strstr: _strstr, _malloc: _malloc, runPostSets: runPostSets, stackAlloc: stackAlloc, stackSave: stackSave, stackRestore: stackRestore, establishStackSpace: establishStackSpace, setTempRet0: setTempRet0, getTempRet0: getTempRet0, setThrew: setThrew, stackAlloc: stackAlloc, stackSave: stackSave, stackRestore: stackRestore, establishStackSpace: establishStackSpace, setThrew: setThrew, setTempRet0: setTempRet0, getTempRet0: getTempRet0, dynCall_viiiii: dynCall_viiiii, dynCall_vd: dynCall_vd, dynCall_vid: dynCall_vid, dynCall_vi: dynCall_vi, dynCall_vii: dynCall_vii, dynCall_ii: dynCall_ii, dynCall_viddd: dynCall_viddd, dynCall_vidd: dynCall_vidd, dynCall_iiii: dynCall_iiii, dynCall_viiiiiiii: dynCall_viiiiiiii, dynCall_viiiiii: dynCall_viiiiii, dynCall_viii: dynCall_viii, dynCall_vidddd: dynCall_vidddd, dynCall_vdi: dynCall_vdi, dynCall_viiiiiii: dynCall_viiiiiii, dynCall_viiiiiiiii: dynCall_viiiiiiiii, dynCall_iii: dynCall_iii, dynCall_i: dynCall_i, dynCall_vdddddd: dynCall_vdddddd, dynCall_vdddd: dynCall_vdddd, dynCall_vdd: dynCall_vdd, dynCall_v: dynCall_v, dynCall_viid: dynCall_viid, dynCall_viiii: dynCall_viiii };
  43625. })
  43626. // EMSCRIPTEN_END_ASM
  43627. (Module.asmGlobalArg, Module.asmLibraryArg, buffer);
  43628. var real__roundf = asm["_roundf"]; asm["_roundf"] = function() {
  43629. assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
  43630. assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
  43631. return real__roundf.apply(null, arguments);
  43632. };
  43633. var real__main = asm["_main"]; asm["_main"] = function() {
  43634. assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
  43635. assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
  43636. return real__main.apply(null, arguments);
  43637. };
  43638. var real_stackSave = asm["stackSave"]; asm["stackSave"] = function() {
  43639. assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
  43640. assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
  43641. return real_stackSave.apply(null, arguments);
  43642. };
  43643. var real_getTempRet0 = asm["getTempRet0"]; asm["getTempRet0"] = function() {
  43644. assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
  43645. assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
  43646. return real_getTempRet0.apply(null, arguments);
  43647. };
  43648. var real__llvm_cttz_i32 = asm["_llvm_cttz_i32"]; asm["_llvm_cttz_i32"] = function() {
  43649. assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
  43650. assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
  43651. return real__llvm_cttz_i32.apply(null, arguments);
  43652. };
  43653. var real_setThrew = asm["setThrew"]; asm["setThrew"] = function() {
  43654. assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
  43655. assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
  43656. return real_setThrew.apply(null, arguments);
  43657. };
  43658. var real__bitshift64Lshr = asm["_bitshift64Lshr"]; asm["_bitshift64Lshr"] = function() {
  43659. assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
  43660. assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
  43661. return real__bitshift64Lshr.apply(null, arguments);
  43662. };
  43663. var real__bitshift64Shl = asm["_bitshift64Shl"]; asm["_bitshift64Shl"] = function() {
  43664. assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
  43665. assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
  43666. return real__bitshift64Shl.apply(null, arguments);
  43667. };
  43668. var real__fflush = asm["_fflush"]; asm["_fflush"] = function() {
  43669. assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
  43670. assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
  43671. return real__fflush.apply(null, arguments);
  43672. };
  43673. var real__sbrk = asm["_sbrk"]; asm["_sbrk"] = function() {
  43674. assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
  43675. assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
  43676. return real__sbrk.apply(null, arguments);
  43677. };
  43678. var real__llvm_bswap_i32 = asm["_llvm_bswap_i32"]; asm["_llvm_bswap_i32"] = function() {
  43679. assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
  43680. assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
  43681. return real__llvm_bswap_i32.apply(null, arguments);
  43682. };
  43683. var real____muldi3 = asm["___muldi3"]; asm["___muldi3"] = function() {
  43684. assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
  43685. assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
  43686. return real____muldi3.apply(null, arguments);
  43687. };
  43688. var real____uremdi3 = asm["___uremdi3"]; asm["___uremdi3"] = function() {
  43689. assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
  43690. assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
  43691. return real____uremdi3.apply(null, arguments);
  43692. };
  43693. var real_stackAlloc = asm["stackAlloc"]; asm["stackAlloc"] = function() {
  43694. assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
  43695. assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
  43696. return real_stackAlloc.apply(null, arguments);
  43697. };
  43698. var real__i64Subtract = asm["_i64Subtract"]; asm["_i64Subtract"] = function() {
  43699. assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
  43700. assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
  43701. return real__i64Subtract.apply(null, arguments);
  43702. };
  43703. var real____udivmoddi4 = asm["___udivmoddi4"]; asm["___udivmoddi4"] = function() {
  43704. assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
  43705. assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
  43706. return real____udivmoddi4.apply(null, arguments);
  43707. };
  43708. var real_setTempRet0 = asm["setTempRet0"]; asm["setTempRet0"] = function() {
  43709. assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
  43710. assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
  43711. return real_setTempRet0.apply(null, arguments);
  43712. };
  43713. var real__i64Add = asm["_i64Add"]; asm["_i64Add"] = function() {
  43714. assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
  43715. assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
  43716. return real__i64Add.apply(null, arguments);
  43717. };
  43718. var real__emscripten_get_global_libc = asm["_emscripten_get_global_libc"]; asm["_emscripten_get_global_libc"] = function() {
  43719. assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
  43720. assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
  43721. return real__emscripten_get_global_libc.apply(null, arguments);
  43722. };
  43723. var real__emscripten_GetProcAddress = asm["_emscripten_GetProcAddress"]; asm["_emscripten_GetProcAddress"] = function() {
  43724. assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
  43725. assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
  43726. return real__emscripten_GetProcAddress.apply(null, arguments);
  43727. };
  43728. var real____udivdi3 = asm["___udivdi3"]; asm["___udivdi3"] = function() {
  43729. assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
  43730. assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
  43731. return real____udivdi3.apply(null, arguments);
  43732. };
  43733. var real____errno_location = asm["___errno_location"]; asm["___errno_location"] = function() {
  43734. assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
  43735. assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
  43736. return real____errno_location.apply(null, arguments);
  43737. };
  43738. var real____muldsi3 = asm["___muldsi3"]; asm["___muldsi3"] = function() {
  43739. assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
  43740. assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
  43741. return real____muldsi3.apply(null, arguments);
  43742. };
  43743. var real__free = asm["_free"]; asm["_free"] = function() {
  43744. assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
  43745. assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
  43746. return real__free.apply(null, arguments);
  43747. };
  43748. var real_establishStackSpace = asm["establishStackSpace"]; asm["establishStackSpace"] = function() {
  43749. assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
  43750. assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
  43751. return real_establishStackSpace.apply(null, arguments);
  43752. };
  43753. var real__memmove = asm["_memmove"]; asm["_memmove"] = function() {
  43754. assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
  43755. assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
  43756. return real__memmove.apply(null, arguments);
  43757. };
  43758. var real__strstr = asm["_strstr"]; asm["_strstr"] = function() {
  43759. assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
  43760. assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
  43761. return real__strstr.apply(null, arguments);
  43762. };
  43763. var real_stackRestore = asm["stackRestore"]; asm["stackRestore"] = function() {
  43764. assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
  43765. assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
  43766. return real_stackRestore.apply(null, arguments);
  43767. };
  43768. var real__malloc = asm["_malloc"]; asm["_malloc"] = function() {
  43769. assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
  43770. assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
  43771. return real__malloc.apply(null, arguments);
  43772. };
  43773. var _roundf = Module["_roundf"] = asm["_roundf"];
  43774. var _main = Module["_main"] = asm["_main"];
  43775. var stackSave = Module["stackSave"] = asm["stackSave"];
  43776. var getTempRet0 = Module["getTempRet0"] = asm["getTempRet0"];
  43777. var _llvm_cttz_i32 = Module["_llvm_cttz_i32"] = asm["_llvm_cttz_i32"];
  43778. var setThrew = Module["setThrew"] = asm["setThrew"];
  43779. var _bitshift64Lshr = Module["_bitshift64Lshr"] = asm["_bitshift64Lshr"];
  43780. var _bitshift64Shl = Module["_bitshift64Shl"] = asm["_bitshift64Shl"];
  43781. var _fflush = Module["_fflush"] = asm["_fflush"];
  43782. var _memset = Module["_memset"] = asm["_memset"];
  43783. var _sbrk = Module["_sbrk"] = asm["_sbrk"];
  43784. var _memcpy = Module["_memcpy"] = asm["_memcpy"];
  43785. var _llvm_bswap_i32 = Module["_llvm_bswap_i32"] = asm["_llvm_bswap_i32"];
  43786. var ___muldi3 = Module["___muldi3"] = asm["___muldi3"];
  43787. var ___uremdi3 = Module["___uremdi3"] = asm["___uremdi3"];
  43788. var stackAlloc = Module["stackAlloc"] = asm["stackAlloc"];
  43789. var _i64Subtract = Module["_i64Subtract"] = asm["_i64Subtract"];
  43790. var ___udivmoddi4 = Module["___udivmoddi4"] = asm["___udivmoddi4"];
  43791. var setTempRet0 = Module["setTempRet0"] = asm["setTempRet0"];
  43792. var _i64Add = Module["_i64Add"] = asm["_i64Add"];
  43793. var _emscripten_get_global_libc = Module["_emscripten_get_global_libc"] = asm["_emscripten_get_global_libc"];
  43794. var _emscripten_GetProcAddress = Module["_emscripten_GetProcAddress"] = asm["_emscripten_GetProcAddress"];
  43795. var ___udivdi3 = Module["___udivdi3"] = asm["___udivdi3"];
  43796. var ___errno_location = Module["___errno_location"] = asm["___errno_location"];
  43797. var ___muldsi3 = Module["___muldsi3"] = asm["___muldsi3"];
  43798. var _free = Module["_free"] = asm["_free"];
  43799. var runPostSets = Module["runPostSets"] = asm["runPostSets"];
  43800. var establishStackSpace = Module["establishStackSpace"] = asm["establishStackSpace"];
  43801. var _memmove = Module["_memmove"] = asm["_memmove"];
  43802. var _strstr = Module["_strstr"] = asm["_strstr"];
  43803. var stackRestore = Module["stackRestore"] = asm["stackRestore"];
  43804. var _malloc = Module["_malloc"] = asm["_malloc"];
  43805. var dynCall_viiiii = Module["dynCall_viiiii"] = asm["dynCall_viiiii"];
  43806. var dynCall_vd = Module["dynCall_vd"] = asm["dynCall_vd"];
  43807. var dynCall_vid = Module["dynCall_vid"] = asm["dynCall_vid"];
  43808. var dynCall_vi = Module["dynCall_vi"] = asm["dynCall_vi"];
  43809. var dynCall_vii = Module["dynCall_vii"] = asm["dynCall_vii"];
  43810. var dynCall_ii = Module["dynCall_ii"] = asm["dynCall_ii"];
  43811. var dynCall_viddd = Module["dynCall_viddd"] = asm["dynCall_viddd"];
  43812. var dynCall_vidd = Module["dynCall_vidd"] = asm["dynCall_vidd"];
  43813. var dynCall_iiii = Module["dynCall_iiii"] = asm["dynCall_iiii"];
  43814. var dynCall_viiiiiiii = Module["dynCall_viiiiiiii"] = asm["dynCall_viiiiiiii"];
  43815. var dynCall_viiiiii = Module["dynCall_viiiiii"] = asm["dynCall_viiiiii"];
  43816. var dynCall_viii = Module["dynCall_viii"] = asm["dynCall_viii"];
  43817. var dynCall_vidddd = Module["dynCall_vidddd"] = asm["dynCall_vidddd"];
  43818. var dynCall_vdi = Module["dynCall_vdi"] = asm["dynCall_vdi"];
  43819. var dynCall_viiiiiii = Module["dynCall_viiiiiii"] = asm["dynCall_viiiiiii"];
  43820. var dynCall_viiiiiiiii = Module["dynCall_viiiiiiiii"] = asm["dynCall_viiiiiiiii"];
  43821. var dynCall_iii = Module["dynCall_iii"] = asm["dynCall_iii"];
  43822. var dynCall_i = Module["dynCall_i"] = asm["dynCall_i"];
  43823. var dynCall_vdddddd = Module["dynCall_vdddddd"] = asm["dynCall_vdddddd"];
  43824. var dynCall_vdddd = Module["dynCall_vdddd"] = asm["dynCall_vdddd"];
  43825. var dynCall_vdd = Module["dynCall_vdd"] = asm["dynCall_vdd"];
  43826. var dynCall_v = Module["dynCall_v"] = asm["dynCall_v"];
  43827. var dynCall_viid = Module["dynCall_viid"] = asm["dynCall_viid"];
  43828. var dynCall_viiii = Module["dynCall_viiii"] = asm["dynCall_viiii"];
  43829. ;
  43830. Runtime.stackAlloc = Module['stackAlloc'];
  43831. Runtime.stackSave = Module['stackSave'];
  43832. Runtime.stackRestore = Module['stackRestore'];
  43833. Runtime.establishStackSpace = Module['establishStackSpace'];
  43834. Runtime.setTempRet0 = Module['setTempRet0'];
  43835. Runtime.getTempRet0 = Module['getTempRet0'];
  43836. // === Auto-generated postamble setup entry stuff ===
  43837. Module['asm'] = asm;
  43838. function ExitStatus(status) {
  43839. this.name = "ExitStatus";
  43840. this.message = "Program terminated with exit(" + status + ")";
  43841. this.status = status;
  43842. };
  43843. ExitStatus.prototype = new Error();
  43844. ExitStatus.prototype.constructor = ExitStatus;
  43845. var initialStackTop;
  43846. var preloadStartTime = null;
  43847. var calledMain = false;
  43848. dependenciesFulfilled = function runCaller() {
  43849. // If run has never been called, and we should call run (INVOKE_RUN is true, and Module.noInitialRun is not false)
  43850. if (!Module['calledRun']) run();
  43851. if (!Module['calledRun']) dependenciesFulfilled = runCaller; // try this again later, after new deps are fulfilled
  43852. }
  43853. Module['callMain'] = Module.callMain = function callMain(args) {
  43854. assert(runDependencies == 0, 'cannot call main when async dependencies remain! (listen on __ATMAIN__)');
  43855. assert(__ATPRERUN__.length == 0, 'cannot call main when preRun functions remain to be called');
  43856. args = args || [];
  43857. ensureInitRuntime();
  43858. var argc = args.length+1;
  43859. function pad() {
  43860. for (var i = 0; i < 4-1; i++) {
  43861. argv.push(0);
  43862. }
  43863. }
  43864. var argv = [allocate(intArrayFromString(Module['thisProgram']), 'i8', ALLOC_NORMAL) ];
  43865. pad();
  43866. for (var i = 0; i < argc-1; i = i + 1) {
  43867. argv.push(allocate(intArrayFromString(args[i]), 'i8', ALLOC_NORMAL));
  43868. pad();
  43869. }
  43870. argv.push(0);
  43871. argv = allocate(argv, 'i32', ALLOC_NORMAL);
  43872. try {
  43873. var ret = Module['_main'](argc, argv, 0);
  43874. // if we're not running an evented main loop, it's time to exit
  43875. exit(ret, /* implicit = */ true);
  43876. }
  43877. catch(e) {
  43878. if (e instanceof ExitStatus) {
  43879. // exit() throws this once it's done to make sure execution
  43880. // has been stopped completely
  43881. return;
  43882. } else if (e == 'SimulateInfiniteLoop') {
  43883. // running an evented main loop, don't immediately exit
  43884. Module['noExitRuntime'] = true;
  43885. return;
  43886. } else {
  43887. var toLog = e;
  43888. if (e && typeof e === 'object' && e.stack) {
  43889. toLog = [e, e.stack];
  43890. }
  43891. Module.printErr('exception thrown: ' + toLog);
  43892. Module['quit'](1, e);
  43893. }
  43894. } finally {
  43895. calledMain = true;
  43896. }
  43897. }
  43898. function run(args) {
  43899. args = args || Module['arguments'];
  43900. if (preloadStartTime === null) preloadStartTime = Date.now();
  43901. if (runDependencies > 0) {
  43902. Module.printErr('run() called, but dependencies remain, so not running');
  43903. return;
  43904. }
  43905. writeStackCookie();
  43906. preRun();
  43907. if (runDependencies > 0) return; // a preRun added a dependency, run will be called later
  43908. if (Module['calledRun']) return; // run may have just been called through dependencies being fulfilled just in this very frame
  43909. function doRun() {
  43910. if (Module['calledRun']) return; // run may have just been called while the async setStatus time below was happening
  43911. Module['calledRun'] = true;
  43912. if (ABORT) return;
  43913. ensureInitRuntime();
  43914. preMain();
  43915. if (ENVIRONMENT_IS_WEB && preloadStartTime !== null) {
  43916. Module.printErr('pre-main prep time: ' + (Date.now() - preloadStartTime) + ' ms');
  43917. }
  43918. if (Module['onRuntimeInitialized']) Module['onRuntimeInitialized']();
  43919. if (Module['_main'] && shouldRunNow) Module['callMain'](args);
  43920. postRun();
  43921. }
  43922. if (Module['setStatus']) {
  43923. Module['setStatus']('Running...');
  43924. setTimeout(function() {
  43925. setTimeout(function() {
  43926. Module['setStatus']('');
  43927. }, 1);
  43928. doRun();
  43929. }, 1);
  43930. } else {
  43931. doRun();
  43932. }
  43933. checkStackCookie();
  43934. }
  43935. Module['run'] = Module.run = run;
  43936. function exit(status, implicit) {
  43937. if (implicit && Module['noExitRuntime']) {
  43938. Module.printErr('exit(' + status + ') implicitly called by end of main(), but noExitRuntime, so not exiting the runtime (you can use emscripten_force_exit, if you want to force a true shutdown)');
  43939. return;
  43940. }
  43941. if (Module['noExitRuntime']) {
  43942. Module.printErr('exit(' + status + ') called, but noExitRuntime, so halting execution but not exiting the runtime or preventing further async execution (you can use emscripten_force_exit, if you want to force a true shutdown)');
  43943. } else {
  43944. ABORT = true;
  43945. EXITSTATUS = status;
  43946. STACKTOP = initialStackTop;
  43947. exitRuntime();
  43948. if (Module['onExit']) Module['onExit'](status);
  43949. }
  43950. if (ENVIRONMENT_IS_NODE) {
  43951. process['exit'](status);
  43952. }
  43953. Module['quit'](status, new ExitStatus(status));
  43954. }
  43955. Module['exit'] = Module.exit = exit;
  43956. var abortDecorators = [];
  43957. function abort(what) {
  43958. if (what !== undefined) {
  43959. Module.print(what);
  43960. Module.printErr(what);
  43961. what = JSON.stringify(what)
  43962. } else {
  43963. what = '';
  43964. }
  43965. ABORT = true;
  43966. EXITSTATUS = 1;
  43967. var extra = '';
  43968. var output = 'abort(' + what + ') at ' + stackTrace() + extra;
  43969. if (abortDecorators) {
  43970. abortDecorators.forEach(function(decorator) {
  43971. output = decorator(output, what);
  43972. });
  43973. }
  43974. throw output;
  43975. }
  43976. Module['abort'] = Module.abort = abort;
  43977. // {{PRE_RUN_ADDITIONS}}
  43978. if (Module['preInit']) {
  43979. if (typeof Module['preInit'] == 'function') Module['preInit'] = [Module['preInit']];
  43980. while (Module['preInit'].length > 0) {
  43981. Module['preInit'].pop()();
  43982. }
  43983. }
  43984. // shouldRunNow refers to calling main(), not run().
  43985. var shouldRunNow = true;
  43986. if (Module['noInitialRun']) {
  43987. shouldRunNow = false;
  43988. }
  43989. run();
  43990. // {{POST_RUN_ADDITIONS}}
  43991. // {{MODULE_ADDITIONS}}